Linux-2.6.12-rc2
Initial git repository build. I'm not bothering with the full history,
even though we have it. We can create a separate "historical" git
archive of that later if we want to, and in the meantime it's about
3.2GB when imported into git - space that would just make the early
git days unnecessarily complicated, when we don't have a lot of good
infrastructure for it.
Let it rip!
diff --git a/drivers/video/matrox/Makefile b/drivers/video/matrox/Makefile
new file mode 100644
index 0000000..f9c00eb
--- /dev/null
+++ b/drivers/video/matrox/Makefile
@@ -0,0 +1,11 @@
+# Makefile for the Linux video drivers.
+# 5 Aug 1999, James Simmons, <mailto:jsimmons@edgeglobal.com>
+# Rewritten to use lists instead of if-statements.
+
+# Each configuration option enables a list of files.
+
+my-obj-$(CONFIG_FB_MATROX_G) += g450_pll.o matroxfb_g450.o matroxfb_crtc2.o
+
+obj-$(CONFIG_FB_MATROX) += matroxfb_base.o matroxfb_accel.o matroxfb_DAC1064.o matroxfb_Ti3026.o matroxfb_misc.o $(my-obj-y)
+obj-$(CONFIG_FB_MATROX_I2C) += i2c-matroxfb.o
+obj-$(CONFIG_FB_MATROX_MAVEN) += matroxfb_maven.o matroxfb_crtc2.o
diff --git a/drivers/video/matrox/g450_pll.c b/drivers/video/matrox/g450_pll.c
new file mode 100644
index 0000000..8073a73
--- /dev/null
+++ b/drivers/video/matrox/g450_pll.c
@@ -0,0 +1,479 @@
+/*
+ *
+ * Hardware accelerated Matrox PCI cards - G450/G550 PLL control.
+ *
+ * (c) 2001-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.64 2002/06/10
+ *
+ * This file is subject to the terms and conditions of the GNU General Public
+ * License. See the file COPYING in the main directory of this archive for
+ * more details.
+ *
+ */
+
+#include "g450_pll.h"
+#include "matroxfb_DAC1064.h"
+
+static inline unsigned int g450_vco2f(unsigned char p, unsigned int fvco) {
+ return (p & 0x40) ? fvco : fvco >> ((p & 3) + 1);
+}
+
+static inline unsigned int g450_f2vco(unsigned char p, unsigned int fin) {
+ return (p & 0x40) ? fin : fin << ((p & 3) + 1);
+}
+
+static unsigned int g450_mnp2vco(CPMINFO unsigned int mnp) {
+ unsigned int m, n;
+
+ m = ((mnp >> 16) & 0x0FF) + 1;
+ n = ((mnp >> 7) & 0x1FE) + 4;
+ return (ACCESS_FBINFO(features).pll.ref_freq * n + (m >> 1)) / m;
+}
+
+unsigned int g450_mnp2f(CPMINFO unsigned int mnp) {
+ return g450_vco2f(mnp, g450_mnp2vco(PMINFO mnp));
+}
+
+static inline unsigned int pll_freq_delta(unsigned int f1, unsigned int f2) {
+ if (f2 < f1) {
+ f2 = f1 - f2;
+ } else {
+ f2 = f2 - f1;
+ }
+ return f2;
+}
+
+#define NO_MORE_MNP 0x01FFFFFF
+#define G450_MNP_FREQBITS (0xFFFFFF43) /* do not mask high byte so we'll catch NO_MORE_MNP */
+
+static unsigned int g450_nextpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* fvco, unsigned int mnp) {
+ unsigned int m, n, p;
+ unsigned int tvco = *fvco;
+
+ m = (mnp >> 16) & 0xFF;
+ p = mnp & 0xFF;
+
+ do {
+ if (m == 0 || m == 0xFF) {
+ if (m == 0) {
+ if (p & 0x40) {
+ return NO_MORE_MNP;
+ }
+ if (p & 3) {
+ p--;
+ } else {
+ p = 0x40;
+ }
+ tvco >>= 1;
+ if (tvco < pi->vcomin) {
+ return NO_MORE_MNP;
+ }
+ *fvco = tvco;
+ }
+
+ p &= 0x43;
+ if (tvco < 550000) {
+/* p |= 0x00; */
+ } else if (tvco < 700000) {
+ p |= 0x08;
+ } else if (tvco < 1000000) {
+ p |= 0x10;
+ } else if (tvco < 1150000) {
+ p |= 0x18;
+ } else {
+ p |= 0x20;
+ }
+ m = 9;
+ } else {
+ m--;
+ }
+ n = ((tvco * (m+1) + ACCESS_FBINFO(features).pll.ref_freq) / (ACCESS_FBINFO(features).pll.ref_freq * 2)) - 2;
+ } while (n < 0x03 || n > 0x7A);
+ return (m << 16) | (n << 8) | p;
+}
+
+static unsigned int g450_firstpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* vco, unsigned int fout) {
+ unsigned int p;
+ unsigned int vcomax;
+
+ vcomax = pi->vcomax;
+ if (fout > (vcomax / 2)) {
+ if (fout > vcomax) {
+ *vco = vcomax;
+ } else {
+ *vco = fout;
+ }
+ p = 0x40;
+ } else {
+ unsigned int tvco;
+
+ p = 3;
+ tvco = g450_f2vco(p, fout);
+ while (p && (tvco > vcomax)) {
+ p--;
+ tvco >>= 1;
+ }
+ if (tvco < pi->vcomin) {
+ tvco = pi->vcomin;
+ }
+ *vco = tvco;
+ }
+ return g450_nextpll(PMINFO pi, vco, 0xFF0000 | p);
+}
+
+static inline unsigned int g450_setpll(CPMINFO unsigned int mnp, unsigned int pll) {
+ switch (pll) {
+ case M_PIXEL_PLL_A:
+ matroxfb_DAC_out(PMINFO M1064_XPIXPLLAM, mnp >> 16);
+ matroxfb_DAC_out(PMINFO M1064_XPIXPLLAN, mnp >> 8);
+ matroxfb_DAC_out(PMINFO M1064_XPIXPLLAP, mnp);
+ return M1064_XPIXPLLSTAT;
+
+ case M_PIXEL_PLL_B:
+ matroxfb_DAC_out(PMINFO M1064_XPIXPLLBM, mnp >> 16);
+ matroxfb_DAC_out(PMINFO M1064_XPIXPLLBN, mnp >> 8);
+ matroxfb_DAC_out(PMINFO M1064_XPIXPLLBP, mnp);
+ return M1064_XPIXPLLSTAT;
+
+ case M_PIXEL_PLL_C:
+ matroxfb_DAC_out(PMINFO M1064_XPIXPLLCM, mnp >> 16);
+ matroxfb_DAC_out(PMINFO M1064_XPIXPLLCN, mnp >> 8);
+ matroxfb_DAC_out(PMINFO M1064_XPIXPLLCP, mnp);
+ return M1064_XPIXPLLSTAT;
+
+ case M_SYSTEM_PLL:
+ matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLM, mnp >> 16);
+ matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLN, mnp >> 8);
+ matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLP, mnp);
+ return DAC1064_XSYSPLLSTAT;
+
+ case M_VIDEO_PLL:
+ matroxfb_DAC_out(PMINFO M1064_XVIDPLLM, mnp >> 16);
+ matroxfb_DAC_out(PMINFO M1064_XVIDPLLN, mnp >> 8);
+ matroxfb_DAC_out(PMINFO M1064_XVIDPLLP, mnp);
+ return M1064_XVIDPLLSTAT;
+ }
+ return 0;
+}
+
+static inline unsigned int g450_cmppll(CPMINFO unsigned int mnp, unsigned int pll) {
+ unsigned char m = mnp >> 16;
+ unsigned char n = mnp >> 8;
+ unsigned char p = mnp;
+
+ switch (pll) {
+ case M_PIXEL_PLL_A:
+ return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLAM) != m ||
+ matroxfb_DAC_in(PMINFO M1064_XPIXPLLAN) != n ||
+ matroxfb_DAC_in(PMINFO M1064_XPIXPLLAP) != p);
+
+ case M_PIXEL_PLL_B:
+ return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLBM) != m ||
+ matroxfb_DAC_in(PMINFO M1064_XPIXPLLBN) != n ||
+ matroxfb_DAC_in(PMINFO M1064_XPIXPLLBP) != p);
+
+ case M_PIXEL_PLL_C:
+ return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) != m ||
+ matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) != n ||
+ matroxfb_DAC_in(PMINFO M1064_XPIXPLLCP) != p);
+
+ case M_SYSTEM_PLL:
+ return (matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLM) != m ||
+ matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLN) != n ||
+ matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLP) != p);
+
+ case M_VIDEO_PLL:
+ return (matroxfb_DAC_in(PMINFO M1064_XVIDPLLM) != m ||
+ matroxfb_DAC_in(PMINFO M1064_XVIDPLLN) != n ||
+ matroxfb_DAC_in(PMINFO M1064_XVIDPLLP) != p);
+ }
+ return 1;
+}
+
+static inline int g450_isplllocked(CPMINFO unsigned int regidx) {
+ unsigned int j;
+
+ for (j = 0; j < 1000; j++) {
+ if (matroxfb_DAC_in(PMINFO regidx) & 0x40) {
+ unsigned int r = 0;
+ int i;
+
+ for (i = 0; i < 100; i++) {
+ r += matroxfb_DAC_in(PMINFO regidx) & 0x40;
+ }
+ return r >= (90 * 0x40);
+ }
+ /* udelay(1)... but DAC_in is much slower... */
+ }
+ return 0;
+}
+
+static int g450_testpll(CPMINFO unsigned int mnp, unsigned int pll) {
+ return g450_isplllocked(PMINFO g450_setpll(PMINFO mnp, pll));
+}
+
+static void updatehwstate_clk(struct matrox_hw_state* hw, unsigned int mnp, unsigned int pll) {
+ switch (pll) {
+ case M_SYSTEM_PLL:
+ hw->DACclk[3] = mnp >> 16;
+ hw->DACclk[4] = mnp >> 8;
+ hw->DACclk[5] = mnp;
+ break;
+ }
+}
+
+void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll) {
+ if (g450_cmppll(PMINFO mnp, pll)) {
+ g450_setpll(PMINFO mnp, pll);
+ }
+}
+
+static inline unsigned int g450_findworkingpll(WPMINFO unsigned int pll, unsigned int* mnparray, unsigned int mnpcount) {
+ unsigned int found = 0;
+ unsigned int idx;
+ unsigned int mnpfound = mnparray[0];
+
+ for (idx = 0; idx < mnpcount; idx++) {
+ unsigned int sarray[3];
+ unsigned int *sptr;
+ {
+ unsigned int mnp;
+
+ sptr = sarray;
+ mnp = mnparray[idx];
+ if (mnp & 0x38) {
+ *sptr++ = mnp - 8;
+ }
+ if ((mnp & 0x38) != 0x38) {
+ *sptr++ = mnp + 8;
+ }
+ *sptr = mnp;
+ }
+ while (sptr >= sarray) {
+ unsigned int mnp = *sptr--;
+
+ if (g450_testpll(PMINFO mnp - 0x0300, pll) &&
+ g450_testpll(PMINFO mnp + 0x0300, pll) &&
+ g450_testpll(PMINFO mnp - 0x0200, pll) &&
+ g450_testpll(PMINFO mnp + 0x0200, pll) &&
+ g450_testpll(PMINFO mnp - 0x0100, pll) &&
+ g450_testpll(PMINFO mnp + 0x0100, pll)) {
+ if (g450_testpll(PMINFO mnp, pll)) {
+ return mnp;
+ }
+ } else if (!found && g450_testpll(PMINFO mnp, pll)) {
+ mnpfound = mnp;
+ found = 1;
+ }
+ }
+ }
+ g450_setpll(PMINFO mnpfound, pll);
+ return mnpfound;
+}
+
+static void g450_addcache(struct matrox_pll_cache* ci, unsigned int mnp_key, unsigned int mnp_value) {
+ if (++ci->valid > ARRAY_SIZE(ci->data)) {
+ ci->valid = ARRAY_SIZE(ci->data);
+ }
+ memmove(ci->data + 1, ci->data, (ci->valid - 1) * sizeof(*ci->data));
+ ci->data[0].mnp_key = mnp_key & G450_MNP_FREQBITS;
+ ci->data[0].mnp_value = mnp_value;
+}
+
+static int g450_checkcache(WPMINFO struct matrox_pll_cache* ci, unsigned int mnp_key) {
+ unsigned int i;
+
+ mnp_key &= G450_MNP_FREQBITS;
+ for (i = 0; i < ci->valid; i++) {
+ if (ci->data[i].mnp_key == mnp_key) {
+ unsigned int mnp;
+
+ mnp = ci->data[i].mnp_value;
+ if (i) {
+ memmove(ci->data + 1, ci->data, i * sizeof(*ci->data));
+ ci->data[0].mnp_key = mnp_key;
+ ci->data[0].mnp_value = mnp;
+ }
+ return mnp;
+ }
+ }
+ return NO_MORE_MNP;
+}
+
+static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
+ unsigned int* mnparray, unsigned int* deltaarray) {
+ unsigned int mnpcount;
+ unsigned int pixel_vco;
+ const struct matrox_pll_limits* pi;
+ struct matrox_pll_cache* ci;
+
+ pixel_vco = 0;
+ switch (pll) {
+ case M_PIXEL_PLL_A:
+ case M_PIXEL_PLL_B:
+ case M_PIXEL_PLL_C:
+ {
+ u_int8_t tmp;
+ unsigned long flags;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ tmp = matroxfb_DAC_in(PMINFO M1064_XPIXCLKCTRL);
+ if (!(tmp & M1064_XPIXCLKCTRL_PLL_UP)) {
+ matroxfb_DAC_out(PMINFO M1064_XPIXCLKCTRL, tmp | M1064_XPIXCLKCTRL_PLL_UP);
+ }
+ matroxfb_DAC_unlock_irqrestore(flags);
+ }
+ {
+ u_int8_t misc;
+
+ misc = mga_inb(M_MISC_REG_READ) & ~0x0C;
+ switch (pll) {
+ case M_PIXEL_PLL_A:
+ break;
+ case M_PIXEL_PLL_B:
+ misc |= 0x04;
+ break;
+ default:
+ misc |= 0x0C;
+ break;
+ }
+ mga_outb(M_MISC_REG, misc);
+ }
+ pi = &ACCESS_FBINFO(limits.pixel);
+ ci = &ACCESS_FBINFO(cache.pixel);
+ break;
+ case M_SYSTEM_PLL:
+ {
+ u_int32_t opt;
+
+ pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &opt);
+ if (!(opt & 0x20)) {
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, opt | 0x20);
+ }
+ }
+ pi = &ACCESS_FBINFO(limits.system);
+ ci = &ACCESS_FBINFO(cache.system);
+ break;
+ case M_VIDEO_PLL:
+ {
+ u_int8_t tmp;
+ unsigned int mnp;
+ unsigned long flags;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ tmp = matroxfb_DAC_in(PMINFO M1064_XPWRCTRL);
+ if (!(tmp & 2)) {
+ matroxfb_DAC_out(PMINFO M1064_XPWRCTRL, tmp | 2);
+ }
+
+ mnp = matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) << 16;
+ mnp |= matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) << 8;
+ pixel_vco = g450_mnp2vco(PMINFO mnp);
+ matroxfb_DAC_unlock_irqrestore(flags);
+ }
+ pi = &ACCESS_FBINFO(limits.video);
+ ci = &ACCESS_FBINFO(cache.video);
+ break;
+ default:
+ return -EINVAL;
+ }
+
+ mnpcount = 0;
+ {
+ unsigned int mnp;
+ unsigned int xvco;
+
+ for(mnp = g450_firstpll(PMINFO pi, &xvco, fout); mnp != NO_MORE_MNP; mnp = g450_nextpll(PMINFO pi, &xvco, mnp)) {
+ unsigned int idx;
+ unsigned int vco;
+ unsigned int delta;
+
+ vco = g450_mnp2vco(PMINFO mnp);
+#if 0
+ if (pll == M_VIDEO_PLL) {
+ unsigned int big, small;
+
+ if (vco < pixel_vco) {
+ small = vco;
+ big = pixel_vco;
+ } else {
+ small = pixel_vco;
+ big = vco;
+ }
+ while (big > small) {
+ big >>= 1;
+ }
+ if (big == small) {
+ continue;
+ }
+ }
+#endif
+ delta = pll_freq_delta(fout, g450_vco2f(mnp, vco));
+ for (idx = mnpcount; idx > 0; idx--) {
+ /* == is important; due to nextpll algorithm we get
+ sorted equally good frequencies from lower VCO
+ frequency to higher - with <= lowest wins, while
+ with < highest one wins */
+ if (delta <= deltaarray[idx-1]) {
+ mnparray[idx] = mnparray[idx-1];
+ deltaarray[idx] = deltaarray[idx-1];
+ } else {
+ break;
+ }
+ }
+ mnparray[idx] = mnp;
+ deltaarray[idx] = delta;
+ mnpcount++;
+ }
+ }
+ /* VideoPLL and PixelPLL matched: do nothing... In all other cases we should get at least one frequency */
+ if (!mnpcount) {
+ return -EBUSY;
+ }
+ {
+ unsigned long flags;
+ unsigned int mnp;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ mnp = g450_checkcache(PMINFO ci, mnparray[0]);
+ if (mnp != NO_MORE_MNP) {
+ matroxfb_g450_setpll_cond(PMINFO mnp, pll);
+ } else {
+ mnp = g450_findworkingpll(PMINFO pll, mnparray, mnpcount);
+ g450_addcache(ci, mnparray[0], mnp);
+ }
+ updatehwstate_clk(&ACCESS_FBINFO(hw), mnp, pll);
+ matroxfb_DAC_unlock_irqrestore(flags);
+ return mnp;
+ }
+}
+
+/* It must be greater than number of possible PLL values.
+ * Currently there is 5(p) * 10(m) = 50 possible values. */
+#define MNP_TABLE_SIZE 64
+
+int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll) {
+ unsigned int* arr;
+
+ arr = kmalloc(sizeof(*arr) * MNP_TABLE_SIZE * 2, GFP_KERNEL);
+ if (arr) {
+ int r;
+
+ r = __g450_setclk(PMINFO fout, pll, arr, arr + MNP_TABLE_SIZE);
+ kfree(arr);
+ return r;
+ }
+ return -ENOMEM;
+}
+
+EXPORT_SYMBOL(matroxfb_g450_setclk);
+EXPORT_SYMBOL(g450_mnp2f);
+EXPORT_SYMBOL(matroxfb_g450_setpll_cond);
+
+MODULE_AUTHOR("(c) 2001-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Matrox G450/G550 PLL driver");
+
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/g450_pll.h b/drivers/video/matrox/g450_pll.h
new file mode 100644
index 0000000..c17ed74
--- /dev/null
+++ b/drivers/video/matrox/g450_pll.h
@@ -0,0 +1,10 @@
+#ifndef __G450_PLL_H__
+#define __G450_PLL_H__
+
+#include "matroxfb_base.h"
+
+int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll);
+unsigned int g450_mnp2f(CPMINFO unsigned int mnp);
+void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll);
+
+#endif /* __G450_PLL_H__ */
diff --git a/drivers/video/matrox/i2c-matroxfb.c b/drivers/video/matrox/i2c-matroxfb.c
new file mode 100644
index 0000000..57abbae
--- /dev/null
+++ b/drivers/video/matrox/i2c-matroxfb.c
@@ -0,0 +1,223 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Version: 1.64 2002/06/10
+ *
+ * See matroxfb_base.c for contributors.
+ *
+ */
+
+#include "matroxfb_base.h"
+#include "matroxfb_maven.h"
+#include <linux/i2c.h>
+#include <linux/i2c-algo-bit.h>
+
+/* MGA-TVO I2C for G200, G400 */
+#define MAT_CLK 0x20
+#define MAT_DATA 0x10
+/* primary head DDC for Mystique(?), G100, G200, G400 */
+#define DDC1_CLK 0x08
+#define DDC1_DATA 0x02
+/* primary head DDC for Millennium, Millennium II */
+#define DDC1B_CLK 0x10
+#define DDC1B_DATA 0x04
+/* secondary head DDC for G400 */
+#define DDC2_CLK 0x04
+#define DDC2_DATA 0x01
+
+/******************************************************/
+
+struct matroxfb_dh_maven_info {
+ struct i2c_bit_adapter maven;
+ struct i2c_bit_adapter ddc1;
+ struct i2c_bit_adapter ddc2;
+};
+
+static int matroxfb_read_gpio(struct matrox_fb_info* minfo) {
+ unsigned long flags;
+ int v;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ v = matroxfb_DAC_in(PMINFO DAC_XGENIODATA);
+ matroxfb_DAC_unlock_irqrestore(flags);
+ return v;
+}
+
+static void matroxfb_set_gpio(struct matrox_fb_info* minfo, int mask, int val) {
+ unsigned long flags;
+ int v;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ v = (matroxfb_DAC_in(PMINFO DAC_XGENIOCTRL) & mask) | val;
+ matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, v);
+ /* We must reset GENIODATA very often... XFree plays with this register */
+ matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0x00);
+ matroxfb_DAC_unlock_irqrestore(flags);
+}
+
+/* software I2C functions */
+static inline void matroxfb_i2c_set(struct matrox_fb_info* minfo, int mask, int state) {
+ if (state)
+ state = 0;
+ else
+ state = mask;
+ matroxfb_set_gpio(minfo, ~mask, state);
+}
+
+static void matroxfb_gpio_setsda(void* data, int state) {
+ struct i2c_bit_adapter* b = data;
+ matroxfb_i2c_set(b->minfo, b->mask.data, state);
+}
+
+static void matroxfb_gpio_setscl(void* data, int state) {
+ struct i2c_bit_adapter* b = data;
+ matroxfb_i2c_set(b->minfo, b->mask.clock, state);
+}
+
+static int matroxfb_gpio_getsda(void* data) {
+ struct i2c_bit_adapter* b = data;
+ return (matroxfb_read_gpio(b->minfo) & b->mask.data) ? 1 : 0;
+}
+
+static int matroxfb_gpio_getscl(void* data) {
+ struct i2c_bit_adapter* b = data;
+ return (matroxfb_read_gpio(b->minfo) & b->mask.clock) ? 1 : 0;
+}
+
+static struct i2c_adapter matrox_i2c_adapter_template =
+{
+ .owner = THIS_MODULE,
+ .id = I2C_HW_B_G400,
+};
+
+static struct i2c_algo_bit_data matrox_i2c_algo_template =
+{
+ NULL,
+ matroxfb_gpio_setsda,
+ matroxfb_gpio_setscl,
+ matroxfb_gpio_getsda,
+ matroxfb_gpio_getscl,
+ 10, 10, 100,
+};
+
+static int i2c_bus_reg(struct i2c_bit_adapter* b, struct matrox_fb_info* minfo,
+ unsigned int data, unsigned int clock, const char* name) {
+ int err;
+
+ b->minfo = minfo;
+ b->mask.data = data;
+ b->mask.clock = clock;
+ b->adapter = matrox_i2c_adapter_template;
+ snprintf(b->adapter.name, I2C_NAME_SIZE, name,
+ minfo->fbcon.node);
+ i2c_set_adapdata(&b->adapter, b);
+ b->adapter.algo_data = &b->bac;
+ b->bac = matrox_i2c_algo_template;
+ b->bac.data = b;
+ err = i2c_bit_add_bus(&b->adapter);
+ b->initialized = !err;
+ return err;
+}
+
+static void i2c_bit_bus_del(struct i2c_bit_adapter* b) {
+ if (b->initialized) {
+ i2c_bit_del_bus(&b->adapter);
+ b->initialized = 0;
+ }
+}
+
+static inline void i2c_maven_done(struct matroxfb_dh_maven_info* minfo2) {
+ i2c_bit_bus_del(&minfo2->maven);
+}
+
+static inline void i2c_ddc1_done(struct matroxfb_dh_maven_info* minfo2) {
+ i2c_bit_bus_del(&minfo2->ddc1);
+}
+
+static inline void i2c_ddc2_done(struct matroxfb_dh_maven_info* minfo2) {
+ i2c_bit_bus_del(&minfo2->ddc2);
+}
+
+static void* i2c_matroxfb_probe(struct matrox_fb_info* minfo) {
+ int err;
+ unsigned long flags;
+ struct matroxfb_dh_maven_info* m2info;
+
+ m2info = (struct matroxfb_dh_maven_info*)kmalloc(sizeof(*m2info), GFP_KERNEL);
+ if (!m2info)
+ return NULL;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0xFF);
+ matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, 0x00);
+ matroxfb_DAC_unlock_irqrestore(flags);
+
+ memset(m2info, 0, sizeof(*m2info));
+
+ switch (ACCESS_FBINFO(chip)) {
+ case MGA_2064:
+ case MGA_2164:
+ err = i2c_bus_reg(&m2info->ddc1, minfo, DDC1B_DATA, DDC1B_CLK, "DDC:fb%u #0");
+ break;
+ default:
+ err = i2c_bus_reg(&m2info->ddc1, minfo, DDC1_DATA, DDC1_CLK, "DDC:fb%u #0");
+ break;
+ }
+ if (err)
+ goto fail_ddc1;
+ if (ACCESS_FBINFO(devflags.dualhead)) {
+ err = i2c_bus_reg(&m2info->ddc2, minfo, DDC2_DATA, DDC2_CLK, "DDC:fb%u #1");
+ if (err == -ENODEV) {
+ printk(KERN_INFO "i2c-matroxfb: VGA->TV plug detected, DDC unavailable.\n");
+ } else if (err)
+ printk(KERN_INFO "i2c-matroxfb: Could not register secondary output i2c bus. Continuing anyway.\n");
+ /* Register maven bus even on G450/G550 */
+ err = i2c_bus_reg(&m2info->maven, minfo, MAT_DATA, MAT_CLK, "MAVEN:fb%u");
+ if (err)
+ printk(KERN_INFO "i2c-matroxfb: Could not register Maven i2c bus. Continuing anyway.\n");
+ }
+ return m2info;
+fail_ddc1:;
+ kfree(m2info);
+ printk(KERN_ERR "i2c-matroxfb: Could not register primary adapter DDC bus.\n");
+ return NULL;
+}
+
+static void i2c_matroxfb_remove(struct matrox_fb_info* minfo, void* data) {
+ struct matroxfb_dh_maven_info* m2info = data;
+
+ i2c_maven_done(m2info);
+ i2c_ddc2_done(m2info);
+ i2c_ddc1_done(m2info);
+ kfree(m2info);
+}
+
+static struct matroxfb_driver i2c_matroxfb = {
+ .node = LIST_HEAD_INIT(i2c_matroxfb.node),
+ .name = "i2c-matroxfb",
+ .probe = i2c_matroxfb_probe,
+ .remove = i2c_matroxfb_remove,
+};
+
+static int __init i2c_matroxfb_init(void) {
+ if (matroxfb_register_driver(&i2c_matroxfb)) {
+ printk(KERN_ERR "i2c-matroxfb: failed to register driver\n");
+ return -ENXIO;
+ }
+ return 0;
+}
+
+static void __exit i2c_matroxfb_exit(void) {
+ matroxfb_unregister_driver(&i2c_matroxfb);
+}
+
+MODULE_AUTHOR("(c) 1999-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Support module providing I2C buses present on Matrox videocards");
+
+module_init(i2c_matroxfb_init);
+module_exit(i2c_matroxfb_exit);
+/* no __setup required */
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_DAC1064.c b/drivers/video/matrox/matroxfb_DAC1064.c
new file mode 100644
index 0000000..149680f
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_DAC1064.c
@@ -0,0 +1,1086 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * See matroxfb_base.c for contributors.
+ *
+ */
+
+/* make checkconfig does not walk through include tree :-( */
+#include <linux/config.h>
+
+#include "matroxfb_DAC1064.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_accel.h"
+#include "g450_pll.h"
+#include <linux/matroxfb.h>
+
+#ifdef NEED_DAC1064
+#define outDAC1064 matroxfb_DAC_out
+#define inDAC1064 matroxfb_DAC_in
+
+#define DAC1064_OPT_SCLK_PCI 0x00
+#define DAC1064_OPT_SCLK_PLL 0x01
+#define DAC1064_OPT_SCLK_EXT 0x02
+#define DAC1064_OPT_SCLK_MASK 0x03
+#define DAC1064_OPT_GDIV1 0x04 /* maybe it is GDIV2 on G100 ?! */
+#define DAC1064_OPT_GDIV3 0x00
+#define DAC1064_OPT_MDIV1 0x08
+#define DAC1064_OPT_MDIV2 0x00
+#define DAC1064_OPT_RESERVED 0x10
+
+static void DAC1064_calcclock(CPMINFO unsigned int freq, unsigned int fmax, unsigned int* in, unsigned int* feed, unsigned int* post) {
+ unsigned int fvco;
+ unsigned int p;
+
+ DBG(__FUNCTION__)
+
+ /* only for devices older than G450 */
+
+ fvco = PLL_calcclock(PMINFO freq, fmax, in, feed, &p);
+
+ p = (1 << p) - 1;
+ if (fvco <= 100000)
+ ;
+ else if (fvco <= 140000)
+ p |= 0x08;
+ else if (fvco <= 180000)
+ p |= 0x10;
+ else
+ p |= 0x18;
+ *post = p;
+}
+
+/* they must be in POS order */
+static const unsigned char MGA1064_DAC_regs[] = {
+ M1064_XCURADDL, M1064_XCURADDH, M1064_XCURCTRL,
+ M1064_XCURCOL0RED, M1064_XCURCOL0GREEN, M1064_XCURCOL0BLUE,
+ M1064_XCURCOL1RED, M1064_XCURCOL1GREEN, M1064_XCURCOL1BLUE,
+ M1064_XCURCOL2RED, M1064_XCURCOL2GREEN, M1064_XCURCOL2BLUE,
+ DAC1064_XVREFCTRL, M1064_XMULCTRL, M1064_XPIXCLKCTRL, M1064_XGENCTRL,
+ M1064_XMISCCTRL,
+ M1064_XGENIOCTRL, M1064_XGENIODATA, M1064_XZOOMCTRL, M1064_XSENSETEST,
+ M1064_XCRCBITSEL,
+ M1064_XCOLKEYMASKL, M1064_XCOLKEYMASKH, M1064_XCOLKEYL, M1064_XCOLKEYH };
+
+static const unsigned char MGA1064_DAC[] = {
+ 0x00, 0x00, M1064_XCURCTRL_DIS,
+ 0x00, 0x00, 0x00, /* black */
+ 0xFF, 0xFF, 0xFF, /* white */
+ 0xFF, 0x00, 0x00, /* red */
+ 0x00, 0,
+ M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_PLL,
+ M1064_XGENCTRL_VS_0 | M1064_XGENCTRL_ALPHA_DIS | M1064_XGENCTRL_BLACK_0IRE | M1064_XGENCTRL_NO_SYNC_ON_GREEN,
+ M1064_XMISCCTRL_DAC_8BIT,
+ 0x00, 0x00, M1064_XZOOMCTRL_1, M1064_XSENSETEST_BCOMP | M1064_XSENSETEST_GCOMP | M1064_XSENSETEST_RCOMP | M1064_XSENSETEST_PDOWN,
+ 0x00,
+ 0x00, 0x00, 0xFF, 0xFF};
+
+static void DAC1064_setpclk(WPMINFO unsigned long fout) {
+ unsigned int m, n, p;
+
+ DBG(__FUNCTION__)
+
+ DAC1064_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
+ ACCESS_FBINFO(hw).DACclk[0] = m;
+ ACCESS_FBINFO(hw).DACclk[1] = n;
+ ACCESS_FBINFO(hw).DACclk[2] = p;
+}
+
+static void DAC1064_setmclk(WPMINFO int oscinfo, unsigned long fmem) {
+ u_int32_t mx;
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ if (ACCESS_FBINFO(devflags.noinit)) {
+ /* read MCLK and give up... */
+ hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
+ hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
+ hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+ return;
+ }
+ mx = hw->MXoptionReg | 0x00000004;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+ mx &= ~0x000000BB;
+ if (oscinfo & DAC1064_OPT_GDIV1)
+ mx |= 0x00000008;
+ if (oscinfo & DAC1064_OPT_MDIV1)
+ mx |= 0x00000010;
+ if (oscinfo & DAC1064_OPT_RESERVED)
+ mx |= 0x00000080;
+ if ((oscinfo & DAC1064_OPT_SCLK_MASK) == DAC1064_OPT_SCLK_PLL) {
+ /* select PCI clock until we have setup oscilator... */
+ int clk;
+ unsigned int m, n, p;
+
+ /* powerup system PLL, select PCI clock */
+ mx |= 0x00000020;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+ mx &= ~0x00000004;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+
+ /* !!! you must not access device if MCLK is not running !!!
+ Doing so cause immediate PCI lockup :-( Maybe they should
+ generate ABORT or I/O (parity...) error and Linux should
+ recover from this... (kill driver/process). But world is not
+ perfect... */
+ /* (bit 2 of PCI_OPTION_REG must be 0... and bits 0,1 must not
+ select PLL... because of PLL can be stopped at this time) */
+ DAC1064_calcclock(PMINFO fmem, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
+ outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3] = m);
+ outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4] = n);
+ outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5] = p);
+ for (clk = 65536; clk; --clk) {
+ if (inDAC1064(PMINFO DAC1064_XSYSPLLSTAT) & 0x40)
+ break;
+ }
+ if (!clk)
+ printk(KERN_ERR "matroxfb: aiee, SYSPLL not locked\n");
+ /* select PLL */
+ mx |= 0x00000005;
+ } else {
+ /* select specified system clock source */
+ mx |= oscinfo & DAC1064_OPT_SCLK_MASK;
+ }
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+ mx &= ~0x00000004;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+ hw->MXoptionReg = mx;
+}
+
+#ifdef CONFIG_FB_MATROX_G
+static void g450_set_plls(WPMINFO2) {
+ u_int32_t c2_ctl;
+ unsigned int pxc;
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ int pixelmnp;
+ int videomnp;
+
+ c2_ctl = hw->crtc2.ctl & ~0x4007; /* Clear PLL + enable for CRTC2 */
+ c2_ctl |= 0x0001; /* Enable CRTC2 */
+ hw->DACreg[POS1064_XPWRCTRL] &= ~0x02; /* Stop VIDEO PLL */
+ pixelmnp = ACCESS_FBINFO(crtc1).mnp;
+ videomnp = ACCESS_FBINFO(crtc2).mnp;
+ if (videomnp < 0) {
+ c2_ctl &= ~0x0001; /* Disable CRTC2 */
+ hw->DACreg[POS1064_XPWRCTRL] &= ~0x10; /* Powerdown CRTC2 */
+ } else if (ACCESS_FBINFO(crtc2).pixclock == ACCESS_FBINFO(features).pll.ref_freq) {
+ c2_ctl |= 0x4002; /* Use reference directly */
+ } else if (videomnp == pixelmnp) {
+ c2_ctl |= 0x0004; /* Use pixel PLL */
+ } else {
+ if (0 == ((videomnp ^ pixelmnp) & 0xFFFFFF00)) {
+ /* PIXEL and VIDEO PLL must not use same frequency. We modify N
+ of PIXEL PLL in such case because of VIDEO PLL may be source
+ of TVO clocks, and chroma subcarrier is derived from its
+ pixel clocks */
+ pixelmnp += 0x000100;
+ }
+ c2_ctl |= 0x0006; /* Use video PLL */
+ hw->DACreg[POS1064_XPWRCTRL] |= 0x02;
+
+ outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+ matroxfb_g450_setpll_cond(PMINFO videomnp, M_VIDEO_PLL);
+ }
+
+ hw->DACreg[POS1064_XPIXCLKCTRL] &= ~M1064_XPIXCLKCTRL_PLL_UP;
+ if (pixelmnp >= 0) {
+ hw->DACreg[POS1064_XPIXCLKCTRL] |= M1064_XPIXCLKCTRL_PLL_UP;
+
+ outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+ matroxfb_g450_setpll_cond(PMINFO pixelmnp, M_PIXEL_PLL_C);
+ }
+ if (c2_ctl != hw->crtc2.ctl) {
+ hw->crtc2.ctl = c2_ctl;
+ mga_outl(0x3C10, c2_ctl);
+ }
+
+ pxc = ACCESS_FBINFO(crtc1).pixclock;
+ if (pxc == 0 || ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC2) {
+ pxc = ACCESS_FBINFO(crtc2).pixclock;
+ }
+ if (ACCESS_FBINFO(chip) == MGA_G550) {
+ if (pxc < 45000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x00; /* 0-50 */
+ } else if (pxc < 55000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x08; /* 34-62 */
+ } else if (pxc < 70000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x10; /* 42-78 */
+ } else if (pxc < 85000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x18; /* 62-92 */
+ } else if (pxc < 100000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x20; /* 74-108 */
+ } else if (pxc < 115000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x28; /* 94-122 */
+ } else if (pxc < 125000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x30; /* 108-132 */
+ } else {
+ hw->DACreg[POS1064_XPANMODE] = 0x38; /* 120-168 */
+ }
+ } else {
+ /* G450 */
+ if (pxc < 45000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x00; /* 0-54 */
+ } else if (pxc < 65000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x08; /* 38-70 */
+ } else if (pxc < 85000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x10; /* 56-96 */
+ } else if (pxc < 105000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x18; /* 80-114 */
+ } else if (pxc < 135000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x20; /* 102-144 */
+ } else if (pxc < 160000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x28; /* 132-166 */
+ } else if (pxc < 175000) {
+ hw->DACreg[POS1064_XPANMODE] = 0x30; /* 154-182 */
+ } else {
+ hw->DACreg[POS1064_XPANMODE] = 0x38; /* 170-204 */
+ }
+ }
+}
+#endif
+
+void DAC1064_global_init(WPMINFO2) {
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ hw->DACreg[POS1064_XMISCCTRL] &= M1064_XMISCCTRL_DAC_WIDTHMASK;
+ hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_LUT_EN;
+ hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_PLL;
+#ifdef CONFIG_FB_MATROX_G
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ hw->DACreg[POS1064_XPWRCTRL] = 0x1F; /* powerup everything */
+ hw->DACreg[POS1064_XOUTPUTCONN] = 0x00; /* disable outputs */
+ hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
+ switch (ACCESS_FBINFO(outputs[0]).src) {
+ case MATROXFB_SRC_CRTC1:
+ case MATROXFB_SRC_CRTC2:
+ hw->DACreg[POS1064_XOUTPUTCONN] |= 0x01; /* enable output; CRTC1/2 selection is in CRTC2 ctl */
+ break;
+ case MATROXFB_SRC_NONE:
+ hw->DACreg[POS1064_XMISCCTRL] &= ~M1064_XMISCCTRL_DAC_EN;
+ break;
+ }
+ switch (ACCESS_FBINFO(outputs[1]).src) {
+ case MATROXFB_SRC_CRTC1:
+ hw->DACreg[POS1064_XOUTPUTCONN] |= 0x04;
+ break;
+ case MATROXFB_SRC_CRTC2:
+ if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_MONITOR) {
+ hw->DACreg[POS1064_XOUTPUTCONN] |= 0x08;
+ } else {
+ hw->DACreg[POS1064_XOUTPUTCONN] |= 0x0C;
+ }
+ break;
+ case MATROXFB_SRC_NONE:
+ hw->DACreg[POS1064_XPWRCTRL] &= ~0x01; /* Poweroff DAC2 */
+ break;
+ }
+ switch (ACCESS_FBINFO(outputs[2]).src) {
+ case MATROXFB_SRC_CRTC1:
+ hw->DACreg[POS1064_XOUTPUTCONN] |= 0x20;
+ break;
+ case MATROXFB_SRC_CRTC2:
+ hw->DACreg[POS1064_XOUTPUTCONN] |= 0x40;
+ break;
+ case MATROXFB_SRC_NONE:
+#if 0
+ /* HELP! If we boot without DFP connected to DVI, we can
+ poweroff TMDS. But if we boot with DFP connected,
+ TMDS generated clocks are used instead of ALL pixclocks
+ available... If someone knows which register
+ handles it, please reveal this secret to me... */
+ hw->DACreg[POS1064_XPWRCTRL] &= ~0x04; /* Poweroff TMDS */
+#endif
+ break;
+ }
+ /* Now set timming related variables... */
+ g450_set_plls(PMINFO2);
+ } else
+#endif
+ {
+ if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1) {
+ hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_EXT;
+ hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_MAFC12;
+ } else if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
+ hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_C2_MAFC12;
+ } else if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1)
+ hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_PANELLINK | G400_XMISCCTRL_VDO_MAFC12;
+ else
+ hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_DIS;
+
+ if (ACCESS_FBINFO(outputs[0]).src != MATROXFB_SRC_NONE)
+ hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
+ }
+}
+
+void DAC1064_global_restore(WPMINFO2) {
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+ outDAC1064(PMINFO M1064_XMISCCTRL, hw->DACreg[POS1064_XMISCCTRL]);
+ if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
+ outDAC1064(PMINFO 0x20, 0x04);
+ outDAC1064(PMINFO 0x1F, ACCESS_FBINFO(devflags.dfp_type));
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ outDAC1064(PMINFO M1064_XSYNCCTRL, 0xCC);
+ outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+ outDAC1064(PMINFO M1064_XPANMODE, hw->DACreg[POS1064_XPANMODE]);
+ outDAC1064(PMINFO M1064_XOUTPUTCONN, hw->DACreg[POS1064_XOUTPUTCONN]);
+ }
+ }
+}
+
+static int DAC1064_init_1(WPMINFO struct my_timming* m) {
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ memcpy(hw->DACreg, MGA1064_DAC, sizeof(MGA1064_DAC_regs));
+ switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ /* case 4: not supported by MGA1064 DAC */
+ case 8:
+ hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_8BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+ break;
+ case 16:
+ if (ACCESS_FBINFO(fbcon).var.green.length == 5)
+ hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_15BPP_1BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+ else
+ hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_16BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+ break;
+ case 24:
+ hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_24BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+ break;
+ case 32:
+ hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_32BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+ break;
+ default:
+ return 1; /* unsupported depth */
+ }
+ hw->DACreg[POS1064_XVREFCTRL] = ACCESS_FBINFO(features.DAC1064.xvrefctrl);
+ hw->DACreg[POS1064_XGENCTRL] &= ~M1064_XGENCTRL_SYNC_ON_GREEN_MASK;
+ hw->DACreg[POS1064_XGENCTRL] |= (m->sync & FB_SYNC_ON_GREEN)?M1064_XGENCTRL_SYNC_ON_GREEN:M1064_XGENCTRL_NO_SYNC_ON_GREEN;
+ hw->DACreg[POS1064_XCURADDL] = 0;
+ hw->DACreg[POS1064_XCURADDH] = 0;
+
+ DAC1064_global_init(PMINFO2);
+ return 0;
+}
+
+static int DAC1064_init_2(WPMINFO struct my_timming* m) {
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 16) { /* 256 entries */
+ int i;
+
+ for (i = 0; i < 256; i++) {
+ hw->DACpal[i * 3 + 0] = i;
+ hw->DACpal[i * 3 + 1] = i;
+ hw->DACpal[i * 3 + 2] = i;
+ }
+ } else if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 8) {
+ if (ACCESS_FBINFO(fbcon).var.green.length == 5) { /* 0..31, 128..159 */
+ int i;
+
+ for (i = 0; i < 32; i++) {
+ /* with p15 == 0 */
+ hw->DACpal[i * 3 + 0] = i << 3;
+ hw->DACpal[i * 3 + 1] = i << 3;
+ hw->DACpal[i * 3 + 2] = i << 3;
+ /* with p15 == 1 */
+ hw->DACpal[(i + 128) * 3 + 0] = i << 3;
+ hw->DACpal[(i + 128) * 3 + 1] = i << 3;
+ hw->DACpal[(i + 128) * 3 + 2] = i << 3;
+ }
+ } else {
+ int i;
+
+ for (i = 0; i < 64; i++) { /* 0..63 */
+ hw->DACpal[i * 3 + 0] = i << 3;
+ hw->DACpal[i * 3 + 1] = i << 2;
+ hw->DACpal[i * 3 + 2] = i << 3;
+ }
+ }
+ } else {
+ memset(hw->DACpal, 0, 768);
+ }
+ return 0;
+}
+
+static void DAC1064_restore_1(WPMINFO2) {
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+ CRITBEGIN
+
+ if ((inDAC1064(PMINFO DAC1064_XSYSPLLM) != hw->DACclk[3]) ||
+ (inDAC1064(PMINFO DAC1064_XSYSPLLN) != hw->DACclk[4]) ||
+ (inDAC1064(PMINFO DAC1064_XSYSPLLP) != hw->DACclk[5])) {
+ outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3]);
+ outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4]);
+ outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5]);
+ }
+ {
+ unsigned int i;
+
+ for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
+ if ((i != POS1064_XPIXCLKCTRL) && (i != POS1064_XMISCCTRL))
+ outDAC1064(PMINFO MGA1064_DAC_regs[i], hw->DACreg[i]);
+ }
+ }
+
+ DAC1064_global_restore(PMINFO2);
+
+ CRITEND
+};
+
+static void DAC1064_restore_2(WPMINFO2) {
+#ifdef DEBUG
+ unsigned int i;
+#endif
+
+ DBG(__FUNCTION__)
+
+#ifdef DEBUG
+ dprintk(KERN_DEBUG "DAC1064regs ");
+ for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
+ dprintk("R%02X=%02X ", MGA1064_DAC_regs[i], ACCESS_FBINFO(hw).DACreg[i]);
+ if ((i & 0x7) == 0x7) dprintk("\n" KERN_DEBUG "continuing... ");
+ }
+ dprintk("\n" KERN_DEBUG "DAC1064clk ");
+ for (i = 0; i < 6; i++)
+ dprintk("C%02X=%02X ", i, ACCESS_FBINFO(hw).DACclk[i]);
+ dprintk("\n");
+#endif
+}
+
+static int m1064_compute(void* out, struct my_timming* m) {
+#define minfo ((struct matrox_fb_info*)out)
+ {
+ int i;
+ int tmout;
+ CRITFLAGS
+
+ DAC1064_setpclk(PMINFO m->pixclock);
+
+ CRITBEGIN
+
+ for (i = 0; i < 3; i++)
+ outDAC1064(PMINFO M1064_XPIXPLLCM + i, ACCESS_FBINFO(hw).DACclk[i]);
+ for (tmout = 500000; tmout; tmout--) {
+ if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+ break;
+ udelay(10);
+ };
+
+ CRITEND
+
+ if (!tmout)
+ printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n");
+ }
+#undef minfo
+ return 0;
+}
+
+static struct matrox_altout m1064 = {
+ .name = "Primary output",
+ .compute = m1064_compute,
+};
+
+#ifdef CONFIG_FB_MATROX_G
+static int g450_compute(void* out, struct my_timming* m) {
+#define minfo ((struct matrox_fb_info*)out)
+ if (m->mnp < 0) {
+ m->mnp = matroxfb_g450_setclk(PMINFO m->pixclock, (m->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+ if (m->mnp >= 0) {
+ m->pixclock = g450_mnp2f(PMINFO m->mnp);
+ }
+ }
+#undef minfo
+ return 0;
+}
+
+static struct matrox_altout g450out = {
+ .name = "Primary output",
+ .compute = g450_compute,
+};
+#endif
+
+#endif /* NEED_DAC1064 */
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static int MGA1064_init(WPMINFO struct my_timming* m) {
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ if (DAC1064_init_1(PMINFO m)) return 1;
+ if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+
+ hw->MiscOutReg = 0xCB;
+ if (m->sync & FB_SYNC_HOR_HIGH_ACT)
+ hw->MiscOutReg &= ~0x40;
+ if (m->sync & FB_SYNC_VERT_HIGH_ACT)
+ hw->MiscOutReg &= ~0x80;
+ if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
+ hw->CRTCEXT[3] |= 0x40;
+
+ if (DAC1064_init_2(PMINFO m)) return 1;
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+static int MGAG100_init(WPMINFO struct my_timming* m) {
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ if (DAC1064_init_1(PMINFO m)) return 1;
+ hw->MXoptionReg &= ~0x2000;
+ if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+
+ hw->MiscOutReg = 0xEF;
+ if (m->sync & FB_SYNC_HOR_HIGH_ACT)
+ hw->MiscOutReg &= ~0x40;
+ if (m->sync & FB_SYNC_VERT_HIGH_ACT)
+ hw->MiscOutReg &= ~0x80;
+ if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
+ hw->CRTCEXT[3] |= 0x40;
+
+ if (DAC1064_init_2(PMINFO m)) return 1;
+ return 0;
+}
+#endif /* G */
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static void MGA1064_ramdac_init(WPMINFO2) {
+
+ DBG(__FUNCTION__)
+
+ /* ACCESS_FBINFO(features.DAC1064.vco_freq_min) = 120000; */
+ ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
+ ACCESS_FBINFO(features.pll.ref_freq) = 14318;
+ ACCESS_FBINFO(features.pll.feed_div_min) = 100;
+ ACCESS_FBINFO(features.pll.feed_div_max) = 127;
+ ACCESS_FBINFO(features.pll.in_div_min) = 1;
+ ACCESS_FBINFO(features.pll.in_div_max) = 31;
+ ACCESS_FBINFO(features.pll.post_shift_max) = 3;
+ ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_EXTERNAL;
+ /* maybe cmdline MCLK= ?, doc says gclk=44MHz, mclk=66MHz... it was 55/83 with old values */
+ DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PLL, 133333);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+/* BIOS environ */
+static int x7AF4 = 0x10; /* flags, maybe 0x10 = SDRAM, 0x00 = SGRAM??? */
+ /* G100 wants 0x10, G200 SGRAM does not care... */
+#if 0
+static int def50 = 0; /* reg50, & 0x0F, & 0x3000 (only 0x0000, 0x1000, 0x2000 (0x3000 disallowed and treated as 0) */
+#endif
+
+static void MGAG100_progPixClock(CPMINFO int flags, int m, int n, int p) {
+ int reg;
+ int selClk;
+ int clk;
+
+ DBG(__FUNCTION__)
+
+ outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) | M1064_XPIXCLKCTRL_DIS |
+ M1064_XPIXCLKCTRL_PLL_UP);
+ switch (flags & 3) {
+ case 0: reg = M1064_XPIXPLLAM; break;
+ case 1: reg = M1064_XPIXPLLBM; break;
+ default: reg = M1064_XPIXPLLCM; break;
+ }
+ outDAC1064(PMINFO reg++, m);
+ outDAC1064(PMINFO reg++, n);
+ outDAC1064(PMINFO reg, p);
+ selClk = mga_inb(M_MISC_REG_READ) & ~0xC;
+ /* there should be flags & 0x03 & case 0/1/else */
