Restore r121752 without modification.



git-svn-id: https://llvm.org/svn/llvm-project/cfe/trunk@121763 91177308-0d34-0410-b5e6-96231b3b80d8
diff --git a/lib/AST/ASTContext.cpp b/lib/AST/ASTContext.cpp
index ecba4a1..a6b0861 100644
--- a/lib/AST/ASTContext.cpp
+++ b/lib/AST/ASTContext.cpp
@@ -1141,7 +1141,7 @@
 }
 
 static QualType getExtFunctionType(ASTContext& Context, QualType T,
-                                        const FunctionType::ExtInfo &Info) {
+                                   const FunctionType::ExtInfo &Info) {
   QualType ResultType;
   if (const PointerType *Pointer = T->getAs<PointerType>()) {
     QualType Pointee = Pointer->getPointeeType();
@@ -1183,15 +1183,11 @@
                                                   Info);
     } else {
       const FunctionProtoType *FPT = cast<FunctionProtoType>(F);
-      ResultType
-        = Context.getFunctionType(FPT->getResultType(), FPT->arg_type_begin(),
-                                  FPT->getNumArgs(), FPT->isVariadic(),
-                                  FPT->getTypeQuals(),
-                                  FPT->hasExceptionSpec(),
-                                  FPT->hasAnyExceptionSpec(),
-                                  FPT->getNumExceptions(),
-                                  FPT->exception_begin(),
-                                  Info);
+      FunctionProtoType::ExtProtoInfo EPI = FPT->getExtProtoInfo();
+      EPI.ExtInfo = Info;
+      ResultType = Context.getFunctionType(FPT->getResultType(),
+                                           FPT->arg_type_begin(),
+                                           FPT->getNumArgs(), EPI);
     }
   } else
     return T;
@@ -1201,20 +1197,17 @@
 
 QualType ASTContext::getNoReturnType(QualType T, bool AddNoReturn) {
   FunctionType::ExtInfo Info = getFunctionExtInfo(T);
-  return getExtFunctionType(*this, T,
-                                 Info.withNoReturn(AddNoReturn));
+  return getExtFunctionType(*this, T, Info.withNoReturn(AddNoReturn));
 }
 
 QualType ASTContext::getCallConvType(QualType T, CallingConv CallConv) {
   FunctionType::ExtInfo Info = getFunctionExtInfo(T);
-  return getExtFunctionType(*this, T,
-                            Info.withCallingConv(CallConv));
+  return getExtFunctionType(*this, T, Info.withCallingConv(CallConv));
 }
 
 QualType ASTContext::getRegParmType(QualType T, unsigned RegParm) {
   FunctionType::ExtInfo Info = getFunctionExtInfo(T);
-  return getExtFunctionType(*this, T,
-                                 Info.withRegParm(RegParm));
+  return getExtFunctionType(*this, T, Info.withRegParm(RegParm));
 }
 
 /// getComplexType - Return the uniqued reference to the type for a complex
@@ -1763,20 +1756,13 @@
 
 /// getFunctionType - Return a normal function type with a typed argument
 /// list.  isVariadic indicates whether the argument list includes '...'.
-QualType ASTContext::getFunctionType(QualType ResultTy,const QualType *ArgArray,
-                                     unsigned NumArgs, bool isVariadic,
-                                     unsigned TypeQuals, bool hasExceptionSpec,
-                                     bool hasAnyExceptionSpec, unsigned NumExs,
-                                     const QualType *ExArray,
-                                     const FunctionType::ExtInfo &Info) {
-
-  const CallingConv CallConv= Info.getCC();
+QualType ASTContext::getFunctionType(QualType ResultTy,
+                                     const QualType *ArgArray, unsigned NumArgs,
+                                   const FunctionProtoType::ExtProtoInfo &EPI) {
   // Unique functions, to guarantee there is only one function of a particular
   // structure.
   llvm::FoldingSetNodeID ID;
-  FunctionProtoType::Profile(ID, ResultTy, ArgArray, NumArgs, isVariadic,
-                             TypeQuals, hasExceptionSpec, hasAnyExceptionSpec,
-                             NumExs, ExArray, Info);
+  FunctionProtoType::Profile(ID, ResultTy, ArgArray, NumArgs, EPI);
 
   void *InsertPos = 0;
   if (FunctionProtoType *FTP =
@@ -1784,11 +1770,13 @@
     return QualType(FTP, 0);
 
   // Determine whether the type being created is already canonical or not.
-  bool isCanonical = !hasExceptionSpec && ResultTy.isCanonical();
+  bool isCanonical = !EPI.HasExceptionSpec && ResultTy.isCanonical();
   for (unsigned i = 0; i != NumArgs && isCanonical; ++i)
     if (!ArgArray[i].isCanonicalAsParam())
       isCanonical = false;
 
+  const CallingConv CallConv = EPI.ExtInfo.getCC();
+
   // If this type isn't canonical, get the canonical version of it.
   // The exception spec is not part of the canonical type.
   QualType Canonical;
@@ -1798,11 +1786,18 @@
     for (unsigned i = 0; i != NumArgs; ++i)
       CanonicalArgs.push_back(getCanonicalParamType(ArgArray[i]));
 
+    FunctionProtoType::ExtProtoInfo CanonicalEPI = EPI;
+    if (CanonicalEPI.HasExceptionSpec) {
+      CanonicalEPI.HasExceptionSpec = false;
+      CanonicalEPI.HasAnyExceptionSpec = false;
+      CanonicalEPI.NumExceptions = 0;
+    }
+    CanonicalEPI.ExtInfo
+      = CanonicalEPI.ExtInfo.withCallingConv(getCanonicalCallConv(CallConv));
+
     Canonical = getFunctionType(getCanonicalType(ResultTy),
                                 CanonicalArgs.data(), NumArgs,
-                                isVariadic, TypeQuals, false,
-                                false, 0, 0,
-                     Info.withCallingConv(getCanonicalCallConv(CallConv)));
+                                CanonicalEPI);
 
     // Get the new insert position for the node we care about.
     FunctionProtoType *NewIP =
@@ -1813,13 +1808,11 @@
   // FunctionProtoType objects are allocated with extra bytes after them
   // for two variable size arrays (for parameter and exception types) at the
   // end of them.
-  FunctionProtoType *FTP =
-    (FunctionProtoType*)Allocate(sizeof(FunctionProtoType) +
-                                 NumArgs*sizeof(QualType) +
-                                 NumExs*sizeof(QualType), TypeAlignment);
-  new (FTP) FunctionProtoType(ResultTy, ArgArray, NumArgs, isVariadic,
-                              TypeQuals, hasExceptionSpec, hasAnyExceptionSpec,
-                              ExArray, NumExs, Canonical, Info);
+  size_t Size = sizeof(FunctionProtoType) +
+                NumArgs * sizeof(QualType) +
+                EPI.NumExceptions * sizeof(QualType);
+  FunctionProtoType *FTP = (FunctionProtoType*) Allocate(Size, TypeAlignment);
+  new (FTP) FunctionProtoType(ResultTy, ArgArray, NumArgs, Canonical, EPI);
   Types.push_back(FTP);
   FunctionProtoTypes.InsertNode(FTP, InsertPos);
   return QualType(FTP, 0);
@@ -4852,6 +4845,8 @@
   if (!isSameCallConv(lcc, rcc))
     return QualType();
 