+ /* and we should first select source and after that we should wait for PLL */
+ /* and we are waiting for PLL with oscilator disabled... Is it right? */
+ switch (flags & 0x03) {
+ case 0x00: break;
+ case 0x01: selClk |= 4; break;
+ default: selClk |= 0x0C; break;
+ }
+ mga_outb(M_MISC_REG, selClk);
+ for (clk = 500000; clk; clk--) {
+ if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+ break;
+ udelay(10);
+ };
+ if (!clk)
+ printk(KERN_ERR "matroxfb: Pixel PLL%c not locked after usual time\n", (reg-M1064_XPIXPLLAM-2)/4 + 'A');
+ selClk = inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_SRC_MASK;
+ switch (flags & 0x0C) {
+ case 0x00: selClk |= M1064_XPIXCLKCTRL_SRC_PCI; break;
+ case 0x04: selClk |= M1064_XPIXCLKCTRL_SRC_PLL; break;
+ default: selClk |= M1064_XPIXCLKCTRL_SRC_EXT; break;
+ }
+ outDAC1064(PMINFO M1064_XPIXCLKCTRL, selClk);
+ outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_DIS);
+}
+
+static void MGAG100_setPixClock(CPMINFO int flags, int freq) {
+ unsigned int m, n, p;
+
+ DBG(__FUNCTION__)
+
+ DAC1064_calcclock(PMINFO freq, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
+ MGAG100_progPixClock(PMINFO flags, m, n, p);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static int MGA1064_preinit(WPMINFO2) {
+ static const int vxres_mystique[] = { 512, 640, 768, 800, 832, 960,
+ 1024, 1152, 1280, 1600, 1664, 1920,
+ 2048, 0};
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ /* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
+ ACCESS_FBINFO(capable.text) = 1;
+ ACCESS_FBINFO(capable.vxres) = vxres_mystique;
+ ACCESS_FBINFO(features.accel.has_cacheflush) = 1;
+
+ ACCESS_FBINFO(outputs[0]).output = &m1064;
+ ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
+ ACCESS_FBINFO(outputs[0]).data = MINFO;
+ ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+
+ if (ACCESS_FBINFO(devflags.noinit))
+ return 0; /* do not modify settings */
+ hw->MXoptionReg &= 0xC0000100;
+ hw->MXoptionReg |= 0x00094E20;
+ if (ACCESS_FBINFO(devflags.novga))
+ hw->MXoptionReg &= ~0x00000100;
+ if (ACCESS_FBINFO(devflags.nobios))
+ hw->MXoptionReg &= ~0x40000000;
+ if (ACCESS_FBINFO(devflags.nopciretry))
+ hw->MXoptionReg |= 0x20000000;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ mga_setr(M_SEQ_INDEX, 0x01, 0x20);
+ mga_outl(M_CTLWTST, 0x00000000);
+ udelay(200);
+ mga_outl(M_MACCESS, 0x00008000);
+ udelay(100);
+ mga_outl(M_MACCESS, 0x0000C000);
+ return 0;
+}
+
+static void MGA1064_reset(WPMINFO2) {
+
+ DBG(__FUNCTION__);
+
+ MGA1064_ramdac_init(PMINFO2);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+static void g450_mclk_init(WPMINFO2) {
+ /* switch all clocks to PCI source */
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3 & ~0x00300C03);
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+
+ if (((ACCESS_FBINFO(values).reg.opt3 & 0x000003) == 0x000003) ||
+ ((ACCESS_FBINFO(values).reg.opt3 & 0x000C00) == 0x000C00) ||
+ ((ACCESS_FBINFO(values).reg.opt3 & 0x300000) == 0x300000)) {
+ matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.video), M_VIDEO_PLL);
+ } else {
+ unsigned long flags;
+ unsigned int pwr;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ pwr = inDAC1064(PMINFO M1064_XPWRCTRL) & ~0x02;
+ outDAC1064(PMINFO M1064_XPWRCTRL, pwr);
+ matroxfb_DAC_unlock_irqrestore(flags);
+ }
+ matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.system), M_SYSTEM_PLL);
+
+ /* switch clocks to their real PLL source(s) */
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3);
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+
+}
+
+static void g450_memory_init(WPMINFO2) {
+ /* disable memory refresh */
+ ACCESS_FBINFO(hw).MXoptionReg &= ~0x001F8000;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+
+ /* set memory interface parameters */
+ ACCESS_FBINFO(hw).MXoptionReg &= ~0x00207E00;
+ ACCESS_FBINFO(hw).MXoptionReg |= 0x00207E00 & ACCESS_FBINFO(values).reg.opt;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ACCESS_FBINFO(values).reg.opt2);
+
+ mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+
+ /* first set up memory interface with disabled memory interface clocks */
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc & ~0x80000000U);
+ mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+ mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess);
+ /* start memory clocks */
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc | 0x80000000U);
+
+ udelay(200);
+
+ if (ACCESS_FBINFO(values).memory.ddr && (!ACCESS_FBINFO(values).memory.emrswen || !ACCESS_FBINFO(values).memory.dll)) {
+ mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk & ~0x1000);
+ }
+ mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess | 0x8000);
+
+ udelay(200);
+
+ ACCESS_FBINFO(hw).MXoptionReg |= 0x001F8000 & ACCESS_FBINFO(values).reg.opt;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+
+ /* value is written to memory chips only if old != new */
+ mga_outl(M_PLNWT, 0);
+ mga_outl(M_PLNWT, ~0);
+
+ if (ACCESS_FBINFO(values).reg.mctlwtst != ACCESS_FBINFO(values).reg.mctlwtst_core) {
+ mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst_core);
+ }
+
+}
+
+static void g450_preinit(WPMINFO2) {
+ u_int32_t c2ctl;
+ u_int8_t curctl;
+ u_int8_t c1ctl;
+
+ /* ACCESS_FBINFO(hw).MXoptionReg = minfo->values.reg.opt; */
+ ACCESS_FBINFO(hw).MXoptionReg &= 0xC0000100;
+ ACCESS_FBINFO(hw).MXoptionReg |= 0x00000020;
+ if (ACCESS_FBINFO(devflags.novga))
+ ACCESS_FBINFO(hw).MXoptionReg &= ~0x00000100;
+ if (ACCESS_FBINFO(devflags.nobios))
+ ACCESS_FBINFO(hw).MXoptionReg &= ~0x40000000;
+ if (ACCESS_FBINFO(devflags.nopciretry))
+ ACCESS_FBINFO(hw).MXoptionReg |= 0x20000000;
+ ACCESS_FBINFO(hw).MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x03400040;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+
+ /* Init system clocks */
+
+ /* stop crtc2 */
+ c2ctl = mga_inl(M_C2CTL);
+ mga_outl(M_C2CTL, c2ctl & ~1);
+ /* stop cursor */
+ curctl = inDAC1064(PMINFO M1064_XCURCTRL);
+ outDAC1064(PMINFO M1064_XCURCTRL, 0);
+ /* stop crtc1 */
+ c1ctl = mga_readr(M_SEQ_INDEX, 1);
+ mga_setr(M_SEQ_INDEX, 1, c1ctl | 0x20);
+
+ g450_mclk_init(PMINFO2);
+ g450_memory_init(PMINFO2);
+
+ /* set legacy VGA clock sources for DOSEmu or VMware... */
+ matroxfb_g450_setclk(PMINFO 25175, M_PIXEL_PLL_A);
+ matroxfb_g450_setclk(PMINFO 28322, M_PIXEL_PLL_B);
+
+ /* restore crtc1 */
+ mga_setr(M_SEQ_INDEX, 1, c1ctl);
+
+ /* restore cursor */
+ outDAC1064(PMINFO M1064_XCURCTRL, curctl);
+
+ /* restore crtc2 */
+ mga_outl(M_C2CTL, c2ctl);
+
+ return;
+}
+
+static int MGAG100_preinit(WPMINFO2) {
+ static const int vxres_g100[] = { 512, 640, 768, 800, 832, 960,
+ 1024, 1152, 1280, 1600, 1664, 1920,
+ 2048, 0};
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ u_int32_t reg50;
+#if 0
+ u_int32_t q;
+#endif
+
+ DBG(__FUNCTION__)
+
+ /* there are some instabilities if in_div > 19 && vco < 61000 */
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ ACCESS_FBINFO(features.pll.vco_freq_min) = 130000; /* my sample: >118 */
+ } else {
+ ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
+ }
+ if (!ACCESS_FBINFO(features.pll.ref_freq)) {
+ ACCESS_FBINFO(features.pll.ref_freq) = 27000;
+ }
+ ACCESS_FBINFO(features.pll.feed_div_min) = 7;
+ ACCESS_FBINFO(features.pll.feed_div_max) = 127;
+ ACCESS_FBINFO(features.pll.in_div_min) = 1;
+ ACCESS_FBINFO(features.pll.in_div_max) = 31;
+ ACCESS_FBINFO(features.pll.post_shift_max) = 3;
+ ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_G100_DEFAULT;
+ /* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
+ ACCESS_FBINFO(capable.text) = 1;
+ ACCESS_FBINFO(capable.vxres) = vxres_g100;
+ ACCESS_FBINFO(features.accel.has_cacheflush) = 1;
+ ACCESS_FBINFO(capable.plnwt) = ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100
+ ? ACCESS_FBINFO(devflags.sgram) : 1;
+
+#ifdef CONFIG_FB_MATROX_G
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ ACCESS_FBINFO(outputs[0]).output = &g450out;
+ } else
+#endif
+ {
+ ACCESS_FBINFO(outputs[0]).output = &m1064;
+ }
+ ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
+ ACCESS_FBINFO(outputs[0]).data = MINFO;
+ ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ /* we must do this always, BIOS does not do it for us
+ and accelerator dies without it */
+ mga_outl(0x1C0C, 0);
+ }
+ if (ACCESS_FBINFO(devflags.noinit))
+ return 0;
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ g450_preinit(PMINFO2);
+ return 0;
+ }
+ hw->MXoptionReg &= 0xC0000100;
+ hw->MXoptionReg |= 0x00000020;
+ if (ACCESS_FBINFO(devflags.novga))
+ hw->MXoptionReg &= ~0x00000100;
+ if (ACCESS_FBINFO(devflags.nobios))
+ hw->MXoptionReg &= ~0x40000000;
+ if (ACCESS_FBINFO(devflags.nopciretry))
+ hw->MXoptionReg |= 0x20000000;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PCI, 133333);
+
+ if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100) {
+ pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ®50);
+ reg50 &= ~0x3000;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+
+ hw->MXoptionReg |= 0x1080;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+ udelay(100);
+ mga_outb(0x1C05, 0x00);
+ mga_outb(0x1C05, 0x80);
+ udelay(100);
+ mga_outb(0x1C05, 0x40);
+ mga_outb(0x1C05, 0xC0);
+ udelay(100);
+ reg50 &= ~0xFF;
+ reg50 |= 0x07;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+ /* it should help with G100 */
+ mga_outb(M_GRAPHICS_INDEX, 6);
+ mga_outb(M_GRAPHICS_DATA, (mga_inb(M_GRAPHICS_DATA) & 3) | 4);
+ mga_setr(M_EXTVGA_INDEX, 0x03, 0x81);
+ mga_setr(M_EXTVGA_INDEX, 0x04, 0x00);
+ mga_writeb(ACCESS_FBINFO(video.vbase), 0x0000, 0xAA);
+ mga_writeb(ACCESS_FBINFO(video.vbase), 0x0800, 0x55);
+ mga_writeb(ACCESS_FBINFO(video.vbase), 0x4000, 0x55);
+#if 0
+ if (mga_readb(ACCESS_FBINFO(video.vbase), 0x0000) != 0xAA) {
+ hw->MXoptionReg &= ~0x1000;
+ }
+#endif
+ hw->MXoptionReg |= 0x00078020;
+ } else if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG200) {
+ pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ®50);
+ reg50 &= ~0x3000;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+
+ if (ACCESS_FBINFO(devflags.memtype) == -1)
+ hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+ else
+ hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
+ if (ACCESS_FBINFO(devflags.sgram))
+ hw->MXoptionReg |= 0x4000;
+ mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+ mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+ udelay(200);
+ mga_outl(M_MACCESS, 0x00000000);
+ mga_outl(M_MACCESS, 0x00008000);
+ udelay(100);
+ mga_outw(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+ hw->MXoptionReg |= 0x00078020;
+ } else {
+ pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ®50);
+ reg50 &= ~0x00000100;
+ reg50 |= 0x00000000;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+
+ if (ACCESS_FBINFO(devflags.memtype) == -1)
+ hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+ else
+ hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
+ if (ACCESS_FBINFO(devflags.sgram))
+ hw->MXoptionReg |= 0x4000;
+ mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+ mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+ udelay(200);
+ mga_outl(M_MACCESS, 0x00000000);
+ mga_outl(M_MACCESS, 0x00008000);
+ udelay(100);
+ mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+ hw->MXoptionReg |= 0x00040020;
+ }
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ return 0;
+}
+
+static void MGAG100_reset(WPMINFO2) {
+ u_int8_t b;
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ {
+#ifdef G100_BROKEN_IBM_82351
+ u_int32_t d;
+
+ find 1014/22 (IBM/82351); /* if found and bridging Matrox, do some strange stuff */
+ pci_read_config_byte(ibm, PCI_SECONDARY_BUS, &b);
+ if (b == ACCESS_FBINFO(pcidev)->bus->number) {
+ pci_write_config_byte(ibm, PCI_COMMAND+1, 0); /* disable back-to-back & SERR */
+ pci_write_config_byte(ibm, 0x41, 0xF4); /* ??? */
+ pci_write_config_byte(ibm, PCI_IO_BASE, 0xF0); /* ??? */
+ pci_write_config_byte(ibm, PCI_IO_LIMIT, 0x00); /* ??? */
+ }
+#endif
+ if (!ACCESS_FBINFO(devflags.noinit)) {
+ if (x7AF4 & 8) {
+ hw->MXoptionReg |= 0x40; /* FIXME... */
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ }
+ mga_setr(M_EXTVGA_INDEX, 0x06, 0x50);
+ }
+ }
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ /* either leave MCLK as is... or they were set in preinit */
+ hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
+ hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
+ hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+ } else {
+ DAC1064_setmclk(PMINFO DAC1064_OPT_RESERVED | DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV1 | DAC1064_OPT_SCLK_PLL, 133333);
+ }
+ if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
+ if (ACCESS_FBINFO(devflags.dfp_type) == -1) {
+ ACCESS_FBINFO(devflags.dfp_type) = inDAC1064(PMINFO 0x1F);
+ }
+ }
+ if (ACCESS_FBINFO(devflags.noinit))
+ return;
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ } else {
+ MGAG100_setPixClock(PMINFO 4, 25175);
+ MGAG100_setPixClock(PMINFO 5, 28322);
+ if (x7AF4 & 0x10) {
+ b = inDAC1064(PMINFO M1064_XGENIODATA) & ~1;
+ outDAC1064(PMINFO M1064_XGENIODATA, b);
+ b = inDAC1064(PMINFO M1064_XGENIOCTRL) | 1;
+ outDAC1064(PMINFO M1064_XGENIOCTRL, b);
+ }
+ }
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static void MGA1064_restore(WPMINFO2) {
+ int i;
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+ CRITBEGIN
+
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ mga_outb(M_IEN, 0x00);
+ mga_outb(M_CACHEFLUSH, 0x00);
+
+ CRITEND
+
+ DAC1064_restore_1(PMINFO2);
+ matroxfb_vgaHWrestore(PMINFO2);
+ ACCESS_FBINFO(crtc1.panpos) = -1;
+ for (i = 0; i < 6; i++)
+ mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
+ DAC1064_restore_2(PMINFO2);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+static void MGAG100_restore(WPMINFO2) {
+ int i;
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+ CRITBEGIN
+
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ CRITEND
+
+ DAC1064_restore_1(PMINFO2);
+ matroxfb_vgaHWrestore(PMINFO2);
+#ifdef CONFIG_FB_MATROX_32MB
+ if (ACCESS_FBINFO(devflags.support32MB))
+ mga_setr(M_EXTVGA_INDEX, 8, hw->CRTCEXT[8]);
+#endif
+ ACCESS_FBINFO(crtc1.panpos) = -1;
+ for (i = 0; i < 6; i++)
+ mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
+ DAC1064_restore_2(PMINFO2);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+struct matrox_switch matrox_mystique = {
+ MGA1064_preinit, MGA1064_reset, MGA1064_init, MGA1064_restore,
+};
+EXPORT_SYMBOL(matrox_mystique);
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+struct matrox_switch matrox_G100 = {
+ MGAG100_preinit, MGAG100_reset, MGAG100_init, MGAG100_restore,
+};
+EXPORT_SYMBOL(matrox_G100);
+#endif
+
+#ifdef NEED_DAC1064
+EXPORT_SYMBOL(DAC1064_global_init);
+EXPORT_SYMBOL(DAC1064_global_restore);
+#endif
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_DAC1064.h b/drivers/video/matrox/matroxfb_DAC1064.h
new file mode 100644
index 0000000..a6a4701
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_DAC1064.h
@@ -0,0 +1,164 @@
+#ifndef __MATROXFB_DAC1064_H__
+#define __MATROXFB_DAC1064_H__
+
+/* make checkconfig does not walk through include tree */
+#include <linux/config.h>
+
+#include "matroxfb_base.h"
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+extern struct matrox_switch matrox_mystique;
+#endif
+#ifdef CONFIG_FB_MATROX_G
+extern struct matrox_switch matrox_G100;
+#endif
+#ifdef NEED_DAC1064
+void DAC1064_global_init(WPMINFO2);
+void DAC1064_global_restore(WPMINFO2);
+#endif
+
+#define M1064_INDEX 0x00
+#define M1064_PALWRADD 0x00
+#define M1064_PALDATA 0x01
+#define M1064_PIXRDMSK 0x02
+#define M1064_PALRDADD 0x03
+#define M1064_X_DATAREG 0x0A
+#define M1064_CURPOSXL 0x0C /* can be accessed as DWORD */
+#define M1064_CURPOSXH 0x0D
+#define M1064_CURPOSYL 0x0E
+#define M1064_CURPOSYH 0x0F
+
+#define M1064_XCURADDL 0x04
+#define M1064_XCURADDH 0x05
+#define M1064_XCURCTRL 0x06
+#define M1064_XCURCTRL_DIS 0x00 /* transparent, transparent, transparent, transparent */
+#define M1064_XCURCTRL_3COLOR 0x01 /* transparent, 0, 1, 2 */
+#define M1064_XCURCTRL_XGA 0x02 /* 0, 1, transparent, complement */
+#define M1064_XCURCTRL_XWIN 0x03 /* transparent, transparent, 0, 1 */
+#define M1064_XCURCOL0RED 0x08
+#define M1064_XCURCOL0GREEN 0x09
+#define M1064_XCURCOL0BLUE 0x0A
+#define M1064_XCURCOL1RED 0x0C
+#define M1064_XCURCOL1GREEN 0x0D
+#define M1064_XCURCOL1BLUE 0x0E
+#define M1064_XCURCOL2RED 0x10
+#define M1064_XCURCOL2GREEN 0x11
+#define M1064_XCURCOL2BLUE 0x12
+#define DAC1064_XVREFCTRL 0x18
+#define DAC1064_XVREFCTRL_INTERNAL 0x3F
+#define DAC1064_XVREFCTRL_EXTERNAL 0x00
+#define DAC1064_XVREFCTRL_G100_DEFAULT 0x03
+#define M1064_XMULCTRL 0x19
+#define M1064_XMULCTRL_DEPTH_8BPP 0x00 /* 8 bpp paletized */
+#define M1064_XMULCTRL_DEPTH_15BPP_1BPP 0x01 /* 15 bpp paletized + 1 bpp overlay */
+#define M1064_XMULCTRL_DEPTH_16BPP 0x02 /* 16 bpp paletized */
+#define M1064_XMULCTRL_DEPTH_24BPP 0x03 /* 24 bpp paletized */
+#define M1064_XMULCTRL_DEPTH_24BPP_8BPP 0x04 /* 24 bpp direct + 8 bpp overlay paletized */
+#define M1064_XMULCTRL_2G8V16 0x05 /* 15 bpp video direct, half xres, 8bpp paletized */
+#define M1064_XMULCTRL_G16V16 0x06 /* 15 bpp video, 15bpp graphics, one of them paletized */
+#define M1064_XMULCTRL_DEPTH_32BPP 0x07 /* 24 bpp paletized + 8 bpp unused */
+#define M1064_XMULCTRL_GRAPHICS_PALETIZED 0x00
+#define M1064_XMULCTRL_VIDEO_PALETIZED 0x08
+#define M1064_XPIXCLKCTRL 0x1A
+#define M1064_XPIXCLKCTRL_SRC_PCI 0x00
+#define M1064_XPIXCLKCTRL_SRC_PLL 0x01
+#define M1064_XPIXCLKCTRL_SRC_EXT 0x02
+#define M1064_XPIXCLKCTRL_SRC_SYS 0x03 /* G200/G400 */
+#define M1064_XPIXCLKCTRL_SRC_PLL2 0x03 /* G450 */
+#define M1064_XPIXCLKCTRL_SRC_MASK 0x03
+#define M1064_XPIXCLKCTRL_EN 0x00
+#define M1064_XPIXCLKCTRL_DIS 0x04
+#define M1064_XPIXCLKCTRL_PLL_DOWN 0x00
+#define M1064_XPIXCLKCTRL_PLL_UP 0x08
+#define M1064_XGENCTRL 0x1D
+#define M1064_XGENCTRL_VS_0 0x00
+#define M1064_XGENCTRL_VS_1 0x01
+#define M1064_XGENCTRL_ALPHA_DIS 0x00
+#define M1064_XGENCTRL_ALPHA_EN 0x02
+#define M1064_XGENCTRL_BLACK_0IRE 0x00
+#define M1064_XGENCTRL_BLACK_75IRE 0x10
+#define M1064_XGENCTRL_SYNC_ON_GREEN 0x00
+#define M1064_XGENCTRL_NO_SYNC_ON_GREEN 0x20
+#define M1064_XGENCTRL_SYNC_ON_GREEN_MASK 0x20
+#define M1064_XMISCCTRL 0x1E
+#define M1064_XMISCCTRL_DAC_DIS 0x00
+#define M1064_XMISCCTRL_DAC_EN 0x01
+#define M1064_XMISCCTRL_MFC_VGA 0x00
+#define M1064_XMISCCTRL_MFC_MAFC 0x02
+#define M1064_XMISCCTRL_MFC_DIS 0x06
+#define GX00_XMISCCTRL_MFC_MAFC 0x02
+#define GX00_XMISCCTRL_MFC_PANELLINK 0x04
+#define GX00_XMISCCTRL_MFC_DIS 0x06
+#define GX00_XMISCCTRL_MFC_MASK 0x06
+#define M1064_XMISCCTRL_DAC_6BIT 0x00
+#define M1064_XMISCCTRL_DAC_8BIT 0x08
+#define M1064_XMISCCTRL_DAC_WIDTHMASK 0x08
+#define M1064_XMISCCTRL_LUT_DIS 0x00
+#define M1064_XMISCCTRL_LUT_EN 0x10
+#define G400_XMISCCTRL_VDO_MAFC12 0x00
+#define G400_XMISCCTRL_VDO_BYPASS656 0x40
+#define G400_XMISCCTRL_VDO_C2_MAFC12 0x80
+#define G400_XMISCCTRL_VDO_C2_BYPASS656 0xC0
+#define G400_XMISCCTRL_VDO_MASK 0xE0
+#define M1064_XGENIOCTRL 0x2A
+#define M1064_XGENIODATA 0x2B
+#define DAC1064_XSYSPLLM 0x2C
+#define DAC1064_XSYSPLLN 0x2D
+#define DAC1064_XSYSPLLP 0x2E
+#define DAC1064_XSYSPLLSTAT 0x2F
+#define M1064_XZOOMCTRL 0x38
+#define M1064_XZOOMCTRL_1 0x00
+#define M1064_XZOOMCTRL_2 0x01
+#define M1064_XZOOMCTRL_4 0x03
+#define M1064_XSENSETEST 0x3A
+#define M1064_XSENSETEST_BCOMP 0x01
+#define M1064_XSENSETEST_GCOMP 0x02
+#define M1064_XSENSETEST_RCOMP 0x04
+#define M1064_XSENSETEST_PDOWN 0x00
+#define M1064_XSENSETEST_PUP 0x80
+#define M1064_XCRCREML 0x3C
+#define M1064_XCRCREMH 0x3D
+#define M1064_XCRCBITSEL 0x3E
+#define M1064_XCOLKEYMASKL 0x40
+#define M1064_XCOLKEYMASKH 0x41
+#define M1064_XCOLKEYL 0x42
+#define M1064_XCOLKEYH 0x43
+#define M1064_XPIXPLLAM 0x44
+#define M1064_XPIXPLLAN 0x45
+#define M1064_XPIXPLLAP 0x46
+#define M1064_XPIXPLLBM 0x48
+#define M1064_XPIXPLLBN 0x49
+#define M1064_XPIXPLLBP 0x4A
+#define M1064_XPIXPLLCM 0x4C
+#define M1064_XPIXPLLCN 0x4D
+#define M1064_XPIXPLLCP 0x4E
+#define M1064_XPIXPLLSTAT 0x4F
+
+#define M1064_XTVO_IDX 0x87
+#define M1064_XTVO_DATA 0x88
+
+#define M1064_XOUTPUTCONN 0x8A
+#define M1064_XSYNCCTRL 0x8B
+#define M1064_XVIDPLLSTAT 0x8C
+#define M1064_XVIDPLLP 0x8D
+#define M1064_XVIDPLLM 0x8E
+#define M1064_XVIDPLLN 0x8F
+
+#define M1064_XPWRCTRL 0xA0
+
+#define M1064_XPANMODE 0xA2
+
+enum POS1064 {
+ POS1064_XCURADDL=0, POS1064_XCURADDH, POS1064_XCURCTRL,
+ POS1064_XCURCOL0RED, POS1064_XCURCOL0GREEN, POS1064_XCURCOL0BLUE,
+ POS1064_XCURCOL1RED, POS1064_XCURCOL1GREEN, POS1064_XCURCOL1BLUE,
+ POS1064_XCURCOL2RED, POS1064_XCURCOL2GREEN, POS1064_XCURCOL2BLUE,
+ POS1064_XVREFCTRL, POS1064_XMULCTRL, POS1064_XPIXCLKCTRL, POS1064_XGENCTRL,
+ POS1064_XMISCCTRL,
+ POS1064_XGENIOCTRL, POS1064_XGENIODATA, POS1064_XZOOMCTRL, POS1064_XSENSETEST,
+ POS1064_XCRCBITSEL,
+ POS1064_XCOLKEYMASKL, POS1064_XCOLKEYMASKH, POS1064_XCOLKEYL, POS1064_XCOLKEYH,
+ POS1064_XOUTPUTCONN, POS1064_XPANMODE, POS1064_XPWRCTRL };
+
+
+#endif /* __MATROXFB_DAC1064_H__ */
diff --git a/drivers/video/matrox/matroxfb_Ti3026.c b/drivers/video/matrox/matroxfb_Ti3026.c
new file mode 100644
index 0000000..537ade5
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_Ti3026.c
@@ -0,0 +1,739 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * MTRR stuff: 1998 Tom Rini <trini@kernel.crashing.org>
+ *
+ * Contributors: "menion?" <menion@mindless.com>
+ * Betatesting, fixes, ideas
+ *
+ * "Kurt Garloff" <garloff@suse.de>
+ * Betatesting, fixes, ideas, videomodes, videomodes timmings
+ *
+ * "Tom Rini" <trini@kernel.crashing.org>
+ * MTRR stuff, PPC cleanups, betatesting, fixes, ideas
+ *
+ * "Bibek Sahu" <scorpio@dodds.net>
+ * Access device through readb|w|l and write b|w|l
+ * Extensive debugging stuff
+ *
+ * "Daniel Haun" <haund@usa.net>
+ * Testing, hardware cursor fixes
+ *
+ * "Scott Wood" <sawst46+@pitt.edu>
+ * Fixes
+ *
+ * "Gerd Knorr" <kraxel@goldbach.isdn.cs.tu-berlin.de>
+ * Betatesting
+ *
+ * "Kelly French" <targon@hazmat.com>
+ * "Fernando Herrera" <fherrera@eurielec.etsit.upm.es>
+ * Betatesting, bug reporting
+ *
+ * "Pablo Bianucci" <pbian@pccp.com.ar>
+ * Fixes, ideas, betatesting
+ *
+ * "Inaky Perez Gonzalez" <inaky@peloncho.fis.ucm.es>
+ * Fixes, enhandcements, ideas, betatesting
+ *
+ * "Ryuichi Oikawa" <roikawa@rr.iiij4u.or.jp>
+ * PPC betatesting, PPC support, backward compatibility
+ *
+ * "Paul Womar" <Paul@pwomar.demon.co.uk>
+ * "Owen Waller" <O.Waller@ee.qub.ac.uk>
+ * PPC betatesting
+ *
+ * "Thomas Pornin" <pornin@bolet.ens.fr>
+ * Alpha betatesting
+ *
+ * "Pieter van Leuven" <pvl@iae.nl>
+ * "Ulf Jaenicke-Roessler" <ujr@physik.phy.tu-dresden.de>
+ * G100 testing
+ *
+ * "H. Peter Arvin" <hpa@transmeta.com>
+ * Ideas
+ *
+ * "Cort Dougan" <cort@cs.nmt.edu>
+ * CHRP fixes and PReP cleanup
+ *
+ * "Mark Vojkovich" <mvojkovi@ucsd.edu>
+ * G400 support
+ *
+ * (following author is not in any relation with this code, but his code
+ * is included in this driver)
+ *
+ * Based on framebuffer driver for VBE 2.0 compliant graphic boards
+ * (c) 1998 Gerd Knorr <kraxel@cs.tu-berlin.de>
+ *
+ * (following author is not in any relation with this code, but his ideas
+ * were used when writting this driver)
+ *
+ * FreeVBE/AF (Matrox), "Shawn Hargreaves" <shawn@talula.demon.co.uk>
+ *
+ */
+
+/* make checkconfig does not verify included files... */
+#include <linux/config.h>
+
+#include "matroxfb_Ti3026.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_accel.h"
+#include <linux/matroxfb.h>
+
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+#define outTi3026 matroxfb_DAC_out
+#define inTi3026 matroxfb_DAC_in
+
+#define TVP3026_INDEX 0x00
+#define TVP3026_PALWRADD 0x00
+#define TVP3026_PALDATA 0x01
+#define TVP3026_PIXRDMSK 0x02
+#define TVP3026_PALRDADD 0x03
+#define TVP3026_CURCOLWRADD 0x04
+#define TVP3026_CLOVERSCAN 0x00
+#define TVP3026_CLCOLOR0 0x01
+#define TVP3026_CLCOLOR1 0x02
+#define TVP3026_CLCOLOR2 0x03
+#define TVP3026_CURCOLDATA 0x05
+#define TVP3026_CURCOLRDADD 0x07
+#define TVP3026_CURCTRL 0x09
+#define TVP3026_X_DATAREG 0x0A
+#define TVP3026_CURRAMDATA 0x0B
+#define TVP3026_CURPOSXL 0x0C
+#define TVP3026_CURPOSXH 0x0D
+#define TVP3026_CURPOSYL 0x0E
+#define TVP3026_CURPOSYH 0x0F
+
+#define TVP3026_XSILICONREV 0x01
+#define TVP3026_XCURCTRL 0x06
+#define TVP3026_XCURCTRL_DIS 0x00 /* transparent, transparent, transparent, transparent */
+#define TVP3026_XCURCTRL_3COLOR 0x01 /* transparent, 0, 1, 2 */
+#define TVP3026_XCURCTRL_XGA 0x02 /* 0, 1, transparent, complement */
+#define TVP3026_XCURCTRL_XWIN 0x03 /* transparent, transparent, 0, 1 */
+#define TVP3026_XCURCTRL_BLANK2048 0x00
+#define TVP3026_XCURCTRL_BLANK4096 0x10
+#define TVP3026_XCURCTRL_INTERLACED 0x20
+#define TVP3026_XCURCTRL_ODD 0x00 /* ext.signal ODD/\EVEN */
+#define TVP3026_XCURCTRL_EVEN 0x40 /* ext.signal EVEN/\ODD */
+#define TVP3026_XCURCTRL_INDIRECT 0x00
+#define TVP3026_XCURCTRL_DIRECT 0x80
+#define TVP3026_XLATCHCTRL 0x0F
+#define TVP3026_XLATCHCTRL_1_1 0x06
+#define TVP3026_XLATCHCTRL_2_1 0x07
+#define TVP3026_XLATCHCTRL_4_1 0x06
+#define TVP3026_XLATCHCTRL_8_1 0x06
+#define TVP3026_XLATCHCTRL_16_1 0x06
+#define TVP3026A_XLATCHCTRL_4_3 0x06 /* ??? do not understand... but it works... !!! */
+#define TVP3026A_XLATCHCTRL_8_3 0x07
+#define TVP3026B_XLATCHCTRL_4_3 0x08
+#define TVP3026B_XLATCHCTRL_8_3 0x06 /* ??? do not understand... but it works... !!! */
+#define TVP3026_XTRUECOLORCTRL 0x18
+#define TVP3026_XTRUECOLORCTRL_VRAM_SHIFT_ACCEL 0x00
+#define TVP3026_XTRUECOLORCTRL_VRAM_SHIFT_TVP 0x20
+#define TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR 0x80
+#define TVP3026_XTRUECOLORCTRL_TRUECOLOR 0x40 /* paletized */
+#define TVP3026_XTRUECOLORCTRL_DIRECTCOLOR 0x00
+#define TVP3026_XTRUECOLORCTRL_24_ALTERNATE 0x08 /* 5:4/5:2 instead of 4:3/8:3 */
+#define TVP3026_XTRUECOLORCTRL_RGB_888 0x16 /* 4:3/8:3 (or 5:4/5:2) */
+#define TVP3026_XTRUECOLORCTRL_BGR_888 0x17
+#define TVP3026_XTRUECOLORCTRL_ORGB_8888 0x06
+#define TVP3026_XTRUECOLORCTRL_BGRO_8888 0x07
+#define TVP3026_XTRUECOLORCTRL_RGB_565 0x05
+#define TVP3026_XTRUECOLORCTRL_ORGB_1555 0x04
+#define TVP3026_XTRUECOLORCTRL_RGB_664 0x03
+#define TVP3026_XTRUECOLORCTRL_RGBO_4444 0x01
+#define TVP3026_XMUXCTRL 0x19
+#define TVP3026_XMUXCTRL_MEMORY_8BIT 0x01 /* - */
+#define TVP3026_XMUXCTRL_MEMORY_16BIT 0x02 /* - */
+#define TVP3026_XMUXCTRL_MEMORY_32BIT 0x03 /* 2MB RAM, 512K * 4 */
+#define TVP3026_XMUXCTRL_MEMORY_64BIT 0x04 /* >2MB RAM, 512K * 8 & more */
+#define TVP3026_XMUXCTRL_PIXEL_4BIT 0x40 /* L0,H0,L1,H1... */
+#define TVP3026_XMUXCTRL_PIXEL_4BIT_SWAPPED 0x60 /* H0,L0,H1,L1... */
+#define TVP3026_XMUXCTRL_PIXEL_8BIT 0x48
+#define TVP3026_XMUXCTRL_PIXEL_16BIT 0x50
+#define TVP3026_XMUXCTRL_PIXEL_32BIT 0x58
+#define TVP3026_XMUXCTRL_VGA 0x98 /* VGA MEMORY, 8BIT PIXEL */
+#define TVP3026_XCLKCTRL 0x1A
+#define TVP3026_XCLKCTRL_DIV1 0x00
+#define TVP3026_XCLKCTRL_DIV2 0x10
+#define TVP3026_XCLKCTRL_DIV4 0x20
+#define TVP3026_XCLKCTRL_DIV8 0x30
+#define TVP3026_XCLKCTRL_DIV16 0x40
+#define TVP3026_XCLKCTRL_DIV32 0x50
+#define TVP3026_XCLKCTRL_DIV64 0x60
+#define TVP3026_XCLKCTRL_CLKSTOPPED 0x70
+#define TVP3026_XCLKCTRL_SRC_CLK0 0x00
+#define TVP3026_XCLKCTRL_SRC_CLK1 0x01
+#define TVP3026_XCLKCTRL_SRC_CLK2 0x02 /* CLK2 is TTL source*/
+#define TVP3026_XCLKCTRL_SRC_NCLK2 0x03 /* not CLK2 is TTL source */
+#define TVP3026_XCLKCTRL_SRC_ECLK2 0x04 /* CLK2 and not CLK2 is ECL source */
+#define TVP3026_XCLKCTRL_SRC_PLL 0x05
+#define TVP3026_XCLKCTRL_SRC_DIS 0x06 /* disable & poweroff internal clock */
+#define TVP3026_XCLKCTRL_SRC_CLK0VGA 0x07
+#define TVP3026_XPALETTEPAGE 0x1C
+#define TVP3026_XGENCTRL 0x1D
+#define TVP3026_XGENCTRL_HSYNC_POS 0x00
+#define TVP3026_XGENCTRL_HSYNC_NEG 0x01
+#define TVP3026_XGENCTRL_VSYNC_POS 0x00
+#define TVP3026_XGENCTRL_VSYNC_NEG 0x02
+#define TVP3026_XGENCTRL_LITTLE_ENDIAN 0x00
+#define TVP3026_XGENCTRL_BIG_ENDIAN 0x08
+#define TVP3026_XGENCTRL_BLACK_0IRE 0x00
+#define TVP3026_XGENCTRL_BLACK_75IRE 0x10
+#define TVP3026_XGENCTRL_NO_SYNC_ON_GREEN 0x00
+#define TVP3026_XGENCTRL_SYNC_ON_GREEN 0x20
+#define TVP3026_XGENCTRL_OVERSCAN_DIS 0x00
+#define TVP3026_XGENCTRL_OVERSCAN_EN 0x40
+#define TVP3026_XMISCCTRL 0x1E
+#define TVP3026_XMISCCTRL_DAC_PUP 0x00
+#define TVP3026_XMISCCTRL_DAC_PDOWN 0x01
+#define TVP3026_XMISCCTRL_DAC_EXT 0x00 /* or 8, bit 3 is ignored */
+#define TVP3026_XMISCCTRL_DAC_6BIT 0x04
+#define TVP3026_XMISCCTRL_DAC_8BIT 0x0C
+#define TVP3026_XMISCCTRL_PSEL_DIS 0x00
+#define TVP3026_XMISCCTRL_PSEL_EN 0x10
+#define TVP3026_XMISCCTRL_PSEL_LOW 0x00 /* PSEL high selects directcolor */
+#define TVP3026_XMISCCTRL_PSEL_HIGH 0x20 /* PSEL high selects truecolor or pseudocolor */
+#define TVP3026_XGENIOCTRL 0x2A
+#define TVP3026_XGENIODATA 0x2B
+#define TVP3026_XPLLADDR 0x2C
+#define TVP3026_XPLLADDR_X(LOOP,MCLK,PIX) (((LOOP)<<4) | ((MCLK)<<2) | (PIX))
+#define TVP3026_XPLLDATA_N 0x00
+#define TVP3026_XPLLDATA_M 0x01
+#define TVP3026_XPLLDATA_P 0x02
+#define TVP3026_XPLLDATA_STAT 0x03
+#define TVP3026_XPIXPLLDATA 0x2D
+#define TVP3026_XMEMPLLDATA 0x2E
+#define TVP3026_XLOOPPLLDATA 0x2F
+#define TVP3026_XCOLKEYOVRMIN 0x30
+#define TVP3026_XCOLKEYOVRMAX 0x31
+#define TVP3026_XCOLKEYREDMIN 0x32
+#define TVP3026_XCOLKEYREDMAX 0x33
+#define TVP3026_XCOLKEYGREENMIN 0x34
+#define TVP3026_XCOLKEYGREENMAX 0x35
+#define TVP3026_XCOLKEYBLUEMIN 0x36
+#define TVP3026_XCOLKEYBLUEMAX 0x37
+#define TVP3026_XCOLKEYCTRL 0x38
+#define TVP3026_XCOLKEYCTRL_OVR_EN 0x01
+#define TVP3026_XCOLKEYCTRL_RED_EN 0x02
+#define TVP3026_XCOLKEYCTRL_GREEN_EN 0x04
+#define TVP3026_XCOLKEYCTRL_BLUE_EN 0x08
+#define TVP3026_XCOLKEYCTRL_NEGATE 0x10
+#define TVP3026_XCOLKEYCTRL_ZOOM1 0x00
+#define TVP3026_XCOLKEYCTRL_ZOOM2 0x20
+#define TVP3026_XCOLKEYCTRL_ZOOM4 0x40
+#define TVP3026_XCOLKEYCTRL_ZOOM8 0x60
+#define TVP3026_XCOLKEYCTRL_ZOOM16 0x80
+#define TVP3026_XCOLKEYCTRL_ZOOM32 0xA0
+#define TVP3026_XMEMPLLCTRL 0x39
+#define TVP3026_XMEMPLLCTRL_DIV(X) (((X)-1)>>1) /* 2,4,6,8,10,12,14,16, division applied to LOOP PLL after divide by 2^P */
+#define TVP3026_XMEMPLLCTRL_STROBEMKC4 0x08
+#define TVP3026_XMEMPLLCTRL_MCLK_DOTCLOCK 0x00 /* MKC4 */
+#define TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL 0x10 /* MKC4 */
+#define TVP3026_XMEMPLLCTRL_RCLK_PIXPLL 0x00
+#define TVP3026_XMEMPLLCTRL_RCLK_LOOPPLL 0x20
+#define TVP3026_XMEMPLLCTRL_RCLK_DOTDIVN 0x40 /* dot clock divided by loop pclk N prescaler */
+#define TVP3026_XSENSETEST 0x3A
+#define TVP3026_XTESTMODEDATA 0x3B
+#define TVP3026_XCRCREML 0x3C
+#define TVP3026_XCRCREMH 0x3D
+#define TVP3026_XCRCBITSEL 0x3E
+#define TVP3026_XID 0x3F
+
+static const unsigned char DACseq[] =
+{ TVP3026_XLATCHCTRL, TVP3026_XTRUECOLORCTRL,
+ TVP3026_XMUXCTRL, TVP3026_XCLKCTRL,
+ TVP3026_XPALETTEPAGE,
+ TVP3026_XGENCTRL,
+ TVP3026_XMISCCTRL,
+ TVP3026_XGENIOCTRL,
+ TVP3026_XGENIODATA,
+ TVP3026_XCOLKEYOVRMIN, TVP3026_XCOLKEYOVRMAX, TVP3026_XCOLKEYREDMIN, TVP3026_XCOLKEYREDMAX,
+ TVP3026_XCOLKEYGREENMIN, TVP3026_XCOLKEYGREENMAX, TVP3026_XCOLKEYBLUEMIN, TVP3026_XCOLKEYBLUEMAX,
+ TVP3026_XCOLKEYCTRL,
+ TVP3026_XMEMPLLCTRL, TVP3026_XSENSETEST, TVP3026_XCURCTRL };
+
+#define POS3026_XLATCHCTRL 0
+#define POS3026_XTRUECOLORCTRL 1
+#define POS3026_XMUXCTRL 2
+#define POS3026_XCLKCTRL 3
+#define POS3026_XGENCTRL 5
+#define POS3026_XMISCCTRL 6
+#define POS3026_XMEMPLLCTRL 18
+#define POS3026_XCURCTRL 20
+
+static const unsigned char MGADACbpp32[] =
+{ TVP3026_XLATCHCTRL_2_1, TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_8888,
+ 0x00, TVP3026_XCLKCTRL_DIV1 | TVP3026_XCLKCTRL_SRC_PLL,
+ 0x00,
+ TVP3026_XGENCTRL_HSYNC_POS | TVP3026_XGENCTRL_VSYNC_POS | TVP3026_XGENCTRL_LITTLE_ENDIAN | TVP3026_XGENCTRL_BLACK_0IRE | TVP3026_XGENCTRL_NO_SYNC_ON_GREEN | TVP3026_XGENCTRL_OVERSCAN_DIS,
+ TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_8BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_HIGH,
+ 0x00,
+ 0x1E,
+ 0xFF, 0xFF, 0xFF, 0xFF,
+ 0xFF, 0xFF, 0xFF, 0xFF,
+ TVP3026_XCOLKEYCTRL_ZOOM1,
+ 0x00, 0x00, TVP3026_XCURCTRL_DIS };
+
+static int Ti3026_calcclock(CPMINFO unsigned int freq, unsigned int fmax, int* in, int* feed, int* post) {
+ unsigned int fvco;
+ unsigned int lin, lfeed, lpost;
+
+ DBG(__FUNCTION__)
+
+ fvco = PLL_calcclock(PMINFO freq, fmax, &lin, &lfeed, &lpost);
+ fvco >>= (*post = lpost);
+ *in = 64 - lin;
+ *feed = 64 - lfeed;
+ return fvco;
+}
+
+static int Ti3026_setpclk(WPMINFO int clk) {
+ unsigned int f_pll;
+ unsigned int pixfeed, pixin, pixpost;
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ f_pll = Ti3026_calcclock(PMINFO clk, ACCESS_FBINFO(max_pixel_clock), &pixin, &pixfeed, &pixpost);
+
+ hw->DACclk[0] = pixin | 0xC0;
+ hw->DACclk[1] = pixfeed;
+ hw->DACclk[2] = pixpost | 0xB0;
+
+ {
+ unsigned int loopfeed, loopin, looppost, loopdiv, z;
+ unsigned int Bpp;
+
+ Bpp = ACCESS_FBINFO(curr.final_bppShift);
+
+ if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+ loopfeed = 3; /* set lm to any possible value */
+ loopin = 3 * 32 / Bpp;
+ } else {
+ loopfeed = 4;
+ loopin = 4 * 32 / Bpp;
+ }
+ z = (110000 * loopin) / (f_pll * loopfeed);
+ loopdiv = 0; /* div 2 */
+ if (z < 2)
+ looppost = 0;
+ else if (z < 4)
+ looppost = 1;
+ else if (z < 8)
+ looppost = 2;
+ else {
+ looppost = 3;
+ loopdiv = z/16;
+ }
+ if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+ hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
+ hw->DACclk[4] = (65 - loopfeed) | 0x80;
+ if (ACCESS_FBINFO(accel.ramdac_rev) > 0x20) {
+ if (isInterleave(MINFO))
+ hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_8_3;
+ else {
+ hw->DACclk[4] &= ~0xC0;
+ hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_4_3;
+ }
+ } else {
+ if (isInterleave(MINFO))
+ ; /* default... */
+ else {
+ hw->DACclk[4] ^= 0xC0; /* change from 0x80 to 0x40 */
+ hw->DACreg[POS3026_XLATCHCTRL] = TVP3026A_XLATCHCTRL_4_3;
+ }
+ }
+ hw->DACclk[5] = looppost | 0xF8;
+ if (ACCESS_FBINFO(devflags.mga_24bpp_fix))
+ hw->DACclk[5] ^= 0x40;
+ } else {
+ hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
+ hw->DACclk[4] = 65 - loopfeed;
+ hw->DACclk[5] = looppost | 0xF0;
+ }
+ hw->DACreg[POS3026_XMEMPLLCTRL] = loopdiv | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_RCLK_LOOPPLL;
+ }
+ return 0;
+}
+
+static int Ti3026_init(WPMINFO struct my_timming* m) {
+ u_int8_t muxctrl = isInterleave(MINFO) ? TVP3026_XMUXCTRL_MEMORY_64BIT : TVP3026_XMUXCTRL_MEMORY_32BIT;
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ memcpy(hw->DACreg, MGADACbpp32, sizeof(hw->DACreg));
+ switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ case 4: hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_16_1; /* or _8_1, they are same */
+ hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR;
+ hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_4BIT;
+ hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV8;
+ hw->DACreg[POS3026_XMISCCTRL] = TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_8BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_LOW;
+ break;
+ case 8: hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_8_1; /* or _4_1, they are same */
+ hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR;
+ hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_8BIT;
+ hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV4;
+ hw->DACreg[POS3026_XMISCCTRL] = TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_8BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_LOW;
+ break;
+ case 16:
+ /* XLATCHCTRL should be _4_1 / _2_1... Why is not? (_2_1 is used everytime) */
+ hw->DACreg[POS3026_XTRUECOLORCTRL] = (ACCESS_FBINFO(fbcon).var.green.length == 5)? (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_1555 ) : (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_565);
+ hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_16BIT;
+ hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV2;
+ break;
+ case 24:
+ /* XLATCHCTRL is: for (A) use _4_3 (?_8_3 is same? TBD), for (B) it is set in setpclk */
+ hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_888;
+ hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_32BIT;
+ hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV4;
+ break;
+ case 32:
+ /* XLATCHCTRL should be _2_1 / _1_1... Why is not? (_2_1 is used everytime) */
+ hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_32BIT;
+ break;
+ default:
+ return 1; /* TODO: failed */
+ }
+ if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+
+ /* set SYNC */
+ hw->MiscOutReg = 0xCB;
+ if (m->sync & FB_SYNC_HOR_HIGH_ACT)
+ hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_HSYNC_NEG;
+ if (m->sync & FB_SYNC_VERT_HIGH_ACT)
+ hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_VSYNC_NEG;
+ if (m->sync & FB_SYNC_ON_GREEN)
+ hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_SYNC_ON_GREEN;
+
+ /* set DELAY */
+ if (ACCESS_FBINFO(video.len) < 0x400000)
+ hw->CRTCEXT[3] |= 0x08;
+ else if (ACCESS_FBINFO(video.len) > 0x400000)
+ hw->CRTCEXT[3] |= 0x10;
+
+ /* set HWCURSOR */
+ if (m->interlaced) {
+ hw->DACreg[POS3026_XCURCTRL] |= TVP3026_XCURCTRL_INTERLACED;
+ }
+ if (m->HTotal >= 1536)
+ hw->DACreg[POS3026_XCURCTRL] |= TVP3026_XCURCTRL_BLANK4096;
+
+ /* set interleaving */
+ hw->MXoptionReg &= ~0x00001000;
+ if (isInterleave(MINFO)) hw->MXoptionReg |= 0x00001000;
+
+ /* set DAC */
+ Ti3026_setpclk(PMINFO m->pixclock);
+ return 0;
+}
+
+static void ti3026_setMCLK(WPMINFO int fout){
+ unsigned int f_pll;
+ unsigned int pclk_m, pclk_n, pclk_p;
+ unsigned int mclk_m, mclk_n, mclk_p;
+ unsigned int rfhcnt, mclk_ctl;
+ int tmout;
+
+ DBG(__FUNCTION__)
+
+ f_pll = Ti3026_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &mclk_n, &mclk_m, &mclk_p);
+
+ /* save pclk */
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
+ pclk_n = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0xFD);
+ pclk_m = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
+ pclk_p = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+
+ /* stop pclk */
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+
+ /* set pclk to new mclk */
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_n | 0xC0);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_m);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_p | 0xB0);
+
+ /* wait for PLL to lock */
+ for (tmout = 500000; tmout; tmout--) {
+ if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+ break;
+ udelay(10);
+ };
+ if (!tmout)
+ printk(KERN_ERR "matroxfb: Temporary pixel PLL not locked after 5 secs\n");
+
+ /* output pclk on mclk pin */
+ mclk_ctl = inTi3026(PMINFO TVP3026_XMEMPLLCTRL);
+ outTi3026(PMINFO TVP3026_XMEMPLLCTRL, mclk_ctl & 0xE7);
+ outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+
+ /* stop MCLK */
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0xFB);
+ outTi3026(PMINFO TVP3026_XMEMPLLDATA, 0x00);
+
+ /* set mclk to new freq */
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0xF3);
+ outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_n | 0xC0);
+ outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_m);
+ outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_p | 0xB0);
+
+ /* wait for PLL to lock */
+ for (tmout = 500000; tmout; tmout--) {
+ if (inTi3026(PMINFO TVP3026_XMEMPLLDATA) & 0x40)
+ break;
+ udelay(10);
+ }
+ if (!tmout)
+ printk(KERN_ERR "matroxfb: Memory PLL not locked after 5 secs\n");
+
+ f_pll = f_pll * 333 / (10000 << mclk_p);
+ if (isMilleniumII(MINFO)) {
+ rfhcnt = (f_pll - 128) / 256;
+ if (rfhcnt > 15)
+ rfhcnt = 15;
+ } else {
+ rfhcnt = (f_pll - 64) / 128;
+ if (rfhcnt > 15)
+ rfhcnt = 0;
+ }
+ ACCESS_FBINFO(hw).MXoptionReg = (ACCESS_FBINFO(hw).MXoptionReg & ~0x000F0000) | (rfhcnt << 16);