+  FunctionType::ExtInfo einfo = FunctionType::ExtInfo(NoReturn, RegParm, lcc);
+
   if (lproto && rproto) { // two C99 style function prototypes
     assert(!lproto->hasExceptionSpec() && !rproto->hasExceptionSpec() &&
            "C++ shouldn't be here");
@@ -4895,10 +4890,10 @@
     }
     if (allLTypes) return lhs;
     if (allRTypes) return rhs;
-    return getFunctionType(retType, types.begin(), types.size(),
-                           lproto->isVariadic(), lproto->getTypeQuals(),
-                           false, false, 0, 0,
-                           FunctionType::ExtInfo(NoReturn, RegParm, lcc));
+
+    FunctionProtoType::ExtProtoInfo EPI = lproto->getExtProtoInfo();
+    EPI.ExtInfo = einfo;
+    return getFunctionType(retType, types.begin(), types.size(), EPI);
   }
 
   if (lproto) allRTypes = false;
@@ -4929,11 +4924,11 @@
 
     if (allLTypes) return lhs;
     if (allRTypes) return rhs;
+
+    FunctionProtoType::ExtProtoInfo EPI = proto->getExtProtoInfo();
+    EPI.ExtInfo = einfo;
     return getFunctionType(retType, proto->arg_type_begin(),
-                           proto->getNumArgs(), proto->isVariadic(),
-                           proto->getTypeQuals(),
-                           false, false, 0, 0,
-                           FunctionType::ExtInfo(NoReturn, RegParm, lcc));
+                           proto->getNumArgs(), EPI);
   }
 
   if (allLTypes) return lhs;
@@ -5218,16 +5213,11 @@
       // In either case, use OldReturnType to build the new function type.
       const FunctionType *F = LHS->getAs<FunctionType>();
       if (const FunctionProtoType *FPT = cast<FunctionProtoType>(F)) {
-        FunctionType::ExtInfo Info = getFunctionExtInfo(LHS);
+        FunctionProtoType::ExtProtoInfo EPI = FPT->getExtProtoInfo();
+        EPI.ExtInfo = getFunctionExtInfo(LHS);
         QualType ResultType
           = getFunctionType(OldReturnType, FPT->arg_type_begin(),
-                                  FPT->getNumArgs(), FPT->isVariadic(),
-                                  FPT->getTypeQuals(),
-                                  FPT->hasExceptionSpec(),
-                                  FPT->hasAnyExceptionSpec(),
-                                  FPT->getNumExceptions(),
-                                  FPT->exception_begin(),
-                                  Info);
+                            FPT->getNumArgs(), EPI);
         return ResultType;
       }
     }
@@ -5580,10 +5570,11 @@
   if (ArgTypes.size() == 0 && TypeStr[0] == '.')
     return getFunctionNoProtoType(ResType);
 
+  FunctionProtoType::ExtProtoInfo EPI;
+  EPI.Variadic = (TypeStr[0] == '.');
   // FIXME: Should we create noreturn types?
-  return getFunctionType(ResType, ArgTypes.data(), ArgTypes.size(),
-                         TypeStr[0] == '.', 0, false, false, 0, 0,
-                         FunctionType::ExtInfo());
+
+  return getFunctionType(ResType, ArgTypes.data(), ArgTypes.size(), EPI);
 }
 
 GVALinkage ASTContext::GetGVALinkageForFunction(const FunctionDecl *FD) {
diff --git a/lib/AST/ASTImporter.cpp b/lib/AST/ASTImporter.cpp
index 8415977..cc485c4 100644
--- a/lib/AST/ASTImporter.cpp
+++ b/lib/AST/ASTImporter.cpp
@@ -1473,16 +1473,12 @@
       return QualType();
     ExceptionTypes.push_back(ExceptionType);
   }
+
+  FunctionProtoType::ExtProtoInfo EPI = T->getExtProtoInfo();
+  EPI.Exceptions = ExceptionTypes.data();
        
   return Importer.getToContext().getFunctionType(ToResultType, ArgTypes.data(),
-                                                 ArgTypes.size(),
-                                                 T->isVariadic(),
-                                                 T->getTypeQuals(),
-                                                 T->hasExceptionSpec(), 
-                                                 T->hasAnyExceptionSpec(),
-                                                 ExceptionTypes.size(),
-                                                 ExceptionTypes.data(),
-                                                 T->getExtInfo());
+                                                 ArgTypes.size(), EPI);
 }
 
 QualType ASTNodeImporter::VisitTypedefType(TypedefType *T) {
diff --git a/lib/AST/ExprCXX.cpp b/lib/AST/ExprCXX.cpp
index b67e824..1c13460 100644
--- a/lib/AST/ExprCXX.cpp
+++ b/lib/AST/ExprCXX.cpp
@@ -185,6 +185,25 @@
   Location = Info->getTypeLoc().getLocalSourceRange().getBegin();
 }
 
+CXXPseudoDestructorExpr::CXXPseudoDestructorExpr(ASTContext &Context,
+    Expr *Base, bool isArrow, SourceLocation OperatorLoc,
+    NestedNameSpecifier *Qualifier, SourceRange QualifierRange,
+    TypeSourceInfo *ScopeType, SourceLocation ColonColonLoc,
+    SourceLocation TildeLoc, PseudoDestructorTypeStorage DestroyedType)
+  : Expr(CXXPseudoDestructorExprClass,
+         Context.getPointerType(Context.getFunctionType(Context.VoidTy, 0, 0,
+                                         FunctionProtoType::ExtProtoInfo())),
+         VK_RValue, OK_Ordinary,
+         /*isTypeDependent=*/(Base->isTypeDependent() ||
+           (DestroyedType.getTypeSourceInfo() &&
+            DestroyedType.getTypeSourceInfo()->getType()->isDependentType())),
+         /*isValueDependent=*/Base->isValueDependent()),
+    Base(static_cast<Stmt *>(Base)), IsArrow(isArrow),
+    OperatorLoc(OperatorLoc), Qualifier(Qualifier),
+    QualifierRange(QualifierRange), 
+    ScopeType(ScopeType), ColonColonLoc(ColonColonLoc), TildeLoc(TildeLoc),
+    DestroyedType(DestroyedType) { }
+
 QualType CXXPseudoDestructorExpr::getDestroyedType() const {
   if (TypeSourceInfo *TInfo = DestroyedType.getTypeSourceInfo())
     return TInfo->getType();
diff --git a/lib/AST/Type.cpp b/lib/AST/Type.cpp
index 127613e..25aa5e0 100644
--- a/lib/AST/Type.cpp
+++ b/lib/AST/Type.cpp
@@ -1097,65 +1097,55 @@
   return "";
 }
 