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+
+ /* output MCLK to MCLK pin */
+ outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+ outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl ) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+
+ /* stop PCLK */
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+
+ /* restore pclk */
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_n);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_m);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_p);
+
+ /* wait for PLL to lock */
+ for (tmout = 500000; tmout; tmout--) {
+ if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+ break;
+ udelay(10);
+ }
+ if (!tmout)
+ printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n");
+}
+
+static void ti3026_ramdac_init(WPMINFO2) {
+
+ DBG(__FUNCTION__)
+
+ ACCESS_FBINFO(features.pll.vco_freq_min) = 110000;
+ ACCESS_FBINFO(features.pll.ref_freq) = 114545;
+ ACCESS_FBINFO(features.pll.feed_div_min) = 2;
+ ACCESS_FBINFO(features.pll.feed_div_max) = 24;
+ ACCESS_FBINFO(features.pll.in_div_min) = 2;
+ ACCESS_FBINFO(features.pll.in_div_max) = 63;
+ ACCESS_FBINFO(features.pll.post_shift_max) = 3;
+ if (ACCESS_FBINFO(devflags.noinit))
+ return;
+ ti3026_setMCLK(PMINFO 60000);
+}
+
+static void Ti3026_restore(WPMINFO2) {
+ int i;
+ unsigned char progdac[6];
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+#ifdef DEBUG
+ dprintk(KERN_INFO "EXTVGA regs: ");
+ for (i = 0; i < 6; i++)
+ dprintk("%02X:", hw->CRTCEXT[i]);
+ dprintk("\n");
+#endif
+
+ CRITBEGIN
+
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+
+ CRITEND
+
+ matroxfb_vgaHWrestore(PMINFO2);
+
+ CRITBEGIN
+
+ ACCESS_FBINFO(crtc1.panpos) = -1;
+ for (i = 0; i < 6; i++)
+ mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
+
+ for (i = 0; i < 21; i++) {
+ outTi3026(PMINFO DACseq[i], hw->DACreg[i]);
+ }
+
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+ progdac[0] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+ progdac[3] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0x15);
+ progdac[1] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+ progdac[4] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
+ progdac[2] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+ progdac[5] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
+
+ CRITEND
+ if (memcmp(hw->DACclk, progdac, 6)) {
+ /* agrhh... setting up PLL is very slow on Millennium... */
+ /* Mystique PLL is locked in few ms, but Millennium PLL lock takes about 0.15 s... */
+ /* Maybe even we should call schedule() ? */
+
+ CRITBEGIN
+ outTi3026(PMINFO TVP3026_XCLKCTRL, hw->DACreg[POS3026_XCLKCTRL]);
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
+ outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0);
+
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+ for (i = 0; i < 3; i++)
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, hw->DACclk[i]);
+ /* wait for PLL only if PLL clock requested (always for PowerMode, never for VGA) */
+ if (hw->MiscOutReg & 0x08) {
+ int tmout;
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+ for (tmout = 500000; tmout; --tmout) {
+ if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+ break;
+ udelay(10);
+ }
+
+ CRITEND
+
+ if (!tmout)
+ printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n");
+ else
+ dprintk(KERN_INFO "PixelPLL: %d\n", 500000-tmout);
+ CRITBEGIN
+ }
+ outTi3026(PMINFO TVP3026_XMEMPLLCTRL, hw->DACreg[POS3026_XMEMPLLCTRL]);
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+ for (i = 3; i < 6; i++)
+ outTi3026(PMINFO TVP3026_XLOOPPLLDATA, hw->DACclk[i]);
+ CRITEND
+ if ((hw->MiscOutReg & 0x08) && ((hw->DACclk[5] & 0x80) == 0x80)) {
+ int tmout;
+
+ CRITBEGIN
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+ for (tmout = 500000; tmout; --tmout) {
+ if (inTi3026(PMINFO TVP3026_XLOOPPLLDATA) & 0x40)
+ break;
+ udelay(10);
+ }
+ CRITEND
+ if (!tmout)
+ printk(KERN_ERR "matroxfb: Loop PLL not locked after 5 secs\n");
+ else
+ dprintk(KERN_INFO "LoopPLL: %d\n", 500000-tmout);
+ }
+ }
+
+#ifdef DEBUG
+ dprintk(KERN_DEBUG "3026DACregs ");
+ for (i = 0; i < 21; i++) {
+ dprintk("R%02X=%02X ", DACseq[i], hw->DACreg[i]);
+ if ((i & 0x7) == 0x7) dprintk("\n" KERN_DEBUG "continuing... ");
+ }
+ dprintk("\n" KERN_DEBUG "DACclk ");
+ for (i = 0; i < 6; i++)
+ dprintk("C%02X=%02X ", i, hw->DACclk[i]);
+ dprintk("\n");
+#endif
+}
+
+static void Ti3026_reset(WPMINFO2) {
+
+ DBG(__FUNCTION__)
+
+ ti3026_ramdac_init(PMINFO2);
+}
+
+static struct matrox_altout ti3026_output = {
+ .name = "Primary output",
+};
+
+static int Ti3026_preinit(WPMINFO2) {
+ static const int vxres_mill2[] = { 512, 640, 768, 800, 832, 960,
+ 1024, 1152, 1280, 1600, 1664, 1920,
+ 2048, 0};
+ static const int vxres_mill1[] = { 640, 768, 800, 960,
+ 1024, 1152, 1280, 1600, 1920,
+ 2048, 0};
+ struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+ DBG(__FUNCTION__)
+
+ ACCESS_FBINFO(millenium) = 1;
+ ACCESS_FBINFO(milleniumII) = (ACCESS_FBINFO(pcidev)->device != PCI_DEVICE_ID_MATROX_MIL);
+ ACCESS_FBINFO(capable.cfb4) = 1;
+ ACCESS_FBINFO(capable.text) = 1; /* isMilleniumII(MINFO); */
+ ACCESS_FBINFO(capable.vxres) = isMilleniumII(MINFO)?vxres_mill2:vxres_mill1;
+
+ ACCESS_FBINFO(outputs[0]).data = MINFO;
+ ACCESS_FBINFO(outputs[0]).output = &ti3026_output;
+ ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
+ ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+
+ if (ACCESS_FBINFO(devflags.noinit))
+ return 0;
+ /* preserve VGA I/O, BIOS and PPC */
+ hw->MXoptionReg &= 0xC0000100;
+ hw->MXoptionReg |= 0x002C0000;
+ if (ACCESS_FBINFO(devflags.novga))
+ hw->MXoptionReg &= ~0x00000100;
+ if (ACCESS_FBINFO(devflags.nobios))
+ hw->MXoptionReg &= ~0x40000000;
+ if (ACCESS_FBINFO(devflags.nopciretry))
+ hw->MXoptionReg |= 0x20000000;
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+
+ ACCESS_FBINFO(accel.ramdac_rev) = inTi3026(PMINFO TVP3026_XSILICONREV);
+
+ outTi3026(PMINFO TVP3026_XCLKCTRL, TVP3026_XCLKCTRL_SRC_CLK0VGA | TVP3026_XCLKCTRL_CLKSTOPPED);
+ outTi3026(PMINFO TVP3026_XTRUECOLORCTRL, TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR);
+ outTi3026(PMINFO TVP3026_XMUXCTRL, TVP3026_XMUXCTRL_VGA);
+
+ outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
+ outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0x00);
+ outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+
+ mga_outb(M_MISC_REG, 0x67);
+
+ outTi3026(PMINFO TVP3026_XMEMPLLCTRL, TVP3026_XMEMPLLCTRL_STROBEMKC4 | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+
+ mga_outl(M_RESET, 1);
+ udelay(250);
+ mga_outl(M_RESET, 0);
+ udelay(250);
+ mga_outl(M_MACCESS, 0x00008000);
+ udelay(10);
+ return 0;
+}
+
+struct matrox_switch matrox_millennium = {
+ Ti3026_preinit, Ti3026_reset, Ti3026_init, Ti3026_restore
+};
+EXPORT_SYMBOL(matrox_millennium);
+#endif
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_Ti3026.h b/drivers/video/matrox/matroxfb_Ti3026.h
new file mode 100644
index 0000000..541933d
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_Ti3026.h
@@ -0,0 +1,13 @@
+#ifndef __MATROXFB_TI3026_H__
+#define __MATROXFB_TI3026_H__
+
+/* make checkconfig does not walk through whole include tree */
+#include <linux/config.h>
+
+#include "matroxfb_base.h"
+
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+extern struct matrox_switch matrox_millennium;
+#endif
+
+#endif /* __MATROXFB_TI3026_H__ */
diff --git a/drivers/video/matrox/matroxfb_accel.c b/drivers/video/matrox/matroxfb_accel.c
new file mode 100644
index 0000000..c7f3e13
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_accel.c
@@ -0,0 +1,497 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * MTRR stuff: 1998 Tom Rini <trini@kernel.crashing.org>
+ *
+ * Contributors: "menion?" <menion@mindless.com>
+ * Betatesting, fixes, ideas
+ *
+ * "Kurt Garloff" <garloff@suse.de>
+ * Betatesting, fixes, ideas, videomodes, videomodes timmings
+ *
+ * "Tom Rini" <trini@kernel.crashing.org>
+ * MTRR stuff, PPC cleanups, betatesting, fixes, ideas
+ *
+ * "Bibek Sahu" <scorpio@dodds.net>
+ * Access device through readb|w|l and write b|w|l
+ * Extensive debugging stuff
+ *
+ * "Daniel Haun" <haund@usa.net>
+ * Testing, hardware cursor fixes
+ *
+ * "Scott Wood" <sawst46+@pitt.edu>
+ * Fixes
+ *
+ * "Gerd Knorr" <kraxel@goldbach.isdn.cs.tu-berlin.de>
+ * Betatesting
+ *
+ * "Kelly French" <targon@hazmat.com>
+ * "Fernando Herrera" <fherrera@eurielec.etsit.upm.es>
+ * Betatesting, bug reporting
+ *
+ * "Pablo Bianucci" <pbian@pccp.com.ar>
+ * Fixes, ideas, betatesting
+ *
+ * "Inaky Perez Gonzalez" <inaky@peloncho.fis.ucm.es>
+ * Fixes, enhandcements, ideas, betatesting
+ *
+ * "Ryuichi Oikawa" <roikawa@rr.iiij4u.or.jp>
+ * PPC betatesting, PPC support, backward compatibility
+ *
+ * "Paul Womar" <Paul@pwomar.demon.co.uk>
+ * "Owen Waller" <O.Waller@ee.qub.ac.uk>
+ * PPC betatesting
+ *
+ * "Thomas Pornin" <pornin@bolet.ens.fr>
+ * Alpha betatesting
+ *
+ * "Pieter van Leuven" <pvl@iae.nl>
+ * "Ulf Jaenicke-Roessler" <ujr@physik.phy.tu-dresden.de>
+ * G100 testing
+ *
+ * "H. Peter Arvin" <hpa@transmeta.com>
+ * Ideas
+ *
+ * "Cort Dougan" <cort@cs.nmt.edu>
+ * CHRP fixes and PReP cleanup
+ *
+ * "Mark Vojkovich" <mvojkovi@ucsd.edu>
+ * G400 support
+ *
+ * (following author is not in any relation with this code, but his code
+ * is included in this driver)
+ *
+ * Based on framebuffer driver for VBE 2.0 compliant graphic boards
+ * (c) 1998 Gerd Knorr <kraxel@cs.tu-berlin.de>
+ *
+ * (following author is not in any relation with this code, but his ideas
+ * were used when writting this driver)
+ *
+ * FreeVBE/AF (Matrox), "Shawn Hargreaves" <shawn@talula.demon.co.uk>
+ *
+ */
+
+#include "matroxfb_accel.h"
+#include "matroxfb_DAC1064.h"
+#include "matroxfb_Ti3026.h"
+#include "matroxfb_misc.h"
+
+#define curr_ydstorg(x) ACCESS_FBINFO2(x, curr.ydstorg.pixels)
+
+#define mga_ydstlen(y,l) mga_outl(M_YDSTLEN | M_EXEC, ((y) << 16) | (l))
+
+static inline void matrox_cfb4_pal(u_int32_t* pal) {
+ unsigned int i;
+
+ for (i = 0; i < 16; i++) {
+ pal[i] = i * 0x11111111U;
+ }
+ pal[i] = 0xFFFFFFFF;
+}
+
+static inline void matrox_cfb8_pal(u_int32_t* pal) {
+ unsigned int i;
+
+ for (i = 0; i < 16; i++) {
+ pal[i] = i * 0x01010101U;
+ }
+ pal[i] = 0x0F0F0F0F;
+}
+
+static void matroxfb_copyarea(struct fb_info* info, const struct fb_copyarea* area);
+static void matroxfb_fillrect(struct fb_info* info, const struct fb_fillrect* rect);
+static void matroxfb_imageblit(struct fb_info* info, const struct fb_image* image);
+static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect);
+static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area);
+
+void matrox_cfbX_init(WPMINFO2) {
+ u_int32_t maccess;
+ u_int32_t mpitch;
+ u_int32_t mopmode;
+ int accel;
+
+ DBG(__FUNCTION__)
+
+ mpitch = ACCESS_FBINFO(fbcon).var.xres_virtual;
+
+ ACCESS_FBINFO(fbops).fb_copyarea = cfb_copyarea;
+ ACCESS_FBINFO(fbops).fb_fillrect = cfb_fillrect;
+ ACCESS_FBINFO(fbops).fb_imageblit = cfb_imageblit;
+ ACCESS_FBINFO(fbops).fb_cursor = soft_cursor;
+
+ accel = (ACCESS_FBINFO(fbcon).var.accel_flags & FB_ACCELF_TEXT) == FB_ACCELF_TEXT;
+
+ switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ case 4: maccess = 0x00000000; /* accelerate as 8bpp video */
+ mpitch = (mpitch >> 1) | 0x8000; /* disable linearization */
+ mopmode = M_OPMODE_4BPP;
+ matrox_cfb4_pal(ACCESS_FBINFO(cmap));
+ if (accel && !(mpitch & 1)) {
+ ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_cfb4_copyarea;
+ ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_cfb4_fillrect;
+ }
+ break;
+ case 8: maccess = 0x00000000;
+ mopmode = M_OPMODE_8BPP;
+ matrox_cfb8_pal(ACCESS_FBINFO(cmap));
+ if (accel) {
+ ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
+ ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
+ ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+ }
+ break;
+ case 16: if (ACCESS_FBINFO(fbcon).var.green.length == 5) {
+ maccess = 0xC0000001;
+ ACCESS_FBINFO(cmap[16]) = 0x7FFF7FFF;
+ } else {
+ maccess = 0x40000001;
+ ACCESS_FBINFO(cmap[16]) = 0xFFFFFFFF;
+ }
+ mopmode = M_OPMODE_16BPP;
+ if (accel) {
+ ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
+ ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
+ ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+ }
+ break;
+ case 24: maccess = 0x00000003;
+ mopmode = M_OPMODE_24BPP;
+ ACCESS_FBINFO(cmap[16]) = 0xFFFFFFFF;
+ if (accel) {
+ ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
+ ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
+ ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+ }
+ break;
+ case 32: maccess = 0x00000002;
+ mopmode = M_OPMODE_32BPP;
+ ACCESS_FBINFO(cmap[16]) = 0xFFFFFFFF;
+ if (accel) {
+ ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
+ ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
+ ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+ }
+ break;
+ default: maccess = 0x00000000;
+ mopmode = 0x00000000;
+ break; /* turn off acceleration!!! */
+ }
+ mga_fifo(8);
+ mga_outl(M_PITCH, mpitch);
+ mga_outl(M_YDSTORG, curr_ydstorg(MINFO));
+ if (ACCESS_FBINFO(capable.plnwt))
+ mga_outl(M_PLNWT, -1);
+ if (ACCESS_FBINFO(capable.srcorg)) {
+ mga_outl(M_SRCORG, 0);
+ mga_outl(M_DSTORG, 0);
+ }
+ mga_outl(M_OPMODE, mopmode);
+ mga_outl(M_CXBNDRY, 0xFFFF0000);
+ mga_outl(M_YTOP, 0);
+ mga_outl(M_YBOT, 0x01FFFFFF);
+ mga_outl(M_MACCESS, maccess);
+ ACCESS_FBINFO(accel.m_dwg_rect) = M_DWG_TRAP | M_DWG_SOLID | M_DWG_ARZERO | M_DWG_SGNZERO | M_DWG_SHIFTZERO;
+ if (isMilleniumII(MINFO)) ACCESS_FBINFO(accel.m_dwg_rect) |= M_DWG_TRANSC;
+ ACCESS_FBINFO(accel.m_opmode) = mopmode;
+}
+
+EXPORT_SYMBOL(matrox_cfbX_init);
+
+static void matrox_accel_bmove(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+ int start, end;
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+ CRITBEGIN
+
+ if ((dy < sy) || ((dy == sy) && (dx <= sx))) {
+ mga_fifo(2);
+ mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_SGNZERO |
+ M_DWG_BFCOL | M_DWG_REPLACE);
+ mga_outl(M_AR5, vxres);
+ width--;
+ start = sy*vxres+sx+curr_ydstorg(MINFO);
+ end = start+width;
+ } else {
+ mga_fifo(3);
+ mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_BFCOL | M_DWG_REPLACE);
+ mga_outl(M_SGN, 5);
+ mga_outl(M_AR5, -vxres);
+ width--;
+ end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+ start = end+width;
+ dy += height-1;
+ }
+ mga_fifo(4);
+ mga_outl(M_AR0, end);
+ mga_outl(M_AR3, start);
+ mga_outl(M_FXBNDRY, ((dx+width)<<16) | dx);
+ mga_ydstlen(dy, height);
+ WaitTillIdle();
+
+ CRITEND
+}
+
+static void matrox_accel_bmove_lin(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+ int start, end;
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+ CRITBEGIN
+
+ if ((dy < sy) || ((dy == sy) && (dx <= sx))) {
+ mga_fifo(2);
+ mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_SGNZERO |
+ M_DWG_BFCOL | M_DWG_REPLACE);
+ mga_outl(M_AR5, vxres);
+ width--;
+ start = sy*vxres+sx+curr_ydstorg(MINFO);
+ end = start+width;
+ } else {
+ mga_fifo(3);
+ mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_BFCOL | M_DWG_REPLACE);
+ mga_outl(M_SGN, 5);
+ mga_outl(M_AR5, -vxres);
+ width--;
+ end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+ start = end+width;
+ dy += height-1;
+ }
+ mga_fifo(5);
+ mga_outl(M_AR0, end);
+ mga_outl(M_AR3, start);
+ mga_outl(M_FXBNDRY, ((dx+width)<<16) | dx);
+ mga_outl(M_YDST, dy*vxres >> 5);
+ mga_outl(M_LEN | M_EXEC, height);
+ WaitTillIdle();
+
+ CRITEND
+}
+
+static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
+ MINFO_FROM_INFO(info);
+
+ if ((area->sx | area->dx | area->width) & 1)
+ cfb_copyarea(info, area);
+ else
+ matrox_accel_bmove_lin(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual) >> 1, area->sy, area->sx >> 1, area->dy, area->dx >> 1, area->height, area->width >> 1);
+}
+
+static void matroxfb_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
+ MINFO_FROM_INFO(info);
+
+ matrox_accel_bmove(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual), area->sy, area->sx, area->dy, area->dx, area->height, area->width);
+}
+
+static void matroxfb_accel_clear(WPMINFO u_int32_t color, int sy, int sx, int height,
+ int width) {
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+ CRITBEGIN
+
+ mga_fifo(5);
+ mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE);
+ mga_outl(M_FCOL, color);
+ mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
+ mga_ydstlen(sy, height);
+ WaitTillIdle();
+
+ CRITEND
+}
+
+static void matroxfb_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
+ MINFO_FROM_INFO(info);
+
+ switch (rect->rop) {
+ case ROP_COPY:
+ matroxfb_accel_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+ break;
+ }
+}
+
+static void matroxfb_cfb4_clear(WPMINFO u_int32_t bgx, int sy, int sx, int height, int width) {
+ int whattodo;
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+ CRITBEGIN
+
+ whattodo = 0;
+ if (sx & 1) {
+ sx ++;
+ if (!width) return;
+ width --;
+ whattodo = 1;
+ }
+ if (width & 1) {
+ whattodo |= 2;
+ }
+ width >>= 1;
+ sx >>= 1;
+ if (width) {
+ mga_fifo(5);
+ mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE2);
+ mga_outl(M_FCOL, bgx);
+ mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
+ mga_outl(M_YDST, sy * ACCESS_FBINFO(fbcon).var.xres_virtual >> 6);
+ mga_outl(M_LEN | M_EXEC, height);
+ WaitTillIdle();
+ }
+ if (whattodo) {
+ u_int32_t step = ACCESS_FBINFO(fbcon).var.xres_virtual >> 1;
+ vaddr_t vbase = ACCESS_FBINFO(video.vbase);
+ if (whattodo & 1) {
+ unsigned int uaddr = sy * step + sx - 1;
+ u_int32_t loop;
+ u_int8_t bgx2 = bgx & 0xF0;
+ for (loop = height; loop > 0; loop --) {
+ mga_writeb(vbase, uaddr, (mga_readb(vbase, uaddr) & 0x0F) | bgx2);
+ uaddr += step;
+ }
+ }
+ if (whattodo & 2) {
+ unsigned int uaddr = sy * step + sx + width;
+ u_int32_t loop;
+ u_int8_t bgx2 = bgx & 0x0F;
+ for (loop = height; loop > 0; loop --) {
+ mga_writeb(vbase, uaddr, (mga_readb(vbase, uaddr) & 0xF0) | bgx2);
+ uaddr += step;
+ }
+ }
+ }
+
+ CRITEND
+}
+
+static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
+ MINFO_FROM_INFO(info);
+
+ switch (rect->rop) {
+ case ROP_COPY:
+ matroxfb_cfb4_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+ break;
+ }
+}
+
+static void matroxfb_1bpp_imageblit(WPMINFO u_int32_t fgx, u_int32_t bgx,
+ const u_int8_t* chardata, int width, int height, int yy, int xx) {
+ u_int32_t step;
+ u_int32_t ydstlen;
+ u_int32_t xlen;
+ u_int32_t ar0;
+ u_int32_t charcell;
+ u_int32_t fxbndry;
+ vaddr_t mmio;
+ int easy;
+ CRITFLAGS
+
+ DBG_HEAVY(__FUNCTION__);
+
+ step = (width + 7) >> 3;
+ charcell = height * step;
+ xlen = (charcell + 3) & ~3;
+ ydstlen = (yy << 16) | height;
+ if (width == step << 3) {
+ ar0 = height * width - 1;
+ easy = 1;
+ } else {
+ ar0 = width - 1;
+ easy = 0;
+ }
+
+ CRITBEGIN
+
+ mga_fifo(3);
+ if (easy)
+ mga_outl(M_DWGCTL, M_DWG_ILOAD | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_LINEAR | M_DWG_REPLACE);
+ else
+ mga_outl(M_DWGCTL, M_DWG_ILOAD | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_REPLACE);
+ mga_outl(M_FCOL, fgx);
+ mga_outl(M_BCOL, bgx);
+ fxbndry = ((xx + width - 1) << 16) | xx;
+ mmio = ACCESS_FBINFO(mmio.vbase);
+
+ mga_fifo(6);
+ mga_writel(mmio, M_FXBNDRY, fxbndry);
+ mga_writel(mmio, M_AR0, ar0);
+ mga_writel(mmio, M_AR3, 0);
+ if (easy) {
+ mga_writel(mmio, M_YDSTLEN | M_EXEC, ydstlen);
+ mga_memcpy_toio(mmio, chardata, xlen);
+ } else {
+ mga_writel(mmio, M_AR5, 0);
+ mga_writel(mmio, M_YDSTLEN | M_EXEC, ydstlen);
+ if ((step & 3) == 0) {
+ /* Great. Source has 32bit aligned lines, so we can feed them
+ directly to the accelerator. */
+ mga_memcpy_toio(mmio, chardata, charcell);
+ } else if (step == 1) {
+ /* Special case for 1..8bit widths */
+ while (height--) {
+#if defined(__BIG_ENDIAN)
+ fb_writel((*chardata) << 24, mmio.vaddr);
+#else
+ fb_writel(*chardata, mmio.vaddr);
+#endif
+ chardata++;
+ }
+ } else if (step == 2) {
+ /* Special case for 9..15bit widths */
+ while (height--) {
+#if defined(__BIG_ENDIAN)
+ fb_writel((*(u_int16_t*)chardata) << 16, mmio.vaddr);
+#else
+ fb_writel(*(u_int16_t*)chardata, mmio.vaddr);
+#endif
+ chardata += 2;
+ }
+ } else {
+ /* Tell... well, why bother... */
+ while (height--) {
+ size_t i;
+
+ for (i = 0; i < step; i += 4) {
+ /* Hope that there are at least three readable bytes beyond the end of bitmap */
+ fb_writel(get_unaligned((u_int32_t*)(chardata + i)),mmio.vaddr);
+ }
+ chardata += step;
+ }
+ }
+ }
+ WaitTillIdle();
+ CRITEND
+}
+
+
+static void matroxfb_imageblit(struct fb_info* info, const struct fb_image* image) {
+ MINFO_FROM_INFO(info);
+
+ DBG_HEAVY(__FUNCTION__);
+
+ if (image->depth == 1) {
+ u_int32_t fgx, bgx;
+
+ fgx = ((u_int32_t*)info->pseudo_palette)[image->fg_color];
+ bgx = ((u_int32_t*)info->pseudo_palette)[image->bg_color];
+ matroxfb_1bpp_imageblit(PMINFO fgx, bgx, image->data, image->width, image->height, image->dy, image->dx);
+ } else {
+ /* Danger! image->depth is useless: logo painting code always
+ passes framebuffer color depth here, although logo data are
+ always 8bpp and info->pseudo_palette is changed to contain
+ logo palette to be used (but only for true/direct-color... sic...).
+ So do it completely in software... */
+ cfb_imageblit(info, image);
+ }
+}
+
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_accel.h b/drivers/video/matrox/matroxfb_accel.h
new file mode 100644
index 0000000..f40c314
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_accel.h
@@ -0,0 +1,8 @@
+#ifndef __MATROXFB_ACCEL_H__
+#define __MATROXFB_ACCEL_H__
+
+#include "matroxfb_base.h"
+
+void matrox_cfbX_init(WPMINFO2);
+
+#endif
diff --git a/drivers/video/matrox/matroxfb_base.c b/drivers/video/matrox/matroxfb_base.c
new file mode 100644
index 0000000..98e00d8
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_base.c
@@ -0,0 +1,2589 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * MTRR stuff: 1998 Tom Rini <trini@kernel.crashing.org>
+ *
+ * Contributors: "menion?" <menion@mindless.com>
+ * Betatesting, fixes, ideas
+ *
+ * "Kurt Garloff" <garloff@suse.de>
+ * Betatesting, fixes, ideas, videomodes, videomodes timmings
+ *
+ * "Tom Rini" <trini@kernel.crashing.org>
+ * MTRR stuff, PPC cleanups, betatesting, fixes, ideas
+ *
+ * "Bibek Sahu" <scorpio@dodds.net>
+ * Access device through readb|w|l and write b|w|l
+ * Extensive debugging stuff
+ *
+ * "Daniel Haun" <haund@usa.net>
+ * Testing, hardware cursor fixes
+ *
+ * "Scott Wood" <sawst46+@pitt.edu>
+ * Fixes
+ *
+ * "Gerd Knorr" <kraxel@goldbach.isdn.cs.tu-berlin.de>
+ * Betatesting
+ *
+ * "Kelly French" <targon@hazmat.com>
+ * "Fernando Herrera" <fherrera@eurielec.etsit.upm.es>
+ * Betatesting, bug reporting
+ *
+ * "Pablo Bianucci" <pbian@pccp.com.ar>
+ * Fixes, ideas, betatesting
+ *
+ * "Inaky Perez Gonzalez" <inaky@peloncho.fis.ucm.es>
+ * Fixes, enhandcements, ideas, betatesting
+ *
+ * "Ryuichi Oikawa" <roikawa@rr.iiij4u.or.jp>
+ * PPC betatesting, PPC support, backward compatibility
+ *
+ * "Paul Womar" <Paul@pwomar.demon.co.uk>
+ * "Owen Waller" <O.Waller@ee.qub.ac.uk>
+ * PPC betatesting
+ *
+ * "Thomas Pornin" <pornin@bolet.ens.fr>
+ * Alpha betatesting
+ *
+ * "Pieter van Leuven" <pvl@iae.nl>
+ * "Ulf Jaenicke-Roessler" <ujr@physik.phy.tu-dresden.de>
+ * G100 testing
+ *
+ * "H. Peter Arvin" <hpa@transmeta.com>
+ * Ideas
+ *
+ * "Cort Dougan" <cort@cs.nmt.edu>
+ * CHRP fixes and PReP cleanup
+ *
+ * "Mark Vojkovich" <mvojkovi@ucsd.edu>
+ * G400 support
+ *
+ * "Samuel Hocevar" <sam@via.ecp.fr>
+ * Fixes
+ *
+ * "Anton Altaparmakov" <AntonA@bigfoot.com>
+ * G400 MAX/non-MAX distinction
+ *
+ * "Ken Aaker" <kdaaker@rchland.vnet.ibm.com>
+ * memtype extension (needed for GXT130P RS/6000 adapter)
+ *
+ * "Uns Lider" <unslider@miranda.org>
+ * G100 PLNWT fixes
+ *
+ * "Denis Zaitsev" <zzz@cd-club.ru>
+ * Fixes
+ *
+ * "Mike Pieper" <mike@pieper-family.de>
+ * TVOut enhandcements, V4L2 control interface.
+ *
+ * "Diego Biurrun" <diego@biurrun.de>
+ * DFP testing
+ *
+ * (following author is not in any relation with this code, but his code
+ * is included in this driver)
+ *
+ * Based on framebuffer driver for VBE 2.0 compliant graphic boards
+ * (c) 1998 Gerd Knorr <kraxel@cs.tu-berlin.de>
+ *
+ * (following author is not in any relation with this code, but his ideas
+ * were used when writting this driver)
+ *
+ * FreeVBE/AF (Matrox), "Shawn Hargreaves" <shawn@talula.demon.co.uk>
+ *
+ */
+
+/* make checkconfig does not check included files... */
+#include <linux/config.h>
+#include <linux/version.h>
+
+#include "matroxfb_base.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_accel.h"
+#include "matroxfb_DAC1064.h"
+#include "matroxfb_Ti3026.h"
+#include "matroxfb_maven.h"
+#include "matroxfb_crtc2.h"
+#include "matroxfb_g450.h"
+#include <linux/matroxfb.h>
+#include <linux/interrupt.h>
+#include <asm/uaccess.h>
+
+#ifdef CONFIG_PPC_PMAC
+unsigned char nvram_read_byte(int);
+static int default_vmode = VMODE_NVRAM;
+static int default_cmode = CMODE_NVRAM;
+#endif
+
+static void matroxfb_unregister_device(struct matrox_fb_info* minfo);
+
+/* --------------------------------------------------------------------- */
+
+/*
+ * card parameters
+ */
+
+/* --------------------------------------------------------------------- */
+
+static struct fb_var_screeninfo vesafb_defined = {
+ 640,480,640,480,/* W,H, W, H (virtual) load xres,xres_virtual*/
+ 0,0, /* virtual -> visible no offset */
+ 8, /* depth -> load bits_per_pixel */
+ 0, /* greyscale ? */
+ {0,0,0}, /* R */
+ {0,0,0}, /* G */
+ {0,0,0}, /* B */
+ {0,0,0}, /* transparency */
+ 0, /* standard pixel format */
+ FB_ACTIVATE_NOW,
+ -1,-1,
+ FB_ACCELF_TEXT, /* accel flags */
+ 39721L,48L,16L,33L,10L,
+ 96L,2L,~0, /* No sync info */
+ FB_VMODE_NONINTERLACED,
+ 0, {0,0,0,0,0}
+};
+
+
+
+/* --------------------------------------------------------------------- */
+static void update_crtc2(WPMINFO unsigned int pos) {
+ struct matroxfb_dh_fb_info* info = ACCESS_FBINFO(crtc2.info);
+
+ /* Make sure that displays are compatible */
+ if (info && (info->fbcon.var.bits_per_pixel == ACCESS_FBINFO(fbcon).var.bits_per_pixel)
+ && (info->fbcon.var.xres_virtual == ACCESS_FBINFO(fbcon).var.xres_virtual)
+ && (info->fbcon.var.green.length == ACCESS_FBINFO(fbcon).var.green.length)
+ ) {
+ switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ case 16:
+ case 32:
+ pos = pos * 8;
+ if (info->interlaced) {
+ mga_outl(0x3C2C, pos);
+ mga_outl(0x3C28, pos + ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(fbcon).var.bits_per_pixel / 8);
+ } else {
+ mga_outl(0x3C28, pos);
+ }
+ break;
+ }
+ }
+}
+
+static void matroxfb_crtc1_panpos(WPMINFO2) {
+ if (ACCESS_FBINFO(crtc1.panpos) >= 0) {
+ unsigned long flags;
+ int panpos;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ panpos = ACCESS_FBINFO(crtc1.panpos);
+ if (panpos >= 0) {
+ unsigned int extvga_reg;
+
+ ACCESS_FBINFO(crtc1.panpos) = -1; /* No update pending anymore */
+ extvga_reg = mga_inb(M_EXTVGA_INDEX);
+ mga_setr(M_EXTVGA_INDEX, 0x00, panpos);
+ if (extvga_reg != 0x00) {
+ mga_outb(M_EXTVGA_INDEX, extvga_reg);
+ }
+ }
+ matroxfb_DAC_unlock_irqrestore(flags);
+ }
+}
+
+static irqreturn_t matrox_irq(int irq, void *dev_id, struct pt_regs *fp)
+{
+ u_int32_t status;
+ int handled = 0;
+
+ MINFO_FROM(dev_id);
+
+ status = mga_inl(M_STATUS);
+
+ if (status & 0x20) {
+ mga_outl(M_ICLEAR, 0x20);
+ ACCESS_FBINFO(crtc1.vsync.cnt)++;
+ matroxfb_crtc1_panpos(PMINFO2);
+ wake_up_interruptible(&ACCESS_FBINFO(crtc1.vsync.wait));
+ handled = 1;
+ }
+ if (status & 0x200) {
+ mga_outl(M_ICLEAR, 0x200);
+ ACCESS_FBINFO(crtc2.vsync.cnt)++;
+ wake_up_interruptible(&ACCESS_FBINFO(crtc2.vsync.wait));
+ handled = 1;
+ }
+ return IRQ_RETVAL(handled);
+}
+
+int matroxfb_enable_irq(WPMINFO int reenable) {
+ u_int32_t bm;
+
+ if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+ bm = 0x220;
+ else
+ bm = 0x020;
+
+ if (!test_and_set_bit(0, &ACCESS_FBINFO(irq_flags))) {
+ if (request_irq(ACCESS_FBINFO(pcidev)->irq, matrox_irq,
+ SA_SHIRQ, "matroxfb", MINFO)) {
+ clear_bit(0, &ACCESS_FBINFO(irq_flags));
+ return -EINVAL;
+ }
+ /* Clear any pending field interrupts */
+ mga_outl(M_ICLEAR, bm);
+ mga_outl(M_IEN, mga_inl(M_IEN) | bm);
+ } else if (reenable) {
+ u_int32_t ien;
+
+ ien = mga_inl(M_IEN);
+ if ((ien & bm) != bm) {
+ printk(KERN_DEBUG "matroxfb: someone disabled IRQ [%08X]\n", ien);
+ mga_outl(M_IEN, ien | bm);
+ }
+ }
+ return 0;
+}
+
+static void matroxfb_disable_irq(WPMINFO2) {
+ if (test_and_clear_bit(0, &ACCESS_FBINFO(irq_flags))) {
+ /* Flush pending pan-at-vbl request... */
+ matroxfb_crtc1_panpos(PMINFO2);
+ if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+ mga_outl(M_IEN, mga_inl(M_IEN) & ~0x220);
+ else
+ mga_outl(M_IEN, mga_inl(M_IEN) & ~0x20);
+ free_irq(ACCESS_FBINFO(pcidev)->irq, MINFO);
+ }
+}
+
+int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc) {
+ wait_queue_t __wait;
+ struct matrox_vsync *vs;
+ unsigned int cnt;
+ int ret;
+
+ switch (crtc) {
+ case 0:
+ vs = &ACCESS_FBINFO(crtc1.vsync);
+ break;
+ case 1:
+ if (ACCESS_FBINFO(devflags.accelerator) != FB_ACCEL_MATROX_MGAG400) {
+ return -ENODEV;
+ }
+ vs = &ACCESS_FBINFO(crtc2.vsync);
+ break;
+ default:
+ return -ENODEV;
+ }
+ ret = matroxfb_enable_irq(PMINFO 0);
+ if (ret) {
+ return ret;
+ }
+ init_waitqueue_entry(&__wait, current);
+
+ cnt = vs->cnt;
+ ret = wait_event_interruptible_timeout(vs->wait, cnt != vs->cnt, HZ/10);
+ if (ret < 0) {
+ return ret;
+ }
+ if (ret == 0) {
+ matroxfb_enable_irq(PMINFO 1);
+ return -ETIMEDOUT;
+ }
+ return 0;
+}
+
+/* --------------------------------------------------------------------- */
+
+static void matrox_pan_var(WPMINFO struct fb_var_screeninfo *var) {
+ unsigned int pos;
+ unsigned short p0, p1, p2;
+#ifdef CONFIG_FB_MATROX_32MB
+ unsigned int p3;
+#endif
+ int vbl;
+ unsigned long flags;
+
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+ if (ACCESS_FBINFO(dead))
+ return;
+
+ ACCESS_FBINFO(fbcon).var.xoffset = var->xoffset;
+ ACCESS_FBINFO(fbcon).var.yoffset = var->yoffset;
+ pos = (ACCESS_FBINFO(fbcon).var.yoffset * ACCESS_FBINFO(fbcon).var.xres_virtual + ACCESS_FBINFO(fbcon).var.xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
+ pos += ACCESS_FBINFO(curr.ydstorg.chunks);
+ p0 = ACCESS_FBINFO(hw).CRTC[0x0D] = pos & 0xFF;
+ p1 = ACCESS_FBINFO(hw).CRTC[0x0C] = (pos & 0xFF00) >> 8;
+ p2 = ACCESS_FBINFO(hw).CRTCEXT[0] = (ACCESS_FBINFO(hw).CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
+#ifdef CONFIG_FB_MATROX_32MB
+ p3 = ACCESS_FBINFO(hw).CRTCEXT[8] = pos >> 21;
+#endif
+
+ /* FB_ACTIVATE_VBL and we can acquire interrupts? Honor FB_ACTIVATE_VBL then... */
+ vbl = (var->activate & FB_ACTIVATE_VBL) && (matroxfb_enable_irq(PMINFO 0) == 0);
+
+ CRITBEGIN
+
+ matroxfb_DAC_lock_irqsave(flags);
+ mga_setr(M_CRTC_INDEX, 0x0D, p0);
+ mga_setr(M_CRTC_INDEX, 0x0C, p1);
+#ifdef CONFIG_FB_MATROX_32MB
+ if (ACCESS_FBINFO(devflags.support32MB))
+ mga_setr(M_EXTVGA_INDEX, 0x08, p3);
+#endif
+ if (vbl) {
+ ACCESS_FBINFO(crtc1.panpos) = p2;
+ } else {
+ /* Abort any pending change */
+ ACCESS_FBINFO(crtc1.panpos) = -1;
+ mga_setr(M_EXTVGA_INDEX, 0x00, p2);
+ }
+ matroxfb_DAC_unlock_irqrestore(flags);
+
+ update_crtc2(PMINFO pos);
+
+ CRITEND
+}
+
+static void matroxfb_remove(WPMINFO int dummy) {
+ /* Currently we are holding big kernel lock on all dead & usecount updates.
+ * Destroy everything after all users release it. Especially do not unregister
+ * framebuffer and iounmap memory, neither fbmem nor fbcon-cfb* does not check
+ * for device unplugged when in use.
+ * In future we should point mmio.vbase & video.vbase somewhere where we can
+ * write data without causing too much damage...
+ */
+
+ ACCESS_FBINFO(dead) = 1;
+ if (ACCESS_FBINFO(usecount)) {
+ /* destroy it later */
+ return;
+ }
+ matroxfb_unregister_device(MINFO);
+ unregister_framebuffer(&ACCESS_FBINFO(fbcon));
+ matroxfb_g450_shutdown(PMINFO2);
+#ifdef CONFIG_MTRR
+ if (ACCESS_FBINFO(mtrr.vram_valid))
+ mtrr_del(ACCESS_FBINFO(mtrr.vram), ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len));
+#endif
+ mga_iounmap(ACCESS_FBINFO(mmio.vbase));
+ mga_iounmap(ACCESS_FBINFO(video.vbase));
+ release_mem_region(ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len_maximum));
+ release_mem_region(ACCESS_FBINFO(mmio.base), 16384);
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+ kfree(minfo);
+#endif
+}
+
+ /*
+ * Open/Release the frame buffer device
+ */
+
+static int matroxfb_open(struct fb_info *info, int user)
+{
+ MINFO_FROM_INFO(info);
+
+ DBG_LOOP(__FUNCTION__)
+
+ if (ACCESS_FBINFO(dead)) {
+ return -ENXIO;
+ }
+ ACCESS_FBINFO(usecount)++;
+ if (user) {
+ ACCESS_FBINFO(userusecount)++;
+ }
+ return(0);
+}
+
+static int matroxfb_release(struct fb_info *info, int user)
+{
+ MINFO_FROM_INFO(info);
+
+ DBG_LOOP(__FUNCTION__)
+
+ if (user) {
+ if (0 == --ACCESS_FBINFO(userusecount)) {
+ matroxfb_disable_irq(PMINFO2);
+ }
+ }
+ if (!(--ACCESS_FBINFO(usecount)) && ACCESS_FBINFO(dead)) {
+ matroxfb_remove(PMINFO 0);
+ }
+ return(0);
+}
+
+static int matroxfb_pan_display(struct fb_var_screeninfo *var,
+ struct fb_info* info) {
+ MINFO_FROM_INFO(info);
+
+ DBG(__FUNCTION__)
+
+ matrox_pan_var(PMINFO var);
+ return 0;
+}
+
+static int matroxfb_get_final_bppShift(CPMINFO int bpp) {
+ int bppshft2;
+
+ DBG(__FUNCTION__)
+
+ bppshft2 = bpp;
+ if (!bppshft2) {
+ return 8;
+ }
+ if (isInterleave(MINFO))
+ bppshft2 >>= 1;
+ if (ACCESS_FBINFO(devflags.video64bits))
+ bppshft2 >>= 1;
+ return bppshft2;
+}
+
+static int matroxfb_test_and_set_rounding(CPMINFO int xres, int bpp) {
+ int over;
+ int rounding;
+
+ DBG(__FUNCTION__)
+
+ switch (bpp) {
+ case 0: return xres;
+ case 4: rounding = 128;
+ break;
+ case 8: rounding = 64; /* doc says 64; 32 is OK for G400 */
+ break;
+ case 16: rounding = 32;
+ break;
+ case 24: rounding = 64; /* doc says 64; 32 is OK for G400 */
+ break;
+ default: rounding = 16;
+ /* on G400, 16 really does not work */
+ if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+ rounding = 32;
+ break;
+ }
+ if (isInterleave(MINFO)) {
+ rounding *= 2;
+ }
+ over = xres % rounding;
+ if (over)
+ xres += rounding-over;
+ return xres;
+}
+
+static int matroxfb_pitch_adjust(CPMINFO int xres, int bpp) {
+ const int* width;
+ int xres_new;
+
+ DBG(__FUNCTION__)
+
+ if (!bpp) return xres;
+
+ width = ACCESS_FBINFO(capable.vxres);
+
+ if (ACCESS_FBINFO(devflags.precise_width)) {
+ while (*width) {
+ if ((*width >= xres) && (matroxfb_test_and_set_rounding(PMINFO *width, bpp) == *width)) {
+ break;
+ }
+ width++;
+ }
+ xres_new = *width;
+ } else {
+ xres_new = matroxfb_test_and_set_rounding(PMINFO xres, bpp);
+ }
+ if (!xres_new) return 0;
+ if (xres != xres_new) {
+ printk(KERN_INFO "matroxfb: cannot set xres to %d, rounded up to %d\n", xres, xres_new);
+ }
+ return xres_new;
+}
+
+static int matroxfb_get_cmap_len(struct fb_var_screeninfo *var) {
+
+ DBG(__FUNCTION__)
+
+ switch (var->bits_per_pixel) {
+ case 4:
+ return 16; /* pseudocolor... 16 entries HW palette */
+ case 8:
+ return 256; /* pseudocolor... 256 entries HW palette */
+ case 16:
+ return 16; /* directcolor... 16 entries SW palette */
+ /* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */
+ case 24:
+ return 16; /* directcolor... 16 entries SW palette */
+ /* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */
+ case 32:
+ return 16; /* directcolor... 16 entries SW palette */
+ /* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */
+ }
+ return 16; /* return something reasonable... or panic()? */
+}
+
+static int matroxfb_decode_var(CPMINFO struct fb_var_screeninfo *var, int *visual, int *video_cmap_len, unsigned int* ydstorg) {
+ struct RGBT {
+ unsigned char bpp;
+ struct {
+ unsigned char offset,
+ length;
+ } red,
+ green,
+ blue,
+ transp;
+ signed char visual;
+ };
+ static const struct RGBT table[]= {
+ { 8,{ 0,8},{0,8},{0,8},{ 0,0},MX_VISUAL_PSEUDOCOLOR},
+ {15,{10,5},{5,5},{0,5},{15,1},MX_VISUAL_DIRECTCOLOR},
+ {16,{11,5},{5,6},{0,5},{ 0,0},MX_VISUAL_DIRECTCOLOR},
+ {24,{16,8},{8,8},{0,8},{ 0,0},MX_VISUAL_DIRECTCOLOR},
+ {32,{16,8},{8,8},{0,8},{24,8},MX_VISUAL_DIRECTCOLOR}
+ };
+ struct RGBT const *rgbt;
+ unsigned int bpp = var->bits_per_pixel;
+ unsigned int vramlen;
+ unsigned int memlen;
+
+ DBG(__FUNCTION__)
+
+ switch (bpp) {
+ case 4: if (!ACCESS_FBINFO(capable.cfb4)) return -EINVAL;
+ break;
+ case 8: break;
+ case 16: break;
+ case 24: break;
+ case 32: break;
+ default: return -EINVAL;
+ }
+ *ydstorg = 0;
+ vramlen = ACCESS_FBINFO(video.len_usable);
+ if (var->yres_virtual < var->yres)
+ var->yres_virtual = var->yres;
+ if (var->xres_virtual < var->xres)
+ var->xres_virtual = var->xres;
+
+ var->xres_virtual = matroxfb_pitch_adjust(PMINFO var->xres_virtual, bpp);
+ memlen = var->xres_virtual * bpp * var->yres_virtual / 8;
+ if (memlen > vramlen) {
+ var->yres_virtual = vramlen * 8 / (var->xres_virtual * bpp);
+ memlen = var->xres_virtual * bpp * var->yres_virtual / 8;
+ }
+ /* There is hardware bug that no line can cross 4MB boundary */
+ /* give up for CFB24, it is impossible to easy workaround it */
+ /* for other try to do something */
+ if (!ACCESS_FBINFO(capable.cross4MB) && (memlen > 0x400000)) {
+ if (bpp == 24) {
+ /* sorry */
+ } else {
+ unsigned int linelen;
+ unsigned int m1 = linelen = var->xres_virtual * bpp / 8;
+ unsigned int m2 = PAGE_SIZE; /* or 128 if you do not need PAGE ALIGNED address */
+ unsigned int max_yres;
+
+ while (m1) {
+ int t;
+
+ while (m2 >= m1) m2 -= m1;
+ t = m1;
+ m1 = m2;
+ m2 = t;
+ }
+ m2 = linelen * PAGE_SIZE / m2;
+ *ydstorg = m2 = 0x400000 % m2;
+ max_yres = (vramlen - m2) / linelen;
+ if (var->yres_virtual > max_yres)
+ var->yres_virtual = max_yres;
+ }
+ }
+ /* YDSTLEN contains only signed 16bit value */
+ if (var->yres_virtual > 32767)
+ var->yres_virtual = 32767;
+ /* we must round yres/xres down, we already rounded y/xres_virtual up
+ if it was possible. We should return -EINVAL, but I disagree */
+ if (var->yres_virtual < var->yres)
+ var->yres = var->yres_virtual;
+ if (var->xres_virtual < var->xres)
+ var->xres = var->xres_virtual;
+ if (var->xoffset + var->xres > var->xres_virtual)
+ var->xoffset = var->xres_virtual - var->xres;
+ if (var->yoffset + var->yres > var->yres_virtual)
+ var->yoffset = var->yres_virtual - var->yres;
+
+ if (bpp == 16 && var->green.length == 5) {
+ bpp--; /* an artifical value - 15 */
+ }
+
+ for (rgbt = table; rgbt->bpp < bpp; rgbt++);
+#define SETCLR(clr)\
+ var->clr.offset = rgbt->clr.offset;\
+ var->clr.length = rgbt->clr.length
+ SETCLR(red);
+ SETCLR(green);
+ SETCLR(blue);
+ SETCLR(transp);
+#undef SETCLR
+ *visual = rgbt->visual;
+
+ if (bpp > 8)
+ dprintk("matroxfb: truecolor: "
+ "size=%d:%d:%d:%d, shift=%d:%d:%d:%d\n",
+ var->transp.length, var->red.length, var->green.length, var->blue.length,
+ var->transp.offset, var->red.offset, var->green.offset, var->blue.offset);
+
+ *video_cmap_len = matroxfb_get_cmap_len(var);
+ dprintk(KERN_INFO "requested %d*%d/%dbpp (%d*%d)\n", var->xres, var->yres, var->bits_per_pixel,
+ var->xres_virtual, var->yres_virtual);
+ return 0;
+}
+
+static int matroxfb_setcolreg(unsigned regno, unsigned red, unsigned green,
+ unsigned blue, unsigned transp,
+ struct fb_info *fb_info)
+{
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+ struct matrox_fb_info* minfo = container_of(fb_info, struct matrox_fb_info, fbcon);
+#endif
+
+ DBG(__FUNCTION__)
+
+ /*
+ * Set a single color register. The values supplied are
+ * already rounded down to the hardware's capabilities
+ * (according to the entries in the `var' structure). Return
+ * != 0 for invalid regno.