-FunctionProtoType::FunctionProtoType(QualType Result, const QualType *ArgArray,
-                                     unsigned numArgs, bool isVariadic, 
-                                     unsigned typeQuals, bool hasExs,
-                                     bool hasAnyExs, const QualType *ExArray,
-                                     unsigned numExs, QualType Canonical,
-                                     const ExtInfo &Info)
-  : FunctionType(FunctionProto, Result, isVariadic, typeQuals, Canonical,
-                 Result->isDependentType(),
-                 Result->isVariablyModifiedType(),
-                 Result->containsUnexpandedParameterPack(),
-                 Info),
-    NumArgs(numArgs), NumExceptions(numExs), HasExceptionSpec(hasExs),
-    AnyExceptionSpec(hasAnyExs) 
+FunctionProtoType::FunctionProtoType(QualType result, const QualType *args,
+                                     unsigned numArgs, QualType canonical,
+                                     const ExtProtoInfo &epi)
+  : FunctionType(FunctionProto, result, epi.Variadic, epi.TypeQuals, canonical,
+                 result->isDependentType(),
+                 result->isVariablyModifiedType(),
+                 result->containsUnexpandedParameterPack(),
+                 epi.ExtInfo),
+    NumArgs(numArgs), NumExceptions(epi.NumExceptions),
+    HasExceptionSpec(epi.HasExceptionSpec),
+    HasAnyExceptionSpec(epi.HasAnyExceptionSpec)
 {
   // Fill in the trailing argument array.
-  QualType *ArgInfo = reinterpret_cast<QualType*>(this+1);
+  QualType *argSlot = reinterpret_cast<QualType*>(this+1);
   for (unsigned i = 0; i != numArgs; ++i) {
-    if (ArgArray[i]->isDependentType())
+    if (args[i]->isDependentType())
       setDependent();
 
-    if (ArgArray[i]->containsUnexpandedParameterPack())
+    if (args[i]->containsUnexpandedParameterPack())
       setContainsUnexpandedParameterPack();
 
-    ArgInfo[i] = ArgArray[i];
+    argSlot[i] = args[i];
   }
   
   // Fill in the exception array.
-  QualType *Ex = ArgInfo + numArgs;
-  for (unsigned i = 0; i != numExs; ++i)
-    Ex[i] = ExArray[i];
+  QualType *exnSlot = argSlot + numArgs;
+  for (unsigned i = 0, e = epi.NumExceptions; i != e; ++i)
+    exnSlot[i] = epi.Exceptions[i];
 }
 
 
 void FunctionProtoType::Profile(llvm::FoldingSetNodeID &ID, QualType Result,
-                                arg_type_iterator ArgTys,
-                                unsigned NumArgs, bool isVariadic,
-                                unsigned TypeQuals, bool hasExceptionSpec,
-                                bool anyExceptionSpec, unsigned NumExceptions,
-                                exception_iterator Exs,
-                                FunctionType::ExtInfo Info) {
+                                const QualType *ArgTys, unsigned NumArgs,
+                                const ExtProtoInfo &epi) {
   ID.AddPointer(Result.getAsOpaquePtr());
   for (unsigned i = 0; i != NumArgs; ++i)
     ID.AddPointer(ArgTys[i].getAsOpaquePtr());
-  ID.AddInteger(isVariadic);
-  ID.AddInteger(TypeQuals);
-  ID.AddInteger(hasExceptionSpec);
-  if (hasExceptionSpec) {
-    ID.AddInteger(anyExceptionSpec);
-    for (unsigned i = 0; i != NumExceptions; ++i)
-      ID.AddPointer(Exs[i].getAsOpaquePtr());
+  ID.AddBoolean(epi.Variadic);
+  ID.AddInteger(epi.TypeQuals);
+  if (epi.HasExceptionSpec) {
+    ID.AddBoolean(epi.HasAnyExceptionSpec);
+    for (unsigned i = 0; i != epi.NumExceptions; ++i)
+      ID.AddPointer(epi.Exceptions[i].getAsOpaquePtr());
   }
-  Info.Profile(ID);
+  epi.ExtInfo.Profile(ID);
 }
 
 void FunctionProtoType::Profile(llvm::FoldingSetNodeID &ID) {
-  Profile(ID, getResultType(), arg_type_begin(), NumArgs, isVariadic(),
-          getTypeQuals(), hasExceptionSpec(), hasAnyExceptionSpec(),
-          getNumExceptions(), exception_begin(),
-          getExtInfo());
+  Profile(ID, getResultType(), arg_type_begin(), NumArgs, getExtProtoInfo());
 }
 
 QualType TypedefType::desugar() const {
diff --git a/lib/CodeGen/CodeGenFunction.cpp b/lib/CodeGen/CodeGenFunction.cpp
index 7bd0c3d..8a0d78c 100644
--- a/lib/CodeGen/CodeGenFunction.cpp
+++ b/lib/CodeGen/CodeGenFunction.cpp
@@ -250,13 +250,14 @@
 
   Builder.SetInsertPoint(EntryBB);
 
-  QualType FnType = getContext().getFunctionType(RetTy, 0, 0, false, 0,
-                                                 false, false, 0, 0,
-                                                 /*FIXME?*/
-                                                 FunctionType::ExtInfo());
-
   // Emit subprogram debug descriptor.
   if (CGDebugInfo *DI = getDebugInfo()) {
+    // FIXME: what is going on here and why does it ignore all these
+    // interesting type properties?
+    QualType FnType =
+      getContext().getFunctionType(RetTy, 0, 0,
+                                   FunctionProtoType::ExtProtoInfo());
+
     DI->setLocation(StartLoc);
     DI->EmitFunctionStart(GD, FnType, CurFn, Builder);
   }
diff --git a/lib/Rewrite/RewriteObjC.cpp b/lib/Rewrite/RewriteObjC.cpp
index 0d38811..539ee49 100644
--- a/lib/Rewrite/RewriteObjC.cpp
+++ b/lib/Rewrite/RewriteObjC.cpp
@@ -450,6 +450,15 @@
           To += From[i];
       }
     }
+
+    QualType getSimpleFunctionType(QualType result,
+                                   const QualType *args,
+                                   unsigned numArgs,
+                                   bool variadic = false) {
+      FunctionProtoType::ExtProtoInfo fpi;
+      fpi.Variadic = variadic;
+      return Context->getFunctionType(result, args, numArgs, fpi);
+    }
   };
 
   // Helper function: create a CStyleCastExpr with trivial type source info.
@@ -2352,11 +2361,8 @@
   IdentifierInfo *SelGetUidIdent = &Context->Idents.get("sel_registerName");
   llvm::SmallVector<QualType, 16> ArgTys;
   ArgTys.push_back(Context->getPointerType(Context->CharTy.withConst()));
-  QualType getFuncType = Context->getFunctionType(Context->getObjCSelType(),
-                                                  &ArgTys[0], ArgTys.size(),
-                                                  false /*isVariadic*/, 0,
-                                                  false, false, 0, 0,
-                                                  FunctionType::ExtInfo());
+  QualType getFuncType =
+    getSimpleFunctionType(Context->getObjCSelType(), &ArgTys[0], ArgTys.size());
   SelGetUidFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                            SourceLocation(),
                                            SelGetUidIdent, getFuncType, 0,
@@ -2451,11 +2457,8 @@
   assert(!argT.isNull() && "Can't find 'id' type");
   ArgTys.push_back(argT);
   ArgTys.push_back(argT);
-  QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
-                                                  &ArgTys[0], ArgTys.size(),
-                                                  false, 0,
-                                                  false, false, 0, 0,
-                                                  FunctionType::ExtInfo());
+  QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+                                               &ArgTys[0], ArgTys.size());
   SuperContructorFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                          SourceLocation(),
                                          msgSendIdent, msgSendType, 0,
@@ -2473,11 +2476,9 @@
   argT = Context->getObjCSelType();
   assert(!argT.isNull() && "Can't find 'SEL' type");
   ArgTys.push_back(argT);
-  QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
-                                                  &ArgTys[0], ArgTys.size(),
-                                                  true /*isVariadic*/, 0,
-                                                  false, false, 0, 0,
-                                                  FunctionType::ExtInfo());
+  QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+                                               &ArgTys[0], ArgTys.size(),
+                                               true /*isVariadic*/);
   MsgSendFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                          SourceLocation(),
                                          msgSendIdent, msgSendType, 0,
@@ -2498,11 +2499,9 @@
   argT = Context->getObjCSelType();
   assert(!argT.isNull() && "Can't find 'SEL' type");
   ArgTys.push_back(argT);
-  QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
-                                                  &ArgTys[0], ArgTys.size(),
-                                                  true /*isVariadic*/, 0,
-                                                  false, false, 0, 0,
-                                                  FunctionType::ExtInfo());
+  QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+                                               &ArgTys[0], ArgTys.size(),
+                                               true /*isVariadic*/);
   MsgSendSuperFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                               SourceLocation(),
                                               msgSendIdent, msgSendType, 0,
@@ -2520,11 +2519,9 @@
   argT = Context->getObjCSelType();
   assert(!argT.isNull() && "Can't find 'SEL' type");
   ArgTys.push_back(argT);
-  QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
-                                                  &ArgTys[0], ArgTys.size(),
-                                                  true /*isVariadic*/, 0,
-                                                  false, false, 0, 0,
-                                                  FunctionType::ExtInfo());
+  QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+                                               &ArgTys[0], ArgTys.size(),
+                                               true /*isVariadic*/);
   MsgSendStretFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                          SourceLocation(),
                                          msgSendIdent, msgSendType, 0,
@@ -2547,11 +2544,9 @@
   argT = Context->getObjCSelType();
   assert(!argT.isNull() && "Can't find 'SEL' type");
   ArgTys.push_back(argT);
-  QualType msgSendType = Context->getFunctionType(Context->getObjCIdType(),
-                                                  &ArgTys[0], ArgTys.size(),
-                                                  true /*isVariadic*/, 0,
-                                                  false, false, 0, 0,
-                                                  FunctionType::ExtInfo());
+  QualType msgSendType = getSimpleFunctionType(Context->getObjCIdType(),
+                                               &ArgTys[0], ArgTys.size(),
+                                               true /*isVariadic*/);
   MsgSendSuperStretFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                                        SourceLocation(),
                                               msgSendIdent, msgSendType, 0,
@@ -2569,11 +2564,9 @@
   argT = Context->getObjCSelType();
   assert(!argT.isNull() && "Can't find 'SEL' type");
   ArgTys.push_back(argT);
-  QualType msgSendType = Context->getFunctionType(Context->DoubleTy,
-                                                  &ArgTys[0], ArgTys.size(),
-                                                  true /*isVariadic*/, 0,
-                                                  false, false, 0, 0,
-                                                  FunctionType::ExtInfo());
+  QualType msgSendType = getSimpleFunctionType(Context->DoubleTy,
+                                               &ArgTys[0], ArgTys.size(),
+                                               true /*isVariadic*/);
   MsgSendFpretFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                               SourceLocation(),
                                               msgSendIdent, msgSendType, 0,
@@ -2586,11 +2579,8 @@
   IdentifierInfo *getClassIdent = &Context->Idents.get("objc_getClass");
   llvm::SmallVector<QualType, 16> ArgTys;
   ArgTys.push_back(Context->getPointerType(Context->CharTy.withConst()));
-  QualType getClassType = Context->getFunctionType(Context->getObjCIdType(),
-                                                   &ArgTys[0], ArgTys.size(),
-                                                   false /*isVariadic*/, 0,
-                                                  false, false, 0, 0,
-                                                   FunctionType::ExtInfo());
+  QualType getClassType = getSimpleFunctionType(Context->getObjCIdType(),
+                                                &ArgTys[0], ArgTys.size());
   GetClassFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                           SourceLocation(),
                                           getClassIdent, getClassType, 0,
@@ -2604,11 +2594,8 @@
     &Context->Idents.get("class_getSuperclass");
   llvm::SmallVector<QualType, 16> ArgTys;
   ArgTys.push_back(Context->getObjCClassType());
-  QualType getClassType = Context->getFunctionType(Context->getObjCClassType(),
-                                                   &ArgTys[0], ArgTys.size(),
-                                                   false /*isVariadic*/, 0,
-                                                   false, false, 0, 0,
-                                                   FunctionType::ExtInfo());
+  QualType getClassType = getSimpleFunctionType(Context->getObjCClassType(),
+                                                &ArgTys[0], ArgTys.size());
   GetSuperClassFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                                    SourceLocation(),
                                                    getSuperClassIdent,
@@ -2623,11 +2610,8 @@
   IdentifierInfo *getClassIdent = &Context->Idents.get("objc_getMetaClass");
   llvm::SmallVector<QualType, 16> ArgTys;
   ArgTys.push_back(Context->getPointerType(Context->CharTy.withConst()));
-  QualType getClassType = Context->getFunctionType(Context->getObjCIdType(),
-                                                   &ArgTys[0], ArgTys.size(),
-                                                   false /*isVariadic*/, 0,
-                                                   false, false, 0, 0,
-                                                   FunctionType::ExtInfo());
+  QualType getClassType = getSimpleFunctionType(Context->getObjCIdType(),
+                                                &ArgTys[0], ArgTys.size());
   GetMetaClassFunctionDecl = FunctionDecl::Create(*Context, TUDecl,
                                               SourceLocation(),
                                               getClassIdent, getClassType, 0,
@@ -3075,12 +3059,10 @@
                                   CK_BitCast, DRE);
 
   // Now do the "normal" pointer to function cast.
-  QualType castType = Context->getFunctionType(returnType,
-    &ArgTypes[0], ArgTypes.size(),
-    // If we don't have a method decl, force a variadic cast.
-    Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : true, 0,
-                                               false, false, 0, 0,
-                                               FunctionType::ExtInfo());
+  QualType castType =
+    getSimpleFunctionType(returnType, &ArgTypes[0], ArgTypes.size(),
+      // If we don't have a method decl, force a variadic cast.
+      Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : true);
   castType = Context->getPointerType(castType);
   cast = NoTypeInfoCStyleCastExpr(Context, castType, CK_BitCast,
                                   cast);
@@ -3108,11 +3090,8 @@
                                     Context->getPointerType(Context->VoidTy),
                                     CK_BitCast, STDRE);
     // Now do the "normal" pointer to function cast.
-    castType = Context->getFunctionType(returnType,
-      &ArgTypes[0], ArgTypes.size(),
-      Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : false, 0,
-                                        false, false, 0, 0,
-                                        FunctionType::ExtInfo());
+    castType = getSimpleFunctionType(returnType, &ArgTypes[0], ArgTypes.size(),
+      Exp->getMethodDecl() ? Exp->getMethodDecl()->isVariadic() : false);
     castType = Context->getPointerType(castType);
     cast = NoTypeInfoCStyleCastExpr(Context, castType, CK_BitCast,
                                     cast);
@@ -4649,9 +4628,7 @@
   // FIXME. Does this work if block takes no argument but has a return type
   // which is of block type?
   if (HasBlockType)
-    FuncType = Context->getFunctionType(Res,
-                        &ArgTypes[0], ArgTypes.size(), false/*no variadic*/, 0,
-                        false, false, 0, 0, FunctionType::ExtInfo());
+    FuncType = getSimpleFunctionType(Res, &ArgTypes[0], ArgTypes.size());
   else FuncType = QualType(FT, 0);
   return FuncType;
 }
@@ -4719,10 +4696,8 @@
     }
   }
   // Now do the pointer to function cast.
-  QualType PtrToFuncCastType = Context->getFunctionType(Exp->getType(),
-    &ArgTypes[0], ArgTypes.size(), false/*no variadic*/, 0,
-                                                        false, false, 0, 0, 
-                                                       FunctionType::ExtInfo());
+  QualType PtrToFuncCastType
+    = getSimpleFunctionType(Exp->getType(), &ArgTypes[0], ArgTypes.size());
 