+ */
+
+ if (regno >= ACCESS_FBINFO(curr.cmap_len))
+ return 1;
+
+ if (ACCESS_FBINFO(fbcon).var.grayscale) {
+ /* gray = 0.30*R + 0.59*G + 0.11*B */
+ red = green = blue = (red * 77 + green * 151 + blue * 28) >> 8;
+ }
+
+ red = CNVT_TOHW(red, ACCESS_FBINFO(fbcon).var.red.length);
+ green = CNVT_TOHW(green, ACCESS_FBINFO(fbcon).var.green.length);
+ blue = CNVT_TOHW(blue, ACCESS_FBINFO(fbcon).var.blue.length);
+ transp = CNVT_TOHW(transp, ACCESS_FBINFO(fbcon).var.transp.length);
+
+ switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ case 4:
+ case 8:
+ mga_outb(M_DAC_REG, regno);
+ mga_outb(M_DAC_VAL, red);
+ mga_outb(M_DAC_VAL, green);
+ mga_outb(M_DAC_VAL, blue);
+ break;
+ case 16:
+ {
+ u_int16_t col =
+ (red << ACCESS_FBINFO(fbcon).var.red.offset) |
+ (green << ACCESS_FBINFO(fbcon).var.green.offset) |
+ (blue << ACCESS_FBINFO(fbcon).var.blue.offset) |
+ (transp << ACCESS_FBINFO(fbcon).var.transp.offset); /* for 1:5:5:5 */
+ ACCESS_FBINFO(cmap[regno]) = col | (col << 16);
+ }
+ break;
+ case 24:
+ case 32:
+ ACCESS_FBINFO(cmap[regno]) =
+ (red << ACCESS_FBINFO(fbcon).var.red.offset) |
+ (green << ACCESS_FBINFO(fbcon).var.green.offset) |
+ (blue << ACCESS_FBINFO(fbcon).var.blue.offset) |
+ (transp << ACCESS_FBINFO(fbcon).var.transp.offset); /* 8:8:8:8 */
+ break;
+ }
+ return 0;
+}
+
+static void matroxfb_init_fix(WPMINFO2)
+{
+ struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+ DBG(__FUNCTION__)
+
+ strcpy(fix->id,"MATROX");
+
+ fix->xpanstep = 8; /* 8 for 8bpp, 4 for 16bpp, 2 for 32bpp */
+ fix->ypanstep = 1;
+ fix->ywrapstep = 0;
+ fix->mmio_start = ACCESS_FBINFO(mmio.base);
+ fix->mmio_len = ACCESS_FBINFO(mmio.len);
+ fix->accel = ACCESS_FBINFO(devflags.accelerator);
+}
+
+static void matroxfb_update_fix(WPMINFO2)
+{
+ struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+ DBG(__FUNCTION__)
+
+ fix->smem_start = ACCESS_FBINFO(video.base) + ACCESS_FBINFO(curr.ydstorg.bytes);
+ fix->smem_len = ACCESS_FBINFO(video.len_usable) - ACCESS_FBINFO(curr.ydstorg.bytes);
+}
+
+static int matroxfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
+{
+ int err;
+ int visual;
+ int cmap_len;
+ unsigned int ydstorg;
+ MINFO_FROM_INFO(info);
+
+ if (ACCESS_FBINFO(dead)) {
+ return -ENXIO;
+ }
+ if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+ return err;
+ return 0;
+}
+
+static int matroxfb_set_par(struct fb_info *info)
+{
+ int err;
+ int visual;
+ int cmap_len;
+ unsigned int ydstorg;
+ struct fb_var_screeninfo *var;
+ MINFO_FROM_INFO(info);
+
+ DBG(__FUNCTION__)
+
+ if (ACCESS_FBINFO(dead)) {
+ return -ENXIO;
+ }
+
+ var = &info->var;
+ if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+ return err;
+ ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase)) + ydstorg;
+ matroxfb_update_fix(PMINFO2);
+ ACCESS_FBINFO(fbcon).fix.visual = visual;
+ ACCESS_FBINFO(fbcon).fix.type = FB_TYPE_PACKED_PIXELS;
+ ACCESS_FBINFO(fbcon).fix.type_aux = 0;
+ ACCESS_FBINFO(fbcon).fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
+ {
+ unsigned int pos;
+
+ ACCESS_FBINFO(curr.cmap_len) = cmap_len;
+ ydstorg += ACCESS_FBINFO(devflags.ydstorg);
+ ACCESS_FBINFO(curr.ydstorg.bytes) = ydstorg;
+ ACCESS_FBINFO(curr.ydstorg.chunks) = ydstorg >> (isInterleave(MINFO)?3:2);
+ if (var->bits_per_pixel == 4)
+ ACCESS_FBINFO(curr.ydstorg.pixels) = ydstorg;
+ else
+ ACCESS_FBINFO(curr.ydstorg.pixels) = (ydstorg * 8) / var->bits_per_pixel;
+ ACCESS_FBINFO(curr.final_bppShift) = matroxfb_get_final_bppShift(PMINFO var->bits_per_pixel);
+ { struct my_timming mt;
+ struct matrox_hw_state* hw;
+ int out;
+
+ matroxfb_var2my(var, &mt);
+ mt.crtc = MATROXFB_SRC_CRTC1;
+ /* CRTC1 delays */
+ switch (var->bits_per_pixel) {
+ case 0: mt.delay = 31 + 0; break;
+ case 16: mt.delay = 21 + 8; break;
+ case 24: mt.delay = 17 + 8; break;
+ case 32: mt.delay = 16 + 8; break;
+ default: mt.delay = 31 + 8; break;
+ }
+
+ hw = &ACCESS_FBINFO(hw);
+
+ down_read(&ACCESS_FBINFO(altout).lock);
+ for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+ if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
+ ACCESS_FBINFO(outputs[out]).output->compute) {
+ ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+ }
+ }
+ up_read(&ACCESS_FBINFO(altout).lock);
+ ACCESS_FBINFO(crtc1).pixclock = mt.pixclock;
+ ACCESS_FBINFO(crtc1).mnp = mt.mnp;
+ ACCESS_FBINFO(hw_switch->init(PMINFO &mt));
+ pos = (var->yoffset * var->xres_virtual + var->xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
+ pos += ACCESS_FBINFO(curr.ydstorg.chunks);
+
+ hw->CRTC[0x0D] = pos & 0xFF;
+ hw->CRTC[0x0C] = (pos & 0xFF00) >> 8;
+ hw->CRTCEXT[0] = (hw->CRTCEXT[0] & 0xF0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
+ hw->CRTCEXT[8] = pos >> 21;
+ ACCESS_FBINFO(hw_switch->restore(PMINFO2));
+ update_crtc2(PMINFO pos);
+ down_read(&ACCESS_FBINFO(altout).lock);
+ for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+ if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
+ ACCESS_FBINFO(outputs[out]).output->program) {
+ ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+ }
+ }
+ for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+ if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
+ ACCESS_FBINFO(outputs[out]).output->start) {
+ ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+ }
+ }
+ up_read(&ACCESS_FBINFO(altout).lock);
+ matrox_cfbX_init(PMINFO2);
+ }
+ }
+ ACCESS_FBINFO(initialized) = 1;
+ return 0;
+}
+
+static int matroxfb_get_vblank(WPMINFO struct fb_vblank *vblank)
+{
+ unsigned int sts1;
+
+ matroxfb_enable_irq(PMINFO 0);
+ memset(vblank, 0, sizeof(*vblank));
+ vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VSYNC |
+ FB_VBLANK_HAVE_VBLANK | FB_VBLANK_HAVE_HBLANK;
+ sts1 = mga_inb(M_INSTS1);
+ vblank->vcount = mga_inl(M_VCOUNT);
+ /* BTW, on my PIII/450 with G400, reading M_INSTS1
+ byte makes this call about 12% slower (1.70 vs. 2.05 us
+ per ioctl()) */
+ if (sts1 & 1)
+ vblank->flags |= FB_VBLANK_HBLANKING;
+ if (sts1 & 8)
+ vblank->flags |= FB_VBLANK_VSYNCING;
+ if (vblank->vcount >= ACCESS_FBINFO(fbcon).var.yres)
+ vblank->flags |= FB_VBLANK_VBLANKING;
+ if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+ vblank->flags |= FB_VBLANK_HAVE_COUNT;
+ /* Only one writer, aligned int value...
+ it should work without lock and without atomic_t */
+ vblank->count = ACCESS_FBINFO(crtc1).vsync.cnt;
+ }
+ return 0;
+}
+
+static struct matrox_altout panellink_output = {
+ .name = "Panellink output",
+};
+
+static int matroxfb_ioctl(struct inode *inode, struct file *file,
+ unsigned int cmd, unsigned long arg,
+ struct fb_info *info)
+{
+ void __user *argp = (void __user *)arg;
+ MINFO_FROM_INFO(info);
+
+ DBG(__FUNCTION__)
+
+ if (ACCESS_FBINFO(dead)) {
+ return -ENXIO;
+ }
+
+ switch (cmd) {
+ case FBIOGET_VBLANK:
+ {
+ struct fb_vblank vblank;
+ int err;
+
+ err = matroxfb_get_vblank(PMINFO &vblank);
+ if (err)
+ return err;
+ if (copy_to_user(argp, &vblank, sizeof(vblank)))
+ return -EFAULT;
+ return 0;
+ }
+ case FBIO_WAITFORVSYNC:
+ {
+ u_int32_t crt;
+
+ if (get_user(crt, (u_int32_t __user *)arg))
+ return -EFAULT;
+
+ return matroxfb_wait_for_sync(PMINFO crt);
+ }
+ case MATROXFB_SET_OUTPUT_MODE:
+ {
+ struct matroxioc_output_mode mom;
+ struct matrox_altout *oproc;
+ int val;
+
+ if (copy_from_user(&mom, argp, sizeof(mom)))
+ return -EFAULT;
+ if (mom.output >= MATROXFB_MAX_OUTPUTS)
+ return -ENXIO;
+ down_read(&ACCESS_FBINFO(altout.lock));
+ oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+ if (!oproc) {
+ val = -ENXIO;
+ } else if (!oproc->verifymode) {
+ if (mom.mode == MATROXFB_OUTPUT_MODE_MONITOR) {
+ val = 0;
+ } else {
+ val = -EINVAL;
+ }
+ } else {
+ val = oproc->verifymode(ACCESS_FBINFO(outputs[mom.output]).data, mom.mode);
+ }
+ if (!val) {
+ if (ACCESS_FBINFO(outputs[mom.output]).mode != mom.mode) {
+ ACCESS_FBINFO(outputs[mom.output]).mode = mom.mode;
+ val = 1;
+ }
+ }
+ up_read(&ACCESS_FBINFO(altout.lock));
+ if (val != 1)
+ return val;
+ switch (ACCESS_FBINFO(outputs[mom.output]).src) {
+ case MATROXFB_SRC_CRTC1:
+ matroxfb_set_par(info);
+ break;
+ case MATROXFB_SRC_CRTC2:
+ {
+ struct matroxfb_dh_fb_info* crtc2;
+
+ down_read(&ACCESS_FBINFO(crtc2.lock));
+ crtc2 = ACCESS_FBINFO(crtc2.info);
+ if (crtc2)
+ crtc2->fbcon.fbops->fb_set_par(&crtc2->fbcon);
+ up_read(&ACCESS_FBINFO(crtc2.lock));
+ }
+ break;
+ }
+ return 0;
+ }
+ case MATROXFB_GET_OUTPUT_MODE:
+ {
+ struct matroxioc_output_mode mom;
+ struct matrox_altout *oproc;
+ int val;
+
+ if (copy_from_user(&mom, argp, sizeof(mom)))
+ return -EFAULT;
+ if (mom.output >= MATROXFB_MAX_OUTPUTS)
+ return -ENXIO;
+ down_read(&ACCESS_FBINFO(altout.lock));
+ oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+ if (!oproc) {
+ val = -ENXIO;
+ } else {
+ mom.mode = ACCESS_FBINFO(outputs[mom.output]).mode;
+ val = 0;
+ }
+ up_read(&ACCESS_FBINFO(altout.lock));
+ if (val)
+ return val;
+ if (copy_to_user(argp, &mom, sizeof(mom)))
+ return -EFAULT;
+ return 0;
+ }
+ case MATROXFB_SET_OUTPUT_CONNECTION:
+ {
+ u_int32_t tmp;
+ int i;
+ int changes;
+
+ if (copy_from_user(&tmp, argp, sizeof(tmp)))
+ return -EFAULT;
+ for (i = 0; i < 32; i++) {
+ if (tmp & (1 << i)) {
+ if (i >= MATROXFB_MAX_OUTPUTS)
+ return -ENXIO;
+ if (!ACCESS_FBINFO(outputs[i]).output)
+ return -ENXIO;
+ switch (ACCESS_FBINFO(outputs[i]).src) {
+ case MATROXFB_SRC_NONE:
+ case MATROXFB_SRC_CRTC1:
+ break;
+ default:
+ return -EBUSY;
+ }
+ }
+ }
+ if (ACCESS_FBINFO(devflags.panellink)) {
+ if (tmp & MATROXFB_OUTPUT_CONN_DFP) {
+ if (tmp & MATROXFB_OUTPUT_CONN_SECONDARY)
+ return -EINVAL;
+ for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+ if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC2) {
+ return -EBUSY;
+ }
+ }
+ }
+ }
+ changes = 0;
+ for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+ if (tmp & (1 << i)) {
+ if (ACCESS_FBINFO(outputs[i]).src != MATROXFB_SRC_CRTC1) {
+ changes = 1;
+ ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_CRTC1;
+ }
+ } else if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+ changes = 1;
+ ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_NONE;
+ }
+ }
+ if (!changes)
+ return 0;
+ matroxfb_set_par(info);
+ return 0;
+ }
+ case MATROXFB_GET_OUTPUT_CONNECTION:
+ {
+ u_int32_t conn = 0;
+ int i;
+
+ for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+ if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+ conn |= 1 << i;
+ }
+ }
+ if (put_user(conn, (u_int32_t __user *)arg))
+ return -EFAULT;
+ return 0;
+ }
+ case MATROXFB_GET_AVAILABLE_OUTPUTS:
+ {
+ u_int32_t conn = 0;
+ int i;
+
+ for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+ if (ACCESS_FBINFO(outputs[i]).output) {
+ switch (ACCESS_FBINFO(outputs[i]).src) {
+ case MATROXFB_SRC_NONE:
+ case MATROXFB_SRC_CRTC1:
+ conn |= 1 << i;
+ break;
+ }
+ }
+ }
+ if (ACCESS_FBINFO(devflags.panellink)) {
+ if (conn & MATROXFB_OUTPUT_CONN_DFP)
+ conn &= ~MATROXFB_OUTPUT_CONN_SECONDARY;
+ if (conn & MATROXFB_OUTPUT_CONN_SECONDARY)
+ conn &= ~MATROXFB_OUTPUT_CONN_DFP;
+ }
+ if (put_user(conn, (u_int32_t __user *)arg))
+ return -EFAULT;
+ return 0;
+ }
+ case MATROXFB_GET_ALL_OUTPUTS:
+ {
+ u_int32_t conn = 0;
+ int i;
+
+ for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+ if (ACCESS_FBINFO(outputs[i]).output) {
+ conn |= 1 << i;
+ }
+ }
+ if (put_user(conn, (u_int32_t __user *)arg))
+ return -EFAULT;
+ return 0;
+ }
+ case VIDIOC_QUERYCAP:
+ {
+ struct v4l2_capability r;
+
+ memset(&r, 0, sizeof(r));
+ strcpy(r.driver, "matroxfb");
+ strcpy(r.card, "Matrox");
+ sprintf(r.bus_info, "PCI:%s", pci_name(ACCESS_FBINFO(pcidev)));
+ r.version = KERNEL_VERSION(1,0,0);
+ r.capabilities = V4L2_CAP_VIDEO_OUTPUT;
+ if (copy_to_user(argp, &r, sizeof(r)))
+ return -EFAULT;
+ return 0;
+
+ }
+ case VIDIOC_QUERYCTRL:
+ {
+ struct v4l2_queryctrl qctrl;
+ int err;
+
+ if (copy_from_user(&qctrl, argp, sizeof(qctrl)))
+ return -EFAULT;
+
+ down_read(&ACCESS_FBINFO(altout).lock);
+ if (!ACCESS_FBINFO(outputs[1]).output) {
+ err = -ENXIO;
+ } else if (ACCESS_FBINFO(outputs[1]).output->getqueryctrl) {
+ err = ACCESS_FBINFO(outputs[1]).output->getqueryctrl(ACCESS_FBINFO(outputs[1]).data, &qctrl);
+ } else {
+ err = -EINVAL;
+ }
+ up_read(&ACCESS_FBINFO(altout).lock);
+ if (err >= 0 &&
+ copy_to_user(argp, &qctrl, sizeof(qctrl)))
+ return -EFAULT;
+ return err;
+ }
+ case VIDIOC_G_CTRL:
+ {
+ struct v4l2_control ctrl;
+ int err;
+
+ if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
+ return -EFAULT;
+
+ down_read(&ACCESS_FBINFO(altout).lock);
+ if (!ACCESS_FBINFO(outputs[1]).output) {
+ err = -ENXIO;
+ } else if (ACCESS_FBINFO(outputs[1]).output->getctrl) {
+ err = ACCESS_FBINFO(outputs[1]).output->getctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+ } else {
+ err = -EINVAL;
+ }
+ up_read(&ACCESS_FBINFO(altout).lock);
+ if (err >= 0 &&
+ copy_to_user(argp, &ctrl, sizeof(ctrl)))
+ return -EFAULT;
+ return err;
+ }
+ case VIDIOC_S_CTRL_OLD:
+ case VIDIOC_S_CTRL:
+ {
+ struct v4l2_control ctrl;
+ int err;
+
+ if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
+ return -EFAULT;
+
+ down_read(&ACCESS_FBINFO(altout).lock);
+ if (!ACCESS_FBINFO(outputs[1]).output) {
+ err = -ENXIO;
+ } else if (ACCESS_FBINFO(outputs[1]).output->setctrl) {
+ err = ACCESS_FBINFO(outputs[1]).output->setctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+ } else {
+ err = -EINVAL;
+ }
+ up_read(&ACCESS_FBINFO(altout).lock);
+ return err;
+ }
+ }
+ return -ENOTTY;
+}
+
+/* 0 unblank, 1 blank, 2 no vsync, 3 no hsync, 4 off */
+
+static int matroxfb_blank(int blank, struct fb_info *info)
+{
+ int seq;
+ int crtc;
+ CRITFLAGS
+ MINFO_FROM_INFO(info);
+
+ DBG(__FUNCTION__)
+
+ if (ACCESS_FBINFO(dead))
+ return 1;
+
+ switch (blank) {
+ case FB_BLANK_NORMAL: seq = 0x20; crtc = 0x00; break; /* works ??? */
+ case FB_BLANK_VSYNC_SUSPEND: seq = 0x20; crtc = 0x10; break;
+ case FB_BLANK_HSYNC_SUSPEND: seq = 0x20; crtc = 0x20; break;
+ case FB_BLANK_POWERDOWN: seq = 0x20; crtc = 0x30; break;
+ default: seq = 0x00; crtc = 0x00; break;
+ }
+
+ CRITBEGIN
+
+ mga_outb(M_SEQ_INDEX, 1);
+ mga_outb(M_SEQ_DATA, (mga_inb(M_SEQ_DATA) & ~0x20) | seq);
+ mga_outb(M_EXTVGA_INDEX, 1);
+ mga_outb(M_EXTVGA_DATA, (mga_inb(M_EXTVGA_DATA) & ~0x30) | crtc);
+
+ CRITEND
+ return 0;
+}
+
+static struct fb_ops matroxfb_ops = {
+ .owner = THIS_MODULE,
+ .fb_open = matroxfb_open,
+ .fb_release = matroxfb_release,
+ .fb_check_var = matroxfb_check_var,
+ .fb_set_par = matroxfb_set_par,
+ .fb_setcolreg = matroxfb_setcolreg,
+ .fb_pan_display =matroxfb_pan_display,
+ .fb_blank = matroxfb_blank,
+ .fb_ioctl = matroxfb_ioctl,
+/* .fb_fillrect = <set by matrox_cfbX_init>, */
+/* .fb_copyarea = <set by matrox_cfbX_init>, */
+/* .fb_imageblit = <set by matrox_cfbX_init>, */
+/* .fb_cursor = <set by matrox_cfbX_init>, */
+};
+
+#define RSDepth(X) (((X) >> 8) & 0x0F)
+#define RS8bpp 0x1
+#define RS15bpp 0x2
+#define RS16bpp 0x3
+#define RS32bpp 0x4
+#define RS4bpp 0x5
+#define RS24bpp 0x6
+#define RSText 0x7
+#define RSText8 0x8
+/* 9-F */
+static struct { struct fb_bitfield red, green, blue, transp; int bits_per_pixel; } colors[] = {
+ { { 0, 8, 0}, { 0, 8, 0}, { 0, 8, 0}, { 0, 0, 0}, 8 },
+ { { 10, 5, 0}, { 5, 5, 0}, { 0, 5, 0}, { 15, 1, 0}, 16 },
+ { { 11, 5, 0}, { 5, 6, 0}, { 0, 5, 0}, { 0, 0, 0}, 16 },
+ { { 16, 8, 0}, { 8, 8, 0}, { 0, 8, 0}, { 24, 8, 0}, 32 },
+ { { 0, 8, 0}, { 0, 8, 0}, { 0, 8, 0}, { 0, 0, 0}, 4 },
+ { { 16, 8, 0}, { 8, 8, 0}, { 0, 8, 0}, { 0, 0, 0}, 24 },
+ { { 0, 6, 0}, { 0, 6, 0}, { 0, 6, 0}, { 0, 0, 0}, 0 }, /* textmode with (default) VGA8x16 */
+ { { 0, 6, 0}, { 0, 6, 0}, { 0, 6, 0}, { 0, 0, 0}, 0 }, /* textmode hardwired to VGA8x8 */
+};
+
+/* initialized by setup, see explanation at end of file (search for MODULE_PARM_DESC) */
+static unsigned int mem; /* "matrox:mem:xxxxxM" */
+static int option_precise_width = 1; /* cannot be changed, option_precise_width==0 must imply noaccel */
+static int inv24; /* "matrox:inv24" */
+static int cross4MB = -1; /* "matrox:cross4MB" */
+static int disabled; /* "matrox:disabled" */
+static int noaccel; /* "matrox:noaccel" */
+static int nopan; /* "matrox:nopan" */
+static int no_pci_retry; /* "matrox:nopciretry" */
+static int novga; /* "matrox:novga" */
+static int nobios; /* "matrox:nobios" */
+static int noinit = 1; /* "matrox:init" */
+static int inverse; /* "matrox:inverse" */
+static int sgram; /* "matrox:sgram" */
+#ifdef CONFIG_MTRR
+static int mtrr = 1; /* "matrox:nomtrr" */
+#endif
+static int grayscale; /* "matrox:grayscale" */
+static int dev = -1; /* "matrox:dev:xxxxx" */
+static unsigned int vesa = ~0; /* "matrox:vesa:xxxxx" */
+static int depth = -1; /* "matrox:depth:xxxxx" */
+static unsigned int xres; /* "matrox:xres:xxxxx" */
+static unsigned int yres; /* "matrox:yres:xxxxx" */
+static unsigned int upper = ~0; /* "matrox:upper:xxxxx" */
+static unsigned int lower = ~0; /* "matrox:lower:xxxxx" */
+static unsigned int vslen; /* "matrox:vslen:xxxxx" */
+static unsigned int left = ~0; /* "matrox:left:xxxxx" */
+static unsigned int right = ~0; /* "matrox:right:xxxxx" */
+static unsigned int hslen; /* "matrox:hslen:xxxxx" */
+static unsigned int pixclock; /* "matrox:pixclock:xxxxx" */
+static int sync = -1; /* "matrox:sync:xxxxx" */
+static unsigned int fv; /* "matrox:fv:xxxxx" */
+static unsigned int fh; /* "matrox:fh:xxxxxk" */
+static unsigned int maxclk; /* "matrox:maxclk:xxxxM" */
+static int dfp; /* "matrox:dfp */
+static int dfp_type = -1; /* "matrox:dfp:xxx */
+static int memtype = -1; /* "matrox:memtype:xxx" */
+static char outputs[8]; /* "matrox:outputs:xxx" */
+
+#ifndef MODULE
+static char videomode[64]; /* "matrox:mode:xxxxx" or "matrox:xxxxx" */
+#endif
+
+static int matroxfb_getmemory(WPMINFO unsigned int maxSize, unsigned int *realSize){
+ vaddr_t vm;
+ unsigned int offs;
+ unsigned int offs2;
+ unsigned char store;
+ unsigned char bytes[32];
+ unsigned char* tmp;
+
+ DBG(__FUNCTION__)
+
+ vm = ACCESS_FBINFO(video.vbase);
+ maxSize &= ~0x1FFFFF; /* must be X*2MB (really it must be 2 or X*4MB) */
+ /* at least 2MB */
+ if (maxSize < 0x0200000) return 0;
+ if (maxSize > 0x2000000) maxSize = 0x2000000;
+
+ mga_outb(M_EXTVGA_INDEX, 0x03);
+ mga_outb(M_EXTVGA_DATA, mga_inb(M_EXTVGA_DATA) | 0x80);
+
+ store = mga_readb(vm, 0x1234);
+ tmp = bytes;
+ for (offs = 0x100000; offs < maxSize; offs += 0x200000)
+ *tmp++ = mga_readb(vm, offs);
+ for (offs = 0x100000; offs < maxSize; offs += 0x200000)
+ mga_writeb(vm, offs, 0x02);
+ if (ACCESS_FBINFO(features.accel.has_cacheflush))
+ mga_outb(M_CACHEFLUSH, 0x00);
+ else
+ mga_writeb(vm, 0x1234, 0x99);
+ for (offs = 0x100000; offs < maxSize; offs += 0x200000) {
+ if (mga_readb(vm, offs) != 0x02)
+ break;
+ mga_writeb(vm, offs, mga_readb(vm, offs) - 0x02);
+ if (mga_readb(vm, offs))
+ break;
+ }
+ tmp = bytes;
+ for (offs2 = 0x100000; offs2 < maxSize; offs2 += 0x200000)
+ mga_writeb(vm, offs2, *tmp++);
+ mga_writeb(vm, 0x1234, store);
+
+ mga_outb(M_EXTVGA_INDEX, 0x03);
+ mga_outb(M_EXTVGA_DATA, mga_inb(M_EXTVGA_DATA) & ~0x80);
+
+ *realSize = offs - 0x100000;
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+ ACCESS_FBINFO(interleave) = !(!isMillenium(MINFO) || ((offs - 0x100000) & 0x3FFFFF));
+#endif
+ return 1;
+}
+
+struct video_board {
+ int maxvram;
+ int maxdisplayable;
+ int accelID;
+ struct matrox_switch* lowlevel;
+ };
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+static struct video_board vbMillennium = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGA2064W, &matrox_millennium};
+static struct video_board vbMillennium2 = {0x1000000, 0x0800000, FB_ACCEL_MATROX_MGA2164W, &matrox_millennium};
+static struct video_board vbMillennium2A = {0x1000000, 0x0800000, FB_ACCEL_MATROX_MGA2164W_AGP, &matrox_millennium};
+#endif /* CONFIG_FB_MATROX_MILLENIUM */
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static struct video_board vbMystique = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGA1064SG, &matrox_mystique};
+#endif /* CONFIG_FB_MATROX_MYSTIQUE */
+#ifdef CONFIG_FB_MATROX_G
+static struct video_board vbG100 = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGAG100, &matrox_G100};
+static struct video_board vbG200 = {0x1000000, 0x1000000, FB_ACCEL_MATROX_MGAG200, &matrox_G100};
+#ifdef CONFIG_FB_MATROX_32MB
+/* from doc it looks like that accelerator can draw only to low 16MB :-( Direct accesses & displaying are OK for
+ whole 32MB */
+static struct video_board vbG400 = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400, &matrox_G100};
+#else
+static struct video_board vbG400 = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400, &matrox_G100};
+#endif
+#endif
+
+#define DEVF_VIDEO64BIT 0x0001
+#define DEVF_SWAPS 0x0002
+#define DEVF_SRCORG 0x0004
+#define DEVF_DUALHEAD 0x0008
+#define DEVF_CROSS4MB 0x0010
+#define DEVF_TEXT4B 0x0020
+/* #define DEVF_recycled 0x0040 */
+/* #define DEVF_recycled 0x0080 */
+#define DEVF_SUPPORT32MB 0x0100
+#define DEVF_ANY_VXRES 0x0200
+#define DEVF_TEXT16B 0x0400
+#define DEVF_CRTC2 0x0800
+#define DEVF_MAVEN_CAPABLE 0x1000
+#define DEVF_PANELLINK_CAPABLE 0x2000
+#define DEVF_G450DAC 0x4000
+
+#define DEVF_GCORE (DEVF_VIDEO64BIT | DEVF_SWAPS | DEVF_CROSS4MB)
+#define DEVF_G2CORE (DEVF_GCORE | DEVF_ANY_VXRES | DEVF_MAVEN_CAPABLE | DEVF_PANELLINK_CAPABLE | DEVF_SRCORG | DEVF_DUALHEAD)
+#define DEVF_G100 (DEVF_GCORE) /* no doc, no vxres... */
+#define DEVF_G200 (DEVF_G2CORE)
+#define DEVF_G400 (DEVF_G2CORE | DEVF_SUPPORT32MB | DEVF_TEXT16B | DEVF_CRTC2)
+/* if you'll find how to drive DFP... */
+#define DEVF_G450 (DEVF_GCORE | DEVF_ANY_VXRES | DEVF_SUPPORT32MB | DEVF_TEXT16B | DEVF_CRTC2 | DEVF_G450DAC | DEVF_SRCORG | DEVF_DUALHEAD)
+#define DEVF_G550 (DEVF_G450)
+
+static struct board {
+ unsigned short vendor, device, rev, svid, sid;
+ unsigned int flags;
+ unsigned int maxclk;
+ enum mga_chip chip;
+ struct video_board* base;
+ const char* name;
+ } dev_list[] = {
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MIL, 0xFF,
+ 0, 0,
+ DEVF_TEXT4B,
+ 230000,
+ MGA_2064,
+ &vbMillennium,
+ "Millennium (PCI)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MIL_2, 0xFF,
+ 0, 0,
+ DEVF_SWAPS,
+ 220000,
+ MGA_2164,
+ &vbMillennium2,
+ "Millennium II (PCI)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MIL_2_AGP, 0xFF,
+ 0, 0,
+ DEVF_SWAPS,
+ 250000,
+ MGA_2164,
+ &vbMillennium2A,
+ "Millennium II (AGP)"},
+#endif
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MYS, 0x02,
+ 0, 0,
+ DEVF_VIDEO64BIT | DEVF_CROSS4MB,
+ 180000,
+ MGA_1064,
+ &vbMystique,
+ "Mystique (PCI)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MYS, 0xFF,
+ 0, 0,
+ DEVF_VIDEO64BIT | DEVF_SWAPS | DEVF_CROSS4MB,
+ 220000,
+ MGA_1164,
+ &vbMystique,
+ "Mystique 220 (PCI)"},
+#endif
+#ifdef CONFIG_FB_MATROX_G
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100_MM, 0xFF,
+ 0, 0,
+ DEVF_G100,
+ 230000,
+ MGA_G100,
+ &vbG100,
+ "MGA-G100 (PCI)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100_AGP, 0xFF,
+ 0, 0,
+ DEVF_G100,
+ 230000,
+ MGA_G100,
+ &vbG100,
+ "MGA-G100 (AGP)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_PCI, 0xFF,
+ 0, 0,
+ DEVF_G200,
+ 250000,
+ MGA_G200,
+ &vbG200,
+ "MGA-G200 (PCI)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF,
+ PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_GENERIC,
+ DEVF_G200,
+ 220000,
+ MGA_G200,
+ &vbG200,
+ "MGA-G200 (AGP)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF,
+ PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MYSTIQUE_G200_AGP,
+ DEVF_G200,
+ 230000,
+ MGA_G200,
+ &vbG200,
+ "Mystique G200 (AGP)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF,
+ PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MILLENIUM_G200_AGP,
+ DEVF_G200,
+ 250000,
+ MGA_G200,
+ &vbG200,
+ "Millennium G200 (AGP)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF,
+ PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MARVEL_G200_AGP,
+ DEVF_G200,
+ 230000,
+ MGA_G200,
+ &vbG200,
+ "Marvel G200 (AGP)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF,
+ PCI_SS_VENDOR_ID_SIEMENS_NIXDORF, PCI_SS_ID_SIEMENS_MGA_G200_AGP,
+ DEVF_G200,
+ 230000,
+ MGA_G200,
+ &vbG200,
+ "MGA-G200 (AGP)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP, 0xFF,
+ 0, 0,
+ DEVF_G200,
+ 230000,
+ MGA_G200,
+ &vbG200,
+ "G200 (AGP)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G400, 0x80,
+ PCI_SS_VENDOR_ID_MATROX, PCI_SS_ID_MATROX_MILLENNIUM_G400_MAX_AGP,
+ DEVF_G400,
+ 360000,
+ MGA_G400,
+ &vbG400,
+ "Millennium G400 MAX (AGP)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G400, 0x80,
+ 0, 0,
+ DEVF_G400,
+ 300000,
+ MGA_G400,
+ &vbG400,
+ "G400 (AGP)"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G400, 0xFF,
+ 0, 0,
+ DEVF_G450,
+ 360000,
+ MGA_G450,
+ &vbG400,
+ "G450"},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G550, 0xFF,
+ 0, 0,
+ DEVF_G550,
+ 360000,
+ MGA_G550,
+ &vbG400,
+ "G550"},
+#endif
+ {0, 0, 0xFF,
+ 0, 0,
+ 0,
+ 0,
+ 0,
+ NULL,
+ NULL}};
+
+#ifndef MODULE
+static struct fb_videomode defaultmode = {
+ /* 640x480 @ 60Hz, 31.5 kHz */
+ NULL, 60, 640, 480, 39721, 40, 24, 32, 11, 96, 2,
+ 0, FB_VMODE_NONINTERLACED
+};
+#endif /* !MODULE */
+
+static int hotplug = 0;
+
+static void setDefaultOutputs(WPMINFO2) {
+ unsigned int i;
+ const char* ptr;
+
+ ACCESS_FBINFO(outputs[0]).default_src = MATROXFB_SRC_CRTC1;
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ ACCESS_FBINFO(outputs[1]).default_src = MATROXFB_SRC_CRTC1;
+ ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+ } else if (dfp) {
+ ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+ }
+ ptr = outputs;
+ for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+ char c = *ptr++;
+
+ if (c == 0) {
+ break;
+ }
+ if (c == '0') {
+ ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_NONE;
+ } else if (c == '1') {
+ ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC1;
+ } else if (c == '2' && ACCESS_FBINFO(devflags.crtc2)) {
+ ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC2;
+ } else {
+ printk(KERN_ERR "matroxfb: Unknown outputs setting\n");
+ break;
+ }
+ }
+ /* Nullify this option for subsequent adapters */
+ outputs[0] = 0;
+}
+
+static int initMatrox2(WPMINFO struct board* b){
+ unsigned long ctrlptr_phys = 0;
+ unsigned long video_base_phys = 0;
+ unsigned int memsize;
+ int err;
+
+ static struct pci_device_id intel_82437[] = {
+ { PCI_DEVICE(PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_82437) },
+ { },
+ };
+
+ DBG(__FUNCTION__)
+
+ /* set default values... */
+ vesafb_defined.accel_flags = FB_ACCELF_TEXT;
+
+ ACCESS_FBINFO(hw_switch) = b->base->lowlevel;
+ ACCESS_FBINFO(devflags.accelerator) = b->base->accelID;
+ ACCESS_FBINFO(max_pixel_clock) = b->maxclk;
+
+ printk(KERN_INFO "matroxfb: Matrox %s detected\n", b->name);
+ ACCESS_FBINFO(capable.plnwt) = 1;
+ ACCESS_FBINFO(chip) = b->chip;
+ ACCESS_FBINFO(capable.srcorg) = b->flags & DEVF_SRCORG;
+ ACCESS_FBINFO(devflags.video64bits) = b->flags & DEVF_VIDEO64BIT;
+ if (b->flags & DEVF_TEXT4B) {
+ ACCESS_FBINFO(devflags.vgastep) = 4;
+ ACCESS_FBINFO(devflags.textmode) = 4;
+ ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+ } else if (b->flags & DEVF_TEXT16B) {
+ ACCESS_FBINFO(devflags.vgastep) = 16;
+ ACCESS_FBINFO(devflags.textmode) = 1;
+ ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+ } else {
+ ACCESS_FBINFO(devflags.vgastep) = 8;
+ ACCESS_FBINFO(devflags.textmode) = 1;
+ ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP8;
+ }
+#ifdef CONFIG_FB_MATROX_32MB
+ ACCESS_FBINFO(devflags.support32MB) = (b->flags & DEVF_SUPPORT32MB) != 0;
+#endif
+ ACCESS_FBINFO(devflags.precise_width) = !(b->flags & DEVF_ANY_VXRES);
+ ACCESS_FBINFO(devflags.crtc2) = (b->flags & DEVF_CRTC2) != 0;
+ ACCESS_FBINFO(devflags.maven_capable) = (b->flags & DEVF_MAVEN_CAPABLE) != 0;
+ ACCESS_FBINFO(devflags.dualhead) = (b->flags & DEVF_DUALHEAD) != 0;
+ ACCESS_FBINFO(devflags.dfp_type) = dfp_type;
+ ACCESS_FBINFO(devflags.g450dac) = (b->flags & DEVF_G450DAC) != 0;
+ ACCESS_FBINFO(devflags.textstep) = ACCESS_FBINFO(devflags.vgastep) * ACCESS_FBINFO(devflags.textmode);
+ ACCESS_FBINFO(devflags.textvram) = 65536 / ACCESS_FBINFO(devflags.textmode);
+ setDefaultOutputs(PMINFO2);
+ if (b->flags & DEVF_PANELLINK_CAPABLE) {
+ ACCESS_FBINFO(outputs[2]).data = MINFO;
+ ACCESS_FBINFO(outputs[2]).output = &panellink_output;
+ ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
+ ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ ACCESS_FBINFO(devflags.panellink) = 1;
+ }
+
+ if (ACCESS_FBINFO(capable.cross4MB) < 0)
+ ACCESS_FBINFO(capable.cross4MB) = b->flags & DEVF_CROSS4MB;
+ if (b->flags & DEVF_SWAPS) {
+ ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
+ video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
+ ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_0;
+ } else {
+ ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
+ video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
+ ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_1;
+ }
+ err = -EINVAL;
+ if (!ctrlptr_phys) {
+ printk(KERN_ERR "matroxfb: control registers are not available, matroxfb disabled\n");
+ goto fail;
+ }
+ if (!video_base_phys) {
+ printk(KERN_ERR "matroxfb: video RAM is not available in PCI address space, matroxfb disabled\n");
+ goto fail;
+ }
+ memsize = b->base->maxvram;
+ if (!request_mem_region(ctrlptr_phys, 16384, "matroxfb MMIO")) {
+ goto fail;
+ }
+ if (!request_mem_region(video_base_phys, memsize, "matroxfb FB")) {
+ goto failCtrlMR;
+ }
+ ACCESS_FBINFO(video.len_maximum) = memsize;
+ /* convert mem (autodetect k, M) */
+ if (mem < 1024) mem *= 1024;
+ if (mem < 0x00100000) mem *= 1024;
+
+ if (mem && (mem < memsize))
+ memsize = mem;
+ err = -ENOMEM;
+ if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &ACCESS_FBINFO(mmio.vbase))) {
+ printk(KERN_ERR "matroxfb: cannot ioremap(%lX, 16384), matroxfb disabled\n", ctrlptr_phys);
+ goto failVideoMR;
+ }
+ ACCESS_FBINFO(mmio.base) = ctrlptr_phys;
+ ACCESS_FBINFO(mmio.len) = 16384;
+ ACCESS_FBINFO(video.base) = video_base_phys;
+ if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &ACCESS_FBINFO(video.vbase))) {
+ printk(KERN_ERR "matroxfb: cannot ioremap(%lX, %d), matroxfb disabled\n",
+ video_base_phys, memsize);
+ goto failCtrlIO;
+ }
+ {
+ u_int32_t cmd;
+ u_int32_t mga_option;
+
+ pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &mga_option);
+ pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, &cmd);
+ mga_option &= 0x7FFFFFFF; /* clear BIG_ENDIAN */
+ mga_option |= MX_OPTION_BSWAP;
+ /* disable palette snooping */
+ cmd &= ~PCI_COMMAND_VGA_PALETTE;
+ if (pci_dev_present(intel_82437)) {
+ if (!(mga_option & 0x20000000) && !ACCESS_FBINFO(devflags.nopciretry)) {
+ printk(KERN_WARNING "matroxfb: Disabling PCI retries due to i82437 present\n");
+ }
+ mga_option |= 0x20000000;
+ ACCESS_FBINFO(devflags.nopciretry) = 1;
+ }
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, cmd);
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mga_option);
+ ACCESS_FBINFO(hw).MXoptionReg = mga_option;
+
+ /* select non-DMA memory for PCI_MGA_DATA, otherwise dump of PCI cfg space can lock PCI bus */
+ /* maybe preinit() candidate, but it is same... for all devices... at this time... */
+ pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MGA_INDEX, 0x00003C00);
+ }
+
+ err = -ENXIO;
+ matroxfb_read_pins(PMINFO2);
+ if (ACCESS_FBINFO(hw_switch)->preinit(PMINFO2)) {
+ goto failVideoIO;
+ }
+
+ err = -ENOMEM;
+ if (!matroxfb_getmemory(PMINFO memsize, &ACCESS_FBINFO(video.len)) || !ACCESS_FBINFO(video.len)) {
+ printk(KERN_ERR "matroxfb: cannot determine memory size\n");
+ goto failVideoIO;
+ }
+ ACCESS_FBINFO(devflags.ydstorg) = 0;
+
+ ACCESS_FBINFO(video.base) = video_base_phys;
+ ACCESS_FBINFO(video.len_usable) = ACCESS_FBINFO(video.len);
+ if (ACCESS_FBINFO(video.len_usable) > b->base->maxdisplayable)
+ ACCESS_FBINFO(video.len_usable) = b->base->maxdisplayable;
+#ifdef CONFIG_MTRR
+ if (mtrr) {
+ ACCESS_FBINFO(mtrr.vram) = mtrr_add(video_base_phys, ACCESS_FBINFO(video.len), MTRR_TYPE_WRCOMB, 1);
+ ACCESS_FBINFO(mtrr.vram_valid) = 1;
+ printk(KERN_INFO "matroxfb: MTRR's turned on\n");
+ }
+#endif /* CONFIG_MTRR */
+
+ if (!ACCESS_FBINFO(devflags.novga))
+ request_region(0x3C0, 32, "matrox");
+ matroxfb_g450_connect(PMINFO2);
+ ACCESS_FBINFO(hw_switch->reset(PMINFO2));
+
+ ACCESS_FBINFO(fbcon.monspecs.hfmin) = 0;
+ ACCESS_FBINFO(fbcon.monspecs.hfmax) = fh;
+ ACCESS_FBINFO(fbcon.monspecs.vfmin) = 0;
+ ACCESS_FBINFO(fbcon.monspecs.vfmax) = fv;
+ ACCESS_FBINFO(fbcon.monspecs.dpms) = 0; /* TBD */
+
+ /* static settings */
+ vesafb_defined.red = colors[depth-1].red;
+ vesafb_defined.green = colors[depth-1].green;
+ vesafb_defined.blue = colors[depth-1].blue;
+ vesafb_defined.bits_per_pixel = colors[depth-1].bits_per_pixel;
+ vesafb_defined.grayscale = grayscale;
+ vesafb_defined.vmode = 0;
+ if (noaccel)
+ vesafb_defined.accel_flags &= ~FB_ACCELF_TEXT;
+
+ ACCESS_FBINFO(fbops) = matroxfb_ops;