   PtrToFuncCastType = Context->getPointerType(PtrToFuncCastType);
 
diff --git a/lib/Sema/SemaDecl.cpp b/lib/Sema/SemaDecl.cpp
index 4038381..66e5170 100644
--- a/lib/Sema/SemaDecl.cpp
+++ b/lib/Sema/SemaDecl.cpp
@@ -1285,10 +1285,7 @@
                                                  OldProto->arg_type_end());
       NewQType = Context.getFunctionType(NewFuncType->getResultType(),
                                          ParamTypes.data(), ParamTypes.size(),
-                                         OldProto->isVariadic(),
-                                         OldProto->getTypeQuals(),
-                                         false, false, 0, 0,
-                                         OldProto->getExtInfo());
+                                         OldProto->getExtProtoInfo());
       New->setType(NewQType);
       New->setHasInheritedPrototype();
 
@@ -1370,9 +1367,7 @@
 
       New->setType(Context.getFunctionType(MergedReturn, &ArgTypes[0],
                                            ArgTypes.size(),
-                                           OldProto->isVariadic(), 0,
-                                           false, false, 0, 0,
-                                           OldProto->getExtInfo()));
+                                           OldProto->getExtProtoInfo()));
       return MergeCompatibleFunctionDecls(New, Old);
     }
 
@@ -4046,9 +4041,11 @@
 
     // Turn this into a variadic function with no parameters.
     const FunctionType *FT = NewFD->getType()->getAs<FunctionType>();
-    QualType R = Context.getFunctionType(FT->getResultType(),
-                                         0, 0, true, 0, false, false, 0, 0,
-                                         FT->getExtInfo());
+    FunctionProtoType::ExtProtoInfo EPI;
+    EPI.Variadic = true;
+    EPI.ExtInfo = FT->getExtInfo();
+
+    QualType R = Context.getFunctionType(FT->getResultType(), 0, 0, EPI);
     NewFD->setType(R);
   }
 
diff --git a/lib/Sema/SemaDeclCXX.cpp b/lib/Sema/SemaDeclCXX.cpp
index 3cfde26..eec80f0 100644
--- a/lib/Sema/SemaDeclCXX.cpp
+++ b/lib/Sema/SemaDeclCXX.cpp
@@ -2851,20 +2851,21 @@
     if (FTI.TypeQuals & Qualifiers::Restrict)
       Diag(D.getIdentifierLoc(), diag::err_invalid_qualified_constructor)
         << "restrict" << SourceRange(D.getIdentifierLoc());
+    D.setInvalidType();
   }
 
   // Rebuild the function type "R" without any type qualifiers (in
   // case any of the errors above fired) and with "void" as the
   // return type, since constructors don't have return types.
   const FunctionProtoType *Proto = R->getAs<FunctionProtoType>();
+  if (Proto->getResultType() == Context.VoidTy && !D.isInvalidType())
+    return R;
+
+  FunctionProtoType::ExtProtoInfo EPI = Proto->getExtProtoInfo();
+  EPI.TypeQuals = 0;
+
   return Context.getFunctionType(Context.VoidTy, Proto->arg_type_begin(),
-                                 Proto->getNumArgs(),
-                                 Proto->isVariadic(), 0,
-                                 Proto->hasExceptionSpec(),
-                                 Proto->hasAnyExceptionSpec(),
-                                 Proto->getNumExceptions(),
-                                 Proto->exception_begin(),
-                                 Proto->getExtInfo());
+                                 Proto->getNumArgs(), EPI);
 }
 
 /// CheckConstructor - Checks a fully-formed constructor for
@@ -3022,16 +3023,14 @@
   // parameters (in case any of the errors above fired) and with
   // "void" as the return type, since destructors don't have return
   // types. 
+  if (!D.isInvalidType())
+    return R;
+
   const FunctionProtoType *Proto = R->getAs<FunctionProtoType>();
-  if (!Proto)
-    return QualType();
-  
-  return Context.getFunctionType(Context.VoidTy, 0, 0, false, 0,
-                                 Proto->hasExceptionSpec(),
-                                 Proto->hasAnyExceptionSpec(),
-                                 Proto->getNumExceptions(),
-                                 Proto->exception_begin(),
-                                 Proto->getExtInfo());
+  FunctionProtoType::ExtProtoInfo EPI = Proto->getExtProtoInfo();
+  EPI.Variadic = false;
+  EPI.TypeQuals = 0;
+  return Context.getFunctionType(Context.VoidTy, 0, 0, EPI);
 }
 
 /// CheckConversionDeclarator - Called by ActOnDeclarator to check the
@@ -3111,15 +3110,8 @@
   // Rebuild the function type "R" without any parameters (in case any
   // of the errors above fired) and with the conversion type as the
   // return type.
-  if (D.isInvalidType()) {
-    R = Context.getFunctionType(ConvType, 0, 0, false,
-                                Proto->getTypeQuals(),
-                                Proto->hasExceptionSpec(),
-                                Proto->hasAnyExceptionSpec(),
-                                Proto->getNumExceptions(),
-                                Proto->exception_begin(),
-                                Proto->getExtInfo());
-  }
+  if (D.isInvalidType())
+    R = Context.getFunctionType(ConvType, 0, 0, Proto->getExtProtoInfo());
 
   // C++0x explicit conversion operators.
   if (D.getDeclSpec().isExplicitSpecified() && !getLangOptions().CPlusPlus0x)
@@ -4310,7 +4302,12 @@
         ExceptSpec.CalledDecl(Constructor);
     }
   }
-  
+
+  FunctionProtoType::ExtProtoInfo EPI;
+  EPI.HasExceptionSpec = ExceptSpec.hasExceptionSpecification();
+  EPI.HasAnyExceptionSpec = ExceptSpec.hasAnyExceptionSpecification();
+  EPI.NumExceptions = ExceptSpec.size();
+  EPI.Exceptions = ExceptSpec.data();
   
   // Create the actual constructor declaration.
   CanQualType ClassType
@@ -4321,12 +4318,7 @@
   CXXConstructorDecl *DefaultCon
     = CXXConstructorDecl::Create(Context, ClassDecl, NameInfo,
                                  Context.getFunctionType(Context.VoidTy,
-                                                         0, 0, false, 0,
-                                       ExceptSpec.hasExceptionSpecification(),
-                                     ExceptSpec.hasAnyExceptionSpecification(),
-                                                         ExceptSpec.size(),
-                                                         ExceptSpec.data(),
-                                                       FunctionType::ExtInfo()),
+                                                         0, 0, EPI),
                                  /*TInfo=*/0,
                                  /*isExplicit=*/false,
                                  /*isInline=*/true,
@@ -4414,13 +4406,12 @@
   }
   