+ ACCESS_FBINFO(fbcon.fbops) = &ACCESS_FBINFO(fbops);
+ ACCESS_FBINFO(fbcon.pseudo_palette) = ACCESS_FBINFO(cmap);
+ /* after __init time we are like module... no logo */
+ ACCESS_FBINFO(fbcon.flags) = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT;
+ ACCESS_FBINFO(fbcon.flags) |= FBINFO_PARTIAL_PAN_OK | /* Prefer panning for scroll under MC viewer/edit */
+ FBINFO_HWACCEL_COPYAREA | /* We have hw-assisted bmove */
+ FBINFO_HWACCEL_FILLRECT | /* And fillrect */
+ FBINFO_HWACCEL_IMAGEBLIT | /* And imageblit */
+ FBINFO_HWACCEL_XPAN | /* And we support both horizontal */
+ FBINFO_HWACCEL_YPAN; /* And vertical panning */
+ ACCESS_FBINFO(video.len_usable) &= PAGE_MASK;
+ fb_alloc_cmap(&ACCESS_FBINFO(fbcon.cmap), 256, 1);
+
+#ifndef MODULE
+ /* mode database is marked __init!!! */
+ if (!hotplug) {
+ fb_find_mode(&vesafb_defined, &ACCESS_FBINFO(fbcon), videomode[0]?videomode:NULL,
+ NULL, 0, &defaultmode, vesafb_defined.bits_per_pixel);
+ }
+#endif /* !MODULE */
+
+ /* mode modifiers */
+ if (hslen)
+ vesafb_defined.hsync_len = hslen;
+ if (vslen)
+ vesafb_defined.vsync_len = vslen;
+ if (left != ~0)
+ vesafb_defined.left_margin = left;
+ if (right != ~0)
+ vesafb_defined.right_margin = right;
+ if (upper != ~0)
+ vesafb_defined.upper_margin = upper;
+ if (lower != ~0)
+ vesafb_defined.lower_margin = lower;
+ if (xres)
+ vesafb_defined.xres = xres;
+ if (yres)
+ vesafb_defined.yres = yres;
+ if (sync != -1)
+ vesafb_defined.sync = sync;
+ else if (vesafb_defined.sync == ~0) {
+ vesafb_defined.sync = 0;
+ if (yres < 400)
+ vesafb_defined.sync |= FB_SYNC_HOR_HIGH_ACT;
+ else if (yres < 480)
+ vesafb_defined.sync |= FB_SYNC_VERT_HIGH_ACT;
+ }
+
+ /* fv, fh, maxclk limits was specified */
+ {
+ unsigned int tmp;
+
+ if (fv) {
+ tmp = fv * (vesafb_defined.upper_margin + vesafb_defined.yres
+ + vesafb_defined.lower_margin + vesafb_defined.vsync_len);
+ if ((tmp < fh) || (fh == 0)) fh = tmp;
+ }
+ if (fh) {
+ tmp = fh * (vesafb_defined.left_margin + vesafb_defined.xres
+ + vesafb_defined.right_margin + vesafb_defined.hsync_len);
+ if ((tmp < maxclk) || (maxclk == 0)) maxclk = tmp;
+ }
+ tmp = (maxclk + 499) / 500;
+ if (tmp) {
+ tmp = (2000000000 + tmp) / tmp;
+ if (tmp > pixclock) pixclock = tmp;
+ }
+ }
+ if (pixclock) {
+ if (pixclock < 2000) /* > 500MHz */
+ pixclock = 4000; /* 250MHz */
+ if (pixclock > 1000000)
+ pixclock = 1000000; /* 1MHz */
+ vesafb_defined.pixclock = pixclock;
+ }
+
+ /* FIXME: Where to move this?! */
+#if defined(CONFIG_PPC_PMAC)
+#ifndef MODULE
+ if (_machine == _MACH_Pmac) {
+ struct fb_var_screeninfo var;
+ if (default_vmode <= 0 || default_vmode > VMODE_MAX)
+ default_vmode = VMODE_640_480_60;
+#ifdef CONFIG_NVRAM
+ if (default_cmode == CMODE_NVRAM)
+ default_cmode = nvram_read_byte(NV_CMODE);
+#endif
+ if (default_cmode < CMODE_8 || default_cmode > CMODE_32)
+ default_cmode = CMODE_8;
+ if (!mac_vmode_to_var(default_vmode, default_cmode, &var)) {
+ var.accel_flags = vesafb_defined.accel_flags;
+ var.xoffset = var.yoffset = 0;
+ /* Note: mac_vmode_to_var() does not set all parameters */
+ vesafb_defined = var;
+ }
+ }
+#endif /* !MODULE */
+#endif /* CONFIG_PPC_PMAC */
+ vesafb_defined.xres_virtual = vesafb_defined.xres;
+ if (nopan) {
+ vesafb_defined.yres_virtual = vesafb_defined.yres;
+ } else {
+ vesafb_defined.yres_virtual = 65536; /* large enough to be INF, but small enough
+ to yres_virtual * xres_virtual < 2^32 */
+ }
+ matroxfb_init_fix(PMINFO2);
+ /* Normalize values (namely yres_virtual) */
+ matroxfb_check_var(&vesafb_defined, &ACCESS_FBINFO(fbcon));
+ /* And put it into "current" var. Do NOT program hardware yet, or we'll not take over
+ * vgacon correctly. fbcon_startup will call fb_set_par for us, WITHOUT check_var,
+ * and unfortunately it will do it BEFORE vgacon contents is saved, so it won't work
+ * anyway. But we at least tried... */
+ ACCESS_FBINFO(fbcon.var) = vesafb_defined;
+ err = -EINVAL;
+
+ printk(KERN_INFO "matroxfb: %dx%dx%dbpp (virtual: %dx%d)\n",
+ vesafb_defined.xres, vesafb_defined.yres, vesafb_defined.bits_per_pixel,
+ vesafb_defined.xres_virtual, vesafb_defined.yres_virtual);
+ printk(KERN_INFO "matroxfb: framebuffer at 0x%lX, mapped to 0x%p, size %d\n",
+ ACCESS_FBINFO(video.base), vaddr_va(ACCESS_FBINFO(video.vbase)), ACCESS_FBINFO(video.len));
+
+/* We do not have to set currcon to 0... register_framebuffer do it for us on first console
+ * and we do not want currcon == 0 for subsequent framebuffers */
+
+ ACCESS_FBINFO(fbcon).device = &ACCESS_FBINFO(pcidev)->dev;
+ if (register_framebuffer(&ACCESS_FBINFO(fbcon)) < 0) {
+ goto failVideoIO;
+ }
+ printk("fb%d: %s frame buffer device\n",
+ ACCESS_FBINFO(fbcon.node), ACCESS_FBINFO(fbcon.fix.id));
+
+ /* there is no console on this fb... but we have to initialize hardware
+ * until someone tells me what is proper thing to do */
+ if (!ACCESS_FBINFO(initialized)) {
+ printk(KERN_INFO "fb%d: initializing hardware\n",
+ ACCESS_FBINFO(fbcon.node));
+ /* We have to use FB_ACTIVATE_FORCE, as we had to put vesafb_defined to the fbcon.var
+ * already before, so register_framebuffer works correctly. */
+ vesafb_defined.activate |= FB_ACTIVATE_FORCE;
+ fb_set_var(&ACCESS_FBINFO(fbcon), &vesafb_defined);
+ }
+
+ return 0;
+failVideoIO:;
+ matroxfb_g450_shutdown(PMINFO2);
+ mga_iounmap(ACCESS_FBINFO(video.vbase));
+failCtrlIO:;
+ mga_iounmap(ACCESS_FBINFO(mmio.vbase));
+failVideoMR:;
+ release_mem_region(video_base_phys, ACCESS_FBINFO(video.len_maximum));
+failCtrlMR:;
+ release_mem_region(ctrlptr_phys, 16384);
+fail:;
+ return err;
+}
+
+static LIST_HEAD(matroxfb_list);
+static LIST_HEAD(matroxfb_driver_list);
+
+#define matroxfb_l(x) list_entry(x, struct matrox_fb_info, next_fb)
+#define matroxfb_driver_l(x) list_entry(x, struct matroxfb_driver, node)
+int matroxfb_register_driver(struct matroxfb_driver* drv) {
+ struct matrox_fb_info* minfo;
+
+ list_add(&drv->node, &matroxfb_driver_list);
+ for (minfo = matroxfb_l(matroxfb_list.next);
+ minfo != matroxfb_l(&matroxfb_list);
+ minfo = matroxfb_l(minfo->next_fb.next)) {
+ void* p;
+
+ if (minfo->drivers_count == MATROXFB_MAX_FB_DRIVERS)
+ continue;
+ p = drv->probe(minfo);
+ if (p) {
+ minfo->drivers_data[minfo->drivers_count] = p;
+ minfo->drivers[minfo->drivers_count++] = drv;
+ }
+ }
+ return 0;
+}
+
+void matroxfb_unregister_driver(struct matroxfb_driver* drv) {
+ struct matrox_fb_info* minfo;
+
+ list_del(&drv->node);
+ for (minfo = matroxfb_l(matroxfb_list.next);
+ minfo != matroxfb_l(&matroxfb_list);
+ minfo = matroxfb_l(minfo->next_fb.next)) {
+ int i;
+
+ for (i = 0; i < minfo->drivers_count; ) {
+ if (minfo->drivers[i] == drv) {
+ if (drv && drv->remove)
+ drv->remove(minfo, minfo->drivers_data[i]);
+ minfo->drivers[i] = minfo->drivers[--minfo->drivers_count];
+ minfo->drivers_data[i] = minfo->drivers_data[minfo->drivers_count];
+ } else
+ i++;
+ }
+ }
+}
+
+static void matroxfb_register_device(struct matrox_fb_info* minfo) {
+ struct matroxfb_driver* drv;
+ int i = 0;
+ list_add(&ACCESS_FBINFO(next_fb), &matroxfb_list);
+ for (drv = matroxfb_driver_l(matroxfb_driver_list.next);
+ drv != matroxfb_driver_l(&matroxfb_driver_list);
+ drv = matroxfb_driver_l(drv->node.next)) {
+ if (drv && drv->probe) {
+ void *p = drv->probe(minfo);
+ if (p) {
+ minfo->drivers_data[i] = p;
+ minfo->drivers[i++] = drv;
+ if (i == MATROXFB_MAX_FB_DRIVERS)
+ break;
+ }
+ }
+ }
+ minfo->drivers_count = i;
+}
+
+static void matroxfb_unregister_device(struct matrox_fb_info* minfo) {
+ int i;
+
+ list_del(&ACCESS_FBINFO(next_fb));
+ for (i = 0; i < minfo->drivers_count; i++) {
+ struct matroxfb_driver* drv = minfo->drivers[i];
+
+ if (drv && drv->remove)
+ drv->remove(minfo, minfo->drivers_data[i]);
+ }
+}
+
+static int matroxfb_probe(struct pci_dev* pdev, const struct pci_device_id* dummy) {
+ struct board* b;
+ u_int8_t rev;
+ u_int16_t svid;
+ u_int16_t sid;
+ struct matrox_fb_info* minfo;
+ int err;
+ u_int32_t cmd;
+#ifndef CONFIG_FB_MATROX_MULTIHEAD
+ static int registered = 0;
+#endif
+ DBG(__FUNCTION__)
+
+ pci_read_config_byte(pdev, PCI_REVISION_ID, &rev);
+ svid = pdev->subsystem_vendor;
+ sid = pdev->subsystem_device;
+ for (b = dev_list; b->vendor; b++) {
+ if ((b->vendor != pdev->vendor) || (b->device != pdev->device) || (b->rev < rev)) continue;
+ if (b->svid)
+ if ((b->svid != svid) || (b->sid != sid)) continue;
+ break;
+ }
+ /* not match... */
+ if (!b->vendor)
+ return -1;
+ if (dev > 0) {
+ /* not requested one... */
+ dev--;
+ return -1;
+ }
+ pci_read_config_dword(pdev, PCI_COMMAND, &cmd);
+ if (pci_enable_device(pdev)) {
+ return -1;
+ }
+
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+ minfo = (struct matrox_fb_info*)kmalloc(sizeof(*minfo), GFP_KERNEL);
+ if (!minfo)
+ return -1;
+#else
+ if (registered) /* singlehead driver... */
+ return -1;
+ minfo = &matroxfb_global_mxinfo;
+#endif
+ memset(MINFO, 0, sizeof(*MINFO));
+
+ ACCESS_FBINFO(pcidev) = pdev;
+ ACCESS_FBINFO(dead) = 0;
+ ACCESS_FBINFO(usecount) = 0;
+ ACCESS_FBINFO(userusecount) = 0;
+
+ pci_set_drvdata(pdev, MINFO);
+ /* DEVFLAGS */
+ ACCESS_FBINFO(devflags.memtype) = memtype;
+ if (memtype != -1)
+ noinit = 0;
+ if (cmd & PCI_COMMAND_MEMORY) {
+ ACCESS_FBINFO(devflags.novga) = novga;
+ ACCESS_FBINFO(devflags.nobios) = nobios;
+ ACCESS_FBINFO(devflags.noinit) = noinit;
+ /* subsequent heads always needs initialization and must not enable BIOS */
+ novga = 1;
+ nobios = 1;
+ noinit = 0;
+ } else {
+ ACCESS_FBINFO(devflags.novga) = 1;
+ ACCESS_FBINFO(devflags.nobios) = 1;
+ ACCESS_FBINFO(devflags.noinit) = 0;
+ }
+
+ ACCESS_FBINFO(devflags.nopciretry) = no_pci_retry;
+ ACCESS_FBINFO(devflags.mga_24bpp_fix) = inv24;
+ ACCESS_FBINFO(devflags.precise_width) = option_precise_width;
+ ACCESS_FBINFO(devflags.sgram) = sgram;
+ ACCESS_FBINFO(capable.cross4MB) = cross4MB;
+
+ spin_lock_init(&ACCESS_FBINFO(lock.DAC));
+ spin_lock_init(&ACCESS_FBINFO(lock.accel));
+ init_rwsem(&ACCESS_FBINFO(crtc2.lock));
+ init_rwsem(&ACCESS_FBINFO(altout.lock));
+ ACCESS_FBINFO(irq_flags) = 0;
+ init_waitqueue_head(&ACCESS_FBINFO(crtc1.vsync.wait));
+ init_waitqueue_head(&ACCESS_FBINFO(crtc2.vsync.wait));
+ ACCESS_FBINFO(crtc1.panpos) = -1;
+
+ err = initMatrox2(PMINFO b);
+ if (!err) {
+#ifndef CONFIG_FB_MATROX_MULTIHEAD
+ registered = 1;
+#endif
+ matroxfb_register_device(MINFO);
+ return 0;
+ }
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+ kfree(minfo);
+#endif
+ return -1;
+}
+
+static void pci_remove_matrox(struct pci_dev* pdev) {
+ struct matrox_fb_info* minfo;
+
+ minfo = pci_get_drvdata(pdev);
+ matroxfb_remove(PMINFO 1);
+}
+
+static struct pci_device_id matroxfb_devices[] = {
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MIL,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MIL_2,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MIL_2_AGP,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+#endif
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_MYS,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+#endif
+#ifdef CONFIG_FB_MATROX_G
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100_MM,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G100_AGP,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_PCI,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G200_AGP,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G400,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+ {PCI_VENDOR_ID_MATROX, PCI_DEVICE_ID_MATROX_G550,
+ PCI_ANY_ID, PCI_ANY_ID, 0, 0, 0},
+#endif
+ {0, 0,
+ 0, 0, 0, 0, 0}
+};
+
+MODULE_DEVICE_TABLE(pci, matroxfb_devices);
+
+
+static struct pci_driver matroxfb_driver = {
+ .name = "matroxfb",
+ .id_table = matroxfb_devices,
+ .probe = matroxfb_probe,
+ .remove = pci_remove_matrox,
+};
+
+/* **************************** init-time only **************************** */
+
+#define RSResolution(X) ((X) & 0x0F)
+#define RS640x400 1
+#define RS640x480 2
+#define RS800x600 3
+#define RS1024x768 4
+#define RS1280x1024 5
+#define RS1600x1200 6
+#define RS768x576 7
+#define RS960x720 8
+#define RS1152x864 9
+#define RS1408x1056 10
+#define RS640x350 11
+#define RS1056x344 12 /* 132 x 43 text */
+#define RS1056x400 13 /* 132 x 50 text */
+#define RS1056x480 14 /* 132 x 60 text */
+#define RSNoxNo 15
+/* 10-FF */
+static struct { int xres, yres, left, right, upper, lower, hslen, vslen, vfreq; } timmings[] __initdata = {
+ { 640, 400, 48, 16, 39, 8, 96, 2, 70 },
+ { 640, 480, 48, 16, 33, 10, 96, 2, 60 },
+ { 800, 600, 144, 24, 28, 8, 112, 6, 60 },
+ { 1024, 768, 160, 32, 30, 4, 128, 4, 60 },
+ { 1280, 1024, 224, 32, 32, 4, 136, 4, 60 },
+ { 1600, 1200, 272, 48, 32, 5, 152, 5, 60 },
+ { 768, 576, 144, 16, 28, 6, 112, 4, 60 },
+ { 960, 720, 144, 24, 28, 8, 112, 4, 60 },
+ { 1152, 864, 192, 32, 30, 4, 128, 4, 60 },
+ { 1408, 1056, 256, 40, 32, 5, 144, 5, 60 },
+ { 640, 350, 48, 16, 39, 8, 96, 2, 70 },
+ { 1056, 344, 96, 24, 59, 44, 160, 2, 70 },
+ { 1056, 400, 96, 24, 39, 8, 160, 2, 70 },
+ { 1056, 480, 96, 24, 36, 12, 160, 3, 60 },
+ { 0, 0, ~0, ~0, ~0, ~0, 0, 0, 0 }
+};
+
+#define RSCreate(X,Y) ((X) | ((Y) << 8))
+static struct { unsigned int vesa; unsigned int info; } *RSptr, vesamap[] __initdata = {
+/* default must be first */
+ { ~0, RSCreate(RSNoxNo, RS8bpp ) },
+ { 0x101, RSCreate(RS640x480, RS8bpp ) },
+ { 0x100, RSCreate(RS640x400, RS8bpp ) },
+ { 0x180, RSCreate(RS768x576, RS8bpp ) },
+ { 0x103, RSCreate(RS800x600, RS8bpp ) },
+ { 0x188, RSCreate(RS960x720, RS8bpp ) },
+ { 0x105, RSCreate(RS1024x768, RS8bpp ) },
+ { 0x190, RSCreate(RS1152x864, RS8bpp ) },
+ { 0x107, RSCreate(RS1280x1024, RS8bpp ) },
+ { 0x198, RSCreate(RS1408x1056, RS8bpp ) },
+ { 0x11C, RSCreate(RS1600x1200, RS8bpp ) },
+ { 0x110, RSCreate(RS640x480, RS15bpp) },
+ { 0x181, RSCreate(RS768x576, RS15bpp) },
+ { 0x113, RSCreate(RS800x600, RS15bpp) },
+ { 0x189, RSCreate(RS960x720, RS15bpp) },
+ { 0x116, RSCreate(RS1024x768, RS15bpp) },
+ { 0x191, RSCreate(RS1152x864, RS15bpp) },
+ { 0x119, RSCreate(RS1280x1024, RS15bpp) },
+ { 0x199, RSCreate(RS1408x1056, RS15bpp) },
+ { 0x11D, RSCreate(RS1600x1200, RS15bpp) },
+ { 0x111, RSCreate(RS640x480, RS16bpp) },
+ { 0x182, RSCreate(RS768x576, RS16bpp) },
+ { 0x114, RSCreate(RS800x600, RS16bpp) },
+ { 0x18A, RSCreate(RS960x720, RS16bpp) },
+ { 0x117, RSCreate(RS1024x768, RS16bpp) },
+ { 0x192, RSCreate(RS1152x864, RS16bpp) },
+ { 0x11A, RSCreate(RS1280x1024, RS16bpp) },
+ { 0x19A, RSCreate(RS1408x1056, RS16bpp) },
+ { 0x11E, RSCreate(RS1600x1200, RS16bpp) },
+ { 0x1B2, RSCreate(RS640x480, RS24bpp) },
+ { 0x184, RSCreate(RS768x576, RS24bpp) },
+ { 0x1B5, RSCreate(RS800x600, RS24bpp) },
+ { 0x18C, RSCreate(RS960x720, RS24bpp) },
+ { 0x1B8, RSCreate(RS1024x768, RS24bpp) },
+ { 0x194, RSCreate(RS1152x864, RS24bpp) },
+ { 0x1BB, RSCreate(RS1280x1024, RS24bpp) },
+ { 0x19C, RSCreate(RS1408x1056, RS24bpp) },
+ { 0x1BF, RSCreate(RS1600x1200, RS24bpp) },
+ { 0x112, RSCreate(RS640x480, RS32bpp) },
+ { 0x183, RSCreate(RS768x576, RS32bpp) },
+ { 0x115, RSCreate(RS800x600, RS32bpp) },
+ { 0x18B, RSCreate(RS960x720, RS32bpp) },
+ { 0x118, RSCreate(RS1024x768, RS32bpp) },
+ { 0x193, RSCreate(RS1152x864, RS32bpp) },
+ { 0x11B, RSCreate(RS1280x1024, RS32bpp) },
+ { 0x19B, RSCreate(RS1408x1056, RS32bpp) },
+ { 0x11F, RSCreate(RS1600x1200, RS32bpp) },
+ { 0x010, RSCreate(RS640x350, RS4bpp ) },
+ { 0x012, RSCreate(RS640x480, RS4bpp ) },
+ { 0x102, RSCreate(RS800x600, RS4bpp ) },
+ { 0x104, RSCreate(RS1024x768, RS4bpp ) },
+ { 0x106, RSCreate(RS1280x1024, RS4bpp ) },
+ { 0, 0 }};
+
+static void __init matroxfb_init_params(void) {
+ /* fh from kHz to Hz */
+ if (fh < 1000)
+ fh *= 1000; /* 1kHz minimum */
+ /* maxclk */
+ if (maxclk < 1000) maxclk *= 1000; /* kHz -> Hz, MHz -> kHz */
+ if (maxclk < 1000000) maxclk *= 1000; /* kHz -> Hz, 1MHz minimum */
+ /* fix VESA number */
+ if (vesa != ~0)
+ vesa &= 0x1DFF; /* mask out clearscreen, acceleration and so on */
+
+ /* static settings */
+ for (RSptr = vesamap; RSptr->vesa; RSptr++) {
+ if (RSptr->vesa == vesa) break;
+ }
+ if (!RSptr->vesa) {
+ printk(KERN_ERR "Invalid vesa mode 0x%04X\n", vesa);
+ RSptr = vesamap;
+ }
+ {
+ int res = RSResolution(RSptr->info)-1;
+ if (left == ~0)
+ left = timmings[res].left;
+ if (!xres)
+ xres = timmings[res].xres;
+ if (right == ~0)
+ right = timmings[res].right;
+ if (!hslen)
+ hslen = timmings[res].hslen;
+ if (upper == ~0)
+ upper = timmings[res].upper;
+ if (!yres)
+ yres = timmings[res].yres;
+ if (lower == ~0)
+ lower = timmings[res].lower;
+ if (!vslen)
+ vslen = timmings[res].vslen;
+ if (!(fv||fh||maxclk||pixclock))
+ fv = timmings[res].vfreq;
+ if (depth == -1)
+ depth = RSDepth(RSptr->info);
+ }
+}
+
+static void __init matrox_init(void) {
+ matroxfb_init_params();
+ pci_register_driver(&matroxfb_driver);
+ dev = -1; /* accept all new devices... */
+}
+
+/* **************************** exit-time only **************************** */
+
+static void __exit matrox_done(void) {
+ pci_unregister_driver(&matroxfb_driver);
+}
+
+#ifndef MODULE
+
+/* ************************* init in-kernel code ************************** */
+
+static int __init matroxfb_setup(char *options) {
+ char *this_opt;
+
+ DBG(__FUNCTION__)
+
+ if (!options || !*options)
+ return 0;
+
+ while ((this_opt = strsep(&options, ",")) != NULL) {
+ if (!*this_opt) continue;
+
+ dprintk("matroxfb_setup: option %s\n", this_opt);
+
+ if (!strncmp(this_opt, "dev:", 4))
+ dev = simple_strtoul(this_opt+4, NULL, 0);
+ else if (!strncmp(this_opt, "depth:", 6)) {
+ switch (simple_strtoul(this_opt+6, NULL, 0)) {
+ case 0: depth = RSText; break;
+ case 4: depth = RS4bpp; break;
+ case 8: depth = RS8bpp; break;
+ case 15:depth = RS15bpp; break;
+ case 16:depth = RS16bpp; break;
+ case 24:depth = RS24bpp; break;
+ case 32:depth = RS32bpp; break;
+ default:
+ printk(KERN_ERR "matroxfb: unsupported color depth\n");
+ }
+ } else if (!strncmp(this_opt, "xres:", 5))
+ xres = simple_strtoul(this_opt+5, NULL, 0);
+ else if (!strncmp(this_opt, "yres:", 5))
+ yres = simple_strtoul(this_opt+5, NULL, 0);
+ else if (!strncmp(this_opt, "vslen:", 6))
+ vslen = simple_strtoul(this_opt+6, NULL, 0);
+ else if (!strncmp(this_opt, "hslen:", 6))
+ hslen = simple_strtoul(this_opt+6, NULL, 0);
+ else if (!strncmp(this_opt, "left:", 5))
+ left = simple_strtoul(this_opt+5, NULL, 0);
+ else if (!strncmp(this_opt, "right:", 6))
+ right = simple_strtoul(this_opt+6, NULL, 0);
+ else if (!strncmp(this_opt, "upper:", 6))
+ upper = simple_strtoul(this_opt+6, NULL, 0);
+ else if (!strncmp(this_opt, "lower:", 6))
+ lower = simple_strtoul(this_opt+6, NULL, 0);
+ else if (!strncmp(this_opt, "pixclock:", 9))
+ pixclock = simple_strtoul(this_opt+9, NULL, 0);
+ else if (!strncmp(this_opt, "sync:", 5))
+ sync = simple_strtoul(this_opt+5, NULL, 0);
+ else if (!strncmp(this_opt, "vesa:", 5))
+ vesa = simple_strtoul(this_opt+5, NULL, 0);
+ else if (!strncmp(this_opt, "maxclk:", 7))
+ maxclk = simple_strtoul(this_opt+7, NULL, 0);
+ else if (!strncmp(this_opt, "fh:", 3))
+ fh = simple_strtoul(this_opt+3, NULL, 0);
+ else if (!strncmp(this_opt, "fv:", 3))
+ fv = simple_strtoul(this_opt+3, NULL, 0);
+ else if (!strncmp(this_opt, "mem:", 4))
+ mem = simple_strtoul(this_opt+4, NULL, 0);
+ else if (!strncmp(this_opt, "mode:", 5))
+ strlcpy(videomode, this_opt+5, sizeof(videomode));
+ else if (!strncmp(this_opt, "outputs:", 8))
+ strlcpy(outputs, this_opt+8, sizeof(outputs));
+ else if (!strncmp(this_opt, "dfp:", 4)) {
+ dfp_type = simple_strtoul(this_opt+4, NULL, 0);
+ dfp = 1;
+ }
+#ifdef CONFIG_PPC_PMAC
+ else if (!strncmp(this_opt, "vmode:", 6)) {
+ unsigned int vmode = simple_strtoul(this_opt+6, NULL, 0);
+ if (vmode > 0 && vmode <= VMODE_MAX)
+ default_vmode = vmode;
+ } else if (!strncmp(this_opt, "cmode:", 6)) {
+ unsigned int cmode = simple_strtoul(this_opt+6, NULL, 0);
+ switch (cmode) {
+ case 0:
+ case 8:
+ default_cmode = CMODE_8;
+ break;
+ case 15:
+ case 16:
+ default_cmode = CMODE_16;
+ break;
+ case 24:
+ case 32:
+ default_cmode = CMODE_32;
+ break;
+ }
+ }
+#endif
+ else if (!strcmp(this_opt, "disabled")) /* nodisabled does not exist */
+ disabled = 1;
+ else if (!strcmp(this_opt, "enabled")) /* noenabled does not exist */
+ disabled = 0;
+ else if (!strcmp(this_opt, "sgram")) /* nosgram == sdram */
+ sgram = 1;
+ else if (!strcmp(this_opt, "sdram"))
+ sgram = 0;
+ else if (!strncmp(this_opt, "memtype:", 8))
+ memtype = simple_strtoul(this_opt+8, NULL, 0);
+ else {
+ int value = 1;
+
+ if (!strncmp(this_opt, "no", 2)) {
+ value = 0;
+ this_opt += 2;
+ }
+ if (! strcmp(this_opt, "inverse"))
+ inverse = value;
+ else if (!strcmp(this_opt, "accel"))
+ noaccel = !value;
+ else if (!strcmp(this_opt, "pan"))
+ nopan = !value;
+ else if (!strcmp(this_opt, "pciretry"))
+ no_pci_retry = !value;
+ else if (!strcmp(this_opt, "vga"))
+ novga = !value;
+ else if (!strcmp(this_opt, "bios"))
+ nobios = !value;
+ else if (!strcmp(this_opt, "init"))
+ noinit = !value;
+#ifdef CONFIG_MTRR
+ else if (!strcmp(this_opt, "mtrr"))
+ mtrr = value;
+#endif
+ else if (!strcmp(this_opt, "inv24"))
+ inv24 = value;
+ else if (!strcmp(this_opt, "cross4MB"))
+ cross4MB = value;
+ else if (!strcmp(this_opt, "grayscale"))
+ grayscale = value;
+ else if (!strcmp(this_opt, "dfp"))
+ dfp = value;
+ else {
+ strlcpy(videomode, this_opt, sizeof(videomode));
+ }
+ }
+ }
+ return 0;
+}
+
+static int __initdata initialized = 0;
+
+static int __init matroxfb_init(void)
+{
+ char *option = NULL;
+
+ DBG(__FUNCTION__)
+
+ if (fb_get_options("matroxfb", &option))
+ return -ENODEV;
+ matroxfb_setup(option);
+
+ if (disabled)
+ return -ENXIO;
+ if (!initialized) {
+ initialized = 1;
+ matrox_init();
+ }
+ hotplug = 1;
+ /* never return failure, user can hotplug matrox later... */
+ return 0;
+}
+
+module_init(matroxfb_init);
+
+#else
+
+/* *************************** init module code **************************** */
+
+MODULE_AUTHOR("(c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Accelerated FBDev driver for Matrox Millennium/Mystique/G100/G200/G400/G450/G550");
+MODULE_LICENSE("GPL");
+
+module_param(mem, int, 0);
+MODULE_PARM_DESC(mem, "Size of available memory in MB, KB or B (2,4,8,12,16MB, default=autodetect)");
+module_param(disabled, int, 0);
+MODULE_PARM_DESC(disabled, "Disabled (0 or 1=disabled) (default=0)");
+module_param(noaccel, int, 0);
+MODULE_PARM_DESC(noaccel, "Do not use accelerating engine (0 or 1=disabled) (default=0)");
+module_param(nopan, int, 0);
+MODULE_PARM_DESC(nopan, "Disable pan on startup (0 or 1=disabled) (default=0)");
+module_param(no_pci_retry, int, 0);
+MODULE_PARM_DESC(no_pci_retry, "PCI retries enabled (0 or 1=disabled) (default=0)");
+module_param(novga, int, 0);
+MODULE_PARM_DESC(novga, "VGA I/O (0x3C0-0x3DF) disabled (0 or 1=disabled) (default=0)");
+module_param(nobios, int, 0);
+MODULE_PARM_DESC(nobios, "Disables ROM BIOS (0 or 1=disabled) (default=do not change BIOS state)");
+module_param(noinit, int, 0);
+MODULE_PARM_DESC(noinit, "Disables W/SG/SD-RAM and bus interface initialization (0 or 1=do not initialize) (default=0)");
+module_param(memtype, int, 0);
+MODULE_PARM_DESC(memtype, "Memory type for G200/G400 (see Documentation/fb/matroxfb.txt for explanation) (default=3 for G200, 0 for G400)");
+#ifdef CONFIG_MTRR
+module_param(mtrr, int, 0);
+MODULE_PARM_DESC(mtrr, "This speeds up video memory accesses (0=disabled or 1) (default=1)");
+#endif
+module_param(sgram, int, 0);
+MODULE_PARM_DESC(sgram, "Indicates that G100/G200/G400 has SGRAM memory (0=SDRAM, 1=SGRAM) (default=0)");
+module_param(inv24, int, 0);
+MODULE_PARM_DESC(inv24, "Inverts clock polarity for 24bpp and loop frequency > 100MHz (default=do not invert polarity)");
+module_param(inverse, int, 0);
+MODULE_PARM_DESC(inverse, "Inverse (0 or 1) (default=0)");
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+module_param(dev, int, 0);
+MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=all working)");
+#else
+module_param(dev, int, 0);
+MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=first working)");
+#endif
+module_param(vesa, int, 0);
+MODULE_PARM_DESC(vesa, "Startup videomode (0x000-0x1FF) (default=0x101)");
+module_param(xres, int, 0);
+MODULE_PARM_DESC(xres, "Horizontal resolution (px), overrides xres from vesa (default=vesa)");
+module_param(yres, int, 0);
+MODULE_PARM_DESC(yres, "Vertical resolution (scans), overrides yres from vesa (default=vesa)");
+module_param(upper, int, 0);
+MODULE_PARM_DESC(upper, "Upper blank space (scans), overrides upper from vesa (default=vesa)");
+module_param(lower, int, 0);
+MODULE_PARM_DESC(lower, "Lower blank space (scans), overrides lower from vesa (default=vesa)");
+module_param(vslen, int, 0);
+MODULE_PARM_DESC(vslen, "Vertical sync length (scans), overrides lower from vesa (default=vesa)");
+module_param(left, int, 0);
+MODULE_PARM_DESC(left, "Left blank space (px), overrides left from vesa (default=vesa)");
+module_param(right, int, 0);
+MODULE_PARM_DESC(right, "Right blank space (px), overrides right from vesa (default=vesa)");
+module_param(hslen, int, 0);
+MODULE_PARM_DESC(hslen, "Horizontal sync length (px), overrides hslen from vesa (default=vesa)");
+module_param(pixclock, int, 0);
+MODULE_PARM_DESC(pixclock, "Pixelclock (ns), overrides pixclock from vesa (default=vesa)");
+module_param(sync, int, 0);
+MODULE_PARM_DESC(sync, "Sync polarity, overrides sync from vesa (default=vesa)");
+module_param(depth, int, 0);
+MODULE_PARM_DESC(depth, "Color depth (0=text,8,15,16,24,32) (default=vesa)");
+module_param(maxclk, int, 0);
+MODULE_PARM_DESC(maxclk, "Startup maximal clock, 0-999MHz, 1000-999999kHz, 1000000-INF Hz");
+module_param(fh, int, 0);
+MODULE_PARM_DESC(fh, "Startup horizontal frequency, 0-999kHz, 1000-INF Hz");
+module_param(fv, int, 0);
+MODULE_PARM_DESC(fv, "Startup vertical frequency, 0-INF Hz\n"
+"You should specify \"fv:max_monitor_vsync,fh:max_monitor_hsync,maxclk:max_monitor_dotclock\"\n");
+module_param(grayscale, int, 0);
+MODULE_PARM_DESC(grayscale, "Sets display into grayscale. Works perfectly with paletized videomode (4, 8bpp), some limitations apply to 16, 24 and 32bpp videomodes (default=nograyscale)");
+module_param(cross4MB, int, 0);
+MODULE_PARM_DESC(cross4MB, "Specifies that 4MB boundary can be in middle of line. (default=autodetected)");
+module_param(dfp, int, 0);
+MODULE_PARM_DESC(dfp, "Specifies whether to use digital flat panel interface of G200/G400 (0 or 1) (default=0)");
+module_param(dfp_type, int, 0);
+MODULE_PARM_DESC(dfp_type, "Specifies DFP interface type (0 to 255) (default=read from hardware)");
+module_param_string(outputs, outputs, sizeof(outputs), 0);
+MODULE_PARM_DESC(outputs, "Specifies which CRTC is mapped to which output (string of up to three letters, consisting of 0 (disabled), 1 (CRTC1), 2 (CRTC2)) (default=111 for Gx50, 101 for G200/G400 with DFP, and 100 for all other devices)");
+#ifdef CONFIG_PPC_PMAC
+module_param_named(vmode, default_vmode, int, 0);
+MODULE_PARM_DESC(vmode, "Specify the vmode mode number that should be used (640x480 default)");
+module_param_named(cmode, default_cmode, int, 0);
+MODULE_PARM_DESC(cmode, "Specify the video depth that should be used (8bit default)");
+#endif
+
+int __init init_module(void){
+
+ DBG(__FUNCTION__)
+
+ if (disabled)
+ return -ENXIO;
+
+ if (depth == 0)
+ depth = RSText;
+ else if (depth == 4)
+ depth = RS4bpp;
+ else if (depth == 8)
+ depth = RS8bpp;
+ else if (depth == 15)
+ depth = RS15bpp;
+ else if (depth == 16)
+ depth = RS16bpp;
+ else if (depth == 24)
+ depth = RS24bpp;
+ else if (depth == 32)
+ depth = RS32bpp;
+ else if (depth != -1) {
+ printk(KERN_ERR "matroxfb: depth %d is not supported, using default\n", depth);
+ depth = -1;
+ }
+ matrox_init();
+ /* never return failure; user can hotplug matrox later... */
+ return 0;
+}
+#endif /* MODULE */
+
+module_exit(matrox_done);
+EXPORT_SYMBOL(matroxfb_register_driver);
+EXPORT_SYMBOL(matroxfb_unregister_driver);
+EXPORT_SYMBOL(matroxfb_wait_for_sync);
+EXPORT_SYMBOL(matroxfb_enable_irq);
+
+/*
+ * Overrides for Emacs so that we follow Linus's tabbing style.
+ * ---------------------------------------------------------------------------
+ * Local variables:
+ * c-basic-offset: 8
+ * End:
+ */
+
diff --git a/drivers/video/matrox/matroxfb_base.h b/drivers/video/matrox/matroxfb_base.h
new file mode 100644
index 0000000..85a0b25
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_base.h
@@ -0,0 +1,781 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ */
+#ifndef __MATROXFB_H__
+#define __MATROXFB_H__
+
+/* general, but fairly heavy, debugging */
+#undef MATROXFB_DEBUG
+
+/* heavy debugging: */
+/* -- logs putc[s], so everytime a char is displayed, it's logged */
+#undef MATROXFB_DEBUG_HEAVY
+
+/* This one _could_ cause infinite loops */
+/* It _does_ cause lots and lots of messages during idle loops */
+#undef MATROXFB_DEBUG_LOOP
+
+/* Debug register calls, too? */
+#undef MATROXFB_DEBUG_REG
+
+/* Guard accelerator accesses with spin_lock_irqsave... */
+#undef MATROXFB_USE_SPINLOCKS
+
+#include <linux/config.h>
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/errno.h>
+#include <linux/string.h>
+#include <linux/mm.h>
+#include <linux/tty.h>
+#include <linux/slab.h>
+#include <linux/delay.h>
+#include <linux/fb.h>
+#include <linux/console.h>
+#include <linux/selection.h>
+#include <linux/ioport.h>
+#include <linux/init.h>
+#include <linux/timer.h>
+#include <linux/pci.h>
+#include <linux/spinlock.h>
+#include <linux/kd.h>
+
+#include <asm/io.h>
+#include <asm/unaligned.h>
+#ifdef CONFIG_MTRR
+#include <asm/mtrr.h>
+#endif
+
+#include "../console/fbcon.h"
+
+#if defined(CONFIG_PPC_PMAC)
+#include <asm/prom.h>
+#include <asm/pci-bridge.h>
+#include "../macmodes.h"
+#endif
+
+/* always compile support for 32MB... It cost almost nothing */
+#define CONFIG_FB_MATROX_32MB
+
+#ifdef MATROXFB_DEBUG
+
+#define DEBUG
+#define DBG(x) printk(KERN_DEBUG "matroxfb: %s\n", (x));
+
+#ifdef MATROXFB_DEBUG_HEAVY
+#define DBG_HEAVY(x) DBG(x)
+#else /* MATROXFB_DEBUG_HEAVY */
+#define DBG_HEAVY(x) /* DBG_HEAVY */
+#endif /* MATROXFB_DEBUG_HEAVY */
+
+#ifdef MATROXFB_DEBUG_LOOP
+#define DBG_LOOP(x) DBG(x)
+#else /* MATROXFB_DEBUG_LOOP */
+#define DBG_LOOP(x) /* DBG_LOOP */
+#endif /* MATROXFB_DEBUG_LOOP */
+
+#ifdef MATROXFB_DEBUG_REG
+#define DBG_REG(x) DBG(x)
+#else /* MATROXFB_DEBUG_REG */
+#define DBG_REG(x) /* DBG_REG */
+#endif /* MATROXFB_DEBUG_REG */
+
+#else /* MATROXFB_DEBUG */
+
+#define DBG(x) /* DBG */
+#define DBG_HEAVY(x) /* DBG_HEAVY */
+#define DBG_REG(x) /* DBG_REG */
+#define DBG_LOOP(x) /* DBG_LOOP */
+
+#endif /* MATROXFB_DEBUG */
+
+#ifdef DEBUG
+#define dprintk(X...) printk(X)
+#else
+#define dprintk(X...)
+#endif
+
+#ifndef PCI_SS_VENDOR_ID_SIEMENS_NIXDORF
+#define PCI_SS_VENDOR_ID_SIEMENS_NIXDORF 0x110A
+#endif
+#ifndef PCI_SS_VENDOR_ID_MATROX
+#define PCI_SS_VENDOR_ID_MATROX PCI_VENDOR_ID_MATROX
+#endif
+
+#ifndef PCI_SS_ID_MATROX_PRODUCTIVA_G100_AGP
+#define PCI_SS_ID_MATROX_GENERIC 0xFF00
+#define PCI_SS_ID_MATROX_PRODUCTIVA_G100_AGP 0xFF01
+#define PCI_SS_ID_MATROX_MYSTIQUE_G200_AGP 0xFF02
+#define PCI_SS_ID_MATROX_MILLENIUM_G200_AGP 0xFF03
+#define PCI_SS_ID_MATROX_MARVEL_G200_AGP 0xFF04
+#define PCI_SS_ID_MATROX_MGA_G100_PCI 0xFF05
+#define PCI_SS_ID_MATROX_MGA_G100_AGP 0x1001
+#define PCI_SS_ID_MATROX_MILLENNIUM_G400_MAX_AGP 0x2179
+#define PCI_SS_ID_SIEMENS_MGA_G100_AGP 0x001E /* 30 */
+#define PCI_SS_ID_SIEMENS_MGA_G200_AGP 0x0032 /* 50 */
+#endif
+
+#define MX_VISUAL_TRUECOLOR FB_VISUAL_DIRECTCOLOR
+#define MX_VISUAL_DIRECTCOLOR FB_VISUAL_TRUECOLOR
+#define MX_VISUAL_PSEUDOCOLOR FB_VISUAL_PSEUDOCOLOR
+
+#define CNVT_TOHW(val,width) ((((val)<<(width))+0x7FFF-(val))>>16)
+
+/* G-series and Mystique have (almost) same DAC */
+#undef NEED_DAC1064
+#if defined(CONFIG_FB_MATROX_MYSTIQUE) || defined(CONFIG_FB_MATROX_G)
+#define NEED_DAC1064 1
+#endif
+
+typedef struct {
+ void __iomem* vaddr;
+} vaddr_t;
+
+static inline unsigned int mga_readb(vaddr_t va, unsigned int offs) {
+ return readb(va.vaddr + offs);
+}
+
+static inline void mga_writeb(vaddr_t va, unsigned int offs, u_int8_t value) {
+ writeb(value, va.vaddr + offs);
+}
+
+static inline void mga_writew(vaddr_t va, unsigned int offs, u_int16_t value) {
+ writew(value, va.vaddr + offs);
+}
+
+static inline u_int32_t mga_readl(vaddr_t va, unsigned int offs) {
+ return readl(va.vaddr + offs);
+}
+
+static inline void mga_writel(vaddr_t va, unsigned int offs, u_int32_t value) {
+ writel(value, va.vaddr + offs);
+}
+
+static inline void mga_memcpy_toio(vaddr_t va, const void* src, int len) {
+#if defined(__alpha__) || defined(__i386__) || defined(__x86_64__)
+ /*
+ * memcpy_toio works for us if:
+ * (1) Copies data as 32bit quantities, not byte after byte,
+ * (2) Performs LE ordered stores, and
+ * (3) It copes with unaligned source (destination is guaranteed to be page
+ * aligned and length is guaranteed to be multiple of 4).
+ */
+ memcpy_toio(va.vaddr, src, len);
+#else
+ u_int32_t __iomem* addr = va.vaddr;
+
+ if ((unsigned long)src & 3) {
+ while (len >= 4) {
+ fb_writel(get_unaligned((u32 *)src), addr);
+ addr++;
+ len -= 4;
+ src += 4;
+ }
+ } else {
+ while (len >= 4) {
+ fb_writel(*(u32 *)src, addr);
+ addr++;
+ len -= 4;
+ src += 4;
+ }
+ }
+#endif
+}
+
+static inline void vaddr_add(vaddr_t* va, unsigned long offs) {
+ va->vaddr += offs;
+}
+
+static inline void __iomem* vaddr_va(vaddr_t va) {
+ return va.vaddr;
+}
+
+#define MGA_IOREMAP_NORMAL 0
+#define MGA_IOREMAP_NOCACHE 1
+
+#define MGA_IOREMAP_FB MGA_IOREMAP_NOCACHE
+#define MGA_IOREMAP_MMIO MGA_IOREMAP_NOCACHE
+static inline int mga_ioremap(unsigned long phys, unsigned long size, int flags, vaddr_t* virt) {
+ if (flags & MGA_IOREMAP_NOCACHE)
+ virt->vaddr = ioremap_nocache(phys, size);
+ else
+ virt->vaddr = ioremap(phys, size);
+ return (virt->vaddr == 0); /* 0, !0... 0, error_code in future */
+}
+
+static inline void mga_iounmap(vaddr_t va) {
+ iounmap(va.vaddr);
+}
+
+struct my_timming {
+ unsigned int pixclock;
+ int mnp;
+ unsigned int crtc;
+ unsigned int HDisplay;
+ unsigned int HSyncStart;
+ unsigned int HSyncEnd;
+ unsigned int HTotal;
+ unsigned int VDisplay;
+ unsigned int VSyncStart;
+ unsigned int VSyncEnd;
+ unsigned int VTotal;
+ unsigned int sync;
+ int dblscan;
+ int interlaced;
+ unsigned int delay; /* CRTC delay */
+};
+
+enum { M_SYSTEM_PLL, M_PIXEL_PLL_A, M_PIXEL_PLL_B, M_PIXEL_PLL_C, M_VIDEO_PLL };
+
+struct matrox_pll_cache {
+ unsigned int valid;
+ struct {
+ unsigned int mnp_key;
+ unsigned int mnp_value;
+ } data[4];
+};
+
+struct matrox_pll_limits {
+ unsigned int vcomin;
+ unsigned int vcomax;
+};
+
+struct matrox_pll_features {
+ unsigned int vco_freq_min;
+ unsigned int ref_freq;
+ unsigned int feed_div_min;
+ unsigned int feed_div_max;
+ unsigned int in_div_min;
+ unsigned int in_div_max;
+ unsigned int post_shift_max;
+};
+
+struct matroxfb_par
+{
+ unsigned int final_bppShift;
+ unsigned int cmap_len;
+ struct {
+ unsigned int bytes;
+ unsigned int pixels;
+ unsigned int chunks;
+ } ydstorg;
+};
+
+struct matrox_fb_info;
+
+struct matrox_DAC1064_features {
+ u_int8_t xvrefctrl;
+ u_int8_t xmiscctrl;
+};
+
+struct matrox_accel_features {
+ int has_cacheflush;
+};
+
+/* current hardware status */
+struct mavenregs {
+ u_int8_t regs[256];
+ int mode;
+ int vlines;
+ int xtal;
+ int fv;
+
+ u_int16_t htotal;
+ u_int16_t hcorr;
+};
+
+struct matrox_crtc2 {
+ u_int32_t ctl;
+};
+
+struct matrox_hw_state {
+ u_int32_t MXoptionReg;
+ unsigned char DACclk[6];
+ unsigned char DACreg[80];
+ unsigned char MiscOutReg;
+ unsigned char DACpal[768];
+ unsigned char CRTC[25];
+ unsigned char CRTCEXT[9];
+ unsigned char SEQ[5];
+ /* unused for MGA mode, but who knows... */
+ unsigned char GCTL[9];
+ /* unused for MGA mode, but who knows... */
+ unsigned char ATTR[21];
+
+ /* TVOut only */
+ struct mavenregs maven;
+
+ struct matrox_crtc2 crtc2;
+};
+
+struct matrox_accel_data {
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+ unsigned char ramdac_rev;
+#endif
+ u_int32_t m_dwg_rect;
+ u_int32_t m_opmode;
+};
+
+struct v4l2_queryctrl;
+struct v4l2_control;
+
+struct matrox_altout {
+ const char *name;
+ int (*compute)(void* altout_dev, struct my_timming* input);
+ int (*program)(void* altout_dev);
+ int (*start)(void* altout_dev);
+ int (*verifymode)(void* altout_dev, u_int32_t mode);
+ int (*getqueryctrl)(void* altout_dev,
+ struct v4l2_queryctrl* ctrl);
+ int (*getctrl)(void* altout_dev,
+ struct v4l2_control* ctrl);
+ int (*setctrl)(void* altout_dev,
+ struct v4l2_control* ctrl);
+};
+
+#define MATROXFB_SRC_NONE 0
+#define MATROXFB_SRC_CRTC1 1
+#define MATROXFB_SRC_CRTC2 2
+
+enum mga_chip { MGA_2064, MGA_2164, MGA_1064, MGA_1164, MGA_G100, MGA_G200, MGA_G400, MGA_G450, MGA_G550 };
+
+struct matrox_bios {
+ unsigned int bios_valid : 1;
+ unsigned int pins_len;
+ unsigned char pins[128];
+ struct {
+ unsigned char vMaj, vMin, vRev;
+ } version;
+ struct {
+ unsigned char state, tvout;
+ } output;
+};
+
+extern struct display fb_display[];
+
+struct matrox_switch;
+struct matroxfb_driver;
+struct matroxfb_dh_fb_info;
+
+struct matrox_vsync {
+ wait_queue_head_t wait;
+ unsigned int cnt;
+};
+
+struct matrox_fb_info {
+ struct fb_info fbcon;
+
+ struct list_head next_fb;
+
+ int dead;
+ int initialized;
+ unsigned int usecount;
+
+ unsigned int userusecount;
+ unsigned long irq_flags;
+
+ struct matroxfb_par curr;
+ struct matrox_hw_state hw;
+
+ struct matrox_accel_data accel;
+
+ struct pci_dev* pcidev;
+
+ struct {
+ struct matrox_vsync vsync;
+ unsigned int pixclock;
+ int mnp;
+ int panpos;
+ } crtc1;
+ struct {
+ struct matrox_vsync vsync;
+ unsigned int pixclock;
+ int mnp;
+ struct matroxfb_dh_fb_info* info;
+ struct rw_semaphore lock;
+ } crtc2;
+ struct {
+ struct rw_semaphore lock;
+ struct {
+ int brightness, contrast, saturation, hue, gamma;
+ int testout, deflicker;
+ } tvo_params;
+ } altout;
+#define MATROXFB_MAX_OUTPUTS 3
+ struct {
+ unsigned int src;
+ struct matrox_altout* output;
+ void* data;
+ unsigned int mode;
+ unsigned int default_src;
+ } outputs[MATROXFB_MAX_OUTPUTS];
+
+#define MATROXFB_MAX_FB_DRIVERS 5
+ struct matroxfb_driver* (drivers[MATROXFB_MAX_FB_DRIVERS]);
+ void* (drivers_data[MATROXFB_MAX_FB_DRIVERS]);
+ unsigned int drivers_count;
+
+ struct {
+ unsigned long base; /* physical */
+ vaddr_t vbase; /* CPU view */
+ unsigned int len;
+ unsigned int len_usable;
+ unsigned int len_maximum;
+ } video;
+
+ struct {
+ unsigned long base; /* physical */
+ vaddr_t vbase; /* CPU view */
+ unsigned int len;
+ } mmio;
+
+ unsigned int max_pixel_clock;
+
+ struct matrox_switch* hw_switch;
+
+ struct {
+ struct matrox_pll_features pll;
+ struct matrox_DAC1064_features DAC1064;
+ struct matrox_accel_features accel;
+ } features;
+ struct {
+ spinlock_t DAC;
+ spinlock_t accel;
+ } lock;
+
+ enum mga_chip chip;
+
+ int interleave;
+ int millenium;
+ int milleniumII;
+ struct {
+ int cfb4;
+ const int* vxres;
+ int cross4MB;
+ int text;
+ int plnwt;
+ int srcorg;
+ } capable;
+#ifdef CONFIG_MTRR
+ struct {
+ int vram;
+ int vram_valid;
+ } mtrr;
+#endif
+ struct {
+ int precise_width;
+ int mga_24bpp_fix;
+ int novga;
+ int nobios;
+ int nopciretry;
+ int noinit;
+ int sgram;
+#ifdef CONFIG_FB_MATROX_32MB
+ int support32MB;
+#endif
+
+ int accelerator;
+ int text_type_aux;
+ int video64bits;
+ int crtc2;
+ int maven_capable;
+ unsigned int vgastep;
+ unsigned int textmode;
+ unsigned int textstep;
+ unsigned int textvram; /* character cells */
+ unsigned int ydstorg; /* offset in bytes from video start to usable memory */
+ /* 0 except for 6MB Millenium */
+ int memtype;
+ int g450dac;
+ int dfp_type;
+ int panellink; /* G400 DFP possible (not G450/G550) */
+ int dualhead;
+ unsigned int fbResource;
+ } devflags;
+ struct fb_ops fbops;
+ struct matrox_bios bios;
+ struct {
+ struct matrox_pll_limits pixel;
+ struct matrox_pll_limits system;
+ struct matrox_pll_limits video;
+ } limits;
+ struct {
+ struct matrox_pll_cache pixel;
+ struct matrox_pll_cache system;
+ struct matrox_pll_cache video;
+ } cache;
+ struct {
+ struct {
+ unsigned int video;
+ unsigned int system;
+ } pll;
+ struct {
+ u_int32_t opt;
+ u_int32_t opt2;
+ u_int32_t opt3;
+ u_int32_t mctlwtst;
+ u_int32_t mctlwtst_core;
+ u_int32_t memmisc;
+ u_int32_t memrdbk;
+ u_int32_t maccess;
+ } reg;
+ struct {
+ unsigned int ddr:1,
+ emrswen:1,
+ dll:1;
+ } memory;
+ } values;
+ u_int32_t cmap[17];
+};
+
+#define info2minfo(info) container_of(info, struct matrox_fb_info, fbcon)
+
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+#define ACCESS_FBINFO2(info, x) (info->x)
+#define ACCESS_FBINFO(x) ACCESS_FBINFO2(minfo,x)
+
+#define MINFO minfo
+
+#define WPMINFO2 struct matrox_fb_info* minfo
+#define WPMINFO WPMINFO2 ,
+#define CPMINFO2 const struct matrox_fb_info* minfo
+#define CPMINFO CPMINFO2 ,
+#define PMINFO2 minfo
+#define PMINFO PMINFO2 ,
+
+#define MINFO_FROM(x) struct matrox_fb_info* minfo = x
+#else
+
+extern struct matrox_fb_info matroxfb_global_mxinfo;
+
+#define ACCESS_FBINFO(x) (matroxfb_global_mxinfo.x)
+#define ACCESS_FBINFO2(info, x) (matroxfb_global_mxinfo.x)
+
+#define MINFO (&matroxfb_global_mxinfo)
+
+#define WPMINFO2 void
+#define WPMINFO
+#define CPMINFO2 void
+#define CPMINFO
+#define PMINFO2
+#define PMINFO
+
+#define MINFO_FROM(x)
+
+#endif
+
+#define MINFO_FROM_INFO(x) MINFO_FROM(info2minfo(x))
+
+struct matrox_switch {
+ int (*preinit)(WPMINFO2);
+ void (*reset)(WPMINFO2);
+ int (*init)(WPMINFO struct my_timming*);
+ void (*restore)(WPMINFO2);
+};
+
+struct matroxfb_driver {
+ struct list_head node;
+ char* name;
+ void* (*probe)(struct matrox_fb_info* info);
+ void (*remove)(struct matrox_fb_info* info, void* data);
+};
+
+int matroxfb_register_driver(struct matroxfb_driver* drv);
+void matroxfb_unregister_driver(struct matroxfb_driver* drv);
+
+#define PCI_OPTION_REG 0x40
+#define PCI_OPTION_ENABLE_ROM 0x40000000
+
+#define PCI_MGA_INDEX 0x44
+#define PCI_MGA_DATA 0x48
+#define PCI_OPTION2_REG 0x50
+#define PCI_OPTION3_REG 0x54
+#define PCI_MEMMISC_REG 0x58
+
+#define M_DWGCTL 0x1C00
+#define M_MACCESS 0x1C04
+#define M_CTLWTST 0x1C08
+
+#define M_PLNWT 0x1C1C
+
+#define M_BCOL 0x1C20
+#define M_FCOL 0x1C24
+
+#define M_SGN 0x1C58
+#define M_LEN 0x1C5C
+#define M_AR0 0x1C60
+#define M_AR1 0x1C64
+#define M_AR2 0x1C68
+#define M_AR3 0x1C6C
+#define M_AR4 0x1C70
+#define M_AR5 0x1C74
+#define M_AR6 0x1C78
+
+#define M_CXBNDRY 0x1C80
+#define M_FXBNDRY 0x1C84
+#define M_YDSTLEN 0x1C88
+#define M_PITCH 0x1C8C
+#define M_YDST 0x1C90
+#define M_YDSTORG 0x1C94
+#define M_YTOP 0x1C98
+#define M_YBOT 0x1C9C
+
+/* mystique only */
+#define M_CACHEFLUSH 0x1FFF
+
+#define M_EXEC 0x0100
+
+#define M_DWG_TRAP 0x04
+#define M_DWG_BITBLT 0x08
+#define M_DWG_ILOAD 0x09
+
+#define M_DWG_LINEAR 0x0080
+#define M_DWG_SOLID 0x0800
+#define M_DWG_ARZERO 0x1000
+#define M_DWG_SGNZERO 0x2000
+#define M_DWG_SHIFTZERO 0x4000
+
+#define M_DWG_REPLACE 0x000C0000
+#define M_DWG_REPLACE2 (M_DWG_REPLACE | 0x40)
+#define M_DWG_XOR 0x00060010
+
+#define M_DWG_BFCOL 0x04000000
+#define M_DWG_BMONOWF 0x08000000
+
+#define M_DWG_TRANSC 0x40000000
+
+#define M_FIFOSTATUS 0x1E10
+#define M_STATUS 0x1E14
+#define M_ICLEAR 0x1E18
+#define M_IEN 0x1E1C
+
+#define M_VCOUNT 0x1E20
+
+#define M_RESET 0x1E40
+#define M_MEMRDBK 0x1E44
+
+#define M_AGP2PLL 0x1E4C
+
+#define M_OPMODE 0x1E54
+#define M_OPMODE_DMA_GEN_WRITE 0x00
+#define M_OPMODE_DMA_BLIT 0x04
+#define M_OPMODE_DMA_VECTOR_WRITE 0x08
+#define M_OPMODE_DMA_LE 0x0000 /* little endian - no transformation */
+#define M_OPMODE_DMA_BE_8BPP 0x0000
+#define M_OPMODE_DMA_BE_16BPP 0x0100
+#define M_OPMODE_DMA_BE_32BPP 0x0200
+#define M_OPMODE_DIR_LE 0x000000 /* little endian - no transformation */
+#define M_OPMODE_DIR_BE_8BPP 0x000000
+#define M_OPMODE_DIR_BE_16BPP 0x010000
+#define M_OPMODE_DIR_BE_32BPP 0x020000
+
+#define M_ATTR_INDEX 0x1FC0
+#define M_ATTR_DATA 0x1FC1
+
+#define M_MISC_REG 0x1FC2
+#define M_3C2_RD 0x1FC2
+
+#define M_SEQ_INDEX 0x1FC4
+#define M_SEQ_DATA 0x1FC5
+
+#define M_MISC_REG_READ 0x1FCC
+
+#define M_GRAPHICS_INDEX 0x1FCE
+#define M_GRAPHICS_DATA 0x1FCF
+
+#define M_CRTC_INDEX 0x1FD4
+
+#define M_ATTR_RESET 0x1FDA
+#define M_3DA_WR 0x1FDA
+#define M_INSTS1 0x1FDA
+
+#define M_EXTVGA_INDEX 0x1FDE
+#define M_EXTVGA_DATA 0x1FDF
+
+/* G200 only */
+#define M_SRCORG 0x2CB4
+#define M_DSTORG 0x2CB8
+
+#define M_RAMDAC_BASE 0x3C00
+
+/* fortunately, same on TVP3026 and MGA1064 */
+#define M_DAC_REG (M_RAMDAC_BASE+0)
+#define M_DAC_VAL (M_RAMDAC_BASE+1)
+#define M_PALETTE_MASK (M_RAMDAC_BASE+2)
+
+#define M_X_INDEX 0x00
+#define M_X_DATAREG 0x0A
+
+#define DAC_XGENIOCTRL 0x2A
+#define DAC_XGENIODATA 0x2B
+
+#define M_C2CTL 0x3C10
+
+#define MX_OPTION_BSWAP 0x00000000
+
+#ifdef __LITTLE_ENDIAN
+#define M_OPMODE_4BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_8BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_16BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_24BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_32BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#else
+#ifdef __BIG_ENDIAN
+#define M_OPMODE_4BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT) /* TODO */
+#define M_OPMODE_8BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_BE_8BPP | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_16BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_BE_16BPP | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_24BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_BE_8BPP | M_OPMODE_DMA_BLIT) /* TODO, ?32 */
+#define M_OPMODE_32BPP (M_OPMODE_DMA_LE | M_OPMODE_DIR_BE_32BPP | M_OPMODE_DMA_BLIT)
+#else
+#error "Byte ordering have to be defined. Cannot continue."
+#endif
+#endif
+
+#define mga_inb(addr) mga_readb(ACCESS_FBINFO(mmio.vbase), (addr))
+#define mga_inl(addr) mga_readl(ACCESS_FBINFO(mmio.vbase), (addr))
+#define mga_outb(addr,val) mga_writeb(ACCESS_FBINFO(mmio.vbase), (addr), (val))
+#define mga_outw(addr,val) mga_writew(ACCESS_FBINFO(mmio.vbase), (addr), (val))
+#define mga_outl(addr,val) mga_writel(ACCESS_FBINFO(mmio.vbase), (addr), (val))
+#define mga_readr(port,idx) (mga_outb((port),(idx)), mga_inb((port)+1))
+#define mga_setr(addr,port,val) mga_outw(addr, ((val)<<8) | (port))
+
+#define mga_fifo(n) do {} while ((mga_inl(M_FIFOSTATUS) & 0xFF) < (n))
+
+#define WaitTillIdle() do {} while (mga_inl(M_STATUS) & 0x10000)
+
+/* code speedup */
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+#define isInterleave(x) (x->interleave)
+#define isMillenium(x) (x->millenium)
+#define isMilleniumII(x) (x->milleniumII)
+#else
+#define isInterleave(x) (0)
+#define isMillenium(x) (0)
+#define isMilleniumII(x) (0)
+#endif
+
+#define matroxfb_DAC_lock() spin_lock(&ACCESS_FBINFO(lock.DAC))
+#define matroxfb_DAC_unlock() spin_unlock(&ACCESS_FBINFO(lock.DAC))
+#define matroxfb_DAC_lock_irqsave(flags) spin_lock_irqsave(&ACCESS_FBINFO(lock.DAC),flags)
+#define matroxfb_DAC_unlock_irqrestore(flags) spin_unlock_irqrestore(&ACCESS_FBINFO(lock.DAC),flags)
+extern void matroxfb_DAC_out(CPMINFO int reg, int val);
+extern int matroxfb_DAC_in(CPMINFO int reg);
+extern void matroxfb_var2my(struct fb_var_screeninfo* fvsi, struct my_timming* mt);
+extern int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc);
+extern int matroxfb_enable_irq(WPMINFO int reenable);
+
+#ifdef MATROXFB_USE_SPINLOCKS
+#define CRITBEGIN spin_lock_irqsave(&ACCESS_FBINFO(lock.accel), critflags);
+#define CRITEND spin_unlock_irqrestore(&ACCESS_FBINFO(lock.accel), critflags);
+#define CRITFLAGS unsigned long critflags;
+#else
+#define CRITBEGIN
+#define CRITEND
+#define CRITFLAGS
+#endif
+
+#endif /* __MATROXFB_H__ */
diff --git a/drivers/video/matrox/matroxfb_crtc2.c b/drivers/video/matrox/matroxfb_crtc2.c
new file mode 100644
index 0000000..429047a
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_crtc2.c
@@ -0,0 +1,741 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ */
+
+#include "matroxfb_maven.h"
+#include "matroxfb_crtc2.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_DAC1064.h"
+#include <linux/matroxfb.h>
+#include <asm/uaccess.h>
+
+/* **************************************************** */
+
+static int mem = 8192;
+
+module_param(mem, int, 0);
+MODULE_PARM_DESC(mem, "Memory size reserved for dualhead (default=8MB)");
+
+/* **************************************************** */
+
+static int matroxfb_dh_setcolreg(unsigned regno, unsigned red, unsigned green,
+ unsigned blue, unsigned transp, struct fb_info* info) {
+ u_int32_t col;
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+
+ if (regno >= 16)
+ return 1;
+ if (m2info->fbcon.var.grayscale) {
+ /* gray = 0.30*R + 0.59*G + 0.11*B */
+ red = green = blue = (red * 77 + green * 151 + blue * 28) >> 8;
+ }
+ red = CNVT_TOHW(red, m2info->fbcon.var.red.length);
+ green = CNVT_TOHW(green, m2info->fbcon.var.green.length);
+ blue = CNVT_TOHW(blue, m2info->fbcon.var.blue.length);
+ transp = CNVT_TOHW(transp, m2info->fbcon.var.transp.length);
+
+ col = (red << m2info->fbcon.var.red.offset) |
+ (green << m2info->fbcon.var.green.offset) |
+ (blue << m2info->fbcon.var.blue.offset) |
+ (transp << m2info->fbcon.var.transp.offset);
+
+ switch (m2info->fbcon.var.bits_per_pixel) {
+ case 16:
+ m2info->cmap[regno] = col | (col << 16);
+ break;
+ case 32:
+ m2info->cmap[regno] = col;
+ break;
+ }
+ return 0;
+#undef m2info
+}
+
+static void matroxfb_dh_restore(struct matroxfb_dh_fb_info* m2info,
+ struct my_timming* mt,
+ int mode,
+ unsigned int pos) {
+ u_int32_t tmp;
+ u_int32_t datactl;
+ MINFO_FROM(m2info->primary_dev);
+
+ switch (mode) {
+ case 15:
+ tmp = 0x00200000;
+ break;
+ case 16:
+ tmp = 0x00400000;
+ break;
+/* case 32: */
+ default:
+ tmp = 0x00800000;
+ break;
+ }
+ tmp |= 0x00000001; /* enable CRTC2 */
+ datactl = 0;
+ if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ tmp |= 0x00000006; /* source from secondary pixel PLL */
+ /* no vidrst when in monitor mode */
+ if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+ tmp |= 0xC0001000; /* Enable H/V vidrst */
+ }
+ } else {
+ tmp |= 0x00000002; /* source from VDOCLK */
+ tmp |= 0xC0000000; /* enable vvidrst & hvidrst */
+ /* MGA TVO is our clock source */
+ }
+ } else if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+ tmp |= 0x00000004; /* source from pixclock */
+ /* PIXPLL is our clock source */
+ }
+ if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+ tmp |= 0x00100000; /* connect CRTC2 to DAC */
+ }
+ if (mt->interlaced) {
+ tmp |= 0x02000000; /* interlaced, second field is bigger, as G450 apparently ignores it */
+ mt->VDisplay >>= 1;
+ mt->VSyncStart >>= 1;
+ mt->VSyncEnd >>= 1;
+ mt->VTotal >>= 1;
+ }
+ if ((mt->HTotal & 7) == 2) {
+ datactl |= 0x00000010;
+ mt->HTotal &= ~7;
+ }
+ tmp |= 0x10000000; /* 0x10000000 is VIDRST polarity */
+ mga_outl(0x3C14, ((mt->HDisplay - 8) << 16) | (mt->HTotal - 8));
+ mga_outl(0x3C18, ((mt->HSyncEnd - 8) << 16) | (mt->HSyncStart - 8));
+ mga_outl(0x3C1C, ((mt->VDisplay - 1) << 16) | (mt->VTotal - 1));
+ mga_outl(0x3C20, ((mt->VSyncEnd - 1) << 16) | (mt->VSyncStart - 1));
+ mga_outl(0x3C24, ((mt->VSyncStart) << 16) | (mt->HSyncStart)); /* preload */
+ {
+ u_int32_t linelen = m2info->fbcon.var.xres_virtual * (m2info->fbcon.var.bits_per_pixel >> 3);
+ if (tmp & 0x02000000) {
+ /* field #0 is smaller, so... */
+ mga_outl(0x3C2C, pos); /* field #1 vmemory start */
+ mga_outl(0x3C28, pos + linelen); /* field #0 vmemory start */
+ linelen <<= 1;
+ m2info->interlaced = 1;
+ } else {
+ mga_outl(0x3C28, pos); /* vmemory start */
+ m2info->interlaced = 0;
+ }
+ mga_outl(0x3C40, linelen);
+ }
+ mga_outl(0x3C4C, datactl); /* data control */
+ if (tmp & 0x02000000) {
+ int i;
+
+ mga_outl(0x3C10, tmp & ~0x02000000);
+ for (i = 0; i < 2; i++) {
+ unsigned int nl;
+ unsigned int lastl = 0;
+
+ while ((nl = mga_inl(0x3C48) & 0xFFF) >= lastl) {
+ lastl = nl;
+ }
+ }
+ }
+ mga_outl(0x3C10, tmp);
+ ACCESS_FBINFO(hw).crtc2.ctl = tmp;
+
+ tmp = mt->VDisplay << 16; /* line compare */
+ if (mt->sync & FB_SYNC_HOR_HIGH_ACT)
+ tmp |= 0x00000100;
+ if (mt->sync & FB_SYNC_VERT_HIGH_ACT)
+ tmp |= 0x00000200;
+ mga_outl(0x3C44, tmp);
+}
+
+static void matroxfb_dh_disable(struct matroxfb_dh_fb_info* m2info) {
+ MINFO_FROM(m2info->primary_dev);
+
+ mga_outl(0x3C10, 0x00000004); /* disable CRTC2, CRTC1->DAC1, PLL as clock source */
+ ACCESS_FBINFO(hw).crtc2.ctl = 0x00000004;
+}
+
+static void matroxfb_dh_cfbX_init(struct matroxfb_dh_fb_info* m2info) {
+ /* no acceleration for secondary head... */
+ m2info->cmap[16] = 0xFFFFFFFF;
+}
+
+static void matroxfb_dh_pan_var(struct matroxfb_dh_fb_info* m2info,
+ struct fb_var_screeninfo* var) {
+ unsigned int pos;
+ unsigned int linelen;
+ unsigned int pixelsize;
+ MINFO_FROM(m2info->primary_dev);
+
+ m2info->fbcon.var.xoffset = var->xoffset;
+ m2info->fbcon.var.yoffset = var->yoffset;
+ pixelsize = m2info->fbcon.var.bits_per_pixel >> 3;
+ linelen = m2info->fbcon.var.xres_virtual * pixelsize;
+ pos = m2info->fbcon.var.yoffset * linelen + m2info->fbcon.var.xoffset * pixelsize;
+ pos += m2info->video.offbase;
+ if (m2info->interlaced) {
+ mga_outl(0x3C2C, pos);
+ mga_outl(0x3C28, pos + linelen);
+ } else {
+ mga_outl(0x3C28, pos);
+ }
+}
+
+static int matroxfb_dh_decode_var(struct matroxfb_dh_fb_info* m2info,
+ struct fb_var_screeninfo* var,
+ int *visual,
+ int *video_cmap_len,
+ int *mode) {
+ unsigned int mask;
+ unsigned int memlen;
+ unsigned int vramlen;
+
+ switch (var->bits_per_pixel) {
+ case 16: mask = 0x1F;
+ break;
+ case 32: mask = 0x0F;
+ break;
+ default: return -EINVAL;
+ }
+ vramlen = m2info->video.len_usable;
+ if (var->yres_virtual < var->yres)
+ var->yres_virtual = var->yres;
+ if (var->xres_virtual < var->xres)
+ var->xres_virtual = var->xres;
+ var->xres_virtual = (var->xres_virtual + mask) & ~mask;
+ if (var->yres_virtual > 32767)
+ return -EINVAL;
+ memlen = var->xres_virtual * var->yres_virtual * (var->bits_per_pixel >> 3);
+ if (memlen > vramlen)
+ return -EINVAL;
+ if (var->xoffset + var->xres > var->xres_virtual)
+ var->xoffset = var->xres_virtual - var->xres;
+ if (var->yoffset + var->yres > var->yres_virtual)
+ var->yoffset = var->yres_virtual - var->yres;
+
+ var->xres &= ~7;
+ var->left_margin &= ~7;
+ var->right_margin &= ~7;
+ var->hsync_len &= ~7;
+
+ *mode = var->bits_per_pixel;
+ if (var->bits_per_pixel == 16) {
+ if (var->green.length == 5) {
+ var->red.offset = 10;
+ var->red.length = 5;
+ var->green.offset = 5;
+ var->green.length = 5;
+ var->blue.offset = 0;
+ var->blue.length = 5;
+ var->transp.offset = 15;
+ var->transp.length = 1;
+ *mode = 15;
+ } else {
+ var->red.offset = 11;
+ var->red.length = 5;
+ var->green.offset = 5;
+ var->green.length = 6;
+ var->blue.offset = 0;
+ var->blue.length = 5;
+ var->transp.offset = 0;
+ var->transp.length = 0;
+ }
+ } else {
+ var->red.offset = 16;
+ var->red.length = 8;
+ var->green.offset = 8;
+ var->green.length = 8;
+ var->blue.offset = 0;
+ var->blue.length = 8;
+ var->transp.offset = 24;
+ var->transp.length = 8;
+ }
+ *visual = FB_VISUAL_TRUECOLOR;
+ *video_cmap_len = 16;
+ return 0;
+}
+
+static int matroxfb_dh_open(struct fb_info* info, int user) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+ MINFO_FROM(m2info->primary_dev);
+
+ if (MINFO) {
+ int err;
+
+ if (ACCESS_FBINFO(dead)) {
+ return -ENXIO;
+ }
+ err = ACCESS_FBINFO(fbops).fb_open(&ACCESS_FBINFO(fbcon), user);
+ if (err) {
+ return err;
+ }
+ }
+ return 0;
+#undef m2info
+}
+
+static int matroxfb_dh_release(struct fb_info* info, int user) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+ int err = 0;
+ MINFO_FROM(m2info->primary_dev);
+
+ if (MINFO) {
+ err = ACCESS_FBINFO(fbops).fb_release(&ACCESS_FBINFO(fbcon), user);
+ }
+ return err;
+#undef m2info
+}
+
+static void matroxfb_dh_init_fix(struct matroxfb_dh_fb_info *m2info) {
+ struct fb_fix_screeninfo *fix = &m2info->fbcon.fix;
+
+ strcpy(fix->id, "MATROX DH");
+
+ fix->smem_start = m2info->video.base;
+ fix->smem_len = m2info->video.len_usable;
+ fix->ypanstep = 1;
+ fix->ywrapstep = 0;
+ fix->xpanstep = 8; /* TBD */
+ fix->mmio_start = m2info->mmio.base;
+ fix->mmio_len = m2info->mmio.len;
+ fix->accel = 0; /* no accel... */
+}
+
+static int matroxfb_dh_check_var(struct fb_var_screeninfo* var, struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+ int visual;
+ int cmap_len;
+ int mode;
+
+ return matroxfb_dh_decode_var(m2info, var, &visual, &cmap_len, &mode);
+#undef m2info
+}
+
+static int matroxfb_dh_set_par(struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+ int visual;
+ int cmap_len;
+ int mode;
+ int err;
+ struct fb_var_screeninfo* var = &info->var;
+ MINFO_FROM(m2info->primary_dev);
+
+ if ((err = matroxfb_dh_decode_var(m2info, var, &visual, &cmap_len, &mode)) != 0)
+ return err;
+ /* cmap */
+ {
+ m2info->fbcon.screen_base = vaddr_va(m2info->video.vbase);
+ m2info->fbcon.fix.visual = visual;
+ m2info->fbcon.fix.type = FB_TYPE_PACKED_PIXELS;
+ m2info->fbcon.fix.type_aux = 0;
+ m2info->fbcon.fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
+ }
+ {
+ struct my_timming mt;
+ unsigned int pos;
+ int out;
+ int cnt;
+
+ matroxfb_var2my(&m2info->fbcon.var, &mt);
+ mt.crtc = MATROXFB_SRC_CRTC2;
+ /* CRTC2 delay */
+ mt.delay = 34;
+
+ pos = (m2info->fbcon.var.yoffset * m2info->fbcon.var.xres_virtual + m2info->fbcon.var.xoffset) * m2info->fbcon.var.bits_per_pixel >> 3;
+ pos += m2info->video.offbase;
+ cnt = 0;
+ down_read(&ACCESS_FBINFO(altout).lock);
+ for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+ if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+ cnt++;
+ if (ACCESS_FBINFO(outputs[out]).output->compute) {
+ ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+ }
+ }
+ }
+ ACCESS_FBINFO(crtc2).pixclock = mt.pixclock;
+ ACCESS_FBINFO(crtc2).mnp = mt.mnp;
+ up_read(&ACCESS_FBINFO(altout).lock);
+ if (cnt) {
+ matroxfb_dh_restore(m2info, &mt, mode, pos);
+ } else {
+ matroxfb_dh_disable(m2info);
+ }
+ DAC1064_global_init(PMINFO2);
+ DAC1064_global_restore(PMINFO2);
+ down_read(&ACCESS_FBINFO(altout).lock);
+ for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+ if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
+ ACCESS_FBINFO(outputs[out]).output->program) {
+ ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+ }
+ }
+ for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+ if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
+ ACCESS_FBINFO(outputs[out]).output->start) {
+ ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+ }
+ }
+ up_read(&ACCESS_FBINFO(altout).lock);
+ matroxfb_dh_cfbX_init(m2info);
+ }
+ m2info->initialized = 1;
+ return 0;
+#undef m2info
+}
+
+static int matroxfb_dh_pan_display(struct fb_var_screeninfo* var, struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+ matroxfb_dh_pan_var(m2info, var);
+ return 0;
+#undef m2info
+}
+
+static int matroxfb_dh_get_vblank(const struct matroxfb_dh_fb_info* m2info, struct fb_vblank* vblank) {
+ MINFO_FROM(m2info->primary_dev);
+
+ matroxfb_enable_irq(PMINFO 0);
+ memset(vblank, 0, sizeof(*vblank));
+ vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VBLANK;
+ /* mask out reserved bits + field number (odd/even) */
+ vblank->vcount = mga_inl(0x3C48) & 0x000007FF;
+ /* compatibility stuff */
+ if (vblank->vcount >= m2info->fbcon.var.yres)
+ vblank->flags |= FB_VBLANK_VBLANKING;
+ if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+ vblank->flags |= FB_VBLANK_HAVE_COUNT;
+ /* Only one writer, aligned int value...
+ it should work without lock and without atomic_t */
+ vblank->count = ACCESS_FBINFO(crtc2).vsync.cnt;
+ }
+ return 0;
+}
+
+static int matroxfb_dh_ioctl(struct inode* inode,
+ struct file* file,
+ unsigned int cmd,
+ unsigned long arg,
+ struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+ MINFO_FROM(m2info->primary_dev);
+
+ DBG(__FUNCTION__)
+
+ switch (cmd) {
+ case FBIOGET_VBLANK:
+ {
+ struct fb_vblank vblank;
+ int err;
+
+ err = matroxfb_dh_get_vblank(m2info, &vblank);
+ if (err)
+ return err;
+ if (copy_to_user((void __user *)arg, &vblank, sizeof(vblank)))
+ return -EFAULT;
+ return 0;
+ }
+ case FBIO_WAITFORVSYNC:
+ {
+ u_int32_t crt;
+
+ if (get_user(crt, (u_int32_t __user *)arg))
+ return -EFAULT;
+
+ if (crt != 0)
+ return -ENODEV;
+ return matroxfb_wait_for_sync(PMINFO 1);
+ }
+ case MATROXFB_SET_OUTPUT_MODE:
+ case MATROXFB_GET_OUTPUT_MODE:
+ case MATROXFB_GET_ALL_OUTPUTS:
+ {
+ return ACCESS_FBINFO(fbcon.fbops)->fb_ioctl(inode, file, cmd, arg, &ACCESS_FBINFO(fbcon));
+ }
+ case MATROXFB_SET_OUTPUT_CONNECTION:
+ {
+ u_int32_t tmp;
+ int out;
+ int changes;
+
+ if (get_user(tmp, (u_int32_t __user *)arg))
+ return -EFAULT;
+ for (out = 0; out < 32; out++) {
+ if (tmp & (1 << out)) {
+ if (out >= MATROXFB_MAX_OUTPUTS)
+ return -ENXIO;
+ if (!ACCESS_FBINFO(outputs[out]).output)
+ return -ENXIO;
+ switch (ACCESS_FBINFO(outputs[out]).src) {
+ case MATROXFB_SRC_NONE:
+ case MATROXFB_SRC_CRTC2:
+ break;
+ default:
+ return -EBUSY;
+ }
+ }
+ }
+ if (ACCESS_FBINFO(devflags.panellink)) {
+ if (tmp & MATROXFB_OUTPUT_CONN_DFP)
+ return -EINVAL;
+ if ((ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) && tmp)
+ return -EBUSY;
+ }
+ changes = 0;
+ for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+ if (tmp & (1 << out)) {
+ if (ACCESS_FBINFO(outputs[out]).src != MATROXFB_SRC_CRTC2) {
+ changes = 1;
+ ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_CRTC2;
+ }
+ } else if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+ changes = 1;
+ ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_NONE;
+ }
+ }
+ if (!changes)
+ return 0;
+ matroxfb_dh_set_par(info);
+ return 0;
+ }
+ case MATROXFB_GET_OUTPUT_CONNECTION:
+ {
+ u_int32_t conn = 0;
+ int out;
+
+ for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+ if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+ conn |= 1 << out;
+ }
+ }
+ if (put_user(conn, (u_int32_t __user *)arg))
+ return -EFAULT;
+ return 0;
+ }
+ case MATROXFB_GET_AVAILABLE_OUTPUTS:
+ {
+ u_int32_t tmp = 0;
+ int out;
+
+ for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+ if (ACCESS_FBINFO(outputs[out]).output) {
+ switch (ACCESS_FBINFO(outputs[out]).src) {
+ case MATROXFB_SRC_NONE:
+ case MATROXFB_SRC_CRTC2:
+ tmp |= 1 << out;
+ break;
+ }
+ }
+ }
+ if (ACCESS_FBINFO(devflags.panellink)) {
+ tmp &= ~MATROXFB_OUTPUT_CONN_DFP;
+ if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) {
+ tmp = 0;
+ }
+ }
+ if (put_user(tmp, (u_int32_t __user *)arg))
+ return -EFAULT;
+ return 0;
+ }
+ }
+ return -ENOTTY;
+#undef m2info
+}
+
+static int matroxfb_dh_blank(int blank, struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+ switch (blank) {
+ case 1:
+ case 2:
+ case 3:
+ case 4:
+ default:;
+ }
+ /* do something... */
+ return 0;
+#undef m2info
+}
+
+static struct fb_ops matroxfb_dh_ops = {
+ .owner = THIS_MODULE,
+ .fb_open = matroxfb_dh_open,
+ .fb_release = matroxfb_dh_release,
+ .fb_check_var = matroxfb_dh_check_var,
+ .fb_set_par = matroxfb_dh_set_par,
+ .fb_setcolreg = matroxfb_dh_setcolreg,
+ .fb_pan_display =matroxfb_dh_pan_display,
+ .fb_blank = matroxfb_dh_blank,
+ .fb_ioctl = matroxfb_dh_ioctl,
+ .fb_fillrect = cfb_fillrect,
+ .fb_copyarea = cfb_copyarea,
+ .fb_imageblit = cfb_imageblit,
+ .fb_cursor = soft_cursor,
+};
+
+static struct fb_var_screeninfo matroxfb_dh_defined = {
+ 640,480,640,480,/* W,H, virtual W,H */
+ 0,0, /* offset */
+ 32, /* depth */
+ 0, /* gray */
+ {0,0,0}, /* R */
+ {0,0,0}, /* G */
+ {0,0,0}, /* B */
+ {0,0,0}, /* alpha */
+ 0, /* nonstd */
+ FB_ACTIVATE_NOW,
+ -1,-1, /* display size */
+ 0, /* accel flags */
+ 39721L,48L,16L,33L,10L,
+ 96L,2,0, /* no sync info */
+ FB_VMODE_NONINTERLACED,
+ 0, {0,0,0,0,0}
+};
+
+static int matroxfb_dh_regit(CPMINFO struct matroxfb_dh_fb_info* m2info) {
+#define minfo (m2info->primary_dev)
+ void* oldcrtc2;
+
+ m2info->fbcon.fbops = &matroxfb_dh_ops;
+ m2info->fbcon.flags = FBINFO_FLAG_DEFAULT;
+ m2info->fbcon.flags |= FBINFO_HWACCEL_XPAN |
+ FBINFO_HWACCEL_YPAN;
+ m2info->fbcon.pseudo_palette = m2info->cmap;
+ fb_alloc_cmap(&m2info->fbcon.cmap, 256, 1);
+
+ if (mem < 64)
+ mem *= 1024;
+ if (mem < 64*1024)
+ mem *= 1024;
+ mem &= ~0x00000FFF; /* PAGE_MASK? */
+ if (ACCESS_FBINFO(video.len_usable) + mem <= ACCESS_FBINFO(video.len))
+ m2info->video.offbase = ACCESS_FBINFO(video.len) - mem;
+ else if (ACCESS_FBINFO(video.len) < mem) {
+ return -ENOMEM;
+ } else { /* check yres on first head... */
+ m2info->video.borrowed = mem;
+ ACCESS_FBINFO(video.len_usable) -= mem;
+ m2info->video.offbase = ACCESS_FBINFO(video.len_usable);
+ }
+ m2info->video.base = ACCESS_FBINFO(video.base) + m2info->video.offbase;
+ m2info->video.len = m2info->video.len_usable = m2info->video.len_maximum = mem;
+ m2info->video.vbase.vaddr = vaddr_va(ACCESS_FBINFO(video.vbase)) + m2info->video.offbase;
+ m2info->mmio.base = ACCESS_FBINFO(mmio.base);
+ m2info->mmio.vbase = ACCESS_FBINFO(mmio.vbase);
+ m2info->mmio.len = ACCESS_FBINFO(mmio.len);
+
+ matroxfb_dh_init_fix(m2info);
+ if (register_framebuffer(&m2info->fbcon)) {
+ return -ENXIO;
+ }
+ if (!m2info->initialized)
+ fb_set_var(&m2info->fbcon, &matroxfb_dh_defined);
+ down_write(&ACCESS_FBINFO(crtc2.lock));
+ oldcrtc2 = ACCESS_FBINFO(crtc2.info);
+ ACCESS_FBINFO(crtc2.info) = m2info;
+ up_write(&ACCESS_FBINFO(crtc2.lock));
+ if (oldcrtc2) {
+ printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 already present: %p\n",
+ oldcrtc2);
+ }
+ return 0;
+#undef minfo
+}
+
+/* ************************** */
+
+static int matroxfb_dh_registerfb(struct matroxfb_dh_fb_info* m2info) {
+#define minfo (m2info->primary_dev)
+ if (matroxfb_dh_regit(PMINFO m2info)) {
+ printk(KERN_ERR "matroxfb_crtc2: secondary head failed to register\n");
+ return -1;
+ }
+ printk(KERN_INFO "matroxfb_crtc2: secondary head of fb%u was registered as fb%u\n",
+ ACCESS_FBINFO(fbcon.node), m2info->fbcon.node);
+ m2info->fbcon_registered = 1;
+ return 0;
+#undef minfo
+}
+
+static void matroxfb_dh_deregisterfb(struct matroxfb_dh_fb_info* m2info) {
+#define minfo (m2info->primary_dev)
+ if (m2info->fbcon_registered) {
+ int id;
+ struct matroxfb_dh_fb_info* crtc2;
+
+ down_write(&ACCESS_FBINFO(crtc2.lock));
+ crtc2 = ACCESS_FBINFO(crtc2.info);
+ if (crtc2 == m2info)
+ ACCESS_FBINFO(crtc2.info) = NULL;
+ up_write(&ACCESS_FBINFO(crtc2.lock));
+ if (crtc2 != m2info) {
+ printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 mismatch at unload: %p != %p\n",
+ crtc2, m2info);
+ printk(KERN_ERR "matroxfb_crtc2: Expect kernel crash after module unload.\n");
+ return;
+ }
+ id = m2info->fbcon.node;
+ unregister_framebuffer(&m2info->fbcon);
+ /* return memory back to primary head */
+ ACCESS_FBINFO(video.len_usable) += m2info->video.borrowed;
+ printk(KERN_INFO "matroxfb_crtc2: fb%u unregistered\n", id);
+ m2info->fbcon_registered = 0;
+ }
+#undef minfo
+}
+
+static void* matroxfb_crtc2_probe(struct matrox_fb_info* minfo) {
+ struct matroxfb_dh_fb_info* m2info;
+
+ /* hardware is CRTC2 incapable... */
+ if (!ACCESS_FBINFO(devflags.crtc2))
+ return NULL;
+ m2info = (struct matroxfb_dh_fb_info*)kmalloc(sizeof(*m2info), GFP_KERNEL);
+ if (!m2info) {
+ printk(KERN_ERR "matroxfb_crtc2: Not enough memory for CRTC2 control structs\n");
+ return NULL;
+ }
+ memset(m2info, 0, sizeof(*m2info));
+ m2info->primary_dev = MINFO;
+ if (matroxfb_dh_registerfb(m2info)) {
+ kfree(m2info);
+ printk(KERN_ERR "matroxfb_crtc2: CRTC2 framebuffer failed to register\n");
+ return NULL;
+ }
+ return m2info;
+}
+
+static void matroxfb_crtc2_remove(struct matrox_fb_info* minfo, void* crtc2) {
+ matroxfb_dh_deregisterfb(crtc2);
+ kfree(crtc2);
+}
+
+static struct matroxfb_driver crtc2 = {
+ .name = "Matrox G400 CRTC2",
+ .probe = matroxfb_crtc2_probe,
+ .remove = matroxfb_crtc2_remove };
+
+static int matroxfb_crtc2_init(void) {
+ if (fb_get_options("matrox_crtc2fb", NULL))
+ return -ENODEV;
+
+ matroxfb_register_driver(&crtc2);
+ return 0;
+}
+
+static void matroxfb_crtc2_exit(void) {
+ matroxfb_unregister_driver(&crtc2);
+}
+
+MODULE_AUTHOR("(c) 1999-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Matrox G400 CRTC2 driver");
+MODULE_LICENSE("GPL");
+module_init(matroxfb_crtc2_init);
+module_exit(matroxfb_crtc2_exit);
+/* we do not have __setup() yet */
diff --git a/drivers/video/matrox/matroxfb_crtc2.h b/drivers/video/matrox/matroxfb_crtc2.h
new file mode 100644
index 0000000..608e40b
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_crtc2.h
@@ -0,0 +1,36 @@
+#ifndef __MATROXFB_CRTC2_H__
+#define __MATROXFB_CRTC2_H__
+
+#include <linux/ioctl.h>
+#include <linux/i2c.h>
+#include <linux/i2c-algo-bit.h>
+#include "matroxfb_base.h"
+
+struct matroxfb_dh_fb_info {
+ struct fb_info fbcon;
+ int fbcon_registered;
+ int initialized;
+
+ struct matrox_fb_info* primary_dev;
+
+ struct {
+ unsigned long base; /* physical */
+ vaddr_t vbase; /* virtual */
+ unsigned int len;
+ unsigned int len_usable;
+ unsigned int len_maximum;
+ unsigned int offbase;
+ unsigned int borrowed;
+ } video;
+ struct {
+ unsigned long base;
+ vaddr_t vbase;
+ unsigned int len;
+ } mmio;
+
+ unsigned int interlaced:1;
+
+ u_int32_t cmap[17];
+};
+
+#endif /* __MATROXFB_CRTC2_H__ */
diff --git a/drivers/video/matrox/matroxfb_g450.c b/drivers/video/matrox/matroxfb_g450.c
new file mode 100644
index 0000000..35008af
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_g450.c
@@ -0,0 +1,626 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * See matroxfb_base.c for contributors.
+ *
+ */
+
+#include "matroxfb_base.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_DAC1064.h"
+#include "g450_pll.h"
+#include <linux/matroxfb.h>
+#include <asm/uaccess.h>
+#include <asm/div64.h>
+
+/* Definition of the various controls */
+struct mctl {
+ struct v4l2_queryctrl desc;
+ size_t control;
+};
+
+#define BLMIN 0xF3
+#define WLMAX 0x3FF
+
+static const struct mctl g450_controls[] =
+{ { { V4L2_CID_BRIGHTNESS, V4L2_CTRL_TYPE_INTEGER,
+ "brightness",
+ 0, WLMAX-BLMIN, 1, 370-BLMIN,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.brightness) },
+ { { V4L2_CID_CONTRAST, V4L2_CTRL_TYPE_INTEGER,
+ "contrast",
+ 0, 1023, 1, 127,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.contrast) },
+ { { V4L2_CID_SATURATION, V4L2_CTRL_TYPE_INTEGER,
+ "saturation",
+ 0, 255, 1, 165,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.saturation) },
+ { { V4L2_CID_HUE, V4L2_CTRL_TYPE_INTEGER,
+ "hue",
+ 0, 255, 1, 0,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.hue) },
+ { { MATROXFB_CID_TESTOUT, V4L2_CTRL_TYPE_BOOLEAN,
+ "test output",
+ 0, 1, 1, 0,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.testout) },
+};
+
+#define G450CTRLS (sizeof(g450_controls)/sizeof(g450_controls[0]))
+
+/* Return: positive number: id found
+ -EINVAL: id not found, return failure
+ -ENOENT: id not found, create fake disabled control */
+static int get_ctrl_id(__u32 v4l2_id) {
+ int i;
+
+ for (i = 0; i < G450CTRLS; i++) {
+ if (v4l2_id < g450_controls[i].desc.id) {
+ if (g450_controls[i].desc.id == 0x08000000) {
+ return -EINVAL;
+ }
+ return -ENOENT;
+ }
+ if (v4l2_id == g450_controls[i].desc.id) {
+ return i;
+ }
+ }
+ return -EINVAL;
+}
+
+static inline int* get_ctrl_ptr(WPMINFO unsigned int idx) {
+ return (int*)((char*)MINFO + g450_controls[idx].control);
+}
+
+static void tvo_fill_defaults(WPMINFO2) {
+ unsigned int i;
+
+ for (i = 0; i < G450CTRLS; i++) {
+ *get_ctrl_ptr(PMINFO i) = g450_controls[i].desc.default_value;
+ }
+}
+
+static int cve2_get_reg(WPMINFO int reg) {
+ unsigned long flags;
+ int val;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ matroxfb_DAC_out(PMINFO 0x87, reg);
+ val = matroxfb_DAC_in(PMINFO 0x88);
+ matroxfb_DAC_unlock_irqrestore(flags);
+ return val;
+}
+
+static void cve2_set_reg(WPMINFO int reg, int val) {
+ unsigned long flags;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ matroxfb_DAC_out(PMINFO 0x87, reg);
+ matroxfb_DAC_out(PMINFO 0x88, val);
+ matroxfb_DAC_unlock_irqrestore(flags);
+}
+
+static void cve2_set_reg10(WPMINFO int reg, int val) {
+ unsigned long flags;
+
+ matroxfb_DAC_lock_irqsave(flags);
+ matroxfb_DAC_out(PMINFO 0x87, reg);
+ matroxfb_DAC_out(PMINFO 0x88, val >> 2);
+ matroxfb_DAC_out(PMINFO 0x87, reg + 1);
+ matroxfb_DAC_out(PMINFO 0x88, val & 3);
+ matroxfb_DAC_unlock_irqrestore(flags);
+}
+
+static void g450_compute_bwlevel(CPMINFO int *bl, int *wl) {
+ const int b = ACCESS_FBINFO(altout.tvo_params.brightness) + BLMIN;
+ const int c = ACCESS_FBINFO(altout.tvo_params.contrast);
+
+ *bl = max(b - c, BLMIN);
+ *wl = min(b + c, WLMAX);
+}
+
+static int g450_query_ctrl(void* md, struct v4l2_queryctrl *p) {
+ int i;
+
+ i = get_ctrl_id(p->id);
+ if (i >= 0) {
+ *p = g450_controls[i].desc;
+ return 0;
+ }
+ if (i == -ENOENT) {
+ static const struct v4l2_queryctrl disctrl =
+ { .flags = V4L2_CTRL_FLAG_DISABLED };
+
+ i = p->id;
+ *p = disctrl;
+ p->id = i;
+ sprintf(p->name, "Ctrl #%08X", i);
+ return 0;
+ }
+ return -EINVAL;
+}
+
+static int g450_set_ctrl(void* md, struct v4l2_control *p) {
+ int i;
+ MINFO_FROM(md);
+
+ i = get_ctrl_id(p->id);
+ if (i < 0) return -EINVAL;
+
+ /*
+ * Check if changed.
+ */
+ if (p->value == *get_ctrl_ptr(PMINFO i)) return 0;
+
+ /*
+ * Check limits.
+ */
+ if (p->value > g450_controls[i].desc.maximum) return -EINVAL;
+ if (p->value < g450_controls[i].desc.minimum) return -EINVAL;
+
+ /*
+ * Store new value.
+ */
+ *get_ctrl_ptr(PMINFO i) = p->value;
+
+ switch (p->id) {
+ case V4L2_CID_BRIGHTNESS:
+ case V4L2_CID_CONTRAST:
+ {
+ int blacklevel, whitelevel;
+ g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
+ cve2_set_reg10(PMINFO 0x0e, blacklevel);
+ cve2_set_reg10(PMINFO 0x1e, whitelevel);
+ }
+ break;
+ case V4L2_CID_SATURATION:
+ cve2_set_reg(PMINFO 0x20, p->value);
+ cve2_set_reg(PMINFO 0x22, p->value);
+ break;
+ case V4L2_CID_HUE:
+ cve2_set_reg(PMINFO 0x25, p->value);
+ break;
+ case MATROXFB_CID_TESTOUT:
+ {
+ unsigned char val = cve2_get_reg (PMINFO 0x05);
+ if (p->value) val |= 0x02;
+ else val &= ~0x02;
+ cve2_set_reg(PMINFO 0x05, val);
+ }
+ break;
+ }
+
+
+ return 0;
+}
+
+static int g450_get_ctrl(void* md, struct v4l2_control *p) {
+ int i;
+ MINFO_FROM(md);
+
+ i = get_ctrl_id(p->id);
+ if (i < 0) return -EINVAL;
+ p->value = *get_ctrl_ptr(PMINFO i);
+ return 0;
+}
+
+struct output_desc {
+ unsigned int h_vis;
+ unsigned int h_f_porch;
+ unsigned int h_sync;
+ unsigned int h_b_porch;
+ unsigned long long int chromasc;
+ unsigned int burst;
+ unsigned int v_total;
+};
+
+static void computeRegs(WPMINFO struct mavenregs* r, struct my_timming* mt, const struct output_desc* outd) {
+ u_int32_t chromasc;
+ u_int32_t hlen;
+ u_int32_t hsl;
+ u_int32_t hbp;
+ u_int32_t hfp;
+ u_int32_t hvis;
+ unsigned int pixclock;
+ unsigned long long piic;
+ int mnp;
+ int over;
+
+ r->regs[0x80] = 0x03; /* | 0x40 for SCART */
+
+ hvis = ((mt->HDisplay << 1) + 3) & ~3;
+
+ if (hvis >= 2048) {
+ hvis = 2044;
+ }
+
+ piic = 1000000000ULL * hvis;
+ do_div(piic, outd->h_vis);
+
+ dprintk(KERN_DEBUG "Want %u kHz pixclock\n", (unsigned int)piic);
+
+ mnp = matroxfb_g450_setclk(PMINFO piic, M_VIDEO_PLL);
+
+ mt->mnp = mnp;
+ mt->pixclock = g450_mnp2f(PMINFO mnp);
+
+ dprintk(KERN_DEBUG "MNP=%08X\n", mnp);
+
+ pixclock = 1000000000U / mt->pixclock;
+
+ dprintk(KERN_DEBUG "Got %u ps pixclock\n", pixclock);
+
+ piic = outd->chromasc;
+ do_div(piic, mt->pixclock);
+ chromasc = piic;
+
+ dprintk(KERN_DEBUG "Chroma is %08X\n", chromasc);
+
+ r->regs[0] = piic >> 24;
+ r->regs[1] = piic >> 16;
+ r->regs[2] = piic >> 8;
+ r->regs[3] = piic >> 0;
+ hbp = (((outd->h_b_porch + pixclock) / pixclock)) & ~1;
+ hfp = (((outd->h_f_porch + pixclock) / pixclock)) & ~1;
+ hsl = (((outd->h_sync + pixclock) / pixclock)) & ~1;
+ hlen = hvis + hfp + hsl + hbp;
+ over = hlen & 0x0F;
+
+ dprintk(KERN_DEBUG "WL: vis=%u, hf=%u, hs=%u, hb=%u, total=%u\n", hvis, hfp, hsl, hbp, hlen);
+
+ if (over) {
+ hfp -= over;
+ hlen -= over;
+ if (over <= 2) {
+ } else if (over < 10) {
+ hfp += 4;
+ hlen += 4;
+ } else {
+ hfp += 16;
+ hlen += 16;
+ }
+ }
+
+ /* maybe cve2 has requirement 800 < hlen < 1184 */
+ r->regs[0x08] = hsl;
+ r->regs[0x09] = (outd->burst + pixclock - 1) / pixclock; /* burst length */
+ r->regs[0x0A] = hbp;
+ r->regs[0x2C] = hfp;
+ r->regs[0x31] = hvis / 8;
+ r->regs[0x32] = hvis & 7;
+
+ dprintk(KERN_DEBUG "PG: vis=%04X, hf=%02X, hs=%02X, hb=%02X, total=%04X\n", hvis, hfp, hsl, hbp, hlen);
+
+ r->regs[0x84] = 1; /* x sync point */
+ r->regs[0x85] = 0;
+ hvis = hvis >> 1;
+ hlen = hlen >> 1;
+
+ dprintk(KERN_DEBUG "hlen=%u hvis=%u\n", hlen, hvis);
+
+ mt->interlaced = 1;
+
+ mt->HDisplay = hvis & ~7;
+ mt->HSyncStart = mt->HDisplay + 8;
+ mt->HSyncEnd = (hlen & ~7) - 8;
+ mt->HTotal = hlen;
+
+ {
+ int upper;
+ unsigned int vtotal;
+ unsigned int vsyncend;
+ unsigned int vdisplay;
+
+ vtotal = mt->VTotal;
+ vsyncend = mt->VSyncEnd;
+ vdisplay = mt->VDisplay;
+ if (vtotal < outd->v_total) {
+ unsigned int yovr = outd->v_total - vtotal;
+
+ vsyncend += yovr >> 1;
+ } else if (vtotal > outd->v_total) {
+ vdisplay = outd->v_total - 4;
+ vsyncend = outd->v_total;
+ }
+ upper = (outd->v_total - vsyncend) >> 1; /* in field lines */
+ r->regs[0x17] = outd->v_total / 4;
+ r->regs[0x18] = outd->v_total & 3;
+ r->regs[0x33] = upper - 1; /* upper blanking */
+ r->regs[0x82] = upper; /* y sync point */
+ r->regs[0x83] = upper >> 8;
+
+ mt->VDisplay = vdisplay;
+ mt->VSyncStart = outd->v_total - 2;
+ mt->VSyncEnd = outd->v_total;
+ mt->VTotal = outd->v_total;
+ }
+}
+
+static void cve2_init_TVdata(int norm, struct mavenregs* data, const struct output_desc** outd) {
+ static const struct output_desc paloutd = {
+ .h_vis = 52148148, // ps
+ .h_f_porch = 1407407, // ps
+ .h_sync = 4666667, // ps
+ .h_b_porch = 5777778, // ps
+ .chromasc = 19042247534182ULL, // 4433618.750 Hz
+ .burst = 2518518, // ps
+ .v_total = 625,
+ };
+ static const struct output_desc ntscoutd = {
+ .h_vis = 52888889, // ps
+ .h_f_porch = 1333333, // ps
+ .h_sync = 4666667, // ps
+ .h_b_porch = 4666667, // ps
+ .chromasc = 15374030659475ULL, // 3579545.454 Hz
+ .burst = 2418418, // ps
+ .v_total = 525, // lines
+ };
+
+ static const struct mavenregs palregs = { {
+ 0x2A, 0x09, 0x8A, 0xCB, /* 00: chroma subcarrier */
+ 0x00,
+ 0x00, /* test */
+ 0xF9, /* modified by code (F9 written...) */
+ 0x00, /* ? not written */
+ 0x7E, /* 08 */
+ 0x44, /* 09 */
+ 0x9C, /* 0A */
+ 0x2E, /* 0B */
+ 0x21, /* 0C */
+ 0x00, /* ? not written */
+// 0x3F, 0x03, /* 0E-0F */
+ 0x3C, 0x03,
+ 0x3C, 0x03, /* 10-11 */
+ 0x1A, /* 12 */
+ 0x2A, /* 13 */
+ 0x1C, 0x3D, 0x14, /* 14-16 */
+ 0x9C, 0x01, /* 17-18 */
+ 0x00, /* 19 */
+ 0xFE, /* 1A */
+ 0x7E, /* 1B */
+ 0x60, /* 1C */
+ 0x05, /* 1D */
+// 0x89, 0x03, /* 1E-1F */
+ 0xAD, 0x03,
+// 0x72, /* 20 */
+ 0xA5,
+ 0x07, /* 21 */
+// 0x72, /* 22 */
+ 0xA5,
+ 0x00, /* 23 */
+ 0x00, /* 24 */
+ 0x00, /* 25 */
+ 0x08, /* 26 */
+ 0x04, /* 27 */
+ 0x00, /* 28 */
+ 0x1A, /* 29 */
+ 0x55, 0x01, /* 2A-2B */
+ 0x26, /* 2C */
+ 0x07, 0x7E, /* 2D-2E */
+ 0x02, 0x54, /* 2F-30 */
+ 0xB0, 0x00, /* 31-32 */
+ 0x14, /* 33 */
+ 0x49, /* 34 */
+ 0x00, /* 35 written multiple times */
+ 0x00, /* 36 not written */
+ 0xA3, /* 37 */
+ 0xC8, /* 38 */
+ 0x22, /* 39 */
+ 0x02, /* 3A */
+ 0x22, /* 3B */
+ 0x3F, 0x03, /* 3C-3D */
+ 0x00, /* 3E written multiple times */
+ 0x00, /* 3F not written */
+ } };
+ static struct mavenregs ntscregs = { {
+ 0x21, 0xF0, 0x7C, 0x1F, /* 00: chroma subcarrier */
+ 0x00,
+ 0x00, /* test */
+ 0xF9, /* modified by code (F9 written...) */
+ 0x00, /* ? not written */
+ 0x7E, /* 08 */
+ 0x43, /* 09 */
+ 0x7E, /* 0A */
+ 0x3D, /* 0B */
+ 0x00, /* 0C */
+ 0x00, /* ? not written */
+ 0x41, 0x00, /* 0E-0F */
+ 0x3C, 0x00, /* 10-11 */
+ 0x17, /* 12 */
+ 0x21, /* 13 */
+ 0x1B, 0x1B, 0x24, /* 14-16 */
+ 0x83, 0x01, /* 17-18 */
+ 0x00, /* 19 */
+ 0x0F, /* 1A */
+ 0x0F, /* 1B */
+ 0x60, /* 1C */
+ 0x05, /* 1D */
+ //0x89, 0x02, /* 1E-1F */
+ 0xC0, 0x02, /* 1E-1F */
+ //0x5F, /* 20 */
+ 0x9C, /* 20 */
+ 0x04, /* 21 */
+ //0x5F, /* 22 */
+ 0x9C, /* 22 */
+ 0x01, /* 23 */
+ 0x02, /* 24 */
+ 0x00, /* 25 */
+ 0x0A, /* 26 */
+ 0x05, /* 27 */
+ 0x00, /* 28 */
+ 0x10, /* 29 */
+ 0xFF, 0x03, /* 2A-2B */
+ 0x24, /* 2C */
+ 0x0F, 0x78, /* 2D-2E */
+ 0x00, 0x00, /* 2F-30 */
+ 0xB2, 0x04, /* 31-32 */
+ 0x14, /* 33 */
+ 0x02, /* 34 */
+ 0x00, /* 35 written multiple times */
+ 0x00, /* 36 not written */
+ 0xA3, /* 37 */
+ 0xC8, /* 38 */
+ 0x15, /* 39 */
+ 0x05, /* 3A */
+ 0x3B, /* 3B */
+ 0x3C, 0x00, /* 3C-3D */
+ 0x00, /* 3E written multiple times */
+ 0x00, /* never written */
+ } };
+
+ if (norm == MATROXFB_OUTPUT_MODE_PAL) {
+ *data = palregs;
+ *outd = &paloutd;
+ } else {
+ *data = ntscregs;
+ *outd = &ntscoutd;
+ }
+ return;
+}
+
+#define LR(x) cve2_set_reg(PMINFO (x), m->regs[(x)])
+static void cve2_init_TV(WPMINFO const struct mavenregs* m) {
+ int i;
+
+ LR(0x80);
+ LR(0x82); LR(0x83);
+ LR(0x84); LR(0x85);
+
+ cve2_set_reg(PMINFO 0x3E, 0x01);
+
+ for (i = 0; i < 0x3E; i++) {
+ LR(i);
+ }
+ cve2_set_reg(PMINFO 0x3E, 0x00);
+}
+
+static int matroxfb_g450_compute(void* md, struct my_timming* mt) {
+ MINFO_FROM(md);
+
+ dprintk(KERN_DEBUG "Computing, mode=%u\n", ACCESS_FBINFO(outputs[1]).mode);
+
+ if (mt->crtc == MATROXFB_SRC_CRTC2 &&
+ ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+ const struct output_desc* outd;
+
+ cve2_init_TVdata(ACCESS_FBINFO(outputs[1]).mode, &ACCESS_FBINFO(hw).maven, &outd);
+ {
+ int blacklevel, whitelevel;
+ g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
+ ACCESS_FBINFO(hw).maven.regs[0x0E] = blacklevel >> 2;
+ ACCESS_FBINFO(hw).maven.regs[0x0F] = blacklevel & 3;
+ ACCESS_FBINFO(hw).maven.regs[0x1E] = whitelevel >> 2;
+ ACCESS_FBINFO(hw).maven.regs[0x1F] = whitelevel & 3;
+
+ ACCESS_FBINFO(hw).maven.regs[0x20] =
+ ACCESS_FBINFO(hw).maven.regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+
+ ACCESS_FBINFO(hw).maven.regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+
+ if (ACCESS_FBINFO(altout.tvo_params.testout)) {
+ ACCESS_FBINFO(hw).maven.regs[0x05] |= 0x02;
+ }
+ }
+ computeRegs(PMINFO &ACCESS_FBINFO(hw).maven, mt, outd);
+ } else if (mt->mnp < 0) {
+ /* We must program clocks before CRTC2, otherwise interlaced mode
+ startup may fail */
+ mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+ mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+ }
+ dprintk(KERN_DEBUG "Pixclock = %u\n", mt->pixclock);
+ return 0;
+}
+
+static int matroxfb_g450_program(void* md) {
+ MINFO_FROM(md);
+
+ if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+ cve2_init_TV(PMINFO &ACCESS_FBINFO(hw).maven);
+ }
+ return 0;
+}
+
+static int matroxfb_g450_verify_mode(void* md, u_int32_t arg) {
+ switch (arg) {
+ case MATROXFB_OUTPUT_MODE_PAL:
+ case MATROXFB_OUTPUT_MODE_NTSC:
+ case MATROXFB_OUTPUT_MODE_MONITOR:
+ return 0;
+ }
+ return -EINVAL;
+}
+
+static int g450_dvi_compute(void* md, struct my_timming* mt) {
+ MINFO_FROM(md);
+
+ if (mt->mnp < 0) {
+ mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+ mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+ }
+ return 0;
+}
+
+static struct matrox_altout matroxfb_g450_altout = {
+ .name = "Secondary output",
+ .compute = matroxfb_g450_compute,
+ .program = matroxfb_g450_program,
+ .verifymode = matroxfb_g450_verify_mode,
+ .getqueryctrl = g450_query_ctrl,
+ .getctrl = g450_get_ctrl,
+ .setctrl = g450_set_ctrl,
+};
+
+static struct matrox_altout matroxfb_g450_dvi = {
+ .name = "DVI output",
+ .compute = g450_dvi_compute,
+};
+
+void matroxfb_g450_connect(WPMINFO2) {
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ down_write(&ACCESS_FBINFO(altout.lock));
+ tvo_fill_defaults(PMINFO2);
+ ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
+ ACCESS_FBINFO(outputs[1]).data = MINFO;
+ ACCESS_FBINFO(outputs[1]).output = &matroxfb_g450_altout;
+ ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
+ ACCESS_FBINFO(outputs[2]).data = MINFO;
+ ACCESS_FBINFO(outputs[2]).output = &matroxfb_g450_dvi;
+ ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ up_write(&ACCESS_FBINFO(altout.lock));
+ }
+}
+
+void matroxfb_g450_shutdown(WPMINFO2) {
+ if (ACCESS_FBINFO(devflags.g450dac)) {
+ down_write(&ACCESS_FBINFO(altout.lock));
+ ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
+ ACCESS_FBINFO(outputs[1]).output = NULL;
+ ACCESS_FBINFO(outputs[1]).data = NULL;
+ ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ ACCESS_FBINFO(outputs[2]).src = MATROXFB_SRC_NONE;
+ ACCESS_FBINFO(outputs[2]).output = NULL;
+ ACCESS_FBINFO(outputs[2]).data = NULL;
+ ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ up_write(&ACCESS_FBINFO(altout.lock));
+ }
+}
+
+EXPORT_SYMBOL(matroxfb_g450_connect);
+EXPORT_SYMBOL(matroxfb_g450_shutdown);
+
+MODULE_AUTHOR("(c) 2000-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Matrox G450/G550 output driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_g450.h b/drivers/video/matrox/matroxfb_g450.h
new file mode 100644
index 0000000..a0822a6
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_g450.h
@@ -0,0 +1,14 @@
+#ifndef __MATROXFB_G450_H__
+#define __MATROXFB_G450_H__
+
+#include "matroxfb_base.h"
+
+#ifdef CONFIG_FB_MATROX_G
+void matroxfb_g450_connect(WPMINFO2);
+void matroxfb_g450_shutdown(WPMINFO2);
+#else
+static inline void matroxfb_g450_connect(WPMINFO2) { };
+static inline void matroxfb_g450_shutdown(WPMINFO2) { };
+#endif
+
+#endif /* __MATROXFB_G450_H__ */
diff --git a/drivers/video/matrox/matroxfb_maven.c b/drivers/video/matrox/matroxfb_maven.c
new file mode 100644
index 0000000..e529841
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_maven.c
@@ -0,0 +1,1328 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * See matroxfb_base.c for contributors.
+ *
+ */
+
+#include "matroxfb_maven.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_DAC1064.h"
+#include <linux/i2c.h>
+#include <linux/matroxfb.h>
+#include <asm/div64.h>
+#include <asm/uaccess.h>
+
+#define MAVEN_I2CID (0x1B)
+
+#define MGATVO_B 1
+#define MGATVO_C 2
+
+static const struct maven_gamma {
+ unsigned char reg83;
+ unsigned char reg84;
+ unsigned char reg85;
+ unsigned char reg86;
+ unsigned char reg87;
+ unsigned char reg88;
+ unsigned char reg89;
+ unsigned char reg8a;
+ unsigned char reg8b;
+} maven_gamma[] = {
+ { 131, 57, 223, 15, 117, 212, 251, 91, 156},
+ { 133, 61, 128, 63, 180, 147, 195, 100, 180},
+ { 131, 19, 63, 31, 50, 66, 171, 64, 176},
+ { 0, 0, 0, 31, 16, 16, 16, 100, 200},
+ { 8, 23, 47, 73, 147, 244, 220, 80, 195},
+ { 22, 43, 64, 80, 147, 115, 58, 85, 168},
+ { 34, 60, 80, 214, 147, 212, 188, 85, 167},
+ { 45, 77, 96, 216, 147, 99, 91, 85, 159},
+ { 56, 76, 112, 107, 147, 212, 148, 64, 144},
+ { 65, 91, 128, 137, 147, 196, 17, 69, 148},
+ { 72, 104, 136, 138, 147, 180, 245, 73, 147},
+ { 87, 116, 143, 126, 16, 83, 229, 77, 144},
+ { 95, 119, 152, 254, 244, 83, 221, 77, 151},
+ { 100, 129, 159, 156, 244, 148, 197, 77, 160},
+ { 105, 141, 167, 247, 244, 132, 181, 84, 166},
+ { 105, 147, 168, 247, 244, 245, 181, 90, 170},
+ { 120, 153, 175, 248, 212, 229, 165, 90, 180},
+ { 119, 156, 176, 248, 244, 229, 84, 74, 160},
+ { 119, 158, 183, 248, 244, 229, 149, 78, 165}
+};
+
+/* Definition of the various controls */
+struct mctl {
+ struct v4l2_queryctrl desc;
+ size_t control;
+};
+
+#define BLMIN 0x0FF
+#define WLMAX 0x3FF
+
+static const struct mctl maven_controls[] =
+{ { { V4L2_CID_BRIGHTNESS, V4L2_CTRL_TYPE_INTEGER,
+ "brightness",
+ 0, WLMAX - BLMIN, 1, 379 - BLMIN,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.brightness) },
+ { { V4L2_CID_CONTRAST, V4L2_CTRL_TYPE_INTEGER,
+ "contrast",
+ 0, 1023, 1, 127,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.contrast) },
+ { { V4L2_CID_SATURATION, V4L2_CTRL_TYPE_INTEGER,
+ "saturation",
+ 0, 255, 1, 155,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.saturation) },
+ { { V4L2_CID_HUE, V4L2_CTRL_TYPE_INTEGER,
+ "hue",
+ 0, 255, 1, 0,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.hue) },
+ { { V4L2_CID_GAMMA, V4L2_CTRL_TYPE_INTEGER,
+ "gamma",
+ 0, sizeof(maven_gamma)/sizeof(maven_gamma[0])-1, 1, 3,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.gamma) },
+ { { MATROXFB_CID_TESTOUT, V4L2_CTRL_TYPE_BOOLEAN,
+ "test output",
+ 0, 1, 1, 0,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.testout) },
+ { { MATROXFB_CID_DEFLICKER, V4L2_CTRL_TYPE_INTEGER,
+ "deflicker mode",
+ 0, 2, 1, 0,
+ 0,
+ }, offsetof(struct matrox_fb_info, altout.tvo_params.deflicker) },
+
+};
+
+#define MAVCTRLS (sizeof(maven_controls)/sizeof(maven_controls[0]))
+
+/* Return: positive number: id found
+ -EINVAL: id not found, return failure
+ -ENOENT: id not found, create fake disabled control */
+static int get_ctrl_id(__u32 v4l2_id) {
+ int i;
+
+ for (i = 0; i < MAVCTRLS; i++) {
+ if (v4l2_id < maven_controls[i].desc.id) {
+ if (maven_controls[i].desc.id == 0x08000000) {
+ return -EINVAL;
+ }
+ return -ENOENT;
+ }
+ if (v4l2_id == maven_controls[i].desc.id) {
+ return i;
+ }
+ }
+ return -EINVAL;
+}
+
+struct maven_data {
+ struct matrox_fb_info* primary_head;
+ struct i2c_client* client;
+ int version;
+};
+
+static int* get_ctrl_ptr(struct maven_data* md, int idx) {
+ return (int*)((char*)(md->primary_head) + maven_controls[idx].control);
+}
+
+static int maven_get_reg(struct i2c_client* c, char reg) {
+ char dst;
+ struct i2c_msg msgs[] = {{ c->addr, I2C_M_REV_DIR_ADDR, sizeof(reg), ® },
+ { c->addr, I2C_M_RD | I2C_M_NOSTART, sizeof(dst), &dst }};
+ s32 err;
+
+ err = i2c_transfer(c->adapter, msgs, 2);
+ if (err < 0)
+ printk(KERN_INFO "ReadReg(%d) failed\n", reg);
+ return dst & 0xFF;
+}
+
+static int maven_set_reg(struct i2c_client* c, int reg, int val) {
+ s32 err;
+
+ err = i2c_smbus_write_byte_data(c, reg, val);
+ if (err)
+ printk(KERN_INFO "WriteReg(%d) failed\n", reg);
+ return err;
+}
+
+static int maven_set_reg_pair(struct i2c_client* c, int reg, int val) {
+ s32 err;
+
+ err = i2c_smbus_write_word_data(c, reg, val);
+ if (err)
+ printk(KERN_INFO "WriteRegPair(%d) failed\n", reg);
+ return err;
+}
+
+static const struct matrox_pll_features maven_pll = {
+ 50000,
+ 27000,
+ 4, 127,
+ 2, 31,
+ 3
+};
+
+struct matrox_pll_features2 {
+ unsigned int vco_freq_min;
+ unsigned int vco_freq_max;
+ unsigned int feed_div_min;
+ unsigned int feed_div_max;
+ unsigned int in_div_min;
+ unsigned int in_div_max;
+ unsigned int post_shift_max;
+};
+
+struct matrox_pll_ctl {
+ unsigned int ref_freq;
+ unsigned int den;
+};
+
+static const struct matrox_pll_features2 maven1000_pll = {
+ 50000000,
+ 300000000,
+ 5, 128,
+ 3, 32,
+ 3
+};
+
+static const struct matrox_pll_ctl maven_PAL = {
+ 540000,
+ 50
+};
+
+static const struct matrox_pll_ctl maven_NTSC = {
+ 450450, /* 27027000/60 == 27000000/59.94005994 */
+ 60
+};
+
+static int matroxfb_PLL_mavenclock(const struct matrox_pll_features2* pll,
+ const struct matrox_pll_ctl* ctl,
+ unsigned int htotal, unsigned int vtotal,
+ unsigned int* in, unsigned int* feed, unsigned int* post,
+ unsigned int* h2) {
+ unsigned int besth2 = 0;
+ unsigned int fxtal = ctl->ref_freq;
+ unsigned int fmin = pll->vco_freq_min / ctl->den;
+ unsigned int fwant;
+ unsigned int p;
+ unsigned int scrlen;
+ unsigned int fmax;
+
+ DBG(__FUNCTION__)
+
+ scrlen = htotal * (vtotal - 1);
+ fwant = htotal * vtotal;
+ fmax = pll->vco_freq_max / ctl->den;
+
+ dprintk(KERN_DEBUG "want: %u, xtal: %u, h: %u, v: %u, fmax: %u\n",
+ fwant, fxtal, htotal, vtotal, fmax);
+ for (p = 1; p <= pll->post_shift_max; p++) {
+ if (fwant * 2 > fmax)
+ break;
+ fwant *= 2;
+ }
+ if (fwant > fmax)
+ return 0;
+ for (; p-- > 0; fwant >>= 1) {
+ unsigned int m;
+
+ if (fwant < fmin) break;
+ for (m = pll->in_div_min; m <= pll->in_div_max; m++) {
+ unsigned int n;
+ unsigned int dvd;
+ unsigned int ln;
+
+ n = (fwant * m) / fxtal;
+ if (n < pll->feed_div_min)
+ continue;
+ if (n > pll->feed_div_max)
+ break;
+
+ ln = fxtal * n;
+ dvd = m << p;
+
+ if (ln % dvd)
+ continue;
+ ln = ln / dvd;
+
+ if (ln < scrlen + 2)
+ continue;
+ ln = ln - scrlen;
+ if (ln > htotal)
+ continue;
+ dprintk(KERN_DEBUG "Match: %u / %u / %u / %u\n", n, m, p, ln);
+ if (ln > besth2) {
+ dprintk(KERN_DEBUG "Better...\n");
+ *h2 = besth2 = ln;
+ *post = p;
+ *in = m;
+ *feed = n;
+ }
+ }
+ }
+ if (besth2 < 2)
+ return 0;
+ dprintk(KERN_ERR "clk: %02X %02X %02X %d %d\n", *in, *feed, *post, fxtal, fwant);
+ return fxtal * (*feed) / (*in) * ctl->den;
+}
+
+static unsigned int matroxfb_mavenclock(const struct matrox_pll_ctl* ctl,
+ unsigned int htotal, unsigned int vtotal,
+ unsigned int* in, unsigned int* feed, unsigned int* post,
+ unsigned int* htotal2) {
+ unsigned int fvco;
+ unsigned int p;
+
+ fvco = matroxfb_PLL_mavenclock(&maven1000_pll, ctl, htotal, vtotal, in, feed, &p, htotal2);
+ if (!fvco)
+ return -EINVAL;
+ p = (1 << p) - 1;
+ if (fvco <= 100000000)
+ ;
+ else if (fvco <= 140000000)
+ p |= 0x08;
+ else if (fvco <= 180000000)
+ p |= 0x10;
+ else
+ p |= 0x18;
+ *post = p;
+ return 0;
+}
+
+static void DAC1064_calcclock(unsigned int freq, unsigned int fmax,
+ unsigned int* in, unsigned int* feed, unsigned int* post) {
+ unsigned int fvco;
+ unsigned int p;
+
+ fvco = matroxfb_PLL_calcclock(&maven_pll, freq, fmax, in, feed, &p);
+ p = (1 << p) - 1;
+ if (fvco <= 100000)
+ ;
+ else if (fvco <= 140000)
+ p |= 0x08;
+ else if (fvco <= 180000)
+ p |= 0x10;
+ else
+ p |= 0x18;
+ *post = p;
+ return;
+}
+
+static unsigned char maven_compute_deflicker (const struct maven_data* md) {
+ unsigned char df;
+
+ df = (md->version == MGATVO_B?0x40:0x00);
+ switch (md->primary_head->altout.tvo_params.deflicker) {
+ case 0:
+/* df |= 0x00; */
+ break;
+ case 1:
+ df |= 0xB1;
+ break;
+ case 2:
+ df |= 0xA2;
+ break;
+ }
+ return df;
+}
+
+static void maven_compute_bwlevel (const struct maven_data* md,
+ int *bl, int *wl) {
+ const int b = md->primary_head->altout.tvo_params.brightness + BLMIN;
+ const int c = md->primary_head->altout.tvo_params.contrast;
+
+ *bl = max(b - c, BLMIN);
+ *wl = min(b + c, WLMAX);
+}
+
+static const struct maven_gamma* maven_compute_gamma (const struct maven_data* md) {
+ return maven_gamma + md->primary_head->altout.tvo_params.gamma;
+}
+
+
+static void maven_init_TVdata(const struct maven_data* md, struct mavenregs* data) {
+ static struct mavenregs palregs = { {
+ 0x2A, 0x09, 0x8A, 0xCB, /* 00: chroma subcarrier */
+ 0x00,
+ 0x00, /* ? not written */
+ 0x00, /* modified by code (F9 written...) */
+ 0x00, /* ? not written */
+ 0x7E, /* 08 */
+ 0x44, /* 09 */
+ 0x9C, /* 0A */
+ 0x2E, /* 0B */
+ 0x21, /* 0C */
+ 0x00, /* ? not written */
+ 0x3F, 0x03, /* 0E-0F */
+ 0x3F, 0x03, /* 10-11 */
+ 0x1A, /* 12 */
+ 0x2A, /* 13 */
+ 0x1C, 0x3D, 0x14, /* 14-16 */
+ 0x9C, 0x01, /* 17-18 */
+ 0x00, /* 19 */
+ 0xFE, /* 1A */
+ 0x7E, /* 1B */
+ 0x60, /* 1C */
+ 0x05, /* 1D */
+ 0x89, 0x03, /* 1E-1F */
+ 0x72, /* 20 */
+ 0x07, /* 21 */
+ 0x72, /* 22 */
+ 0x00, /* 23 */
+ 0x00, /* 24 */
+ 0x00, /* 25 */
+ 0x08, /* 26 */
+ 0x04, /* 27 */
+ 0x00, /* 28 */
+ 0x1A, /* 29 */
+ 0x55, 0x01, /* 2A-2B */
+ 0x26, /* 2C */
+ 0x07, 0x7E, /* 2D-2E */
+ 0x02, 0x54, /* 2F-30 */
+ 0xB0, 0x00, /* 31-32 */
+ 0x14, /* 33 */
+ 0x49, /* 34 */
+ 0x00, /* 35 written multiple times */
+ 0x00, /* 36 not written */
+ 0xA3, /* 37 */
+ 0xC8, /* 38 */
+ 0x22, /* 39 */
+ 0x02, /* 3A */
+ 0x22, /* 3B */
+ 0x3F, 0x03, /* 3C-3D */
+ 0x00, /* 3E written multiple times */
+ 0x00, /* 3F not written */
+ }, MATROXFB_OUTPUT_MODE_PAL, 625, 50 };
+ static struct mavenregs ntscregs = { {
+ 0x21, 0xF0, 0x7C, 0x1F, /* 00: chroma subcarrier */
+ 0x00,
+ 0x00, /* ? not written */
+ 0x00, /* modified by code (F9 written...) */
+ 0x00, /* ? not written */
+ 0x7E, /* 08 */
+ 0x43, /* 09 */
+ 0x7E, /* 0A */
+ 0x3D, /* 0B */
+ 0x00, /* 0C */
+ 0x00, /* ? not written */
+ 0x41, 0x00, /* 0E-0F */
+ 0x3C, 0x00, /* 10-11 */
+ 0x17, /* 12 */
+ 0x21, /* 13 */
+ 0x1B, 0x1B, 0x24, /* 14-16 */
+ 0x83, 0x01, /* 17-18 */
+ 0x00, /* 19 */
+ 0x0F, /* 1A */
+ 0x0F, /* 1B */
+ 0x60, /* 1C */
+ 0x05, /* 1D */
+ 0x89, 0x02, /* 1E-1F */
+ 0x5F, /* 20 */
+ 0x04, /* 21 */
+ 0x5F, /* 22 */
+ 0x01, /* 23 */
+ 0x02, /* 24 */
+ 0x00, /* 25 */
+ 0x0A, /* 26 */
+ 0x05, /* 27 */
+ 0x00, /* 28 */
+ 0x10, /* 29 */
+ 0xFF, 0x03, /* 2A-2B */
+ 0x24, /* 2C */
+ 0x0F, 0x78, /* 2D-2E */
+ 0x00, 0x00, /* 2F-30 */
+ 0xB2, 0x04, /* 31-32 */
+ 0x14, /* 33 */
+ 0x02, /* 34 */
+ 0x00, /* 35 written multiple times */
+ 0x00, /* 36 not written */
+ 0xA3, /* 37 */
+ 0xC8, /* 38 */
+ 0x15, /* 39 */
+ 0x05, /* 3A */
+ 0x3B, /* 3B */
+ 0x3C, 0x00, /* 3C-3D */
+ 0x00, /* 3E written multiple times */
+ 0x00, /* never written */
+ }, MATROXFB_OUTPUT_MODE_NTSC, 525, 60 };
+ MINFO_FROM(md->primary_head);
+
+ if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_PAL)
+ *data = palregs;
+ else
+ *data = ntscregs;
+
+ /* Set deflicker */
+ data->regs[0x93] = maven_compute_deflicker(md);
+
+ /* set gamma */
+ {
+ const struct maven_gamma* g;
+ g = maven_compute_gamma(md);
+ data->regs[0x83] = g->reg83;
+ data->regs[0x84] = g->reg84;
+ data->regs[0x85] = g->reg85;
+ data->regs[0x86] = g->reg86;
+ data->regs[0x87] = g->reg87;
+ data->regs[0x88] = g->reg88;
+ data->regs[0x89] = g->reg89;
+ data->regs[0x8A] = g->reg8a;
+ data->regs[0x8B] = g->reg8b;
+ }
+
+ /* Set contrast / brightness */
+ {
+ int bl, wl;
+ maven_compute_bwlevel (md, &bl, &wl);
+ data->regs[0x0e] = bl >> 2;
+ data->regs[0x0f] = bl & 3;
+ data->regs[0x1e] = wl >> 2;
+ data->regs[0x1f] = wl & 3;
+ }
+
+ /* Set saturation */
+ {
+ data->regs[0x20] =
+ data->regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+ }
+
+ /* Set HUE */
+ data->regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+ return;
+}
+
+#define LR(x) maven_set_reg(c, (x), m->regs[(x)])
+#define LRP(x) maven_set_reg_pair(c, (x), m->regs[(x)] | (m->regs[(x)+1] << 8))
+static void maven_init_TV(struct i2c_client* c, const struct mavenregs* m) {
+ int val;
+
+
+ maven_set_reg(c, 0x3E, 0x01);
+ maven_get_reg(c, 0x82); /* fetch oscillator state? */
+ maven_set_reg(c, 0x8C, 0x00);
+ maven_get_reg(c, 0x94); /* get 0x82 */
+ maven_set_reg(c, 0x94, 0xA2);
+ /* xmiscctrl */
+
+ maven_set_reg_pair(c, 0x8E, 0x1EFF);
+ maven_set_reg(c, 0xC6, 0x01);
+
+ /* removed code... */
+
+ maven_get_reg(c, 0x06);
+ maven_set_reg(c, 0x06, 0xF9); /* or read |= 0xF0 ? */
+
+ /* removed code here... */
+
+ /* real code begins here? */
+ /* chroma subcarrier */
+ LR(0x00); LR(0x01); LR(0x02); LR(0x03);
+
+ LR(0x04);
+
+ LR(0x2C);
+ LR(0x08);
+ LR(0x0A);
+ LR(0x09);
+ LR(0x29);
+ LRP(0x31);
+ LRP(0x17);
+ LR(0x0B);
+ LR(0x0C);
+ if (m->mode == MATROXFB_OUTPUT_MODE_PAL) {
+ maven_set_reg(c, 0x35, 0x10); /* ... */
+ } else {
+ maven_set_reg(c, 0x35, 0x0F); /* ... */
+ }
+
+ LRP(0x10);
+
+ LRP(0x0E);
+ LRP(0x1E);
+
+ LR(0x20); /* saturation #1 */
+ LR(0x22); /* saturation #2 */
+ LR(0x25); /* hue */
+ LR(0x34);
+ LR(0x33);
+ LR(0x19);
+ LR(0x12);
+ LR(0x3B);
+ LR(0x13);
+ LR(0x39);
+ LR(0x1D);
+ LR(0x3A);
+ LR(0x24);
+ LR(0x14);
+ LR(0x15);
+ LR(0x16);
+ LRP(0x2D);
+ LRP(0x2F);
+ LR(0x1A);
+ LR(0x1B);
+ LR(0x1C);
+ LR(0x23);
+ LR(0x26);
+ LR(0x28);
+ LR(0x27);
+ LR(0x21);
+ LRP(0x2A);
+ if (m->mode == MATROXFB_OUTPUT_MODE_PAL)
+ maven_set_reg(c, 0x35, 0x1D); /* ... */
+ else
+ maven_set_reg(c, 0x35, 0x1C);
+
+ LRP(0x3C);
+ LR(0x37);
+ LR(0x38);
+ maven_set_reg(c, 0xB3, 0x01);
+
+ maven_get_reg(c, 0xB0); /* read 0x80 */
+ maven_set_reg(c, 0xB0, 0x08); /* ugh... */
+ maven_get_reg(c, 0xB9); /* read 0x7C */
+ maven_set_reg(c, 0xB9, 0x78);
+ maven_get_reg(c, 0xBF); /* read 0x00 */
+ maven_set_reg(c, 0xBF, 0x02);
+ maven_get_reg(c, 0x94); /* read 0x82 */
+ maven_set_reg(c, 0x94, 0xB3);
+
+ LR(0x80); /* 04 1A 91 or 05 21 91 */
+ LR(0x81);
+ LR(0x82);
+
+ maven_set_reg(c, 0x8C, 0x20);
+ maven_get_reg(c, 0x8D);
+ maven_set_reg(c, 0x8D, 0x10);
+
+ LR(0x90); /* 4D 50 52 or 4E 05 45 */
+ LR(0x91);
+ LR(0x92);
+
+ LRP(0x9A); /* 0049 or 004F */
+ LRP(0x9C); /* 0004 or 0004 */
+ LRP(0x9E); /* 0458 or 045E */
+ LRP(0xA0); /* 05DA or 051B */
+ LRP(0xA2); /* 00CC or 00CF */
+ LRP(0xA4); /* 007D or 007F */
+ LRP(0xA6); /* 007C or 007E */
+ LRP(0xA8); /* 03CB or 03CE */
+ LRP(0x98); /* 0000 or 0000 */
+ LRP(0xAE); /* 0044 or 003A */
+ LRP(0x96); /* 05DA or 051B */
+ LRP(0xAA); /* 04BC or 046A */
+ LRP(0xAC); /* 004D or 004E */
+
+ LR(0xBE);
+ LR(0xC2);
+
+ maven_get_reg(c, 0x8D);
+ maven_set_reg(c, 0x8D, 0x04);
+
+ LR(0x20); /* saturation #1 */
+ LR(0x22); /* saturation #2 */
+ LR(0x93); /* whoops */
+ LR(0x20); /* oh, saturation #1 again */
+ LR(0x22); /* oh, saturation #2 again */
+ LR(0x25); /* hue */
+ LRP(0x0E);
+ LRP(0x1E);
+ LRP(0x0E); /* problems with memory? */
+ LRP(0x1E); /* yes, matrox must have problems in memory area... */
+
+ /* load gamma correction stuff */
+ LR(0x83);
+ LR(0x84);
+ LR(0x85);
+ LR(0x86);
+ LR(0x87);
+ LR(0x88);
+ LR(0x89);
+ LR(0x8A);
+ LR(0x8B);
+
+ val = maven_get_reg(c, 0x8D);
+ val &= 0x14; /* 0x10 or anything ored with it */
+ maven_set_reg(c, 0x8D, val);
+
+ LR(0x33);
+ LR(0x19);
+ LR(0x12);
+ LR(0x3B);
+ LR(0x13);
+ LR(0x39);
+ LR(0x1D);
+ LR(0x3A);
+ LR(0x24);
+ LR(0x14);
+ LR(0x15);
+ LR(0x16);
+ LRP(0x2D);
+ LRP(0x2F);
+ LR(0x1A);
+ LR(0x1B);
+ LR(0x1C);
+ LR(0x23);
+ LR(0x26);
+ LR(0x28);
+ LR(0x27);
+ LR(0x21);
+ LRP(0x2A);
+ if (m->mode == MATROXFB_OUTPUT_MODE_PAL)
+ maven_set_reg(c, 0x35, 0x1D);
+ else
+ maven_set_reg(c, 0x35, 0x1C);
+ LRP(0x3C);
+ LR(0x37);
+ LR(0x38);
+
+ maven_get_reg(c, 0xB0);
+ LR(0xB0); /* output mode */
+ LR(0x90);
+ LR(0xBE);
+ LR(0xC2);
+
+ LRP(0x9A);
+ LRP(0xA2);
+ LRP(0x9E);
+ LRP(0xA6);
+ LRP(0xAA);
+ LRP(0xAC);
+ maven_set_reg(c, 0x3E, 0x00);
+ maven_set_reg(c, 0x95, 0x20);
+}
+
+static int maven_find_exact_clocks(unsigned int ht, unsigned int vt,
+ struct mavenregs* m) {
+ unsigned int x;
+ unsigned int err = ~0;
+
+ /* 1:1 */
+ m->regs[0x80] = 0x0F;
+ m->regs[0x81] = 0x07;
+ m->regs[0x82] = 0x81;
+
+ for (x = 0; x < 8; x++) {
+ unsigned int a, b, c, h2;
+ unsigned int h = ht + 2 + x;
+
+ if (!matroxfb_mavenclock((m->mode == MATROXFB_OUTPUT_MODE_PAL) ? &maven_PAL : &maven_NTSC, h, vt, &a, &b, &c, &h2)) {
+ unsigned int diff = h - h2;
+
+ if (diff < err) {
+ err = diff;
+ m->regs[0x80] = a - 1;
+ m->regs[0x81] = b - 1;
+ m->regs[0x82] = c | 0x80;
+ m->hcorr = h2 - 2;
+ m->htotal = h - 2;
+ }
+ }
+ }
+ return err != ~0U;
+}
+
+static inline int maven_compute_timming(struct maven_data* md,
+ struct my_timming* mt,
+ struct mavenregs* m) {
+ unsigned int tmpi;
+ unsigned int a, bv, c;
+ MINFO_FROM(md->primary_head);
+
+ m->mode = ACCESS_FBINFO(outputs[1]).mode;
+ if (m->mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+ unsigned int lmargin;
+ unsigned int umargin;
+ unsigned int vslen;
+ unsigned int hcrt;
+ unsigned int slen;
+
+ maven_init_TVdata(md, m);
+
+ if (maven_find_exact_clocks(mt->HTotal, mt->VTotal, m) == 0)
+ return -EINVAL;
+
+ lmargin = mt->HTotal - mt->HSyncEnd;
+ slen = mt->HSyncEnd - mt->HSyncStart;
+ hcrt = mt->HTotal - slen - mt->delay;
+ umargin = mt->VTotal - mt->VSyncEnd;
+ vslen = mt->VSyncEnd - mt->VSyncStart;
+
+ if (m->hcorr < mt->HTotal)
+ hcrt += m->hcorr;
+ if (hcrt > mt->HTotal)
+ hcrt -= mt->HTotal;
+ if (hcrt + 2 > mt->HTotal)
+ hcrt = 0; /* or issue warning? */
+
+ /* last (first? middle?) line in picture can have different length */
+ /* hlen - 2 */
+ m->regs[0x96] = m->hcorr;
+ m->regs[0x97] = m->hcorr >> 8;
+ /* ... */
+ m->regs[0x98] = 0x00; m->regs[0x99] = 0x00;
+ /* hblanking end */
+ m->regs[0x9A] = lmargin; /* 100% */
+ m->regs[0x9B] = lmargin >> 8; /* 100% */
+ /* who knows */
+ m->regs[0x9C] = 0x04;
+ m->regs[0x9D] = 0x00;
+ /* htotal - 2 */
+ m->regs[0xA0] = m->htotal;
+ m->regs[0xA1] = m->htotal >> 8;
+ /* vblanking end */
+ m->regs[0xA2] = mt->VTotal - mt->VSyncStart - 1; /* stop vblanking */
+ m->regs[0xA3] = (mt->VTotal - mt->VSyncStart - 1) >> 8;
+ /* something end... [A6]+1..[A8] */
+ if (md->version == MGATVO_B) {
+ m->regs[0xA4] = 0x04;
+ m->regs[0xA5] = 0x00;
+ } else {
+ m->regs[0xA4] = 0x01;
+ m->regs[0xA5] = 0x00;
+ }
+ /* something start... 0..[A4]-1 */
+ m->regs[0xA6] = 0x00;
+ m->regs[0xA7] = 0x00;
+ /* vertical line count - 1 */
+ m->regs[0xA8] = mt->VTotal - 1;
+ m->regs[0xA9] = (mt->VTotal - 1) >> 8;
+ /* horizontal vidrst pos */
+ m->regs[0xAA] = hcrt; /* 0 <= hcrt <= htotal - 2 */
+ m->regs[0xAB] = hcrt >> 8;
+ /* vertical vidrst pos */
+ m->regs[0xAC] = mt->VTotal - 2;
+ m->regs[0xAD] = (mt->VTotal - 2) >> 8;
+ /* moves picture up/down and so on... */
+ m->regs[0xAE] = 0x01; /* Fix this... 0..VTotal */
+ m->regs[0xAF] = 0x00;
+ {
+ int hdec;
+ int hlen;
+ unsigned int ibmin = 4 + lmargin + mt->HDisplay;
+ unsigned int ib;
+ int i;
+
+ /* Verify! */
+ /* Where 94208 came from? */
+ if (mt->HTotal)
+ hdec = 94208 / (mt->HTotal);
+ else
+ hdec = 0x81;
+ if (hdec > 0x81)
+ hdec = 0x81;
+ if (hdec < 0x41)
+ hdec = 0x41;
+ hdec--;
+ hlen = 98304 - 128 - ((lmargin + mt->HDisplay - 8) * hdec);
+ if (hlen < 0)
+ hlen = 0;
+ hlen = hlen >> 8;
+ if (hlen > 0xFF)
+ hlen = 0xFF;
+ /* Now we have to compute input buffer length.
+ If you want any picture, it must be between
+ 4 + lmargin + xres
+ and
+ 94208 / hdec
+ If you want perfect picture even on the top
+ of screen, it must be also
+ 0x3C0000 * i / hdec + Q - R / hdec
+ where
+ R Qmin Qmax
+ 0x07000 0x5AE 0x5BF
+ 0x08000 0x5CF 0x5FF
+ 0x0C000 0x653 0x67F
+ 0x10000 0x6F8 0x6FF
+ */
+ i = 1;
+ do {
+ ib = ((0x3C0000 * i - 0x8000)/ hdec + 0x05E7) >> 8;
+ i++;
+ } while (ib < ibmin);
+ if (ib >= m->htotal + 2) {
+ ib = ibmin;
+ }
+
+ m->regs[0x90] = hdec; /* < 0x40 || > 0x80 is bad... 0x80 is questionable */
+ m->regs[0xC2] = hlen;
+ /* 'valid' input line length */
+ m->regs[0x9E] = ib;
+ m->regs[0x9F] = ib >> 8;
+ }
+ {
+ int vdec;
+ int vlen;
+
+#define MATROX_USE64BIT_DIVIDE
+ if (mt->VTotal) {
+#ifdef MATROX_USE64BIT_DIVIDE
+ u64 f1;
+ u32 a;
+ u32 b;
+
+ a = m->vlines * (m->htotal + 2);
+ b = (mt->VTotal - 1) * (m->htotal + 2) + m->hcorr + 2;
+
+ f1 = ((u64)a) << 15; /* *32768 */
+ do_div(f1, b);
+ vdec = f1;
+#else
+ vdec = m->vlines * 32768 / mt->VTotal;
+#endif
+ } else
+ vdec = 0x8000;
+ if (vdec > 0x8000)
+ vdec = 0x8000;
+ vlen = (vslen + umargin + mt->VDisplay) * vdec;
+ vlen = (vlen >> 16) - 146; /* FIXME: 146?! */
+ if (vlen < 0)
+ vlen = 0;
+ if (vlen > 0xFF)
+ vlen = 0xFF;
+ vdec--;
+ m->regs[0x91] = vdec;
+ m->regs[0x92] = vdec >> 8;
+ m->regs[0xBE] = vlen;
+ }
+ m->regs[0xB0] = 0x08; /* output: SVideo/Composite */
+ return 0;
+ }
+
+ DAC1064_calcclock(mt->pixclock, 450000, &a, &bv, &c);
+ m->regs[0x80] = a;
+ m->regs[0x81] = bv;
+ m->regs[0x82] = c | 0x80;
+
+ m->regs[0xB3] = 0x01;
+ m->regs[0x94] = 0xB2;
+
+ /* htotal... */
+ m->regs[0x96] = mt->HTotal;
+ m->regs[0x97] = mt->HTotal >> 8;
+ /* ?? */
+ m->regs[0x98] = 0x00;
+ m->regs[0x99] = 0x00;
+ /* hsync len */
+ tmpi = mt->HSyncEnd - mt->HSyncStart;
+ m->regs[0x9A] = tmpi;
+ m->regs[0x9B] = tmpi >> 8;
+ /* hblank end */
+ tmpi = mt->HTotal - mt->HSyncStart;
+ m->regs[0x9C] = tmpi;
+ m->regs[0x9D] = tmpi >> 8;
+ /* hblank start */
+ tmpi += mt->HDisplay;
+ m->regs[0x9E] = tmpi;
+ m->regs[0x9F] = tmpi >> 8;
+ /* htotal + 1 */
+ tmpi = mt->HTotal + 1;
+ m->regs[0xA0] = tmpi;
+ m->regs[0xA1] = tmpi >> 8;
+ /* vsync?! */
+ tmpi = mt->VSyncEnd - mt->VSyncStart - 1;
+ m->regs[0xA2] = tmpi;
+ m->regs[0xA3] = tmpi >> 8;
+ /* ignored? */
+ tmpi = mt->VTotal - mt->VSyncStart;
+ m->regs[0xA4] = tmpi;
+ m->regs[0xA5] = tmpi >> 8;
+ /* ignored? */
+ tmpi = mt->VTotal - 1;
+ m->regs[0xA6] = tmpi;
+ m->regs[0xA7] = tmpi >> 8;
+ /* vtotal - 1 */
+ m->regs[0xA8] = tmpi;
+ m->regs[0xA9] = tmpi >> 8;
+ /* hor vidrst */
+ tmpi = mt->HTotal - mt->delay;
+ m->regs[0xAA] = tmpi;
+ m->regs[0xAB] = tmpi >> 8;
+ /* vert vidrst */
+ tmpi = mt->VTotal - 2;
+ m->regs[0xAC] = tmpi;
+ m->regs[0xAD] = tmpi >> 8;
+ /* ignored? */
+ m->regs[0xAE] = 0x00;
+ m->regs[0xAF] = 0x00;
+
+ m->regs[0xB0] = 0x03; /* output: monitor */
+ m->regs[0xB1] = 0xA0; /* ??? */
+ m->regs[0x8C] = 0x20; /* must be set... */
+ m->regs[0x8D] = 0x04; /* defaults to 0x10: test signal */
+ m->regs[0xB9] = 0x1A; /* defaults to 0x2C: too bright */
+ m->regs[0xBF] = 0x22; /* makes picture stable */
+
+ return 0;
+}
+
+static inline int maven_program_timming(struct maven_data* md,
+ const struct mavenregs* m) {
+ struct i2c_client* c = md->client;
+
+ if (m->mode == MATROXFB_OUTPUT_MODE_MONITOR) {
+ LR(0x80);
+ LR(0x81);
+ LR(0x82);
+
+ LR(0xB3);
+ LR(0x94);
+
+ LRP(0x96);
+ LRP(0x98);
+ LRP(0x9A);
+ LRP(0x9C);
+ LRP(0x9E);
+ LRP(0xA0);
+ LRP(0xA2);
+ LRP(0xA4);
+ LRP(0xA6);
+ LRP(0xA8);
+ LRP(0xAA);
+ LRP(0xAC);
+ LRP(0xAE);
+
+ LR(0xB0); /* output: monitor */
+ LR(0xB1); /* ??? */
+ LR(0x8C); /* must be set... */
+ LR(0x8D); /* defaults to 0x10: test signal */
+ LR(0xB9); /* defaults to 0x2C: too bright */
+ LR(0xBF); /* makes picture stable */
+ } else {
+ maven_init_TV(c, m);
+ }
+ return 0;
+}
+
+static inline int maven_resync(struct maven_data* md) {
+ struct i2c_client* c = md->client;
+ maven_set_reg(c, 0x95, 0x20); /* start whole thing */
+ return 0;
+}
+
+static int maven_get_queryctrl (struct maven_data* md,
+ struct v4l2_queryctrl *p) {
+ int i;
+
+ i = get_ctrl_id(p->id);
+ if (i >= 0) {
+ *p = maven_controls[i].desc;
+ return 0;
+ }
+ if (i == -ENOENT) {
+ static const struct v4l2_queryctrl disctrl =
+ { .flags = V4L2_CTRL_FLAG_DISABLED };
+
+ i = p->id;
+ *p = disctrl;
+ p->id = i;
+ sprintf(p->name, "Ctrl #%08X", i);
+ return 0;
+ }
+ return -EINVAL;
+}
+
+static int maven_set_control (struct maven_data* md,
+ struct v4l2_control *p) {
+ int i;
+
+ i = get_ctrl_id(p->id);
+ if (i < 0) return -EINVAL;
+
+ /*
+ * Check if changed.
+ */
+ if (p->value == *get_ctrl_ptr(md, i)) return 0;
+
+ /*
+ * Check limits.
+ */
+ if (p->value > maven_controls[i].desc.maximum) return -EINVAL;
+ if (p->value < maven_controls[i].desc.minimum) return -EINVAL;
+
+ /*
+ * Store new value.
+ */
+ *get_ctrl_ptr(md, i) = p->value;
+
+ switch (p->id) {
+ case V4L2_CID_BRIGHTNESS:
+ case V4L2_CID_CONTRAST:
+ {
+ int blacklevel, whitelevel;
+ maven_compute_bwlevel(md, &blacklevel, &whitelevel);
+ blacklevel = (blacklevel >> 2) | ((blacklevel & 3) << 8);
+ whitelevel = (whitelevel >> 2) | ((whitelevel & 3) << 8);
+ maven_set_reg_pair(md->client, 0x0e, blacklevel);
+ maven_set_reg_pair(md->client, 0x1e, whitelevel);
+ }
+ break;
+ case V4L2_CID_SATURATION:
+ {
+ maven_set_reg(md->client, 0x20, p->value);
+ maven_set_reg(md->client, 0x22, p->value);
+ }
+ break;
+ case V4L2_CID_HUE:
+ {
+ maven_set_reg(md->client, 0x25, p->value);
+ }
+ break;
+ case V4L2_CID_GAMMA:
+ {
+ const struct maven_gamma* g;
+ g = maven_compute_gamma(md);
+ maven_set_reg(md->client, 0x83, g->reg83);
+ maven_set_reg(md->client, 0x84, g->reg84);
+ maven_set_reg(md->client, 0x85, g->reg85);
+ maven_set_reg(md->client, 0x86, g->reg86);
+ maven_set_reg(md->client, 0x87, g->reg87);
+ maven_set_reg(md->client, 0x88, g->reg88);
+ maven_set_reg(md->client, 0x89, g->reg89);
+ maven_set_reg(md->client, 0x8a, g->reg8a);
+ maven_set_reg(md->client, 0x8b, g->reg8b);
+ }
+ break;
+ case MATROXFB_CID_TESTOUT:
+ {
+ unsigned char val
+ = maven_get_reg (md->client,0x8d);
+ if (p->value) val |= 0x10;
+ else val &= ~0x10;
+ maven_set_reg (md->client, 0x8d, val);
+ }
+ break;
+ case MATROXFB_CID_DEFLICKER:
+ {
+ maven_set_reg(md->client, 0x93, maven_compute_deflicker(md));
+ }
+ break;
+ }
+
+
+ return 0;
+}
+
+static int maven_get_control (struct maven_data* md,
+ struct v4l2_control *p) {
+ int i;
+
+ i = get_ctrl_id(p->id);
+ if (i < 0) return -EINVAL;
+ p->value = *get_ctrl_ptr(md, i);
+ return 0;
+}
+
+/******************************************************/
+
+static int maven_out_compute(void* md, struct my_timming* mt) {
+#define mdinfo ((struct maven_data*)md)
+#define minfo (mdinfo->primary_head)
+ return maven_compute_timming(md, mt, &ACCESS_FBINFO(hw).maven);
+#undef minfo
+#undef mdinfo
+}
+
+static int maven_out_program(void* md) {
+#define mdinfo ((struct maven_data*)md)
+#define minfo (mdinfo->primary_head)
+ return maven_program_timming(md, &ACCESS_FBINFO(hw).maven);
+#undef minfo
+#undef mdinfo
+}
+
+static int maven_out_start(void* md) {
+ return maven_resync(md);
+}
+
+static int maven_out_verify_mode(void* md, u_int32_t arg) {
+ switch (arg) {
+ case MATROXFB_OUTPUT_MODE_PAL:
+ case MATROXFB_OUTPUT_MODE_NTSC:
+ case MATROXFB_OUTPUT_MODE_MONITOR:
+ return 0;
+ }
+ return -EINVAL;
+}
+
+static int maven_out_get_queryctrl(void* md, struct v4l2_queryctrl* p) {
+ return maven_get_queryctrl(md, p);
+}
+
+static int maven_out_get_ctrl(void* md, struct v4l2_control* p) {
+ return maven_get_control(md, p);
+}
+
+static int maven_out_set_ctrl(void* md, struct v4l2_control* p) {
+ return maven_set_control(md, p);
+}
+
+static struct matrox_altout maven_altout = {
+ .name = "Secondary output",
+ .compute = maven_out_compute,
+ .program = maven_out_program,
+ .start = maven_out_start,
+ .verifymode = maven_out_verify_mode,
+ .getqueryctrl = maven_out_get_queryctrl,
+ .getctrl = maven_out_get_ctrl,
+ .setctrl = maven_out_set_ctrl,
+};
+
+static int maven_init_client(struct i2c_client* clnt) {
+ struct maven_data* md = i2c_get_clientdata(clnt);
+ MINFO_FROM(container_of(clnt->adapter, struct i2c_bit_adapter, adapter)->minfo);
+
+ md->primary_head = MINFO;
+ md->client = clnt;
+ down_write(&ACCESS_FBINFO(altout.lock));
+ ACCESS_FBINFO(outputs[1]).output = &maven_altout;
+ ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
+ ACCESS_FBINFO(outputs[1]).data = md;
+ ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ up_write(&ACCESS_FBINFO(altout.lock));
+ if (maven_get_reg(clnt, 0xB2) < 0x14) {
+ md->version = MGATVO_B;
+ /* Tweak some things for this old chip */
+ } else {
+ md->version = MGATVO_C;
+ }
+ /*
+ * Set all parameters to its initial values.
+ */
+ {
+ unsigned int i;
+
+ for (i = 0; i < MAVCTRLS; ++i) {
+ *get_ctrl_ptr(md, i) = maven_controls[i].desc.default_value;
+ }
+ }
+
+ return 0;
+}
+
+static int maven_shutdown_client(struct i2c_client* clnt) {
+ struct maven_data* md = i2c_get_clientdata(clnt);
+
+ if (md->primary_head) {
+ MINFO_FROM(md->primary_head);
+
+ down_write(&ACCESS_FBINFO(altout.lock));
+ ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
+ ACCESS_FBINFO(outputs[1]).output = NULL;
+ ACCESS_FBINFO(outputs[1]).data = NULL;
+ ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ up_write(&ACCESS_FBINFO(altout.lock));
+ md->primary_head = NULL;
+ }
+ return 0;
+}
+
+static unsigned short normal_i2c[] = { MAVEN_I2CID, I2C_CLIENT_END };
+static unsigned short normal_i2c_range[] = { MAVEN_I2CID, MAVEN_I2CID, I2C_CLIENT_END };
+I2C_CLIENT_INSMOD;
+
+static struct i2c_driver maven_driver;
+
+static int maven_detect_client(struct i2c_adapter* adapter, int address, int kind) {
+ int err = 0;
+ struct i2c_client* new_client;
+ struct maven_data* data;
+
+ if (!i2c_check_functionality(adapter, I2C_FUNC_SMBUS_WRITE_WORD_DATA |
+ I2C_FUNC_SMBUS_BYTE_DATA |
+ I2C_FUNC_PROTOCOL_MANGLING))
+ goto ERROR0;
+ if (!(new_client = (struct i2c_client*)kmalloc(sizeof(*new_client) + sizeof(*data),
+ GFP_KERNEL))) {
+ err = -ENOMEM;
+ goto ERROR0;
+ }
+ memset(new_client, 0, sizeof(*new_client) + sizeof(*data));
+ data = (struct maven_data*)(new_client + 1);
+ i2c_set_clientdata(new_client, data);
+ new_client->addr = address;
+ new_client->adapter = adapter;
+ new_client->driver = &maven_driver;
+ new_client->flags = 0;
+ strcpy(new_client->name, "maven client");
+ if ((err = i2c_attach_client(new_client)))
+ goto ERROR3;
+ err = maven_init_client(new_client);
+ if (err)
+ goto ERROR4;
+ return 0;
+ERROR4:;
+ i2c_detach_client(new_client);
+ERROR3:;
+ kfree(new_client);
+ERROR0:;
+ return err;
+}
+
+static int maven_attach_adapter(struct i2c_adapter* adapter) {
+ if (adapter->id == (I2C_ALGO_BIT | I2C_HW_B_G400))
+ return i2c_probe(adapter, &addr_data, &maven_detect_client);
+ return 0;
+}
+
+static int maven_detach_client(struct i2c_client* client) {
+ int err;
+
+ if ((err = i2c_detach_client(client))) {
+ printk(KERN_ERR "maven: Cannot deregister client\n");
+ return err;
+ }
+ maven_shutdown_client(client);
+ kfree(client);
+ return 0;
+}
+
+static int maven_command(struct i2c_client* client, unsigned int cmd, void* arg) {
+ return -ENOIOCTLCMD; /* or -EINVAL, depends on who will call this */
+}
+
+static struct i2c_driver maven_driver={
+ .owner = THIS_MODULE,
+ .name = "maven",
+ .id = I2C_DRIVERID_MGATVO,
+ .flags = I2C_DF_NOTIFY,
+ .attach_adapter = maven_attach_adapter,
+ .detach_client = maven_detach_client,
+ .command = maven_command,
+};
+
+/* ************************** */
+
+static int matroxfb_maven_init(void) {
+ int err;
+
+ err = i2c_add_driver(&maven_driver);
+ if (err) {
+ printk(KERN_ERR "maven: Maven driver failed to register (%d).\n", err);
+ return err;
+ }
+ return 0;
+}
+
+static void matroxfb_maven_exit(void) {
+ i2c_del_driver(&maven_driver);
+}
+
+MODULE_AUTHOR("(c) 1999-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Matrox G200/G400 Matrox MGA-TVO driver");
+MODULE_LICENSE("GPL");
+module_init(matroxfb_maven_init);
+module_exit(matroxfb_maven_exit);
+/* we do not have __setup() yet */
diff --git a/drivers/video/matrox/matroxfb_maven.h b/drivers/video/matrox/matroxfb_maven.h
new file mode 100644
index 0000000..99eddec
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_maven.h
@@ -0,0 +1,20 @@
+#ifndef __MATROXFB_MAVEN_H__
+#define __MATROXFB_MAVEN_H__
+
+#include <linux/ioctl.h>
+#include <linux/i2c.h>
+#include <linux/i2c-algo-bit.h>
+#include "matroxfb_base.h"
+
+struct i2c_bit_adapter {
+ struct i2c_adapter adapter;
+ int initialized;
+ struct i2c_algo_bit_data bac;
+ struct matrox_fb_info* minfo;
+ struct {
+ unsigned int data;
+ unsigned int clock;
+ } mask;
+};
+
+#endif /* __MATROXFB_MAVEN_H__ */
diff --git a/drivers/video/matrox/matroxfb_misc.c b/drivers/video/matrox/matroxfb_misc.c
new file mode 100644
index 0000000..76fd3a5
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_misc.c
@@ -0,0 +1,777 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * MTRR stuff: 1998 Tom Rini <trini@kernel.crashing.org>
+ *
+ * Contributors: "menion?" <menion@mindless.com>
+ * Betatesting, fixes, ideas
+ *
+ * "Kurt Garloff" <garloff@suse.de>
+ * Betatesting, fixes, ideas, videomodes, videomodes timmings
+ *
+ * "Tom Rini" <trini@kernel.crashing.org>
+ * MTRR stuff, PPC cleanups, betatesting, fixes, ideas
+ *
+ * "Bibek Sahu" <scorpio@dodds.net>
+ * Access device through readb|w|l and write b|w|l
+ * Extensive debugging stuff
+ *
+ * "Daniel Haun" <haund@usa.net>
+ * Testing, hardware cursor fixes
+ *
+ * "Scott Wood" <sawst46+@pitt.edu>
+ * Fixes
+ *
+ * "Gerd Knorr" <kraxel@goldbach.isdn.cs.tu-berlin.de>
+ * Betatesting
+ *
+ * "Kelly French" <targon@hazmat.com>
+ * "Fernando Herrera" <fherrera@eurielec.etsit.upm.es>
+ * Betatesting, bug reporting
+ *
+ * "Pablo Bianucci" <pbian@pccp.com.ar>
+ * Fixes, ideas, betatesting
+ *
+ * "Inaky Perez Gonzalez" <inaky@peloncho.fis.ucm.es>
+ * Fixes, enhandcements, ideas, betatesting
+ *
+ * "Ryuichi Oikawa" <roikawa@rr.iiij4u.or.jp>
+ * PPC betatesting, PPC support, backward compatibility
+ *
+ * "Paul Womar" <Paul@pwomar.demon.co.uk>
+ * "Owen Waller" <O.Waller@ee.qub.ac.uk>
+ * PPC betatesting
+ *
+ * "Thomas Pornin" <pornin@bolet.ens.fr>
+ * Alpha betatesting
+ *
+ * "Pieter van Leuven" <pvl@iae.nl>
+ * "Ulf Jaenicke-Roessler" <ujr@physik.phy.tu-dresden.de>
+ * G100 testing
+ *
+ * "H. Peter Arvin" <hpa@transmeta.com>
+ * Ideas
+ *
+ * "Cort Dougan" <cort@cs.nmt.edu>
+ * CHRP fixes and PReP cleanup
+ *
+ * "Mark Vojkovich" <mvojkovi@ucsd.edu>
+ * G400 support
+ *
+ * "David C. Hansen" <haveblue@us.ibm.com>
+ * Fixes
+ *
+ * (following author is not in any relation with this code, but his code
+ * is included in this driver)
+ *
+ * Based on framebuffer driver for VBE 2.0 compliant graphic boards
+ * (c) 1998 Gerd Knorr <kraxel@cs.tu-berlin.de>
+ *
+ * (following author is not in any relation with this code, but his ideas
+ * were used when writting this driver)
+ *
+ * FreeVBE/AF (Matrox), "Shawn Hargreaves" <shawn@talula.demon.co.uk>
+ *
+ */
+
+/* make checkconfig does not check includes for this... */
+#include <linux/config.h>
+
+#include "matroxfb_misc.h"
+#include <linux/interrupt.h>
+#include <linux/matroxfb.h>
+
+void matroxfb_DAC_out(CPMINFO int reg, int val) {
+ DBG_REG(__FUNCTION__)
+ mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
+ mga_outb(M_RAMDAC_BASE+M_X_DATAREG, val);
+}
+
+int matroxfb_DAC_in(CPMINFO int reg) {
+ DBG_REG(__FUNCTION__)
+ mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
+ return mga_inb(M_RAMDAC_BASE+M_X_DATAREG);
+}
+
+void matroxfb_var2my(struct fb_var_screeninfo* var, struct my_timming* mt) {
+ unsigned int pixclock = var->pixclock;
+
+ DBG(__FUNCTION__)
+
+ if (!pixclock) pixclock = 10000; /* 10ns = 100MHz */
+ mt->pixclock = 1000000000 / pixclock;
+ if (mt->pixclock < 1) mt->pixclock = 1;
+ mt->mnp = -1;
+ mt->dblscan = var->vmode & FB_VMODE_DOUBLE;
+ mt->interlaced = var->vmode & FB_VMODE_INTERLACED;
+ mt->HDisplay = var->xres;
+ mt->HSyncStart = mt->HDisplay + var->right_margin;
+ mt->HSyncEnd = mt->HSyncStart + var->hsync_len;
+ mt->HTotal = mt->HSyncEnd + var->left_margin;
+ mt->VDisplay = var->yres;
+ mt->VSyncStart = mt->VDisplay + var->lower_margin;
+ mt->VSyncEnd = mt->VSyncStart + var->vsync_len;
+ mt->VTotal = mt->VSyncEnd + var->upper_margin;
+ mt->sync = var->sync;
+}
+
+int matroxfb_PLL_calcclock(const struct matrox_pll_features* pll, unsigned int freq, unsigned int fmax,
+ unsigned int* in, unsigned int* feed, unsigned int* post) {
+ unsigned int bestdiff = ~0;
+ unsigned int bestvco = 0;
+ unsigned int fxtal = pll->ref_freq;
+ unsigned int fwant;
+ unsigned int p;
+
+ DBG(__FUNCTION__)
+
+ fwant = freq;
+
+#ifdef DEBUG
+ printk(KERN_ERR "post_shift_max: %d\n", pll->post_shift_max);
+ printk(KERN_ERR "ref_freq: %d\n", pll->ref_freq);
+ printk(KERN_ERR "freq: %d\n", freq);
+ printk(KERN_ERR "vco_freq_min: %d\n", pll->vco_freq_min);
+ printk(KERN_ERR "in_div_min: %d\n", pll->in_div_min);
+ printk(KERN_ERR "in_div_max: %d\n", pll->in_div_max);
+ printk(KERN_ERR "feed_div_min: %d\n", pll->feed_div_min);
+ printk(KERN_ERR "feed_div_max: %d\n", pll->feed_div_max);
+ printk(KERN_ERR "fmax: %d\n", fmax);
+#endif
+ for (p = 1; p <= pll->post_shift_max; p++) {
+ if (fwant * 2 > fmax)
+ break;
+ fwant *= 2;
+ }
+ if (fwant < pll->vco_freq_min) fwant = pll->vco_freq_min;
+ if (fwant > fmax) fwant = fmax;
+ for (; p-- > 0; fwant >>= 1, bestdiff >>= 1) {
+ unsigned int m;
+
+ if (fwant < pll->vco_freq_min) break;
+ for (m = pll->in_div_min; m <= pll->in_div_max; m++) {
+ unsigned int diff, fvco;
+ unsigned int n;
+
+ n = (fwant * (m + 1) + (fxtal >> 1)) / fxtal - 1;
+ if (n > pll->feed_div_max)
+ break;
+ if (n < pll->feed_div_min)
+ n = pll->feed_div_min;
+ fvco = (fxtal * (n + 1)) / (m + 1);
+ if (fvco < fwant)
+ diff = fwant - fvco;
+ else
+ diff = fvco - fwant;
+ if (diff < bestdiff) {
+ bestdiff = diff;
+ *post = p;
+ *in = m;
+ *feed = n;
+ bestvco = fvco;
+ }
+ }
+ }
+ dprintk(KERN_ERR "clk: %02X %02X %02X %d %d %d\n", *in, *feed, *post, fxtal, bestvco, fwant);
+ return bestvco;
+}
+
+int matroxfb_vgaHWinit(WPMINFO struct my_timming* m) {
+ unsigned int hd, hs, he, hbe, ht;
+ unsigned int vd, vs, ve, vt, lc;
+ unsigned int wd;
+ unsigned int divider;
+ int i;
+ int fwidth;
+ struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+
+ fwidth = 8;
+
+ DBG(__FUNCTION__)
+
+ hw->SEQ[0] = 0x00;
+ if (fwidth == 9)
+ hw->SEQ[1] = 0x00;
+ else
+ hw->SEQ[1] = 0x01; /* or 0x09 */
+ hw->SEQ[2] = 0x0F; /* bitplanes */
+ hw->SEQ[3] = 0x00;
+ hw->SEQ[4] = 0x0E;
+ /* CRTC 0..7, 9, 16..19, 21, 22 are reprogrammed by Matrox Millennium code... Hope that by MGA1064 too */
+ if (m->dblscan) {
+ m->VTotal <<= 1;
+ m->VDisplay <<= 1;
+ m->VSyncStart <<= 1;
+ m->VSyncEnd <<= 1;
+ }
+ if (m->interlaced) {
+ m->VTotal >>= 1;
+ m->VDisplay >>= 1;
+ m->VSyncStart >>= 1;
+ m->VSyncEnd >>= 1;
+ }
+
+ /* GCTL is ignored when not using 0xA0000 aperture */
+ hw->GCTL[0] = 0x00;
+ hw->GCTL[1] = 0x00;
+ hw->GCTL[2] = 0x00;
+ hw->GCTL[3] = 0x00;
+ hw->GCTL[4] = 0x00;
+ hw->GCTL[5] = 0x40;
+ hw->GCTL[6] = 0x05;
+ hw->GCTL[7] = 0x0F;
+ hw->GCTL[8] = 0xFF;
+
+ /* Whole ATTR is ignored in PowerGraphics mode */
+ for (i = 0; i < 16; i++)
+ hw->ATTR[i] = i;
+ hw->ATTR[16] = 0x41;
+ hw->ATTR[17] = 0xFF;
+ hw->ATTR[18] = 0x0F;
+ if (fwidth == 9)
+ hw->ATTR[19] = 0x08;
+ else
+ hw->ATTR[19] = 0x00;
+ hw->ATTR[20] = 0x00;
+
+ hd = m->HDisplay >> 3;
+ hs = m->HSyncStart >> 3;
+ he = m->HSyncEnd >> 3;
+ ht = m->HTotal >> 3;
+ /* standard timmings are in 8pixels, but for interleaved we cannot */
+ /* do it for 4bpp (because of (4bpp >> 1(interleaved))/4 == 0) */
+ /* using 16 or more pixels per unit can save us */
+ divider = ACCESS_FBINFO(curr.final_bppShift);
+ while (divider & 3) {
+ hd >>= 1;
+ hs >>= 1;
+ he >>= 1;
+ ht >>= 1;
+ divider <<= 1;
+ }
+ divider = divider / 4;
+ /* divider can be from 1 to 8 */
+ while (divider > 8) {
+ hd <<= 1;
+ hs <<= 1;
+ he <<= 1;
+ ht <<= 1;
+ divider >>= 1;
+ }
+ hd = hd - 1;
+ hs = hs - 1;
+ he = he - 1;
+ ht = ht - 1;
+ vd = m->VDisplay - 1;
+ vs = m->VSyncStart - 1;
+ ve = m->VSyncEnd - 1;
+ vt = m->VTotal - 2;
+ lc = vd;
+ /* G200 cannot work with (ht & 7) == 6 */
+ if (((ht & 0x07) == 0x06) || ((ht & 0x0F) == 0x04))
+ ht++;
+ hbe = ht;
+ wd = ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(curr.final_bppShift) / 64;
+
+ hw->CRTCEXT[0] = 0;
+ hw->CRTCEXT[5] = 0;
+ if (m->interlaced) {
+ hw->CRTCEXT[0] = 0x80;
+ hw->CRTCEXT[5] = (hs + he - ht) >> 1;
+ if (!m->dblscan)
+ wd <<= 1;
+ vt &= ~1;
+ }
+ hw->CRTCEXT[0] |= (wd & 0x300) >> 4;
+ hw->CRTCEXT[1] = (((ht - 4) & 0x100) >> 8) |
+ ((hd & 0x100) >> 7) | /* blanking */
+ ((hs & 0x100) >> 6) | /* sync start */
+ (hbe & 0x040); /* end hor. blanking */
+ /* FIXME: Enable vidrst only on G400, and only if TV-out is used */
+ if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1)
+ hw->CRTCEXT[1] |= 0x88; /* enable horizontal and vertical vidrst */
+ hw->CRTCEXT[2] = ((vt & 0xC00) >> 10) |
+ ((vd & 0x400) >> 8) | /* disp end */
+ ((vd & 0xC00) >> 7) | /* vblanking start */
+ ((vs & 0xC00) >> 5) |
+ ((lc & 0x400) >> 3);
+ hw->CRTCEXT[3] = (divider - 1) | 0x80;
+ hw->CRTCEXT[4] = 0;
+
+ hw->CRTC[0] = ht-4;
+ hw->CRTC[1] = hd;
+ hw->CRTC[2] = hd;
+ hw->CRTC[3] = (hbe & 0x1F) | 0x80;
+ hw->CRTC[4] = hs;
+ hw->CRTC[5] = ((hbe & 0x20) << 2) | (he & 0x1F);
+ hw->CRTC[6] = vt & 0xFF;
+ hw->CRTC[7] = ((vt & 0x100) >> 8) |
+ ((vd & 0x100) >> 7) |
+ ((vs & 0x100) >> 6) |
+ ((vd & 0x100) >> 5) |
+ ((lc & 0x100) >> 4) |
+ ((vt & 0x200) >> 4) |
+ ((vd & 0x200) >> 3) |
+ ((vs & 0x200) >> 2);
+ hw->CRTC[8] = 0x00;
+ hw->CRTC[9] = ((vd & 0x200) >> 4) |
+ ((lc & 0x200) >> 3);
+ if (m->dblscan && !m->interlaced)
+ hw->CRTC[9] |= 0x80;
+ for (i = 10; i < 16; i++)
+ hw->CRTC[i] = 0x00;
+ hw->CRTC[16] = vs /* & 0xFF */;
+ hw->CRTC[17] = (ve & 0x0F) | 0x20;
+ hw->CRTC[18] = vd /* & 0xFF */;
+ hw->CRTC[19] = wd /* & 0xFF */;
+ hw->CRTC[20] = 0x00;
+ hw->CRTC[21] = vd /* & 0xFF */;
+ hw->CRTC[22] = (vt + 1) /* & 0xFF */;
+ hw->CRTC[23] = 0xC3;
+ hw->CRTC[24] = lc;
+ return 0;
+};
+
+void matroxfb_vgaHWrestore(WPMINFO2) {
+ int i;
+ struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+ CRITFLAGS
+
+ DBG(__FUNCTION__)
+
+ dprintk(KERN_INFO "MiscOutReg: %02X\n", hw->MiscOutReg);
+ dprintk(KERN_INFO "SEQ regs: ");
+ for (i = 0; i < 5; i++)
+ dprintk("%02X:", hw->SEQ[i]);
+ dprintk("\n");
+ dprintk(KERN_INFO "GDC regs: ");
+ for (i = 0; i < 9; i++)
+ dprintk("%02X:", hw->GCTL[i]);
+ dprintk("\n");
+ dprintk(KERN_INFO "CRTC regs: ");
+ for (i = 0; i < 25; i++)
+ dprintk("%02X:", hw->CRTC[i]);
+ dprintk("\n");
+ dprintk(KERN_INFO "ATTR regs: ");
+ for (i = 0; i < 21; i++)
+ dprintk("%02X:", hw->ATTR[i]);
+ dprintk("\n");
+
+ CRITBEGIN
+
+ mga_inb(M_ATTR_RESET);
+ mga_outb(M_ATTR_INDEX, 0);
+ mga_outb(M_MISC_REG, hw->MiscOutReg);
+ for (i = 1; i < 5; i++)
+ mga_setr(M_SEQ_INDEX, i, hw->SEQ[i]);
+ mga_setr(M_CRTC_INDEX, 17, hw->CRTC[17] & 0x7F);
+ for (i = 0; i < 25; i++)
+ mga_setr(M_CRTC_INDEX, i, hw->CRTC[i]);
+ for (i = 0; i < 9; i++)
+ mga_setr(M_GRAPHICS_INDEX, i, hw->GCTL[i]);
+ for (i = 0; i < 21; i++) {
+ mga_inb(M_ATTR_RESET);
+ mga_outb(M_ATTR_INDEX, i);
+ mga_outb(M_ATTR_INDEX, hw->ATTR[i]);
+ }
+ mga_outb(M_PALETTE_MASK, 0xFF);
+ mga_outb(M_DAC_REG, 0x00);
+ for (i = 0; i < 768; i++)
+ mga_outb(M_DAC_VAL, hw->DACpal[i]);
+ mga_inb(M_ATTR_RESET);
+ mga_outb(M_ATTR_INDEX, 0x20);
+
+ CRITEND
+}
+
+static void get_pins(unsigned char __iomem* pins, struct matrox_bios* bd) {
+ unsigned int b0 = readb(pins);
+
+ if (b0 == 0x2E && readb(pins+1) == 0x41) {
+ unsigned int pins_len = readb(pins+2);
+ unsigned int i;
+ unsigned char cksum;
+ unsigned char* dst = bd->pins;
+
+ if (pins_len < 3 || pins_len > 128) {
+ return;
+ }
+ *dst++ = 0x2E;
+ *dst++ = 0x41;
+ *dst++ = pins_len;
+ cksum = 0x2E + 0x41 + pins_len;
+ for (i = 3; i < pins_len; i++) {
+ cksum += *dst++ = readb(pins+i);
+ }
+ if (cksum) {
+ return;
+ }
+ bd->pins_len = pins_len;
+ } else if (b0 == 0x40 && readb(pins+1) == 0x00) {
+ unsigned int i;
+ unsigned char* dst = bd->pins;
+
+ *dst++ = 0x40;
+ *dst++ = 0;
+ for (i = 2; i < 0x40; i++) {
+ *dst++ = readb(pins+i);
+ }
+ bd->pins_len = 0x40;
+ }
+}
+
+static void get_bios_version(unsigned char __iomem * vbios, struct matrox_bios* bd) {
+ unsigned int pcir_offset;
+
+ pcir_offset = readb(vbios + 24) | (readb(vbios + 25) << 8);
+ if (pcir_offset >= 26 && pcir_offset < 0xFFE0 &&
+ readb(vbios + pcir_offset ) == 'P' &&
+ readb(vbios + pcir_offset + 1) == 'C' &&
+ readb(vbios + pcir_offset + 2) == 'I' &&
+ readb(vbios + pcir_offset + 3) == 'R') {
+ unsigned char h;
+
+ h = readb(vbios + pcir_offset + 0x12);
+ bd->version.vMaj = (h >> 4) & 0xF;
+ bd->version.vMin = h & 0xF;
+ bd->version.vRev = readb(vbios + pcir_offset + 0x13);
+ } else {
+ unsigned char h;
+
+ h = readb(vbios + 5);
+ bd->version.vMaj = (h >> 4) & 0xF;
+ bd->version.vMin = h & 0xF;
+ bd->version.vRev = 0;
+ }
+}
+
+static void get_bios_output(unsigned char __iomem* vbios, struct matrox_bios* bd) {
+ unsigned char b;
+
+ b = readb(vbios + 0x7FF1);
+ if (b == 0xFF) {
+ b = 0;
+ }
+ bd->output.state = b;
+}
+
+static void get_bios_tvout(unsigned char __iomem* vbios, struct matrox_bios* bd) {
+ unsigned int i;
+
+ /* Check for 'IBM .*(V....TVO' string - it means TVO BIOS */
+ bd->output.tvout = 0;
+ if (readb(vbios + 0x1D) != 'I' ||
+ readb(vbios + 0x1E) != 'B' ||
+ readb(vbios + 0x1F) != 'M' ||
+ readb(vbios + 0x20) != ' ') {
+ return;
+ }
+ for (i = 0x2D; i < 0x2D + 128; i++) {
+ unsigned char b = readb(vbios + i);
+
+ if (b == '(' && readb(vbios + i + 1) == 'V') {
+ if (readb(vbios + i + 6) == 'T' &&
+ readb(vbios + i + 7) == 'V' &&
+ readb(vbios + i + 8) == 'O') {
+ bd->output.tvout = 1;
+ }
+ return;
+ }
+ if (b == 0)
+ break;
+ }
+}
+
+static void parse_bios(unsigned char __iomem* vbios, struct matrox_bios* bd) {
+ unsigned int pins_offset;
+
+ if (readb(vbios) != 0x55 || readb(vbios + 1) != 0xAA) {
+ return;
+ }
+ bd->bios_valid = 1;
+ get_bios_version(vbios, bd);
+ get_bios_output(vbios, bd);
+ get_bios_tvout(vbios, bd);
+ pins_offset = readb(vbios + 0x7FFC) | (readb(vbios + 0x7FFD) << 8);
+ if (pins_offset <= 0xFF80) {
+ get_pins(vbios + pins_offset, bd);
+ }
+}
+
+#define get_u16(x) (le16_to_cpu(get_unaligned((__u16*)(x))))
+#define get_u32(x) (le32_to_cpu(get_unaligned((__u32*)(x))))
+static int parse_pins1(WPMINFO const struct matrox_bios* bd) {
+ unsigned int maxdac;
+
+ switch (bd->pins[22]) {
+ case 0: maxdac = 175000; break;
+ case 1: maxdac = 220000; break;
+ default: maxdac = 240000; break;
+ }
+ if (get_u16(bd->pins + 24)) {
+ maxdac = get_u16(bd->pins + 24) * 10;
+ }
+ MINFO->limits.pixel.vcomax = maxdac;
+ MINFO->values.pll.system = get_u16(bd->pins + 28) ? get_u16(bd->pins + 28) * 10 : 50000;
+ /* ignore 4MB, 8MB, module clocks */
+ MINFO->features.pll.ref_freq = 14318;
+ MINFO->values.reg.mctlwtst = 0x00030101;
+ return 0;
+}
+
+static void default_pins1(WPMINFO2) {
+ /* Millennium */
+ MINFO->limits.pixel.vcomax = 220000;
+ MINFO->values.pll.system = 50000;
+ MINFO->features.pll.ref_freq = 14318;
+ MINFO->values.reg.mctlwtst = 0x00030101;
+}
+
+static int parse_pins2(WPMINFO const struct matrox_bios* bd) {
+ MINFO->limits.pixel.vcomax =
+ MINFO->limits.system.vcomax = (bd->pins[41] == 0xFF) ? 230000 : ((bd->pins[41] + 100) * 1000);
+ MINFO->values.reg.mctlwtst = ((bd->pins[51] & 0x01) ? 0x00000001 : 0) |
+ ((bd->pins[51] & 0x02) ? 0x00000100 : 0) |
+ ((bd->pins[51] & 0x04) ? 0x00010000 : 0) |
+ ((bd->pins[51] & 0x08) ? 0x00020000 : 0);
+ MINFO->values.pll.system = (bd->pins[43] == 0xFF) ? 50000 : ((bd->pins[43] + 100) * 1000);
+ MINFO->features.pll.ref_freq = 14318;
+ return 0;
+}
+
+static void default_pins2(WPMINFO2) {
+ /* Millennium II, Mystique */
+ MINFO->limits.pixel.vcomax =
+ MINFO->limits.system.vcomax = 230000;
+ MINFO->values.reg.mctlwtst = 0x00030101;
+ MINFO->values.pll.system = 50000;
+ MINFO->features.pll.ref_freq = 14318;
+}
+
+static int parse_pins3(WPMINFO const struct matrox_bios* bd) {
+ MINFO->limits.pixel.vcomax =
+ MINFO->limits.system.vcomax = (bd->pins[36] == 0xFF) ? 230000 : ((bd->pins[36] + 100) * 1000);
+ MINFO->values.reg.mctlwtst = get_u32(bd->pins + 48) == 0xFFFFFFFF ? 0x01250A21 : get_u32(bd->pins + 48);
+ /* memory config */
+ MINFO->values.reg.memrdbk = ((bd->pins[57] << 21) & 0x1E000000) |
+ ((bd->pins[57] << 22) & 0x00C00000) |
+ ((bd->pins[56] << 1) & 0x000001E0) |
+ ( bd->pins[56] & 0x0000000F);
+ MINFO->values.reg.opt = (bd->pins[54] & 7) << 10;
+ MINFO->values.reg.opt2 = bd->pins[58] << 12;
+ MINFO->features.pll.ref_freq = (bd->pins[52] & 0x20) ? 14318 : 27000;
+ return 0;
+}
+
+static void default_pins3(WPMINFO2) {
+ /* G100, G200 */
+ MINFO->limits.pixel.vcomax =
+ MINFO->limits.system.vcomax = 230000;
+ MINFO->values.reg.mctlwtst = 0x01250A21;
+ MINFO->values.reg.memrdbk = 0x00000000;
+ MINFO->values.reg.opt = 0x00000C00;
+ MINFO->values.reg.opt2 = 0x00000000;
+ MINFO->features.pll.ref_freq = 27000;
+}
+
+static int parse_pins4(WPMINFO const struct matrox_bios* bd) {
+ MINFO->limits.pixel.vcomax = (bd->pins[ 39] == 0xFF) ? 230000 : bd->pins[ 39] * 4000;
+ MINFO->limits.system.vcomax = (bd->pins[ 38] == 0xFF) ? MINFO->limits.pixel.vcomax : bd->pins[ 38] * 4000;
+ MINFO->values.reg.mctlwtst = get_u32(bd->pins + 71);
+ MINFO->values.reg.memrdbk = ((bd->pins[87] << 21) & 0x1E000000) |
+ ((bd->pins[87] << 22) & 0x00C00000) |
+ ((bd->pins[86] << 1) & 0x000001E0) |
+ ( bd->pins[86] & 0x0000000F);
+ MINFO->values.reg.opt = ((bd->pins[53] << 15) & 0x00400000) |
+ ((bd->pins[53] << 22) & 0x10000000) |
+ ((bd->pins[53] << 7) & 0x00001C00);
+ MINFO->values.reg.opt3 = get_u32(bd->pins + 67);
+ MINFO->values.pll.system = (bd->pins[ 65] == 0xFF) ? 200000 : bd->pins[ 65] * 4000;
+ MINFO->features.pll.ref_freq = (bd->pins[ 92] & 0x01) ? 14318 : 27000;
+ return 0;
+}
+
+static void default_pins4(WPMINFO2) {
+ /* G400 */
+ MINFO->limits.pixel.vcomax =
+ MINFO->limits.system.vcomax = 252000;
+ MINFO->values.reg.mctlwtst = 0x04A450A1;
+ MINFO->values.reg.memrdbk = 0x000000E7;
+ MINFO->values.reg.opt = 0x10000400;
+ MINFO->values.reg.opt3 = 0x0190A419;
+ MINFO->values.pll.system = 200000;
+ MINFO->features.pll.ref_freq = 27000;
+}
+
+static int parse_pins5(WPMINFO const struct matrox_bios* bd) {
+ unsigned int mult;
+
+ mult = bd->pins[4]?8000:6000;
+
+ MINFO->limits.pixel.vcomax = (bd->pins[ 38] == 0xFF) ? 600000 : bd->pins[ 38] * mult;
+ MINFO->limits.system.vcomax = (bd->pins[ 36] == 0xFF) ? MINFO->limits.pixel.vcomax : bd->pins[ 36] * mult;
+ MINFO->limits.video.vcomax = (bd->pins[ 37] == 0xFF) ? MINFO->limits.system.vcomax : bd->pins[ 37] * mult;
+ MINFO->limits.pixel.vcomin = (bd->pins[123] == 0xFF) ? 256000 : bd->pins[123] * mult;
+ MINFO->limits.system.vcomin = (bd->pins[121] == 0xFF) ? MINFO->limits.pixel.vcomin : bd->pins[121] * mult;
+ MINFO->limits.video.vcomin = (bd->pins[122] == 0xFF) ? MINFO->limits.system.vcomin : bd->pins[122] * mult;
+ MINFO->values.pll.system =
+ MINFO->values.pll.video = (bd->pins[ 92] == 0xFF) ? 284000 : bd->pins[ 92] * 4000;
+ MINFO->values.reg.opt = get_u32(bd->pins+ 48);
+ MINFO->values.reg.opt2 = get_u32(bd->pins+ 52);
+ MINFO->values.reg.opt3 = get_u32(bd->pins+ 94);
+ MINFO->values.reg.mctlwtst = get_u32(bd->pins+ 98);
+ MINFO->values.reg.memmisc = get_u32(bd->pins+102);
+ MINFO->values.reg.memrdbk = get_u32(bd->pins+106);
+ MINFO->features.pll.ref_freq = (bd->pins[110] & 0x01) ? 14318 : 27000;
+ MINFO->values.memory.ddr = (bd->pins[114] & 0x60) == 0x20;
+ MINFO->values.memory.dll = (bd->pins[115] & 0x02) != 0;
+ MINFO->values.memory.emrswen = (bd->pins[115] & 0x01) != 0;
+ MINFO->values.reg.maccess = MINFO->values.memory.emrswen ? 0x00004000 : 0x00000000;
+ if (bd->pins[115] & 4) {
+ MINFO->values.reg.mctlwtst_core = MINFO->values.reg.mctlwtst;
+ } else {
+ u_int32_t wtst_xlat[] = { 0, 1, 5, 6, 7, 5, 2, 3 };
+ MINFO->values.reg.mctlwtst_core = (MINFO->values.reg.mctlwtst & ~7) |
+ wtst_xlat[MINFO->values.reg.mctlwtst & 7];
+ }
+ return 0;
+}
+
+static void default_pins5(WPMINFO2) {
+ /* Mine 16MB G450 with SDRAM DDR */
+ MINFO->limits.pixel.vcomax =
+ MINFO->limits.system.vcomax =
+ MINFO->limits.video.vcomax = 600000;
+ MINFO->limits.pixel.vcomin =
+ MINFO->limits.system.vcomin =
+ MINFO->limits.video.vcomin = 256000;
+ MINFO->values.pll.system =
+ MINFO->values.pll.video = 284000;
+ MINFO->values.reg.opt = 0x404A1160;
+ MINFO->values.reg.opt2 = 0x0000AC00;
+ MINFO->values.reg.opt3 = 0x0090A409;
+ MINFO->values.reg.mctlwtst_core =
+ MINFO->values.reg.mctlwtst = 0x0C81462B;
+ MINFO->values.reg.memmisc = 0x80000004;
+ MINFO->values.reg.memrdbk = 0x01001103;
+ MINFO->features.pll.ref_freq = 27000;
+ MINFO->values.memory.ddr = 1;
+ MINFO->values.memory.dll = 1;
+ MINFO->values.memory.emrswen = 1;
+ MINFO->values.reg.maccess = 0x00004000;
+}
+
+static int matroxfb_set_limits(WPMINFO const struct matrox_bios* bd) {
+ unsigned int pins_version;
+ static const unsigned int pinslen[] = { 64, 64, 64, 128, 128 };
+
+ switch (ACCESS_FBINFO(chip)) {
+ case MGA_2064: default_pins1(PMINFO2); break;
+ case MGA_2164:
+ case MGA_1064:
+ case MGA_1164: default_pins2(PMINFO2); break;
+ case MGA_G100:
+ case MGA_G200: default_pins3(PMINFO2); break;
+ case MGA_G400: default_pins4(PMINFO2); break;
+ case MGA_G450:
+ case MGA_G550: default_pins5(PMINFO2); break;
+ }
+ if (!bd->bios_valid) {
+ printk(KERN_INFO "matroxfb: Your Matrox device does not have BIOS\n");
+ return -1;
+ }
+ if (bd->pins_len < 64) {
+ printk(KERN_INFO "matroxfb: BIOS on your Matrox device does not contain powerup info\n");
+ return -1;
+ }
+ if (bd->pins[0] == 0x2E && bd->pins[1] == 0x41) {
+ pins_version = bd->pins[5];
+ if (pins_version < 2 || pins_version > 5) {
+ printk(KERN_INFO "matroxfb: Unknown version (%u) of powerup info\n", pins_version);
+ return -1;
+ }
+ } else {
+ pins_version = 1;
+ }
+ if (bd->pins_len != pinslen[pins_version - 1]) {
+ printk(KERN_INFO "matroxfb: Invalid powerup info\n");
+ return -1;
+ }
+ switch (pins_version) {
+ case 1:
+ return parse_pins1(PMINFO bd);
+ case 2:
+ return parse_pins2(PMINFO bd);
+ case 3:
+ return parse_pins3(PMINFO bd);
+ case 4:
+ return parse_pins4(PMINFO bd);
+ case 5:
+ return parse_pins5(PMINFO bd);
+ default:
+ printk(KERN_DEBUG "matroxfb: Powerup info version %u is not yet supported\n", pins_version);
+ return -1;
+ }
+}
+
+void matroxfb_read_pins(WPMINFO2) {
+ u32 opt;
+ u32 biosbase;
+ u32 fbbase;
+ struct pci_dev* pdev = ACCESS_FBINFO(pcidev);
+
+ memset(&ACCESS_FBINFO(bios), 0, sizeof(ACCESS_FBINFO(bios)));
+ pci_read_config_dword(pdev, PCI_OPTION_REG, &opt);
+ pci_write_config_dword(pdev, PCI_OPTION_REG, opt | PCI_OPTION_ENABLE_ROM);
+ pci_read_config_dword(pdev, PCI_ROM_ADDRESS, &biosbase);
+ pci_read_config_dword(pdev, ACCESS_FBINFO(devflags.fbResource), &fbbase);
+ pci_write_config_dword(pdev, PCI_ROM_ADDRESS, (fbbase & PCI_ROM_ADDRESS_MASK) | PCI_ROM_ADDRESS_ENABLE);
+ parse_bios(vaddr_va(ACCESS_FBINFO(video).vbase), &ACCESS_FBINFO(bios));
+ pci_write_config_dword(pdev, PCI_ROM_ADDRESS, biosbase);
+ pci_write_config_dword(pdev, PCI_OPTION_REG, opt);
+#ifdef CONFIG_X86
+ if (!ACCESS_FBINFO(bios).bios_valid) {
+ unsigned char __iomem* b;
+
+ b = ioremap(0x000C0000, 65536);
+ if (!b) {
+ printk(KERN_INFO "matroxfb: Unable to map legacy BIOS\n");
+ } else {
+ unsigned int ven = readb(b+0x64+0) | (readb(b+0x64+1) << 8);
+ unsigned int dev = readb(b+0x64+2) | (readb(b+0x64+3) << 8);
+
+ if (ven != pdev->vendor || dev != pdev->device) {
+ printk(KERN_INFO "matroxfb: Legacy BIOS is for %04X:%04X, while this device is %04X:%04X\n",
+ ven, dev, pdev->vendor, pdev->device);
+ } else {
+ parse_bios(b, &ACCESS_FBINFO(bios));
+ }
+ iounmap(b);
+ }
+ }
+#endif
+ matroxfb_set_limits(PMINFO &ACCESS_FBINFO(bios));
+}
+
+EXPORT_SYMBOL(matroxfb_DAC_in);
+EXPORT_SYMBOL(matroxfb_DAC_out);
+EXPORT_SYMBOL(matroxfb_var2my);
+EXPORT_SYMBOL(matroxfb_PLL_calcclock);
+#ifndef CONFIG_FB_MATROX_MULTIHEAD
+struct matrox_fb_info matroxfb_global_mxinfo;
+EXPORT_SYMBOL(matroxfb_global_mxinfo);
+#endif
+EXPORT_SYMBOL(matroxfb_vgaHWinit); /* DAC1064, Ti3026 */
+EXPORT_SYMBOL(matroxfb_vgaHWrestore); /* DAC1064, Ti3026 */
+EXPORT_SYMBOL(matroxfb_read_pins);
+
+MODULE_AUTHOR("(c) 1999-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Miscellaneous support for Matrox video cards");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_misc.h b/drivers/video/matrox/matroxfb_misc.h
new file mode 100644
index 0000000..cb62cc0
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_misc.h
@@ -0,0 +1,18 @@
+#ifndef __MATROXFB_MISC_H__
+#define __MATROXFB_MISC_H__
+
+#include "matroxfb_base.h"
+
+/* also for modules */
+int matroxfb_PLL_calcclock(const struct matrox_pll_features* pll, unsigned int freq, unsigned int fmax,
+ unsigned int* in, unsigned int* feed, unsigned int* post);
+static inline int PLL_calcclock(CPMINFO unsigned int freq, unsigned int fmax,
+ unsigned int* in, unsigned int* feed, unsigned int* post) {
+ return matroxfb_PLL_calcclock(&ACCESS_FBINFO(features.pll), freq, fmax, in, feed, post);
+}
+
+int matroxfb_vgaHWinit(WPMINFO struct my_timming* m);
+void matroxfb_vgaHWrestore(WPMINFO2);
+void matroxfb_read_pins(WPMINFO2);
+
+#endif /* __MATROXFB_MISC_H__ */