   // Create the actual destructor declaration.
-  QualType Ty = Context.getFunctionType(Context.VoidTy,
-                                        0, 0, false, 0,
-                                        ExceptSpec.hasExceptionSpecification(),
-                                    ExceptSpec.hasAnyExceptionSpecification(),
-                                        ExceptSpec.size(),
-                                        ExceptSpec.data(),
-                                        FunctionType::ExtInfo());
+  FunctionProtoType::ExtProtoInfo EPI;
+  EPI.HasExceptionSpec = ExceptSpec.hasExceptionSpecification();
+  EPI.HasAnyExceptionSpec = ExceptSpec.hasAnyExceptionSpecification();
+  EPI.NumExceptions = ExceptSpec.size();
+  EPI.Exceptions = ExceptSpec.data();
+  QualType Ty = Context.getFunctionType(Context.VoidTy, 0, 0, EPI);
   
   CanQualType ClassType
     = Context.getCanonicalType(Context.getTypeDeclType(ClassDecl));
@@ -4812,17 +4803,16 @@
   
   //   An implicitly-declared copy assignment operator is an inline public
   //   member of its class.
+  FunctionProtoType::ExtProtoInfo EPI;
+  EPI.HasExceptionSpec = ExceptSpec.hasExceptionSpecification();
+  EPI.HasAnyExceptionSpec = ExceptSpec.hasAnyExceptionSpecification();
+  EPI.NumExceptions = ExceptSpec.size();
+  EPI.Exceptions = ExceptSpec.data();
   DeclarationName Name = Context.DeclarationNames.getCXXOperatorName(OO_Equal);
   DeclarationNameInfo NameInfo(Name, ClassDecl->getLocation());
   CXXMethodDecl *CopyAssignment
     = CXXMethodDecl::Create(Context, ClassDecl, NameInfo,
-                            Context.getFunctionType(RetType, &ArgType, 1,
-                                                    false, 0,
-                                         ExceptSpec.hasExceptionSpecification(),
-                                      ExceptSpec.hasAnyExceptionSpecification(),
-                                                    ExceptSpec.size(),
-                                                    ExceptSpec.data(),
-                                                    FunctionType::ExtInfo()),
+                            Context.getFunctionType(RetType, &ArgType, 1, EPI),
                             /*TInfo=*/0, /*isStatic=*/false,
                             /*StorageClassAsWritten=*/SC_None,
                             /*isInline=*/true);
@@ -5278,6 +5268,11 @@
   
   //   An implicitly-declared copy constructor is an inline public
   //   member of its class.
+  FunctionProtoType::ExtProtoInfo EPI;
+  EPI.HasExceptionSpec = ExceptSpec.hasExceptionSpecification();
+  EPI.HasAnyExceptionSpec = ExceptSpec.hasAnyExceptionSpecification();
+  EPI.NumExceptions = ExceptSpec.size();
+  EPI.Exceptions = ExceptSpec.data();
   DeclarationName Name
     = Context.DeclarationNames.getCXXConstructorName(
                                            Context.getCanonicalType(ClassType));
@@ -5285,13 +5280,7 @@
   CXXConstructorDecl *CopyConstructor
     = CXXConstructorDecl::Create(Context, ClassDecl, NameInfo,
                                  Context.getFunctionType(Context.VoidTy,
-                                                         &ArgType, 1,
-                                                         false, 0,
-                                         ExceptSpec.hasExceptionSpecification(),
-                                      ExceptSpec.hasAnyExceptionSpecification(),
-                                                         ExceptSpec.size(),
-                                                         ExceptSpec.data(),
-                                                       FunctionType::ExtInfo()),
+                                                         &ArgType, 1, EPI),
                                  /*TInfo=*/0,
                                  /*isExplicit=*/false,
                                  /*isInline=*/true,
diff --git a/lib/Sema/SemaExceptionSpec.cpp b/lib/Sema/SemaExceptionSpec.cpp
index 885e52d..d08e84d 100644
--- a/lib/Sema/SemaExceptionSpec.cpp
+++ b/lib/Sema/SemaExceptionSpec.cpp
@@ -115,6 +115,9 @@
   if (!MissingExceptionSpecification && !MissingEmptyExceptionSpecification)
     return true;
 
+  const FunctionProtoType *NewProto 
+    = New->getType()->getAs<FunctionProtoType>();
+
   // The new function declaration is only missing an empty exception
   // specification "throw()". If the throw() specification came from a
   // function in a system header that has C linkage, just add an empty
@@ -123,42 +126,38 @@
   // to many libc functions as an optimization. Unfortunately, that
   // optimization isn't permitted by the C++ standard, so we're forced
   // to work around it here.
-  if (MissingEmptyExceptionSpecification &&
-      isa<FunctionProtoType>(New->getType()) &&
+  if (MissingEmptyExceptionSpecification && NewProto &&
       (Old->getLocation().isInvalid() ||
        Context.getSourceManager().isInSystemHeader(Old->getLocation())) &&
       Old->isExternC()) {
-    const FunctionProtoType *NewProto 
-      = cast<FunctionProtoType>(New->getType());
+    FunctionProtoType::ExtProtoInfo EPI = NewProto->getExtProtoInfo();
+    EPI.HasExceptionSpec = true;
+    EPI.HasAnyExceptionSpec = false;
+    EPI.NumExceptions = 0;
     QualType NewType = Context.getFunctionType(NewProto->getResultType(),
                                                NewProto->arg_type_begin(),
                                                NewProto->getNumArgs(),
-                                               NewProto->isVariadic(),
-                                               NewProto->getTypeQuals(),
-                                               true, false, 0, 0,
-                                               NewProto->getExtInfo());
+                                               EPI);
     New->setType(NewType);
     return false;
   }
 
-  if (MissingExceptionSpecification && isa<FunctionProtoType>(New->getType())) {
-    const FunctionProtoType *NewProto 
-      = cast<FunctionProtoType>(New->getType());
+  if (MissingExceptionSpecification && NewProto) {
     const FunctionProtoType *OldProto
       = Old->getType()->getAs<FunctionProtoType>();
 
+    FunctionProtoType::ExtProtoInfo EPI = NewProto->getExtProtoInfo();
+    EPI.HasExceptionSpec = OldProto->hasExceptionSpec();
+    EPI.HasAnyExceptionSpec = OldProto->hasAnyExceptionSpec();
+    EPI.NumExceptions = OldProto->getNumExceptions();
+    EPI.Exceptions = OldProto->exception_begin();
+
     // Update the type of the function with the appropriate exception
     // specification.
     QualType NewType = Context.getFunctionType(NewProto->getResultType(),
                                                NewProto->arg_type_begin(),
                                                NewProto->getNumArgs(),
-                                               NewProto->isVariadic(),
-                                               NewProto->getTypeQuals(),
-                                               OldProto->hasExceptionSpec(),
-                                               OldProto->hasAnyExceptionSpec(),
-                                               OldProto->getNumExceptions(),
-                                               OldProto->exception_begin(),
-                                               NewProto->getExtInfo());
+                                               EPI);
     New->setType(NewType);
 
     // If exceptions are disabled, suppress the warning about missing
diff --git a/lib/Sema/SemaExpr.cpp b/lib/Sema/SemaExpr.cpp
index 27e9e62..3f114dd 100644
--- a/lib/Sema/SemaExpr.cpp
+++ b/lib/Sema/SemaExpr.cpp
@@ -8326,8 +8326,9 @@
     
     // Turn protoless block types into nullary block types.
     if (isa<FunctionNoProtoType>(FTy)) {
-      BlockTy = Context.getFunctionType(RetTy, 0, 0, false, 0,
-                                        false, false, 0, 0, Ext);
+      FunctionProtoType::ExtProtoInfo EPI;
+      EPI.ExtInfo = Ext;
+      BlockTy = Context.getFunctionType(RetTy, 0, 0, EPI);
 
     // Otherwise, if we don't need to change anything about the function type,
     // preserve its sugar structure.
@@ -8338,23 +8339,20 @@
     // Otherwise, make the minimal modifications to the function type.
     } else {
       const FunctionProtoType *FPT = cast<FunctionProtoType>(FTy);
+      FunctionProtoType::ExtProtoInfo EPI = FPT->getExtProtoInfo();
+      EPI.TypeQuals = 0; // FIXME: silently?
+      EPI.ExtInfo = Ext;
       BlockTy = Context.getFunctionType(RetTy,
                                         FPT->arg_type_begin(),
                                         FPT->getNumArgs(),
-                                        FPT->isVariadic(),
-                                        /*quals*/ 0,
-                                        FPT->hasExceptionSpec(),
-                                        FPT->hasAnyExceptionSpec(),
-                                        FPT->getNumExceptions(),
-                                        FPT->exception_begin(),
-                                        Ext);
+                                        EPI);
     }
 
   // If we don't have a function type, just build one from nothing.
   } else {
-    BlockTy = Context.getFunctionType(RetTy, 0, 0, false, 0,
-                                      false, false, 0, 0,
-                             FunctionType::ExtInfo(NoReturn, 0, CC_Default));
+    FunctionProtoType::ExtProtoInfo EPI;
+    EPI.ExtInfo = FunctionType::ExtInfo(NoReturn, 0, CC_Default);
+    BlockTy = Context.getFunctionType(RetTy, 0, 0, EPI);
   }
 
   DiagnoseUnusedParameters(BSI->TheDecl->param_begin(),
diff --git a/lib/Sema/SemaExprCXX.cpp b/lib/Sema/SemaExprCXX.cpp
index 41a3429..76fcaea 100644
--- a/lib/Sema/SemaExprCXX.cpp
+++ b/lib/Sema/SemaExprCXX.cpp
@@ -1074,21 +1074,24 @@
     // To perform this comparison, we compute the function type that
     // the deallocation function should have, and use that type both
     // for template argument deduction and for comparison purposes.
+    //
+    // FIXME: this comparison should ignore CC and the like.
     QualType ExpectedFunctionType;
     {
       const FunctionProtoType *Proto
         = OperatorNew->getType()->getAs<FunctionProtoType>();
+
       llvm::SmallVector<QualType, 4> ArgTypes;
       ArgTypes.push_back(Context.VoidPtrTy); 
       for (unsigned I = 1, N = Proto->getNumArgs(); I < N; ++I)
         ArgTypes.push_back(Proto->getArgType(I));
 
+      FunctionProtoType::ExtProtoInfo EPI;
+      EPI.Variadic = Proto->isVariadic();
+
       ExpectedFunctionType
         = Context.getFunctionType(Context.VoidTy, ArgTypes.data(),
-                                  ArgTypes.size(),
-                                  Proto->isVariadic(),
-                                  0, false, false, 0, 0,
-                                  FunctionType::ExtInfo());
+                                  ArgTypes.size(), EPI);
     }
 
     for (LookupResult::iterator D = FoundDelete.begin(), 
@@ -1340,12 +1343,15 @@
     assert(StdBadAlloc && "Must have std::bad_alloc declared");
     BadAllocType = Context.getTypeDeclType(getStdBadAlloc());
   }
+
+  FunctionProtoType::ExtProtoInfo EPI;
+  EPI.HasExceptionSpec = true;
+  if (HasBadAllocExceptionSpec) {
+    EPI.NumExceptions = 1;
+    EPI.Exceptions = &BadAllocType;
+  }
   
-  QualType FnType = Context.getFunctionType(Return, &Argument, 1, false, 0,
-                                            true, false,
-                                            HasBadAllocExceptionSpec? 1 : 0,
-                                            &BadAllocType,
-                                            FunctionType::ExtInfo());
+  QualType FnType = Context.getFunctionType(Return, &Argument, 1, EPI);
   FunctionDecl *Alloc =
     FunctionDecl::Create(Context, GlobalCtx, SourceLocation(), Name,
                          FnType, /*TInfo=*/0, SC_None,
diff --git a/lib/Sema/SemaLookup.cpp b/lib/Sema/SemaLookup.cpp
index 6ff9cc6..d4db84b 100644
--- a/lib/Sema/SemaLookup.cpp
+++ b/lib/Sema/SemaLookup.cpp
@@ -671,13 +671,14 @@
     // Compute the type of the function that we would expect the conversion
     // function to have, if it were to match the name given.
     // FIXME: Calling convention!
-    FunctionType::ExtInfo ConvProtoInfo = ConvProto->getExtInfo();
+    FunctionProtoType::ExtProtoInfo EPI = ConvProto->getExtProtoInfo();
+    EPI.ExtInfo = EPI.ExtInfo.withCallingConv(CC_Default);
+    EPI.HasExceptionSpec = false;
+    EPI.HasAnyExceptionSpec = false;
+    EPI.NumExceptions = 0;
     QualType ExpectedType
       = R.getSema().Context.getFunctionType(R.getLookupName().getCXXNameType(),
-                                            0, 0, ConvProto->isVariadic(),
-                                            ConvProto->getTypeQuals(),
-                                            false, false, 0, 0,
-                                    ConvProtoInfo.withCallingConv(CC_Default));
+                                            0, 0, EPI);
  
     // Perform template argument deduction against the type that we would
     // expect the function to have.
diff --git a/lib/Sema/SemaTemplateInstantiateDecl.cpp b/lib/Sema/SemaTemplateInstantiateDecl.cpp
index 31692fc..2f73991 100644
--- a/lib/Sema/SemaTemplateInstantiateDecl.cpp
+++ b/lib/Sema/SemaTemplateInstantiateDecl.cpp
@@ -1995,19 +1995,20 @@
 
     // Rebuild the function type 
 
+    FunctionProtoType::ExtProtoInfo EPI = Proto->getExtProtoInfo();
+    EPI.HasExceptionSpec = Proto->hasExceptionSpec();
+    EPI.HasAnyExceptionSpec = Proto->hasAnyExceptionSpec();
+    EPI.NumExceptions = Exceptions.size();
+    EPI.Exceptions = Exceptions.data();
+    EPI.ExtInfo = Proto->getExtInfo();
+
     const FunctionProtoType *NewProto
       = New->getType()->getAs<FunctionProtoType>();
     assert(NewProto && "Template instantiation without function prototype?");
     New->setType(SemaRef.Context.getFunctionType(NewProto->getResultType(),
                                                  NewProto->arg_type_begin(),
                                                  NewProto->getNumArgs(),
-                                                 NewProto->isVariadic(),
-                                                 NewProto->getTypeQuals(),
-                                                 Proto->hasExceptionSpec(),
-                                                 Proto->hasAnyExceptionSpec(),
-                                                 Exceptions.size(),
-                                                 Exceptions.data(),
-                                                 Proto->getExtInfo()));
+                                                 EPI));
   }
 
   SemaRef.InstantiateAttrs(TemplateArgs, Tmpl, New);
diff --git a/lib/Sema/SemaType.cpp b/lib/Sema/SemaType.cpp
index 23c159f..2a75ff0 100644
--- a/lib/Sema/SemaType.cpp
+++ b/lib/Sema/SemaType.cpp
@@ -829,7 +829,7 @@
                                  unsigned NumParamTypes,
                                  bool Variadic, unsigned Quals,
                                  SourceLocation Loc, DeclarationName Entity,
-                                 const FunctionType::ExtInfo &Info) {
+                                 FunctionType::ExtInfo Info) {
   if (T->isArrayType() || T->isFunctionType()) {
     Diag(Loc, diag::err_func_returning_array_function) 
       << T->isFunctionType() << T;
@@ -850,8 +850,12 @@
   if (Invalid)
     return QualType();
 
-  return Context.getFunctionType(T, ParamTypes, NumParamTypes, Variadic,
-                                 Quals, false, false, 0, 0, Info);
+  FunctionProtoType::ExtProtoInfo EPI;
+  EPI.Variadic = Variadic;
+  EPI.TypeQuals = Quals;
+  EPI.ExtInfo = Info;
+
+  return Context.getFunctionType(T, ParamTypes, NumParamTypes, EPI);
 }
 
 /// \brief Build a member pointer type \c T Class::*.
@@ -1265,6 +1269,10 @@
           break;
         }
 
+        FunctionProtoType::ExtProtoInfo EPI;
+        EPI.Variadic = FTI.isVariadic;
+        EPI.TypeQuals = FTI.TypeQuals;
+
         // Otherwise, we have a function with an argument list that is
         // potentially variadic.
         llvm::SmallVector<QualType, 16> ArgTys;
@@ -1316,22 +1324,23 @@
         }
 
         llvm::SmallVector<QualType, 4> Exceptions;
-        Exceptions.reserve(FTI.NumExceptions);
-        for (unsigned ei = 0, ee = FTI.NumExceptions; ei != ee; ++ei) {
-          // FIXME: Preserve type source info.
-          QualType ET = GetTypeFromParser(FTI.Exceptions[ei].Ty);
-          // Check that the type is valid for an exception spec, and drop it if
-          // not.
-          if (!CheckSpecifiedExceptionType(ET, FTI.Exceptions[ei].Range))
-            Exceptions.push_back(ET);
+        if (FTI.hasExceptionSpec) {
+          EPI.HasExceptionSpec = FTI.hasExceptionSpec;
+          EPI.HasAnyExceptionSpec = FTI.hasAnyExceptionSpec;
+          EPI.NumExceptions = FTI.NumExceptions;
+          Exceptions.reserve(FTI.NumExceptions);
+          for (unsigned ei = 0, ee = FTI.NumExceptions; ei != ee; ++ei) {
+            // FIXME: Preserve type source info.
+            QualType ET = GetTypeFromParser(FTI.Exceptions[ei].Ty);
+            // Check that the type is valid for an exception spec, and
+            // drop it if not.
+            if (!CheckSpecifiedExceptionType(ET, FTI.Exceptions[ei].Range))
+              Exceptions.push_back(ET);
+          }
+          EPI.Exceptions = Exceptions.data();
         }
 
-        T = Context.getFunctionType(T, ArgTys.data(), ArgTys.size(),
-                                    FTI.isVariadic, FTI.TypeQuals,
-                                    FTI.hasExceptionSpec,
-                                    FTI.hasAnyExceptionSpec,
-                                    Exceptions.size(), Exceptions.data(),
-                                    FunctionType::ExtInfo());
+        T = Context.getFunctionType(T, ArgTys.data(), ArgTys.size(), EPI);
       }
 
       // For GCC compatibility, we allow attributes that apply only to
@@ -1437,9 +1446,11 @@
           << FreeFunction;
 
       // Strip the cv-quals from the type.
+      FunctionProtoType::ExtProtoInfo EPI = FnTy->getExtProtoInfo();
+      EPI.TypeQuals = 0;
+
       T = Context.getFunctionType(FnTy->getResultType(), FnTy->arg_type_begin(),
-                                  FnTy->getNumArgs(), FnTy->isVariadic(), 0, 
-                                  false, false, 0, 0, FunctionType::ExtInfo());
+                                  FnTy->getNumArgs(), EPI);
     }
   }
 
diff --git a/lib/Serialization/ASTReader.cpp b/lib/Serialization/ASTReader.cpp
index 5fe95bf..098f71a 100644
--- a/lib/Serialization/ASTReader.cpp
+++ b/lib/Serialization/ASTReader.cpp
@@ -2842,28 +2842,29 @@
 
   case TYPE_FUNCTION_PROTO: {
     QualType ResultType = GetType(Record[0]);
-    bool NoReturn = Record[1];
-    unsigned RegParm = Record[2];
-    CallingConv CallConv = (CallingConv)Record[3];
+
+    FunctionProtoType::ExtProtoInfo EPI;
+    EPI.ExtInfo = FunctionType::ExtInfo(/*noreturn*/ Record[1],
+                                        /*regparm*/ Record[2],
+                                        static_cast<CallingConv>(Record[3]));
+
     unsigned Idx = 4;
     unsigned NumParams = Record[Idx++];
     llvm::SmallVector<QualType, 16> ParamTypes;
     for (unsigned I = 0; I != NumParams; ++I)
       ParamTypes.push_back(GetType(Record[Idx++]));
-    bool isVariadic = Record[Idx++];
-    unsigned Quals = Record[Idx++];
-    bool hasExceptionSpec = Record[Idx++];
-    bool hasAnyExceptionSpec = Record[Idx++];
-    unsigned NumExceptions = Record[Idx++];
+
+    EPI.Variadic = Record[Idx++];
+    EPI.TypeQuals = Record[Idx++];
+    EPI.HasExceptionSpec = Record[Idx++];
+    EPI.HasAnyExceptionSpec = Record[Idx++];
+    EPI.NumExceptions = Record[Idx++];
     llvm::SmallVector<QualType, 2> Exceptions;
-    for (unsigned I = 0; I != NumExceptions; ++I)
+    for (unsigned I = 0; I != EPI.NumExceptions; ++I)
       Exceptions.push_back(GetType(Record[Idx++]));
+    EPI.Exceptions = Exceptions.data();
     return Context->getFunctionType(ResultType, ParamTypes.data(), NumParams,
-                                    isVariadic, Quals, hasExceptionSpec,
-                                    hasAnyExceptionSpec, NumExceptions,
-                                    Exceptions.data(),
-                                    FunctionType::ExtInfo(NoReturn, RegParm,
-                                                          CallConv));
+                                    EPI);
   }
 
   case TYPE_UNRESOLVED_USING: