Merge git://git.kernel.org/pub/scm/linux/kernel/git/gregkh/usb-2.6
* git://git.kernel.org/pub/scm/linux/kernel/git/gregkh/usb-2.6: (142 commits)
USB: Fix sysfs paths in documentation
USB: skeleton: fix coding style issues.
USB: O_NONBLOCK in read path of skeleton
USB: make usb-skeleton honor O_NONBLOCK in write path
USB: skel_read really sucks royally
USB: Add hub descriptor update hook for xHCI
USB: xhci: Support USB hubs.
USB: xhci: Set multi-TT field for LS/FS devices under hubs.
USB: xhci: Set route string for all devices.
USB: xhci: Fix command wait list handling.
USB: xhci: Change how xHCI commands are handled.
USB: xhci: Refactor input device context setup.
USB: xhci: Endpoint representation refactoring.
USB: gadget: ether needs to select CRC32
USB: fix USBTMC get_capabilities success handling
USB: fix missing error check in probing
USB: usbfs: add USBDEVFS_URB_BULK_CONTINUATION flag
USB: support for autosuspend in sierra while online
USB: ehci-dbgp,ehci: Allow dbpg to work with suspend/resume
USB: ehci-dbgp,documentation: Documentation updates for ehci-dbgp
...
diff --git a/Documentation/ABI/testing/sysfs-gpio b/Documentation/ABI/testing/sysfs-gpio
index 8aab809..80f4c94 100644
--- a/Documentation/ABI/testing/sysfs-gpio
+++ b/Documentation/ABI/testing/sysfs-gpio
@@ -19,6 +19,7 @@
/gpioN ... for each exported GPIO #N
/value ... always readable, writes fail for input GPIOs
/direction ... r/w as: in, out (default low); write: high, low
+ /edge ... r/w as: none, falling, rising, both
/gpiochipN ... for each gpiochip; #N is its first GPIO
/base ... (r/o) same as N
/label ... (r/o) descriptive, not necessarily unique
diff --git a/Documentation/accounting/getdelays.c b/Documentation/accounting/getdelays.c
index aa73e72..6e25c26 100644
--- a/Documentation/accounting/getdelays.c
+++ b/Documentation/accounting/getdelays.c
@@ -116,7 +116,7 @@
}
-int send_cmd(int sd, __u16 nlmsg_type, __u32 nlmsg_pid,
+static int send_cmd(int sd, __u16 nlmsg_type, __u32 nlmsg_pid,
__u8 genl_cmd, __u16 nla_type,
void *nla_data, int nla_len)
{
@@ -160,7 +160,7 @@
* Probe the controller in genetlink to find the family id
* for the TASKSTATS family
*/
-int get_family_id(int sd)
+static int get_family_id(int sd)
{
struct {
struct nlmsghdr n;
@@ -190,7 +190,7 @@
return id;
}
-void print_delayacct(struct taskstats *t)
+static void print_delayacct(struct taskstats *t)
{
printf("\n\nCPU %15s%15s%15s%15s\n"
" %15llu%15llu%15llu%15llu\n"
@@ -216,7 +216,7 @@
(unsigned long long)t->freepages_delay_total);
}
-void task_context_switch_counts(struct taskstats *t)
+static void task_context_switch_counts(struct taskstats *t)
{
printf("\n\nTask %15s%15s\n"
" %15llu%15llu\n",
@@ -224,7 +224,7 @@
(unsigned long long)t->nvcsw, (unsigned long long)t->nivcsw);
}
-void print_cgroupstats(struct cgroupstats *c)
+static void print_cgroupstats(struct cgroupstats *c)
{
printf("sleeping %llu, blocked %llu, running %llu, stopped %llu, "
"uninterruptible %llu\n", (unsigned long long)c->nr_sleeping,
@@ -235,7 +235,7 @@
}
-void print_ioacct(struct taskstats *t)
+static void print_ioacct(struct taskstats *t)
{
printf("%s: read=%llu, write=%llu, cancelled_write=%llu\n",
t->ac_comm,
diff --git a/Documentation/auxdisplay/cfag12864b-example.c b/Documentation/auxdisplay/cfag12864b-example.c
index 2caeea5..1d2c010 100644
--- a/Documentation/auxdisplay/cfag12864b-example.c
+++ b/Documentation/auxdisplay/cfag12864b-example.c
@@ -62,7 +62,7 @@
* Unable to open: return = -1
* Unable to mmap: return = -2
*/
-int cfag12864b_init(char *path)
+static int cfag12864b_init(char *path)
{
cfag12864b_fd = open(path, O_RDWR);
if (cfag12864b_fd == -1)
@@ -81,7 +81,7 @@
/*
* exit a cfag12864b framebuffer device
*/
-void cfag12864b_exit(void)
+static void cfag12864b_exit(void)
{
munmap(cfag12864b_mem, CFAG12864B_SIZE);
close(cfag12864b_fd);
@@ -90,7 +90,7 @@
/*
* set (x, y) pixel
*/
-void cfag12864b_set(unsigned char x, unsigned char y)
+static void cfag12864b_set(unsigned char x, unsigned char y)
{
if (CFAG12864B_CHECK(x, y))
cfag12864b_buffer[CFAG12864B_ADDRESS(x, y)] |=
@@ -100,7 +100,7 @@
/*
* unset (x, y) pixel
*/
-void cfag12864b_unset(unsigned char x, unsigned char y)
+static void cfag12864b_unset(unsigned char x, unsigned char y)
{
if (CFAG12864B_CHECK(x, y))
cfag12864b_buffer[CFAG12864B_ADDRESS(x, y)] &=
@@ -113,7 +113,7 @@
* Pixel off: return = 0
* Pixel on: return = 1
*/
-unsigned char cfag12864b_isset(unsigned char x, unsigned char y)
+static unsigned char cfag12864b_isset(unsigned char x, unsigned char y)
{
if (CFAG12864B_CHECK(x, y))
if (cfag12864b_buffer[CFAG12864B_ADDRESS(x, y)] &
@@ -126,7 +126,7 @@
/*
* not (x, y) pixel
*/
-void cfag12864b_not(unsigned char x, unsigned char y)
+static void cfag12864b_not(unsigned char x, unsigned char y)
{
if (cfag12864b_isset(x, y))
cfag12864b_unset(x, y);
@@ -137,7 +137,7 @@
/*
* fill (set all pixels)
*/
-void cfag12864b_fill(void)
+static void cfag12864b_fill(void)
{
unsigned short i;
@@ -148,7 +148,7 @@
/*
* clear (unset all pixels)
*/
-void cfag12864b_clear(void)
+static void cfag12864b_clear(void)
{
unsigned short i;
@@ -162,7 +162,7 @@
* Pixel off: src[i] = 0
* Pixel on: src[i] > 0
*/
-void cfag12864b_format(unsigned char * matrix)
+static void cfag12864b_format(unsigned char * matrix)
{
unsigned char i, j, n;
@@ -182,7 +182,7 @@
/*
* blit buffer to lcd
*/
-void cfag12864b_blit(void)
+static void cfag12864b_blit(void)
{
memcpy(cfag12864b_mem, cfag12864b_buffer, CFAG12864B_SIZE);
}
@@ -198,7 +198,7 @@
#define EXAMPLES 6
-void example(unsigned char n)
+static void example(unsigned char n)
{
unsigned short i, j;
unsigned char matrix[CFAG12864B_WIDTH * CFAG12864B_HEIGHT];
diff --git a/Documentation/fb/ep93xx-fb.txt b/Documentation/fb/ep93xx-fb.txt
new file mode 100644
index 0000000..5af1bd9
--- /dev/null
+++ b/Documentation/fb/ep93xx-fb.txt
@@ -0,0 +1,135 @@
+================================
+Driver for EP93xx LCD controller
+================================
+
+The EP93xx LCD controller can drive both standard desktop monitors and
+embedded LCD displays. If you have a standard desktop monitor then you
+can use the standard Linux video mode database. In your board file:
+
+ static struct ep93xxfb_mach_info some_board_fb_info = {
+ .num_modes = EP93XXFB_USE_MODEDB,
+ .bpp = 16,
+ };
+
+If you have an embedded LCD display then you need to define a video
+mode for it as follows:
+
+ static struct fb_videomode some_board_video_modes[] = {
+ {
+ .name = "some_lcd_name",
+ /* Pixel clock, porches, etc */
+ },
+ };
+
+Note that the pixel clock value is in pico-seconds. You can use the
+KHZ2PICOS macro to convert the pixel clock value. Most other values
+are in pixel clocks. See Documentation/fb/framebuffer.txt for further
+details.
+
+The ep93xxfb_mach_info structure for your board should look like the
+following:
+
+ static struct ep93xxfb_mach_info some_board_fb_info = {
+ .num_modes = ARRAY_SIZE(some_board_video_modes),
+ .modes = some_board_video_modes,
+ .default_mode = &some_board_video_modes[0],
+ .bpp = 16,
+ };
+
+The framebuffer device can be registered by adding the following to
+your board initialisation function:
+
+ ep93xx_register_fb(&some_board_fb_info);
+
+=====================
+Video Attribute Flags
+=====================
+
+The ep93xxfb_mach_info structure has a flags field which can be used
+to configure the controller. The video attributes flags are fully
+documented in section 7 of the EP93xx users' guide. The following
+flags are available:
+
+EP93XXFB_PCLK_FALLING Clock data on the falling edge of the
+ pixel clock. The default is to clock
+ data on the rising edge.
+
+EP93XXFB_SYNC_BLANK_HIGH Blank signal is active high. By
+ default the blank signal is active low.
+
+EP93XXFB_SYNC_HORIZ_HIGH Horizontal sync is active high. By
+ default the horizontal sync is active low.
+
+EP93XXFB_SYNC_VERT_HIGH Vertical sync is active high. By
+ default the vertical sync is active high.
+
+The physical address of the framebuffer can be controlled using the
+following flags:
+
+EP93XXFB_USE_SDCSN0 Use SDCSn[0] for the framebuffer. This
+ is the default setting.
+
+EP93XXFB_USE_SDCSN1 Use SDCSn[1] for the framebuffer.
+
+EP93XXFB_USE_SDCSN2 Use SDCSn[2] for the framebuffer.
+
+EP93XXFB_USE_SDCSN3 Use SDCSn[3] for the framebuffer.
+
+==================
+Platform callbacks
+==================
+
+The EP93xx framebuffer driver supports three optional platform
+callbacks: setup, teardown and blank. The setup and teardown functions
+are called when the framebuffer driver is installed and removed
+respectively. The blank function is called whenever the display is
+blanked or unblanked.
+
+The setup and teardown devices pass the platform_device structure as
+an argument. The fb_info and ep93xxfb_mach_info structures can be
+obtained as follows:
+
+ static int some_board_fb_setup(struct platform_device *pdev)
+ {
+ struct ep93xxfb_mach_info *mach_info = pdev->dev.platform_data;
+ struct fb_info *fb_info = platform_get_drvdata(pdev);
+
+ /* Board specific framebuffer setup */
+ }
+
+======================
+Setting the video mode
+======================
+
+The video mode is set using the following syntax:
+
+ video=XRESxYRES[-BPP][@REFRESH]
+
+If the EP93xx video driver is built-in then the video mode is set on
+the Linux kernel command line, for example:
+
+ video=ep93xx-fb:800x600-16@60
+
+If the EP93xx video driver is built as a module then the video mode is
+set when the module is installed:
+
+ modprobe ep93xx-fb video=320x240
+
+==============
+Screenpage bug
+==============
+
+At least on the EP9315 there is a silicon bug which causes bit 27 of
+the VIDSCRNPAGE (framebuffer physical offset) to be tied low. There is
+an unofficial errata for this bug at:
+ http://marc.info/?l=linux-arm-kernel&m=110061245502000&w=2
+
+By default the EP93xx framebuffer driver checks if the allocated physical
+address has bit 27 set. If it does, then the memory is freed and an
+error is returned. The check can be disabled by adding the following
+option when loading the driver:
+
+ ep93xx-fb.check_screenpage_bug=0
+
+In some cases it may be possible to reconfigure your SDRAM layout to
+avoid this bug. See section 13 of the EP93xx users' guide for details.
diff --git a/Documentation/fb/matroxfb.txt b/Documentation/fb/matroxfb.txt
index ad7a677..e5ce8a1 100644
--- a/Documentation/fb/matroxfb.txt
+++ b/Documentation/fb/matroxfb.txt
@@ -186,9 +186,7 @@
dev:X - bind driver to device X. Driver numbers device from 0 up to N,
where device 0 is first `known' device found, 1 second and so on.
lspci lists devices in this order.
- Default is `every' known device for driver with multihead support
- and first working device (usually dev:0) for driver without
- multihead support.
+ Default is `every' known device.
nohwcursor - disables hardware cursor (use software cursor instead).
hwcursor - enables hardware cursor. It is default. If you are using
non-accelerated mode (`noaccel' or `fbset -accel false'), software
diff --git a/Documentation/filesystems/ncpfs.txt b/Documentation/filesystems/ncpfs.txt
index f12c30c..5af164f 100644
--- a/Documentation/filesystems/ncpfs.txt
+++ b/Documentation/filesystems/ncpfs.txt
@@ -7,6 +7,6 @@
will have it as well.
Related products are linware and mars_nwe, which will give Linux partial
-NetWare server functionality. Linware's home site is
-klokan.sh.cvut.cz/pub/linux/linware; mars_nwe can be found on
-ftp.gwdg.de/pub/linux/misc/ncpfs.
+NetWare server functionality.
+
+mars_nwe can be found on ftp.gwdg.de/pub/linux/misc/ncpfs.
diff --git a/Documentation/filesystems/proc.txt b/Documentation/filesystems/proc.txt
index 75988ba..b5aee78 100644
--- a/Documentation/filesystems/proc.txt
+++ b/Documentation/filesystems/proc.txt
@@ -176,6 +176,7 @@
CapBnd: ffffffffffffffff
voluntary_ctxt_switches: 0
nonvoluntary_ctxt_switches: 1
+ Stack usage: 12 kB
This shows you nearly the same information you would get if you viewed it with
the ps command. In fact, ps uses the proc file system to obtain its
@@ -229,6 +230,7 @@
Mems_allowed_list Same as previous, but in "list format"
voluntary_ctxt_switches number of voluntary context switches
nonvoluntary_ctxt_switches number of non voluntary context switches
+ Stack usage: stack usage high water mark (round up to page size)
..............................................................................
Table 1-3: Contents of the statm files (as of 2.6.8-rc3)
@@ -307,7 +309,7 @@
08049000-0804a000 rw-p 00001000 03:00 8312 /opt/test
0804a000-0806b000 rw-p 00000000 00:00 0 [heap]
a7cb1000-a7cb2000 ---p 00000000 00:00 0
-a7cb2000-a7eb2000 rw-p 00000000 00:00 0
+a7cb2000-a7eb2000 rw-p 00000000 00:00 0 [threadstack:001ff4b4]
a7eb2000-a7eb3000 ---p 00000000 00:00 0
a7eb3000-a7ed5000 rw-p 00000000 00:00 0
a7ed5000-a8008000 r-xp 00000000 03:00 4222 /lib/libc.so.6
@@ -343,6 +345,7 @@
[stack] = the stack of the main process
[vdso] = the "virtual dynamic shared object",
the kernel system call handler
+ [threadstack:xxxxxxxx] = the stack of the thread, xxxxxxxx is the stack size
or if empty, the mapping is anonymous.
diff --git a/Documentation/gpio.txt b/Documentation/gpio.txt
index e4b6985..fa4dc07 100644
--- a/Documentation/gpio.txt
+++ b/Documentation/gpio.txt
@@ -524,6 +524,13 @@
is configured as an output, this value may be written;
any nonzero value is treated as high.
+ "edge" ... reads as either "none", "rising", "falling", or
+ "both". Write these strings to select the signal edge(s)
+ that will make poll(2) on the "value" file return.
+
+ This file exists only if the pin can be configured as an
+ interrupt generating input pin.
+
GPIO controllers have paths like /sys/class/gpio/chipchip42/ (for the
controller implementing GPIOs starting at #42) and have the following
read-only attributes:
@@ -555,6 +562,11 @@
/* reverse gpio_export() */
void gpio_unexport();
+ /* create a sysfs link to an exported GPIO node */
+ int gpio_export_link(struct device *dev, const char *name,
+ unsigned gpio)
+
+
After a kernel driver requests a GPIO, it may only be made available in
the sysfs interface by gpio_export(). The driver can control whether the
signal direction may change. This helps drivers prevent userspace code
@@ -563,3 +575,8 @@
This explicit exporting can help with debugging (by making some kinds
of experiments easier), or can provide an always-there interface that's
suitable for documenting as part of a board support package.
+
+After the GPIO has been exported, gpio_export_link() allows creating
+symlinks from elsewhere in sysfs to the GPIO sysfs node. Drivers can
+use this to provide the interface under their own device in sysfs with
+a descriptive name.
diff --git a/Documentation/ia64/aliasing-test.c b/Documentation/ia64/aliasing-test.c
index d23610f..3dfb76c 100644
--- a/Documentation/ia64/aliasing-test.c
+++ b/Documentation/ia64/aliasing-test.c
@@ -24,7 +24,7 @@
int sum;
-int map_mem(char *path, off_t offset, size_t length, int touch)
+static int map_mem(char *path, off_t offset, size_t length, int touch)
{
int fd, rc;
void *addr;
@@ -62,7 +62,7 @@
return 0;
}
-int scan_tree(char *path, char *file, off_t offset, size_t length, int touch)
+static int scan_tree(char *path, char *file, off_t offset, size_t length, int touch)
{
struct dirent **namelist;
char *name, *path2;
@@ -119,7 +119,7 @@
char buf[1024];
-int read_rom(char *path)
+static int read_rom(char *path)
{
int fd, rc;
size_t size = 0;
@@ -146,7 +146,7 @@
return size;
}
-int scan_rom(char *path, char *file)
+static int scan_rom(char *path, char *file)
{
struct dirent **namelist;
char *name, *path2;
diff --git a/Documentation/lguest/lguest.c b/Documentation/lguest/lguest.c
index 950cde6..ba9373f 100644
--- a/Documentation/lguest/lguest.c
+++ b/Documentation/lguest/lguest.c
@@ -42,6 +42,7 @@
#include <signal.h>
#include "linux/lguest_launcher.h"
#include "linux/virtio_config.h"
+#include <linux/virtio_ids.h>
#include "linux/virtio_net.h"
#include "linux/virtio_blk.h"
#include "linux/virtio_console.h"
@@ -133,6 +134,9 @@
/* Is it operational */
bool running;
+ /* Does Guest want an intrrupt on empty? */
+ bool irq_on_empty;
+
/* Device-specific data. */
void *priv;
};
@@ -623,10 +627,13 @@
return;
vq->pending_used = 0;
- /* If they don't want an interrupt, don't send one, unless empty. */
- if ((vq->vring.avail->flags & VRING_AVAIL_F_NO_INTERRUPT)
- && lg_last_avail(vq) != vq->vring.avail->idx)
- return;
+ /* If they don't want an interrupt, don't send one... */
+ if (vq->vring.avail->flags & VRING_AVAIL_F_NO_INTERRUPT) {
+ /* ... unless they've asked us to force one on empty. */
+ if (!vq->dev->irq_on_empty
+ || lg_last_avail(vq) != vq->vring.avail->idx)
+ return;
+ }
/* Send the Guest an interrupt tell them we used something up. */
if (write(lguest_fd, buf, sizeof(buf)) != 0)
@@ -1042,6 +1049,15 @@
close(vq->eventfd);
}
+static bool accepted_feature(struct device *dev, unsigned int bit)
+{
+ const u8 *features = get_feature_bits(dev) + dev->feature_len;
+
+ if (dev->feature_len < bit / CHAR_BIT)
+ return false;
+ return features[bit / CHAR_BIT] & (1 << (bit % CHAR_BIT));
+}
+
static void start_device(struct device *dev)
{
unsigned int i;
@@ -1055,6 +1071,8 @@
verbose(" %02x", get_feature_bits(dev)
[dev->feature_len+i]);
+ dev->irq_on_empty = accepted_feature(dev, VIRTIO_F_NOTIFY_ON_EMPTY);
+
for (vq = dev->vq; vq; vq = vq->next) {
if (vq->service)
create_thread(vq);
diff --git a/Documentation/pcmcia/crc32hash.c b/Documentation/pcmcia/crc32hash.c
index 4210e5a..44f8bee 100644
--- a/Documentation/pcmcia/crc32hash.c
+++ b/Documentation/pcmcia/crc32hash.c
@@ -8,7 +8,7 @@
#include <ctype.h>
#include <stdlib.h>
-unsigned int crc32(unsigned char const *p, unsigned int len)
+static unsigned int crc32(unsigned char const *p, unsigned int len)
{
int i;
unsigned int crc = 0;
diff --git a/Documentation/powerpc/dts-bindings/fsl/esdhc.txt b/Documentation/powerpc/dts-bindings/fsl/esdhc.txt
index 3ed3797..8a00407 100644
--- a/Documentation/powerpc/dts-bindings/fsl/esdhc.txt
+++ b/Documentation/powerpc/dts-bindings/fsl/esdhc.txt
@@ -10,6 +10,8 @@
- interrupts : should contain eSDHC interrupt.
- interrupt-parent : interrupt source phandle.
- clock-frequency : specifies eSDHC base clock frequency.
+ - sdhci,wp-inverted : (optional) specifies that eSDHC controller
+ reports inverted write-protect state;
- sdhci,1-bit-only : (optional) specifies that a controller can
only handle 1-bit data transfers.
diff --git a/Documentation/rtc.txt b/Documentation/rtc.txt
index 8deffcd..9104c10 100644
--- a/Documentation/rtc.txt
+++ b/Documentation/rtc.txt
@@ -135,6 +135,30 @@
the system clock from the discrete RTC, but use the integrated one for all
other tasks, because of its greater functionality.
+SYSFS INTERFACE
+---------------
+
+The sysfs interface under /sys/class/rtc/rtcN provides access to various
+rtc attributes without requiring the use of ioctls. All dates and times
+are in the RTC's timezone, rather than in system time.
+
+date: RTC-provided date
+hctosys: 1 if the RTC provided the system time at boot via the
+ CONFIG_RTC_HCTOSYS kernel option, 0 otherwise
+max_user_freq: The maximum interrupt rate an unprivileged user may request
+ from this RTC.
+name: The name of the RTC corresponding to this sysfs directory
+since_epoch: The number of seconds since the epoch according to the RTC
+time: RTC-provided time
+wakealarm: The time at which the clock will generate a system wakeup
+ event. This is a one shot wakeup event, so must be reset
+ after wake if a daily wakeup is required. Format is either
+ seconds since the epoch or, if there's a leading +, seconds
+ in the future.
+
+IOCTL INTERFACE
+---------------
+
The ioctl() calls supported by /dev/rtc are also supported by the RTC class
framework. However, because the chips and systems are not standardized,
some PC/AT functionality might not be provided. And in the same way, some
@@ -185,6 +209,8 @@
hardware in the irq_set_freq function. If it isn't, return -EINVAL. If
you cannot actually change the frequency, do not define irq_set_freq.
+ * RTC_PIE_ON, RTC_PIE_OFF: the irq_set_state function will be called.
+
If all else fails, check out the rtc-test.c driver!
diff --git a/Documentation/spi/spi-summary b/Documentation/spi/spi-summary
index 4a02d25..deab51d 100644
--- a/Documentation/spi/spi-summary
+++ b/Documentation/spi/spi-summary
@@ -350,7 +350,7 @@
.resume = CHIP_resume,
};
-The driver core will autmatically attempt to bind this driver to any SPI
+The driver core will automatically attempt to bind this driver to any SPI
device whose board_info gave a modalias of "CHIP". Your probe() code
might look like this unless you're creating a device which is managing
a bus (appearing under /sys/class/spi_master).
diff --git a/Documentation/spi/spidev_test.c b/Documentation/spi/spidev_test.c
index c1a5aad..10abd37 100644
--- a/Documentation/spi/spidev_test.c
+++ b/Documentation/spi/spidev_test.c
@@ -69,7 +69,7 @@
puts("");
}
-void print_usage(const char *prog)
+static void print_usage(const char *prog)
{
printf("Usage: %s [-DsbdlHOLC3]\n", prog);
puts(" -D --device device to use (default /dev/spidev1.1)\n"
@@ -85,7 +85,7 @@
exit(1);
}
-void parse_opts(int argc, char *argv[])
+static void parse_opts(int argc, char *argv[])
{
while (1) {
static const struct option lopts[] = {
diff --git a/Documentation/sysctl/kernel.txt b/Documentation/sysctl/kernel.txt
index 3e5b63e..b3d8b49 100644
--- a/Documentation/sysctl/kernel.txt
+++ b/Documentation/sysctl/kernel.txt
@@ -313,6 +313,14 @@
==============================================================
+printk_delay:
+
+Delay each printk message in printk_delay milliseconds
+
+Value from 0 - 10000 is allowed.
+
+==============================================================
+
randomize-va-space:
This option can be used to select the type of process address
diff --git a/Documentation/video4linux/v4lgrab.c b/Documentation/video4linux/v4lgrab.c
index 05769cf..c8ded17 100644
--- a/Documentation/video4linux/v4lgrab.c
+++ b/Documentation/video4linux/v4lgrab.c
@@ -89,7 +89,7 @@
} \
}
-int get_brightness_adj(unsigned char *image, long size, int *brightness) {
+static int get_brightness_adj(unsigned char *image, long size, int *brightness) {
long i, tot = 0;
for (i=0;i<size*3;i++)
tot += image[i];
diff --git a/Documentation/vm/page-types.c b/Documentation/vm/page-types.c
index 0833f44..3eda8ea 100644
--- a/Documentation/vm/page-types.c
+++ b/Documentation/vm/page-types.c
@@ -158,12 +158,12 @@
type __min2 = (y); \
__min1 < __min2 ? __min1 : __min2; })
-unsigned long pages2mb(unsigned long pages)
+static unsigned long pages2mb(unsigned long pages)
{
return (pages * page_size) >> 20;
}
-void fatal(const char *x, ...)
+static void fatal(const char *x, ...)
{
va_list ap;
@@ -178,7 +178,7 @@
* page flag names
*/
-char *page_flag_name(uint64_t flags)
+static char *page_flag_name(uint64_t flags)
{
static char buf[65];
int present;
@@ -197,7 +197,7 @@
return buf;
}
-char *page_flag_longname(uint64_t flags)
+static char *page_flag_longname(uint64_t flags)
{
static char buf[1024];
int i, n;
@@ -221,7 +221,7 @@
* page list and summary
*/
-void show_page_range(unsigned long offset, uint64_t flags)
+static void show_page_range(unsigned long offset, uint64_t flags)
{
static uint64_t flags0;
static unsigned long index;
@@ -241,12 +241,12 @@
count = 1;
}
-void show_page(unsigned long offset, uint64_t flags)
+static void show_page(unsigned long offset, uint64_t flags)
{
printf("%lu\t%s\n", offset, page_flag_name(flags));
}
-void show_summary(void)
+static void show_summary(void)
{
int i;
@@ -272,7 +272,7 @@
* page flag filters
*/
-int bit_mask_ok(uint64_t flags)
+static int bit_mask_ok(uint64_t flags)
{
int i;
@@ -289,7 +289,7 @@
return 1;
}
-uint64_t expand_overloaded_flags(uint64_t flags)
+static uint64_t expand_overloaded_flags(uint64_t flags)
{
/* SLOB/SLUB overload several page flags */
if (flags & BIT(SLAB)) {
@@ -308,7 +308,7 @@
return flags;
}
-uint64_t well_known_flags(uint64_t flags)
+static uint64_t well_known_flags(uint64_t flags)
{
/* hide flags intended only for kernel hacker */
flags &= ~KPF_HACKERS_BITS;
@@ -325,7 +325,7 @@
* page frame walker
*/
-int hash_slot(uint64_t flags)
+static int hash_slot(uint64_t flags)
{
int k = HASH_KEY(flags);
int i;
@@ -352,7 +352,7 @@
exit(EXIT_FAILURE);
}
-void add_page(unsigned long offset, uint64_t flags)
+static void add_page(unsigned long offset, uint64_t flags)
{
flags = expand_overloaded_flags(flags);
@@ -371,7 +371,7 @@
total_pages++;
}
-void walk_pfn(unsigned long index, unsigned long count)
+static void walk_pfn(unsigned long index, unsigned long count)
{
unsigned long batch;
unsigned long n;
@@ -404,7 +404,7 @@
}
}
-void walk_addr_ranges(void)
+static void walk_addr_ranges(void)
{
int i;
@@ -428,7 +428,7 @@
* user interface
*/
-const char *page_flag_type(uint64_t flag)
+static const char *page_flag_type(uint64_t flag)
{
if (flag & KPF_HACKERS_BITS)
return "(r)";
@@ -437,7 +437,7 @@
return " ";
}
-void usage(void)
+static void usage(void)
{
int i, j;
@@ -482,7 +482,7 @@
"(r) raw mode bits (o) overloaded bits\n");
}
-unsigned long long parse_number(const char *str)
+static unsigned long long parse_number(const char *str)
{
unsigned long long n;
@@ -494,16 +494,16 @@
return n;
}
-void parse_pid(const char *str)
+static void parse_pid(const char *str)
{
opt_pid = parse_number(str);
}
-void parse_file(const char *name)
+static void parse_file(const char *name)
{
}
-void add_addr_range(unsigned long offset, unsigned long size)
+static void add_addr_range(unsigned long offset, unsigned long size)
{
if (nr_addr_ranges >= MAX_ADDR_RANGES)
fatal("too much addr ranges\n");
@@ -513,7 +513,7 @@
nr_addr_ranges++;
}
-void parse_addr_range(const char *optarg)
+static void parse_addr_range(const char *optarg)
{
unsigned long offset;
unsigned long size;
@@ -547,7 +547,7 @@
add_addr_range(offset, size);
}
-void add_bits_filter(uint64_t mask, uint64_t bits)
+static void add_bits_filter(uint64_t mask, uint64_t bits)
{
if (nr_bit_filters >= MAX_BIT_FILTERS)
fatal("too much bit filters\n");
@@ -557,7 +557,7 @@
nr_bit_filters++;
}
-uint64_t parse_flag_name(const char *str, int len)
+static uint64_t parse_flag_name(const char *str, int len)
{
int i;
@@ -577,7 +577,7 @@
return parse_number(str);
}
-uint64_t parse_flag_names(const char *str, int all)
+static uint64_t parse_flag_names(const char *str, int all)
{
const char *p = str;
uint64_t flags = 0;
@@ -596,7 +596,7 @@
return flags;
}
-void parse_bits_mask(const char *optarg)
+static void parse_bits_mask(const char *optarg)
{
uint64_t mask;
uint64_t bits;
@@ -621,7 +621,7 @@
}
-struct option opts[] = {
+static struct option opts[] = {
{ "raw" , 0, NULL, 'r' },
{ "pid" , 1, NULL, 'p' },
{ "file" , 1, NULL, 'f' },
diff --git a/Documentation/vm/slabinfo.c b/Documentation/vm/slabinfo.c
index df32276..92e729f 100644
--- a/Documentation/vm/slabinfo.c
+++ b/Documentation/vm/slabinfo.c
@@ -87,7 +87,7 @@
regex_t pattern;
-void fatal(const char *x, ...)
+static void fatal(const char *x, ...)
{
va_list ap;
@@ -97,7 +97,7 @@
exit(EXIT_FAILURE);
}
-void usage(void)
+static void usage(void)
{
printf("slabinfo 5/7/2007. (c) 2007 sgi.\n\n"
"slabinfo [-ahnpvtsz] [-d debugopts] [slab-regexp]\n"
@@ -131,7 +131,7 @@
);
}
-unsigned long read_obj(const char *name)
+static unsigned long read_obj(const char *name)
{
FILE *f = fopen(name, "r");
@@ -151,7 +151,7 @@
/*
* Get the contents of an attribute
*/
-unsigned long get_obj(const char *name)
+static unsigned long get_obj(const char *name)
{
if (!read_obj(name))
return 0;
@@ -159,7 +159,7 @@
return atol(buffer);
}
-unsigned long get_obj_and_str(const char *name, char **x)
+static unsigned long get_obj_and_str(const char *name, char **x)
{
unsigned long result = 0;
char *p;
@@ -178,7 +178,7 @@
return result;
}
-void set_obj(struct slabinfo *s, const char *name, int n)
+static void set_obj(struct slabinfo *s, const char *name, int n)
{
char x[100];
FILE *f;
@@ -192,7 +192,7 @@
fclose(f);
}
-unsigned long read_slab_obj(struct slabinfo *s, const char *name)
+static unsigned long read_slab_obj(struct slabinfo *s, const char *name)
{
char x[100];
FILE *f;
@@ -215,7 +215,7 @@
/*
* Put a size string together
*/
-int store_size(char *buffer, unsigned long value)
+static int store_size(char *buffer, unsigned long value)
{
unsigned long divisor = 1;
char trailer = 0;
@@ -247,7 +247,7 @@
return n;
}
-void decode_numa_list(int *numa, char *t)
+static void decode_numa_list(int *numa, char *t)
{
int node;
int nr;
@@ -272,7 +272,7 @@
}
}
-void slab_validate(struct slabinfo *s)
+static void slab_validate(struct slabinfo *s)
{
if (strcmp(s->name, "*") == 0)
return;
@@ -280,7 +280,7 @@
set_obj(s, "validate", 1);
}
-void slab_shrink(struct slabinfo *s)
+static void slab_shrink(struct slabinfo *s)
{
if (strcmp(s->name, "*") == 0)
return;
@@ -290,7 +290,7 @@
int line = 0;
-void first_line(void)
+static void first_line(void)
{
if (show_activity)
printf("Name Objects Alloc Free %%Fast Fallb O\n");
@@ -302,7 +302,7 @@
/*
* Find the shortest alias of a slab
*/
-struct aliasinfo *find_one_alias(struct slabinfo *find)
+static struct aliasinfo *find_one_alias(struct slabinfo *find)
{
struct aliasinfo *a;
struct aliasinfo *best = NULL;
@@ -318,18 +318,18 @@
return best;
}
-unsigned long slab_size(struct slabinfo *s)
+static unsigned long slab_size(struct slabinfo *s)
{
return s->slabs * (page_size << s->order);
}
-unsigned long slab_activity(struct slabinfo *s)
+static unsigned long slab_activity(struct slabinfo *s)
{
return s->alloc_fastpath + s->free_fastpath +
s->alloc_slowpath + s->free_slowpath;
}
-void slab_numa(struct slabinfo *s, int mode)
+static void slab_numa(struct slabinfo *s, int mode)
{
int node;
@@ -374,7 +374,7 @@
line++;
}
-void show_tracking(struct slabinfo *s)
+static void show_tracking(struct slabinfo *s)
{
printf("\n%s: Kernel object allocation\n", s->name);
printf("-----------------------------------------------------------------------\n");
@@ -392,7 +392,7 @@
}
-void ops(struct slabinfo *s)
+static void ops(struct slabinfo *s)
{
if (strcmp(s->name, "*") == 0)
return;
@@ -405,14 +405,14 @@
printf("\n%s has no kmem_cache operations\n", s->name);
}
-const char *onoff(int x)
+static const char *onoff(int x)
{
if (x)
return "On ";
return "Off";
}
-void slab_stats(struct slabinfo *s)
+static void slab_stats(struct slabinfo *s)
{
unsigned long total_alloc;
unsigned long total_free;
@@ -477,7 +477,7 @@
s->deactivate_to_tail, (s->deactivate_to_tail * 100) / total);
}
-void report(struct slabinfo *s)
+static void report(struct slabinfo *s)
{
if (strcmp(s->name, "*") == 0)
return;
@@ -518,7 +518,7 @@
slab_stats(s);
}
-void slabcache(struct slabinfo *s)
+static void slabcache(struct slabinfo *s)
{
char size_str[20];
char dist_str[40];
@@ -593,7 +593,7 @@
/*
* Analyze debug options. Return false if something is amiss.
*/
-int debug_opt_scan(char *opt)
+static int debug_opt_scan(char *opt)
{
if (!opt || !opt[0] || strcmp(opt, "-") == 0)
return 1;
@@ -642,7 +642,7 @@
return 1;
}
-int slab_empty(struct slabinfo *s)
+static int slab_empty(struct slabinfo *s)
{
if (s->objects > 0)
return 0;
@@ -657,7 +657,7 @@
return 1;
}
-void slab_debug(struct slabinfo *s)
+static void slab_debug(struct slabinfo *s)
{
if (strcmp(s->name, "*") == 0)
return;
@@ -717,7 +717,7 @@
set_obj(s, "trace", 1);
}
-void totals(void)
+static void totals(void)
{
struct slabinfo *s;
@@ -976,7 +976,7 @@
b1, b2, b3);
}
-void sort_slabs(void)
+static void sort_slabs(void)
{
struct slabinfo *s1,*s2;
@@ -1005,7 +1005,7 @@
}
}
-void sort_aliases(void)
+static void sort_aliases(void)
{
struct aliasinfo *a1,*a2;
@@ -1030,7 +1030,7 @@
}
}
-void link_slabs(void)
+static void link_slabs(void)
{
struct aliasinfo *a;
struct slabinfo *s;
@@ -1048,7 +1048,7 @@
}
}
-void alias(void)
+static void alias(void)
{
struct aliasinfo *a;
char *active = NULL;
@@ -1079,7 +1079,7 @@
}
-void rename_slabs(void)
+static void rename_slabs(void)
{
struct slabinfo *s;
struct aliasinfo *a;
@@ -1102,12 +1102,12 @@
}
}
-int slab_mismatch(char *slab)
+static int slab_mismatch(char *slab)
{
return regexec(&pattern, slab, 0, NULL, 0);
}
-void read_slab_dir(void)
+static void read_slab_dir(void)
{
DIR *dir;
struct dirent *de;
@@ -1209,7 +1209,7 @@
fatal("Too many aliases\n");
}
-void output_slabs(void)
+static void output_slabs(void)
{
struct slabinfo *slab;
diff --git a/Documentation/watchdog/src/watchdog-test.c b/Documentation/watchdog/src/watchdog-test.c
index 65f6c19..a750532 100644
--- a/Documentation/watchdog/src/watchdog-test.c
+++ b/Documentation/watchdog/src/watchdog-test.c
@@ -18,7 +18,7 @@
* the PC Watchdog card to reset its internal timer so it doesn't trigger
* a computer reset.
*/
-void keep_alive(void)
+static void keep_alive(void)
{
int dummy;
diff --git a/MAINTAINERS b/MAINTAINERS
index 5e1bf0c..e1fc32e 100644
--- a/MAINTAINERS
+++ b/MAINTAINERS
@@ -3527,7 +3527,6 @@
NCP FILESYSTEM
M: Petr Vandrovec <vandrove@vc.cvut.cz>
-L: linware@sh.cvut.cz
S: Maintained
F: fs/ncpfs/
@@ -3769,7 +3768,13 @@
M: Jarkko Lavinen <jarkko.lavinen@nokia.com>
L: linux-omap@vger.kernel.org
S: Maintained
-F: drivers/mmc/host/*omap*
+F: drivers/mmc/host/omap.c
+
+OMAP HS MMC SUPPORT
+M: Madhusudhan Chikkature <madhu.cr@ti.com>
+L: linux-omap@vger.kernel.org
+S: Maintained
+F: drivers/mmc/host/omap_hsmmc.c
OMAP RANDOM NUMBER GENERATOR SUPPORT
M: Deepak Saxena <dsaxena@plexity.net>
@@ -4460,7 +4465,7 @@
P: Chen Liqin
M: liqin.chen@sunplusct.com
P: Lennox Wu
-M: lennox.wu@sunplusct.com
+M: lennox.wu@gmail.com
W: http://www.sunplusct.com
S: Supported
diff --git a/arch/arm/configs/n770_defconfig b/arch/arm/configs/n770_defconfig
index 672f6db..a1657b7 100644
--- a/arch/arm/configs/n770_defconfig
+++ b/arch/arm/configs/n770_defconfig
@@ -875,7 +875,7 @@
CONFIG_FB_OMAP_LCDC_HWA742=y
# CONFIG_FB_OMAP_LCDC_BLIZZARD is not set
CONFIG_FB_OMAP_MANUAL_UPDATE=y
-# CONFIG_FB_OMAP_LCD_MIPID is not set
+CONFIG_FB_OMAP_LCD_MIPID=y
# CONFIG_FB_OMAP_BOOTLOADER_INIT is not set
CONFIG_FB_OMAP_CONSISTENT_DMA_SIZE=2
# CONFIG_FB_OMAP_DMA_TUNE is not set
diff --git a/arch/arm/configs/omap3_beagle_defconfig b/arch/arm/configs/omap3_beagle_defconfig
index 51c0fa8..357d402 100644
--- a/arch/arm/configs/omap3_beagle_defconfig
+++ b/arch/arm/configs/omap3_beagle_defconfig
@@ -778,7 +778,33 @@
#
# CONFIG_VGASTATE is not set
# CONFIG_VIDEO_OUTPUT_CONTROL is not set
-# CONFIG_FB is not set
+CONFIG_FB=y
+# CONFIG_FIRMWARE_EDID is not set
+# CONFIG_FB_DDC is not set
+CONFIG_FB_CFB_FILLRECT=y
+CONFIG_FB_CFB_COPYAREA=y
+CONFIG_FB_CFB_IMAGEBLIT=y
+# CONFIG_FB_CFB_REV_PIXELS_IN_BYTE is not set
+# CONFIG_FB_SYS_FILLRECT is not set
+# CONFIG_FB_SYS_COPYAREA is not set
+# CONFIG_FB_SYS_IMAGEBLIT is not set
+# CONFIG_FB_FOREIGN_ENDIAN is not set
+# CONFIG_FB_SYS_FOPS is not set
+# CONFIG_FB_SVGALIB is not set
+# CONFIG_FB_MACMODES is not set
+# CONFIG_FB_BACKLIGHT is not set
+# CONFIG_FB_MODE_HELPERS is not set
+# CONFIG_FB_TILEBLITTING is not set
+
+#
+# Frame buffer hardware drivers
+#
+# CONFIG_FB_S1D13XXX is not set
+# CONFIG_FB_VIRTUAL is not set
+CONFIG_FB_OMAP=y
+# CONFIG_FB_OMAP_LCDC_EXTERNAL is not set
+# CONFIG_FB_OMAP_BOOTLOADER_INIT is not set
+CONFIG_FB_OMAP_CONSISTENT_DMA_SIZE=2
# CONFIG_BACKLIGHT_LCD_SUPPORT is not set
#
@@ -791,6 +817,25 @@
#
# CONFIG_VGA_CONSOLE is not set
CONFIG_DUMMY_CONSOLE=y
+CONFIG_FRAMEBUFFER_CONSOLE=y
+# CONFIG_FRAMEBUFFER_CONSOLE_DETECT_PRIMARY is not set
+CONFIG_FRAMEBUFFER_CONSOLE_ROTATION=y
+CONFIG_FONTS=y
+CONFIG_FONT_8x8=y
+CONFIG_FONT_8x16=y
+# CONFIG_FONT_6x11 is not set
+# CONFIG_FONT_7x14 is not set
+# CONFIG_FONT_PEARL_8x8 is not set
+# CONFIG_FONT_ACORN_8x8 is not set
+# CONFIG_FONT_MINI_4x6 is not set
+# CONFIG_FONT_SUN8x16 is not set
+# CONFIG_FONT_SUN12x22 is not set
+# CONFIG_FONT_10x18 is not set
+# CONFIG_LOGO is not set
+
+#
+# Sound
+#
# CONFIG_SOUND is not set
# CONFIG_HID_SUPPORT is not set
CONFIG_USB_SUPPORT=y
diff --git a/arch/arm/configs/omap_3430sdp_defconfig b/arch/arm/configs/omap_3430sdp_defconfig
index 9a510ea..8a4a7e2 100644
--- a/arch/arm/configs/omap_3430sdp_defconfig
+++ b/arch/arm/configs/omap_3430sdp_defconfig
@@ -1313,8 +1313,33 @@
# Graphics support
#
# CONFIG_VGASTATE is not set
-# CONFIG_VIDEO_OUTPUT_CONTROL is not set
-# CONFIG_FB is not set
+CONFIG_FB=y
+# CONFIG_FIRMWARE_EDID is not set
+# CONFIG_FB_DDC is not set
+CONFIG_FB_CFB_FILLRECT=y
+CONFIG_FB_CFB_COPYAREA=y
+CONFIG_FB_CFB_IMAGEBLIT=y
+# CONFIG_FB_CFB_REV_PIXELS_IN_BYTE is not set
+# CONFIG_FB_SYS_FILLRECT is not set
+# CONFIG_FB_SYS_COPYAREA is not set
+# CONFIG_FB_SYS_IMAGEBLIT is not set
+# CONFIG_FB_FOREIGN_ENDIAN is not set
+# CONFIG_FB_SYS_FOPS is not set
+# CONFIG_FB_SVGALIB is not set
+# CONFIG_FB_MACMODES is not set
+# CONFIG_FB_BACKLIGHT is not set
+# CONFIG_FB_MODE_HELPERS is not set
+# CONFIG_FB_TILEBLITTING is not set
+
+#
+# Frame buffer hardware drivers
+#
+# CONFIG_FB_S1D13XXX is not set
+# CONFIG_FB_VIRTUAL is not set
+CONFIG_FB_OMAP=y
+# CONFIG_FB_OMAP_LCDC_EXTERNAL is not set
+# CONFIG_FB_OMAP_BOOTLOADER_INIT is not set
+CONFIG_FB_OMAP_CONSISTENT_DMA_SIZE=2
# CONFIG_BACKLIGHT_LCD_SUPPORT is not set
#
@@ -1331,6 +1356,16 @@
#
# CONFIG_VGA_CONSOLE is not set
CONFIG_DUMMY_CONSOLE=y
+CONFIG_FRAMEBUFFER_CONSOLE=y
+# CONFIG_FRAMEBUFFER_CONSOLE_DETECT_PRIMARY is not set
+# CONFIG_FRAMEBUFFER_CONSOLE_ROTATION is not set
+# CONFIG_FONTS is not set
+CONFIG_FONT_8x8=y
+CONFIG_FONT_8x16=y
+CONFIG_LOGO=y
+CONFIG_LOGO_LINUX_MONO=y
+CONFIG_LOGO_LINUX_VGA16=y
+CONFIG_LOGO_LINUX_CLUT224=y
CONFIG_SOUND=y
CONFIG_SOUND_OSS_CORE=y
CONFIG_SND=y
diff --git a/arch/arm/configs/omap_ldp_defconfig b/arch/arm/configs/omap_ldp_defconfig
index 679a4a3..b9c4891 100644
--- a/arch/arm/configs/omap_ldp_defconfig
+++ b/arch/arm/configs/omap_ldp_defconfig
@@ -690,6 +690,7 @@
# CONFIG_GPIO_MAX732X is not set
# CONFIG_GPIO_PCA953X is not set
# CONFIG_GPIO_PCF857X is not set
+CONFIG_GPIO_TWL4030=y
#
# PCI GPIO expanders:
@@ -742,6 +743,7 @@
# CONFIG_MFD_SM501 is not set
# CONFIG_HTC_EGPIO is not set
# CONFIG_HTC_PASIC3 is not set
+CONFIG_TWL4030_CORE=y
# CONFIG_MFD_TMIO is not set
# CONFIG_MFD_T7L66XB is not set
# CONFIG_MFD_TC6387XB is not set
@@ -767,8 +769,46 @@
#
# CONFIG_VGASTATE is not set
CONFIG_VIDEO_OUTPUT_CONTROL=m
-# CONFIG_FB is not set
-# CONFIG_BACKLIGHT_LCD_SUPPORT is not set
+CONFIG_FB=y
+CONFIG_FIRMWARE_EDID=y
+# CONFIG_FB_DDC is not set
+# CONFIG_FB_BOOT_VESA_SUPPORT is not set
+CONFIG_FB_CFB_FILLRECT=y
+CONFIG_FB_CFB_COPYAREA=y
+CONFIG_FB_CFB_IMAGEBLIT=y
+# CONFIG_FB_CFB_REV_PIXELS_IN_BYTE is not set
+# CONFIG_FB_SYS_FILLRECT is not set
+# CONFIG_FB_SYS_COPYAREA is not set
+# CONFIG_FB_SYS_IMAGEBLIT is not set
+# CONFIG_FB_FOREIGN_ENDIAN is not set
+# CONFIG_FB_SYS_FOPS is not set
+# CONFIG_FB_SVGALIB is not set
+# CONFIG_FB_MACMODES is not set
+# CONFIG_FB_BACKLIGHT is not set
+CONFIG_FB_MODE_HELPERS=y
+CONFIG_FB_TILEBLITTING=y
+
+#
+# Frame buffer hardware drivers
+#
+# CONFIG_FB_S1D13XXX is not set
+# CONFIG_FB_VIRTUAL is not set
+# CONFIG_FB_METRONOME is not set
+CONFIG_FB_OMAP=y
+CONFIG_FB_OMAP_LCD_VGA=y
+# CONFIG_FB_OMAP_LCDC_EXTERNAL is not set
+# CONFIG_FB_OMAP_BOOTLOADER_INIT is not set
+CONFIG_FB_OMAP_CONSISTENT_DMA_SIZE=4
+CONFIG_BACKLIGHT_LCD_SUPPORT=y
+CONFIG_LCD_CLASS_DEVICE=y
+# CONFIG_LCD_LTV350QV is not set
+# CONFIG_LCD_ILI9320 is not set
+# CONFIG_LCD_TDO24M is not set
+# CONFIG_LCD_VGG2432A4 is not set
+CONFIG_LCD_PLATFORM=y
+CONFIG_BACKLIGHT_CLASS_DEVICE=y
+# CONFIG_BACKLIGHT_CORGI is not set
+# CONFIG_BACKLIGHT_GENERIC is not set
#
# Display device support
@@ -780,6 +820,16 @@
#
# CONFIG_VGA_CONSOLE is not set
CONFIG_DUMMY_CONSOLE=y
+CONFIG_FRAMEBUFFER_CONSOLE=y
+# CONFIG_FRAMEBUFFER_CONSOLE_DETECT_PRIMARY is not set
+# CONFIG_FRAMEBUFFER_CONSOLE_ROTATION is not set
+# CONFIG_FONTS is not set
+CONFIG_FONT_8x8=y
+CONFIG_FONT_8x16=y
+CONFIG_LOGO=y
+CONFIG_LOGO_LINUX_MONO=y
+CONFIG_LOGO_LINUX_VGA16=y
+CONFIG_LOGO_LINUX_CLUT224=y
CONFIG_SOUND=y
CONFIG_SND=y
# CONFIG_SND_SEQUENCER is not set
diff --git a/arch/arm/mach-at91/Kconfig b/arch/arm/mach-at91/Kconfig
index a24d824..e35d54d 100644
--- a/arch/arm/mach-at91/Kconfig
+++ b/arch/arm/mach-at91/Kconfig
@@ -289,6 +289,13 @@
help
Select this if you are using the Adeneo Neocore 926 board.
+config MACH_AT91SAM9G20EK_2MMC
+ bool "Atmel AT91SAM9G20-EK Evaluation Kit modified for 2 MMC Slots"
+ depends on ARCH_AT91SAM9G20
+ help
+ Select this if you are using an Atmel AT91SAM9G20-EK Evaluation Kit
+ Rev A or B modified for 2 MMC Slots.
+
endif
# ----------------------------------------------------------
diff --git a/arch/arm/mach-at91/Makefile b/arch/arm/mach-at91/Makefile
index a6ed015..ada440a 100644
--- a/arch/arm/mach-at91/Makefile
+++ b/arch/arm/mach-at91/Makefile
@@ -59,6 +59,7 @@
# AT91SAM9G20 board-specific support
obj-$(CONFIG_MACH_AT91SAM9G20EK) += board-sam9g20ek.o
+obj-$(CONFIG_MACH_AT91SAM9G20EK_2MMC) += board-sam9g20ek-2slot-mmc.o
obj-$(CONFIG_MACH_CPU9G20) += board-cpu9krea.o
# AT91SAM9G45 board-specific support
diff --git a/arch/arm/mach-at91/at91sam9260_devices.c b/arch/arm/mach-at91/at91sam9260_devices.c
index ee4ea0e7..07eb7b0 100644
--- a/arch/arm/mach-at91/at91sam9260_devices.c
+++ b/arch/arm/mach-at91/at91sam9260_devices.c
@@ -278,6 +278,102 @@
void __init at91_add_device_mmc(short mmc_id, struct at91_mmc_data *data) {}
#endif
+/* --------------------------------------------------------------------
+ * MMC / SD Slot for Atmel MCI Driver
+ * -------------------------------------------------------------------- */
+
+#if defined(CONFIG_MMC_ATMELMCI) || defined(CONFIG_MMC_ATMELMCI_MODULE)
+static u64 mmc_dmamask = DMA_BIT_MASK(32);
+static struct mci_platform_data mmc_data;
+
+static struct resource mmc_resources[] = {
+ [0] = {
+ .start = AT91SAM9260_BASE_MCI,
+ .end = AT91SAM9260_BASE_MCI + SZ_16K - 1,
+ .flags = IORESOURCE_MEM,
+ },
+ [1] = {
+ .start = AT91SAM9260_ID_MCI,
+ .end = AT91SAM9260_ID_MCI,
+ .flags = IORESOURCE_IRQ,
+ },
+};
+
+static struct platform_device at91sam9260_mmc_device = {
+ .name = "atmel_mci",
+ .id = -1,
+ .dev = {
+ .dma_mask = &mmc_dmamask,
+ .coherent_dma_mask = DMA_BIT_MASK(32),
+ .platform_data = &mmc_data,
+ },
+ .resource = mmc_resources,
+ .num_resources = ARRAY_SIZE(mmc_resources),
+};
+
+void __init at91_add_device_mci(short mmc_id, struct mci_platform_data *data)
+{
+ unsigned int i;
+ unsigned int slot_count = 0;
+
+ if (!data)
+ return;
+
+ for (i = 0; i < ATMEL_MCI_MAX_NR_SLOTS; i++) {
+ if (data->slot[i].bus_width) {
+ /* input/irq */
+ if (data->slot[i].detect_pin) {
+ at91_set_gpio_input(data->slot[i].detect_pin, 1);
+ at91_set_deglitch(data->slot[i].detect_pin, 1);
+ }
+ if (data->slot[i].wp_pin)
+ at91_set_gpio_input(data->slot[i].wp_pin, 1);
+
+ switch (i) {
+ case 0:
+ /* CMD */
+ at91_set_A_periph(AT91_PIN_PA7, 1);
+ /* DAT0, maybe DAT1..DAT3 */
+ at91_set_A_periph(AT91_PIN_PA6, 1);
+ if (data->slot[i].bus_width == 4) {
+ at91_set_A_periph(AT91_PIN_PA9, 1);
+ at91_set_A_periph(AT91_PIN_PA10, 1);
+ at91_set_A_periph(AT91_PIN_PA11, 1);
+ }
+ slot_count++;
+ break;
+ case 1:
+ /* CMD */
+ at91_set_B_periph(AT91_PIN_PA1, 1);
+ /* DAT0, maybe DAT1..DAT3 */
+ at91_set_B_periph(AT91_PIN_PA0, 1);
+ if (data->slot[i].bus_width == 4) {
+ at91_set_B_periph(AT91_PIN_PA5, 1);
+ at91_set_B_periph(AT91_PIN_PA4, 1);
+ at91_set_B_periph(AT91_PIN_PA3, 1);
+ }
+ slot_count++;
+ break;
+ default:
+ printk(KERN_ERR
+ "AT91: SD/MMC slot %d not available\n", i);
+ break;
+ }
+ }
+ }
+
+ if (slot_count) {
+ /* CLK */
+ at91_set_A_periph(AT91_PIN_PA8, 0);
+
+ mmc_data = *data;
+ platform_device_register(&at91sam9260_mmc_device);
+ }
+}
+#else
+void __init at91_add_device_mci(short mmc_id, struct mci_platform_data *data) {}
+#endif
+
/* --------------------------------------------------------------------
* NAND / SmartMedia
diff --git a/arch/arm/mach-at91/board-sam9g20ek-2slot-mmc.c b/arch/arm/mach-at91/board-sam9g20ek-2slot-mmc.c
new file mode 100644
index 0000000..a28e53f
--- /dev/null
+++ b/arch/arm/mach-at91/board-sam9g20ek-2slot-mmc.c
@@ -0,0 +1,277 @@
+/*
+ * Copyright (C) 2005 SAN People
+ * Copyright (C) 2008 Atmel
+ * Copyright (C) 2009 Rob Emanuele
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+
+#include <linux/types.h>
+#include <linux/init.h>
+#include <linux/mm.h>
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/spi/spi.h>
+#include <linux/spi/at73c213.h>
+#include <linux/clk.h>
+
+#include <mach/hardware.h>
+#include <asm/setup.h>
+#include <asm/mach-types.h>
+#include <asm/irq.h>
+
+#include <asm/mach/arch.h>
+#include <asm/mach/map.h>
+#include <asm/mach/irq.h>
+
+#include <mach/board.h>
+#include <mach/gpio.h>
+#include <mach/at91sam9_smc.h>
+
+#include "sam9_smc.h"
+#include "generic.h"
+
+
+static void __init ek_map_io(void)
+{
+ /* Initialize processor: 18.432 MHz crystal */
+ at91sam9260_initialize(18432000);
+
+ /* DGBU on ttyS0. (Rx & Tx only) */
+ at91_register_uart(0, 0, 0);
+
+ /* USART0 on ttyS1. (Rx, Tx, CTS, RTS, DTR, DSR, DCD, RI) */
+ at91_register_uart(AT91SAM9260_ID_US0, 1, ATMEL_UART_CTS | ATMEL_UART_RTS
+ | ATMEL_UART_DTR | ATMEL_UART_DSR | ATMEL_UART_DCD
+ | ATMEL_UART_RI);
+
+ /* USART1 on ttyS2. (Rx, Tx, RTS, CTS) */
+ at91_register_uart(AT91SAM9260_ID_US1, 2, ATMEL_UART_CTS | ATMEL_UART_RTS);
+
+ /* set serial console to ttyS0 (ie, DBGU) */
+ at91_set_serial_console(0);
+}
+
+static void __init ek_init_irq(void)
+{
+ at91sam9260_init_interrupts(NULL);
+}
+
+
+/*
+ * USB Host port
+ */
+static struct at91_usbh_data __initdata ek_usbh_data = {
+ .ports = 2,
+};
+
+/*
+ * USB Device port
+ */
+static struct at91_udc_data __initdata ek_udc_data = {
+ .vbus_pin = AT91_PIN_PC5,
+ .pullup_pin = 0, /* pull-up driven by UDC */
+};
+
+
+/*
+ * SPI devices.
+ */
+static struct spi_board_info ek_spi_devices[] = {
+#if !defined(CONFIG_MMC_ATMELMCI)
+ { /* DataFlash chip */
+ .modalias = "mtd_dataflash",
+ .chip_select = 1,
+ .max_speed_hz = 15 * 1000 * 1000,
+ .bus_num = 0,
+ },
+#if defined(CONFIG_MTD_AT91_DATAFLASH_CARD)
+ { /* DataFlash card */
+ .modalias = "mtd_dataflash",
+ .chip_select = 0,
+ .max_speed_hz = 15 * 1000 * 1000,
+ .bus_num = 0,
+ },
+#endif
+#endif
+};
+
+
+/*
+ * MACB Ethernet device
+ */
+static struct at91_eth_data __initdata ek_macb_data = {
+ .phy_irq_pin = AT91_PIN_PC12,
+ .is_rmii = 1,
+};
+
+
+/*
+ * NAND flash
+ */
+static struct mtd_partition __initdata ek_nand_partition[] = {
+ {
+ .name = "Bootstrap",
+ .offset = 0,
+ .size = 4 * SZ_1M,
+ },
+ {
+ .name = "Partition 1",
+ .offset = MTDPART_OFS_NXTBLK,
+ .size = 60 * SZ_1M,
+ },
+ {
+ .name = "Partition 2",
+ .offset = MTDPART_OFS_NXTBLK,
+ .size = MTDPART_SIZ_FULL,
+ },
+};
+
+static struct mtd_partition * __init nand_partitions(int size, int *num_partitions)
+{
+ *num_partitions = ARRAY_SIZE(ek_nand_partition);
+ return ek_nand_partition;
+}
+
+/* det_pin is not connected */
+static struct atmel_nand_data __initdata ek_nand_data = {
+ .ale = 21,
+ .cle = 22,
+ .rdy_pin = AT91_PIN_PC13,
+ .enable_pin = AT91_PIN_PC14,
+ .partition_info = nand_partitions,
+#if defined(CONFIG_MTD_NAND_ATMEL_BUSWIDTH_16)
+ .bus_width_16 = 1,
+#else
+ .bus_width_16 = 0,
+#endif
+};
+
+static struct sam9_smc_config __initdata ek_nand_smc_config = {
+ .ncs_read_setup = 0,
+ .nrd_setup = 2,
+ .ncs_write_setup = 0,
+ .nwe_setup = 2,
+
+ .ncs_read_pulse = 4,
+ .nrd_pulse = 4,
+ .ncs_write_pulse = 4,
+ .nwe_pulse = 4,
+
+ .read_cycle = 7,
+ .write_cycle = 7,
+
+ .mode = AT91_SMC_READMODE | AT91_SMC_WRITEMODE | AT91_SMC_EXNWMODE_DISABLE,
+ .tdf_cycles = 3,
+};
+
+static void __init ek_add_device_nand(void)
+{
+ /* setup bus-width (8 or 16) */
+ if (ek_nand_data.bus_width_16)
+ ek_nand_smc_config.mode |= AT91_SMC_DBW_16;
+ else
+ ek_nand_smc_config.mode |= AT91_SMC_DBW_8;
+
+ /* configure chip-select 3 (NAND) */
+ sam9_smc_configure(3, &ek_nand_smc_config);
+
+ at91_add_device_nand(&ek_nand_data);
+}
+
+
+/*
+ * MCI (SD/MMC)
+ * det_pin and wp_pin are not connected
+ */
+#if defined(CONFIG_MMC_ATMELMCI) || defined(CONFIG_MMC_ATMELMCI_MODULE)
+static struct mci_platform_data __initdata ek_mmc_data = {
+ .slot[0] = {
+ .bus_width = 4,
+ .detect_pin = -ENODEV,
+ .wp_pin = -ENODEV,
+ },
+ .slot[1] = {
+ .bus_width = 4,
+ .detect_pin = -ENODEV,
+ .wp_pin = -ENODEV,
+ },
+
+};
+#else
+static struct amci_platform_data __initdata ek_mmc_data = {
+};
+#endif
+
+/*
+ * LEDs
+ */
+static struct gpio_led ek_leds[] = {
+ { /* "bottom" led, green, userled1 to be defined */
+ .name = "ds5",
+ .gpio = AT91_PIN_PB12,
+ .active_low = 1,
+ .default_trigger = "none",
+ },
+ { /* "power" led, yellow */
+ .name = "ds1",
+ .gpio = AT91_PIN_PB13,
+ .default_trigger = "heartbeat",
+ }
+};
+
+static struct i2c_board_info __initdata ek_i2c_devices[] = {
+ {
+ I2C_BOARD_INFO("24c512", 0x50),
+ },
+};
+
+
+static void __init ek_board_init(void)
+{
+ /* Serial */
+ at91_add_device_serial();
+ /* USB Host */
+ at91_add_device_usbh(&ek_usbh_data);
+ /* USB Device */
+ at91_add_device_udc(&ek_udc_data);
+ /* SPI */
+ at91_add_device_spi(ek_spi_devices, ARRAY_SIZE(ek_spi_devices));
+ /* NAND */
+ ek_add_device_nand();
+ /* Ethernet */
+ at91_add_device_eth(&ek_macb_data);
+ /* MMC */
+ at91_add_device_mci(0, &ek_mmc_data);
+ /* I2C */
+ at91_add_device_i2c(ek_i2c_devices, ARRAY_SIZE(ek_i2c_devices));
+ /* LEDs */
+ at91_gpio_leds(ek_leds, ARRAY_SIZE(ek_leds));
+ /* PCK0 provides MCLK to the WM8731 */
+ at91_set_B_periph(AT91_PIN_PC1, 0);
+ /* SSC (for WM8731) */
+ at91_add_device_ssc(AT91SAM9260_ID_SSC, ATMEL_SSC_TX);
+}
+
+MACHINE_START(AT91SAM9G20EK_2MMC, "Atmel AT91SAM9G20-EK 2 MMC Slot Mod")
+ /* Maintainer: Rob Emanuele */
+ .phys_io = AT91_BASE_SYS,
+ .io_pg_offst = (AT91_VA_BASE_SYS >> 18) & 0xfffc,
+ .boot_params = AT91_SDRAM_BASE + 0x100,
+ .timer = &at91sam926x_timer,
+ .map_io = ek_map_io,
+ .init_irq = ek_init_irq,
+ .init_machine = ek_board_init,
+MACHINE_END
diff --git a/arch/arm/mach-at91/include/mach/board.h b/arch/arm/mach-at91/include/mach/board.h
index 13f27a4..583f38a 100644
--- a/arch/arm/mach-at91/include/mach/board.h
+++ b/arch/arm/mach-at91/include/mach/board.h
@@ -37,6 +37,7 @@
#include <linux/leds.h>
#include <linux/spi/spi.h>
#include <linux/usb/atmel_usba_udc.h>
+#include <linux/atmel-mci.h>
#include <sound/atmel-ac97c.h>
/* USB Device */
@@ -64,6 +65,7 @@
extern void __init at91_add_device_cf(struct at91_cf_data *data);
/* MMC / SD */
+ /* at91_mci platform config */
struct at91_mmc_data {
u8 det_pin; /* card detect IRQ */
unsigned slot_b:1; /* uses Slot B */
@@ -73,6 +75,9 @@
};
extern void __init at91_add_device_mmc(short mmc_id, struct at91_mmc_data *data);
+ /* atmel-mci platform config */
+extern void __init at91_add_device_mci(short mmc_id, struct mci_platform_data *data);
+
/* Ethernet (EMAC & MACB) */
struct at91_eth_data {
u32 phy_mask;
diff --git a/arch/arm/mach-ep93xx/clock.c b/arch/arm/mach-ep93xx/clock.c
index 3dd0e2a..dda19cd7 100644
--- a/arch/arm/mach-ep93xx/clock.c
+++ b/arch/arm/mach-ep93xx/clock.c
@@ -37,7 +37,7 @@
static unsigned long get_uart_rate(struct clk *clk);
static int set_keytchclk_rate(struct clk *clk, unsigned long rate);
-
+static int set_div_rate(struct clk *clk, unsigned long rate);
static struct clk clk_uart1 = {
.sw_locked = 1,
@@ -76,6 +76,13 @@
.rate = EP93XX_EXT_CLK_RATE,
};
+static struct clk clk_video = {
+ .sw_locked = 1,
+ .enable_reg = EP93XX_SYSCON_VIDCLKDIV,
+ .enable_mask = EP93XX_SYSCON_CLKDIV_ENABLE,
+ .set_rate = set_div_rate,
+};
+
/* DMA Clocks */
static struct clk clk_m2p0 = {
.enable_reg = EP93XX_SYSCON_PWRCNT,
@@ -140,6 +147,7 @@
INIT_CK(NULL, "pll2", &clk_pll2),
INIT_CK("ep93xx-ohci", NULL, &clk_usb_host),
INIT_CK("ep93xx-keypad", NULL, &clk_keypad),
+ INIT_CK("ep93xx-fb", NULL, &clk_video),
INIT_CK(NULL, "pwm_clk", &clk_pwm),
INIT_CK(NULL, "m2p0", &clk_m2p0),
INIT_CK(NULL, "m2p1", &clk_m2p1),
@@ -236,6 +244,84 @@
return 0;
}
+static unsigned long calc_clk_div(unsigned long rate, int *psel, int *esel,
+ int *pdiv, int *div)
+{
+ unsigned long max_rate, best_rate = 0,
+ actual_rate = 0, mclk_rate = 0, rate_err = -1;
+ int i, found = 0, __div = 0, __pdiv = 0;
+
+ /* Don't exceed the maximum rate */
+ max_rate = max(max(clk_pll1.rate / 4, clk_pll2.rate / 4),
+ (unsigned long)EP93XX_EXT_CLK_RATE / 4);
+ rate = min(rate, max_rate);
+
+ /*
+ * Try the two pll's and the external clock
+ * Because the valid predividers are 2, 2.5 and 3, we multiply
+ * all the clocks by 2 to avoid floating point math.
+ *
+ * This is based on the algorithm in the ep93xx raster guide:
+ * http://be-a-maverick.com/en/pubs/appNote/AN269REV1.pdf
+ *
+ */
+ for (i = 0; i < 3; i++) {
+ if (i == 0)
+ mclk_rate = EP93XX_EXT_CLK_RATE * 2;
+ else if (i == 1)
+ mclk_rate = clk_pll1.rate * 2;
+ else if (i == 2)
+ mclk_rate = clk_pll2.rate * 2;
+
+ /* Try each predivider value */
+ for (__pdiv = 4; __pdiv <= 6; __pdiv++) {
+ __div = mclk_rate / (rate * __pdiv);
+ if (__div < 2 || __div > 127)
+ continue;
+
+ actual_rate = mclk_rate / (__pdiv * __div);
+
+ if (!found || abs(actual_rate - rate) < rate_err) {
+ *pdiv = __pdiv - 3;
+ *div = __div;
+ *psel = (i == 2);
+ *esel = (i != 0);
+ best_rate = actual_rate;
+ rate_err = abs(actual_rate - rate);
+ found = 1;
+ }
+ }
+ }
+
+ if (!found)
+ return 0;
+
+ return best_rate;
+}
+
+static int set_div_rate(struct clk *clk, unsigned long rate)
+{
+ unsigned long actual_rate;
+ int psel = 0, esel = 0, pdiv = 0, div = 0;
+ u32 val;
+
+ actual_rate = calc_clk_div(rate, &psel, &esel, &pdiv, &div);
+ if (actual_rate == 0)
+ return -EINVAL;
+ clk->rate = actual_rate;
+
+ /* Clear the esel, psel, pdiv and div bits */
+ val = __raw_readl(clk->enable_reg);
+ val &= ~0x7fff;
+
+ /* Set the new esel, psel, pdiv and div bits for the new clock rate */
+ val |= (esel ? EP93XX_SYSCON_CLKDIV_ESEL : 0) |
+ (psel ? EP93XX_SYSCON_CLKDIV_PSEL : 0) |
+ (pdiv << EP93XX_SYSCON_CLKDIV_PDIV_SHIFT) | div;
+ ep93xx_syscon_swlocked_write(val, clk->enable_reg);
+ return 0;
+}
+
int clk_set_rate(struct clk *clk, unsigned long rate)
{
if (clk->set_rate)
diff --git a/arch/arm/mach-ep93xx/core.c b/arch/arm/mach-ep93xx/core.c
index 16b92c3..f7ebed9 100644
--- a/arch/arm/mach-ep93xx/core.c
+++ b/arch/arm/mach-ep93xx/core.c
@@ -30,6 +30,7 @@
#include <linux/i2c-gpio.h>
#include <mach/hardware.h>
+#include <mach/fb.h>
#include <asm/mach/map.h>
#include <asm/mach/time.h>
@@ -682,6 +683,37 @@
EXPORT_SYMBOL(ep93xx_pwm_release_gpio);
+/*************************************************************************
+ * EP93xx video peripheral handling
+ *************************************************************************/
+static struct ep93xxfb_mach_info ep93xxfb_data;
+
+static struct resource ep93xx_fb_resource[] = {
+ {
+ .start = EP93XX_RASTER_PHYS_BASE,
+ .end = EP93XX_RASTER_PHYS_BASE + 0x800 - 1,
+ .flags = IORESOURCE_MEM,
+ },
+};
+
+static struct platform_device ep93xx_fb_device = {
+ .name = "ep93xx-fb",
+ .id = -1,
+ .dev = {
+ .platform_data = &ep93xxfb_data,
+ .coherent_dma_mask = DMA_BIT_MASK(32),
+ .dma_mask = &ep93xx_fb_device.dev.coherent_dma_mask,
+ },
+ .num_resources = ARRAY_SIZE(ep93xx_fb_resource),
+ .resource = ep93xx_fb_resource,
+};
+
+void __init ep93xx_register_fb(struct ep93xxfb_mach_info *data)
+{
+ ep93xxfb_data = *data;
+ platform_device_register(&ep93xx_fb_device);
+}
+
extern void ep93xx_gpio_init(void);
void __init ep93xx_init_devices(void)
diff --git a/arch/arm/mach-ep93xx/include/mach/ep93xx-regs.h b/arch/arm/mach-ep93xx/include/mach/ep93xx-regs.h
index ea78e90..0fbf87b 100644
--- a/arch/arm/mach-ep93xx/include/mach/ep93xx-regs.h
+++ b/arch/arm/mach-ep93xx/include/mach/ep93xx-regs.h
@@ -70,6 +70,7 @@
#define EP93XX_USB_PHYS_BASE (EP93XX_AHB_PHYS_BASE + 0x00020000)
#define EP93XX_USB_BASE EP93XX_AHB_IOMEM(0x00020000)
+#define EP93XX_RASTER_PHYS_BASE (EP93XX_AHB_PHYS_BASE + 0x00030000)
#define EP93XX_RASTER_BASE EP93XX_AHB_IOMEM(0x00030000)
#define EP93XX_GRAPHICS_ACCEL_BASE EP93XX_AHB_IOMEM(0x00040000)
@@ -207,6 +208,11 @@
#define EP93XX_SYSCON_DEVCFG_ADCPD (1<<2)
#define EP93XX_SYSCON_DEVCFG_KEYS (1<<1)
#define EP93XX_SYSCON_DEVCFG_SHENA (1<<0)
+#define EP93XX_SYSCON_VIDCLKDIV EP93XX_SYSCON_REG(0x84)
+#define EP93XX_SYSCON_CLKDIV_ENABLE (1<<15)
+#define EP93XX_SYSCON_CLKDIV_ESEL (1<<14)
+#define EP93XX_SYSCON_CLKDIV_PSEL (1<<13)
+#define EP93XX_SYSCON_CLKDIV_PDIV_SHIFT 8
#define EP93XX_SYSCON_KEYTCHCLKDIV EP93XX_SYSCON_REG(0x90)
#define EP93XX_SYSCON_KEYTCHCLKDIV_TSEN (1<<31)
#define EP93XX_SYSCON_KEYTCHCLKDIV_ADIV (1<<16)
diff --git a/arch/arm/mach-ep93xx/include/mach/fb.h b/arch/arm/mach-ep93xx/include/mach/fb.h
new file mode 100644
index 0000000..d5ae11d7
--- /dev/null
+++ b/arch/arm/mach-ep93xx/include/mach/fb.h
@@ -0,0 +1,56 @@
+/*
+ * arch/arm/mach-ep93xx/include/mach/fb.h
+ */
+
+#ifndef __ASM_ARCH_EP93XXFB_H
+#define __ASM_ARCH_EP93XXFB_H
+
+struct platform_device;
+struct fb_videomode;
+struct fb_info;
+
+#define EP93XXFB_USE_MODEDB 0
+
+/* VideoAttributes flags */
+#define EP93XXFB_STATE_MACHINE_ENABLE (1 << 0)
+#define EP93XXFB_PIXEL_CLOCK_ENABLE (1 << 1)
+#define EP93XXFB_VSYNC_ENABLE (1 << 2)
+#define EP93XXFB_PIXEL_DATA_ENABLE (1 << 3)
+#define EP93XXFB_COMPOSITE_SYNC (1 << 4)
+#define EP93XXFB_SYNC_VERT_HIGH (1 << 5)
+#define EP93XXFB_SYNC_HORIZ_HIGH (1 << 6)
+#define EP93XXFB_SYNC_BLANK_HIGH (1 << 7)
+#define EP93XXFB_PCLK_FALLING (1 << 8)
+#define EP93XXFB_ENABLE_AC (1 << 9)
+#define EP93XXFB_ENABLE_LCD (1 << 10)
+#define EP93XXFB_ENABLE_CCIR (1 << 12)
+#define EP93XXFB_USE_PARALLEL_INTERFACE (1 << 13)
+#define EP93XXFB_ENABLE_INTERRUPT (1 << 14)
+#define EP93XXFB_USB_INTERLACE (1 << 16)
+#define EP93XXFB_USE_EQUALIZATION (1 << 17)
+#define EP93XXFB_USE_DOUBLE_HORZ (1 << 18)
+#define EP93XXFB_USE_DOUBLE_VERT (1 << 19)
+#define EP93XXFB_USE_BLANK_PIXEL (1 << 20)
+#define EP93XXFB_USE_SDCSN0 (0 << 21)
+#define EP93XXFB_USE_SDCSN1 (1 << 21)
+#define EP93XXFB_USE_SDCSN2 (2 << 21)
+#define EP93XXFB_USE_SDCSN3 (3 << 21)
+
+#define EP93XXFB_ENABLE (EP93XXFB_STATE_MACHINE_ENABLE | \
+ EP93XXFB_PIXEL_CLOCK_ENABLE | \
+ EP93XXFB_VSYNC_ENABLE | \
+ EP93XXFB_PIXEL_DATA_ENABLE)
+
+struct ep93xxfb_mach_info {
+ unsigned int num_modes;
+ const struct fb_videomode *modes;
+ const struct fb_videomode *default_mode;
+ int bpp;
+ unsigned int flags;
+
+ int (*setup)(struct platform_device *pdev);
+ void (*teardown)(struct platform_device *pdev);
+ void (*blank)(int blank_mode, struct fb_info *info);
+};
+
+#endif /* __ASM_ARCH_EP93XXFB_H */
diff --git a/arch/arm/mach-ep93xx/include/mach/platform.h b/arch/arm/mach-ep93xx/include/mach/platform.h
index 5f5fa65..01a0f08 100644
--- a/arch/arm/mach-ep93xx/include/mach/platform.h
+++ b/arch/arm/mach-ep93xx/include/mach/platform.h
@@ -6,6 +6,7 @@
struct i2c_board_info;
struct platform_device;
+struct ep93xxfb_mach_info;
struct ep93xx_eth_data
{
@@ -33,6 +34,7 @@
void ep93xx_register_eth(struct ep93xx_eth_data *data, int copy_addr);
void ep93xx_register_i2c(struct i2c_board_info *devices, int num);
+void ep93xx_register_fb(struct ep93xxfb_mach_info *data);
void ep93xx_register_pwm(int pwm0, int pwm1);
int ep93xx_pwm_acquire_gpio(struct platform_device *pdev);
void ep93xx_pwm_release_gpio(struct platform_device *pdev);
diff --git a/arch/arm/mach-omap2/board-rx51-peripherals.c b/arch/arm/mach-omap2/board-rx51-peripherals.c
index e70baa7..e6e8290 100644
--- a/arch/arm/mach-omap2/board-rx51-peripherals.c
+++ b/arch/arm/mach-omap2/board-rx51-peripherals.c
@@ -19,6 +19,7 @@
#include <linux/delay.h>
#include <linux/regulator/machine.h>
#include <linux/gpio.h>
+#include <linux/mmc/host.h>
#include <mach/mcspi.h>
#include <mach/mux.h>
@@ -102,6 +103,7 @@
.cover_only = true,
.gpio_cd = 160,
.gpio_wp = -EINVAL,
+ .power_saving = true,
},
{
.name = "internal",
@@ -109,6 +111,8 @@
.wires = 8,
.gpio_cd = -EINVAL,
.gpio_wp = -EINVAL,
+ .nonremovable = true,
+ .power_saving = true,
},
{} /* Terminator */
};
diff --git a/arch/arm/mach-omap2/devices.c b/arch/arm/mach-omap2/devices.c
index a2e9156..bcfcfc7 100644
--- a/arch/arm/mach-omap2/devices.c
+++ b/arch/arm/mach-omap2/devices.c
@@ -257,6 +257,11 @@
#define OMAP2_MCSPI3_BASE 0x480b8000
#define OMAP2_MCSPI4_BASE 0x480ba000
+#define OMAP4_MCSPI1_BASE 0x48098100
+#define OMAP4_MCSPI2_BASE 0x4809a100
+#define OMAP4_MCSPI3_BASE 0x480b8100
+#define OMAP4_MCSPI4_BASE 0x480ba100
+
static struct omap2_mcspi_platform_config omap2_mcspi1_config = {
.num_cs = 4,
};
@@ -301,7 +306,8 @@
},
};
-#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3)
+#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3) || \
+ defined(CONFIG_ARCH_OMAP4)
static struct omap2_mcspi_platform_config omap2_mcspi3_config = {
.num_cs = 2,
};
@@ -325,7 +331,7 @@
};
#endif
-#ifdef CONFIG_ARCH_OMAP3
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
static struct omap2_mcspi_platform_config omap2_mcspi4_config = {
.num_cs = 1,
};
@@ -351,14 +357,25 @@
static void omap_init_mcspi(void)
{
+ if (cpu_is_omap44xx()) {
+ omap2_mcspi1_resources[0].start = OMAP4_MCSPI1_BASE;
+ omap2_mcspi1_resources[0].end = OMAP4_MCSPI1_BASE + 0xff;
+ omap2_mcspi2_resources[0].start = OMAP4_MCSPI2_BASE;
+ omap2_mcspi2_resources[0].end = OMAP4_MCSPI2_BASE + 0xff;
+ omap2_mcspi3_resources[0].start = OMAP4_MCSPI3_BASE;
+ omap2_mcspi3_resources[0].end = OMAP4_MCSPI3_BASE + 0xff;
+ omap2_mcspi4_resources[0].start = OMAP4_MCSPI4_BASE;
+ omap2_mcspi4_resources[0].end = OMAP4_MCSPI4_BASE + 0xff;
+ }
platform_device_register(&omap2_mcspi1);
platform_device_register(&omap2_mcspi2);
-#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3)
- if (cpu_is_omap2430() || cpu_is_omap343x())
+#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3) || \
+ defined(CONFIG_ARCH_OMAP4)
+ if (cpu_is_omap2430() || cpu_is_omap343x() || cpu_is_omap44xx())
platform_device_register(&omap2_mcspi3);
#endif
-#ifdef CONFIG_ARCH_OMAP3
- if (cpu_is_omap343x())
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
+ if (cpu_is_omap343x() || cpu_is_omap44xx())
platform_device_register(&omap2_mcspi4);
#endif
}
@@ -397,7 +414,7 @@
/*-------------------------------------------------------------------------*/
-#ifdef CONFIG_ARCH_OMAP3
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
#define MMCHS_SYSCONFIG 0x0010
#define MMCHS_SYSCONFIG_SWRESET (1 << 1)
@@ -424,8 +441,8 @@
**/
static void __init omap_hsmmc_reset(void)
{
- u32 i, nr_controllers = cpu_is_omap34xx() ? OMAP34XX_NR_MMC :
- OMAP24XX_NR_MMC;
+ u32 i, nr_controllers = cpu_is_omap44xx() ? OMAP44XX_NR_MMC :
+ (cpu_is_omap34xx() ? OMAP34XX_NR_MMC : OMAP24XX_NR_MMC);
for (i = 0; i < nr_controllers; i++) {
u32 v, base = 0;
@@ -442,8 +459,21 @@
case 2:
base = OMAP3_MMC3_BASE;
break;
+ case 3:
+ if (!cpu_is_omap44xx())
+ return;
+ base = OMAP4_MMC4_BASE;
+ break;
+ case 4:
+ if (!cpu_is_omap44xx())
+ return;
+ base = OMAP4_MMC5_BASE;
+ break;
}
+ if (cpu_is_omap44xx())
+ base += OMAP4_MMC_REG_OFFSET;
+
dummy_pdev.id = i;
dev_set_name(&dummy_pdev.dev, "mmci-omap-hs.%d", i);
iclk = clk_get(dev, "ick");
@@ -581,11 +611,23 @@
irq = INT_24XX_MMC2_IRQ;
break;
case 2:
- if (!cpu_is_omap34xx())
+ if (!cpu_is_omap44xx() && !cpu_is_omap34xx())
return;
base = OMAP3_MMC3_BASE;
irq = INT_34XX_MMC3_IRQ;
break;
+ case 3:
+ if (!cpu_is_omap44xx())
+ return;
+ base = OMAP4_MMC4_BASE + OMAP4_MMC_REG_OFFSET;
+ irq = INT_44XX_MMC4_IRQ;
+ break;
+ case 4:
+ if (!cpu_is_omap44xx())
+ return;
+ base = OMAP4_MMC5_BASE + OMAP4_MMC_REG_OFFSET;
+ irq = INT_44XX_MMC5_IRQ;
+ break;
default:
continue;
}
@@ -593,8 +635,15 @@
if (cpu_is_omap2420()) {
size = OMAP2420_MMC_SIZE;
name = "mmci-omap";
+ } else if (cpu_is_omap44xx()) {
+ if (i < 3) {
+ base += OMAP4_MMC_REG_OFFSET;
+ irq += IRQ_GIC_START;
+ }
+ size = OMAP4_HSMMC_SIZE;
+ name = "mmci-omap-hs";
} else {
- size = HSMMC_SIZE;
+ size = OMAP3_HSMMC_SIZE;
name = "mmci-omap-hs";
}
omap_mmc_add(name, i, base, size, irq, mmc_data[i]);
diff --git a/arch/arm/mach-omap2/mmc-twl4030.c b/arch/arm/mach-omap2/mmc-twl4030.c
index 3c04c2f..c9c59a2 100644
--- a/arch/arm/mach-omap2/mmc-twl4030.c
+++ b/arch/arm/mach-omap2/mmc-twl4030.c
@@ -198,6 +198,18 @@
#define twl_mmc_resume NULL
#endif
+#if defined(CONFIG_ARCH_OMAP3) && defined(CONFIG_PM)
+
+static int twl4030_mmc_get_context_loss(struct device *dev)
+{
+ /* FIXME: PM DPS not implemented yet */
+ return 0;
+}
+
+#else
+#define twl4030_mmc_get_context_loss NULL
+#endif
+
static int twl_mmc1_set_power(struct device *dev, int slot, int power_on,
int vdd)
{
@@ -328,6 +340,61 @@
return ret;
}
+static int twl_mmc1_set_sleep(struct device *dev, int slot, int sleep, int vdd,
+ int cardsleep)
+{
+ struct twl_mmc_controller *c = &hsmmc[0];
+ int mode = sleep ? REGULATOR_MODE_STANDBY : REGULATOR_MODE_NORMAL;
+
+ return regulator_set_mode(c->vcc, mode);
+}
+
+static int twl_mmc23_set_sleep(struct device *dev, int slot, int sleep, int vdd,
+ int cardsleep)
+{
+ struct twl_mmc_controller *c = NULL;
+ struct omap_mmc_platform_data *mmc = dev->platform_data;
+ int i, err, mode;
+
+ for (i = 1; i < ARRAY_SIZE(hsmmc); i++) {
+ if (mmc == hsmmc[i].mmc) {
+ c = &hsmmc[i];
+ break;
+ }
+ }
+
+ if (c == NULL)
+ return -ENODEV;
+
+ /*
+ * If we don't see a Vcc regulator, assume it's a fixed
+ * voltage always-on regulator.
+ */
+ if (!c->vcc)
+ return 0;
+
+ mode = sleep ? REGULATOR_MODE_STANDBY : REGULATOR_MODE_NORMAL;
+
+ if (!c->vcc_aux)
+ return regulator_set_mode(c->vcc, mode);
+
+ if (cardsleep) {
+ /* VCC can be turned off if card is asleep */
+ struct regulator *vcc_aux = c->vcc_aux;
+
+ c->vcc_aux = NULL;
+ if (sleep)
+ err = twl_mmc23_set_power(dev, slot, 0, 0);
+ else
+ err = twl_mmc23_set_power(dev, slot, 1, vdd);
+ c->vcc_aux = vcc_aux;
+ } else
+ err = regulator_set_mode(c->vcc, mode);
+ if (err)
+ return err;
+ return regulator_set_mode(c->vcc_aux, mode);
+}
+
static struct omap_mmc_platform_data *hsmmc_data[OMAP34XX_NR_MMC] __initdata;
void __init twl4030_mmc_init(struct twl4030_hsmmc_info *controllers)
@@ -390,6 +457,9 @@
} else
mmc->slots[0].switch_pin = -EINVAL;
+ mmc->get_context_loss_count =
+ twl4030_mmc_get_context_loss;
+
/* write protect normally uses an OMAP gpio */
if (gpio_is_valid(c->gpio_wp)) {
gpio_request(c->gpio_wp, "mmc_wp");
@@ -400,6 +470,12 @@
} else
mmc->slots[0].gpio_wp = -EINVAL;
+ if (c->nonremovable)
+ mmc->slots[0].nonremovable = 1;
+
+ if (c->power_saving)
+ mmc->slots[0].power_saving = 1;
+
/* NOTE: MMC slots should have a Vcc regulator set up.
* This may be from a TWL4030-family chip, another
* controllable regulator, or a fixed supply.
@@ -412,6 +488,7 @@
case 1:
/* on-chip level shifting via PBIAS0/PBIAS1 */
mmc->slots[0].set_power = twl_mmc1_set_power;
+ mmc->slots[0].set_sleep = twl_mmc1_set_sleep;
break;
case 2:
if (c->ext_clock)
@@ -422,6 +499,7 @@
case 3:
/* off-chip level shifting, or none */
mmc->slots[0].set_power = twl_mmc23_set_power;
+ mmc->slots[0].set_sleep = twl_mmc23_set_sleep;
break;
default:
pr_err("MMC%d configuration not supported!\n", c->mmc);
diff --git a/arch/arm/mach-omap2/mmc-twl4030.h b/arch/arm/mach-omap2/mmc-twl4030.h
index 3807c45..a47e685 100644
--- a/arch/arm/mach-omap2/mmc-twl4030.h
+++ b/arch/arm/mach-omap2/mmc-twl4030.h
@@ -12,6 +12,8 @@
bool transceiver; /* MMC-2 option */
bool ext_clock; /* use external pin for input clock */
bool cover_only; /* No card detect - just cover switch */
+ bool nonremovable; /* Nonremovable e.g. eMMC */
+ bool power_saving; /* Try to sleep or power off when possible */
int gpio_cd; /* or -EINVAL */
int gpio_wp; /* or -EINVAL */
char *name; /* or NULL for default */
diff --git a/arch/arm/plat-mxc/include/mach/spi.h b/arch/arm/plat-mxc/include/mach/spi.h
new file mode 100644
index 0000000..08be445
--- /dev/null
+++ b/arch/arm/plat-mxc/include/mach/spi.h
@@ -0,0 +1,27 @@
+
+#ifndef __MACH_SPI_H_
+#define __MACH_SPI_H_
+
+/*
+ * struct spi_imx_master - device.platform_data for SPI controller devices.
+ * @chipselect: Array of chipselects for this master. Numbers >= 0 mean gpio
+ * pins, numbers < 0 mean internal CSPI chipselects according
+ * to MXC_SPI_CS(). Normally you want to use gpio based chip
+ * selects as the CSPI module tries to be intelligent about
+ * when to assert the chipselect: The CSPI module deasserts the
+ * chipselect once it runs out of input data. The other problem
+ * is that it is not possible to mix between high active and low
+ * active chipselects on one single bus using the internal
+ * chipselects. Unfortunately Freescale decided to put some
+ * chipselects on dedicated pins which are not usable as gpios,
+ * so we have to support the internal chipselects.
+ * @num_chipselect: ARRAY_SIZE(chipselect)
+ */
+struct spi_imx_master {
+ int *chipselect;
+ int num_chipselect;
+};
+
+#define MXC_SPI_CS(no) ((no) - 32)
+
+#endif /* __MACH_SPI_H_*/
diff --git a/arch/arm/plat-omap/include/mach/irqs.h b/arch/arm/plat-omap/include/mach/irqs.h
index fb7cb77..28a1650 100644
--- a/arch/arm/plat-omap/include/mach/irqs.h
+++ b/arch/arm/plat-omap/include/mach/irqs.h
@@ -503,6 +503,7 @@
#define INT_44XX_FPKA_READY_IRQ (50 + IRQ_GIC_START)
#define INT_44XX_SHA1MD51_IRQ (51 + IRQ_GIC_START)
#define INT_44XX_RNG_IRQ (52 + IRQ_GIC_START)
+#define INT_44XX_MMC5_IRQ (59 + IRQ_GIC_START)
#define INT_44XX_I2C3_IRQ (61 + IRQ_GIC_START)
#define INT_44XX_FPKA_ERROR_IRQ (64 + IRQ_GIC_START)
#define INT_44XX_PBIAS_IRQ (75 + IRQ_GIC_START)
@@ -511,6 +512,7 @@
#define INT_44XX_TLL_IRQ (78 + IRQ_GIC_START)
#define INT_44XX_PARTHASH_IRQ (79 + IRQ_GIC_START)
#define INT_44XX_MMC3_IRQ (94 + IRQ_GIC_START)
+#define INT_44XX_MMC4_IRQ (96 + IRQ_GIC_START)
/* Max. 128 level 2 IRQs (OMAP1610), 192 GPIOs (OMAP730/850) and
diff --git a/arch/arm/plat-omap/include/mach/lcd_mipid.h b/arch/arm/plat-omap/include/mach/lcd_mipid.h
index f8fbc48..8e52c65 100644
--- a/arch/arm/plat-omap/include/mach/lcd_mipid.h
+++ b/arch/arm/plat-omap/include/mach/lcd_mipid.h
@@ -16,7 +16,12 @@
struct mipid_platform_data {
int nreset_gpio;
int data_lines;
+
void (*shutdown)(struct mipid_platform_data *pdata);
+ void (*set_bklight_level)(struct mipid_platform_data *pdata,
+ int level);
+ int (*get_bklight_level)(struct mipid_platform_data *pdata);
+ int (*get_bklight_max)(struct mipid_platform_data *pdata);
};
#endif
diff --git a/arch/arm/plat-omap/include/mach/mmc.h b/arch/arm/plat-omap/include/mach/mmc.h
index 81d5b36..7229b95 100644
--- a/arch/arm/plat-omap/include/mach/mmc.h
+++ b/arch/arm/plat-omap/include/mach/mmc.h
@@ -25,11 +25,18 @@
#define OMAP24XX_NR_MMC 2
#define OMAP34XX_NR_MMC 3
+#define OMAP44XX_NR_MMC 5
#define OMAP2420_MMC_SIZE OMAP1_MMC_SIZE
-#define HSMMC_SIZE 0x200
+#define OMAP3_HSMMC_SIZE 0x200
+#define OMAP4_HSMMC_SIZE 0x1000
#define OMAP2_MMC1_BASE 0x4809c000
#define OMAP2_MMC2_BASE 0x480b4000
#define OMAP3_MMC3_BASE 0x480ad000
+#define OMAP4_MMC4_BASE 0x480d1000
+#define OMAP4_MMC5_BASE 0x480d5000
+#define OMAP4_MMC_REG_OFFSET 0x100
+#define HSMMC5 (1 << 4)
+#define HSMMC4 (1 << 3)
#define HSMMC3 (1 << 2)
#define HSMMC2 (1 << 1)
#define HSMMC1 (1 << 0)
@@ -59,6 +66,9 @@
int (*suspend)(struct device *dev, int slot);
int (*resume)(struct device *dev, int slot);
+ /* Return context loss count due to PM states changing */
+ int (*get_context_loss_count)(struct device *dev);
+
u64 dma_mask;
struct omap_mmc_slot_data {
@@ -80,12 +90,20 @@
/* use the internal clock */
unsigned internal_clock:1;
+ /* nonremovable e.g. eMMC */
+ unsigned nonremovable:1;
+
+ /* Try to sleep or power off when possible */
+ unsigned power_saving:1;
+
int switch_pin; /* gpio (card detect) */
int gpio_wp; /* gpio (write protect) */
int (* set_bus_mode)(struct device *dev, int slot, int bus_mode);
int (* set_power)(struct device *dev, int slot, int power_on, int vdd);
int (* get_ro)(struct device *dev, int slot);
+ int (*set_sleep)(struct device *dev, int slot, int sleep,
+ int vdd, int cardsleep);
/* return MMC cover switch state, can be NULL if not supported.
*
diff --git a/arch/arm/plat-omap/include/mach/omapfb.h b/arch/arm/plat-omap/include/mach/omapfb.h
index 7b74d12..b226bdf 100644
--- a/arch/arm/plat-omap/include/mach/omapfb.h
+++ b/arch/arm/plat-omap/include/mach/omapfb.h
@@ -276,8 +276,8 @@
void *fbi);
struct omapfb_mem_region {
- dma_addr_t paddr;
- void *vaddr;
+ u32 paddr;
+ void __iomem *vaddr;
unsigned long size;
u8 type; /* OMAPFB_PLANE_MEM_* */
unsigned alloc:1; /* allocated by the driver */
diff --git a/arch/blackfin/include/asm/sections.h b/arch/blackfin/include/asm/sections.h
index e7fd0ec..ae4dae1 100644
--- a/arch/blackfin/include/asm/sections.h
+++ b/arch/blackfin/include/asm/sections.h
@@ -1,9 +1,6 @@
#ifndef _BLACKFIN_SECTIONS_H
#define _BLACKFIN_SECTIONS_H
-/* nothing to see, move along */
-#include <asm-generic/sections.h>
-
/* only used when MTD_UCLINUX */
extern unsigned long memory_mtd_start, memory_mtd_end, mtd_size;
@@ -15,4 +12,39 @@
_stext_l2[], _etext_l2[], _sdata_l2[], _edata_l2[], _sbss_l2[],
_ebss_l2[], _l2_lma_start[];
+#include <asm/mem_map.h>
+
+/* Blackfin systems have discontinuous memory map and no virtualized memory */
+static inline int arch_is_kernel_text(unsigned long addr)
+{
+ return
+ (L1_CODE_LENGTH &&
+ addr >= (unsigned long)_stext_l1 &&
+ addr < (unsigned long)_etext_l1)
+ ||
+ (L2_LENGTH &&
+ addr >= (unsigned long)_stext_l2 &&
+ addr < (unsigned long)_etext_l2);
+}
+#define arch_is_kernel_text(addr) arch_is_kernel_text(addr)
+
+static inline int arch_is_kernel_data(unsigned long addr)
+{
+ return
+ (L1_DATA_A_LENGTH &&
+ addr >= (unsigned long)_sdata_l1 &&
+ addr < (unsigned long)_ebss_l1)
+ ||
+ (L1_DATA_B_LENGTH &&
+ addr >= (unsigned long)_sdata_b_l1 &&
+ addr < (unsigned long)_ebss_b_l1)
+ ||
+ (L2_LENGTH &&
+ addr >= (unsigned long)_sdata_l2 &&
+ addr < (unsigned long)_ebss_l2);
+}
+#define arch_is_kernel_data(addr) arch_is_kernel_data(addr)
+
+#include <asm-generic/sections.h>
+
#endif
diff --git a/arch/ia64/Kconfig b/arch/ia64/Kconfig
index 011a1cd..6851e52 100644
--- a/arch/ia64/Kconfig
+++ b/arch/ia64/Kconfig
@@ -500,6 +500,10 @@
def_bool y
depends on NUMA
+config ARCH_PROC_KCORE_TEXT
+ def_bool y
+ depends on PROC_KCORE
+
config IA32_SUPPORT
bool "Support for Linux/x86 binaries"
help
diff --git a/arch/ia64/mm/init.c b/arch/ia64/mm/init.c
index 1d28624..1857766 100644
--- a/arch/ia64/mm/init.c
+++ b/arch/ia64/mm/init.c
@@ -617,7 +617,6 @@
long reserved_pages, codesize, datasize, initsize;
pg_data_t *pgdat;
int i;
- static struct kcore_list kcore_mem, kcore_vmem, kcore_kernel;
BUG_ON(PTRS_PER_PGD * sizeof(pgd_t) != PAGE_SIZE);
BUG_ON(PTRS_PER_PMD * sizeof(pmd_t) != PAGE_SIZE);
@@ -639,10 +638,6 @@
high_memory = __va(max_low_pfn * PAGE_SIZE);
- kclist_add(&kcore_mem, __va(0), max_low_pfn * PAGE_SIZE);
- kclist_add(&kcore_vmem, (void *)VMALLOC_START, VMALLOC_END-VMALLOC_START);
- kclist_add(&kcore_kernel, _stext, _end - _stext);
-
for_each_online_pgdat(pgdat)
if (pgdat->bdata->node_bootmem_map)
totalram_pages += free_all_bootmem_node(pgdat);
diff --git a/arch/mips/mm/init.c b/arch/mips/mm/init.c
index 1f4ee47..15aa190 100644
--- a/arch/mips/mm/init.c
+++ b/arch/mips/mm/init.c
@@ -352,7 +352,6 @@
free_area_init_nodes(max_zone_pfns);
}
-static struct kcore_list kcore_mem, kcore_vmalloc;
#ifdef CONFIG_64BIT
static struct kcore_list kcore_kseg0;
#endif
@@ -409,11 +408,9 @@
if ((unsigned long) &_text > (unsigned long) CKSEG0)
/* The -4 is a hack so that user tools don't have to handle
the overflow. */
- kclist_add(&kcore_kseg0, (void *) CKSEG0, 0x80000000 - 4);
+ kclist_add(&kcore_kseg0, (void *) CKSEG0,
+ 0x80000000 - 4, KCORE_TEXT);
#endif
- kclist_add(&kcore_mem, __va(0), max_low_pfn << PAGE_SHIFT);
- kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
- VMALLOC_END-VMALLOC_START);
printk(KERN_INFO "Memory: %luk/%luk available (%ldk kernel code, "
"%ldk reserved, %ldk data, %ldk init, %ldk highmem)\n",
diff --git a/arch/mn10300/kernel/setup.c b/arch/mn10300/kernel/setup.c
index 79890ed..3f24c29 100644
--- a/arch/mn10300/kernel/setup.c
+++ b/arch/mn10300/kernel/setup.c
@@ -285,7 +285,7 @@
{
}
-struct seq_operations cpuinfo_op = {
+const struct seq_operations cpuinfo_op = {
.start = c_start,
.next = c_next,
.stop = c_stop,
diff --git a/arch/powerpc/boot/dts/mpc8377_mds.dts b/arch/powerpc/boot/dts/mpc8377_mds.dts
index f32c281..855782c 100644
--- a/arch/powerpc/boot/dts/mpc8377_mds.dts
+++ b/arch/powerpc/boot/dts/mpc8377_mds.dts
@@ -159,6 +159,7 @@
reg = <0x2e000 0x1000>;
interrupts = <42 0x8>;
interrupt-parent = <&ipic>;
+ sdhci,wp-inverted;
/* Filled in by U-Boot */
clock-frequency = <0>;
};
diff --git a/arch/powerpc/boot/dts/mpc8377_rdb.dts b/arch/powerpc/boot/dts/mpc8377_rdb.dts
index 28e022a..9e2264b 100644
--- a/arch/powerpc/boot/dts/mpc8377_rdb.dts
+++ b/arch/powerpc/boot/dts/mpc8377_rdb.dts
@@ -173,6 +173,7 @@
reg = <0x2e000 0x1000>;
interrupts = <42 0x8>;
interrupt-parent = <&ipic>;
+ sdhci,wp-inverted;
/* Filled in by U-Boot */
clock-frequency = <111111111>;
};
diff --git a/arch/powerpc/boot/dts/mpc8377_wlan.dts b/arch/powerpc/boot/dts/mpc8377_wlan.dts
index 3febc4e..9a60369 100644
--- a/arch/powerpc/boot/dts/mpc8377_wlan.dts
+++ b/arch/powerpc/boot/dts/mpc8377_wlan.dts
@@ -150,6 +150,7 @@
reg = <0x2e000 0x1000>;
interrupts = <42 0x8>;
interrupt-parent = <&ipic>;
+ sdhci,wp-inverted;
clock-frequency = <133333333>;
};
};
diff --git a/arch/powerpc/boot/dts/mpc8378_mds.dts b/arch/powerpc/boot/dts/mpc8378_mds.dts
index f720ab9..f70cf60 100644
--- a/arch/powerpc/boot/dts/mpc8378_mds.dts
+++ b/arch/powerpc/boot/dts/mpc8378_mds.dts
@@ -159,6 +159,7 @@
reg = <0x2e000 0x1000>;
interrupts = <42 0x8>;
interrupt-parent = <&ipic>;
+ sdhci,wp-inverted;
/* Filled in by U-Boot */
clock-frequency = <0>;
};
diff --git a/arch/powerpc/boot/dts/mpc8378_rdb.dts b/arch/powerpc/boot/dts/mpc8378_rdb.dts
index a11ead8..4e6a1a4 100644
--- a/arch/powerpc/boot/dts/mpc8378_rdb.dts
+++ b/arch/powerpc/boot/dts/mpc8378_rdb.dts
@@ -173,6 +173,7 @@
reg = <0x2e000 0x1000>;
interrupts = <42 0x8>;
interrupt-parent = <&ipic>;
+ sdhci,wp-inverted;
/* Filled in by U-Boot */
clock-frequency = <111111111>;
};
diff --git a/arch/powerpc/boot/dts/mpc8379_mds.dts b/arch/powerpc/boot/dts/mpc8379_mds.dts
index 4fa221f..645ec51 100644
--- a/arch/powerpc/boot/dts/mpc8379_mds.dts
+++ b/arch/powerpc/boot/dts/mpc8379_mds.dts
@@ -157,6 +157,7 @@
reg = <0x2e000 0x1000>;
interrupts = <42 0x8>;
interrupt-parent = <&ipic>;
+ sdhci,wp-inverted;
/* Filled in by U-Boot */
clock-frequency = <0>;
};
diff --git a/arch/powerpc/boot/dts/mpc8379_rdb.dts b/arch/powerpc/boot/dts/mpc8379_rdb.dts
index e35dfba..72336d5 100644
--- a/arch/powerpc/boot/dts/mpc8379_rdb.dts
+++ b/arch/powerpc/boot/dts/mpc8379_rdb.dts
@@ -171,6 +171,7 @@
reg = <0x2e000 0x1000>;
interrupts = <42 0x8>;
interrupt-parent = <&ipic>;
+ sdhci,wp-inverted;
/* Filled in by U-Boot */
clock-frequency = <111111111>;
};
diff --git a/arch/powerpc/kernel/setup-common.c b/arch/powerpc/kernel/setup-common.c
index 02fed27..1d5570a 100644
--- a/arch/powerpc/kernel/setup-common.c
+++ b/arch/powerpc/kernel/setup-common.c
@@ -328,7 +328,7 @@
{
}
-struct seq_operations cpuinfo_op = {
+const struct seq_operations cpuinfo_op = {
.start =c_start,
.next = c_next,
.stop = c_stop,
diff --git a/arch/powerpc/mm/init_32.c b/arch/powerpc/mm/init_32.c
index 3ef5084..9ddcfb4 100644
--- a/arch/powerpc/mm/init_32.c
+++ b/arch/powerpc/mm/init_32.c
@@ -242,39 +242,3 @@
}
#endif
-#ifdef CONFIG_PROC_KCORE
-static struct kcore_list kcore_vmem;
-
-static int __init setup_kcore(void)
-{
- int i;
-
- for (i = 0; i < lmb.memory.cnt; i++) {
- unsigned long base;
- unsigned long size;
- struct kcore_list *kcore_mem;
-
- base = lmb.memory.region[i].base;
- size = lmb.memory.region[i].size;
-
- kcore_mem = kmalloc(sizeof(struct kcore_list), GFP_ATOMIC);
- if (!kcore_mem)
- panic("%s: kmalloc failed\n", __func__);
-
- /* must stay under 32 bits */
- if ( 0xfffffffful - (unsigned long)__va(base) < size) {
- size = 0xfffffffful - (unsigned long)(__va(base));
- printk(KERN_DEBUG "setup_kcore: restrict size=%lx\n",
- size);
- }
-
- kclist_add(kcore_mem, __va(base), size);
- }
-
- kclist_add(&kcore_vmem, (void *)VMALLOC_START,
- VMALLOC_END-VMALLOC_START);
-
- return 0;
-}
-module_init(setup_kcore);
-#endif
diff --git a/arch/powerpc/mm/init_64.c b/arch/powerpc/mm/init_64.c
index 3158232..335c578 100644
--- a/arch/powerpc/mm/init_64.c
+++ b/arch/powerpc/mm/init_64.c
@@ -109,35 +109,6 @@
}
#endif
-#ifdef CONFIG_PROC_KCORE
-static struct kcore_list kcore_vmem;
-
-static int __init setup_kcore(void)
-{
- int i;
-
- for (i=0; i < lmb.memory.cnt; i++) {
- unsigned long base, size;
- struct kcore_list *kcore_mem;
-
- base = lmb.memory.region[i].base;
- size = lmb.memory.region[i].size;
-
- /* GFP_ATOMIC to avoid might_sleep warnings during boot */
- kcore_mem = kmalloc(sizeof(struct kcore_list), GFP_ATOMIC);
- if (!kcore_mem)
- panic("%s: kmalloc failed\n", __func__);
-
- kclist_add(kcore_mem, __va(base), size);
- }
-
- kclist_add(&kcore_vmem, (void *)VMALLOC_START, VMALLOC_END-VMALLOC_START);
-
- return 0;
-}
-module_init(setup_kcore);
-#endif
-
static void pgd_ctor(void *addr)
{
memset(addr, 0, PGD_TABLE_SIZE);
diff --git a/arch/powerpc/mm/mem.c b/arch/powerpc/mm/mem.c
index 0e5c59b..5973631 100644
--- a/arch/powerpc/mm/mem.c
+++ b/arch/powerpc/mm/mem.c
@@ -143,8 +143,8 @@
* memory regions, find holes and callback for contiguous regions.
*/
int
-walk_memory_resource(unsigned long start_pfn, unsigned long nr_pages, void *arg,
- int (*func)(unsigned long, unsigned long, void *))
+walk_system_ram_range(unsigned long start_pfn, unsigned long nr_pages,
+ void *arg, int (*func)(unsigned long, unsigned long, void *))
{
struct lmb_property res;
unsigned long pfn, len;
@@ -166,7 +166,7 @@
}
return ret;
}
-EXPORT_SYMBOL_GPL(walk_memory_resource);
+EXPORT_SYMBOL_GPL(walk_system_ram_range);
/*
* Initialize the bootmem system and give it all the memory we
diff --git a/arch/powerpc/platforms/pseries/hvCall_inst.c b/arch/powerpc/platforms/pseries/hvCall_inst.c
index eae51ef..3631a4f 100644
--- a/arch/powerpc/platforms/pseries/hvCall_inst.c
+++ b/arch/powerpc/platforms/pseries/hvCall_inst.c
@@ -71,7 +71,7 @@
return 0;
}
-static struct seq_operations hcall_inst_seq_ops = {
+static const struct seq_operations hcall_inst_seq_ops = {
.start = hc_start,
.next = hc_next,
.stop = hc_stop,
diff --git a/arch/score/include/asm/page.h b/arch/score/include/asm/page.h
index ee58210..d92a5a2 100644
--- a/arch/score/include/asm/page.h
+++ b/arch/score/include/asm/page.h
@@ -2,10 +2,11 @@
#define _ASM_SCORE_PAGE_H
#include <linux/pfn.h>
+#include <linux/const.h>
/* PAGE_SHIFT determines the page size */
#define PAGE_SHIFT (12)
-#define PAGE_SIZE (1UL << PAGE_SHIFT)
+#define PAGE_SIZE (_AC(1,UL) << PAGE_SHIFT)
#define PAGE_MASK (~(PAGE_SIZE-1))
#ifdef __KERNEL__
diff --git a/arch/score/include/asm/thread_info.h b/arch/score/include/asm/thread_info.h
index 3a11228..5593999 100644
--- a/arch/score/include/asm/thread_info.h
+++ b/arch/score/include/asm/thread_info.h
@@ -7,6 +7,15 @@
#define KU_USER 0x08
#define KU_KERN 0x00
+#include <asm/page.h>
+#include <linux/const.h>
+
+/* thread information allocation */
+#define THREAD_SIZE_ORDER (1)
+#define THREAD_SIZE (PAGE_SIZE << THREAD_SIZE_ORDER)
+#define THREAD_MASK (THREAD_SIZE - _AC(1,UL))
+#define __HAVE_ARCH_THREAD_INFO_ALLOCATOR
+
#ifndef __ASSEMBLY__
#include <asm/processor.h>
@@ -62,12 +71,6 @@
register struct thread_info *__current_thread_info __asm__("r28");
#define current_thread_info() __current_thread_info
-/* thread information allocation */
-#define THREAD_SIZE_ORDER (1)
-#define THREAD_SIZE (PAGE_SIZE << THREAD_SIZE_ORDER)
-#define THREAD_MASK (THREAD_SIZE - 1UL)
-#define __HAVE_ARCH_THREAD_INFO_ALLOCATOR
-
#define alloc_thread_info(tsk) kmalloc(THREAD_SIZE, GFP_KERNEL)
#define free_thread_info(info) kfree(info)
diff --git a/arch/score/kernel/vmlinux.lds.S b/arch/score/kernel/vmlinux.lds.S
index f855698..eebcbaa 100644
--- a/arch/score/kernel/vmlinux.lds.S
+++ b/arch/score/kernel/vmlinux.lds.S
@@ -24,6 +24,8 @@
*/
#include <asm-generic/vmlinux.lds.h>
+#include <asm/thread_info.h>
+#include <asm/page.h>
OUTPUT_ARCH(score)
ENTRY(_stext)
@@ -49,21 +51,9 @@
. = ALIGN(16);
RODATA
- /* Exception table */
- . = ALIGN(16);
- __ex_table : {
- __start___ex_table = .;
- *(__ex_table)
- __stop___ex_table = .;
- }
+ EXCEPTION_TABLE(16)
- /* writeable */
- .data ALIGN (4096): {
- *(.data.init_task)
-
- DATA_DATA
- CONSTRUCTORS
- }
+ RW_DATA_SECTION(32, PAGE_SIZE, THREAD_SIZE)
/* We want the small data sections together, so single-instruction offsets
can access them all, and initialized data all before uninitialized, so
@@ -72,45 +62,14 @@
.sdata : {
*(.sdata)
}
-
- . = ALIGN(32);
- .data.cacheline_aligned : {
- *(.data.cacheline_aligned)
- }
_edata = .; /* End of data section */
/* will be freed after init */
- . = ALIGN(4096); /* Init code and data */
+ . = ALIGN(PAGE_SIZE); /* Init code and data */
__init_begin = .;
- . = ALIGN(4096);
- .init.text : {
- _sinittext = .;
- INIT_TEXT
- _einittext = .;
- }
- .init.data : {
- INIT_DATA
- }
- . = ALIGN(16);
- .init.setup : {
- __setup_start = .;
- *(.init.setup)
- __setup_end = .;
- }
-
- .initcall.init : {
- __initcall_start = .;
- INITCALLS
- __initcall_end = .;
- }
-
- .con_initcall.init : {
- __con_initcall_start = .;
- *(.con_initcall.init)
- __con_initcall_end = .;
- }
- SECURITY_INIT
+ INIT_TEXT_SECTION(PAGE_SIZE)
+ INIT_DATA_SECTION(16)
/* .exit.text is discarded at runtime, not link time, to deal with
* references from .rodata
@@ -121,28 +80,10 @@
.exit.data : {
EXIT_DATA
}
-#if defined(CONFIG_BLK_DEV_INITRD)
- .init.ramfs ALIGN(4096): {
- __initramfs_start = .;
- *(.init.ramfs)
- __initramfs_end = .;
- . = ALIGN(4);
- LONG(0);
- }
-#endif
- . = ALIGN(4096);
+ . = ALIGN(PAGE_SIZE);
__init_end = .;
/* freed after init ends here */
- __bss_start = .; /* BSS */
- .sbss : {
- *(.sbss)
- *(.scommon)
- }
- .bss : {
- *(.bss)
- *(COMMON)
- }
- __bss_stop = .;
+ BSS_SECTION(0, 0, 0)
_end = .;
}
diff --git a/arch/sh/mm/init.c b/arch/sh/mm/init.c
index fabb7c6..8173e38 100644
--- a/arch/sh/mm/init.c
+++ b/arch/sh/mm/init.c
@@ -186,8 +186,6 @@
set_fixmap_nocache(FIX_UNCACHED, __pa(&__uncached_start));
}
-static struct kcore_list kcore_mem, kcore_vmalloc;
-
void __init mem_init(void)
{
int codesize, datasize, initsize;
@@ -226,10 +224,6 @@
datasize = (unsigned long) &_edata - (unsigned long) &_etext;
initsize = (unsigned long) &__init_end - (unsigned long) &__init_begin;
- kclist_add(&kcore_mem, __va(0), max_low_pfn << PAGE_SHIFT);
- kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
- VMALLOC_END - VMALLOC_START);
-
printk(KERN_INFO "Memory: %luk/%luk available (%dk kernel code, "
"%dk data, %dk init)\n",
nr_free_pages() << (PAGE_SHIFT-10),
diff --git a/arch/sparc/include/asm/vio.h b/arch/sparc/include/asm/vio.h
index d4de32f..6cdbf7e 100644
--- a/arch/sparc/include/asm/vio.h
+++ b/arch/sparc/include/asm/vio.h
@@ -258,7 +258,7 @@
static inline u32 vio_dring_avail(struct vio_dring_state *dr,
unsigned int ring_size)
{
- BUILD_BUG_ON(!is_power_of_2(ring_size));
+ MAYBE_BUILD_BUG_ON(!is_power_of_2(ring_size));
return (dr->pending -
((dr->prod - dr->cons) & (ring_size - 1)));
diff --git a/arch/x86/Kconfig b/arch/x86/Kconfig
index e4ff5d1..7c7a54b 100644
--- a/arch/x86/Kconfig
+++ b/arch/x86/Kconfig
@@ -1204,6 +1204,10 @@
def_bool y
depends on NUMA && X86_32
+config ARCH_PROC_KCORE_TEXT
+ def_bool y
+ depends on X86_64 && PROC_KCORE
+
config ARCH_SPARSEMEM_DEFAULT
def_bool y
depends on X86_64
diff --git a/arch/x86/include/asm/syscall.h b/arch/x86/include/asm/syscall.h
index d82f39b..8d33bc5 100644
--- a/arch/x86/include/asm/syscall.h
+++ b/arch/x86/include/asm/syscall.h
@@ -1,7 +1,7 @@
/*
* Access to user system call parameters and results
*
- * Copyright (C) 2008 Red Hat, Inc. All rights reserved.
+ * Copyright (C) 2008-2009 Red Hat, Inc. All rights reserved.
*
* This copyrighted material is made available to anyone wishing to use,
* modify, copy, or redistribute it subject to the terms and conditions
@@ -16,13 +16,13 @@
#include <linux/sched.h>
#include <linux/err.h>
-static inline long syscall_get_nr(struct task_struct *task,
- struct pt_regs *regs)
+/*
+ * Only the low 32 bits of orig_ax are meaningful, so we return int.
+ * This importantly ignores the high bits on 64-bit, so comparisons
+ * sign-extend the low 32 bits.
+ */
+static inline int syscall_get_nr(struct task_struct *task, struct pt_regs *regs)
{
- /*
- * We always sign-extend a -1 value being set here,
- * so this is always either -1L or a syscall number.
- */
return regs->orig_ax;
}
diff --git a/arch/x86/kernel/ptrace.c b/arch/x86/kernel/ptrace.c
index 8d7d5c9..7b058a2 100644
--- a/arch/x86/kernel/ptrace.c
+++ b/arch/x86/kernel/ptrace.c
@@ -325,16 +325,6 @@
return set_flags(child, value);
#ifdef CONFIG_X86_64
- /*
- * Orig_ax is really just a flag with small positive and
- * negative values, so make sure to always sign-extend it
- * from 32 bits so that it works correctly regardless of
- * whether we come from a 32-bit environment or not.
- */
- case offsetof(struct user_regs_struct, orig_ax):
- value = (long) (s32) value;
- break;
-
case offsetof(struct user_regs_struct,fs_base):
if (value >= TASK_SIZE_OF(child))
return -EIO;
@@ -1126,10 +1116,15 @@
case offsetof(struct user32, regs.orig_eax):
/*
- * Sign-extend the value so that orig_eax = -1
- * causes (long)orig_ax < 0 tests to fire correctly.
+ * A 32-bit debugger setting orig_eax means to restore
+ * the state of the task restarting a 32-bit syscall.
+ * Make sure we interpret the -ERESTART* codes correctly
+ * in case the task is not actually still sitting at the
+ * exit from a 32-bit syscall with TS_COMPAT still set.
*/
- regs->orig_ax = (long) (s32) value;
+ regs->orig_ax = value;
+ if (syscall_get_nr(child, regs) >= 0)
+ task_thread_info(child)->status |= TS_COMPAT;
break;
case offsetof(struct user32, regs.eflags):
diff --git a/arch/x86/lguest/boot.c b/arch/x86/lguest/boot.c
index 4cb7d5d..7e59dc1 100644
--- a/arch/x86/lguest/boot.c
+++ b/arch/x86/lguest/boot.c
@@ -1135,11 +1135,6 @@
/* Setting up memory is fairly easy. */
static __init char *lguest_memory_setup(void)
{
- /* We do this here and not earlier because lockcheck used to barf if we
- * did it before start_kernel(). I think we fixed that, so it'd be
- * nice to move it back to lguest_init. Patch welcome... */
- atomic_notifier_chain_register(&panic_notifier_list, &paniced);
-
/*
*The Linux bootloader header contains an "e820" memory map: the
* Launcher populated the first entry with our memory limit.
@@ -1364,10 +1359,13 @@
/*
* If we don't initialize the lock dependency checker now, it crashes
- * paravirt_disable_iospace.
+ * atomic_notifier_chain_register, then paravirt_disable_iospace.
*/
lockdep_init();
+ /* Hook in our special panic hypercall code. */
+ atomic_notifier_chain_register(&panic_notifier_list, &paniced);
+
/*
* The IDE code spends about 3 seconds probing for disks: if we reserve
* all the I/O ports up front it can't get them and so doesn't probe.
diff --git a/arch/x86/mm/init_32.c b/arch/x86/mm/init_32.c
index b49b4f6..30938c1 100644
--- a/arch/x86/mm/init_32.c
+++ b/arch/x86/mm/init_32.c
@@ -857,8 +857,6 @@
}
}
-static struct kcore_list kcore_mem, kcore_vmalloc;
-
void __init mem_init(void)
{
int codesize, reservedpages, datasize, initsize;
@@ -886,10 +884,6 @@
datasize = (unsigned long) &_edata - (unsigned long) &_etext;
initsize = (unsigned long) &__init_end - (unsigned long) &__init_begin;
- kclist_add(&kcore_mem, __va(0), max_low_pfn << PAGE_SHIFT);
- kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
- VMALLOC_END-VMALLOC_START);
-
printk(KERN_INFO "Memory: %luk/%luk available (%dk kernel code, "
"%dk reserved, %dk data, %dk init, %ldk highmem)\n",
nr_free_pages() << (PAGE_SHIFT-10),
diff --git a/arch/x86/mm/init_64.c b/arch/x86/mm/init_64.c
index 810bd31..5a4398a 100644
--- a/arch/x86/mm/init_64.c
+++ b/arch/x86/mm/init_64.c
@@ -647,8 +647,7 @@
#endif /* CONFIG_MEMORY_HOTPLUG */
-static struct kcore_list kcore_mem, kcore_vmalloc, kcore_kernel,
- kcore_modules, kcore_vsyscall;
+static struct kcore_list kcore_vsyscall;
void __init mem_init(void)
{
@@ -677,13 +676,8 @@
initsize = (unsigned long) &__init_end - (unsigned long) &__init_begin;
/* Register memory areas for /proc/kcore */
- kclist_add(&kcore_mem, __va(0), max_low_pfn << PAGE_SHIFT);
- kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
- VMALLOC_END-VMALLOC_START);
- kclist_add(&kcore_kernel, &_stext, _end - _stext);
- kclist_add(&kcore_modules, (void *)MODULES_VADDR, MODULES_LEN);
kclist_add(&kcore_vsyscall, (void *)VSYSCALL_START,
- VSYSCALL_END - VSYSCALL_START);
+ VSYSCALL_END - VSYSCALL_START, KCORE_OTHER);
printk(KERN_INFO "Memory: %luk/%luk available (%ldk kernel code, "
"%ldk absent, %ldk reserved, %ldk data, %ldk init)\n",
diff --git a/drivers/block/DAC960.c b/drivers/block/DAC960.c
index c77b6f3..6fa7b0f 100644
--- a/drivers/block/DAC960.c
+++ b/drivers/block/DAC960.c
@@ -6562,7 +6562,7 @@
if (copy_from_user(CommandBuffer, Buffer, Count)) return -EFAULT;
CommandBuffer[Count] = '\0';
Length = strlen(CommandBuffer);
- if (CommandBuffer[Length-1] == '\n')
+ if (Length > 0 && CommandBuffer[Length-1] == '\n')
CommandBuffer[--Length] = '\0';
if (Controller->FirmwareType == DAC960_V1_Controller)
return (DAC960_V1_ExecuteUserCommand(Controller, CommandBuffer)
diff --git a/drivers/block/cciss.c b/drivers/block/cciss.c
index 4f19105..24c3e21 100644
--- a/drivers/block/cciss.c
+++ b/drivers/block/cciss.c
@@ -363,7 +363,7 @@
h->busy_configuring = 0;
}
-static struct seq_operations cciss_seq_ops = {
+static const struct seq_operations cciss_seq_ops = {
.start = cciss_seq_start,
.show = cciss_seq_show,
.next = cciss_seq_next,
diff --git a/drivers/block/virtio_blk.c b/drivers/block/virtio_blk.c
index aa89fe4..43f1938 100644
--- a/drivers/block/virtio_blk.c
+++ b/drivers/block/virtio_blk.c
@@ -3,6 +3,7 @@
#include <linux/blkdev.h>
#include <linux/hdreg.h>
#include <linux/virtio.h>
+#include <linux/virtio_ids.h>
#include <linux/virtio_blk.h>
#include <linux/scatterlist.h>
@@ -91,15 +92,26 @@
return false;
vbr->req = req;
- if (blk_fs_request(vbr->req)) {
+ switch (req->cmd_type) {
+ case REQ_TYPE_FS:
vbr->out_hdr.type = 0;
vbr->out_hdr.sector = blk_rq_pos(vbr->req);
vbr->out_hdr.ioprio = req_get_ioprio(vbr->req);
- } else if (blk_pc_request(vbr->req)) {
+ break;
+ case REQ_TYPE_BLOCK_PC:
vbr->out_hdr.type = VIRTIO_BLK_T_SCSI_CMD;
vbr->out_hdr.sector = 0;
vbr->out_hdr.ioprio = req_get_ioprio(vbr->req);
- } else {
+ break;
+ case REQ_TYPE_LINUX_BLOCK:
+ if (req->cmd[0] == REQ_LB_OP_FLUSH) {
+ vbr->out_hdr.type = VIRTIO_BLK_T_FLUSH;
+ vbr->out_hdr.sector = 0;
+ vbr->out_hdr.ioprio = req_get_ioprio(vbr->req);
+ break;
+ }
+ /*FALLTHRU*/
+ default:
/* We don't put anything else in the queue. */
BUG();
}
@@ -139,7 +151,7 @@
}
}
- if (vblk->vq->vq_ops->add_buf(vblk->vq, vblk->sg, out, in, vbr)) {
+ if (vblk->vq->vq_ops->add_buf(vblk->vq, vblk->sg, out, in, vbr) < 0) {
mempool_free(vbr, vblk->pool);
return false;
}
@@ -199,6 +211,12 @@
return err;
}
+static void virtblk_prepare_flush(struct request_queue *q, struct request *req)
+{
+ req->cmd_type = REQ_TYPE_LINUX_BLOCK;
+ req->cmd[0] = REQ_LB_OP_FLUSH;
+}
+
static int virtblk_ioctl(struct block_device *bdev, fmode_t mode,
unsigned cmd, unsigned long data)
{
@@ -337,7 +355,10 @@
index++;
/* If barriers are supported, tell block layer that queue is ordered */
- if (virtio_has_feature(vdev, VIRTIO_BLK_F_BARRIER))
+ if (virtio_has_feature(vdev, VIRTIO_BLK_F_FLUSH))
+ blk_queue_ordered(vblk->disk->queue, QUEUE_ORDERED_DRAIN_FLUSH,
+ virtblk_prepare_flush);
+ else if (virtio_has_feature(vdev, VIRTIO_BLK_F_BARRIER))
blk_queue_ordered(vblk->disk->queue, QUEUE_ORDERED_TAG, NULL);
/* If disk is read-only in the host, the guest should obey */
@@ -424,7 +445,7 @@
static unsigned int features[] = {
VIRTIO_BLK_F_BARRIER, VIRTIO_BLK_F_SEG_MAX, VIRTIO_BLK_F_SIZE_MAX,
VIRTIO_BLK_F_GEOMETRY, VIRTIO_BLK_F_RO, VIRTIO_BLK_F_BLK_SIZE,
- VIRTIO_BLK_F_SCSI, VIRTIO_BLK_F_IDENTIFY
+ VIRTIO_BLK_F_SCSI, VIRTIO_BLK_F_IDENTIFY, VIRTIO_BLK_F_FLUSH
};
/*
diff --git a/drivers/char/hw_random/virtio-rng.c b/drivers/char/hw_random/virtio-rng.c
index 32216b6..962968f 100644
--- a/drivers/char/hw_random/virtio-rng.c
+++ b/drivers/char/hw_random/virtio-rng.c
@@ -21,6 +21,7 @@
#include <linux/scatterlist.h>
#include <linux/spinlock.h>
#include <linux/virtio.h>
+#include <linux/virtio_ids.h>
#include <linux/virtio_rng.h>
/* The host will fill any buffer we give it with sweet, sweet randomness. We
@@ -51,7 +52,7 @@
sg_init_one(&sg, random_data+data_left, RANDOM_DATA_SIZE-data_left);
/* There should always be room for one buffer. */
- if (vq->vq_ops->add_buf(vq, &sg, 0, 1, random_data) != 0)
+ if (vq->vq_ops->add_buf(vq, &sg, 0, 1, random_data) < 0)
BUG();
vq->vq_ops->kick(vq);
}
diff --git a/drivers/char/misc.c b/drivers/char/misc.c
index 1ee27cc..07fa612 100644
--- a/drivers/char/misc.c
+++ b/drivers/char/misc.c
@@ -91,7 +91,7 @@
}
-static struct seq_operations misc_seq_ops = {
+static const struct seq_operations misc_seq_ops = {
.start = misc_seq_start,
.next = misc_seq_next,
.stop = misc_seq_stop,
diff --git a/drivers/char/tpm/tpm.c b/drivers/char/tpm/tpm.c
index b0603b2..32b957e 100644
--- a/drivers/char/tpm/tpm.c
+++ b/drivers/char/tpm/tpm.c
@@ -696,7 +696,7 @@
cmd.header.in = pcrread_header;
cmd.params.pcrread_in.pcr_idx = cpu_to_be32(pcr_idx);
- BUILD_BUG_ON(cmd.header.in.length > READ_PCR_RESULT_SIZE);
+ BUG_ON(cmd.header.in.length > READ_PCR_RESULT_SIZE);
rc = transmit_cmd(chip, &cmd, cmd.header.in.length,
"attempting to read a pcr value");
@@ -760,7 +760,7 @@
return -ENODEV;
cmd.header.in = pcrextend_header;
- BUILD_BUG_ON(be32_to_cpu(cmd.header.in.length) > EXTEND_PCR_SIZE);
+ BUG_ON(be32_to_cpu(cmd.header.in.length) > EXTEND_PCR_SIZE);
cmd.params.pcrextend_in.pcr_idx = cpu_to_be32(pcr_idx);
memcpy(cmd.params.pcrextend_in.hash, hash, TPM_DIGEST_SIZE);
rc = transmit_cmd(chip, &cmd, cmd.header.in.length,
diff --git a/drivers/char/tpm/tpm_bios.c b/drivers/char/tpm/tpm_bios.c
index 0c2f55a..bf2170f 100644
--- a/drivers/char/tpm/tpm_bios.c
+++ b/drivers/char/tpm/tpm_bios.c
@@ -343,14 +343,14 @@
return 0;
}
-static struct seq_operations tpm_ascii_b_measurments_seqops = {
+static const struct seq_operations tpm_ascii_b_measurments_seqops = {
.start = tpm_bios_measurements_start,
.next = tpm_bios_measurements_next,
.stop = tpm_bios_measurements_stop,
.show = tpm_ascii_bios_measurements_show,
};
-static struct seq_operations tpm_binary_b_measurments_seqops = {
+static const struct seq_operations tpm_binary_b_measurments_seqops = {
.start = tpm_bios_measurements_start,
.next = tpm_bios_measurements_next,
.stop = tpm_bios_measurements_stop,
diff --git a/drivers/char/virtio_console.c b/drivers/char/virtio_console.c
index c74dacf..0d328b5 100644
--- a/drivers/char/virtio_console.c
+++ b/drivers/char/virtio_console.c
@@ -31,6 +31,7 @@
#include <linux/err.h>
#include <linux/init.h>
#include <linux/virtio.h>
+#include <linux/virtio_ids.h>
#include <linux/virtio_console.h>
#include "hvc_console.h"
@@ -65,7 +66,7 @@
/* add_buf wants a token to identify this buffer: we hand it any
* non-NULL pointer, since there's only ever one buffer. */
- if (out_vq->vq_ops->add_buf(out_vq, sg, 1, 0, (void *)1) == 0) {
+ if (out_vq->vq_ops->add_buf(out_vq, sg, 1, 0, (void *)1) >= 0) {
/* Tell Host to go! */
out_vq->vq_ops->kick(out_vq);
/* Chill out until it's done with the buffer. */
@@ -85,7 +86,7 @@
sg_init_one(sg, inbuf, PAGE_SIZE);
/* We should always be able to add one buffer to an empty queue. */
- if (in_vq->vq_ops->add_buf(in_vq, sg, 0, 1, inbuf) != 0)
+ if (in_vq->vq_ops->add_buf(in_vq, sg, 0, 1, inbuf) < 0)
BUG();
in_vq->vq_ops->kick(in_vq);
}
diff --git a/drivers/connector/cn_proc.c b/drivers/connector/cn_proc.c
index 85e5dc0..abf4a25 100644
--- a/drivers/connector/cn_proc.c
+++ b/drivers/connector/cn_proc.c
@@ -139,6 +139,31 @@
cn_netlink_send(msg, CN_IDX_PROC, GFP_KERNEL);
}
+void proc_sid_connector(struct task_struct *task)
+{
+ struct cn_msg *msg;
+ struct proc_event *ev;
+ struct timespec ts;
+ __u8 buffer[CN_PROC_MSG_SIZE];
+
+ if (atomic_read(&proc_event_num_listeners) < 1)
+ return;
+
+ msg = (struct cn_msg *)buffer;
+ ev = (struct proc_event *)msg->data;
+ get_seq(&msg->seq, &ev->cpu);
+ ktime_get_ts(&ts); /* get high res monotonic timestamp */
+ put_unaligned(timespec_to_ns(&ts), (__u64 *)&ev->timestamp_ns);
+ ev->what = PROC_EVENT_SID;
+ ev->event_data.sid.process_pid = task->pid;
+ ev->event_data.sid.process_tgid = task->tgid;
+
+ memcpy(&msg->id, &cn_proc_event_id, sizeof(msg->id));
+ msg->ack = 0; /* not used */
+ msg->len = sizeof(*ev);
+ cn_netlink_send(msg, CN_IDX_PROC, GFP_KERNEL);
+}
+
void proc_exit_connector(struct task_struct *task)
{
struct cn_msg *msg;
diff --git a/drivers/gpio/Kconfig b/drivers/gpio/Kconfig
index 6b4c484..2ad0128 100644
--- a/drivers/gpio/Kconfig
+++ b/drivers/gpio/Kconfig
@@ -162,6 +162,16 @@
Say yes here to access the GPIO signals of WM831x power management
chips from Wolfson Microelectronics.
+config GPIO_ADP5520
+ tristate "GPIO Support for ADP5520 PMIC"
+ depends on PMIC_ADP5520
+ help
+ This option enables support for on-chip GPIO found
+ on Analog Devices ADP5520 PMICs.
+
+ To compile this driver as a module, choose M here: the module will
+ be called adp5520-gpio.
+
comment "PCI GPIO expanders:"
config GPIO_BT8XX
@@ -180,6 +190,12 @@
If unsure, say N.
+config GPIO_LANGWELL
+ bool "Intel Moorestown Platform Langwell GPIO support"
+ depends on PCI
+ help
+ Say Y here to support Intel Moorestown platform GPIO.
+
comment "SPI GPIO expanders:"
config GPIO_MAX7301
@@ -195,4 +211,23 @@
SPI driver for Microchip MCP23S08 I/O expander. This provides
a GPIO interface supporting inputs and outputs.
+config GPIO_MC33880
+ tristate "Freescale MC33880 high-side/low-side switch"
+ depends on SPI_MASTER
+ help
+ SPI driver for Freescale MC33880 high-side/low-side switch.
+ This provides GPIO interface supporting inputs and outputs.
+
+comment "AC97 GPIO expanders:"
+
+config GPIO_UCB1400
+ bool "Philips UCB1400 GPIO"
+ depends on UCB1400_CORE
+ help
+ This enables support for the Philips UCB1400 GPIO pins.
+ The UCB1400 is an AC97 audio codec.
+
+ To compile this driver as a module, choose M here: the
+ module will be called ucb1400_gpio.
+
endif
diff --git a/drivers/gpio/Makefile b/drivers/gpio/Makefile
index ea7c745..00a532c 100644
--- a/drivers/gpio/Makefile
+++ b/drivers/gpio/Makefile
@@ -4,13 +4,17 @@
obj-$(CONFIG_GPIOLIB) += gpiolib.o
+obj-$(CONFIG_GPIO_ADP5520) += adp5520-gpio.o
+obj-$(CONFIG_GPIO_LANGWELL) += langwell_gpio.o
obj-$(CONFIG_GPIO_MAX7301) += max7301.o
obj-$(CONFIG_GPIO_MAX732X) += max732x.o
+obj-$(CONFIG_GPIO_MC33880) += mc33880.o
obj-$(CONFIG_GPIO_MCP23S08) += mcp23s08.o
obj-$(CONFIG_GPIO_PCA953X) += pca953x.o
obj-$(CONFIG_GPIO_PCF857X) += pcf857x.o
obj-$(CONFIG_GPIO_PL061) += pl061.o
obj-$(CONFIG_GPIO_TWL4030) += twl4030-gpio.o
+obj-$(CONFIG_GPIO_UCB1400) += ucb1400_gpio.o
obj-$(CONFIG_GPIO_XILINX) += xilinx_gpio.o
obj-$(CONFIG_GPIO_BT8XX) += bt8xxgpio.o
obj-$(CONFIG_GPIO_VR41XX) += vr41xx_giu.o
diff --git a/drivers/gpio/adp5520-gpio.c b/drivers/gpio/adp5520-gpio.c
new file mode 100644
index 0000000..ad05bbc
--- /dev/null
+++ b/drivers/gpio/adp5520-gpio.c
@@ -0,0 +1,206 @@
+/*
+ * GPIO driver for Analog Devices ADP5520 MFD PMICs
+ *
+ * Copyright 2009 Analog Devices Inc.
+ *
+ * Licensed under the GPL-2 or later.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/init.h>
+#include <linux/platform_device.h>
+#include <linux/mfd/adp5520.h>
+
+#include <linux/gpio.h>
+
+struct adp5520_gpio {
+ struct device *master;
+ struct gpio_chip gpio_chip;
+ unsigned char lut[ADP5520_MAXGPIOS];
+ unsigned long output;
+};
+
+static int adp5520_gpio_get_value(struct gpio_chip *chip, unsigned off)
+{
+ struct adp5520_gpio *dev;
+ uint8_t reg_val;
+
+ dev = container_of(chip, struct adp5520_gpio, gpio_chip);
+
+ /*
+ * There are dedicated registers for GPIO IN/OUT.
+ * Make sure we return the right value, even when configured as output
+ */
+
+ if (test_bit(off, &dev->output))
+ adp5520_read(dev->master, GPIO_OUT, ®_val);
+ else
+ adp5520_read(dev->master, GPIO_IN, ®_val);
+
+ return !!(reg_val & dev->lut[off]);
+}
+
+static void adp5520_gpio_set_value(struct gpio_chip *chip,
+ unsigned off, int val)
+{
+ struct adp5520_gpio *dev;
+ dev = container_of(chip, struct adp5520_gpio, gpio_chip);
+
+ if (val)
+ adp5520_set_bits(dev->master, GPIO_OUT, dev->lut[off]);
+ else
+ adp5520_clr_bits(dev->master, GPIO_OUT, dev->lut[off]);
+}
+
+static int adp5520_gpio_direction_input(struct gpio_chip *chip, unsigned off)
+{
+ struct adp5520_gpio *dev;
+ dev = container_of(chip, struct adp5520_gpio, gpio_chip);
+
+ clear_bit(off, &dev->output);
+
+ return adp5520_clr_bits(dev->master, GPIO_CFG_2, dev->lut[off]);
+}
+
+static int adp5520_gpio_direction_output(struct gpio_chip *chip,
+ unsigned off, int val)
+{
+ struct adp5520_gpio *dev;
+ int ret = 0;
+ dev = container_of(chip, struct adp5520_gpio, gpio_chip);
+
+ set_bit(off, &dev->output);
+
+ if (val)
+ ret |= adp5520_set_bits(dev->master, GPIO_OUT, dev->lut[off]);
+ else
+ ret |= adp5520_clr_bits(dev->master, GPIO_OUT, dev->lut[off]);
+
+ ret |= adp5520_set_bits(dev->master, GPIO_CFG_2, dev->lut[off]);
+
+ return ret;
+}
+
+static int __devinit adp5520_gpio_probe(struct platform_device *pdev)
+{
+ struct adp5520_gpio_platfrom_data *pdata = pdev->dev.platform_data;
+ struct adp5520_gpio *dev;
+ struct gpio_chip *gc;
+ int ret, i, gpios;
+ unsigned char ctl_mask = 0;
+
+ if (pdata == NULL) {
+ dev_err(&pdev->dev, "missing platform data\n");
+ return -ENODEV;
+ }
+
+ if (pdev->id != ID_ADP5520) {
+ dev_err(&pdev->dev, "only ADP5520 supports GPIO\n");
+ return -ENODEV;
+ }
+
+ dev = kzalloc(sizeof(*dev), GFP_KERNEL);
+ if (dev == NULL) {
+ dev_err(&pdev->dev, "failed to alloc memory\n");
+ return -ENOMEM;
+ }
+
+ dev->master = pdev->dev.parent;
+
+ for (gpios = 0, i = 0; i < ADP5520_MAXGPIOS; i++)
+ if (pdata->gpio_en_mask & (1 << i))
+ dev->lut[gpios++] = 1 << i;
+
+ if (gpios < 1) {
+ ret = -EINVAL;
+ goto err;
+ }
+
+ gc = &dev->gpio_chip;
+ gc->direction_input = adp5520_gpio_direction_input;
+ gc->direction_output = adp5520_gpio_direction_output;
+ gc->get = adp5520_gpio_get_value;
+ gc->set = adp5520_gpio_set_value;
+ gc->can_sleep = 1;
+
+ gc->base = pdata->gpio_start;
+ gc->ngpio = gpios;
+ gc->label = pdev->name;
+ gc->owner = THIS_MODULE;
+
+ ret = adp5520_clr_bits(dev->master, GPIO_CFG_1,
+ pdata->gpio_en_mask);
+
+ if (pdata->gpio_en_mask & GPIO_C3)
+ ctl_mask |= C3_MODE;
+
+ if (pdata->gpio_en_mask & GPIO_R3)
+ ctl_mask |= R3_MODE;
+
+ if (ctl_mask)
+ ret = adp5520_set_bits(dev->master, LED_CONTROL,
+ ctl_mask);
+
+ ret |= adp5520_set_bits(dev->master, GPIO_PULLUP,
+ pdata->gpio_pullup_mask);
+
+ if (ret) {
+ dev_err(&pdev->dev, "failed to write\n");
+ goto err;
+ }
+
+ ret = gpiochip_add(&dev->gpio_chip);
+ if (ret)
+ goto err;
+
+ platform_set_drvdata(pdev, dev);
+ return 0;
+
+err:
+ kfree(dev);
+ return ret;
+}
+
+static int __devexit adp5520_gpio_remove(struct platform_device *pdev)
+{
+ struct adp5520_gpio *dev;
+ int ret;
+
+ dev = platform_get_drvdata(pdev);
+ ret = gpiochip_remove(&dev->gpio_chip);
+ if (ret) {
+ dev_err(&pdev->dev, "%s failed, %d\n",
+ "gpiochip_remove()", ret);
+ return ret;
+ }
+
+ kfree(dev);
+ return 0;
+}
+
+static struct platform_driver adp5520_gpio_driver = {
+ .driver = {
+ .name = "adp5520-gpio",
+ .owner = THIS_MODULE,
+ },
+ .probe = adp5520_gpio_probe,
+ .remove = __devexit_p(adp5520_gpio_remove),
+};
+
+static int __init adp5520_gpio_init(void)
+{
+ return platform_driver_register(&adp5520_gpio_driver);
+}
+module_init(adp5520_gpio_init);
+
+static void __exit adp5520_gpio_exit(void)
+{
+ platform_driver_unregister(&adp5520_gpio_driver);
+}
+module_exit(adp5520_gpio_exit);
+
+MODULE_AUTHOR("Michael Hennerich <hennerich@blackfin.uclinux.org>");
+MODULE_DESCRIPTION("GPIO ADP5520 Driver");
+MODULE_LICENSE("GPL");
+MODULE_ALIAS("platform:adp5520-gpio");
diff --git a/drivers/gpio/bt8xxgpio.c b/drivers/gpio/bt8xxgpio.c
index 5590414..2559f22 100644
--- a/drivers/gpio/bt8xxgpio.c
+++ b/drivers/gpio/bt8xxgpio.c
@@ -46,8 +46,7 @@
#include <linux/module.h>
#include <linux/pci.h>
#include <linux/spinlock.h>
-
-#include <asm/gpio.h>
+#include <linux/gpio.h>
/* Steal the hardware definitions from the bttv driver. */
#include "../media/video/bt8xx/bt848.h"
diff --git a/drivers/gpio/gpiolib.c b/drivers/gpio/gpiolib.c
index 51a8d41..bb11a42 100644
--- a/drivers/gpio/gpiolib.c
+++ b/drivers/gpio/gpiolib.c
@@ -1,5 +1,6 @@
#include <linux/kernel.h>
#include <linux/module.h>
+#include <linux/interrupt.h>
#include <linux/irq.h>
#include <linux/spinlock.h>
#include <linux/device.h>
@@ -7,6 +8,7 @@
#include <linux/debugfs.h>
#include <linux/seq_file.h>
#include <linux/gpio.h>
+#include <linux/idr.h>
/* Optional implementation infrastructure for GPIO interfaces.
@@ -49,6 +51,13 @@
#define FLAG_RESERVED 2
#define FLAG_EXPORT 3 /* protected by sysfs_lock */
#define FLAG_SYSFS 4 /* exported via /sys/class/gpio/control */
+#define FLAG_TRIG_FALL 5 /* trigger on falling edge */
+#define FLAG_TRIG_RISE 6 /* trigger on rising edge */
+
+#define PDESC_ID_SHIFT 16 /* add new flags before this one */
+
+#define GPIO_FLAGS_MASK ((1 << PDESC_ID_SHIFT) - 1)
+#define GPIO_TRIGGER_MASK (BIT(FLAG_TRIG_FALL) | BIT(FLAG_TRIG_RISE))
#ifdef CONFIG_DEBUG_FS
const char *label;
@@ -56,6 +65,15 @@
};
static struct gpio_desc gpio_desc[ARCH_NR_GPIOS];
+#ifdef CONFIG_GPIO_SYSFS
+struct poll_desc {
+ struct work_struct work;
+ struct sysfs_dirent *value_sd;
+};
+
+static struct idr pdesc_idr;
+#endif
+
static inline void desc_set_label(struct gpio_desc *d, const char *label)
{
#ifdef CONFIG_DEBUG_FS
@@ -188,10 +206,10 @@
* /value
* * always readable, subject to hardware behavior
* * may be writable, as zero/nonzero
- *
- * REVISIT there will likely be an attribute for configuring async
- * notifications, e.g. to specify polling interval or IRQ trigger type
- * that would for example trigger a poll() on the "value".
+ * /edge
+ * * configures behavior of poll(2) on /value
+ * * available only if pin can generate IRQs on input
+ * * is read/write as "none", "falling", "rising", or "both"
*/
static ssize_t gpio_direction_show(struct device *dev,
@@ -288,6 +306,175 @@
static /*const*/ DEVICE_ATTR(value, 0644,
gpio_value_show, gpio_value_store);
+static irqreturn_t gpio_sysfs_irq(int irq, void *priv)
+{
+ struct work_struct *work = priv;
+
+ schedule_work(work);
+ return IRQ_HANDLED;
+}
+
+static void gpio_notify_sysfs(struct work_struct *work)
+{
+ struct poll_desc *pdesc;
+
+ pdesc = container_of(work, struct poll_desc, work);
+ sysfs_notify_dirent(pdesc->value_sd);
+}
+
+static int gpio_setup_irq(struct gpio_desc *desc, struct device *dev,
+ unsigned long gpio_flags)
+{
+ struct poll_desc *pdesc;
+ unsigned long irq_flags;
+ int ret, irq, id;
+
+ if ((desc->flags & GPIO_TRIGGER_MASK) == gpio_flags)
+ return 0;
+
+ irq = gpio_to_irq(desc - gpio_desc);
+ if (irq < 0)
+ return -EIO;
+
+ id = desc->flags >> PDESC_ID_SHIFT;
+ pdesc = idr_find(&pdesc_idr, id);
+ if (pdesc) {
+ free_irq(irq, &pdesc->work);
+ cancel_work_sync(&pdesc->work);
+ }
+
+ desc->flags &= ~GPIO_TRIGGER_MASK;
+
+ if (!gpio_flags) {
+ ret = 0;
+ goto free_sd;
+ }
+
+ irq_flags = IRQF_SHARED;
+ if (test_bit(FLAG_TRIG_FALL, &gpio_flags))
+ irq_flags |= IRQF_TRIGGER_FALLING;
+ if (test_bit(FLAG_TRIG_RISE, &gpio_flags))
+ irq_flags |= IRQF_TRIGGER_RISING;
+
+ if (!pdesc) {
+ pdesc = kmalloc(sizeof(*pdesc), GFP_KERNEL);
+ if (!pdesc) {
+ ret = -ENOMEM;
+ goto err_out;
+ }
+
+ do {
+ ret = -ENOMEM;
+ if (idr_pre_get(&pdesc_idr, GFP_KERNEL))
+ ret = idr_get_new_above(&pdesc_idr,
+ pdesc, 1, &id);
+ } while (ret == -EAGAIN);
+
+ if (ret)
+ goto free_mem;
+
+ desc->flags &= GPIO_FLAGS_MASK;
+ desc->flags |= (unsigned long)id << PDESC_ID_SHIFT;
+
+ if (desc->flags >> PDESC_ID_SHIFT != id) {
+ ret = -ERANGE;
+ goto free_id;
+ }
+
+ pdesc->value_sd = sysfs_get_dirent(dev->kobj.sd, "value");
+ if (!pdesc->value_sd) {
+ ret = -ENODEV;
+ goto free_id;
+ }
+ INIT_WORK(&pdesc->work, gpio_notify_sysfs);
+ }
+
+ ret = request_irq(irq, gpio_sysfs_irq, irq_flags,
+ "gpiolib", &pdesc->work);
+ if (ret)
+ goto free_sd;
+
+ desc->flags |= gpio_flags;
+ return 0;
+
+free_sd:
+ sysfs_put(pdesc->value_sd);
+free_id:
+ idr_remove(&pdesc_idr, id);
+ desc->flags &= GPIO_FLAGS_MASK;
+free_mem:
+ kfree(pdesc);
+err_out:
+ return ret;
+}
+
+static const struct {
+ const char *name;
+ unsigned long flags;
+} trigger_types[] = {
+ { "none", 0 },
+ { "falling", BIT(FLAG_TRIG_FALL) },
+ { "rising", BIT(FLAG_TRIG_RISE) },
+ { "both", BIT(FLAG_TRIG_FALL) | BIT(FLAG_TRIG_RISE) },
+};
+
+static ssize_t gpio_edge_show(struct device *dev,
+ struct device_attribute *attr, char *buf)
+{
+ const struct gpio_desc *desc = dev_get_drvdata(dev);
+ ssize_t status;
+
+ mutex_lock(&sysfs_lock);
+
+ if (!test_bit(FLAG_EXPORT, &desc->flags))
+ status = -EIO;
+ else {
+ int i;
+
+ status = 0;
+ for (i = 0; i < ARRAY_SIZE(trigger_types); i++)
+ if ((desc->flags & GPIO_TRIGGER_MASK)
+ == trigger_types[i].flags) {
+ status = sprintf(buf, "%s\n",
+ trigger_types[i].name);
+ break;
+ }
+ }
+
+ mutex_unlock(&sysfs_lock);
+ return status;
+}
+
+static ssize_t gpio_edge_store(struct device *dev,
+ struct device_attribute *attr, const char *buf, size_t size)
+{
+ struct gpio_desc *desc = dev_get_drvdata(dev);
+ ssize_t status;
+ int i;
+
+ for (i = 0; i < ARRAY_SIZE(trigger_types); i++)
+ if (sysfs_streq(trigger_types[i].name, buf))
+ goto found;
+ return -EINVAL;
+
+found:
+ mutex_lock(&sysfs_lock);
+
+ if (!test_bit(FLAG_EXPORT, &desc->flags))
+ status = -EIO;
+ else {
+ status = gpio_setup_irq(desc, dev, trigger_types[i].flags);
+ if (!status)
+ status = size;
+ }
+
+ mutex_unlock(&sysfs_lock);
+
+ return status;
+}
+
+static DEVICE_ATTR(edge, 0644, gpio_edge_show, gpio_edge_store);
+
static const struct attribute *gpio_attrs[] = {
&dev_attr_direction.attr,
&dev_attr_value.attr,
@@ -473,7 +660,7 @@
struct device *dev;
dev = device_create(&gpio_class, desc->chip->dev, MKDEV(0, 0),
- desc, ioname ? ioname : "gpio%d", gpio);
+ desc, ioname ? ioname : "gpio%d", gpio);
if (dev) {
if (direction_may_change)
status = sysfs_create_group(&dev->kobj,
@@ -481,6 +668,14 @@
else
status = device_create_file(dev,
&dev_attr_value);
+
+ if (!status && gpio_to_irq(gpio) >= 0
+ && (direction_may_change
+ || !test_bit(FLAG_IS_OUT,
+ &desc->flags)))
+ status = device_create_file(dev,
+ &dev_attr_edge);
+
if (status != 0)
device_unregister(dev);
} else
@@ -505,6 +700,51 @@
}
/**
+ * gpio_export_link - create a sysfs link to an exported GPIO node
+ * @dev: device under which to create symlink
+ * @name: name of the symlink
+ * @gpio: gpio to create symlink to, already exported
+ *
+ * Set up a symlink from /sys/.../dev/name to /sys/class/gpio/gpioN
+ * node. Caller is responsible for unlinking.
+ *
+ * Returns zero on success, else an error.
+ */
+int gpio_export_link(struct device *dev, const char *name, unsigned gpio)
+{
+ struct gpio_desc *desc;
+ int status = -EINVAL;
+
+ if (!gpio_is_valid(gpio))
+ goto done;
+
+ mutex_lock(&sysfs_lock);
+
+ desc = &gpio_desc[gpio];
+
+ if (test_bit(FLAG_EXPORT, &desc->flags)) {
+ struct device *tdev;
+
+ tdev = class_find_device(&gpio_class, NULL, desc, match_export);
+ if (tdev != NULL) {
+ status = sysfs_create_link(&dev->kobj, &tdev->kobj,
+ name);
+ } else {
+ status = -ENODEV;
+ }
+ }
+
+ mutex_unlock(&sysfs_lock);
+
+done:
+ if (status)
+ pr_debug("%s: gpio%d status %d\n", __func__, gpio, status);
+
+ return status;
+}
+EXPORT_SYMBOL_GPL(gpio_export_link);
+
+/**
* gpio_unexport - reverse effect of gpio_export()
* @gpio: gpio to make unavailable
*
@@ -527,6 +767,7 @@
dev = class_find_device(&gpio_class, NULL, desc, match_export);
if (dev) {
+ gpio_setup_irq(desc, dev, 0);
clear_bit(FLAG_EXPORT, &desc->flags);
put_device(dev);
device_unregister(dev);
@@ -611,6 +852,8 @@
unsigned long flags;
unsigned gpio;
+ idr_init(&pdesc_idr);
+
status = class_register(&gpio_class);
if (status < 0)
return status;
diff --git a/drivers/gpio/langwell_gpio.c b/drivers/gpio/langwell_gpio.c
new file mode 100644
index 0000000..5711ce5
--- /dev/null
+++ b/drivers/gpio/langwell_gpio.c
@@ -0,0 +1,297 @@
+/* langwell_gpio.c Moorestown platform Langwell chip GPIO driver
+ * Copyright (c) 2008 - 2009, Intel Corporation.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+ */
+
+/* Supports:
+ * Moorestown platform Langwell chip.
+ */
+
+#include <linux/module.h>
+#include <linux/pci.h>
+#include <linux/kernel.h>
+#include <linux/delay.h>
+#include <linux/stddef.h>
+#include <linux/interrupt.h>
+#include <linux/init.h>
+#include <linux/irq.h>
+#include <linux/io.h>
+#include <linux/gpio.h>
+
+struct lnw_gpio_register {
+ u32 GPLR[2];
+ u32 GPDR[2];
+ u32 GPSR[2];
+ u32 GPCR[2];
+ u32 GRER[2];
+ u32 GFER[2];
+ u32 GEDR[2];
+};
+
+struct lnw_gpio {
+ struct gpio_chip chip;
+ struct lnw_gpio_register *reg_base;
+ spinlock_t lock;
+ unsigned irq_base;
+};
+
+static int lnw_gpio_get(struct gpio_chip *chip, unsigned offset)
+{
+ struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+ u8 reg = offset / 32;
+ void __iomem *gplr;
+
+ gplr = (void __iomem *)(&lnw->reg_base->GPLR[reg]);
+ return readl(gplr) & BIT(offset % 32);
+}
+
+static void lnw_gpio_set(struct gpio_chip *chip, unsigned offset, int value)
+{
+ struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+ u8 reg = offset / 32;
+ void __iomem *gpsr, *gpcr;
+
+ if (value) {
+ gpsr = (void __iomem *)(&lnw->reg_base->GPSR[reg]);
+ writel(BIT(offset % 32), gpsr);
+ } else {
+ gpcr = (void __iomem *)(&lnw->reg_base->GPCR[reg]);
+ writel(BIT(offset % 32), gpcr);
+ }
+}
+
+static int lnw_gpio_direction_input(struct gpio_chip *chip, unsigned offset)
+{
+ struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+ u8 reg = offset / 32;
+ u32 value;
+ unsigned long flags;
+ void __iomem *gpdr;
+
+ gpdr = (void __iomem *)(&lnw->reg_base->GPDR[reg]);
+ spin_lock_irqsave(&lnw->lock, flags);
+ value = readl(gpdr);
+ value &= ~BIT(offset % 32);
+ writel(value, gpdr);
+ spin_unlock_irqrestore(&lnw->lock, flags);
+ return 0;
+}
+
+static int lnw_gpio_direction_output(struct gpio_chip *chip,
+ unsigned offset, int value)
+{
+ struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+ u8 reg = offset / 32;
+ unsigned long flags;
+ void __iomem *gpdr;
+
+ lnw_gpio_set(chip, offset, value);
+ gpdr = (void __iomem *)(&lnw->reg_base->GPDR[reg]);
+ spin_lock_irqsave(&lnw->lock, flags);
+ value = readl(gpdr);
+ value |= BIT(offset % 32);;
+ writel(value, gpdr);
+ spin_unlock_irqrestore(&lnw->lock, flags);
+ return 0;
+}
+
+static int lnw_gpio_to_irq(struct gpio_chip *chip, unsigned offset)
+{
+ struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+ return lnw->irq_base + offset;
+}
+
+static int lnw_irq_type(unsigned irq, unsigned type)
+{
+ struct lnw_gpio *lnw = get_irq_chip_data(irq);
+ u32 gpio = irq - lnw->irq_base;
+ u8 reg = gpio / 32;
+ unsigned long flags;
+ u32 value;
+ void __iomem *grer = (void __iomem *)(&lnw->reg_base->GRER[reg]);
+ void __iomem *gfer = (void __iomem *)(&lnw->reg_base->GFER[reg]);
+
+ if (gpio < 0 || gpio > lnw->chip.ngpio)
+ return -EINVAL;
+ spin_lock_irqsave(&lnw->lock, flags);
+ if (type & IRQ_TYPE_EDGE_RISING)
+ value = readl(grer) | BIT(gpio % 32);
+ else
+ value = readl(grer) & (~BIT(gpio % 32));
+ writel(value, grer);
+
+ if (type & IRQ_TYPE_EDGE_FALLING)
+ value = readl(gfer) | BIT(gpio % 32);
+ else
+ value = readl(gfer) & (~BIT(gpio % 32));
+ writel(value, gfer);
+ spin_unlock_irqrestore(&lnw->lock, flags);
+
+ return 0;
+};
+
+static void lnw_irq_unmask(unsigned irq)
+{
+ struct lnw_gpio *lnw = get_irq_chip_data(irq);
+ u32 gpio = irq - lnw->irq_base;
+ u8 reg = gpio / 32;
+ void __iomem *gedr;
+
+ gedr = (void __iomem *)(&lnw->reg_base->GEDR[reg]);
+ writel(BIT(gpio % 32), gedr);
+};
+
+static void lnw_irq_mask(unsigned irq)
+{
+};
+
+static struct irq_chip lnw_irqchip = {
+ .name = "LNW-GPIO",
+ .mask = lnw_irq_mask,
+ .unmask = lnw_irq_unmask,
+ .set_type = lnw_irq_type,
+};
+
+static struct pci_device_id lnw_gpio_ids[] = {
+ { PCI_DEVICE(PCI_VENDOR_ID_INTEL, 0x080f) },
+ { 0, }
+};
+MODULE_DEVICE_TABLE(pci, lnw_gpio_ids);
+
+static void lnw_irq_handler(unsigned irq, struct irq_desc *desc)
+{
+ struct lnw_gpio *lnw = (struct lnw_gpio *)get_irq_data(irq);
+ u32 reg, gpio;
+ void __iomem *gedr;
+ u32 gedr_v;
+
+ /* check GPIO controller to check which pin triggered the interrupt */
+ for (reg = 0; reg < lnw->chip.ngpio / 32; reg++) {
+ gedr = (void __iomem *)(&lnw->reg_base->GEDR[reg]);
+ gedr_v = readl(gedr);
+ if (!gedr_v)
+ continue;
+ for (gpio = reg*32; gpio < reg*32+32; gpio++) {
+ gedr_v = readl(gedr);
+ if (gedr_v & BIT(gpio % 32)) {
+ pr_debug("pin %d triggered\n", gpio);
+ generic_handle_irq(lnw->irq_base + gpio);
+ }
+ }
+ /* clear the edge detect status bit */
+ writel(gedr_v, gedr);
+ }
+ desc->chip->eoi(irq);
+}
+
+static int __devinit lnw_gpio_probe(struct pci_dev *pdev,
+ const struct pci_device_id *id)
+{
+ void *base;
+ int i;
+ resource_size_t start, len;
+ struct lnw_gpio *lnw;
+ u32 irq_base;
+ u32 gpio_base;
+ int retval = 0;
+
+ retval = pci_enable_device(pdev);
+ if (retval)
+ goto done;
+
+ retval = pci_request_regions(pdev, "langwell_gpio");
+ if (retval) {
+ dev_err(&pdev->dev, "error requesting resources\n");
+ goto err2;
+ }
+ /* get the irq_base from bar1 */
+ start = pci_resource_start(pdev, 1);
+ len = pci_resource_len(pdev, 1);
+ base = ioremap_nocache(start, len);
+ if (!base) {
+ dev_err(&pdev->dev, "error mapping bar1\n");
+ goto err3;
+ }
+ irq_base = *(u32 *)base;
+ gpio_base = *((u32 *)base + 1);
+ /* release the IO mapping, since we already get the info from bar1 */
+ iounmap(base);
+ /* get the register base from bar0 */
+ start = pci_resource_start(pdev, 0);
+ len = pci_resource_len(pdev, 0);
+ base = ioremap_nocache(start, len);
+ if (!base) {
+ dev_err(&pdev->dev, "error mapping bar0\n");
+ retval = -EFAULT;
+ goto err3;
+ }
+
+ lnw = kzalloc(sizeof(struct lnw_gpio), GFP_KERNEL);
+ if (!lnw) {
+ dev_err(&pdev->dev, "can't allocate langwell_gpio chip data\n");
+ retval = -ENOMEM;
+ goto err4;
+ }
+ lnw->reg_base = base;
+ lnw->irq_base = irq_base;
+ lnw->chip.label = dev_name(&pdev->dev);
+ lnw->chip.direction_input = lnw_gpio_direction_input;
+ lnw->chip.direction_output = lnw_gpio_direction_output;
+ lnw->chip.get = lnw_gpio_get;
+ lnw->chip.set = lnw_gpio_set;
+ lnw->chip.to_irq = lnw_gpio_to_irq;
+ lnw->chip.base = gpio_base;
+ lnw->chip.ngpio = 64;
+ lnw->chip.can_sleep = 0;
+ pci_set_drvdata(pdev, lnw);
+ retval = gpiochip_add(&lnw->chip);
+ if (retval) {
+ dev_err(&pdev->dev, "langwell gpiochip_add error %d\n", retval);
+ goto err5;
+ }
+ set_irq_data(pdev->irq, lnw);
+ set_irq_chained_handler(pdev->irq, lnw_irq_handler);
+ for (i = 0; i < lnw->chip.ngpio; i++) {
+ set_irq_chip_and_handler_name(i + lnw->irq_base, &lnw_irqchip,
+ handle_simple_irq, "demux");
+ set_irq_chip_data(i + lnw->irq_base, lnw);
+ }
+
+ spin_lock_init(&lnw->lock);
+ goto done;
+err5:
+ kfree(lnw);
+err4:
+ iounmap(base);
+err3:
+ pci_release_regions(pdev);
+err2:
+ pci_disable_device(pdev);
+done:
+ return retval;
+}
+
+static struct pci_driver lnw_gpio_driver = {
+ .name = "langwell_gpio",
+ .id_table = lnw_gpio_ids,
+ .probe = lnw_gpio_probe,
+};
+
+static int __init lnw_gpio_init(void)
+{
+ return pci_register_driver(&lnw_gpio_driver);
+}
+
+device_initcall(lnw_gpio_init);
diff --git a/drivers/gpio/max7301.c b/drivers/gpio/max7301.c
index 7b82eaa..480956f 100644
--- a/drivers/gpio/max7301.c
+++ b/drivers/gpio/max7301.c
@@ -339,3 +339,4 @@
MODULE_AUTHOR("Juergen Beisert");
MODULE_LICENSE("GPL v2");
MODULE_DESCRIPTION("MAX7301 SPI based GPIO-Expander");
+MODULE_ALIAS("spi:" DRIVER_NAME);
diff --git a/drivers/gpio/mc33880.c b/drivers/gpio/mc33880.c
new file mode 100644
index 0000000..e7d01bd
--- /dev/null
+++ b/drivers/gpio/mc33880.c
@@ -0,0 +1,196 @@
+/*
+ * mc33880.c MC33880 high-side/low-side switch GPIO driver
+ * Copyright (c) 2009 Intel Corporation
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+ */
+
+/* Supports:
+ * Freescale MC33880 high-side/low-side switch
+ */
+
+#include <linux/init.h>
+#include <linux/mutex.h>
+#include <linux/spi/spi.h>
+#include <linux/spi/mc33880.h>
+#include <linux/gpio.h>
+
+#define DRIVER_NAME "mc33880"
+
+/*
+ * Pin configurations, see MAX7301 datasheet page 6
+ */
+#define PIN_CONFIG_MASK 0x03
+#define PIN_CONFIG_IN_PULLUP 0x03
+#define PIN_CONFIG_IN_WO_PULLUP 0x02
+#define PIN_CONFIG_OUT 0x01
+
+#define PIN_NUMBER 8
+
+
+/*
+ * Some registers must be read back to modify.
+ * To save time we cache them here in memory
+ */
+struct mc33880 {
+ struct mutex lock; /* protect from simultanous accesses */
+ u8 port_config;
+ struct gpio_chip chip;
+ struct spi_device *spi;
+};
+
+static int mc33880_write_config(struct mc33880 *mc)
+{
+ return spi_write(mc->spi, &mc->port_config, sizeof(mc->port_config));
+}
+
+
+static int __mc33880_set(struct mc33880 *mc, unsigned offset, int value)
+{
+ if (value)
+ mc->port_config |= 1 << offset;
+ else
+ mc->port_config &= ~(1 << offset);
+
+ return mc33880_write_config(mc);
+}
+
+
+static void mc33880_set(struct gpio_chip *chip, unsigned offset, int value)
+{
+ struct mc33880 *mc = container_of(chip, struct mc33880, chip);
+
+ mutex_lock(&mc->lock);
+
+ __mc33880_set(mc, offset, value);
+
+ mutex_unlock(&mc->lock);
+}
+
+static int __devinit mc33880_probe(struct spi_device *spi)
+{
+ struct mc33880 *mc;
+ struct mc33880_platform_data *pdata;
+ int ret;
+
+ pdata = spi->dev.platform_data;
+ if (!pdata || !pdata->base) {
+ dev_dbg(&spi->dev, "incorrect or missing platform data\n");
+ return -EINVAL;
+ }
+
+ /*
+ * bits_per_word cannot be configured in platform data
+ */
+ spi->bits_per_word = 8;
+
+ ret = spi_setup(spi);
+ if (ret < 0)
+ return ret;
+
+ mc = kzalloc(sizeof(struct mc33880), GFP_KERNEL);
+ if (!mc)
+ return -ENOMEM;
+
+ mutex_init(&mc->lock);
+
+ dev_set_drvdata(&spi->dev, mc);
+
+ mc->spi = spi;
+
+ mc->chip.label = DRIVER_NAME,
+ mc->chip.set = mc33880_set;
+ mc->chip.base = pdata->base;
+ mc->chip.ngpio = PIN_NUMBER;
+ mc->chip.can_sleep = 1;
+ mc->chip.dev = &spi->dev;
+ mc->chip.owner = THIS_MODULE;
+
+ mc->port_config = 0x00;
+ /* write twice, because during initialisation the first setting
+ * is just for testing SPI communication, and the second is the
+ * "real" configuration
+ */
+ ret = mc33880_write_config(mc);
+ mc->port_config = 0x00;
+ if (!ret)
+ ret = mc33880_write_config(mc);
+
+ if (ret) {
+ printk(KERN_ERR "Failed writing to " DRIVER_NAME ": %d\n", ret);
+ goto exit_destroy;
+ }
+
+ ret = gpiochip_add(&mc->chip);
+ if (ret)
+ goto exit_destroy;
+
+ return ret;
+
+exit_destroy:
+ dev_set_drvdata(&spi->dev, NULL);
+ mutex_destroy(&mc->lock);
+ kfree(mc);
+ return ret;
+}
+
+static int mc33880_remove(struct spi_device *spi)
+{
+ struct mc33880 *mc;
+ int ret;
+
+ mc = dev_get_drvdata(&spi->dev);
+ if (mc == NULL)
+ return -ENODEV;
+
+ dev_set_drvdata(&spi->dev, NULL);
+
+ ret = gpiochip_remove(&mc->chip);
+ if (!ret) {
+ mutex_destroy(&mc->lock);
+ kfree(mc);
+ } else
+ dev_err(&spi->dev, "Failed to remove the GPIO controller: %d\n",
+ ret);
+
+ return ret;
+}
+
+static struct spi_driver mc33880_driver = {
+ .driver = {
+ .name = DRIVER_NAME,
+ .owner = THIS_MODULE,
+ },
+ .probe = mc33880_probe,
+ .remove = __devexit_p(mc33880_remove),
+};
+
+static int __init mc33880_init(void)
+{
+ return spi_register_driver(&mc33880_driver);
+}
+/* register after spi postcore initcall and before
+ * subsys initcalls that may rely on these GPIOs
+ */
+subsys_initcall(mc33880_init);
+
+static void __exit mc33880_exit(void)
+{
+ spi_unregister_driver(&mc33880_driver);
+}
+module_exit(mc33880_exit);
+
+MODULE_AUTHOR("Mocean Laboratories <info@mocean-labs.com>");
+MODULE_LICENSE("GPL v2");
+
diff --git a/drivers/gpio/mcp23s08.c b/drivers/gpio/mcp23s08.c
index f6fae0e..cd651ec 100644
--- a/drivers/gpio/mcp23s08.c
+++ b/drivers/gpio/mcp23s08.c
@@ -6,12 +6,10 @@
#include <linux/device.h>
#include <linux/workqueue.h>
#include <linux/mutex.h>
-
+#include <linux/gpio.h>
#include <linux/spi/spi.h>
#include <linux/spi/mcp23s08.h>
-#include <asm/gpio.h>
-
/* Registers are all 8 bits wide.
*
@@ -433,3 +431,4 @@
module_exit(mcp23s08_exit);
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:mcp23s08");
diff --git a/drivers/gpio/pca953x.c b/drivers/gpio/pca953x.c
index cdb6574..6a2fb3f 100644
--- a/drivers/gpio/pca953x.c
+++ b/drivers/gpio/pca953x.c
@@ -13,6 +13,7 @@
#include <linux/module.h>
#include <linux/init.h>
+#include <linux/gpio.h>
#include <linux/i2c.h>
#include <linux/i2c/pca953x.h>
#ifdef CONFIG_OF_GPIO
@@ -20,8 +21,6 @@
#include <linux/of_gpio.h>
#endif
-#include <asm/gpio.h>
-
#define PCA953X_INPUT 0
#define PCA953X_OUTPUT 1
#define PCA953X_INVERT 2
@@ -40,6 +39,7 @@
{ "pca9557", 8, },
{ "max7310", 8, },
+ { "max7315", 8, },
{ "pca6107", 8, },
{ "tca6408", 8, },
{ "tca6416", 16, },
diff --git a/drivers/gpio/pcf857x.c b/drivers/gpio/pcf857x.c
index 9525724..72f2449 100644
--- a/drivers/gpio/pcf857x.c
+++ b/drivers/gpio/pcf857x.c
@@ -20,11 +20,10 @@
#include <linux/kernel.h>
#include <linux/slab.h>
+#include <linux/gpio.h>
#include <linux/i2c.h>
#include <linux/i2c/pcf857x.h>
-#include <asm/gpio.h>
-
static const struct i2c_device_id pcf857x_id[] = {
{ "pcf8574", 8 },
diff --git a/drivers/gpio/ucb1400_gpio.c b/drivers/gpio/ucb1400_gpio.c
new file mode 100644
index 0000000..50e6bd1
--- /dev/null
+++ b/drivers/gpio/ucb1400_gpio.c
@@ -0,0 +1,125 @@
+/*
+ * Philips UCB1400 GPIO driver
+ *
+ * Author: Marek Vasut <marek.vasut@gmail.com>
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/ucb1400.h>
+
+struct ucb1400_gpio_data *ucbdata;
+
+static int ucb1400_gpio_dir_in(struct gpio_chip *gc, unsigned off)
+{
+ struct ucb1400_gpio *gpio;
+ gpio = container_of(gc, struct ucb1400_gpio, gc);
+ ucb1400_gpio_set_direction(gpio->ac97, off, 0);
+ return 0;
+}
+
+static int ucb1400_gpio_dir_out(struct gpio_chip *gc, unsigned off, int val)
+{
+ struct ucb1400_gpio *gpio;
+ gpio = container_of(gc, struct ucb1400_gpio, gc);
+ ucb1400_gpio_set_direction(gpio->ac97, off, 1);
+ ucb1400_gpio_set_value(gpio->ac97, off, val);
+ return 0;
+}
+
+static int ucb1400_gpio_get(struct gpio_chip *gc, unsigned off)
+{
+ struct ucb1400_gpio *gpio;
+ gpio = container_of(gc, struct ucb1400_gpio, gc);
+ return ucb1400_gpio_get_value(gpio->ac97, off);
+}
+
+static void ucb1400_gpio_set(struct gpio_chip *gc, unsigned off, int val)
+{
+ struct ucb1400_gpio *gpio;
+ gpio = container_of(gc, struct ucb1400_gpio, gc);
+ ucb1400_gpio_set_value(gpio->ac97, off, val);
+}
+
+static int ucb1400_gpio_probe(struct platform_device *dev)
+{
+ struct ucb1400_gpio *ucb = dev->dev.platform_data;
+ int err = 0;
+
+ if (!(ucbdata && ucbdata->gpio_offset)) {
+ err = -EINVAL;
+ goto err;
+ }
+
+ platform_set_drvdata(dev, ucb);
+
+ ucb->gc.label = "ucb1400_gpio";
+ ucb->gc.base = ucbdata->gpio_offset;
+ ucb->gc.ngpio = 10;
+ ucb->gc.owner = THIS_MODULE;
+
+ ucb->gc.direction_input = ucb1400_gpio_dir_in;
+ ucb->gc.direction_output = ucb1400_gpio_dir_out;
+ ucb->gc.get = ucb1400_gpio_get;
+ ucb->gc.set = ucb1400_gpio_set;
+ ucb->gc.can_sleep = 1;
+
+ err = gpiochip_add(&ucb->gc);
+ if (err)
+ goto err;
+
+ if (ucbdata && ucbdata->gpio_setup)
+ err = ucbdata->gpio_setup(&dev->dev, ucb->gc.ngpio);
+
+err:
+ return err;
+
+}
+
+static int ucb1400_gpio_remove(struct platform_device *dev)
+{
+ int err = 0;
+ struct ucb1400_gpio *ucb = platform_get_drvdata(dev);
+
+ if (ucbdata && ucbdata->gpio_teardown) {
+ err = ucbdata->gpio_teardown(&dev->dev, ucb->gc.ngpio);
+ if (err)
+ return err;
+ }
+
+ err = gpiochip_remove(&ucb->gc);
+ return err;
+}
+
+static struct platform_driver ucb1400_gpio_driver = {
+ .probe = ucb1400_gpio_probe,
+ .remove = ucb1400_gpio_remove,
+ .driver = {
+ .name = "ucb1400_gpio"
+ },
+};
+
+static int __init ucb1400_gpio_init(void)
+{
+ return platform_driver_register(&ucb1400_gpio_driver);
+}
+
+static void __exit ucb1400_gpio_exit(void)
+{
+ platform_driver_unregister(&ucb1400_gpio_driver);
+}
+
+void __init ucb1400_gpio_set_data(struct ucb1400_gpio_data *data)
+{
+ ucbdata = data;
+}
+
+module_init(ucb1400_gpio_init);
+module_exit(ucb1400_gpio_exit);
+
+MODULE_DESCRIPTION("Philips UCB1400 GPIO driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/hwmon/adcxx.c b/drivers/hwmon/adcxx.c
index 242294d..5e9e095 100644
--- a/drivers/hwmon/adcxx.c
+++ b/drivers/hwmon/adcxx.c
@@ -43,6 +43,7 @@
#include <linux/hwmon.h>
#include <linux/hwmon-sysfs.h>
#include <linux/mutex.h>
+#include <linux/mod_devicetable.h>
#include <linux/spi/spi.h>
#define DRVNAME "adcxx"
@@ -157,8 +158,9 @@
/*----------------------------------------------------------------------*/
-static int __devinit adcxx_probe(struct spi_device *spi, int channels)
+static int __devinit adcxx_probe(struct spi_device *spi)
{
+ int channels = spi_get_device_id(spi)->driver_data;
struct adcxx *adc;
int status;
int i;
@@ -204,26 +206,6 @@
return status;
}
-static int __devinit adcxx1s_probe(struct spi_device *spi)
-{
- return adcxx_probe(spi, 1);
-}
-
-static int __devinit adcxx2s_probe(struct spi_device *spi)
-{
- return adcxx_probe(spi, 2);
-}
-
-static int __devinit adcxx4s_probe(struct spi_device *spi)
-{
- return adcxx_probe(spi, 4);
-}
-
-static int __devinit adcxx8s_probe(struct spi_device *spi)
-{
- return adcxx_probe(spi, 8);
-}
-
static int __devexit adcxx_remove(struct spi_device *spi)
{
struct adcxx *adc = dev_get_drvdata(&spi->dev);
@@ -241,79 +223,33 @@
return 0;
}
-static struct spi_driver adcxx1s_driver = {
- .driver = {
- .name = "adcxx1s",
- .owner = THIS_MODULE,
- },
- .probe = adcxx1s_probe,
- .remove = __devexit_p(adcxx_remove),
+static const struct spi_device_id adcxx_ids[] = {
+ { "adcxx1s", 1 },
+ { "adcxx2s", 2 },
+ { "adcxx4s", 4 },
+ { "adcxx8s", 8 },
+ { },
};
+MODULE_DEVICE_TABLE(spi, adcxx_ids);
-static struct spi_driver adcxx2s_driver = {
+static struct spi_driver adcxx_driver = {
.driver = {
- .name = "adcxx2s",
+ .name = "adcxx",
.owner = THIS_MODULE,
},
- .probe = adcxx2s_probe,
- .remove = __devexit_p(adcxx_remove),
-};
-
-static struct spi_driver adcxx4s_driver = {
- .driver = {
- .name = "adcxx4s",
- .owner = THIS_MODULE,
- },
- .probe = adcxx4s_probe,
- .remove = __devexit_p(adcxx_remove),
-};
-
-static struct spi_driver adcxx8s_driver = {
- .driver = {
- .name = "adcxx8s",
- .owner = THIS_MODULE,
- },
- .probe = adcxx8s_probe,
+ .id_table = adcxx_ids,
+ .probe = adcxx_probe,
.remove = __devexit_p(adcxx_remove),
};
static int __init init_adcxx(void)
{
- int status;
- status = spi_register_driver(&adcxx1s_driver);
- if (status)
- goto reg_1_failed;
-
- status = spi_register_driver(&adcxx2s_driver);
- if (status)
- goto reg_2_failed;
-
- status = spi_register_driver(&adcxx4s_driver);
- if (status)
- goto reg_4_failed;
-
- status = spi_register_driver(&adcxx8s_driver);
- if (status)
- goto reg_8_failed;
-
- return status;
-
-reg_8_failed:
- spi_unregister_driver(&adcxx4s_driver);
-reg_4_failed:
- spi_unregister_driver(&adcxx2s_driver);
-reg_2_failed:
- spi_unregister_driver(&adcxx1s_driver);
-reg_1_failed:
- return status;
+ return spi_register_driver(&adcxx_driver);
}
static void __exit exit_adcxx(void)
{
- spi_unregister_driver(&adcxx1s_driver);
- spi_unregister_driver(&adcxx2s_driver);
- spi_unregister_driver(&adcxx4s_driver);
- spi_unregister_driver(&adcxx8s_driver);
+ spi_unregister_driver(&adcxx_driver);
}
module_init(init_adcxx);
@@ -322,8 +258,3 @@
MODULE_AUTHOR("Marc Pignat");
MODULE_DESCRIPTION("National Semiconductor adcxx8sxxx Linux driver");
MODULE_LICENSE("GPL");
-
-MODULE_ALIAS("adcxx1s");
-MODULE_ALIAS("adcxx2s");
-MODULE_ALIAS("adcxx4s");
-MODULE_ALIAS("adcxx8s");
diff --git a/drivers/hwmon/dme1737.c b/drivers/hwmon/dme1737.c
index 9814d51..2c2cb1e 100644
--- a/drivers/hwmon/dme1737.c
+++ b/drivers/hwmon/dme1737.c
@@ -1134,7 +1134,7 @@
res = PWM_FREQ_FROM_REG(data->pwm_freq[ix]);
break;
case SYS_PWM_ENABLE:
- if (ix > 3) {
+ if (ix >= 3) {
res = 1; /* pwm[5-6] hard-wired to manual mode */
} else {
res = PWM_EN_FROM_REG(data->pwm_config[ix]);
diff --git a/drivers/hwmon/lis3lv02d_spi.c b/drivers/hwmon/lis3lv02d_spi.c
index 82ebca5..ecd7395 100644
--- a/drivers/hwmon/lis3lv02d_spi.c
+++ b/drivers/hwmon/lis3lv02d_spi.c
@@ -139,4 +139,4 @@
MODULE_AUTHOR("Daniel Mack <daniel@caiaq.de>");
MODULE_DESCRIPTION("lis3lv02d SPI glue layer");
MODULE_LICENSE("GPL");
-
+MODULE_ALIAS("spi:" DRV_NAME);
diff --git a/drivers/hwmon/lm70.c b/drivers/hwmon/lm70.c
index ae6204f..ab8a5d3 100644
--- a/drivers/hwmon/lm70.c
+++ b/drivers/hwmon/lm70.c
@@ -32,6 +32,7 @@
#include <linux/sysfs.h>
#include <linux/hwmon.h>
#include <linux/mutex.h>
+#include <linux/mod_devicetable.h>
#include <linux/spi/spi.h>
@@ -130,11 +131,20 @@
/*----------------------------------------------------------------------*/
-static int __devinit common_probe(struct spi_device *spi, int chip)
+static int __devinit lm70_probe(struct spi_device *spi)
{
+ int chip = spi_get_device_id(spi)->driver_data;
struct lm70 *p_lm70;
int status;
+ /* signaling is SPI_MODE_0 for both LM70 and TMP121 */
+ if (spi->mode & (SPI_CPOL | SPI_CPHA))
+ return -EINVAL;
+
+ /* 3-wire link (shared SI/SO) for LM70 */
+ if (chip == LM70_CHIP_LM70 && !(spi->mode & SPI_3WIRE))
+ return -EINVAL;
+
/* NOTE: we assume 8-bit words, and convert to 16 bits manually */
p_lm70 = kzalloc(sizeof *p_lm70, GFP_KERNEL);
@@ -170,24 +180,6 @@
return status;
}
-static int __devinit lm70_probe(struct spi_device *spi)
-{
- /* signaling is SPI_MODE_0 on a 3-wire link (shared SI/SO) */
- if ((spi->mode & (SPI_CPOL | SPI_CPHA)) || !(spi->mode & SPI_3WIRE))
- return -EINVAL;
-
- return common_probe(spi, LM70_CHIP_LM70);
-}
-
-static int __devinit tmp121_probe(struct spi_device *spi)
-{
- /* signaling is SPI_MODE_0 with only MISO connected */
- if (spi->mode & (SPI_CPOL | SPI_CPHA))
- return -EINVAL;
-
- return common_probe(spi, LM70_CHIP_TMP121);
-}
-
static int __devexit lm70_remove(struct spi_device *spi)
{
struct lm70 *p_lm70 = dev_get_drvdata(&spi->dev);
@@ -201,41 +193,32 @@
return 0;
}
-static struct spi_driver tmp121_driver = {
- .driver = {
- .name = "tmp121",
- .owner = THIS_MODULE,
- },
- .probe = tmp121_probe,
- .remove = __devexit_p(lm70_remove),
+
+static const struct spi_device_id lm70_ids[] = {
+ { "lm70", LM70_CHIP_LM70 },
+ { "tmp121", LM70_CHIP_TMP121 },
+ { },
};
+MODULE_DEVICE_TABLE(spi, lm70_ids);
static struct spi_driver lm70_driver = {
.driver = {
.name = "lm70",
.owner = THIS_MODULE,
},
+ .id_table = lm70_ids,
.probe = lm70_probe,
.remove = __devexit_p(lm70_remove),
};
static int __init init_lm70(void)
{
- int ret = spi_register_driver(&lm70_driver);
- if (ret)
- return ret;
-
- ret = spi_register_driver(&tmp121_driver);
- if (ret)
- spi_unregister_driver(&lm70_driver);
-
- return ret;
+ return spi_register_driver(&lm70_driver);
}
static void __exit cleanup_lm70(void)
{
spi_unregister_driver(&lm70_driver);
- spi_unregister_driver(&tmp121_driver);
}
module_init(init_lm70);
diff --git a/drivers/hwmon/max1111.c b/drivers/hwmon/max1111.c
index bfaa665..9ac4972 100644
--- a/drivers/hwmon/max1111.c
+++ b/drivers/hwmon/max1111.c
@@ -242,3 +242,4 @@
MODULE_AUTHOR("Eric Miao <eric.miao@marvell.com>");
MODULE_DESCRIPTION("MAX1111 ADC Driver");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:max1111");
diff --git a/drivers/infiniband/hw/ehca/ehca_mrmw.c b/drivers/infiniband/hw/ehca/ehca_mrmw.c
index 7663a2a..7550a53 100644
--- a/drivers/infiniband/hw/ehca/ehca_mrmw.c
+++ b/drivers/infiniband/hw/ehca/ehca_mrmw.c
@@ -2463,7 +2463,7 @@
int ret;
ehca_mr_len = 0;
- ret = walk_memory_resource(0, 1ULL << MAX_PHYSMEM_BITS, NULL,
+ ret = walk_system_ram_range(0, 1ULL << MAX_PHYSMEM_BITS, NULL,
ehca_create_busmap_callback);
return ret;
}
diff --git a/drivers/input/touchscreen/ad7877.c b/drivers/input/touchscreen/ad7877.c
index ecaeb7e..eb83939c 100644
--- a/drivers/input/touchscreen/ad7877.c
+++ b/drivers/input/touchscreen/ad7877.c
@@ -842,3 +842,4 @@
MODULE_AUTHOR("Michael Hennerich <hennerich@blackfin.uclinux.org>");
MODULE_DESCRIPTION("AD7877 touchscreen Driver");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ad7877");
diff --git a/drivers/input/touchscreen/ad7879.c b/drivers/input/touchscreen/ad7879.c
index 5d8a703..19b4db7e 100644
--- a/drivers/input/touchscreen/ad7879.c
+++ b/drivers/input/touchscreen/ad7879.c
@@ -779,3 +779,4 @@
MODULE_AUTHOR("Michael Hennerich <hennerich@blackfin.uclinux.org>");
MODULE_DESCRIPTION("AD7879(-1) touchscreen Driver");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ad7879");
diff --git a/drivers/input/touchscreen/ads7846.c b/drivers/input/touchscreen/ads7846.c
index ba9d38c..09c8109 100644
--- a/drivers/input/touchscreen/ads7846.c
+++ b/drivers/input/touchscreen/ads7846.c
@@ -1256,3 +1256,4 @@
MODULE_DESCRIPTION("ADS7846 TouchScreen Driver");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ads7846");
diff --git a/drivers/isdn/capi/kcapi_proc.c b/drivers/isdn/capi/kcapi_proc.c
index 50ed778..09d4db7 100644
--- a/drivers/isdn/capi/kcapi_proc.c
+++ b/drivers/isdn/capi/kcapi_proc.c
@@ -89,14 +89,14 @@
return 0;
}
-static struct seq_operations seq_controller_ops = {
+static const struct seq_operations seq_controller_ops = {
.start = controller_start,
.next = controller_next,
.stop = controller_stop,
.show = controller_show,
};
-static struct seq_operations seq_contrstats_ops = {
+static const struct seq_operations seq_contrstats_ops = {
.start = controller_start,
.next = controller_next,
.stop = controller_stop,
@@ -194,14 +194,14 @@
return 0;
}
-static struct seq_operations seq_applications_ops = {
+static const struct seq_operations seq_applications_ops = {
.start = applications_start,
.next = applications_next,
.stop = applications_stop,
.show = applications_show,
};
-static struct seq_operations seq_applstats_ops = {
+static const struct seq_operations seq_applstats_ops = {
.start = applications_start,
.next = applications_next,
.stop = applications_stop,
@@ -264,7 +264,7 @@
return 0;
}
-static struct seq_operations seq_capi_driver_ops = {
+static const struct seq_operations seq_capi_driver_ops = {
.start = capi_driver_start,
.next = capi_driver_next,
.stop = capi_driver_stop,
diff --git a/drivers/leds/leds-dac124s085.c b/drivers/leds/leds-dac124s085.c
index 098d9aa..2913d76 100644
--- a/drivers/leds/leds-dac124s085.c
+++ b/drivers/leds/leds-dac124s085.c
@@ -148,3 +148,4 @@
MODULE_AUTHOR("Guennadi Liakhovetski <lg@denx.de>");
MODULE_DESCRIPTION("DAC124S085 LED driver");
MODULE_LICENSE("GPL v2");
+MODULE_ALIAS("spi:dac124s085");
diff --git a/drivers/lguest/core.c b/drivers/lguest/core.c
index 1e2cb84..8744d24 100644
--- a/drivers/lguest/core.c
+++ b/drivers/lguest/core.c
@@ -67,12 +67,11 @@
* so we make sure they're zeroed.
*/
for (i = 0; i < TOTAL_SWITCHER_PAGES; i++) {
- unsigned long addr = get_zeroed_page(GFP_KERNEL);
- if (!addr) {
+ switcher_page[i] = alloc_page(GFP_KERNEL|__GFP_ZERO);
+ if (!switcher_page[i]) {
err = -ENOMEM;
goto free_some_pages;
}
- switcher_page[i] = virt_to_page(addr);
}
/*
diff --git a/drivers/lguest/page_tables.c b/drivers/lguest/page_tables.c
index 8aaad65..cf94326 100644
--- a/drivers/lguest/page_tables.c
+++ b/drivers/lguest/page_tables.c
@@ -380,7 +380,7 @@
* And we copy the flags to the shadow PMD entry. The page
* number in the shadow PMD is the page we just allocated.
*/
- native_set_pmd(spmd, __pmd(__pa(ptepage) | pmd_flags(gpmd)));
+ set_pmd(spmd, __pmd(__pa(ptepage) | pmd_flags(gpmd)));
}
/*
@@ -447,7 +447,7 @@
* we will come back here when a write does actually occur, so
* we can update the Guest's _PAGE_DIRTY flag.
*/
- native_set_pte(spte, gpte_to_spte(cpu, pte_wrprotect(gpte), 0));
+ set_pte(spte, gpte_to_spte(cpu, pte_wrprotect(gpte), 0));
/*
* Finally, we write the Guest PTE entry back: we've set the
@@ -528,7 +528,7 @@
/* Now we can free the page of PTEs */
free_page((long)ptepage);
/* And zero out the PMD entry so we never release it twice. */
- native_set_pmd(spmd, __pmd(0));
+ set_pmd(spmd, __pmd(0));
}
}
@@ -833,15 +833,15 @@
*/
if (pte_flags(gpte) & (_PAGE_DIRTY | _PAGE_ACCESSED)) {
check_gpte(cpu, gpte);
- native_set_pte(spte,
- gpte_to_spte(cpu, gpte,
+ set_pte(spte,
+ gpte_to_spte(cpu, gpte,
pte_flags(gpte) & _PAGE_DIRTY));
} else {
/*
* Otherwise kill it and we can demand_page()
* it in later.
*/
- native_set_pte(spte, __pte(0));
+ set_pte(spte, __pte(0));
}
#ifdef CONFIG_X86_PAE
}
@@ -983,25 +983,22 @@
*/
for (i = j = 0; i < mapped_pages && j < PTRS_PER_PMD;
i += PTRS_PER_PTE, j++) {
- /* FIXME: native_set_pmd is overkill here. */
- native_set_pmd(&pmd, __pmd(((unsigned long)(linear + i)
- - mem_base) | _PAGE_PRESENT | _PAGE_RW | _PAGE_USER));
+ pmd = pfn_pmd(((unsigned long)&linear[i] - mem_base)/PAGE_SIZE,
+ __pgprot(_PAGE_PRESENT | _PAGE_RW | _PAGE_USER));
if (copy_to_user(&pmds[j], &pmd, sizeof(pmd)) != 0)
return -EFAULT;
}
/* One PGD entry, pointing to that PMD page. */
- set_pgd(&pgd, __pgd(((u32)pmds - mem_base) | _PAGE_PRESENT));
+ pgd = __pgd(((unsigned long)pmds - mem_base) | _PAGE_PRESENT);
/* Copy it in as the first PGD entry (ie. addresses 0-1G). */
if (copy_to_user(&pgdir[0], &pgd, sizeof(pgd)) != 0)
return -EFAULT;
/*
- * And the third PGD entry (ie. addresses 3G-4G).
- *
- * FIXME: This assumes that PAGE_OFFSET for the Guest is 0xC0000000.
+ * And the other PGD entry to make the linear mapping at PAGE_OFFSET
*/
- if (copy_to_user(&pgdir[3], &pgd, sizeof(pgd)) != 0)
+ if (copy_to_user(&pgdir[KERNEL_PGD_BOUNDARY], &pgd, sizeof(pgd)))
return -EFAULT;
#else
/*
@@ -1141,15 +1138,13 @@
{
pte_t *switcher_pte_page = __get_cpu_var(switcher_pte_pages);
pte_t regs_pte;
- unsigned long pfn;
#ifdef CONFIG_X86_PAE
pmd_t switcher_pmd;
pmd_t *pmd_table;
- /* FIXME: native_set_pmd is overkill here. */
- native_set_pmd(&switcher_pmd, pfn_pmd(__pa(switcher_pte_page) >>
- PAGE_SHIFT, PAGE_KERNEL_EXEC));
+ switcher_pmd = pfn_pmd(__pa(switcher_pte_page) >> PAGE_SHIFT,
+ PAGE_KERNEL_EXEC);
/* Figure out where the pmd page is, by reading the PGD, and converting
* it to a virtual address. */
@@ -1157,7 +1152,7 @@
pgdirs[cpu->cpu_pgd].pgdir[SWITCHER_PGD_INDEX])
<< PAGE_SHIFT);
/* Now write it into the shadow page table. */
- native_set_pmd(&pmd_table[SWITCHER_PMD_INDEX], switcher_pmd);
+ set_pmd(&pmd_table[SWITCHER_PMD_INDEX], switcher_pmd);
#else
pgd_t switcher_pgd;
@@ -1179,10 +1174,8 @@
* page is already mapped there, we don't have to copy them out
* again.
*/
- pfn = __pa(cpu->regs_page) >> PAGE_SHIFT;
- native_set_pte(®s_pte, pfn_pte(pfn, PAGE_KERNEL));
- native_set_pte(&switcher_pte_page[pte_index((unsigned long)pages)],
- regs_pte);
+ regs_pte = pfn_pte(__pa(cpu->regs_page) >> PAGE_SHIFT, PAGE_KERNEL);
+ set_pte(&switcher_pte_page[pte_index((unsigned long)pages)], regs_pte);
}
/*:*/
@@ -1209,7 +1202,7 @@
/* The first entries are easy: they map the Switcher code. */
for (i = 0; i < pages; i++) {
- native_set_pte(&pte[i], mk_pte(switcher_page[i],
+ set_pte(&pte[i], mk_pte(switcher_page[i],
__pgprot(_PAGE_PRESENT|_PAGE_ACCESSED)));
}
@@ -1217,14 +1210,14 @@
i = pages + cpu*2;
/* First page (Guest registers) is writable from the Guest */
- native_set_pte(&pte[i], pfn_pte(page_to_pfn(switcher_page[i]),
+ set_pte(&pte[i], pfn_pte(page_to_pfn(switcher_page[i]),
__pgprot(_PAGE_PRESENT|_PAGE_ACCESSED|_PAGE_RW)));
/*
* The second page contains the "struct lguest_ro_state", and is
* read-only.
*/
- native_set_pte(&pte[i+1], pfn_pte(page_to_pfn(switcher_page[i+1]),
+ set_pte(&pte[i+1], pfn_pte(page_to_pfn(switcher_page[i+1]),
__pgprot(_PAGE_PRESENT|_PAGE_ACCESSED)));
}
diff --git a/drivers/mfd/ezx-pcap.c b/drivers/mfd/ezx-pcap.c
index 016be49..87628891 100644
--- a/drivers/mfd/ezx-pcap.c
+++ b/drivers/mfd/ezx-pcap.c
@@ -548,3 +548,4 @@
MODULE_LICENSE("GPL");
MODULE_AUTHOR("Daniel Ribeiro / Harald Welte");
MODULE_DESCRIPTION("Motorola PCAP2 ASIC Driver");
+MODULE_ALIAS("spi:ezx-pcap");
diff --git a/drivers/mfd/ucb1400_core.c b/drivers/mfd/ucb1400_core.c
index 78c2135..2afc0800 100644
--- a/drivers/mfd/ucb1400_core.c
+++ b/drivers/mfd/ucb1400_core.c
@@ -48,9 +48,11 @@
int err;
struct ucb1400 *ucb;
struct ucb1400_ts ucb_ts;
+ struct ucb1400_gpio ucb_gpio;
struct snd_ac97 *ac97;
memset(&ucb_ts, 0, sizeof(ucb_ts));
+ memset(&ucb_gpio, 0, sizeof(ucb_gpio));
ucb = kzalloc(sizeof(struct ucb1400), GFP_KERNEL);
if (!ucb) {
@@ -68,25 +70,44 @@
goto err0;
}
+ /* GPIO */
+ ucb_gpio.ac97 = ac97;
+ ucb->ucb1400_gpio = platform_device_alloc("ucb1400_gpio", -1);
+ if (!ucb->ucb1400_gpio) {
+ err = -ENOMEM;
+ goto err0;
+ }
+ err = platform_device_add_data(ucb->ucb1400_gpio, &ucb_gpio,
+ sizeof(ucb_gpio));
+ if (err)
+ goto err1;
+ err = platform_device_add(ucb->ucb1400_gpio);
+ if (err)
+ goto err1;
+
/* TOUCHSCREEN */
ucb_ts.ac97 = ac97;
ucb->ucb1400_ts = platform_device_alloc("ucb1400_ts", -1);
if (!ucb->ucb1400_ts) {
err = -ENOMEM;
- goto err0;
+ goto err2;
}
err = platform_device_add_data(ucb->ucb1400_ts, &ucb_ts,
sizeof(ucb_ts));
if (err)
- goto err1;
+ goto err3;
err = platform_device_add(ucb->ucb1400_ts);
if (err)
- goto err1;
+ goto err3;
return 0;
-err1:
+err3:
platform_device_put(ucb->ucb1400_ts);
+err2:
+ platform_device_unregister(ucb->ucb1400_gpio);
+err1:
+ platform_device_put(ucb->ucb1400_gpio);
err0:
kfree(ucb);
err:
@@ -98,6 +119,8 @@
struct ucb1400 *ucb = dev_get_drvdata(dev);
platform_device_unregister(ucb->ucb1400_ts);
+ platform_device_unregister(ucb->ucb1400_gpio);
+
kfree(ucb);
return 0;
}
diff --git a/drivers/misc/eeprom/at25.c b/drivers/misc/eeprom/at25.c
index 2e535a0..d902d81 100644
--- a/drivers/misc/eeprom/at25.c
+++ b/drivers/misc/eeprom/at25.c
@@ -417,4 +417,4 @@
MODULE_DESCRIPTION("Driver for most SPI EEPROMs");
MODULE_AUTHOR("David Brownell");
MODULE_LICENSE("GPL");
-
+MODULE_ALIAS("spi:at25");
diff --git a/drivers/misc/lkdtm.c b/drivers/misc/lkdtm.c
index 1bfe5d1..3648b23 100644
--- a/drivers/misc/lkdtm.c
+++ b/drivers/misc/lkdtm.c
@@ -283,7 +283,7 @@
switch (cpoint) {
case INT_HARDWARE_ENTRY:
- lkdtm.kp.symbol_name = "__do_IRQ";
+ lkdtm.kp.symbol_name = "do_IRQ";
lkdtm.entry = (kprobe_opcode_t*) jp_do_irq;
break;
case INT_HW_IRQ_EN:
diff --git a/drivers/mmc/core/core.c b/drivers/mmc/core/core.c
index d84c880..7dab2e5 100644
--- a/drivers/mmc/core/core.c
+++ b/drivers/mmc/core/core.c
@@ -344,6 +344,101 @@
EXPORT_SYMBOL(mmc_align_data_size);
/**
+ * mmc_host_enable - enable a host.
+ * @host: mmc host to enable
+ *
+ * Hosts that support power saving can use the 'enable' and 'disable'
+ * methods to exit and enter power saving states. For more information
+ * see comments for struct mmc_host_ops.
+ */
+int mmc_host_enable(struct mmc_host *host)
+{
+ if (!(host->caps & MMC_CAP_DISABLE))
+ return 0;
+
+ if (host->en_dis_recurs)
+ return 0;
+
+ if (host->nesting_cnt++)
+ return 0;
+
+ cancel_delayed_work_sync(&host->disable);
+
+ if (host->enabled)
+ return 0;
+
+ if (host->ops->enable) {
+ int err;
+
+ host->en_dis_recurs = 1;
+ err = host->ops->enable(host);
+ host->en_dis_recurs = 0;
+
+ if (err) {
+ pr_debug("%s: enable error %d\n",
+ mmc_hostname(host), err);
+ return err;
+ }
+ }
+ host->enabled = 1;
+ return 0;
+}
+EXPORT_SYMBOL(mmc_host_enable);
+
+static int mmc_host_do_disable(struct mmc_host *host, int lazy)
+{
+ if (host->ops->disable) {
+ int err;
+
+ host->en_dis_recurs = 1;
+ err = host->ops->disable(host, lazy);
+ host->en_dis_recurs = 0;
+
+ if (err < 0) {
+ pr_debug("%s: disable error %d\n",
+ mmc_hostname(host), err);
+ return err;
+ }
+ if (err > 0) {
+ unsigned long delay = msecs_to_jiffies(err);
+
+ mmc_schedule_delayed_work(&host->disable, delay);
+ }
+ }
+ host->enabled = 0;
+ return 0;
+}
+
+/**
+ * mmc_host_disable - disable a host.
+ * @host: mmc host to disable
+ *
+ * Hosts that support power saving can use the 'enable' and 'disable'
+ * methods to exit and enter power saving states. For more information
+ * see comments for struct mmc_host_ops.
+ */
+int mmc_host_disable(struct mmc_host *host)
+{
+ int err;
+
+ if (!(host->caps & MMC_CAP_DISABLE))
+ return 0;
+
+ if (host->en_dis_recurs)
+ return 0;
+
+ if (--host->nesting_cnt)
+ return 0;
+
+ if (!host->enabled)
+ return 0;
+
+ err = mmc_host_do_disable(host, 0);
+ return err;
+}
+EXPORT_SYMBOL(mmc_host_disable);
+
+/**
* __mmc_claim_host - exclusively claim a host
* @host: mmc host to claim
* @abort: whether or not the operation should be aborted
@@ -366,25 +461,111 @@
while (1) {
set_current_state(TASK_UNINTERRUPTIBLE);
stop = abort ? atomic_read(abort) : 0;
- if (stop || !host->claimed)
+ if (stop || !host->claimed || host->claimer == current)
break;
spin_unlock_irqrestore(&host->lock, flags);
schedule();
spin_lock_irqsave(&host->lock, flags);
}
set_current_state(TASK_RUNNING);
- if (!stop)
+ if (!stop) {
host->claimed = 1;
- else
+ host->claimer = current;
+ host->claim_cnt += 1;
+ } else
wake_up(&host->wq);
spin_unlock_irqrestore(&host->lock, flags);
remove_wait_queue(&host->wq, &wait);
+ if (!stop)
+ mmc_host_enable(host);
return stop;
}
EXPORT_SYMBOL(__mmc_claim_host);
/**
+ * mmc_try_claim_host - try exclusively to claim a host
+ * @host: mmc host to claim
+ *
+ * Returns %1 if the host is claimed, %0 otherwise.
+ */
+int mmc_try_claim_host(struct mmc_host *host)
+{
+ int claimed_host = 0;
+ unsigned long flags;
+
+ spin_lock_irqsave(&host->lock, flags);
+ if (!host->claimed || host->claimer == current) {
+ host->claimed = 1;
+ host->claimer = current;
+ host->claim_cnt += 1;
+ claimed_host = 1;
+ }
+ spin_unlock_irqrestore(&host->lock, flags);
+ return claimed_host;
+}
+EXPORT_SYMBOL(mmc_try_claim_host);
+
+static void mmc_do_release_host(struct mmc_host *host)
+{
+ unsigned long flags;
+
+ spin_lock_irqsave(&host->lock, flags);
+ if (--host->claim_cnt) {
+ /* Release for nested claim */
+ spin_unlock_irqrestore(&host->lock, flags);
+ } else {
+ host->claimed = 0;
+ host->claimer = NULL;
+ spin_unlock_irqrestore(&host->lock, flags);
+ wake_up(&host->wq);
+ }
+}
+
+void mmc_host_deeper_disable(struct work_struct *work)
+{
+ struct mmc_host *host =
+ container_of(work, struct mmc_host, disable.work);
+
+ /* If the host is claimed then we do not want to disable it anymore */
+ if (!mmc_try_claim_host(host))
+ return;
+ mmc_host_do_disable(host, 1);
+ mmc_do_release_host(host);
+}
+
+/**
+ * mmc_host_lazy_disable - lazily disable a host.
+ * @host: mmc host to disable
+ *
+ * Hosts that support power saving can use the 'enable' and 'disable'
+ * methods to exit and enter power saving states. For more information
+ * see comments for struct mmc_host_ops.
+ */
+int mmc_host_lazy_disable(struct mmc_host *host)
+{
+ if (!(host->caps & MMC_CAP_DISABLE))
+ return 0;
+
+ if (host->en_dis_recurs)
+ return 0;
+
+ if (--host->nesting_cnt)
+ return 0;
+
+ if (!host->enabled)
+ return 0;
+
+ if (host->disable_delay) {
+ mmc_schedule_delayed_work(&host->disable,
+ msecs_to_jiffies(host->disable_delay));
+ return 0;
+ } else
+ return mmc_host_do_disable(host, 1);
+}
+EXPORT_SYMBOL(mmc_host_lazy_disable);
+
+/**
* mmc_release_host - release a host
* @host: mmc host to release
*
@@ -393,15 +574,11 @@
*/
void mmc_release_host(struct mmc_host *host)
{
- unsigned long flags;
-
WARN_ON(!host->claimed);
- spin_lock_irqsave(&host->lock, flags);
- host->claimed = 0;
- spin_unlock_irqrestore(&host->lock, flags);
+ mmc_host_lazy_disable(host);
- wake_up(&host->wq);
+ mmc_do_release_host(host);
}
EXPORT_SYMBOL(mmc_release_host);
@@ -687,7 +864,13 @@
*/
static void mmc_power_up(struct mmc_host *host)
{
- int bit = fls(host->ocr_avail) - 1;
+ int bit;
+
+ /* If ocr is set, we use it */
+ if (host->ocr)
+ bit = ffs(host->ocr) - 1;
+ else
+ bit = fls(host->ocr_avail) - 1;
host->ios.vdd = bit;
if (mmc_host_is_spi(host)) {
@@ -947,6 +1130,8 @@
spin_unlock_irqrestore(&host->lock, flags);
#endif
+ if (host->caps & MMC_CAP_DISABLE)
+ cancel_delayed_work(&host->disable);
cancel_delayed_work(&host->detect);
mmc_flush_scheduled_work();
@@ -958,6 +1143,8 @@
mmc_claim_host(host);
mmc_detach_bus(host);
mmc_release_host(host);
+ mmc_bus_put(host);
+ return;
}
mmc_bus_put(host);
@@ -966,6 +1153,80 @@
mmc_power_off(host);
}
+void mmc_power_save_host(struct mmc_host *host)
+{
+ mmc_bus_get(host);
+
+ if (!host->bus_ops || host->bus_dead || !host->bus_ops->power_restore) {
+ mmc_bus_put(host);
+ return;
+ }
+
+ if (host->bus_ops->power_save)
+ host->bus_ops->power_save(host);
+
+ mmc_bus_put(host);
+
+ mmc_power_off(host);
+}
+EXPORT_SYMBOL(mmc_power_save_host);
+
+void mmc_power_restore_host(struct mmc_host *host)
+{
+ mmc_bus_get(host);
+
+ if (!host->bus_ops || host->bus_dead || !host->bus_ops->power_restore) {
+ mmc_bus_put(host);
+ return;
+ }
+
+ mmc_power_up(host);
+ host->bus_ops->power_restore(host);
+
+ mmc_bus_put(host);
+}
+EXPORT_SYMBOL(mmc_power_restore_host);
+
+int mmc_card_awake(struct mmc_host *host)
+{
+ int err = -ENOSYS;
+
+ mmc_bus_get(host);
+
+ if (host->bus_ops && !host->bus_dead && host->bus_ops->awake)
+ err = host->bus_ops->awake(host);
+
+ mmc_bus_put(host);
+
+ return err;
+}
+EXPORT_SYMBOL(mmc_card_awake);
+
+int mmc_card_sleep(struct mmc_host *host)
+{
+ int err = -ENOSYS;
+
+ mmc_bus_get(host);
+
+ if (host->bus_ops && !host->bus_dead && host->bus_ops->awake)
+ err = host->bus_ops->sleep(host);
+
+ mmc_bus_put(host);
+
+ return err;
+}
+EXPORT_SYMBOL(mmc_card_sleep);
+
+int mmc_card_can_sleep(struct mmc_host *host)
+{
+ struct mmc_card *card = host->card;
+
+ if (card && mmc_card_mmc(card) && card->ext_csd.rev >= 3)
+ return 1;
+ return 0;
+}
+EXPORT_SYMBOL(mmc_card_can_sleep);
+
#ifdef CONFIG_PM
/**
@@ -975,27 +1236,36 @@
*/
int mmc_suspend_host(struct mmc_host *host, pm_message_t state)
{
+ int err = 0;
+
+ if (host->caps & MMC_CAP_DISABLE)
+ cancel_delayed_work(&host->disable);
cancel_delayed_work(&host->detect);
mmc_flush_scheduled_work();
mmc_bus_get(host);
if (host->bus_ops && !host->bus_dead) {
if (host->bus_ops->suspend)
- host->bus_ops->suspend(host);
- if (!host->bus_ops->resume) {
+ err = host->bus_ops->suspend(host);
+ if (err == -ENOSYS || !host->bus_ops->resume) {
+ /*
+ * We simply "remove" the card in this case.
+ * It will be redetected on resume.
+ */
if (host->bus_ops->remove)
host->bus_ops->remove(host);
-
mmc_claim_host(host);
mmc_detach_bus(host);
mmc_release_host(host);
+ err = 0;
}
}
mmc_bus_put(host);
- mmc_power_off(host);
+ if (!err)
+ mmc_power_off(host);
- return 0;
+ return err;
}
EXPORT_SYMBOL(mmc_suspend_host);
@@ -1006,12 +1276,26 @@
*/
int mmc_resume_host(struct mmc_host *host)
{
+ int err = 0;
+
mmc_bus_get(host);
if (host->bus_ops && !host->bus_dead) {
mmc_power_up(host);
mmc_select_voltage(host, host->ocr);
BUG_ON(!host->bus_ops->resume);
- host->bus_ops->resume(host);
+ err = host->bus_ops->resume(host);
+ if (err) {
+ printk(KERN_WARNING "%s: error %d during resume "
+ "(card was removed?)\n",
+ mmc_hostname(host), err);
+ if (host->bus_ops->remove)
+ host->bus_ops->remove(host);
+ mmc_claim_host(host);
+ mmc_detach_bus(host);
+ mmc_release_host(host);
+ /* no need to bother upper layers */
+ err = 0;
+ }
}
mmc_bus_put(host);
@@ -1021,7 +1305,7 @@
*/
mmc_detect_change(host, 1);
- return 0;
+ return err;
}
EXPORT_SYMBOL(mmc_resume_host);
diff --git a/drivers/mmc/core/core.h b/drivers/mmc/core/core.h
index c819eff..67ae6ab 100644
--- a/drivers/mmc/core/core.h
+++ b/drivers/mmc/core/core.h
@@ -16,10 +16,14 @@
#define MMC_CMD_RETRIES 3
struct mmc_bus_ops {
+ int (*awake)(struct mmc_host *);
+ int (*sleep)(struct mmc_host *);
void (*remove)(struct mmc_host *);
void (*detect)(struct mmc_host *);
- void (*suspend)(struct mmc_host *);
- void (*resume)(struct mmc_host *);
+ int (*suspend)(struct mmc_host *);
+ int (*resume)(struct mmc_host *);
+ void (*power_save)(struct mmc_host *);
+ void (*power_restore)(struct mmc_host *);
};
void mmc_attach_bus(struct mmc_host *host, const struct mmc_bus_ops *ops);
diff --git a/drivers/mmc/core/host.c b/drivers/mmc/core/host.c
index 5e945e6..a268d12 100644
--- a/drivers/mmc/core/host.c
+++ b/drivers/mmc/core/host.c
@@ -83,6 +83,7 @@
spin_lock_init(&host->lock);
init_waitqueue_head(&host->wq);
INIT_DELAYED_WORK(&host->detect, mmc_rescan);
+ INIT_DELAYED_WORK_DEFERRABLE(&host->disable, mmc_host_deeper_disable);
/*
* By default, hosts do not support SGIO or large requests.
diff --git a/drivers/mmc/core/host.h b/drivers/mmc/core/host.h
index c2dc3d2..8c87e11 100644
--- a/drivers/mmc/core/host.h
+++ b/drivers/mmc/core/host.h
@@ -14,5 +14,7 @@
int mmc_register_host_class(void);
void mmc_unregister_host_class(void);
+void mmc_host_deeper_disable(struct work_struct *work);
+
#endif
diff --git a/drivers/mmc/core/mmc.c b/drivers/mmc/core/mmc.c
index 2fb9d5f..bfefce3 100644
--- a/drivers/mmc/core/mmc.c
+++ b/drivers/mmc/core/mmc.c
@@ -160,7 +160,6 @@
{
int err;
u8 *ext_csd;
- unsigned int ext_csd_struct;
BUG_ON(!card);
@@ -180,11 +179,11 @@
err = mmc_send_ext_csd(card, ext_csd);
if (err) {
- /*
- * We all hosts that cannot perform the command
- * to fail more gracefully
- */
- if (err != -EINVAL)
+ /* If the host or the card can't do the switch,
+ * fail more gracefully. */
+ if ((err != -EINVAL)
+ && (err != -ENOSYS)
+ && (err != -EFAULT))
goto out;
/*
@@ -207,16 +206,16 @@
goto out;
}
- ext_csd_struct = ext_csd[EXT_CSD_REV];
- if (ext_csd_struct > 3) {
+ card->ext_csd.rev = ext_csd[EXT_CSD_REV];
+ if (card->ext_csd.rev > 3) {
printk(KERN_ERR "%s: unrecognised EXT_CSD structure "
"version %d\n", mmc_hostname(card->host),
- ext_csd_struct);
+ card->ext_csd.rev);
err = -EINVAL;
goto out;
}
- if (ext_csd_struct >= 2) {
+ if (card->ext_csd.rev >= 2) {
card->ext_csd.sectors =
ext_csd[EXT_CSD_SEC_CNT + 0] << 0 |
ext_csd[EXT_CSD_SEC_CNT + 1] << 8 |
@@ -241,6 +240,15 @@
goto out;
}
+ if (card->ext_csd.rev >= 3) {
+ u8 sa_shift = ext_csd[EXT_CSD_S_A_TIMEOUT];
+
+ /* Sleep / awake timeout in 100ns units */
+ if (sa_shift > 0 && sa_shift <= 0x17)
+ card->ext_csd.sa_timeout =
+ 1 << ext_csd[EXT_CSD_S_A_TIMEOUT];
+ }
+
out:
kfree(ext_csd);
@@ -408,12 +416,17 @@
(host->caps & MMC_CAP_MMC_HIGHSPEED)) {
err = mmc_switch(card, EXT_CSD_CMD_SET_NORMAL,
EXT_CSD_HS_TIMING, 1);
- if (err)
+ if (err && err != -EBADMSG)
goto free_card;
- mmc_card_set_highspeed(card);
-
- mmc_set_timing(card->host, MMC_TIMING_MMC_HS);
+ if (err) {
+ printk(KERN_WARNING "%s: switch to highspeed failed\n",
+ mmc_hostname(card->host));
+ err = 0;
+ } else {
+ mmc_card_set_highspeed(card);
+ mmc_set_timing(card->host, MMC_TIMING_MMC_HS);
+ }
}
/*
@@ -448,10 +461,17 @@
err = mmc_switch(card, EXT_CSD_CMD_SET_NORMAL,
EXT_CSD_BUS_WIDTH, ext_csd_bit);
- if (err)
+ if (err && err != -EBADMSG)
goto free_card;
- mmc_set_bus_width(card->host, bus_width);
+ if (err) {
+ printk(KERN_WARNING "%s: switch to bus width %d "
+ "failed\n", mmc_hostname(card->host),
+ 1 << bus_width);
+ err = 0;
+ } else {
+ mmc_set_bus_width(card->host, bus_width);
+ }
}
if (!oldcard)
@@ -507,12 +527,10 @@
}
}
-#ifdef CONFIG_MMC_UNSAFE_RESUME
-
/*
* Suspend callback from host.
*/
-static void mmc_suspend(struct mmc_host *host)
+static int mmc_suspend(struct mmc_host *host)
{
BUG_ON(!host);
BUG_ON(!host->card);
@@ -522,6 +540,8 @@
mmc_deselect_cards(host);
host->card->state &= ~MMC_STATE_HIGHSPEED;
mmc_release_host(host);
+
+ return 0;
}
/*
@@ -530,7 +550,7 @@
* This function tries to determine if the same card is still present
* and, if so, restore all state to it.
*/
-static void mmc_resume(struct mmc_host *host)
+static int mmc_resume(struct mmc_host *host)
{
int err;
@@ -541,30 +561,99 @@
err = mmc_init_card(host, host->ocr, host->card);
mmc_release_host(host);
- if (err) {
- mmc_remove(host);
-
- mmc_claim_host(host);
- mmc_detach_bus(host);
- mmc_release_host(host);
- }
-
+ return err;
}
-#else
+static void mmc_power_restore(struct mmc_host *host)
+{
+ host->card->state &= ~MMC_STATE_HIGHSPEED;
+ mmc_claim_host(host);
+ mmc_init_card(host, host->ocr, host->card);
+ mmc_release_host(host);
+}
-#define mmc_suspend NULL
-#define mmc_resume NULL
+static int mmc_sleep(struct mmc_host *host)
+{
+ struct mmc_card *card = host->card;
+ int err = -ENOSYS;
-#endif
+ if (card && card->ext_csd.rev >= 3) {
+ err = mmc_card_sleepawake(host, 1);
+ if (err < 0)
+ pr_debug("%s: Error %d while putting card into sleep",
+ mmc_hostname(host), err);
+ }
+
+ return err;
+}
+
+static int mmc_awake(struct mmc_host *host)
+{
+ struct mmc_card *card = host->card;
+ int err = -ENOSYS;
+
+ if (card && card->ext_csd.rev >= 3) {
+ err = mmc_card_sleepawake(host, 0);
+ if (err < 0)
+ pr_debug("%s: Error %d while awaking sleeping card",
+ mmc_hostname(host), err);
+ }
+
+ return err;
+}
+
+#ifdef CONFIG_MMC_UNSAFE_RESUME
static const struct mmc_bus_ops mmc_ops = {
+ .awake = mmc_awake,
+ .sleep = mmc_sleep,
.remove = mmc_remove,
.detect = mmc_detect,
.suspend = mmc_suspend,
.resume = mmc_resume,
+ .power_restore = mmc_power_restore,
};
+static void mmc_attach_bus_ops(struct mmc_host *host)
+{
+ mmc_attach_bus(host, &mmc_ops);
+}
+
+#else
+
+static const struct mmc_bus_ops mmc_ops = {
+ .awake = mmc_awake,
+ .sleep = mmc_sleep,
+ .remove = mmc_remove,
+ .detect = mmc_detect,
+ .suspend = NULL,
+ .resume = NULL,
+ .power_restore = mmc_power_restore,
+};
+
+static const struct mmc_bus_ops mmc_ops_unsafe = {
+ .awake = mmc_awake,
+ .sleep = mmc_sleep,
+ .remove = mmc_remove,
+ .detect = mmc_detect,
+ .suspend = mmc_suspend,
+ .resume = mmc_resume,
+ .power_restore = mmc_power_restore,
+};
+
+static void mmc_attach_bus_ops(struct mmc_host *host)
+{
+ const struct mmc_bus_ops *bus_ops;
+
+ if (host->caps & MMC_CAP_NONREMOVABLE)
+ bus_ops = &mmc_ops_unsafe;
+ else
+ bus_ops = &mmc_ops;
+ mmc_attach_bus(host, bus_ops);
+}
+
+#endif
+
/*
* Starting point for MMC card init.
*/
@@ -575,7 +664,7 @@
BUG_ON(!host);
WARN_ON(!host->claimed);
- mmc_attach_bus(host, &mmc_ops);
+ mmc_attach_bus_ops(host);
/*
* We need to get OCR a different way for SPI.
diff --git a/drivers/mmc/core/mmc_ops.c b/drivers/mmc/core/mmc_ops.c
index 34ce270..d2cb5c6 100644
--- a/drivers/mmc/core/mmc_ops.c
+++ b/drivers/mmc/core/mmc_ops.c
@@ -57,6 +57,42 @@
return _mmc_select_card(host, NULL);
}
+int mmc_card_sleepawake(struct mmc_host *host, int sleep)
+{
+ struct mmc_command cmd;
+ struct mmc_card *card = host->card;
+ int err;
+
+ if (sleep)
+ mmc_deselect_cards(host);
+
+ memset(&cmd, 0, sizeof(struct mmc_command));
+
+ cmd.opcode = MMC_SLEEP_AWAKE;
+ cmd.arg = card->rca << 16;
+ if (sleep)
+ cmd.arg |= 1 << 15;
+
+ cmd.flags = MMC_RSP_R1B | MMC_CMD_AC;
+ err = mmc_wait_for_cmd(host, &cmd, 0);
+ if (err)
+ return err;
+
+ /*
+ * If the host does not wait while the card signals busy, then we will
+ * will have to wait the sleep/awake timeout. Note, we cannot use the
+ * SEND_STATUS command to poll the status because that command (and most
+ * others) is invalid while the card sleeps.
+ */
+ if (!(host->caps & MMC_CAP_WAIT_WHILE_BUSY))
+ mmc_delay(DIV_ROUND_UP(card->ext_csd.sa_timeout, 10000));
+
+ if (!sleep)
+ err = mmc_select_card(card);
+
+ return err;
+}
+
int mmc_go_idle(struct mmc_host *host)
{
int err;
@@ -354,6 +390,7 @@
{
int err;
struct mmc_command cmd;
+ u32 status;
BUG_ON(!card);
BUG_ON(!card->host);
@@ -371,6 +408,28 @@
if (err)
return err;
+ /* Must check status to be sure of no errors */
+ do {
+ err = mmc_send_status(card, &status);
+ if (err)
+ return err;
+ if (card->host->caps & MMC_CAP_WAIT_WHILE_BUSY)
+ break;
+ if (mmc_host_is_spi(card->host))
+ break;
+ } while (R1_CURRENT_STATE(status) == 7);
+
+ if (mmc_host_is_spi(card->host)) {
+ if (status & R1_SPI_ILLEGAL_COMMAND)
+ return -EBADMSG;
+ } else {
+ if (status & 0xFDFFA000)
+ printk(KERN_WARNING "%s: unexpected status %#x after "
+ "switch", mmc_hostname(card->host), status);
+ if (status & R1_SWITCH_ERROR)
+ return -EBADMSG;
+ }
+
return 0;
}
diff --git a/drivers/mmc/core/mmc_ops.h b/drivers/mmc/core/mmc_ops.h
index 17854bf..653eb8e 100644
--- a/drivers/mmc/core/mmc_ops.h
+++ b/drivers/mmc/core/mmc_ops.h
@@ -25,6 +25,7 @@
int mmc_send_cid(struct mmc_host *host, u32 *cid);
int mmc_spi_read_ocr(struct mmc_host *host, int highcap, u32 *ocrp);
int mmc_spi_set_crc(struct mmc_host *host, int use_crc);
+int mmc_card_sleepawake(struct mmc_host *host, int sleep);
#endif
diff --git a/drivers/mmc/core/sd.c b/drivers/mmc/core/sd.c
index 7ad646f..10b2a4d 100644
--- a/drivers/mmc/core/sd.c
+++ b/drivers/mmc/core/sd.c
@@ -210,11 +210,11 @@
err = mmc_sd_switch(card, 0, 0, 1, status);
if (err) {
- /*
- * We all hosts that cannot perform the command
- * to fail more gracefully
- */
- if (err != -EINVAL)
+ /* If the host or the card can't do the switch,
+ * fail more gracefully. */
+ if ((err != -EINVAL)
+ && (err != -ENOSYS)
+ && (err != -EFAULT))
goto out;
printk(KERN_WARNING "%s: problem reading switch "
@@ -561,12 +561,10 @@
}
}
-#ifdef CONFIG_MMC_UNSAFE_RESUME
-
/*
* Suspend callback from host.
*/
-static void mmc_sd_suspend(struct mmc_host *host)
+static int mmc_sd_suspend(struct mmc_host *host)
{
BUG_ON(!host);
BUG_ON(!host->card);
@@ -576,6 +574,8 @@
mmc_deselect_cards(host);
host->card->state &= ~MMC_STATE_HIGHSPEED;
mmc_release_host(host);
+
+ return 0;
}
/*
@@ -584,7 +584,7 @@
* This function tries to determine if the same card is still present
* and, if so, restore all state to it.
*/
-static void mmc_sd_resume(struct mmc_host *host)
+static int mmc_sd_resume(struct mmc_host *host)
{
int err;
@@ -595,30 +595,63 @@
err = mmc_sd_init_card(host, host->ocr, host->card);
mmc_release_host(host);
- if (err) {
- mmc_sd_remove(host);
-
- mmc_claim_host(host);
- mmc_detach_bus(host);
- mmc_release_host(host);
- }
-
+ return err;
}
-#else
+static void mmc_sd_power_restore(struct mmc_host *host)
+{
+ host->card->state &= ~MMC_STATE_HIGHSPEED;
+ mmc_claim_host(host);
+ mmc_sd_init_card(host, host->ocr, host->card);
+ mmc_release_host(host);
+}
-#define mmc_sd_suspend NULL
-#define mmc_sd_resume NULL
-
-#endif
+#ifdef CONFIG_MMC_UNSAFE_RESUME
static const struct mmc_bus_ops mmc_sd_ops = {
.remove = mmc_sd_remove,
.detect = mmc_sd_detect,
.suspend = mmc_sd_suspend,
.resume = mmc_sd_resume,
+ .power_restore = mmc_sd_power_restore,
};
+static void mmc_sd_attach_bus_ops(struct mmc_host *host)
+{
+ mmc_attach_bus(host, &mmc_sd_ops);
+}
+
+#else
+
+static const struct mmc_bus_ops mmc_sd_ops = {
+ .remove = mmc_sd_remove,
+ .detect = mmc_sd_detect,
+ .suspend = NULL,
+ .resume = NULL,
+ .power_restore = mmc_sd_power_restore,
+};
+
+static const struct mmc_bus_ops mmc_sd_ops_unsafe = {
+ .remove = mmc_sd_remove,
+ .detect = mmc_sd_detect,
+ .suspend = mmc_sd_suspend,
+ .resume = mmc_sd_resume,
+ .power_restore = mmc_sd_power_restore,
+};
+
+static void mmc_sd_attach_bus_ops(struct mmc_host *host)
+{
+ const struct mmc_bus_ops *bus_ops;
+
+ if (host->caps & MMC_CAP_NONREMOVABLE)
+ bus_ops = &mmc_sd_ops_unsafe;
+ else
+ bus_ops = &mmc_sd_ops;
+ mmc_attach_bus(host, bus_ops);
+}
+
+#endif
+
/*
* Starting point for SD card init.
*/
@@ -629,7 +662,7 @@
BUG_ON(!host);
WARN_ON(!host->claimed);
- mmc_attach_bus(host, &mmc_sd_ops);
+ mmc_sd_attach_bus_ops(host);
/*
* We need to get OCR a different way for SPI.
diff --git a/drivers/mmc/core/sdio.c b/drivers/mmc/core/sdio.c
index fb99ccf..cdb845b 100644
--- a/drivers/mmc/core/sdio.c
+++ b/drivers/mmc/core/sdio.c
@@ -165,6 +165,29 @@
}
/*
+ * If desired, disconnect the pull-up resistor on CD/DAT[3] (pin 1)
+ * of the card. This may be required on certain setups of boards,
+ * controllers and embedded sdio device which do not need the card's
+ * pull-up. As a result, card detection is disabled and power is saved.
+ */
+static int sdio_disable_cd(struct mmc_card *card)
+{
+ int ret;
+ u8 ctrl;
+
+ if (!card->cccr.disable_cd)
+ return 0;
+
+ ret = mmc_io_rw_direct(card, 0, 0, SDIO_CCCR_IF, 0, &ctrl);
+ if (ret)
+ return ret;
+
+ ctrl |= SDIO_BUS_CD_DISABLE;
+
+ return mmc_io_rw_direct(card, 1, 0, SDIO_CCCR_IF, ctrl, NULL);
+}
+
+/*
* Test if the card supports high-speed mode and, if so, switch to it.
*/
static int sdio_enable_hs(struct mmc_card *card)
@@ -195,6 +218,135 @@
}
/*
+ * Handle the detection and initialisation of a card.
+ *
+ * In the case of a resume, "oldcard" will contain the card
+ * we're trying to reinitialise.
+ */
+static int mmc_sdio_init_card(struct mmc_host *host, u32 ocr,
+ struct mmc_card *oldcard)
+{
+ struct mmc_card *card;
+ int err;
+
+ BUG_ON(!host);
+ WARN_ON(!host->claimed);
+
+ /*
+ * Inform the card of the voltage
+ */
+ err = mmc_send_io_op_cond(host, host->ocr, &ocr);
+ if (err)
+ goto err;
+
+ /*
+ * For SPI, enable CRC as appropriate.
+ */
+ if (mmc_host_is_spi(host)) {
+ err = mmc_spi_set_crc(host, use_spi_crc);
+ if (err)
+ goto err;
+ }
+
+ /*
+ * Allocate card structure.
+ */
+ card = mmc_alloc_card(host, NULL);
+ if (IS_ERR(card)) {
+ err = PTR_ERR(card);
+ goto err;
+ }
+
+ card->type = MMC_TYPE_SDIO;
+
+ /*
+ * For native busses: set card RCA and quit open drain mode.
+ */
+ if (!mmc_host_is_spi(host)) {
+ err = mmc_send_relative_addr(host, &card->rca);
+ if (err)
+ goto remove;
+
+ mmc_set_bus_mode(host, MMC_BUSMODE_PUSHPULL);
+ }
+
+ /*
+ * Select card, as all following commands rely on that.
+ */
+ if (!mmc_host_is_spi(host)) {
+ err = mmc_select_card(card);
+ if (err)
+ goto remove;
+ }
+
+ /*
+ * Read the common registers.
+ */
+ err = sdio_read_cccr(card);
+ if (err)
+ goto remove;
+
+ /*
+ * Read the common CIS tuples.
+ */
+ err = sdio_read_common_cis(card);
+ if (err)
+ goto remove;
+
+ if (oldcard) {
+ int same = (card->cis.vendor == oldcard->cis.vendor &&
+ card->cis.device == oldcard->cis.device);
+ mmc_remove_card(card);
+ if (!same) {
+ err = -ENOENT;
+ goto err;
+ }
+ card = oldcard;
+ return 0;
+ }
+
+ /*
+ * Switch to high-speed (if supported).
+ */
+ err = sdio_enable_hs(card);
+ if (err)
+ goto remove;
+
+ /*
+ * Change to the card's maximum speed.
+ */
+ if (mmc_card_highspeed(card)) {
+ /*
+ * The SDIO specification doesn't mention how
+ * the CIS transfer speed register relates to
+ * high-speed, but it seems that 50 MHz is
+ * mandatory.
+ */
+ mmc_set_clock(host, 50000000);
+ } else {
+ mmc_set_clock(host, card->cis.max_dtr);
+ }
+
+ /*
+ * Switch to wider bus (if supported).
+ */
+ err = sdio_enable_wide(card);
+ if (err)
+ goto remove;
+
+ if (!oldcard)
+ host->card = card;
+ return 0;
+
+remove:
+ if (!oldcard)
+ mmc_remove_card(card);
+
+err:
+ return err;
+}
+
+/*
* Host is being removed. Free up the current card.
*/
static void mmc_sdio_remove(struct mmc_host *host)
@@ -243,10 +395,77 @@
}
}
+/*
+ * SDIO suspend. We need to suspend all functions separately.
+ * Therefore all registered functions must have drivers with suspend
+ * and resume methods. Failing that we simply remove the whole card.
+ */
+static int mmc_sdio_suspend(struct mmc_host *host)
+{
+ int i, err = 0;
+
+ for (i = 0; i < host->card->sdio_funcs; i++) {
+ struct sdio_func *func = host->card->sdio_func[i];
+ if (func && sdio_func_present(func) && func->dev.driver) {
+ const struct dev_pm_ops *pmops = func->dev.driver->pm;
+ if (!pmops || !pmops->suspend || !pmops->resume) {
+ /* force removal of entire card in that case */
+ err = -ENOSYS;
+ } else
+ err = pmops->suspend(&func->dev);
+ if (err)
+ break;
+ }
+ }
+ while (err && --i >= 0) {
+ struct sdio_func *func = host->card->sdio_func[i];
+ if (func && sdio_func_present(func) && func->dev.driver) {
+ const struct dev_pm_ops *pmops = func->dev.driver->pm;
+ pmops->resume(&func->dev);
+ }
+ }
+
+ return err;
+}
+
+static int mmc_sdio_resume(struct mmc_host *host)
+{
+ int i, err;
+
+ BUG_ON(!host);
+ BUG_ON(!host->card);
+
+ /* Basic card reinitialization. */
+ mmc_claim_host(host);
+ err = mmc_sdio_init_card(host, host->ocr, host->card);
+ mmc_release_host(host);
+
+ /*
+ * If the card looked to be the same as before suspending, then
+ * we proceed to resume all card functions. If one of them returns
+ * an error then we simply return that error to the core and the
+ * card will be redetected as new. It is the responsibility of
+ * the function driver to perform further tests with the extra
+ * knowledge it has of the card to confirm the card is indeed the
+ * same as before suspending (same MAC address for network cards,
+ * etc.) and return an error otherwise.
+ */
+ for (i = 0; !err && i < host->card->sdio_funcs; i++) {
+ struct sdio_func *func = host->card->sdio_func[i];
+ if (func && sdio_func_present(func) && func->dev.driver) {
+ const struct dev_pm_ops *pmops = func->dev.driver->pm;
+ err = pmops->resume(&func->dev);
+ }
+ }
+
+ return err;
+}
static const struct mmc_bus_ops mmc_sdio_ops = {
.remove = mmc_sdio_remove,
.detect = mmc_sdio_detect,
+ .suspend = mmc_sdio_suspend,
+ .resume = mmc_sdio_resume,
};
@@ -275,13 +494,6 @@
ocr &= ~0x7F;
}
- if (ocr & MMC_VDD_165_195) {
- printk(KERN_WARNING "%s: SDIO card claims to support the "
- "incompletely defined 'low voltage range'. This "
- "will be ignored.\n", mmc_hostname(host));
- ocr &= ~MMC_VDD_165_195;
- }
-
host->ocr = mmc_select_voltage(host, ocr);
/*
@@ -293,101 +505,23 @@
}
/*
- * Inform the card of the voltage
+ * Detect and init the card.
*/
- err = mmc_send_io_op_cond(host, host->ocr, &ocr);
+ err = mmc_sdio_init_card(host, host->ocr, NULL);
if (err)
goto err;
-
- /*
- * For SPI, enable CRC as appropriate.
- */
- if (mmc_host_is_spi(host)) {
- err = mmc_spi_set_crc(host, use_spi_crc);
- if (err)
- goto err;
- }
+ card = host->card;
/*
* The number of functions on the card is encoded inside
* the ocr.
*/
- funcs = (ocr & 0x70000000) >> 28;
+ card->sdio_funcs = funcs = (ocr & 0x70000000) >> 28;
/*
- * Allocate card structure.
+ * If needed, disconnect card detection pull-up resistor.
*/
- card = mmc_alloc_card(host, NULL);
- if (IS_ERR(card)) {
- err = PTR_ERR(card);
- goto err;
- }
-
- card->type = MMC_TYPE_SDIO;
- card->sdio_funcs = funcs;
-
- host->card = card;
-
- /*
- * For native busses: set card RCA and quit open drain mode.
- */
- if (!mmc_host_is_spi(host)) {
- err = mmc_send_relative_addr(host, &card->rca);
- if (err)
- goto remove;
-
- mmc_set_bus_mode(host, MMC_BUSMODE_PUSHPULL);
- }
-
- /*
- * Select card, as all following commands rely on that.
- */
- if (!mmc_host_is_spi(host)) {
- err = mmc_select_card(card);
- if (err)
- goto remove;
- }
-
- /*
- * Read the common registers.
- */
- err = sdio_read_cccr(card);
- if (err)
- goto remove;
-
- /*
- * Read the common CIS tuples.
- */
- err = sdio_read_common_cis(card);
- if (err)
- goto remove;
-
- /*
- * Switch to high-speed (if supported).
- */
- err = sdio_enable_hs(card);
- if (err)
- goto remove;
-
- /*
- * Change to the card's maximum speed.
- */
- if (mmc_card_highspeed(card)) {
- /*
- * The SDIO specification doesn't mention how
- * the CIS transfer speed register relates to
- * high-speed, but it seems that 50 MHz is
- * mandatory.
- */
- mmc_set_clock(host, 50000000);
- } else {
- mmc_set_clock(host, card->cis.max_dtr);
- }
-
- /*
- * Switch to wider bus (if supported).
- */
- err = sdio_enable_wide(card);
+ err = sdio_disable_cd(card);
if (err)
goto remove;
diff --git a/drivers/mmc/core/sdio_bus.c b/drivers/mmc/core/sdio_bus.c
index 46284b5..d37464e 100644
--- a/drivers/mmc/core/sdio_bus.c
+++ b/drivers/mmc/core/sdio_bus.c
@@ -20,9 +20,6 @@
#include "sdio_cis.h"
#include "sdio_bus.h"
-#define dev_to_sdio_func(d) container_of(d, struct sdio_func, dev)
-#define to_sdio_driver(d) container_of(d, struct sdio_driver, drv)
-
/* show configuration fields */
#define sdio_config_attr(field, format_string) \
static ssize_t \
diff --git a/drivers/mmc/core/sdio_cis.c b/drivers/mmc/core/sdio_cis.c
index 963f293..6636354 100644
--- a/drivers/mmc/core/sdio_cis.c
+++ b/drivers/mmc/core/sdio_cis.c
@@ -40,7 +40,7 @@
nr_strings++;
}
- if (buf[i-1] != '\0') {
+ if (nr_strings < 4) {
printk(KERN_WARNING "SDIO: ignoring broken CISTPL_VERS_1\n");
return 0;
}
diff --git a/drivers/mmc/core/sdio_io.c b/drivers/mmc/core/sdio_io.c
index f61fc2d..f9aa8a7 100644
--- a/drivers/mmc/core/sdio_io.c
+++ b/drivers/mmc/core/sdio_io.c
@@ -624,7 +624,7 @@
BUG_ON(!func);
- if (addr < 0xF0 || addr > 0xFF) {
+ if ((addr < 0xF0 || addr > 0xFF) && (!mmc_card_lenient_fn0(func->card))) {
if (err_ret)
*err_ret = -EINVAL;
return;
diff --git a/drivers/mmc/host/Kconfig b/drivers/mmc/host/Kconfig
index 891ef18..7cb057f 100644
--- a/drivers/mmc/host/Kconfig
+++ b/drivers/mmc/host/Kconfig
@@ -132,11 +132,11 @@
config MMC_OMAP_HS
tristate "TI OMAP High Speed Multimedia Card Interface support"
- depends on ARCH_OMAP2430 || ARCH_OMAP3
+ depends on ARCH_OMAP2430 || ARCH_OMAP3 || ARCH_OMAP4
help
This selects the TI OMAP High Speed Multimedia card Interface.
- If you have an OMAP2430 or OMAP3 board with a Multimedia Card slot,
- say Y or M here.
+ If you have an OMAP2430 or OMAP3 board or OMAP4 board with a
+ Multimedia Card slot, say Y or M here.
If unsure, say N.
@@ -160,6 +160,12 @@
If unsure, say N.
+choice
+ prompt "Atmel SD/MMC Driver"
+ default MMC_ATMELMCI if AVR32
+ help
+ Choose which driver to use for the Atmel MCI Silicon
+
config MMC_AT91
tristate "AT91 SD/MMC Card Interface support"
depends on ARCH_AT91
@@ -170,17 +176,19 @@
config MMC_ATMELMCI
tristate "Atmel Multimedia Card Interface support"
- depends on AVR32
+ depends on AVR32 || ARCH_AT91
help
This selects the Atmel Multimedia Card Interface driver. If
- you have an AT32 (AVR32) platform with a Multimedia Card
- slot, say Y or M here.
+ you have an AT32 (AVR32) or AT91 platform with a Multimedia
+ Card slot, say Y or M here.
If unsure, say N.
+endchoice
+
config MMC_ATMELMCI_DMA
bool "Atmel MCI DMA support (EXPERIMENTAL)"
- depends on MMC_ATMELMCI && DMA_ENGINE && EXPERIMENTAL
+ depends on MMC_ATMELMCI && AVR32 && DMA_ENGINE && EXPERIMENTAL
help
Say Y here to have the Atmel MCI driver use a DMA engine to
do data transfers and thus increase the throughput and
@@ -199,6 +207,13 @@
If unsure, say N.
+config MMC_MSM7X00A
+ tristate "Qualcomm MSM 7X00A SDCC Controller Support"
+ depends on MMC && ARCH_MSM
+ help
+ This provides support for the SD/MMC cell found in the
+ MSM 7X00A controllers from Qualcomm.
+
config MMC_MXC
tristate "Freescale i.MX2/3 Multimedia Card Interface support"
depends on ARCH_MXC
diff --git a/drivers/mmc/host/Makefile b/drivers/mmc/host/Makefile
index cf153f6..abcb040 100644
--- a/drivers/mmc/host/Makefile
+++ b/drivers/mmc/host/Makefile
@@ -23,6 +23,7 @@
obj-$(CONFIG_MMC_AT91) += at91_mci.o
obj-$(CONFIG_MMC_ATMELMCI) += atmel-mci.o
obj-$(CONFIG_MMC_TIFM_SD) += tifm_sd.o
+obj-$(CONFIG_MMC_MSM7X00A) += msm_sdcc.o
obj-$(CONFIG_MMC_MVSDIO) += mvsdio.o
obj-$(CONFIG_MMC_SPI) += mmc_spi.o
ifeq ($(CONFIG_OF),y)
diff --git a/drivers/mmc/host/atmel-mci.c b/drivers/mmc/host/atmel-mci.c
index 7b603e4..065fa81 100644
--- a/drivers/mmc/host/atmel-mci.c
+++ b/drivers/mmc/host/atmel-mci.c
@@ -30,6 +30,7 @@
#include <asm/io.h>
#include <asm/unaligned.h>
+#include <mach/cpu.h>
#include <mach/board.h>
#include "atmel-mci-regs.h"
@@ -210,6 +211,18 @@
set_bit(event, &host->pending_events)
/*
+ * Enable or disable features/registers based on
+ * whether the processor supports them
+ */
+static bool mci_has_rwproof(void)
+{
+ if (cpu_is_at91sam9261() || cpu_is_at91rm9200())
+ return false;
+ else
+ return true;
+}
+
+/*
* The debugfs stuff below is mostly optimized away when
* CONFIG_DEBUG_FS is not set.
*/
@@ -276,8 +289,13 @@
[3] = "BLKE",
[4] = "DTIP",
[5] = "NOTBUSY",
+ [6] = "ENDRX",
+ [7] = "ENDTX",
[8] = "SDIOIRQA",
[9] = "SDIOIRQB",
+ [12] = "SDIOWAIT",
+ [14] = "RXBUFF",
+ [15] = "TXBUFE",
[16] = "RINDE",
[17] = "RDIRE",
[18] = "RCRCE",
@@ -285,6 +303,11 @@
[20] = "RTOE",
[21] = "DCRCE",
[22] = "DTOE",
+ [23] = "CSTOE",
+ [24] = "BLKOVRE",
+ [25] = "DMADONE",
+ [26] = "FIFOEMPTY",
+ [27] = "XFRDONE",
[30] = "OVRE",
[31] = "UNRE",
};
@@ -849,13 +872,15 @@
clkdiv = 255;
}
+ host->mode_reg = MCI_MR_CLKDIV(clkdiv);
+
/*
* WRPROOF and RDPROOF prevent overruns/underruns by
* stopping the clock when the FIFO is full/empty.
* This state is not expected to last for long.
*/
- host->mode_reg = MCI_MR_CLKDIV(clkdiv) | MCI_MR_WRPROOF
- | MCI_MR_RDPROOF;
+ if (mci_has_rwproof())
+ host->mode_reg |= (MCI_MR_WRPROOF | MCI_MR_RDPROOF);
if (list_empty(&host->queue))
mci_writel(host, MR, host->mode_reg);
@@ -1648,8 +1673,10 @@
nr_slots++;
}
- if (!nr_slots)
+ if (!nr_slots) {
+ dev_err(&pdev->dev, "init failed: no slot defined\n");
goto err_init_slot;
+ }
dev_info(&pdev->dev,
"Atmel MCI controller at 0x%08lx irq %d, %u slots\n",
diff --git a/drivers/mmc/host/mmc_spi.c b/drivers/mmc/host/mmc_spi.c
index a461017..d55fe4f 100644
--- a/drivers/mmc/host/mmc_spi.c
+++ b/drivers/mmc/host/mmc_spi.c
@@ -1562,3 +1562,4 @@
"Hans-Peter Nilsson, Jan Nikitenko");
MODULE_DESCRIPTION("SPI SD/MMC host driver");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:mmc_spi");
diff --git a/drivers/mmc/host/msm_sdcc.c b/drivers/mmc/host/msm_sdcc.c
new file mode 100644
index 0000000..dba4600
--- /dev/null
+++ b/drivers/mmc/host/msm_sdcc.c
@@ -0,0 +1,1287 @@
+/*
+ * linux/drivers/mmc/host/msm_sdcc.c - Qualcomm MSM 7X00A SDCC Driver
+ *
+ * Copyright (C) 2007 Google Inc,
+ * Copyright (C) 2003 Deep Blue Solutions, Ltd, All Rights Reserved.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * Based on mmci.c
+ *
+ * Author: San Mehat (san@android.com)
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/moduleparam.h>
+#include <linux/init.h>
+#include <linux/ioport.h>
+#include <linux/device.h>
+#include <linux/interrupt.h>
+#include <linux/delay.h>
+#include <linux/err.h>
+#include <linux/highmem.h>
+#include <linux/log2.h>
+#include <linux/mmc/host.h>
+#include <linux/mmc/card.h>
+#include <linux/clk.h>
+#include <linux/scatterlist.h>
+#include <linux/platform_device.h>
+#include <linux/dma-mapping.h>
+#include <linux/debugfs.h>
+#include <linux/io.h>
+#include <linux/memory.h>
+
+#include <asm/cacheflush.h>
+#include <asm/div64.h>
+#include <asm/sizes.h>
+
+#include <asm/mach/mmc.h>
+#include <mach/msm_iomap.h>
+#include <mach/dma.h>
+#include <mach/htc_pwrsink.h>
+
+#include "msm_sdcc.h"
+
+#define DRIVER_NAME "msm-sdcc"
+
+static unsigned int msmsdcc_fmin = 144000;
+static unsigned int msmsdcc_fmax = 50000000;
+static unsigned int msmsdcc_4bit = 1;
+static unsigned int msmsdcc_pwrsave = 1;
+static unsigned int msmsdcc_piopoll = 1;
+static unsigned int msmsdcc_sdioirq;
+
+#define PIO_SPINMAX 30
+#define CMD_SPINMAX 20
+
+static void
+msmsdcc_start_command(struct msmsdcc_host *host, struct mmc_command *cmd,
+ u32 c);
+
+static void
+msmsdcc_request_end(struct msmsdcc_host *host, struct mmc_request *mrq)
+{
+ writel(0, host->base + MMCICOMMAND);
+
+ BUG_ON(host->curr.data);
+
+ host->curr.mrq = NULL;
+ host->curr.cmd = NULL;
+
+ if (mrq->data)
+ mrq->data->bytes_xfered = host->curr.data_xfered;
+ if (mrq->cmd->error == -ETIMEDOUT)
+ mdelay(5);
+
+ /*
+ * Need to drop the host lock here; mmc_request_done may call
+ * back into the driver...
+ */
+ spin_unlock(&host->lock);
+ mmc_request_done(host->mmc, mrq);
+ spin_lock(&host->lock);
+}
+
+static void
+msmsdcc_stop_data(struct msmsdcc_host *host)
+{
+ writel(0, host->base + MMCIDATACTRL);
+ host->curr.data = NULL;
+ host->curr.got_dataend = host->curr.got_datablkend = 0;
+}
+
+uint32_t msmsdcc_fifo_addr(struct msmsdcc_host *host)
+{
+ switch (host->pdev_id) {
+ case 1:
+ return MSM_SDC1_PHYS + MMCIFIFO;
+ case 2:
+ return MSM_SDC2_PHYS + MMCIFIFO;
+ case 3:
+ return MSM_SDC3_PHYS + MMCIFIFO;
+ case 4:
+ return MSM_SDC4_PHYS + MMCIFIFO;
+ }
+ BUG();
+ return 0;
+}
+
+static void
+msmsdcc_dma_complete_func(struct msm_dmov_cmd *cmd,
+ unsigned int result,
+ struct msm_dmov_errdata *err)
+{
+ struct msmsdcc_dma_data *dma_data =
+ container_of(cmd, struct msmsdcc_dma_data, hdr);
+ struct msmsdcc_host *host = dma_data->host;
+ unsigned long flags;
+ struct mmc_request *mrq;
+
+ spin_lock_irqsave(&host->lock, flags);
+ mrq = host->curr.mrq;
+ BUG_ON(!mrq);
+
+ if (!(result & DMOV_RSLT_VALID)) {
+ pr_err("msmsdcc: Invalid DataMover result\n");
+ goto out;
+ }
+
+ if (result & DMOV_RSLT_DONE) {
+ host->curr.data_xfered = host->curr.xfer_size;
+ } else {
+ /* Error or flush */
+ if (result & DMOV_RSLT_ERROR)
+ pr_err("%s: DMA error (0x%.8x)\n",
+ mmc_hostname(host->mmc), result);
+ if (result & DMOV_RSLT_FLUSH)
+ pr_err("%s: DMA channel flushed (0x%.8x)\n",
+ mmc_hostname(host->mmc), result);
+ if (err)
+ pr_err("Flush data: %.8x %.8x %.8x %.8x %.8x %.8x\n",
+ err->flush[0], err->flush[1], err->flush[2],
+ err->flush[3], err->flush[4], err->flush[5]);
+ if (!mrq->data->error)
+ mrq->data->error = -EIO;
+ }
+ host->dma.busy = 0;
+ dma_unmap_sg(mmc_dev(host->mmc), host->dma.sg, host->dma.num_ents,
+ host->dma.dir);
+
+ if (host->curr.user_pages) {
+ struct scatterlist *sg = host->dma.sg;
+ int i;
+
+ for (i = 0; i < host->dma.num_ents; i++)
+ flush_dcache_page(sg_page(sg++));
+ }
+
+ host->dma.sg = NULL;
+
+ if ((host->curr.got_dataend && host->curr.got_datablkend)
+ || mrq->data->error) {
+
+ /*
+ * If we've already gotten our DATAEND / DATABLKEND
+ * for this request, then complete it through here.
+ */
+ msmsdcc_stop_data(host);
+
+ if (!mrq->data->error)
+ host->curr.data_xfered = host->curr.xfer_size;
+ if (!mrq->data->stop || mrq->cmd->error) {
+ writel(0, host->base + MMCICOMMAND);
+ host->curr.mrq = NULL;
+ host->curr.cmd = NULL;
+ mrq->data->bytes_xfered = host->curr.data_xfered;
+
+ spin_unlock_irqrestore(&host->lock, flags);
+ mmc_request_done(host->mmc, mrq);
+ return;
+ } else
+ msmsdcc_start_command(host, mrq->data->stop, 0);
+ }
+
+out:
+ spin_unlock_irqrestore(&host->lock, flags);
+ return;
+}
+
+static int validate_dma(struct msmsdcc_host *host, struct mmc_data *data)
+{
+ if (host->dma.channel == -1)
+ return -ENOENT;
+
+ if ((data->blksz * data->blocks) < MCI_FIFOSIZE)
+ return -EINVAL;
+ if ((data->blksz * data->blocks) % MCI_FIFOSIZE)
+ return -EINVAL;
+ return 0;
+}
+
+static int msmsdcc_config_dma(struct msmsdcc_host *host, struct mmc_data *data)
+{
+ struct msmsdcc_nc_dmadata *nc;
+ dmov_box *box;
+ uint32_t rows;
+ uint32_t crci;
+ unsigned int n;
+ int i, rc;
+ struct scatterlist *sg = data->sg;
+
+ rc = validate_dma(host, data);
+ if (rc)
+ return rc;
+
+ host->dma.sg = data->sg;
+ host->dma.num_ents = data->sg_len;
+
+ nc = host->dma.nc;
+
+ switch (host->pdev_id) {
+ case 1:
+ crci = MSMSDCC_CRCI_SDC1;
+ break;
+ case 2:
+ crci = MSMSDCC_CRCI_SDC2;
+ break;
+ case 3:
+ crci = MSMSDCC_CRCI_SDC3;
+ break;
+ case 4:
+ crci = MSMSDCC_CRCI_SDC4;
+ break;
+ default:
+ host->dma.sg = NULL;
+ host->dma.num_ents = 0;
+ return -ENOENT;
+ }
+
+ if (data->flags & MMC_DATA_READ)
+ host->dma.dir = DMA_FROM_DEVICE;
+ else
+ host->dma.dir = DMA_TO_DEVICE;
+
+ host->curr.user_pages = 0;
+
+ n = dma_map_sg(mmc_dev(host->mmc), host->dma.sg,
+ host->dma.num_ents, host->dma.dir);
+
+ if (n != host->dma.num_ents) {
+ pr_err("%s: Unable to map in all sg elements\n",
+ mmc_hostname(host->mmc));
+ host->dma.sg = NULL;
+ host->dma.num_ents = 0;
+ return -ENOMEM;
+ }
+
+ box = &nc->cmd[0];
+ for (i = 0; i < host->dma.num_ents; i++) {
+ box->cmd = CMD_MODE_BOX;
+
+ if (i == (host->dma.num_ents - 1))
+ box->cmd |= CMD_LC;
+ rows = (sg_dma_len(sg) % MCI_FIFOSIZE) ?
+ (sg_dma_len(sg) / MCI_FIFOSIZE) + 1 :
+ (sg_dma_len(sg) / MCI_FIFOSIZE) ;
+
+ if (data->flags & MMC_DATA_READ) {
+ box->src_row_addr = msmsdcc_fifo_addr(host);
+ box->dst_row_addr = sg_dma_address(sg);
+
+ box->src_dst_len = (MCI_FIFOSIZE << 16) |
+ (MCI_FIFOSIZE);
+ box->row_offset = MCI_FIFOSIZE;
+
+ box->num_rows = rows * ((1 << 16) + 1);
+ box->cmd |= CMD_SRC_CRCI(crci);
+ } else {
+ box->src_row_addr = sg_dma_address(sg);
+ box->dst_row_addr = msmsdcc_fifo_addr(host);
+
+ box->src_dst_len = (MCI_FIFOSIZE << 16) |
+ (MCI_FIFOSIZE);
+ box->row_offset = (MCI_FIFOSIZE << 16);
+
+ box->num_rows = rows * ((1 << 16) + 1);
+ box->cmd |= CMD_DST_CRCI(crci);
+ }
+ box++;
+ sg++;
+ }
+
+ /* location of command block must be 64 bit aligned */
+ BUG_ON(host->dma.cmd_busaddr & 0x07);
+
+ nc->cmdptr = (host->dma.cmd_busaddr >> 3) | CMD_PTR_LP;
+ host->dma.hdr.cmdptr = DMOV_CMD_PTR_LIST |
+ DMOV_CMD_ADDR(host->dma.cmdptr_busaddr);
+ host->dma.hdr.complete_func = msmsdcc_dma_complete_func;
+
+ return 0;
+}
+
+static void
+msmsdcc_start_data(struct msmsdcc_host *host, struct mmc_data *data)
+{
+ unsigned int datactrl, timeout;
+ unsigned long long clks;
+ void __iomem *base = host->base;
+ unsigned int pio_irqmask = 0;
+
+ host->curr.data = data;
+ host->curr.xfer_size = data->blksz * data->blocks;
+ host->curr.xfer_remain = host->curr.xfer_size;
+ host->curr.data_xfered = 0;
+ host->curr.got_dataend = 0;
+ host->curr.got_datablkend = 0;
+
+ memset(&host->pio, 0, sizeof(host->pio));
+
+ clks = (unsigned long long)data->timeout_ns * host->clk_rate;
+ do_div(clks, NSEC_PER_SEC);
+ timeout = data->timeout_clks + (unsigned int)clks;
+ writel(timeout, base + MMCIDATATIMER);
+
+ writel(host->curr.xfer_size, base + MMCIDATALENGTH);
+
+ datactrl = MCI_DPSM_ENABLE | (data->blksz << 4);
+
+ if (!msmsdcc_config_dma(host, data))
+ datactrl |= MCI_DPSM_DMAENABLE;
+ else {
+ host->pio.sg = data->sg;
+ host->pio.sg_len = data->sg_len;
+ host->pio.sg_off = 0;
+
+ if (data->flags & MMC_DATA_READ) {
+ pio_irqmask = MCI_RXFIFOHALFFULLMASK;
+ if (host->curr.xfer_remain < MCI_FIFOSIZE)
+ pio_irqmask |= MCI_RXDATAAVLBLMASK;
+ } else
+ pio_irqmask = MCI_TXFIFOHALFEMPTYMASK;
+ }
+
+ if (data->flags & MMC_DATA_READ)
+ datactrl |= MCI_DPSM_DIRECTION;
+
+ writel(pio_irqmask, base + MMCIMASK1);
+ writel(datactrl, base + MMCIDATACTRL);
+
+ if (datactrl & MCI_DPSM_DMAENABLE) {
+ host->dma.busy = 1;
+ msm_dmov_enqueue_cmd(host->dma.channel, &host->dma.hdr);
+ }
+}
+
+static void
+msmsdcc_start_command(struct msmsdcc_host *host, struct mmc_command *cmd, u32 c)
+{
+ void __iomem *base = host->base;
+
+ if (readl(base + MMCICOMMAND) & MCI_CPSM_ENABLE) {
+ writel(0, base + MMCICOMMAND);
+ udelay(2 + ((5 * 1000000) / host->clk_rate));
+ }
+
+ c |= cmd->opcode | MCI_CPSM_ENABLE;
+
+ if (cmd->flags & MMC_RSP_PRESENT) {
+ if (cmd->flags & MMC_RSP_136)
+ c |= MCI_CPSM_LONGRSP;
+ c |= MCI_CPSM_RESPONSE;
+ }
+
+ if (cmd->opcode == 17 || cmd->opcode == 18 ||
+ cmd->opcode == 24 || cmd->opcode == 25 ||
+ cmd->opcode == 53)
+ c |= MCI_CSPM_DATCMD;
+
+ if (cmd == cmd->mrq->stop)
+ c |= MCI_CSPM_MCIABORT;
+
+ host->curr.cmd = cmd;
+
+ host->stats.cmds++;
+
+ writel(cmd->arg, base + MMCIARGUMENT);
+ writel(c, base + MMCICOMMAND);
+}
+
+static void
+msmsdcc_data_err(struct msmsdcc_host *host, struct mmc_data *data,
+ unsigned int status)
+{
+ if (status & MCI_DATACRCFAIL) {
+ pr_err("%s: Data CRC error\n", mmc_hostname(host->mmc));
+ pr_err("%s: opcode 0x%.8x\n", __func__,
+ data->mrq->cmd->opcode);
+ pr_err("%s: blksz %d, blocks %d\n", __func__,
+ data->blksz, data->blocks);
+ data->error = -EILSEQ;
+ } else if (status & MCI_DATATIMEOUT) {
+ pr_err("%s: Data timeout\n", mmc_hostname(host->mmc));
+ data->error = -ETIMEDOUT;
+ } else if (status & MCI_RXOVERRUN) {
+ pr_err("%s: RX overrun\n", mmc_hostname(host->mmc));
+ data->error = -EIO;
+ } else if (status & MCI_TXUNDERRUN) {
+ pr_err("%s: TX underrun\n", mmc_hostname(host->mmc));
+ data->error = -EIO;
+ } else {
+ pr_err("%s: Unknown error (0x%.8x)\n",
+ mmc_hostname(host->mmc), status);
+ data->error = -EIO;
+ }
+}
+
+
+static int
+msmsdcc_pio_read(struct msmsdcc_host *host, char *buffer, unsigned int remain)
+{
+ void __iomem *base = host->base;
+ uint32_t *ptr = (uint32_t *) buffer;
+ int count = 0;
+
+ while (readl(base + MMCISTATUS) & MCI_RXDATAAVLBL) {
+
+ *ptr = readl(base + MMCIFIFO + (count % MCI_FIFOSIZE));
+ ptr++;
+ count += sizeof(uint32_t);
+
+ remain -= sizeof(uint32_t);
+ if (remain == 0)
+ break;
+ }
+ return count;
+}
+
+static int
+msmsdcc_pio_write(struct msmsdcc_host *host, char *buffer,
+ unsigned int remain, u32 status)
+{
+ void __iomem *base = host->base;
+ char *ptr = buffer;
+
+ do {
+ unsigned int count, maxcnt;
+
+ maxcnt = status & MCI_TXFIFOEMPTY ? MCI_FIFOSIZE :
+ MCI_FIFOHALFSIZE;
+ count = min(remain, maxcnt);
+
+ writesl(base + MMCIFIFO, ptr, count >> 2);
+ ptr += count;
+ remain -= count;
+
+ if (remain == 0)
+ break;
+
+ status = readl(base + MMCISTATUS);
+ } while (status & MCI_TXFIFOHALFEMPTY);
+
+ return ptr - buffer;
+}
+
+static int
+msmsdcc_spin_on_status(struct msmsdcc_host *host, uint32_t mask, int maxspin)
+{
+ while (maxspin) {
+ if ((readl(host->base + MMCISTATUS) & mask))
+ return 0;
+ udelay(1);
+ --maxspin;
+ }
+ return -ETIMEDOUT;
+}
+
+static int
+msmsdcc_pio_irq(int irq, void *dev_id)
+{
+ struct msmsdcc_host *host = dev_id;
+ void __iomem *base = host->base;
+ uint32_t status;
+
+ status = readl(base + MMCISTATUS);
+
+ do {
+ unsigned long flags;
+ unsigned int remain, len;
+ char *buffer;
+
+ if (!(status & (MCI_TXFIFOHALFEMPTY | MCI_RXDATAAVLBL))) {
+ if (host->curr.xfer_remain == 0 || !msmsdcc_piopoll)
+ break;
+
+ if (msmsdcc_spin_on_status(host,
+ (MCI_TXFIFOHALFEMPTY |
+ MCI_RXDATAAVLBL),
+ PIO_SPINMAX)) {
+ break;
+ }
+ }
+
+ /* Map the current scatter buffer */
+ local_irq_save(flags);
+ buffer = kmap_atomic(sg_page(host->pio.sg),
+ KM_BIO_SRC_IRQ) + host->pio.sg->offset;
+ buffer += host->pio.sg_off;
+ remain = host->pio.sg->length - host->pio.sg_off;
+ len = 0;
+ if (status & MCI_RXACTIVE)
+ len = msmsdcc_pio_read(host, buffer, remain);
+ if (status & MCI_TXACTIVE)
+ len = msmsdcc_pio_write(host, buffer, remain, status);
+
+ /* Unmap the buffer */
+ kunmap_atomic(buffer, KM_BIO_SRC_IRQ);
+ local_irq_restore(flags);
+
+ host->pio.sg_off += len;
+ host->curr.xfer_remain -= len;
+ host->curr.data_xfered += len;
+ remain -= len;
+
+ if (remain == 0) {
+ /* This sg page is full - do some housekeeping */
+ if (status & MCI_RXACTIVE && host->curr.user_pages)
+ flush_dcache_page(sg_page(host->pio.sg));
+
+ if (!--host->pio.sg_len) {
+ memset(&host->pio, 0, sizeof(host->pio));
+ break;
+ }
+
+ /* Advance to next sg */
+ host->pio.sg++;
+ host->pio.sg_off = 0;
+ }
+
+ status = readl(base + MMCISTATUS);
+ } while (1);
+
+ if (status & MCI_RXACTIVE && host->curr.xfer_remain < MCI_FIFOSIZE)
+ writel(MCI_RXDATAAVLBLMASK, base + MMCIMASK1);
+
+ if (!host->curr.xfer_remain)
+ writel(0, base + MMCIMASK1);
+
+ return IRQ_HANDLED;
+}
+
+static void msmsdcc_do_cmdirq(struct msmsdcc_host *host, uint32_t status)
+{
+ struct mmc_command *cmd = host->curr.cmd;
+ void __iomem *base = host->base;
+
+ host->curr.cmd = NULL;
+ cmd->resp[0] = readl(base + MMCIRESPONSE0);
+ cmd->resp[1] = readl(base + MMCIRESPONSE1);
+ cmd->resp[2] = readl(base + MMCIRESPONSE2);
+ cmd->resp[3] = readl(base + MMCIRESPONSE3);
+
+ del_timer(&host->command_timer);
+ if (status & MCI_CMDTIMEOUT) {
+ cmd->error = -ETIMEDOUT;
+ } else if (status & MCI_CMDCRCFAIL &&
+ cmd->flags & MMC_RSP_CRC) {
+ pr_err("%s: Command CRC error\n", mmc_hostname(host->mmc));
+ cmd->error = -EILSEQ;
+ }
+
+ if (!cmd->data || cmd->error) {
+ if (host->curr.data && host->dma.sg)
+ msm_dmov_stop_cmd(host->dma.channel,
+ &host->dma.hdr, 0);
+ else if (host->curr.data) { /* Non DMA */
+ msmsdcc_stop_data(host);
+ msmsdcc_request_end(host, cmd->mrq);
+ } else /* host->data == NULL */
+ msmsdcc_request_end(host, cmd->mrq);
+ } else if (!(cmd->data->flags & MMC_DATA_READ))
+ msmsdcc_start_data(host, cmd->data);
+}
+
+static void
+msmsdcc_handle_irq_data(struct msmsdcc_host *host, u32 status,
+ void __iomem *base)
+{
+ struct mmc_data *data = host->curr.data;
+
+ if (!data)
+ return;
+
+ /* Check for data errors */
+ if (status & (MCI_DATACRCFAIL | MCI_DATATIMEOUT |
+ MCI_TXUNDERRUN | MCI_RXOVERRUN)) {
+ msmsdcc_data_err(host, data, status);
+ host->curr.data_xfered = 0;
+ if (host->dma.sg)
+ msm_dmov_stop_cmd(host->dma.channel,
+ &host->dma.hdr, 0);
+ else {
+ msmsdcc_stop_data(host);
+ if (!data->stop)
+ msmsdcc_request_end(host, data->mrq);
+ else
+ msmsdcc_start_command(host, data->stop, 0);
+ }
+ }
+
+ /* Check for data done */
+ if (!host->curr.got_dataend && (status & MCI_DATAEND))
+ host->curr.got_dataend = 1;
+
+ if (!host->curr.got_datablkend && (status & MCI_DATABLOCKEND))
+ host->curr.got_datablkend = 1;
+
+ /*
+ * If DMA is still in progress, we complete via the completion handler
+ */
+ if (host->curr.got_dataend && host->curr.got_datablkend &&
+ !host->dma.busy) {
+ /*
+ * There appears to be an issue in the controller where
+ * if you request a small block transfer (< fifo size),
+ * you may get your DATAEND/DATABLKEND irq without the
+ * PIO data irq.
+ *
+ * Check to see if there is still data to be read,
+ * and simulate a PIO irq.
+ */
+ if (readl(base + MMCISTATUS) & MCI_RXDATAAVLBL)
+ msmsdcc_pio_irq(1, host);
+
+ msmsdcc_stop_data(host);
+ if (!data->error)
+ host->curr.data_xfered = host->curr.xfer_size;
+
+ if (!data->stop)
+ msmsdcc_request_end(host, data->mrq);
+ else
+ msmsdcc_start_command(host, data->stop, 0);
+ }
+}
+
+static irqreturn_t
+msmsdcc_irq(int irq, void *dev_id)
+{
+ struct msmsdcc_host *host = dev_id;
+ void __iomem *base = host->base;
+ u32 status;
+ int ret = 0;
+ int cardint = 0;
+
+ spin_lock(&host->lock);
+
+ do {
+ status = readl(base + MMCISTATUS);
+
+ status &= (readl(base + MMCIMASK0) | MCI_DATABLOCKENDMASK);
+ writel(status, base + MMCICLEAR);
+
+ msmsdcc_handle_irq_data(host, status, base);
+
+ if (status & (MCI_CMDSENT | MCI_CMDRESPEND | MCI_CMDCRCFAIL |
+ MCI_CMDTIMEOUT) && host->curr.cmd) {
+ msmsdcc_do_cmdirq(host, status);
+ }
+
+ if (status & MCI_SDIOINTOPER) {
+ cardint = 1;
+ status &= ~MCI_SDIOINTOPER;
+ }
+ ret = 1;
+ } while (status);
+
+ spin_unlock(&host->lock);
+
+ /*
+ * We have to delay handling the card interrupt as it calls
+ * back into the driver.
+ */
+ if (cardint)
+ mmc_signal_sdio_irq(host->mmc);
+
+ return IRQ_RETVAL(ret);
+}
+
+static void
+msmsdcc_request(struct mmc_host *mmc, struct mmc_request *mrq)
+{
+ struct msmsdcc_host *host = mmc_priv(mmc);
+ unsigned long flags;
+
+ WARN_ON(host->curr.mrq != NULL);
+ WARN_ON(host->pwr == 0);
+
+ spin_lock_irqsave(&host->lock, flags);
+
+ host->stats.reqs++;
+
+ if (host->eject) {
+ if (mrq->data && !(mrq->data->flags & MMC_DATA_READ)) {
+ mrq->cmd->error = 0;
+ mrq->data->bytes_xfered = mrq->data->blksz *
+ mrq->data->blocks;
+ } else
+ mrq->cmd->error = -ENOMEDIUM;
+
+ spin_unlock_irqrestore(&host->lock, flags);
+ mmc_request_done(mmc, mrq);
+ return;
+ }
+
+ host->curr.mrq = mrq;
+
+ if (mrq->data && mrq->data->flags & MMC_DATA_READ)
+ msmsdcc_start_data(host, mrq->data);
+
+ msmsdcc_start_command(host, mrq->cmd, 0);
+
+ if (host->cmdpoll && !msmsdcc_spin_on_status(host,
+ MCI_CMDRESPEND|MCI_CMDCRCFAIL|MCI_CMDTIMEOUT,
+ CMD_SPINMAX)) {
+ uint32_t status = readl(host->base + MMCISTATUS);
+ msmsdcc_do_cmdirq(host, status);
+ writel(MCI_CMDRESPEND | MCI_CMDCRCFAIL | MCI_CMDTIMEOUT,
+ host->base + MMCICLEAR);
+ host->stats.cmdpoll_hits++;
+ } else {
+ host->stats.cmdpoll_misses++;
+ mod_timer(&host->command_timer, jiffies + HZ);
+ }
+ spin_unlock_irqrestore(&host->lock, flags);
+}
+
+static void
+msmsdcc_set_ios(struct mmc_host *mmc, struct mmc_ios *ios)
+{
+ struct msmsdcc_host *host = mmc_priv(mmc);
+ u32 clk = 0, pwr = 0;
+ int rc;
+
+ if (ios->clock) {
+
+ if (!host->clks_on) {
+ clk_enable(host->pclk);
+ clk_enable(host->clk);
+ host->clks_on = 1;
+ }
+ if (ios->clock != host->clk_rate) {
+ rc = clk_set_rate(host->clk, ios->clock);
+ if (rc < 0)
+ pr_err("%s: Error setting clock rate (%d)\n",
+ mmc_hostname(host->mmc), rc);
+ else
+ host->clk_rate = ios->clock;
+ }
+ clk |= MCI_CLK_ENABLE;
+ }
+
+ if (ios->bus_width == MMC_BUS_WIDTH_4)
+ clk |= (2 << 10); /* Set WIDEBUS */
+
+ if (ios->clock > 400000 && msmsdcc_pwrsave)
+ clk |= (1 << 9); /* PWRSAVE */
+
+ clk |= (1 << 12); /* FLOW_ENA */
+ clk |= (1 << 15); /* feedback clock */
+
+ if (host->plat->translate_vdd)
+ pwr |= host->plat->translate_vdd(mmc_dev(mmc), ios->vdd);
+
+ switch (ios->power_mode) {
+ case MMC_POWER_OFF:
+ htc_pwrsink_set(PWRSINK_SDCARD, 0);
+ break;
+ case MMC_POWER_UP:
+ pwr |= MCI_PWR_UP;
+ break;
+ case MMC_POWER_ON:
+ htc_pwrsink_set(PWRSINK_SDCARD, 100);
+ pwr |= MCI_PWR_ON;
+ break;
+ }
+
+ if (ios->bus_mode == MMC_BUSMODE_OPENDRAIN)
+ pwr |= MCI_OD;
+
+ writel(clk, host->base + MMCICLOCK);
+
+ if (host->pwr != pwr) {
+ host->pwr = pwr;
+ writel(pwr, host->base + MMCIPOWER);
+ }
+
+ if (!(clk & MCI_CLK_ENABLE) && host->clks_on) {
+ clk_disable(host->clk);
+ clk_disable(host->pclk);
+ host->clks_on = 0;
+ }
+}
+
+static void msmsdcc_enable_sdio_irq(struct mmc_host *mmc, int enable)
+{
+ struct msmsdcc_host *host = mmc_priv(mmc);
+ unsigned long flags;
+ u32 status;
+
+ spin_lock_irqsave(&host->lock, flags);
+ if (msmsdcc_sdioirq == 1) {
+ status = readl(host->base + MMCIMASK0);
+ if (enable)
+ status |= MCI_SDIOINTOPERMASK;
+ else
+ status &= ~MCI_SDIOINTOPERMASK;
+ host->saved_irq0mask = status;
+ writel(status, host->base + MMCIMASK0);
+ }
+ spin_unlock_irqrestore(&host->lock, flags);
+}
+
+static const struct mmc_host_ops msmsdcc_ops = {
+ .request = msmsdcc_request,
+ .set_ios = msmsdcc_set_ios,
+ .enable_sdio_irq = msmsdcc_enable_sdio_irq,
+};
+
+static void
+msmsdcc_check_status(unsigned long data)
+{
+ struct msmsdcc_host *host = (struct msmsdcc_host *)data;
+ unsigned int status;
+
+ if (!host->plat->status) {
+ mmc_detect_change(host->mmc, 0);
+ goto out;
+ }
+
+ status = host->plat->status(mmc_dev(host->mmc));
+ host->eject = !status;
+ if (status ^ host->oldstat) {
+ pr_info("%s: Slot status change detected (%d -> %d)\n",
+ mmc_hostname(host->mmc), host->oldstat, status);
+ if (status)
+ mmc_detect_change(host->mmc, (5 * HZ) / 2);
+ else
+ mmc_detect_change(host->mmc, 0);
+ }
+
+ host->oldstat = status;
+
+out:
+ if (host->timer.function)
+ mod_timer(&host->timer, jiffies + HZ);
+}
+
+static irqreturn_t
+msmsdcc_platform_status_irq(int irq, void *dev_id)
+{
+ struct msmsdcc_host *host = dev_id;
+
+ printk(KERN_DEBUG "%s: %d\n", __func__, irq);
+ msmsdcc_check_status((unsigned long) host);
+ return IRQ_HANDLED;
+}
+
+static void
+msmsdcc_status_notify_cb(int card_present, void *dev_id)
+{
+ struct msmsdcc_host *host = dev_id;
+
+ printk(KERN_DEBUG "%s: card_present %d\n", mmc_hostname(host->mmc),
+ card_present);
+ msmsdcc_check_status((unsigned long) host);
+}
+
+/*
+ * called when a command expires.
+ * Dump some debugging, and then error
+ * out the transaction.
+ */
+static void
+msmsdcc_command_expired(unsigned long _data)
+{
+ struct msmsdcc_host *host = (struct msmsdcc_host *) _data;
+ struct mmc_request *mrq;
+ unsigned long flags;
+
+ spin_lock_irqsave(&host->lock, flags);
+ mrq = host->curr.mrq;
+
+ if (!mrq) {
+ pr_info("%s: Command expiry misfire\n",
+ mmc_hostname(host->mmc));
+ spin_unlock_irqrestore(&host->lock, flags);
+ return;
+ }
+
+ pr_err("%s: Command timeout (%p %p %p %p)\n",
+ mmc_hostname(host->mmc), mrq, mrq->cmd,
+ mrq->data, host->dma.sg);
+
+ mrq->cmd->error = -ETIMEDOUT;
+ msmsdcc_stop_data(host);
+
+ writel(0, host->base + MMCICOMMAND);
+
+ host->curr.mrq = NULL;
+ host->curr.cmd = NULL;
+
+ spin_unlock_irqrestore(&host->lock, flags);
+ mmc_request_done(host->mmc, mrq);
+}
+
+static int
+msmsdcc_init_dma(struct msmsdcc_host *host)
+{
+ memset(&host->dma, 0, sizeof(struct msmsdcc_dma_data));
+ host->dma.host = host;
+ host->dma.channel = -1;
+
+ if (!host->dmares)
+ return -ENODEV;
+
+ host->dma.nc = dma_alloc_coherent(NULL,
+ sizeof(struct msmsdcc_nc_dmadata),
+ &host->dma.nc_busaddr,
+ GFP_KERNEL);
+ if (host->dma.nc == NULL) {
+ pr_err("Unable to allocate DMA buffer\n");
+ return -ENOMEM;
+ }
+ memset(host->dma.nc, 0x00, sizeof(struct msmsdcc_nc_dmadata));
+ host->dma.cmd_busaddr = host->dma.nc_busaddr;
+ host->dma.cmdptr_busaddr = host->dma.nc_busaddr +
+ offsetof(struct msmsdcc_nc_dmadata, cmdptr);
+ host->dma.channel = host->dmares->start;
+
+ return 0;
+}
+
+#ifdef CONFIG_MMC_MSM7X00A_RESUME_IN_WQ
+static void
+do_resume_work(struct work_struct *work)
+{
+ struct msmsdcc_host *host =
+ container_of(work, struct msmsdcc_host, resume_task);
+ struct mmc_host *mmc = host->mmc;
+
+ if (mmc) {
+ mmc_resume_host(mmc);
+ if (host->stat_irq)
+ enable_irq(host->stat_irq);
+ }
+}
+#endif
+
+static int
+msmsdcc_probe(struct platform_device *pdev)
+{
+ struct mmc_platform_data *plat = pdev->dev.platform_data;
+ struct msmsdcc_host *host;
+ struct mmc_host *mmc;
+ struct resource *cmd_irqres = NULL;
+ struct resource *pio_irqres = NULL;
+ struct resource *stat_irqres = NULL;
+ struct resource *memres = NULL;
+ struct resource *dmares = NULL;
+ int ret;
+
+ /* must have platform data */
+ if (!plat) {
+ pr_err("%s: Platform data not available\n", __func__);
+ ret = -EINVAL;
+ goto out;
+ }
+
+ if (pdev->id < 1 || pdev->id > 4)
+ return -EINVAL;
+
+ if (pdev->resource == NULL || pdev->num_resources < 2) {
+ pr_err("%s: Invalid resource\n", __func__);
+ return -ENXIO;
+ }
+
+ memres = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ dmares = platform_get_resource(pdev, IORESOURCE_DMA, 0);
+ cmd_irqres = platform_get_resource_byname(pdev, IORESOURCE_IRQ,
+ "cmd_irq");
+ pio_irqres = platform_get_resource_byname(pdev, IORESOURCE_IRQ,
+ "pio_irq");
+ stat_irqres = platform_get_resource_byname(pdev, IORESOURCE_IRQ,
+ "status_irq");
+
+ if (!cmd_irqres || !pio_irqres || !memres) {
+ pr_err("%s: Invalid resource\n", __func__);
+ return -ENXIO;
+ }
+
+ /*
+ * Setup our host structure
+ */
+
+ mmc = mmc_alloc_host(sizeof(struct msmsdcc_host), &pdev->dev);
+ if (!mmc) {
+ ret = -ENOMEM;
+ goto out;
+ }
+
+ host = mmc_priv(mmc);
+ host->pdev_id = pdev->id;
+ host->plat = plat;
+ host->mmc = mmc;
+
+ host->cmdpoll = 1;
+
+ host->base = ioremap(memres->start, PAGE_SIZE);
+ if (!host->base) {
+ ret = -ENOMEM;
+ goto out;
+ }
+
+ host->cmd_irqres = cmd_irqres;
+ host->pio_irqres = pio_irqres;
+ host->memres = memres;
+ host->dmares = dmares;
+ spin_lock_init(&host->lock);
+
+ /*
+ * Setup DMA
+ */
+ msmsdcc_init_dma(host);
+
+ /*
+ * Setup main peripheral bus clock
+ */
+ host->pclk = clk_get(&pdev->dev, "sdc_pclk");
+ if (IS_ERR(host->pclk)) {
+ ret = PTR_ERR(host->pclk);
+ goto host_free;
+ }
+
+ ret = clk_enable(host->pclk);
+ if (ret)
+ goto pclk_put;
+
+ host->pclk_rate = clk_get_rate(host->pclk);
+
+ /*
+ * Setup SDC MMC clock
+ */
+ host->clk = clk_get(&pdev->dev, "sdc_clk");
+ if (IS_ERR(host->clk)) {
+ ret = PTR_ERR(host->clk);
+ goto pclk_disable;
+ }
+
+ ret = clk_enable(host->clk);
+ if (ret)
+ goto clk_put;
+
+ ret = clk_set_rate(host->clk, msmsdcc_fmin);
+ if (ret) {
+ pr_err("%s: Clock rate set failed (%d)\n", __func__, ret);
+ goto clk_disable;
+ }
+
+ host->clk_rate = clk_get_rate(host->clk);
+
+ host->clks_on = 1;
+
+ /*
+ * Setup MMC host structure
+ */
+ mmc->ops = &msmsdcc_ops;
+ mmc->f_min = msmsdcc_fmin;
+ mmc->f_max = msmsdcc_fmax;
+ mmc->ocr_avail = plat->ocr_mask;
+
+ if (msmsdcc_4bit)
+ mmc->caps |= MMC_CAP_4_BIT_DATA;
+ if (msmsdcc_sdioirq)
+ mmc->caps |= MMC_CAP_SDIO_IRQ;
+ mmc->caps |= MMC_CAP_MMC_HIGHSPEED | MMC_CAP_SD_HIGHSPEED;
+
+ mmc->max_phys_segs = NR_SG;
+ mmc->max_hw_segs = NR_SG;
+ mmc->max_blk_size = 4096; /* MCI_DATA_CTL BLOCKSIZE up to 4096 */
+ mmc->max_blk_count = 65536;
+
+ mmc->max_req_size = 33554432; /* MCI_DATA_LENGTH is 25 bits */
+ mmc->max_seg_size = mmc->max_req_size;
+
+ writel(0, host->base + MMCIMASK0);
+ writel(0x5e007ff, host->base + MMCICLEAR); /* Add: 1 << 25 */
+
+ writel(MCI_IRQENABLE, host->base + MMCIMASK0);
+ host->saved_irq0mask = MCI_IRQENABLE;
+
+ /*
+ * Setup card detect change
+ */
+
+ memset(&host->timer, 0, sizeof(host->timer));
+
+ if (stat_irqres && !(stat_irqres->flags & IORESOURCE_DISABLED)) {
+ unsigned long irqflags = IRQF_SHARED |
+ (stat_irqres->flags & IRQF_TRIGGER_MASK);
+
+ host->stat_irq = stat_irqres->start;
+ ret = request_irq(host->stat_irq,
+ msmsdcc_platform_status_irq,
+ irqflags,
+ DRIVER_NAME " (slot)",
+ host);
+ if (ret) {
+ pr_err("%s: Unable to get slot IRQ %d (%d)\n",
+ mmc_hostname(mmc), host->stat_irq, ret);
+ goto clk_disable;
+ }
+ } else if (plat->register_status_notify) {
+ plat->register_status_notify(msmsdcc_status_notify_cb, host);
+ } else if (!plat->status)
+ pr_err("%s: No card detect facilities available\n",
+ mmc_hostname(mmc));
+ else {
+ init_timer(&host->timer);
+ host->timer.data = (unsigned long)host;
+ host->timer.function = msmsdcc_check_status;
+ host->timer.expires = jiffies + HZ;
+ add_timer(&host->timer);
+ }
+
+ if (plat->status) {
+ host->oldstat = host->plat->status(mmc_dev(host->mmc));
+ host->eject = !host->oldstat;
+ }
+
+ /*
+ * Setup a command timer. We currently need this due to
+ * some 'strange' timeout / error handling situations.
+ */
+ init_timer(&host->command_timer);
+ host->command_timer.data = (unsigned long) host;
+ host->command_timer.function = msmsdcc_command_expired;
+
+ ret = request_irq(cmd_irqres->start, msmsdcc_irq, IRQF_SHARED,
+ DRIVER_NAME " (cmd)", host);
+ if (ret)
+ goto stat_irq_free;
+
+ ret = request_irq(pio_irqres->start, msmsdcc_pio_irq, IRQF_SHARED,
+ DRIVER_NAME " (pio)", host);
+ if (ret)
+ goto cmd_irq_free;
+
+ mmc_set_drvdata(pdev, mmc);
+ mmc_add_host(mmc);
+
+ pr_info("%s: Qualcomm MSM SDCC at 0x%016llx irq %d,%d dma %d\n",
+ mmc_hostname(mmc), (unsigned long long)memres->start,
+ (unsigned int) cmd_irqres->start,
+ (unsigned int) host->stat_irq, host->dma.channel);
+ pr_info("%s: 4 bit data mode %s\n", mmc_hostname(mmc),
+ (mmc->caps & MMC_CAP_4_BIT_DATA ? "enabled" : "disabled"));
+ pr_info("%s: MMC clock %u -> %u Hz, PCLK %u Hz\n",
+ mmc_hostname(mmc), msmsdcc_fmin, msmsdcc_fmax, host->pclk_rate);
+ pr_info("%s: Slot eject status = %d\n", mmc_hostname(mmc), host->eject);
+ pr_info("%s: Power save feature enable = %d\n",
+ mmc_hostname(mmc), msmsdcc_pwrsave);
+
+ if (host->dma.channel != -1) {
+ pr_info("%s: DM non-cached buffer at %p, dma_addr 0x%.8x\n",
+ mmc_hostname(mmc), host->dma.nc, host->dma.nc_busaddr);
+ pr_info("%s: DM cmd busaddr 0x%.8x, cmdptr busaddr 0x%.8x\n",
+ mmc_hostname(mmc), host->dma.cmd_busaddr,
+ host->dma.cmdptr_busaddr);
+ } else
+ pr_info("%s: PIO transfer enabled\n", mmc_hostname(mmc));
+ if (host->timer.function)
+ pr_info("%s: Polling status mode enabled\n", mmc_hostname(mmc));
+
+ return 0;
+ cmd_irq_free:
+ free_irq(cmd_irqres->start, host);
+ stat_irq_free:
+ if (host->stat_irq)
+ free_irq(host->stat_irq, host);
+ clk_disable:
+ clk_disable(host->clk);
+ clk_put:
+ clk_put(host->clk);
+ pclk_disable:
+ clk_disable(host->pclk);
+ pclk_put:
+ clk_put(host->pclk);
+ host_free:
+ mmc_free_host(mmc);
+ out:
+ return ret;
+}
+
+static int
+msmsdcc_suspend(struct platform_device *dev, pm_message_t state)
+{
+ struct mmc_host *mmc = mmc_get_drvdata(dev);
+ int rc = 0;
+
+ if (mmc) {
+ struct msmsdcc_host *host = mmc_priv(mmc);
+
+ if (host->stat_irq)
+ disable_irq(host->stat_irq);
+
+ if (mmc->card && mmc->card->type != MMC_TYPE_SDIO)
+ rc = mmc_suspend_host(mmc, state);
+ if (!rc) {
+ writel(0, host->base + MMCIMASK0);
+
+ if (host->clks_on) {
+ clk_disable(host->clk);
+ clk_disable(host->pclk);
+ host->clks_on = 0;
+ }
+ }
+ }
+ return rc;
+}
+
+static int
+msmsdcc_resume(struct platform_device *dev)
+{
+ struct mmc_host *mmc = mmc_get_drvdata(dev);
+ unsigned long flags;
+
+ if (mmc) {
+ struct msmsdcc_host *host = mmc_priv(mmc);
+
+ spin_lock_irqsave(&host->lock, flags);
+
+ if (!host->clks_on) {
+ clk_enable(host->pclk);
+ clk_enable(host->clk);
+ host->clks_on = 1;
+ }
+
+ writel(host->saved_irq0mask, host->base + MMCIMASK0);
+
+ spin_unlock_irqrestore(&host->lock, flags);
+
+ if (mmc->card && mmc->card->type != MMC_TYPE_SDIO)
+ mmc_resume_host(mmc);
+ if (host->stat_irq)
+ enable_irq(host->stat_irq);
+ else if (host->stat_irq)
+ enable_irq(host->stat_irq);
+ }
+ return 0;
+}
+
+static struct platform_driver msmsdcc_driver = {
+ .probe = msmsdcc_probe,
+ .suspend = msmsdcc_suspend,
+ .resume = msmsdcc_resume,
+ .driver = {
+ .name = "msm_sdcc",
+ },
+};
+
+static int __init msmsdcc_init(void)
+{
+ return platform_driver_register(&msmsdcc_driver);
+}
+
+static void __exit msmsdcc_exit(void)
+{
+ platform_driver_unregister(&msmsdcc_driver);
+}
+
+module_init(msmsdcc_init);
+module_exit(msmsdcc_exit);
+
+MODULE_DESCRIPTION("Qualcomm MSM 7X00A Multimedia Card Interface driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/mmc/host/msm_sdcc.h b/drivers/mmc/host/msm_sdcc.h
new file mode 100644
index 0000000..8c84484
--- /dev/null
+++ b/drivers/mmc/host/msm_sdcc.h
@@ -0,0 +1,238 @@
+/*
+ * linux/drivers/mmc/host/msmsdcc.h - QCT MSM7K SDC Controller
+ *
+ * Copyright (C) 2008 Google, All Rights Reserved.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * - Based on mmci.h
+ */
+
+#ifndef _MSM_SDCC_H
+#define _MSM_SDCC_H
+
+#define MSMSDCC_CRCI_SDC1 6
+#define MSMSDCC_CRCI_SDC2 7
+#define MSMSDCC_CRCI_SDC3 12
+#define MSMSDCC_CRCI_SDC4 13
+
+#define MMCIPOWER 0x000
+#define MCI_PWR_OFF 0x00
+#define MCI_PWR_UP 0x02
+#define MCI_PWR_ON 0x03
+#define MCI_OD (1 << 6)
+
+#define MMCICLOCK 0x004
+#define MCI_CLK_ENABLE (1 << 8)
+#define MCI_CLK_PWRSAVE (1 << 9)
+#define MCI_CLK_WIDEBUS (1 << 10)
+#define MCI_CLK_FLOWENA (1 << 12)
+#define MCI_CLK_INVERTOUT (1 << 13)
+#define MCI_CLK_SELECTIN (1 << 14)
+
+#define MMCIARGUMENT 0x008
+#define MMCICOMMAND 0x00c
+#define MCI_CPSM_RESPONSE (1 << 6)
+#define MCI_CPSM_LONGRSP (1 << 7)
+#define MCI_CPSM_INTERRUPT (1 << 8)
+#define MCI_CPSM_PENDING (1 << 9)
+#define MCI_CPSM_ENABLE (1 << 10)
+#define MCI_CPSM_PROGENA (1 << 11)
+#define MCI_CSPM_DATCMD (1 << 12)
+#define MCI_CSPM_MCIABORT (1 << 13)
+#define MCI_CSPM_CCSENABLE (1 << 14)
+#define MCI_CSPM_CCSDISABLE (1 << 15)
+
+
+#define MMCIRESPCMD 0x010
+#define MMCIRESPONSE0 0x014
+#define MMCIRESPONSE1 0x018
+#define MMCIRESPONSE2 0x01c
+#define MMCIRESPONSE3 0x020
+#define MMCIDATATIMER 0x024
+#define MMCIDATALENGTH 0x028
+
+#define MMCIDATACTRL 0x02c
+#define MCI_DPSM_ENABLE (1 << 0)
+#define MCI_DPSM_DIRECTION (1 << 1)
+#define MCI_DPSM_MODE (1 << 2)
+#define MCI_DPSM_DMAENABLE (1 << 3)
+
+#define MMCIDATACNT 0x030
+#define MMCISTATUS 0x034
+#define MCI_CMDCRCFAIL (1 << 0)
+#define MCI_DATACRCFAIL (1 << 1)
+#define MCI_CMDTIMEOUT (1 << 2)
+#define MCI_DATATIMEOUT (1 << 3)
+#define MCI_TXUNDERRUN (1 << 4)
+#define MCI_RXOVERRUN (1 << 5)
+#define MCI_CMDRESPEND (1 << 6)
+#define MCI_CMDSENT (1 << 7)
+#define MCI_DATAEND (1 << 8)
+#define MCI_DATABLOCKEND (1 << 10)
+#define MCI_CMDACTIVE (1 << 11)
+#define MCI_TXACTIVE (1 << 12)
+#define MCI_RXACTIVE (1 << 13)
+#define MCI_TXFIFOHALFEMPTY (1 << 14)
+#define MCI_RXFIFOHALFFULL (1 << 15)
+#define MCI_TXFIFOFULL (1 << 16)
+#define MCI_RXFIFOFULL (1 << 17)
+#define MCI_TXFIFOEMPTY (1 << 18)
+#define MCI_RXFIFOEMPTY (1 << 19)
+#define MCI_TXDATAAVLBL (1 << 20)
+#define MCI_RXDATAAVLBL (1 << 21)
+#define MCI_SDIOINTR (1 << 22)
+#define MCI_PROGDONE (1 << 23)
+#define MCI_ATACMDCOMPL (1 << 24)
+#define MCI_SDIOINTOPER (1 << 25)
+#define MCI_CCSTIMEOUT (1 << 26)
+
+#define MMCICLEAR 0x038
+#define MCI_CMDCRCFAILCLR (1 << 0)
+#define MCI_DATACRCFAILCLR (1 << 1)
+#define MCI_CMDTIMEOUTCLR (1 << 2)
+#define MCI_DATATIMEOUTCLR (1 << 3)
+#define MCI_TXUNDERRUNCLR (1 << 4)
+#define MCI_RXOVERRUNCLR (1 << 5)
+#define MCI_CMDRESPENDCLR (1 << 6)
+#define MCI_CMDSENTCLR (1 << 7)
+#define MCI_DATAENDCLR (1 << 8)
+#define MCI_DATABLOCKENDCLR (1 << 10)
+
+#define MMCIMASK0 0x03c
+#define MCI_CMDCRCFAILMASK (1 << 0)
+#define MCI_DATACRCFAILMASK (1 << 1)
+#define MCI_CMDTIMEOUTMASK (1 << 2)
+#define MCI_DATATIMEOUTMASK (1 << 3)
+#define MCI_TXUNDERRUNMASK (1 << 4)
+#define MCI_RXOVERRUNMASK (1 << 5)
+#define MCI_CMDRESPENDMASK (1 << 6)
+#define MCI_CMDSENTMASK (1 << 7)
+#define MCI_DATAENDMASK (1 << 8)
+#define MCI_DATABLOCKENDMASK (1 << 10)
+#define MCI_CMDACTIVEMASK (1 << 11)
+#define MCI_TXACTIVEMASK (1 << 12)
+#define MCI_RXACTIVEMASK (1 << 13)
+#define MCI_TXFIFOHALFEMPTYMASK (1 << 14)
+#define MCI_RXFIFOHALFFULLMASK (1 << 15)
+#define MCI_TXFIFOFULLMASK (1 << 16)
+#define MCI_RXFIFOFULLMASK (1 << 17)
+#define MCI_TXFIFOEMPTYMASK (1 << 18)
+#define MCI_RXFIFOEMPTYMASK (1 << 19)
+#define MCI_TXDATAAVLBLMASK (1 << 20)
+#define MCI_RXDATAAVLBLMASK (1 << 21)
+#define MCI_SDIOINTMASK (1 << 22)
+#define MCI_PROGDONEMASK (1 << 23)
+#define MCI_ATACMDCOMPLMASK (1 << 24)
+#define MCI_SDIOINTOPERMASK (1 << 25)
+#define MCI_CCSTIMEOUTMASK (1 << 26)
+
+#define MMCIMASK1 0x040
+#define MMCIFIFOCNT 0x044
+#define MCICCSTIMER 0x058
+
+#define MMCIFIFO 0x080 /* to 0x0bc */
+
+#define MCI_IRQENABLE \
+ (MCI_CMDCRCFAILMASK|MCI_DATACRCFAILMASK|MCI_CMDTIMEOUTMASK| \
+ MCI_DATATIMEOUTMASK|MCI_TXUNDERRUNMASK|MCI_RXOVERRUNMASK| \
+ MCI_CMDRESPENDMASK|MCI_CMDSENTMASK|MCI_DATAENDMASK)
+
+/*
+ * The size of the FIFO in bytes.
+ */
+#define MCI_FIFOSIZE (16*4)
+
+#define MCI_FIFOHALFSIZE (MCI_FIFOSIZE / 2)
+
+#define NR_SG 32
+
+struct clk;
+
+struct msmsdcc_nc_dmadata {
+ dmov_box cmd[NR_SG];
+ uint32_t cmdptr;
+};
+
+struct msmsdcc_dma_data {
+ struct msmsdcc_nc_dmadata *nc;
+ dma_addr_t nc_busaddr;
+ dma_addr_t cmd_busaddr;
+ dma_addr_t cmdptr_busaddr;
+
+ struct msm_dmov_cmd hdr;
+ enum dma_data_direction dir;
+
+ struct scatterlist *sg;
+ int num_ents;
+
+ int channel;
+ struct msmsdcc_host *host;
+ int busy; /* Set if DM is busy */
+};
+
+struct msmsdcc_pio_data {
+ struct scatterlist *sg;
+ unsigned int sg_len;
+ unsigned int sg_off;
+};
+
+struct msmsdcc_curr_req {
+ struct mmc_request *mrq;
+ struct mmc_command *cmd;
+ struct mmc_data *data;
+ unsigned int xfer_size; /* Total data size */
+ unsigned int xfer_remain; /* Bytes remaining to send */
+ unsigned int data_xfered; /* Bytes acked by BLKEND irq */
+ int got_dataend;
+ int got_datablkend;
+ int user_pages;
+};
+
+struct msmsdcc_stats {
+ unsigned int reqs;
+ unsigned int cmds;
+ unsigned int cmdpoll_hits;
+ unsigned int cmdpoll_misses;
+};
+
+struct msmsdcc_host {
+ struct resource *cmd_irqres;
+ struct resource *pio_irqres;
+ struct resource *memres;
+ struct resource *dmares;
+ void __iomem *base;
+ int pdev_id;
+ unsigned int stat_irq;
+
+ struct msmsdcc_curr_req curr;
+
+ struct mmc_host *mmc;
+ struct clk *clk; /* main MMC bus clock */
+ struct clk *pclk; /* SDCC peripheral bus clock */
+ unsigned int clks_on; /* set if clocks are enabled */
+ struct timer_list command_timer;
+
+ unsigned int eject; /* eject state */
+
+ spinlock_t lock;
+
+ unsigned int clk_rate; /* Current clock rate */
+ unsigned int pclk_rate;
+
+ u32 pwr;
+ u32 saved_irq0mask; /* MMCIMASK0 reg value */
+ struct mmc_platform_data *plat;
+
+ struct timer_list timer;
+ unsigned int oldstat;
+
+ struct msmsdcc_dma_data dma;
+ struct msmsdcc_pio_data pio;
+ int cmdpoll;
+ struct msmsdcc_stats stats;
+};
+
+#endif
diff --git a/drivers/mmc/host/omap_hsmmc.c b/drivers/mmc/host/omap_hsmmc.c
index 1cf9cfb..4487cc0 100644
--- a/drivers/mmc/host/omap_hsmmc.c
+++ b/drivers/mmc/host/omap_hsmmc.c
@@ -17,6 +17,8 @@
#include <linux/module.h>
#include <linux/init.h>
+#include <linux/debugfs.h>
+#include <linux/seq_file.h>
#include <linux/interrupt.h>
#include <linux/delay.h>
#include <linux/dma-mapping.h>
@@ -25,6 +27,7 @@
#include <linux/timer.h>
#include <linux/clk.h>
#include <linux/mmc/host.h>
+#include <linux/mmc/core.h>
#include <linux/io.h>
#include <linux/semaphore.h>
#include <mach/dma.h>
@@ -35,6 +38,7 @@
/* OMAP HSMMC Host Controller Registers */
#define OMAP_HSMMC_SYSCONFIG 0x0010
+#define OMAP_HSMMC_SYSSTATUS 0x0014
#define OMAP_HSMMC_CON 0x002C
#define OMAP_HSMMC_BLK 0x0104
#define OMAP_HSMMC_ARG 0x0108
@@ -70,6 +74,8 @@
#define DTO_MASK 0x000F0000
#define DTO_SHIFT 16
#define INT_EN_MASK 0x307F0033
+#define BWR_ENABLE (1 << 4)
+#define BRR_ENABLE (1 << 5)
#define INIT_STREAM (1 << 1)
#define DP_SELECT (1 << 21)
#define DDIR (1 << 4)
@@ -92,6 +98,8 @@
#define DUAL_VOLT_OCR_BIT 7
#define SRC (1 << 25)
#define SRD (1 << 26)
+#define SOFTRESET (1 << 1)
+#define RESETDONE (1 << 0)
/*
* FIXME: Most likely all the data using these _DEVID defines should come
@@ -101,11 +109,18 @@
#define OMAP_MMC1_DEVID 0
#define OMAP_MMC2_DEVID 1
#define OMAP_MMC3_DEVID 2
+#define OMAP_MMC4_DEVID 3
+#define OMAP_MMC5_DEVID 4
#define MMC_TIMEOUT_MS 20
#define OMAP_MMC_MASTER_CLOCK 96000000
#define DRIVER_NAME "mmci-omap-hs"
+/* Timeouts for entering power saving states on inactivity, msec */
+#define OMAP_MMC_DISABLED_TIMEOUT 100
+#define OMAP_MMC_SLEEP_TIMEOUT 1000
+#define OMAP_MMC_OFF_TIMEOUT 8000
+
/*
* One controller can have multiple slots, like on some omap boards using
* omap.c controller driver. Luckily this is not currently done on any known
@@ -122,7 +137,7 @@
#define OMAP_HSMMC_WRITE(base, reg, val) \
__raw_writel((val), (base) + OMAP_HSMMC_##reg)
-struct mmc_omap_host {
+struct omap_hsmmc_host {
struct device *dev;
struct mmc_host *mmc;
struct mmc_request *mrq;
@@ -135,27 +150,35 @@
struct work_struct mmc_carddetect_work;
void __iomem *base;
resource_size_t mapbase;
+ spinlock_t irq_lock; /* Prevent races with irq handler */
+ unsigned long flags;
unsigned int id;
unsigned int dma_len;
unsigned int dma_sg_idx;
unsigned char bus_mode;
+ unsigned char power_mode;
u32 *buffer;
u32 bytesleft;
int suspended;
int irq;
- int carddetect;
int use_dma, dma_ch;
int dma_line_tx, dma_line_rx;
int slot_id;
- int dbclk_enabled;
+ int got_dbclk;
int response_busy;
+ int context_loss;
+ int dpm_state;
+ int vdd;
+ int protect_card;
+ int reqs_blocked;
+
struct omap_mmc_platform_data *pdata;
};
/*
* Stop clock to the card
*/
-static void omap_mmc_stop_clock(struct mmc_omap_host *host)
+static void omap_hsmmc_stop_clock(struct omap_hsmmc_host *host)
{
OMAP_HSMMC_WRITE(host->base, SYSCTL,
OMAP_HSMMC_READ(host->base, SYSCTL) & ~CEN);
@@ -163,15 +186,178 @@
dev_dbg(mmc_dev(host->mmc), "MMC Clock is not stoped\n");
}
+#ifdef CONFIG_PM
+
+/*
+ * Restore the MMC host context, if it was lost as result of a
+ * power state change.
+ */
+static int omap_hsmmc_context_restore(struct omap_hsmmc_host *host)
+{
+ struct mmc_ios *ios = &host->mmc->ios;
+ struct omap_mmc_platform_data *pdata = host->pdata;
+ int context_loss = 0;
+ u32 hctl, capa, con;
+ u16 dsor = 0;
+ unsigned long timeout;
+
+ if (pdata->get_context_loss_count) {
+ context_loss = pdata->get_context_loss_count(host->dev);
+ if (context_loss < 0)
+ return 1;
+ }
+
+ dev_dbg(mmc_dev(host->mmc), "context was %slost\n",
+ context_loss == host->context_loss ? "not " : "");
+ if (host->context_loss == context_loss)
+ return 1;
+
+ /* Wait for hardware reset */
+ timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
+ while ((OMAP_HSMMC_READ(host->base, SYSSTATUS) & RESETDONE) != RESETDONE
+ && time_before(jiffies, timeout))
+ ;
+
+ /* Do software reset */
+ OMAP_HSMMC_WRITE(host->base, SYSCONFIG, SOFTRESET);
+ timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
+ while ((OMAP_HSMMC_READ(host->base, SYSSTATUS) & RESETDONE) != RESETDONE
+ && time_before(jiffies, timeout))
+ ;
+
+ OMAP_HSMMC_WRITE(host->base, SYSCONFIG,
+ OMAP_HSMMC_READ(host->base, SYSCONFIG) | AUTOIDLE);
+
+ if (host->id == OMAP_MMC1_DEVID) {
+ if (host->power_mode != MMC_POWER_OFF &&
+ (1 << ios->vdd) <= MMC_VDD_23_24)
+ hctl = SDVS18;
+ else
+ hctl = SDVS30;
+ capa = VS30 | VS18;
+ } else {
+ hctl = SDVS18;
+ capa = VS18;
+ }
+
+ OMAP_HSMMC_WRITE(host->base, HCTL,
+ OMAP_HSMMC_READ(host->base, HCTL) | hctl);
+
+ OMAP_HSMMC_WRITE(host->base, CAPA,
+ OMAP_HSMMC_READ(host->base, CAPA) | capa);
+
+ OMAP_HSMMC_WRITE(host->base, HCTL,
+ OMAP_HSMMC_READ(host->base, HCTL) | SDBP);
+
+ timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
+ while ((OMAP_HSMMC_READ(host->base, HCTL) & SDBP) != SDBP
+ && time_before(jiffies, timeout))
+ ;
+
+ OMAP_HSMMC_WRITE(host->base, STAT, STAT_CLEAR);
+ OMAP_HSMMC_WRITE(host->base, ISE, INT_EN_MASK);
+ OMAP_HSMMC_WRITE(host->base, IE, INT_EN_MASK);
+
+ /* Do not initialize card-specific things if the power is off */
+ if (host->power_mode == MMC_POWER_OFF)
+ goto out;
+
+ con = OMAP_HSMMC_READ(host->base, CON);
+ switch (ios->bus_width) {
+ case MMC_BUS_WIDTH_8:
+ OMAP_HSMMC_WRITE(host->base, CON, con | DW8);
+ break;
+ case MMC_BUS_WIDTH_4:
+ OMAP_HSMMC_WRITE(host->base, CON, con & ~DW8);
+ OMAP_HSMMC_WRITE(host->base, HCTL,
+ OMAP_HSMMC_READ(host->base, HCTL) | FOUR_BIT);
+ break;
+ case MMC_BUS_WIDTH_1:
+ OMAP_HSMMC_WRITE(host->base, CON, con & ~DW8);
+ OMAP_HSMMC_WRITE(host->base, HCTL,
+ OMAP_HSMMC_READ(host->base, HCTL) & ~FOUR_BIT);
+ break;
+ }
+
+ if (ios->clock) {
+ dsor = OMAP_MMC_MASTER_CLOCK / ios->clock;
+ if (dsor < 1)
+ dsor = 1;
+
+ if (OMAP_MMC_MASTER_CLOCK / dsor > ios->clock)
+ dsor++;
+
+ if (dsor > 250)
+ dsor = 250;
+ }
+
+ OMAP_HSMMC_WRITE(host->base, SYSCTL,
+ OMAP_HSMMC_READ(host->base, SYSCTL) & ~CEN);
+ OMAP_HSMMC_WRITE(host->base, SYSCTL, (dsor << 6) | (DTO << 16));
+ OMAP_HSMMC_WRITE(host->base, SYSCTL,
+ OMAP_HSMMC_READ(host->base, SYSCTL) | ICE);
+
+ timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
+ while ((OMAP_HSMMC_READ(host->base, SYSCTL) & ICS) != ICS
+ && time_before(jiffies, timeout))
+ ;
+
+ OMAP_HSMMC_WRITE(host->base, SYSCTL,
+ OMAP_HSMMC_READ(host->base, SYSCTL) | CEN);
+
+ con = OMAP_HSMMC_READ(host->base, CON);
+ if (ios->bus_mode == MMC_BUSMODE_OPENDRAIN)
+ OMAP_HSMMC_WRITE(host->base, CON, con | OD);
+ else
+ OMAP_HSMMC_WRITE(host->base, CON, con & ~OD);
+out:
+ host->context_loss = context_loss;
+
+ dev_dbg(mmc_dev(host->mmc), "context is restored\n");
+ return 0;
+}
+
+/*
+ * Save the MMC host context (store the number of power state changes so far).
+ */
+static void omap_hsmmc_context_save(struct omap_hsmmc_host *host)
+{
+ struct omap_mmc_platform_data *pdata = host->pdata;
+ int context_loss;
+
+ if (pdata->get_context_loss_count) {
+ context_loss = pdata->get_context_loss_count(host->dev);
+ if (context_loss < 0)
+ return;
+ host->context_loss = context_loss;
+ }
+}
+
+#else
+
+static int omap_hsmmc_context_restore(struct omap_hsmmc_host *host)
+{
+ return 0;
+}
+
+static void omap_hsmmc_context_save(struct omap_hsmmc_host *host)
+{
+}
+
+#endif
+
/*
* Send init stream sequence to card
* before sending IDLE command
*/
-static void send_init_stream(struct mmc_omap_host *host)
+static void send_init_stream(struct omap_hsmmc_host *host)
{
int reg = 0;
unsigned long timeout;
+ if (host->protect_card)
+ return;
+
disable_irq(host->irq);
OMAP_HSMMC_WRITE(host->base, CON,
OMAP_HSMMC_READ(host->base, CON) | INIT_STREAM);
@@ -183,51 +369,53 @@
OMAP_HSMMC_WRITE(host->base, CON,
OMAP_HSMMC_READ(host->base, CON) & ~INIT_STREAM);
+
+ OMAP_HSMMC_WRITE(host->base, STAT, STAT_CLEAR);
+ OMAP_HSMMC_READ(host->base, STAT);
+
enable_irq(host->irq);
}
static inline
-int mmc_omap_cover_is_closed(struct mmc_omap_host *host)
+int omap_hsmmc_cover_is_closed(struct omap_hsmmc_host *host)
{
int r = 1;
- if (host->pdata->slots[host->slot_id].get_cover_state)
- r = host->pdata->slots[host->slot_id].get_cover_state(host->dev,
- host->slot_id);
+ if (mmc_slot(host).get_cover_state)
+ r = mmc_slot(host).get_cover_state(host->dev, host->slot_id);
return r;
}
static ssize_t
-mmc_omap_show_cover_switch(struct device *dev, struct device_attribute *attr,
+omap_hsmmc_show_cover_switch(struct device *dev, struct device_attribute *attr,
char *buf)
{
struct mmc_host *mmc = container_of(dev, struct mmc_host, class_dev);
- struct mmc_omap_host *host = mmc_priv(mmc);
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
- return sprintf(buf, "%s\n", mmc_omap_cover_is_closed(host) ? "closed" :
- "open");
+ return sprintf(buf, "%s\n",
+ omap_hsmmc_cover_is_closed(host) ? "closed" : "open");
}
-static DEVICE_ATTR(cover_switch, S_IRUGO, mmc_omap_show_cover_switch, NULL);
+static DEVICE_ATTR(cover_switch, S_IRUGO, omap_hsmmc_show_cover_switch, NULL);
static ssize_t
-mmc_omap_show_slot_name(struct device *dev, struct device_attribute *attr,
+omap_hsmmc_show_slot_name(struct device *dev, struct device_attribute *attr,
char *buf)
{
struct mmc_host *mmc = container_of(dev, struct mmc_host, class_dev);
- struct mmc_omap_host *host = mmc_priv(mmc);
- struct omap_mmc_slot_data slot = host->pdata->slots[host->slot_id];
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
- return sprintf(buf, "%s\n", slot.name);
+ return sprintf(buf, "%s\n", mmc_slot(host).name);
}
-static DEVICE_ATTR(slot_name, S_IRUGO, mmc_omap_show_slot_name, NULL);
+static DEVICE_ATTR(slot_name, S_IRUGO, omap_hsmmc_show_slot_name, NULL);
/*
* Configure the response type and send the cmd.
*/
static void
-mmc_omap_start_command(struct mmc_omap_host *host, struct mmc_command *cmd,
+omap_hsmmc_start_command(struct omap_hsmmc_host *host, struct mmc_command *cmd,
struct mmc_data *data)
{
int cmdreg = 0, resptype = 0, cmdtype = 0;
@@ -241,7 +429,12 @@
*/
OMAP_HSMMC_WRITE(host->base, STAT, STAT_CLEAR);
OMAP_HSMMC_WRITE(host->base, ISE, INT_EN_MASK);
- OMAP_HSMMC_WRITE(host->base, IE, INT_EN_MASK);
+
+ if (host->use_dma)
+ OMAP_HSMMC_WRITE(host->base, IE,
+ INT_EN_MASK & ~(BRR_ENABLE | BWR_ENABLE));
+ else
+ OMAP_HSMMC_WRITE(host->base, IE, INT_EN_MASK);
host->response_busy = 0;
if (cmd->flags & MMC_RSP_PRESENT) {
@@ -275,12 +468,20 @@
if (host->use_dma)
cmdreg |= DMA_EN;
+ /*
+ * In an interrupt context (i.e. STOP command), the spinlock is unlocked
+ * by the interrupt handler, otherwise (i.e. for a new request) it is
+ * unlocked here.
+ */
+ if (!in_interrupt())
+ spin_unlock_irqrestore(&host->irq_lock, host->flags);
+
OMAP_HSMMC_WRITE(host->base, ARG, cmd->arg);
OMAP_HSMMC_WRITE(host->base, CMD, cmdreg);
}
static int
-mmc_omap_get_dma_dir(struct mmc_omap_host *host, struct mmc_data *data)
+omap_hsmmc_get_dma_dir(struct omap_hsmmc_host *host, struct mmc_data *data)
{
if (data->flags & MMC_DATA_WRITE)
return DMA_TO_DEVICE;
@@ -292,11 +493,18 @@
* Notify the transfer complete to MMC core
*/
static void
-mmc_omap_xfer_done(struct mmc_omap_host *host, struct mmc_data *data)
+omap_hsmmc_xfer_done(struct omap_hsmmc_host *host, struct mmc_data *data)
{
if (!data) {
struct mmc_request *mrq = host->mrq;
+ /* TC before CC from CMD6 - don't know why, but it happens */
+ if (host->cmd && host->cmd->opcode == 6 &&
+ host->response_busy) {
+ host->response_busy = 0;
+ return;
+ }
+
host->mrq = NULL;
mmc_request_done(host->mmc, mrq);
return;
@@ -306,7 +514,7 @@
if (host->use_dma && host->dma_ch != -1)
dma_unmap_sg(mmc_dev(host->mmc), data->sg, host->dma_len,
- mmc_omap_get_dma_dir(host, data));
+ omap_hsmmc_get_dma_dir(host, data));
if (!data->error)
data->bytes_xfered += data->blocks * (data->blksz);
@@ -318,14 +526,14 @@
mmc_request_done(host->mmc, data->mrq);
return;
}
- mmc_omap_start_command(host, data->stop, NULL);
+ omap_hsmmc_start_command(host, data->stop, NULL);
}
/*
* Notify the core about command completion
*/
static void
-mmc_omap_cmd_done(struct mmc_omap_host *host, struct mmc_command *cmd)
+omap_hsmmc_cmd_done(struct omap_hsmmc_host *host, struct mmc_command *cmd)
{
host->cmd = NULL;
@@ -350,13 +558,13 @@
/*
* DMA clean up for command errors
*/
-static void mmc_dma_cleanup(struct mmc_omap_host *host, int errno)
+static void omap_hsmmc_dma_cleanup(struct omap_hsmmc_host *host, int errno)
{
host->data->error = errno;
if (host->use_dma && host->dma_ch != -1) {
dma_unmap_sg(mmc_dev(host->mmc), host->data->sg, host->dma_len,
- mmc_omap_get_dma_dir(host, host->data));
+ omap_hsmmc_get_dma_dir(host, host->data));
omap_free_dma(host->dma_ch);
host->dma_ch = -1;
up(&host->sem);
@@ -368,10 +576,10 @@
* Readable error output
*/
#ifdef CONFIG_MMC_DEBUG
-static void mmc_omap_report_irq(struct mmc_omap_host *host, u32 status)
+static void omap_hsmmc_report_irq(struct omap_hsmmc_host *host, u32 status)
{
/* --- means reserved bit without definition at documentation */
- static const char *mmc_omap_status_bits[] = {
+ static const char *omap_hsmmc_status_bits[] = {
"CC", "TC", "BGE", "---", "BWR", "BRR", "---", "---", "CIRQ",
"OBI", "---", "---", "---", "---", "---", "ERRI", "CTO", "CCRC",
"CEB", "CIE", "DTO", "DCRC", "DEB", "---", "ACE", "---",
@@ -384,9 +592,9 @@
len = sprintf(buf, "MMC IRQ 0x%x :", status);
buf += len;
- for (i = 0; i < ARRAY_SIZE(mmc_omap_status_bits); i++)
+ for (i = 0; i < ARRAY_SIZE(omap_hsmmc_status_bits); i++)
if (status & (1 << i)) {
- len = sprintf(buf, " %s", mmc_omap_status_bits[i]);
+ len = sprintf(buf, " %s", omap_hsmmc_status_bits[i]);
buf += len;
}
@@ -401,8 +609,8 @@
* SRC or SRD bit of SYSCTL register
* Can be called from interrupt context
*/
-static inline void mmc_omap_reset_controller_fsm(struct mmc_omap_host *host,
- unsigned long bit)
+static inline void omap_hsmmc_reset_controller_fsm(struct omap_hsmmc_host *host,
+ unsigned long bit)
{
unsigned long i = 0;
unsigned long limit = (loops_per_jiffy *
@@ -424,17 +632,20 @@
/*
* MMC controller IRQ handler
*/
-static irqreturn_t mmc_omap_irq(int irq, void *dev_id)
+static irqreturn_t omap_hsmmc_irq(int irq, void *dev_id)
{
- struct mmc_omap_host *host = dev_id;
+ struct omap_hsmmc_host *host = dev_id;
struct mmc_data *data;
int end_cmd = 0, end_trans = 0, status;
+ spin_lock(&host->irq_lock);
+
if (host->mrq == NULL) {
OMAP_HSMMC_WRITE(host->base, STAT,
OMAP_HSMMC_READ(host->base, STAT));
/* Flush posted write */
OMAP_HSMMC_READ(host->base, STAT);
+ spin_unlock(&host->irq_lock);
return IRQ_HANDLED;
}
@@ -444,13 +655,14 @@
if (status & ERR) {
#ifdef CONFIG_MMC_DEBUG
- mmc_omap_report_irq(host, status);
+ omap_hsmmc_report_irq(host, status);
#endif
if ((status & CMD_TIMEOUT) ||
(status & CMD_CRC)) {
if (host->cmd) {
if (status & CMD_TIMEOUT) {
- mmc_omap_reset_controller_fsm(host, SRC);
+ omap_hsmmc_reset_controller_fsm(host,
+ SRC);
host->cmd->error = -ETIMEDOUT;
} else {
host->cmd->error = -EILSEQ;
@@ -459,9 +671,10 @@
}
if (host->data || host->response_busy) {
if (host->data)
- mmc_dma_cleanup(host, -ETIMEDOUT);
+ omap_hsmmc_dma_cleanup(host,
+ -ETIMEDOUT);
host->response_busy = 0;
- mmc_omap_reset_controller_fsm(host, SRD);
+ omap_hsmmc_reset_controller_fsm(host, SRD);
}
}
if ((status & DATA_TIMEOUT) ||
@@ -471,11 +684,11 @@
-ETIMEDOUT : -EILSEQ;
if (host->data)
- mmc_dma_cleanup(host, err);
+ omap_hsmmc_dma_cleanup(host, err);
else
host->mrq->cmd->error = err;
host->response_busy = 0;
- mmc_omap_reset_controller_fsm(host, SRD);
+ omap_hsmmc_reset_controller_fsm(host, SRD);
end_trans = 1;
}
}
@@ -494,14 +707,16 @@
OMAP_HSMMC_READ(host->base, STAT);
if (end_cmd || ((status & CC) && host->cmd))
- mmc_omap_cmd_done(host, host->cmd);
- if (end_trans || (status & TC))
- mmc_omap_xfer_done(host, data);
+ omap_hsmmc_cmd_done(host, host->cmd);
+ if ((end_trans || (status & TC)) && host->mrq)
+ omap_hsmmc_xfer_done(host, data);
+
+ spin_unlock(&host->irq_lock);
return IRQ_HANDLED;
}
-static void set_sd_bus_power(struct mmc_omap_host *host)
+static void set_sd_bus_power(struct omap_hsmmc_host *host)
{
unsigned long i;
@@ -521,7 +736,7 @@
* The MMC2 transceiver controls are used instead of DAT4..DAT7.
* Some chips, like eMMC ones, use internal transceivers.
*/
-static int omap_mmc_switch_opcond(struct mmc_omap_host *host, int vdd)
+static int omap_hsmmc_switch_opcond(struct omap_hsmmc_host *host, int vdd)
{
u32 reg_val = 0;
int ret;
@@ -529,22 +744,24 @@
/* Disable the clocks */
clk_disable(host->fclk);
clk_disable(host->iclk);
- clk_disable(host->dbclk);
+ if (host->got_dbclk)
+ clk_disable(host->dbclk);
/* Turn the power off */
ret = mmc_slot(host).set_power(host->dev, host->slot_id, 0, 0);
- if (ret != 0)
- goto err;
/* Turn the power ON with given VDD 1.8 or 3.0v */
- ret = mmc_slot(host).set_power(host->dev, host->slot_id, 1, vdd);
+ if (!ret)
+ ret = mmc_slot(host).set_power(host->dev, host->slot_id, 1,
+ vdd);
+ clk_enable(host->iclk);
+ clk_enable(host->fclk);
+ if (host->got_dbclk)
+ clk_enable(host->dbclk);
+
if (ret != 0)
goto err;
- clk_enable(host->fclk);
- clk_enable(host->iclk);
- clk_enable(host->dbclk);
-
OMAP_HSMMC_WRITE(host->base, HCTL,
OMAP_HSMMC_READ(host->base, HCTL) & SDVSCLR);
reg_val = OMAP_HSMMC_READ(host->base, HCTL);
@@ -552,7 +769,7 @@
/*
* If a MMC dual voltage card is detected, the set_ios fn calls
* this fn with VDD bit set for 1.8V. Upon card removal from the
- * slot, omap_mmc_set_ios sets the VDD back to 3V on MMC_POWER_OFF.
+ * slot, omap_hsmmc_set_ios sets the VDD back to 3V on MMC_POWER_OFF.
*
* Cope with a bit of slop in the range ... per data sheets:
* - "1.8V" for vdds_mmc1/vdds_mmc1a can be up to 2.45V max,
@@ -578,25 +795,59 @@
return ret;
}
+/* Protect the card while the cover is open */
+static void omap_hsmmc_protect_card(struct omap_hsmmc_host *host)
+{
+ if (!mmc_slot(host).get_cover_state)
+ return;
+
+ host->reqs_blocked = 0;
+ if (mmc_slot(host).get_cover_state(host->dev, host->slot_id)) {
+ if (host->protect_card) {
+ printk(KERN_INFO "%s: cover is closed, "
+ "card is now accessible\n",
+ mmc_hostname(host->mmc));
+ host->protect_card = 0;
+ }
+ } else {
+ if (!host->protect_card) {
+ printk(KERN_INFO "%s: cover is open, "
+ "card is now inaccessible\n",
+ mmc_hostname(host->mmc));
+ host->protect_card = 1;
+ }
+ }
+}
+
/*
* Work Item to notify the core about card insertion/removal
*/
-static void mmc_omap_detect(struct work_struct *work)
+static void omap_hsmmc_detect(struct work_struct *work)
{
- struct mmc_omap_host *host = container_of(work, struct mmc_omap_host,
- mmc_carddetect_work);
+ struct omap_hsmmc_host *host =
+ container_of(work, struct omap_hsmmc_host, mmc_carddetect_work);
struct omap_mmc_slot_data *slot = &mmc_slot(host);
+ int carddetect;
- if (mmc_slot(host).card_detect)
- host->carddetect = slot->card_detect(slot->card_detect_irq);
- else
- host->carddetect = -ENOSYS;
+ if (host->suspended)
+ return;
sysfs_notify(&host->mmc->class_dev.kobj, NULL, "cover_switch");
- if (host->carddetect) {
+
+ if (slot->card_detect)
+ carddetect = slot->card_detect(slot->card_detect_irq);
+ else {
+ omap_hsmmc_protect_card(host);
+ carddetect = -ENOSYS;
+ }
+
+ if (carddetect) {
mmc_detect_change(host->mmc, (HZ * 200) / 1000);
} else {
- mmc_omap_reset_controller_fsm(host, SRD);
+ mmc_host_enable(host->mmc);
+ omap_hsmmc_reset_controller_fsm(host, SRD);
+ mmc_host_lazy_disable(host->mmc);
+
mmc_detect_change(host->mmc, (HZ * 50) / 1000);
}
}
@@ -604,16 +855,18 @@
/*
* ISR for handling card insertion and removal
*/
-static irqreturn_t omap_mmc_cd_handler(int irq, void *dev_id)
+static irqreturn_t omap_hsmmc_cd_handler(int irq, void *dev_id)
{
- struct mmc_omap_host *host = (struct mmc_omap_host *)dev_id;
+ struct omap_hsmmc_host *host = (struct omap_hsmmc_host *)dev_id;
+ if (host->suspended)
+ return IRQ_HANDLED;
schedule_work(&host->mmc_carddetect_work);
return IRQ_HANDLED;
}
-static int mmc_omap_get_dma_sync_dev(struct mmc_omap_host *host,
+static int omap_hsmmc_get_dma_sync_dev(struct omap_hsmmc_host *host,
struct mmc_data *data)
{
int sync_dev;
@@ -625,7 +878,7 @@
return sync_dev;
}
-static void mmc_omap_config_dma_params(struct mmc_omap_host *host,
+static void omap_hsmmc_config_dma_params(struct omap_hsmmc_host *host,
struct mmc_data *data,
struct scatterlist *sgl)
{
@@ -639,7 +892,7 @@
sg_dma_address(sgl), 0, 0);
} else {
omap_set_dma_src_params(dma_ch, 0, OMAP_DMA_AMODE_CONSTANT,
- (host->mapbase + OMAP_HSMMC_DATA), 0, 0);
+ (host->mapbase + OMAP_HSMMC_DATA), 0, 0);
omap_set_dma_dest_params(dma_ch, 0, OMAP_DMA_AMODE_POST_INC,
sg_dma_address(sgl), 0, 0);
}
@@ -649,7 +902,7 @@
omap_set_dma_transfer_params(dma_ch, OMAP_DMA_DATA_TYPE_S32,
blksz / 4, nblk, OMAP_DMA_SYNC_FRAME,
- mmc_omap_get_dma_sync_dev(host, data),
+ omap_hsmmc_get_dma_sync_dev(host, data),
!(data->flags & MMC_DATA_WRITE));
omap_start_dma(dma_ch);
@@ -658,9 +911,9 @@
/*
* DMA call back function
*/
-static void mmc_omap_dma_cb(int lch, u16 ch_status, void *data)
+static void omap_hsmmc_dma_cb(int lch, u16 ch_status, void *data)
{
- struct mmc_omap_host *host = data;
+ struct omap_hsmmc_host *host = data;
if (ch_status & OMAP2_DMA_MISALIGNED_ERR_IRQ)
dev_dbg(mmc_dev(host->mmc), "MISALIGNED_ADRS_ERR\n");
@@ -671,7 +924,7 @@
host->dma_sg_idx++;
if (host->dma_sg_idx < host->dma_len) {
/* Fire up the next transfer. */
- mmc_omap_config_dma_params(host, host->data,
+ omap_hsmmc_config_dma_params(host, host->data,
host->data->sg + host->dma_sg_idx);
return;
}
@@ -688,14 +941,14 @@
/*
* Routine to configure and start DMA for the MMC card
*/
-static int
-mmc_omap_start_dma_transfer(struct mmc_omap_host *host, struct mmc_request *req)
+static int omap_hsmmc_start_dma_transfer(struct omap_hsmmc_host *host,
+ struct mmc_request *req)
{
int dma_ch = 0, ret = 0, err = 1, i;
struct mmc_data *data = req->data;
/* Sanity check: all the SG entries must be aligned by block size. */
- for (i = 0; i < host->dma_len; i++) {
+ for (i = 0; i < data->sg_len; i++) {
struct scatterlist *sgl;
sgl = data->sg + i;
@@ -726,8 +979,8 @@
return err;
}
- ret = omap_request_dma(mmc_omap_get_dma_sync_dev(host, data), "MMC/SD",
- mmc_omap_dma_cb,host, &dma_ch);
+ ret = omap_request_dma(omap_hsmmc_get_dma_sync_dev(host, data),
+ "MMC/SD", omap_hsmmc_dma_cb, host, &dma_ch);
if (ret != 0) {
dev_err(mmc_dev(host->mmc),
"%s: omap_request_dma() failed with %d\n",
@@ -736,17 +989,18 @@
}
host->dma_len = dma_map_sg(mmc_dev(host->mmc), data->sg,
- data->sg_len, mmc_omap_get_dma_dir(host, data));
+ data->sg_len, omap_hsmmc_get_dma_dir(host, data));
host->dma_ch = dma_ch;
host->dma_sg_idx = 0;
- mmc_omap_config_dma_params(host, data, data->sg);
+ omap_hsmmc_config_dma_params(host, data, data->sg);
return 0;
}
-static void set_data_timeout(struct mmc_omap_host *host,
- struct mmc_request *req)
+static void set_data_timeout(struct omap_hsmmc_host *host,
+ unsigned int timeout_ns,
+ unsigned int timeout_clks)
{
unsigned int timeout, cycle_ns;
uint32_t reg, clkd, dto = 0;
@@ -757,8 +1011,8 @@
clkd = 1;
cycle_ns = 1000000000 / (clk_get_rate(host->fclk) / clkd);
- timeout = req->data->timeout_ns / cycle_ns;
- timeout += req->data->timeout_clks;
+ timeout = timeout_ns / cycle_ns;
+ timeout += timeout_clks;
if (timeout) {
while ((timeout & 0x80000000) == 0) {
dto += 1;
@@ -785,22 +1039,28 @@
* Configure block length for MMC/SD cards and initiate the transfer.
*/
static int
-mmc_omap_prepare_data(struct mmc_omap_host *host, struct mmc_request *req)
+omap_hsmmc_prepare_data(struct omap_hsmmc_host *host, struct mmc_request *req)
{
int ret;
host->data = req->data;
if (req->data == NULL) {
OMAP_HSMMC_WRITE(host->base, BLK, 0);
+ /*
+ * Set an arbitrary 100ms data timeout for commands with
+ * busy signal.
+ */
+ if (req->cmd->flags & MMC_RSP_BUSY)
+ set_data_timeout(host, 100000000U, 0);
return 0;
}
OMAP_HSMMC_WRITE(host->base, BLK, (req->data->blksz)
| (req->data->blocks << 16));
- set_data_timeout(host, req);
+ set_data_timeout(host, req->data->timeout_ns, req->data->timeout_clks);
if (host->use_dma) {
- ret = mmc_omap_start_dma_transfer(host, req);
+ ret = omap_hsmmc_start_dma_transfer(host, req);
if (ret != 0) {
dev_dbg(mmc_dev(host->mmc), "MMC start dma failure\n");
return ret;
@@ -812,35 +1072,92 @@
/*
* Request function. for read/write operation
*/
-static void omap_mmc_request(struct mmc_host *mmc, struct mmc_request *req)
+static void omap_hsmmc_request(struct mmc_host *mmc, struct mmc_request *req)
{
- struct mmc_omap_host *host = mmc_priv(mmc);
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
+ int err;
+ /*
+ * Prevent races with the interrupt handler because of unexpected
+ * interrupts, but not if we are already in interrupt context i.e.
+ * retries.
+ */
+ if (!in_interrupt()) {
+ spin_lock_irqsave(&host->irq_lock, host->flags);
+ /*
+ * Protect the card from I/O if there is a possibility
+ * it can be removed.
+ */
+ if (host->protect_card) {
+ if (host->reqs_blocked < 3) {
+ /*
+ * Ensure the controller is left in a consistent
+ * state by resetting the command and data state
+ * machines.
+ */
+ omap_hsmmc_reset_controller_fsm(host, SRD);
+ omap_hsmmc_reset_controller_fsm(host, SRC);
+ host->reqs_blocked += 1;
+ }
+ req->cmd->error = -EBADF;
+ if (req->data)
+ req->data->error = -EBADF;
+ spin_unlock_irqrestore(&host->irq_lock, host->flags);
+ mmc_request_done(mmc, req);
+ return;
+ } else if (host->reqs_blocked)
+ host->reqs_blocked = 0;
+ }
WARN_ON(host->mrq != NULL);
host->mrq = req;
- mmc_omap_prepare_data(host, req);
- mmc_omap_start_command(host, req->cmd, req->data);
+ err = omap_hsmmc_prepare_data(host, req);
+ if (err) {
+ req->cmd->error = err;
+ if (req->data)
+ req->data->error = err;
+ host->mrq = NULL;
+ if (!in_interrupt())
+ spin_unlock_irqrestore(&host->irq_lock, host->flags);
+ mmc_request_done(mmc, req);
+ return;
+ }
+
+ omap_hsmmc_start_command(host, req->cmd, req->data);
}
-
/* Routine to configure clock values. Exposed API to core */
-static void omap_mmc_set_ios(struct mmc_host *mmc, struct mmc_ios *ios)
+static void omap_hsmmc_set_ios(struct mmc_host *mmc, struct mmc_ios *ios)
{
- struct mmc_omap_host *host = mmc_priv(mmc);
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
u16 dsor = 0;
unsigned long regval;
unsigned long timeout;
u32 con;
+ int do_send_init_stream = 0;
- switch (ios->power_mode) {
- case MMC_POWER_OFF:
- mmc_slot(host).set_power(host->dev, host->slot_id, 0, 0);
- break;
- case MMC_POWER_UP:
- mmc_slot(host).set_power(host->dev, host->slot_id, 1, ios->vdd);
- break;
+ mmc_host_enable(host->mmc);
+
+ if (ios->power_mode != host->power_mode) {
+ switch (ios->power_mode) {
+ case MMC_POWER_OFF:
+ mmc_slot(host).set_power(host->dev, host->slot_id,
+ 0, 0);
+ host->vdd = 0;
+ break;
+ case MMC_POWER_UP:
+ mmc_slot(host).set_power(host->dev, host->slot_id,
+ 1, ios->vdd);
+ host->vdd = ios->vdd;
+ break;
+ case MMC_POWER_ON:
+ do_send_init_stream = 1;
+ break;
+ }
+ host->power_mode = ios->power_mode;
}
+ /* FIXME: set registers based only on changes to ios */
+
con = OMAP_HSMMC_READ(host->base, CON);
switch (mmc->ios.bus_width) {
case MMC_BUS_WIDTH_8:
@@ -870,8 +1187,8 @@
* MMC_POWER_UP upon recalculating the voltage.
* vdd 1.8v.
*/
- if (omap_mmc_switch_opcond(host, ios->vdd) != 0)
- dev_dbg(mmc_dev(host->mmc),
+ if (omap_hsmmc_switch_opcond(host, ios->vdd) != 0)
+ dev_dbg(mmc_dev(host->mmc),
"Switch operation failed\n");
}
}
@@ -887,7 +1204,7 @@
if (dsor > 250)
dsor = 250;
}
- omap_mmc_stop_clock(host);
+ omap_hsmmc_stop_clock(host);
regval = OMAP_HSMMC_READ(host->base, SYSCTL);
regval = regval & ~(CLKD_MASK);
regval = regval | (dsor << 6) | (DTO << 16);
@@ -897,42 +1214,47 @@
/* Wait till the ICS bit is set */
timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
- while ((OMAP_HSMMC_READ(host->base, SYSCTL) & ICS) != 0x2
+ while ((OMAP_HSMMC_READ(host->base, SYSCTL) & ICS) != ICS
&& time_before(jiffies, timeout))
msleep(1);
OMAP_HSMMC_WRITE(host->base, SYSCTL,
OMAP_HSMMC_READ(host->base, SYSCTL) | CEN);
- if (ios->power_mode == MMC_POWER_ON)
+ if (do_send_init_stream)
send_init_stream(host);
+ con = OMAP_HSMMC_READ(host->base, CON);
if (ios->bus_mode == MMC_BUSMODE_OPENDRAIN)
- OMAP_HSMMC_WRITE(host->base, CON,
- OMAP_HSMMC_READ(host->base, CON) | OD);
+ OMAP_HSMMC_WRITE(host->base, CON, con | OD);
+ else
+ OMAP_HSMMC_WRITE(host->base, CON, con & ~OD);
+
+ if (host->power_mode == MMC_POWER_OFF)
+ mmc_host_disable(host->mmc);
+ else
+ mmc_host_lazy_disable(host->mmc);
}
static int omap_hsmmc_get_cd(struct mmc_host *mmc)
{
- struct mmc_omap_host *host = mmc_priv(mmc);
- struct omap_mmc_platform_data *pdata = host->pdata;
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
- if (!pdata->slots[0].card_detect)
+ if (!mmc_slot(host).card_detect)
return -ENOSYS;
- return pdata->slots[0].card_detect(pdata->slots[0].card_detect_irq);
+ return mmc_slot(host).card_detect(mmc_slot(host).card_detect_irq);
}
static int omap_hsmmc_get_ro(struct mmc_host *mmc)
{
- struct mmc_omap_host *host = mmc_priv(mmc);
- struct omap_mmc_platform_data *pdata = host->pdata;
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
- if (!pdata->slots[0].get_ro)
+ if (!mmc_slot(host).get_ro)
return -ENOSYS;
- return pdata->slots[0].get_ro(host->dev, 0);
+ return mmc_slot(host).get_ro(host->dev, 0);
}
-static void omap_hsmmc_init(struct mmc_omap_host *host)
+static void omap_hsmmc_conf_bus_power(struct omap_hsmmc_host *host)
{
u32 hctl, capa, value;
@@ -959,19 +1281,340 @@
set_sd_bus_power(host);
}
-static struct mmc_host_ops mmc_omap_ops = {
- .request = omap_mmc_request,
- .set_ios = omap_mmc_set_ios,
+/*
+ * Dynamic power saving handling, FSM:
+ * ENABLED -> DISABLED -> CARDSLEEP / REGSLEEP -> OFF
+ * ^___________| | |
+ * |______________________|______________________|
+ *
+ * ENABLED: mmc host is fully functional
+ * DISABLED: fclk is off
+ * CARDSLEEP: fclk is off, card is asleep, voltage regulator is asleep
+ * REGSLEEP: fclk is off, voltage regulator is asleep
+ * OFF: fclk is off, voltage regulator is off
+ *
+ * Transition handlers return the timeout for the next state transition
+ * or negative error.
+ */
+
+enum {ENABLED = 0, DISABLED, CARDSLEEP, REGSLEEP, OFF};
+
+/* Handler for [ENABLED -> DISABLED] transition */
+static int omap_hsmmc_enabled_to_disabled(struct omap_hsmmc_host *host)
+{
+ omap_hsmmc_context_save(host);
+ clk_disable(host->fclk);
+ host->dpm_state = DISABLED;
+
+ dev_dbg(mmc_dev(host->mmc), "ENABLED -> DISABLED\n");
+
+ if (host->power_mode == MMC_POWER_OFF)
+ return 0;
+
+ return msecs_to_jiffies(OMAP_MMC_SLEEP_TIMEOUT);
+}
+
+/* Handler for [DISABLED -> REGSLEEP / CARDSLEEP] transition */
+static int omap_hsmmc_disabled_to_sleep(struct omap_hsmmc_host *host)
+{
+ int err, new_state;
+
+ if (!mmc_try_claim_host(host->mmc))
+ return 0;
+
+ clk_enable(host->fclk);
+ omap_hsmmc_context_restore(host);
+ if (mmc_card_can_sleep(host->mmc)) {
+ err = mmc_card_sleep(host->mmc);
+ if (err < 0) {
+ clk_disable(host->fclk);
+ mmc_release_host(host->mmc);
+ return err;
+ }
+ new_state = CARDSLEEP;
+ } else {
+ new_state = REGSLEEP;
+ }
+ if (mmc_slot(host).set_sleep)
+ mmc_slot(host).set_sleep(host->dev, host->slot_id, 1, 0,
+ new_state == CARDSLEEP);
+ /* FIXME: turn off bus power and perhaps interrupts too */
+ clk_disable(host->fclk);
+ host->dpm_state = new_state;
+
+ mmc_release_host(host->mmc);
+
+ dev_dbg(mmc_dev(host->mmc), "DISABLED -> %s\n",
+ host->dpm_state == CARDSLEEP ? "CARDSLEEP" : "REGSLEEP");
+
+ if ((host->mmc->caps & MMC_CAP_NONREMOVABLE) ||
+ mmc_slot(host).card_detect ||
+ (mmc_slot(host).get_cover_state &&
+ mmc_slot(host).get_cover_state(host->dev, host->slot_id)))
+ return msecs_to_jiffies(OMAP_MMC_OFF_TIMEOUT);
+
+ return 0;
+}
+
+/* Handler for [REGSLEEP / CARDSLEEP -> OFF] transition */
+static int omap_hsmmc_sleep_to_off(struct omap_hsmmc_host *host)
+{
+ if (!mmc_try_claim_host(host->mmc))
+ return 0;
+
+ if (!((host->mmc->caps & MMC_CAP_NONREMOVABLE) ||
+ mmc_slot(host).card_detect ||
+ (mmc_slot(host).get_cover_state &&
+ mmc_slot(host).get_cover_state(host->dev, host->slot_id)))) {
+ mmc_release_host(host->mmc);
+ return 0;
+ }
+
+ mmc_slot(host).set_power(host->dev, host->slot_id, 0, 0);
+ host->vdd = 0;
+ host->power_mode = MMC_POWER_OFF;
+
+ dev_dbg(mmc_dev(host->mmc), "%s -> OFF\n",
+ host->dpm_state == CARDSLEEP ? "CARDSLEEP" : "REGSLEEP");
+
+ host->dpm_state = OFF;
+
+ mmc_release_host(host->mmc);
+
+ return 0;
+}
+
+/* Handler for [DISABLED -> ENABLED] transition */
+static int omap_hsmmc_disabled_to_enabled(struct omap_hsmmc_host *host)
+{
+ int err;
+
+ err = clk_enable(host->fclk);
+ if (err < 0)
+ return err;
+
+ omap_hsmmc_context_restore(host);
+ host->dpm_state = ENABLED;
+
+ dev_dbg(mmc_dev(host->mmc), "DISABLED -> ENABLED\n");
+
+ return 0;
+}
+
+/* Handler for [SLEEP -> ENABLED] transition */
+static int omap_hsmmc_sleep_to_enabled(struct omap_hsmmc_host *host)
+{
+ if (!mmc_try_claim_host(host->mmc))
+ return 0;
+
+ clk_enable(host->fclk);
+ omap_hsmmc_context_restore(host);
+ if (mmc_slot(host).set_sleep)
+ mmc_slot(host).set_sleep(host->dev, host->slot_id, 0,
+ host->vdd, host->dpm_state == CARDSLEEP);
+ if (mmc_card_can_sleep(host->mmc))
+ mmc_card_awake(host->mmc);
+
+ dev_dbg(mmc_dev(host->mmc), "%s -> ENABLED\n",
+ host->dpm_state == CARDSLEEP ? "CARDSLEEP" : "REGSLEEP");
+
+ host->dpm_state = ENABLED;
+
+ mmc_release_host(host->mmc);
+
+ return 0;
+}
+
+/* Handler for [OFF -> ENABLED] transition */
+static int omap_hsmmc_off_to_enabled(struct omap_hsmmc_host *host)
+{
+ clk_enable(host->fclk);
+
+ omap_hsmmc_context_restore(host);
+ omap_hsmmc_conf_bus_power(host);
+ mmc_power_restore_host(host->mmc);
+
+ host->dpm_state = ENABLED;
+
+ dev_dbg(mmc_dev(host->mmc), "OFF -> ENABLED\n");
+
+ return 0;
+}
+
+/*
+ * Bring MMC host to ENABLED from any other PM state.
+ */
+static int omap_hsmmc_enable(struct mmc_host *mmc)
+{
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
+
+ switch (host->dpm_state) {
+ case DISABLED:
+ return omap_hsmmc_disabled_to_enabled(host);
+ case CARDSLEEP:
+ case REGSLEEP:
+ return omap_hsmmc_sleep_to_enabled(host);
+ case OFF:
+ return omap_hsmmc_off_to_enabled(host);
+ default:
+ dev_dbg(mmc_dev(host->mmc), "UNKNOWN state\n");
+ return -EINVAL;
+ }
+}
+
+/*
+ * Bring MMC host in PM state (one level deeper).
+ */
+static int omap_hsmmc_disable(struct mmc_host *mmc, int lazy)
+{
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
+
+ switch (host->dpm_state) {
+ case ENABLED: {
+ int delay;
+
+ delay = omap_hsmmc_enabled_to_disabled(host);
+ if (lazy || delay < 0)
+ return delay;
+ return 0;
+ }
+ case DISABLED:
+ return omap_hsmmc_disabled_to_sleep(host);
+ case CARDSLEEP:
+ case REGSLEEP:
+ return omap_hsmmc_sleep_to_off(host);
+ default:
+ dev_dbg(mmc_dev(host->mmc), "UNKNOWN state\n");
+ return -EINVAL;
+ }
+}
+
+static int omap_hsmmc_enable_fclk(struct mmc_host *mmc)
+{
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
+ int err;
+
+ err = clk_enable(host->fclk);
+ if (err)
+ return err;
+ dev_dbg(mmc_dev(host->mmc), "mmc_fclk: enabled\n");
+ omap_hsmmc_context_restore(host);
+ return 0;
+}
+
+static int omap_hsmmc_disable_fclk(struct mmc_host *mmc, int lazy)
+{
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
+
+ omap_hsmmc_context_save(host);
+ clk_disable(host->fclk);
+ dev_dbg(mmc_dev(host->mmc), "mmc_fclk: disabled\n");
+ return 0;
+}
+
+static const struct mmc_host_ops omap_hsmmc_ops = {
+ .enable = omap_hsmmc_enable_fclk,
+ .disable = omap_hsmmc_disable_fclk,
+ .request = omap_hsmmc_request,
+ .set_ios = omap_hsmmc_set_ios,
.get_cd = omap_hsmmc_get_cd,
.get_ro = omap_hsmmc_get_ro,
/* NYET -- enable_sdio_irq */
};
-static int __init omap_mmc_probe(struct platform_device *pdev)
+static const struct mmc_host_ops omap_hsmmc_ps_ops = {
+ .enable = omap_hsmmc_enable,
+ .disable = omap_hsmmc_disable,
+ .request = omap_hsmmc_request,
+ .set_ios = omap_hsmmc_set_ios,
+ .get_cd = omap_hsmmc_get_cd,
+ .get_ro = omap_hsmmc_get_ro,
+ /* NYET -- enable_sdio_irq */
+};
+
+#ifdef CONFIG_DEBUG_FS
+
+static int omap_hsmmc_regs_show(struct seq_file *s, void *data)
+{
+ struct mmc_host *mmc = s->private;
+ struct omap_hsmmc_host *host = mmc_priv(mmc);
+ int context_loss = 0;
+
+ if (host->pdata->get_context_loss_count)
+ context_loss = host->pdata->get_context_loss_count(host->dev);
+
+ seq_printf(s, "mmc%d:\n"
+ " enabled:\t%d\n"
+ " dpm_state:\t%d\n"
+ " nesting_cnt:\t%d\n"
+ " ctx_loss:\t%d:%d\n"
+ "\nregs:\n",
+ mmc->index, mmc->enabled ? 1 : 0,
+ host->dpm_state, mmc->nesting_cnt,
+ host->context_loss, context_loss);
+
+ if (host->suspended || host->dpm_state == OFF) {
+ seq_printf(s, "host suspended, can't read registers\n");
+ return 0;
+ }
+
+ if (clk_enable(host->fclk) != 0) {
+ seq_printf(s, "can't read the regs\n");
+ return 0;
+ }
+
+ seq_printf(s, "SYSCONFIG:\t0x%08x\n",
+ OMAP_HSMMC_READ(host->base, SYSCONFIG));
+ seq_printf(s, "CON:\t\t0x%08x\n",
+ OMAP_HSMMC_READ(host->base, CON));
+ seq_printf(s, "HCTL:\t\t0x%08x\n",
+ OMAP_HSMMC_READ(host->base, HCTL));
+ seq_printf(s, "SYSCTL:\t\t0x%08x\n",
+ OMAP_HSMMC_READ(host->base, SYSCTL));
+ seq_printf(s, "IE:\t\t0x%08x\n",
+ OMAP_HSMMC_READ(host->base, IE));
+ seq_printf(s, "ISE:\t\t0x%08x\n",
+ OMAP_HSMMC_READ(host->base, ISE));
+ seq_printf(s, "CAPA:\t\t0x%08x\n",
+ OMAP_HSMMC_READ(host->base, CAPA));
+
+ clk_disable(host->fclk);
+
+ return 0;
+}
+
+static int omap_hsmmc_regs_open(struct inode *inode, struct file *file)
+{
+ return single_open(file, omap_hsmmc_regs_show, inode->i_private);
+}
+
+static const struct file_operations mmc_regs_fops = {
+ .open = omap_hsmmc_regs_open,
+ .read = seq_read,
+ .llseek = seq_lseek,
+ .release = single_release,
+};
+
+static void omap_hsmmc_debugfs(struct mmc_host *mmc)
+{
+ if (mmc->debugfs_root)
+ debugfs_create_file("regs", S_IRUSR, mmc->debugfs_root,
+ mmc, &mmc_regs_fops);
+}
+
+#else
+
+static void omap_hsmmc_debugfs(struct mmc_host *mmc)
+{
+}
+
+#endif
+
+static int __init omap_hsmmc_probe(struct platform_device *pdev)
{
struct omap_mmc_platform_data *pdata = pdev->dev.platform_data;
struct mmc_host *mmc;
- struct mmc_omap_host *host = NULL;
+ struct omap_hsmmc_host *host = NULL;
struct resource *res;
int ret = 0, irq;
@@ -995,7 +1638,7 @@
if (res == NULL)
return -EBUSY;
- mmc = mmc_alloc_host(sizeof(struct mmc_omap_host), &pdev->dev);
+ mmc = mmc_alloc_host(sizeof(struct omap_hsmmc_host), &pdev->dev);
if (!mmc) {
ret = -ENOMEM;
goto err;
@@ -1013,15 +1656,21 @@
host->slot_id = 0;
host->mapbase = res->start;
host->base = ioremap(host->mapbase, SZ_4K);
+ host->power_mode = -1;
platform_set_drvdata(pdev, host);
- INIT_WORK(&host->mmc_carddetect_work, mmc_omap_detect);
+ INIT_WORK(&host->mmc_carddetect_work, omap_hsmmc_detect);
- mmc->ops = &mmc_omap_ops;
+ if (mmc_slot(host).power_saving)
+ mmc->ops = &omap_hsmmc_ps_ops;
+ else
+ mmc->ops = &omap_hsmmc_ops;
+
mmc->f_min = 400000;
mmc->f_max = 52000000;
sema_init(&host->sem, 1);
+ spin_lock_init(&host->irq_lock);
host->iclk = clk_get(&pdev->dev, "ick");
if (IS_ERR(host->iclk)) {
@@ -1037,31 +1686,42 @@
goto err1;
}
- if (clk_enable(host->fclk) != 0) {
+ omap_hsmmc_context_save(host);
+
+ mmc->caps |= MMC_CAP_DISABLE;
+ mmc_set_disable_delay(mmc, OMAP_MMC_DISABLED_TIMEOUT);
+ /* we start off in DISABLED state */
+ host->dpm_state = DISABLED;
+
+ if (mmc_host_enable(host->mmc) != 0) {
clk_put(host->iclk);
clk_put(host->fclk);
goto err1;
}
if (clk_enable(host->iclk) != 0) {
- clk_disable(host->fclk);
+ mmc_host_disable(host->mmc);
clk_put(host->iclk);
clk_put(host->fclk);
goto err1;
}
- host->dbclk = clk_get(&pdev->dev, "mmchsdb_fck");
- /*
- * MMC can still work without debounce clock.
- */
- if (IS_ERR(host->dbclk))
- dev_warn(mmc_dev(host->mmc), "Failed to get debounce clock\n");
- else
- if (clk_enable(host->dbclk) != 0)
- dev_dbg(mmc_dev(host->mmc), "Enabling debounce"
- " clk failed\n");
+ if (cpu_is_omap2430()) {
+ host->dbclk = clk_get(&pdev->dev, "mmchsdb_fck");
+ /*
+ * MMC can still work without debounce clock.
+ */
+ if (IS_ERR(host->dbclk))
+ dev_warn(mmc_dev(host->mmc),
+ "Failed to get debounce clock\n");
else
- host->dbclk_enabled = 1;
+ host->got_dbclk = 1;
+
+ if (host->got_dbclk)
+ if (clk_enable(host->dbclk) != 0)
+ dev_dbg(mmc_dev(host->mmc), "Enabling debounce"
+ " clk failed\n");
+ }
/* Since we do only SG emulation, we can have as many segs
* as we want. */
@@ -1073,14 +1733,18 @@
mmc->max_req_size = mmc->max_blk_size * mmc->max_blk_count;
mmc->max_seg_size = mmc->max_req_size;
- mmc->caps |= MMC_CAP_MMC_HIGHSPEED | MMC_CAP_SD_HIGHSPEED;
+ mmc->caps |= MMC_CAP_MMC_HIGHSPEED | MMC_CAP_SD_HIGHSPEED |
+ MMC_CAP_WAIT_WHILE_BUSY;
- if (pdata->slots[host->slot_id].wires >= 8)
+ if (mmc_slot(host).wires >= 8)
mmc->caps |= MMC_CAP_8_BIT_DATA;
- else if (pdata->slots[host->slot_id].wires >= 4)
+ else if (mmc_slot(host).wires >= 4)
mmc->caps |= MMC_CAP_4_BIT_DATA;
- omap_hsmmc_init(host);
+ if (mmc_slot(host).nonremovable)
+ mmc->caps |= MMC_CAP_NONREMOVABLE;
+
+ omap_hsmmc_conf_bus_power(host);
/* Select DMA lines */
switch (host->id) {
@@ -1096,13 +1760,21 @@
host->dma_line_tx = OMAP34XX_DMA_MMC3_TX;
host->dma_line_rx = OMAP34XX_DMA_MMC3_RX;
break;
+ case OMAP_MMC4_DEVID:
+ host->dma_line_tx = OMAP44XX_DMA_MMC4_TX;
+ host->dma_line_rx = OMAP44XX_DMA_MMC4_RX;
+ break;
+ case OMAP_MMC5_DEVID:
+ host->dma_line_tx = OMAP44XX_DMA_MMC5_TX;
+ host->dma_line_rx = OMAP44XX_DMA_MMC5_RX;
+ break;
default:
dev_err(mmc_dev(host->mmc), "Invalid MMC id\n");
goto err_irq;
}
/* Request IRQ for MMC operations */
- ret = request_irq(host->irq, mmc_omap_irq, IRQF_DISABLED,
+ ret = request_irq(host->irq, omap_hsmmc_irq, IRQF_DISABLED,
mmc_hostname(mmc), host);
if (ret) {
dev_dbg(mmc_dev(host->mmc), "Unable to grab HSMMC IRQ\n");
@@ -1112,7 +1784,8 @@
/* initialize power supplies, gpios, etc */
if (pdata->init != NULL) {
if (pdata->init(&pdev->dev) != 0) {
- dev_dbg(mmc_dev(host->mmc), "late init error\n");
+ dev_dbg(mmc_dev(host->mmc),
+ "Unable to configure MMC IRQs\n");
goto err_irq_cd_init;
}
}
@@ -1121,7 +1794,7 @@
/* Request IRQ for card detect */
if ((mmc_slot(host).card_detect_irq)) {
ret = request_irq(mmc_slot(host).card_detect_irq,
- omap_mmc_cd_handler,
+ omap_hsmmc_cd_handler,
IRQF_TRIGGER_RISING | IRQF_TRIGGER_FALLING
| IRQF_DISABLED,
mmc_hostname(mmc), host);
@@ -1135,21 +1808,26 @@
OMAP_HSMMC_WRITE(host->base, ISE, INT_EN_MASK);
OMAP_HSMMC_WRITE(host->base, IE, INT_EN_MASK);
+ mmc_host_lazy_disable(host->mmc);
+
+ omap_hsmmc_protect_card(host);
+
mmc_add_host(mmc);
- if (host->pdata->slots[host->slot_id].name != NULL) {
+ if (mmc_slot(host).name != NULL) {
ret = device_create_file(&mmc->class_dev, &dev_attr_slot_name);
if (ret < 0)
goto err_slot_name;
}
- if (mmc_slot(host).card_detect_irq &&
- host->pdata->slots[host->slot_id].get_cover_state) {
+ if (mmc_slot(host).card_detect_irq && mmc_slot(host).get_cover_state) {
ret = device_create_file(&mmc->class_dev,
&dev_attr_cover_switch);
if (ret < 0)
goto err_cover_switch;
}
+ omap_hsmmc_debugfs(mmc);
+
return 0;
err_cover_switch:
@@ -1161,11 +1839,11 @@
err_irq_cd_init:
free_irq(host->irq, host);
err_irq:
- clk_disable(host->fclk);
+ mmc_host_disable(host->mmc);
clk_disable(host->iclk);
clk_put(host->fclk);
clk_put(host->iclk);
- if (host->dbclk_enabled) {
+ if (host->got_dbclk) {
clk_disable(host->dbclk);
clk_put(host->dbclk);
}
@@ -1180,12 +1858,13 @@
return ret;
}
-static int omap_mmc_remove(struct platform_device *pdev)
+static int omap_hsmmc_remove(struct platform_device *pdev)
{
- struct mmc_omap_host *host = platform_get_drvdata(pdev);
+ struct omap_hsmmc_host *host = platform_get_drvdata(pdev);
struct resource *res;
if (host) {
+ mmc_host_enable(host->mmc);
mmc_remove_host(host->mmc);
if (host->pdata->cleanup)
host->pdata->cleanup(&pdev->dev);
@@ -1194,11 +1873,11 @@
free_irq(mmc_slot(host).card_detect_irq, host);
flush_scheduled_work();
- clk_disable(host->fclk);
+ mmc_host_disable(host->mmc);
clk_disable(host->iclk);
clk_put(host->fclk);
clk_put(host->iclk);
- if (host->dbclk_enabled) {
+ if (host->got_dbclk) {
clk_disable(host->dbclk);
clk_put(host->dbclk);
}
@@ -1216,36 +1895,51 @@
}
#ifdef CONFIG_PM
-static int omap_mmc_suspend(struct platform_device *pdev, pm_message_t state)
+static int omap_hsmmc_suspend(struct platform_device *pdev, pm_message_t state)
{
int ret = 0;
- struct mmc_omap_host *host = platform_get_drvdata(pdev);
+ struct omap_hsmmc_host *host = platform_get_drvdata(pdev);
if (host && host->suspended)
return 0;
if (host) {
+ host->suspended = 1;
+ if (host->pdata->suspend) {
+ ret = host->pdata->suspend(&pdev->dev,
+ host->slot_id);
+ if (ret) {
+ dev_dbg(mmc_dev(host->mmc),
+ "Unable to handle MMC board"
+ " level suspend\n");
+ host->suspended = 0;
+ return ret;
+ }
+ }
+ cancel_work_sync(&host->mmc_carddetect_work);
+ mmc_host_enable(host->mmc);
ret = mmc_suspend_host(host->mmc, state);
if (ret == 0) {
- host->suspended = 1;
-
OMAP_HSMMC_WRITE(host->base, ISE, 0);
OMAP_HSMMC_WRITE(host->base, IE, 0);
- if (host->pdata->suspend) {
- ret = host->pdata->suspend(&pdev->dev,
- host->slot_id);
- if (ret)
- dev_dbg(mmc_dev(host->mmc),
- "Unable to handle MMC board"
- " level suspend\n");
- }
OMAP_HSMMC_WRITE(host->base, HCTL,
- OMAP_HSMMC_READ(host->base, HCTL) & ~SDBP);
- clk_disable(host->fclk);
+ OMAP_HSMMC_READ(host->base, HCTL) & ~SDBP);
+ mmc_host_disable(host->mmc);
clk_disable(host->iclk);
- clk_disable(host->dbclk);
+ if (host->got_dbclk)
+ clk_disable(host->dbclk);
+ } else {
+ host->suspended = 0;
+ if (host->pdata->resume) {
+ ret = host->pdata->resume(&pdev->dev,
+ host->slot_id);
+ if (ret)
+ dev_dbg(mmc_dev(host->mmc),
+ "Unmask interrupt failed\n");
+ }
+ mmc_host_disable(host->mmc);
}
}
@@ -1253,32 +1947,28 @@
}
/* Routine to resume the MMC device */
-static int omap_mmc_resume(struct platform_device *pdev)
+static int omap_hsmmc_resume(struct platform_device *pdev)
{
int ret = 0;
- struct mmc_omap_host *host = platform_get_drvdata(pdev);
+ struct omap_hsmmc_host *host = platform_get_drvdata(pdev);
if (host && !host->suspended)
return 0;
if (host) {
-
- ret = clk_enable(host->fclk);
+ ret = clk_enable(host->iclk);
if (ret)
goto clk_en_err;
- ret = clk_enable(host->iclk);
- if (ret) {
- clk_disable(host->fclk);
- clk_put(host->fclk);
+ if (mmc_host_enable(host->mmc) != 0) {
+ clk_disable(host->iclk);
goto clk_en_err;
}
- if (clk_enable(host->dbclk) != 0)
- dev_dbg(mmc_dev(host->mmc),
- "Enabling debounce clk failed\n");
+ if (host->got_dbclk)
+ clk_enable(host->dbclk);
- omap_hsmmc_init(host);
+ omap_hsmmc_conf_bus_power(host);
if (host->pdata->resume) {
ret = host->pdata->resume(&pdev->dev, host->slot_id);
@@ -1287,10 +1977,14 @@
"Unmask interrupt failed\n");
}
+ omap_hsmmc_protect_card(host);
+
/* Notify the core to resume the host */
ret = mmc_resume_host(host->mmc);
if (ret == 0)
host->suspended = 0;
+
+ mmc_host_lazy_disable(host->mmc);
}
return ret;
@@ -1302,35 +1996,34 @@
}
#else
-#define omap_mmc_suspend NULL
-#define omap_mmc_resume NULL
+#define omap_hsmmc_suspend NULL
+#define omap_hsmmc_resume NULL
#endif
-static struct platform_driver omap_mmc_driver = {
- .probe = omap_mmc_probe,
- .remove = omap_mmc_remove,
- .suspend = omap_mmc_suspend,
- .resume = omap_mmc_resume,
+static struct platform_driver omap_hsmmc_driver = {
+ .remove = omap_hsmmc_remove,
+ .suspend = omap_hsmmc_suspend,
+ .resume = omap_hsmmc_resume,
.driver = {
.name = DRIVER_NAME,
.owner = THIS_MODULE,
},
};
-static int __init omap_mmc_init(void)
+static int __init omap_hsmmc_init(void)
{
/* Register the MMC driver */
- return platform_driver_register(&omap_mmc_driver);
+ return platform_driver_register(&omap_hsmmc_driver);
}
-static void __exit omap_mmc_cleanup(void)
+static void __exit omap_hsmmc_cleanup(void)
{
/* Unregister MMC driver */
- platform_driver_unregister(&omap_mmc_driver);
+ platform_driver_unregister(&omap_hsmmc_driver);
}
-module_init(omap_mmc_init);
-module_exit(omap_mmc_cleanup);
+module_init(omap_hsmmc_init);
+module_exit(omap_hsmmc_cleanup);
MODULE_DESCRIPTION("OMAP High Speed Multimedia Card driver");
MODULE_LICENSE("GPL");
diff --git a/drivers/mmc/host/sdhci-of.c b/drivers/mmc/host/sdhci-of.c
index 1e8aa590..01ab916 100644
--- a/drivers/mmc/host/sdhci-of.c
+++ b/drivers/mmc/host/sdhci-of.c
@@ -21,6 +21,7 @@
#include <linux/of.h>
#include <linux/of_platform.h>
#include <linux/mmc/host.h>
+#include <asm/machdep.h>
#include "sdhci.h"
struct sdhci_of_data {
@@ -48,6 +49,8 @@
#define ESDHC_CLOCK_HCKEN 0x00000002
#define ESDHC_CLOCK_IPGEN 0x00000001
+#define ESDHC_HOST_CONTROL_RES 0x05
+
static u32 esdhc_readl(struct sdhci_host *host, int reg)
{
return in_be32(host->ioaddr + reg);
@@ -109,13 +112,17 @@
int base = reg & ~0x3;
int shift = (reg & 0x3) * 8;
+ /* Prevent SDHCI core from writing reserved bits (e.g. HISPD). */
+ if (reg == SDHCI_HOST_CONTROL)
+ val &= ~ESDHC_HOST_CONTROL_RES;
+
clrsetbits_be32(host->ioaddr + base , 0xff << shift, val << shift);
}
static void esdhc_set_clock(struct sdhci_host *host, unsigned int clock)
{
- int div;
int pre_div = 2;
+ int div = 1;
clrbits32(host->ioaddr + ESDHC_SYSTEM_CONTROL, ESDHC_CLOCK_IPGEN |
ESDHC_CLOCK_HCKEN | ESDHC_CLOCK_PEREN | ESDHC_CLOCK_MASK);
@@ -123,19 +130,17 @@
if (clock == 0)
goto out;
- if (host->max_clk / 16 > clock) {
- for (; pre_div < 256; pre_div *= 2) {
- if (host->max_clk / pre_div < clock * 16)
- break;
- }
- }
+ while (host->max_clk / pre_div / 16 > clock && pre_div < 256)
+ pre_div *= 2;
- for (div = 1; div <= 16; div++) {
- if (host->max_clk / (div * pre_div) <= clock)
- break;
- }
+ while (host->max_clk / pre_div / div > clock && div < 16)
+ div++;
+
+ dev_dbg(mmc_dev(host->mmc), "desired SD clock: %d, actual: %d\n",
+ clock, host->max_clk / pre_div / div);
pre_div >>= 1;
+ div--;
setbits32(host->ioaddr + ESDHC_SYSTEM_CONTROL, ESDHC_CLOCK_IPGEN |
ESDHC_CLOCK_HCKEN | ESDHC_CLOCK_PEREN |
@@ -165,19 +170,12 @@
return of_host->clock / 256 / 16;
}
-static unsigned int esdhc_get_timeout_clock(struct sdhci_host *host)
-{
- struct sdhci_of_host *of_host = sdhci_priv(host);
-
- return of_host->clock / 1000;
-}
-
static struct sdhci_of_data sdhci_esdhc = {
.quirks = SDHCI_QUIRK_FORCE_BLK_SZ_2048 |
SDHCI_QUIRK_BROKEN_CARD_DETECTION |
- SDHCI_QUIRK_INVERTED_WRITE_PROTECT |
SDHCI_QUIRK_NO_BUSY_IRQ |
SDHCI_QUIRK_NONSTANDARD_CLOCK |
+ SDHCI_QUIRK_DATA_TIMEOUT_USES_SDCLK |
SDHCI_QUIRK_PIO_NEEDS_DELAY |
SDHCI_QUIRK_RESTORE_IRQS_AFTER_RESET |
SDHCI_QUIRK_NO_CARD_NO_RESET,
@@ -192,7 +190,6 @@
.enable_dma = esdhc_enable_dma,
.get_max_clock = esdhc_get_max_clock,
.get_min_clock = esdhc_get_min_clock,
- .get_timeout_clock = esdhc_get_timeout_clock,
},
};
@@ -219,6 +216,15 @@
#endif
+static bool __devinit sdhci_of_wp_inverted(struct device_node *np)
+{
+ if (of_get_property(np, "sdhci,wp-inverted", NULL))
+ return true;
+
+ /* Old device trees don't have the wp-inverted property. */
+ return machine_is(mpc837x_rdb) || machine_is(mpc837x_mds);
+}
+
static int __devinit sdhci_of_probe(struct of_device *ofdev,
const struct of_device_id *match)
{
@@ -261,6 +267,9 @@
if (of_get_property(np, "sdhci,1-bit-only", NULL))
host->quirks |= SDHCI_QUIRK_FORCE_1_BIT_DATA;
+ if (sdhci_of_wp_inverted(np))
+ host->quirks |= SDHCI_QUIRK_INVERTED_WRITE_PROTECT;
+
clk = of_get_property(np, "clock-frequency", &size);
if (clk && size == sizeof(*clk) && *clk)
of_host->clock = *clk;
diff --git a/drivers/mmc/host/sdhci-pci.c b/drivers/mmc/host/sdhci-pci.c
index 2f15cc1..e035664 100644
--- a/drivers/mmc/host/sdhci-pci.c
+++ b/drivers/mmc/host/sdhci-pci.c
@@ -83,7 +83,8 @@
if (chip->pdev->subsystem_vendor == PCI_VENDOR_ID_IBM)
chip->quirks |= SDHCI_QUIRK_CLOCK_BEFORE_RESET;
- if (chip->pdev->subsystem_vendor == PCI_VENDOR_ID_SAMSUNG)
+ if (chip->pdev->subsystem_vendor == PCI_VENDOR_ID_SAMSUNG ||
+ chip->pdev->subsystem_vendor == PCI_VENDOR_ID_SONY)
chip->quirks |= SDHCI_QUIRK_NO_CARD_NO_RESET;
return 0;
@@ -395,7 +396,7 @@
if (((pdev->class & 0xFFFF00) == (PCI_CLASS_SYSTEM_SDHCI << 8)) &&
((pdev->class & 0x0000FF) != PCI_SDHCI_IFDMA) &&
- (host->flags & SDHCI_USE_DMA)) {
+ (host->flags & SDHCI_USE_SDMA)) {
dev_warn(&pdev->dev, "Will use DMA mode even though HW "
"doesn't fully claim to support it.\n");
}
diff --git a/drivers/mmc/host/sdhci.c b/drivers/mmc/host/sdhci.c
index fc96f8c..c279fbc 100644
--- a/drivers/mmc/host/sdhci.c
+++ b/drivers/mmc/host/sdhci.c
@@ -591,6 +591,9 @@
target_timeout = data->timeout_ns / 1000 +
data->timeout_clks / host->clock;
+ if (host->quirks & SDHCI_QUIRK_DATA_TIMEOUT_USES_SDCLK)
+ host->timeout_clk = host->clock / 1000;
+
/*
* Figure out needed cycles.
* We do this in steps in order to fit inside a 32 bit int.
@@ -652,7 +655,7 @@
count = sdhci_calc_timeout(host, data);
sdhci_writeb(host, count, SDHCI_TIMEOUT_CONTROL);
- if (host->flags & SDHCI_USE_DMA)
+ if (host->flags & (SDHCI_USE_SDMA | SDHCI_USE_ADMA))
host->flags |= SDHCI_REQ_USE_DMA;
/*
@@ -991,8 +994,8 @@
clk |= SDHCI_CLOCK_INT_EN;
sdhci_writew(host, clk, SDHCI_CLOCK_CONTROL);
- /* Wait max 10 ms */
- timeout = 10;
+ /* Wait max 20 ms */
+ timeout = 20;
while (!((clk = sdhci_readw(host, SDHCI_CLOCK_CONTROL))
& SDHCI_CLOCK_INT_STABLE)) {
if (timeout == 0) {
@@ -1597,7 +1600,7 @@
{
int ret;
- if (host->flags & SDHCI_USE_DMA) {
+ if (host->flags & (SDHCI_USE_SDMA | SDHCI_USE_ADMA)) {
if (host->ops->enable_dma)
host->ops->enable_dma(host);
}
@@ -1678,23 +1681,20 @@
caps = sdhci_readl(host, SDHCI_CAPABILITIES);
if (host->quirks & SDHCI_QUIRK_FORCE_DMA)
- host->flags |= SDHCI_USE_DMA;
- else if (!(caps & SDHCI_CAN_DO_DMA))
- DBG("Controller doesn't have DMA capability\n");
+ host->flags |= SDHCI_USE_SDMA;
+ else if (!(caps & SDHCI_CAN_DO_SDMA))
+ DBG("Controller doesn't have SDMA capability\n");
else
- host->flags |= SDHCI_USE_DMA;
+ host->flags |= SDHCI_USE_SDMA;
if ((host->quirks & SDHCI_QUIRK_BROKEN_DMA) &&
- (host->flags & SDHCI_USE_DMA)) {
+ (host->flags & SDHCI_USE_SDMA)) {
DBG("Disabling DMA as it is marked broken\n");
- host->flags &= ~SDHCI_USE_DMA;
+ host->flags &= ~SDHCI_USE_SDMA;
}
- if (host->flags & SDHCI_USE_DMA) {
- if ((host->version >= SDHCI_SPEC_200) &&
- (caps & SDHCI_CAN_DO_ADMA2))
- host->flags |= SDHCI_USE_ADMA;
- }
+ if ((host->version >= SDHCI_SPEC_200) && (caps & SDHCI_CAN_DO_ADMA2))
+ host->flags |= SDHCI_USE_ADMA;
if ((host->quirks & SDHCI_QUIRK_BROKEN_ADMA) &&
(host->flags & SDHCI_USE_ADMA)) {
@@ -1702,13 +1702,14 @@
host->flags &= ~SDHCI_USE_ADMA;
}
- if (host->flags & SDHCI_USE_DMA) {
+ if (host->flags & (SDHCI_USE_SDMA | SDHCI_USE_ADMA)) {
if (host->ops->enable_dma) {
if (host->ops->enable_dma(host)) {
printk(KERN_WARNING "%s: No suitable DMA "
"available. Falling back to PIO.\n",
mmc_hostname(mmc));
- host->flags &= ~(SDHCI_USE_DMA | SDHCI_USE_ADMA);
+ host->flags &=
+ ~(SDHCI_USE_SDMA | SDHCI_USE_ADMA);
}
}
}
@@ -1736,7 +1737,7 @@
* mask, but PIO does not need the hw shim so we set a new
* mask here in that case.
*/
- if (!(host->flags & SDHCI_USE_DMA)) {
+ if (!(host->flags & (SDHCI_USE_SDMA | SDHCI_USE_ADMA))) {
host->dma_mask = DMA_BIT_MASK(64);
mmc_dev(host->mmc)->dma_mask = &host->dma_mask;
}
@@ -1757,13 +1758,15 @@
host->timeout_clk =
(caps & SDHCI_TIMEOUT_CLK_MASK) >> SDHCI_TIMEOUT_CLK_SHIFT;
if (host->timeout_clk == 0) {
- if (!host->ops->get_timeout_clock) {
+ if (host->ops->get_timeout_clock) {
+ host->timeout_clk = host->ops->get_timeout_clock(host);
+ } else if (!(host->quirks &
+ SDHCI_QUIRK_DATA_TIMEOUT_USES_SDCLK)) {
printk(KERN_ERR
"%s: Hardware doesn't specify timeout clock "
"frequency.\n", mmc_hostname(mmc));
return -ENODEV;
}
- host->timeout_clk = host->ops->get_timeout_clock(host);
}
if (caps & SDHCI_TIMEOUT_CLK_UNIT)
host->timeout_clk *= 1000;
@@ -1772,7 +1775,8 @@
* Set host parameters.
*/
mmc->ops = &sdhci_ops;
- if (host->ops->get_min_clock)
+ if (host->quirks & SDHCI_QUIRK_NONSTANDARD_CLOCK &&
+ host->ops->set_clock && host->ops->get_min_clock)
mmc->f_min = host->ops->get_min_clock(host);
else
mmc->f_min = host->max_clk / 256;
@@ -1810,7 +1814,7 @@
*/
if (host->flags & SDHCI_USE_ADMA)
mmc->max_hw_segs = 128;
- else if (host->flags & SDHCI_USE_DMA)
+ else if (host->flags & SDHCI_USE_SDMA)
mmc->max_hw_segs = 1;
else /* PIO */
mmc->max_hw_segs = 128;
@@ -1893,10 +1897,10 @@
mmc_add_host(mmc);
- printk(KERN_INFO "%s: SDHCI controller on %s [%s] using %s%s\n",
+ printk(KERN_INFO "%s: SDHCI controller on %s [%s] using %s\n",
mmc_hostname(mmc), host->hw_name, dev_name(mmc_dev(mmc)),
- (host->flags & SDHCI_USE_ADMA)?"A":"",
- (host->flags & SDHCI_USE_DMA)?"DMA":"PIO");
+ (host->flags & SDHCI_USE_ADMA) ? "ADMA" :
+ (host->flags & SDHCI_USE_SDMA) ? "DMA" : "PIO");
sdhci_enable_card_detection(host);
diff --git a/drivers/mmc/host/sdhci.h b/drivers/mmc/host/sdhci.h
index c77e9ff..ce5f1d7 100644
--- a/drivers/mmc/host/sdhci.h
+++ b/drivers/mmc/host/sdhci.h
@@ -143,7 +143,7 @@
#define SDHCI_CAN_DO_ADMA2 0x00080000
#define SDHCI_CAN_DO_ADMA1 0x00100000
#define SDHCI_CAN_DO_HISPD 0x00200000
-#define SDHCI_CAN_DO_DMA 0x00400000
+#define SDHCI_CAN_DO_SDMA 0x00400000
#define SDHCI_CAN_VDD_330 0x01000000
#define SDHCI_CAN_VDD_300 0x02000000
#define SDHCI_CAN_VDD_180 0x04000000
@@ -232,6 +232,8 @@
#define SDHCI_QUIRK_FORCE_1_BIT_DATA (1<<22)
/* Controller needs 10ms delay between applying power and clock */
#define SDHCI_QUIRK_DELAY_AFTER_POWER (1<<23)
+/* Controller uses SDCLK instead of TMCLK for data timeouts */
+#define SDHCI_QUIRK_DATA_TIMEOUT_USES_SDCLK (1<<24)
int irq; /* Device IRQ */
void __iomem * ioaddr; /* Mapped address */
@@ -250,7 +252,7 @@
spinlock_t lock; /* Mutex */
int flags; /* Host attributes */
-#define SDHCI_USE_DMA (1<<0) /* Host is DMA capable */
+#define SDHCI_USE_SDMA (1<<0) /* Host is SDMA capable */
#define SDHCI_USE_ADMA (1<<1) /* Host is ADMA capable */
#define SDHCI_REQ_USE_DMA (1<<2) /* Use DMA for this req. */
#define SDHCI_DEVICE_DEAD (1<<3) /* Device unresponsive */
diff --git a/drivers/mtd/devices/mtd_dataflash.c b/drivers/mtd/devices/mtd_dataflash.c
index 43976aa..211c27ac 100644
--- a/drivers/mtd/devices/mtd_dataflash.c
+++ b/drivers/mtd/devices/mtd_dataflash.c
@@ -966,3 +966,4 @@
MODULE_LICENSE("GPL");
MODULE_AUTHOR("Andrew Victor, David Brownell");
MODULE_DESCRIPTION("MTD DataFlash driver");
+MODULE_ALIAS("spi:mtd_dataflash");
diff --git a/drivers/net/ehea/ehea_qmr.c b/drivers/net/ehea/ehea_qmr.c
index 3747457f5..bc7c5b7 100644
--- a/drivers/net/ehea/ehea_qmr.c
+++ b/drivers/net/ehea/ehea_qmr.c
@@ -751,7 +751,7 @@
mutex_lock(&ehea_busmap_mutex);
ehea_mr_len = 0;
- ret = walk_memory_resource(0, 1ULL << MAX_PHYSMEM_BITS, NULL,
+ ret = walk_system_ram_range(0, 1ULL << MAX_PHYSMEM_BITS, NULL,
ehea_create_busmap_callback);
mutex_unlock(&ehea_busmap_mutex);
return ret;
diff --git a/drivers/net/enc28j60.c b/drivers/net/enc28j60.c
index 117fc6c..66813c9 100644
--- a/drivers/net/enc28j60.c
+++ b/drivers/net/enc28j60.c
@@ -1666,3 +1666,4 @@
MODULE_LICENSE("GPL");
module_param_named(debug, debug.msg_enable, int, 0);
MODULE_PARM_DESC(debug, "Debug verbosity level (0=none, ..., ffff=all)");
+MODULE_ALIAS("spi:" DRV_NAME);
diff --git a/drivers/net/ks8851.c b/drivers/net/ks8851.c
index 547ac7c..2378358 100644
--- a/drivers/net/ks8851.c
+++ b/drivers/net/ks8851.c
@@ -1321,3 +1321,4 @@
module_param_named(message, msg_enable, int, 0);
MODULE_PARM_DESC(message, "Message verbosity level (0=none, 31=all)");
+MODULE_ALIAS("spi:ks8851");
diff --git a/drivers/net/niu.c b/drivers/net/niu.c
index 76cc261..f9364d0 100644
--- a/drivers/net/niu.c
+++ b/drivers/net/niu.c
@@ -5615,7 +5615,7 @@
/* The XMAC_MIN register only accepts values for TX min which
* have the low 3 bits cleared.
*/
- BUILD_BUG_ON(min & 0x7);
+ BUG_ON(min & 0x7);
if (np->flags & NIU_FLAGS_XMAC)
niu_init_tx_xmac(np, min, max);
diff --git a/drivers/net/virtio_net.c b/drivers/net/virtio_net.c
index 32266fb..5c498d2 100644
--- a/drivers/net/virtio_net.c
+++ b/drivers/net/virtio_net.c
@@ -22,6 +22,7 @@
#include <linux/ethtool.h>
#include <linux/module.h>
#include <linux/virtio.h>
+#include <linux/virtio_ids.h>
#include <linux/virtio_net.h>
#include <linux/scatterlist.h>
#include <linux/if_vlan.h>
@@ -320,7 +321,7 @@
skb_queue_head(&vi->recv, skb);
err = vi->rvq->vq_ops->add_buf(vi->rvq, sg, 0, num, skb);
- if (err) {
+ if (err < 0) {
skb_unlink(skb, &vi->recv);
trim_pages(vi, skb);
kfree_skb(skb);
@@ -373,7 +374,7 @@
skb_queue_head(&vi->recv, skb);
err = vi->rvq->vq_ops->add_buf(vi->rvq, sg, 0, 1, skb);
- if (err) {
+ if (err < 0) {
skb_unlink(skb, &vi->recv);
kfree_skb(skb);
break;
@@ -527,7 +528,7 @@
num = skb_to_sgvec(skb, sg+1, 0, skb->len) + 1;
err = vi->svq->vq_ops->add_buf(vi->svq, sg, num, 0, skb);
- if (!err && !vi->free_in_tasklet)
+ if (err >= 0 && !vi->free_in_tasklet)
mod_timer(&vi->xmit_free_timer, jiffies + (HZ/10));
return err;
@@ -538,7 +539,7 @@
struct virtnet_info *vi = (void *)data;
netif_tx_lock_bh(vi->dev);
- if (vi->last_xmit_skb && xmit_skb(vi, vi->last_xmit_skb) == 0) {
+ if (vi->last_xmit_skb && xmit_skb(vi, vi->last_xmit_skb) >= 0) {
vi->svq->vq_ops->kick(vi->svq);
vi->last_xmit_skb = NULL;
}
@@ -557,7 +558,7 @@
/* If we has a buffer left over from last time, send it now. */
if (unlikely(vi->last_xmit_skb) &&
- xmit_skb(vi, vi->last_xmit_skb) != 0)
+ xmit_skb(vi, vi->last_xmit_skb) < 0)
goto stop_queue;
vi->last_xmit_skb = NULL;
@@ -565,7 +566,7 @@
/* Put new one in send queue and do transmit */
if (likely(skb)) {
__skb_queue_head(&vi->send, skb);
- if (xmit_skb(vi, skb) != 0) {
+ if (xmit_skb(vi, skb) < 0) {
vi->last_xmit_skb = skb;
skb = NULL;
goto stop_queue;
@@ -668,7 +669,7 @@
sg_set_buf(&sg[i + 1], sg_virt(s), s->length);
sg_set_buf(&sg[out + in - 1], &status, sizeof(status));
- BUG_ON(vi->cvq->vq_ops->add_buf(vi->cvq, sg, out, in, vi));
+ BUG_ON(vi->cvq->vq_ops->add_buf(vi->cvq, sg, out, in, vi) < 0);
vi->cvq->vq_ops->kick(vi->cvq);
diff --git a/drivers/net/wireless/libertas/if_spi.c b/drivers/net/wireless/libertas/if_spi.c
index 446e327..cb8be8d 100644
--- a/drivers/net/wireless/libertas/if_spi.c
+++ b/drivers/net/wireless/libertas/if_spi.c
@@ -1222,3 +1222,4 @@
MODULE_AUTHOR("Andrey Yurovsky <andrey@cozybit.com>, "
"Colin McCabe <colin@cozybit.com>");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:libertas_spi");
diff --git a/drivers/net/wireless/p54/p54spi.c b/drivers/net/wireless/p54/p54spi.c
index 05458d9..afd26bf 100644
--- a/drivers/net/wireless/p54/p54spi.c
+++ b/drivers/net/wireless/p54/p54spi.c
@@ -731,3 +731,4 @@
MODULE_LICENSE("GPL");
MODULE_AUTHOR("Christian Lamparter <chunkeey@web.de>");
+MODULE_ALIAS("spi:cx3110x");
diff --git a/drivers/net/wireless/wl12xx/wl1251_main.c b/drivers/net/wireless/wl12xx/wl1251_main.c
index 5809ef5..1103256 100644
--- a/drivers/net/wireless/wl12xx/wl1251_main.c
+++ b/drivers/net/wireless/wl12xx/wl1251_main.c
@@ -1426,3 +1426,4 @@
MODULE_DESCRIPTION("TI wl1251 Wireles LAN Driver Core");
MODULE_LICENSE("GPL");
MODULE_AUTHOR("Kalle Valo <kalle.valo@nokia.com>");
+MODULE_ALIAS("spi:wl12xx");
diff --git a/drivers/of/base.c b/drivers/of/base.c
index 69f85c0..ddf224d 100644
--- a/drivers/of/base.c
+++ b/drivers/of/base.c
@@ -447,7 +447,6 @@
static struct of_modalias_table of_modalias_table[] = {
{ "fsl,mcu-mpc8349emitx", "mcu-mpc8349emitx" },
{ "mmc-spi-slot", "mmc_spi" },
- { "stm,m25p40", "m25p80" },
};
/**
diff --git a/drivers/rtc/Kconfig b/drivers/rtc/Kconfig
index 73771b0..3c20dae 100644
--- a/drivers/rtc/Kconfig
+++ b/drivers/rtc/Kconfig
@@ -378,6 +378,15 @@
This driver can also be built as a module. If so, the module
will be called rtc-ds3234.
+config RTC_DRV_PCF2123
+ tristate "NXP PCF2123"
+ help
+ If you say yes here you get support for the NXP PCF2123
+ RTC chip.
+
+ This driver can also be built as a module. If so, the module
+ will be called rtc-pcf2123.
+
endif # SPI_MASTER
comment "Platform RTC drivers"
@@ -500,6 +509,17 @@
This driver can also be built as a module, if so, the module
will be called "rtc-m48t59".
+config RTC_MXC
+ tristate "Freescale MXC Real Time Clock"
+ depends on ARCH_MXC
+ depends on RTC_CLASS
+ help
+ If you say yes here you get support for the Freescale MXC
+ RTC module.
+
+ This driver can also be built as a module, if so, the module
+ will be called "rtc-mxc".
+
config RTC_DRV_BQ4802
tristate "TI BQ4802"
help
@@ -778,4 +798,33 @@
This driver can also be built as a module. If so, the module
will be called rtc-ps3.
+config RTC_DRV_COH901331
+ tristate "ST-Ericsson COH 901 331 RTC"
+ depends on ARCH_U300
+ help
+ If you say Y here you will get access to ST-Ericsson
+ COH 901 331 RTC clock found in some ST-Ericsson Mobile
+ Platforms.
+
+ This driver can also be built as a module. If so, the module
+ will be called "rtc-coh901331".
+
+
+config RTC_DRV_STMP
+ tristate "Freescale STMP3xxx RTC"
+ depends on ARCH_STMP3XXX
+ help
+ If you say yes here you will get support for the onboard
+ STMP3xxx RTC.
+
+ This driver can also be built as a module. If so, the module
+ will be called rtc-stmp3xxx.
+
+config RTC_DRV_PCAP
+ tristate "PCAP RTC"
+ depends on EZX_PCAP
+ help
+ If you say Y here you will get support for the RTC found on
+ the PCAP2 ASIC used on some Motorola phones.
+
endif # RTC_CLASS
diff --git a/drivers/rtc/Makefile b/drivers/rtc/Makefile
index 5e152ff..aa3fbd5 100644
--- a/drivers/rtc/Makefile
+++ b/drivers/rtc/Makefile
@@ -23,7 +23,9 @@
obj-$(CONFIG_RTC_DRV_AT91SAM9) += rtc-at91sam9.o
obj-$(CONFIG_RTC_DRV_AU1XXX) += rtc-au1xxx.o
obj-$(CONFIG_RTC_DRV_BFIN) += rtc-bfin.o
+obj-$(CONFIG_RTC_DRV_BQ4802) += rtc-bq4802.o
obj-$(CONFIG_RTC_DRV_CMOS) += rtc-cmos.o
+obj-$(CONFIG_RTC_DRV_COH901331) += rtc-coh901331.o
obj-$(CONFIG_RTC_DRV_DM355EVM) += rtc-dm355evm.o
obj-$(CONFIG_RTC_DRV_DS1216) += rtc-ds1216.o
obj-$(CONFIG_RTC_DRV_DS1286) += rtc-ds1286.o
@@ -40,24 +42,26 @@
obj-$(CONFIG_RTC_DRV_EFI) += rtc-efi.o
obj-$(CONFIG_RTC_DRV_EP93XX) += rtc-ep93xx.o
obj-$(CONFIG_RTC_DRV_FM3130) += rtc-fm3130.o
+obj-$(CONFIG_RTC_DRV_GENERIC) += rtc-generic.o
obj-$(CONFIG_RTC_DRV_ISL1208) += rtc-isl1208.o
obj-$(CONFIG_RTC_DRV_M41T80) += rtc-m41t80.o
obj-$(CONFIG_RTC_DRV_M41T94) += rtc-m41t94.o
obj-$(CONFIG_RTC_DRV_M48T35) += rtc-m48t35.o
obj-$(CONFIG_RTC_DRV_M48T59) += rtc-m48t59.o
obj-$(CONFIG_RTC_DRV_M48T86) += rtc-m48t86.o
-obj-$(CONFIG_RTC_DRV_BQ4802) += rtc-bq4802.o
-obj-$(CONFIG_RTC_DRV_SUN4V) += rtc-sun4v.o
-obj-$(CONFIG_RTC_DRV_STARFIRE) += rtc-starfire.o
+obj-$(CONFIG_RTC_MXC) += rtc-mxc.o
obj-$(CONFIG_RTC_DRV_MAX6900) += rtc-max6900.o
obj-$(CONFIG_RTC_DRV_MAX6902) += rtc-max6902.o
obj-$(CONFIG_RTC_DRV_MV) += rtc-mv.o
obj-$(CONFIG_RTC_DRV_OMAP) += rtc-omap.o
+obj-$(CONFIG_RTC_DRV_PCAP) += rtc-pcap.o
obj-$(CONFIG_RTC_DRV_PCF8563) += rtc-pcf8563.o
obj-$(CONFIG_RTC_DRV_PCF8583) += rtc-pcf8583.o
+obj-$(CONFIG_RTC_DRV_PCF2123) += rtc-pcf2123.o
+obj-$(CONFIG_RTC_DRV_PCF50633) += rtc-pcf50633.o
obj-$(CONFIG_RTC_DRV_PL030) += rtc-pl030.o
obj-$(CONFIG_RTC_DRV_PL031) += rtc-pl031.o
-obj-$(CONFIG_RTC_DRV_GENERIC) += rtc-generic.o
+obj-$(CONFIG_RTC_DRV_PS3) += rtc-ps3.o
obj-$(CONFIG_RTC_DRV_PXA) += rtc-pxa.o
obj-$(CONFIG_RTC_DRV_R9701) += rtc-r9701.o
obj-$(CONFIG_RTC_DRV_RS5C313) += rtc-rs5c313.o
@@ -69,7 +73,10 @@
obj-$(CONFIG_RTC_DRV_S3C) += rtc-s3c.o
obj-$(CONFIG_RTC_DRV_SA1100) += rtc-sa1100.o
obj-$(CONFIG_RTC_DRV_SH) += rtc-sh.o
+obj-$(CONFIG_RTC_DRV_STARFIRE) += rtc-starfire.o
obj-$(CONFIG_RTC_DRV_STK17TA8) += rtc-stk17ta8.o
+obj-$(CONFIG_RTC_DRV_STMP) += rtc-stmp3xxx.o
+obj-$(CONFIG_RTC_DRV_SUN4V) += rtc-sun4v.o
obj-$(CONFIG_RTC_DRV_TEST) += rtc-test.o
obj-$(CONFIG_RTC_DRV_TWL4030) += rtc-twl4030.o
obj-$(CONFIG_RTC_DRV_TX4939) += rtc-tx4939.o
@@ -78,5 +85,3 @@
obj-$(CONFIG_RTC_DRV_WM831X) += rtc-wm831x.o
obj-$(CONFIG_RTC_DRV_WM8350) += rtc-wm8350.o
obj-$(CONFIG_RTC_DRV_X1205) += rtc-x1205.o
-obj-$(CONFIG_RTC_DRV_PCF50633) += rtc-pcf50633.o
-obj-$(CONFIG_RTC_DRV_PS3) += rtc-ps3.o
diff --git a/drivers/rtc/rtc-at91rm9200.c b/drivers/rtc/rtc-at91rm9200.c
index b5bf937..bc8bbca 100644
--- a/drivers/rtc/rtc-at91rm9200.c
+++ b/drivers/rtc/rtc-at91rm9200.c
@@ -289,7 +289,7 @@
AT91_RTC_CALEV);
ret = request_irq(AT91_ID_SYS, at91_rtc_interrupt,
- IRQF_DISABLED | IRQF_SHARED,
+ IRQF_SHARED,
"at91_rtc", pdev);
if (ret) {
printk(KERN_ERR "at91_rtc: IRQ %d already in use.\n",
@@ -340,7 +340,7 @@
static u32 at91_rtc_imr;
-static int at91_rtc_suspend(struct platform_device *pdev, pm_message_t state)
+static int at91_rtc_suspend(struct device *dev)
{
/* this IRQ is shared with DBGU and other hardware which isn't
* necessarily doing PM like we are...
@@ -348,7 +348,7 @@
at91_rtc_imr = at91_sys_read(AT91_RTC_IMR)
& (AT91_RTC_ALARM|AT91_RTC_SECEV);
if (at91_rtc_imr) {
- if (device_may_wakeup(&pdev->dev))
+ if (device_may_wakeup(dev))
enable_irq_wake(AT91_ID_SYS);
else
at91_sys_write(AT91_RTC_IDR, at91_rtc_imr);
@@ -356,28 +356,34 @@
return 0;
}
-static int at91_rtc_resume(struct platform_device *pdev)
+static int at91_rtc_resume(struct device *dev)
{
if (at91_rtc_imr) {
- if (device_may_wakeup(&pdev->dev))
+ if (device_may_wakeup(dev))
disable_irq_wake(AT91_ID_SYS);
else
at91_sys_write(AT91_RTC_IER, at91_rtc_imr);
}
return 0;
}
+
+static const struct dev_pm_ops at91_rtc_pm = {
+ .suspend = at91_rtc_suspend,
+ .resume = at91_rtc_resume,
+};
+
+#define at91_rtc_pm_ptr &at91_rtc_pm
+
#else
-#define at91_rtc_suspend NULL
-#define at91_rtc_resume NULL
+#define at91_rtc_pm_ptr NULL
#endif
static struct platform_driver at91_rtc_driver = {
.remove = __exit_p(at91_rtc_remove),
- .suspend = at91_rtc_suspend,
- .resume = at91_rtc_resume,
.driver = {
.name = "at91_rtc",
.owner = THIS_MODULE,
+ .pm = at91_rtc_pm_ptr,
},
};
diff --git a/drivers/rtc/rtc-bfin.c b/drivers/rtc/rtc-bfin.c
index a118eb0..b11485b 100644
--- a/drivers/rtc/rtc-bfin.c
+++ b/drivers/rtc/rtc-bfin.c
@@ -383,7 +383,7 @@
}
/* Grab the IRQ and init the hardware */
- ret = request_irq(IRQ_RTC, bfin_rtc_interrupt, IRQF_SHARED, pdev->name, dev);
+ ret = request_irq(IRQ_RTC, bfin_rtc_interrupt, 0, pdev->name, dev);
if (unlikely(ret))
goto err_reg;
/* sometimes the bootloader touched things, but the write complete was not
diff --git a/drivers/rtc/rtc-coh901331.c b/drivers/rtc/rtc-coh901331.c
new file mode 100644
index 0000000..7fe1fa2
--- /dev/null
+++ b/drivers/rtc/rtc-coh901331.c
@@ -0,0 +1,311 @@
+/*
+ * Copyright (C) 2007-2009 ST-Ericsson AB
+ * License terms: GNU General Public License (GPL) version 2
+ * Real Time Clock interface for ST-Ericsson AB COH 901 331 RTC.
+ * Author: Linus Walleij <linus.walleij@stericsson.com>
+ * Based on rtc-pl031.c by Deepak Saxena <dsaxena@plexity.net>
+ * Copyright 2006 (c) MontaVista Software, Inc.
+ */
+#include <linux/init.h>
+#include <linux/module.h>
+#include <linux/rtc.h>
+#include <linux/clk.h>
+#include <linux/interrupt.h>
+#include <linux/pm.h>
+#include <linux/platform_device.h>
+#include <linux/io.h>
+
+/*
+ * Registers in the COH 901 331
+ */
+/* Alarm value 32bit (R/W) */
+#define COH901331_ALARM 0x00U
+/* Used to set current time 32bit (R/W) */
+#define COH901331_SET_TIME 0x04U
+/* Indication if current time is valid 32bit (R/-) */
+#define COH901331_VALID 0x08U
+/* Read the current time 32bit (R/-) */
+#define COH901331_CUR_TIME 0x0cU
+/* Event register for the "alarm" interrupt */
+#define COH901331_IRQ_EVENT 0x10U
+/* Mask register for the "alarm" interrupt */
+#define COH901331_IRQ_MASK 0x14U
+/* Force register for the "alarm" interrupt */
+#define COH901331_IRQ_FORCE 0x18U
+
+/*
+ * Reference to RTC block clock
+ * Notice that the frequent clk_enable()/clk_disable() on this
+ * clock is mainly to be able to turn on/off other clocks in the
+ * hierarchy as needed, the RTC clock is always on anyway.
+ */
+struct coh901331_port {
+ struct rtc_device *rtc;
+ struct clk *clk;
+ u32 phybase;
+ u32 physize;
+ void __iomem *virtbase;
+ int irq;
+#ifdef CONFIG_PM
+ u32 irqmaskstore;
+#endif
+};
+
+static irqreturn_t coh901331_interrupt(int irq, void *data)
+{
+ struct coh901331_port *rtap = data;
+
+ clk_enable(rtap->clk);
+ /* Ack IRQ */
+ writel(1, rtap->virtbase + COH901331_IRQ_EVENT);
+ clk_disable(rtap->clk);
+ /* Set alarm flag */
+ rtc_update_irq(rtap->rtc, 1, RTC_AF);
+
+ return IRQ_HANDLED;
+}
+
+static int coh901331_read_time(struct device *dev, struct rtc_time *tm)
+{
+ struct coh901331_port *rtap = dev_get_drvdata(dev);
+
+ clk_enable(rtap->clk);
+ /* Check if the time is valid */
+ if (readl(rtap->virtbase + COH901331_VALID)) {
+ rtc_time_to_tm(readl(rtap->virtbase + COH901331_CUR_TIME), tm);
+ clk_disable(rtap->clk);
+ return rtc_valid_tm(tm);
+ }
+ clk_disable(rtap->clk);
+ return -EINVAL;
+}
+
+static int coh901331_set_mmss(struct device *dev, unsigned long secs)
+{
+ struct coh901331_port *rtap = dev_get_drvdata(dev);
+
+ clk_enable(rtap->clk);
+ writel(secs, rtap->virtbase + COH901331_SET_TIME);
+ clk_disable(rtap->clk);
+
+ return 0;
+}
+
+static int coh901331_read_alarm(struct device *dev, struct rtc_wkalrm *alarm)
+{
+ struct coh901331_port *rtap = dev_get_drvdata(dev);
+
+ clk_enable(rtap->clk);
+ rtc_time_to_tm(readl(rtap->virtbase + COH901331_ALARM), &alarm->time);
+ alarm->pending = readl(rtap->virtbase + COH901331_IRQ_EVENT) & 1U;
+ alarm->enabled = readl(rtap->virtbase + COH901331_IRQ_MASK) & 1U;
+ clk_disable(rtap->clk);
+
+ return 0;
+}
+
+static int coh901331_set_alarm(struct device *dev, struct rtc_wkalrm *alarm)
+{
+ struct coh901331_port *rtap = dev_get_drvdata(dev);
+ unsigned long time;
+
+ rtc_tm_to_time(&alarm->time, &time);
+ clk_enable(rtap->clk);
+ writel(time, rtap->virtbase + COH901331_ALARM);
+ writel(alarm->enabled, rtap->virtbase + COH901331_IRQ_MASK);
+ clk_disable(rtap->clk);
+
+ return 0;
+}
+
+static int coh901331_alarm_irq_enable(struct device *dev, unsigned int enabled)
+{
+ struct coh901331_port *rtap = dev_get_drvdata(dev);
+
+ clk_enable(rtap->clk);
+ if (enabled)
+ writel(1, rtap->virtbase + COH901331_IRQ_MASK);
+ else
+ writel(0, rtap->virtbase + COH901331_IRQ_MASK);
+ clk_disable(rtap->clk);
+}
+
+static struct rtc_class_ops coh901331_ops = {
+ .read_time = coh901331_read_time,
+ .set_mmss = coh901331_set_mmss,
+ .read_alarm = coh901331_read_alarm,
+ .set_alarm = coh901331_set_alarm,
+ .alarm_irq_enable = coh901331_alarm_irq_enable,
+};
+
+static int __exit coh901331_remove(struct platform_device *pdev)
+{
+ struct coh901331_port *rtap = dev_get_drvdata(&pdev->dev);
+
+ if (rtap) {
+ free_irq(rtap->irq, rtap);
+ rtc_device_unregister(rtap->rtc);
+ clk_put(rtap->clk);
+ iounmap(rtap->virtbase);
+ release_mem_region(rtap->phybase, rtap->physize);
+ platform_set_drvdata(pdev, NULL);
+ kfree(rtap);
+ }
+
+ return 0;
+}
+
+
+static int __init coh901331_probe(struct platform_device *pdev)
+{
+ int ret;
+ struct coh901331_port *rtap;
+ struct resource *res;
+
+ rtap = kzalloc(sizeof(struct coh901331_port), GFP_KERNEL);
+ if (!rtap)
+ return -ENOMEM;
+
+ res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ if (!res) {
+ ret = -ENOENT;
+ goto out_no_resource;
+ }
+ rtap->phybase = res->start;
+ rtap->physize = resource_size(res);
+
+ if (request_mem_region(rtap->phybase, rtap->physize,
+ "rtc-coh901331") == NULL) {
+ ret = -EBUSY;
+ goto out_no_memregion;
+ }
+
+ rtap->virtbase = ioremap(rtap->phybase, rtap->physize);
+ if (!rtap->virtbase) {
+ ret = -ENOMEM;
+ goto out_no_remap;
+ }
+
+ rtap->irq = platform_get_irq(pdev, 0);
+ if (request_irq(rtap->irq, coh901331_interrupt, IRQF_DISABLED,
+ "RTC COH 901 331 Alarm", rtap)) {
+ ret = -EIO;
+ goto out_no_irq;
+ }
+
+ rtap->clk = clk_get(&pdev->dev, NULL);
+ if (IS_ERR(rtap->clk)) {
+ ret = PTR_ERR(rtap->clk);
+ dev_err(&pdev->dev, "could not get clock\n");
+ goto out_no_clk;
+ }
+
+ /* We enable/disable the clock only to assure it works */
+ ret = clk_enable(rtap->clk);
+ if (ret) {
+ dev_err(&pdev->dev, "could not enable clock\n");
+ goto out_no_clk_enable;
+ }
+ clk_disable(rtap->clk);
+
+ rtap->rtc = rtc_device_register("coh901331", &pdev->dev, &coh901331_ops,
+ THIS_MODULE);
+ if (IS_ERR(rtap->rtc)) {
+ ret = PTR_ERR(rtap->rtc);
+ goto out_no_rtc;
+ }
+
+ platform_set_drvdata(pdev, rtap);
+
+ return 0;
+
+ out_no_rtc:
+ out_no_clk_enable:
+ clk_put(rtap->clk);
+ out_no_clk:
+ free_irq(rtap->irq, rtap);
+ out_no_irq:
+ iounmap(rtap->virtbase);
+ out_no_remap:
+ platform_set_drvdata(pdev, NULL);
+ out_no_memregion:
+ release_mem_region(rtap->phybase, SZ_4K);
+ out_no_resource:
+ kfree(rtap);
+ return ret;
+}
+
+#ifdef CONFIG_PM
+static int coh901331_suspend(struct platform_device *pdev, pm_message_t state)
+{
+ struct coh901331_port *rtap = dev_get_drvdata(&pdev->dev);
+
+ /*
+ * If this RTC alarm will be used for waking the system up,
+ * don't disable it of course. Else we just disable the alarm
+ * and await suspension.
+ */
+ if (device_may_wakeup(&pdev->dev)) {
+ enable_irq_wake(rtap->irq);
+ } else {
+ clk_enable(rtap->clk);
+ rtap->irqmaskstore = readl(rtap->virtbase + COH901331_IRQ_MASK);
+ writel(0, rtap->virtbase + COH901331_IRQ_MASK);
+ clk_disable(rtap->clk);
+ }
+ return 0;
+}
+
+static int coh901331_resume(struct platform_device *pdev)
+{
+ struct coh901331_port *rtap = dev_get_drvdata(&pdev->dev);
+
+ if (device_may_wakeup(&pdev->dev))
+ disable_irq_wake(rtap->irq);
+ else
+ clk_enable(rtap->clk);
+ writel(rtap->irqmaskstore, rtap->virtbase + COH901331_IRQ_MASK);
+ clk_disable(rtap->clk);
+ return 0;
+}
+#else
+#define coh901331_suspend NULL
+#define coh901331_resume NULL
+#endif
+
+static void coh901331_shutdown(struct platform_device *pdev)
+{
+ struct coh901331_port *rtap = dev_get_drvdata(&pdev->dev);
+
+ clk_enable(rtap->clk);
+ writel(0, rtap->virtbase + COH901331_IRQ_MASK);
+ clk_disable(rtap->clk);
+}
+
+static struct platform_driver coh901331_driver = {
+ .driver = {
+ .name = "rtc-coh901331",
+ .owner = THIS_MODULE,
+ },
+ .remove = __exit_p(coh901331_remove),
+ .suspend = coh901331_suspend,
+ .resume = coh901331_resume,
+ .shutdown = coh901331_shutdown,
+};
+
+static int __init coh901331_init(void)
+{
+ return platform_driver_probe(&coh901331_driver, coh901331_probe);
+}
+
+static void __exit coh901331_exit(void)
+{
+ platform_driver_unregister(&coh901331_driver);
+}
+
+module_init(coh901331_init);
+module_exit(coh901331_exit);
+
+MODULE_AUTHOR("Linus Walleij <linus.walleij@stericsson.com>");
+MODULE_DESCRIPTION("ST-Ericsson AB COH 901 331 RTC Driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/rtc/rtc-ds1305.c b/drivers/rtc/rtc-ds1305.c
index 8f410e5..2736b11 100644
--- a/drivers/rtc/rtc-ds1305.c
+++ b/drivers/rtc/rtc-ds1305.c
@@ -841,3 +841,4 @@
MODULE_DESCRIPTION("RTC driver for DS1305 and DS1306 chips");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:rtc-ds1305");
diff --git a/drivers/rtc/rtc-ds1307.c b/drivers/rtc/rtc-ds1307.c
index 47a93c0..eb99ee4 100644
--- a/drivers/rtc/rtc-ds1307.c
+++ b/drivers/rtc/rtc-ds1307.c
@@ -896,8 +896,7 @@
return 0;
exit_irq:
- if (ds1307->rtc)
- rtc_device_unregister(ds1307->rtc);
+ rtc_device_unregister(ds1307->rtc);
exit_free:
kfree(ds1307);
return err;
diff --git a/drivers/rtc/rtc-ds1390.c b/drivers/rtc/rtc-ds1390.c
index e01b955..cdb7050 100644
--- a/drivers/rtc/rtc-ds1390.c
+++ b/drivers/rtc/rtc-ds1390.c
@@ -189,3 +189,4 @@
MODULE_DESCRIPTION("Dallas/Maxim DS1390/93/94 SPI RTC driver");
MODULE_AUTHOR("Mark Jackson <mpfj@mimc.co.uk>");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:rtc-ds1390");
diff --git a/drivers/rtc/rtc-ds3234.c b/drivers/rtc/rtc-ds3234.c
index c51589e..a774ca3 100644
--- a/drivers/rtc/rtc-ds3234.c
+++ b/drivers/rtc/rtc-ds3234.c
@@ -188,3 +188,4 @@
MODULE_DESCRIPTION("DS3234 SPI RTC driver");
MODULE_AUTHOR("Dennis Aberilla <denzzzhome@yahoo.com>");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ds3234");
diff --git a/drivers/rtc/rtc-ep93xx.c b/drivers/rtc/rtc-ep93xx.c
index 551332e..9da02d1 100644
--- a/drivers/rtc/rtc-ep93xx.c
+++ b/drivers/rtc/rtc-ep93xx.c
@@ -128,12 +128,16 @@
return -ENOMEM;
res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
- if (res == NULL)
- return -ENXIO;
+ if (res == NULL) {
+ err = -ENXIO;
+ goto fail_free;
+ }
res = request_mem_region(res->start, resource_size(res), pdev->name);
- if (res == NULL)
- return -EBUSY;
+ if (res == NULL) {
+ err = -EBUSY;
+ goto fail_free;
+ }
ep93xx_rtc->mmio_base = ioremap(res->start, resource_size(res));
if (ep93xx_rtc->mmio_base == NULL) {
@@ -169,6 +173,8 @@
pdev->dev.platform_data = NULL;
}
release_mem_region(res->start, resource_size(res));
+fail_free:
+ kfree(ep93xx_rtc);
return err;
}
diff --git a/drivers/rtc/rtc-m41t94.c b/drivers/rtc/rtc-m41t94.c
index c3a18c5..c8c97a4 100644
--- a/drivers/rtc/rtc-m41t94.c
+++ b/drivers/rtc/rtc-m41t94.c
@@ -171,3 +171,4 @@
MODULE_AUTHOR("Kim B. Heino <Kim.Heino@bluegiga.com>");
MODULE_DESCRIPTION("Driver for ST M41T94 SPI RTC");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:rtc-m41t94");
diff --git a/drivers/rtc/rtc-max6902.c b/drivers/rtc/rtc-max6902.c
index 36a8ea9..657403e 100644
--- a/drivers/rtc/rtc-max6902.c
+++ b/drivers/rtc/rtc-max6902.c
@@ -175,3 +175,4 @@
MODULE_DESCRIPTION ("max6902 spi RTC driver");
MODULE_AUTHOR ("Raphael Assenat");
MODULE_LICENSE ("GPL");
+MODULE_ALIAS("spi:rtc-max6902");
diff --git a/drivers/rtc/rtc-mxc.c b/drivers/rtc/rtc-mxc.c
new file mode 100644
index 0000000..6bd5072
--- /dev/null
+++ b/drivers/rtc/rtc-mxc.c
@@ -0,0 +1,507 @@
+/*
+ * Copyright 2004-2008 Freescale Semiconductor, Inc. All Rights Reserved.
+ *
+ * The code contained herein is licensed under the GNU General Public
+ * License. You may obtain a copy of the GNU General Public License
+ * Version 2 or later at the following locations:
+ *
+ * http://www.opensource.org/licenses/gpl-license.html
+ * http://www.gnu.org/copyleft/gpl.html
+ */
+
+#include <linux/io.h>
+#include <linux/rtc.h>
+#include <linux/module.h>
+#include <linux/interrupt.h>
+#include <linux/platform_device.h>
+#include <linux/clk.h>
+
+#include <mach/hardware.h>
+
+#define RTC_INPUT_CLK_32768HZ (0x00 << 5)
+#define RTC_INPUT_CLK_32000HZ (0x01 << 5)
+#define RTC_INPUT_CLK_38400HZ (0x02 << 5)
+
+#define RTC_SW_BIT (1 << 0)
+#define RTC_ALM_BIT (1 << 2)
+#define RTC_1HZ_BIT (1 << 4)
+#define RTC_2HZ_BIT (1 << 7)
+#define RTC_SAM0_BIT (1 << 8)
+#define RTC_SAM1_BIT (1 << 9)
+#define RTC_SAM2_BIT (1 << 10)
+#define RTC_SAM3_BIT (1 << 11)
+#define RTC_SAM4_BIT (1 << 12)
+#define RTC_SAM5_BIT (1 << 13)
+#define RTC_SAM6_BIT (1 << 14)
+#define RTC_SAM7_BIT (1 << 15)
+#define PIT_ALL_ON (RTC_2HZ_BIT | RTC_SAM0_BIT | RTC_SAM1_BIT | \
+ RTC_SAM2_BIT | RTC_SAM3_BIT | RTC_SAM4_BIT | \
+ RTC_SAM5_BIT | RTC_SAM6_BIT | RTC_SAM7_BIT)
+
+#define RTC_ENABLE_BIT (1 << 7)
+
+#define MAX_PIE_NUM 9
+#define MAX_PIE_FREQ 512
+static const u32 PIE_BIT_DEF[MAX_PIE_NUM][2] = {
+ { 2, RTC_2HZ_BIT },
+ { 4, RTC_SAM0_BIT },
+ { 8, RTC_SAM1_BIT },
+ { 16, RTC_SAM2_BIT },
+ { 32, RTC_SAM3_BIT },
+ { 64, RTC_SAM4_BIT },
+ { 128, RTC_SAM5_BIT },
+ { 256, RTC_SAM6_BIT },
+ { MAX_PIE_FREQ, RTC_SAM7_BIT },
+};
+
+/* Those are the bits from a classic RTC we want to mimic */
+#define RTC_IRQF 0x80 /* any of the following 3 is active */
+#define RTC_PF 0x40 /* Periodic interrupt */
+#define RTC_AF 0x20 /* Alarm interrupt */
+#define RTC_UF 0x10 /* Update interrupt for 1Hz RTC */
+
+#define MXC_RTC_TIME 0
+#define MXC_RTC_ALARM 1
+
+#define RTC_HOURMIN 0x00 /* 32bit rtc hour/min counter reg */
+#define RTC_SECOND 0x04 /* 32bit rtc seconds counter reg */
+#define RTC_ALRM_HM 0x08 /* 32bit rtc alarm hour/min reg */
+#define RTC_ALRM_SEC 0x0C /* 32bit rtc alarm seconds reg */
+#define RTC_RTCCTL 0x10 /* 32bit rtc control reg */
+#define RTC_RTCISR 0x14 /* 32bit rtc interrupt status reg */
+#define RTC_RTCIENR 0x18 /* 32bit rtc interrupt enable reg */
+#define RTC_STPWCH 0x1C /* 32bit rtc stopwatch min reg */
+#define RTC_DAYR 0x20 /* 32bit rtc days counter reg */
+#define RTC_DAYALARM 0x24 /* 32bit rtc day alarm reg */
+#define RTC_TEST1 0x28 /* 32bit rtc test reg 1 */
+#define RTC_TEST2 0x2C /* 32bit rtc test reg 2 */
+#define RTC_TEST3 0x30 /* 32bit rtc test reg 3 */
+
+struct rtc_plat_data {
+ struct rtc_device *rtc;
+ void __iomem *ioaddr;
+ int irq;
+ struct clk *clk;
+ unsigned int irqen;
+ int alrm_sec;
+ int alrm_min;
+ int alrm_hour;
+ int alrm_mday;
+ struct timespec mxc_rtc_delta;
+ struct rtc_time g_rtc_alarm;
+};
+
+/*
+ * This function is used to obtain the RTC time or the alarm value in
+ * second.
+ */
+static u32 get_alarm_or_time(struct device *dev, int time_alarm)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+ void __iomem *ioaddr = pdata->ioaddr;
+ u32 day = 0, hr = 0, min = 0, sec = 0, hr_min = 0;
+
+ switch (time_alarm) {
+ case MXC_RTC_TIME:
+ day = readw(ioaddr + RTC_DAYR);
+ hr_min = readw(ioaddr + RTC_HOURMIN);
+ sec = readw(ioaddr + RTC_SECOND);
+ break;
+ case MXC_RTC_ALARM:
+ day = readw(ioaddr + RTC_DAYALARM);
+ hr_min = readw(ioaddr + RTC_ALRM_HM) & 0xffff;
+ sec = readw(ioaddr + RTC_ALRM_SEC);
+ break;
+ }
+
+ hr = hr_min >> 8;
+ min = hr_min & 0xff;
+
+ return (((day * 24 + hr) * 60) + min) * 60 + sec;
+}
+
+/*
+ * This function sets the RTC alarm value or the time value.
+ */
+static void set_alarm_or_time(struct device *dev, int time_alarm, u32 time)
+{
+ u32 day, hr, min, sec, temp;
+ struct platform_device *pdev = to_platform_device(dev);
+ struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+ void __iomem *ioaddr = pdata->ioaddr;
+
+ day = time / 86400;
+ time -= day * 86400;
+
+ /* time is within a day now */
+ hr = time / 3600;
+ time -= hr * 3600;
+
+ /* time is within an hour now */
+ min = time / 60;
+ sec = time - min * 60;
+
+ temp = (hr << 8) + min;
+
+ switch (time_alarm) {
+ case MXC_RTC_TIME:
+ writew(day, ioaddr + RTC_DAYR);
+ writew(sec, ioaddr + RTC_SECOND);
+ writew(temp, ioaddr + RTC_HOURMIN);
+ break;
+ case MXC_RTC_ALARM:
+ writew(day, ioaddr + RTC_DAYALARM);
+ writew(sec, ioaddr + RTC_ALRM_SEC);
+ writew(temp, ioaddr + RTC_ALRM_HM);
+ break;
+ }
+}
+
+/*
+ * This function updates the RTC alarm registers and then clears all the
+ * interrupt status bits.
+ */
+static int rtc_update_alarm(struct device *dev, struct rtc_time *alrm)
+{
+ struct rtc_time alarm_tm, now_tm;
+ unsigned long now, time;
+ int ret;
+ struct platform_device *pdev = to_platform_device(dev);
+ struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+ void __iomem *ioaddr = pdata->ioaddr;
+
+ now = get_alarm_or_time(dev, MXC_RTC_TIME);
+ rtc_time_to_tm(now, &now_tm);
+ alarm_tm.tm_year = now_tm.tm_year;
+ alarm_tm.tm_mon = now_tm.tm_mon;
+ alarm_tm.tm_mday = now_tm.tm_mday;
+ alarm_tm.tm_hour = alrm->tm_hour;
+ alarm_tm.tm_min = alrm->tm_min;
+ alarm_tm.tm_sec = alrm->tm_sec;
+ rtc_tm_to_time(&now_tm, &now);
+ rtc_tm_to_time(&alarm_tm, &time);
+
+ if (time < now) {
+ time += 60 * 60 * 24;
+ rtc_time_to_tm(time, &alarm_tm);
+ }
+
+ ret = rtc_tm_to_time(&alarm_tm, &time);
+
+ /* clear all the interrupt status bits */
+ writew(readw(ioaddr + RTC_RTCISR), ioaddr + RTC_RTCISR);
+ set_alarm_or_time(dev, MXC_RTC_ALARM, time);
+
+ return ret;
+}
+
+/* This function is the RTC interrupt service routine. */
+static irqreturn_t mxc_rtc_interrupt(int irq, void *dev_id)
+{
+ struct platform_device *pdev = dev_id;
+ struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+ void __iomem *ioaddr = pdata->ioaddr;
+ u32 status;
+ u32 events = 0;
+
+ spin_lock_irq(&pdata->rtc->irq_lock);
+ status = readw(ioaddr + RTC_RTCISR) & readw(ioaddr + RTC_RTCIENR);
+ /* clear interrupt sources */
+ writew(status, ioaddr + RTC_RTCISR);
+
+ /* clear alarm interrupt if it has occurred */
+ if (status & RTC_ALM_BIT)
+ status &= ~RTC_ALM_BIT;
+
+ /* update irq data & counter */
+ if (status & RTC_ALM_BIT)
+ events |= (RTC_AF | RTC_IRQF);
+
+ if (status & RTC_1HZ_BIT)
+ events |= (RTC_UF | RTC_IRQF);
+
+ if (status & PIT_ALL_ON)
+ events |= (RTC_PF | RTC_IRQF);
+
+ if ((status & RTC_ALM_BIT) && rtc_valid_tm(&pdata->g_rtc_alarm))
+ rtc_update_alarm(&pdev->dev, &pdata->g_rtc_alarm);
+
+ rtc_update_irq(pdata->rtc, 1, events);
+ spin_unlock_irq(&pdata->rtc->irq_lock);
+
+ return IRQ_HANDLED;
+}
+
+/*
+ * Clear all interrupts and release the IRQ
+ */
+static void mxc_rtc_release(struct device *dev)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+ void __iomem *ioaddr = pdata->ioaddr;
+
+ spin_lock_irq(&pdata->rtc->irq_lock);
+
+ /* Disable all rtc interrupts */
+ writew(0, ioaddr + RTC_RTCIENR);
+
+ /* Clear all interrupt status */
+ writew(0xffffffff, ioaddr + RTC_RTCISR);
+
+ spin_unlock_irq(&pdata->rtc->irq_lock);
+}
+
+static void mxc_rtc_irq_enable(struct device *dev, unsigned int bit,
+ unsigned int enabled)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+ void __iomem *ioaddr = pdata->ioaddr;
+ u32 reg;
+
+ spin_lock_irq(&pdata->rtc->irq_lock);
+ reg = readw(ioaddr + RTC_RTCIENR);
+
+ if (enabled)
+ reg |= bit;
+ else
+ reg &= ~bit;
+
+ writew(reg, ioaddr + RTC_RTCIENR);
+ spin_unlock_irq(&pdata->rtc->irq_lock);
+}
+
+static int mxc_rtc_alarm_irq_enable(struct device *dev, unsigned int enabled)
+{
+ mxc_rtc_irq_enable(dev, RTC_ALM_BIT, enabled);
+ return 0;
+}
+
+static int mxc_rtc_update_irq_enable(struct device *dev, unsigned int enabled)
+{
+ mxc_rtc_irq_enable(dev, RTC_1HZ_BIT, enabled);
+ return 0;
+}
+
+/*
+ * This function reads the current RTC time into tm in Gregorian date.
+ */
+static int mxc_rtc_read_time(struct device *dev, struct rtc_time *tm)
+{
+ u32 val;
+
+ /* Avoid roll-over from reading the different registers */
+ do {
+ val = get_alarm_or_time(dev, MXC_RTC_TIME);
+ } while (val != get_alarm_or_time(dev, MXC_RTC_TIME));
+
+ rtc_time_to_tm(val, tm);
+
+ return 0;
+}
+
+/*
+ * This function sets the internal RTC time based on tm in Gregorian date.
+ */
+static int mxc_rtc_set_mmss(struct device *dev, unsigned long time)
+{
+ /* Avoid roll-over from reading the different registers */
+ do {
+ set_alarm_or_time(dev, MXC_RTC_TIME, time);
+ } while (time != get_alarm_or_time(dev, MXC_RTC_TIME));
+
+ return 0;
+}
+
+/*
+ * This function reads the current alarm value into the passed in 'alrm'
+ * argument. It updates the alrm's pending field value based on the whether
+ * an alarm interrupt occurs or not.
+ */
+static int mxc_rtc_read_alarm(struct device *dev, struct rtc_wkalrm *alrm)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+ void __iomem *ioaddr = pdata->ioaddr;
+
+ rtc_time_to_tm(get_alarm_or_time(dev, MXC_RTC_ALARM), &alrm->time);
+ alrm->pending = ((readw(ioaddr + RTC_RTCISR) & RTC_ALM_BIT)) ? 1 : 0;
+
+ return 0;
+}
+
+/*
+ * This function sets the RTC alarm based on passed in alrm.
+ */
+static int mxc_rtc_set_alarm(struct device *dev, struct rtc_wkalrm *alrm)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+ int ret;
+
+ if (rtc_valid_tm(&alrm->time)) {
+ if (alrm->time.tm_sec > 59 ||
+ alrm->time.tm_hour > 23 ||
+ alrm->time.tm_min > 59)
+ return -EINVAL;
+
+ ret = rtc_update_alarm(dev, &alrm->time);
+ } else {
+ ret = rtc_valid_tm(&alrm->time);
+ if (ret)
+ return ret;
+
+ ret = rtc_update_alarm(dev, &alrm->time);
+ }
+
+ if (ret)
+ return ret;
+
+ memcpy(&pdata->g_rtc_alarm, &alrm->time, sizeof(struct rtc_time));
+ mxc_rtc_irq_enable(dev, RTC_ALM_BIT, alrm->enabled);
+
+ return 0;
+}
+
+/* RTC layer */
+static struct rtc_class_ops mxc_rtc_ops = {
+ .release = mxc_rtc_release,
+ .read_time = mxc_rtc_read_time,
+ .set_mmss = mxc_rtc_set_mmss,
+ .read_alarm = mxc_rtc_read_alarm,
+ .set_alarm = mxc_rtc_set_alarm,
+ .alarm_irq_enable = mxc_rtc_alarm_irq_enable,
+ .update_irq_enable = mxc_rtc_update_irq_enable,
+};
+
+static int __init mxc_rtc_probe(struct platform_device *pdev)
+{
+ struct clk *clk;
+ struct resource *res;
+ struct rtc_device *rtc;
+ struct rtc_plat_data *pdata = NULL;
+ u32 reg;
+ int ret, rate;
+
+ res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ if (!res)
+ return -ENODEV;
+
+ pdata = kzalloc(sizeof(*pdata), GFP_KERNEL);
+ if (!pdata)
+ return -ENOMEM;
+
+ pdata->ioaddr = ioremap(res->start, resource_size(res));
+
+ clk = clk_get(&pdev->dev, "ckil");
+ if (IS_ERR(clk))
+ return PTR_ERR(clk);
+
+ rate = clk_get_rate(clk);
+ clk_put(clk);
+
+ if (rate == 32768)
+ reg = RTC_INPUT_CLK_32768HZ;
+ else if (rate == 32000)
+ reg = RTC_INPUT_CLK_32000HZ;
+ else if (rate == 38400)
+ reg = RTC_INPUT_CLK_38400HZ;
+ else {
+ dev_err(&pdev->dev, "rtc clock is not valid (%lu)\n",
+ clk_get_rate(clk));
+ ret = -EINVAL;
+ goto exit_free_pdata;
+ }
+
+ reg |= RTC_ENABLE_BIT;
+ writew(reg, (pdata->ioaddr + RTC_RTCCTL));
+ if (((readw(pdata->ioaddr + RTC_RTCCTL)) & RTC_ENABLE_BIT) == 0) {
+ dev_err(&pdev->dev, "hardware module can't be enabled!\n");
+ ret = -EIO;
+ goto exit_free_pdata;
+ }
+
+ pdata->clk = clk_get(&pdev->dev, "rtc");
+ if (IS_ERR(pdata->clk)) {
+ dev_err(&pdev->dev, "unable to get clock!\n");
+ ret = PTR_ERR(pdata->clk);
+ goto exit_free_pdata;
+ }
+
+ clk_enable(pdata->clk);
+
+ rtc = rtc_device_register(pdev->name, &pdev->dev, &mxc_rtc_ops,
+ THIS_MODULE);
+ if (IS_ERR(rtc)) {
+ ret = PTR_ERR(rtc);
+ goto exit_put_clk;
+ }
+
+ pdata->rtc = rtc;
+ platform_set_drvdata(pdev, pdata);
+
+ /* Configure and enable the RTC */
+ pdata->irq = platform_get_irq(pdev, 0);
+
+ if (pdata->irq >= 0 &&
+ request_irq(pdata->irq, mxc_rtc_interrupt, IRQF_SHARED,
+ pdev->name, pdev) < 0) {
+ dev_warn(&pdev->dev, "interrupt not available.\n");
+ pdata->irq = -1;
+ }
+
+ return 0;
+
+exit_put_clk:
+ clk_put(pdata->clk);
+
+exit_free_pdata:
+ kfree(pdata);
+
+ return ret;
+}
+
+static int __exit mxc_rtc_remove(struct platform_device *pdev)
+{
+ struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+
+ rtc_device_unregister(pdata->rtc);
+
+ if (pdata->irq >= 0)
+ free_irq(pdata->irq, pdev);
+
+ clk_disable(pdata->clk);
+ clk_put(pdata->clk);
+ kfree(pdata);
+ platform_set_drvdata(pdev, NULL);
+
+ return 0;
+}
+
+static struct platform_driver mxc_rtc_driver = {
+ .driver = {
+ .name = "mxc_rtc",
+ .owner = THIS_MODULE,
+ },
+ .remove = __exit_p(mxc_rtc_remove),
+};
+
+static int __init mxc_rtc_init(void)
+{
+ return platform_driver_probe(&mxc_rtc_driver, mxc_rtc_probe);
+}
+
+static void __exit mxc_rtc_exit(void)
+{
+ platform_driver_unregister(&mxc_rtc_driver);
+}
+
+module_init(mxc_rtc_init);
+module_exit(mxc_rtc_exit);
+
+MODULE_AUTHOR("Daniel Mack <daniel@caiaq.de>");
+MODULE_DESCRIPTION("RTC driver for Freescale MXC");
+MODULE_LICENSE("GPL");
+
diff --git a/drivers/rtc/rtc-pcap.c b/drivers/rtc/rtc-pcap.c
new file mode 100644
index 0000000..a99c289
--- /dev/null
+++ b/drivers/rtc/rtc-pcap.c
@@ -0,0 +1,224 @@
+/*
+ * pcap rtc code for Motorola EZX phones
+ *
+ * Copyright (c) 2008 guiming zhuo <gmzhuo@gmail.com>
+ * Copyright (c) 2009 Daniel Ribeiro <drwyrm@gmail.com>
+ *
+ * Based on Motorola's rtc.c Copyright (c) 2003-2005 Motorola
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+
+#include <linux/kernel.h>
+#include <linux/module.h>
+#include <linux/init.h>
+#include <linux/mfd/ezx-pcap.h>
+#include <linux/rtc.h>
+#include <linux/platform_device.h>
+
+struct pcap_rtc {
+ struct pcap_chip *pcap;
+ struct rtc_device *rtc;
+};
+
+static irqreturn_t pcap_rtc_irq(int irq, void *_pcap_rtc)
+{
+ struct pcap_rtc *pcap_rtc = _pcap_rtc;
+ unsigned long rtc_events;
+
+ if (irq == pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_1HZ))
+ rtc_events = RTC_IRQF | RTC_UF;
+ else if (irq == pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_TODA))
+ rtc_events = RTC_IRQF | RTC_AF;
+ else
+ rtc_events = 0;
+
+ rtc_update_irq(pcap_rtc->rtc, 1, rtc_events);
+ return IRQ_HANDLED;
+}
+
+static int pcap_rtc_read_alarm(struct device *dev, struct rtc_wkalrm *alrm)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+ struct rtc_time *tm = &alrm->time;
+ unsigned long secs;
+ u32 tod; /* time of day, seconds since midnight */
+ u32 days; /* days since 1/1/1970 */
+
+ ezx_pcap_read(pcap_rtc->pcap, PCAP_REG_RTC_TODA, &tod);
+ secs = tod & PCAP_RTC_TOD_MASK;
+
+ ezx_pcap_read(pcap_rtc->pcap, PCAP_REG_RTC_DAYA, &days);
+ secs += (days & PCAP_RTC_DAY_MASK) * SEC_PER_DAY;
+
+ rtc_time_to_tm(secs, tm);
+
+ return 0;
+}
+
+static int pcap_rtc_set_alarm(struct device *dev, struct rtc_wkalrm *alrm)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+ struct rtc_time *tm = &alrm->time;
+ unsigned long secs;
+ u32 tod, days;
+
+ rtc_tm_to_time(tm, &secs);
+
+ tod = secs % SEC_PER_DAY;
+ ezx_pcap_write(pcap_rtc->pcap, PCAP_REG_RTC_TODA, tod);
+
+ days = secs / SEC_PER_DAY;
+ ezx_pcap_write(pcap_rtc->pcap, PCAP_REG_RTC_DAYA, days);
+
+ return 0;
+}
+
+static int pcap_rtc_read_time(struct device *dev, struct rtc_time *tm)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+ unsigned long secs;
+ u32 tod, days;
+
+ ezx_pcap_read(pcap_rtc->pcap, PCAP_REG_RTC_TOD, &tod);
+ secs = tod & PCAP_RTC_TOD_MASK;
+
+ ezx_pcap_read(pcap_rtc->pcap, PCAP_REG_RTC_DAY, &days);
+ secs += (days & PCAP_RTC_DAY_MASK) * SEC_PER_DAY;
+
+ rtc_time_to_tm(secs, tm);
+
+ return rtc_valid_tm(tm);
+}
+
+static int pcap_rtc_set_mmss(struct device *dev, unsigned long secs)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+ u32 tod, days;
+
+ tod = secs % SEC_PER_DAY;
+ ezx_pcap_write(pcap_rtc->pcap, PCAP_REG_RTC_TOD, tod);
+
+ days = secs / SEC_PER_DAY;
+ ezx_pcap_write(pcap_rtc->pcap, PCAP_REG_RTC_DAY, days);
+
+ return 0;
+}
+
+static int pcap_rtc_irq_enable(struct device *dev, int pirq, unsigned int en)
+{
+ struct platform_device *pdev = to_platform_device(dev);
+ struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+
+ if (en)
+ enable_irq(pcap_to_irq(pcap_rtc->pcap, pirq));
+ else
+ disable_irq(pcap_to_irq(pcap_rtc->pcap, pirq));
+
+ return 0;
+}
+
+static int pcap_rtc_alarm_irq_enable(struct device *dev, unsigned int en)
+{
+ return pcap_rtc_irq_enable(dev, PCAP_IRQ_TODA, en);
+}
+
+static int pcap_rtc_update_irq_enable(struct device *dev, unsigned int en)
+{
+ return pcap_rtc_irq_enable(dev, PCAP_IRQ_1HZ, en);
+}
+
+static const struct rtc_class_ops pcap_rtc_ops = {
+ .read_time = pcap_rtc_read_time,
+ .read_alarm = pcap_rtc_read_alarm,
+ .set_alarm = pcap_rtc_set_alarm,
+ .set_mmss = pcap_rtc_set_mmss,
+ .alarm_irq_enable = pcap_rtc_alarm_irq_enable,
+ .update_irq_enable = pcap_rtc_update_irq_enable,
+};
+
+static int __devinit pcap_rtc_probe(struct platform_device *pdev)
+{
+ struct pcap_rtc *pcap_rtc;
+ int timer_irq, alarm_irq;
+ int err = -ENOMEM;
+
+ pcap_rtc = kmalloc(sizeof(struct pcap_rtc), GFP_KERNEL);
+ if (!pcap_rtc)
+ return err;
+
+ pcap_rtc->pcap = dev_get_drvdata(pdev->dev.parent);
+
+ pcap_rtc->rtc = rtc_device_register("pcap", &pdev->dev,
+ &pcap_rtc_ops, THIS_MODULE);
+ if (IS_ERR(pcap_rtc->rtc)) {
+ err = PTR_ERR(pcap_rtc->rtc);
+ goto fail_rtc;
+ }
+
+ platform_set_drvdata(pdev, pcap_rtc);
+
+ timer_irq = pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_1HZ);
+ alarm_irq = pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_TODA);
+
+ err = request_irq(timer_irq, pcap_rtc_irq, 0, "RTC Timer", pcap_rtc);
+ if (err)
+ goto fail_timer;
+
+ err = request_irq(alarm_irq, pcap_rtc_irq, 0, "RTC Alarm", pcap_rtc);
+ if (err)
+ goto fail_alarm;
+
+ return 0;
+fail_alarm:
+ free_irq(timer_irq, pcap_rtc);
+fail_timer:
+ rtc_device_unregister(pcap_rtc->rtc);
+fail_rtc:
+ kfree(pcap_rtc);
+ return err;
+}
+
+static int __devexit pcap_rtc_remove(struct platform_device *pdev)
+{
+ struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+
+ free_irq(pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_1HZ), pcap_rtc);
+ free_irq(pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_TODA), pcap_rtc);
+ rtc_device_unregister(pcap_rtc->rtc);
+ kfree(pcap_rtc);
+
+ return 0;
+}
+
+static struct platform_driver pcap_rtc_driver = {
+ .remove = __devexit_p(pcap_rtc_remove),
+ .driver = {
+ .name = "pcap-rtc",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init rtc_pcap_init(void)
+{
+ return platform_driver_probe(&pcap_rtc_driver, pcap_rtc_probe);
+}
+
+static void __exit rtc_pcap_exit(void)
+{
+ platform_driver_unregister(&pcap_rtc_driver);
+}
+
+module_init(rtc_pcap_init);
+module_exit(rtc_pcap_exit);
+
+MODULE_DESCRIPTION("Motorola pcap rtc driver");
+MODULE_AUTHOR("guiming zhuo <gmzhuo@gmail.com>");
+MODULE_LICENSE("GPL");
diff --git a/drivers/rtc/rtc-pcf2123.c b/drivers/rtc/rtc-pcf2123.c
new file mode 100644
index 0000000..e75df9d
--- /dev/null
+++ b/drivers/rtc/rtc-pcf2123.c
@@ -0,0 +1,364 @@
+/*
+ * An SPI driver for the Philips PCF2123 RTC
+ * Copyright 2009 Cyber Switching, Inc.
+ *
+ * Author: Chris Verges <chrisv@cyberswitching.com>
+ * Maintainers: http://www.cyberswitching.com
+ *
+ * based on the RS5C348 driver in this same directory.
+ *
+ * Thanks to Christian Pellegrin <chripell@fsfe.org> for
+ * the sysfs contributions to this driver.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * Please note that the CS is active high, so platform data
+ * should look something like:
+ *
+ * static struct spi_board_info ek_spi_devices[] = {
+ * ...
+ * {
+ * .modalias = "rtc-pcf2123",
+ * .chip_select = 1,
+ * .controller_data = (void *)AT91_PIN_PA10,
+ * .max_speed_hz = 1000 * 1000,
+ * .mode = SPI_CS_HIGH,
+ * .bus_num = 0,
+ * },
+ * ...
+ *};
+ *
+ */
+
+#include <linux/bcd.h>
+#include <linux/delay.h>
+#include <linux/device.h>
+#include <linux/errno.h>
+#include <linux/init.h>
+#include <linux/kernel.h>
+#include <linux/string.h>
+#include <linux/rtc.h>
+#include <linux/spi/spi.h>
+
+#define DRV_VERSION "0.6"
+
+#define PCF2123_REG_CTRL1 (0x00) /* Control Register 1 */
+#define PCF2123_REG_CTRL2 (0x01) /* Control Register 2 */
+#define PCF2123_REG_SC (0x02) /* datetime */
+#define PCF2123_REG_MN (0x03)
+#define PCF2123_REG_HR (0x04)
+#define PCF2123_REG_DM (0x05)
+#define PCF2123_REG_DW (0x06)
+#define PCF2123_REG_MO (0x07)
+#define PCF2123_REG_YR (0x08)
+
+#define PCF2123_SUBADDR (1 << 4)
+#define PCF2123_WRITE ((0 << 7) | PCF2123_SUBADDR)
+#define PCF2123_READ ((1 << 7) | PCF2123_SUBADDR)
+
+static struct spi_driver pcf2123_driver;
+
+struct pcf2123_sysfs_reg {
+ struct device_attribute attr;
+ char name[2];
+};
+
+struct pcf2123_plat_data {
+ struct rtc_device *rtc;
+ struct pcf2123_sysfs_reg regs[16];
+};
+
+/*
+ * Causes a 30 nanosecond delay to ensure that the PCF2123 chip select
+ * is released properly after an SPI write. This function should be
+ * called after EVERY read/write call over SPI.
+ */
+static inline void pcf2123_delay_trec(void)
+{
+ ndelay(30);
+}
+
+static ssize_t pcf2123_show(struct device *dev, struct device_attribute *attr,
+ char *buffer)
+{
+ struct spi_device *spi = to_spi_device(dev);
+ struct pcf2123_sysfs_reg *r;
+ u8 txbuf[1], rxbuf[1];
+ unsigned long reg;
+ int ret;
+
+ r = container_of(attr, struct pcf2123_sysfs_reg, attr);
+
+ if (strict_strtoul(r->name, 16, ®))
+ return -EINVAL;
+
+ txbuf[0] = PCF2123_READ | reg;
+ ret = spi_write_then_read(spi, txbuf, 1, rxbuf, 1);
+ if (ret < 0)
+ return -EIO;
+ pcf2123_delay_trec();
+ return sprintf(buffer, "0x%x\n", rxbuf[0]);
+}
+
+static ssize_t pcf2123_store(struct device *dev, struct device_attribute *attr,
+ const char *buffer, size_t count) {
+ struct spi_device *spi = to_spi_device(dev);
+ struct pcf2123_sysfs_reg *r;
+ u8 txbuf[2];
+ unsigned long reg;
+ unsigned long val;
+
+ int ret;
+
+ r = container_of(attr, struct pcf2123_sysfs_reg, attr);
+
+ if (strict_strtoul(r->name, 16, ®)
+ || strict_strtoul(buffer, 10, &val))
+ return -EINVAL;
+
+ txbuf[0] = PCF2123_WRITE | reg;
+ txbuf[1] = val;
+ ret = spi_write(spi, txbuf, sizeof(txbuf));
+ if (ret < 0)
+ return -EIO;
+ pcf2123_delay_trec();
+ return count;
+}
+
+static int pcf2123_rtc_read_time(struct device *dev, struct rtc_time *tm)
+{
+ struct spi_device *spi = to_spi_device(dev);
+ u8 txbuf[1], rxbuf[7];
+ int ret;
+
+ txbuf[0] = PCF2123_READ | PCF2123_REG_SC;
+ ret = spi_write_then_read(spi, txbuf, sizeof(txbuf),
+ rxbuf, sizeof(rxbuf));
+ if (ret < 0)
+ return ret;
+ pcf2123_delay_trec();
+
+ tm->tm_sec = bcd2bin(rxbuf[0] & 0x7F);
+ tm->tm_min = bcd2bin(rxbuf[1] & 0x7F);
+ tm->tm_hour = bcd2bin(rxbuf[2] & 0x3F); /* rtc hr 0-23 */
+ tm->tm_mday = bcd2bin(rxbuf[3] & 0x3F);
+ tm->tm_wday = rxbuf[4] & 0x07;
+ tm->tm_mon = bcd2bin(rxbuf[5] & 0x1F) - 1; /* rtc mn 1-12 */
+ tm->tm_year = bcd2bin(rxbuf[6]);
+ if (tm->tm_year < 70)
+ tm->tm_year += 100; /* assume we are in 1970...2069 */
+
+ dev_dbg(dev, "%s: tm is secs=%d, mins=%d, hours=%d, "
+ "mday=%d, mon=%d, year=%d, wday=%d\n",
+ __func__,
+ tm->tm_sec, tm->tm_min, tm->tm_hour,
+ tm->tm_mday, tm->tm_mon, tm->tm_year, tm->tm_wday);
+
+ /* the clock can give out invalid datetime, but we cannot return
+ * -EINVAL otherwise hwclock will refuse to set the time on bootup.
+ */
+ if (rtc_valid_tm(tm) < 0)
+ dev_err(dev, "retrieved date/time is not valid.\n");
+
+ return 0;
+}
+
+static int pcf2123_rtc_set_time(struct device *dev, struct rtc_time *tm)
+{
+ struct spi_device *spi = to_spi_device(dev);
+ u8 txbuf[8];
+ int ret;
+
+ dev_dbg(dev, "%s: tm is secs=%d, mins=%d, hours=%d, "
+ "mday=%d, mon=%d, year=%d, wday=%d\n",
+ __func__,
+ tm->tm_sec, tm->tm_min, tm->tm_hour,
+ tm->tm_mday, tm->tm_mon, tm->tm_year, tm->tm_wday);
+
+ /* Stop the counter first */
+ txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+ txbuf[1] = 0x20;
+ ret = spi_write(spi, txbuf, 2);
+ if (ret < 0)
+ return ret;
+ pcf2123_delay_trec();
+
+ /* Set the new time */
+ txbuf[0] = PCF2123_WRITE | PCF2123_REG_SC;
+ txbuf[1] = bin2bcd(tm->tm_sec & 0x7F);
+ txbuf[2] = bin2bcd(tm->tm_min & 0x7F);
+ txbuf[3] = bin2bcd(tm->tm_hour & 0x3F);
+ txbuf[4] = bin2bcd(tm->tm_mday & 0x3F);
+ txbuf[5] = tm->tm_wday & 0x07;
+ txbuf[6] = bin2bcd((tm->tm_mon + 1) & 0x1F); /* rtc mn 1-12 */
+ txbuf[7] = bin2bcd(tm->tm_year < 100 ? tm->tm_year : tm->tm_year - 100);
+
+ ret = spi_write(spi, txbuf, sizeof(txbuf));
+ if (ret < 0)
+ return ret;
+ pcf2123_delay_trec();
+
+ /* Start the counter */
+ txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+ txbuf[1] = 0x00;
+ ret = spi_write(spi, txbuf, 2);
+ if (ret < 0)
+ return ret;
+ pcf2123_delay_trec();
+
+ return 0;
+}
+
+static const struct rtc_class_ops pcf2123_rtc_ops = {
+ .read_time = pcf2123_rtc_read_time,
+ .set_time = pcf2123_rtc_set_time,
+};
+
+static int __devinit pcf2123_probe(struct spi_device *spi)
+{
+ struct rtc_device *rtc;
+ struct pcf2123_plat_data *pdata;
+ u8 txbuf[2], rxbuf[2];
+ int ret, i;
+
+ pdata = kzalloc(sizeof(struct pcf2123_plat_data), GFP_KERNEL);
+ if (!pdata)
+ return -ENOMEM;
+ spi->dev.platform_data = pdata;
+
+ /* Send a software reset command */
+ txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+ txbuf[1] = 0x58;
+ dev_dbg(&spi->dev, "resetting RTC (0x%02X 0x%02X)\n",
+ txbuf[0], txbuf[1]);
+ ret = spi_write(spi, txbuf, 2 * sizeof(u8));
+ if (ret < 0)
+ goto kfree_exit;
+ pcf2123_delay_trec();
+
+ /* Stop the counter */
+ txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+ txbuf[1] = 0x20;
+ dev_dbg(&spi->dev, "stopping RTC (0x%02X 0x%02X)\n",
+ txbuf[0], txbuf[1]);
+ ret = spi_write(spi, txbuf, 2 * sizeof(u8));
+ if (ret < 0)
+ goto kfree_exit;
+ pcf2123_delay_trec();
+
+ /* See if the counter was actually stopped */
+ txbuf[0] = PCF2123_READ | PCF2123_REG_CTRL1;
+ dev_dbg(&spi->dev, "checking for presence of RTC (0x%02X)\n",
+ txbuf[0]);
+ ret = spi_write_then_read(spi, txbuf, 1 * sizeof(u8),
+ rxbuf, 2 * sizeof(u8));
+ dev_dbg(&spi->dev, "received data from RTC (0x%02X 0x%02X)\n",
+ rxbuf[0], rxbuf[1]);
+ if (ret < 0)
+ goto kfree_exit;
+ pcf2123_delay_trec();
+
+ if (!(rxbuf[0] & 0x20)) {
+ dev_err(&spi->dev, "chip not found\n");
+ goto kfree_exit;
+ }
+
+ dev_info(&spi->dev, "chip found, driver version " DRV_VERSION "\n");
+ dev_info(&spi->dev, "spiclk %u KHz.\n",
+ (spi->max_speed_hz + 500) / 1000);
+
+ /* Start the counter */
+ txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+ txbuf[1] = 0x00;
+ ret = spi_write(spi, txbuf, sizeof(txbuf));
+ if (ret < 0)
+ goto kfree_exit;
+ pcf2123_delay_trec();
+
+ /* Finalize the initialization */
+ rtc = rtc_device_register(pcf2123_driver.driver.name, &spi->dev,
+ &pcf2123_rtc_ops, THIS_MODULE);
+
+ if (IS_ERR(rtc)) {
+ dev_err(&spi->dev, "failed to register.\n");
+ ret = PTR_ERR(rtc);
+ goto kfree_exit;
+ }
+
+ pdata->rtc = rtc;
+
+ for (i = 0; i < 16; i++) {
+ sprintf(pdata->regs[i].name, "%1x", i);
+ pdata->regs[i].attr.attr.mode = S_IRUGO | S_IWUSR;
+ pdata->regs[i].attr.attr.name = pdata->regs[i].name;
+ pdata->regs[i].attr.show = pcf2123_show;
+ pdata->regs[i].attr.store = pcf2123_store;
+ ret = device_create_file(&spi->dev, &pdata->regs[i].attr);
+ if (ret) {
+ dev_err(&spi->dev, "Unable to create sysfs %s\n",
+ pdata->regs[i].name);
+ goto sysfs_exit;
+ }
+ }
+
+ return 0;
+
+sysfs_exit:
+ for (i--; i >= 0; i--)
+ device_remove_file(&spi->dev, &pdata->regs[i].attr);
+
+kfree_exit:
+ kfree(pdata);
+ spi->dev.platform_data = NULL;
+ return ret;
+}
+
+static int pcf2123_remove(struct spi_device *spi)
+{
+ struct pcf2123_plat_data *pdata = spi->dev.platform_data;
+ int i;
+
+ if (pdata) {
+ struct rtc_device *rtc = pdata->rtc;
+
+ if (rtc)
+ rtc_device_unregister(rtc);
+ for (i = 0; i < 16; i++)
+ if (pdata->regs[i].name[0])
+ device_remove_file(&spi->dev,
+ &pdata->regs[i].attr);
+ kfree(pdata);
+ }
+
+ return 0;
+}
+
+static struct spi_driver pcf2123_driver = {
+ .driver = {
+ .name = "rtc-pcf2123",
+ .bus = &spi_bus_type,
+ .owner = THIS_MODULE,
+ },
+ .probe = pcf2123_probe,
+ .remove = __devexit_p(pcf2123_remove),
+};
+
+static int __init pcf2123_init(void)
+{
+ return spi_register_driver(&pcf2123_driver);
+}
+
+static void __exit pcf2123_exit(void)
+{
+ spi_unregister_driver(&pcf2123_driver);
+}
+
+MODULE_AUTHOR("Chris Verges <chrisv@cyberswitching.com>");
+MODULE_DESCRIPTION("NXP PCF2123 RTC driver");
+MODULE_LICENSE("GPL");
+MODULE_VERSION(DRV_VERSION);
+
+module_init(pcf2123_init);
+module_exit(pcf2123_exit);
diff --git a/drivers/rtc/rtc-r9701.c b/drivers/rtc/rtc-r9701.c
index 42028f2..9beba49c 100644
--- a/drivers/rtc/rtc-r9701.c
+++ b/drivers/rtc/rtc-r9701.c
@@ -174,3 +174,4 @@
MODULE_DESCRIPTION("r9701 spi RTC driver");
MODULE_AUTHOR("Magnus Damm <damm@opensource.se>");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:rtc-r9701");
diff --git a/drivers/rtc/rtc-rs5c348.c b/drivers/rtc/rtc-rs5c348.c
index dd1e2bc..2099037 100644
--- a/drivers/rtc/rtc-rs5c348.c
+++ b/drivers/rtc/rtc-rs5c348.c
@@ -251,3 +251,4 @@
MODULE_DESCRIPTION("Ricoh RS5C348 RTC driver");
MODULE_LICENSE("GPL");
MODULE_VERSION(DRV_VERSION);
+MODULE_ALIAS("spi:rtc-rs5c348");
diff --git a/drivers/rtc/rtc-stmp3xxx.c b/drivers/rtc/rtc-stmp3xxx.c
new file mode 100644
index 0000000..d7ce1a5
--- /dev/null
+++ b/drivers/rtc/rtc-stmp3xxx.c
@@ -0,0 +1,304 @@
+/*
+ * Freescale STMP37XX/STMP378X Real Time Clock driver
+ *
+ * Copyright (c) 2007 Sigmatel, Inc.
+ * Peter Hartley, <peter.hartley@sigmatel.com>
+ *
+ * Copyright 2008 Freescale Semiconductor, Inc. All Rights Reserved.
+ * Copyright 2008 Embedded Alley Solutions, Inc All Rights Reserved.
+ */
+
+/*
+ * The code contained herein is licensed under the GNU General Public
+ * License. You may obtain a copy of the GNU General Public License
+ * Version 2 or later at the following locations:
+ *
+ * http://www.opensource.org/licenses/gpl-license.html
+ * http://www.gnu.org/copyleft/gpl.html
+ */
+#include <linux/kernel.h>
+#include <linux/module.h>
+#include <linux/init.h>
+#include <linux/platform_device.h>
+#include <linux/interrupt.h>
+#include <linux/rtc.h>
+
+#include <mach/platform.h>
+#include <mach/stmp3xxx.h>
+#include <mach/regs-rtc.h>
+
+struct stmp3xxx_rtc_data {
+ struct rtc_device *rtc;
+ unsigned irq_count;
+ void __iomem *io;
+ int irq_alarm, irq_1msec;
+};
+
+static void stmp3xxx_wait_time(struct stmp3xxx_rtc_data *rtc_data)
+{
+ /*
+ * The datasheet doesn't say which way round the
+ * NEW_REGS/STALE_REGS bitfields go. In fact it's 0x1=P0,
+ * 0x2=P1, .., 0x20=P5, 0x40=ALARM, 0x80=SECONDS
+ */
+ while (__raw_readl(rtc_data->io + HW_RTC_STAT) &
+ BF(0x80, RTC_STAT_STALE_REGS))
+ cpu_relax();
+}
+
+/* Time read/write */
+static int stmp3xxx_rtc_gettime(struct device *dev, struct rtc_time *rtc_tm)
+{
+ struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+ stmp3xxx_wait_time(rtc_data);
+ rtc_time_to_tm(__raw_readl(rtc_data->io + HW_RTC_SECONDS), rtc_tm);
+ return 0;
+}
+
+static int stmp3xxx_rtc_set_mmss(struct device *dev, unsigned long t)
+{
+ struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+ __raw_writel(t, rtc_data->io + HW_RTC_SECONDS);
+ stmp3xxx_wait_time(rtc_data);
+ return 0;
+}
+
+/* interrupt(s) handler */
+static irqreturn_t stmp3xxx_rtc_interrupt(int irq, void *dev_id)
+{
+ struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev_id);
+ u32 status;
+ u32 events = 0;
+
+ status = __raw_readl(rtc_data->io + HW_RTC_CTRL) &
+ (BM_RTC_CTRL_ALARM_IRQ | BM_RTC_CTRL_ONEMSEC_IRQ);
+
+ if (status & BM_RTC_CTRL_ALARM_IRQ) {
+ stmp3xxx_clearl(BM_RTC_CTRL_ALARM_IRQ,
+ rtc_data->io + HW_RTC_CTRL);
+ events |= RTC_AF | RTC_IRQF;
+ }
+
+ if (status & BM_RTC_CTRL_ONEMSEC_IRQ) {
+ stmp3xxx_clearl(BM_RTC_CTRL_ONEMSEC_IRQ,
+ rtc_data->io + HW_RTC_CTRL);
+ if (++rtc_data->irq_count % 1000 == 0) {
+ events |= RTC_UF | RTC_IRQF;
+ rtc_data->irq_count = 0;
+ }
+ }
+
+ if (events)
+ rtc_update_irq(rtc_data->rtc, 1, events);
+
+ return IRQ_HANDLED;
+}
+
+static int stmp3xxx_alarm_irq_enable(struct device *dev, unsigned int enabled)
+{
+ struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+ void __iomem *p = rtc_data->io + HW_RTC_PERSISTENT0,
+ *ctl = rtc_data->io + HW_RTC_CTRL;
+
+ if (enabled) {
+ stmp3xxx_setl(BM_RTC_PERSISTENT0_ALARM_EN |
+ BM_RTC_PERSISTENT0_ALARM_WAKE_EN, p);
+ stmp3xxx_setl(BM_RTC_CTRL_ALARM_IRQ_EN, ctl);
+ } else {
+ stmp3xxx_clearl(BM_RTC_PERSISTENT0_ALARM_EN |
+ BM_RTC_PERSISTENT0_ALARM_WAKE_EN, p);
+ stmp3xxx_clearl(BM_RTC_CTRL_ALARM_IRQ_EN, ctl);
+ }
+ return 0;
+}
+
+static int stmp3xxx_update_irq_enable(struct device *dev, unsigned int enabled)
+{
+ struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+ if (enabled)
+ stmp3xxx_setl(BM_RTC_CTRL_ONEMSEC_IRQ_EN,
+ rtc_data->io + HW_RTC_CTRL);
+ else
+ stmp3xxx_clearl(BM_RTC_CTRL_ONEMSEC_IRQ_EN,
+ rtc_data->io + HW_RTC_CTRL);
+ return 0;
+}
+
+static int stmp3xxx_rtc_read_alarm(struct device *dev, struct rtc_wkalrm *alm)
+{
+ struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+ rtc_time_to_tm(__raw_readl(rtc_data->io + HW_RTC_ALARM), &alm->time);
+ return 0;
+}
+
+static int stmp3xxx_rtc_set_alarm(struct device *dev, struct rtc_wkalrm *alm)
+{
+ unsigned long t;
+ struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+ rtc_tm_to_time(&alm->time, &t);
+ __raw_writel(t, rtc_data->io + HW_RTC_ALARM);
+ return 0;
+}
+
+static struct rtc_class_ops stmp3xxx_rtc_ops = {
+ .alarm_irq_enable =
+ stmp3xxx_alarm_irq_enable,
+ .update_irq_enable =
+ stmp3xxx_update_irq_enable,
+ .read_time = stmp3xxx_rtc_gettime,
+ .set_mmss = stmp3xxx_rtc_set_mmss,
+ .read_alarm = stmp3xxx_rtc_read_alarm,
+ .set_alarm = stmp3xxx_rtc_set_alarm,
+};
+
+static int stmp3xxx_rtc_remove(struct platform_device *pdev)
+{
+ struct stmp3xxx_rtc_data *rtc_data = platform_get_drvdata(pdev);
+
+ if (!rtc_data)
+ return 0;
+
+ stmp3xxx_clearl(BM_RTC_CTRL_ONEMSEC_IRQ_EN | BM_RTC_CTRL_ALARM_IRQ_EN,
+ rtc_data->io + HW_RTC_CTRL);
+ free_irq(rtc_data->irq_alarm, &pdev->dev);
+ free_irq(rtc_data->irq_1msec, &pdev->dev);
+ rtc_device_unregister(rtc_data->rtc);
+ iounmap(rtc_data->io);
+ kfree(rtc_data);
+
+ return 0;
+}
+
+static int stmp3xxx_rtc_probe(struct platform_device *pdev)
+{
+ struct stmp3xxx_rtc_data *rtc_data;
+ struct resource *r;
+ int err;
+
+ rtc_data = kzalloc(sizeof *rtc_data, GFP_KERNEL);
+ if (!rtc_data)
+ return -ENOMEM;
+
+ r = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ if (!r) {
+ dev_err(&pdev->dev, "failed to get resource\n");
+ err = -ENXIO;
+ goto out_free;
+ }
+
+ rtc_data->io = ioremap(r->start, resource_size(r));
+ if (!rtc_data->io) {
+ dev_err(&pdev->dev, "ioremap failed\n");
+ err = -EIO;
+ goto out_free;
+ }
+
+ rtc_data->irq_alarm = platform_get_irq(pdev, 0);
+ rtc_data->irq_1msec = platform_get_irq(pdev, 1);
+
+ if (!(__raw_readl(HW_RTC_STAT + rtc_data->io) &
+ BM_RTC_STAT_RTC_PRESENT)) {
+ dev_err(&pdev->dev, "no device onboard\n");
+ err = -ENODEV;
+ goto out_remap;
+ }
+
+ stmp3xxx_reset_block(rtc_data->io, true);
+ stmp3xxx_clearl(BM_RTC_PERSISTENT0_ALARM_EN |
+ BM_RTC_PERSISTENT0_ALARM_WAKE_EN |
+ BM_RTC_PERSISTENT0_ALARM_WAKE,
+ rtc_data->io + HW_RTC_PERSISTENT0);
+ rtc_data->rtc = rtc_device_register(pdev->name, &pdev->dev,
+ &stmp3xxx_rtc_ops, THIS_MODULE);
+ if (IS_ERR(rtc_data->rtc)) {
+ err = PTR_ERR(rtc_data->rtc);
+ goto out_remap;
+ }
+
+ rtc_data->irq_count = 0;
+ err = request_irq(rtc_data->irq_alarm, stmp3xxx_rtc_interrupt,
+ IRQF_DISABLED, "RTC alarm", &pdev->dev);
+ if (err) {
+ dev_err(&pdev->dev, "Cannot claim IRQ%d\n",
+ rtc_data->irq_alarm);
+ goto out_irq_alarm;
+ }
+ err = request_irq(rtc_data->irq_1msec, stmp3xxx_rtc_interrupt,
+ IRQF_DISABLED, "RTC tick", &pdev->dev);
+ if (err) {
+ dev_err(&pdev->dev, "Cannot claim IRQ%d\n",
+ rtc_data->irq_1msec);
+ goto out_irq1;
+ }
+
+ platform_set_drvdata(pdev, rtc_data);
+
+ return 0;
+
+out_irq1:
+ free_irq(rtc_data->irq_alarm, &pdev->dev);
+out_irq_alarm:
+ stmp3xxx_clearl(BM_RTC_CTRL_ONEMSEC_IRQ_EN | BM_RTC_CTRL_ALARM_IRQ_EN,
+ rtc_data->io + HW_RTC_CTRL);
+ rtc_device_unregister(rtc_data->rtc);
+out_remap:
+ iounmap(rtc_data->io);
+out_free:
+ kfree(rtc_data);
+ return err;
+}
+
+#ifdef CONFIG_PM
+static int stmp3xxx_rtc_suspend(struct platform_device *dev, pm_message_t state)
+{
+ return 0;
+}
+
+static int stmp3xxx_rtc_resume(struct platform_device *dev)
+{
+ struct stmp3xxx_rtc_data *rtc_data = platform_get_drvdata(dev);
+
+ stmp3xxx_reset_block(rtc_data->io, true);
+ stmp3xxx_clearl(BM_RTC_PERSISTENT0_ALARM_EN |
+ BM_RTC_PERSISTENT0_ALARM_WAKE_EN |
+ BM_RTC_PERSISTENT0_ALARM_WAKE,
+ rtc_data->io + HW_RTC_PERSISTENT0);
+ return 0;
+}
+#else
+#define stmp3xxx_rtc_suspend NULL
+#define stmp3xxx_rtc_resume NULL
+#endif
+
+static struct platform_driver stmp3xxx_rtcdrv = {
+ .probe = stmp3xxx_rtc_probe,
+ .remove = stmp3xxx_rtc_remove,
+ .suspend = stmp3xxx_rtc_suspend,
+ .resume = stmp3xxx_rtc_resume,
+ .driver = {
+ .name = "stmp3xxx-rtc",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init stmp3xxx_rtc_init(void)
+{
+ return platform_driver_register(&stmp3xxx_rtcdrv);
+}
+
+static void __exit stmp3xxx_rtc_exit(void)
+{
+ platform_driver_unregister(&stmp3xxx_rtcdrv);
+}
+
+module_init(stmp3xxx_rtc_init);
+module_exit(stmp3xxx_rtc_exit);
+
+MODULE_DESCRIPTION("STMP3xxx RTC Driver");
+MODULE_AUTHOR("dmitry pervushin <dpervushin@embeddedalley.com>");
+MODULE_LICENSE("GPL");
diff --git a/drivers/rtc/rtc-sysfs.c b/drivers/rtc/rtc-sysfs.c
index 2531ce4..7dd23a6 100644
--- a/drivers/rtc/rtc-sysfs.c
+++ b/drivers/rtc/rtc-sysfs.c
@@ -102,6 +102,19 @@
return n;
}
+static ssize_t
+rtc_sysfs_show_hctosys(struct device *dev, struct device_attribute *attr,
+ char *buf)
+{
+#ifdef CONFIG_RTC_HCTOSYS_DEVICE
+ if (strcmp(dev_name(&to_rtc_device(dev)->dev),
+ CONFIG_RTC_HCTOSYS_DEVICE) == 0)
+ return sprintf(buf, "1\n");
+ else
+#endif
+ return sprintf(buf, "0\n");
+}
+
static struct device_attribute rtc_attrs[] = {
__ATTR(name, S_IRUGO, rtc_sysfs_show_name, NULL),
__ATTR(date, S_IRUGO, rtc_sysfs_show_date, NULL),
@@ -109,6 +122,7 @@
__ATTR(since_epoch, S_IRUGO, rtc_sysfs_show_since_epoch, NULL),
__ATTR(max_user_freq, S_IRUGO | S_IWUSR, rtc_sysfs_show_max_user_freq,
rtc_sysfs_set_max_user_freq),
+ __ATTR(hctosys, S_IRUGO, rtc_sysfs_show_hctosys, NULL),
{ },
};
diff --git a/drivers/scsi/sg.c b/drivers/scsi/sg.c
index 4968c4c..848b594 100644
--- a/drivers/scsi/sg.c
+++ b/drivers/scsi/sg.c
@@ -2233,7 +2233,7 @@
.open = sg_proc_open_dev,
.release = seq_release,
};
-static struct seq_operations dev_seq_ops = {
+static const struct seq_operations dev_seq_ops = {
.start = dev_seq_start,
.next = dev_seq_next,
.stop = dev_seq_stop,
@@ -2246,7 +2246,7 @@
.open = sg_proc_open_devstrs,
.release = seq_release,
};
-static struct seq_operations devstrs_seq_ops = {
+static const struct seq_operations devstrs_seq_ops = {
.start = dev_seq_start,
.next = dev_seq_next,
.stop = dev_seq_stop,
@@ -2259,7 +2259,7 @@
.open = sg_proc_open_debug,
.release = seq_release,
};
-static struct seq_operations debug_seq_ops = {
+static const struct seq_operations debug_seq_ops = {
.start = dev_seq_start,
.next = dev_seq_next,
.stop = dev_seq_stop,
diff --git a/drivers/serial/max3100.c b/drivers/serial/max3100.c
index 75ab006..3c30c56 100644
--- a/drivers/serial/max3100.c
+++ b/drivers/serial/max3100.c
@@ -925,3 +925,4 @@
MODULE_DESCRIPTION("MAX3100 driver");
MODULE_AUTHOR("Christian Pellegrin <chripell@evolware.org>");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:max3100");
diff --git a/drivers/spi/Kconfig b/drivers/spi/Kconfig
index 2c733c2..4b6f7cb 100644
--- a/drivers/spi/Kconfig
+++ b/drivers/spi/Kconfig
@@ -117,10 +117,11 @@
speed with a custom version of this driver; see the source code.
config SPI_IMX
- tristate "Freescale iMX SPI controller"
- depends on ARCH_MX1 && EXPERIMENTAL
+ tristate "Freescale i.MX SPI controllers"
+ depends on ARCH_MXC
+ select SPI_BITBANG
help
- This enables using the Freescale iMX SPI controller in master
+ This enables using the Freescale i.MX SPI controllers in master
mode.
config SPI_LM70_LLP
@@ -173,11 +174,21 @@
tristate "ARM AMBA PL022 SSP controller (EXPERIMENTAL)"
depends on ARM_AMBA && EXPERIMENTAL
default y if MACH_U300
+ default y if ARCH_REALVIEW
+ default y if INTEGRATOR_IMPD1
+ default y if ARCH_VERSATILE
help
This selects the ARM(R) AMBA(R) PrimeCell PL022 SSP
controller. If you have an embedded system with an AMBA(R)
bus and a PL022 controller, say Y or M here.
+config SPI_PPC4xx
+ tristate "PPC4xx SPI Controller"
+ depends on PPC32 && 4xx && SPI_MASTER
+ select SPI_BITBANG
+ help
+ This selects a driver for the PPC4xx SPI Controller.
+
config SPI_PXA2XX
tristate "PXA2xx SSP SPI master"
depends on ARCH_PXA && EXPERIMENTAL
@@ -211,6 +222,12 @@
help
SPI driver for SuperH SCI blocks.
+config SPI_STMP3XXX
+ tristate "Freescale STMP37xx/378x SPI/SSP controller"
+ depends on ARCH_STMP3XXX && SPI_MASTER
+ help
+ SPI driver for Freescale STMP37xx/378x SoC SSP interface
+
config SPI_TXX9
tristate "Toshiba TXx9 SPI controller"
depends on GENERIC_GPIO && CPU_TX49XX
diff --git a/drivers/spi/Makefile b/drivers/spi/Makefile
index 3de408d..6d7a3f8 100644
--- a/drivers/spi/Makefile
+++ b/drivers/spi/Makefile
@@ -17,7 +17,7 @@
obj-$(CONFIG_SPI_AU1550) += au1550_spi.o
obj-$(CONFIG_SPI_BUTTERFLY) += spi_butterfly.o
obj-$(CONFIG_SPI_GPIO) += spi_gpio.o
-obj-$(CONFIG_SPI_IMX) += spi_imx.o
+obj-$(CONFIG_SPI_IMX) += mxc_spi.o
obj-$(CONFIG_SPI_LM70_LLP) += spi_lm70llp.o
obj-$(CONFIG_SPI_PXA2XX) += pxa2xx_spi.o
obj-$(CONFIG_SPI_OMAP_UWIRE) += omap_uwire.o
@@ -26,11 +26,13 @@
obj-$(CONFIG_SPI_PL022) += amba-pl022.o
obj-$(CONFIG_SPI_MPC52xx_PSC) += mpc52xx_psc_spi.o
obj-$(CONFIG_SPI_MPC8xxx) += spi_mpc8xxx.o
+obj-$(CONFIG_SPI_PPC4xx) += spi_ppc4xx.o
obj-$(CONFIG_SPI_S3C24XX_GPIO) += spi_s3c24xx_gpio.o
obj-$(CONFIG_SPI_S3C24XX) += spi_s3c24xx.o
obj-$(CONFIG_SPI_TXX9) += spi_txx9.o
obj-$(CONFIG_SPI_XILINX) += xilinx_spi.o
obj-$(CONFIG_SPI_SH_SCI) += spi_sh_sci.o
+obj-$(CONFIG_SPI_STMP3XXX) += spi_stmp.o
# ... add above this line ...
# SPI protocol drivers (device/link on bus)
diff --git a/drivers/spi/mxc_spi.c b/drivers/spi/mxc_spi.c
new file mode 100644
index 0000000..b144723
--- /dev/null
+++ b/drivers/spi/mxc_spi.c
@@ -0,0 +1,685 @@
+/*
+ * Copyright 2004-2007 Freescale Semiconductor, Inc. All Rights Reserved.
+ * Copyright (C) 2008 Juergen Beisert
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License
+ * as published by the Free Software Foundation; either version 2
+ * of the License, or (at your option) any later version.
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the
+ * Free Software Foundation
+ * 51 Franklin Street, Fifth Floor
+ * Boston, MA 02110-1301, USA.
+ */
+
+#include <linux/clk.h>
+#include <linux/completion.h>
+#include <linux/delay.h>
+#include <linux/err.h>
+#include <linux/gpio.h>
+#include <linux/init.h>
+#include <linux/interrupt.h>
+#include <linux/io.h>
+#include <linux/irq.h>
+#include <linux/kernel.h>
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/spi/spi.h>
+#include <linux/spi/spi_bitbang.h>
+#include <linux/types.h>
+
+#include <mach/spi.h>
+
+#define DRIVER_NAME "spi_imx"
+
+#define MXC_CSPIRXDATA 0x00
+#define MXC_CSPITXDATA 0x04
+#define MXC_CSPICTRL 0x08
+#define MXC_CSPIINT 0x0c
+#define MXC_RESET 0x1c
+
+/* generic defines to abstract from the different register layouts */
+#define MXC_INT_RR (1 << 0) /* Receive data ready interrupt */
+#define MXC_INT_TE (1 << 1) /* Transmit FIFO empty interrupt */
+
+struct mxc_spi_config {
+ unsigned int speed_hz;
+ unsigned int bpw;
+ unsigned int mode;
+ int cs;
+};
+
+struct mxc_spi_data {
+ struct spi_bitbang bitbang;
+
+ struct completion xfer_done;
+ void *base;
+ int irq;
+ struct clk *clk;
+ unsigned long spi_clk;
+ int *chipselect;
+
+ unsigned int count;
+ void (*tx)(struct mxc_spi_data *);
+ void (*rx)(struct mxc_spi_data *);
+ void *rx_buf;
+ const void *tx_buf;
+ unsigned int txfifo; /* number of words pushed in tx FIFO */
+
+ /* SoC specific functions */
+ void (*intctrl)(struct mxc_spi_data *, int);
+ int (*config)(struct mxc_spi_data *, struct mxc_spi_config *);
+ void (*trigger)(struct mxc_spi_data *);
+ int (*rx_available)(struct mxc_spi_data *);
+};
+
+#define MXC_SPI_BUF_RX(type) \
+static void mxc_spi_buf_rx_##type(struct mxc_spi_data *mxc_spi) \
+{ \
+ unsigned int val = readl(mxc_spi->base + MXC_CSPIRXDATA); \
+ \
+ if (mxc_spi->rx_buf) { \
+ *(type *)mxc_spi->rx_buf = val; \
+ mxc_spi->rx_buf += sizeof(type); \
+ } \
+}
+
+#define MXC_SPI_BUF_TX(type) \
+static void mxc_spi_buf_tx_##type(struct mxc_spi_data *mxc_spi) \
+{ \
+ type val = 0; \
+ \
+ if (mxc_spi->tx_buf) { \
+ val = *(type *)mxc_spi->tx_buf; \
+ mxc_spi->tx_buf += sizeof(type); \
+ } \
+ \
+ mxc_spi->count -= sizeof(type); \
+ \
+ writel(val, mxc_spi->base + MXC_CSPITXDATA); \
+}
+
+MXC_SPI_BUF_RX(u8)
+MXC_SPI_BUF_TX(u8)
+MXC_SPI_BUF_RX(u16)
+MXC_SPI_BUF_TX(u16)
+MXC_SPI_BUF_RX(u32)
+MXC_SPI_BUF_TX(u32)
+
+/* First entry is reserved, second entry is valid only if SDHC_SPIEN is set
+ * (which is currently not the case in this driver)
+ */
+static int mxc_clkdivs[] = {0, 3, 4, 6, 8, 12, 16, 24, 32, 48, 64, 96, 128, 192,
+ 256, 384, 512, 768, 1024};
+
+/* MX21, MX27 */
+static unsigned int mxc_spi_clkdiv_1(unsigned int fin,
+ unsigned int fspi)
+{
+ int i, max;
+
+ if (cpu_is_mx21())
+ max = 18;
+ else
+ max = 16;
+
+ for (i = 2; i < max; i++)
+ if (fspi * mxc_clkdivs[i] >= fin)
+ return i;
+
+ return max;
+}
+
+/* MX1, MX31, MX35 */
+static unsigned int mxc_spi_clkdiv_2(unsigned int fin,
+ unsigned int fspi)
+{
+ int i, div = 4;
+
+ for (i = 0; i < 7; i++) {
+ if (fspi * div >= fin)
+ return i;
+ div <<= 1;
+ }
+
+ return 7;
+}
+
+#define MX31_INTREG_TEEN (1 << 0)
+#define MX31_INTREG_RREN (1 << 3)
+
+#define MX31_CSPICTRL_ENABLE (1 << 0)
+#define MX31_CSPICTRL_MASTER (1 << 1)
+#define MX31_CSPICTRL_XCH (1 << 2)
+#define MX31_CSPICTRL_POL (1 << 4)
+#define MX31_CSPICTRL_PHA (1 << 5)
+#define MX31_CSPICTRL_SSCTL (1 << 6)
+#define MX31_CSPICTRL_SSPOL (1 << 7)
+#define MX31_CSPICTRL_BC_SHIFT 8
+#define MX35_CSPICTRL_BL_SHIFT 20
+#define MX31_CSPICTRL_CS_SHIFT 24
+#define MX35_CSPICTRL_CS_SHIFT 12
+#define MX31_CSPICTRL_DR_SHIFT 16
+
+#define MX31_CSPISTATUS 0x14
+#define MX31_STATUS_RR (1 << 3)
+
+/* These functions also work for the i.MX35, but be aware that
+ * the i.MX35 has a slightly different register layout for bits
+ * we do not use here.
+ */
+static void mx31_intctrl(struct mxc_spi_data *mxc_spi, int enable)
+{
+ unsigned int val = 0;
+
+ if (enable & MXC_INT_TE)
+ val |= MX31_INTREG_TEEN;
+ if (enable & MXC_INT_RR)
+ val |= MX31_INTREG_RREN;
+
+ writel(val, mxc_spi->base + MXC_CSPIINT);
+}
+
+static void mx31_trigger(struct mxc_spi_data *mxc_spi)
+{
+ unsigned int reg;
+
+ reg = readl(mxc_spi->base + MXC_CSPICTRL);
+ reg |= MX31_CSPICTRL_XCH;
+ writel(reg, mxc_spi->base + MXC_CSPICTRL);
+}
+
+static int mx31_config(struct mxc_spi_data *mxc_spi,
+ struct mxc_spi_config *config)
+{
+ unsigned int reg = MX31_CSPICTRL_ENABLE | MX31_CSPICTRL_MASTER;
+
+ reg |= mxc_spi_clkdiv_2(mxc_spi->spi_clk, config->speed_hz) <<
+ MX31_CSPICTRL_DR_SHIFT;
+
+ if (cpu_is_mx31())
+ reg |= (config->bpw - 1) << MX31_CSPICTRL_BC_SHIFT;
+ else if (cpu_is_mx35()) {
+ reg |= (config->bpw - 1) << MX35_CSPICTRL_BL_SHIFT;
+ reg |= MX31_CSPICTRL_SSCTL;
+ }
+
+ if (config->mode & SPI_CPHA)
+ reg |= MX31_CSPICTRL_PHA;
+ if (config->mode & SPI_CPOL)
+ reg |= MX31_CSPICTRL_POL;
+ if (config->mode & SPI_CS_HIGH)
+ reg |= MX31_CSPICTRL_SSPOL;
+ if (config->cs < 0) {
+ if (cpu_is_mx31())
+ reg |= (config->cs + 32) << MX31_CSPICTRL_CS_SHIFT;
+ else if (cpu_is_mx35())
+ reg |= (config->cs + 32) << MX35_CSPICTRL_CS_SHIFT;
+ }
+
+ writel(reg, mxc_spi->base + MXC_CSPICTRL);
+
+ return 0;
+}
+
+static int mx31_rx_available(struct mxc_spi_data *mxc_spi)
+{
+ return readl(mxc_spi->base + MX31_CSPISTATUS) & MX31_STATUS_RR;
+}
+
+#define MX27_INTREG_RR (1 << 4)
+#define MX27_INTREG_TEEN (1 << 9)
+#define MX27_INTREG_RREN (1 << 13)
+
+#define MX27_CSPICTRL_POL (1 << 5)
+#define MX27_CSPICTRL_PHA (1 << 6)
+#define MX27_CSPICTRL_SSPOL (1 << 8)
+#define MX27_CSPICTRL_XCH (1 << 9)
+#define MX27_CSPICTRL_ENABLE (1 << 10)
+#define MX27_CSPICTRL_MASTER (1 << 11)
+#define MX27_CSPICTRL_DR_SHIFT 14
+#define MX27_CSPICTRL_CS_SHIFT 19
+
+static void mx27_intctrl(struct mxc_spi_data *mxc_spi, int enable)
+{
+ unsigned int val = 0;
+
+ if (enable & MXC_INT_TE)
+ val |= MX27_INTREG_TEEN;
+ if (enable & MXC_INT_RR)
+ val |= MX27_INTREG_RREN;
+
+ writel(val, mxc_spi->base + MXC_CSPIINT);
+}
+
+static void mx27_trigger(struct mxc_spi_data *mxc_spi)
+{
+ unsigned int reg;
+
+ reg = readl(mxc_spi->base + MXC_CSPICTRL);
+ reg |= MX27_CSPICTRL_XCH;
+ writel(reg, mxc_spi->base + MXC_CSPICTRL);
+}
+
+static int mx27_config(struct mxc_spi_data *mxc_spi,
+ struct mxc_spi_config *config)
+{
+ unsigned int reg = MX27_CSPICTRL_ENABLE | MX27_CSPICTRL_MASTER;
+
+ reg |= mxc_spi_clkdiv_1(mxc_spi->spi_clk, config->speed_hz) <<
+ MX27_CSPICTRL_DR_SHIFT;
+ reg |= config->bpw - 1;
+
+ if (config->mode & SPI_CPHA)
+ reg |= MX27_CSPICTRL_PHA;
+ if (config->mode & SPI_CPOL)
+ reg |= MX27_CSPICTRL_POL;
+ if (config->mode & SPI_CS_HIGH)
+ reg |= MX27_CSPICTRL_SSPOL;
+ if (config->cs < 0)
+ reg |= (config->cs + 32) << MX27_CSPICTRL_CS_SHIFT;
+
+ writel(reg, mxc_spi->base + MXC_CSPICTRL);
+
+ return 0;
+}
+
+static int mx27_rx_available(struct mxc_spi_data *mxc_spi)
+{
+ return readl(mxc_spi->base + MXC_CSPIINT) & MX27_INTREG_RR;
+}
+
+#define MX1_INTREG_RR (1 << 3)
+#define MX1_INTREG_TEEN (1 << 8)
+#define MX1_INTREG_RREN (1 << 11)
+
+#define MX1_CSPICTRL_POL (1 << 4)
+#define MX1_CSPICTRL_PHA (1 << 5)
+#define MX1_CSPICTRL_XCH (1 << 8)
+#define MX1_CSPICTRL_ENABLE (1 << 9)
+#define MX1_CSPICTRL_MASTER (1 << 10)
+#define MX1_CSPICTRL_DR_SHIFT 13
+
+static void mx1_intctrl(struct mxc_spi_data *mxc_spi, int enable)
+{
+ unsigned int val = 0;
+
+ if (enable & MXC_INT_TE)
+ val |= MX1_INTREG_TEEN;
+ if (enable & MXC_INT_RR)
+ val |= MX1_INTREG_RREN;
+
+ writel(val, mxc_spi->base + MXC_CSPIINT);
+}
+
+static void mx1_trigger(struct mxc_spi_data *mxc_spi)
+{
+ unsigned int reg;
+
+ reg = readl(mxc_spi->base + MXC_CSPICTRL);
+ reg |= MX1_CSPICTRL_XCH;
+ writel(reg, mxc_spi->base + MXC_CSPICTRL);
+}
+
+static int mx1_config(struct mxc_spi_data *mxc_spi,
+ struct mxc_spi_config *config)
+{
+ unsigned int reg = MX1_CSPICTRL_ENABLE | MX1_CSPICTRL_MASTER;
+
+ reg |= mxc_spi_clkdiv_2(mxc_spi->spi_clk, config->speed_hz) <<
+ MX1_CSPICTRL_DR_SHIFT;
+ reg |= config->bpw - 1;
+
+ if (config->mode & SPI_CPHA)
+ reg |= MX1_CSPICTRL_PHA;
+ if (config->mode & SPI_CPOL)
+ reg |= MX1_CSPICTRL_POL;
+
+ writel(reg, mxc_spi->base + MXC_CSPICTRL);
+
+ return 0;
+}
+
+static int mx1_rx_available(struct mxc_spi_data *mxc_spi)
+{
+ return readl(mxc_spi->base + MXC_CSPIINT) & MX1_INTREG_RR;
+}
+
+static void mxc_spi_chipselect(struct spi_device *spi, int is_active)
+{
+ struct mxc_spi_data *mxc_spi = spi_master_get_devdata(spi->master);
+ unsigned int cs = 0;
+ int gpio = mxc_spi->chipselect[spi->chip_select];
+ struct mxc_spi_config config;
+
+ if (spi->mode & SPI_CS_HIGH)
+ cs = 1;
+
+ if (is_active == BITBANG_CS_INACTIVE) {
+ if (gpio >= 0)
+ gpio_set_value(gpio, !cs);
+ return;
+ }
+
+ config.bpw = spi->bits_per_word;
+ config.speed_hz = spi->max_speed_hz;
+ config.mode = spi->mode;
+ config.cs = mxc_spi->chipselect[spi->chip_select];
+
+ mxc_spi->config(mxc_spi, &config);
+
+ /* Initialize the functions for transfer */
+ if (config.bpw <= 8) {
+ mxc_spi->rx = mxc_spi_buf_rx_u8;
+ mxc_spi->tx = mxc_spi_buf_tx_u8;
+ } else if (config.bpw <= 16) {
+ mxc_spi->rx = mxc_spi_buf_rx_u16;
+ mxc_spi->tx = mxc_spi_buf_tx_u16;
+ } else if (config.bpw <= 32) {
+ mxc_spi->rx = mxc_spi_buf_rx_u32;
+ mxc_spi->tx = mxc_spi_buf_tx_u32;
+ } else
+ BUG();
+
+ if (gpio >= 0)
+ gpio_set_value(gpio, cs);
+
+ return;
+}
+
+static void mxc_spi_push(struct mxc_spi_data *mxc_spi)
+{
+ while (mxc_spi->txfifo < 8) {
+ if (!mxc_spi->count)
+ break;
+ mxc_spi->tx(mxc_spi);
+ mxc_spi->txfifo++;
+ }
+
+ mxc_spi->trigger(mxc_spi);
+}
+
+static irqreturn_t mxc_spi_isr(int irq, void *dev_id)
+{
+ struct mxc_spi_data *mxc_spi = dev_id;
+
+ while (mxc_spi->rx_available(mxc_spi)) {
+ mxc_spi->rx(mxc_spi);
+ mxc_spi->txfifo--;
+ }
+
+ if (mxc_spi->count) {
+ mxc_spi_push(mxc_spi);
+ return IRQ_HANDLED;
+ }
+
+ if (mxc_spi->txfifo) {
+ /* No data left to push, but still waiting for rx data,
+ * enable receive data available interrupt.
+ */
+ mxc_spi->intctrl(mxc_spi, MXC_INT_RR);
+ return IRQ_HANDLED;
+ }
+
+ mxc_spi->intctrl(mxc_spi, 0);
+ complete(&mxc_spi->xfer_done);
+
+ return IRQ_HANDLED;
+}
+
+static int mxc_spi_setupxfer(struct spi_device *spi,
+ struct spi_transfer *t)
+{
+ struct mxc_spi_data *mxc_spi = spi_master_get_devdata(spi->master);
+ struct mxc_spi_config config;
+
+ config.bpw = t ? t->bits_per_word : spi->bits_per_word;
+ config.speed_hz = t ? t->speed_hz : spi->max_speed_hz;
+ config.mode = spi->mode;
+
+ mxc_spi->config(mxc_spi, &config);
+
+ return 0;
+}
+
+static int mxc_spi_transfer(struct spi_device *spi,
+ struct spi_transfer *transfer)
+{
+ struct mxc_spi_data *mxc_spi = spi_master_get_devdata(spi->master);
+
+ mxc_spi->tx_buf = transfer->tx_buf;
+ mxc_spi->rx_buf = transfer->rx_buf;
+ mxc_spi->count = transfer->len;
+ mxc_spi->txfifo = 0;
+
+ init_completion(&mxc_spi->xfer_done);
+
+ mxc_spi_push(mxc_spi);
+
+ mxc_spi->intctrl(mxc_spi, MXC_INT_TE);
+
+ wait_for_completion(&mxc_spi->xfer_done);
+
+ return transfer->len;
+}
+
+static int mxc_spi_setup(struct spi_device *spi)
+{
+ if (!spi->bits_per_word)
+ spi->bits_per_word = 8;
+
+ pr_debug("%s: mode %d, %u bpw, %d hz\n", __func__,
+ spi->mode, spi->bits_per_word, spi->max_speed_hz);
+
+ mxc_spi_chipselect(spi, BITBANG_CS_INACTIVE);
+
+ return 0;
+}
+
+static void mxc_spi_cleanup(struct spi_device *spi)
+{
+}
+
+static int __init mxc_spi_probe(struct platform_device *pdev)
+{
+ struct spi_imx_master *mxc_platform_info;
+ struct spi_master *master;
+ struct mxc_spi_data *mxc_spi;
+ struct resource *res;
+ int i, ret;
+
+ mxc_platform_info = (struct spi_imx_master *)pdev->dev.platform_data;
+ if (!mxc_platform_info) {
+ dev_err(&pdev->dev, "can't get the platform data\n");
+ return -EINVAL;
+ }
+
+ master = spi_alloc_master(&pdev->dev, sizeof(struct mxc_spi_data));
+ if (!master)
+ return -ENOMEM;
+
+ platform_set_drvdata(pdev, master);
+
+ master->bus_num = pdev->id;
+ master->num_chipselect = mxc_platform_info->num_chipselect;
+
+ mxc_spi = spi_master_get_devdata(master);
+ mxc_spi->bitbang.master = spi_master_get(master);
+ mxc_spi->chipselect = mxc_platform_info->chipselect;
+
+ for (i = 0; i < master->num_chipselect; i++) {
+ if (mxc_spi->chipselect[i] < 0)
+ continue;
+ ret = gpio_request(mxc_spi->chipselect[i], DRIVER_NAME);
+ if (ret) {
+ i--;
+ while (i > 0)
+ if (mxc_spi->chipselect[i] >= 0)
+ gpio_free(mxc_spi->chipselect[i--]);
+ dev_err(&pdev->dev, "can't get cs gpios");
+ goto out_master_put;
+ }
+ gpio_direction_output(mxc_spi->chipselect[i], 1);
+ }
+
+ mxc_spi->bitbang.chipselect = mxc_spi_chipselect;
+ mxc_spi->bitbang.setup_transfer = mxc_spi_setupxfer;
+ mxc_spi->bitbang.txrx_bufs = mxc_spi_transfer;
+ mxc_spi->bitbang.master->setup = mxc_spi_setup;
+ mxc_spi->bitbang.master->cleanup = mxc_spi_cleanup;
+
+ init_completion(&mxc_spi->xfer_done);
+
+ res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ if (!res) {
+ dev_err(&pdev->dev, "can't get platform resource\n");
+ ret = -ENOMEM;
+ goto out_gpio_free;
+ }
+
+ if (!request_mem_region(res->start, resource_size(res), pdev->name)) {
+ dev_err(&pdev->dev, "request_mem_region failed\n");
+ ret = -EBUSY;
+ goto out_gpio_free;
+ }
+
+ mxc_spi->base = ioremap(res->start, resource_size(res));
+ if (!mxc_spi->base) {
+ ret = -EINVAL;
+ goto out_release_mem;
+ }
+
+ mxc_spi->irq = platform_get_irq(pdev, 0);
+ if (!mxc_spi->irq) {
+ ret = -EINVAL;
+ goto out_iounmap;
+ }
+
+ ret = request_irq(mxc_spi->irq, mxc_spi_isr, 0, DRIVER_NAME, mxc_spi);
+ if (ret) {
+ dev_err(&pdev->dev, "can't get irq%d: %d\n", mxc_spi->irq, ret);
+ goto out_iounmap;
+ }
+
+ if (cpu_is_mx31() || cpu_is_mx35()) {
+ mxc_spi->intctrl = mx31_intctrl;
+ mxc_spi->config = mx31_config;
+ mxc_spi->trigger = mx31_trigger;
+ mxc_spi->rx_available = mx31_rx_available;
+ } else if (cpu_is_mx27() || cpu_is_mx21()) {
+ mxc_spi->intctrl = mx27_intctrl;
+ mxc_spi->config = mx27_config;
+ mxc_spi->trigger = mx27_trigger;
+ mxc_spi->rx_available = mx27_rx_available;
+ } else if (cpu_is_mx1()) {
+ mxc_spi->intctrl = mx1_intctrl;
+ mxc_spi->config = mx1_config;
+ mxc_spi->trigger = mx1_trigger;
+ mxc_spi->rx_available = mx1_rx_available;
+ } else
+ BUG();
+
+ mxc_spi->clk = clk_get(&pdev->dev, NULL);
+ if (IS_ERR(mxc_spi->clk)) {
+ dev_err(&pdev->dev, "unable to get clock\n");
+ ret = PTR_ERR(mxc_spi->clk);
+ goto out_free_irq;
+ }
+
+ clk_enable(mxc_spi->clk);
+ mxc_spi->spi_clk = clk_get_rate(mxc_spi->clk);
+
+ if (!cpu_is_mx31() || !cpu_is_mx35())
+ writel(1, mxc_spi->base + MXC_RESET);
+
+ mxc_spi->intctrl(mxc_spi, 0);
+
+ ret = spi_bitbang_start(&mxc_spi->bitbang);
+ if (ret) {
+ dev_err(&pdev->dev, "bitbang start failed with %d\n", ret);
+ goto out_clk_put;
+ }
+
+ dev_info(&pdev->dev, "probed\n");
+
+ return ret;
+
+out_clk_put:
+ clk_disable(mxc_spi->clk);
+ clk_put(mxc_spi->clk);
+out_free_irq:
+ free_irq(mxc_spi->irq, mxc_spi);
+out_iounmap:
+ iounmap(mxc_spi->base);
+out_release_mem:
+ release_mem_region(res->start, resource_size(res));
+out_gpio_free:
+ for (i = 0; i < master->num_chipselect; i++)
+ if (mxc_spi->chipselect[i] >= 0)
+ gpio_free(mxc_spi->chipselect[i]);
+out_master_put:
+ spi_master_put(master);
+ kfree(master);
+ platform_set_drvdata(pdev, NULL);
+ return ret;
+}
+
+static int __exit mxc_spi_remove(struct platform_device *pdev)
+{
+ struct spi_master *master = platform_get_drvdata(pdev);
+ struct resource *res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ struct mxc_spi_data *mxc_spi = spi_master_get_devdata(master);
+ int i;
+
+ spi_bitbang_stop(&mxc_spi->bitbang);
+
+ writel(0, mxc_spi->base + MXC_CSPICTRL);
+ clk_disable(mxc_spi->clk);
+ clk_put(mxc_spi->clk);
+ free_irq(mxc_spi->irq, mxc_spi);
+ iounmap(mxc_spi->base);
+
+ for (i = 0; i < master->num_chipselect; i++)
+ if (mxc_spi->chipselect[i] >= 0)
+ gpio_free(mxc_spi->chipselect[i]);
+
+ spi_master_put(master);
+
+ release_mem_region(res->start, resource_size(res));
+
+ platform_set_drvdata(pdev, NULL);
+
+ return 0;
+}
+
+static struct platform_driver mxc_spi_driver = {
+ .driver = {
+ .name = DRIVER_NAME,
+ .owner = THIS_MODULE,
+ },
+ .probe = mxc_spi_probe,
+ .remove = __exit_p(mxc_spi_remove),
+};
+
+static int __init mxc_spi_init(void)
+{
+ return platform_driver_register(&mxc_spi_driver);
+}
+
+static void __exit mxc_spi_exit(void)
+{
+ platform_driver_unregister(&mxc_spi_driver);
+}
+
+module_init(mxc_spi_init);
+module_exit(mxc_spi_exit);
+
+MODULE_DESCRIPTION("SPI Master Controller driver");
+MODULE_AUTHOR("Sascha Hauer, Pengutronix");
+MODULE_LICENSE("GPL");
diff --git a/drivers/spi/omap2_mcspi.c b/drivers/spi/omap2_mcspi.c
index 9b80ad3..ba1a872 100644
--- a/drivers/spi/omap2_mcspi.c
+++ b/drivers/spi/omap2_mcspi.c
@@ -41,6 +41,9 @@
#define OMAP2_MCSPI_MAX_FREQ 48000000
+/* OMAP2 has 3 SPI controllers, while OMAP3 has 4 */
+#define OMAP2_MCSPI_MAX_CTRL 4
+
#define OMAP2_MCSPI_REVISION 0x00
#define OMAP2_MCSPI_SYSCONFIG 0x10
#define OMAP2_MCSPI_SYSSTATUS 0x14
@@ -59,40 +62,40 @@
/* per-register bitmasks: */
-#define OMAP2_MCSPI_SYSCONFIG_SMARTIDLE (2 << 3)
-#define OMAP2_MCSPI_SYSCONFIG_ENAWAKEUP (1 << 2)
-#define OMAP2_MCSPI_SYSCONFIG_AUTOIDLE (1 << 0)
-#define OMAP2_MCSPI_SYSCONFIG_SOFTRESET (1 << 1)
+#define OMAP2_MCSPI_SYSCONFIG_SMARTIDLE BIT(4)
+#define OMAP2_MCSPI_SYSCONFIG_ENAWAKEUP BIT(2)
+#define OMAP2_MCSPI_SYSCONFIG_AUTOIDLE BIT(0)
+#define OMAP2_MCSPI_SYSCONFIG_SOFTRESET BIT(1)
-#define OMAP2_MCSPI_SYSSTATUS_RESETDONE (1 << 0)
+#define OMAP2_MCSPI_SYSSTATUS_RESETDONE BIT(0)
-#define OMAP2_MCSPI_MODULCTRL_SINGLE (1 << 0)
-#define OMAP2_MCSPI_MODULCTRL_MS (1 << 2)
-#define OMAP2_MCSPI_MODULCTRL_STEST (1 << 3)
+#define OMAP2_MCSPI_MODULCTRL_SINGLE BIT(0)
+#define OMAP2_MCSPI_MODULCTRL_MS BIT(2)
+#define OMAP2_MCSPI_MODULCTRL_STEST BIT(3)
-#define OMAP2_MCSPI_CHCONF_PHA (1 << 0)
-#define OMAP2_MCSPI_CHCONF_POL (1 << 1)
+#define OMAP2_MCSPI_CHCONF_PHA BIT(0)
+#define OMAP2_MCSPI_CHCONF_POL BIT(1)
#define OMAP2_MCSPI_CHCONF_CLKD_MASK (0x0f << 2)
-#define OMAP2_MCSPI_CHCONF_EPOL (1 << 6)
+#define OMAP2_MCSPI_CHCONF_EPOL BIT(6)
#define OMAP2_MCSPI_CHCONF_WL_MASK (0x1f << 7)
-#define OMAP2_MCSPI_CHCONF_TRM_RX_ONLY (0x01 << 12)
-#define OMAP2_MCSPI_CHCONF_TRM_TX_ONLY (0x02 << 12)
+#define OMAP2_MCSPI_CHCONF_TRM_RX_ONLY BIT(12)
+#define OMAP2_MCSPI_CHCONF_TRM_TX_ONLY BIT(13)
#define OMAP2_MCSPI_CHCONF_TRM_MASK (0x03 << 12)
-#define OMAP2_MCSPI_CHCONF_DMAW (1 << 14)
-#define OMAP2_MCSPI_CHCONF_DMAR (1 << 15)
-#define OMAP2_MCSPI_CHCONF_DPE0 (1 << 16)
-#define OMAP2_MCSPI_CHCONF_DPE1 (1 << 17)
-#define OMAP2_MCSPI_CHCONF_IS (1 << 18)
-#define OMAP2_MCSPI_CHCONF_TURBO (1 << 19)
-#define OMAP2_MCSPI_CHCONF_FORCE (1 << 20)
+#define OMAP2_MCSPI_CHCONF_DMAW BIT(14)
+#define OMAP2_MCSPI_CHCONF_DMAR BIT(15)
+#define OMAP2_MCSPI_CHCONF_DPE0 BIT(16)
+#define OMAP2_MCSPI_CHCONF_DPE1 BIT(17)
+#define OMAP2_MCSPI_CHCONF_IS BIT(18)
+#define OMAP2_MCSPI_CHCONF_TURBO BIT(19)
+#define OMAP2_MCSPI_CHCONF_FORCE BIT(20)
-#define OMAP2_MCSPI_CHSTAT_RXS (1 << 0)
-#define OMAP2_MCSPI_CHSTAT_TXS (1 << 1)
-#define OMAP2_MCSPI_CHSTAT_EOT (1 << 2)
+#define OMAP2_MCSPI_CHSTAT_RXS BIT(0)
+#define OMAP2_MCSPI_CHSTAT_TXS BIT(1)
+#define OMAP2_MCSPI_CHSTAT_EOT BIT(2)
-#define OMAP2_MCSPI_CHCTRL_EN (1 << 0)
+#define OMAP2_MCSPI_CHCTRL_EN BIT(0)
-#define OMAP2_MCSPI_WAKEUPENABLE_WKEN (1 << 0)
+#define OMAP2_MCSPI_WAKEUPENABLE_WKEN BIT(0)
/* We have 2 DMA channels per CS, one for RX and one for TX */
struct omap2_mcspi_dma {
@@ -131,8 +134,23 @@
void __iomem *base;
unsigned long phys;
int word_len;
+ struct list_head node;
+ /* Context save and restore shadow register */
+ u32 chconf0;
};
+/* used for context save and restore, structure members to be updated whenever
+ * corresponding registers are modified.
+ */
+struct omap2_mcspi_regs {
+ u32 sysconfig;
+ u32 modulctrl;
+ u32 wakeupenable;
+ struct list_head cs;
+};
+
+static struct omap2_mcspi_regs omap2_mcspi_ctx[OMAP2_MCSPI_MAX_CTRL];
+
static struct workqueue_struct *omap2_mcspi_wq;
#define MOD_REG_BIT(val, mask, set) do { \
@@ -172,12 +190,27 @@
return __raw_readl(cs->base + idx);
}
+static inline u32 mcspi_cached_chconf0(const struct spi_device *spi)
+{
+ struct omap2_mcspi_cs *cs = spi->controller_state;
+
+ return cs->chconf0;
+}
+
+static inline void mcspi_write_chconf0(const struct spi_device *spi, u32 val)
+{
+ struct omap2_mcspi_cs *cs = spi->controller_state;
+
+ cs->chconf0 = val;
+ mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, val);
+}
+
static void omap2_mcspi_set_dma_req(const struct spi_device *spi,
int is_read, int enable)
{
u32 l, rw;
- l = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+ l = mcspi_cached_chconf0(spi);
if (is_read) /* 1 is read, 0 write */
rw = OMAP2_MCSPI_CHCONF_DMAR;
@@ -185,7 +218,7 @@
rw = OMAP2_MCSPI_CHCONF_DMAW;
MOD_REG_BIT(l, rw, enable);
- mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, l);
+ mcspi_write_chconf0(spi, l);
}
static void omap2_mcspi_set_enable(const struct spi_device *spi, int enable)
@@ -200,9 +233,9 @@
{
u32 l;
- l = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+ l = mcspi_cached_chconf0(spi);
MOD_REG_BIT(l, OMAP2_MCSPI_CHCONF_FORCE, cs_active);
- mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, l);
+ mcspi_write_chconf0(spi, l);
}
static void omap2_mcspi_set_master_mode(struct spi_master *master)
@@ -217,6 +250,46 @@
MOD_REG_BIT(l, OMAP2_MCSPI_MODULCTRL_MS, 0);
MOD_REG_BIT(l, OMAP2_MCSPI_MODULCTRL_SINGLE, 1);
mcspi_write_reg(master, OMAP2_MCSPI_MODULCTRL, l);
+
+ omap2_mcspi_ctx[master->bus_num - 1].modulctrl = l;
+}
+
+static void omap2_mcspi_restore_ctx(struct omap2_mcspi *mcspi)
+{
+ struct spi_master *spi_cntrl;
+ struct omap2_mcspi_cs *cs;
+ spi_cntrl = mcspi->master;
+
+ /* McSPI: context restore */
+ mcspi_write_reg(spi_cntrl, OMAP2_MCSPI_MODULCTRL,
+ omap2_mcspi_ctx[spi_cntrl->bus_num - 1].modulctrl);
+
+ mcspi_write_reg(spi_cntrl, OMAP2_MCSPI_SYSCONFIG,
+ omap2_mcspi_ctx[spi_cntrl->bus_num - 1].sysconfig);
+
+ mcspi_write_reg(spi_cntrl, OMAP2_MCSPI_WAKEUPENABLE,
+ omap2_mcspi_ctx[spi_cntrl->bus_num - 1].wakeupenable);
+
+ list_for_each_entry(cs, &omap2_mcspi_ctx[spi_cntrl->bus_num - 1].cs,
+ node)
+ __raw_writel(cs->chconf0, cs->base + OMAP2_MCSPI_CHCONF0);
+}
+static void omap2_mcspi_disable_clocks(struct omap2_mcspi *mcspi)
+{
+ clk_disable(mcspi->ick);
+ clk_disable(mcspi->fck);
+}
+
+static int omap2_mcspi_enable_clocks(struct omap2_mcspi *mcspi)
+{
+ if (clk_enable(mcspi->ick))
+ return -ENODEV;
+ if (clk_enable(mcspi->fck))
+ return -ENODEV;
+
+ omap2_mcspi_restore_ctx(mcspi);
+
+ return 0;
}
static unsigned
@@ -357,7 +430,7 @@
c = count;
word_len = cs->word_len;
- l = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+ l = mcspi_cached_chconf0(spi);
l &= ~OMAP2_MCSPI_CHCONF_TRM_MASK;
/* We store the pre-calculated register addresses on stack to speed
@@ -397,8 +470,7 @@
* more word i/o: switch to rx+tx
*/
if (c == 0 && tx == NULL)
- mcspi_write_cs_reg(spi,
- OMAP2_MCSPI_CHCONF0, l);
+ mcspi_write_chconf0(spi, l);
*rx++ = __raw_readl(rx_reg);
#ifdef VERBOSE
dev_dbg(&spi->dev, "read-%d %02x\n",
@@ -436,8 +508,7 @@
* more word i/o: switch to rx+tx
*/
if (c == 0 && tx == NULL)
- mcspi_write_cs_reg(spi,
- OMAP2_MCSPI_CHCONF0, l);
+ mcspi_write_chconf0(spi, l);
*rx++ = __raw_readl(rx_reg);
#ifdef VERBOSE
dev_dbg(&spi->dev, "read-%d %04x\n",
@@ -475,8 +546,7 @@
* more word i/o: switch to rx+tx
*/
if (c == 0 && tx == NULL)
- mcspi_write_cs_reg(spi,
- OMAP2_MCSPI_CHCONF0, l);
+ mcspi_write_chconf0(spi, l);
*rx++ = __raw_readl(rx_reg);
#ifdef VERBOSE
dev_dbg(&spi->dev, "read-%d %04x\n",
@@ -505,10 +575,12 @@
{
struct omap2_mcspi_cs *cs = spi->controller_state;
struct omap2_mcspi *mcspi;
+ struct spi_master *spi_cntrl;
u32 l = 0, div = 0;
u8 word_len = spi->bits_per_word;
mcspi = spi_master_get_devdata(spi->master);
+ spi_cntrl = mcspi->master;
if (t != NULL && t->bits_per_word)
word_len = t->bits_per_word;
@@ -522,7 +594,7 @@
} else
div = 15;
- l = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+ l = mcspi_cached_chconf0(spi);
/* standard 4-wire master mode: SCK, MOSI/out, MISO/in, nCS
* REVISIT: this controller could support SPI_3WIRE mode.
@@ -554,7 +626,7 @@
else
l &= ~OMAP2_MCSPI_CHCONF_PHA;
- mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, l);
+ mcspi_write_chconf0(spi, l);
dev_dbg(&spi->dev, "setup: speed %d, sample %s edge, clk %s\n",
OMAP2_MCSPI_MAX_FREQ / (1 << div),
@@ -647,7 +719,11 @@
return -ENOMEM;
cs->base = mcspi->base + spi->chip_select * 0x14;
cs->phys = mcspi->phys + spi->chip_select * 0x14;
+ cs->chconf0 = 0;
spi->controller_state = cs;
+ /* Link this to context save list */
+ list_add_tail(&cs->node,
+ &omap2_mcspi_ctx[mcspi->master->bus_num - 1].cs);
}
if (mcspi_dma->dma_rx_channel == -1
@@ -657,11 +733,11 @@
return ret;
}
- clk_enable(mcspi->ick);
- clk_enable(mcspi->fck);
+ if (omap2_mcspi_enable_clocks(mcspi))
+ return -ENODEV;
+
ret = omap2_mcspi_setup_transfer(spi, NULL);
- clk_disable(mcspi->fck);
- clk_disable(mcspi->ick);
+ omap2_mcspi_disable_clocks(mcspi);
return ret;
}
@@ -670,10 +746,15 @@
{
struct omap2_mcspi *mcspi;
struct omap2_mcspi_dma *mcspi_dma;
+ struct omap2_mcspi_cs *cs;
mcspi = spi_master_get_devdata(spi->master);
mcspi_dma = &mcspi->dma_channels[spi->chip_select];
+ /* Unlink controller state from context save list */
+ cs = spi->controller_state;
+ list_del(&cs->node);
+
kfree(spi->controller_state);
if (mcspi_dma->dma_rx_channel != -1) {
@@ -693,8 +774,8 @@
mcspi = container_of(work, struct omap2_mcspi, work);
spin_lock_irq(&mcspi->lock);
- clk_enable(mcspi->ick);
- clk_enable(mcspi->fck);
+ if (omap2_mcspi_enable_clocks(mcspi))
+ goto out;
/* We only enable one channel at a time -- the one whose message is
* at the head of the queue -- although this controller would gladly
@@ -741,13 +822,13 @@
cs_active = 1;
}
- chconf = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+ chconf = mcspi_cached_chconf0(spi);
chconf &= ~OMAP2_MCSPI_CHCONF_TRM_MASK;
if (t->tx_buf == NULL)
chconf |= OMAP2_MCSPI_CHCONF_TRM_RX_ONLY;
else if (t->rx_buf == NULL)
chconf |= OMAP2_MCSPI_CHCONF_TRM_TX_ONLY;
- mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, chconf);
+ mcspi_write_chconf0(spi, chconf);
if (t->len) {
unsigned count;
@@ -796,9 +877,9 @@
spin_lock_irq(&mcspi->lock);
}
- clk_disable(mcspi->fck);
- clk_disable(mcspi->ick);
+ omap2_mcspi_disable_clocks(mcspi);
+out:
spin_unlock_irq(&mcspi->lock);
}
@@ -885,8 +966,8 @@
struct spi_master *master = mcspi->master;
u32 tmp;
- clk_enable(mcspi->ick);
- clk_enable(mcspi->fck);
+ if (omap2_mcspi_enable_clocks(mcspi))
+ return -1;
mcspi_write_reg(master, OMAP2_MCSPI_SYSCONFIG,
OMAP2_MCSPI_SYSCONFIG_SOFTRESET);
@@ -894,18 +975,18 @@
tmp = mcspi_read_reg(master, OMAP2_MCSPI_SYSSTATUS);
} while (!(tmp & OMAP2_MCSPI_SYSSTATUS_RESETDONE));
- mcspi_write_reg(master, OMAP2_MCSPI_SYSCONFIG,
- OMAP2_MCSPI_SYSCONFIG_AUTOIDLE |
- OMAP2_MCSPI_SYSCONFIG_ENAWAKEUP |
- OMAP2_MCSPI_SYSCONFIG_SMARTIDLE);
+ tmp = OMAP2_MCSPI_SYSCONFIG_AUTOIDLE |
+ OMAP2_MCSPI_SYSCONFIG_ENAWAKEUP |
+ OMAP2_MCSPI_SYSCONFIG_SMARTIDLE;
+ mcspi_write_reg(master, OMAP2_MCSPI_SYSCONFIG, tmp);
+ omap2_mcspi_ctx[master->bus_num - 1].sysconfig = tmp;
- mcspi_write_reg(master, OMAP2_MCSPI_WAKEUPENABLE,
- OMAP2_MCSPI_WAKEUPENABLE_WKEN);
+ tmp = OMAP2_MCSPI_WAKEUPENABLE_WKEN;
+ mcspi_write_reg(master, OMAP2_MCSPI_WAKEUPENABLE, tmp);
+ omap2_mcspi_ctx[master->bus_num - 1].wakeupenable = tmp;
omap2_mcspi_set_master_mode(master);
-
- clk_disable(mcspi->fck);
- clk_disable(mcspi->ick);
+ omap2_mcspi_disable_clocks(mcspi);
return 0;
}
@@ -933,7 +1014,8 @@
OMAP24XX_DMA_SPI2_TX1,
};
-#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP34XX)
+#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP34XX) \
+ || defined(CONFIG_ARCH_OMAP4)
static u8 __initdata spi3_rxdma_id[] = {
OMAP24XX_DMA_SPI3_RX0,
OMAP24XX_DMA_SPI3_RX1,
@@ -945,7 +1027,7 @@
};
#endif
-#ifdef CONFIG_ARCH_OMAP3
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
static u8 __initdata spi4_rxdma_id[] = {
OMAP34XX_DMA_SPI4_RX0,
};
@@ -975,14 +1057,15 @@
txdma_id = spi2_txdma_id;
num_chipselect = 2;
break;
-#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3)
+#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3) \
+ || defined(CONFIG_ARCH_OMAP4)
case 3:
rxdma_id = spi3_rxdma_id;
txdma_id = spi3_txdma_id;
num_chipselect = 2;
break;
#endif
-#ifdef CONFIG_ARCH_OMAP3
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
case 4:
rxdma_id = spi4_rxdma_id;
txdma_id = spi4_txdma_id;
@@ -1038,6 +1121,7 @@
spin_lock_init(&mcspi->lock);
INIT_LIST_HEAD(&mcspi->msg_queue);
+ INIT_LIST_HEAD(&omap2_mcspi_ctx[master->bus_num - 1].cs);
mcspi->ick = clk_get(&pdev->dev, "ick");
if (IS_ERR(mcspi->ick)) {
diff --git a/drivers/spi/pxa2xx_spi.c b/drivers/spi/pxa2xx_spi.c
index d949dbf..31dd56f 100644
--- a/drivers/spi/pxa2xx_spi.c
+++ b/drivers/spi/pxa2xx_spi.c
@@ -1729,7 +1729,7 @@
{
return platform_driver_probe(&driver, pxa2xx_spi_probe);
}
-module_init(pxa2xx_spi_init);
+subsys_initcall(pxa2xx_spi_init);
static void __exit pxa2xx_spi_exit(void)
{
diff --git a/drivers/spi/spi.c b/drivers/spi/spi.c
index 70845ccd..b76f246 100644
--- a/drivers/spi/spi.c
+++ b/drivers/spi/spi.c
@@ -23,6 +23,7 @@
#include <linux/init.h>
#include <linux/cache.h>
#include <linux/mutex.h>
+#include <linux/mod_devicetable.h>
#include <linux/spi/spi.h>
@@ -59,9 +60,32 @@
* and the sysfs version makes coldplug work too.
*/
+static const struct spi_device_id *spi_match_id(const struct spi_device_id *id,
+ const struct spi_device *sdev)
+{
+ while (id->name[0]) {
+ if (!strcmp(sdev->modalias, id->name))
+ return id;
+ id++;
+ }
+ return NULL;
+}
+
+const struct spi_device_id *spi_get_device_id(const struct spi_device *sdev)
+{
+ const struct spi_driver *sdrv = to_spi_driver(sdev->dev.driver);
+
+ return spi_match_id(sdrv->id_table, sdev);
+}
+EXPORT_SYMBOL_GPL(spi_get_device_id);
+
static int spi_match_device(struct device *dev, struct device_driver *drv)
{
const struct spi_device *spi = to_spi_device(dev);
+ const struct spi_driver *sdrv = to_spi_driver(drv);
+
+ if (sdrv->id_table)
+ return !!spi_match_id(sdrv->id_table, spi);
return strcmp(spi->modalias, drv->name) == 0;
}
@@ -70,7 +94,7 @@
{
const struct spi_device *spi = to_spi_device(dev);
- add_uevent_var(env, "MODALIAS=%s", spi->modalias);
+ add_uevent_var(env, "MODALIAS=%s%s", SPI_MODULE_PREFIX, spi->modalias);
return 0;
}
@@ -639,6 +663,65 @@
}
EXPORT_SYMBOL_GPL(spi_setup);
+/**
+ * spi_async - asynchronous SPI transfer
+ * @spi: device with which data will be exchanged
+ * @message: describes the data transfers, including completion callback
+ * Context: any (irqs may be blocked, etc)
+ *
+ * This call may be used in_irq and other contexts which can't sleep,
+ * as well as from task contexts which can sleep.
+ *
+ * The completion callback is invoked in a context which can't sleep.
+ * Before that invocation, the value of message->status is undefined.
+ * When the callback is issued, message->status holds either zero (to
+ * indicate complete success) or a negative error code. After that
+ * callback returns, the driver which issued the transfer request may
+ * deallocate the associated memory; it's no longer in use by any SPI
+ * core or controller driver code.
+ *
+ * Note that although all messages to a spi_device are handled in
+ * FIFO order, messages may go to different devices in other orders.
+ * Some device might be higher priority, or have various "hard" access
+ * time requirements, for example.
+ *
+ * On detection of any fault during the transfer, processing of
+ * the entire message is aborted, and the device is deselected.
+ * Until returning from the associated message completion callback,
+ * no other spi_message queued to that device will be processed.
+ * (This rule applies equally to all the synchronous transfer calls,
+ * which are wrappers around this core asynchronous primitive.)
+ */
+int spi_async(struct spi_device *spi, struct spi_message *message)
+{
+ struct spi_master *master = spi->master;
+
+ /* Half-duplex links include original MicroWire, and ones with
+ * only one data pin like SPI_3WIRE (switches direction) or where
+ * either MOSI or MISO is missing. They can also be caused by
+ * software limitations.
+ */
+ if ((master->flags & SPI_MASTER_HALF_DUPLEX)
+ || (spi->mode & SPI_3WIRE)) {
+ struct spi_transfer *xfer;
+ unsigned flags = master->flags;
+
+ list_for_each_entry(xfer, &message->transfers, transfer_list) {
+ if (xfer->rx_buf && xfer->tx_buf)
+ return -EINVAL;
+ if ((flags & SPI_MASTER_NO_TX) && xfer->tx_buf)
+ return -EINVAL;
+ if ((flags & SPI_MASTER_NO_RX) && xfer->rx_buf)
+ return -EINVAL;
+ }
+ }
+
+ message->spi = spi;
+ message->status = -EINPROGRESS;
+ return master->transfer(spi, message);
+}
+EXPORT_SYMBOL_GPL(spi_async);
+
/*-------------------------------------------------------------------------*/
diff --git a/drivers/spi/spi_imx.c b/drivers/spi/spi_imx.c
deleted file mode 100644
index c195e45..0000000
--- a/drivers/spi/spi_imx.c
+++ /dev/null
@@ -1,1770 +0,0 @@
-/*
- * drivers/spi/spi_imx.c
- *
- * Copyright (C) 2006 SWAPP
- * Andrea Paterniani <a.paterniani@swapp-eng.it>
- *
- * Initial version inspired by:
- * linux-2.6.17-rc3-mm1/drivers/spi/pxa2xx_spi.c
- *
- * This program is free software; you can redistribute it and/or modify
- * it under the terms of the GNU General Public License as published by
- * the Free Software Foundation; either version 2 of the License, or
- * (at your option) any later version.
- *
- * This program is distributed in the hope that it will be useful,
- * but WITHOUT ANY WARRANTY; without even the implied warranty of
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
- * GNU General Public License for more details.
- */
-
-#include <linux/init.h>
-#include <linux/module.h>
-#include <linux/device.h>
-#include <linux/ioport.h>
-#include <linux/errno.h>
-#include <linux/interrupt.h>
-#include <linux/platform_device.h>
-#include <linux/dma-mapping.h>
-#include <linux/spi/spi.h>
-#include <linux/workqueue.h>
-#include <linux/delay.h>
-#include <linux/clk.h>
-
-#include <asm/io.h>
-#include <asm/irq.h>
-#include <asm/delay.h>
-
-#include <mach/hardware.h>
-#include <mach/imx-dma.h>
-#include <mach/spi_imx.h>
-
-/*-------------------------------------------------------------------------*/
-/* SPI Registers offsets from peripheral base address */
-#define SPI_RXDATA (0x00)
-#define SPI_TXDATA (0x04)
-#define SPI_CONTROL (0x08)
-#define SPI_INT_STATUS (0x0C)
-#define SPI_TEST (0x10)
-#define SPI_PERIOD (0x14)
-#define SPI_DMA (0x18)
-#define SPI_RESET (0x1C)
-
-/* SPI Control Register Bit Fields & Masks */
-#define SPI_CONTROL_BITCOUNT_MASK (0xF) /* Bit Count Mask */
-#define SPI_CONTROL_BITCOUNT(n) (((n) - 1) & SPI_CONTROL_BITCOUNT_MASK)
-#define SPI_CONTROL_POL (0x1 << 4) /* Clock Polarity Mask */
-#define SPI_CONTROL_POL_ACT_HIGH (0x0 << 4) /* Active high pol. (0=idle) */
-#define SPI_CONTROL_POL_ACT_LOW (0x1 << 4) /* Active low pol. (1=idle) */
-#define SPI_CONTROL_PHA (0x1 << 5) /* Clock Phase Mask */
-#define SPI_CONTROL_PHA_0 (0x0 << 5) /* Clock Phase 0 */
-#define SPI_CONTROL_PHA_1 (0x1 << 5) /* Clock Phase 1 */
-#define SPI_CONTROL_SSCTL (0x1 << 6) /* /SS Waveform Select Mask */
-#define SPI_CONTROL_SSCTL_0 (0x0 << 6) /* Master: /SS stays low between SPI burst
- Slave: RXFIFO advanced by BIT_COUNT */
-#define SPI_CONTROL_SSCTL_1 (0x1 << 6) /* Master: /SS insert pulse between SPI burst
- Slave: RXFIFO advanced by /SS rising edge */
-#define SPI_CONTROL_SSPOL (0x1 << 7) /* /SS Polarity Select Mask */
-#define SPI_CONTROL_SSPOL_ACT_LOW (0x0 << 7) /* /SS Active low */
-#define SPI_CONTROL_SSPOL_ACT_HIGH (0x1 << 7) /* /SS Active high */
-#define SPI_CONTROL_XCH (0x1 << 8) /* Exchange */
-#define SPI_CONTROL_SPIEN (0x1 << 9) /* SPI Module Enable */
-#define SPI_CONTROL_MODE (0x1 << 10) /* SPI Mode Select Mask */
-#define SPI_CONTROL_MODE_SLAVE (0x0 << 10) /* SPI Mode Slave */
-#define SPI_CONTROL_MODE_MASTER (0x1 << 10) /* SPI Mode Master */
-#define SPI_CONTROL_DRCTL (0x3 << 11) /* /SPI_RDY Control Mask */
-#define SPI_CONTROL_DRCTL_0 (0x0 << 11) /* Ignore /SPI_RDY */
-#define SPI_CONTROL_DRCTL_1 (0x1 << 11) /* /SPI_RDY falling edge triggers input */
-#define SPI_CONTROL_DRCTL_2 (0x2 << 11) /* /SPI_RDY active low level triggers input */
-#define SPI_CONTROL_DATARATE (0x7 << 13) /* Data Rate Mask */
-#define SPI_PERCLK2_DIV_MIN (0) /* PERCLK2:4 */
-#define SPI_PERCLK2_DIV_MAX (7) /* PERCLK2:512 */
-#define SPI_CONTROL_DATARATE_MIN (SPI_PERCLK2_DIV_MAX << 13)
-#define SPI_CONTROL_DATARATE_MAX (SPI_PERCLK2_DIV_MIN << 13)
-#define SPI_CONTROL_DATARATE_BAD (SPI_CONTROL_DATARATE_MIN + 1)
-
-/* SPI Interrupt/Status Register Bit Fields & Masks */
-#define SPI_STATUS_TE (0x1 << 0) /* TXFIFO Empty Status */
-#define SPI_STATUS_TH (0x1 << 1) /* TXFIFO Half Status */
-#define SPI_STATUS_TF (0x1 << 2) /* TXFIFO Full Status */
-#define SPI_STATUS_RR (0x1 << 3) /* RXFIFO Data Ready Status */
-#define SPI_STATUS_RH (0x1 << 4) /* RXFIFO Half Status */
-#define SPI_STATUS_RF (0x1 << 5) /* RXFIFO Full Status */
-#define SPI_STATUS_RO (0x1 << 6) /* RXFIFO Overflow */
-#define SPI_STATUS_BO (0x1 << 7) /* Bit Count Overflow */
-#define SPI_STATUS (0xFF) /* SPI Status Mask */
-#define SPI_INTEN_TE (0x1 << 8) /* TXFIFO Empty Interrupt Enable */
-#define SPI_INTEN_TH (0x1 << 9) /* TXFIFO Half Interrupt Enable */
-#define SPI_INTEN_TF (0x1 << 10) /* TXFIFO Full Interrupt Enable */
-#define SPI_INTEN_RE (0x1 << 11) /* RXFIFO Data Ready Interrupt Enable */
-#define SPI_INTEN_RH (0x1 << 12) /* RXFIFO Half Interrupt Enable */
-#define SPI_INTEN_RF (0x1 << 13) /* RXFIFO Full Interrupt Enable */
-#define SPI_INTEN_RO (0x1 << 14) /* RXFIFO Overflow Interrupt Enable */
-#define SPI_INTEN_BO (0x1 << 15) /* Bit Count Overflow Interrupt Enable */
-#define SPI_INTEN (0xFF << 8) /* SPI Interrupt Enable Mask */
-
-/* SPI Test Register Bit Fields & Masks */
-#define SPI_TEST_TXCNT (0xF << 0) /* TXFIFO Counter */
-#define SPI_TEST_RXCNT_LSB (4) /* RXFIFO Counter LSB */
-#define SPI_TEST_RXCNT (0xF << 4) /* RXFIFO Counter */
-#define SPI_TEST_SSTATUS (0xF << 8) /* State Machine Status */
-#define SPI_TEST_LBC (0x1 << 14) /* Loop Back Control */
-
-/* SPI Period Register Bit Fields & Masks */
-#define SPI_PERIOD_WAIT (0x7FFF << 0) /* Wait Between Transactions */
-#define SPI_PERIOD_MAX_WAIT (0x7FFF) /* Max Wait Between
- Transactions */
-#define SPI_PERIOD_CSRC (0x1 << 15) /* Period Clock Source Mask */
-#define SPI_PERIOD_CSRC_BCLK (0x0 << 15) /* Period Clock Source is
- Bit Clock */
-#define SPI_PERIOD_CSRC_32768 (0x1 << 15) /* Period Clock Source is
- 32.768 KHz Clock */
-
-/* SPI DMA Register Bit Fields & Masks */
-#define SPI_DMA_RHDMA (0x1 << 4) /* RXFIFO Half Status */
-#define SPI_DMA_RFDMA (0x1 << 5) /* RXFIFO Full Status */
-#define SPI_DMA_TEDMA (0x1 << 6) /* TXFIFO Empty Status */
-#define SPI_DMA_THDMA (0x1 << 7) /* TXFIFO Half Status */
-#define SPI_DMA_RHDEN (0x1 << 12) /* RXFIFO Half DMA Request Enable */
-#define SPI_DMA_RFDEN (0x1 << 13) /* RXFIFO Full DMA Request Enable */
-#define SPI_DMA_TEDEN (0x1 << 14) /* TXFIFO Empty DMA Request Enable */
-#define SPI_DMA_THDEN (0x1 << 15) /* TXFIFO Half DMA Request Enable */
-
-/* SPI Soft Reset Register Bit Fields & Masks */
-#define SPI_RESET_START (0x1) /* Start */
-
-/* Default SPI configuration values */
-#define SPI_DEFAULT_CONTROL \
-( \
- SPI_CONTROL_BITCOUNT(16) | \
- SPI_CONTROL_POL_ACT_HIGH | \
- SPI_CONTROL_PHA_0 | \
- SPI_CONTROL_SPIEN | \
- SPI_CONTROL_SSCTL_1 | \
- SPI_CONTROL_MODE_MASTER | \
- SPI_CONTROL_DRCTL_0 | \
- SPI_CONTROL_DATARATE_MIN \
-)
-#define SPI_DEFAULT_ENABLE_LOOPBACK (0)
-#define SPI_DEFAULT_ENABLE_DMA (0)
-#define SPI_DEFAULT_PERIOD_WAIT (8)
-/*-------------------------------------------------------------------------*/
-
-
-/*-------------------------------------------------------------------------*/
-/* TX/RX SPI FIFO size */
-#define SPI_FIFO_DEPTH (8)
-#define SPI_FIFO_BYTE_WIDTH (2)
-#define SPI_FIFO_OVERFLOW_MARGIN (2)
-
-/* DMA burst length for half full/empty request trigger */
-#define SPI_DMA_BLR (SPI_FIFO_DEPTH * SPI_FIFO_BYTE_WIDTH / 2)
-
-/* Dummy char output to achieve reads.
- Choosing something different from all zeroes may help pattern recogition
- for oscilloscope analysis, but may break some drivers. */
-#define SPI_DUMMY_u8 0
-#define SPI_DUMMY_u16 ((SPI_DUMMY_u8 << 8) | SPI_DUMMY_u8)
-#define SPI_DUMMY_u32 ((SPI_DUMMY_u16 << 16) | SPI_DUMMY_u16)
-
-/**
- * Macro to change a u32 field:
- * @r : register to edit
- * @m : bit mask
- * @v : new value for the field correctly bit-alligned
-*/
-#define u32_EDIT(r, m, v) r = (r & ~(m)) | (v)
-
-/* Message state */
-#define START_STATE ((void*)0)
-#define RUNNING_STATE ((void*)1)
-#define DONE_STATE ((void*)2)
-#define ERROR_STATE ((void*)-1)
-
-/* Queue state */
-#define QUEUE_RUNNING (0)
-#define QUEUE_STOPPED (1)
-
-#define IS_DMA_ALIGNED(x) (((u32)(x) & 0x03) == 0)
-#define DMA_ALIGNMENT 4
-/*-------------------------------------------------------------------------*/
-
-
-/*-------------------------------------------------------------------------*/
-/* Driver data structs */
-
-/* Context */
-struct driver_data {
- /* Driver model hookup */
- struct platform_device *pdev;
-
- /* SPI framework hookup */
- struct spi_master *master;
-
- /* IMX hookup */
- struct spi_imx_master *master_info;
-
- /* Memory resources and SPI regs virtual address */
- struct resource *ioarea;
- void __iomem *regs;
-
- /* SPI RX_DATA physical address */
- dma_addr_t rd_data_phys;
-
- /* Driver message queue */
- struct workqueue_struct *workqueue;
- struct work_struct work;
- spinlock_t lock;
- struct list_head queue;
- int busy;
- int run;
-
- /* Message Transfer pump */
- struct tasklet_struct pump_transfers;
-
- /* Current message, transfer and state */
- struct spi_message *cur_msg;
- struct spi_transfer *cur_transfer;
- struct chip_data *cur_chip;
-
- /* Rd / Wr buffers pointers */
- size_t len;
- void *tx;
- void *tx_end;
- void *rx;
- void *rx_end;
-
- u8 rd_only;
- u8 n_bytes;
- int cs_change;
-
- /* Function pointers */
- irqreturn_t (*transfer_handler)(struct driver_data *drv_data);
- void (*cs_control)(u32 command);
-
- /* DMA setup */
- int rx_channel;
- int tx_channel;
- dma_addr_t rx_dma;
- dma_addr_t tx_dma;
- int rx_dma_needs_unmap;
- int tx_dma_needs_unmap;
- size_t tx_map_len;
- u32 dummy_dma_buf ____cacheline_aligned;
-
- struct clk *clk;
-};
-
-/* Runtime state */
-struct chip_data {
- u32 control;
- u32 period;
- u32 test;
-
- u8 enable_dma:1;
- u8 bits_per_word;
- u8 n_bytes;
- u32 max_speed_hz;
-
- void (*cs_control)(u32 command);
-};
-/*-------------------------------------------------------------------------*/
-
-
-static void pump_messages(struct work_struct *work);
-
-static void flush(struct driver_data *drv_data)
-{
- void __iomem *regs = drv_data->regs;
- u32 control;
-
- dev_dbg(&drv_data->pdev->dev, "flush\n");
-
- /* Wait for end of transaction */
- do {
- control = readl(regs + SPI_CONTROL);
- } while (control & SPI_CONTROL_XCH);
-
- /* Release chip select if requested, transfer delays are
- handled in pump_transfers */
- if (drv_data->cs_change)
- drv_data->cs_control(SPI_CS_DEASSERT);
-
- /* Disable SPI to flush FIFOs */
- writel(control & ~SPI_CONTROL_SPIEN, regs + SPI_CONTROL);
- writel(control, regs + SPI_CONTROL);
-}
-
-static void restore_state(struct driver_data *drv_data)
-{
- void __iomem *regs = drv_data->regs;
- struct chip_data *chip = drv_data->cur_chip;
-
- /* Load chip registers */
- dev_dbg(&drv_data->pdev->dev,
- "restore_state\n"
- " test = 0x%08X\n"
- " control = 0x%08X\n",
- chip->test,
- chip->control);
- writel(chip->test, regs + SPI_TEST);
- writel(chip->period, regs + SPI_PERIOD);
- writel(0, regs + SPI_INT_STATUS);
- writel(chip->control, regs + SPI_CONTROL);
-}
-
-static void null_cs_control(u32 command)
-{
-}
-
-static inline u32 data_to_write(struct driver_data *drv_data)
-{
- return ((u32)(drv_data->tx_end - drv_data->tx)) / drv_data->n_bytes;
-}
-
-static inline u32 data_to_read(struct driver_data *drv_data)
-{
- return ((u32)(drv_data->rx_end - drv_data->rx)) / drv_data->n_bytes;
-}
-
-static int write(struct driver_data *drv_data)
-{
- void __iomem *regs = drv_data->regs;
- void *tx = drv_data->tx;
- void *tx_end = drv_data->tx_end;
- u8 n_bytes = drv_data->n_bytes;
- u32 remaining_writes;
- u32 fifo_avail_space;
- u32 n;
- u16 d;
-
- /* Compute how many fifo writes to do */
- remaining_writes = (u32)(tx_end - tx) / n_bytes;
- fifo_avail_space = SPI_FIFO_DEPTH -
- (readl(regs + SPI_TEST) & SPI_TEST_TXCNT);
- if (drv_data->rx && (fifo_avail_space > SPI_FIFO_OVERFLOW_MARGIN))
- /* Fix misunderstood receive overflow */
- fifo_avail_space -= SPI_FIFO_OVERFLOW_MARGIN;
- n = min(remaining_writes, fifo_avail_space);
-
- dev_dbg(&drv_data->pdev->dev,
- "write type %s\n"
- " remaining writes = %d\n"
- " fifo avail space = %d\n"
- " fifo writes = %d\n",
- (n_bytes == 1) ? "u8" : "u16",
- remaining_writes,
- fifo_avail_space,
- n);
-
- if (n > 0) {
- /* Fill SPI TXFIFO */
- if (drv_data->rd_only) {
- tx += n * n_bytes;
- while (n--)
- writel(SPI_DUMMY_u16, regs + SPI_TXDATA);
- } else {
- if (n_bytes == 1) {
- while (n--) {
- d = *(u8*)tx;
- writel(d, regs + SPI_TXDATA);
- tx += 1;
- }
- } else {
- while (n--) {
- d = *(u16*)tx;
- writel(d, regs + SPI_TXDATA);
- tx += 2;
- }
- }
- }
-
- /* Trigger transfer */
- writel(readl(regs + SPI_CONTROL) | SPI_CONTROL_XCH,
- regs + SPI_CONTROL);
-
- /* Update tx pointer */
- drv_data->tx = tx;
- }
-
- return (tx >= tx_end);
-}
-
-static int read(struct driver_data *drv_data)
-{
- void __iomem *regs = drv_data->regs;
- void *rx = drv_data->rx;
- void *rx_end = drv_data->rx_end;
- u8 n_bytes = drv_data->n_bytes;
- u32 remaining_reads;
- u32 fifo_rxcnt;
- u32 n;
- u16 d;
-
- /* Compute how many fifo reads to do */
- remaining_reads = (u32)(rx_end - rx) / n_bytes;
- fifo_rxcnt = (readl(regs + SPI_TEST) & SPI_TEST_RXCNT) >>
- SPI_TEST_RXCNT_LSB;
- n = min(remaining_reads, fifo_rxcnt);
-
- dev_dbg(&drv_data->pdev->dev,
- "read type %s\n"
- " remaining reads = %d\n"
- " fifo rx count = %d\n"
- " fifo reads = %d\n",
- (n_bytes == 1) ? "u8" : "u16",
- remaining_reads,
- fifo_rxcnt,
- n);
-
- if (n > 0) {
- /* Read SPI RXFIFO */
- if (n_bytes == 1) {
- while (n--) {
- d = readl(regs + SPI_RXDATA);
- *((u8*)rx) = d;
- rx += 1;
- }
- } else {
- while (n--) {
- d = readl(regs + SPI_RXDATA);
- *((u16*)rx) = d;
- rx += 2;
- }
- }
-
- /* Update rx pointer */
- drv_data->rx = rx;
- }
-
- return (rx >= rx_end);
-}
-
-static void *next_transfer(struct driver_data *drv_data)
-{
- struct spi_message *msg = drv_data->cur_msg;
- struct spi_transfer *trans = drv_data->cur_transfer;
-
- /* Move to next transfer */
- if (trans->transfer_list.next != &msg->transfers) {
- drv_data->cur_transfer =
- list_entry(trans->transfer_list.next,
- struct spi_transfer,
- transfer_list);
- return RUNNING_STATE;
- }
-
- return DONE_STATE;
-}
-
-static int map_dma_buffers(struct driver_data *drv_data)
-{
- struct spi_message *msg;
- struct device *dev;
- void *buf;
-
- drv_data->rx_dma_needs_unmap = 0;
- drv_data->tx_dma_needs_unmap = 0;
-
- if (!drv_data->master_info->enable_dma ||
- !drv_data->cur_chip->enable_dma)
- return -1;
-
- msg = drv_data->cur_msg;
- dev = &msg->spi->dev;
- if (msg->is_dma_mapped) {
- if (drv_data->tx_dma)
- /* The caller provided at least dma and cpu virtual
- address for write; pump_transfers() will consider the
- transfer as write only if cpu rx virtual address is
- NULL */
- return 0;
-
- if (drv_data->rx_dma) {
- /* The caller provided dma and cpu virtual address to
- performe read only transfer -->
- use drv_data->dummy_dma_buf for dummy writes to
- achive reads */
- buf = &drv_data->dummy_dma_buf;
- drv_data->tx_map_len = sizeof(drv_data->dummy_dma_buf);
- drv_data->tx_dma = dma_map_single(dev,
- buf,
- drv_data->tx_map_len,
- DMA_TO_DEVICE);
- if (dma_mapping_error(dev, drv_data->tx_dma))
- return -1;
-
- drv_data->tx_dma_needs_unmap = 1;
-
- /* Flags transfer as rd_only for pump_transfers() DMA
- regs programming (should be redundant) */
- drv_data->tx = NULL;
-
- return 0;
- }
- }
-
- if (!IS_DMA_ALIGNED(drv_data->rx) || !IS_DMA_ALIGNED(drv_data->tx))
- return -1;
-
- if (drv_data->tx == NULL) {
- /* Read only message --> use drv_data->dummy_dma_buf for dummy
- writes to achive reads */
- buf = &drv_data->dummy_dma_buf;
- drv_data->tx_map_len = sizeof(drv_data->dummy_dma_buf);
- } else {
- buf = drv_data->tx;
- drv_data->tx_map_len = drv_data->len;
- }
- drv_data->tx_dma = dma_map_single(dev,
- buf,
- drv_data->tx_map_len,
- DMA_TO_DEVICE);
- if (dma_mapping_error(dev, drv_data->tx_dma))
- return -1;
- drv_data->tx_dma_needs_unmap = 1;
-
- /* NULL rx means write-only transfer and no map needed
- * since rx DMA will not be used */
- if (drv_data->rx) {
- buf = drv_data->rx;
- drv_data->rx_dma = dma_map_single(dev,
- buf,
- drv_data->len,
- DMA_FROM_DEVICE);
- if (dma_mapping_error(dev, drv_data->rx_dma)) {
- if (drv_data->tx_dma) {
- dma_unmap_single(dev,
- drv_data->tx_dma,
- drv_data->tx_map_len,
- DMA_TO_DEVICE);
- drv_data->tx_dma_needs_unmap = 0;
- }
- return -1;
- }
- drv_data->rx_dma_needs_unmap = 1;
- }
-
- return 0;
-}
-
-static void unmap_dma_buffers(struct driver_data *drv_data)
-{
- struct spi_message *msg = drv_data->cur_msg;
- struct device *dev = &msg->spi->dev;
-
- if (drv_data->rx_dma_needs_unmap) {
- dma_unmap_single(dev,
- drv_data->rx_dma,
- drv_data->len,
- DMA_FROM_DEVICE);
- drv_data->rx_dma_needs_unmap = 0;
- }
- if (drv_data->tx_dma_needs_unmap) {
- dma_unmap_single(dev,
- drv_data->tx_dma,
- drv_data->tx_map_len,
- DMA_TO_DEVICE);
- drv_data->tx_dma_needs_unmap = 0;
- }
-}
-
-/* Caller already set message->status (dma is already blocked) */
-static void giveback(struct spi_message *message, struct driver_data *drv_data)
-{
- void __iomem *regs = drv_data->regs;
-
- /* Bring SPI to sleep; restore_state() and pump_transfer()
- will do new setup */
- writel(0, regs + SPI_INT_STATUS);
- writel(0, regs + SPI_DMA);
-
- /* Unconditioned deselct */
- drv_data->cs_control(SPI_CS_DEASSERT);
-
- message->state = NULL;
- if (message->complete)
- message->complete(message->context);
-
- drv_data->cur_msg = NULL;
- drv_data->cur_transfer = NULL;
- drv_data->cur_chip = NULL;
- queue_work(drv_data->workqueue, &drv_data->work);
-}
-
-static void dma_err_handler(int channel, void *data, int errcode)
-{
- struct driver_data *drv_data = data;
- struct spi_message *msg = drv_data->cur_msg;
-
- dev_dbg(&drv_data->pdev->dev, "dma_err_handler\n");
-
- /* Disable both rx and tx dma channels */
- imx_dma_disable(drv_data->rx_channel);
- imx_dma_disable(drv_data->tx_channel);
- unmap_dma_buffers(drv_data);
-
- flush(drv_data);
-
- msg->state = ERROR_STATE;
- tasklet_schedule(&drv_data->pump_transfers);
-}
-
-static void dma_tx_handler(int channel, void *data)
-{
- struct driver_data *drv_data = data;
-
- dev_dbg(&drv_data->pdev->dev, "dma_tx_handler\n");
-
- imx_dma_disable(channel);
-
- /* Now waits for TX FIFO empty */
- writel(SPI_INTEN_TE, drv_data->regs + SPI_INT_STATUS);
-}
-
-static irqreturn_t dma_transfer(struct driver_data *drv_data)
-{
- u32 status;
- struct spi_message *msg = drv_data->cur_msg;
- void __iomem *regs = drv_data->regs;
-
- status = readl(regs + SPI_INT_STATUS);
-
- if ((status & (SPI_INTEN_RO | SPI_STATUS_RO))
- == (SPI_INTEN_RO | SPI_STATUS_RO)) {
- writel(status & ~SPI_INTEN, regs + SPI_INT_STATUS);
-
- imx_dma_disable(drv_data->tx_channel);
- imx_dma_disable(drv_data->rx_channel);
- unmap_dma_buffers(drv_data);
-
- flush(drv_data);
-
- dev_warn(&drv_data->pdev->dev,
- "dma_transfer - fifo overun\n");
-
- msg->state = ERROR_STATE;
- tasklet_schedule(&drv_data->pump_transfers);
-
- return IRQ_HANDLED;
- }
-
- if (status & SPI_STATUS_TE) {
- writel(status & ~SPI_INTEN_TE, regs + SPI_INT_STATUS);
-
- if (drv_data->rx) {
- /* Wait end of transfer before read trailing data */
- while (readl(regs + SPI_CONTROL) & SPI_CONTROL_XCH)
- cpu_relax();
-
- imx_dma_disable(drv_data->rx_channel);
- unmap_dma_buffers(drv_data);
-
- /* Release chip select if requested, transfer delays are
- handled in pump_transfers() */
- if (drv_data->cs_change)
- drv_data->cs_control(SPI_CS_DEASSERT);
-
- /* Calculate number of trailing data and read them */
- dev_dbg(&drv_data->pdev->dev,
- "dma_transfer - test = 0x%08X\n",
- readl(regs + SPI_TEST));
- drv_data->rx = drv_data->rx_end -
- ((readl(regs + SPI_TEST) &
- SPI_TEST_RXCNT) >>
- SPI_TEST_RXCNT_LSB)*drv_data->n_bytes;
- read(drv_data);
- } else {
- /* Write only transfer */
- unmap_dma_buffers(drv_data);
-
- flush(drv_data);
- }
-
- /* End of transfer, update total byte transfered */
- msg->actual_length += drv_data->len;
-
- /* Move to next transfer */
- msg->state = next_transfer(drv_data);
-
- /* Schedule transfer tasklet */
- tasklet_schedule(&drv_data->pump_transfers);
-
- return IRQ_HANDLED;
- }
-
- /* Opps problem detected */
- return IRQ_NONE;
-}
-
-static irqreturn_t interrupt_wronly_transfer(struct driver_data *drv_data)
-{
- struct spi_message *msg = drv_data->cur_msg;
- void __iomem *regs = drv_data->regs;
- u32 status;
- irqreturn_t handled = IRQ_NONE;
-
- status = readl(regs + SPI_INT_STATUS);
-
- if (status & SPI_INTEN_TE) {
- /* TXFIFO Empty Interrupt on the last transfered word */
- writel(status & ~SPI_INTEN, regs + SPI_INT_STATUS);
- dev_dbg(&drv_data->pdev->dev,
- "interrupt_wronly_transfer - end of tx\n");
-
- flush(drv_data);
-
- /* Update total byte transfered */
- msg->actual_length += drv_data->len;
-
- /* Move to next transfer */
- msg->state = next_transfer(drv_data);
-
- /* Schedule transfer tasklet */
- tasklet_schedule(&drv_data->pump_transfers);
-
- return IRQ_HANDLED;
- } else {
- while (status & SPI_STATUS_TH) {
- dev_dbg(&drv_data->pdev->dev,
- "interrupt_wronly_transfer - status = 0x%08X\n",
- status);
-
- /* Pump data */
- if (write(drv_data)) {
- /* End of TXFIFO writes,
- now wait until TXFIFO is empty */
- writel(SPI_INTEN_TE, regs + SPI_INT_STATUS);
- return IRQ_HANDLED;
- }
-
- status = readl(regs + SPI_INT_STATUS);
-
- /* We did something */
- handled = IRQ_HANDLED;
- }
- }
-
- return handled;
-}
-
-static irqreturn_t interrupt_transfer(struct driver_data *drv_data)
-{
- struct spi_message *msg = drv_data->cur_msg;
- void __iomem *regs = drv_data->regs;
- u32 status, control;
- irqreturn_t handled = IRQ_NONE;
- unsigned long limit;
-
- status = readl(regs + SPI_INT_STATUS);
-
- if (status & SPI_INTEN_TE) {
- /* TXFIFO Empty Interrupt on the last transfered word */
- writel(status & ~SPI_INTEN, regs + SPI_INT_STATUS);
- dev_dbg(&drv_data->pdev->dev,
- "interrupt_transfer - end of tx\n");
-
- if (msg->state == ERROR_STATE) {
- /* RXFIFO overrun was detected and message aborted */
- flush(drv_data);
- } else {
- /* Wait for end of transaction */
- do {
- control = readl(regs + SPI_CONTROL);
- } while (control & SPI_CONTROL_XCH);
-
- /* Release chip select if requested, transfer delays are
- handled in pump_transfers */
- if (drv_data->cs_change)
- drv_data->cs_control(SPI_CS_DEASSERT);
-
- /* Read trailing bytes */
- limit = loops_per_jiffy << 1;
- while ((read(drv_data) == 0) && --limit)
- cpu_relax();
-
- if (limit == 0)
- dev_err(&drv_data->pdev->dev,
- "interrupt_transfer - "
- "trailing byte read failed\n");
- else
- dev_dbg(&drv_data->pdev->dev,
- "interrupt_transfer - end of rx\n");
-
- /* Update total byte transfered */
- msg->actual_length += drv_data->len;
-
- /* Move to next transfer */
- msg->state = next_transfer(drv_data);
- }
-
- /* Schedule transfer tasklet */
- tasklet_schedule(&drv_data->pump_transfers);
-
- return IRQ_HANDLED;
- } else {
- while (status & (SPI_STATUS_TH | SPI_STATUS_RO)) {
- dev_dbg(&drv_data->pdev->dev,
- "interrupt_transfer - status = 0x%08X\n",
- status);
-
- if (status & SPI_STATUS_RO) {
- /* RXFIFO overrun, abort message end wait
- until TXFIFO is empty */
- writel(SPI_INTEN_TE, regs + SPI_INT_STATUS);
-
- dev_warn(&drv_data->pdev->dev,
- "interrupt_transfer - fifo overun\n"
- " data not yet written = %d\n"
- " data not yet read = %d\n",
- data_to_write(drv_data),
- data_to_read(drv_data));
-
- msg->state = ERROR_STATE;
-
- return IRQ_HANDLED;
- }
-
- /* Pump data */
- read(drv_data);
- if (write(drv_data)) {
- /* End of TXFIFO writes,
- now wait until TXFIFO is empty */
- writel(SPI_INTEN_TE, regs + SPI_INT_STATUS);
- return IRQ_HANDLED;
- }
-
- status = readl(regs + SPI_INT_STATUS);
-
- /* We did something */
- handled = IRQ_HANDLED;
- }
- }
-
- return handled;
-}
-
-static irqreturn_t spi_int(int irq, void *dev_id)
-{
- struct driver_data *drv_data = (struct driver_data *)dev_id;
-
- if (!drv_data->cur_msg) {
- dev_err(&drv_data->pdev->dev,
- "spi_int - bad message state\n");
- /* Never fail */
- return IRQ_HANDLED;
- }
-
- return drv_data->transfer_handler(drv_data);
-}
-
-static inline u32 spi_speed_hz(struct driver_data *drv_data, u32 data_rate)
-{
- return clk_get_rate(drv_data->clk) / (4 << ((data_rate) >> 13));
-}
-
-static u32 spi_data_rate(struct driver_data *drv_data, u32 speed_hz)
-{
- u32 div;
- u32 quantized_hz = clk_get_rate(drv_data->clk) >> 2;
-
- for (div = SPI_PERCLK2_DIV_MIN;
- div <= SPI_PERCLK2_DIV_MAX;
- div++, quantized_hz >>= 1) {
- if (quantized_hz <= speed_hz)
- /* Max available speed LEQ required speed */
- return div << 13;
- }
- return SPI_CONTROL_DATARATE_BAD;
-}
-
-static void pump_transfers(unsigned long data)
-{
- struct driver_data *drv_data = (struct driver_data *)data;
- struct spi_message *message;
- struct spi_transfer *transfer, *previous;
- struct chip_data *chip;
- void __iomem *regs;
- u32 tmp, control;
-
- dev_dbg(&drv_data->pdev->dev, "pump_transfer\n");
-
- message = drv_data->cur_msg;
-
- /* Handle for abort */
- if (message->state == ERROR_STATE) {
- message->status = -EIO;
- giveback(message, drv_data);
- return;
- }
-
- /* Handle end of message */
- if (message->state == DONE_STATE) {
- message->status = 0;
- giveback(message, drv_data);
- return;
- }
-
- chip = drv_data->cur_chip;
-
- /* Delay if requested at end of transfer*/
- transfer = drv_data->cur_transfer;
- if (message->state == RUNNING_STATE) {
- previous = list_entry(transfer->transfer_list.prev,
- struct spi_transfer,
- transfer_list);
- if (previous->delay_usecs)
- udelay(previous->delay_usecs);
- } else {
- /* START_STATE */
- message->state = RUNNING_STATE;
- drv_data->cs_control = chip->cs_control;
- }
-
- transfer = drv_data->cur_transfer;
- drv_data->tx = (void *)transfer->tx_buf;
- drv_data->tx_end = drv_data->tx + transfer->len;
- drv_data->rx = transfer->rx_buf;
- drv_data->rx_end = drv_data->rx + transfer->len;
- drv_data->rx_dma = transfer->rx_dma;
- drv_data->tx_dma = transfer->tx_dma;
- drv_data->len = transfer->len;
- drv_data->cs_change = transfer->cs_change;
- drv_data->rd_only = (drv_data->tx == NULL);
-
- regs = drv_data->regs;
- control = readl(regs + SPI_CONTROL);
-
- /* Bits per word setup */
- tmp = transfer->bits_per_word;
- if (tmp == 0) {
- /* Use device setup */
- tmp = chip->bits_per_word;
- drv_data->n_bytes = chip->n_bytes;
- } else
- /* Use per-transfer setup */
- drv_data->n_bytes = (tmp <= 8) ? 1 : 2;
- u32_EDIT(control, SPI_CONTROL_BITCOUNT_MASK, tmp - 1);
-
- /* Speed setup (surely valid because already checked) */
- tmp = transfer->speed_hz;
- if (tmp == 0)
- tmp = chip->max_speed_hz;
- tmp = spi_data_rate(drv_data, tmp);
- u32_EDIT(control, SPI_CONTROL_DATARATE, tmp);
-
- writel(control, regs + SPI_CONTROL);
-
- /* Assert device chip-select */
- drv_data->cs_control(SPI_CS_ASSERT);
-
- /* DMA cannot read/write SPI FIFOs other than 16 bits at a time; hence
- if bits_per_word is less or equal 8 PIO transfers are performed.
- Moreover DMA is convinient for transfer length bigger than FIFOs
- byte size. */
- if ((drv_data->n_bytes == 2) &&
- (drv_data->len > SPI_FIFO_DEPTH*SPI_FIFO_BYTE_WIDTH) &&
- (map_dma_buffers(drv_data) == 0)) {
- dev_dbg(&drv_data->pdev->dev,
- "pump dma transfer\n"
- " tx = %p\n"
- " tx_dma = %08X\n"
- " rx = %p\n"
- " rx_dma = %08X\n"
- " len = %d\n",
- drv_data->tx,
- (unsigned int)drv_data->tx_dma,
- drv_data->rx,
- (unsigned int)drv_data->rx_dma,
- drv_data->len);
-
- /* Ensure we have the correct interrupt handler */
- drv_data->transfer_handler = dma_transfer;
-
- /* Trigger transfer */
- writel(readl(regs + SPI_CONTROL) | SPI_CONTROL_XCH,
- regs + SPI_CONTROL);
-
- /* Setup tx DMA */
- if (drv_data->tx)
- /* Linear source address */
- CCR(drv_data->tx_channel) =
- CCR_DMOD_FIFO |
- CCR_SMOD_LINEAR |
- CCR_SSIZ_32 | CCR_DSIZ_16 |
- CCR_REN;
- else
- /* Read only transfer -> fixed source address for
- dummy write to achive read */
- CCR(drv_data->tx_channel) =
- CCR_DMOD_FIFO |
- CCR_SMOD_FIFO |
- CCR_SSIZ_32 | CCR_DSIZ_16 |
- CCR_REN;
-
- imx_dma_setup_single(
- drv_data->tx_channel,
- drv_data->tx_dma,
- drv_data->len,
- drv_data->rd_data_phys + 4,
- DMA_MODE_WRITE);
-
- if (drv_data->rx) {
- /* Setup rx DMA for linear destination address */
- CCR(drv_data->rx_channel) =
- CCR_DMOD_LINEAR |
- CCR_SMOD_FIFO |
- CCR_DSIZ_32 | CCR_SSIZ_16 |
- CCR_REN;
- imx_dma_setup_single(
- drv_data->rx_channel,
- drv_data->rx_dma,
- drv_data->len,
- drv_data->rd_data_phys,
- DMA_MODE_READ);
- imx_dma_enable(drv_data->rx_channel);
-
- /* Enable SPI interrupt */
- writel(SPI_INTEN_RO, regs + SPI_INT_STATUS);
-
- /* Set SPI to request DMA service on both
- Rx and Tx half fifo watermark */
- writel(SPI_DMA_RHDEN | SPI_DMA_THDEN, regs + SPI_DMA);
- } else
- /* Write only access -> set SPI to request DMA
- service on Tx half fifo watermark */
- writel(SPI_DMA_THDEN, regs + SPI_DMA);
-
- imx_dma_enable(drv_data->tx_channel);
- } else {
- dev_dbg(&drv_data->pdev->dev,
- "pump pio transfer\n"
- " tx = %p\n"
- " rx = %p\n"
- " len = %d\n",
- drv_data->tx,
- drv_data->rx,
- drv_data->len);
-
- /* Ensure we have the correct interrupt handler */
- if (drv_data->rx)
- drv_data->transfer_handler = interrupt_transfer;
- else
- drv_data->transfer_handler = interrupt_wronly_transfer;
-
- /* Enable SPI interrupt */
- if (drv_data->rx)
- writel(SPI_INTEN_TH | SPI_INTEN_RO,
- regs + SPI_INT_STATUS);
- else
- writel(SPI_INTEN_TH, regs + SPI_INT_STATUS);
- }
-}
-
-static void pump_messages(struct work_struct *work)
-{
- struct driver_data *drv_data =
- container_of(work, struct driver_data, work);
- unsigned long flags;
-
- /* Lock queue and check for queue work */
- spin_lock_irqsave(&drv_data->lock, flags);
- if (list_empty(&drv_data->queue) || drv_data->run == QUEUE_STOPPED) {
- drv_data->busy = 0;
- spin_unlock_irqrestore(&drv_data->lock, flags);
- return;
- }
-
- /* Make sure we are not already running a message */
- if (drv_data->cur_msg) {
- spin_unlock_irqrestore(&drv_data->lock, flags);
- return;
- }
-
- /* Extract head of queue */
- drv_data->cur_msg = list_entry(drv_data->queue.next,
- struct spi_message, queue);
- list_del_init(&drv_data->cur_msg->queue);
- drv_data->busy = 1;
- spin_unlock_irqrestore(&drv_data->lock, flags);
-
- /* Initial message state */
- drv_data->cur_msg->state = START_STATE;
- drv_data->cur_transfer = list_entry(drv_data->cur_msg->transfers.next,
- struct spi_transfer,
- transfer_list);
-
- /* Setup the SPI using the per chip configuration */
- drv_data->cur_chip = spi_get_ctldata(drv_data->cur_msg->spi);
- restore_state(drv_data);
-
- /* Mark as busy and launch transfers */
- tasklet_schedule(&drv_data->pump_transfers);
-}
-
-static int transfer(struct spi_device *spi, struct spi_message *msg)
-{
- struct driver_data *drv_data = spi_master_get_devdata(spi->master);
- u32 min_speed_hz, max_speed_hz, tmp;
- struct spi_transfer *trans;
- unsigned long flags;
-
- msg->actual_length = 0;
-
- /* Per transfer setup check */
- min_speed_hz = spi_speed_hz(drv_data, SPI_CONTROL_DATARATE_MIN);
- max_speed_hz = spi->max_speed_hz;
- list_for_each_entry(trans, &msg->transfers, transfer_list) {
- tmp = trans->bits_per_word;
- if (tmp > 16) {
- dev_err(&drv_data->pdev->dev,
- "message rejected : "
- "invalid transfer bits_per_word (%d bits)\n",
- tmp);
- goto msg_rejected;
- }
- tmp = trans->speed_hz;
- if (tmp) {
- if (tmp < min_speed_hz) {
- dev_err(&drv_data->pdev->dev,
- "message rejected : "
- "device min speed (%d Hz) exceeds "
- "required transfer speed (%d Hz)\n",
- min_speed_hz,
- tmp);
- goto msg_rejected;
- } else if (tmp > max_speed_hz) {
- dev_err(&drv_data->pdev->dev,
- "message rejected : "
- "transfer speed (%d Hz) exceeds "
- "device max speed (%d Hz)\n",
- tmp,
- max_speed_hz);
- goto msg_rejected;
- }
- }
- }
-
- /* Message accepted */
- msg->status = -EINPROGRESS;
- msg->state = START_STATE;
-
- spin_lock_irqsave(&drv_data->lock, flags);
- if (drv_data->run == QUEUE_STOPPED) {
- spin_unlock_irqrestore(&drv_data->lock, flags);
- return -ESHUTDOWN;
- }
-
- list_add_tail(&msg->queue, &drv_data->queue);
- if (drv_data->run == QUEUE_RUNNING && !drv_data->busy)
- queue_work(drv_data->workqueue, &drv_data->work);
-
- spin_unlock_irqrestore(&drv_data->lock, flags);
- return 0;
-
-msg_rejected:
- /* Message rejected and not queued */
- msg->status = -EINVAL;
- msg->state = ERROR_STATE;
- if (msg->complete)
- msg->complete(msg->context);
- return -EINVAL;
-}
-
-/* On first setup bad values must free chip_data memory since will cause
- spi_new_device to fail. Bad value setup from protocol driver are simply not
- applied and notified to the calling driver. */
-static int setup(struct spi_device *spi)
-{
- struct driver_data *drv_data = spi_master_get_devdata(spi->master);
- struct spi_imx_chip *chip_info;
- struct chip_data *chip;
- int first_setup = 0;
- u32 tmp;
- int status = 0;
-
- /* Get controller data */
- chip_info = spi->controller_data;
-
- /* Get controller_state */
- chip = spi_get_ctldata(spi);
- if (chip == NULL) {
- first_setup = 1;
-
- chip = kzalloc(sizeof(struct chip_data), GFP_KERNEL);
- if (!chip) {
- dev_err(&spi->dev,
- "setup - cannot allocate controller state\n");
- return -ENOMEM;
- }
- chip->control = SPI_DEFAULT_CONTROL;
-
- if (chip_info == NULL) {
- /* spi_board_info.controller_data not is supplied */
- chip_info = kzalloc(sizeof(struct spi_imx_chip),
- GFP_KERNEL);
- if (!chip_info) {
- dev_err(&spi->dev,
- "setup - "
- "cannot allocate controller data\n");
- status = -ENOMEM;
- goto err_first_setup;
- }
- /* Set controller data default value */
- chip_info->enable_loopback =
- SPI_DEFAULT_ENABLE_LOOPBACK;
- chip_info->enable_dma = SPI_DEFAULT_ENABLE_DMA;
- chip_info->ins_ss_pulse = 1;
- chip_info->bclk_wait = SPI_DEFAULT_PERIOD_WAIT;
- chip_info->cs_control = null_cs_control;
- }
- }
-
- /* Now set controller state based on controller data */
-
- if (first_setup) {
- /* SPI loopback */
- if (chip_info->enable_loopback)
- chip->test = SPI_TEST_LBC;
- else
- chip->test = 0;
-
- /* SPI dma driven */
- chip->enable_dma = chip_info->enable_dma;
-
- /* SPI /SS pulse between spi burst */
- if (chip_info->ins_ss_pulse)
- u32_EDIT(chip->control,
- SPI_CONTROL_SSCTL, SPI_CONTROL_SSCTL_1);
- else
- u32_EDIT(chip->control,
- SPI_CONTROL_SSCTL, SPI_CONTROL_SSCTL_0);
-
- /* SPI bclk waits between each bits_per_word spi burst */
- if (chip_info->bclk_wait > SPI_PERIOD_MAX_WAIT) {
- dev_err(&spi->dev,
- "setup - "
- "bclk_wait exceeds max allowed (%d)\n",
- SPI_PERIOD_MAX_WAIT);
- goto err_first_setup;
- }
- chip->period = SPI_PERIOD_CSRC_BCLK |
- (chip_info->bclk_wait & SPI_PERIOD_WAIT);
- }
-
- /* SPI mode */
- tmp = spi->mode;
- if (tmp & SPI_CS_HIGH) {
- u32_EDIT(chip->control,
- SPI_CONTROL_SSPOL, SPI_CONTROL_SSPOL_ACT_HIGH);
- }
- switch (tmp & SPI_MODE_3) {
- case SPI_MODE_0:
- tmp = 0;
- break;
- case SPI_MODE_1:
- tmp = SPI_CONTROL_PHA_1;
- break;
- case SPI_MODE_2:
- tmp = SPI_CONTROL_POL_ACT_LOW;
- break;
- default:
- /* SPI_MODE_3 */
- tmp = SPI_CONTROL_PHA_1 | SPI_CONTROL_POL_ACT_LOW;
- break;
- }
- u32_EDIT(chip->control, SPI_CONTROL_POL | SPI_CONTROL_PHA, tmp);
-
- /* SPI word width */
- tmp = spi->bits_per_word;
- if (tmp > 16) {
- status = -EINVAL;
- dev_err(&spi->dev,
- "setup - "
- "invalid bits_per_word (%d)\n",
- tmp);
- if (first_setup)
- goto err_first_setup;
- else {
- /* Undo setup using chip as backup copy */
- tmp = chip->bits_per_word;
- spi->bits_per_word = tmp;
- }
- }
- chip->bits_per_word = tmp;
- u32_EDIT(chip->control, SPI_CONTROL_BITCOUNT_MASK, tmp - 1);
- chip->n_bytes = (tmp <= 8) ? 1 : 2;
-
- /* SPI datarate */
- tmp = spi_data_rate(drv_data, spi->max_speed_hz);
- if (tmp == SPI_CONTROL_DATARATE_BAD) {
- status = -EINVAL;
- dev_err(&spi->dev,
- "setup - "
- "HW min speed (%d Hz) exceeds required "
- "max speed (%d Hz)\n",
- spi_speed_hz(drv_data, SPI_CONTROL_DATARATE_MIN),
- spi->max_speed_hz);
- if (first_setup)
- goto err_first_setup;
- else
- /* Undo setup using chip as backup copy */
- spi->max_speed_hz = chip->max_speed_hz;
- } else {
- u32_EDIT(chip->control, SPI_CONTROL_DATARATE, tmp);
- /* Actual rounded max_speed_hz */
- tmp = spi_speed_hz(drv_data, tmp);
- spi->max_speed_hz = tmp;
- chip->max_speed_hz = tmp;
- }
-
- /* SPI chip-select management */
- if (chip_info->cs_control)
- chip->cs_control = chip_info->cs_control;
- else
- chip->cs_control = null_cs_control;
-
- /* Save controller_state */
- spi_set_ctldata(spi, chip);
-
- /* Summary */
- dev_dbg(&spi->dev,
- "setup succeded\n"
- " loopback enable = %s\n"
- " dma enable = %s\n"
- " insert /ss pulse = %s\n"
- " period wait = %d\n"
- " mode = %d\n"
- " bits per word = %d\n"
- " min speed = %d Hz\n"
- " rounded max speed = %d Hz\n",
- chip->test & SPI_TEST_LBC ? "Yes" : "No",
- chip->enable_dma ? "Yes" : "No",
- chip->control & SPI_CONTROL_SSCTL ? "Yes" : "No",
- chip->period & SPI_PERIOD_WAIT,
- spi->mode,
- spi->bits_per_word,
- spi_speed_hz(drv_data, SPI_CONTROL_DATARATE_MIN),
- spi->max_speed_hz);
- return status;
-
-err_first_setup:
- kfree(chip);
- return status;
-}
-
-static void cleanup(struct spi_device *spi)
-{
- kfree(spi_get_ctldata(spi));
-}
-
-static int __init init_queue(struct driver_data *drv_data)
-{
- INIT_LIST_HEAD(&drv_data->queue);
- spin_lock_init(&drv_data->lock);
-
- drv_data->run = QUEUE_STOPPED;
- drv_data->busy = 0;
-
- tasklet_init(&drv_data->pump_transfers,
- pump_transfers, (unsigned long)drv_data);
-
- INIT_WORK(&drv_data->work, pump_messages);
- drv_data->workqueue = create_singlethread_workqueue(
- dev_name(drv_data->master->dev.parent));
- if (drv_data->workqueue == NULL)
- return -EBUSY;
-
- return 0;
-}
-
-static int start_queue(struct driver_data *drv_data)
-{
- unsigned long flags;
-
- spin_lock_irqsave(&drv_data->lock, flags);
-
- if (drv_data->run == QUEUE_RUNNING || drv_data->busy) {
- spin_unlock_irqrestore(&drv_data->lock, flags);
- return -EBUSY;
- }
-
- drv_data->run = QUEUE_RUNNING;
- drv_data->cur_msg = NULL;
- drv_data->cur_transfer = NULL;
- drv_data->cur_chip = NULL;
- spin_unlock_irqrestore(&drv_data->lock, flags);
-
- queue_work(drv_data->workqueue, &drv_data->work);
-
- return 0;
-}
-
-static int stop_queue(struct driver_data *drv_data)
-{
- unsigned long flags;
- unsigned limit = 500;
- int status = 0;
-
- spin_lock_irqsave(&drv_data->lock, flags);
-
- /* This is a bit lame, but is optimized for the common execution path.
- * A wait_queue on the drv_data->busy could be used, but then the common
- * execution path (pump_messages) would be required to call wake_up or
- * friends on every SPI message. Do this instead */
- drv_data->run = QUEUE_STOPPED;
- while (!list_empty(&drv_data->queue) && drv_data->busy && limit--) {
- spin_unlock_irqrestore(&drv_data->lock, flags);
- msleep(10);
- spin_lock_irqsave(&drv_data->lock, flags);
- }
-
- if (!list_empty(&drv_data->queue) || drv_data->busy)
- status = -EBUSY;
-
- spin_unlock_irqrestore(&drv_data->lock, flags);
-
- return status;
-}
-
-static int destroy_queue(struct driver_data *drv_data)
-{
- int status;
-
- status = stop_queue(drv_data);
- if (status != 0)
- return status;
-
- if (drv_data->workqueue)
- destroy_workqueue(drv_data->workqueue);
-
- return 0;
-}
-
-static int __init spi_imx_probe(struct platform_device *pdev)
-{
- struct device *dev = &pdev->dev;
- struct spi_imx_master *platform_info;
- struct spi_master *master;
- struct driver_data *drv_data;
- struct resource *res;
- int irq, status = 0;
-
- platform_info = dev->platform_data;
- if (platform_info == NULL) {
- dev_err(&pdev->dev, "probe - no platform data supplied\n");
- status = -ENODEV;
- goto err_no_pdata;
- }
-
- /* Allocate master with space for drv_data */
- master = spi_alloc_master(dev, sizeof(struct driver_data));
- if (!master) {
- dev_err(&pdev->dev, "probe - cannot alloc spi_master\n");
- status = -ENOMEM;
- goto err_no_mem;
- }
- drv_data = spi_master_get_devdata(master);
- drv_data->master = master;
- drv_data->master_info = platform_info;
- drv_data->pdev = pdev;
-
- /* the spi->mode bits understood by this driver: */
- master->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
-
- master->bus_num = pdev->id;
- master->num_chipselect = platform_info->num_chipselect;
- master->dma_alignment = DMA_ALIGNMENT;
- master->cleanup = cleanup;
- master->setup = setup;
- master->transfer = transfer;
-
- drv_data->dummy_dma_buf = SPI_DUMMY_u32;
-
- drv_data->clk = clk_get(&pdev->dev, "perclk2");
- if (IS_ERR(drv_data->clk)) {
- dev_err(&pdev->dev, "probe - cannot get clock\n");
- status = PTR_ERR(drv_data->clk);
- goto err_no_clk;
- }
- clk_enable(drv_data->clk);
-
- /* Find and map resources */
- res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
- if (!res) {
- dev_err(&pdev->dev, "probe - MEM resources not defined\n");
- status = -ENODEV;
- goto err_no_iores;
- }
- drv_data->ioarea = request_mem_region(res->start,
- res->end - res->start + 1,
- pdev->name);
- if (drv_data->ioarea == NULL) {
- dev_err(&pdev->dev, "probe - cannot reserve region\n");
- status = -ENXIO;
- goto err_no_iores;
- }
- drv_data->regs = ioremap(res->start, res->end - res->start + 1);
- if (drv_data->regs == NULL) {
- dev_err(&pdev->dev, "probe - cannot map IO\n");
- status = -ENXIO;
- goto err_no_iomap;
- }
- drv_data->rd_data_phys = (dma_addr_t)res->start;
-
- /* Attach to IRQ */
- irq = platform_get_irq(pdev, 0);
- if (irq < 0) {
- dev_err(&pdev->dev, "probe - IRQ resource not defined\n");
- status = -ENODEV;
- goto err_no_irqres;
- }
- status = request_irq(irq, spi_int, IRQF_DISABLED,
- dev_name(dev), drv_data);
- if (status < 0) {
- dev_err(&pdev->dev, "probe - cannot get IRQ (%d)\n", status);
- goto err_no_irqres;
- }
-
- /* Setup DMA if requested */
- drv_data->tx_channel = -1;
- drv_data->rx_channel = -1;
- if (platform_info->enable_dma) {
- /* Get rx DMA channel */
- drv_data->rx_channel = imx_dma_request_by_prio("spi_imx_rx",
- DMA_PRIO_HIGH);
- if (drv_data->rx_channel < 0) {
- dev_err(dev,
- "probe - problem (%d) requesting rx channel\n",
- drv_data->rx_channel);
- goto err_no_rxdma;
- } else
- imx_dma_setup_handlers(drv_data->rx_channel, NULL,
- dma_err_handler, drv_data);
-
- /* Get tx DMA channel */
- drv_data->tx_channel = imx_dma_request_by_prio("spi_imx_tx",
- DMA_PRIO_MEDIUM);
- if (drv_data->tx_channel < 0) {
- dev_err(dev,
- "probe - problem (%d) requesting tx channel\n",
- drv_data->tx_channel);
- imx_dma_free(drv_data->rx_channel);
- goto err_no_txdma;
- } else
- imx_dma_setup_handlers(drv_data->tx_channel,
- dma_tx_handler, dma_err_handler,
- drv_data);
-
- /* Set request source and burst length for allocated channels */
- switch (drv_data->pdev->id) {
- case 1:
- /* Using SPI1 */
- RSSR(drv_data->rx_channel) = DMA_REQ_SPI1_R;
- RSSR(drv_data->tx_channel) = DMA_REQ_SPI1_T;
- break;
- case 2:
- /* Using SPI2 */
- RSSR(drv_data->rx_channel) = DMA_REQ_SPI2_R;
- RSSR(drv_data->tx_channel) = DMA_REQ_SPI2_T;
- break;
- default:
- dev_err(dev, "probe - bad SPI Id\n");
- imx_dma_free(drv_data->rx_channel);
- imx_dma_free(drv_data->tx_channel);
- status = -ENODEV;
- goto err_no_devid;
- }
- BLR(drv_data->rx_channel) = SPI_DMA_BLR;
- BLR(drv_data->tx_channel) = SPI_DMA_BLR;
- }
-
- /* Load default SPI configuration */
- writel(SPI_RESET_START, drv_data->regs + SPI_RESET);
- writel(0, drv_data->regs + SPI_RESET);
- writel(SPI_DEFAULT_CONTROL, drv_data->regs + SPI_CONTROL);
-
- /* Initial and start queue */
- status = init_queue(drv_data);
- if (status != 0) {
- dev_err(&pdev->dev, "probe - problem initializing queue\n");
- goto err_init_queue;
- }
- status = start_queue(drv_data);
- if (status != 0) {
- dev_err(&pdev->dev, "probe - problem starting queue\n");
- goto err_start_queue;
- }
-
- /* Register with the SPI framework */
- platform_set_drvdata(pdev, drv_data);
- status = spi_register_master(master);
- if (status != 0) {
- dev_err(&pdev->dev, "probe - problem registering spi master\n");
- goto err_spi_register;
- }
-
- dev_dbg(dev, "probe succeded\n");
- return 0;
-
-err_init_queue:
-err_start_queue:
-err_spi_register:
- destroy_queue(drv_data);
-
-err_no_rxdma:
-err_no_txdma:
-err_no_devid:
- free_irq(irq, drv_data);
-
-err_no_irqres:
- iounmap(drv_data->regs);
-
-err_no_iomap:
- release_resource(drv_data->ioarea);
- kfree(drv_data->ioarea);
-
-err_no_iores:
- clk_disable(drv_data->clk);
- clk_put(drv_data->clk);
-
-err_no_clk:
- spi_master_put(master);
-
-err_no_pdata:
-err_no_mem:
- return status;
-}
-
-static int __exit spi_imx_remove(struct platform_device *pdev)
-{
- struct driver_data *drv_data = platform_get_drvdata(pdev);
- int irq;
- int status = 0;
-
- if (!drv_data)
- return 0;
-
- tasklet_kill(&drv_data->pump_transfers);
-
- /* Remove the queue */
- status = destroy_queue(drv_data);
- if (status != 0) {
- dev_err(&pdev->dev, "queue remove failed (%d)\n", status);
- return status;
- }
-
- /* Reset SPI */
- writel(SPI_RESET_START, drv_data->regs + SPI_RESET);
- writel(0, drv_data->regs + SPI_RESET);
-
- /* Release DMA */
- if (drv_data->master_info->enable_dma) {
- RSSR(drv_data->rx_channel) = 0;
- RSSR(drv_data->tx_channel) = 0;
- imx_dma_free(drv_data->tx_channel);
- imx_dma_free(drv_data->rx_channel);
- }
-
- /* Release IRQ */
- irq = platform_get_irq(pdev, 0);
- if (irq >= 0)
- free_irq(irq, drv_data);
-
- clk_disable(drv_data->clk);
- clk_put(drv_data->clk);
-
- /* Release map resources */
- iounmap(drv_data->regs);
- release_resource(drv_data->ioarea);
- kfree(drv_data->ioarea);
-
- /* Disconnect from the SPI framework */
- spi_unregister_master(drv_data->master);
- spi_master_put(drv_data->master);
-
- /* Prevent double remove */
- platform_set_drvdata(pdev, NULL);
-
- dev_dbg(&pdev->dev, "remove succeded\n");
-
- return 0;
-}
-
-static void spi_imx_shutdown(struct platform_device *pdev)
-{
- struct driver_data *drv_data = platform_get_drvdata(pdev);
-
- /* Reset SPI */
- writel(SPI_RESET_START, drv_data->regs + SPI_RESET);
- writel(0, drv_data->regs + SPI_RESET);
-
- dev_dbg(&pdev->dev, "shutdown succeded\n");
-}
-
-#ifdef CONFIG_PM
-
-static int spi_imx_suspend(struct platform_device *pdev, pm_message_t state)
-{
- struct driver_data *drv_data = platform_get_drvdata(pdev);
- int status = 0;
-
- status = stop_queue(drv_data);
- if (status != 0) {
- dev_warn(&pdev->dev, "suspend cannot stop queue\n");
- return status;
- }
-
- dev_dbg(&pdev->dev, "suspended\n");
-
- return 0;
-}
-
-static int spi_imx_resume(struct platform_device *pdev)
-{
- struct driver_data *drv_data = platform_get_drvdata(pdev);
- int status = 0;
-
- /* Start the queue running */
- status = start_queue(drv_data);
- if (status != 0)
- dev_err(&pdev->dev, "problem starting queue (%d)\n", status);
- else
- dev_dbg(&pdev->dev, "resumed\n");
-
- return status;
-}
-#else
-#define spi_imx_suspend NULL
-#define spi_imx_resume NULL
-#endif /* CONFIG_PM */
-
-/* work with hotplug and coldplug */
-MODULE_ALIAS("platform:spi_imx");
-
-static struct platform_driver driver = {
- .driver = {
- .name = "spi_imx",
- .owner = THIS_MODULE,
- },
- .remove = __exit_p(spi_imx_remove),
- .shutdown = spi_imx_shutdown,
- .suspend = spi_imx_suspend,
- .resume = spi_imx_resume,
-};
-
-static int __init spi_imx_init(void)
-{
- return platform_driver_probe(&driver, spi_imx_probe);
-}
-module_init(spi_imx_init);
-
-static void __exit spi_imx_exit(void)
-{
- platform_driver_unregister(&driver);
-}
-module_exit(spi_imx_exit);
-
-MODULE_AUTHOR("Andrea Paterniani, <a.paterniani@swapp-eng.it>");
-MODULE_DESCRIPTION("iMX SPI Controller Driver");
-MODULE_LICENSE("GPL");
diff --git a/drivers/spi/spi_ppc4xx.c b/drivers/spi/spi_ppc4xx.c
new file mode 100644
index 0000000..140a18d
--- /dev/null
+++ b/drivers/spi/spi_ppc4xx.c
@@ -0,0 +1,612 @@
+/*
+ * SPI_PPC4XX SPI controller driver.
+ *
+ * Copyright (C) 2007 Gary Jennejohn <garyj@denx.de>
+ * Copyright 2008 Stefan Roese <sr@denx.de>, DENX Software Engineering
+ * Copyright 2009 Harris Corporation, Steven A. Falco <sfalco@harris.com>
+ *
+ * Based in part on drivers/spi/spi_s3c24xx.c
+ *
+ * Copyright (c) 2006 Ben Dooks
+ * Copyright (c) 2006 Simtec Electronics
+ * Ben Dooks <ben@simtec.co.uk>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License version 2 as published
+ * by the Free Software Foundation.
+ */
+
+/*
+ * The PPC4xx SPI controller has no FIFO so each sent/received byte will
+ * generate an interrupt to the CPU. This can cause high CPU utilization.
+ * This driver allows platforms to reduce the interrupt load on the CPU
+ * during SPI transfers by setting max_speed_hz via the device tree.
+ */
+
+#include <linux/module.h>
+#include <linux/init.h>
+#include <linux/sched.h>
+#include <linux/errno.h>
+#include <linux/wait.h>
+#include <linux/of_platform.h>
+#include <linux/of_spi.h>
+#include <linux/of_gpio.h>
+#include <linux/interrupt.h>
+#include <linux/delay.h>
+
+#include <linux/gpio.h>
+#include <linux/spi/spi.h>
+#include <linux/spi/spi_bitbang.h>
+
+#include <asm/io.h>
+#include <asm/dcr.h>
+#include <asm/dcr-regs.h>
+
+/* bits in mode register - bit 0 is MSb */
+
+/*
+ * SPI_PPC4XX_MODE_SCP = 0 means "data latched on trailing edge of clock"
+ * SPI_PPC4XX_MODE_SCP = 1 means "data latched on leading edge of clock"
+ * Note: This is the inverse of CPHA.
+ */
+#define SPI_PPC4XX_MODE_SCP (0x80 >> 3)
+
+/* SPI_PPC4XX_MODE_SPE = 1 means "port enabled" */
+#define SPI_PPC4XX_MODE_SPE (0x80 >> 4)
+
+/*
+ * SPI_PPC4XX_MODE_RD = 0 means "MSB first" - this is the normal mode
+ * SPI_PPC4XX_MODE_RD = 1 means "LSB first" - this is bit-reversed mode
+ * Note: This is identical to SPI_LSB_FIRST.
+ */
+#define SPI_PPC4XX_MODE_RD (0x80 >> 5)
+
+/*
+ * SPI_PPC4XX_MODE_CI = 0 means "clock idles low"
+ * SPI_PPC4XX_MODE_CI = 1 means "clock idles high"
+ * Note: This is identical to CPOL.
+ */
+#define SPI_PPC4XX_MODE_CI (0x80 >> 6)
+
+/*
+ * SPI_PPC4XX_MODE_IL = 0 means "loopback disable"
+ * SPI_PPC4XX_MODE_IL = 1 means "loopback enable"
+ */
+#define SPI_PPC4XX_MODE_IL (0x80 >> 7)
+
+/* bits in control register */
+/* starts a transfer when set */
+#define SPI_PPC4XX_CR_STR (0x80 >> 7)
+
+/* bits in status register */
+/* port is busy with a transfer */
+#define SPI_PPC4XX_SR_BSY (0x80 >> 6)
+/* RxD ready */
+#define SPI_PPC4XX_SR_RBR (0x80 >> 7)
+
+/* clock settings (SCP and CI) for various SPI modes */
+#define SPI_CLK_MODE0 (SPI_PPC4XX_MODE_SCP | 0)
+#define SPI_CLK_MODE1 (0 | 0)
+#define SPI_CLK_MODE2 (SPI_PPC4XX_MODE_SCP | SPI_PPC4XX_MODE_CI)
+#define SPI_CLK_MODE3 (0 | SPI_PPC4XX_MODE_CI)
+
+#define DRIVER_NAME "spi_ppc4xx_of"
+
+struct spi_ppc4xx_regs {
+ u8 mode;
+ u8 rxd;
+ u8 txd;
+ u8 cr;
+ u8 sr;
+ u8 dummy;
+ /*
+ * Clock divisor modulus register
+ * This uses the follwing formula:
+ * SCPClkOut = OPBCLK/(4(CDM + 1))
+ * or
+ * CDM = (OPBCLK/4*SCPClkOut) - 1
+ * bit 0 is the MSb!
+ */
+ u8 cdm;
+};
+
+/* SPI Controller driver's private data. */
+struct ppc4xx_spi {
+ /* bitbang has to be first */
+ struct spi_bitbang bitbang;
+ struct completion done;
+
+ u64 mapbase;
+ u64 mapsize;
+ int irqnum;
+ /* need this to set the SPI clock */
+ unsigned int opb_freq;
+
+ /* for transfers */
+ int len;
+ int count;
+ /* data buffers */
+ const unsigned char *tx;
+ unsigned char *rx;
+
+ int *gpios;
+
+ struct spi_ppc4xx_regs __iomem *regs; /* pointer to the registers */
+ struct spi_master *master;
+ struct device *dev;
+};
+
+/* need this so we can set the clock in the chipselect routine */
+struct spi_ppc4xx_cs {
+ u8 mode;
+};
+
+static int spi_ppc4xx_txrx(struct spi_device *spi, struct spi_transfer *t)
+{
+ struct ppc4xx_spi *hw;
+ u8 data;
+
+ dev_dbg(&spi->dev, "txrx: tx %p, rx %p, len %d\n",
+ t->tx_buf, t->rx_buf, t->len);
+
+ hw = spi_master_get_devdata(spi->master);
+
+ hw->tx = t->tx_buf;
+ hw->rx = t->rx_buf;
+ hw->len = t->len;
+ hw->count = 0;
+
+ /* send the first byte */
+ data = hw->tx ? hw->tx[0] : 0;
+ out_8(&hw->regs->txd, data);
+ out_8(&hw->regs->cr, SPI_PPC4XX_CR_STR);
+ wait_for_completion(&hw->done);
+
+ return hw->count;
+}
+
+static int spi_ppc4xx_setupxfer(struct spi_device *spi, struct spi_transfer *t)
+{
+ struct ppc4xx_spi *hw = spi_master_get_devdata(spi->master);
+ struct spi_ppc4xx_cs *cs = spi->controller_state;
+ int scr;
+ u8 cdm = 0;
+ u32 speed;
+ u8 bits_per_word;
+
+ /* Start with the generic configuration for this device. */
+ bits_per_word = spi->bits_per_word;
+ speed = spi->max_speed_hz;
+
+ /*
+ * Modify the configuration if the transfer overrides it. Do not allow
+ * the transfer to overwrite the generic configuration with zeros.
+ */
+ if (t) {
+ if (t->bits_per_word)
+ bits_per_word = t->bits_per_word;
+
+ if (t->speed_hz)
+ speed = min(t->speed_hz, spi->max_speed_hz);
+ }
+
+ if (bits_per_word != 8) {
+ dev_err(&spi->dev, "invalid bits-per-word (%d)\n",
+ bits_per_word);
+ return -EINVAL;
+ }
+
+ if (!speed || (speed > spi->max_speed_hz)) {
+ dev_err(&spi->dev, "invalid speed_hz (%d)\n", speed);
+ return -EINVAL;
+ }
+
+ /* Write new configration */
+ out_8(&hw->regs->mode, cs->mode);
+
+ /* Set the clock */
+ /* opb_freq was already divided by 4 */
+ scr = (hw->opb_freq / speed) - 1;
+ if (scr > 0)
+ cdm = min(scr, 0xff);
+
+ dev_dbg(&spi->dev, "setting pre-scaler to %d (hz %d)\n", cdm, speed);
+
+ if (in_8(&hw->regs->cdm) != cdm)
+ out_8(&hw->regs->cdm, cdm);
+
+ spin_lock(&hw->bitbang.lock);
+ if (!hw->bitbang.busy) {
+ hw->bitbang.chipselect(spi, BITBANG_CS_INACTIVE);
+ /* Need to ndelay here? */
+ }
+ spin_unlock(&hw->bitbang.lock);
+
+ return 0;
+}
+
+static int spi_ppc4xx_setup(struct spi_device *spi)
+{
+ struct spi_ppc4xx_cs *cs = spi->controller_state;
+
+ if (spi->bits_per_word != 8) {
+ dev_err(&spi->dev, "invalid bits-per-word (%d)\n",
+ spi->bits_per_word);
+ return -EINVAL;
+ }
+
+ if (!spi->max_speed_hz) {
+ dev_err(&spi->dev, "invalid max_speed_hz (must be non-zero)\n");
+ return -EINVAL;
+ }
+
+ if (cs == NULL) {
+ cs = kzalloc(sizeof *cs, GFP_KERNEL);
+ if (!cs)
+ return -ENOMEM;
+ spi->controller_state = cs;
+ }
+
+ /*
+ * We set all bits of the SPI0_MODE register, so,
+ * no need to read-modify-write
+ */
+ cs->mode = SPI_PPC4XX_MODE_SPE;
+
+ switch (spi->mode & (SPI_CPHA | SPI_CPOL)) {
+ case SPI_MODE_0:
+ cs->mode |= SPI_CLK_MODE0;
+ break;
+ case SPI_MODE_1:
+ cs->mode |= SPI_CLK_MODE1;
+ break;
+ case SPI_MODE_2:
+ cs->mode |= SPI_CLK_MODE2;
+ break;
+ case SPI_MODE_3:
+ cs->mode |= SPI_CLK_MODE3;
+ break;
+ }
+
+ if (spi->mode & SPI_LSB_FIRST)
+ cs->mode |= SPI_PPC4XX_MODE_RD;
+
+ return 0;
+}
+
+static void spi_ppc4xx_chipsel(struct spi_device *spi, int value)
+{
+ struct ppc4xx_spi *hw = spi_master_get_devdata(spi->master);
+ unsigned int cs = spi->chip_select;
+ unsigned int cspol;
+
+ /*
+ * If there are no chip selects at all, or if this is the special
+ * case of a non-existent (dummy) chip select, do nothing.
+ */
+
+ if (!hw->master->num_chipselect || hw->gpios[cs] == -EEXIST)
+ return;
+
+ cspol = spi->mode & SPI_CS_HIGH ? 1 : 0;
+ if (value == BITBANG_CS_INACTIVE)
+ cspol = !cspol;
+
+ gpio_set_value(hw->gpios[cs], cspol);
+}
+
+static irqreturn_t spi_ppc4xx_int(int irq, void *dev_id)
+{
+ struct ppc4xx_spi *hw;
+ u8 status;
+ u8 data;
+ unsigned int count;
+
+ hw = (struct ppc4xx_spi *)dev_id;
+
+ status = in_8(&hw->regs->sr);
+ if (!status)
+ return IRQ_NONE;
+
+ /*
+ * BSY de-asserts one cycle after the transfer is complete. The
+ * interrupt is asserted after the transfer is complete. The exact
+ * relationship is not documented, hence this code.
+ */
+
+ if (unlikely(status & SPI_PPC4XX_SR_BSY)) {
+ u8 lstatus;
+ int cnt = 0;
+
+ dev_dbg(hw->dev, "got interrupt but spi still busy?\n");
+ do {
+ ndelay(10);
+ lstatus = in_8(&hw->regs->sr);
+ } while (++cnt < 100 && lstatus & SPI_PPC4XX_SR_BSY);
+
+ if (cnt >= 100) {
+ dev_err(hw->dev, "busywait: too many loops!\n");
+ complete(&hw->done);
+ return IRQ_HANDLED;
+ } else {
+ /* status is always 1 (RBR) here */
+ status = in_8(&hw->regs->sr);
+ dev_dbg(hw->dev, "loops %d status %x\n", cnt, status);
+ }
+ }
+
+ count = hw->count;
+ hw->count++;
+
+ /* RBR triggered this interrupt. Therefore, data must be ready. */
+ data = in_8(&hw->regs->rxd);
+ if (hw->rx)
+ hw->rx[count] = data;
+
+ count++;
+
+ if (count < hw->len) {
+ data = hw->tx ? hw->tx[count] : 0;
+ out_8(&hw->regs->txd, data);
+ out_8(&hw->regs->cr, SPI_PPC4XX_CR_STR);
+ } else {
+ complete(&hw->done);
+ }
+
+ return IRQ_HANDLED;
+}
+
+static void spi_ppc4xx_cleanup(struct spi_device *spi)
+{
+ kfree(spi->controller_state);
+}
+
+static void spi_ppc4xx_enable(struct ppc4xx_spi *hw)
+{
+ /*
+ * On all 4xx PPC's the SPI bus is shared/multiplexed with
+ * the 2nd I2C bus. We need to enable the the SPI bus before
+ * using it.
+ */
+
+ /* need to clear bit 14 to enable SPC */
+ dcri_clrset(SDR0, SDR0_PFC1, 0x80000000 >> 14, 0);
+}
+
+static void free_gpios(struct ppc4xx_spi *hw)
+{
+ if (hw->master->num_chipselect) {
+ int i;
+ for (i = 0; i < hw->master->num_chipselect; i++)
+ if (gpio_is_valid(hw->gpios[i]))
+ gpio_free(hw->gpios[i]);
+
+ kfree(hw->gpios);
+ hw->gpios = NULL;
+ }
+}
+
+/*
+ * of_device layer stuff...
+ */
+static int __init spi_ppc4xx_of_probe(struct of_device *op,
+ const struct of_device_id *match)
+{
+ struct ppc4xx_spi *hw;
+ struct spi_master *master;
+ struct spi_bitbang *bbp;
+ struct resource resource;
+ struct device_node *np = op->node;
+ struct device *dev = &op->dev;
+ struct device_node *opbnp;
+ int ret;
+ int num_gpios;
+ const unsigned int *clk;
+
+ master = spi_alloc_master(dev, sizeof *hw);
+ if (master == NULL)
+ return -ENOMEM;
+ dev_set_drvdata(dev, master);
+ hw = spi_master_get_devdata(master);
+ hw->master = spi_master_get(master);
+ hw->dev = dev;
+
+ init_completion(&hw->done);
+
+ /*
+ * A count of zero implies a single SPI device without any chip-select.
+ * Note that of_gpio_count counts all gpios assigned to this spi master.
+ * This includes both "null" gpio's and real ones.
+ */
+ num_gpios = of_gpio_count(np);
+ if (num_gpios) {
+ int i;
+
+ hw->gpios = kzalloc(sizeof(int) * num_gpios, GFP_KERNEL);
+ if (!hw->gpios) {
+ ret = -ENOMEM;
+ goto free_master;
+ }
+
+ for (i = 0; i < num_gpios; i++) {
+ int gpio;
+ enum of_gpio_flags flags;
+
+ gpio = of_get_gpio_flags(np, i, &flags);
+ hw->gpios[i] = gpio;
+
+ if (gpio_is_valid(gpio)) {
+ /* Real CS - set the initial state. */
+ ret = gpio_request(gpio, np->name);
+ if (ret < 0) {
+ dev_err(dev, "can't request gpio "
+ "#%d: %d\n", i, ret);
+ goto free_gpios;
+ }
+
+ gpio_direction_output(gpio,
+ !!(flags & OF_GPIO_ACTIVE_LOW));
+ } else if (gpio == -EEXIST) {
+ ; /* No CS, but that's OK. */
+ } else {
+ dev_err(dev, "invalid gpio #%d: %d\n", i, gpio);
+ ret = -EINVAL;
+ goto free_gpios;
+ }
+ }
+ }
+
+ /* Setup the state for the bitbang driver */
+ bbp = &hw->bitbang;
+ bbp->master = hw->master;
+ bbp->setup_transfer = spi_ppc4xx_setupxfer;
+ bbp->chipselect = spi_ppc4xx_chipsel;
+ bbp->txrx_bufs = spi_ppc4xx_txrx;
+ bbp->use_dma = 0;
+ bbp->master->setup = spi_ppc4xx_setup;
+ bbp->master->cleanup = spi_ppc4xx_cleanup;
+
+ /* Allocate bus num dynamically. */
+ bbp->master->bus_num = -1;
+
+ /* the spi->mode bits understood by this driver: */
+ bbp->master->mode_bits =
+ SPI_CPHA | SPI_CPOL | SPI_CS_HIGH | SPI_LSB_FIRST;
+
+ /* this many pins in all GPIO controllers */
+ bbp->master->num_chipselect = num_gpios;
+
+ /* Get the clock for the OPB */
+ opbnp = of_find_compatible_node(NULL, NULL, "ibm,opb");
+ if (opbnp == NULL) {
+ dev_err(dev, "OPB: cannot find node\n");
+ ret = -ENODEV;
+ goto free_gpios;
+ }
+ /* Get the clock (Hz) for the OPB */
+ clk = of_get_property(opbnp, "clock-frequency", NULL);
+ if (clk == NULL) {
+ dev_err(dev, "OPB: no clock-frequency property set\n");
+ of_node_put(opbnp);
+ ret = -ENODEV;
+ goto free_gpios;
+ }
+ hw->opb_freq = *clk;
+ hw->opb_freq >>= 2;
+ of_node_put(opbnp);
+
+ ret = of_address_to_resource(np, 0, &resource);
+ if (ret) {
+ dev_err(dev, "error while parsing device node resource\n");
+ goto free_gpios;
+ }
+ hw->mapbase = resource.start;
+ hw->mapsize = resource.end - resource.start + 1;
+
+ /* Sanity check */
+ if (hw->mapsize < sizeof(struct spi_ppc4xx_regs)) {
+ dev_err(dev, "too small to map registers\n");
+ ret = -EINVAL;
+ goto free_gpios;
+ }
+
+ /* Request IRQ */
+ hw->irqnum = irq_of_parse_and_map(np, 0);
+ ret = request_irq(hw->irqnum, spi_ppc4xx_int,
+ IRQF_DISABLED, "spi_ppc4xx_of", (void *)hw);
+ if (ret) {
+ dev_err(dev, "unable to allocate interrupt\n");
+ goto free_gpios;
+ }
+
+ if (!request_mem_region(hw->mapbase, hw->mapsize, DRIVER_NAME)) {
+ dev_err(dev, "resource unavailable\n");
+ ret = -EBUSY;
+ goto request_mem_error;
+ }
+
+ hw->regs = ioremap(hw->mapbase, sizeof(struct spi_ppc4xx_regs));
+
+ if (!hw->regs) {
+ dev_err(dev, "unable to memory map registers\n");
+ ret = -ENXIO;
+ goto map_io_error;
+ }
+
+ spi_ppc4xx_enable(hw);
+
+ /* Finally register our spi controller */
+ dev->dma_mask = 0;
+ ret = spi_bitbang_start(bbp);
+ if (ret) {
+ dev_err(dev, "failed to register SPI master\n");
+ goto unmap_regs;
+ }
+
+ dev_info(dev, "driver initialized\n");
+ of_register_spi_devices(master, np);
+
+ return 0;
+
+unmap_regs:
+ iounmap(hw->regs);
+map_io_error:
+ release_mem_region(hw->mapbase, hw->mapsize);
+request_mem_error:
+ free_irq(hw->irqnum, hw);
+free_gpios:
+ free_gpios(hw);
+free_master:
+ dev_set_drvdata(dev, NULL);
+ spi_master_put(master);
+
+ dev_err(dev, "initialization failed\n");
+ return ret;
+}
+
+static int __exit spi_ppc4xx_of_remove(struct of_device *op)
+{
+ struct spi_master *master = dev_get_drvdata(&op->dev);
+ struct ppc4xx_spi *hw = spi_master_get_devdata(master);
+
+ spi_bitbang_stop(&hw->bitbang);
+ dev_set_drvdata(&op->dev, NULL);
+ release_mem_region(hw->mapbase, hw->mapsize);
+ free_irq(hw->irqnum, hw);
+ iounmap(hw->regs);
+ free_gpios(hw);
+ return 0;
+}
+
+static struct of_device_id spi_ppc4xx_of_match[] = {
+ { .compatible = "ibm,ppc4xx-spi", },
+ {},
+};
+
+MODULE_DEVICE_TABLE(of, spi_ppc4xx_of_match);
+
+static struct of_platform_driver spi_ppc4xx_of_driver = {
+ .match_table = spi_ppc4xx_of_match,
+ .probe = spi_ppc4xx_of_probe,
+ .remove = __exit_p(spi_ppc4xx_of_remove),
+ .driver = {
+ .name = DRIVER_NAME,
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init spi_ppc4xx_init(void)
+{
+ return of_register_platform_driver(&spi_ppc4xx_of_driver);
+}
+module_init(spi_ppc4xx_init);
+
+static void __exit spi_ppc4xx_exit(void)
+{
+ of_unregister_platform_driver(&spi_ppc4xx_of_driver);
+}
+module_exit(spi_ppc4xx_exit);
+
+MODULE_AUTHOR("Gary Jennejohn & Stefan Roese");
+MODULE_DESCRIPTION("Simple PPC4xx SPI Driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/spi/spi_s3c24xx.c b/drivers/spi/spi_s3c24xx.c
index 6ba8aec..33d94f7 100644
--- a/drivers/spi/spi_s3c24xx.c
+++ b/drivers/spi/spi_s3c24xx.c
@@ -20,17 +20,28 @@
#include <linux/clk.h>
#include <linux/platform_device.h>
#include <linux/gpio.h>
+#include <linux/io.h>
#include <linux/spi/spi.h>
#include <linux/spi/spi_bitbang.h>
-#include <asm/io.h>
-#include <asm/dma.h>
-#include <mach/hardware.h>
-
#include <plat/regs-spi.h>
#include <mach/spi.h>
+/**
+ * s3c24xx_spi_devstate - per device data
+ * @hz: Last frequency calculated for @sppre field.
+ * @mode: Last mode setting for the @spcon field.
+ * @spcon: Value to write to the SPCON register.
+ * @sppre: Value to write to the SPPRE register.
+ */
+struct s3c24xx_spi_devstate {
+ unsigned int hz;
+ unsigned int mode;
+ u8 spcon;
+ u8 sppre;
+};
+
struct s3c24xx_spi {
/* bitbang has to be first */
struct spi_bitbang bitbang;
@@ -71,43 +82,31 @@
static void s3c24xx_spi_chipsel(struct spi_device *spi, int value)
{
+ struct s3c24xx_spi_devstate *cs = spi->controller_state;
struct s3c24xx_spi *hw = to_hw(spi);
unsigned int cspol = spi->mode & SPI_CS_HIGH ? 1 : 0;
- unsigned int spcon;
+
+ /* change the chipselect state and the state of the spi engine clock */
switch (value) {
case BITBANG_CS_INACTIVE:
hw->set_cs(hw->pdata, spi->chip_select, cspol^1);
+ writeb(cs->spcon, hw->regs + S3C2410_SPCON);
break;
case BITBANG_CS_ACTIVE:
- spcon = readb(hw->regs + S3C2410_SPCON);
-
- if (spi->mode & SPI_CPHA)
- spcon |= S3C2410_SPCON_CPHA_FMTB;
- else
- spcon &= ~S3C2410_SPCON_CPHA_FMTB;
-
- if (spi->mode & SPI_CPOL)
- spcon |= S3C2410_SPCON_CPOL_HIGH;
- else
- spcon &= ~S3C2410_SPCON_CPOL_HIGH;
-
- spcon |= S3C2410_SPCON_ENSCK;
-
- /* write new configration */
-
- writeb(spcon, hw->regs + S3C2410_SPCON);
+ writeb(cs->spcon | S3C2410_SPCON_ENSCK,
+ hw->regs + S3C2410_SPCON);
hw->set_cs(hw->pdata, spi->chip_select, cspol);
-
break;
}
}
-static int s3c24xx_spi_setupxfer(struct spi_device *spi,
- struct spi_transfer *t)
+static int s3c24xx_spi_update_state(struct spi_device *spi,
+ struct spi_transfer *t)
{
struct s3c24xx_spi *hw = to_hw(spi);
+ struct s3c24xx_spi_devstate *cs = spi->controller_state;
unsigned int bpw;
unsigned int hz;
unsigned int div;
@@ -127,17 +126,73 @@
return -EINVAL;
}
- clk = clk_get_rate(hw->clk);
- div = DIV_ROUND_UP(clk, hz * 2) - 1;
+ if (spi->mode != cs->mode) {
+ u8 spcon = SPCON_DEFAULT;
- if (div > 255)
- div = 255;
+ if (spi->mode & SPI_CPHA)
+ spcon |= S3C2410_SPCON_CPHA_FMTB;
- dev_dbg(&spi->dev, "setting pre-scaler to %d (wanted %d, got %ld)\n",
- div, hz, clk / (2 * (div + 1)));
+ if (spi->mode & SPI_CPOL)
+ spcon |= S3C2410_SPCON_CPOL_HIGH;
+ cs->mode = spi->mode;
+ cs->spcon = spcon;
+ }
- writeb(div, hw->regs + S3C2410_SPPRE);
+ if (cs->hz != hz) {
+ clk = clk_get_rate(hw->clk);
+ div = DIV_ROUND_UP(clk, hz * 2) - 1;
+
+ if (div > 255)
+ div = 255;
+
+ dev_dbg(&spi->dev, "pre-scaler=%d (wanted %d, got %ld)\n",
+ div, hz, clk / (2 * (div + 1)));
+
+ cs->hz = hz;
+ cs->sppre = div;
+ }
+
+ return 0;
+}
+
+static int s3c24xx_spi_setupxfer(struct spi_device *spi,
+ struct spi_transfer *t)
+{
+ struct s3c24xx_spi_devstate *cs = spi->controller_state;
+ struct s3c24xx_spi *hw = to_hw(spi);
+ int ret;
+
+ ret = s3c24xx_spi_update_state(spi, t);
+ if (!ret)
+ writeb(cs->sppre, hw->regs + S3C2410_SPPRE);
+
+ return ret;
+}
+
+static int s3c24xx_spi_setup(struct spi_device *spi)
+{
+ struct s3c24xx_spi_devstate *cs = spi->controller_state;
+ struct s3c24xx_spi *hw = to_hw(spi);
+ int ret;
+
+ /* allocate settings on the first call */
+ if (!cs) {
+ cs = kzalloc(sizeof(struct s3c24xx_spi_devstate), GFP_KERNEL);
+ if (!cs) {
+ dev_err(&spi->dev, "no memory for controller state\n");
+ return -ENOMEM;
+ }
+
+ cs->spcon = SPCON_DEFAULT;
+ cs->hz = -1;
+ spi->controller_state = cs;
+ }
+
+ /* initialise the state from the device */
+ ret = s3c24xx_spi_update_state(spi, NULL);
+ if (ret)
+ return ret;
spin_lock(&hw->bitbang.lock);
if (!hw->bitbang.busy) {
@@ -149,17 +204,9 @@
return 0;
}
-static int s3c24xx_spi_setup(struct spi_device *spi)
+static void s3c24xx_spi_cleanup(struct spi_device *spi)
{
- int ret;
-
- ret = s3c24xx_spi_setupxfer(spi, NULL);
- if (ret < 0) {
- dev_err(&spi->dev, "setupxfer returned %d\n", ret);
- return ret;
- }
-
- return 0;
+ kfree(spi->controller_state);
}
static inline unsigned int hw_txbyte(struct s3c24xx_spi *hw, int count)
@@ -289,7 +336,9 @@
hw->bitbang.setup_transfer = s3c24xx_spi_setupxfer;
hw->bitbang.chipselect = s3c24xx_spi_chipsel;
hw->bitbang.txrx_bufs = s3c24xx_spi_txrx;
- hw->bitbang.master->setup = s3c24xx_spi_setup;
+
+ hw->master->setup = s3c24xx_spi_setup;
+ hw->master->cleanup = s3c24xx_spi_cleanup;
dev_dbg(hw->dev, "bitbang at %p\n", &hw->bitbang);
@@ -302,7 +351,7 @@
goto err_no_iores;
}
- hw->ioarea = request_mem_region(res->start, (res->end - res->start)+1,
+ hw->ioarea = request_mem_region(res->start, resource_size(res),
pdev->name);
if (hw->ioarea == NULL) {
@@ -311,7 +360,7 @@
goto err_no_iores;
}
- hw->regs = ioremap(res->start, (res->end - res->start)+1);
+ hw->regs = ioremap(res->start, resource_size(res));
if (hw->regs == NULL) {
dev_err(&pdev->dev, "Cannot map IO\n");
err = -ENXIO;
@@ -421,9 +470,9 @@
#ifdef CONFIG_PM
-static int s3c24xx_spi_suspend(struct platform_device *pdev, pm_message_t msg)
+static int s3c24xx_spi_suspend(struct device *dev)
{
- struct s3c24xx_spi *hw = platform_get_drvdata(pdev);
+ struct s3c24xx_spi *hw = platform_get_drvdata(to_platform_device(dev));
if (hw->pdata && hw->pdata->gpio_setup)
hw->pdata->gpio_setup(hw->pdata, 0);
@@ -432,27 +481,31 @@
return 0;
}
-static int s3c24xx_spi_resume(struct platform_device *pdev)
+static int s3c24xx_spi_resume(struct device *dev)
{
- struct s3c24xx_spi *hw = platform_get_drvdata(pdev);
+ struct s3c24xx_spi *hw = platform_get_drvdata(to_platform_device(dev));
s3c24xx_spi_initialsetup(hw);
return 0;
}
+static struct dev_pm_ops s3c24xx_spi_pmops = {
+ .suspend = s3c24xx_spi_suspend,
+ .resume = s3c24xx_spi_resume,
+};
+
+#define S3C24XX_SPI_PMOPS &s3c24xx_spi_pmops
#else
-#define s3c24xx_spi_suspend NULL
-#define s3c24xx_spi_resume NULL
-#endif
+#define S3C24XX_SPI_PMOPS NULL
+#endif /* CONFIG_PM */
MODULE_ALIAS("platform:s3c2410-spi");
static struct platform_driver s3c24xx_spi_driver = {
.remove = __exit_p(s3c24xx_spi_remove),
- .suspend = s3c24xx_spi_suspend,
- .resume = s3c24xx_spi_resume,
.driver = {
.name = "s3c2410-spi",
.owner = THIS_MODULE,
+ .pm = S3C24XX_SPI_PMOPS,
},
};
diff --git a/drivers/spi/spi_stmp.c b/drivers/spi/spi_stmp.c
new file mode 100644
index 0000000..d871dc2
--- /dev/null
+++ b/drivers/spi/spi_stmp.c
@@ -0,0 +1,679 @@
+/*
+ * Freescale STMP378X SPI master driver
+ *
+ * Author: dmitry pervushin <dimka@embeddedalley.com>
+ *
+ * Copyright 2008 Freescale Semiconductor, Inc. All Rights Reserved.
+ * Copyright 2008 Embedded Alley Solutions, Inc All Rights Reserved.
+ */
+
+/*
+ * The code contained herein is licensed under the GNU General Public
+ * License. You may obtain a copy of the GNU General Public License
+ * Version 2 or later at the following locations:
+ *
+ * http://www.opensource.org/licenses/gpl-license.html
+ * http://www.gnu.org/copyleft/gpl.html
+ */
+#include <linux/module.h>
+#include <linux/init.h>
+#include <linux/interrupt.h>
+#include <linux/platform_device.h>
+#include <linux/spi/spi.h>
+#include <linux/err.h>
+#include <linux/clk.h>
+#include <linux/io.h>
+#include <linux/dma-mapping.h>
+#include <linux/delay.h>
+
+#include <mach/platform.h>
+#include <mach/stmp3xxx.h>
+#include <mach/dma.h>
+#include <mach/regs-ssp.h>
+#include <mach/regs-apbh.h>
+
+
+/* 0 means DMA mode(recommended, default), !0 - PIO mode */
+static int pio;
+static int clock;
+
+/* default timeout for busy waits is 2 seconds */
+#define STMP_SPI_TIMEOUT (2 * HZ)
+
+struct stmp_spi {
+ int id;
+
+ void * __iomem regs; /* vaddr of the control registers */
+
+ int irq, err_irq;
+ u32 dma;
+ struct stmp3xxx_dma_descriptor d;
+
+ u32 speed_khz;
+ u32 saved_timings;
+ u32 divider;
+
+ struct clk *clk;
+ struct device *master_dev;
+
+ struct work_struct work;
+ struct workqueue_struct *workqueue;
+
+ /* lock protects queue access */
+ spinlock_t lock;
+ struct list_head queue;
+
+ struct completion done;
+};
+
+#define busy_wait(cond) \
+ ({ \
+ unsigned long end_jiffies = jiffies + STMP_SPI_TIMEOUT; \
+ bool succeeded = false; \
+ do { \
+ if (cond) { \
+ succeeded = true; \
+ break; \
+ } \
+ cpu_relax(); \
+ } while (time_before(end_jiffies, jiffies)); \
+ succeeded; \
+ })
+
+/**
+ * stmp_spi_init_hw
+ * Initialize the SSP port
+ */
+static int stmp_spi_init_hw(struct stmp_spi *ss)
+{
+ int err = 0;
+ void *pins = ss->master_dev->platform_data;
+
+ err = stmp3xxx_request_pin_group(pins, dev_name(ss->master_dev));
+ if (err)
+ goto out;
+
+ ss->clk = clk_get(NULL, "ssp");
+ if (IS_ERR(ss->clk)) {
+ err = PTR_ERR(ss->clk);
+ goto out_free_pins;
+ }
+ clk_enable(ss->clk);
+
+ stmp3xxx_reset_block(ss->regs, false);
+ stmp3xxx_dma_reset_channel(ss->dma);
+
+ return 0;
+
+out_free_pins:
+ stmp3xxx_release_pin_group(pins, dev_name(ss->master_dev));
+out:
+ return err;
+}
+
+static void stmp_spi_release_hw(struct stmp_spi *ss)
+{
+ void *pins = ss->master_dev->platform_data;
+
+ if (ss->clk && !IS_ERR(ss->clk)) {
+ clk_disable(ss->clk);
+ clk_put(ss->clk);
+ }
+ stmp3xxx_release_pin_group(pins, dev_name(ss->master_dev));
+}
+
+static int stmp_spi_setup_transfer(struct spi_device *spi,
+ struct spi_transfer *t)
+{
+ u8 bits_per_word;
+ u32 hz;
+ struct stmp_spi *ss = spi_master_get_devdata(spi->master);
+ u16 rate;
+
+ bits_per_word = spi->bits_per_word;
+ if (t && t->bits_per_word)
+ bits_per_word = t->bits_per_word;
+
+ /*
+ * Calculate speed:
+ * - by default, use maximum speed from ssp clk
+ * - if device overrides it, use it
+ * - if transfer specifies other speed, use transfer's one
+ */
+ hz = 1000 * ss->speed_khz / ss->divider;
+ if (spi->max_speed_hz)
+ hz = min(hz, spi->max_speed_hz);
+ if (t && t->speed_hz)
+ hz = min(hz, t->speed_hz);
+
+ if (hz == 0) {
+ dev_err(&spi->dev, "Cannot continue with zero clock\n");
+ return -EINVAL;
+ }
+
+ if (bits_per_word != 8) {
+ dev_err(&spi->dev, "%s, unsupported bits_per_word=%d\n",
+ __func__, bits_per_word);
+ return -EINVAL;
+ }
+
+ dev_dbg(&spi->dev, "Requested clk rate = %uHz, max = %uHz/%d = %uHz\n",
+ hz, ss->speed_khz, ss->divider,
+ ss->speed_khz * 1000 / ss->divider);
+
+ if (ss->speed_khz * 1000 / ss->divider < hz) {
+ dev_err(&spi->dev, "%s, unsupported clock rate %uHz\n",
+ __func__, hz);
+ return -EINVAL;
+ }
+
+ rate = 1000 * ss->speed_khz/ss->divider/hz;
+
+ writel(BF(ss->divider, SSP_TIMING_CLOCK_DIVIDE) |
+ BF(rate - 1, SSP_TIMING_CLOCK_RATE),
+ HW_SSP_TIMING + ss->regs);
+
+ writel(BF(1 /* mode SPI */, SSP_CTRL1_SSP_MODE) |
+ BF(4 /* 8 bits */, SSP_CTRL1_WORD_LENGTH) |
+ ((spi->mode & SPI_CPOL) ? BM_SSP_CTRL1_POLARITY : 0) |
+ ((spi->mode & SPI_CPHA) ? BM_SSP_CTRL1_PHASE : 0) |
+ (pio ? 0 : BM_SSP_CTRL1_DMA_ENABLE),
+ ss->regs + HW_SSP_CTRL1);
+
+ return 0;
+}
+
+static int stmp_spi_setup(struct spi_device *spi)
+{
+ /* spi_setup() does basic checks,
+ * stmp_spi_setup_transfer() does more later
+ */
+ if (spi->bits_per_word != 8) {
+ dev_err(&spi->dev, "%s, unsupported bits_per_word=%d\n",
+ __func__, spi->bits_per_word);
+ return -EINVAL;
+ }
+ return 0;
+}
+
+static inline u32 stmp_spi_cs(unsigned cs)
+{
+ return ((cs & 1) ? BM_SSP_CTRL0_WAIT_FOR_CMD : 0) |
+ ((cs & 2) ? BM_SSP_CTRL0_WAIT_FOR_IRQ : 0);
+}
+
+static int stmp_spi_txrx_dma(struct stmp_spi *ss, int cs,
+ unsigned char *buf, dma_addr_t dma_buf, int len,
+ int first, int last, bool write)
+{
+ u32 c0 = 0;
+ dma_addr_t spi_buf_dma = dma_buf;
+ int status = 0;
+ enum dma_data_direction dir = write ? DMA_TO_DEVICE : DMA_FROM_DEVICE;
+
+ c0 |= (first ? BM_SSP_CTRL0_LOCK_CS : 0);
+ c0 |= (last ? BM_SSP_CTRL0_IGNORE_CRC : 0);
+ c0 |= (write ? 0 : BM_SSP_CTRL0_READ);
+ c0 |= BM_SSP_CTRL0_DATA_XFER;
+
+ c0 |= stmp_spi_cs(cs);
+
+ c0 |= BF(len, SSP_CTRL0_XFER_COUNT);
+
+ if (!dma_buf)
+ spi_buf_dma = dma_map_single(ss->master_dev, buf, len, dir);
+
+ ss->d.command->cmd =
+ BF(len, APBH_CHn_CMD_XFER_COUNT) |
+ BF(1, APBH_CHn_CMD_CMDWORDS) |
+ BM_APBH_CHn_CMD_WAIT4ENDCMD |
+ BM_APBH_CHn_CMD_IRQONCMPLT |
+ BF(write ? BV_APBH_CHn_CMD_COMMAND__DMA_READ :
+ BV_APBH_CHn_CMD_COMMAND__DMA_WRITE,
+ APBH_CHn_CMD_COMMAND);
+ ss->d.command->pio_words[0] = c0;
+ ss->d.command->buf_ptr = spi_buf_dma;
+
+ stmp3xxx_dma_reset_channel(ss->dma);
+ stmp3xxx_dma_clear_interrupt(ss->dma);
+ stmp3xxx_dma_enable_interrupt(ss->dma);
+ init_completion(&ss->done);
+ stmp3xxx_dma_go(ss->dma, &ss->d, 1);
+ wait_for_completion(&ss->done);
+
+ if (!busy_wait(readl(ss->regs + HW_SSP_CTRL0) & BM_SSP_CTRL0_RUN))
+ status = ETIMEDOUT;
+
+ if (!dma_buf)
+ dma_unmap_single(ss->master_dev, spi_buf_dma, len, dir);
+
+ return status;
+}
+
+static inline void stmp_spi_enable(struct stmp_spi *ss)
+{
+ stmp3xxx_setl(BM_SSP_CTRL0_LOCK_CS, ss->regs + HW_SSP_CTRL0);
+ stmp3xxx_clearl(BM_SSP_CTRL0_IGNORE_CRC, ss->regs + HW_SSP_CTRL0);
+}
+
+static inline void stmp_spi_disable(struct stmp_spi *ss)
+{
+ stmp3xxx_clearl(BM_SSP_CTRL0_LOCK_CS, ss->regs + HW_SSP_CTRL0);
+ stmp3xxx_setl(BM_SSP_CTRL0_IGNORE_CRC, ss->regs + HW_SSP_CTRL0);
+}
+
+static int stmp_spi_txrx_pio(struct stmp_spi *ss, int cs,
+ unsigned char *buf, int len,
+ bool first, bool last, bool write)
+{
+ if (first)
+ stmp_spi_enable(ss);
+
+ stmp3xxx_setl(stmp_spi_cs(cs), ss->regs + HW_SSP_CTRL0);
+
+ while (len--) {
+ if (last && len <= 0)
+ stmp_spi_disable(ss);
+
+ stmp3xxx_clearl(BM_SSP_CTRL0_XFER_COUNT,
+ ss->regs + HW_SSP_CTRL0);
+ stmp3xxx_setl(1, ss->regs + HW_SSP_CTRL0);
+
+ if (write)
+ stmp3xxx_clearl(BM_SSP_CTRL0_READ,
+ ss->regs + HW_SSP_CTRL0);
+ else
+ stmp3xxx_setl(BM_SSP_CTRL0_READ,
+ ss->regs + HW_SSP_CTRL0);
+
+ /* Run! */
+ stmp3xxx_setl(BM_SSP_CTRL0_RUN, ss->regs + HW_SSP_CTRL0);
+
+ if (!busy_wait(readl(ss->regs + HW_SSP_CTRL0) &
+ BM_SSP_CTRL0_RUN))
+ break;
+
+ if (write)
+ writel(*buf, ss->regs + HW_SSP_DATA);
+
+ /* Set TRANSFER */
+ stmp3xxx_setl(BM_SSP_CTRL0_DATA_XFER, ss->regs + HW_SSP_CTRL0);
+
+ if (!write) {
+ if (busy_wait((readl(ss->regs + HW_SSP_STATUS) &
+ BM_SSP_STATUS_FIFO_EMPTY)))
+ break;
+ *buf = readl(ss->regs + HW_SSP_DATA) & 0xFF;
+ }
+
+ if (!busy_wait(readl(ss->regs + HW_SSP_CTRL0) &
+ BM_SSP_CTRL0_RUN))
+ break;
+
+ /* advance to the next byte */
+ buf++;
+ }
+
+ return len < 0 ? 0 : -ETIMEDOUT;
+}
+
+static int stmp_spi_handle_message(struct stmp_spi *ss, struct spi_message *m)
+{
+ bool first, last;
+ struct spi_transfer *t, *tmp_t;
+ int status = 0;
+ int cs;
+
+ cs = m->spi->chip_select;
+
+ list_for_each_entry_safe(t, tmp_t, &m->transfers, transfer_list) {
+
+ first = (&t->transfer_list == m->transfers.next);
+ last = (&t->transfer_list == m->transfers.prev);
+
+ if (first || t->speed_hz || t->bits_per_word)
+ stmp_spi_setup_transfer(m->spi, t);
+
+ /* reject "not last" transfers which request to change cs */
+ if (t->cs_change && !last) {
+ dev_err(&m->spi->dev,
+ "Message with t->cs_change has been skipped\n");
+ continue;
+ }
+
+ if (t->tx_buf) {
+ status = pio ?
+ stmp_spi_txrx_pio(ss, cs, (void *)t->tx_buf,
+ t->len, first, last, true) :
+ stmp_spi_txrx_dma(ss, cs, (void *)t->tx_buf,
+ t->tx_dma, t->len, first, last, true);
+#ifdef DEBUG
+ if (t->len < 0x10)
+ print_hex_dump_bytes("Tx ",
+ DUMP_PREFIX_OFFSET,
+ t->tx_buf, t->len);
+ else
+ pr_debug("Tx: %d bytes\n", t->len);
+#endif
+ }
+ if (t->rx_buf) {
+ status = pio ?
+ stmp_spi_txrx_pio(ss, cs, t->rx_buf,
+ t->len, first, last, false) :
+ stmp_spi_txrx_dma(ss, cs, t->rx_buf,
+ t->rx_dma, t->len, first, last, false);
+#ifdef DEBUG
+ if (t->len < 0x10)
+ print_hex_dump_bytes("Rx ",
+ DUMP_PREFIX_OFFSET,
+ t->rx_buf, t->len);
+ else
+ pr_debug("Rx: %d bytes\n", t->len);
+#endif
+ }
+
+ if (t->delay_usecs)
+ udelay(t->delay_usecs);
+
+ if (status)
+ break;
+
+ }
+ return status;
+}
+
+/**
+ * stmp_spi_handle - handle messages from the queue
+ */
+static void stmp_spi_handle(struct work_struct *w)
+{
+ struct stmp_spi *ss = container_of(w, struct stmp_spi, work);
+ unsigned long flags;
+ struct spi_message *m;
+
+ spin_lock_irqsave(&ss->lock, flags);
+ while (!list_empty(&ss->queue)) {
+ m = list_entry(ss->queue.next, struct spi_message, queue);
+ list_del_init(&m->queue);
+ spin_unlock_irqrestore(&ss->lock, flags);
+
+ m->status = stmp_spi_handle_message(ss, m);
+ m->complete(m->context);
+
+ spin_lock_irqsave(&ss->lock, flags);
+ }
+ spin_unlock_irqrestore(&ss->lock, flags);
+
+ return;
+}
+
+/**
+ * stmp_spi_transfer - perform message transfer.
+ * Called indirectly from spi_async, queues all the messages to
+ * spi_handle_message.
+ * @spi: spi device
+ * @m: message to be queued
+ */
+static int stmp_spi_transfer(struct spi_device *spi, struct spi_message *m)
+{
+ struct stmp_spi *ss = spi_master_get_devdata(spi->master);
+ unsigned long flags;
+
+ m->status = -EINPROGRESS;
+ spin_lock_irqsave(&ss->lock, flags);
+ list_add_tail(&m->queue, &ss->queue);
+ queue_work(ss->workqueue, &ss->work);
+ spin_unlock_irqrestore(&ss->lock, flags);
+ return 0;
+}
+
+static irqreturn_t stmp_spi_irq(int irq, void *dev_id)
+{
+ struct stmp_spi *ss = dev_id;
+
+ stmp3xxx_dma_clear_interrupt(ss->dma);
+ complete(&ss->done);
+ return IRQ_HANDLED;
+}
+
+static irqreturn_t stmp_spi_irq_err(int irq, void *dev_id)
+{
+ struct stmp_spi *ss = dev_id;
+ u32 c1, st;
+
+ c1 = readl(ss->regs + HW_SSP_CTRL1);
+ st = readl(ss->regs + HW_SSP_STATUS);
+ dev_err(ss->master_dev, "%s: status = 0x%08X, c1 = 0x%08X\n",
+ __func__, st, c1);
+ stmp3xxx_clearl(c1 & 0xCCCC0000, ss->regs + HW_SSP_CTRL1);
+
+ return IRQ_HANDLED;
+}
+
+static int __devinit stmp_spi_probe(struct platform_device *dev)
+{
+ int err = 0;
+ struct spi_master *master;
+ struct stmp_spi *ss;
+ struct resource *r;
+
+ master = spi_alloc_master(&dev->dev, sizeof(struct stmp_spi));
+ if (master == NULL) {
+ err = -ENOMEM;
+ goto out0;
+ }
+ master->flags = SPI_MASTER_HALF_DUPLEX;
+
+ ss = spi_master_get_devdata(master);
+ platform_set_drvdata(dev, master);
+
+ /* Get resources(memory, IRQ) associated with the device */
+ r = platform_get_resource(dev, IORESOURCE_MEM, 0);
+ if (r == NULL) {
+ err = -ENODEV;
+ goto out_put_master;
+ }
+ ss->regs = ioremap(r->start, resource_size(r));
+ if (!ss->regs) {
+ err = -EINVAL;
+ goto out_put_master;
+ }
+
+ ss->master_dev = &dev->dev;
+ ss->id = dev->id;
+
+ INIT_WORK(&ss->work, stmp_spi_handle);
+ INIT_LIST_HEAD(&ss->queue);
+ spin_lock_init(&ss->lock);
+
+ ss->workqueue = create_singlethread_workqueue(dev_name(&dev->dev));
+ if (!ss->workqueue) {
+ err = -ENXIO;
+ goto out_put_master;
+ }
+ master->transfer = stmp_spi_transfer;
+ master->setup = stmp_spi_setup;
+
+ /* the spi->mode bits understood by this driver: */
+ master->mode_bits = SPI_CPOL | SPI_CPHA;
+
+ ss->irq = platform_get_irq(dev, 0);
+ if (ss->irq < 0) {
+ err = ss->irq;
+ goto out_put_master;
+ }
+ ss->err_irq = platform_get_irq(dev, 1);
+ if (ss->err_irq < 0) {
+ err = ss->err_irq;
+ goto out_put_master;
+ }
+
+ r = platform_get_resource(dev, IORESOURCE_DMA, 0);
+ if (r == NULL) {
+ err = -ENODEV;
+ goto out_put_master;
+ }
+
+ ss->dma = r->start;
+ err = stmp3xxx_dma_request(ss->dma, &dev->dev, dev_name(&dev->dev));
+ if (err)
+ goto out_put_master;
+
+ err = stmp3xxx_dma_allocate_command(ss->dma, &ss->d);
+ if (err)
+ goto out_free_dma;
+
+ master->bus_num = dev->id;
+ master->num_chipselect = 1;
+
+ /* SPI controller initializations */
+ err = stmp_spi_init_hw(ss);
+ if (err) {
+ dev_dbg(&dev->dev, "cannot initialize hardware\n");
+ goto out_free_dma_desc;
+ }
+
+ if (clock) {
+ dev_info(&dev->dev, "clock rate forced to %d\n", clock);
+ clk_set_rate(ss->clk, clock);
+ }
+ ss->speed_khz = clk_get_rate(ss->clk);
+ ss->divider = 2;
+ dev_info(&dev->dev, "max possible speed %d = %ld/%d kHz\n",
+ ss->speed_khz, clk_get_rate(ss->clk), ss->divider);
+
+ /* Register for SPI interrupt */
+ err = request_irq(ss->irq, stmp_spi_irq, 0,
+ dev_name(&dev->dev), ss);
+ if (err) {
+ dev_dbg(&dev->dev, "request_irq failed, %d\n", err);
+ goto out_release_hw;
+ }
+
+ /* ..and shared interrupt for all SSP controllers */
+ err = request_irq(ss->err_irq, stmp_spi_irq_err, IRQF_SHARED,
+ dev_name(&dev->dev), ss);
+ if (err) {
+ dev_dbg(&dev->dev, "request_irq(error) failed, %d\n", err);
+ goto out_free_irq;
+ }
+
+ err = spi_register_master(master);
+ if (err) {
+ dev_dbg(&dev->dev, "cannot register spi master, %d\n", err);
+ goto out_free_irq_2;
+ }
+ dev_info(&dev->dev, "at (mapped) 0x%08X, irq=%d, bus %d, %s mode\n",
+ (u32)ss->regs, ss->irq, master->bus_num,
+ pio ? "PIO" : "DMA");
+ return 0;
+
+out_free_irq_2:
+ free_irq(ss->err_irq, ss);
+out_free_irq:
+ free_irq(ss->irq, ss);
+out_free_dma_desc:
+ stmp3xxx_dma_free_command(ss->dma, &ss->d);
+out_free_dma:
+ stmp3xxx_dma_release(ss->dma);
+out_release_hw:
+ stmp_spi_release_hw(ss);
+out_put_master:
+ if (ss->workqueue)
+ destroy_workqueue(ss->workqueue);
+ if (ss->regs)
+ iounmap(ss->regs);
+ platform_set_drvdata(dev, NULL);
+ spi_master_put(master);
+out0:
+ return err;
+}
+
+static int __devexit stmp_spi_remove(struct platform_device *dev)
+{
+ struct stmp_spi *ss;
+ struct spi_master *master;
+
+ master = platform_get_drvdata(dev);
+ if (master == NULL)
+ goto out0;
+ ss = spi_master_get_devdata(master);
+
+ spi_unregister_master(master);
+
+ free_irq(ss->err_irq, ss);
+ free_irq(ss->irq, ss);
+ stmp3xxx_dma_free_command(ss->dma, &ss->d);
+ stmp3xxx_dma_release(ss->dma);
+ stmp_spi_release_hw(ss);
+ destroy_workqueue(ss->workqueue);
+ iounmap(ss->regs);
+ spi_master_put(master);
+ platform_set_drvdata(dev, NULL);
+out0:
+ return 0;
+}
+
+#ifdef CONFIG_PM
+static int stmp_spi_suspend(struct platform_device *pdev, pm_message_t pmsg)
+{
+ struct stmp_spi *ss;
+ struct spi_master *master;
+
+ master = platform_get_drvdata(pdev);
+ ss = spi_master_get_devdata(master);
+
+ ss->saved_timings = readl(HW_SSP_TIMING + ss->regs);
+ clk_disable(ss->clk);
+
+ return 0;
+}
+
+static int stmp_spi_resume(struct platform_device *pdev)
+{
+ struct stmp_spi *ss;
+ struct spi_master *master;
+
+ master = platform_get_drvdata(pdev);
+ ss = spi_master_get_devdata(master);
+
+ clk_enable(ss->clk);
+ stmp3xxx_reset_block(ss->regs, false);
+ writel(ss->saved_timings, ss->regs + HW_SSP_TIMING);
+
+ return 0;
+}
+
+#else
+#define stmp_spi_suspend NULL
+#define stmp_spi_resume NULL
+#endif
+
+static struct platform_driver stmp_spi_driver = {
+ .probe = stmp_spi_probe,
+ .remove = __devexit_p(stmp_spi_remove),
+ .driver = {
+ .name = "stmp3xxx_ssp",
+ .owner = THIS_MODULE,
+ },
+ .suspend = stmp_spi_suspend,
+ .resume = stmp_spi_resume,
+};
+
+static int __init stmp_spi_init(void)
+{
+ return platform_driver_register(&stmp_spi_driver);
+}
+
+static void __exit stmp_spi_exit(void)
+{
+ platform_driver_unregister(&stmp_spi_driver);
+}
+
+module_init(stmp_spi_init);
+module_exit(stmp_spi_exit);
+module_param(pio, int, S_IRUGO);
+module_param(clock, int, S_IRUGO);
+MODULE_AUTHOR("dmitry pervushin <dpervushin@embeddedalley.com>");
+MODULE_DESCRIPTION("STMP3xxx SPI/SSP driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/spi/spidev.c b/drivers/spi/spidev.c
index 606e7a4..f921bd1 100644
--- a/drivers/spi/spidev.c
+++ b/drivers/spi/spidev.c
@@ -688,3 +688,4 @@
MODULE_AUTHOR("Andrea Paterniani, <a.paterniani@swapp-eng.it>");
MODULE_DESCRIPTION("User mode SPI device interface");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:spidev");
diff --git a/drivers/spi/tle62x0.c b/drivers/spi/tle62x0.c
index 455991f..bf9540f 100644
--- a/drivers/spi/tle62x0.c
+++ b/drivers/spi/tle62x0.c
@@ -329,3 +329,4 @@
MODULE_AUTHOR("Ben Dooks <ben@simtec.co.uk>");
MODULE_DESCRIPTION("TLE62x0 SPI driver");
MODULE_LICENSE("GPL v2");
+MODULE_ALIAS("spi:tle62x0");
diff --git a/drivers/staging/stlc45xx/stlc45xx.c b/drivers/staging/stlc45xx/stlc45xx.c
index 12d414d..be99eb3 100644
--- a/drivers/staging/stlc45xx/stlc45xx.c
+++ b/drivers/staging/stlc45xx/stlc45xx.c
@@ -2591,3 +2591,4 @@
MODULE_LICENSE("GPL");
MODULE_AUTHOR("Kalle Valo <kalle.valo@nokia.com>");
+MODULE_ALIAS("spi:cx3110x");
diff --git a/drivers/video/Kconfig b/drivers/video/Kconfig
index 11af4cb..9bbb285 100644
--- a/drivers/video/Kconfig
+++ b/drivers/video/Kconfig
@@ -1275,26 +1275,6 @@
painting procedures (the secondary head does not use acceleration
engine).
-config FB_MATROX_MULTIHEAD
- bool "Multihead support"
- depends on FB_MATROX
- ---help---
- Say Y here if you have more than one (supported) Matrox device in
- your computer and you want to use all of them for different monitors
- ("multihead"). If you have only one device, you should say N because
- the driver compiled with Y is larger and a bit slower, especially on
- ia32 (ix86).
-
- If you said M to "Matrox unified accelerated driver" and N here, you
- will still be able to use several Matrox devices simultaneously:
- insert several instances of the module matroxfb into the kernel
- with insmod, supplying the parameter "dev=N" where N is 0, 1, etc.
- for the different Matrox devices. This method is slightly faster but
- uses 40 KB of kernel memory per Matrox card.
-
- There is no need for enabling 'Matrox multihead support' if you have
- only one Matrox card in the box.
-
config FB_RADEON
tristate "ATI Radeon display support"
depends on FB && PCI
@@ -2041,6 +2021,17 @@
and 8, 15 or 16 bpp color; 90 degrees clockwise display rotation for
panels <= 320 pixel horizontal resolution.
+config FB_DA8XX
+ tristate "DA8xx/OMAP-L1xx Framebuffer support"
+ depends on FB && ARCH_DAVINCI_DA8XX
+ select FB_CFB_FILLRECT
+ select FB_CFB_COPYAREA
+ select FB_CFB_IMAGEBLIT
+ ---help---
+ This is the frame buffer device driver for the TI LCD controller
+ found on DA8xx/OMAP-L1xx SoCs.
+ If unsure, say N.
+
config FB_VIRTUAL
tristate "Virtual Frame Buffer support (ONLY FOR TESTING!)"
depends on FB
@@ -2117,6 +2108,17 @@
---help---
Framebuffer support for Fujitsu Lime GDC on host CPU bus.
+config FB_EP93XX
+ tristate "EP93XX frame buffer support"
+ depends on FB && ARCH_EP93XX
+ select FB_CFB_FILLRECT
+ select FB_CFB_COPYAREA
+ select FB_CFB_IMAGEBLIT
+ ---help---
+ Framebuffer driver for the Cirrus Logic EP93XX series of processors.
+ This driver is also available as a module. The module will be called
+ ep93xx-fb.
+
config FB_PRE_INIT_FB
bool "Don't reinitialize, use bootloader's GDC/Display configuration"
depends on FB_MB862XX_LIME
@@ -2124,6 +2126,14 @@
Select this option if display contents should be inherited as set by
the bootloader.
+config FB_MSM
+ tristate
+ depends on FB && ARCH_MSM
+ select FB_CFB_FILLRECT
+ select FB_CFB_COPYAREA
+ select FB_CFB_IMAGEBLIT
+ default y
+
config FB_MX3
tristate "MX3 Framebuffer support"
depends on FB && MX3_IPU
diff --git a/drivers/video/Makefile b/drivers/video/Makefile
index 01a819f..80232e1 100644
--- a/drivers/video/Makefile
+++ b/drivers/video/Makefile
@@ -85,6 +85,7 @@
obj-$(CONFIG_FB_TGA) += tgafb.o
obj-$(CONFIG_FB_HP300) += hpfb.o
obj-$(CONFIG_FB_G364) += g364fb.o
+obj-$(CONFIG_FB_EP93XX) += ep93xx-fb.o
obj-$(CONFIG_FB_SA1100) += sa1100fb.o
obj-$(CONFIG_FB_HIT) += hitfb.o
obj-$(CONFIG_FB_EPSON1355) += epson1355fb.o
@@ -126,6 +127,7 @@
obj-$(CONFIG_XEN_FBDEV_FRONTEND) += xen-fbfront.o
obj-$(CONFIG_FB_CARMINE) += carminefb.o
obj-$(CONFIG_FB_MB862XX) += mb862xx/
+obj-$(CONFIG_FB_MSM) += msm/
# Platform or fallback drivers go here
obj-$(CONFIG_FB_UVESA) += uvesafb.o
@@ -136,6 +138,7 @@
obj-$(CONFIG_FB_BF54X_LQ043) += bf54x-lq043fb.o
obj-$(CONFIG_FB_BFIN_T350MCQB) += bfin-t350mcqb-fb.o
obj-$(CONFIG_FB_MX3) += mx3fb.o
+obj-$(CONFIG_FB_DA8XX) += da8xx-fb.o
# the test framebuffer is last
obj-$(CONFIG_FB_VIRTUAL) += vfb.o
diff --git a/drivers/video/aty/atyfb_base.c b/drivers/video/aty/atyfb_base.c
index 63d3739..913b4a4 100644
--- a/drivers/video/aty/atyfb_base.c
+++ b/drivers/video/aty/atyfb_base.c
@@ -132,7 +132,7 @@
#endif
#define PRINTKI(fmt, args...) printk(KERN_INFO "atyfb: " fmt, ## args)
-#define PRINTKE(fmt, args...) printk(KERN_ERR "atyfb: " fmt, ## args)
+#define PRINTKE(fmt, args...) printk(KERN_ERR "atyfb: " fmt, ## args)
#if defined(CONFIG_PM) || defined(CONFIG_PMAC_BACKLIGHT) || \
defined (CONFIG_FB_ATY_GENERIC_LCD) || defined(CONFIG_FB_ATY_BACKLIGHT)
@@ -188,24 +188,23 @@
*/
static void ATIReduceRatio(int *Numerator, int *Denominator)
{
- int Multiplier, Divider, Remainder;
+ int Multiplier, Divider, Remainder;
- Multiplier = *Numerator;
- Divider = *Denominator;
+ Multiplier = *Numerator;
+ Divider = *Denominator;
- while ((Remainder = Multiplier % Divider))
- {
- Multiplier = Divider;
- Divider = Remainder;
- }
+ while ((Remainder = Multiplier % Divider)) {
+ Multiplier = Divider;
+ Divider = Remainder;
+ }
- *Numerator /= Divider;
- *Denominator /= Divider;
+ *Numerator /= Divider;
+ *Denominator /= Divider;
}
#endif
- /*
- * The Hardware parameters for each card
- */
+/*
+ * The Hardware parameters for each card
+ */
struct pci_mmap_map {
unsigned long voff;
@@ -223,17 +222,19 @@
.ypanstep = 1,
};
- /*
- * Frame buffer device API
- */
+/*
+ * Frame buffer device API
+ */
static int atyfb_open(struct fb_info *info, int user);
static int atyfb_release(struct fb_info *info, int user);
-static int atyfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info);
+static int atyfb_check_var(struct fb_var_screeninfo *var,
+ struct fb_info *info);
static int atyfb_set_par(struct fb_info *info);
static int atyfb_setcolreg(u_int regno, u_int red, u_int green, u_int blue,
- u_int transp, struct fb_info *info);
-static int atyfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info);
+ u_int transp, struct fb_info *info);
+static int atyfb_pan_display(struct fb_var_screeninfo *var,
+ struct fb_info *info);
static int atyfb_blank(int blank, struct fb_info *info);
static int atyfb_ioctl(struct fb_info *info, u_int cmd, u_long arg);
#ifdef __sparc__
@@ -241,9 +242,9 @@
#endif
static int atyfb_sync(struct fb_info *info);
- /*
- * Internal routines
- */
+/*
+ * Internal routines
+ */
static int aty_init(struct fb_info *info);
@@ -254,8 +255,11 @@
static void aty_get_crtc(const struct atyfb_par *par, struct crtc *crtc);
static void aty_set_crtc(const struct atyfb_par *par, const struct crtc *crtc);
-static int aty_var_to_crtc(const struct fb_info *info, const struct fb_var_screeninfo *var, struct crtc *crtc);
-static int aty_crtc_to_var(const struct crtc *crtc, struct fb_var_screeninfo *var);
+static int aty_var_to_crtc(const struct fb_info *info,
+ const struct fb_var_screeninfo *var,
+ struct crtc *crtc);
+static int aty_crtc_to_var(const struct crtc *crtc,
+ struct fb_var_screeninfo *var);
static void set_off_pitch(struct atyfb_par *par, const struct fb_info *info);
#ifdef CONFIG_PPC
static int read_aty_sense(const struct atyfb_par *par);
@@ -264,9 +268,9 @@
static DEFINE_MUTEX(reboot_lock);
static struct fb_info *reboot_info;
- /*
- * Interface used by the world
- */
+/*
+ * Interface used by the world
+ */
static struct fb_var_screeninfo default_var = {
/* 640x480, 60 Hz, Non-Interlaced (25.175 MHz dotclock) */
@@ -452,14 +456,14 @@
type = chip_id & CFG_CHIP_TYPE;
rev = (chip_id & CFG_CHIP_REV) >> 24;
- switch(par->pci_id) {
+ switch (par->pci_id) {
#ifdef CONFIG_FB_ATY_GX
case PCI_CHIP_MACH64GX:
- if(type != 0x00d7)
+ if (type != 0x00d7)
return -ENODEV;
break;
case PCI_CHIP_MACH64CX:
- if(type != 0x0057)
+ if (type != 0x0057)
return -ENODEV;
break;
#endif
@@ -564,7 +568,8 @@
};
#endif /* CONFIG_FB_ATY_CT */
-static u32 atyfb_get_pixclock(struct fb_var_screeninfo *var, struct atyfb_par *par)
+static u32 atyfb_get_pixclock(struct fb_var_screeninfo *var,
+ struct atyfb_par *par)
{
u32 pixclock = var->pixclock;
#ifdef CONFIG_FB_ATY_GENERIC_LCD
@@ -572,7 +577,7 @@
par->pll.ct.xres = 0;
if (par->lcd_table != 0) {
lcd_on_off = aty_ld_lcd(LCD_GEN_CNTL, par);
- if(lcd_on_off & LCD_ON) {
+ if (lcd_on_off & LCD_ON) {
par->pll.ct.xres = var->xres;
pixclock = par->lcd_pixclock;
}
@@ -584,7 +589,7 @@
#if defined(CONFIG_PPC)
/*
- * Apple monitor sense
+ * Apple monitor sense
*/
static int __devinit read_aty_sense(const struct atyfb_par *par)
@@ -625,16 +630,16 @@
/* ------------------------------------------------------------------------- */
/*
- * CRTC programming
+ * CRTC programming
*/
static void aty_get_crtc(const struct atyfb_par *par, struct crtc *crtc)
{
#ifdef CONFIG_FB_ATY_GENERIC_LCD
if (par->lcd_table != 0) {
- if(!M64_HAS(LT_LCD_REGS)) {
- crtc->lcd_index = aty_ld_le32(LCD_INDEX, par);
- aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
+ if (!M64_HAS(LT_LCD_REGS)) {
+ crtc->lcd_index = aty_ld_le32(LCD_INDEX, par);
+ aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
}
crtc->lcd_config_panel = aty_ld_lcd(CNFG_PANEL, par);
crtc->lcd_gen_cntl = aty_ld_lcd(LCD_GEN_CNTL, par);
@@ -642,7 +647,7 @@
/* switch to non shadow registers */
aty_st_lcd(LCD_GEN_CNTL, crtc->lcd_gen_cntl &
- ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
+ ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
/* save stretching */
crtc->horz_stretching = aty_ld_lcd(HORZ_STRETCHING, par);
@@ -663,7 +668,7 @@
if (par->lcd_table != 0) {
/* switch to shadow registers */
aty_st_lcd(LCD_GEN_CNTL, (crtc->lcd_gen_cntl & ~CRTC_RW_SELECT) |
- SHADOW_EN | SHADOW_RW_EN, par);
+ SHADOW_EN | SHADOW_RW_EN, par);
crtc->shadow_h_tot_disp = aty_ld_le32(CRTC_H_TOTAL_DISP, par);
crtc->shadow_h_sync_strt_wid = aty_ld_le32(CRTC_H_SYNC_STRT_WID, par);
@@ -680,21 +685,20 @@
#ifdef CONFIG_FB_ATY_GENERIC_LCD
if (par->lcd_table != 0) {
/* stop CRTC */
- aty_st_le32(CRTC_GEN_CNTL, crtc->gen_cntl & ~(CRTC_EXT_DISP_EN | CRTC_EN), par);
+ aty_st_le32(CRTC_GEN_CNTL, crtc->gen_cntl &
+ ~(CRTC_EXT_DISP_EN | CRTC_EN), par);
/* update non-shadow registers first */
aty_st_lcd(CNFG_PANEL, crtc->lcd_config_panel, par);
aty_st_lcd(LCD_GEN_CNTL, crtc->lcd_gen_cntl &
- ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
+ ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
/* temporarily disable stretching */
- aty_st_lcd(HORZ_STRETCHING,
- crtc->horz_stretching &
- ~(HORZ_STRETCH_MODE | HORZ_STRETCH_EN), par);
- aty_st_lcd(VERT_STRETCHING,
- crtc->vert_stretching &
- ~(VERT_STRETCH_RATIO1 | VERT_STRETCH_RATIO2 |
- VERT_STRETCH_USE0 | VERT_STRETCH_EN), par);
+ aty_st_lcd(HORZ_STRETCHING, crtc->horz_stretching &
+ ~(HORZ_STRETCH_MODE | HORZ_STRETCH_EN), par);
+ aty_st_lcd(VERT_STRETCHING, crtc->vert_stretching &
+ ~(VERT_STRETCH_RATIO1 | VERT_STRETCH_RATIO2 |
+ VERT_STRETCH_USE0 | VERT_STRETCH_EN), par);
}
#endif
/* turn off CRT */
@@ -702,17 +706,19 @@
DPRINTK("setting up CRTC\n");
DPRINTK("set primary CRT to %ix%i %c%c composite %c\n",
- ((((crtc->h_tot_disp>>16) & 0xff) + 1)<<3), (((crtc->v_tot_disp>>16) & 0x7ff) + 1),
- (crtc->h_sync_strt_wid & 0x200000)?'N':'P', (crtc->v_sync_strt_wid & 0x200000)?'N':'P',
- (crtc->gen_cntl & CRTC_CSYNC_EN)?'P':'N');
+ ((((crtc->h_tot_disp >> 16) & 0xff) + 1) << 3),
+ (((crtc->v_tot_disp >> 16) & 0x7ff) + 1),
+ (crtc->h_sync_strt_wid & 0x200000) ? 'N' : 'P',
+ (crtc->v_sync_strt_wid & 0x200000) ? 'N' : 'P',
+ (crtc->gen_cntl & CRTC_CSYNC_EN) ? 'P' : 'N');
- DPRINTK("CRTC_H_TOTAL_DISP: %x\n",crtc->h_tot_disp);
- DPRINTK("CRTC_H_SYNC_STRT_WID: %x\n",crtc->h_sync_strt_wid);
- DPRINTK("CRTC_V_TOTAL_DISP: %x\n",crtc->v_tot_disp);
- DPRINTK("CRTC_V_SYNC_STRT_WID: %x\n",crtc->v_sync_strt_wid);
+ DPRINTK("CRTC_H_TOTAL_DISP: %x\n", crtc->h_tot_disp);
+ DPRINTK("CRTC_H_SYNC_STRT_WID: %x\n", crtc->h_sync_strt_wid);
+ DPRINTK("CRTC_V_TOTAL_DISP: %x\n", crtc->v_tot_disp);
+ DPRINTK("CRTC_V_SYNC_STRT_WID: %x\n", crtc->v_sync_strt_wid);
DPRINTK("CRTC_OFF_PITCH: %x\n", crtc->off_pitch);
DPRINTK("CRTC_VLINE_CRNT_VLINE: %x\n", crtc->vline_crnt_vline);
- DPRINTK("CRTC_GEN_CNTL: %x\n",crtc->gen_cntl);
+ DPRINTK("CRTC_GEN_CNTL: %x\n", crtc->gen_cntl);
aty_st_le32(CRTC_H_TOTAL_DISP, crtc->h_tot_disp, par);
aty_st_le32(CRTC_H_SYNC_STRT_WID, crtc->h_sync_strt_wid, par);
@@ -732,16 +738,22 @@
if (par->lcd_table != 0) {
/* switch to shadow registers */
aty_st_lcd(LCD_GEN_CNTL, (crtc->lcd_gen_cntl & ~CRTC_RW_SELECT) |
- (SHADOW_EN | SHADOW_RW_EN), par);
+ SHADOW_EN | SHADOW_RW_EN, par);
DPRINTK("set shadow CRT to %ix%i %c%c\n",
- ((((crtc->shadow_h_tot_disp>>16) & 0xff) + 1)<<3), (((crtc->shadow_v_tot_disp>>16) & 0x7ff) + 1),
- (crtc->shadow_h_sync_strt_wid & 0x200000)?'N':'P', (crtc->shadow_v_sync_strt_wid & 0x200000)?'N':'P');
+ ((((crtc->shadow_h_tot_disp >> 16) & 0xff) + 1) << 3),
+ (((crtc->shadow_v_tot_disp >> 16) & 0x7ff) + 1),
+ (crtc->shadow_h_sync_strt_wid & 0x200000) ? 'N' : 'P',
+ (crtc->shadow_v_sync_strt_wid & 0x200000) ? 'N' : 'P');
- DPRINTK("SHADOW CRTC_H_TOTAL_DISP: %x\n", crtc->shadow_h_tot_disp);
- DPRINTK("SHADOW CRTC_H_SYNC_STRT_WID: %x\n", crtc->shadow_h_sync_strt_wid);
- DPRINTK("SHADOW CRTC_V_TOTAL_DISP: %x\n", crtc->shadow_v_tot_disp);
- DPRINTK("SHADOW CRTC_V_SYNC_STRT_WID: %x\n", crtc->shadow_v_sync_strt_wid);
+ DPRINTK("SHADOW CRTC_H_TOTAL_DISP: %x\n",
+ crtc->shadow_h_tot_disp);
+ DPRINTK("SHADOW CRTC_H_SYNC_STRT_WID: %x\n",
+ crtc->shadow_h_sync_strt_wid);
+ DPRINTK("SHADOW CRTC_V_TOTAL_DISP: %x\n",
+ crtc->shadow_v_tot_disp);
+ DPRINTK("SHADOW CRTC_V_SYNC_STRT_WID: %x\n",
+ crtc->shadow_v_sync_strt_wid);
aty_st_le32(CRTC_H_TOTAL_DISP, crtc->shadow_h_tot_disp, par);
aty_st_le32(CRTC_H_SYNC_STRT_WID, crtc->shadow_h_sync_strt_wid, par);
@@ -752,16 +764,16 @@
DPRINTK("LCD_GEN_CNTL: %x\n", crtc->lcd_gen_cntl);
DPRINTK("HORZ_STRETCHING: %x\n", crtc->horz_stretching);
DPRINTK("VERT_STRETCHING: %x\n", crtc->vert_stretching);
- if(!M64_HAS(LT_LCD_REGS))
- DPRINTK("EXT_VERT_STRETCH: %x\n", crtc->ext_vert_stretch);
+ if (!M64_HAS(LT_LCD_REGS))
+ DPRINTK("EXT_VERT_STRETCH: %x\n", crtc->ext_vert_stretch);
aty_st_lcd(LCD_GEN_CNTL, crtc->lcd_gen_cntl, par);
aty_st_lcd(HORZ_STRETCHING, crtc->horz_stretching, par);
aty_st_lcd(VERT_STRETCHING, crtc->vert_stretching, par);
- if(!M64_HAS(LT_LCD_REGS)) {
- aty_st_lcd(EXT_VERT_STRETCH, crtc->ext_vert_stretch, par);
- aty_ld_le32(LCD_INDEX, par);
- aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
+ if (!M64_HAS(LT_LCD_REGS)) {
+ aty_st_lcd(EXT_VERT_STRETCH, crtc->ext_vert_stretch, par);
+ aty_ld_le32(LCD_INDEX, par);
+ aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
}
}
#endif /* CONFIG_FB_ATY_GENERIC_LCD */
@@ -779,7 +791,8 @@
}
static int aty_var_to_crtc(const struct fb_info *info,
- const struct fb_var_screeninfo *var, struct crtc *crtc)
+ const struct fb_var_screeninfo *var,
+ struct crtc *crtc)
{
struct atyfb_par *par = (struct atyfb_par *) info->par;
u32 xres, yres, vxres, vyres, xoffset, yoffset, bpp;
@@ -814,34 +827,32 @@
if (bpp <= 8) {
bpp = 8;
pix_width = CRTC_PIX_WIDTH_8BPP;
- dp_pix_width =
- HOST_8BPP | SRC_8BPP | DST_8BPP |
- BYTE_ORDER_LSB_TO_MSB;
+ dp_pix_width = HOST_8BPP | SRC_8BPP | DST_8BPP |
+ BYTE_ORDER_LSB_TO_MSB;
dp_chain_mask = DP_CHAIN_8BPP;
} else if (bpp <= 15) {
bpp = 16;
pix_width = CRTC_PIX_WIDTH_15BPP;
dp_pix_width = HOST_15BPP | SRC_15BPP | DST_15BPP |
- BYTE_ORDER_LSB_TO_MSB;
+ BYTE_ORDER_LSB_TO_MSB;
dp_chain_mask = DP_CHAIN_15BPP;
} else if (bpp <= 16) {
bpp = 16;
pix_width = CRTC_PIX_WIDTH_16BPP;
dp_pix_width = HOST_16BPP | SRC_16BPP | DST_16BPP |
- BYTE_ORDER_LSB_TO_MSB;
+ BYTE_ORDER_LSB_TO_MSB;
dp_chain_mask = DP_CHAIN_16BPP;
} else if (bpp <= 24 && M64_HAS(INTEGRATED)) {
bpp = 24;
pix_width = CRTC_PIX_WIDTH_24BPP;
- dp_pix_width =
- HOST_8BPP | SRC_8BPP | DST_8BPP |
- BYTE_ORDER_LSB_TO_MSB;
+ dp_pix_width = HOST_8BPP | SRC_8BPP | DST_8BPP |
+ BYTE_ORDER_LSB_TO_MSB;
dp_chain_mask = DP_CHAIN_24BPP;
} else if (bpp <= 32) {
bpp = 32;
pix_width = CRTC_PIX_WIDTH_32BPP;
dp_pix_width = HOST_32BPP | SRC_32BPP | DST_32BPP |
- BYTE_ORDER_LSB_TO_MSB;
+ BYTE_ORDER_LSB_TO_MSB;
dp_chain_mask = DP_CHAIN_32BPP;
} else
FAIL("invalid bpp");
@@ -854,9 +865,9 @@
h_sync_pol = sync & FB_SYNC_HOR_HIGH_ACT ? 0 : 1;
v_sync_pol = sync & FB_SYNC_VERT_HIGH_ACT ? 0 : 1;
- if((xres > 1600) || (yres > 1200)) {
+ if ((xres > 1600) || (yres > 1200)) {
FAIL("MACH64 chips are designed for max 1600x1200\n"
- "select anoter resolution.");
+ "select anoter resolution.");
}
h_sync_strt = h_disp + var->right_margin;
h_sync_end = h_sync_strt + var->hsync_len;
@@ -869,11 +880,12 @@
#ifdef CONFIG_FB_ATY_GENERIC_LCD
if (par->lcd_table != 0) {
- if(!M64_HAS(LT_LCD_REGS)) {
- u32 lcd_index = aty_ld_le32(LCD_INDEX, par);
- crtc->lcd_index = lcd_index &
- ~(LCD_INDEX_MASK | LCD_DISPLAY_DIS | LCD_SRC_SEL | CRTC2_DISPLAY_DIS);
- aty_st_le32(LCD_INDEX, lcd_index, par);
+ if (!M64_HAS(LT_LCD_REGS)) {
+ u32 lcd_index = aty_ld_le32(LCD_INDEX, par);
+ crtc->lcd_index = lcd_index &
+ ~(LCD_INDEX_MASK | LCD_DISPLAY_DIS |
+ LCD_SRC_SEL | CRTC2_DISPLAY_DIS);
+ aty_st_le32(LCD_INDEX, lcd_index, par);
}
if (!M64_HAS(MOBIL_BUS))
@@ -888,12 +900,14 @@
USE_SHADOWED_ROWCUR | SHADOW_EN | SHADOW_RW_EN);
crtc->lcd_gen_cntl |= DONT_SHADOW_VPAR | LOCK_8DOT;
- if((crtc->lcd_gen_cntl & LCD_ON) &&
- ((xres > par->lcd_width) || (yres > par->lcd_height))) {
- /* We cannot display the mode on the LCD. If the CRT is enabled
- we can turn off the LCD.
- If the CRT is off, it isn't a good idea to switch it on; we don't
- know if one is connected. So it's better to fail then.
+ if ((crtc->lcd_gen_cntl & LCD_ON) &&
+ ((xres > par->lcd_width) || (yres > par->lcd_height))) {
+ /*
+ * We cannot display the mode on the LCD. If the CRT is
+ * enabled we can turn off the LCD.
+ * If the CRT is off, it isn't a good idea to switch it
+ * on; we don't know if one is connected. So it's better
+ * to fail then.
*/
if (crtc->lcd_gen_cntl & CRT_ON) {
if (!(var->activate & FB_ACTIVATE_TEST))
@@ -916,17 +930,18 @@
vmode &= ~(FB_VMODE_DOUBLE | FB_VMODE_INTERLACED);
- /* This is horror! When we simulate, say 640x480 on an 800x600
- LCD monitor, the CRTC should be programmed 800x600 values for
- the non visible part, but 640x480 for the visible part.
- This code has been tested on a laptop with it's 1400x1050 LCD
- monitor and a conventional monitor both switched on.
- Tested modes: 1280x1024, 1152x864, 1024x768, 800x600,
- works with little glitches also with DOUBLESCAN modes
+ /*
+ * This is horror! When we simulate, say 640x480 on an 800x600
+ * LCD monitor, the CRTC should be programmed 800x600 values for
+ * the non visible part, but 640x480 for the visible part.
+ * This code has been tested on a laptop with it's 1400x1050 LCD
+ * monitor and a conventional monitor both switched on.
+ * Tested modes: 1280x1024, 1152x864, 1024x768, 800x600,
+ * works with little glitches also with DOUBLESCAN modes
*/
if (yres < par->lcd_height) {
VScan = par->lcd_height / yres;
- if(VScan > 1) {
+ if (VScan > 1) {
VScan = 2;
vmode |= FB_VMODE_DOUBLE;
}
@@ -952,7 +967,7 @@
FAIL_MAX("h_disp too large", h_disp, 0xff);
FAIL_MAX("h_sync_strt too large", h_sync_strt, 0x1ff);
/*FAIL_MAX("h_sync_wid too large", h_sync_wid, 0x1f);*/
- if(h_sync_wid > 0x1f)
+ if (h_sync_wid > 0x1f)
h_sync_wid = 0x1f;
FAIL_MAX("h_total too large", h_total, 0x1ff);
@@ -978,7 +993,7 @@
FAIL_MAX("v_disp too large", v_disp, 0x7ff);
FAIL_MAX("v_sync_stsrt too large", v_sync_strt, 0x7ff);
/*FAIL_MAX("v_sync_wid too large", v_sync_wid, 0x1f);*/
- if(v_sync_wid > 0x1f)
+ if (v_sync_wid > 0x1f)
v_sync_wid = 0x1f;
FAIL_MAX("v_total too large", v_total, 0x7ff);
@@ -995,11 +1010,13 @@
((line_length / bpp) << 22);
crtc->vline_crnt_vline = 0;
- crtc->h_tot_disp = h_total | (h_disp<<16);
- crtc->h_sync_strt_wid = (h_sync_strt & 0xff) | (h_sync_dly<<8) |
- ((h_sync_strt & 0x100)<<4) | (h_sync_wid<<16) | (h_sync_pol<<21);
- crtc->v_tot_disp = v_total | (v_disp<<16);
- crtc->v_sync_strt_wid = v_sync_strt | (v_sync_wid<<16) | (v_sync_pol<<21);
+ crtc->h_tot_disp = h_total | (h_disp << 16);
+ crtc->h_sync_strt_wid = (h_sync_strt & 0xff) | (h_sync_dly << 8) |
+ ((h_sync_strt & 0x100) << 4) | (h_sync_wid << 16) |
+ (h_sync_pol << 21);
+ crtc->v_tot_disp = v_total | (v_disp << 16);
+ crtc->v_sync_strt_wid = v_sync_strt | (v_sync_wid << 16) |
+ (v_sync_pol << 21);
/* crtc->gen_cntl = aty_ld_le32(CRTC_GEN_CNTL, par) & CRTC_PRESERVED_MASK; */
crtc->gen_cntl = CRTC_EXT_DISP_EN | CRTC_EN | pix_width | c_sync;
@@ -1014,13 +1031,15 @@
#ifdef CONFIG_FB_ATY_GENERIC_LCD
if (par->lcd_table != 0) {
vdisplay = yres;
- if(vmode & FB_VMODE_DOUBLE)
+ if (vmode & FB_VMODE_DOUBLE)
vdisplay <<= 1;
crtc->gen_cntl &= ~(CRTC2_EN | CRTC2_PIX_WIDTH);
crtc->lcd_gen_cntl &= ~(HORZ_DIVBY2_EN | DIS_HOR_CRT_DIVBY2 |
- /*TVCLK_PM_EN | VCLK_DAC_PM_EN |*/
- USE_SHADOWED_VEND | USE_SHADOWED_ROWCUR | SHADOW_EN | SHADOW_RW_EN);
- crtc->lcd_gen_cntl |= (DONT_SHADOW_VPAR/* | LOCK_8DOT*/);
+ /*TVCLK_PM_EN | VCLK_DAC_PM_EN |*/
+ USE_SHADOWED_VEND |
+ USE_SHADOWED_ROWCUR |
+ SHADOW_EN | SHADOW_RW_EN);
+ crtc->lcd_gen_cntl |= DONT_SHADOW_VPAR/* | LOCK_8DOT*/;
/* MOBILITY M1 tested, FIXME: LT */
crtc->horz_stretching = aty_ld_lcd(HORZ_STRETCHING, par);
@@ -1028,28 +1047,32 @@
crtc->ext_vert_stretch = aty_ld_lcd(EXT_VERT_STRETCH, par) &
~(AUTO_VERT_RATIO | VERT_STRETCH_MODE | VERT_STRETCH_RATIO3);
- crtc->horz_stretching &=
- ~(HORZ_STRETCH_RATIO | HORZ_STRETCH_LOOP | AUTO_HORZ_RATIO |
- HORZ_STRETCH_MODE | HORZ_STRETCH_EN);
+ crtc->horz_stretching &= ~(HORZ_STRETCH_RATIO |
+ HORZ_STRETCH_LOOP | AUTO_HORZ_RATIO |
+ HORZ_STRETCH_MODE | HORZ_STRETCH_EN);
if (xres < par->lcd_width && crtc->lcd_gen_cntl & LCD_ON) {
do {
/*
- * The horizontal blender misbehaves when HDisplay is less than a
- * a certain threshold (440 for a 1024-wide panel). It doesn't
- * stretch such modes enough. Use pixel replication instead of
- * blending to stretch modes that can be made to exactly fit the
- * panel width. The undocumented "NoLCDBlend" option allows the
- * pixel-replicated mode to be slightly wider or narrower than the
- * panel width. It also causes a mode that is exactly half as wide
- * as the panel to be pixel-replicated, rather than blended.
- */
+ * The horizontal blender misbehaves when
+ * HDisplay is less than a certain threshold
+ * (440 for a 1024-wide panel). It doesn't
+ * stretch such modes enough. Use pixel
+ * replication instead of blending to stretch
+ * modes that can be made to exactly fit the
+ * panel width. The undocumented "NoLCDBlend"
+ * option allows the pixel-replicated mode to
+ * be slightly wider or narrower than the
+ * panel width. It also causes a mode that is
+ * exactly half as wide as the panel to be
+ * pixel-replicated, rather than blended.
+ */
int HDisplay = xres & ~7;
int nStretch = par->lcd_width / HDisplay;
int Remainder = par->lcd_width % HDisplay;
if ((!Remainder && ((nStretch > 2))) ||
- (((HDisplay * 16) / par->lcd_width) < 7)) {
- static const char StretchLoops[] = {10, 12, 13, 15, 16};
+ (((HDisplay * 16) / par->lcd_width) < 7)) {
+ static const char StretchLoops[] = { 10, 12, 13, 15, 16 };
int horz_stretch_loop = -1, BestRemainder;
int Numerator = HDisplay, Denominator = par->lcd_width;
int Index = 5;
@@ -1098,12 +1121,12 @@
(((vdisplay * (VERT_STRETCH_RATIO0 + 1)) / par->lcd_height) & VERT_STRETCH_RATIO0));
if (!M64_HAS(LT_LCD_REGS) &&
- xres <= (M64_HAS(MOBIL_BUS)?1024:800))
+ xres <= (M64_HAS(MOBIL_BUS) ? 1024 : 800))
crtc->ext_vert_stretch |= VERT_STRETCH_MODE;
} else {
/*
- * Don't use vertical blending if the mode is too wide or not
- * vertically stretched.
+ * Don't use vertical blending if the mode is too wide
+ * or not vertically stretched.
*/
crtc->vert_stretching = 0;
}
@@ -1125,11 +1148,11 @@
return 0;
}
-static int aty_crtc_to_var(const struct crtc *crtc, struct fb_var_screeninfo *var)
+static int aty_crtc_to_var(const struct crtc *crtc,
+ struct fb_var_screeninfo *var)
{
u32 xres, yres, bpp, left, right, upper, lower, hslen, vslen, sync;
- u32 h_total, h_disp, h_sync_strt, h_sync_dly, h_sync_wid,
- h_sync_pol;
+ u32 h_total, h_disp, h_sync_strt, h_sync_dly, h_sync_wid, h_sync_pol;
u32 v_total, v_disp, v_sync_strt, v_sync_wid, v_sync_pol, c_sync;
u32 pix_width;
u32 double_scan, interlace;
@@ -1161,8 +1184,8 @@
lower = v_sync_strt - v_disp;
vslen = v_sync_wid;
sync = (h_sync_pol ? 0 : FB_SYNC_HOR_HIGH_ACT) |
- (v_sync_pol ? 0 : FB_SYNC_VERT_HIGH_ACT) |
- (c_sync ? FB_SYNC_COMP_HIGH_ACT : 0);
+ (v_sync_pol ? 0 : FB_SYNC_VERT_HIGH_ACT) |
+ (c_sync ? FB_SYNC_COMP_HIGH_ACT : 0);
switch (pix_width) {
#if 0
@@ -1252,20 +1275,21 @@
var->vsync_len = vslen;
var->sync = sync;
var->vmode = FB_VMODE_NONINTERLACED;
- /* In double scan mode, the vertical parameters are doubled, so we need to
- half them to get the right values.
- In interlaced mode the values are already correct, so no correction is
- necessary.
+ /*
+ * In double scan mode, the vertical parameters are doubled,
+ * so we need to halve them to get the right values.
+ * In interlaced mode the values are already correct,
+ * so no correction is necessary.
*/
if (interlace)
var->vmode = FB_VMODE_INTERLACED;
if (double_scan) {
var->vmode = FB_VMODE_DOUBLE;
- var->yres>>=1;
- var->upper_margin>>=1;
- var->lower_margin>>=1;
- var->vsync_len>>=1;
+ var->yres >>= 1;
+ var->upper_margin >>= 1;
+ var->lower_margin >>= 1;
+ var->vsync_len >>= 1;
}
return 0;
@@ -1286,7 +1310,8 @@
if (par->asleep)
return 0;
- if ((err = aty_var_to_crtc(info, var, &par->crtc)))
+ err = aty_var_to_crtc(info, var, &par->crtc);
+ if (err)
return err;
pixclock = atyfb_get_pixclock(var, par);
@@ -1295,7 +1320,9 @@
PRINTKE("Invalid pixclock\n");
return -EINVAL;
} else {
- if((err = par->pll_ops->var_to_pll(info, pixclock, var->bits_per_pixel, &par->pll)))
+ err = par->pll_ops->var_to_pll(info, pixclock,
+ var->bits_per_pixel, &par->pll);
+ if (err)
return err;
}
@@ -1313,22 +1340,23 @@
wait_for_idle(par);
aty_set_crtc(par, &par->crtc);
- par->dac_ops->set_dac(info, &par->pll, var->bits_per_pixel, par->accel_flags);
+ par->dac_ops->set_dac(info, &par->pll,
+ var->bits_per_pixel, par->accel_flags);
par->pll_ops->set_pll(info, &par->pll);
#ifdef DEBUG
- if(par->pll_ops && par->pll_ops->pll_to_var)
- pixclock_in_ps = par->pll_ops->pll_to_var(info, &(par->pll));
+ if (par->pll_ops && par->pll_ops->pll_to_var)
+ pixclock_in_ps = par->pll_ops->pll_to_var(info, &par->pll);
else
pixclock_in_ps = 0;
- if(0 == pixclock_in_ps) {
+ if (0 == pixclock_in_ps) {
PRINTKE("ALERT ops->pll_to_var get 0\n");
pixclock_in_ps = pixclock;
}
memset(&debug, 0, sizeof(debug));
- if(!aty_crtc_to_var(&(par->crtc), &debug)) {
+ if (!aty_crtc_to_var(&par->crtc, &debug)) {
u32 hSync, vRefresh;
u32 h_disp, h_sync_strt, h_sync_end, h_total;
u32 v_disp, v_sync_strt, v_sync_end, v_total;
@@ -1344,16 +1372,20 @@
hSync = 1000000000 / (pixclock_in_ps * h_total);
vRefresh = (hSync * 1000) / v_total;
- if (par->crtc.gen_cntl & CRTC_INTERLACE_EN)
- vRefresh *= 2;
- if (par->crtc.gen_cntl & CRTC_DBL_SCAN_EN)
- vRefresh /= 2;
+ if (par->crtc.gen_cntl & CRTC_INTERLACE_EN)
+ vRefresh *= 2;
+ if (par->crtc.gen_cntl & CRTC_DBL_SCAN_EN)
+ vRefresh /= 2;
DPRINTK("atyfb_set_par\n");
- DPRINTK(" Set Visible Mode to %ix%i-%i\n", var->xres, var->yres, var->bits_per_pixel);
- DPRINTK(" Virtual resolution %ix%i, pixclock_in_ps %i (calculated %i)\n",
- var->xres_virtual, var->yres_virtual, pixclock, pixclock_in_ps);
- DPRINTK(" Dot clock: %i MHz\n", 1000000 / pixclock_in_ps);
+ DPRINTK(" Set Visible Mode to %ix%i-%i\n",
+ var->xres, var->yres, var->bits_per_pixel);
+ DPRINTK(" Virtual resolution %ix%i, "
+ "pixclock_in_ps %i (calculated %i)\n",
+ var->xres_virtual, var->yres_virtual,
+ pixclock, pixclock_in_ps);
+ DPRINTK(" Dot clock: %i MHz\n",
+ 1000000 / pixclock_in_ps);
DPRINTK(" Horizontal sync: %i kHz\n", hSync);
DPRINTK(" Vertical refresh: %i Hz\n", vRefresh);
DPRINTK(" x style: %i.%03i %i %i %i %i %i %i %i %i\n",
@@ -1448,7 +1480,8 @@
base = 0x2000;
printk("debug atyfb: Mach64 non-shadow register values:");
for (i = 0; i < 256; i = i+4) {
- if(i%16 == 0) printk("\ndebug atyfb: 0x%04X: ", base + i);
+ if (i % 16 == 0)
+ printk("\ndebug atyfb: 0x%04X: ", base + i);
printk(" %08X", aty_ld_le32(i, par));
}
printk("\n\n");
@@ -1458,8 +1491,10 @@
base = 0x00;
printk("debug atyfb: Mach64 PLL register values:");
for (i = 0; i < 64; i++) {
- if(i%16 == 0) printk("\ndebug atyfb: 0x%02X: ", base + i);
- if(i%4 == 0) printk(" ");
+ if (i % 16 == 0)
+ printk("\ndebug atyfb: 0x%02X: ", base + i);
+ if (i % 4 == 0)
+ printk(" ");
printk("%02X", aty_ld_pll_ct(i, par));
}
printk("\n\n");
@@ -1470,19 +1505,21 @@
/* LCD registers */
base = 0x00;
printk("debug atyfb: LCD register values:");
- if(M64_HAS(LT_LCD_REGS)) {
- for(i = 0; i <= POWER_MANAGEMENT; i++) {
- if(i == EXT_VERT_STRETCH)
- continue;
- printk("\ndebug atyfb: 0x%04X: ", lt_lcd_regs[i]);
- printk(" %08X", aty_ld_lcd(i, par));
- }
-
+ if (M64_HAS(LT_LCD_REGS)) {
+ for (i = 0; i <= POWER_MANAGEMENT; i++) {
+ if (i == EXT_VERT_STRETCH)
+ continue;
+ printk("\ndebug atyfb: 0x%04X: ",
+ lt_lcd_regs[i]);
+ printk(" %08X", aty_ld_lcd(i, par));
+ }
} else {
- for (i = 0; i < 64; i++) {
- if(i%4 == 0) printk("\ndebug atyfb: 0x%02X: ", base + i);
- printk(" %08X", aty_ld_lcd(i, par));
- }
+ for (i = 0; i < 64; i++) {
+ if (i % 4 == 0)
+ printk("\ndebug atyfb: 0x%02X: ",
+ base + i);
+ printk(" %08X", aty_ld_lcd(i, par));
+ }
}
printk("\n\n");
}
@@ -1500,9 +1537,10 @@
union aty_pll pll;
u32 pixclock;
- memcpy(&pll, &(par->pll), sizeof(pll));
+ memcpy(&pll, &par->pll, sizeof(pll));
- if((err = aty_var_to_crtc(info, var, &crtc)))
+ err = aty_var_to_crtc(info, var, &crtc);
+ if (err)
return err;
pixclock = atyfb_get_pixclock(var, par);
@@ -1512,7 +1550,9 @@
PRINTKE("Invalid pixclock\n");
return -EINVAL;
} else {
- if((err = par->pll_ops->var_to_pll(info, pixclock, var->bits_per_pixel, &pll)))
+ err = par->pll_ops->var_to_pll(info, pixclock,
+ var->bits_per_pixel, &pll);
+ if (err)
return err;
}
@@ -1539,9 +1579,9 @@
}
- /*
- * Open/Release the frame buffer device
- */
+/*
+ * Open/Release the frame buffer device
+ */
static int atyfb_open(struct fb_info *info, int user)
{
@@ -1553,7 +1593,7 @@
par->mmaped = 0;
#endif
}
- return (0);
+ return 0;
}
static irqreturn_t aty_irq(int irq, void *dev_id)
@@ -1568,7 +1608,8 @@
if (int_cntl & CRTC_VBLANK_INT) {
/* clear interrupt */
- aty_st_le32(CRTC_INT_CNTL, (int_cntl & CRTC_INT_EN_MASK) | CRTC_VBLANK_INT_AK, par);
+ aty_st_le32(CRTC_INT_CNTL, (int_cntl & CRTC_INT_EN_MASK) |
+ CRTC_VBLANK_INT_AK, par);
par->vblank.count++;
if (par->vblank.pan_display) {
par->vblank.pan_display = 0;
@@ -1603,9 +1644,11 @@
spin_lock_irq(&par->int_lock);
int_cntl = aty_ld_le32(CRTC_INT_CNTL, par) & CRTC_INT_EN_MASK;
if (!(int_cntl & CRTC_VBLANK_INT_EN)) {
- printk("atyfb: someone disabled IRQ [%08x]\n", int_cntl);
+ printk("atyfb: someone disabled IRQ [%08x]\n",
+ int_cntl);
/* re-enable interrupt */
- aty_st_le32(CRTC_INT_CNTL, int_cntl | CRTC_VBLANK_INT_EN, par );
+ aty_st_le32(CRTC_INT_CNTL, int_cntl |
+ CRTC_VBLANK_INT_EN, par);
}
spin_unlock_irq(&par->int_lock);
}
@@ -1625,7 +1668,7 @@
spin_lock_irq(&par->int_lock);
int_cntl = aty_ld_le32(CRTC_INT_CNTL, par) & CRTC_INT_EN_MASK;
/* disable interrupt */
- aty_st_le32(CRTC_INT_CNTL, int_cntl & ~CRTC_VBLANK_INT_EN, par );
+ aty_st_le32(CRTC_INT_CNTL, int_cntl & ~CRTC_VBLANK_INT_EN, par);
spin_unlock_irq(&par->int_lock);
free_irq(par->irq, par);
}
@@ -1636,50 +1679,62 @@
static int atyfb_release(struct fb_info *info, int user)
{
struct atyfb_par *par = (struct atyfb_par *) info->par;
- if (user) {
- par->open--;
- mdelay(1);
- wait_for_idle(par);
- if (!par->open) {
#ifdef __sparc__
- int was_mmaped = par->mmaped;
-
- par->mmaped = 0;
-
- if (was_mmaped) {
- struct fb_var_screeninfo var;
-
- /* Now reset the default display config, we have no
- * idea what the program(s) which mmap'd the chip did
- * to the configuration, nor whether it restored it
- * correctly.
- */
- var = default_var;
- if (noaccel)
- var.accel_flags &= ~FB_ACCELF_TEXT;
- else
- var.accel_flags |= FB_ACCELF_TEXT;
- if (var.yres == var.yres_virtual) {
- u32 videoram = (info->fix.smem_len - (PAGE_SIZE << 2));
- var.yres_virtual = ((videoram * 8) / var.bits_per_pixel) / var.xres_virtual;
- if (var.yres_virtual < var.yres)
- var.yres_virtual = var.yres;
- }
- }
+ int was_mmaped;
#endif
- aty_disable_irq(par);
+
+ if (!user)
+ return 0;
+
+ par->open--;
+ mdelay(1);
+ wait_for_idle(par);
+
+ if (par->open)
+ return 0;
+
+#ifdef __sparc__
+ was_mmaped = par->mmaped;
+
+ par->mmaped = 0;
+
+ if (was_mmaped) {
+ struct fb_var_screeninfo var;
+
+ /*
+ * Now reset the default display config, we have
+ * no idea what the program(s) which mmap'd the
+ * chip did to the configuration, nor whether it
+ * restored it correctly.
+ */
+ var = default_var;
+ if (noaccel)
+ var.accel_flags &= ~FB_ACCELF_TEXT;
+ else
+ var.accel_flags |= FB_ACCELF_TEXT;
+ if (var.yres == var.yres_virtual) {
+ u32 videoram = (info->fix.smem_len - (PAGE_SIZE << 2));
+ var.yres_virtual =
+ ((videoram * 8) / var.bits_per_pixel) /
+ var.xres_virtual;
+ if (var.yres_virtual < var.yres)
+ var.yres_virtual = var.yres;
}
}
- return (0);
+#endif
+ aty_disable_irq(par);
+
+ return 0;
}
- /*
- * Pan or Wrap the Display
- *
- * This call looks only at xoffset, yoffset and the FB_VMODE_YWRAP flag
- */
+/*
+ * Pan or Wrap the Display
+ *
+ * This call looks only at xoffset, yoffset and the FB_VMODE_YWRAP flag
+ */
-static int atyfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info)
+static int atyfb_pan_display(struct fb_var_screeninfo *var,
+ struct fb_info *info)
{
struct atyfb_par *par = (struct atyfb_par *) info->par;
u32 xres, yres, xoffset, yoffset;
@@ -1690,7 +1745,8 @@
yres >>= 1;
xoffset = (var->xoffset + 7) & ~7;
yoffset = var->yoffset;
- if (xoffset + xres > par->crtc.vxres || yoffset + yres > par->crtc.vyres)
+ if (xoffset + xres > par->crtc.vxres ||
+ yoffset + yres > par->crtc.vyres)
return -EINVAL;
info->var.xoffset = xoffset;
info->var.yoffset = yoffset;
@@ -1727,10 +1783,10 @@
return ret;
count = vbl->count;
- ret = wait_event_interruptible_timeout(vbl->wait, count != vbl->count, HZ/10);
- if (ret < 0) {
+ ret = wait_event_interruptible_timeout(vbl->wait,
+ count != vbl->count, HZ/10);
+ if (ret < 0)
return ret;
- }
if (ret == 0) {
aty_enable_irq(par, 1);
return -ETIMEDOUT;
@@ -1784,7 +1840,8 @@
fbtyp.fb_depth = info->var.bits_per_pixel;
fbtyp.fb_cmsize = info->cmap.len;
fbtyp.fb_size = info->fix.smem_len;
- if (copy_to_user((struct fbtype __user *) arg, &fbtyp, sizeof(fbtyp)))
+ if (copy_to_user((struct fbtype __user *) arg, &fbtyp,
+ sizeof(fbtyp)))
return -EFAULT;
break;
#endif /* __sparc__ */
@@ -1804,7 +1861,7 @@
case ATYIO_CLKR:
if (M64_HAS(INTEGRATED)) {
struct atyclk clk;
- union aty_pll *pll = &(par->pll);
+ union aty_pll *pll = &par->pll;
u32 dsp_config = pll->ct.dsp_config;
u32 dsp_on_off = pll->ct.dsp_on_off;
clk.ref_clk_per = par->ref_clk_per;
@@ -1829,8 +1886,9 @@
case ATYIO_CLKW:
if (M64_HAS(INTEGRATED)) {
struct atyclk clk;
- union aty_pll *pll = &(par->pll);
- if (copy_from_user(&clk, (struct atyclk __user *) arg, sizeof(clk)))
+ union aty_pll *pll = &par->pll;
+ if (copy_from_user(&clk, (struct atyclk __user *) arg,
+ sizeof(clk)))
return -EFAULT;
par->ref_clk_per = clk.ref_clk_per;
pll->ct.pll_ref_div = clk.pll_ref_div;
@@ -1841,8 +1899,10 @@
pll->ct.vclk_fb_div = clk.vclk_fb_div;
pll->ct.vclk_post_div_real = clk.vclk_post_div;
pll->ct.dsp_config = (clk.dsp_xclks_per_row & 0x3fff) |
- ((clk.dsp_loop_latency & 0xf)<<16)| ((clk.dsp_precision & 7)<<20);
- pll->ct.dsp_on_off = (clk.dsp_off & 0x7ff) | ((clk.dsp_on & 0x7ff)<<16);
+ ((clk.dsp_loop_latency & 0xf) << 16) |
+ ((clk.dsp_precision & 7) << 20);
+ pll->ct.dsp_on_off = (clk.dsp_off & 0x7ff) |
+ ((clk.dsp_on & 0x7ff) << 16);
/*aty_calc_pll_ct(info, &pll->ct);*/
aty_set_pll_ct(info, pll);
} else
@@ -1913,8 +1973,7 @@
continue;
map_size = par->mmap_map[i].size - (offset - start);
- map_offset =
- par->mmap_map[i].poff + (offset - start);
+ map_offset = par->mmap_map[i].poff + (offset - start);
break;
}
if (!map_size) {
@@ -1924,8 +1983,7 @@
if (page + map_size > size)
map_size = size - page;
- pgprot_val(vma->vm_page_prot) &=
- ~(par->mmap_map[i].prot_mask);
+ pgprot_val(vma->vm_page_prot) &= ~(par->mmap_map[i].prot_mask);
pgprot_val(vma->vm_page_prot) |= par->mmap_map[i].prot_flag;
if (remap_pfn_range(vma, vma->vm_start + page,
@@ -2029,7 +2087,8 @@
par->asleep = 1;
par->lock_blank = 1;
- /* Because we may change PCI D state ourselves, we need to
+ /*
+ * Because we may change PCI D state ourselves, we need to
* first save the config space content so the core can
* restore it properly on resume.
*/
@@ -2080,7 +2139,8 @@
acquire_console_sem();
- /* PCI state will have been restored by the core, so
+ /*
+ * PCI state will have been restored by the core, so
* we should be in D0 now with our config space fully
* restored
*/
@@ -2192,8 +2252,8 @@
info->bl_dev = bd;
fb_bl_default_curve(info, 0,
- 0x3F * FB_BACKLIGHT_MAX / MAX_LEVEL,
- 0xFF * FB_BACKLIGHT_MAX / MAX_LEVEL);
+ 0x3F * FB_BACKLIGHT_MAX / MAX_LEVEL,
+ 0xFF * FB_BACKLIGHT_MAX / MAX_LEVEL);
bd->props.max_brightness = FB_BACKLIGHT_LEVELS - 1;
bd->props.brightness = bd->props.max_brightness;
@@ -2236,16 +2296,16 @@
size = ARRAY_SIZE(ragepro_tbl);
}
- for (i=0; i < size; i++) {
+ for (i = 0; i < size; i++) {
if (xclk < refresh_tbl[i])
- break;
+ break;
}
par->mem_refresh_rate = i;
}
- /*
- * Initialisation
- */
+/*
+ * Initialisation
+ */
static struct fb_info *fb_list = NULL;
@@ -2375,8 +2435,10 @@
}
#endif
#ifdef CONFIG_PPC_PMAC
- /* The Apple iBook1 uses non-standard memory frequencies. We detect it
- * and set the frequency manually. */
+ /*
+ * The Apple iBook1 uses non-standard memory frequencies.
+ * We detect it and set the frequency manually.
+ */
if (machine_is_compatible("PowerBook2,1")) {
par->pll_limits.mclk = 70;
par->pll_limits.xclk = 53;
@@ -2421,13 +2483,14 @@
/* save previous video mode */
aty_get_crtc(par, &par->saved_crtc);
- if(par->pll_ops->get_pll)
+ if (par->pll_ops->get_pll)
par->pll_ops->get_pll(info, &par->saved_pll);
par->mem_cntl = aty_ld_le32(MEM_CNTL, par);
gtb_memsize = M64_HAS(GTB_DSP);
if (gtb_memsize)
- switch (par->mem_cntl & 0xF) { /* 0xF used instead of MEM_SIZE_ALIAS */
+ /* 0xF used instead of MEM_SIZE_ALIAS */
+ switch (par->mem_cntl & 0xF) {
case MEM_SIZE_512K:
info->fix.smem_len = 0x80000;
break;
@@ -2496,8 +2559,8 @@
}
/*
- * Reg Block 0 (CT-compatible block) is at mmio_start
- * Reg Block 1 (multimedia extensions) is at mmio_start - 0x400
+ * Reg Block 0 (CT-compatible block) is at mmio_start
+ * Reg Block 1 (multimedia extensions) is at mmio_start - 0x400
*/
if (M64_HAS(GX)) {
info->fix.mmio_len = 0x400;
@@ -2516,84 +2579,98 @@
}
PRINTKI("%d%c %s, %s MHz XTAL, %d MHz PLL, %d Mhz MCLK, %d MHz XCLK\n",
- info->fix.smem_len == 0x80000 ? 512 : (info->fix.smem_len >> 20),
- info->fix.smem_len == 0x80000 ? 'K' : 'M', ramname, xtal, par->pll_limits.pll_max,
- par->pll_limits.mclk, par->pll_limits.xclk);
+ info->fix.smem_len == 0x80000 ? 512 : (info->fix.smem_len>>20),
+ info->fix.smem_len == 0x80000 ? 'K' : 'M', ramname, xtal,
+ par->pll_limits.pll_max, par->pll_limits.mclk,
+ par->pll_limits.xclk);
#if defined(DEBUG) && defined(CONFIG_FB_ATY_CT)
if (M64_HAS(INTEGRATED)) {
int i;
- printk("debug atyfb: BUS_CNTL DAC_CNTL MEM_CNTL EXT_MEM_CNTL CRTC_GEN_CNTL "
- "DSP_CONFIG DSP_ON_OFF CLOCK_CNTL\n"
- "debug atyfb: %08x %08x %08x %08x %08x %08x %08x %08x\n"
+ printk("debug atyfb: BUS_CNTL DAC_CNTL MEM_CNTL "
+ "EXT_MEM_CNTL CRTC_GEN_CNTL DSP_CONFIG "
+ "DSP_ON_OFF CLOCK_CNTL\n"
+ "debug atyfb: %08x %08x %08x "
+ "%08x %08x %08x "
+ "%08x %08x\n"
"debug atyfb: PLL",
- aty_ld_le32(BUS_CNTL, par), aty_ld_le32(DAC_CNTL, par),
- aty_ld_le32(MEM_CNTL, par), aty_ld_le32(EXT_MEM_CNTL, par),
- aty_ld_le32(CRTC_GEN_CNTL, par), aty_ld_le32(DSP_CONFIG, par),
- aty_ld_le32(DSP_ON_OFF, par), aty_ld_le32(CLOCK_CNTL, par));
+ aty_ld_le32(BUS_CNTL, par),
+ aty_ld_le32(DAC_CNTL, par),
+ aty_ld_le32(MEM_CNTL, par),
+ aty_ld_le32(EXT_MEM_CNTL, par),
+ aty_ld_le32(CRTC_GEN_CNTL, par),
+ aty_ld_le32(DSP_CONFIG, par),
+ aty_ld_le32(DSP_ON_OFF, par),
+ aty_ld_le32(CLOCK_CNTL, par));
for (i = 0; i < 40; i++)
printk(" %02x", aty_ld_pll_ct(i, par));
printk("\n");
}
#endif
- if(par->pll_ops->init_pll)
+ if (par->pll_ops->init_pll)
par->pll_ops->init_pll(info, &par->pll);
if (par->pll_ops->resume_pll)
par->pll_ops->resume_pll(info, &par->pll);
/*
- * Last page of 8 MB (4 MB on ISA) aperture is MMIO,
- * unless the auxiliary register aperture is used.
+ * Last page of 8 MB (4 MB on ISA) aperture is MMIO,
+ * unless the auxiliary register aperture is used.
*/
-
if (!par->aux_start &&
- (info->fix.smem_len == 0x800000 || (par->bus_type == ISA && info->fix.smem_len == 0x400000)))
+ (info->fix.smem_len == 0x800000 ||
+ (par->bus_type == ISA && info->fix.smem_len == 0x400000)))
info->fix.smem_len -= GUI_RESERVE;
/*
- * Disable register access through the linear aperture
- * if the auxiliary aperture is used so we can access
- * the full 8 MB of video RAM on 8 MB boards.
+ * Disable register access through the linear aperture
+ * if the auxiliary aperture is used so we can access
+ * the full 8 MB of video RAM on 8 MB boards.
*/
if (par->aux_start)
- aty_st_le32(BUS_CNTL, aty_ld_le32(BUS_CNTL, par) | BUS_APER_REG_DIS, par);
+ aty_st_le32(BUS_CNTL, aty_ld_le32(BUS_CNTL, par) |
+ BUS_APER_REG_DIS, par);
#ifdef CONFIG_MTRR
par->mtrr_aper = -1;
par->mtrr_reg = -1;
if (!nomtrr) {
/* Cover the whole resource. */
- par->mtrr_aper = mtrr_add(par->res_start, par->res_size, MTRR_TYPE_WRCOMB, 1);
- if (par->mtrr_aper >= 0 && !par->aux_start) {
+ par->mtrr_aper = mtrr_add(par->res_start, par->res_size,
+ MTRR_TYPE_WRCOMB, 1);
+ if (par->mtrr_aper >= 0 && !par->aux_start) {
/* Make a hole for mmio. */
- par->mtrr_reg = mtrr_add(par->res_start + 0x800000 - GUI_RESERVE,
- GUI_RESERVE, MTRR_TYPE_UNCACHABLE, 1);
+ par->mtrr_reg = mtrr_add(par->res_start + 0x800000 -
+ GUI_RESERVE, GUI_RESERVE,
+ MTRR_TYPE_UNCACHABLE, 1);
if (par->mtrr_reg < 0) {
mtrr_del(par->mtrr_aper, 0, 0);
par->mtrr_aper = -1;
}
- }
+ }
}
#endif
info->fbops = &atyfb_ops;
info->pseudo_palette = par->pseudo_palette;
info->flags = FBINFO_DEFAULT |
- FBINFO_HWACCEL_IMAGEBLIT |
- FBINFO_HWACCEL_FILLRECT |
- FBINFO_HWACCEL_COPYAREA |
- FBINFO_HWACCEL_YPAN;
+ FBINFO_HWACCEL_IMAGEBLIT |
+ FBINFO_HWACCEL_FILLRECT |
+ FBINFO_HWACCEL_COPYAREA |
+ FBINFO_HWACCEL_YPAN;
#ifdef CONFIG_PMAC_BACKLIGHT
if (M64_HAS(G3_PB_1_1) && machine_is_compatible("PowerBook1,1")) {
- /* these bits let the 101 powerbook wake up from sleep -- paulus */
- aty_st_lcd(POWER_MANAGEMENT, aty_ld_lcd(POWER_MANAGEMENT, par)
- | (USE_F32KHZ | TRISTATE_MEM_EN), par);
+ /*
+ * these bits let the 101 powerbook
+ * wake up from sleep -- paulus
+ */
+ aty_st_lcd(POWER_MANAGEMENT, aty_ld_lcd(POWER_MANAGEMENT, par) |
+ USE_F32KHZ | TRISTATE_MEM_EN, par);
} else
#endif
if (M64_HAS(MOBIL_BUS) && backlight) {
#ifdef CONFIG_FB_ATY_BACKLIGHT
- aty_bl_init (par);
+ aty_bl_init(par);
#endif
}
@@ -2601,8 +2678,8 @@
#ifdef CONFIG_PPC
if (machine_is(powermac)) {
/*
- * FIXME: The NVRAM stuff should be put in a Mac-specific file, as it
- * applies to all Mac video cards
+ * FIXME: The NVRAM stuff should be put in a Mac-specific file,
+ * as it applies to all Mac video cards
*/
if (mode) {
if (mac_find_mode(&var, info, mode, 8))
@@ -2615,8 +2692,7 @@
default_vmode = VMODE_1024_768_60;
else if (machine_is_compatible("iMac"))
default_vmode = VMODE_1024_768_75;
- else if (machine_is_compatible
- ("PowerBook2,1"))
+ else if (machine_is_compatible("PowerBook2,1"))
/* iBook with 800x600 LCD */
default_vmode = VMODE_800_600_60;
else
@@ -2630,7 +2706,7 @@
if (default_cmode < CMODE_8 || default_cmode > CMODE_32)
default_cmode = CMODE_8;
if (!mac_vmode_to_var(default_vmode, default_cmode,
- &var))
+ &var))
has_var = 1;
}
}
@@ -2702,12 +2778,12 @@
#ifdef CONFIG_MTRR
if (par->mtrr_reg >= 0) {
- mtrr_del(par->mtrr_reg, 0, 0);
- par->mtrr_reg = -1;
+ mtrr_del(par->mtrr_reg, 0, 0);
+ par->mtrr_reg = -1;
}
if (par->mtrr_aper >= 0) {
- mtrr_del(par->mtrr_aper, 0, 0);
- par->mtrr_aper = -1;
+ mtrr_del(par->mtrr_aper, 0, 0);
+ par->mtrr_aper = -1;
}
#endif
return ret;
@@ -2735,18 +2811,18 @@
phys_size[m64_num] = size;
phys_guiregbase[m64_num] = guiregbase;
PRINTKI("stored them all: $%08lX $%08lX $%08lX \n", vmembase, size,
- guiregbase);
+ guiregbase);
return 0;
- mach64_invalid:
+ mach64_invalid:
phys_vmembase[m64_num] = 0;
return -1;
}
#endif /* CONFIG_ATARI */
- /*
- * Blank the display.
- */
+/*
+ * Blank the display.
+ */
static int atyfb_blank(int blank, struct fb_info *info)
{
@@ -2768,20 +2844,20 @@
gen_cntl = aty_ld_le32(CRTC_GEN_CNTL, par);
gen_cntl &= ~0x400004c;
switch (blank) {
- case FB_BLANK_UNBLANK:
- break;
- case FB_BLANK_NORMAL:
- gen_cntl |= 0x4000040;
- break;
- case FB_BLANK_VSYNC_SUSPEND:
- gen_cntl |= 0x4000048;
- break;
- case FB_BLANK_HSYNC_SUSPEND:
- gen_cntl |= 0x4000044;
- break;
- case FB_BLANK_POWERDOWN:
- gen_cntl |= 0x400004c;
- break;
+ case FB_BLANK_UNBLANK:
+ break;
+ case FB_BLANK_NORMAL:
+ gen_cntl |= 0x4000040;
+ break;
+ case FB_BLANK_VSYNC_SUSPEND:
+ gen_cntl |= 0x4000048;
+ break;
+ case FB_BLANK_HSYNC_SUSPEND:
+ gen_cntl |= 0x4000044;
+ break;
+ case FB_BLANK_POWERDOWN:
+ gen_cntl |= 0x400004c;
+ break;
}
aty_st_le32(CRTC_GEN_CNTL, gen_cntl, par);
@@ -2806,15 +2882,15 @@
aty_st_8(DAC_DATA, blue, par);
}
- /*
- * Set a single color register. The values supplied are already
- * rounded down to the hardware's capabilities (according to the
- * entries in the var structure). Return != 0 for invalid regno.
- * !! 4 & 8 = PSEUDO, > 8 = DIRECTCOLOR
- */
+/*
+ * Set a single color register. The values supplied are already
+ * rounded down to the hardware's capabilities (according to the
+ * entries in the var structure). Return != 0 for invalid regno.
+ * !! 4 & 8 = PSEUDO, > 8 = DIRECTCOLOR
+ */
static int atyfb_setcolreg(u_int regno, u_int red, u_int green, u_int blue,
- u_int transp, struct fb_info *info)
+ u_int transp, struct fb_info *info)
{
struct atyfb_par *par = (struct atyfb_par *) info->par;
int i, depth;
@@ -2868,16 +2944,15 @@
if (depth == 16) {
if (regno < 32)
aty_st_pal(regno << 3, red,
- par->palette[regno<<1].green,
+ par->palette[regno << 1].green,
blue, par);
- red = par->palette[regno>>1].red;
- blue = par->palette[regno>>1].blue;
+ red = par->palette[regno >> 1].red;
+ blue = par->palette[regno >> 1].blue;
regno <<= 2;
} else if (depth == 15) {
regno <<= 3;
- for(i = 0; i < 8; i++) {
- aty_st_pal(regno + i, red, green, blue, par);
- }
+ for (i = 0; i < 8; i++)
+ aty_st_pal(regno + i, red, green, blue, par);
}
}
aty_st_pal(regno, red, green, blue, par);
@@ -2890,7 +2965,8 @@
#ifdef __sparc__
static int __devinit atyfb_setup_sparc(struct pci_dev *pdev,
- struct fb_info *info, unsigned long addr)
+ struct fb_info *info,
+ unsigned long addr)
{
struct atyfb_par *par = info->par;
struct device_node *dp;
@@ -2978,7 +3054,8 @@
j++;
}
- if((ret = correct_chipset(par)))
+ ret = correct_chipset(par);
+ if (ret)
return ret;
if (IS_XL(pdev->device)) {
@@ -3108,28 +3185,28 @@
u32 driv_inf_tab, sig;
u16 lcd_ofs;
- /* To support an LCD panel, we should know it's dimensions and
+ /*
+ * To support an LCD panel, we should know it's dimensions and
* it's desired pixel clock.
* There are two ways to do it:
* - Check the startup video mode and calculate the panel
* size from it. This is unreliable.
* - Read it from the driver information table in the video BIOS.
- */
+ */
/* Address of driver information table is at offset 0x78. */
driv_inf_tab = bios_base + *((u16 *)(bios_base+0x78));
/* Check for the driver information table signature. */
- sig = (*(u32 *)driv_inf_tab);
+ sig = *(u32 *)driv_inf_tab;
if ((sig == 0x54504c24) || /* Rage LT pro */
- (sig == 0x544d5224) || /* Rage mobility */
- (sig == 0x54435824) || /* Rage XC */
- (sig == 0x544c5824)) { /* Rage XL */
+ (sig == 0x544d5224) || /* Rage mobility */
+ (sig == 0x54435824) || /* Rage XC */
+ (sig == 0x544c5824)) { /* Rage XL */
PRINTKI("BIOS contains driver information table.\n");
- lcd_ofs = (*(u16 *)(driv_inf_tab + 10));
+ lcd_ofs = *(u16 *)(driv_inf_tab + 10);
par->lcd_table = 0;
- if (lcd_ofs != 0) {
+ if (lcd_ofs != 0)
par->lcd_table = bios_base + lcd_ofs;
- }
}
if (par->lcd_table != 0) {
@@ -3144,14 +3221,16 @@
u16 width, height, panel_type, refresh_rates;
u16 *lcdmodeptr;
u32 format;
- u8 lcd_refresh_rates[16] = {50,56,60,67,70,72,75,76,85,90,100,120,140,150,160,200};
- /* The most important information is the panel size at
+ u8 lcd_refresh_rates[16] = { 50, 56, 60, 67, 70, 72, 75, 76, 85,
+ 90, 100, 120, 140, 150, 160, 200 };
+ /*
+ * The most important information is the panel size at
* offset 25 and 27, but there's some other nice information
* which we print to the screen.
*/
id = *(u8 *)par->lcd_table;
- strncpy(model,(char *)par->lcd_table+1,24);
- model[23]=0;
+ strncpy(model, (char *)par->lcd_table+1, 24);
+ model[23] = 0;
width = par->lcd_width = *(u16 *)(par->lcd_table+25);
height = par->lcd_height = *(u16 *)(par->lcd_table+27);
@@ -3164,7 +3243,7 @@
txtdual = "dual (split) ";
else
txtdual = "";
- tech = (panel_type>>2) & 63;
+ tech = (panel_type >> 2) & 63;
switch (tech) {
case 0:
txtmonitor = "passive matrix";
@@ -3224,22 +3303,24 @@
}
}
PRINTKI("%s%s %s monitor detected: %s\n",
- txtdual ,txtcolour, txtmonitor, model);
+ txtdual, txtcolour, txtmonitor, model);
PRINTKI(" id=%d, %dx%d pixels, %s\n",
id, width, height, txtformat);
refresh_rates_buf[0] = 0;
refresh_rates = *(u16 *)(par->lcd_table+62);
m = 1;
f = 0;
- for (i=0;i<16;i++) {
+ for (i = 0; i < 16; i++) {
if (refresh_rates & m) {
if (f == 0) {
- sprintf(strbuf, "%d", lcd_refresh_rates[i]);
+ sprintf(strbuf, "%d",
+ lcd_refresh_rates[i]);
f++;
} else {
- sprintf(strbuf, ",%d", lcd_refresh_rates[i]);
+ sprintf(strbuf, ",%d",
+ lcd_refresh_rates[i]);
}
- strcat(refresh_rates_buf,strbuf);
+ strcat(refresh_rates_buf, strbuf);
}
m = m << 1;
}
@@ -3247,7 +3328,8 @@
PRINTKI(" supports refresh rates [%s], default %d Hz\n",
refresh_rates_buf, lcd_refresh_rates[default_refresh_rate]);
par->lcd_refreshrate = lcd_refresh_rates[default_refresh_rate];
- /* We now need to determine the crtc parameters for the
+ /*
+ * We now need to determine the crtc parameters for the
* LCD monitor. This is tricky, because they are not stored
* individually in the BIOS. Instead, the BIOS contains a
* table of display modes that work for this monitor.
@@ -3382,7 +3464,9 @@
}
#endif /* __i386__ */
-static int __devinit atyfb_setup_generic(struct pci_dev *pdev, struct fb_info *info, unsigned long addr)
+static int __devinit atyfb_setup_generic(struct pci_dev *pdev,
+ struct fb_info *info,
+ unsigned long addr)
{
struct atyfb_par *par = info->par;
u16 tmp;
@@ -3429,10 +3513,12 @@
goto atyfb_setup_generic_fail;
}
- if((ret = correct_chipset(par)))
+ ret = correct_chipset(par);
+ if (ret)
goto atyfb_setup_generic_fail;
#ifdef __i386__
- if((ret = init_from_bios(par)))
+ ret = init_from_bios(par);
+ if (ret)
goto atyfb_setup_generic_fail;
#endif
if (!(aty_ld_le32(CRTC_GEN_CNTL, par) & CRTC_EXT_DISP_EN))
@@ -3457,7 +3543,8 @@
#endif /* !__sparc__ */
-static int __devinit atyfb_pci_probe(struct pci_dev *pdev, const struct pci_device_id *ent)
+static int __devinit atyfb_pci_probe(struct pci_dev *pdev,
+ const struct pci_device_id *ent)
{
unsigned long addr, res_start, res_size;
struct fb_info *info;
@@ -3482,10 +3569,10 @@
/* Reserve space */
res_start = rp->start;
res_size = rp->end - rp->start + 1;
- if (!request_mem_region (res_start, res_size, "atyfb"))
+ if (!request_mem_region(res_start, res_size, "atyfb"))
return -EBUSY;
- /* Allocate framebuffer */
+ /* Allocate framebuffer */
info = framebuffer_alloc(sizeof(struct atyfb_par), &pdev->dev);
if (!info) {
PRINTKE("atyfb_pci_probe() can't alloc fb_info\n");
@@ -3573,7 +3660,8 @@
for (m64_num = 0; m64_num < mach64_count; m64_num++) {
if (!phys_vmembase[m64_num] || !phys_size[m64_num] ||
!phys_guiregbase[m64_num]) {
- PRINTKI("phys_*[%d] parameters not set => returning early. \n", m64_num);
+ PRINTKI("phys_*[%d] parameters not set => "
+ "returning early. \n", m64_num);
continue;
}
@@ -3589,8 +3677,8 @@
par->irq = (unsigned int) -1; /* something invalid */
/*
- * Map the video memory (physical address given) to somewhere in the
- * kernel address space.
+ * Map the video memory (physical address given)
+ * to somewhere in the kernel address space.
*/
info->screen_base = ioremap(phys_vmembase[m64_num], phys_size[m64_num]);
info->fix.smem_start = (unsigned long)info->screen_base; /* Fake! */
@@ -3661,12 +3749,12 @@
#ifdef CONFIG_MTRR
if (par->mtrr_reg >= 0) {
- mtrr_del(par->mtrr_reg, 0, 0);
- par->mtrr_reg = -1;
+ mtrr_del(par->mtrr_reg, 0, 0);
+ par->mtrr_reg = -1;
}
if (par->mtrr_aper >= 0) {
- mtrr_del(par->mtrr_aper, 0, 0);
- par->mtrr_aper = -1;
+ mtrr_del(par->mtrr_aper, 0, 0);
+ par->mtrr_aper = -1;
}
#endif
#ifndef __sparc__
@@ -3900,29 +3988,29 @@
static int __init atyfb_init(void)
{
- int err1 = 1, err2 = 1;
+ int err1 = 1, err2 = 1;
#ifndef MODULE
- char *option = NULL;
+ char *option = NULL;
- if (fb_get_options("atyfb", &option))
- return -ENODEV;
- atyfb_setup(option);
+ if (fb_get_options("atyfb", &option))
+ return -ENODEV;
+ atyfb_setup(option);
#endif
#ifdef CONFIG_PCI
- err1 = pci_register_driver(&atyfb_driver);
+ err1 = pci_register_driver(&atyfb_driver);
#endif
#ifdef CONFIG_ATARI
- err2 = atyfb_atari_probe();
+ err2 = atyfb_atari_probe();
#endif
- if (err1 && err2)
- return -ENODEV;
+ if (err1 && err2)
+ return -ENODEV;
- if (dmi_check_system(atyfb_reboot_ids))
- register_reboot_notifier(&atyfb_reboot_notifier);
+ if (dmi_check_system(atyfb_reboot_ids))
+ register_reboot_notifier(&atyfb_reboot_notifier);
- return 0;
+ return 0;
}
static void __exit atyfb_exit(void)
@@ -3951,8 +4039,7 @@
module_param(xclk, int, 0);
MODULE_PARM_DESC(xclk, "int: override accelerated engine clock");
module_param(comp_sync, int, 0);
-MODULE_PARM_DESC(comp_sync,
- "Set composite sync signal to low (0) or high (1)");
+MODULE_PARM_DESC(comp_sync, "Set composite sync signal to low (0) or high (1)");
module_param(mode, charp, 0);
MODULE_PARM_DESC(mode, "Specify resolution as \"<xres>x<yres>[-<bpp>][@<refresh>]\" ");
#ifdef CONFIG_MTRR
diff --git a/drivers/video/au1100fb.c b/drivers/video/au1100fb.c
index 378f277..a699aab 100644
--- a/drivers/video/au1100fb.c
+++ b/drivers/video/au1100fb.c
@@ -715,8 +715,11 @@
}
/* Mode option (only option that start with digit) */
else if (isdigit(this_opt[0])) {
- mode = kmalloc(strlen(this_opt) + 1, GFP_KERNEL);
- strncpy(mode, this_opt, strlen(this_opt) + 1);
+ mode = kstrdup(this_opt, GFP_KERNEL);
+ if (!mode) {
+ print_err("memory allocation failed");
+ return -ENOMEM;
+ }
}
/* Unsupported option */
else {
diff --git a/drivers/video/backlight/corgi_lcd.c b/drivers/video/backlight/corgi_lcd.c
index f8a4bb2..2211a85 100644
--- a/drivers/video/backlight/corgi_lcd.c
+++ b/drivers/video/backlight/corgi_lcd.c
@@ -639,3 +639,4 @@
MODULE_DESCRIPTION("LCD and backlight driver for SHARP C7x0/Cxx00");
MODULE_AUTHOR("Eric Miao <eric.miao@marvell.com>");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:corgi-lcd");
diff --git a/drivers/video/backlight/ltv350qv.c b/drivers/video/backlight/ltv350qv.c
index 2eb206b..4631ca8f 100644
--- a/drivers/video/backlight/ltv350qv.c
+++ b/drivers/video/backlight/ltv350qv.c
@@ -328,3 +328,4 @@
MODULE_AUTHOR("Haavard Skinnemoen <hskinnemoen@atmel.com>");
MODULE_DESCRIPTION("Samsung LTV350QV LCD Driver");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ltv350qv");
diff --git a/drivers/video/backlight/tdo24m.c b/drivers/video/backlight/tdo24m.c
index 51422fc..bbfb502 100644
--- a/drivers/video/backlight/tdo24m.c
+++ b/drivers/video/backlight/tdo24m.c
@@ -472,3 +472,4 @@
MODULE_AUTHOR("Eric Miao <eric.miao@marvell.com>");
MODULE_DESCRIPTION("Driver for Toppoly TDO24M LCD Panel");
MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:tdo24m");
diff --git a/drivers/video/backlight/tosa_lcd.c b/drivers/video/backlight/tosa_lcd.c
index b7fbc75..50ec17d 100644
--- a/drivers/video/backlight/tosa_lcd.c
+++ b/drivers/video/backlight/tosa_lcd.c
@@ -300,4 +300,4 @@
MODULE_AUTHOR("Dmitry Baryshkov");
MODULE_LICENSE("GPL v2");
MODULE_DESCRIPTION("LCD/Backlight control for Sharp SL-6000 PDA");
-
+MODULE_ALIAS("spi:tosa-lcd");
diff --git a/drivers/video/backlight/vgg2432a4.c b/drivers/video/backlight/vgg2432a4.c
index 8e653b8..b49063c 100644
--- a/drivers/video/backlight/vgg2432a4.c
+++ b/drivers/video/backlight/vgg2432a4.c
@@ -280,5 +280,4 @@
MODULE_AUTHOR("Ben Dooks <ben-linux@fluff.org>");
MODULE_DESCRIPTION("VGG2432A4 LCD Driver");
MODULE_LICENSE("GPL v2");
-
-
+MODULE_ALIAS("spi:VGG2432A4");
diff --git a/drivers/video/console/bitblit.c b/drivers/video/console/bitblit.c
index 69864b1..6b7c8fb 100644
--- a/drivers/video/console/bitblit.c
+++ b/drivers/video/console/bitblit.c
@@ -25,7 +25,7 @@
struct vc_data *vc)
{
int i, offset = (vc->vc_font.height < 10) ? 1 : 2;
- int width = (vc->vc_font.width + 7) >> 3;
+ int width = DIV_ROUND_UP(vc->vc_font.width, 8);
unsigned int cellsize = vc->vc_font.height * width;
u8 c;
@@ -144,7 +144,7 @@
int fg, int bg)
{
struct fb_image image;
- u32 width = (vc->vc_font.width + 7)/8;
+ u32 width = DIV_ROUND_UP(vc->vc_font.width, 8);
u32 cellsize = width * vc->vc_font.height;
u32 maxcnt = info->pixmap.size/cellsize;
u32 scan_align = info->pixmap.scan_align - 1;
@@ -173,7 +173,7 @@
cnt = count;
image.width = vc->vc_font.width * cnt;
- pitch = ((image.width + 7) >> 3) + scan_align;
+ pitch = DIV_ROUND_UP(image.width, 8) + scan_align;
pitch &= ~scan_align;
size = pitch * image.height + buf_align;
size &= ~buf_align;
@@ -239,7 +239,7 @@
struct fb_cursor cursor;
struct fbcon_ops *ops = info->fbcon_par;
unsigned short charmask = vc->vc_hi_font_mask ? 0x1ff : 0xff;
- int w = (vc->vc_font.width + 7) >> 3, c;
+ int w = DIV_ROUND_UP(vc->vc_font.width, 8), c;
int y = real_y(ops->p, vc->vc_y);
int attribute, use_sw = (vc->vc_cursor_type & 0x10);
int err = 1;
diff --git a/drivers/video/console/fbcon.c b/drivers/video/console/fbcon.c
index 3a44695..5a686ce 100644
--- a/drivers/video/console/fbcon.c
+++ b/drivers/video/console/fbcon.c
@@ -114,6 +114,7 @@
static int fbcon_is_default = 1;
static int fbcon_has_exited;
static int primary_device = -1;
+static int fbcon_has_console_bind;
#ifdef CONFIG_FRAMEBUFFER_CONSOLE_DETECT_PRIMARY
static int map_override;
@@ -544,6 +545,8 @@
con2fb_map[i] = -1;
}
info_idx = -1;
+ } else {
+ fbcon_has_console_bind = 1;
}
return err;
@@ -725,7 +728,7 @@
int oldidx, int found)
{
struct fbcon_ops *ops = oldinfo->fbcon_par;
- int err = 0;
+ int err = 0, ret;
if (oldinfo->fbops->fb_release &&
oldinfo->fbops->fb_release(oldinfo, 0)) {
@@ -752,8 +755,14 @@
newinfo in an undefined state. Thus, a call to
fb_set_par() may be needed for the newinfo.
*/
- if (newinfo->fbops->fb_set_par)
- newinfo->fbops->fb_set_par(newinfo);
+ if (newinfo->fbops->fb_set_par) {
+ ret = newinfo->fbops->fb_set_par(newinfo);
+
+ if (ret)
+ printk(KERN_ERR "con2fb_release_oldinfo: "
+ "detected unhandled fb_set_par error, "
+ "error code %d\n", ret);
+ }
}
return err;
@@ -763,11 +772,18 @@
int unit, int show_logo)
{
struct fbcon_ops *ops = info->fbcon_par;
+ int ret;
ops->currcon = fg_console;
- if (info->fbops->fb_set_par && !(ops->flags & FBCON_FLAGS_INIT))
- info->fbops->fb_set_par(info);
+ if (info->fbops->fb_set_par && !(ops->flags & FBCON_FLAGS_INIT)) {
+ ret = info->fbops->fb_set_par(info);
+
+ if (ret)
+ printk(KERN_ERR "con2fb_init_display: detected "
+ "unhandled fb_set_par error, "
+ "error code %d\n", ret);
+ }
ops->flags |= FBCON_FLAGS_INIT;
ops->graphics = 0;
@@ -1006,7 +1022,7 @@
struct vc_data *svc = *default_mode;
struct display *t, *p = &fb_display[vc->vc_num];
int logo = 1, new_rows, new_cols, rows, cols, charcnt = 256;
- int cap;
+ int cap, ret;
if (info_idx == -1 || info == NULL)
return;
@@ -1092,8 +1108,15 @@
*/
if (CON_IS_VISIBLE(vc) && vc->vc_mode == KD_TEXT) {
if (info->fbops->fb_set_par &&
- !(ops->flags & FBCON_FLAGS_INIT))
- info->fbops->fb_set_par(info);
+ !(ops->flags & FBCON_FLAGS_INIT)) {
+ ret = info->fbops->fb_set_par(info);
+
+ if (ret)
+ printk(KERN_ERR "fbcon_init: detected "
+ "unhandled fb_set_par error, "
+ "error code %d\n", ret);
+ }
+
ops->flags |= FBCON_FLAGS_INIT;
}
@@ -2119,7 +2142,7 @@
struct fbcon_ops *ops;
struct display *p = &fb_display[vc->vc_num];
struct fb_var_screeninfo var;
- int i, prev_console, charcnt = 256;
+ int i, ret, prev_console, charcnt = 256;
info = registered_fb[con2fb_map[vc->vc_num]];
ops = info->fbcon_par;
@@ -2174,8 +2197,14 @@
if (old_info != NULL && (old_info != info ||
info->flags & FBINFO_MISC_ALWAYS_SETPAR)) {
- if (info->fbops->fb_set_par)
- info->fbops->fb_set_par(info);
+ if (info->fbops->fb_set_par) {
+ ret = info->fbops->fb_set_par(info);
+
+ if (ret)
+ printk(KERN_ERR "fbcon_switch: detected "
+ "unhandled fb_set_par error, "
+ "error code %d\n", ret);
+ }
if (old_info != info)
fbcon_del_cursor_timer(old_info);
@@ -2923,6 +2952,10 @@
ret = unbind_con_driver(&fb_con, first_fb_vc, last_fb_vc,
fbcon_is_default);
+
+ if (!ret)
+ fbcon_has_console_bind = 0;
+
return ret;
}
#else
@@ -2936,6 +2969,9 @@
{
int i, new_idx = -1, ret = 0;
+ if (!fbcon_has_console_bind)
+ return 0;
+
for (i = first_fb_vc; i <= last_fb_vc; i++) {
if (con2fb_map[i] != idx &&
con2fb_map[i] != -1) {
diff --git a/drivers/video/console/newport_con.c b/drivers/video/console/newport_con.c
index d31b203..3772433 100644
--- a/drivers/video/console/newport_con.c
+++ b/drivers/video/console/newport_con.c
@@ -216,7 +216,7 @@
}
newport_xsize = newport_ysize = 0;
- for (i = 0; linetable[i + 1] && (i < sizeof(linetable)); i += 2) {
+ for (i = 0; i < ARRAY_SIZE(linetable) - 1 && linetable[i + 1]; i += 2) {
cols = 0;
newport_vc2_set(npregs, VC2_IREG_RADDR, linetable[i]);
npregs->set.dcbmode = (NPORT_DMODE_AVC2 | VC2_REGADDR_RAM |
diff --git a/drivers/video/console/vgacon.c b/drivers/video/console/vgacon.c
index 74e96cf..da55cca 100644
--- a/drivers/video/console/vgacon.c
+++ b/drivers/video/console/vgacon.c
@@ -589,12 +589,14 @@
static void vgacon_deinit(struct vc_data *c)
{
- /* When closing the last console, reset video origin */
- if (!--vgacon_uni_pagedir[1]) {
+ /* When closing the active console, reset video origin */
+ if (CON_IS_VISIBLE(c)) {
c->vc_visible_origin = vga_vram_base;
vga_set_mem_top(c);
- con_free_unimap(c);
}
+
+ if (!--vgacon_uni_pagedir[1])
+ con_free_unimap(c);
c->vc_uni_pagedir_loc = &c->vc_uni_pagedir;
con_set_default_unimap(c);
}
diff --git a/drivers/video/da8xx-fb.c b/drivers/video/da8xx-fb.c
new file mode 100644
index 0000000..42e1005
--- /dev/null
+++ b/drivers/video/da8xx-fb.c
@@ -0,0 +1,890 @@
+/*
+ * Copyright (C) 2008-2009 MontaVista Software Inc.
+ * Copyright (C) 2008-2009 Texas Instruments Inc
+ *
+ * Based on the LCD driver for TI Avalanche processors written by
+ * Ajay Singh and Shalom Hai.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option)any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/fb.h>
+#include <linux/dma-mapping.h>
+#include <linux/device.h>
+#include <linux/platform_device.h>
+#include <linux/uaccess.h>
+#include <linux/device.h>
+#include <linux/interrupt.h>
+#include <linux/clk.h>
+#include <video/da8xx-fb.h>
+
+#define DRIVER_NAME "da8xx_lcdc"
+
+/* LCD Status Register */
+#define LCD_END_OF_FRAME0 BIT(8)
+#define LCD_FIFO_UNDERFLOW BIT(5)
+#define LCD_SYNC_LOST BIT(2)
+
+/* LCD DMA Control Register */
+#define LCD_DMA_BURST_SIZE(x) ((x) << 4)
+#define LCD_DMA_BURST_1 0x0
+#define LCD_DMA_BURST_2 0x1
+#define LCD_DMA_BURST_4 0x2
+#define LCD_DMA_BURST_8 0x3
+#define LCD_DMA_BURST_16 0x4
+#define LCD_END_OF_FRAME_INT_ENA BIT(2)
+#define LCD_DUAL_FRAME_BUFFER_ENABLE BIT(0)
+
+/* LCD Control Register */
+#define LCD_CLK_DIVISOR(x) ((x) << 8)
+#define LCD_RASTER_MODE 0x01
+
+/* LCD Raster Control Register */
+#define LCD_PALETTE_LOAD_MODE(x) ((x) << 20)
+#define PALETTE_AND_DATA 0x00
+#define PALETTE_ONLY 0x01
+
+#define LCD_MONO_8BIT_MODE BIT(9)
+#define LCD_RASTER_ORDER BIT(8)
+#define LCD_TFT_MODE BIT(7)
+#define LCD_UNDERFLOW_INT_ENA BIT(6)
+#define LCD_MONOCHROME_MODE BIT(1)
+#define LCD_RASTER_ENABLE BIT(0)
+#define LCD_TFT_ALT_ENABLE BIT(23)
+#define LCD_STN_565_ENABLE BIT(24)
+
+/* LCD Raster Timing 2 Register */
+#define LCD_AC_BIAS_TRANSITIONS_PER_INT(x) ((x) << 16)
+#define LCD_AC_BIAS_FREQUENCY(x) ((x) << 8)
+#define LCD_SYNC_CTRL BIT(25)
+#define LCD_SYNC_EDGE BIT(24)
+#define LCD_INVERT_PIXEL_CLOCK BIT(22)
+#define LCD_INVERT_LINE_CLOCK BIT(21)
+#define LCD_INVERT_FRAME_CLOCK BIT(20)
+
+/* LCD Block */
+#define LCD_CTRL_REG 0x4
+#define LCD_STAT_REG 0x8
+#define LCD_RASTER_CTRL_REG 0x28
+#define LCD_RASTER_TIMING_0_REG 0x2C
+#define LCD_RASTER_TIMING_1_REG 0x30
+#define LCD_RASTER_TIMING_2_REG 0x34
+#define LCD_DMA_CTRL_REG 0x40
+#define LCD_DMA_FRM_BUF_BASE_ADDR_0_REG 0x44
+#define LCD_DMA_FRM_BUF_CEILING_ADDR_0_REG 0x48
+
+#define WSI_TIMEOUT 50
+#define PALETTE_SIZE 256
+#define LEFT_MARGIN 64
+#define RIGHT_MARGIN 64
+#define UPPER_MARGIN 32
+#define LOWER_MARGIN 32
+
+static resource_size_t da8xx_fb_reg_base;
+static struct resource *lcdc_regs;
+
+static inline unsigned int lcdc_read(unsigned int addr)
+{
+ return (unsigned int)__raw_readl(da8xx_fb_reg_base + (addr));
+}
+
+static inline void lcdc_write(unsigned int val, unsigned int addr)
+{
+ __raw_writel(val, da8xx_fb_reg_base + (addr));
+}
+
+struct da8xx_fb_par {
+ resource_size_t p_palette_base;
+ unsigned char *v_palette_base;
+ struct clk *lcdc_clk;
+ int irq;
+ unsigned short pseudo_palette[16];
+ unsigned int databuf_sz;
+ unsigned int palette_sz;
+};
+
+/* Variable Screen Information */
+static struct fb_var_screeninfo da8xx_fb_var __devinitdata = {
+ .xoffset = 0,
+ .yoffset = 0,
+ .transp = {0, 0, 0},
+ .nonstd = 0,
+ .activate = 0,
+ .height = -1,
+ .width = -1,
+ .pixclock = 46666, /* 46us - AUO display */
+ .accel_flags = 0,
+ .left_margin = LEFT_MARGIN,
+ .right_margin = RIGHT_MARGIN,
+ .upper_margin = UPPER_MARGIN,
+ .lower_margin = LOWER_MARGIN,
+ .sync = 0,
+ .vmode = FB_VMODE_NONINTERLACED
+};
+
+static struct fb_fix_screeninfo da8xx_fb_fix __devinitdata = {
+ .id = "DA8xx FB Drv",
+ .type = FB_TYPE_PACKED_PIXELS,
+ .type_aux = 0,
+ .visual = FB_VISUAL_PSEUDOCOLOR,
+ .xpanstep = 1,
+ .ypanstep = 1,
+ .ywrapstep = 1,
+ .accel = FB_ACCEL_NONE
+};
+
+struct da8xx_panel {
+ const char name[25]; /* Full name <vendor>_<model> */
+ unsigned short width;
+ unsigned short height;
+ int hfp; /* Horizontal front porch */
+ int hbp; /* Horizontal back porch */
+ int hsw; /* Horizontal Sync Pulse Width */
+ int vfp; /* Vertical front porch */
+ int vbp; /* Vertical back porch */
+ int vsw; /* Vertical Sync Pulse Width */
+ int pxl_clk; /* Pixel clock */
+ unsigned char invert_pxl_clk; /* Invert Pixel clock */
+};
+
+static struct da8xx_panel known_lcd_panels[] = {
+ /* Sharp LCD035Q3DG01 */
+ [0] = {
+ .name = "Sharp_LCD035Q3DG01",
+ .width = 320,
+ .height = 240,
+ .hfp = 8,
+ .hbp = 6,
+ .hsw = 0,
+ .vfp = 2,
+ .vbp = 2,
+ .vsw = 0,
+ .pxl_clk = 0x10,
+ .invert_pxl_clk = 1,
+ },
+ /* Sharp LK043T1DG01 */
+ [1] = {
+ .name = "Sharp_LK043T1DG01",
+ .width = 480,
+ .height = 272,
+ .hfp = 2,
+ .hbp = 2,
+ .hsw = 41,
+ .vfp = 2,
+ .vbp = 2,
+ .vsw = 10,
+ .pxl_clk = 0x12,
+ .invert_pxl_clk = 0,
+ },
+};
+
+/* Disable the Raster Engine of the LCD Controller */
+static void lcd_disable_raster(struct da8xx_fb_par *par)
+{
+ u32 reg;
+
+ reg = lcdc_read(LCD_RASTER_CTRL_REG);
+ if (reg & LCD_RASTER_ENABLE)
+ lcdc_write(reg & ~LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+}
+
+static void lcd_blit(int load_mode, struct da8xx_fb_par *par)
+{
+ u32 tmp = par->p_palette_base + par->databuf_sz - 4;
+ u32 reg;
+
+ /* Update the databuf in the hw. */
+ lcdc_write(par->p_palette_base, LCD_DMA_FRM_BUF_BASE_ADDR_0_REG);
+ lcdc_write(tmp, LCD_DMA_FRM_BUF_CEILING_ADDR_0_REG);
+
+ /* Start the DMA. */
+ reg = lcdc_read(LCD_RASTER_CTRL_REG);
+ reg &= ~(3 << 20);
+ if (load_mode == LOAD_DATA)
+ reg |= LCD_PALETTE_LOAD_MODE(PALETTE_AND_DATA);
+ else if (load_mode == LOAD_PALETTE)
+ reg |= LCD_PALETTE_LOAD_MODE(PALETTE_ONLY);
+
+ lcdc_write(reg, LCD_RASTER_CTRL_REG);
+}
+
+/* Configure the Burst Size of DMA */
+static int lcd_cfg_dma(int burst_size)
+{
+ u32 reg;
+
+ reg = lcdc_read(LCD_DMA_CTRL_REG) & 0x00000001;
+ switch (burst_size) {
+ case 1:
+ reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_1);
+ break;
+ case 2:
+ reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_2);
+ break;
+ case 4:
+ reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_4);
+ break;
+ case 8:
+ reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_8);
+ break;
+ case 16:
+ reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_16);
+ break;
+ default:
+ return -EINVAL;
+ }
+ lcdc_write(reg, LCD_DMA_CTRL_REG);
+
+ return 0;
+}
+
+static void lcd_cfg_ac_bias(int period, int transitions_per_int)
+{
+ u32 reg;
+
+ /* Set the AC Bias Period and Number of Transisitons per Interrupt */
+ reg = lcdc_read(LCD_RASTER_TIMING_2_REG) & 0xFFF00000;
+ reg |= LCD_AC_BIAS_FREQUENCY(period) |
+ LCD_AC_BIAS_TRANSITIONS_PER_INT(transitions_per_int);
+ lcdc_write(reg, LCD_RASTER_TIMING_2_REG);
+}
+
+static void lcd_cfg_horizontal_sync(int back_porch, int pulse_width,
+ int front_porch)
+{
+ u32 reg;
+
+ reg = lcdc_read(LCD_RASTER_TIMING_0_REG) & 0xf;
+ reg |= ((back_porch & 0xff) << 24)
+ | ((front_porch & 0xff) << 16)
+ | ((pulse_width & 0x3f) << 10);
+ lcdc_write(reg, LCD_RASTER_TIMING_0_REG);
+}
+
+static void lcd_cfg_vertical_sync(int back_porch, int pulse_width,
+ int front_porch)
+{
+ u32 reg;
+
+ reg = lcdc_read(LCD_RASTER_TIMING_1_REG) & 0x3ff;
+ reg |= ((back_porch & 0xff) << 24)
+ | ((front_porch & 0xff) << 16)
+ | ((pulse_width & 0x3f) << 10);
+ lcdc_write(reg, LCD_RASTER_TIMING_1_REG);
+}
+
+static int lcd_cfg_display(const struct lcd_ctrl_config *cfg)
+{
+ u32 reg;
+
+ reg = lcdc_read(LCD_RASTER_CTRL_REG) & ~(LCD_TFT_MODE |
+ LCD_MONO_8BIT_MODE |
+ LCD_MONOCHROME_MODE);
+
+ switch (cfg->p_disp_panel->panel_shade) {
+ case MONOCHROME:
+ reg |= LCD_MONOCHROME_MODE;
+ if (cfg->mono_8bit_mode)
+ reg |= LCD_MONO_8BIT_MODE;
+ break;
+ case COLOR_ACTIVE:
+ reg |= LCD_TFT_MODE;
+ if (cfg->tft_alt_mode)
+ reg |= LCD_TFT_ALT_ENABLE;
+ break;
+
+ case COLOR_PASSIVE:
+ if (cfg->stn_565_mode)
+ reg |= LCD_STN_565_ENABLE;
+ break;
+
+ default:
+ return -EINVAL;
+ }
+
+ /* enable additional interrupts here */
+ reg |= LCD_UNDERFLOW_INT_ENA;
+
+ lcdc_write(reg, LCD_RASTER_CTRL_REG);
+
+ reg = lcdc_read(LCD_RASTER_TIMING_2_REG);
+
+ if (cfg->sync_ctrl)
+ reg |= LCD_SYNC_CTRL;
+ else
+ reg &= ~LCD_SYNC_CTRL;
+
+ if (cfg->sync_edge)
+ reg |= LCD_SYNC_EDGE;
+ else
+ reg &= ~LCD_SYNC_EDGE;
+
+ if (cfg->invert_line_clock)
+ reg |= LCD_INVERT_LINE_CLOCK;
+ else
+ reg &= ~LCD_INVERT_LINE_CLOCK;
+
+ if (cfg->invert_frm_clock)
+ reg |= LCD_INVERT_FRAME_CLOCK;
+ else
+ reg &= ~LCD_INVERT_FRAME_CLOCK;
+
+ lcdc_write(reg, LCD_RASTER_TIMING_2_REG);
+
+ return 0;
+}
+
+static int lcd_cfg_frame_buffer(struct da8xx_fb_par *par, u32 width, u32 height,
+ u32 bpp, u32 raster_order)
+{
+ u32 bpl, reg;
+
+ /* Disable Dual Frame Buffer. */
+ reg = lcdc_read(LCD_DMA_CTRL_REG);
+ lcdc_write(reg & ~LCD_DUAL_FRAME_BUFFER_ENABLE,
+ LCD_DMA_CTRL_REG);
+ /* Set the Panel Width */
+ /* Pixels per line = (PPL + 1)*16 */
+ /*0x3F in bits 4..9 gives max horisontal resolution = 1024 pixels*/
+ width &= 0x3f0;
+ reg = lcdc_read(LCD_RASTER_TIMING_0_REG);
+ reg &= 0xfffffc00;
+ reg |= ((width >> 4) - 1) << 4;
+ lcdc_write(reg, LCD_RASTER_TIMING_0_REG);
+
+ /* Set the Panel Height */
+ reg = lcdc_read(LCD_RASTER_TIMING_1_REG);
+ reg = ((height - 1) & 0x3ff) | (reg & 0xfffffc00);
+ lcdc_write(reg, LCD_RASTER_TIMING_1_REG);
+
+ /* Set the Raster Order of the Frame Buffer */
+ reg = lcdc_read(LCD_RASTER_CTRL_REG) & ~(1 << 8);
+ if (raster_order)
+ reg |= LCD_RASTER_ORDER;
+ lcdc_write(reg, LCD_RASTER_CTRL_REG);
+
+ switch (bpp) {
+ case 1:
+ case 2:
+ case 4:
+ case 16:
+ par->palette_sz = 16 * 2;
+ break;
+
+ case 8:
+ par->palette_sz = 256 * 2;
+ break;
+
+ default:
+ return -EINVAL;
+ }
+
+ bpl = width * bpp / 8;
+ par->databuf_sz = height * bpl + par->palette_sz;
+
+ return 0;
+}
+
+static int fb_setcolreg(unsigned regno, unsigned red, unsigned green,
+ unsigned blue, unsigned transp,
+ struct fb_info *info)
+{
+ struct da8xx_fb_par *par = info->par;
+ unsigned short *palette = (unsigned short *)par->v_palette_base;
+ u_short pal;
+
+ if (regno > 255)
+ return 1;
+
+ if (info->fix.visual == FB_VISUAL_DIRECTCOLOR)
+ return 1;
+
+ if (info->var.bits_per_pixel == 8) {
+ red >>= 4;
+ green >>= 8;
+ blue >>= 12;
+
+ pal = (red & 0x0f00);
+ pal |= (green & 0x00f0);
+ pal |= (blue & 0x000f);
+
+ palette[regno] = pal;
+
+ } else if ((info->var.bits_per_pixel == 16) && regno < 16) {
+ red >>= (16 - info->var.red.length);
+ red <<= info->var.red.offset;
+
+ green >>= (16 - info->var.green.length);
+ green <<= info->var.green.offset;
+
+ blue >>= (16 - info->var.blue.length);
+ blue <<= info->var.blue.offset;
+
+ par->pseudo_palette[regno] = red | green | blue;
+
+ palette[0] = 0x4000;
+ }
+
+ return 0;
+}
+
+static void lcd_reset(struct da8xx_fb_par *par)
+{
+ /* Disable the Raster if previously Enabled */
+ if (lcdc_read(LCD_RASTER_CTRL_REG) & LCD_RASTER_ENABLE)
+ lcd_disable_raster(par);
+
+ /* DMA has to be disabled */
+ lcdc_write(0, LCD_DMA_CTRL_REG);
+ lcdc_write(0, LCD_RASTER_CTRL_REG);
+}
+
+static int lcd_init(struct da8xx_fb_par *par, const struct lcd_ctrl_config *cfg,
+ struct da8xx_panel *panel)
+{
+ u32 bpp;
+ int ret = 0;
+
+ lcd_reset(par);
+
+ /* Configure the LCD clock divisor. */
+ lcdc_write(LCD_CLK_DIVISOR(panel->pxl_clk) |
+ (LCD_RASTER_MODE & 0x1), LCD_CTRL_REG);
+
+ if (panel->invert_pxl_clk)
+ lcdc_write((lcdc_read(LCD_RASTER_TIMING_2_REG) |
+ LCD_INVERT_PIXEL_CLOCK), LCD_RASTER_TIMING_2_REG);
+ else
+ lcdc_write((lcdc_read(LCD_RASTER_TIMING_2_REG) &
+ ~LCD_INVERT_PIXEL_CLOCK), LCD_RASTER_TIMING_2_REG);
+
+ /* Configure the DMA burst size. */
+ ret = lcd_cfg_dma(cfg->dma_burst_sz);
+ if (ret < 0)
+ return ret;
+
+ /* Configure the AC bias properties. */
+ lcd_cfg_ac_bias(cfg->ac_bias, cfg->ac_bias_intrpt);
+
+ /* Configure the vertical and horizontal sync properties. */
+ lcd_cfg_vertical_sync(panel->vbp, panel->vsw, panel->vfp);
+ lcd_cfg_horizontal_sync(panel->hbp, panel->hsw, panel->hfp);
+
+ /* Configure for disply */
+ ret = lcd_cfg_display(cfg);
+ if (ret < 0)
+ return ret;
+
+ if (QVGA != cfg->p_disp_panel->panel_type)
+ return -EINVAL;
+
+ if (cfg->bpp <= cfg->p_disp_panel->max_bpp &&
+ cfg->bpp >= cfg->p_disp_panel->min_bpp)
+ bpp = cfg->bpp;
+ else
+ bpp = cfg->p_disp_panel->max_bpp;
+ if (bpp == 12)
+ bpp = 16;
+ ret = lcd_cfg_frame_buffer(par, (unsigned int)panel->width,
+ (unsigned int)panel->height, bpp,
+ cfg->raster_order);
+ if (ret < 0)
+ return ret;
+
+ /* Configure FDD */
+ lcdc_write((lcdc_read(LCD_RASTER_CTRL_REG) & 0xfff00fff) |
+ (cfg->fdd << 12), LCD_RASTER_CTRL_REG);
+
+ return 0;
+}
+
+static irqreturn_t lcdc_irq_handler(int irq, void *arg)
+{
+ u32 stat = lcdc_read(LCD_STAT_REG);
+ u32 reg;
+
+ if ((stat & LCD_SYNC_LOST) && (stat & LCD_FIFO_UNDERFLOW)) {
+ reg = lcdc_read(LCD_RASTER_CTRL_REG);
+ lcdc_write(reg & ~LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+ lcdc_write(stat, LCD_STAT_REG);
+ lcdc_write(reg | LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+ } else
+ lcdc_write(stat, LCD_STAT_REG);
+
+ return IRQ_HANDLED;
+}
+
+static int fb_check_var(struct fb_var_screeninfo *var,
+ struct fb_info *info)
+{
+ int err = 0;
+
+ switch (var->bits_per_pixel) {
+ case 1:
+ case 8:
+ var->red.offset = 0;
+ var->red.length = 8;
+ var->green.offset = 0;
+ var->green.length = 8;
+ var->blue.offset = 0;
+ var->blue.length = 8;
+ var->transp.offset = 0;
+ var->transp.length = 0;
+ break;
+ case 4:
+ var->red.offset = 0;
+ var->red.length = 4;
+ var->green.offset = 0;
+ var->green.length = 4;
+ var->blue.offset = 0;
+ var->blue.length = 4;
+ var->transp.offset = 0;
+ var->transp.length = 0;
+ break;
+ case 16: /* RGB 565 */
+ var->red.offset = 0;
+ var->red.length = 5;
+ var->green.offset = 5;
+ var->green.length = 6;
+ var->blue.offset = 11;
+ var->blue.length = 5;
+ var->transp.offset = 0;
+ var->transp.length = 0;
+ break;
+ default:
+ err = -EINVAL;
+ }
+
+ var->red.msb_right = 0;
+ var->green.msb_right = 0;
+ var->blue.msb_right = 0;
+ var->transp.msb_right = 0;
+ return err;
+}
+
+static int __devexit fb_remove(struct platform_device *dev)
+{
+ struct fb_info *info = dev_get_drvdata(&dev->dev);
+
+ if (info) {
+ struct da8xx_fb_par *par = info->par;
+
+ if (lcdc_read(LCD_RASTER_CTRL_REG) & LCD_RASTER_ENABLE)
+ lcd_disable_raster(par);
+ lcdc_write(0, LCD_RASTER_CTRL_REG);
+
+ /* disable DMA */
+ lcdc_write(0, LCD_DMA_CTRL_REG);
+
+ unregister_framebuffer(info);
+ fb_dealloc_cmap(&info->cmap);
+ dma_free_coherent(NULL, par->databuf_sz + PAGE_SIZE,
+ info->screen_base,
+ info->fix.smem_start);
+ free_irq(par->irq, par);
+ clk_disable(par->lcdc_clk);
+ clk_put(par->lcdc_clk);
+ framebuffer_release(info);
+ iounmap((void __iomem *)da8xx_fb_reg_base);
+ release_mem_region(lcdc_regs->start, resource_size(lcdc_regs));
+
+ }
+ return 0;
+}
+
+static int fb_ioctl(struct fb_info *info, unsigned int cmd,
+ unsigned long arg)
+{
+ struct lcd_sync_arg sync_arg;
+
+ switch (cmd) {
+ case FBIOGET_CONTRAST:
+ case FBIOPUT_CONTRAST:
+ case FBIGET_BRIGHTNESS:
+ case FBIPUT_BRIGHTNESS:
+ case FBIGET_COLOR:
+ case FBIPUT_COLOR:
+ return -ENOTTY;
+ case FBIPUT_HSYNC:
+ if (copy_from_user(&sync_arg, (char *)arg,
+ sizeof(struct lcd_sync_arg)))
+ return -EFAULT;
+ lcd_cfg_horizontal_sync(sync_arg.back_porch,
+ sync_arg.pulse_width,
+ sync_arg.front_porch);
+ break;
+ case FBIPUT_VSYNC:
+ if (copy_from_user(&sync_arg, (char *)arg,
+ sizeof(struct lcd_sync_arg)))
+ return -EFAULT;
+ lcd_cfg_vertical_sync(sync_arg.back_porch,
+ sync_arg.pulse_width,
+ sync_arg.front_porch);
+ break;
+ default:
+ return -EINVAL;
+ }
+ return 0;
+}
+
+static struct fb_ops da8xx_fb_ops = {
+ .owner = THIS_MODULE,
+ .fb_check_var = fb_check_var,
+ .fb_setcolreg = fb_setcolreg,
+ .fb_ioctl = fb_ioctl,
+ .fb_fillrect = cfb_fillrect,
+ .fb_copyarea = cfb_copyarea,
+ .fb_imageblit = cfb_imageblit,
+};
+
+static int __init fb_probe(struct platform_device *device)
+{
+ struct da8xx_lcdc_platform_data *fb_pdata =
+ device->dev.platform_data;
+ struct lcd_ctrl_config *lcd_cfg;
+ struct da8xx_panel *lcdc_info;
+ struct fb_info *da8xx_fb_info;
+ struct clk *fb_clk = NULL;
+ struct da8xx_fb_par *par;
+ resource_size_t len;
+ int ret, i;
+
+ if (fb_pdata == NULL) {
+ dev_err(&device->dev, "Can not get platform data\n");
+ return -ENOENT;
+ }
+
+ lcdc_regs = platform_get_resource(device, IORESOURCE_MEM, 0);
+ if (!lcdc_regs) {
+ dev_err(&device->dev,
+ "Can not get memory resource for LCD controller\n");
+ return -ENOENT;
+ }
+
+ len = resource_size(lcdc_regs);
+
+ lcdc_regs = request_mem_region(lcdc_regs->start, len, lcdc_regs->name);
+ if (!lcdc_regs)
+ return -EBUSY;
+
+ da8xx_fb_reg_base = (resource_size_t)ioremap(lcdc_regs->start, len);
+ if (!da8xx_fb_reg_base) {
+ ret = -EBUSY;
+ goto err_request_mem;
+ }
+
+ fb_clk = clk_get(&device->dev, NULL);
+ if (IS_ERR(fb_clk)) {
+ dev_err(&device->dev, "Can not get device clock\n");
+ ret = -ENODEV;
+ goto err_ioremap;
+ }
+ ret = clk_enable(fb_clk);
+ if (ret)
+ goto err_clk_put;
+
+ for (i = 0, lcdc_info = known_lcd_panels;
+ i < ARRAY_SIZE(known_lcd_panels);
+ i++, lcdc_info++) {
+ if (strcmp(fb_pdata->type, lcdc_info->name) == 0)
+ break;
+ }
+
+ if (i == ARRAY_SIZE(known_lcd_panels)) {
+ dev_err(&device->dev, "GLCD: No valid panel found\n");
+ ret = ENODEV;
+ goto err_clk_disable;
+ } else
+ dev_info(&device->dev, "GLCD: Found %s panel\n",
+ fb_pdata->type);
+
+ lcd_cfg = (struct lcd_ctrl_config *)fb_pdata->controller_data;
+
+ da8xx_fb_info = framebuffer_alloc(sizeof(struct da8xx_fb_par),
+ &device->dev);
+ if (!da8xx_fb_info) {
+ dev_dbg(&device->dev, "Memory allocation failed for fb_info\n");
+ ret = -ENOMEM;
+ goto err_clk_disable;
+ }
+
+ par = da8xx_fb_info->par;
+
+ if (lcd_init(par, lcd_cfg, lcdc_info) < 0) {
+ dev_err(&device->dev, "lcd_init failed\n");
+ ret = -EFAULT;
+ goto err_release_fb;
+ }
+
+ /* allocate frame buffer */
+ da8xx_fb_info->screen_base = dma_alloc_coherent(NULL,
+ par->databuf_sz + PAGE_SIZE,
+ (resource_size_t *)
+ &da8xx_fb_info->fix.smem_start,
+ GFP_KERNEL | GFP_DMA);
+
+ if (!da8xx_fb_info->screen_base) {
+ dev_err(&device->dev,
+ "GLCD: kmalloc for frame buffer failed\n");
+ ret = -EINVAL;
+ goto err_release_fb;
+ }
+
+ /* move palette base pointer by (PAGE_SIZE - palette_sz) bytes */
+ par->v_palette_base = da8xx_fb_info->screen_base +
+ (PAGE_SIZE - par->palette_sz);
+ par->p_palette_base = da8xx_fb_info->fix.smem_start +
+ (PAGE_SIZE - par->palette_sz);
+
+ /* the rest of the frame buffer is pixel data */
+ da8xx_fb_fix.smem_start = par->p_palette_base + par->palette_sz;
+ da8xx_fb_fix.smem_len = par->databuf_sz - par->palette_sz;
+ da8xx_fb_fix.line_length = (lcdc_info->width * lcd_cfg->bpp) / 8;
+
+ par->lcdc_clk = fb_clk;
+
+ par->irq = platform_get_irq(device, 0);
+ if (par->irq < 0) {
+ ret = -ENOENT;
+ goto err_release_fb_mem;
+ }
+
+ ret = request_irq(par->irq, lcdc_irq_handler, 0, DRIVER_NAME, par);
+ if (ret)
+ goto err_release_fb_mem;
+
+ /* Initialize par */
+ da8xx_fb_info->var.bits_per_pixel = lcd_cfg->bpp;
+
+ da8xx_fb_var.xres = lcdc_info->width;
+ da8xx_fb_var.xres_virtual = lcdc_info->width;
+
+ da8xx_fb_var.yres = lcdc_info->height;
+ da8xx_fb_var.yres_virtual = lcdc_info->height;
+
+ da8xx_fb_var.grayscale =
+ lcd_cfg->p_disp_panel->panel_shade == MONOCHROME ? 1 : 0;
+ da8xx_fb_var.bits_per_pixel = lcd_cfg->bpp;
+
+ da8xx_fb_var.hsync_len = lcdc_info->hsw;
+ da8xx_fb_var.vsync_len = lcdc_info->vsw;
+
+ /* Initialize fbinfo */
+ da8xx_fb_info->flags = FBINFO_FLAG_DEFAULT;
+ da8xx_fb_info->fix = da8xx_fb_fix;
+ da8xx_fb_info->var = da8xx_fb_var;
+ da8xx_fb_info->fbops = &da8xx_fb_ops;
+ da8xx_fb_info->pseudo_palette = par->pseudo_palette;
+
+ ret = fb_alloc_cmap(&da8xx_fb_info->cmap, PALETTE_SIZE, 0);
+ if (ret)
+ goto err_free_irq;
+
+ /* First palette_sz byte of the frame buffer is the palette */
+ da8xx_fb_info->cmap.len = par->palette_sz;
+
+ /* Flush the buffer to the screen. */
+ lcd_blit(LOAD_DATA, par);
+
+ /* initialize var_screeninfo */
+ da8xx_fb_var.activate = FB_ACTIVATE_FORCE;
+ fb_set_var(da8xx_fb_info, &da8xx_fb_var);
+
+ dev_set_drvdata(&device->dev, da8xx_fb_info);
+ /* Register the Frame Buffer */
+ if (register_framebuffer(da8xx_fb_info) < 0) {
+ dev_err(&device->dev,
+ "GLCD: Frame Buffer Registration Failed!\n");
+ ret = -EINVAL;
+ goto err_dealloc_cmap;
+ }
+
+ /* enable raster engine */
+ lcdc_write(lcdc_read(LCD_RASTER_CTRL_REG) |
+ LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+
+ return 0;
+
+err_dealloc_cmap:
+ fb_dealloc_cmap(&da8xx_fb_info->cmap);
+
+err_free_irq:
+ free_irq(par->irq, par);
+
+err_release_fb_mem:
+ dma_free_coherent(NULL, par->databuf_sz + PAGE_SIZE,
+ da8xx_fb_info->screen_base,
+ da8xx_fb_info->fix.smem_start);
+
+err_release_fb:
+ framebuffer_release(da8xx_fb_info);
+
+err_clk_disable:
+ clk_disable(fb_clk);
+
+err_clk_put:
+ clk_put(fb_clk);
+
+err_ioremap:
+ iounmap((void __iomem *)da8xx_fb_reg_base);
+
+err_request_mem:
+ release_mem_region(lcdc_regs->start, len);
+
+ return ret;
+}
+
+#ifdef CONFIG_PM
+static int fb_suspend(struct platform_device *dev, pm_message_t state)
+{
+ return -EBUSY;
+}
+static int fb_resume(struct platform_device *dev)
+{
+ return -EBUSY;
+}
+#else
+#define fb_suspend NULL
+#define fb_resume NULL
+#endif
+
+static struct platform_driver da8xx_fb_driver = {
+ .probe = fb_probe,
+ .remove = fb_remove,
+ .suspend = fb_suspend,
+ .resume = fb_resume,
+ .driver = {
+ .name = DRIVER_NAME,
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init da8xx_fb_init(void)
+{
+ return platform_driver_register(&da8xx_fb_driver);
+}
+
+static void __exit da8xx_fb_cleanup(void)
+{
+ platform_driver_unregister(&da8xx_fb_driver);
+}
+
+module_init(da8xx_fb_init);
+module_exit(da8xx_fb_cleanup);
+
+MODULE_DESCRIPTION("Framebuffer driver for TI da8xx/omap-l1xx");
+MODULE_AUTHOR("Texas Instruments");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/ep93xx-fb.c b/drivers/video/ep93xx-fb.c
new file mode 100644
index 0000000..bd9d46f
--- /dev/null
+++ b/drivers/video/ep93xx-fb.c
@@ -0,0 +1,646 @@
+/*
+ * linux/drivers/video/ep93xx-fb.c
+ *
+ * Framebuffer support for the EP93xx series.
+ *
+ * Copyright (C) 2007 Bluewater Systems Ltd
+ * Author: Ryan Mallon <ryan@bluewatersys.com>
+ *
+ * Copyright (c) 2009 H Hartley Sweeten <hsweeten@visionengravers.com>
+ *
+ * Based on the Cirrus Logic ep93xxfb driver, and various other ep93xxfb
+ * drivers.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+
+#include <linux/platform_device.h>
+#include <linux/dma-mapping.h>
+#include <linux/clk.h>
+#include <linux/fb.h>
+
+#include <mach/fb.h>
+
+/* Vertical Frame Timing Registers */
+#define EP93XXFB_VLINES_TOTAL 0x0000 /* SW locked */
+#define EP93XXFB_VSYNC 0x0004 /* SW locked */
+#define EP93XXFB_VACTIVE 0x0008 /* SW locked */
+#define EP93XXFB_VBLANK 0x0228 /* SW locked */
+#define EP93XXFB_VCLK 0x000c /* SW locked */
+
+/* Horizontal Frame Timing Registers */
+#define EP93XXFB_HCLKS_TOTAL 0x0010 /* SW locked */
+#define EP93XXFB_HSYNC 0x0014 /* SW locked */
+#define EP93XXFB_HACTIVE 0x0018 /* SW locked */
+#define EP93XXFB_HBLANK 0x022c /* SW locked */
+#define EP93XXFB_HCLK 0x001c /* SW locked */
+
+/* Frame Buffer Memory Configuration Registers */
+#define EP93XXFB_SCREEN_PAGE 0x0028
+#define EP93XXFB_SCREEN_HPAGE 0x002c
+#define EP93XXFB_SCREEN_LINES 0x0030
+#define EP93XXFB_LINE_LENGTH 0x0034
+#define EP93XXFB_VLINE_STEP 0x0038
+#define EP93XXFB_LINE_CARRY 0x003c /* SW locked */
+#define EP93XXFB_EOL_OFFSET 0x0230
+
+/* Other Video Registers */
+#define EP93XXFB_BRIGHTNESS 0x0020
+#define EP93XXFB_ATTRIBS 0x0024 /* SW locked */
+#define EP93XXFB_SWLOCK 0x007c /* SW locked */
+#define EP93XXFB_AC_RATE 0x0214
+#define EP93XXFB_FIFO_LEVEL 0x0234
+#define EP93XXFB_PIXELMODE 0x0054
+#define EP93XXFB_PIXELMODE_32BPP (0x7 << 0)
+#define EP93XXFB_PIXELMODE_24BPP (0x6 << 0)
+#define EP93XXFB_PIXELMODE_16BPP (0x4 << 0)
+#define EP93XXFB_PIXELMODE_8BPP (0x2 << 0)
+#define EP93XXFB_PIXELMODE_SHIFT_1P_24B (0x0 << 3)
+#define EP93XXFB_PIXELMODE_SHIFT_1P_18B (0x1 << 3)
+#define EP93XXFB_PIXELMODE_COLOR_LUT (0x0 << 10)
+#define EP93XXFB_PIXELMODE_COLOR_888 (0x4 << 10)
+#define EP93XXFB_PIXELMODE_COLOR_555 (0x5 << 10)
+#define EP93XXFB_PARL_IF_OUT 0x0058
+#define EP93XXFB_PARL_IF_IN 0x005c
+
+/* Blink Control Registers */
+#define EP93XXFB_BLINK_RATE 0x0040
+#define EP93XXFB_BLINK_MASK 0x0044
+#define EP93XXFB_BLINK_PATTRN 0x0048
+#define EP93XXFB_PATTRN_MASK 0x004c
+#define EP93XXFB_BKGRND_OFFSET 0x0050
+
+/* Hardware Cursor Registers */
+#define EP93XXFB_CURSOR_ADR_START 0x0060
+#define EP93XXFB_CURSOR_ADR_RESET 0x0064
+#define EP93XXFB_CURSOR_SIZE 0x0068
+#define EP93XXFB_CURSOR_COLOR1 0x006c
+#define EP93XXFB_CURSOR_COLOR2 0x0070
+#define EP93XXFB_CURSOR_BLINK_COLOR1 0x021c
+#define EP93XXFB_CURSOR_BLINK_COLOR2 0x0220
+#define EP93XXFB_CURSOR_XY_LOC 0x0074
+#define EP93XXFB_CURSOR_DSCAN_HY_LOC 0x0078
+#define EP93XXFB_CURSOR_BLINK_RATE_CTRL 0x0224
+
+/* LUT Registers */
+#define EP93XXFB_GRY_SCL_LUTR 0x0080
+#define EP93XXFB_GRY_SCL_LUTG 0x0280
+#define EP93XXFB_GRY_SCL_LUTB 0x0300
+#define EP93XXFB_LUT_SW_CONTROL 0x0218
+#define EP93XXFB_LUT_SW_CONTROL_SWTCH (1 << 0)
+#define EP93XXFB_LUT_SW_CONTROL_SSTAT (1 << 1)
+#define EP93XXFB_COLOR_LUT 0x0400
+
+/* Video Signature Registers */
+#define EP93XXFB_VID_SIG_RSLT_VAL 0x0200
+#define EP93XXFB_VID_SIG_CTRL 0x0204
+#define EP93XXFB_VSIG 0x0208
+#define EP93XXFB_HSIG 0x020c
+#define EP93XXFB_SIG_CLR_STR 0x0210
+
+/* Minimum / Maximum resolutions supported */
+#define EP93XXFB_MIN_XRES 64
+#define EP93XXFB_MIN_YRES 64
+#define EP93XXFB_MAX_XRES 1024
+#define EP93XXFB_MAX_YRES 768
+
+struct ep93xx_fbi {
+ struct ep93xxfb_mach_info *mach_info;
+ struct clk *clk;
+ struct resource *res;
+ void __iomem *mmio_base;
+ unsigned int pseudo_palette[256];
+};
+
+static int check_screenpage_bug = 1;
+module_param(check_screenpage_bug, int, 0644);
+MODULE_PARM_DESC(check_screenpage_bug,
+ "Check for bit 27 screen page bug. Default = 1");
+
+static inline unsigned int ep93xxfb_readl(struct ep93xx_fbi *fbi,
+ unsigned int off)
+{
+ return __raw_readl(fbi->mmio_base + off);
+}
+
+static inline void ep93xxfb_writel(struct ep93xx_fbi *fbi,
+ unsigned int val, unsigned int off)
+{
+ __raw_writel(val, fbi->mmio_base + off);
+}
+
+/*
+ * Write to one of the locked raster registers.
+ */
+static inline void ep93xxfb_out_locked(struct ep93xx_fbi *fbi,
+ unsigned int val, unsigned int reg)
+{
+ /*
+ * We don't need a lock or delay here since the raster register
+ * block will remain unlocked until the next access.
+ */
+ ep93xxfb_writel(fbi, 0xaa, EP93XXFB_SWLOCK);
+ ep93xxfb_writel(fbi, val, reg);
+}
+
+static void ep93xxfb_set_video_attribs(struct fb_info *info)
+{
+ struct ep93xx_fbi *fbi = info->par;
+ unsigned int attribs;
+
+ attribs = EP93XXFB_ENABLE;
+ attribs |= fbi->mach_info->flags;
+ ep93xxfb_out_locked(fbi, attribs, EP93XXFB_ATTRIBS);
+}
+
+static int ep93xxfb_set_pixelmode(struct fb_info *info)
+{
+ struct ep93xx_fbi *fbi = info->par;
+ unsigned int val;
+
+ info->var.transp.offset = 0;
+ info->var.transp.length = 0;
+
+ switch (info->var.bits_per_pixel) {
+ case 8:
+ val = EP93XXFB_PIXELMODE_8BPP | EP93XXFB_PIXELMODE_COLOR_LUT |
+ EP93XXFB_PIXELMODE_SHIFT_1P_18B;
+
+ info->var.red.offset = 0;
+ info->var.red.length = 8;
+ info->var.green.offset = 0;
+ info->var.green.length = 8;
+ info->var.blue.offset = 0;
+ info->var.blue.length = 8;
+ info->fix.visual = FB_VISUAL_PSEUDOCOLOR;
+ break;
+
+ case 16:
+ val = EP93XXFB_PIXELMODE_16BPP | EP93XXFB_PIXELMODE_COLOR_555 |
+ EP93XXFB_PIXELMODE_SHIFT_1P_18B;
+
+ info->var.red.offset = 11;
+ info->var.red.length = 5;
+ info->var.green.offset = 5;
+ info->var.green.length = 6;
+ info->var.blue.offset = 0;
+ info->var.blue.length = 5;
+ info->fix.visual = FB_VISUAL_TRUECOLOR;
+ break;
+
+ case 24:
+ val = EP93XXFB_PIXELMODE_24BPP | EP93XXFB_PIXELMODE_COLOR_888 |
+ EP93XXFB_PIXELMODE_SHIFT_1P_24B;
+
+ info->var.red.offset = 16;
+ info->var.red.length = 8;
+ info->var.green.offset = 8;
+ info->var.green.length = 8;
+ info->var.blue.offset = 0;
+ info->var.blue.length = 8;
+ info->fix.visual = FB_VISUAL_TRUECOLOR;
+ break;
+
+ case 32:
+ val = EP93XXFB_PIXELMODE_32BPP | EP93XXFB_PIXELMODE_COLOR_888 |
+ EP93XXFB_PIXELMODE_SHIFT_1P_24B;
+
+ info->var.red.offset = 16;
+ info->var.red.length = 8;
+ info->var.green.offset = 8;
+ info->var.green.length = 8;
+ info->var.blue.offset = 0;
+ info->var.blue.length = 8;
+ info->fix.visual = FB_VISUAL_TRUECOLOR;
+ break;
+
+ default:
+ return -EINVAL;
+ }
+
+ ep93xxfb_writel(fbi, val, EP93XXFB_PIXELMODE);
+ return 0;
+}
+
+static void ep93xxfb_set_timing(struct fb_info *info)
+{
+ struct ep93xx_fbi *fbi = info->par;
+ unsigned int vlines_total, hclks_total, start, stop;
+
+ vlines_total = info->var.yres + info->var.upper_margin +
+ info->var.lower_margin + info->var.vsync_len - 1;
+
+ hclks_total = info->var.xres + info->var.left_margin +
+ info->var.right_margin + info->var.hsync_len - 1;
+
+ ep93xxfb_out_locked(fbi, vlines_total, EP93XXFB_VLINES_TOTAL);
+ ep93xxfb_out_locked(fbi, hclks_total, EP93XXFB_HCLKS_TOTAL);
+
+ start = vlines_total;
+ stop = vlines_total - info->var.vsync_len;
+ ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VSYNC);
+
+ start = vlines_total - info->var.vsync_len - info->var.upper_margin;
+ stop = info->var.lower_margin - 1;
+ ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VBLANK);
+ ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VACTIVE);
+
+ start = vlines_total;
+ stop = vlines_total + 1;
+ ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VCLK);
+
+ start = hclks_total;
+ stop = hclks_total - info->var.hsync_len;
+ ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HSYNC);
+
+ start = hclks_total - info->var.hsync_len - info->var.left_margin;
+ stop = info->var.right_margin - 1;
+ ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HBLANK);
+ ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HACTIVE);
+
+ start = hclks_total;
+ stop = hclks_total;
+ ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HCLK);
+
+ ep93xxfb_out_locked(fbi, 0x0, EP93XXFB_LINE_CARRY);
+}
+
+static int ep93xxfb_set_par(struct fb_info *info)
+{
+ struct ep93xx_fbi *fbi = info->par;
+
+ clk_set_rate(fbi->clk, 1000 * PICOS2KHZ(info->var.pixclock));
+
+ ep93xxfb_set_timing(info);
+
+ info->fix.line_length = info->var.xres_virtual *
+ info->var.bits_per_pixel / 8;
+
+ ep93xxfb_writel(fbi, info->fix.smem_start, EP93XXFB_SCREEN_PAGE);
+ ep93xxfb_writel(fbi, info->var.yres - 1, EP93XXFB_SCREEN_LINES);
+ ep93xxfb_writel(fbi, ((info->var.xres * info->var.bits_per_pixel)
+ / 32) - 1, EP93XXFB_LINE_LENGTH);
+ ep93xxfb_writel(fbi, info->fix.line_length / 4, EP93XXFB_VLINE_STEP);
+ ep93xxfb_set_video_attribs(info);
+ return 0;
+}
+
+static int ep93xxfb_check_var(struct fb_var_screeninfo *var,
+ struct fb_info *info)
+{
+ int err;
+
+ err = ep93xxfb_set_pixelmode(info);
+ if (err)
+ return err;
+
+ var->xres = max_t(unsigned int, var->xres, EP93XXFB_MIN_XRES);
+ var->xres = min_t(unsigned int, var->xres, EP93XXFB_MAX_XRES);
+ var->xres_virtual = max(var->xres_virtual, var->xres);
+
+ var->yres = max_t(unsigned int, var->yres, EP93XXFB_MIN_YRES);
+ var->yres = min_t(unsigned int, var->yres, EP93XXFB_MAX_YRES);
+ var->yres_virtual = max(var->yres_virtual, var->yres);
+
+ return 0;
+}
+
+static int ep93xxfb_mmap(struct fb_info *info, struct vm_area_struct *vma)
+{
+ unsigned int offset = vma->vm_pgoff << PAGE_SHIFT;
+
+ if (offset < info->fix.smem_len) {
+ return dma_mmap_writecombine(info->dev, vma, info->screen_base,
+ info->fix.smem_start,
+ info->fix.smem_len);
+ }
+
+ return -EINVAL;
+}
+
+static int ep93xxfb_blank(int blank_mode, struct fb_info *info)
+{
+ struct ep93xx_fbi *fbi = info->par;
+ unsigned int attribs = ep93xxfb_readl(fbi, EP93XXFB_ATTRIBS);
+
+ if (blank_mode) {
+ if (fbi->mach_info->blank)
+ fbi->mach_info->blank(blank_mode, info);
+ ep93xxfb_out_locked(fbi, attribs & ~EP93XXFB_ENABLE,
+ EP93XXFB_ATTRIBS);
+ clk_disable(fbi->clk);
+ } else {
+ clk_enable(fbi->clk);
+ ep93xxfb_out_locked(fbi, attribs | EP93XXFB_ENABLE,
+ EP93XXFB_ATTRIBS);
+ if (fbi->mach_info->blank)
+ fbi->mach_info->blank(blank_mode, info);
+ }
+
+ return 0;
+}
+
+static inline int ep93xxfb_convert_color(int val, int width)
+{
+ return ((val << width) + 0x7fff - val) >> 16;
+}
+
+static int ep93xxfb_setcolreg(unsigned int regno, unsigned int red,
+ unsigned int green, unsigned int blue,
+ unsigned int transp, struct fb_info *info)
+{
+ struct ep93xx_fbi *fbi = info->par;
+ unsigned int *pal = info->pseudo_palette;
+ unsigned int ctrl, i, rgb, lut_current, lut_stat;
+
+ switch (info->fix.visual) {
+ case FB_VISUAL_PSEUDOCOLOR:
+ rgb = ((red & 0xff00) << 8) | (green & 0xff00) |
+ ((blue & 0xff00) >> 8);
+
+ pal[regno] = rgb;
+ ep93xxfb_writel(fbi, rgb, (EP93XXFB_COLOR_LUT + (regno << 2)));
+ ctrl = ep93xxfb_readl(fbi, EP93XXFB_LUT_SW_CONTROL);
+ lut_stat = !!(ctrl & EP93XXFB_LUT_SW_CONTROL_SSTAT);
+ lut_current = !!(ctrl & EP93XXFB_LUT_SW_CONTROL_SWTCH);
+
+ if (lut_stat == lut_current) {
+ for (i = 0; i < 256; i++) {
+ ep93xxfb_writel(fbi, pal[i],
+ EP93XXFB_COLOR_LUT + (i << 2));
+ }
+
+ ep93xxfb_writel(fbi,
+ ctrl ^ EP93XXFB_LUT_SW_CONTROL_SWTCH,
+ EP93XXFB_LUT_SW_CONTROL);
+ }
+ break;
+
+ case FB_VISUAL_TRUECOLOR:
+ if (regno > 16)
+ return 1;
+
+ red = ep93xxfb_convert_color(red, info->var.red.length);
+ green = ep93xxfb_convert_color(green, info->var.green.length);
+ blue = ep93xxfb_convert_color(blue, info->var.blue.length);
+ transp = ep93xxfb_convert_color(transp,
+ info->var.transp.length);
+
+ pal[regno] = (red << info->var.red.offset) |
+ (green << info->var.green.offset) |
+ (blue << info->var.blue.offset) |
+ (transp << info->var.transp.offset);
+ break;
+
+ default:
+ return 1;
+ }
+
+ return 0;
+}
+
+static struct fb_ops ep93xxfb_ops = {
+ .owner = THIS_MODULE,
+ .fb_check_var = ep93xxfb_check_var,
+ .fb_set_par = ep93xxfb_set_par,
+ .fb_blank = ep93xxfb_blank,
+ .fb_fillrect = cfb_fillrect,
+ .fb_copyarea = cfb_copyarea,
+ .fb_imageblit = cfb_imageblit,
+ .fb_setcolreg = ep93xxfb_setcolreg,
+ .fb_mmap = ep93xxfb_mmap,
+};
+
+static int __init ep93xxfb_calc_fbsize(struct ep93xxfb_mach_info *mach_info)
+{
+ int i, fb_size = 0;
+
+ if (mach_info->num_modes == EP93XXFB_USE_MODEDB) {
+ fb_size = EP93XXFB_MAX_XRES * EP93XXFB_MAX_YRES *
+ mach_info->bpp / 8;
+ } else {
+ for (i = 0; i < mach_info->num_modes; i++) {
+ const struct fb_videomode *mode;
+ int size;
+
+ mode = &mach_info->modes[i];
+ size = mode->xres * mode->yres * mach_info->bpp / 8;
+ if (size > fb_size)
+ fb_size = size;
+ }
+ }
+
+ return fb_size;
+}
+
+static int __init ep93xxfb_alloc_videomem(struct fb_info *info)
+{
+ struct ep93xx_fbi *fbi = info->par;
+ char __iomem *virt_addr;
+ dma_addr_t phys_addr;
+ unsigned int fb_size;
+
+ fb_size = ep93xxfb_calc_fbsize(fbi->mach_info);
+ virt_addr = dma_alloc_writecombine(info->dev, fb_size,
+ &phys_addr, GFP_KERNEL);
+ if (!virt_addr)
+ return -ENOMEM;
+
+ /*
+ * There is a bug in the ep93xx framebuffer which causes problems
+ * if bit 27 of the physical address is set.
+ * See: http://marc.info/?l=linux-arm-kernel&m=110061245502000&w=2
+ * There does not seem to be any offical errata for this, but I
+ * have confirmed the problem exists on my hardware (ep9315) at
+ * least.
+ */
+ if (check_screenpage_bug && phys_addr & (1 << 27)) {
+ dev_err(info->dev, "ep93xx framebuffer bug. phys addr (0x%x) "
+ "has bit 27 set: cannot init framebuffer\n",
+ phys_addr);
+
+ dma_free_coherent(info->dev, fb_size, virt_addr, phys_addr);
+ return -ENOMEM;
+ }
+
+ info->fix.smem_start = phys_addr;
+ info->fix.smem_len = fb_size;
+ info->screen_base = virt_addr;
+
+ return 0;
+}
+
+static void ep93xxfb_dealloc_videomem(struct fb_info *info)
+{
+ if (info->screen_base)
+ dma_free_coherent(info->dev, info->fix.smem_len,
+ info->screen_base, info->fix.smem_start);
+}
+
+static int __init ep93xxfb_probe(struct platform_device *pdev)
+{
+ struct ep93xxfb_mach_info *mach_info = pdev->dev.platform_data;
+ struct fb_info *info;
+ struct ep93xx_fbi *fbi;
+ struct resource *res;
+ char *video_mode;
+ int err;
+
+ if (!mach_info)
+ return -EINVAL;
+
+ info = framebuffer_alloc(sizeof(struct ep93xx_fbi), &pdev->dev);
+ if (!info)
+ return -ENOMEM;
+
+ info->dev = &pdev->dev;
+ platform_set_drvdata(pdev, info);
+ fbi = info->par;
+ fbi->mach_info = mach_info;
+
+ err = fb_alloc_cmap(&info->cmap, 256, 0);
+ if (err)
+ goto failed;
+
+ err = ep93xxfb_alloc_videomem(info);
+ if (err)
+ goto failed;
+
+ res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ if (!res) {
+ err = -ENXIO;
+ goto failed;
+ }
+
+ res = request_mem_region(res->start, resource_size(res), pdev->name);
+ if (!res) {
+ err = -EBUSY;
+ goto failed;
+ }
+
+ fbi->res = res;
+ fbi->mmio_base = ioremap(res->start, resource_size(res));
+ if (!fbi->mmio_base) {
+ err = -ENXIO;
+ goto failed;
+ }
+
+ strcpy(info->fix.id, pdev->name);
+ info->fbops = &ep93xxfb_ops;
+ info->fix.type = FB_TYPE_PACKED_PIXELS;
+ info->fix.accel = FB_ACCEL_NONE;
+ info->var.activate = FB_ACTIVATE_NOW;
+ info->var.vmode = FB_VMODE_NONINTERLACED;
+ info->flags = FBINFO_DEFAULT;
+ info->node = -1;
+ info->state = FBINFO_STATE_RUNNING;
+ info->pseudo_palette = &fbi->pseudo_palette;
+
+ fb_get_options("ep93xx-fb", &video_mode);
+ err = fb_find_mode(&info->var, info, video_mode,
+ fbi->mach_info->modes, fbi->mach_info->num_modes,
+ fbi->mach_info->default_mode, fbi->mach_info->bpp);
+ if (err == 0) {
+ dev_err(info->dev, "No suitable video mode found\n");
+ err = -EINVAL;
+ goto failed;
+ }
+
+ if (mach_info->setup) {
+ err = mach_info->setup(pdev);
+ if (err)
+ return err;
+ }
+
+ err = ep93xxfb_check_var(&info->var, info);
+ if (err)
+ goto failed;
+
+ fbi->clk = clk_get(info->dev, NULL);
+ if (IS_ERR(fbi->clk)) {
+ err = PTR_ERR(fbi->clk);
+ fbi->clk = NULL;
+ goto failed;
+ }
+
+ ep93xxfb_set_par(info);
+ clk_enable(fbi->clk);
+
+ err = register_framebuffer(info);
+ if (err)
+ goto failed;
+
+ dev_info(info->dev, "registered. Mode = %dx%d-%d\n",
+ info->var.xres, info->var.yres, info->var.bits_per_pixel);
+ return 0;
+
+failed:
+ if (fbi->clk)
+ clk_put(fbi->clk);
+ if (fbi->mmio_base)
+ iounmap(fbi->mmio_base);
+ if (fbi->res)
+ release_mem_region(fbi->res->start, resource_size(fbi->res));
+ ep93xxfb_dealloc_videomem(info);
+ if (&info->cmap)
+ fb_dealloc_cmap(&info->cmap);
+ if (fbi->mach_info->teardown)
+ fbi->mach_info->teardown(pdev);
+ kfree(info);
+ platform_set_drvdata(pdev, NULL);
+
+ return err;
+}
+
+static int ep93xxfb_remove(struct platform_device *pdev)
+{
+ struct fb_info *info = platform_get_drvdata(pdev);
+ struct ep93xx_fbi *fbi = info->par;
+
+ unregister_framebuffer(info);
+ clk_disable(fbi->clk);
+ clk_put(fbi->clk);
+ iounmap(fbi->mmio_base);
+ release_mem_region(fbi->res->start, resource_size(fbi->res));
+ ep93xxfb_dealloc_videomem(info);
+ fb_dealloc_cmap(&info->cmap);
+
+ if (fbi->mach_info->teardown)
+ fbi->mach_info->teardown(pdev);
+
+ kfree(info);
+ platform_set_drvdata(pdev, NULL);
+
+ return 0;
+}
+
+static struct platform_driver ep93xxfb_driver = {
+ .probe = ep93xxfb_probe,
+ .remove = ep93xxfb_remove,
+ .driver = {
+ .name = "ep93xx-fb",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __devinit ep93xxfb_init(void)
+{
+ return platform_driver_register(&ep93xxfb_driver);
+}
+
+static void __exit ep93xxfb_exit(void)
+{
+ platform_driver_unregister(&ep93xxfb_driver);
+}
+
+module_init(ep93xxfb_init);
+module_exit(ep93xxfb_exit);
+
+MODULE_DESCRIPTION("EP93XX Framebuffer Driver");
+MODULE_ALIAS("platform:ep93xx-fb");
+MODULE_AUTHOR("Ryan Mallon <ryan&bluewatersys.com>, "
+ "H Hartley Sweeten <hsweeten@visionengravers.com");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/fbmem.c b/drivers/video/fbmem.c
index a85c818..a1f2e7c 100644
--- a/drivers/video/fbmem.c
+++ b/drivers/video/fbmem.c
@@ -871,8 +871,8 @@
err = -EINVAL;
if (err || !info->fbops->fb_pan_display ||
- var->yoffset + yres > info->var.yres_virtual ||
- var->xoffset + info->var.xres > info->var.xres_virtual)
+ var->yoffset > info->var.yres_virtual - yres ||
+ var->xoffset > info->var.xres_virtual - info->var.xres)
return -EINVAL;
if ((err = info->fbops->fb_pan_display(var, info)))
@@ -954,6 +954,7 @@
goto done;
if ((var->activate & FB_ACTIVATE_MASK) == FB_ACTIVATE_NOW) {
+ struct fb_var_screeninfo old_var;
struct fb_videomode mode;
if (info->fbops->fb_get_caps) {
@@ -963,10 +964,20 @@
goto done;
}
+ old_var = info->var;
info->var = *var;
- if (info->fbops->fb_set_par)
- info->fbops->fb_set_par(info);
+ if (info->fbops->fb_set_par) {
+ ret = info->fbops->fb_set_par(info);
+
+ if (ret) {
+ info->var = old_var;
+ printk(KERN_WARNING "detected "
+ "fb_set_par error, "
+ "error code: %d\n", ret);
+ goto done;
+ }
+ }
fb_pan_display(info, &info->var);
fb_set_cmap(&info->cmap, info);
diff --git a/drivers/video/matrox/g450_pll.c b/drivers/video/matrox/g450_pll.c
index d42346e..09f6e04 100644
--- a/drivers/video/matrox/g450_pll.c
+++ b/drivers/video/matrox/g450_pll.c
@@ -25,16 +25,19 @@
return (p & 0x40) ? fin : fin << ((p & 3) + 1);
}
-static unsigned int g450_mnp2vco(CPMINFO unsigned int mnp) {
+static unsigned int g450_mnp2vco(const struct matrox_fb_info *minfo,
+ unsigned int mnp)
+{
unsigned int m, n;
m = ((mnp >> 16) & 0x0FF) + 1;
n = ((mnp >> 7) & 0x1FE) + 4;
- return (ACCESS_FBINFO(features).pll.ref_freq * n + (m >> 1)) / m;
+ return (minfo->features.pll.ref_freq * n + (m >> 1)) / m;
}
-unsigned int g450_mnp2f(CPMINFO unsigned int mnp) {
- return g450_vco2f(mnp, g450_mnp2vco(PMINFO mnp));
+unsigned int g450_mnp2f(const struct matrox_fb_info *minfo, unsigned int mnp)
+{
+ return g450_vco2f(mnp, g450_mnp2vco(minfo, mnp));
}
static inline unsigned int pll_freq_delta(unsigned int f1, unsigned int f2) {
@@ -49,7 +52,10 @@
#define NO_MORE_MNP 0x01FFFFFF
#define G450_MNP_FREQBITS (0xFFFFFF43) /* do not mask high byte so we'll catch NO_MORE_MNP */
-static unsigned int g450_nextpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* fvco, unsigned int mnp) {
+static unsigned int g450_nextpll(const struct matrox_fb_info *minfo,
+ const struct matrox_pll_limits *pi,
+ unsigned int *fvco, unsigned int mnp)
+{
unsigned int m, n, p;
unsigned int tvco = *fvco;
@@ -90,12 +96,15 @@
} else {
m--;
}
- n = ((tvco * (m+1) + ACCESS_FBINFO(features).pll.ref_freq) / (ACCESS_FBINFO(features).pll.ref_freq * 2)) - 2;
+ n = ((tvco * (m+1) + minfo->features.pll.ref_freq) / (minfo->features.pll.ref_freq * 2)) - 2;
} while (n < 0x03 || n > 0x7A);
return (m << 16) | (n << 8) | p;
}
-static unsigned int g450_firstpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* vco, unsigned int fout) {
+static unsigned int g450_firstpll(const struct matrox_fb_info *minfo,
+ const struct matrox_pll_limits *pi,
+ unsigned int *vco, unsigned int fout)
+{
unsigned int p;
unsigned int vcomax;
@@ -121,88 +130,94 @@
}
*vco = tvco;
}
- return g450_nextpll(PMINFO pi, vco, 0xFF0000 | p);
+ return g450_nextpll(minfo, pi, vco, 0xFF0000 | p);
}
-static inline unsigned int g450_setpll(CPMINFO unsigned int mnp, unsigned int pll) {
+static inline unsigned int g450_setpll(const struct matrox_fb_info *minfo,
+ unsigned int mnp, unsigned int pll)
+{
switch (pll) {
case M_PIXEL_PLL_A:
- matroxfb_DAC_out(PMINFO M1064_XPIXPLLAM, mnp >> 16);
- matroxfb_DAC_out(PMINFO M1064_XPIXPLLAN, mnp >> 8);
- matroxfb_DAC_out(PMINFO M1064_XPIXPLLAP, mnp);
+ matroxfb_DAC_out(minfo, M1064_XPIXPLLAM, mnp >> 16);
+ matroxfb_DAC_out(minfo, M1064_XPIXPLLAN, mnp >> 8);
+ matroxfb_DAC_out(minfo, M1064_XPIXPLLAP, mnp);
return M1064_XPIXPLLSTAT;
case M_PIXEL_PLL_B:
- matroxfb_DAC_out(PMINFO M1064_XPIXPLLBM, mnp >> 16);
- matroxfb_DAC_out(PMINFO M1064_XPIXPLLBN, mnp >> 8);
- matroxfb_DAC_out(PMINFO M1064_XPIXPLLBP, mnp);
+ matroxfb_DAC_out(minfo, M1064_XPIXPLLBM, mnp >> 16);
+ matroxfb_DAC_out(minfo, M1064_XPIXPLLBN, mnp >> 8);
+ matroxfb_DAC_out(minfo, M1064_XPIXPLLBP, mnp);
return M1064_XPIXPLLSTAT;
case M_PIXEL_PLL_C:
- matroxfb_DAC_out(PMINFO M1064_XPIXPLLCM, mnp >> 16);
- matroxfb_DAC_out(PMINFO M1064_XPIXPLLCN, mnp >> 8);
- matroxfb_DAC_out(PMINFO M1064_XPIXPLLCP, mnp);
+ matroxfb_DAC_out(minfo, M1064_XPIXPLLCM, mnp >> 16);
+ matroxfb_DAC_out(minfo, M1064_XPIXPLLCN, mnp >> 8);
+ matroxfb_DAC_out(minfo, M1064_XPIXPLLCP, mnp);
return M1064_XPIXPLLSTAT;
case M_SYSTEM_PLL:
- matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLM, mnp >> 16);
- matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLN, mnp >> 8);
- matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLP, mnp);
+ matroxfb_DAC_out(minfo, DAC1064_XSYSPLLM, mnp >> 16);
+ matroxfb_DAC_out(minfo, DAC1064_XSYSPLLN, mnp >> 8);
+ matroxfb_DAC_out(minfo, DAC1064_XSYSPLLP, mnp);
return DAC1064_XSYSPLLSTAT;
case M_VIDEO_PLL:
- matroxfb_DAC_out(PMINFO M1064_XVIDPLLM, mnp >> 16);
- matroxfb_DAC_out(PMINFO M1064_XVIDPLLN, mnp >> 8);
- matroxfb_DAC_out(PMINFO M1064_XVIDPLLP, mnp);
+ matroxfb_DAC_out(minfo, M1064_XVIDPLLM, mnp >> 16);
+ matroxfb_DAC_out(minfo, M1064_XVIDPLLN, mnp >> 8);
+ matroxfb_DAC_out(minfo, M1064_XVIDPLLP, mnp);
return M1064_XVIDPLLSTAT;
}
return 0;
}
-static inline unsigned int g450_cmppll(CPMINFO unsigned int mnp, unsigned int pll) {
+static inline unsigned int g450_cmppll(const struct matrox_fb_info *minfo,
+ unsigned int mnp, unsigned int pll)
+{
unsigned char m = mnp >> 16;
unsigned char n = mnp >> 8;
unsigned char p = mnp;
switch (pll) {
case M_PIXEL_PLL_A:
- return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLAM) != m ||
- matroxfb_DAC_in(PMINFO M1064_XPIXPLLAN) != n ||
- matroxfb_DAC_in(PMINFO M1064_XPIXPLLAP) != p);
+ return (matroxfb_DAC_in(minfo, M1064_XPIXPLLAM) != m ||
+ matroxfb_DAC_in(minfo, M1064_XPIXPLLAN) != n ||
+ matroxfb_DAC_in(minfo, M1064_XPIXPLLAP) != p);
case M_PIXEL_PLL_B:
- return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLBM) != m ||
- matroxfb_DAC_in(PMINFO M1064_XPIXPLLBN) != n ||
- matroxfb_DAC_in(PMINFO M1064_XPIXPLLBP) != p);
+ return (matroxfb_DAC_in(minfo, M1064_XPIXPLLBM) != m ||
+ matroxfb_DAC_in(minfo, M1064_XPIXPLLBN) != n ||
+ matroxfb_DAC_in(minfo, M1064_XPIXPLLBP) != p);
case M_PIXEL_PLL_C:
- return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) != m ||
- matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) != n ||
- matroxfb_DAC_in(PMINFO M1064_XPIXPLLCP) != p);
+ return (matroxfb_DAC_in(minfo, M1064_XPIXPLLCM) != m ||
+ matroxfb_DAC_in(minfo, M1064_XPIXPLLCN) != n ||
+ matroxfb_DAC_in(minfo, M1064_XPIXPLLCP) != p);
case M_SYSTEM_PLL:
- return (matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLM) != m ||
- matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLN) != n ||
- matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLP) != p);
+ return (matroxfb_DAC_in(minfo, DAC1064_XSYSPLLM) != m ||
+ matroxfb_DAC_in(minfo, DAC1064_XSYSPLLN) != n ||
+ matroxfb_DAC_in(minfo, DAC1064_XSYSPLLP) != p);
case M_VIDEO_PLL:
- return (matroxfb_DAC_in(PMINFO M1064_XVIDPLLM) != m ||
- matroxfb_DAC_in(PMINFO M1064_XVIDPLLN) != n ||
- matroxfb_DAC_in(PMINFO M1064_XVIDPLLP) != p);
+ return (matroxfb_DAC_in(minfo, M1064_XVIDPLLM) != m ||
+ matroxfb_DAC_in(minfo, M1064_XVIDPLLN) != n ||
+ matroxfb_DAC_in(minfo, M1064_XVIDPLLP) != p);
}
return 1;
}
-static inline int g450_isplllocked(CPMINFO unsigned int regidx) {
+static inline int g450_isplllocked(const struct matrox_fb_info *minfo,
+ unsigned int regidx)
+{
unsigned int j;
for (j = 0; j < 1000; j++) {
- if (matroxfb_DAC_in(PMINFO regidx) & 0x40) {
+ if (matroxfb_DAC_in(minfo, regidx) & 0x40) {
unsigned int r = 0;
int i;
for (i = 0; i < 100; i++) {
- r += matroxfb_DAC_in(PMINFO regidx) & 0x40;
+ r += matroxfb_DAC_in(minfo, regidx) & 0x40;
}
return r >= (90 * 0x40);
}
@@ -211,8 +226,10 @@
return 0;
}
-static int g450_testpll(CPMINFO unsigned int mnp, unsigned int pll) {
- return g450_isplllocked(PMINFO g450_setpll(PMINFO mnp, pll));
+static int g450_testpll(const struct matrox_fb_info *minfo, unsigned int mnp,
+ unsigned int pll)
+{
+ return g450_isplllocked(minfo, g450_setpll(minfo, mnp, pll));
}
static void updatehwstate_clk(struct matrox_hw_state* hw, unsigned int mnp, unsigned int pll) {
@@ -225,13 +242,19 @@
}
}
-void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll) {
- if (g450_cmppll(PMINFO mnp, pll)) {
- g450_setpll(PMINFO mnp, pll);
+void matroxfb_g450_setpll_cond(struct matrox_fb_info *minfo, unsigned int mnp,
+ unsigned int pll)
+{
+ if (g450_cmppll(minfo, mnp, pll)) {
+ g450_setpll(minfo, mnp, pll);
}
}
-static inline unsigned int g450_findworkingpll(WPMINFO unsigned int pll, unsigned int* mnparray, unsigned int mnpcount) {
+static inline unsigned int g450_findworkingpll(struct matrox_fb_info *minfo,
+ unsigned int pll,
+ unsigned int *mnparray,
+ unsigned int mnpcount)
+{
unsigned int found = 0;
unsigned int idx;
unsigned int mnpfound = mnparray[0];
@@ -255,22 +278,22 @@
while (sptr >= sarray) {
unsigned int mnp = *sptr--;
- if (g450_testpll(PMINFO mnp - 0x0300, pll) &&
- g450_testpll(PMINFO mnp + 0x0300, pll) &&
- g450_testpll(PMINFO mnp - 0x0200, pll) &&
- g450_testpll(PMINFO mnp + 0x0200, pll) &&
- g450_testpll(PMINFO mnp - 0x0100, pll) &&
- g450_testpll(PMINFO mnp + 0x0100, pll)) {
- if (g450_testpll(PMINFO mnp, pll)) {
+ if (g450_testpll(minfo, mnp - 0x0300, pll) &&
+ g450_testpll(minfo, mnp + 0x0300, pll) &&
+ g450_testpll(minfo, mnp - 0x0200, pll) &&
+ g450_testpll(minfo, mnp + 0x0200, pll) &&
+ g450_testpll(minfo, mnp - 0x0100, pll) &&
+ g450_testpll(minfo, mnp + 0x0100, pll)) {
+ if (g450_testpll(minfo, mnp, pll)) {
return mnp;
}
- } else if (!found && g450_testpll(PMINFO mnp, pll)) {
+ } else if (!found && g450_testpll(minfo, mnp, pll)) {
mnpfound = mnp;
found = 1;
}
}
}
- g450_setpll(PMINFO mnpfound, pll);
+ g450_setpll(minfo, mnpfound, pll);
return mnpfound;
}
@@ -283,7 +306,9 @@
ci->data[0].mnp_value = mnp_value;
}
-static int g450_checkcache(WPMINFO struct matrox_pll_cache* ci, unsigned int mnp_key) {
+static int g450_checkcache(struct matrox_fb_info *minfo,
+ struct matrox_pll_cache *ci, unsigned int mnp_key)
+{
unsigned int i;
mnp_key &= G450_MNP_FREQBITS;
@@ -303,8 +328,10 @@
return NO_MORE_MNP;
}
-static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll,
- unsigned int* mnparray, unsigned int* deltaarray) {
+static int __g450_setclk(struct matrox_fb_info *minfo, unsigned int fout,
+ unsigned int pll, unsigned int *mnparray,
+ unsigned int *deltaarray)
+{
unsigned int mnpcount;
unsigned int pixel_vco;
const struct matrox_pll_limits* pi;
@@ -321,19 +348,19 @@
matroxfb_DAC_lock_irqsave(flags);
- xpwrctrl = matroxfb_DAC_in(PMINFO M1064_XPWRCTRL);
- matroxfb_DAC_out(PMINFO M1064_XPWRCTRL, xpwrctrl & ~M1064_XPWRCTRL_PANELPDN);
+ xpwrctrl = matroxfb_DAC_in(minfo, M1064_XPWRCTRL);
+ matroxfb_DAC_out(minfo, M1064_XPWRCTRL, xpwrctrl & ~M1064_XPWRCTRL_PANELPDN);
mga_outb(M_SEQ_INDEX, M_SEQ1);
mga_outb(M_SEQ_DATA, mga_inb(M_SEQ_DATA) | M_SEQ1_SCROFF);
- tmp = matroxfb_DAC_in(PMINFO M1064_XPIXCLKCTRL);
+ tmp = matroxfb_DAC_in(minfo, M1064_XPIXCLKCTRL);
tmp |= M1064_XPIXCLKCTRL_DIS;
if (!(tmp & M1064_XPIXCLKCTRL_PLL_UP)) {
tmp |= M1064_XPIXCLKCTRL_PLL_UP;
}
- matroxfb_DAC_out(PMINFO M1064_XPIXCLKCTRL, tmp);
+ matroxfb_DAC_out(minfo, M1064_XPIXCLKCTRL, tmp);
/* DVI PLL preferred for frequencies up to
panel link max, standard PLL otherwise */
- if (fout >= MINFO->max_pixel_clock_panellink)
+ if (fout >= minfo->max_pixel_clock_panellink)
tmp = 0;
else tmp =
M1064_XDVICLKCTRL_DVIDATAPATHSEL |
@@ -341,8 +368,8 @@
M1064_XDVICLKCTRL_C1DVICLKEN |
M1064_XDVICLKCTRL_DVILOOPCTL |
M1064_XDVICLKCTRL_P1LOOPBWDTCTL;
- matroxfb_DAC_out(PMINFO M1064_XDVICLKCTRL,tmp);
- matroxfb_DAC_out(PMINFO M1064_XPWRCTRL,
+ matroxfb_DAC_out(minfo, M1064_XDVICLKCTRL, tmp);
+ matroxfb_DAC_out(minfo, M1064_XPWRCTRL,
xpwrctrl);
matroxfb_DAC_unlock_irqrestore(flags);
@@ -363,20 +390,20 @@
}
mga_outb(M_MISC_REG, misc);
}
- pi = &ACCESS_FBINFO(limits.pixel);
- ci = &ACCESS_FBINFO(cache.pixel);
+ pi = &minfo->limits.pixel;
+ ci = &minfo->cache.pixel;
break;
case M_SYSTEM_PLL:
{
u_int32_t opt;
- pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &opt);
+ pci_read_config_dword(minfo->pcidev, PCI_OPTION_REG, &opt);
if (!(opt & 0x20)) {
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, opt | 0x20);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, opt | 0x20);
}
}
- pi = &ACCESS_FBINFO(limits.system);
- ci = &ACCESS_FBINFO(cache.system);
+ pi = &minfo->limits.system;
+ ci = &minfo->cache.system;
break;
case M_VIDEO_PLL:
{
@@ -385,18 +412,18 @@
unsigned long flags;
matroxfb_DAC_lock_irqsave(flags);
- tmp = matroxfb_DAC_in(PMINFO M1064_XPWRCTRL);
+ tmp = matroxfb_DAC_in(minfo, M1064_XPWRCTRL);
if (!(tmp & 2)) {
- matroxfb_DAC_out(PMINFO M1064_XPWRCTRL, tmp | 2);
+ matroxfb_DAC_out(minfo, M1064_XPWRCTRL, tmp | 2);
}
- mnp = matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) << 16;
- mnp |= matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) << 8;
- pixel_vco = g450_mnp2vco(PMINFO mnp);
+ mnp = matroxfb_DAC_in(minfo, M1064_XPIXPLLCM) << 16;
+ mnp |= matroxfb_DAC_in(minfo, M1064_XPIXPLLCN) << 8;
+ pixel_vco = g450_mnp2vco(minfo, mnp);
matroxfb_DAC_unlock_irqrestore(flags);
}
- pi = &ACCESS_FBINFO(limits.video);
- ci = &ACCESS_FBINFO(cache.video);
+ pi = &minfo->limits.video;
+ ci = &minfo->cache.video;
break;
default:
return -EINVAL;
@@ -407,12 +434,12 @@
unsigned int mnp;
unsigned int xvco;
- for(mnp = g450_firstpll(PMINFO pi, &xvco, fout); mnp != NO_MORE_MNP; mnp = g450_nextpll(PMINFO pi, &xvco, mnp)) {
+ for (mnp = g450_firstpll(minfo, pi, &xvco, fout); mnp != NO_MORE_MNP; mnp = g450_nextpll(minfo, pi, &xvco, mnp)) {
unsigned int idx;
unsigned int vco;
unsigned int delta;
- vco = g450_mnp2vco(PMINFO mnp);
+ vco = g450_mnp2vco(minfo, mnp);
#if 0
if (pll == M_VIDEO_PLL) {
unsigned int big, small;
@@ -444,7 +471,7 @@
* (freqs near VCOmin aren't as stable)
*/
if (delta == deltaarray[idx-1]
- && vco != g450_mnp2vco(PMINFO mnparray[idx-1])
+ && vco != g450_mnp2vco(minfo, mnparray[idx-1])
&& vco < (pi->vcomin * 17 / 16)) {
break;
}
@@ -468,14 +495,14 @@
unsigned int mnp;
matroxfb_DAC_lock_irqsave(flags);
- mnp = g450_checkcache(PMINFO ci, mnparray[0]);
+ mnp = g450_checkcache(minfo, ci, mnparray[0]);
if (mnp != NO_MORE_MNP) {
- matroxfb_g450_setpll_cond(PMINFO mnp, pll);
+ matroxfb_g450_setpll_cond(minfo, mnp, pll);
} else {
- mnp = g450_findworkingpll(PMINFO pll, mnparray, mnpcount);
+ mnp = g450_findworkingpll(minfo, pll, mnparray, mnpcount);
g450_addcache(ci, mnparray[0], mnp);
}
- updatehwstate_clk(&ACCESS_FBINFO(hw), mnp, pll);
+ updatehwstate_clk(&minfo->hw, mnp, pll);
matroxfb_DAC_unlock_irqrestore(flags);
return mnp;
}
@@ -485,14 +512,16 @@
* Currently there is 5(p) * 10(m) = 50 possible values. */
#define MNP_TABLE_SIZE 64
-int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll) {
+int matroxfb_g450_setclk(struct matrox_fb_info *minfo, unsigned int fout,
+ unsigned int pll)
+{
unsigned int* arr;
arr = kmalloc(sizeof(*arr) * MNP_TABLE_SIZE * 2, GFP_KERNEL);
if (arr) {
int r;
- r = __g450_setclk(PMINFO fout, pll, arr, arr + MNP_TABLE_SIZE);
+ r = __g450_setclk(minfo, fout, pll, arr, arr + MNP_TABLE_SIZE);
kfree(arr);
return r;
}
diff --git a/drivers/video/matrox/g450_pll.h b/drivers/video/matrox/g450_pll.h
index c17ed74..aac615d 100644
--- a/drivers/video/matrox/g450_pll.h
+++ b/drivers/video/matrox/g450_pll.h
@@ -3,8 +3,10 @@
#include "matroxfb_base.h"
-int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll);
-unsigned int g450_mnp2f(CPMINFO unsigned int mnp);
-void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll);
+int matroxfb_g450_setclk(struct matrox_fb_info *minfo, unsigned int fout,
+ unsigned int pll);
+unsigned int g450_mnp2f(const struct matrox_fb_info *minfo, unsigned int mnp);
+void matroxfb_g450_setpll_cond(struct matrox_fb_info *minfo, unsigned int mnp,
+ unsigned int pll);
#endif /* __G450_PLL_H__ */
diff --git a/drivers/video/matrox/i2c-matroxfb.c b/drivers/video/matrox/i2c-matroxfb.c
index c14e3e2..f3728ab 100644
--- a/drivers/video/matrox/i2c-matroxfb.c
+++ b/drivers/video/matrox/i2c-matroxfb.c
@@ -41,7 +41,7 @@
int v;
matroxfb_DAC_lock_irqsave(flags);
- v = matroxfb_DAC_in(PMINFO DAC_XGENIODATA);
+ v = matroxfb_DAC_in(minfo, DAC_XGENIODATA);
matroxfb_DAC_unlock_irqrestore(flags);
return v;
}
@@ -51,10 +51,10 @@
int v;
matroxfb_DAC_lock_irqsave(flags);
- v = (matroxfb_DAC_in(PMINFO DAC_XGENIOCTRL) & mask) | val;
- matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, v);
+ v = (matroxfb_DAC_in(minfo, DAC_XGENIOCTRL) & mask) | val;
+ matroxfb_DAC_out(minfo, DAC_XGENIOCTRL, v);
/* We must reset GENIODATA very often... XFree plays with this register */
- matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0x00);
+ matroxfb_DAC_out(minfo, DAC_XGENIODATA, 0x00);
matroxfb_DAC_unlock_irqrestore(flags);
}
@@ -112,7 +112,7 @@
i2c_set_adapdata(&b->adapter, b);
b->adapter.class = class;
b->adapter.algo_data = &b->bac;
- b->adapter.dev.parent = &ACCESS_FBINFO(pcidev)->dev;
+ b->adapter.dev.parent = &minfo->pcidev->dev;
b->bac = matrox_i2c_algo_template;
b->bac.data = b;
err = i2c_bit_add_bus(&b->adapter);
@@ -149,11 +149,11 @@
return NULL;
matroxfb_DAC_lock_irqsave(flags);
- matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0xFF);
- matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, 0x00);
+ matroxfb_DAC_out(minfo, DAC_XGENIODATA, 0xFF);
+ matroxfb_DAC_out(minfo, DAC_XGENIOCTRL, 0x00);
matroxfb_DAC_unlock_irqrestore(flags);
- switch (ACCESS_FBINFO(chip)) {
+ switch (minfo->chip) {
case MGA_2064:
case MGA_2164:
err = i2c_bus_reg(&m2info->ddc1, minfo,
@@ -168,7 +168,7 @@
}
if (err)
goto fail_ddc1;
- if (ACCESS_FBINFO(devflags.dualhead)) {
+ if (minfo->devflags.dualhead) {
err = i2c_bus_reg(&m2info->ddc2, minfo,
DDC2_DATA, DDC2_CLK,
"DDC:fb%u #1", I2C_CLASS_DDC);
diff --git a/drivers/video/matrox/matroxfb_DAC1064.c b/drivers/video/matrox/matroxfb_DAC1064.c
index a74e5da..f9fa0fd 100644
--- a/drivers/video/matrox/matroxfb_DAC1064.c
+++ b/drivers/video/matrox/matroxfb_DAC1064.c
@@ -33,7 +33,11 @@
#define DAC1064_OPT_MDIV2 0x00
#define DAC1064_OPT_RESERVED 0x10
-static void DAC1064_calcclock(CPMINFO unsigned int freq, unsigned int fmax, unsigned int* in, unsigned int* feed, unsigned int* post) {
+static void DAC1064_calcclock(const struct matrox_fb_info *minfo,
+ unsigned int freq, unsigned int fmax,
+ unsigned int *in, unsigned int *feed,
+ unsigned int *post)
+{
unsigned int fvco;
unsigned int p;
@@ -41,7 +45,7 @@
/* only for devices older than G450 */
- fvco = PLL_calcclock(PMINFO freq, fmax, in, feed, &p);
+ fvco = PLL_calcclock(minfo, freq, fmax, in, feed, &p);
p = (1 << p) - 1;
if (fvco <= 100000)
@@ -80,32 +84,35 @@
0x00,
0x00, 0x00, 0xFF, 0xFF};
-static void DAC1064_setpclk(WPMINFO unsigned long fout) {
+static void DAC1064_setpclk(struct matrox_fb_info *minfo, unsigned long fout)
+{
unsigned int m, n, p;
DBG(__func__)
- DAC1064_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
- ACCESS_FBINFO(hw).DACclk[0] = m;
- ACCESS_FBINFO(hw).DACclk[1] = n;
- ACCESS_FBINFO(hw).DACclk[2] = p;
+ DAC1064_calcclock(minfo, fout, minfo->max_pixel_clock, &m, &n, &p);
+ minfo->hw.DACclk[0] = m;
+ minfo->hw.DACclk[1] = n;
+ minfo->hw.DACclk[2] = p;
}
-static void DAC1064_setmclk(WPMINFO int oscinfo, unsigned long fmem) {
+static void DAC1064_setmclk(struct matrox_fb_info *minfo, int oscinfo,
+ unsigned long fmem)
+{
u_int32_t mx;
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
- if (ACCESS_FBINFO(devflags.noinit)) {
+ if (minfo->devflags.noinit) {
/* read MCLK and give up... */
- hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
- hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
- hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+ hw->DACclk[3] = inDAC1064(minfo, DAC1064_XSYSPLLM);
+ hw->DACclk[4] = inDAC1064(minfo, DAC1064_XSYSPLLN);
+ hw->DACclk[5] = inDAC1064(minfo, DAC1064_XSYSPLLP);
return;
}
mx = hw->MXoptionReg | 0x00000004;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
mx &= ~0x000000BB;
if (oscinfo & DAC1064_OPT_GDIV1)
mx |= 0x00000008;
@@ -120,9 +127,9 @@
/* powerup system PLL, select PCI clock */
mx |= 0x00000020;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
mx &= ~0x00000004;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
/* !!! you must not access device if MCLK is not running !!!
Doing so cause immediate PCI lockup :-( Maybe they should
@@ -131,12 +138,12 @@
perfect... */
/* (bit 2 of PCI_OPTION_REG must be 0... and bits 0,1 must not
select PLL... because of PLL can be stopped at this time) */
- DAC1064_calcclock(PMINFO fmem, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
- outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3] = m);
- outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4] = n);
- outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5] = p);
+ DAC1064_calcclock(minfo, fmem, minfo->max_pixel_clock, &m, &n, &p);
+ outDAC1064(minfo, DAC1064_XSYSPLLM, hw->DACclk[3] = m);
+ outDAC1064(minfo, DAC1064_XSYSPLLN, hw->DACclk[4] = n);
+ outDAC1064(minfo, DAC1064_XSYSPLLP, hw->DACclk[5] = p);
for (clk = 65536; clk; --clk) {
- if (inDAC1064(PMINFO DAC1064_XSYSPLLSTAT) & 0x40)
+ if (inDAC1064(minfo, DAC1064_XSYSPLLSTAT) & 0x40)
break;
}
if (!clk)
@@ -147,29 +154,30 @@
/* select specified system clock source */
mx |= oscinfo & DAC1064_OPT_SCLK_MASK;
}
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
mx &= ~0x00000004;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
hw->MXoptionReg = mx;
}
#ifdef CONFIG_FB_MATROX_G
-static void g450_set_plls(WPMINFO2) {
+static void g450_set_plls(struct matrox_fb_info *minfo)
+{
u_int32_t c2_ctl;
unsigned int pxc;
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
int pixelmnp;
int videomnp;
c2_ctl = hw->crtc2.ctl & ~0x4007; /* Clear PLL + enable for CRTC2 */
c2_ctl |= 0x0001; /* Enable CRTC2 */
hw->DACreg[POS1064_XPWRCTRL] &= ~0x02; /* Stop VIDEO PLL */
- pixelmnp = ACCESS_FBINFO(crtc1).mnp;
- videomnp = ACCESS_FBINFO(crtc2).mnp;
+ pixelmnp = minfo->crtc1.mnp;
+ videomnp = minfo->crtc2.mnp;
if (videomnp < 0) {
c2_ctl &= ~0x0001; /* Disable CRTC2 */
hw->DACreg[POS1064_XPWRCTRL] &= ~0x10; /* Powerdown CRTC2 */
- } else if (ACCESS_FBINFO(crtc2).pixclock == ACCESS_FBINFO(features).pll.ref_freq) {
+ } else if (minfo->crtc2.pixclock == minfo->features.pll.ref_freq) {
c2_ctl |= 0x4002; /* Use reference directly */
} else if (videomnp == pixelmnp) {
c2_ctl |= 0x0004; /* Use pixel PLL */
@@ -184,27 +192,27 @@
c2_ctl |= 0x0006; /* Use video PLL */
hw->DACreg[POS1064_XPWRCTRL] |= 0x02;
- outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
- matroxfb_g450_setpll_cond(PMINFO videomnp, M_VIDEO_PLL);
+ outDAC1064(minfo, M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+ matroxfb_g450_setpll_cond(minfo, videomnp, M_VIDEO_PLL);
}
hw->DACreg[POS1064_XPIXCLKCTRL] &= ~M1064_XPIXCLKCTRL_PLL_UP;
if (pixelmnp >= 0) {
hw->DACreg[POS1064_XPIXCLKCTRL] |= M1064_XPIXCLKCTRL_PLL_UP;
- outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
- matroxfb_g450_setpll_cond(PMINFO pixelmnp, M_PIXEL_PLL_C);
+ outDAC1064(minfo, M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+ matroxfb_g450_setpll_cond(minfo, pixelmnp, M_PIXEL_PLL_C);
}
if (c2_ctl != hw->crtc2.ctl) {
hw->crtc2.ctl = c2_ctl;
mga_outl(0x3C10, c2_ctl);
}
- pxc = ACCESS_FBINFO(crtc1).pixclock;
- if (pxc == 0 || ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC2) {
- pxc = ACCESS_FBINFO(crtc2).pixclock;
+ pxc = minfo->crtc1.pixclock;
+ if (pxc == 0 || minfo->outputs[2].src == MATROXFB_SRC_CRTC2) {
+ pxc = minfo->crtc2.pixclock;
}
- if (ACCESS_FBINFO(chip) == MGA_G550) {
+ if (minfo->chip == MGA_G550) {
if (pxc < 45000) {
hw->DACreg[POS1064_XPANMODE] = 0x00; /* 0-50 */
} else if (pxc < 55000) {
@@ -245,18 +253,19 @@
}
#endif
-void DAC1064_global_init(WPMINFO2) {
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+void DAC1064_global_init(struct matrox_fb_info *minfo)
+{
+ struct matrox_hw_state *hw = &minfo->hw;
hw->DACreg[POS1064_XMISCCTRL] &= M1064_XMISCCTRL_DAC_WIDTHMASK;
hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_LUT_EN;
hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_PLL;
#ifdef CONFIG_FB_MATROX_G
- if (ACCESS_FBINFO(devflags.g450dac)) {
+ if (minfo->devflags.g450dac) {
hw->DACreg[POS1064_XPWRCTRL] = 0x1F; /* powerup everything */
hw->DACreg[POS1064_XOUTPUTCONN] = 0x00; /* disable outputs */
hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
- switch (ACCESS_FBINFO(outputs[0]).src) {
+ switch (minfo->outputs[0].src) {
case MATROXFB_SRC_CRTC1:
case MATROXFB_SRC_CRTC2:
hw->DACreg[POS1064_XOUTPUTCONN] |= 0x01; /* enable output; CRTC1/2 selection is in CRTC2 ctl */
@@ -265,12 +274,12 @@
hw->DACreg[POS1064_XMISCCTRL] &= ~M1064_XMISCCTRL_DAC_EN;
break;
}
- switch (ACCESS_FBINFO(outputs[1]).src) {
+ switch (minfo->outputs[1].src) {
case MATROXFB_SRC_CRTC1:
hw->DACreg[POS1064_XOUTPUTCONN] |= 0x04;
break;
case MATROXFB_SRC_CRTC2:
- if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_MONITOR) {
+ if (minfo->outputs[1].mode == MATROXFB_OUTPUT_MODE_MONITOR) {
hw->DACreg[POS1064_XOUTPUTCONN] |= 0x08;
} else {
hw->DACreg[POS1064_XOUTPUTCONN] |= 0x0C;
@@ -280,7 +289,7 @@
hw->DACreg[POS1064_XPWRCTRL] &= ~0x01; /* Poweroff DAC2 */
break;
}
- switch (ACCESS_FBINFO(outputs[2]).src) {
+ switch (minfo->outputs[2].src) {
case MATROXFB_SRC_CRTC1:
hw->DACreg[POS1064_XOUTPUTCONN] |= 0x20;
break;
@@ -299,55 +308,57 @@
break;
}
/* Now set timming related variables... */
- g450_set_plls(PMINFO2);
+ g450_set_plls(minfo);
} else
#endif
{
- if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1) {
+ if (minfo->outputs[1].src == MATROXFB_SRC_CRTC1) {
hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_EXT;
hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_MAFC12;
- } else if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
+ } else if (minfo->outputs[1].src == MATROXFB_SRC_CRTC2) {
hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_C2_MAFC12;
- } else if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1)
+ } else if (minfo->outputs[2].src == MATROXFB_SRC_CRTC1)
hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_PANELLINK | G400_XMISCCTRL_VDO_MAFC12;
else
hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_DIS;
- if (ACCESS_FBINFO(outputs[0]).src != MATROXFB_SRC_NONE)
+ if (minfo->outputs[0].src != MATROXFB_SRC_NONE)
hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
}
}
-void DAC1064_global_restore(WPMINFO2) {
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+void DAC1064_global_restore(struct matrox_fb_info *minfo)
+{
+ struct matrox_hw_state *hw = &minfo->hw;
- outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
- outDAC1064(PMINFO M1064_XMISCCTRL, hw->DACreg[POS1064_XMISCCTRL]);
- if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
- outDAC1064(PMINFO 0x20, 0x04);
- outDAC1064(PMINFO 0x1F, ACCESS_FBINFO(devflags.dfp_type));
- if (ACCESS_FBINFO(devflags.g450dac)) {
- outDAC1064(PMINFO M1064_XSYNCCTRL, 0xCC);
- outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
- outDAC1064(PMINFO M1064_XPANMODE, hw->DACreg[POS1064_XPANMODE]);
- outDAC1064(PMINFO M1064_XOUTPUTCONN, hw->DACreg[POS1064_XOUTPUTCONN]);
+ outDAC1064(minfo, M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+ outDAC1064(minfo, M1064_XMISCCTRL, hw->DACreg[POS1064_XMISCCTRL]);
+ if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400) {
+ outDAC1064(minfo, 0x20, 0x04);
+ outDAC1064(minfo, 0x1F, minfo->devflags.dfp_type);
+ if (minfo->devflags.g450dac) {
+ outDAC1064(minfo, M1064_XSYNCCTRL, 0xCC);
+ outDAC1064(minfo, M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+ outDAC1064(minfo, M1064_XPANMODE, hw->DACreg[POS1064_XPANMODE]);
+ outDAC1064(minfo, M1064_XOUTPUTCONN, hw->DACreg[POS1064_XOUTPUTCONN]);
}
}
}
-static int DAC1064_init_1(WPMINFO struct my_timming* m) {
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int DAC1064_init_1(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
memcpy(hw->DACreg, MGA1064_DAC, sizeof(MGA1064_DAC_regs));
- switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ switch (minfo->fbcon.var.bits_per_pixel) {
/* case 4: not supported by MGA1064 DAC */
case 8:
hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_8BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
break;
case 16:
- if (ACCESS_FBINFO(fbcon).var.green.length == 5)
+ if (minfo->fbcon.var.green.length == 5)
hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_15BPP_1BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
else
hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_16BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
@@ -361,22 +372,23 @@
default:
return 1; /* unsupported depth */
}
- hw->DACreg[POS1064_XVREFCTRL] = ACCESS_FBINFO(features.DAC1064.xvrefctrl);
+ hw->DACreg[POS1064_XVREFCTRL] = minfo->features.DAC1064.xvrefctrl;
hw->DACreg[POS1064_XGENCTRL] &= ~M1064_XGENCTRL_SYNC_ON_GREEN_MASK;
hw->DACreg[POS1064_XGENCTRL] |= (m->sync & FB_SYNC_ON_GREEN)?M1064_XGENCTRL_SYNC_ON_GREEN:M1064_XGENCTRL_NO_SYNC_ON_GREEN;
hw->DACreg[POS1064_XCURADDL] = 0;
hw->DACreg[POS1064_XCURADDH] = 0;
- DAC1064_global_init(PMINFO2);
+ DAC1064_global_init(minfo);
return 0;
}
-static int DAC1064_init_2(WPMINFO struct my_timming* m) {
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int DAC1064_init_2(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
- if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 16) { /* 256 entries */
+ if (minfo->fbcon.var.bits_per_pixel > 16) { /* 256 entries */
int i;
for (i = 0; i < 256; i++) {
@@ -384,8 +396,8 @@
hw->DACpal[i * 3 + 1] = i;
hw->DACpal[i * 3 + 2] = i;
}
- } else if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 8) {
- if (ACCESS_FBINFO(fbcon).var.green.length == 5) { /* 0..31, 128..159 */
+ } else if (minfo->fbcon.var.bits_per_pixel > 8) {
+ if (minfo->fbcon.var.green.length == 5) { /* 0..31, 128..159 */
int i;
for (i = 0; i < 32; i++) {
@@ -413,8 +425,9 @@
return 0;
}
-static void DAC1064_restore_1(WPMINFO2) {
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static void DAC1064_restore_1(struct matrox_fb_info *minfo)
+{
+ struct matrox_hw_state *hw = &minfo->hw;
CRITFLAGS
@@ -422,28 +435,29 @@
CRITBEGIN
- if ((inDAC1064(PMINFO DAC1064_XSYSPLLM) != hw->DACclk[3]) ||
- (inDAC1064(PMINFO DAC1064_XSYSPLLN) != hw->DACclk[4]) ||
- (inDAC1064(PMINFO DAC1064_XSYSPLLP) != hw->DACclk[5])) {
- outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3]);
- outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4]);
- outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5]);
+ if ((inDAC1064(minfo, DAC1064_XSYSPLLM) != hw->DACclk[3]) ||
+ (inDAC1064(minfo, DAC1064_XSYSPLLN) != hw->DACclk[4]) ||
+ (inDAC1064(minfo, DAC1064_XSYSPLLP) != hw->DACclk[5])) {
+ outDAC1064(minfo, DAC1064_XSYSPLLM, hw->DACclk[3]);
+ outDAC1064(minfo, DAC1064_XSYSPLLN, hw->DACclk[4]);
+ outDAC1064(minfo, DAC1064_XSYSPLLP, hw->DACclk[5]);
}
{
unsigned int i;
for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
if ((i != POS1064_XPIXCLKCTRL) && (i != POS1064_XMISCCTRL))
- outDAC1064(PMINFO MGA1064_DAC_regs[i], hw->DACreg[i]);
+ outDAC1064(minfo, MGA1064_DAC_regs[i], hw->DACreg[i]);
}
}
- DAC1064_global_restore(PMINFO2);
+ DAC1064_global_restore(minfo);
CRITEND
};
-static void DAC1064_restore_2(WPMINFO2) {
+static void DAC1064_restore_2(struct matrox_fb_info *minfo)
+{
#ifdef DEBUG
unsigned int i;
#endif
@@ -453,12 +467,12 @@
#ifdef DEBUG
dprintk(KERN_DEBUG "DAC1064regs ");
for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
- dprintk("R%02X=%02X ", MGA1064_DAC_regs[i], ACCESS_FBINFO(hw).DACreg[i]);
+ dprintk("R%02X=%02X ", MGA1064_DAC_regs[i], minfo->hw.DACreg[i]);
if ((i & 0x7) == 0x7) dprintk(KERN_DEBUG "continuing... ");
}
dprintk(KERN_DEBUG "DAC1064clk ");
for (i = 0; i < 6; i++)
- dprintk("C%02X=%02X ", i, ACCESS_FBINFO(hw).DACclk[i]);
+ dprintk("C%02X=%02X ", i, minfo->hw.DACclk[i]);
dprintk("\n");
#endif
}
@@ -470,14 +484,14 @@
int tmout;
CRITFLAGS
- DAC1064_setpclk(PMINFO m->pixclock);
+ DAC1064_setpclk(minfo, m->pixclock);
CRITBEGIN
for (i = 0; i < 3; i++)
- outDAC1064(PMINFO M1064_XPIXPLLCM + i, ACCESS_FBINFO(hw).DACclk[i]);
+ outDAC1064(minfo, M1064_XPIXPLLCM + i, minfo->hw.DACclk[i]);
for (tmout = 500000; tmout; tmout--) {
- if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+ if (inDAC1064(minfo, M1064_XPIXPLLSTAT) & 0x40)
break;
udelay(10);
};
@@ -500,9 +514,9 @@
static int g450_compute(void* out, struct my_timming* m) {
#define minfo ((struct matrox_fb_info*)out)
if (m->mnp < 0) {
- m->mnp = matroxfb_g450_setclk(PMINFO m->pixclock, (m->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+ m->mnp = matroxfb_g450_setclk(minfo, m->pixclock, (m->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
if (m->mnp >= 0) {
- m->pixclock = g450_mnp2f(PMINFO m->mnp);
+ m->pixclock = g450_mnp2f(minfo, m->mnp);
}
}
#undef minfo
@@ -518,13 +532,14 @@
#endif /* NEED_DAC1064 */
#ifdef CONFIG_FB_MATROX_MYSTIQUE
-static int MGA1064_init(WPMINFO struct my_timming* m) {
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int MGA1064_init(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
- if (DAC1064_init_1(PMINFO m)) return 1;
- if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+ if (DAC1064_init_1(minfo, m)) return 1;
+ if (matroxfb_vgaHWinit(minfo, m)) return 1;
hw->MiscOutReg = 0xCB;
if (m->sync & FB_SYNC_HOR_HIGH_ACT)
@@ -534,20 +549,21 @@
if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
hw->CRTCEXT[3] |= 0x40;
- if (DAC1064_init_2(PMINFO m)) return 1;
+ if (DAC1064_init_2(minfo, m)) return 1;
return 0;
}
#endif
#ifdef CONFIG_FB_MATROX_G
-static int MGAG100_init(WPMINFO struct my_timming* m) {
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int MGAG100_init(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
- if (DAC1064_init_1(PMINFO m)) return 1;
+ if (DAC1064_init_1(minfo, m)) return 1;
hw->MXoptionReg &= ~0x2000;
- if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+ if (matroxfb_vgaHWinit(minfo, m)) return 1;
hw->MiscOutReg = 0xEF;
if (m->sync & FB_SYNC_HOR_HIGH_ACT)
@@ -557,27 +573,28 @@
if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
hw->CRTCEXT[3] |= 0x40;
- if (DAC1064_init_2(PMINFO m)) return 1;
+ if (DAC1064_init_2(minfo, m)) return 1;
return 0;
}
#endif /* G */
#ifdef CONFIG_FB_MATROX_MYSTIQUE
-static void MGA1064_ramdac_init(WPMINFO2) {
+static void MGA1064_ramdac_init(struct matrox_fb_info *minfo)
+{
DBG(__func__)
- /* ACCESS_FBINFO(features.DAC1064.vco_freq_min) = 120000; */
- ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
- ACCESS_FBINFO(features.pll.ref_freq) = 14318;
- ACCESS_FBINFO(features.pll.feed_div_min) = 100;
- ACCESS_FBINFO(features.pll.feed_div_max) = 127;
- ACCESS_FBINFO(features.pll.in_div_min) = 1;
- ACCESS_FBINFO(features.pll.in_div_max) = 31;
- ACCESS_FBINFO(features.pll.post_shift_max) = 3;
- ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_EXTERNAL;
+ /* minfo->features.DAC1064.vco_freq_min = 120000; */
+ minfo->features.pll.vco_freq_min = 62000;
+ minfo->features.pll.ref_freq = 14318;
+ minfo->features.pll.feed_div_min = 100;
+ minfo->features.pll.feed_div_max = 127;
+ minfo->features.pll.in_div_min = 1;
+ minfo->features.pll.in_div_max = 31;
+ minfo->features.pll.post_shift_max = 3;
+ minfo->features.DAC1064.xvrefctrl = DAC1064_XVREFCTRL_EXTERNAL;
/* maybe cmdline MCLK= ?, doc says gclk=44MHz, mclk=66MHz... it was 55/83 with old values */
- DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PLL, 133333);
+ DAC1064_setmclk(minfo, DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PLL, 133333);
}
#endif
@@ -589,23 +606,25 @@
static int def50 = 0; /* reg50, & 0x0F, & 0x3000 (only 0x0000, 0x1000, 0x2000 (0x3000 disallowed and treated as 0) */
#endif
-static void MGAG100_progPixClock(CPMINFO int flags, int m, int n, int p) {
+static void MGAG100_progPixClock(const struct matrox_fb_info *minfo, int flags,
+ int m, int n, int p)
+{
int reg;
int selClk;
int clk;
DBG(__func__)
- outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) | M1064_XPIXCLKCTRL_DIS |
+ outDAC1064(minfo, M1064_XPIXCLKCTRL, inDAC1064(minfo, M1064_XPIXCLKCTRL) | M1064_XPIXCLKCTRL_DIS |
M1064_XPIXCLKCTRL_PLL_UP);
switch (flags & 3) {
case 0: reg = M1064_XPIXPLLAM; break;
case 1: reg = M1064_XPIXPLLBM; break;
default: reg = M1064_XPIXPLLCM; break;
}
- outDAC1064(PMINFO reg++, m);
- outDAC1064(PMINFO reg++, n);
- outDAC1064(PMINFO reg, p);
+ outDAC1064(minfo, reg++, m);
+ outDAC1064(minfo, reg++, n);
+ outDAC1064(minfo, reg, p);
selClk = mga_inb(M_MISC_REG_READ) & ~0xC;
/* there should be flags & 0x03 & case 0/1/else */
/* and we should first select source and after that we should wait for PLL */
@@ -617,61 +636,64 @@
}
mga_outb(M_MISC_REG, selClk);
for (clk = 500000; clk; clk--) {
- if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+ if (inDAC1064(minfo, M1064_XPIXPLLSTAT) & 0x40)
break;
udelay(10);
};
if (!clk)
printk(KERN_ERR "matroxfb: Pixel PLL%c not locked after usual time\n", (reg-M1064_XPIXPLLAM-2)/4 + 'A');
- selClk = inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_SRC_MASK;
+ selClk = inDAC1064(minfo, M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_SRC_MASK;
switch (flags & 0x0C) {
case 0x00: selClk |= M1064_XPIXCLKCTRL_SRC_PCI; break;
case 0x04: selClk |= M1064_XPIXCLKCTRL_SRC_PLL; break;
default: selClk |= M1064_XPIXCLKCTRL_SRC_EXT; break;
}
- outDAC1064(PMINFO M1064_XPIXCLKCTRL, selClk);
- outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_DIS);
+ outDAC1064(minfo, M1064_XPIXCLKCTRL, selClk);
+ outDAC1064(minfo, M1064_XPIXCLKCTRL, inDAC1064(minfo, M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_DIS);
}
-static void MGAG100_setPixClock(CPMINFO int flags, int freq) {
+static void MGAG100_setPixClock(const struct matrox_fb_info *minfo, int flags,
+ int freq)
+{
unsigned int m, n, p;
DBG(__func__)
- DAC1064_calcclock(PMINFO freq, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
- MGAG100_progPixClock(PMINFO flags, m, n, p);
+ DAC1064_calcclock(minfo, freq, minfo->max_pixel_clock, &m, &n, &p);
+ MGAG100_progPixClock(minfo, flags, m, n, p);
}
#endif
#ifdef CONFIG_FB_MATROX_MYSTIQUE
-static int MGA1064_preinit(WPMINFO2) {
+static int MGA1064_preinit(struct matrox_fb_info *minfo)
+{
static const int vxres_mystique[] = { 512, 640, 768, 800, 832, 960,
1024, 1152, 1280, 1600, 1664, 1920,
2048, 0};
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
- /* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
- ACCESS_FBINFO(capable.text) = 1;
- ACCESS_FBINFO(capable.vxres) = vxres_mystique;
+ /* minfo->capable.cfb4 = 0; ... preinitialized by 0 */
+ minfo->capable.text = 1;
+ minfo->capable.vxres = vxres_mystique;
- ACCESS_FBINFO(outputs[0]).output = &m1064;
- ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
- ACCESS_FBINFO(outputs[0]).data = MINFO;
- ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ minfo->outputs[0].output = &m1064;
+ minfo->outputs[0].src = minfo->outputs[0].default_src;
+ minfo->outputs[0].data = minfo;
+ minfo->outputs[0].mode = MATROXFB_OUTPUT_MODE_MONITOR;
- if (ACCESS_FBINFO(devflags.noinit))
+ if (minfo->devflags.noinit)
return 0; /* do not modify settings */
hw->MXoptionReg &= 0xC0000100;
hw->MXoptionReg |= 0x00094E20;
- if (ACCESS_FBINFO(devflags.novga))
+ if (minfo->devflags.novga)
hw->MXoptionReg &= ~0x00000100;
- if (ACCESS_FBINFO(devflags.nobios))
+ if (minfo->devflags.nobios)
hw->MXoptionReg &= ~0x40000000;
- if (ACCESS_FBINFO(devflags.nopciretry))
+ if (minfo->devflags.nopciretry)
hw->MXoptionReg |= 0x20000000;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
mga_setr(M_SEQ_INDEX, 0x01, 0x20);
mga_outl(M_CTLWTST, 0x00000000);
udelay(200);
@@ -681,101 +703,105 @@
return 0;
}
-static void MGA1064_reset(WPMINFO2) {
+static void MGA1064_reset(struct matrox_fb_info *minfo)
+{
DBG(__func__);
- MGA1064_ramdac_init(PMINFO2);
+ MGA1064_ramdac_init(minfo);
}
#endif
#ifdef CONFIG_FB_MATROX_G
-static void g450_mclk_init(WPMINFO2) {
+static void g450_mclk_init(struct matrox_fb_info *minfo)
+{
/* switch all clocks to PCI source */
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3 & ~0x00300C03);
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
-
- if (((ACCESS_FBINFO(values).reg.opt3 & 0x000003) == 0x000003) ||
- ((ACCESS_FBINFO(values).reg.opt3 & 0x000C00) == 0x000C00) ||
- ((ACCESS_FBINFO(values).reg.opt3 & 0x300000) == 0x300000)) {
- matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.video), M_VIDEO_PLL);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg | 4);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION3_REG, minfo->values.reg.opt3 & ~0x00300C03);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
+
+ if (((minfo->values.reg.opt3 & 0x000003) == 0x000003) ||
+ ((minfo->values.reg.opt3 & 0x000C00) == 0x000C00) ||
+ ((minfo->values.reg.opt3 & 0x300000) == 0x300000)) {
+ matroxfb_g450_setclk(minfo, minfo->values.pll.video, M_VIDEO_PLL);
} else {
unsigned long flags;
unsigned int pwr;
matroxfb_DAC_lock_irqsave(flags);
- pwr = inDAC1064(PMINFO M1064_XPWRCTRL) & ~0x02;
- outDAC1064(PMINFO M1064_XPWRCTRL, pwr);
+ pwr = inDAC1064(minfo, M1064_XPWRCTRL) & ~0x02;
+ outDAC1064(minfo, M1064_XPWRCTRL, pwr);
matroxfb_DAC_unlock_irqrestore(flags);
}
- matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.system), M_SYSTEM_PLL);
+ matroxfb_g450_setclk(minfo, minfo->values.pll.system, M_SYSTEM_PLL);
/* switch clocks to their real PLL source(s) */
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3);
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg | 4);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION3_REG, minfo->values.reg.opt3);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
}
-static void g450_memory_init(WPMINFO2) {
+static void g450_memory_init(struct matrox_fb_info *minfo)
+{
/* disable memory refresh */
- ACCESS_FBINFO(hw).MXoptionReg &= ~0x001F8000;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+ minfo->hw.MXoptionReg &= ~0x001F8000;
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
/* set memory interface parameters */
- ACCESS_FBINFO(hw).MXoptionReg &= ~0x00207E00;
- ACCESS_FBINFO(hw).MXoptionReg |= 0x00207E00 & ACCESS_FBINFO(values).reg.opt;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ACCESS_FBINFO(values).reg.opt2);
+ minfo->hw.MXoptionReg &= ~0x00207E00;
+ minfo->hw.MXoptionReg |= 0x00207E00 & minfo->values.reg.opt;
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, minfo->values.reg.opt2);
- mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+ mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
/* first set up memory interface with disabled memory interface clocks */
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc & ~0x80000000U);
- mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
- mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess);
+ pci_write_config_dword(minfo->pcidev, PCI_MEMMISC_REG, minfo->values.reg.memmisc & ~0x80000000U);
+ mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
+ mga_outl(M_MACCESS, minfo->values.reg.maccess);
/* start memory clocks */
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc | 0x80000000U);
+ pci_write_config_dword(minfo->pcidev, PCI_MEMMISC_REG, minfo->values.reg.memmisc | 0x80000000U);
udelay(200);
- if (ACCESS_FBINFO(values).memory.ddr && (!ACCESS_FBINFO(values).memory.emrswen || !ACCESS_FBINFO(values).memory.dll)) {
- mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk & ~0x1000);
+ if (minfo->values.memory.ddr && (!minfo->values.memory.emrswen || !minfo->values.memory.dll)) {
+ mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk & ~0x1000);
}
- mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess | 0x8000);
+ mga_outl(M_MACCESS, minfo->values.reg.maccess | 0x8000);
udelay(200);
- ACCESS_FBINFO(hw).MXoptionReg |= 0x001F8000 & ACCESS_FBINFO(values).reg.opt;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+ minfo->hw.MXoptionReg |= 0x001F8000 & minfo->values.reg.opt;
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
/* value is written to memory chips only if old != new */
mga_outl(M_PLNWT, 0);
mga_outl(M_PLNWT, ~0);
- if (ACCESS_FBINFO(values).reg.mctlwtst != ACCESS_FBINFO(values).reg.mctlwtst_core) {
- mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst_core);
+ if (minfo->values.reg.mctlwtst != minfo->values.reg.mctlwtst_core) {
+ mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst_core);
}
}
-static void g450_preinit(WPMINFO2) {
+static void g450_preinit(struct matrox_fb_info *minfo)
+{
u_int32_t c2ctl;
u_int8_t curctl;
u_int8_t c1ctl;
- /* ACCESS_FBINFO(hw).MXoptionReg = minfo->values.reg.opt; */
- ACCESS_FBINFO(hw).MXoptionReg &= 0xC0000100;
- ACCESS_FBINFO(hw).MXoptionReg |= 0x00000020;
- if (ACCESS_FBINFO(devflags.novga))
- ACCESS_FBINFO(hw).MXoptionReg &= ~0x00000100;
- if (ACCESS_FBINFO(devflags.nobios))
- ACCESS_FBINFO(hw).MXoptionReg &= ~0x40000000;
- if (ACCESS_FBINFO(devflags.nopciretry))
- ACCESS_FBINFO(hw).MXoptionReg |= 0x20000000;
- ACCESS_FBINFO(hw).MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x03400040;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+ /* minfo->hw.MXoptionReg = minfo->values.reg.opt; */
+ minfo->hw.MXoptionReg &= 0xC0000100;
+ minfo->hw.MXoptionReg |= 0x00000020;
+ if (minfo->devflags.novga)
+ minfo->hw.MXoptionReg &= ~0x00000100;
+ if (minfo->devflags.nobios)
+ minfo->hw.MXoptionReg &= ~0x40000000;
+ if (minfo->devflags.nopciretry)
+ minfo->hw.MXoptionReg |= 0x20000000;
+ minfo->hw.MXoptionReg |= minfo->values.reg.opt & 0x03400040;
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
/* Init system clocks */
@@ -783,24 +809,24 @@
c2ctl = mga_inl(M_C2CTL);
mga_outl(M_C2CTL, c2ctl & ~1);
/* stop cursor */
- curctl = inDAC1064(PMINFO M1064_XCURCTRL);
- outDAC1064(PMINFO M1064_XCURCTRL, 0);
+ curctl = inDAC1064(minfo, M1064_XCURCTRL);
+ outDAC1064(minfo, M1064_XCURCTRL, 0);
/* stop crtc1 */
c1ctl = mga_readr(M_SEQ_INDEX, 1);
mga_setr(M_SEQ_INDEX, 1, c1ctl | 0x20);
- g450_mclk_init(PMINFO2);
- g450_memory_init(PMINFO2);
+ g450_mclk_init(minfo);
+ g450_memory_init(minfo);
/* set legacy VGA clock sources for DOSEmu or VMware... */
- matroxfb_g450_setclk(PMINFO 25175, M_PIXEL_PLL_A);
- matroxfb_g450_setclk(PMINFO 28322, M_PIXEL_PLL_B);
+ matroxfb_g450_setclk(minfo, 25175, M_PIXEL_PLL_A);
+ matroxfb_g450_setclk(minfo, 28322, M_PIXEL_PLL_B);
/* restore crtc1 */
mga_setr(M_SEQ_INDEX, 1, c1ctl);
/* restore cursor */
- outDAC1064(PMINFO M1064_XCURCTRL, curctl);
+ outDAC1064(minfo, M1064_XCURCTRL, curctl);
/* restore crtc2 */
mga_outl(M_C2CTL, c2ctl);
@@ -808,11 +834,12 @@
return;
}
-static int MGAG100_preinit(WPMINFO2) {
+static int MGAG100_preinit(struct matrox_fb_info *minfo)
+{
static const int vxres_g100[] = { 512, 640, 768, 800, 832, 960,
1024, 1152, 1280, 1600, 1664, 1920,
2048, 0};
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
u_int32_t reg50;
#if 0
@@ -822,68 +849,68 @@
DBG(__func__)
/* there are some instabilities if in_div > 19 && vco < 61000 */
- if (ACCESS_FBINFO(devflags.g450dac)) {
- ACCESS_FBINFO(features.pll.vco_freq_min) = 130000; /* my sample: >118 */
+ if (minfo->devflags.g450dac) {
+ minfo->features.pll.vco_freq_min = 130000; /* my sample: >118 */
} else {
- ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
+ minfo->features.pll.vco_freq_min = 62000;
}
- if (!ACCESS_FBINFO(features.pll.ref_freq)) {
- ACCESS_FBINFO(features.pll.ref_freq) = 27000;
+ if (!minfo->features.pll.ref_freq) {
+ minfo->features.pll.ref_freq = 27000;
}
- ACCESS_FBINFO(features.pll.feed_div_min) = 7;
- ACCESS_FBINFO(features.pll.feed_div_max) = 127;
- ACCESS_FBINFO(features.pll.in_div_min) = 1;
- ACCESS_FBINFO(features.pll.in_div_max) = 31;
- ACCESS_FBINFO(features.pll.post_shift_max) = 3;
- ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_G100_DEFAULT;
- /* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
- ACCESS_FBINFO(capable.text) = 1;
- ACCESS_FBINFO(capable.vxres) = vxres_g100;
- ACCESS_FBINFO(capable.plnwt) = ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100
- ? ACCESS_FBINFO(devflags.sgram) : 1;
+ minfo->features.pll.feed_div_min = 7;
+ minfo->features.pll.feed_div_max = 127;
+ minfo->features.pll.in_div_min = 1;
+ minfo->features.pll.in_div_max = 31;
+ minfo->features.pll.post_shift_max = 3;
+ minfo->features.DAC1064.xvrefctrl = DAC1064_XVREFCTRL_G100_DEFAULT;
+ /* minfo->capable.cfb4 = 0; ... preinitialized by 0 */
+ minfo->capable.text = 1;
+ minfo->capable.vxres = vxres_g100;
+ minfo->capable.plnwt = minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG100
+ ? minfo->devflags.sgram : 1;
#ifdef CONFIG_FB_MATROX_G
- if (ACCESS_FBINFO(devflags.g450dac)) {
- ACCESS_FBINFO(outputs[0]).output = &g450out;
+ if (minfo->devflags.g450dac) {
+ minfo->outputs[0].output = &g450out;
} else
#endif
{
- ACCESS_FBINFO(outputs[0]).output = &m1064;
+ minfo->outputs[0].output = &m1064;
}
- ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
- ACCESS_FBINFO(outputs[0]).data = MINFO;
- ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ minfo->outputs[0].src = minfo->outputs[0].default_src;
+ minfo->outputs[0].data = minfo;
+ minfo->outputs[0].mode = MATROXFB_OUTPUT_MODE_MONITOR;
- if (ACCESS_FBINFO(devflags.g450dac)) {
+ if (minfo->devflags.g450dac) {
/* we must do this always, BIOS does not do it for us
and accelerator dies without it */
mga_outl(0x1C0C, 0);
}
- if (ACCESS_FBINFO(devflags.noinit))
+ if (minfo->devflags.noinit)
return 0;
- if (ACCESS_FBINFO(devflags.g450dac)) {
- g450_preinit(PMINFO2);
+ if (minfo->devflags.g450dac) {
+ g450_preinit(minfo);
return 0;
}
hw->MXoptionReg &= 0xC0000100;
hw->MXoptionReg |= 0x00000020;
- if (ACCESS_FBINFO(devflags.novga))
+ if (minfo->devflags.novga)
hw->MXoptionReg &= ~0x00000100;
- if (ACCESS_FBINFO(devflags.nobios))
+ if (minfo->devflags.nobios)
hw->MXoptionReg &= ~0x40000000;
- if (ACCESS_FBINFO(devflags.nopciretry))
+ if (minfo->devflags.nopciretry)
hw->MXoptionReg |= 0x20000000;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
- DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PCI, 133333);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
+ DAC1064_setmclk(minfo, DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PCI, 133333);
- if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100) {
- pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ®50);
+ if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG100) {
+ pci_read_config_dword(minfo->pcidev, PCI_OPTION2_REG, ®50);
reg50 &= ~0x3000;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
hw->MXoptionReg |= 0x1080;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
- mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
+ mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
udelay(100);
mga_outb(0x1C05, 0x00);
mga_outb(0x1C05, 0x80);
@@ -893,68 +920,69 @@
udelay(100);
reg50 &= ~0xFF;
reg50 |= 0x07;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
/* it should help with G100 */
mga_outb(M_GRAPHICS_INDEX, 6);
mga_outb(M_GRAPHICS_DATA, (mga_inb(M_GRAPHICS_DATA) & 3) | 4);
mga_setr(M_EXTVGA_INDEX, 0x03, 0x81);
mga_setr(M_EXTVGA_INDEX, 0x04, 0x00);
- mga_writeb(ACCESS_FBINFO(video.vbase), 0x0000, 0xAA);
- mga_writeb(ACCESS_FBINFO(video.vbase), 0x0800, 0x55);
- mga_writeb(ACCESS_FBINFO(video.vbase), 0x4000, 0x55);
+ mga_writeb(minfo->video.vbase, 0x0000, 0xAA);
+ mga_writeb(minfo->video.vbase, 0x0800, 0x55);
+ mga_writeb(minfo->video.vbase, 0x4000, 0x55);
#if 0
- if (mga_readb(ACCESS_FBINFO(video.vbase), 0x0000) != 0xAA) {
+ if (mga_readb(minfo->video.vbase, 0x0000) != 0xAA) {
hw->MXoptionReg &= ~0x1000;
}
#endif
hw->MXoptionReg |= 0x00078020;
- } else if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG200) {
- pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ®50);
+ } else if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG200) {
+ pci_read_config_dword(minfo->pcidev, PCI_OPTION2_REG, ®50);
reg50 &= ~0x3000;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
- if (ACCESS_FBINFO(devflags.memtype) == -1)
- hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+ if (minfo->devflags.memtype == -1)
+ hw->MXoptionReg |= minfo->values.reg.opt & 0x1C00;
else
- hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
- if (ACCESS_FBINFO(devflags.sgram))
+ hw->MXoptionReg |= (minfo->devflags.memtype & 7) << 10;
+ if (minfo->devflags.sgram)
hw->MXoptionReg |= 0x4000;
- mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
- mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+ mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
+ mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
udelay(200);
mga_outl(M_MACCESS, 0x00000000);
mga_outl(M_MACCESS, 0x00008000);
udelay(100);
- mga_outw(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+ mga_outw(M_MEMRDBK, minfo->values.reg.memrdbk);
hw->MXoptionReg |= 0x00078020;
} else {
- pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ®50);
+ pci_read_config_dword(minfo->pcidev, PCI_OPTION2_REG, ®50);
reg50 &= ~0x00000100;
reg50 |= 0x00000000;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
- if (ACCESS_FBINFO(devflags.memtype) == -1)
- hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+ if (minfo->devflags.memtype == -1)
+ hw->MXoptionReg |= minfo->values.reg.opt & 0x1C00;
else
- hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
- if (ACCESS_FBINFO(devflags.sgram))
+ hw->MXoptionReg |= (minfo->devflags.memtype & 7) << 10;
+ if (minfo->devflags.sgram)
hw->MXoptionReg |= 0x4000;
- mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
- mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+ mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
+ mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
udelay(200);
mga_outl(M_MACCESS, 0x00000000);
mga_outl(M_MACCESS, 0x00008000);
udelay(100);
- mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+ mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
hw->MXoptionReg |= 0x00040020;
}
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
return 0;
}
-static void MGAG100_reset(WPMINFO2) {
+static void MGAG100_reset(struct matrox_fb_info *minfo)
+{
u_int8_t b;
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
@@ -964,54 +992,55 @@
find 1014/22 (IBM/82351); /* if found and bridging Matrox, do some strange stuff */
pci_read_config_byte(ibm, PCI_SECONDARY_BUS, &b);
- if (b == ACCESS_FBINFO(pcidev)->bus->number) {
+ if (b == minfo->pcidev->bus->number) {
pci_write_config_byte(ibm, PCI_COMMAND+1, 0); /* disable back-to-back & SERR */
pci_write_config_byte(ibm, 0x41, 0xF4); /* ??? */
pci_write_config_byte(ibm, PCI_IO_BASE, 0xF0); /* ??? */
pci_write_config_byte(ibm, PCI_IO_LIMIT, 0x00); /* ??? */
}
#endif
- if (!ACCESS_FBINFO(devflags.noinit)) {
+ if (!minfo->devflags.noinit) {
if (x7AF4 & 8) {
hw->MXoptionReg |= 0x40; /* FIXME... */
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
}
mga_setr(M_EXTVGA_INDEX, 0x06, 0x00);
}
}
- if (ACCESS_FBINFO(devflags.g450dac)) {
+ if (minfo->devflags.g450dac) {
/* either leave MCLK as is... or they were set in preinit */
- hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
- hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
- hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+ hw->DACclk[3] = inDAC1064(minfo, DAC1064_XSYSPLLM);
+ hw->DACclk[4] = inDAC1064(minfo, DAC1064_XSYSPLLN);
+ hw->DACclk[5] = inDAC1064(minfo, DAC1064_XSYSPLLP);
} else {
- DAC1064_setmclk(PMINFO DAC1064_OPT_RESERVED | DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV1 | DAC1064_OPT_SCLK_PLL, 133333);
+ DAC1064_setmclk(minfo, DAC1064_OPT_RESERVED | DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV1 | DAC1064_OPT_SCLK_PLL, 133333);
}
- if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
- if (ACCESS_FBINFO(devflags.dfp_type) == -1) {
- ACCESS_FBINFO(devflags.dfp_type) = inDAC1064(PMINFO 0x1F);
+ if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400) {
+ if (minfo->devflags.dfp_type == -1) {
+ minfo->devflags.dfp_type = inDAC1064(minfo, 0x1F);
}
}
- if (ACCESS_FBINFO(devflags.noinit))
+ if (minfo->devflags.noinit)
return;
- if (ACCESS_FBINFO(devflags.g450dac)) {
+ if (minfo->devflags.g450dac) {
} else {
- MGAG100_setPixClock(PMINFO 4, 25175);
- MGAG100_setPixClock(PMINFO 5, 28322);
+ MGAG100_setPixClock(minfo, 4, 25175);
+ MGAG100_setPixClock(minfo, 5, 28322);
if (x7AF4 & 0x10) {
- b = inDAC1064(PMINFO M1064_XGENIODATA) & ~1;
- outDAC1064(PMINFO M1064_XGENIODATA, b);
- b = inDAC1064(PMINFO M1064_XGENIOCTRL) | 1;
- outDAC1064(PMINFO M1064_XGENIOCTRL, b);
+ b = inDAC1064(minfo, M1064_XGENIODATA) & ~1;
+ outDAC1064(minfo, M1064_XGENIODATA, b);
+ b = inDAC1064(minfo, M1064_XGENIOCTRL) | 1;
+ outDAC1064(minfo, M1064_XGENIOCTRL, b);
}
}
}
#endif
#ifdef CONFIG_FB_MATROX_MYSTIQUE
-static void MGA1064_restore(WPMINFO2) {
+static void MGA1064_restore(struct matrox_fb_info *minfo)
+{
int i;
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
CRITFLAGS
@@ -1019,25 +1048,26 @@
CRITBEGIN
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
mga_outb(M_IEN, 0x00);
mga_outb(M_CACHEFLUSH, 0x00);
CRITEND
- DAC1064_restore_1(PMINFO2);
- matroxfb_vgaHWrestore(PMINFO2);
- ACCESS_FBINFO(crtc1.panpos) = -1;
+ DAC1064_restore_1(minfo);
+ matroxfb_vgaHWrestore(minfo);
+ minfo->crtc1.panpos = -1;
for (i = 0; i < 6; i++)
mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
- DAC1064_restore_2(PMINFO2);
+ DAC1064_restore_2(minfo);
}
#endif
#ifdef CONFIG_FB_MATROX_G
-static void MGAG100_restore(WPMINFO2) {
+static void MGAG100_restore(struct matrox_fb_info *minfo)
+{
int i;
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
CRITFLAGS
@@ -1045,19 +1075,17 @@
CRITBEGIN
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
CRITEND
- DAC1064_restore_1(PMINFO2);
- matroxfb_vgaHWrestore(PMINFO2);
-#ifdef CONFIG_FB_MATROX_32MB
- if (ACCESS_FBINFO(devflags.support32MB))
+ DAC1064_restore_1(minfo);
+ matroxfb_vgaHWrestore(minfo);
+ if (minfo->devflags.support32MB)
mga_setr(M_EXTVGA_INDEX, 8, hw->CRTCEXT[8]);
-#endif
- ACCESS_FBINFO(crtc1.panpos) = -1;
+ minfo->crtc1.panpos = -1;
for (i = 0; i < 6; i++)
mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
- DAC1064_restore_2(PMINFO2);
+ DAC1064_restore_2(minfo);
}
#endif
diff --git a/drivers/video/matrox/matroxfb_DAC1064.h b/drivers/video/matrox/matroxfb_DAC1064.h
index 7a98ce8..c6ed780 100644
--- a/drivers/video/matrox/matroxfb_DAC1064.h
+++ b/drivers/video/matrox/matroxfb_DAC1064.h
@@ -11,8 +11,8 @@
extern struct matrox_switch matrox_G100;
#endif
#ifdef NEED_DAC1064
-void DAC1064_global_init(WPMINFO2);
-void DAC1064_global_restore(WPMINFO2);
+void DAC1064_global_init(struct matrox_fb_info *minfo);
+void DAC1064_global_restore(struct matrox_fb_info *minfo);
#endif
#define M1064_INDEX 0x00
diff --git a/drivers/video/matrox/matroxfb_Ti3026.c b/drivers/video/matrox/matroxfb_Ti3026.c
index 4e82511..835aaaa 100644
--- a/drivers/video/matrox/matroxfb_Ti3026.c
+++ b/drivers/video/matrox/matroxfb_Ti3026.c
@@ -279,27 +279,31 @@
TVP3026_XCOLKEYCTRL_ZOOM1,
0x00, 0x00, TVP3026_XCURCTRL_DIS };
-static int Ti3026_calcclock(CPMINFO unsigned int freq, unsigned int fmax, int* in, int* feed, int* post) {
+static int Ti3026_calcclock(const struct matrox_fb_info *minfo,
+ unsigned int freq, unsigned int fmax, int *in,
+ int *feed, int *post)
+{
unsigned int fvco;
unsigned int lin, lfeed, lpost;
DBG(__func__)
- fvco = PLL_calcclock(PMINFO freq, fmax, &lin, &lfeed, &lpost);
+ fvco = PLL_calcclock(minfo, freq, fmax, &lin, &lfeed, &lpost);
fvco >>= (*post = lpost);
*in = 64 - lin;
*feed = 64 - lfeed;
return fvco;
}
-static int Ti3026_setpclk(WPMINFO int clk) {
+static int Ti3026_setpclk(struct matrox_fb_info *minfo, int clk)
+{
unsigned int f_pll;
unsigned int pixfeed, pixin, pixpost;
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
- f_pll = Ti3026_calcclock(PMINFO clk, ACCESS_FBINFO(max_pixel_clock), &pixin, &pixfeed, &pixpost);
+ f_pll = Ti3026_calcclock(minfo, clk, minfo->max_pixel_clock, &pixin, &pixfeed, &pixpost);
hw->DACclk[0] = pixin | 0xC0;
hw->DACclk[1] = pixfeed;
@@ -309,9 +313,9 @@
unsigned int loopfeed, loopin, looppost, loopdiv, z;
unsigned int Bpp;
- Bpp = ACCESS_FBINFO(curr.final_bppShift);
+ Bpp = minfo->curr.final_bppShift;
- if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+ if (minfo->fbcon.var.bits_per_pixel == 24) {
loopfeed = 3; /* set lm to any possible value */
loopin = 3 * 32 / Bpp;
} else {
@@ -330,18 +334,18 @@
looppost = 3;
loopdiv = z/16;
}
- if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+ if (minfo->fbcon.var.bits_per_pixel == 24) {
hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
hw->DACclk[4] = (65 - loopfeed) | 0x80;
- if (ACCESS_FBINFO(accel.ramdac_rev) > 0x20) {
- if (isInterleave(MINFO))
+ if (minfo->accel.ramdac_rev > 0x20) {
+ if (isInterleave(minfo))
hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_8_3;
else {
hw->DACclk[4] &= ~0xC0;
hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_4_3;
}
} else {
- if (isInterleave(MINFO))
+ if (isInterleave(minfo))
; /* default... */
else {
hw->DACclk[4] ^= 0xC0; /* change from 0x80 to 0x40 */
@@ -349,7 +353,7 @@
}
}
hw->DACclk[5] = looppost | 0xF8;
- if (ACCESS_FBINFO(devflags.mga_24bpp_fix))
+ if (minfo->devflags.mga_24bpp_fix)
hw->DACclk[5] ^= 0x40;
} else {
hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
@@ -361,14 +365,15 @@
return 0;
}
-static int Ti3026_init(WPMINFO struct my_timming* m) {
- u_int8_t muxctrl = isInterleave(MINFO) ? TVP3026_XMUXCTRL_MEMORY_64BIT : TVP3026_XMUXCTRL_MEMORY_32BIT;
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int Ti3026_init(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+ u_int8_t muxctrl = isInterleave(minfo) ? TVP3026_XMUXCTRL_MEMORY_64BIT : TVP3026_XMUXCTRL_MEMORY_32BIT;
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
memcpy(hw->DACreg, MGADACbpp32, sizeof(hw->DACreg));
- switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ switch (minfo->fbcon.var.bits_per_pixel) {
case 4: hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_16_1; /* or _8_1, they are same */
hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR;
hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_4BIT;
@@ -383,7 +388,7 @@
break;
case 16:
/* XLATCHCTRL should be _4_1 / _2_1... Why is not? (_2_1 is used everytime) */
- hw->DACreg[POS3026_XTRUECOLORCTRL] = (ACCESS_FBINFO(fbcon).var.green.length == 5)? (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_1555 ) : (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_565);
+ hw->DACreg[POS3026_XTRUECOLORCTRL] = (minfo->fbcon.var.green.length == 5) ? (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_1555) : (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_565);
hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_16BIT;
hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV2;
break;
@@ -400,7 +405,7 @@
default:
return 1; /* TODO: failed */
}
- if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+ if (matroxfb_vgaHWinit(minfo, m)) return 1;
/* set SYNC */
hw->MiscOutReg = 0xCB;
@@ -412,9 +417,9 @@
hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_SYNC_ON_GREEN;
/* set DELAY */
- if (ACCESS_FBINFO(video.len) < 0x400000)
+ if (minfo->video.len < 0x400000)
hw->CRTCEXT[3] |= 0x08;
- else if (ACCESS_FBINFO(video.len) > 0x400000)
+ else if (minfo->video.len > 0x400000)
hw->CRTCEXT[3] |= 0x10;
/* set HWCURSOR */
@@ -426,14 +431,15 @@
/* set interleaving */
hw->MXoptionReg &= ~0x00001000;
- if (isInterleave(MINFO)) hw->MXoptionReg |= 0x00001000;
+ if (isInterleave(minfo)) hw->MXoptionReg |= 0x00001000;
/* set DAC */
- Ti3026_setpclk(PMINFO m->pixclock);
+ Ti3026_setpclk(minfo, m->pixclock);
return 0;
}
-static void ti3026_setMCLK(WPMINFO int fout){
+static void ti3026_setMCLK(struct matrox_fb_info *minfo, int fout)
+{
unsigned int f_pll;
unsigned int pclk_m, pclk_n, pclk_p;
unsigned int mclk_m, mclk_n, mclk_p;
@@ -442,29 +448,29 @@
DBG(__func__)
- f_pll = Ti3026_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &mclk_n, &mclk_m, &mclk_p);
+ f_pll = Ti3026_calcclock(minfo, fout, minfo->max_pixel_clock, &mclk_n, &mclk_m, &mclk_p);
/* save pclk */
- outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
- pclk_n = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
- outTi3026(PMINFO TVP3026_XPLLADDR, 0xFD);
- pclk_m = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
- outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
- pclk_p = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0xFC);
+ pclk_n = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0xFD);
+ pclk_m = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0xFE);
+ pclk_p = inTi3026(minfo, TVP3026_XPIXPLLDATA);
/* stop pclk */
- outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0xFE);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, 0x00);
/* set pclk to new mclk */
- outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_n | 0xC0);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_m);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_p | 0xB0);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0xFC);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, mclk_n | 0xC0);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, mclk_m);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, mclk_p | 0xB0);
/* wait for PLL to lock */
for (tmout = 500000; tmout; tmout--) {
- if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+ if (inTi3026(minfo, TVP3026_XPIXPLLDATA) & 0x40)
break;
udelay(10);
};
@@ -472,23 +478,23 @@
printk(KERN_ERR "matroxfb: Temporary pixel PLL not locked after 5 secs\n");
/* output pclk on mclk pin */
- mclk_ctl = inTi3026(PMINFO TVP3026_XMEMPLLCTRL);
- outTi3026(PMINFO TVP3026_XMEMPLLCTRL, mclk_ctl & 0xE7);
- outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+ mclk_ctl = inTi3026(minfo, TVP3026_XMEMPLLCTRL);
+ outTi3026(minfo, TVP3026_XMEMPLLCTRL, mclk_ctl & 0xE7);
+ outTi3026(minfo, TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_STROBEMKC4);
/* stop MCLK */
- outTi3026(PMINFO TVP3026_XPLLADDR, 0xFB);
- outTi3026(PMINFO TVP3026_XMEMPLLDATA, 0x00);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0xFB);
+ outTi3026(minfo, TVP3026_XMEMPLLDATA, 0x00);
/* set mclk to new freq */
- outTi3026(PMINFO TVP3026_XPLLADDR, 0xF3);
- outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_n | 0xC0);
- outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_m);
- outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_p | 0xB0);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0xF3);
+ outTi3026(minfo, TVP3026_XMEMPLLDATA, mclk_n | 0xC0);
+ outTi3026(minfo, TVP3026_XMEMPLLDATA, mclk_m);
+ outTi3026(minfo, TVP3026_XMEMPLLDATA, mclk_p | 0xB0);
/* wait for PLL to lock */
for (tmout = 500000; tmout; tmout--) {
- if (inTi3026(PMINFO TVP3026_XMEMPLLDATA) & 0x40)
+ if (inTi3026(minfo, TVP3026_XMEMPLLDATA) & 0x40)
break;
udelay(10);
}
@@ -496,7 +502,7 @@
printk(KERN_ERR "matroxfb: Memory PLL not locked after 5 secs\n");
f_pll = f_pll * 333 / (10000 << mclk_p);
- if (isMilleniumII(MINFO)) {
+ if (isMilleniumII(minfo)) {
rfhcnt = (f_pll - 128) / 256;
if (rfhcnt > 15)
rfhcnt = 15;
@@ -505,26 +511,26 @@
if (rfhcnt > 15)
rfhcnt = 0;
}
- ACCESS_FBINFO(hw).MXoptionReg = (ACCESS_FBINFO(hw).MXoptionReg & ~0x000F0000) | (rfhcnt << 16);
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+ minfo->hw.MXoptionReg = (minfo->hw.MXoptionReg & ~0x000F0000) | (rfhcnt << 16);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
/* output MCLK to MCLK pin */
- outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
- outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl ) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+ outTi3026(minfo, TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+ outTi3026(minfo, TVP3026_XMEMPLLCTRL, (mclk_ctl ) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_STROBEMKC4);
/* stop PCLK */
- outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0xFE);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, 0x00);
/* restore pclk */
- outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_n);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_m);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_p);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0xFC);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, pclk_n);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, pclk_m);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, pclk_p);
/* wait for PLL to lock */
for (tmout = 500000; tmout; tmout--) {
- if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+ if (inTi3026(minfo, TVP3026_XPIXPLLDATA) & 0x40)
break;
udelay(10);
}
@@ -532,26 +538,27 @@
printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n");
}
-static void ti3026_ramdac_init(WPMINFO2) {
-
+static void ti3026_ramdac_init(struct matrox_fb_info *minfo)
+{
DBG(__func__)
- ACCESS_FBINFO(features.pll.vco_freq_min) = 110000;
- ACCESS_FBINFO(features.pll.ref_freq) = 114545;
- ACCESS_FBINFO(features.pll.feed_div_min) = 2;
- ACCESS_FBINFO(features.pll.feed_div_max) = 24;
- ACCESS_FBINFO(features.pll.in_div_min) = 2;
- ACCESS_FBINFO(features.pll.in_div_max) = 63;
- ACCESS_FBINFO(features.pll.post_shift_max) = 3;
- if (ACCESS_FBINFO(devflags.noinit))
+ minfo->features.pll.vco_freq_min = 110000;
+ minfo->features.pll.ref_freq = 114545;
+ minfo->features.pll.feed_div_min = 2;
+ minfo->features.pll.feed_div_max = 24;
+ minfo->features.pll.in_div_min = 2;
+ minfo->features.pll.in_div_max = 63;
+ minfo->features.pll.post_shift_max = 3;
+ if (minfo->devflags.noinit)
return;
- ti3026_setMCLK(PMINFO 60000);
+ ti3026_setMCLK(minfo, 60000);
}
-static void Ti3026_restore(WPMINFO2) {
+static void Ti3026_restore(struct matrox_fb_info *minfo)
+{
int i;
unsigned char progdac[6];
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
CRITFLAGS
DBG(__func__)
@@ -565,31 +572,31 @@
CRITBEGIN
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
CRITEND
- matroxfb_vgaHWrestore(PMINFO2);
+ matroxfb_vgaHWrestore(minfo);
CRITBEGIN
- ACCESS_FBINFO(crtc1.panpos) = -1;
+ minfo->crtc1.panpos = -1;
for (i = 0; i < 6; i++)
mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
for (i = 0; i < 21; i++) {
- outTi3026(PMINFO DACseq[i], hw->DACreg[i]);
+ outTi3026(minfo, DACseq[i], hw->DACreg[i]);
}
- outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
- progdac[0] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
- progdac[3] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
- outTi3026(PMINFO TVP3026_XPLLADDR, 0x15);
- progdac[1] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
- progdac[4] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
- outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
- progdac[2] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
- progdac[5] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0x00);
+ progdac[0] = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+ progdac[3] = inTi3026(minfo, TVP3026_XLOOPPLLDATA);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0x15);
+ progdac[1] = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+ progdac[4] = inTi3026(minfo, TVP3026_XLOOPPLLDATA);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0x2A);
+ progdac[2] = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+ progdac[5] = inTi3026(minfo, TVP3026_XLOOPPLLDATA);
CRITEND
if (memcmp(hw->DACclk, progdac, 6)) {
@@ -598,20 +605,20 @@
/* Maybe even we should call schedule() ? */
CRITBEGIN
- outTi3026(PMINFO TVP3026_XCLKCTRL, hw->DACreg[POS3026_XCLKCTRL]);
- outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
- outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0);
+ outTi3026(minfo, TVP3026_XCLKCTRL, hw->DACreg[POS3026_XCLKCTRL]);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0x2A);
+ outTi3026(minfo, TVP3026_XLOOPPLLDATA, 0);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, 0);
- outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0x00);
for (i = 0; i < 3; i++)
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, hw->DACclk[i]);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, hw->DACclk[i]);
/* wait for PLL only if PLL clock requested (always for PowerMode, never for VGA) */
if (hw->MiscOutReg & 0x08) {
int tmout;
- outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0x3F);
for (tmout = 500000; tmout; --tmout) {
- if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+ if (inTi3026(minfo, TVP3026_XPIXPLLDATA) & 0x40)
break;
udelay(10);
}
@@ -624,18 +631,18 @@
dprintk(KERN_INFO "PixelPLL: %d\n", 500000-tmout);
CRITBEGIN
}
- outTi3026(PMINFO TVP3026_XMEMPLLCTRL, hw->DACreg[POS3026_XMEMPLLCTRL]);
- outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+ outTi3026(minfo, TVP3026_XMEMPLLCTRL, hw->DACreg[POS3026_XMEMPLLCTRL]);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0x00);
for (i = 3; i < 6; i++)
- outTi3026(PMINFO TVP3026_XLOOPPLLDATA, hw->DACclk[i]);
+ outTi3026(minfo, TVP3026_XLOOPPLLDATA, hw->DACclk[i]);
CRITEND
if ((hw->MiscOutReg & 0x08) && ((hw->DACclk[5] & 0x80) == 0x80)) {
int tmout;
CRITBEGIN
- outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0x3F);
for (tmout = 500000; tmout; --tmout) {
- if (inTi3026(PMINFO TVP3026_XLOOPPLLDATA) & 0x40)
+ if (inTi3026(minfo, TVP3026_XLOOPPLLDATA) & 0x40)
break;
udelay(10);
}
@@ -660,65 +667,66 @@
#endif
}
-static void Ti3026_reset(WPMINFO2) {
-
+static void Ti3026_reset(struct matrox_fb_info *minfo)
+{
DBG(__func__)
- ti3026_ramdac_init(PMINFO2);
+ ti3026_ramdac_init(minfo);
}
static struct matrox_altout ti3026_output = {
.name = "Primary output",
};
-static int Ti3026_preinit(WPMINFO2) {
+static int Ti3026_preinit(struct matrox_fb_info *minfo)
+{
static const int vxres_mill2[] = { 512, 640, 768, 800, 832, 960,
1024, 1152, 1280, 1600, 1664, 1920,
2048, 0};
static const int vxres_mill1[] = { 640, 768, 800, 960,
1024, 1152, 1280, 1600, 1920,
2048, 0};
- struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state *hw = &minfo->hw;
DBG(__func__)
- ACCESS_FBINFO(millenium) = 1;
- ACCESS_FBINFO(milleniumII) = (ACCESS_FBINFO(pcidev)->device != PCI_DEVICE_ID_MATROX_MIL);
- ACCESS_FBINFO(capable.cfb4) = 1;
- ACCESS_FBINFO(capable.text) = 1; /* isMilleniumII(MINFO); */
- ACCESS_FBINFO(capable.vxres) = isMilleniumII(MINFO)?vxres_mill2:vxres_mill1;
+ minfo->millenium = 1;
+ minfo->milleniumII = (minfo->pcidev->device != PCI_DEVICE_ID_MATROX_MIL);
+ minfo->capable.cfb4 = 1;
+ minfo->capable.text = 1; /* isMilleniumII(minfo); */
+ minfo->capable.vxres = isMilleniumII(minfo) ? vxres_mill2 : vxres_mill1;
- ACCESS_FBINFO(outputs[0]).data = MINFO;
- ACCESS_FBINFO(outputs[0]).output = &ti3026_output;
- ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
- ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ minfo->outputs[0].data = minfo;
+ minfo->outputs[0].output = &ti3026_output;
+ minfo->outputs[0].src = minfo->outputs[0].default_src;
+ minfo->outputs[0].mode = MATROXFB_OUTPUT_MODE_MONITOR;
- if (ACCESS_FBINFO(devflags.noinit))
+ if (minfo->devflags.noinit)
return 0;
/* preserve VGA I/O, BIOS and PPC */
hw->MXoptionReg &= 0xC0000100;
hw->MXoptionReg |= 0x002C0000;
- if (ACCESS_FBINFO(devflags.novga))
+ if (minfo->devflags.novga)
hw->MXoptionReg &= ~0x00000100;
- if (ACCESS_FBINFO(devflags.nobios))
+ if (minfo->devflags.nobios)
hw->MXoptionReg &= ~0x40000000;
- if (ACCESS_FBINFO(devflags.nopciretry))
+ if (minfo->devflags.nopciretry)
hw->MXoptionReg |= 0x20000000;
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
- ACCESS_FBINFO(accel.ramdac_rev) = inTi3026(PMINFO TVP3026_XSILICONREV);
+ minfo->accel.ramdac_rev = inTi3026(minfo, TVP3026_XSILICONREV);
- outTi3026(PMINFO TVP3026_XCLKCTRL, TVP3026_XCLKCTRL_SRC_CLK0VGA | TVP3026_XCLKCTRL_CLKSTOPPED);
- outTi3026(PMINFO TVP3026_XTRUECOLORCTRL, TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR);
- outTi3026(PMINFO TVP3026_XMUXCTRL, TVP3026_XMUXCTRL_VGA);
+ outTi3026(minfo, TVP3026_XCLKCTRL, TVP3026_XCLKCTRL_SRC_CLK0VGA | TVP3026_XCLKCTRL_CLKSTOPPED);
+ outTi3026(minfo, TVP3026_XTRUECOLORCTRL, TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR);
+ outTi3026(minfo, TVP3026_XMUXCTRL, TVP3026_XMUXCTRL_VGA);
- outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
- outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0x00);
- outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+ outTi3026(minfo, TVP3026_XPLLADDR, 0x2A);
+ outTi3026(minfo, TVP3026_XLOOPPLLDATA, 0x00);
+ outTi3026(minfo, TVP3026_XPIXPLLDATA, 0x00);
mga_outb(M_MISC_REG, 0x67);
- outTi3026(PMINFO TVP3026_XMEMPLLCTRL, TVP3026_XMEMPLLCTRL_STROBEMKC4 | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+ outTi3026(minfo, TVP3026_XMEMPLLCTRL, TVP3026_XMEMPLLCTRL_STROBEMKC4 | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
mga_outl(M_RESET, 1);
udelay(250);
diff --git a/drivers/video/matrox/matroxfb_accel.c b/drivers/video/matrox/matroxfb_accel.c
index 9c3aeee..8335a6f 100644
--- a/drivers/video/matrox/matroxfb_accel.c
+++ b/drivers/video/matrox/matroxfb_accel.c
@@ -81,7 +81,7 @@
#include "matroxfb_Ti3026.h"
#include "matroxfb_misc.h"
-#define curr_ydstorg(x) ACCESS_FBINFO2(x, curr.ydstorg.pixels)
+#define curr_ydstorg(x) ((x)->curr.ydstorg.pixels)
#define mga_ydstlen(y,l) mga_outl(M_YDSTLEN | M_EXEC, ((y) << 16) | (l))
@@ -107,7 +107,8 @@
static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect);
static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area);
-void matrox_cfbX_init(WPMINFO2) {
+void matrox_cfbX_init(struct matrox_fb_info *minfo)
+{
u_int32_t maccess;
u_int32_t mpitch;
u_int32_t mopmode;
@@ -115,59 +116,59 @@
DBG(__func__)
- mpitch = ACCESS_FBINFO(fbcon).var.xres_virtual;
+ mpitch = minfo->fbcon.var.xres_virtual;
- ACCESS_FBINFO(fbops).fb_copyarea = cfb_copyarea;
- ACCESS_FBINFO(fbops).fb_fillrect = cfb_fillrect;
- ACCESS_FBINFO(fbops).fb_imageblit = cfb_imageblit;
- ACCESS_FBINFO(fbops).fb_cursor = NULL;
+ minfo->fbops.fb_copyarea = cfb_copyarea;
+ minfo->fbops.fb_fillrect = cfb_fillrect;
+ minfo->fbops.fb_imageblit = cfb_imageblit;
+ minfo->fbops.fb_cursor = NULL;
- accel = (ACCESS_FBINFO(fbcon).var.accel_flags & FB_ACCELF_TEXT) == FB_ACCELF_TEXT;
+ accel = (minfo->fbcon.var.accel_flags & FB_ACCELF_TEXT) == FB_ACCELF_TEXT;
- switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ switch (minfo->fbcon.var.bits_per_pixel) {
case 4: maccess = 0x00000000; /* accelerate as 8bpp video */
mpitch = (mpitch >> 1) | 0x8000; /* disable linearization */
mopmode = M_OPMODE_4BPP;
- matrox_cfb4_pal(ACCESS_FBINFO(cmap));
+ matrox_cfb4_pal(minfo->cmap);
if (accel && !(mpitch & 1)) {
- ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_cfb4_copyarea;
- ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_cfb4_fillrect;
+ minfo->fbops.fb_copyarea = matroxfb_cfb4_copyarea;
+ minfo->fbops.fb_fillrect = matroxfb_cfb4_fillrect;
}
break;
case 8: maccess = 0x00000000;
mopmode = M_OPMODE_8BPP;
- matrox_cfb8_pal(ACCESS_FBINFO(cmap));
+ matrox_cfb8_pal(minfo->cmap);
if (accel) {
- ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
- ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
- ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+ minfo->fbops.fb_copyarea = matroxfb_copyarea;
+ minfo->fbops.fb_fillrect = matroxfb_fillrect;
+ minfo->fbops.fb_imageblit = matroxfb_imageblit;
}
break;
- case 16: if (ACCESS_FBINFO(fbcon).var.green.length == 5)
+ case 16: if (minfo->fbcon.var.green.length == 5)
maccess = 0xC0000001;
else
maccess = 0x40000001;
mopmode = M_OPMODE_16BPP;
if (accel) {
- ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
- ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
- ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+ minfo->fbops.fb_copyarea = matroxfb_copyarea;
+ minfo->fbops.fb_fillrect = matroxfb_fillrect;
+ minfo->fbops.fb_imageblit = matroxfb_imageblit;
}
break;
case 24: maccess = 0x00000003;
mopmode = M_OPMODE_24BPP;
if (accel) {
- ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
- ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
- ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+ minfo->fbops.fb_copyarea = matroxfb_copyarea;
+ minfo->fbops.fb_fillrect = matroxfb_fillrect;
+ minfo->fbops.fb_imageblit = matroxfb_imageblit;
}
break;
case 32: maccess = 0x00000002;
mopmode = M_OPMODE_32BPP;
if (accel) {
- ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
- ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
- ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+ minfo->fbops.fb_copyarea = matroxfb_copyarea;
+ minfo->fbops.fb_fillrect = matroxfb_fillrect;
+ minfo->fbops.fb_imageblit = matroxfb_imageblit;
}
break;
default: maccess = 0x00000000;
@@ -176,10 +177,10 @@
}
mga_fifo(8);
mga_outl(M_PITCH, mpitch);
- mga_outl(M_YDSTORG, curr_ydstorg(MINFO));
- if (ACCESS_FBINFO(capable.plnwt))
+ mga_outl(M_YDSTORG, curr_ydstorg(minfo));
+ if (minfo->capable.plnwt)
mga_outl(M_PLNWT, -1);
- if (ACCESS_FBINFO(capable.srcorg)) {
+ if (minfo->capable.srcorg) {
mga_outl(M_SRCORG, 0);
mga_outl(M_DSTORG, 0);
}
@@ -188,14 +189,16 @@
mga_outl(M_YTOP, 0);
mga_outl(M_YBOT, 0x01FFFFFF);
mga_outl(M_MACCESS, maccess);
- ACCESS_FBINFO(accel.m_dwg_rect) = M_DWG_TRAP | M_DWG_SOLID | M_DWG_ARZERO | M_DWG_SGNZERO | M_DWG_SHIFTZERO;
- if (isMilleniumII(MINFO)) ACCESS_FBINFO(accel.m_dwg_rect) |= M_DWG_TRANSC;
- ACCESS_FBINFO(accel.m_opmode) = mopmode;
+ minfo->accel.m_dwg_rect = M_DWG_TRAP | M_DWG_SOLID | M_DWG_ARZERO | M_DWG_SGNZERO | M_DWG_SHIFTZERO;
+ if (isMilleniumII(minfo)) minfo->accel.m_dwg_rect |= M_DWG_TRANSC;
+ minfo->accel.m_opmode = mopmode;
}
EXPORT_SYMBOL(matrox_cfbX_init);
-static void matrox_accel_bmove(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+static void matrox_accel_bmove(struct matrox_fb_info *minfo, int vxres, int sy,
+ int sx, int dy, int dx, int height, int width)
+{
int start, end;
CRITFLAGS
@@ -209,7 +212,7 @@
M_DWG_BFCOL | M_DWG_REPLACE);
mga_outl(M_AR5, vxres);
width--;
- start = sy*vxres+sx+curr_ydstorg(MINFO);
+ start = sy*vxres+sx+curr_ydstorg(minfo);
end = start+width;
} else {
mga_fifo(3);
@@ -217,7 +220,7 @@
mga_outl(M_SGN, 5);
mga_outl(M_AR5, -vxres);
width--;
- end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+ end = (sy+height-1)*vxres+sx+curr_ydstorg(minfo);
start = end+width;
dy += height-1;
}
@@ -231,7 +234,10 @@
CRITEND
}
-static void matrox_accel_bmove_lin(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+static void matrox_accel_bmove_lin(struct matrox_fb_info *minfo, int vxres,
+ int sy, int sx, int dy, int dx, int height,
+ int width)
+{
int start, end;
CRITFLAGS
@@ -245,7 +251,7 @@
M_DWG_BFCOL | M_DWG_REPLACE);
mga_outl(M_AR5, vxres);
width--;
- start = sy*vxres+sx+curr_ydstorg(MINFO);
+ start = sy*vxres+sx+curr_ydstorg(minfo);
end = start+width;
} else {
mga_fifo(3);
@@ -253,7 +259,7 @@
mga_outl(M_SGN, 5);
mga_outl(M_AR5, -vxres);
width--;
- end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+ end = (sy+height-1)*vxres+sx+curr_ydstorg(minfo);
start = end+width;
dy += height-1;
}
@@ -269,22 +275,23 @@
}
static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
if ((area->sx | area->dx | area->width) & 1)
cfb_copyarea(info, area);
else
- matrox_accel_bmove_lin(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual) >> 1, area->sy, area->sx >> 1, area->dy, area->dx >> 1, area->height, area->width >> 1);
+ matrox_accel_bmove_lin(minfo, minfo->fbcon.var.xres_virtual >> 1, area->sy, area->sx >> 1, area->dy, area->dx >> 1, area->height, area->width >> 1);
}
static void matroxfb_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
- matrox_accel_bmove(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual), area->sy, area->sx, area->dy, area->dx, area->height, area->width);
+ matrox_accel_bmove(minfo, minfo->fbcon.var.xres_virtual, area->sy, area->sx, area->dy, area->dx, area->height, area->width);
}
-static void matroxfb_accel_clear(WPMINFO u_int32_t color, int sy, int sx, int height,
- int width) {
+static void matroxfb_accel_clear(struct matrox_fb_info *minfo, u_int32_t color,
+ int sy, int sx, int height, int width)
+{
CRITFLAGS
DBG(__func__)
@@ -292,7 +299,7 @@
CRITBEGIN
mga_fifo(5);
- mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE);
+ mga_outl(M_DWGCTL, minfo->accel.m_dwg_rect | M_DWG_REPLACE);
mga_outl(M_FCOL, color);
mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
mga_ydstlen(sy, height);
@@ -302,16 +309,18 @@
}
static void matroxfb_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
switch (rect->rop) {
case ROP_COPY:
- matroxfb_accel_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+ matroxfb_accel_clear(minfo, ((u_int32_t *)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
break;
}
}
-static void matroxfb_cfb4_clear(WPMINFO u_int32_t bgx, int sy, int sx, int height, int width) {
+static void matroxfb_cfb4_clear(struct matrox_fb_info *minfo, u_int32_t bgx,
+ int sy, int sx, int height, int width)
+{
int whattodo;
CRITFLAGS
@@ -333,16 +342,16 @@
sx >>= 1;
if (width) {
mga_fifo(5);
- mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE2);
+ mga_outl(M_DWGCTL, minfo->accel.m_dwg_rect | M_DWG_REPLACE2);
mga_outl(M_FCOL, bgx);
mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
- mga_outl(M_YDST, sy * ACCESS_FBINFO(fbcon).var.xres_virtual >> 6);
+ mga_outl(M_YDST, sy * minfo->fbcon.var.xres_virtual >> 6);
mga_outl(M_LEN | M_EXEC, height);
WaitTillIdle();
}
if (whattodo) {
- u_int32_t step = ACCESS_FBINFO(fbcon).var.xres_virtual >> 1;
- vaddr_t vbase = ACCESS_FBINFO(video.vbase);
+ u_int32_t step = minfo->fbcon.var.xres_virtual >> 1;
+ vaddr_t vbase = minfo->video.vbase;
if (whattodo & 1) {
unsigned int uaddr = sy * step + sx - 1;
u_int32_t loop;
@@ -367,17 +376,19 @@
}
static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
switch (rect->rop) {
case ROP_COPY:
- matroxfb_cfb4_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+ matroxfb_cfb4_clear(minfo, ((u_int32_t *)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
break;
}
}
-static void matroxfb_1bpp_imageblit(WPMINFO u_int32_t fgx, u_int32_t bgx,
- const u_int8_t* chardata, int width, int height, int yy, int xx) {
+static void matroxfb_1bpp_imageblit(struct matrox_fb_info *minfo, u_int32_t fgx,
+ u_int32_t bgx, const u_int8_t *chardata,
+ int width, int height, int yy, int xx)
+{
u_int32_t step;
u_int32_t ydstlen;
u_int32_t xlen;
@@ -412,7 +423,7 @@
mga_outl(M_FCOL, fgx);
mga_outl(M_BCOL, bgx);
fxbndry = ((xx + width - 1) << 16) | xx;
- mmio = ACCESS_FBINFO(mmio.vbase);
+ mmio = minfo->mmio.vbase;
mga_fifo(6);
mga_writel(mmio, M_FXBNDRY, fxbndry);
@@ -467,7 +478,7 @@
static void matroxfb_imageblit(struct fb_info* info, const struct fb_image* image) {
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
DBG_HEAVY(__func__);
@@ -476,7 +487,7 @@
fgx = ((u_int32_t*)info->pseudo_palette)[image->fg_color];
bgx = ((u_int32_t*)info->pseudo_palette)[image->bg_color];
- matroxfb_1bpp_imageblit(PMINFO fgx, bgx, image->data, image->width, image->height, image->dy, image->dx);
+ matroxfb_1bpp_imageblit(minfo, fgx, bgx, image->data, image->width, image->height, image->dy, image->dx);
} else {
/* Danger! image->depth is useless: logo painting code always
passes framebuffer color depth here, although logo data are
diff --git a/drivers/video/matrox/matroxfb_accel.h b/drivers/video/matrox/matroxfb_accel.h
index f40c314..1e418e62 100644
--- a/drivers/video/matrox/matroxfb_accel.h
+++ b/drivers/video/matrox/matroxfb_accel.h
@@ -3,6 +3,6 @@
#include "matroxfb_base.h"
-void matrox_cfbX_init(WPMINFO2);
+void matrox_cfbX_init(struct matrox_fb_info *minfo);
#endif
diff --git a/drivers/video/matrox/matroxfb_base.c b/drivers/video/matrox/matroxfb_base.c
index 0c1049b..7064fb4 100644
--- a/drivers/video/matrox/matroxfb_base.c
+++ b/drivers/video/matrox/matroxfb_base.c
@@ -154,21 +154,22 @@
/* --------------------------------------------------------------------- */
-static void update_crtc2(WPMINFO unsigned int pos) {
- struct matroxfb_dh_fb_info* info = ACCESS_FBINFO(crtc2.info);
+static void update_crtc2(struct matrox_fb_info *minfo, unsigned int pos)
+{
+ struct matroxfb_dh_fb_info *info = minfo->crtc2.info;
/* Make sure that displays are compatible */
- if (info && (info->fbcon.var.bits_per_pixel == ACCESS_FBINFO(fbcon).var.bits_per_pixel)
- && (info->fbcon.var.xres_virtual == ACCESS_FBINFO(fbcon).var.xres_virtual)
- && (info->fbcon.var.green.length == ACCESS_FBINFO(fbcon).var.green.length)
+ if (info && (info->fbcon.var.bits_per_pixel == minfo->fbcon.var.bits_per_pixel)
+ && (info->fbcon.var.xres_virtual == minfo->fbcon.var.xres_virtual)
+ && (info->fbcon.var.green.length == minfo->fbcon.var.green.length)
) {
- switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ switch (minfo->fbcon.var.bits_per_pixel) {
case 16:
case 32:
pos = pos * 8;
if (info->interlaced) {
mga_outl(0x3C2C, pos);
- mga_outl(0x3C28, pos + ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(fbcon).var.bits_per_pixel / 8);
+ mga_outl(0x3C28, pos + minfo->fbcon.var.xres_virtual * minfo->fbcon.var.bits_per_pixel / 8);
} else {
mga_outl(0x3C28, pos);
}
@@ -177,17 +178,18 @@
}
}
-static void matroxfb_crtc1_panpos(WPMINFO2) {
- if (ACCESS_FBINFO(crtc1.panpos) >= 0) {
+static void matroxfb_crtc1_panpos(struct matrox_fb_info *minfo)
+{
+ if (minfo->crtc1.panpos >= 0) {
unsigned long flags;
int panpos;
matroxfb_DAC_lock_irqsave(flags);
- panpos = ACCESS_FBINFO(crtc1.panpos);
+ panpos = minfo->crtc1.panpos;
if (panpos >= 0) {
unsigned int extvga_reg;
- ACCESS_FBINFO(crtc1.panpos) = -1; /* No update pending anymore */
+ minfo->crtc1.panpos = -1; /* No update pending anymore */
extvga_reg = mga_inb(M_EXTVGA_INDEX);
mga_setr(M_EXTVGA_INDEX, 0x00, panpos);
if (extvga_reg != 0x00) {
@@ -202,39 +204,39 @@
{
u_int32_t status;
int handled = 0;
-
- MINFO_FROM(dev_id);
+ struct matrox_fb_info *minfo = dev_id;
status = mga_inl(M_STATUS);
if (status & 0x20) {
mga_outl(M_ICLEAR, 0x20);
- ACCESS_FBINFO(crtc1.vsync.cnt)++;
- matroxfb_crtc1_panpos(PMINFO2);
- wake_up_interruptible(&ACCESS_FBINFO(crtc1.vsync.wait));
+ minfo->crtc1.vsync.cnt++;
+ matroxfb_crtc1_panpos(minfo);
+ wake_up_interruptible(&minfo->crtc1.vsync.wait);
handled = 1;
}
if (status & 0x200) {
mga_outl(M_ICLEAR, 0x200);
- ACCESS_FBINFO(crtc2.vsync.cnt)++;
- wake_up_interruptible(&ACCESS_FBINFO(crtc2.vsync.wait));
+ minfo->crtc2.vsync.cnt++;
+ wake_up_interruptible(&minfo->crtc2.vsync.wait);
handled = 1;
}
return IRQ_RETVAL(handled);
}
-int matroxfb_enable_irq(WPMINFO int reenable) {
+int matroxfb_enable_irq(struct matrox_fb_info *minfo, int reenable)
+{
u_int32_t bm;
- if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+ if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400)
bm = 0x220;
else
bm = 0x020;
- if (!test_and_set_bit(0, &ACCESS_FBINFO(irq_flags))) {
- if (request_irq(ACCESS_FBINFO(pcidev)->irq, matrox_irq,
- IRQF_SHARED, "matroxfb", MINFO)) {
- clear_bit(0, &ACCESS_FBINFO(irq_flags));
+ if (!test_and_set_bit(0, &minfo->irq_flags)) {
+ if (request_irq(minfo->pcidev->irq, matrox_irq,
+ IRQF_SHARED, "matroxfb", minfo)) {
+ clear_bit(0, &minfo->irq_flags);
return -EINVAL;
}
/* Clear any pending field interrupts */
@@ -252,37 +254,39 @@
return 0;
}
-static void matroxfb_disable_irq(WPMINFO2) {
- if (test_and_clear_bit(0, &ACCESS_FBINFO(irq_flags))) {
+static void matroxfb_disable_irq(struct matrox_fb_info *minfo)
+{
+ if (test_and_clear_bit(0, &minfo->irq_flags)) {
/* Flush pending pan-at-vbl request... */
- matroxfb_crtc1_panpos(PMINFO2);
- if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+ matroxfb_crtc1_panpos(minfo);
+ if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400)
mga_outl(M_IEN, mga_inl(M_IEN) & ~0x220);
else
mga_outl(M_IEN, mga_inl(M_IEN) & ~0x20);
- free_irq(ACCESS_FBINFO(pcidev)->irq, MINFO);
+ free_irq(minfo->pcidev->irq, minfo);
}
}
-int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc) {
+int matroxfb_wait_for_sync(struct matrox_fb_info *minfo, u_int32_t crtc)
+{
struct matrox_vsync *vs;
unsigned int cnt;
int ret;
switch (crtc) {
case 0:
- vs = &ACCESS_FBINFO(crtc1.vsync);
+ vs = &minfo->crtc1.vsync;
break;
case 1:
- if (ACCESS_FBINFO(devflags.accelerator) != FB_ACCEL_MATROX_MGAG400) {
+ if (minfo->devflags.accelerator != FB_ACCEL_MATROX_MGAG400) {
return -ENODEV;
}
- vs = &ACCESS_FBINFO(crtc2.vsync);
+ vs = &minfo->crtc2.vsync;
break;
default:
return -ENODEV;
}
- ret = matroxfb_enable_irq(PMINFO 0);
+ ret = matroxfb_enable_irq(minfo, 0);
if (ret) {
return ret;
}
@@ -293,7 +297,7 @@
return ret;
}
if (ret == 0) {
- matroxfb_enable_irq(PMINFO 1);
+ matroxfb_enable_irq(minfo, 1);
return -ETIMEDOUT;
}
return 0;
@@ -301,12 +305,12 @@
/* --------------------------------------------------------------------- */
-static void matrox_pan_var(WPMINFO struct fb_var_screeninfo *var) {
+static void matrox_pan_var(struct matrox_fb_info *minfo,
+ struct fb_var_screeninfo *var)
+{
unsigned int pos;
unsigned short p0, p1, p2;
-#ifdef CONFIG_FB_MATROX_32MB
unsigned int p3;
-#endif
int vbl;
unsigned long flags;
@@ -314,47 +318,44 @@
DBG(__func__)
- if (ACCESS_FBINFO(dead))
+ if (minfo->dead)
return;
- ACCESS_FBINFO(fbcon).var.xoffset = var->xoffset;
- ACCESS_FBINFO(fbcon).var.yoffset = var->yoffset;
- pos = (ACCESS_FBINFO(fbcon).var.yoffset * ACCESS_FBINFO(fbcon).var.xres_virtual + ACCESS_FBINFO(fbcon).var.xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
- pos += ACCESS_FBINFO(curr.ydstorg.chunks);
- p0 = ACCESS_FBINFO(hw).CRTC[0x0D] = pos & 0xFF;
- p1 = ACCESS_FBINFO(hw).CRTC[0x0C] = (pos & 0xFF00) >> 8;
- p2 = ACCESS_FBINFO(hw).CRTCEXT[0] = (ACCESS_FBINFO(hw).CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
-#ifdef CONFIG_FB_MATROX_32MB
- p3 = ACCESS_FBINFO(hw).CRTCEXT[8] = pos >> 21;
-#endif
+ minfo->fbcon.var.xoffset = var->xoffset;
+ minfo->fbcon.var.yoffset = var->yoffset;
+ pos = (minfo->fbcon.var.yoffset * minfo->fbcon.var.xres_virtual + minfo->fbcon.var.xoffset) * minfo->curr.final_bppShift / 32;
+ pos += minfo->curr.ydstorg.chunks;
+ p0 = minfo->hw.CRTC[0x0D] = pos & 0xFF;
+ p1 = minfo->hw.CRTC[0x0C] = (pos & 0xFF00) >> 8;
+ p2 = minfo->hw.CRTCEXT[0] = (minfo->hw.CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
+ p3 = minfo->hw.CRTCEXT[8] = pos >> 21;
/* FB_ACTIVATE_VBL and we can acquire interrupts? Honor FB_ACTIVATE_VBL then... */
- vbl = (var->activate & FB_ACTIVATE_VBL) && (matroxfb_enable_irq(PMINFO 0) == 0);
+ vbl = (var->activate & FB_ACTIVATE_VBL) && (matroxfb_enable_irq(minfo, 0) == 0);
CRITBEGIN
matroxfb_DAC_lock_irqsave(flags);
mga_setr(M_CRTC_INDEX, 0x0D, p0);
mga_setr(M_CRTC_INDEX, 0x0C, p1);
-#ifdef CONFIG_FB_MATROX_32MB
- if (ACCESS_FBINFO(devflags.support32MB))
+ if (minfo->devflags.support32MB)
mga_setr(M_EXTVGA_INDEX, 0x08, p3);
-#endif
if (vbl) {
- ACCESS_FBINFO(crtc1.panpos) = p2;
+ minfo->crtc1.panpos = p2;
} else {
/* Abort any pending change */
- ACCESS_FBINFO(crtc1.panpos) = -1;
+ minfo->crtc1.panpos = -1;
mga_setr(M_EXTVGA_INDEX, 0x00, p2);
}
matroxfb_DAC_unlock_irqrestore(flags);
- update_crtc2(PMINFO pos);
+ update_crtc2(minfo, pos);
CRITEND
}
-static void matroxfb_remove(WPMINFO int dummy) {
+static void matroxfb_remove(struct matrox_fb_info *minfo, int dummy)
+{
/* Currently we are holding big kernel lock on all dead & usecount updates.
* Destroy everything after all users release it. Especially do not unregister
* framebuffer and iounmap memory, neither fbmem nor fbcon-cfb* does not check
@@ -363,25 +364,23 @@
* write data without causing too much damage...
*/
- ACCESS_FBINFO(dead) = 1;
- if (ACCESS_FBINFO(usecount)) {
+ minfo->dead = 1;
+ if (minfo->usecount) {
/* destroy it later */
return;
}
- matroxfb_unregister_device(MINFO);
- unregister_framebuffer(&ACCESS_FBINFO(fbcon));
- matroxfb_g450_shutdown(PMINFO2);
+ matroxfb_unregister_device(minfo);
+ unregister_framebuffer(&minfo->fbcon);
+ matroxfb_g450_shutdown(minfo);
#ifdef CONFIG_MTRR
- if (ACCESS_FBINFO(mtrr.vram_valid))
- mtrr_del(ACCESS_FBINFO(mtrr.vram), ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len));
+ if (minfo->mtrr.vram_valid)
+ mtrr_del(minfo->mtrr.vram, minfo->video.base, minfo->video.len);
#endif
- mga_iounmap(ACCESS_FBINFO(mmio.vbase));
- mga_iounmap(ACCESS_FBINFO(video.vbase));
- release_mem_region(ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len_maximum));
- release_mem_region(ACCESS_FBINFO(mmio.base), 16384);
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
+ mga_iounmap(minfo->mmio.vbase);
+ mga_iounmap(minfo->video.vbase);
+ release_mem_region(minfo->video.base, minfo->video.len_maximum);
+ release_mem_region(minfo->mmio.base, 16384);
kfree(minfo);
-#endif
}
/*
@@ -390,48 +389,50 @@
static int matroxfb_open(struct fb_info *info, int user)
{
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
DBG_LOOP(__func__)
- if (ACCESS_FBINFO(dead)) {
+ if (minfo->dead) {
return -ENXIO;
}
- ACCESS_FBINFO(usecount)++;
+ minfo->usecount++;
if (user) {
- ACCESS_FBINFO(userusecount)++;
+ minfo->userusecount++;
}
return(0);
}
static int matroxfb_release(struct fb_info *info, int user)
{
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
DBG_LOOP(__func__)
if (user) {
- if (0 == --ACCESS_FBINFO(userusecount)) {
- matroxfb_disable_irq(PMINFO2);
+ if (0 == --minfo->userusecount) {
+ matroxfb_disable_irq(minfo);
}
}
- if (!(--ACCESS_FBINFO(usecount)) && ACCESS_FBINFO(dead)) {
- matroxfb_remove(PMINFO 0);
+ if (!(--minfo->usecount) && minfo->dead) {
+ matroxfb_remove(minfo, 0);
}
return(0);
}
static int matroxfb_pan_display(struct fb_var_screeninfo *var,
struct fb_info* info) {
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
DBG(__func__)
- matrox_pan_var(PMINFO var);
+ matrox_pan_var(minfo, var);
return 0;
}
-static int matroxfb_get_final_bppShift(CPMINFO int bpp) {
+static int matroxfb_get_final_bppShift(const struct matrox_fb_info *minfo,
+ int bpp)
+{
int bppshft2;
DBG(__func__)
@@ -440,14 +441,16 @@
if (!bppshft2) {
return 8;
}
- if (isInterleave(MINFO))
+ if (isInterleave(minfo))
bppshft2 >>= 1;
- if (ACCESS_FBINFO(devflags.video64bits))
+ if (minfo->devflags.video64bits)
bppshft2 >>= 1;
return bppshft2;
}
-static int matroxfb_test_and_set_rounding(CPMINFO int xres, int bpp) {
+static int matroxfb_test_and_set_rounding(const struct matrox_fb_info *minfo,
+ int xres, int bpp)
+{
int over;
int rounding;
@@ -465,11 +468,11 @@
break;
default: rounding = 16;
/* on G400, 16 really does not work */
- if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+ if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400)
rounding = 32;
break;
}
- if (isInterleave(MINFO)) {
+ if (isInterleave(minfo)) {
rounding *= 2;
}
over = xres % rounding;
@@ -478,7 +481,9 @@
return xres;
}
-static int matroxfb_pitch_adjust(CPMINFO int xres, int bpp) {
+static int matroxfb_pitch_adjust(const struct matrox_fb_info *minfo, int xres,
+ int bpp)
+{
const int* width;
int xres_new;
@@ -486,18 +491,18 @@
if (!bpp) return xres;
- width = ACCESS_FBINFO(capable.vxres);
+ width = minfo->capable.vxres;
- if (ACCESS_FBINFO(devflags.precise_width)) {
+ if (minfo->devflags.precise_width) {
while (*width) {
- if ((*width >= xres) && (matroxfb_test_and_set_rounding(PMINFO *width, bpp) == *width)) {
+ if ((*width >= xres) && (matroxfb_test_and_set_rounding(minfo, *width, bpp) == *width)) {
break;
}
width++;
}
xres_new = *width;
} else {
- xres_new = matroxfb_test_and_set_rounding(PMINFO xres, bpp);
+ xres_new = matroxfb_test_and_set_rounding(minfo, xres, bpp);
}
return xres_new;
}
@@ -524,7 +529,10 @@
return 16; /* return something reasonable... or panic()? */
}
-static int matroxfb_decode_var(CPMINFO struct fb_var_screeninfo *var, int *visual, int *video_cmap_len, unsigned int* ydstorg) {
+static int matroxfb_decode_var(const struct matrox_fb_info *minfo,
+ struct fb_var_screeninfo *var, int *visual,
+ int *video_cmap_len, unsigned int* ydstorg)
+{
struct RGBT {
unsigned char bpp;
struct {
@@ -551,7 +559,7 @@
DBG(__func__)
switch (bpp) {
- case 4: if (!ACCESS_FBINFO(capable.cfb4)) return -EINVAL;
+ case 4: if (!minfo->capable.cfb4) return -EINVAL;
break;
case 8: break;
case 16: break;
@@ -560,13 +568,13 @@
default: return -EINVAL;
}
*ydstorg = 0;
- vramlen = ACCESS_FBINFO(video.len_usable);
+ vramlen = minfo->video.len_usable;
if (var->yres_virtual < var->yres)
var->yres_virtual = var->yres;
if (var->xres_virtual < var->xres)
var->xres_virtual = var->xres;
- var->xres_virtual = matroxfb_pitch_adjust(PMINFO var->xres_virtual, bpp);
+ var->xres_virtual = matroxfb_pitch_adjust(minfo, var->xres_virtual, bpp);
memlen = var->xres_virtual * bpp * var->yres_virtual / 8;
if (memlen > vramlen) {
var->yres_virtual = vramlen * 8 / (var->xres_virtual * bpp);
@@ -575,7 +583,7 @@
/* There is hardware bug that no line can cross 4MB boundary */
/* give up for CFB24, it is impossible to easy workaround it */
/* for other try to do something */
- if (!ACCESS_FBINFO(capable.cross4MB) && (memlen > 0x400000)) {
+ if (!minfo->capable.cross4MB && (memlen > 0x400000)) {
if (bpp == 24) {
/* sorry */
} else {
@@ -644,9 +652,7 @@
unsigned blue, unsigned transp,
struct fb_info *fb_info)
{
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
struct matrox_fb_info* minfo = container_of(fb_info, struct matrox_fb_info, fbcon);
-#endif
DBG(__func__)
@@ -657,20 +663,20 @@
* != 0 for invalid regno.
*/
- if (regno >= ACCESS_FBINFO(curr.cmap_len))
+ if (regno >= minfo->curr.cmap_len)
return 1;
- if (ACCESS_FBINFO(fbcon).var.grayscale) {
+ if (minfo->fbcon.var.grayscale) {
/* gray = 0.30*R + 0.59*G + 0.11*B */
red = green = blue = (red * 77 + green * 151 + blue * 28) >> 8;
}
- red = CNVT_TOHW(red, ACCESS_FBINFO(fbcon).var.red.length);
- green = CNVT_TOHW(green, ACCESS_FBINFO(fbcon).var.green.length);
- blue = CNVT_TOHW(blue, ACCESS_FBINFO(fbcon).var.blue.length);
- transp = CNVT_TOHW(transp, ACCESS_FBINFO(fbcon).var.transp.length);
+ red = CNVT_TOHW(red, minfo->fbcon.var.red.length);
+ green = CNVT_TOHW(green, minfo->fbcon.var.green.length);
+ blue = CNVT_TOHW(blue, minfo->fbcon.var.blue.length);
+ transp = CNVT_TOHW(transp, minfo->fbcon.var.transp.length);
- switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+ switch (minfo->fbcon.var.bits_per_pixel) {
case 4:
case 8:
mga_outb(M_DAC_REG, regno);
@@ -683,30 +689,30 @@
break;
{
u_int16_t col =
- (red << ACCESS_FBINFO(fbcon).var.red.offset) |
- (green << ACCESS_FBINFO(fbcon).var.green.offset) |
- (blue << ACCESS_FBINFO(fbcon).var.blue.offset) |
- (transp << ACCESS_FBINFO(fbcon).var.transp.offset); /* for 1:5:5:5 */
- ACCESS_FBINFO(cmap[regno]) = col | (col << 16);
+ (red << minfo->fbcon.var.red.offset) |
+ (green << minfo->fbcon.var.green.offset) |
+ (blue << minfo->fbcon.var.blue.offset) |
+ (transp << minfo->fbcon.var.transp.offset); /* for 1:5:5:5 */
+ minfo->cmap[regno] = col | (col << 16);
}
break;
case 24:
case 32:
if (regno >= 16)
break;
- ACCESS_FBINFO(cmap[regno]) =
- (red << ACCESS_FBINFO(fbcon).var.red.offset) |
- (green << ACCESS_FBINFO(fbcon).var.green.offset) |
- (blue << ACCESS_FBINFO(fbcon).var.blue.offset) |
- (transp << ACCESS_FBINFO(fbcon).var.transp.offset); /* 8:8:8:8 */
+ minfo->cmap[regno] =
+ (red << minfo->fbcon.var.red.offset) |
+ (green << minfo->fbcon.var.green.offset) |
+ (blue << minfo->fbcon.var.blue.offset) |
+ (transp << minfo->fbcon.var.transp.offset); /* 8:8:8:8 */
break;
}
return 0;
}
-static void matroxfb_init_fix(WPMINFO2)
+static void matroxfb_init_fix(struct matrox_fb_info *minfo)
{
- struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+ struct fb_fix_screeninfo *fix = &minfo->fbcon.fix;
DBG(__func__)
strcpy(fix->id,"MATROX");
@@ -714,20 +720,20 @@
fix->xpanstep = 8; /* 8 for 8bpp, 4 for 16bpp, 2 for 32bpp */
fix->ypanstep = 1;
fix->ywrapstep = 0;
- fix->mmio_start = ACCESS_FBINFO(mmio.base);
- fix->mmio_len = ACCESS_FBINFO(mmio.len);
- fix->accel = ACCESS_FBINFO(devflags.accelerator);
+ fix->mmio_start = minfo->mmio.base;
+ fix->mmio_len = minfo->mmio.len;
+ fix->accel = minfo->devflags.accelerator;
}
-static void matroxfb_update_fix(WPMINFO2)
+static void matroxfb_update_fix(struct matrox_fb_info *minfo)
{
- struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+ struct fb_fix_screeninfo *fix = &minfo->fbcon.fix;
DBG(__func__)
- mutex_lock(&ACCESS_FBINFO(fbcon).mm_lock);
- fix->smem_start = ACCESS_FBINFO(video.base) + ACCESS_FBINFO(curr.ydstorg.bytes);
- fix->smem_len = ACCESS_FBINFO(video.len_usable) - ACCESS_FBINFO(curr.ydstorg.bytes);
- mutex_unlock(&ACCESS_FBINFO(fbcon).mm_lock);
+ mutex_lock(&minfo->fbcon.mm_lock);
+ fix->smem_start = minfo->video.base + minfo->curr.ydstorg.bytes;
+ fix->smem_len = minfo->video.len_usable - minfo->curr.ydstorg.bytes;
+ mutex_unlock(&minfo->fbcon.mm_lock);
}
static int matroxfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
@@ -736,12 +742,12 @@
int visual;
int cmap_len;
unsigned int ydstorg;
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
- if (ACCESS_FBINFO(dead)) {
+ if (minfo->dead) {
return -ENXIO;
}
- if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+ if ((err = matroxfb_decode_var(minfo, var, &visual, &cmap_len, &ydstorg)) != 0)
return err;
return 0;
}
@@ -753,35 +759,35 @@
int cmap_len;
unsigned int ydstorg;
struct fb_var_screeninfo *var;
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
DBG(__func__)
- if (ACCESS_FBINFO(dead)) {
+ if (minfo->dead) {
return -ENXIO;
}
var = &info->var;
- if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+ if ((err = matroxfb_decode_var(minfo, var, &visual, &cmap_len, &ydstorg)) != 0)
return err;
- ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase)) + ydstorg;
- matroxfb_update_fix(PMINFO2);
- ACCESS_FBINFO(fbcon).fix.visual = visual;
- ACCESS_FBINFO(fbcon).fix.type = FB_TYPE_PACKED_PIXELS;
- ACCESS_FBINFO(fbcon).fix.type_aux = 0;
- ACCESS_FBINFO(fbcon).fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
+ minfo->fbcon.screen_base = vaddr_va(minfo->video.vbase) + ydstorg;
+ matroxfb_update_fix(minfo);
+ minfo->fbcon.fix.visual = visual;
+ minfo->fbcon.fix.type = FB_TYPE_PACKED_PIXELS;
+ minfo->fbcon.fix.type_aux = 0;
+ minfo->fbcon.fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
{
unsigned int pos;
- ACCESS_FBINFO(curr.cmap_len) = cmap_len;
- ydstorg += ACCESS_FBINFO(devflags.ydstorg);
- ACCESS_FBINFO(curr.ydstorg.bytes) = ydstorg;
- ACCESS_FBINFO(curr.ydstorg.chunks) = ydstorg >> (isInterleave(MINFO)?3:2);
+ minfo->curr.cmap_len = cmap_len;
+ ydstorg += minfo->devflags.ydstorg;
+ minfo->curr.ydstorg.bytes = ydstorg;
+ minfo->curr.ydstorg.chunks = ydstorg >> (isInterleave(minfo) ? 3 : 2);
if (var->bits_per_pixel == 4)
- ACCESS_FBINFO(curr.ydstorg.pixels) = ydstorg;
+ minfo->curr.ydstorg.pixels = ydstorg;
else
- ACCESS_FBINFO(curr.ydstorg.pixels) = (ydstorg * 8) / var->bits_per_pixel;
- ACCESS_FBINFO(curr.final_bppShift) = matroxfb_get_final_bppShift(PMINFO var->bits_per_pixel);
+ minfo->curr.ydstorg.pixels = (ydstorg * 8) / var->bits_per_pixel;
+ minfo->curr.final_bppShift = matroxfb_get_final_bppShift(minfo, var->bits_per_pixel);
{ struct my_timming mt;
struct matrox_hw_state* hw;
int out;
@@ -797,54 +803,55 @@
default: mt.delay = 31 + 8; break;
}
- hw = &ACCESS_FBINFO(hw);
+ hw = &minfo->hw;
- down_read(&ACCESS_FBINFO(altout).lock);
+ down_read(&minfo->altout.lock);
for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
- if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
- ACCESS_FBINFO(outputs[out]).output->compute) {
- ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+ if (minfo->outputs[out].src == MATROXFB_SRC_CRTC1 &&
+ minfo->outputs[out].output->compute) {
+ minfo->outputs[out].output->compute(minfo->outputs[out].data, &mt);
}
}
- up_read(&ACCESS_FBINFO(altout).lock);
- ACCESS_FBINFO(crtc1).pixclock = mt.pixclock;
- ACCESS_FBINFO(crtc1).mnp = mt.mnp;
- ACCESS_FBINFO(hw_switch->init(PMINFO &mt));
- pos = (var->yoffset * var->xres_virtual + var->xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
- pos += ACCESS_FBINFO(curr.ydstorg.chunks);
+ up_read(&minfo->altout.lock);
+ minfo->crtc1.pixclock = mt.pixclock;
+ minfo->crtc1.mnp = mt.mnp;
+ minfo->hw_switch->init(minfo, &mt);
+ pos = (var->yoffset * var->xres_virtual + var->xoffset) * minfo->curr.final_bppShift / 32;
+ pos += minfo->curr.ydstorg.chunks;
hw->CRTC[0x0D] = pos & 0xFF;
hw->CRTC[0x0C] = (pos & 0xFF00) >> 8;
hw->CRTCEXT[0] = (hw->CRTCEXT[0] & 0xF0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
hw->CRTCEXT[8] = pos >> 21;
- ACCESS_FBINFO(hw_switch->restore(PMINFO2));
- update_crtc2(PMINFO pos);
- down_read(&ACCESS_FBINFO(altout).lock);
+ minfo->hw_switch->restore(minfo);
+ update_crtc2(minfo, pos);
+ down_read(&minfo->altout.lock);
for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
- if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
- ACCESS_FBINFO(outputs[out]).output->program) {
- ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+ if (minfo->outputs[out].src == MATROXFB_SRC_CRTC1 &&
+ minfo->outputs[out].output->program) {
+ minfo->outputs[out].output->program(minfo->outputs[out].data);
}
}
for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
- if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
- ACCESS_FBINFO(outputs[out]).output->start) {
- ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+ if (minfo->outputs[out].src == MATROXFB_SRC_CRTC1 &&
+ minfo->outputs[out].output->start) {
+ minfo->outputs[out].output->start(minfo->outputs[out].data);
}
}
- up_read(&ACCESS_FBINFO(altout).lock);
- matrox_cfbX_init(PMINFO2);
+ up_read(&minfo->altout.lock);
+ matrox_cfbX_init(minfo);
}
}
- ACCESS_FBINFO(initialized) = 1;
+ minfo->initialized = 1;
return 0;
}
-static int matroxfb_get_vblank(WPMINFO struct fb_vblank *vblank)
+static int matroxfb_get_vblank(struct matrox_fb_info *minfo,
+ struct fb_vblank *vblank)
{
unsigned int sts1;
- matroxfb_enable_irq(PMINFO 0);
+ matroxfb_enable_irq(minfo, 0);
memset(vblank, 0, sizeof(*vblank));
vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VSYNC |
FB_VBLANK_HAVE_VBLANK | FB_VBLANK_HAVE_HBLANK;
@@ -857,13 +864,13 @@
vblank->flags |= FB_VBLANK_HBLANKING;
if (sts1 & 8)
vblank->flags |= FB_VBLANK_VSYNCING;
- if (vblank->vcount >= ACCESS_FBINFO(fbcon).var.yres)
+ if (vblank->vcount >= minfo->fbcon.var.yres)
vblank->flags |= FB_VBLANK_VBLANKING;
- if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+ if (test_bit(0, &minfo->irq_flags)) {
vblank->flags |= FB_VBLANK_HAVE_COUNT;
/* Only one writer, aligned int value...
it should work without lock and without atomic_t */
- vblank->count = ACCESS_FBINFO(crtc1).vsync.cnt;
+ vblank->count = minfo->crtc1.vsync.cnt;
}
return 0;
}
@@ -876,11 +883,11 @@
unsigned int cmd, unsigned long arg)
{
void __user *argp = (void __user *)arg;
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
DBG(__func__)
- if (ACCESS_FBINFO(dead)) {
+ if (minfo->dead) {
return -ENXIO;
}
@@ -890,7 +897,7 @@
struct fb_vblank vblank;
int err;
- err = matroxfb_get_vblank(PMINFO &vblank);
+ err = matroxfb_get_vblank(minfo, &vblank);
if (err)
return err;
if (copy_to_user(argp, &vblank, sizeof(vblank)))
@@ -904,7 +911,7 @@
if (get_user(crt, (u_int32_t __user *)arg))
return -EFAULT;
- return matroxfb_wait_for_sync(PMINFO crt);
+ return matroxfb_wait_for_sync(minfo, crt);
}
case MATROXFB_SET_OUTPUT_MODE:
{
@@ -916,8 +923,8 @@
return -EFAULT;
if (mom.output >= MATROXFB_MAX_OUTPUTS)
return -ENXIO;
- down_read(&ACCESS_FBINFO(altout.lock));
- oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+ down_read(&minfo->altout.lock);
+ oproc = minfo->outputs[mom.output].output;
if (!oproc) {
val = -ENXIO;
} else if (!oproc->verifymode) {
@@ -927,18 +934,18 @@
val = -EINVAL;
}
} else {
- val = oproc->verifymode(ACCESS_FBINFO(outputs[mom.output]).data, mom.mode);
+ val = oproc->verifymode(minfo->outputs[mom.output].data, mom.mode);
}
if (!val) {
- if (ACCESS_FBINFO(outputs[mom.output]).mode != mom.mode) {
- ACCESS_FBINFO(outputs[mom.output]).mode = mom.mode;
+ if (minfo->outputs[mom.output].mode != mom.mode) {
+ minfo->outputs[mom.output].mode = mom.mode;
val = 1;
}
}
- up_read(&ACCESS_FBINFO(altout.lock));
+ up_read(&minfo->altout.lock);
if (val != 1)
return val;
- switch (ACCESS_FBINFO(outputs[mom.output]).src) {
+ switch (minfo->outputs[mom.output].src) {
case MATROXFB_SRC_CRTC1:
matroxfb_set_par(info);
break;
@@ -946,11 +953,11 @@
{
struct matroxfb_dh_fb_info* crtc2;
- down_read(&ACCESS_FBINFO(crtc2.lock));
- crtc2 = ACCESS_FBINFO(crtc2.info);
+ down_read(&minfo->crtc2.lock);
+ crtc2 = minfo->crtc2.info;
if (crtc2)
crtc2->fbcon.fbops->fb_set_par(&crtc2->fbcon);
- up_read(&ACCESS_FBINFO(crtc2.lock));
+ up_read(&minfo->crtc2.lock);
}
break;
}
@@ -966,15 +973,15 @@
return -EFAULT;
if (mom.output >= MATROXFB_MAX_OUTPUTS)
return -ENXIO;
- down_read(&ACCESS_FBINFO(altout.lock));
- oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+ down_read(&minfo->altout.lock);
+ oproc = minfo->outputs[mom.output].output;
if (!oproc) {
val = -ENXIO;
} else {
- mom.mode = ACCESS_FBINFO(outputs[mom.output]).mode;
+ mom.mode = minfo->outputs[mom.output].mode;
val = 0;
}
- up_read(&ACCESS_FBINFO(altout.lock));
+ up_read(&minfo->altout.lock);
if (val)
return val;
if (copy_to_user(argp, &mom, sizeof(mom)))
@@ -993,9 +1000,9 @@
if (tmp & (1 << i)) {
if (i >= MATROXFB_MAX_OUTPUTS)
return -ENXIO;
- if (!ACCESS_FBINFO(outputs[i]).output)
+ if (!minfo->outputs[i].output)
return -ENXIO;
- switch (ACCESS_FBINFO(outputs[i]).src) {
+ switch (minfo->outputs[i].src) {
case MATROXFB_SRC_NONE:
case MATROXFB_SRC_CRTC1:
break;
@@ -1004,12 +1011,12 @@
}
}
}
- if (ACCESS_FBINFO(devflags.panellink)) {
+ if (minfo->devflags.panellink) {
if (tmp & MATROXFB_OUTPUT_CONN_DFP) {
if (tmp & MATROXFB_OUTPUT_CONN_SECONDARY)
return -EINVAL;
for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
- if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC2) {
+ if (minfo->outputs[i].src == MATROXFB_SRC_CRTC2) {
return -EBUSY;
}
}
@@ -1018,13 +1025,13 @@
changes = 0;
for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
if (tmp & (1 << i)) {
- if (ACCESS_FBINFO(outputs[i]).src != MATROXFB_SRC_CRTC1) {
+ if (minfo->outputs[i].src != MATROXFB_SRC_CRTC1) {
changes = 1;
- ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_CRTC1;
+ minfo->outputs[i].src = MATROXFB_SRC_CRTC1;
}
- } else if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+ } else if (minfo->outputs[i].src == MATROXFB_SRC_CRTC1) {
changes = 1;
- ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_NONE;
+ minfo->outputs[i].src = MATROXFB_SRC_NONE;
}
}
if (!changes)
@@ -1038,7 +1045,7 @@
int i;
for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
- if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+ if (minfo->outputs[i].src == MATROXFB_SRC_CRTC1) {
conn |= 1 << i;
}
}
@@ -1052,8 +1059,8 @@
int i;
for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
- if (ACCESS_FBINFO(outputs[i]).output) {
- switch (ACCESS_FBINFO(outputs[i]).src) {
+ if (minfo->outputs[i].output) {
+ switch (minfo->outputs[i].src) {
case MATROXFB_SRC_NONE:
case MATROXFB_SRC_CRTC1:
conn |= 1 << i;
@@ -1061,7 +1068,7 @@
}
}
}
- if (ACCESS_FBINFO(devflags.panellink)) {
+ if (minfo->devflags.panellink) {
if (conn & MATROXFB_OUTPUT_CONN_DFP)
conn &= ~MATROXFB_OUTPUT_CONN_SECONDARY;
if (conn & MATROXFB_OUTPUT_CONN_SECONDARY)
@@ -1077,7 +1084,7 @@
int i;
for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
- if (ACCESS_FBINFO(outputs[i]).output) {
+ if (minfo->outputs[i].output) {
conn |= 1 << i;
}
}
@@ -1092,7 +1099,7 @@
memset(&r, 0, sizeof(r));
strcpy(r.driver, "matroxfb");
strcpy(r.card, "Matrox");
- sprintf(r.bus_info, "PCI:%s", pci_name(ACCESS_FBINFO(pcidev)));
+ sprintf(r.bus_info, "PCI:%s", pci_name(minfo->pcidev));
r.version = KERNEL_VERSION(1,0,0);
r.capabilities = V4L2_CAP_VIDEO_OUTPUT;
if (copy_to_user(argp, &r, sizeof(r)))
@@ -1108,15 +1115,15 @@
if (copy_from_user(&qctrl, argp, sizeof(qctrl)))
return -EFAULT;
- down_read(&ACCESS_FBINFO(altout).lock);
- if (!ACCESS_FBINFO(outputs[1]).output) {
+ down_read(&minfo->altout.lock);
+ if (!minfo->outputs[1].output) {
err = -ENXIO;
- } else if (ACCESS_FBINFO(outputs[1]).output->getqueryctrl) {
- err = ACCESS_FBINFO(outputs[1]).output->getqueryctrl(ACCESS_FBINFO(outputs[1]).data, &qctrl);
+ } else if (minfo->outputs[1].output->getqueryctrl) {
+ err = minfo->outputs[1].output->getqueryctrl(minfo->outputs[1].data, &qctrl);
} else {
err = -EINVAL;
}
- up_read(&ACCESS_FBINFO(altout).lock);
+ up_read(&minfo->altout.lock);
if (err >= 0 &&
copy_to_user(argp, &qctrl, sizeof(qctrl)))
return -EFAULT;
@@ -1130,15 +1137,15 @@
if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
return -EFAULT;
- down_read(&ACCESS_FBINFO(altout).lock);
- if (!ACCESS_FBINFO(outputs[1]).output) {
+ down_read(&minfo->altout.lock);
+ if (!minfo->outputs[1].output) {
err = -ENXIO;
- } else if (ACCESS_FBINFO(outputs[1]).output->getctrl) {
- err = ACCESS_FBINFO(outputs[1]).output->getctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+ } else if (minfo->outputs[1].output->getctrl) {
+ err = minfo->outputs[1].output->getctrl(minfo->outputs[1].data, &ctrl);
} else {
err = -EINVAL;
}
- up_read(&ACCESS_FBINFO(altout).lock);
+ up_read(&minfo->altout.lock);
if (err >= 0 &&
copy_to_user(argp, &ctrl, sizeof(ctrl)))
return -EFAULT;
@@ -1153,15 +1160,15 @@
if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
return -EFAULT;
- down_read(&ACCESS_FBINFO(altout).lock);
- if (!ACCESS_FBINFO(outputs[1]).output) {
+ down_read(&minfo->altout.lock);
+ if (!minfo->outputs[1].output) {
err = -ENXIO;
- } else if (ACCESS_FBINFO(outputs[1]).output->setctrl) {
- err = ACCESS_FBINFO(outputs[1]).output->setctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+ } else if (minfo->outputs[1].output->setctrl) {
+ err = minfo->outputs[1].output->setctrl(minfo->outputs[1].data, &ctrl);
} else {
err = -EINVAL;
}
- up_read(&ACCESS_FBINFO(altout).lock);
+ up_read(&minfo->altout.lock);
return err;
}
}
@@ -1175,11 +1182,11 @@
int seq;
int crtc;
CRITFLAGS
- MINFO_FROM_INFO(info);
+ struct matrox_fb_info *minfo = info2minfo(info);
DBG(__func__)
- if (ACCESS_FBINFO(dead))
+ if (minfo->dead)
return 1;
switch (blank) {
@@ -1281,7 +1288,9 @@
static char videomode[64]; /* "matrox:mode:xxxxx" or "matrox:xxxxx" */
#endif
-static int matroxfb_getmemory(WPMINFO unsigned int maxSize, unsigned int *realSize){
+static int matroxfb_getmemory(struct matrox_fb_info *minfo,
+ unsigned int maxSize, unsigned int *realSize)
+{
vaddr_t vm;
unsigned int offs;
unsigned int offs2;
@@ -1291,7 +1300,7 @@
DBG(__func__)
- vm = ACCESS_FBINFO(video.vbase);
+ vm = minfo->video.vbase;
maxSize &= ~0x1FFFFF; /* must be X*2MB (really it must be 2 or X*4MB) */
/* at least 2MB */
if (maxSize < 0x0200000) return 0;
@@ -1323,7 +1332,7 @@
*realSize = offs - 0x100000;
#ifdef CONFIG_FB_MATROX_MILLENIUM
- ACCESS_FBINFO(interleave) = !(!isMillenium(MINFO) || ((offs - 0x100000) & 0x3FFFFF));
+ minfo->interleave = !(!isMillenium(minfo) || ((offs - 0x100000) & 0x3FFFFF));
#endif
return 1;
}
@@ -1345,13 +1354,9 @@
#ifdef CONFIG_FB_MATROX_G
static struct video_board vbG100 = {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGAG100, &matrox_G100};
static struct video_board vbG200 = {0x1000000, 0x1000000, FB_ACCEL_MATROX_MGAG200, &matrox_G100};
-#ifdef CONFIG_FB_MATROX_32MB
/* from doc it looks like that accelerator can draw only to low 16MB :-( Direct accesses & displaying are OK for
whole 32MB */
static struct video_board vbG400 = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400, &matrox_G100};
-#else
-static struct video_board vbG400 = {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400, &matrox_G100};
-#endif
#endif
#define DEVF_VIDEO64BIT 0x0001
@@ -1558,16 +1563,17 @@
static int hotplug = 0;
-static void setDefaultOutputs(WPMINFO2) {
+static void setDefaultOutputs(struct matrox_fb_info *minfo)
+{
unsigned int i;
const char* ptr;
- ACCESS_FBINFO(outputs[0]).default_src = MATROXFB_SRC_CRTC1;
- if (ACCESS_FBINFO(devflags.g450dac)) {
- ACCESS_FBINFO(outputs[1]).default_src = MATROXFB_SRC_CRTC1;
- ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+ minfo->outputs[0].default_src = MATROXFB_SRC_CRTC1;
+ if (minfo->devflags.g450dac) {
+ minfo->outputs[1].default_src = MATROXFB_SRC_CRTC1;
+ minfo->outputs[2].default_src = MATROXFB_SRC_CRTC1;
} else if (dfp) {
- ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+ minfo->outputs[2].default_src = MATROXFB_SRC_CRTC1;
}
ptr = outputs;
for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
@@ -1577,11 +1583,11 @@
break;
}
if (c == '0') {
- ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_NONE;
+ minfo->outputs[i].default_src = MATROXFB_SRC_NONE;
} else if (c == '1') {
- ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC1;
- } else if (c == '2' && ACCESS_FBINFO(devflags.crtc2)) {
- ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC2;
+ minfo->outputs[i].default_src = MATROXFB_SRC_CRTC1;
+ } else if (c == '2' && minfo->devflags.crtc2) {
+ minfo->outputs[i].default_src = MATROXFB_SRC_CRTC2;
} else {
printk(KERN_ERR "matroxfb: Unknown outputs setting\n");
break;
@@ -1591,7 +1597,8 @@
outputs[0] = 0;
}
-static int initMatrox2(WPMINFO struct board* b){
+static int initMatrox2(struct matrox_fb_info *minfo, struct board *b)
+{
unsigned long ctrlptr_phys = 0;
unsigned long video_base_phys = 0;
unsigned int memsize;
@@ -1607,58 +1614,56 @@
/* set default values... */
vesafb_defined.accel_flags = FB_ACCELF_TEXT;
- ACCESS_FBINFO(hw_switch) = b->base->lowlevel;
- ACCESS_FBINFO(devflags.accelerator) = b->base->accelID;
- ACCESS_FBINFO(max_pixel_clock) = b->maxclk;
+ minfo->hw_switch = b->base->lowlevel;
+ minfo->devflags.accelerator = b->base->accelID;
+ minfo->max_pixel_clock = b->maxclk;
printk(KERN_INFO "matroxfb: Matrox %s detected\n", b->name);
- ACCESS_FBINFO(capable.plnwt) = 1;
- ACCESS_FBINFO(chip) = b->chip;
- ACCESS_FBINFO(capable.srcorg) = b->flags & DEVF_SRCORG;
- ACCESS_FBINFO(devflags.video64bits) = b->flags & DEVF_VIDEO64BIT;
+ minfo->capable.plnwt = 1;
+ minfo->chip = b->chip;
+ minfo->capable.srcorg = b->flags & DEVF_SRCORG;
+ minfo->devflags.video64bits = b->flags & DEVF_VIDEO64BIT;
if (b->flags & DEVF_TEXT4B) {
- ACCESS_FBINFO(devflags.vgastep) = 4;
- ACCESS_FBINFO(devflags.textmode) = 4;
- ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+ minfo->devflags.vgastep = 4;
+ minfo->devflags.textmode = 4;
+ minfo->devflags.text_type_aux = FB_AUX_TEXT_MGA_STEP16;
} else if (b->flags & DEVF_TEXT16B) {
- ACCESS_FBINFO(devflags.vgastep) = 16;
- ACCESS_FBINFO(devflags.textmode) = 1;
- ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+ minfo->devflags.vgastep = 16;
+ minfo->devflags.textmode = 1;
+ minfo->devflags.text_type_aux = FB_AUX_TEXT_MGA_STEP16;
} else {
- ACCESS_FBINFO(devflags.vgastep) = 8;
- ACCESS_FBINFO(devflags.textmode) = 1;
- ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP8;
+ minfo->devflags.vgastep = 8;
+ minfo->devflags.textmode = 1;
+ minfo->devflags.text_type_aux = FB_AUX_TEXT_MGA_STEP8;
}
-#ifdef CONFIG_FB_MATROX_32MB
- ACCESS_FBINFO(devflags.support32MB) = (b->flags & DEVF_SUPPORT32MB) != 0;
-#endif
- ACCESS_FBINFO(devflags.precise_width) = !(b->flags & DEVF_ANY_VXRES);
- ACCESS_FBINFO(devflags.crtc2) = (b->flags & DEVF_CRTC2) != 0;
- ACCESS_FBINFO(devflags.maven_capable) = (b->flags & DEVF_MAVEN_CAPABLE) != 0;
- ACCESS_FBINFO(devflags.dualhead) = (b->flags & DEVF_DUALHEAD) != 0;
- ACCESS_FBINFO(devflags.dfp_type) = dfp_type;
- ACCESS_FBINFO(devflags.g450dac) = (b->flags & DEVF_G450DAC) != 0;
- ACCESS_FBINFO(devflags.textstep) = ACCESS_FBINFO(devflags.vgastep) * ACCESS_FBINFO(devflags.textmode);
- ACCESS_FBINFO(devflags.textvram) = 65536 / ACCESS_FBINFO(devflags.textmode);
- setDefaultOutputs(PMINFO2);
+ minfo->devflags.support32MB = (b->flags & DEVF_SUPPORT32MB) != 0;
+ minfo->devflags.precise_width = !(b->flags & DEVF_ANY_VXRES);
+ minfo->devflags.crtc2 = (b->flags & DEVF_CRTC2) != 0;
+ minfo->devflags.maven_capable = (b->flags & DEVF_MAVEN_CAPABLE) != 0;
+ minfo->devflags.dualhead = (b->flags & DEVF_DUALHEAD) != 0;
+ minfo->devflags.dfp_type = dfp_type;
+ minfo->devflags.g450dac = (b->flags & DEVF_G450DAC) != 0;
+ minfo->devflags.textstep = minfo->devflags.vgastep * minfo->devflags.textmode;
+ minfo->devflags.textvram = 65536 / minfo->devflags.textmode;
+ setDefaultOutputs(minfo);
if (b->flags & DEVF_PANELLINK_CAPABLE) {
- ACCESS_FBINFO(outputs[2]).data = MINFO;
- ACCESS_FBINFO(outputs[2]).output = &panellink_output;
- ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
- ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
- ACCESS_FBINFO(devflags.panellink) = 1;
+ minfo->outputs[2].data = minfo;
+ minfo->outputs[2].output = &panellink_output;
+ minfo->outputs[2].src = minfo->outputs[2].default_src;
+ minfo->outputs[2].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ minfo->devflags.panellink = 1;
}
- if (ACCESS_FBINFO(capable.cross4MB) < 0)
- ACCESS_FBINFO(capable.cross4MB) = b->flags & DEVF_CROSS4MB;
+ if (minfo->capable.cross4MB < 0)
+ minfo->capable.cross4MB = b->flags & DEVF_CROSS4MB;
if (b->flags & DEVF_SWAPS) {
- ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
- video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
- ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_0;
+ ctrlptr_phys = pci_resource_start(minfo->pcidev, 1);
+ video_base_phys = pci_resource_start(minfo->pcidev, 0);
+ minfo->devflags.fbResource = PCI_BASE_ADDRESS_0;
} else {
- ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
- video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
- ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_1;
+ ctrlptr_phys = pci_resource_start(minfo->pcidev, 0);
+ video_base_phys = pci_resource_start(minfo->pcidev, 1);
+ minfo->devflags.fbResource = PCI_BASE_ADDRESS_1;
}
err = -EINVAL;
if (!ctrlptr_phys) {
@@ -1676,7 +1681,7 @@
if (!request_mem_region(video_base_phys, memsize, "matroxfb FB")) {
goto failCtrlMR;
}
- ACCESS_FBINFO(video.len_maximum) = memsize;
+ minfo->video.len_maximum = memsize;
/* convert mem (autodetect k, M) */
if (mem < 1024) mem *= 1024;
if (mem < 0x00100000) mem *= 1024;
@@ -1684,14 +1689,14 @@
if (mem && (mem < memsize))
memsize = mem;
err = -ENOMEM;
- if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &ACCESS_FBINFO(mmio.vbase))) {
+ if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &minfo->mmio.vbase)) {
printk(KERN_ERR "matroxfb: cannot ioremap(%lX, 16384), matroxfb disabled\n", ctrlptr_phys);
goto failVideoMR;
}
- ACCESS_FBINFO(mmio.base) = ctrlptr_phys;
- ACCESS_FBINFO(mmio.len) = 16384;
- ACCESS_FBINFO(video.base) = video_base_phys;
- if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &ACCESS_FBINFO(video.vbase))) {
+ minfo->mmio.base = ctrlptr_phys;
+ minfo->mmio.len = 16384;
+ minfo->video.base = video_base_phys;
+ if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &minfo->video.vbase)) {
printk(KERN_ERR "matroxfb: cannot ioremap(%lX, %d), matroxfb disabled\n",
video_base_phys, memsize);
goto failCtrlIO;
@@ -1700,63 +1705,63 @@
u_int32_t cmd;
u_int32_t mga_option;
- pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &mga_option);
- pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, &cmd);
+ pci_read_config_dword(minfo->pcidev, PCI_OPTION_REG, &mga_option);
+ pci_read_config_dword(minfo->pcidev, PCI_COMMAND, &cmd);
mga_option &= 0x7FFFFFFF; /* clear BIG_ENDIAN */
mga_option |= MX_OPTION_BSWAP;
/* disable palette snooping */
cmd &= ~PCI_COMMAND_VGA_PALETTE;
if (pci_dev_present(intel_82437)) {
- if (!(mga_option & 0x20000000) && !ACCESS_FBINFO(devflags.nopciretry)) {
+ if (!(mga_option & 0x20000000) && !minfo->devflags.nopciretry) {
printk(KERN_WARNING "matroxfb: Disabling PCI retries due to i82437 present\n");
}
mga_option |= 0x20000000;
- ACCESS_FBINFO(devflags.nopciretry) = 1;
+ minfo->devflags.nopciretry = 1;
}
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, cmd);
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mga_option);
- ACCESS_FBINFO(hw).MXoptionReg = mga_option;
+ pci_write_config_dword(minfo->pcidev, PCI_COMMAND, cmd);
+ pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mga_option);
+ minfo->hw.MXoptionReg = mga_option;
/* select non-DMA memory for PCI_MGA_DATA, otherwise dump of PCI cfg space can lock PCI bus */
/* maybe preinit() candidate, but it is same... for all devices... at this time... */
- pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MGA_INDEX, 0x00003C00);
+ pci_write_config_dword(minfo->pcidev, PCI_MGA_INDEX, 0x00003C00);
}
err = -ENXIO;
- matroxfb_read_pins(PMINFO2);
- if (ACCESS_FBINFO(hw_switch)->preinit(PMINFO2)) {
+ matroxfb_read_pins(minfo);
+ if (minfo->hw_switch->preinit(minfo)) {
goto failVideoIO;
}
err = -ENOMEM;
- if (!matroxfb_getmemory(PMINFO memsize, &ACCESS_FBINFO(video.len)) || !ACCESS_FBINFO(video.len)) {
+ if (!matroxfb_getmemory(minfo, memsize, &minfo->video.len) || !minfo->video.len) {
printk(KERN_ERR "matroxfb: cannot determine memory size\n");
goto failVideoIO;
}
- ACCESS_FBINFO(devflags.ydstorg) = 0;
+ minfo->devflags.ydstorg = 0;
- ACCESS_FBINFO(video.base) = video_base_phys;
- ACCESS_FBINFO(video.len_usable) = ACCESS_FBINFO(video.len);
- if (ACCESS_FBINFO(video.len_usable) > b->base->maxdisplayable)
- ACCESS_FBINFO(video.len_usable) = b->base->maxdisplayable;
+ minfo->video.base = video_base_phys;
+ minfo->video.len_usable = minfo->video.len;
+ if (minfo->video.len_usable > b->base->maxdisplayable)
+ minfo->video.len_usable = b->base->maxdisplayable;
#ifdef CONFIG_MTRR
if (mtrr) {
- ACCESS_FBINFO(mtrr.vram) = mtrr_add(video_base_phys, ACCESS_FBINFO(video.len), MTRR_TYPE_WRCOMB, 1);
- ACCESS_FBINFO(mtrr.vram_valid) = 1;
+ minfo->mtrr.vram = mtrr_add(video_base_phys, minfo->video.len, MTRR_TYPE_WRCOMB, 1);
+ minfo->mtrr.vram_valid = 1;
printk(KERN_INFO "matroxfb: MTRR's turned on\n");
}
#endif /* CONFIG_MTRR */
- if (!ACCESS_FBINFO(devflags.novga))
+ if (!minfo->devflags.novga)
request_region(0x3C0, 32, "matrox");
- matroxfb_g450_connect(PMINFO2);
- ACCESS_FBINFO(hw_switch->reset(PMINFO2));
+ matroxfb_g450_connect(minfo);
+ minfo->hw_switch->reset(minfo);
- ACCESS_FBINFO(fbcon.monspecs.hfmin) = 0;
- ACCESS_FBINFO(fbcon.monspecs.hfmax) = fh;
- ACCESS_FBINFO(fbcon.monspecs.vfmin) = 0;
- ACCESS_FBINFO(fbcon.monspecs.vfmax) = fv;
- ACCESS_FBINFO(fbcon.monspecs.dpms) = 0; /* TBD */
+ minfo->fbcon.monspecs.hfmin = 0;
+ minfo->fbcon.monspecs.hfmax = fh;
+ minfo->fbcon.monspecs.vfmin = 0;
+ minfo->fbcon.monspecs.vfmax = fv;
+ minfo->fbcon.monspecs.dpms = 0; /* TBD */
/* static settings */
vesafb_defined.red = colors[depth-1].red;
@@ -1768,24 +1773,24 @@
if (noaccel)
vesafb_defined.accel_flags &= ~FB_ACCELF_TEXT;
- ACCESS_FBINFO(fbops) = matroxfb_ops;
- ACCESS_FBINFO(fbcon.fbops) = &ACCESS_FBINFO(fbops);
- ACCESS_FBINFO(fbcon.pseudo_palette) = ACCESS_FBINFO(cmap);
+ minfo->fbops = matroxfb_ops;
+ minfo->fbcon.fbops = &minfo->fbops;
+ minfo->fbcon.pseudo_palette = minfo->cmap;
/* after __init time we are like module... no logo */
- ACCESS_FBINFO(fbcon.flags) = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT;
- ACCESS_FBINFO(fbcon.flags) |= FBINFO_PARTIAL_PAN_OK | /* Prefer panning for scroll under MC viewer/edit */
+ minfo->fbcon.flags = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT;
+ minfo->fbcon.flags |= FBINFO_PARTIAL_PAN_OK | /* Prefer panning for scroll under MC viewer/edit */
FBINFO_HWACCEL_COPYAREA | /* We have hw-assisted bmove */
FBINFO_HWACCEL_FILLRECT | /* And fillrect */
FBINFO_HWACCEL_IMAGEBLIT | /* And imageblit */
FBINFO_HWACCEL_XPAN | /* And we support both horizontal */
FBINFO_HWACCEL_YPAN; /* And vertical panning */
- ACCESS_FBINFO(video.len_usable) &= PAGE_MASK;
- fb_alloc_cmap(&ACCESS_FBINFO(fbcon.cmap), 256, 1);
+ minfo->video.len_usable &= PAGE_MASK;
+ fb_alloc_cmap(&minfo->fbcon.cmap, 256, 1);
#ifndef MODULE
/* mode database is marked __init!!! */
if (!hotplug) {
- fb_find_mode(&vesafb_defined, &ACCESS_FBINFO(fbcon), videomode[0]?videomode:NULL,
+ fb_find_mode(&vesafb_defined, &minfo->fbcon, videomode[0] ? videomode : NULL,
NULL, 0, &defaultmode, vesafb_defined.bits_per_pixel);
}
#endif /* !MODULE */
@@ -1874,52 +1879,52 @@
vesafb_defined.yres_virtual = 65536; /* large enough to be INF, but small enough
to yres_virtual * xres_virtual < 2^32 */
}
- matroxfb_init_fix(PMINFO2);
- ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase));
+ matroxfb_init_fix(minfo);
+ minfo->fbcon.screen_base = vaddr_va(minfo->video.vbase);
/* Normalize values (namely yres_virtual) */
- matroxfb_check_var(&vesafb_defined, &ACCESS_FBINFO(fbcon));
+ matroxfb_check_var(&vesafb_defined, &minfo->fbcon);
/* And put it into "current" var. Do NOT program hardware yet, or we'll not take over
* vgacon correctly. fbcon_startup will call fb_set_par for us, WITHOUT check_var,
* and unfortunately it will do it BEFORE vgacon contents is saved, so it won't work
* anyway. But we at least tried... */
- ACCESS_FBINFO(fbcon.var) = vesafb_defined;
+ minfo->fbcon.var = vesafb_defined;
err = -EINVAL;
printk(KERN_INFO "matroxfb: %dx%dx%dbpp (virtual: %dx%d)\n",
vesafb_defined.xres, vesafb_defined.yres, vesafb_defined.bits_per_pixel,
vesafb_defined.xres_virtual, vesafb_defined.yres_virtual);
printk(KERN_INFO "matroxfb: framebuffer at 0x%lX, mapped to 0x%p, size %d\n",
- ACCESS_FBINFO(video.base), vaddr_va(ACCESS_FBINFO(video.vbase)), ACCESS_FBINFO(video.len));
+ minfo->video.base, vaddr_va(minfo->video.vbase), minfo->video.len);
/* We do not have to set currcon to 0... register_framebuffer do it for us on first console
* and we do not want currcon == 0 for subsequent framebuffers */
- ACCESS_FBINFO(fbcon).device = &ACCESS_FBINFO(pcidev)->dev;
- if (register_framebuffer(&ACCESS_FBINFO(fbcon)) < 0) {
+ minfo->fbcon.device = &minfo->pcidev->dev;
+ if (register_framebuffer(&minfo->fbcon) < 0) {
goto failVideoIO;
}
printk("fb%d: %s frame buffer device\n",
- ACCESS_FBINFO(fbcon.node), ACCESS_FBINFO(fbcon.fix.id));
+ minfo->fbcon.node, minfo->fbcon.fix.id);
/* there is no console on this fb... but we have to initialize hardware
* until someone tells me what is proper thing to do */
- if (!ACCESS_FBINFO(initialized)) {
+ if (!minfo->initialized) {
printk(KERN_INFO "fb%d: initializing hardware\n",
- ACCESS_FBINFO(fbcon.node));
+ minfo->fbcon.node);
/* We have to use FB_ACTIVATE_FORCE, as we had to put vesafb_defined to the fbcon.var
* already before, so register_framebuffer works correctly. */
vesafb_defined.activate |= FB_ACTIVATE_FORCE;
- fb_set_var(&ACCESS_FBINFO(fbcon), &vesafb_defined);
+ fb_set_var(&minfo->fbcon, &vesafb_defined);
}
return 0;
failVideoIO:;
- matroxfb_g450_shutdown(PMINFO2);
- mga_iounmap(ACCESS_FBINFO(video.vbase));
+ matroxfb_g450_shutdown(minfo);
+ mga_iounmap(minfo->video.vbase);
failCtrlIO:;
- mga_iounmap(ACCESS_FBINFO(mmio.vbase));
+ mga_iounmap(minfo->mmio.vbase);
failVideoMR:;
- release_mem_region(video_base_phys, ACCESS_FBINFO(video.len_maximum));
+ release_mem_region(video_base_phys, minfo->video.len_maximum);
failCtrlMR:;
release_mem_region(ctrlptr_phys, 16384);
fail:;
@@ -1975,7 +1980,7 @@
static void matroxfb_register_device(struct matrox_fb_info* minfo) {
struct matroxfb_driver* drv;
int i = 0;
- list_add(&ACCESS_FBINFO(next_fb), &matroxfb_list);
+ list_add(&minfo->next_fb, &matroxfb_list);
for (drv = matroxfb_driver_l(matroxfb_driver_list.next);
drv != matroxfb_driver_l(&matroxfb_driver_list);
drv = matroxfb_driver_l(drv->node.next)) {
@@ -1995,7 +2000,7 @@
static void matroxfb_unregister_device(struct matrox_fb_info* minfo) {
int i;
- list_del(&ACCESS_FBINFO(next_fb));
+ list_del(&minfo->next_fb);
for (i = 0; i < minfo->drivers_count; i++) {
struct matroxfb_driver* drv = minfo->drivers[i];
@@ -2011,9 +2016,6 @@
struct matrox_fb_info* minfo;
int err;
u_int32_t cmd;
-#ifndef CONFIG_FB_MATROX_MULTIHEAD
- static int registered = 0;
-#endif
DBG(__func__)
svid = pdev->subsystem_vendor;
@@ -2037,68 +2039,57 @@
return -1;
}
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
minfo = kmalloc(sizeof(*minfo), GFP_KERNEL);
if (!minfo)
return -1;
-#else
- if (registered) /* singlehead driver... */
- return -1;
- minfo = &matroxfb_global_mxinfo;
-#endif
- memset(MINFO, 0, sizeof(*MINFO));
+ memset(minfo, 0, sizeof(*minfo));
- ACCESS_FBINFO(pcidev) = pdev;
- ACCESS_FBINFO(dead) = 0;
- ACCESS_FBINFO(usecount) = 0;
- ACCESS_FBINFO(userusecount) = 0;
+ minfo->pcidev = pdev;
+ minfo->dead = 0;
+ minfo->usecount = 0;
+ minfo->userusecount = 0;
- pci_set_drvdata(pdev, MINFO);
+ pci_set_drvdata(pdev, minfo);
/* DEVFLAGS */
- ACCESS_FBINFO(devflags.memtype) = memtype;
+ minfo->devflags.memtype = memtype;
if (memtype != -1)
noinit = 0;
if (cmd & PCI_COMMAND_MEMORY) {
- ACCESS_FBINFO(devflags.novga) = novga;
- ACCESS_FBINFO(devflags.nobios) = nobios;
- ACCESS_FBINFO(devflags.noinit) = noinit;
+ minfo->devflags.novga = novga;
+ minfo->devflags.nobios = nobios;
+ minfo->devflags.noinit = noinit;
/* subsequent heads always needs initialization and must not enable BIOS */
novga = 1;
nobios = 1;
noinit = 0;
} else {
- ACCESS_FBINFO(devflags.novga) = 1;
- ACCESS_FBINFO(devflags.nobios) = 1;
- ACCESS_FBINFO(devflags.noinit) = 0;
+ minfo->devflags.novga = 1;
+ minfo->devflags.nobios = 1;
+ minfo->devflags.noinit = 0;
}
- ACCESS_FBINFO(devflags.nopciretry) = no_pci_retry;
- ACCESS_FBINFO(devflags.mga_24bpp_fix) = inv24;
- ACCESS_FBINFO(devflags.precise_width) = option_precise_width;
- ACCESS_FBINFO(devflags.sgram) = sgram;
- ACCESS_FBINFO(capable.cross4MB) = cross4MB;
+ minfo->devflags.nopciretry = no_pci_retry;
+ minfo->devflags.mga_24bpp_fix = inv24;
+ minfo->devflags.precise_width = option_precise_width;
+ minfo->devflags.sgram = sgram;
+ minfo->capable.cross4MB = cross4MB;
- spin_lock_init(&ACCESS_FBINFO(lock.DAC));
- spin_lock_init(&ACCESS_FBINFO(lock.accel));
- init_rwsem(&ACCESS_FBINFO(crtc2.lock));
- init_rwsem(&ACCESS_FBINFO(altout.lock));
- mutex_init(&ACCESS_FBINFO(fbcon).mm_lock);
- ACCESS_FBINFO(irq_flags) = 0;
- init_waitqueue_head(&ACCESS_FBINFO(crtc1.vsync.wait));
- init_waitqueue_head(&ACCESS_FBINFO(crtc2.vsync.wait));
- ACCESS_FBINFO(crtc1.panpos) = -1;
+ spin_lock_init(&minfo->lock.DAC);
+ spin_lock_init(&minfo->lock.accel);
+ init_rwsem(&minfo->crtc2.lock);
+ init_rwsem(&minfo->altout.lock);
+ mutex_init(&minfo->fbcon.mm_lock);
+ minfo->irq_flags = 0;
+ init_waitqueue_head(&minfo->crtc1.vsync.wait);
+ init_waitqueue_head(&minfo->crtc2.vsync.wait);
+ minfo->crtc1.panpos = -1;
- err = initMatrox2(PMINFO b);
+ err = initMatrox2(minfo, b);
if (!err) {
-#ifndef CONFIG_FB_MATROX_MULTIHEAD
- registered = 1;
-#endif
- matroxfb_register_device(MINFO);
+ matroxfb_register_device(minfo);
return 0;
}
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
kfree(minfo);
-#endif
return -1;
}
@@ -2106,7 +2097,7 @@
struct matrox_fb_info* minfo;
minfo = pci_get_drvdata(pdev);
- matroxfb_remove(PMINFO 1);
+ matroxfb_remove(minfo, 1);
}
static struct pci_device_id matroxfb_devices[] = {
@@ -2510,13 +2501,8 @@
MODULE_PARM_DESC(inv24, "Inverts clock polarity for 24bpp and loop frequency > 100MHz (default=do not invert polarity)");
module_param(inverse, int, 0);
MODULE_PARM_DESC(inverse, "Inverse (0 or 1) (default=0)");
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
module_param(dev, int, 0);
MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=all working)");
-#else
-module_param(dev, int, 0);
-MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=first working)");
-#endif
module_param(vesa, int, 0);
MODULE_PARM_DESC(vesa, "Startup videomode (0x000-0x1FF) (default=0x101)");
module_param(xres, int, 0);
diff --git a/drivers/video/matrox/matroxfb_base.h b/drivers/video/matrox/matroxfb_base.h
index 9588323..f3a4e15 100644
--- a/drivers/video/matrox/matroxfb_base.h
+++ b/drivers/video/matrox/matroxfb_base.h
@@ -54,9 +54,6 @@
#include "../macmodes.h"
#endif
-/* always compile support for 32MB... It cost almost nothing */
-#define CONFIG_FB_MATROX_32MB
-
#ifdef MATROXFB_DEBUG
#define DEBUG
@@ -464,9 +461,7 @@
int nopciretry;
int noinit;
int sgram;
-#ifdef CONFIG_FB_MATROX_32MB
int support32MB;
-#endif
int accelerator;
int text_type_aux;
@@ -524,47 +519,11 @@
#define info2minfo(info) container_of(info, struct matrox_fb_info, fbcon)
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
-#define ACCESS_FBINFO2(info, x) (info->x)
-#define ACCESS_FBINFO(x) ACCESS_FBINFO2(minfo,x)
-
-#define MINFO minfo
-
-#define WPMINFO2 struct matrox_fb_info* minfo
-#define WPMINFO WPMINFO2 ,
-#define CPMINFO2 const struct matrox_fb_info* minfo
-#define CPMINFO CPMINFO2 ,
-#define PMINFO2 minfo
-#define PMINFO PMINFO2 ,
-
-#define MINFO_FROM(x) struct matrox_fb_info* minfo = x
-#else
-
-extern struct matrox_fb_info matroxfb_global_mxinfo;
-
-#define ACCESS_FBINFO(x) (matroxfb_global_mxinfo.x)
-#define ACCESS_FBINFO2(info, x) (matroxfb_global_mxinfo.x)
-
-#define MINFO (&matroxfb_global_mxinfo)
-
-#define WPMINFO2 void
-#define WPMINFO
-#define CPMINFO2 void
-#define CPMINFO
-#define PMINFO2
-#define PMINFO
-
-#define MINFO_FROM(x)
-
-#endif
-
-#define MINFO_FROM_INFO(x) MINFO_FROM(info2minfo(x))
-
struct matrox_switch {
- int (*preinit)(WPMINFO2);
- void (*reset)(WPMINFO2);
- int (*init)(WPMINFO struct my_timming*);
- void (*restore)(WPMINFO2);
+ int (*preinit)(struct matrox_fb_info *minfo);
+ void (*reset)(struct matrox_fb_info *minfo);
+ int (*init)(struct matrox_fb_info *minfo, struct my_timming*);
+ void (*restore)(struct matrox_fb_info *minfo);
};
struct matroxfb_driver {
@@ -727,11 +686,11 @@
#endif
#endif
-#define mga_inb(addr) mga_readb(ACCESS_FBINFO(mmio.vbase), (addr))
-#define mga_inl(addr) mga_readl(ACCESS_FBINFO(mmio.vbase), (addr))
-#define mga_outb(addr,val) mga_writeb(ACCESS_FBINFO(mmio.vbase), (addr), (val))
-#define mga_outw(addr,val) mga_writew(ACCESS_FBINFO(mmio.vbase), (addr), (val))
-#define mga_outl(addr,val) mga_writel(ACCESS_FBINFO(mmio.vbase), (addr), (val))
+#define mga_inb(addr) mga_readb(minfo->mmio.vbase, (addr))
+#define mga_inl(addr) mga_readl(minfo->mmio.vbase, (addr))
+#define mga_outb(addr,val) mga_writeb(minfo->mmio.vbase, (addr), (val))
+#define mga_outw(addr,val) mga_writew(minfo->mmio.vbase, (addr), (val))
+#define mga_outl(addr,val) mga_writel(minfo->mmio.vbase, (addr), (val))
#define mga_readr(port,idx) (mga_outb((port),(idx)), mga_inb((port)+1))
#define mga_setr(addr,port,val) mga_outw(addr, ((val)<<8) | (port))
@@ -750,19 +709,20 @@
#define isMilleniumII(x) (0)
#endif
-#define matroxfb_DAC_lock() spin_lock(&ACCESS_FBINFO(lock.DAC))
-#define matroxfb_DAC_unlock() spin_unlock(&ACCESS_FBINFO(lock.DAC))
-#define matroxfb_DAC_lock_irqsave(flags) spin_lock_irqsave(&ACCESS_FBINFO(lock.DAC),flags)
-#define matroxfb_DAC_unlock_irqrestore(flags) spin_unlock_irqrestore(&ACCESS_FBINFO(lock.DAC),flags)
-extern void matroxfb_DAC_out(CPMINFO int reg, int val);
-extern int matroxfb_DAC_in(CPMINFO int reg);
+#define matroxfb_DAC_lock() spin_lock(&minfo->lock.DAC)
+#define matroxfb_DAC_unlock() spin_unlock(&minfo->lock.DAC)
+#define matroxfb_DAC_lock_irqsave(flags) spin_lock_irqsave(&minfo->lock.DAC, flags)
+#define matroxfb_DAC_unlock_irqrestore(flags) spin_unlock_irqrestore(&minfo->lock.DAC, flags)
+extern void matroxfb_DAC_out(const struct matrox_fb_info *minfo, int reg,
+ int val);
+extern int matroxfb_DAC_in(const struct matrox_fb_info *minfo, int reg);
extern void matroxfb_var2my(struct fb_var_screeninfo* fvsi, struct my_timming* mt);
-extern int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc);
-extern int matroxfb_enable_irq(WPMINFO int reenable);
+extern int matroxfb_wait_for_sync(struct matrox_fb_info *minfo, u_int32_t crtc);
+extern int matroxfb_enable_irq(struct matrox_fb_info *minfo, int reenable);
#ifdef MATROXFB_USE_SPINLOCKS
-#define CRITBEGIN spin_lock_irqsave(&ACCESS_FBINFO(lock.accel), critflags);
-#define CRITEND spin_unlock_irqrestore(&ACCESS_FBINFO(lock.accel), critflags);
+#define CRITBEGIN spin_lock_irqsave(&minfo->lock.accel, critflags);
+#define CRITEND spin_unlock_irqrestore(&minfo->lock.accel, critflags);
#define CRITFLAGS unsigned long critflags;
#else
#define CRITBEGIN
diff --git a/drivers/video/matrox/matroxfb_crtc2.c b/drivers/video/matrox/matroxfb_crtc2.c
index ebcb5c6..78414ba 100644
--- a/drivers/video/matrox/matroxfb_crtc2.c
+++ b/drivers/video/matrox/matroxfb_crtc2.c
@@ -65,7 +65,7 @@
unsigned int pos) {
u_int32_t tmp;
u_int32_t datactl;
- MINFO_FROM(m2info->primary_dev);
+ struct matrox_fb_info *minfo = m2info->primary_dev;
switch (mode) {
case 15:
@@ -81,11 +81,11 @@
}
tmp |= 0x00000001; /* enable CRTC2 */
datactl = 0;
- if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
- if (ACCESS_FBINFO(devflags.g450dac)) {
+ if (minfo->outputs[1].src == MATROXFB_SRC_CRTC2) {
+ if (minfo->devflags.g450dac) {
tmp |= 0x00000006; /* source from secondary pixel PLL */
/* no vidrst when in monitor mode */
- if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+ if (minfo->outputs[1].mode != MATROXFB_OUTPUT_MODE_MONITOR) {
tmp |= 0xC0001000; /* Enable H/V vidrst */
}
} else {
@@ -93,11 +93,11 @@
tmp |= 0xC0000000; /* enable vvidrst & hvidrst */
/* MGA TVO is our clock source */
}
- } else if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+ } else if (minfo->outputs[0].src == MATROXFB_SRC_CRTC2) {
tmp |= 0x00000004; /* source from pixclock */
/* PIXPLL is our clock source */
}
- if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+ if (minfo->outputs[0].src == MATROXFB_SRC_CRTC2) {
tmp |= 0x00100000; /* connect CRTC2 to DAC */
}
if (mt->interlaced) {
@@ -146,7 +146,7 @@
}
}
mga_outl(0x3C10, tmp);
- ACCESS_FBINFO(hw).crtc2.ctl = tmp;
+ minfo->hw.crtc2.ctl = tmp;
tmp = mt->VDisplay << 16; /* line compare */
if (mt->sync & FB_SYNC_HOR_HIGH_ACT)
@@ -157,10 +157,10 @@
}
static void matroxfb_dh_disable(struct matroxfb_dh_fb_info* m2info) {
- MINFO_FROM(m2info->primary_dev);
+ struct matrox_fb_info *minfo = m2info->primary_dev;
mga_outl(0x3C10, 0x00000004); /* disable CRTC2, CRTC1->DAC1, PLL as clock source */
- ACCESS_FBINFO(hw).crtc2.ctl = 0x00000004;
+ minfo->hw.crtc2.ctl = 0x00000004;
}
static void matroxfb_dh_pan_var(struct matroxfb_dh_fb_info* m2info,
@@ -168,7 +168,7 @@
unsigned int pos;
unsigned int linelen;
unsigned int pixelsize;
- MINFO_FROM(m2info->primary_dev);
+ struct matrox_fb_info *minfo = m2info->primary_dev;
m2info->fbcon.var.xoffset = var->xoffset;
m2info->fbcon.var.yoffset = var->yoffset;
@@ -260,15 +260,15 @@
static int matroxfb_dh_open(struct fb_info* info, int user) {
#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
- MINFO_FROM(m2info->primary_dev);
+ struct matrox_fb_info *minfo = m2info->primary_dev;
- if (MINFO) {
+ if (minfo) {
int err;
- if (ACCESS_FBINFO(dead)) {
+ if (minfo->dead) {
return -ENXIO;
}
- err = ACCESS_FBINFO(fbops).fb_open(&ACCESS_FBINFO(fbcon), user);
+ err = minfo->fbops.fb_open(&minfo->fbcon, user);
if (err) {
return err;
}
@@ -280,10 +280,10 @@
static int matroxfb_dh_release(struct fb_info* info, int user) {
#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
int err = 0;
- MINFO_FROM(m2info->primary_dev);
+ struct matrox_fb_info *minfo = m2info->primary_dev;
- if (MINFO) {
- err = ACCESS_FBINFO(fbops).fb_release(&ACCESS_FBINFO(fbcon), user);
+ if (minfo) {
+ err = minfo->fbops.fb_release(&minfo->fbcon, user);
}
return err;
#undef m2info
@@ -326,7 +326,7 @@
int mode;
int err;
struct fb_var_screeninfo* var = &info->var;
- MINFO_FROM(m2info->primary_dev);
+ struct matrox_fb_info *minfo = m2info->primary_dev;
if ((err = matroxfb_dh_decode_var(m2info, var, &visual, &cmap_len, &mode)) != 0)
return err;
@@ -352,39 +352,39 @@
pos = (m2info->fbcon.var.yoffset * m2info->fbcon.var.xres_virtual + m2info->fbcon.var.xoffset) * m2info->fbcon.var.bits_per_pixel >> 3;
pos += m2info->video.offbase;
cnt = 0;
- down_read(&ACCESS_FBINFO(altout).lock);
+ down_read(&minfo->altout.lock);
for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
- if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+ if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2) {
cnt++;
- if (ACCESS_FBINFO(outputs[out]).output->compute) {
- ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+ if (minfo->outputs[out].output->compute) {
+ minfo->outputs[out].output->compute(minfo->outputs[out].data, &mt);
}
}
}
- ACCESS_FBINFO(crtc2).pixclock = mt.pixclock;
- ACCESS_FBINFO(crtc2).mnp = mt.mnp;
- up_read(&ACCESS_FBINFO(altout).lock);
+ minfo->crtc2.pixclock = mt.pixclock;
+ minfo->crtc2.mnp = mt.mnp;
+ up_read(&minfo->altout.lock);
if (cnt) {
matroxfb_dh_restore(m2info, &mt, mode, pos);
} else {
matroxfb_dh_disable(m2info);
}
- DAC1064_global_init(PMINFO2);
- DAC1064_global_restore(PMINFO2);
- down_read(&ACCESS_FBINFO(altout).lock);
+ DAC1064_global_init(minfo);
+ DAC1064_global_restore(minfo);
+ down_read(&minfo->altout.lock);
for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
- if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
- ACCESS_FBINFO(outputs[out]).output->program) {
- ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+ if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2 &&
+ minfo->outputs[out].output->program) {
+ minfo->outputs[out].output->program(minfo->outputs[out].data);
}
}
for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
- if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
- ACCESS_FBINFO(outputs[out]).output->start) {
- ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+ if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2 &&
+ minfo->outputs[out].output->start) {
+ minfo->outputs[out].output->start(minfo->outputs[out].data);
}
}
- up_read(&ACCESS_FBINFO(altout).lock);
+ up_read(&minfo->altout.lock);
}
m2info->initialized = 1;
return 0;
@@ -399,9 +399,9 @@
}
static int matroxfb_dh_get_vblank(const struct matroxfb_dh_fb_info* m2info, struct fb_vblank* vblank) {
- MINFO_FROM(m2info->primary_dev);
+ struct matrox_fb_info *minfo = m2info->primary_dev;
- matroxfb_enable_irq(PMINFO 0);
+ matroxfb_enable_irq(minfo, 0);
memset(vblank, 0, sizeof(*vblank));
vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VBLANK;
/* mask out reserved bits + field number (odd/even) */
@@ -409,11 +409,11 @@
/* compatibility stuff */
if (vblank->vcount >= m2info->fbcon.var.yres)
vblank->flags |= FB_VBLANK_VBLANKING;
- if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+ if (test_bit(0, &minfo->irq_flags)) {
vblank->flags |= FB_VBLANK_HAVE_COUNT;
/* Only one writer, aligned int value...
it should work without lock and without atomic_t */
- vblank->count = ACCESS_FBINFO(crtc2).vsync.cnt;
+ vblank->count = minfo->crtc2.vsync.cnt;
}
return 0;
}
@@ -423,7 +423,7 @@
unsigned long arg)
{
#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
- MINFO_FROM(m2info->primary_dev);
+ struct matrox_fb_info *minfo = m2info->primary_dev;
DBG(__func__)
@@ -449,13 +449,13 @@
if (crt != 0)
return -ENODEV;
- return matroxfb_wait_for_sync(PMINFO 1);
+ return matroxfb_wait_for_sync(minfo, 1);
}
case MATROXFB_SET_OUTPUT_MODE:
case MATROXFB_GET_OUTPUT_MODE:
case MATROXFB_GET_ALL_OUTPUTS:
{
- return ACCESS_FBINFO(fbcon.fbops)->fb_ioctl(&ACCESS_FBINFO(fbcon), cmd, arg);
+ return minfo->fbcon.fbops->fb_ioctl(&minfo->fbcon, cmd, arg);
}
case MATROXFB_SET_OUTPUT_CONNECTION:
{
@@ -469,9 +469,9 @@
if (tmp & (1 << out)) {
if (out >= MATROXFB_MAX_OUTPUTS)
return -ENXIO;
- if (!ACCESS_FBINFO(outputs[out]).output)
+ if (!minfo->outputs[out].output)
return -ENXIO;
- switch (ACCESS_FBINFO(outputs[out]).src) {
+ switch (minfo->outputs[out].src) {
case MATROXFB_SRC_NONE:
case MATROXFB_SRC_CRTC2:
break;
@@ -480,22 +480,22 @@
}
}
}
- if (ACCESS_FBINFO(devflags.panellink)) {
+ if (minfo->devflags.panellink) {
if (tmp & MATROXFB_OUTPUT_CONN_DFP)
return -EINVAL;
- if ((ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) && tmp)
+ if ((minfo->outputs[2].src == MATROXFB_SRC_CRTC1) && tmp)
return -EBUSY;
}
changes = 0;
for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
if (tmp & (1 << out)) {
- if (ACCESS_FBINFO(outputs[out]).src != MATROXFB_SRC_CRTC2) {
+ if (minfo->outputs[out].src != MATROXFB_SRC_CRTC2) {
changes = 1;
- ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_CRTC2;
+ minfo->outputs[out].src = MATROXFB_SRC_CRTC2;
}
- } else if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+ } else if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2) {
changes = 1;
- ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_NONE;
+ minfo->outputs[out].src = MATROXFB_SRC_NONE;
}
}
if (!changes)
@@ -509,7 +509,7 @@
int out;
for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
- if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+ if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2) {
conn |= 1 << out;
}
}
@@ -523,8 +523,8 @@
int out;
for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
- if (ACCESS_FBINFO(outputs[out]).output) {
- switch (ACCESS_FBINFO(outputs[out]).src) {
+ if (minfo->outputs[out].output) {
+ switch (minfo->outputs[out].src) {
case MATROXFB_SRC_NONE:
case MATROXFB_SRC_CRTC2:
tmp |= 1 << out;
@@ -532,9 +532,9 @@
}
}
}
- if (ACCESS_FBINFO(devflags.panellink)) {
+ if (minfo->devflags.panellink) {
tmp &= ~MATROXFB_OUTPUT_CONN_DFP;
- if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) {
+ if (minfo->outputs[2].src == MATROXFB_SRC_CRTC1) {
tmp = 0;
}
}
@@ -595,7 +595,9 @@
0, {0,0,0,0,0}
};
-static int matroxfb_dh_regit(CPMINFO struct matroxfb_dh_fb_info* m2info) {
+static int matroxfb_dh_regit(const struct matrox_fb_info *minfo,
+ struct matroxfb_dh_fb_info *m2info)
+{
#define minfo (m2info->primary_dev)
void* oldcrtc2;
@@ -611,21 +613,21 @@
if (mem < 64*1024)
mem *= 1024;
mem &= ~0x00000FFF; /* PAGE_MASK? */
- if (ACCESS_FBINFO(video.len_usable) + mem <= ACCESS_FBINFO(video.len))
- m2info->video.offbase = ACCESS_FBINFO(video.len) - mem;
- else if (ACCESS_FBINFO(video.len) < mem) {
+ if (minfo->video.len_usable + mem <= minfo->video.len)
+ m2info->video.offbase = minfo->video.len - mem;
+ else if (minfo->video.len < mem) {
return -ENOMEM;
} else { /* check yres on first head... */
m2info->video.borrowed = mem;
- ACCESS_FBINFO(video.len_usable) -= mem;
- m2info->video.offbase = ACCESS_FBINFO(video.len_usable);
+ minfo->video.len_usable -= mem;
+ m2info->video.offbase = minfo->video.len_usable;
}
- m2info->video.base = ACCESS_FBINFO(video.base) + m2info->video.offbase;
+ m2info->video.base = minfo->video.base + m2info->video.offbase;
m2info->video.len = m2info->video.len_usable = m2info->video.len_maximum = mem;
- m2info->video.vbase.vaddr = vaddr_va(ACCESS_FBINFO(video.vbase)) + m2info->video.offbase;
- m2info->mmio.base = ACCESS_FBINFO(mmio.base);
- m2info->mmio.vbase = ACCESS_FBINFO(mmio.vbase);
- m2info->mmio.len = ACCESS_FBINFO(mmio.len);
+ m2info->video.vbase.vaddr = vaddr_va(minfo->video.vbase) + m2info->video.offbase;
+ m2info->mmio.base = minfo->mmio.base;
+ m2info->mmio.vbase = minfo->mmio.vbase;
+ m2info->mmio.len = minfo->mmio.len;
matroxfb_dh_init_fix(m2info);
if (register_framebuffer(&m2info->fbcon)) {
@@ -633,10 +635,10 @@
}
if (!m2info->initialized)
fb_set_var(&m2info->fbcon, &matroxfb_dh_defined);
- down_write(&ACCESS_FBINFO(crtc2.lock));
- oldcrtc2 = ACCESS_FBINFO(crtc2.info);
- ACCESS_FBINFO(crtc2.info) = m2info;
- up_write(&ACCESS_FBINFO(crtc2.lock));
+ down_write(&minfo->crtc2.lock);
+ oldcrtc2 = minfo->crtc2.info;
+ minfo->crtc2.info = m2info;
+ up_write(&minfo->crtc2.lock);
if (oldcrtc2) {
printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 already present: %p\n",
oldcrtc2);
@@ -649,12 +651,12 @@
static int matroxfb_dh_registerfb(struct matroxfb_dh_fb_info* m2info) {
#define minfo (m2info->primary_dev)
- if (matroxfb_dh_regit(PMINFO m2info)) {
+ if (matroxfb_dh_regit(minfo, m2info)) {
printk(KERN_ERR "matroxfb_crtc2: secondary head failed to register\n");
return -1;
}
printk(KERN_INFO "matroxfb_crtc2: secondary head of fb%u was registered as fb%u\n",
- ACCESS_FBINFO(fbcon.node), m2info->fbcon.node);
+ minfo->fbcon.node, m2info->fbcon.node);
m2info->fbcon_registered = 1;
return 0;
#undef minfo
@@ -666,11 +668,11 @@
int id;
struct matroxfb_dh_fb_info* crtc2;
- down_write(&ACCESS_FBINFO(crtc2.lock));
- crtc2 = ACCESS_FBINFO(crtc2.info);
+ down_write(&minfo->crtc2.lock);
+ crtc2 = minfo->crtc2.info;
if (crtc2 == m2info)
- ACCESS_FBINFO(crtc2.info) = NULL;
- up_write(&ACCESS_FBINFO(crtc2.lock));
+ minfo->crtc2.info = NULL;
+ up_write(&minfo->crtc2.lock);
if (crtc2 != m2info) {
printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 mismatch at unload: %p != %p\n",
crtc2, m2info);
@@ -680,7 +682,7 @@
id = m2info->fbcon.node;
unregister_framebuffer(&m2info->fbcon);
/* return memory back to primary head */
- ACCESS_FBINFO(video.len_usable) += m2info->video.borrowed;
+ minfo->video.len_usable += m2info->video.borrowed;
printk(KERN_INFO "matroxfb_crtc2: fb%u unregistered\n", id);
m2info->fbcon_registered = 0;
}
@@ -691,14 +693,14 @@
struct matroxfb_dh_fb_info* m2info;
/* hardware is CRTC2 incapable... */
- if (!ACCESS_FBINFO(devflags.crtc2))
+ if (!minfo->devflags.crtc2)
return NULL;
m2info = kzalloc(sizeof(*m2info), GFP_KERNEL);
if (!m2info) {
printk(KERN_ERR "matroxfb_crtc2: Not enough memory for CRTC2 control structs\n");
return NULL;
}
- m2info->primary_dev = MINFO;
+ m2info->primary_dev = minfo;
if (matroxfb_dh_registerfb(m2info)) {
kfree(m2info);
printk(KERN_ERR "matroxfb_crtc2: CRTC2 framebuffer failed to register\n");
diff --git a/drivers/video/matrox/matroxfb_g450.c b/drivers/video/matrox/matroxfb_g450.c
index 6209a76..cff0546 100644
--- a/drivers/video/matrox/matroxfb_g450.c
+++ b/drivers/video/matrox/matroxfb_g450.c
@@ -80,52 +80,59 @@
return -EINVAL;
}
-static inline int* get_ctrl_ptr(WPMINFO unsigned int idx) {
- return (int*)((char*)MINFO + g450_controls[idx].control);
+static inline int *get_ctrl_ptr(struct matrox_fb_info *minfo, unsigned int idx)
+{
+ return (int*)((char*)minfo + g450_controls[idx].control);
}
-static void tvo_fill_defaults(WPMINFO2) {
+static void tvo_fill_defaults(struct matrox_fb_info *minfo)
+{
unsigned int i;
for (i = 0; i < G450CTRLS; i++) {
- *get_ctrl_ptr(PMINFO i) = g450_controls[i].desc.default_value;
+ *get_ctrl_ptr(minfo, i) = g450_controls[i].desc.default_value;
}
}
-static int cve2_get_reg(WPMINFO int reg) {
+static int cve2_get_reg(struct matrox_fb_info *minfo, int reg)
+{
unsigned long flags;
int val;
matroxfb_DAC_lock_irqsave(flags);
- matroxfb_DAC_out(PMINFO 0x87, reg);
- val = matroxfb_DAC_in(PMINFO 0x88);
+ matroxfb_DAC_out(minfo, 0x87, reg);
+ val = matroxfb_DAC_in(minfo, 0x88);
matroxfb_DAC_unlock_irqrestore(flags);
return val;
}
-static void cve2_set_reg(WPMINFO int reg, int val) {
+static void cve2_set_reg(struct matrox_fb_info *minfo, int reg, int val)
+{
unsigned long flags;
matroxfb_DAC_lock_irqsave(flags);
- matroxfb_DAC_out(PMINFO 0x87, reg);
- matroxfb_DAC_out(PMINFO 0x88, val);
+ matroxfb_DAC_out(minfo, 0x87, reg);
+ matroxfb_DAC_out(minfo, 0x88, val);
matroxfb_DAC_unlock_irqrestore(flags);
}
-static void cve2_set_reg10(WPMINFO int reg, int val) {
+static void cve2_set_reg10(struct matrox_fb_info *minfo, int reg, int val)
+{
unsigned long flags;
matroxfb_DAC_lock_irqsave(flags);
- matroxfb_DAC_out(PMINFO 0x87, reg);
- matroxfb_DAC_out(PMINFO 0x88, val >> 2);
- matroxfb_DAC_out(PMINFO 0x87, reg + 1);
- matroxfb_DAC_out(PMINFO 0x88, val & 3);
+ matroxfb_DAC_out(minfo, 0x87, reg);
+ matroxfb_DAC_out(minfo, 0x88, val >> 2);
+ matroxfb_DAC_out(minfo, 0x87, reg + 1);
+ matroxfb_DAC_out(minfo, 0x88, val & 3);
matroxfb_DAC_unlock_irqrestore(flags);
}
-static void g450_compute_bwlevel(CPMINFO int *bl, int *wl) {
- const int b = ACCESS_FBINFO(altout.tvo_params.brightness) + BLMIN;
- const int c = ACCESS_FBINFO(altout.tvo_params.contrast);
+static void g450_compute_bwlevel(const struct matrox_fb_info *minfo, int *bl,
+ int *wl)
+{
+ const int b = minfo->altout.tvo_params.brightness + BLMIN;
+ const int c = minfo->altout.tvo_params.contrast;
*bl = max(b - c, BLMIN);
*wl = min(b + c, WLMAX);
@@ -154,7 +161,7 @@
static int g450_set_ctrl(void* md, struct v4l2_control *p) {
int i;
- MINFO_FROM(md);
+ struct matrox_fb_info *minfo = md;
i = get_ctrl_id(p->id);
if (i < 0) return -EINVAL;
@@ -162,7 +169,7 @@
/*
* Check if changed.
*/
- if (p->value == *get_ctrl_ptr(PMINFO i)) return 0;
+ if (p->value == *get_ctrl_ptr(minfo, i)) return 0;
/*
* Check limits.
@@ -173,31 +180,31 @@
/*
* Store new value.
*/
- *get_ctrl_ptr(PMINFO i) = p->value;
+ *get_ctrl_ptr(minfo, i) = p->value;
switch (p->id) {
case V4L2_CID_BRIGHTNESS:
case V4L2_CID_CONTRAST:
{
int blacklevel, whitelevel;
- g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
- cve2_set_reg10(PMINFO 0x0e, blacklevel);
- cve2_set_reg10(PMINFO 0x1e, whitelevel);
+ g450_compute_bwlevel(minfo, &blacklevel, &whitelevel);
+ cve2_set_reg10(minfo, 0x0e, blacklevel);
+ cve2_set_reg10(minfo, 0x1e, whitelevel);
}
break;
case V4L2_CID_SATURATION:
- cve2_set_reg(PMINFO 0x20, p->value);
- cve2_set_reg(PMINFO 0x22, p->value);
+ cve2_set_reg(minfo, 0x20, p->value);
+ cve2_set_reg(minfo, 0x22, p->value);
break;
case V4L2_CID_HUE:
- cve2_set_reg(PMINFO 0x25, p->value);
+ cve2_set_reg(minfo, 0x25, p->value);
break;
case MATROXFB_CID_TESTOUT:
{
- unsigned char val = cve2_get_reg (PMINFO 0x05);
+ unsigned char val = cve2_get_reg(minfo, 0x05);
if (p->value) val |= 0x02;
else val &= ~0x02;
- cve2_set_reg(PMINFO 0x05, val);
+ cve2_set_reg(minfo, 0x05, val);
}
break;
}
@@ -208,11 +215,11 @@
static int g450_get_ctrl(void* md, struct v4l2_control *p) {
int i;
- MINFO_FROM(md);
+ struct matrox_fb_info *minfo = md;
i = get_ctrl_id(p->id);
if (i < 0) return -EINVAL;
- p->value = *get_ctrl_ptr(PMINFO i);
+ p->value = *get_ctrl_ptr(minfo, i);
return 0;
}
@@ -226,7 +233,9 @@
unsigned int v_total;
};
-static void computeRegs(WPMINFO struct mavenregs* r, struct my_timming* mt, const struct output_desc* outd) {
+static void computeRegs(struct matrox_fb_info *minfo, struct mavenregs *r,
+ struct my_timming *mt, const struct output_desc *outd)
+{
u_int32_t chromasc;
u_int32_t hlen;
u_int32_t hsl;
@@ -251,10 +260,10 @@
dprintk(KERN_DEBUG "Want %u kHz pixclock\n", (unsigned int)piic);
- mnp = matroxfb_g450_setclk(PMINFO piic, M_VIDEO_PLL);
+ mnp = matroxfb_g450_setclk(minfo, piic, M_VIDEO_PLL);
mt->mnp = mnp;
- mt->pixclock = g450_mnp2f(PMINFO mnp);
+ mt->pixclock = g450_mnp2f(minfo, mnp);
dprintk(KERN_DEBUG "MNP=%08X\n", mnp);
@@ -490,65 +499,67 @@
return;
}
-#define LR(x) cve2_set_reg(PMINFO (x), m->regs[(x)])
-static void cve2_init_TV(WPMINFO const struct mavenregs* m) {
+#define LR(x) cve2_set_reg(minfo, (x), m->regs[(x)])
+static void cve2_init_TV(struct matrox_fb_info *minfo,
+ const struct mavenregs *m)
+{
int i;
LR(0x80);
LR(0x82); LR(0x83);
LR(0x84); LR(0x85);
- cve2_set_reg(PMINFO 0x3E, 0x01);
+ cve2_set_reg(minfo, 0x3E, 0x01);
for (i = 0; i < 0x3E; i++) {
LR(i);
}
- cve2_set_reg(PMINFO 0x3E, 0x00);
+ cve2_set_reg(minfo, 0x3E, 0x00);
}
static int matroxfb_g450_compute(void* md, struct my_timming* mt) {
- MINFO_FROM(md);
+ struct matrox_fb_info *minfo = md;
- dprintk(KERN_DEBUG "Computing, mode=%u\n", ACCESS_FBINFO(outputs[1]).mode);
+ dprintk(KERN_DEBUG "Computing, mode=%u\n", minfo->outputs[1].mode);
if (mt->crtc == MATROXFB_SRC_CRTC2 &&
- ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+ minfo->outputs[1].mode != MATROXFB_OUTPUT_MODE_MONITOR) {
const struct output_desc* outd;
- cve2_init_TVdata(ACCESS_FBINFO(outputs[1]).mode, &ACCESS_FBINFO(hw).maven, &outd);
+ cve2_init_TVdata(minfo->outputs[1].mode, &minfo->hw.maven, &outd);
{
int blacklevel, whitelevel;
- g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
- ACCESS_FBINFO(hw).maven.regs[0x0E] = blacklevel >> 2;
- ACCESS_FBINFO(hw).maven.regs[0x0F] = blacklevel & 3;
- ACCESS_FBINFO(hw).maven.regs[0x1E] = whitelevel >> 2;
- ACCESS_FBINFO(hw).maven.regs[0x1F] = whitelevel & 3;
+ g450_compute_bwlevel(minfo, &blacklevel, &whitelevel);
+ minfo->hw.maven.regs[0x0E] = blacklevel >> 2;
+ minfo->hw.maven.regs[0x0F] = blacklevel & 3;
+ minfo->hw.maven.regs[0x1E] = whitelevel >> 2;
+ minfo->hw.maven.regs[0x1F] = whitelevel & 3;
- ACCESS_FBINFO(hw).maven.regs[0x20] =
- ACCESS_FBINFO(hw).maven.regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+ minfo->hw.maven.regs[0x20] =
+ minfo->hw.maven.regs[0x22] = minfo->altout.tvo_params.saturation;
- ACCESS_FBINFO(hw).maven.regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+ minfo->hw.maven.regs[0x25] = minfo->altout.tvo_params.hue;
- if (ACCESS_FBINFO(altout.tvo_params.testout)) {
- ACCESS_FBINFO(hw).maven.regs[0x05] |= 0x02;
+ if (minfo->altout.tvo_params.testout) {
+ minfo->hw.maven.regs[0x05] |= 0x02;
}
}
- computeRegs(PMINFO &ACCESS_FBINFO(hw).maven, mt, outd);
+ computeRegs(minfo, &minfo->hw.maven, mt, outd);
} else if (mt->mnp < 0) {
/* We must program clocks before CRTC2, otherwise interlaced mode
startup may fail */
- mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
- mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+ mt->mnp = matroxfb_g450_setclk(minfo, mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+ mt->pixclock = g450_mnp2f(minfo, mt->mnp);
}
dprintk(KERN_DEBUG "Pixclock = %u\n", mt->pixclock);
return 0;
}
static int matroxfb_g450_program(void* md) {
- MINFO_FROM(md);
+ struct matrox_fb_info *minfo = md;
- if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
- cve2_init_TV(PMINFO &ACCESS_FBINFO(hw).maven);
+ if (minfo->outputs[1].mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+ cve2_init_TV(minfo, &minfo->hw.maven);
}
return 0;
}
@@ -564,11 +575,11 @@
}
static int g450_dvi_compute(void* md, struct my_timming* mt) {
- MINFO_FROM(md);
+ struct matrox_fb_info *minfo = md;
if (mt->mnp < 0) {
- mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
- mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+ mt->mnp = matroxfb_g450_setclk(minfo, mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+ mt->pixclock = g450_mnp2f(minfo, mt->mnp);
}
return 0;
}
@@ -588,34 +599,36 @@
.compute = g450_dvi_compute,
};
-void matroxfb_g450_connect(WPMINFO2) {
- if (ACCESS_FBINFO(devflags.g450dac)) {
- down_write(&ACCESS_FBINFO(altout.lock));
- tvo_fill_defaults(PMINFO2);
- ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
- ACCESS_FBINFO(outputs[1]).data = MINFO;
- ACCESS_FBINFO(outputs[1]).output = &matroxfb_g450_altout;
- ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
- ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
- ACCESS_FBINFO(outputs[2]).data = MINFO;
- ACCESS_FBINFO(outputs[2]).output = &matroxfb_g450_dvi;
- ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
- up_write(&ACCESS_FBINFO(altout.lock));
+void matroxfb_g450_connect(struct matrox_fb_info *minfo)
+{
+ if (minfo->devflags.g450dac) {
+ down_write(&minfo->altout.lock);
+ tvo_fill_defaults(minfo);
+ minfo->outputs[1].src = minfo->outputs[1].default_src;
+ minfo->outputs[1].data = minfo;
+ minfo->outputs[1].output = &matroxfb_g450_altout;
+ minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ minfo->outputs[2].src = minfo->outputs[2].default_src;
+ minfo->outputs[2].data = minfo;
+ minfo->outputs[2].output = &matroxfb_g450_dvi;
+ minfo->outputs[2].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ up_write(&minfo->altout.lock);
}
}
-void matroxfb_g450_shutdown(WPMINFO2) {
- if (ACCESS_FBINFO(devflags.g450dac)) {
- down_write(&ACCESS_FBINFO(altout.lock));
- ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
- ACCESS_FBINFO(outputs[1]).output = NULL;
- ACCESS_FBINFO(outputs[1]).data = NULL;
- ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
- ACCESS_FBINFO(outputs[2]).src = MATROXFB_SRC_NONE;
- ACCESS_FBINFO(outputs[2]).output = NULL;
- ACCESS_FBINFO(outputs[2]).data = NULL;
- ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
- up_write(&ACCESS_FBINFO(altout.lock));
+void matroxfb_g450_shutdown(struct matrox_fb_info *minfo)
+{
+ if (minfo->devflags.g450dac) {
+ down_write(&minfo->altout.lock);
+ minfo->outputs[1].src = MATROXFB_SRC_NONE;
+ minfo->outputs[1].output = NULL;
+ minfo->outputs[1].data = NULL;
+ minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ minfo->outputs[2].src = MATROXFB_SRC_NONE;
+ minfo->outputs[2].output = NULL;
+ minfo->outputs[2].data = NULL;
+ minfo->outputs[2].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ up_write(&minfo->altout.lock);
}
}
diff --git a/drivers/video/matrox/matroxfb_g450.h b/drivers/video/matrox/matroxfb_g450.h
index a0822a6..3a3e654 100644
--- a/drivers/video/matrox/matroxfb_g450.h
+++ b/drivers/video/matrox/matroxfb_g450.h
@@ -4,11 +4,11 @@
#include "matroxfb_base.h"
#ifdef CONFIG_FB_MATROX_G
-void matroxfb_g450_connect(WPMINFO2);
-void matroxfb_g450_shutdown(WPMINFO2);
+void matroxfb_g450_connect(struct matrox_fb_info *minfo);
+void matroxfb_g450_shutdown(struct matrox_fb_info *minfo);
#else
-static inline void matroxfb_g450_connect(WPMINFO2) { };
-static inline void matroxfb_g450_shutdown(WPMINFO2) { };
+static inline void matroxfb_g450_connect(struct matrox_fb_info *minfo) { };
+static inline void matroxfb_g450_shutdown(struct matrox_fb_info *minfo) { };
#endif
#endif /* __MATROXFB_G450_H__ */
diff --git a/drivers/video/matrox/matroxfb_maven.c b/drivers/video/matrox/matroxfb_maven.c
index 042408a..91af915 100644
--- a/drivers/video/matrox/matroxfb_maven.c
+++ b/drivers/video/matrox/matroxfb_maven.c
@@ -458,9 +458,9 @@
0x00, /* 3E written multiple times */
0x00, /* never written */
}, MATROXFB_OUTPUT_MODE_NTSC, 525, 60 };
- MINFO_FROM(md->primary_head);
+ struct matrox_fb_info *minfo = md->primary_head;
- if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_PAL)
+ if (minfo->outputs[1].mode == MATROXFB_OUTPUT_MODE_PAL)
*data = palregs;
else
*data = ntscregs;
@@ -496,11 +496,11 @@
/* Set saturation */
{
data->regs[0x20] =
- data->regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+ data->regs[0x22] = minfo->altout.tvo_params.saturation;
}
/* Set HUE */
- data->regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+ data->regs[0x25] = minfo->altout.tvo_params.hue;
return;
}
@@ -741,9 +741,9 @@
struct mavenregs* m) {
unsigned int tmpi;
unsigned int a, bv, c;
- MINFO_FROM(md->primary_head);
+ struct matrox_fb_info *minfo = md->primary_head;
- m->mode = ACCESS_FBINFO(outputs[1]).mode;
+ m->mode = minfo->outputs[1].mode;
if (m->mode != MATROXFB_OUTPUT_MODE_MONITOR) {
unsigned int lmargin;
unsigned int umargin;
@@ -1132,7 +1132,7 @@
static int maven_out_compute(void* md, struct my_timming* mt) {
#define mdinfo ((struct maven_data*)md)
#define minfo (mdinfo->primary_head)
- return maven_compute_timming(md, mt, &ACCESS_FBINFO(hw).maven);
+ return maven_compute_timming(md, mt, &minfo->hw.maven);
#undef minfo
#undef mdinfo
}
@@ -1140,7 +1140,7 @@
static int maven_out_program(void* md) {
#define mdinfo ((struct maven_data*)md)
#define minfo (mdinfo->primary_head)
- return maven_program_timming(md, &ACCESS_FBINFO(hw).maven);
+ return maven_program_timming(md, &minfo->hw.maven);
#undef minfo
#undef mdinfo
}
@@ -1184,16 +1184,18 @@
static int maven_init_client(struct i2c_client* clnt) {
struct maven_data* md = i2c_get_clientdata(clnt);
- MINFO_FROM(container_of(clnt->adapter, struct i2c_bit_adapter, adapter)->minfo);
+ struct matrox_fb_info *minfo = container_of(clnt->adapter,
+ struct i2c_bit_adapter,
+ adapter)->minfo;
- md->primary_head = MINFO;
+ md->primary_head = minfo;
md->client = clnt;
- down_write(&ACCESS_FBINFO(altout.lock));
- ACCESS_FBINFO(outputs[1]).output = &maven_altout;
- ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
- ACCESS_FBINFO(outputs[1]).data = md;
- ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
- up_write(&ACCESS_FBINFO(altout.lock));
+ down_write(&minfo->altout.lock);
+ minfo->outputs[1].output = &maven_altout;
+ minfo->outputs[1].src = minfo->outputs[1].default_src;
+ minfo->outputs[1].data = md;
+ minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ up_write(&minfo->altout.lock);
if (maven_get_reg(clnt, 0xB2) < 0x14) {
md->version = MGATVO_B;
/* Tweak some things for this old chip */
@@ -1218,14 +1220,14 @@
struct maven_data* md = i2c_get_clientdata(clnt);
if (md->primary_head) {
- MINFO_FROM(md->primary_head);
+ struct matrox_fb_info *minfo = md->primary_head;
- down_write(&ACCESS_FBINFO(altout.lock));
- ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
- ACCESS_FBINFO(outputs[1]).output = NULL;
- ACCESS_FBINFO(outputs[1]).data = NULL;
- ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
- up_write(&ACCESS_FBINFO(altout.lock));
+ down_write(&minfo->altout.lock);
+ minfo->outputs[1].src = MATROXFB_SRC_NONE;
+ minfo->outputs[1].output = NULL;
+ minfo->outputs[1].data = NULL;
+ minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+ up_write(&minfo->altout.lock);
md->primary_head = NULL;
}
return 0;
diff --git a/drivers/video/matrox/matroxfb_misc.c b/drivers/video/matrox/matroxfb_misc.c
index 5b5f072..9948ca2 100644
--- a/drivers/video/matrox/matroxfb_misc.c
+++ b/drivers/video/matrox/matroxfb_misc.c
@@ -89,13 +89,15 @@
#include <linux/interrupt.h>
#include <linux/matroxfb.h>
-void matroxfb_DAC_out(CPMINFO int reg, int val) {
+void matroxfb_DAC_out(const struct matrox_fb_info *minfo, int reg, int val)
+{
DBG_REG(__func__)
mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
mga_outb(M_RAMDAC_BASE+M_X_DATAREG, val);
}
-int matroxfb_DAC_in(CPMINFO int reg) {
+int matroxfb_DAC_in(const struct matrox_fb_info *minfo, int reg)
+{
DBG_REG(__func__)
mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
return mga_inb(M_RAMDAC_BASE+M_X_DATAREG);
@@ -184,13 +186,14 @@
return bestvco;
}
-int matroxfb_vgaHWinit(WPMINFO struct my_timming* m) {
+int matroxfb_vgaHWinit(struct matrox_fb_info *minfo, struct my_timming *m)
+{
unsigned int hd, hs, he, hbe, ht;
unsigned int vd, vs, ve, vt, lc;
unsigned int wd;
unsigned int divider;
int i;
- struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state * const hw = &minfo->hw;
DBG(__func__)
@@ -240,7 +243,7 @@
/* standard timmings are in 8pixels, but for interleaved we cannot */
/* do it for 4bpp (because of (4bpp >> 1(interleaved))/4 == 0) */
/* using 16 or more pixels per unit can save us */
- divider = ACCESS_FBINFO(curr.final_bppShift);
+ divider = minfo->curr.final_bppShift;
while (divider & 3) {
hd >>= 1;
hs >>= 1;
@@ -270,7 +273,7 @@
if (((ht & 0x07) == 0x06) || ((ht & 0x0F) == 0x04))
ht++;
hbe = ht;
- wd = ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(curr.final_bppShift) / 64;
+ wd = minfo->fbcon.var.xres_virtual * minfo->curr.final_bppShift / 64;
hw->CRTCEXT[0] = 0;
hw->CRTCEXT[5] = 0;
@@ -287,7 +290,7 @@
((hs & 0x100) >> 6) | /* sync start */
(hbe & 0x040); /* end hor. blanking */
/* FIXME: Enable vidrst only on G400, and only if TV-out is used */
- if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1)
+ if (minfo->outputs[1].src == MATROXFB_SRC_CRTC1)
hw->CRTCEXT[1] |= 0x88; /* enable horizontal and vertical vidrst */
hw->CRTCEXT[2] = ((vt & 0xC00) >> 10) |
((vd & 0x400) >> 8) | /* disp end */
@@ -331,9 +334,10 @@
return 0;
};
-void matroxfb_vgaHWrestore(WPMINFO2) {
+void matroxfb_vgaHWrestore(struct matrox_fb_info *minfo)
+{
int i;
- struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+ struct matrox_hw_state * const hw = &minfo->hw;
CRITFLAGS
DBG(__func__)
@@ -522,7 +526,9 @@
#endif
}
-static int parse_pins1(WPMINFO const struct matrox_bios* bd) {
+static int parse_pins1(struct matrox_fb_info *minfo,
+ const struct matrox_bios *bd)
+{
unsigned int maxdac;
switch (bd->pins[22]) {
@@ -533,173 +539,188 @@
if (get_unaligned_le16(bd->pins + 24)) {
maxdac = get_unaligned_le16(bd->pins + 24) * 10;
}
- MINFO->limits.pixel.vcomax = maxdac;
- MINFO->values.pll.system = get_unaligned_le16(bd->pins + 28) ?
+ minfo->limits.pixel.vcomax = maxdac;
+ minfo->values.pll.system = get_unaligned_le16(bd->pins + 28) ?
get_unaligned_le16(bd->pins + 28) * 10 : 50000;
/* ignore 4MB, 8MB, module clocks */
- MINFO->features.pll.ref_freq = 14318;
- MINFO->values.reg.mctlwtst = 0x00030101;
+ minfo->features.pll.ref_freq = 14318;
+ minfo->values.reg.mctlwtst = 0x00030101;
return 0;
}
-static void default_pins1(WPMINFO2) {
+static void default_pins1(struct matrox_fb_info *minfo)
+{
/* Millennium */
- MINFO->limits.pixel.vcomax = 220000;
- MINFO->values.pll.system = 50000;
- MINFO->features.pll.ref_freq = 14318;
- MINFO->values.reg.mctlwtst = 0x00030101;
+ minfo->limits.pixel.vcomax = 220000;
+ minfo->values.pll.system = 50000;
+ minfo->features.pll.ref_freq = 14318;
+ minfo->values.reg.mctlwtst = 0x00030101;
}
-static int parse_pins2(WPMINFO const struct matrox_bios* bd) {
- MINFO->limits.pixel.vcomax =
- MINFO->limits.system.vcomax = (bd->pins[41] == 0xFF) ? 230000 : ((bd->pins[41] + 100) * 1000);
- MINFO->values.reg.mctlwtst = ((bd->pins[51] & 0x01) ? 0x00000001 : 0) |
+static int parse_pins2(struct matrox_fb_info *minfo,
+ const struct matrox_bios *bd)
+{
+ minfo->limits.pixel.vcomax =
+ minfo->limits.system.vcomax = (bd->pins[41] == 0xFF) ? 230000 : ((bd->pins[41] + 100) * 1000);
+ minfo->values.reg.mctlwtst = ((bd->pins[51] & 0x01) ? 0x00000001 : 0) |
((bd->pins[51] & 0x02) ? 0x00000100 : 0) |
((bd->pins[51] & 0x04) ? 0x00010000 : 0) |
((bd->pins[51] & 0x08) ? 0x00020000 : 0);
- MINFO->values.pll.system = (bd->pins[43] == 0xFF) ? 50000 : ((bd->pins[43] + 100) * 1000);
- MINFO->features.pll.ref_freq = 14318;
+ minfo->values.pll.system = (bd->pins[43] == 0xFF) ? 50000 : ((bd->pins[43] + 100) * 1000);
+ minfo->features.pll.ref_freq = 14318;
return 0;
}
-static void default_pins2(WPMINFO2) {
+static void default_pins2(struct matrox_fb_info *minfo)
+{
/* Millennium II, Mystique */
- MINFO->limits.pixel.vcomax =
- MINFO->limits.system.vcomax = 230000;
- MINFO->values.reg.mctlwtst = 0x00030101;
- MINFO->values.pll.system = 50000;
- MINFO->features.pll.ref_freq = 14318;
+ minfo->limits.pixel.vcomax =
+ minfo->limits.system.vcomax = 230000;
+ minfo->values.reg.mctlwtst = 0x00030101;
+ minfo->values.pll.system = 50000;
+ minfo->features.pll.ref_freq = 14318;
}
-static int parse_pins3(WPMINFO const struct matrox_bios* bd) {
- MINFO->limits.pixel.vcomax =
- MINFO->limits.system.vcomax = (bd->pins[36] == 0xFF) ? 230000 : ((bd->pins[36] + 100) * 1000);
- MINFO->values.reg.mctlwtst = get_unaligned_le32(bd->pins + 48) == 0xFFFFFFFF ?
+static int parse_pins3(struct matrox_fb_info *minfo,
+ const struct matrox_bios *bd)
+{
+ minfo->limits.pixel.vcomax =
+ minfo->limits.system.vcomax = (bd->pins[36] == 0xFF) ? 230000 : ((bd->pins[36] + 100) * 1000);
+ minfo->values.reg.mctlwtst = get_unaligned_le32(bd->pins + 48) == 0xFFFFFFFF ?
0x01250A21 : get_unaligned_le32(bd->pins + 48);
/* memory config */
- MINFO->values.reg.memrdbk = ((bd->pins[57] << 21) & 0x1E000000) |
+ minfo->values.reg.memrdbk = ((bd->pins[57] << 21) & 0x1E000000) |
((bd->pins[57] << 22) & 0x00C00000) |
((bd->pins[56] << 1) & 0x000001E0) |
( bd->pins[56] & 0x0000000F);
- MINFO->values.reg.opt = (bd->pins[54] & 7) << 10;
- MINFO->values.reg.opt2 = bd->pins[58] << 12;
- MINFO->features.pll.ref_freq = (bd->pins[52] & 0x20) ? 14318 : 27000;
+ minfo->values.reg.opt = (bd->pins[54] & 7) << 10;
+ minfo->values.reg.opt2 = bd->pins[58] << 12;
+ minfo->features.pll.ref_freq = (bd->pins[52] & 0x20) ? 14318 : 27000;
return 0;
}
-static void default_pins3(WPMINFO2) {
+static void default_pins3(struct matrox_fb_info *minfo)
+{
/* G100, G200 */
- MINFO->limits.pixel.vcomax =
- MINFO->limits.system.vcomax = 230000;
- MINFO->values.reg.mctlwtst = 0x01250A21;
- MINFO->values.reg.memrdbk = 0x00000000;
- MINFO->values.reg.opt = 0x00000C00;
- MINFO->values.reg.opt2 = 0x00000000;
- MINFO->features.pll.ref_freq = 27000;
+ minfo->limits.pixel.vcomax =
+ minfo->limits.system.vcomax = 230000;
+ minfo->values.reg.mctlwtst = 0x01250A21;
+ minfo->values.reg.memrdbk = 0x00000000;
+ minfo->values.reg.opt = 0x00000C00;
+ minfo->values.reg.opt2 = 0x00000000;
+ minfo->features.pll.ref_freq = 27000;
}
-static int parse_pins4(WPMINFO const struct matrox_bios* bd) {
- MINFO->limits.pixel.vcomax = (bd->pins[ 39] == 0xFF) ? 230000 : bd->pins[ 39] * 4000;
- MINFO->limits.system.vcomax = (bd->pins[ 38] == 0xFF) ? MINFO->limits.pixel.vcomax : bd->pins[ 38] * 4000;
- MINFO->values.reg.mctlwtst = get_unaligned_le32(bd->pins + 71);
- MINFO->values.reg.memrdbk = ((bd->pins[87] << 21) & 0x1E000000) |
+static int parse_pins4(struct matrox_fb_info *minfo,
+ const struct matrox_bios *bd)
+{
+ minfo->limits.pixel.vcomax = (bd->pins[ 39] == 0xFF) ? 230000 : bd->pins[ 39] * 4000;
+ minfo->limits.system.vcomax = (bd->pins[ 38] == 0xFF) ? minfo->limits.pixel.vcomax : bd->pins[ 38] * 4000;
+ minfo->values.reg.mctlwtst = get_unaligned_le32(bd->pins + 71);
+ minfo->values.reg.memrdbk = ((bd->pins[87] << 21) & 0x1E000000) |
((bd->pins[87] << 22) & 0x00C00000) |
((bd->pins[86] << 1) & 0x000001E0) |
( bd->pins[86] & 0x0000000F);
- MINFO->values.reg.opt = ((bd->pins[53] << 15) & 0x00400000) |
+ minfo->values.reg.opt = ((bd->pins[53] << 15) & 0x00400000) |
((bd->pins[53] << 22) & 0x10000000) |
((bd->pins[53] << 7) & 0x00001C00);
- MINFO->values.reg.opt3 = get_unaligned_le32(bd->pins + 67);
- MINFO->values.pll.system = (bd->pins[ 65] == 0xFF) ? 200000 : bd->pins[ 65] * 4000;
- MINFO->features.pll.ref_freq = (bd->pins[ 92] & 0x01) ? 14318 : 27000;
+ minfo->values.reg.opt3 = get_unaligned_le32(bd->pins + 67);
+ minfo->values.pll.system = (bd->pins[ 65] == 0xFF) ? 200000 : bd->pins[ 65] * 4000;
+ minfo->features.pll.ref_freq = (bd->pins[ 92] & 0x01) ? 14318 : 27000;
return 0;
}
-static void default_pins4(WPMINFO2) {
+static void default_pins4(struct matrox_fb_info *minfo)
+{
/* G400 */
- MINFO->limits.pixel.vcomax =
- MINFO->limits.system.vcomax = 252000;
- MINFO->values.reg.mctlwtst = 0x04A450A1;
- MINFO->values.reg.memrdbk = 0x000000E7;
- MINFO->values.reg.opt = 0x10000400;
- MINFO->values.reg.opt3 = 0x0190A419;
- MINFO->values.pll.system = 200000;
- MINFO->features.pll.ref_freq = 27000;
+ minfo->limits.pixel.vcomax =
+ minfo->limits.system.vcomax = 252000;
+ minfo->values.reg.mctlwtst = 0x04A450A1;
+ minfo->values.reg.memrdbk = 0x000000E7;
+ minfo->values.reg.opt = 0x10000400;
+ minfo->values.reg.opt3 = 0x0190A419;
+ minfo->values.pll.system = 200000;
+ minfo->features.pll.ref_freq = 27000;
}
-static int parse_pins5(WPMINFO const struct matrox_bios* bd) {
+static int parse_pins5(struct matrox_fb_info *minfo,
+ const struct matrox_bios *bd)
+{
unsigned int mult;
mult = bd->pins[4]?8000:6000;
- MINFO->limits.pixel.vcomax = (bd->pins[ 38] == 0xFF) ? 600000 : bd->pins[ 38] * mult;
- MINFO->limits.system.vcomax = (bd->pins[ 36] == 0xFF) ? MINFO->limits.pixel.vcomax : bd->pins[ 36] * mult;
- MINFO->limits.video.vcomax = (bd->pins[ 37] == 0xFF) ? MINFO->limits.system.vcomax : bd->pins[ 37] * mult;
- MINFO->limits.pixel.vcomin = (bd->pins[123] == 0xFF) ? 256000 : bd->pins[123] * mult;
- MINFO->limits.system.vcomin = (bd->pins[121] == 0xFF) ? MINFO->limits.pixel.vcomin : bd->pins[121] * mult;
- MINFO->limits.video.vcomin = (bd->pins[122] == 0xFF) ? MINFO->limits.system.vcomin : bd->pins[122] * mult;
- MINFO->values.pll.system =
- MINFO->values.pll.video = (bd->pins[ 92] == 0xFF) ? 284000 : bd->pins[ 92] * 4000;
- MINFO->values.reg.opt = get_unaligned_le32(bd->pins + 48);
- MINFO->values.reg.opt2 = get_unaligned_le32(bd->pins + 52);
- MINFO->values.reg.opt3 = get_unaligned_le32(bd->pins + 94);
- MINFO->values.reg.mctlwtst = get_unaligned_le32(bd->pins + 98);
- MINFO->values.reg.memmisc = get_unaligned_le32(bd->pins + 102);
- MINFO->values.reg.memrdbk = get_unaligned_le32(bd->pins + 106);
- MINFO->features.pll.ref_freq = (bd->pins[110] & 0x01) ? 14318 : 27000;
- MINFO->values.memory.ddr = (bd->pins[114] & 0x60) == 0x20;
- MINFO->values.memory.dll = (bd->pins[115] & 0x02) != 0;
- MINFO->values.memory.emrswen = (bd->pins[115] & 0x01) != 0;
- MINFO->values.reg.maccess = MINFO->values.memory.emrswen ? 0x00004000 : 0x00000000;
+ minfo->limits.pixel.vcomax = (bd->pins[ 38] == 0xFF) ? 600000 : bd->pins[ 38] * mult;
+ minfo->limits.system.vcomax = (bd->pins[ 36] == 0xFF) ? minfo->limits.pixel.vcomax : bd->pins[ 36] * mult;
+ minfo->limits.video.vcomax = (bd->pins[ 37] == 0xFF) ? minfo->limits.system.vcomax : bd->pins[ 37] * mult;
+ minfo->limits.pixel.vcomin = (bd->pins[123] == 0xFF) ? 256000 : bd->pins[123] * mult;
+ minfo->limits.system.vcomin = (bd->pins[121] == 0xFF) ? minfo->limits.pixel.vcomin : bd->pins[121] * mult;
+ minfo->limits.video.vcomin = (bd->pins[122] == 0xFF) ? minfo->limits.system.vcomin : bd->pins[122] * mult;
+ minfo->values.pll.system =
+ minfo->values.pll.video = (bd->pins[ 92] == 0xFF) ? 284000 : bd->pins[ 92] * 4000;
+ minfo->values.reg.opt = get_unaligned_le32(bd->pins + 48);
+ minfo->values.reg.opt2 = get_unaligned_le32(bd->pins + 52);
+ minfo->values.reg.opt3 = get_unaligned_le32(bd->pins + 94);
+ minfo->values.reg.mctlwtst = get_unaligned_le32(bd->pins + 98);
+ minfo->values.reg.memmisc = get_unaligned_le32(bd->pins + 102);
+ minfo->values.reg.memrdbk = get_unaligned_le32(bd->pins + 106);
+ minfo->features.pll.ref_freq = (bd->pins[110] & 0x01) ? 14318 : 27000;
+ minfo->values.memory.ddr = (bd->pins[114] & 0x60) == 0x20;
+ minfo->values.memory.dll = (bd->pins[115] & 0x02) != 0;
+ minfo->values.memory.emrswen = (bd->pins[115] & 0x01) != 0;
+ minfo->values.reg.maccess = minfo->values.memory.emrswen ? 0x00004000 : 0x00000000;
if (bd->pins[115] & 4) {
- MINFO->values.reg.mctlwtst_core = MINFO->values.reg.mctlwtst;
+ minfo->values.reg.mctlwtst_core = minfo->values.reg.mctlwtst;
} else {
u_int32_t wtst_xlat[] = { 0, 1, 5, 6, 7, 5, 2, 3 };
- MINFO->values.reg.mctlwtst_core = (MINFO->values.reg.mctlwtst & ~7) |
- wtst_xlat[MINFO->values.reg.mctlwtst & 7];
+ minfo->values.reg.mctlwtst_core = (minfo->values.reg.mctlwtst & ~7) |
+ wtst_xlat[minfo->values.reg.mctlwtst & 7];
}
- MINFO->max_pixel_clock_panellink = bd->pins[47] * 4000;
+ minfo->max_pixel_clock_panellink = bd->pins[47] * 4000;
return 0;
}
-static void default_pins5(WPMINFO2) {
+static void default_pins5(struct matrox_fb_info *minfo)
+{
/* Mine 16MB G450 with SDRAM DDR */
- MINFO->limits.pixel.vcomax =
- MINFO->limits.system.vcomax =
- MINFO->limits.video.vcomax = 600000;
- MINFO->limits.pixel.vcomin =
- MINFO->limits.system.vcomin =
- MINFO->limits.video.vcomin = 256000;
- MINFO->values.pll.system =
- MINFO->values.pll.video = 284000;
- MINFO->values.reg.opt = 0x404A1160;
- MINFO->values.reg.opt2 = 0x0000AC00;
- MINFO->values.reg.opt3 = 0x0090A409;
- MINFO->values.reg.mctlwtst_core =
- MINFO->values.reg.mctlwtst = 0x0C81462B;
- MINFO->values.reg.memmisc = 0x80000004;
- MINFO->values.reg.memrdbk = 0x01001103;
- MINFO->features.pll.ref_freq = 27000;
- MINFO->values.memory.ddr = 1;
- MINFO->values.memory.dll = 1;
- MINFO->values.memory.emrswen = 1;
- MINFO->values.reg.maccess = 0x00004000;
+ minfo->limits.pixel.vcomax =
+ minfo->limits.system.vcomax =
+ minfo->limits.video.vcomax = 600000;
+ minfo->limits.pixel.vcomin =
+ minfo->limits.system.vcomin =
+ minfo->limits.video.vcomin = 256000;
+ minfo->values.pll.system =
+ minfo->values.pll.video = 284000;
+ minfo->values.reg.opt = 0x404A1160;
+ minfo->values.reg.opt2 = 0x0000AC00;
+ minfo->values.reg.opt3 = 0x0090A409;
+ minfo->values.reg.mctlwtst_core =
+ minfo->values.reg.mctlwtst = 0x0C81462B;
+ minfo->values.reg.memmisc = 0x80000004;
+ minfo->values.reg.memrdbk = 0x01001103;
+ minfo->features.pll.ref_freq = 27000;
+ minfo->values.memory.ddr = 1;
+ minfo->values.memory.dll = 1;
+ minfo->values.memory.emrswen = 1;
+ minfo->values.reg.maccess = 0x00004000;
}
-static int matroxfb_set_limits(WPMINFO const struct matrox_bios* bd) {
+static int matroxfb_set_limits(struct matrox_fb_info *minfo,
+ const struct matrox_bios *bd)
+{
unsigned int pins_version;
static const unsigned int pinslen[] = { 64, 64, 64, 128, 128 };
- switch (ACCESS_FBINFO(chip)) {
- case MGA_2064: default_pins1(PMINFO2); break;
+ switch (minfo->chip) {
+ case MGA_2064: default_pins1(minfo); break;
case MGA_2164:
case MGA_1064:
- case MGA_1164: default_pins2(PMINFO2); break;
+ case MGA_1164: default_pins2(minfo); break;
case MGA_G100:
- case MGA_G200: default_pins3(PMINFO2); break;
- case MGA_G400: default_pins4(PMINFO2); break;
+ case MGA_G200: default_pins3(minfo); break;
+ case MGA_G400: default_pins4(minfo); break;
case MGA_G450:
- case MGA_G550: default_pins5(PMINFO2); break;
+ case MGA_G550: default_pins5(minfo); break;
}
if (!bd->bios_valid) {
printk(KERN_INFO "matroxfb: Your Matrox device does not have BIOS\n");
@@ -724,38 +745,39 @@
}
switch (pins_version) {
case 1:
- return parse_pins1(PMINFO bd);
+ return parse_pins1(minfo, bd);
case 2:
- return parse_pins2(PMINFO bd);
+ return parse_pins2(minfo, bd);
case 3:
- return parse_pins3(PMINFO bd);
+ return parse_pins3(minfo, bd);
case 4:
- return parse_pins4(PMINFO bd);
+ return parse_pins4(minfo, bd);
case 5:
- return parse_pins5(PMINFO bd);
+ return parse_pins5(minfo, bd);
default:
printk(KERN_DEBUG "matroxfb: Powerup info version %u is not yet supported\n", pins_version);
return -1;
}
}
-void matroxfb_read_pins(WPMINFO2) {
+void matroxfb_read_pins(struct matrox_fb_info *minfo)
+{
u32 opt;
u32 biosbase;
u32 fbbase;
- struct pci_dev* pdev = ACCESS_FBINFO(pcidev);
+ struct pci_dev *pdev = minfo->pcidev;
- memset(&ACCESS_FBINFO(bios), 0, sizeof(ACCESS_FBINFO(bios)));
+ memset(&minfo->bios, 0, sizeof(minfo->bios));
pci_read_config_dword(pdev, PCI_OPTION_REG, &opt);
pci_write_config_dword(pdev, PCI_OPTION_REG, opt | PCI_OPTION_ENABLE_ROM);
pci_read_config_dword(pdev, PCI_ROM_ADDRESS, &biosbase);
- pci_read_config_dword(pdev, ACCESS_FBINFO(devflags.fbResource), &fbbase);
+ pci_read_config_dword(pdev, minfo->devflags.fbResource, &fbbase);
pci_write_config_dword(pdev, PCI_ROM_ADDRESS, (fbbase & PCI_ROM_ADDRESS_MASK) | PCI_ROM_ADDRESS_ENABLE);
- parse_bios(vaddr_va(ACCESS_FBINFO(video).vbase), &ACCESS_FBINFO(bios));
+ parse_bios(vaddr_va(minfo->video.vbase), &minfo->bios);
pci_write_config_dword(pdev, PCI_ROM_ADDRESS, biosbase);
pci_write_config_dword(pdev, PCI_OPTION_REG, opt);
#ifdef CONFIG_X86
- if (!ACCESS_FBINFO(bios).bios_valid) {
+ if (!minfo->bios.bios_valid) {
unsigned char __iomem* b;
b = ioremap(0x000C0000, 65536);
@@ -769,25 +791,21 @@
printk(KERN_INFO "matroxfb: Legacy BIOS is for %04X:%04X, while this device is %04X:%04X\n",
ven, dev, pdev->vendor, pdev->device);
} else {
- parse_bios(b, &ACCESS_FBINFO(bios));
+ parse_bios(b, &minfo->bios);
}
iounmap(b);
}
}
#endif
- matroxfb_set_limits(PMINFO &ACCESS_FBINFO(bios));
+ matroxfb_set_limits(minfo, &minfo->bios);
printk(KERN_INFO "PInS memtype = %u\n",
- (ACCESS_FBINFO(values).reg.opt & 0x1C00) >> 10);
+ (minfo->values.reg.opt & 0x1C00) >> 10);
}
EXPORT_SYMBOL(matroxfb_DAC_in);
EXPORT_SYMBOL(matroxfb_DAC_out);
EXPORT_SYMBOL(matroxfb_var2my);
EXPORT_SYMBOL(matroxfb_PLL_calcclock);
-#ifndef CONFIG_FB_MATROX_MULTIHEAD
-struct matrox_fb_info matroxfb_global_mxinfo;
-EXPORT_SYMBOL(matroxfb_global_mxinfo);
-#endif
EXPORT_SYMBOL(matroxfb_vgaHWinit); /* DAC1064, Ti3026 */
EXPORT_SYMBOL(matroxfb_vgaHWrestore); /* DAC1064, Ti3026 */
EXPORT_SYMBOL(matroxfb_read_pins);
diff --git a/drivers/video/matrox/matroxfb_misc.h b/drivers/video/matrox/matroxfb_misc.h
index cb62cc0..351c823 100644
--- a/drivers/video/matrox/matroxfb_misc.h
+++ b/drivers/video/matrox/matroxfb_misc.h
@@ -6,13 +6,16 @@
/* also for modules */
int matroxfb_PLL_calcclock(const struct matrox_pll_features* pll, unsigned int freq, unsigned int fmax,
unsigned int* in, unsigned int* feed, unsigned int* post);
-static inline int PLL_calcclock(CPMINFO unsigned int freq, unsigned int fmax,
- unsigned int* in, unsigned int* feed, unsigned int* post) {
- return matroxfb_PLL_calcclock(&ACCESS_FBINFO(features.pll), freq, fmax, in, feed, post);
+static inline int PLL_calcclock(const struct matrox_fb_info *minfo,
+ unsigned int freq, unsigned int fmax,
+ unsigned int *in, unsigned int *feed,
+ unsigned int *post)
+{
+ return matroxfb_PLL_calcclock(&minfo->features.pll, freq, fmax, in, feed, post);
}
-int matroxfb_vgaHWinit(WPMINFO struct my_timming* m);
-void matroxfb_vgaHWrestore(WPMINFO2);
-void matroxfb_read_pins(WPMINFO2);
+int matroxfb_vgaHWinit(struct matrox_fb_info *minfo, struct my_timming* m);
+void matroxfb_vgaHWrestore(struct matrox_fb_info *minfo);
+void matroxfb_read_pins(struct matrox_fb_info *minfo);
#endif /* __MATROXFB_MISC_H__ */
diff --git a/drivers/video/msm/Makefile b/drivers/video/msm/Makefile
new file mode 100644
index 0000000..802d6ae
--- /dev/null
+++ b/drivers/video/msm/Makefile
@@ -0,0 +1,19 @@
+
+# core framebuffer
+#
+obj-y := msm_fb.o
+
+# MDP DMA/PPP engine
+#
+obj-y += mdp.o mdp_scale_tables.o mdp_ppp.o
+
+# MDDI interface
+#
+obj-y += mddi.o
+
+# MDDI client/panel drivers
+#
+obj-y += mddi_client_dummy.o
+obj-y += mddi_client_toshiba.o
+obj-y += mddi_client_nt35399.o
+
diff --git a/drivers/video/msm/mddi.c b/drivers/video/msm/mddi.c
new file mode 100644
index 0000000..f2de5a1
--- /dev/null
+++ b/drivers/video/msm/mddi.c
@@ -0,0 +1,828 @@
+/*
+ * MSM MDDI Transport
+ *
+ * Copyright (C) 2007 Google Incorporated
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/dma-mapping.h>
+#include <linux/interrupt.h>
+#include <linux/platform_device.h>
+#include <linux/delay.h>
+#include <linux/spinlock.h>
+#include <linux/clk.h>
+#include <linux/io.h>
+#include <mach/msm_iomap.h>
+#include <mach/irqs.h>
+#include <mach/board.h>
+#include <linux/delay.h>
+
+#include <mach/msm_fb.h>
+#include "mddi_hw.h"
+
+#define FLAG_DISABLE_HIBERNATION 0x0001
+#define FLAG_HAVE_CAPS 0x0002
+#define FLAG_HAS_VSYNC_IRQ 0x0004
+#define FLAG_HAVE_STATUS 0x0008
+
+#define CMD_GET_CLIENT_CAP 0x0601
+#define CMD_GET_CLIENT_STATUS 0x0602
+
+union mddi_rev {
+ unsigned char raw[MDDI_REV_BUFFER_SIZE];
+ struct mddi_rev_packet hdr;
+ struct mddi_client_status status;
+ struct mddi_client_caps caps;
+ struct mddi_register_access reg;
+};
+
+struct reg_read_info {
+ struct completion done;
+ uint32_t reg;
+ uint32_t status;
+ uint32_t result;
+};
+
+struct mddi_info {
+ uint16_t flags;
+ uint16_t version;
+ char __iomem *base;
+ int irq;
+ struct clk *clk;
+ struct msm_mddi_client_data client_data;
+
+ /* buffer for rev encap packets */
+ void *rev_data;
+ dma_addr_t rev_addr;
+ struct mddi_llentry *reg_write_data;
+ dma_addr_t reg_write_addr;
+ struct mddi_llentry *reg_read_data;
+ dma_addr_t reg_read_addr;
+ size_t rev_data_curr;
+
+ spinlock_t int_lock;
+ uint32_t int_enable;
+ uint32_t got_int;
+ wait_queue_head_t int_wait;
+
+ struct mutex reg_write_lock;
+ struct mutex reg_read_lock;
+ struct reg_read_info *reg_read;
+
+ struct mddi_client_caps caps;
+ struct mddi_client_status status;
+
+ void (*power_client)(struct msm_mddi_client_data *, int);
+
+ /* client device published to bind us to the
+ * appropriate mddi_client driver
+ */
+ char client_name[20];
+
+ struct platform_device client_pdev;
+};
+
+static void mddi_init_rev_encap(struct mddi_info *mddi);
+
+#define mddi_readl(r) readl(mddi->base + (MDDI_##r))
+#define mddi_writel(v, r) writel((v), mddi->base + (MDDI_##r))
+
+void mddi_activate_link(struct msm_mddi_client_data *cdata)
+{
+ struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+ client_data);
+
+ mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+}
+
+static void mddi_handle_link_list_done(struct mddi_info *mddi)
+{
+}
+
+static void mddi_reset_rev_encap_ptr(struct mddi_info *mddi)
+{
+ printk(KERN_INFO "mddi: resetting rev ptr\n");
+ mddi->rev_data_curr = 0;
+ mddi_writel(mddi->rev_addr, REV_PTR);
+ mddi_writel(mddi->rev_addr, REV_PTR);
+ mddi_writel(MDDI_CMD_FORCE_NEW_REV_PTR, CMD);
+}
+
+static void mddi_handle_rev_data(struct mddi_info *mddi, union mddi_rev *rev)
+{
+ int i;
+ struct reg_read_info *ri;
+
+ if ((rev->hdr.length <= MDDI_REV_BUFFER_SIZE - 2) &&
+ (rev->hdr.length >= sizeof(struct mddi_rev_packet) - 2)) {
+
+ switch (rev->hdr.type) {
+ case TYPE_CLIENT_CAPS:
+ memcpy(&mddi->caps, &rev->caps,
+ sizeof(struct mddi_client_caps));
+ mddi->flags |= FLAG_HAVE_CAPS;
+ wake_up(&mddi->int_wait);
+ break;
+ case TYPE_CLIENT_STATUS:
+ memcpy(&mddi->status, &rev->status,
+ sizeof(struct mddi_client_status));
+ mddi->flags |= FLAG_HAVE_STATUS;
+ wake_up(&mddi->int_wait);
+ break;
+ case TYPE_REGISTER_ACCESS:
+ ri = mddi->reg_read;
+ if (ri == 0) {
+ printk(KERN_INFO "rev: got reg %x = %x without "
+ " pending read\n",
+ rev->reg.register_address,
+ rev->reg.register_data_list);
+ break;
+ }
+ if (ri->reg != rev->reg.register_address) {
+ printk(KERN_INFO "rev: got reg %x = %x for "
+ "wrong register, expected "
+ "%x\n",
+ rev->reg.register_address,
+ rev->reg.register_data_list, ri->reg);
+ break;
+ }
+ mddi->reg_read = NULL;
+ ri->status = 0;
+ ri->result = rev->reg.register_data_list;
+ complete(&ri->done);
+ break;
+ default:
+ printk(KERN_INFO "rev: unknown reverse packet: "
+ "len=%04x type=%04x CURR_REV_PTR=%x\n",
+ rev->hdr.length, rev->hdr.type,
+ mddi_readl(CURR_REV_PTR));
+ for (i = 0; i < rev->hdr.length + 2; i++) {
+ if ((i % 16) == 0)
+ printk(KERN_INFO "\n");
+ printk(KERN_INFO " %02x", rev->raw[i]);
+ }
+ printk(KERN_INFO "\n");
+ mddi_reset_rev_encap_ptr(mddi);
+ }
+ } else {
+ printk(KERN_INFO "bad rev length, %d, CURR_REV_PTR %x\n",
+ rev->hdr.length, mddi_readl(CURR_REV_PTR));
+ mddi_reset_rev_encap_ptr(mddi);
+ }
+}
+
+static void mddi_wait_interrupt(struct mddi_info *mddi, uint32_t intmask);
+
+static void mddi_handle_rev_data_avail(struct mddi_info *mddi)
+{
+ union mddi_rev *rev = mddi->rev_data;
+ uint32_t rev_data_count;
+ uint32_t rev_crc_err_count;
+ int i;
+ struct reg_read_info *ri;
+ size_t prev_offset;
+ uint16_t length;
+
+ union mddi_rev *crev = mddi->rev_data + mddi->rev_data_curr;
+
+ /* clear the interrupt */
+ mddi_writel(MDDI_INT_REV_DATA_AVAIL, INT);
+ rev_data_count = mddi_readl(REV_PKT_CNT);
+ rev_crc_err_count = mddi_readl(REV_CRC_ERR);
+ if (rev_data_count > 1)
+ printk(KERN_INFO "rev_data_count %d\n", rev_data_count);
+
+ if (rev_crc_err_count) {
+ printk(KERN_INFO "rev_crc_err_count %d, INT %x\n",
+ rev_crc_err_count, mddi_readl(INT));
+ ri = mddi->reg_read;
+ if (ri == 0) {
+ printk(KERN_INFO "rev: got crc error without pending "
+ "read\n");
+ } else {
+ mddi->reg_read = NULL;
+ ri->status = -EIO;
+ ri->result = -1;
+ complete(&ri->done);
+ }
+ }
+
+ if (rev_data_count == 0)
+ return;
+
+ prev_offset = mddi->rev_data_curr;
+
+ length = *((uint8_t *)mddi->rev_data + mddi->rev_data_curr);
+ mddi->rev_data_curr++;
+ if (mddi->rev_data_curr == MDDI_REV_BUFFER_SIZE)
+ mddi->rev_data_curr = 0;
+ length += *((uint8_t *)mddi->rev_data + mddi->rev_data_curr) << 8;
+ mddi->rev_data_curr += 1 + length;
+ if (mddi->rev_data_curr >= MDDI_REV_BUFFER_SIZE)
+ mddi->rev_data_curr =
+ mddi->rev_data_curr % MDDI_REV_BUFFER_SIZE;
+
+ if (length > MDDI_REV_BUFFER_SIZE - 2) {
+ printk(KERN_INFO "mddi: rev data length greater than buffer"
+ "size\n");
+ mddi_reset_rev_encap_ptr(mddi);
+ return;
+ }
+
+ if (prev_offset + 2 + length >= MDDI_REV_BUFFER_SIZE) {
+ union mddi_rev tmprev;
+ size_t rem = MDDI_REV_BUFFER_SIZE - prev_offset;
+ memcpy(&tmprev.raw[0], mddi->rev_data + prev_offset, rem);
+ memcpy(&tmprev.raw[rem], mddi->rev_data, 2 + length - rem);
+ mddi_handle_rev_data(mddi, &tmprev);
+ } else {
+ mddi_handle_rev_data(mddi, crev);
+ }
+
+ if (prev_offset < MDDI_REV_BUFFER_SIZE / 2 &&
+ mddi->rev_data_curr >= MDDI_REV_BUFFER_SIZE / 2) {
+ mddi_writel(mddi->rev_addr, REV_PTR);
+ }
+}
+
+static irqreturn_t mddi_isr(int irq, void *data)
+{
+ struct msm_mddi_client_data *cdata = data;
+ struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+ client_data);
+ uint32_t active, status;
+
+ spin_lock(&mddi->int_lock);
+
+ active = mddi_readl(INT);
+ status = mddi_readl(STAT);
+
+ mddi_writel(active, INT);
+
+ /* ignore any interrupts we have disabled */
+ active &= mddi->int_enable;
+
+ mddi->got_int |= active;
+ wake_up(&mddi->int_wait);
+
+ if (active & MDDI_INT_PRI_LINK_LIST_DONE) {
+ mddi->int_enable &= (~MDDI_INT_PRI_LINK_LIST_DONE);
+ mddi_handle_link_list_done(mddi);
+ }
+ if (active & MDDI_INT_REV_DATA_AVAIL)
+ mddi_handle_rev_data_avail(mddi);
+
+ if (active & ~MDDI_INT_NEED_CLEAR)
+ mddi->int_enable &= ~(active & ~MDDI_INT_NEED_CLEAR);
+
+ if (active & MDDI_INT_LINK_ACTIVE) {
+ mddi->int_enable &= (~MDDI_INT_LINK_ACTIVE);
+ mddi->int_enable |= MDDI_INT_IN_HIBERNATION;
+ }
+
+ if (active & MDDI_INT_IN_HIBERNATION) {
+ mddi->int_enable &= (~MDDI_INT_IN_HIBERNATION);
+ mddi->int_enable |= MDDI_INT_LINK_ACTIVE;
+ }
+
+ mddi_writel(mddi->int_enable, INTEN);
+ spin_unlock(&mddi->int_lock);
+
+ return IRQ_HANDLED;
+}
+
+static long mddi_wait_interrupt_timeout(struct mddi_info *mddi,
+ uint32_t intmask, int timeout)
+{
+ unsigned long irq_flags;
+
+ spin_lock_irqsave(&mddi->int_lock, irq_flags);
+ mddi->got_int &= ~intmask;
+ mddi->int_enable |= intmask;
+ mddi_writel(mddi->int_enable, INTEN);
+ spin_unlock_irqrestore(&mddi->int_lock, irq_flags);
+ return wait_event_timeout(mddi->int_wait, mddi->got_int & intmask,
+ timeout);
+}
+
+static void mddi_wait_interrupt(struct mddi_info *mddi, uint32_t intmask)
+{
+ if (mddi_wait_interrupt_timeout(mddi, intmask, HZ/10) == 0)
+ printk(KERN_INFO KERN_ERR "mddi_wait_interrupt %d, timeout "
+ "waiting for %x, INT = %x, STAT = %x gotint = %x\n",
+ current->pid, intmask, mddi_readl(INT), mddi_readl(STAT),
+ mddi->got_int);
+}
+
+static void mddi_init_rev_encap(struct mddi_info *mddi)
+{
+ memset(mddi->rev_data, 0xee, MDDI_REV_BUFFER_SIZE);
+ mddi_writel(mddi->rev_addr, REV_PTR);
+ mddi_writel(MDDI_CMD_FORCE_NEW_REV_PTR, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+}
+
+void mddi_set_auto_hibernate(struct msm_mddi_client_data *cdata, int on)
+{
+ struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+ client_data);
+ mddi_writel(MDDI_CMD_POWERDOWN, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_IN_HIBERNATION);
+ mddi_writel(MDDI_CMD_HIBERNATE | !!on, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+}
+
+
+static uint16_t mddi_init_registers(struct mddi_info *mddi)
+{
+ mddi_writel(0x0001, VERSION);
+ mddi_writel(MDDI_HOST_BYTES_PER_SUBFRAME, BPS);
+ mddi_writel(0x0003, SPM); /* subframes per media */
+ mddi_writel(0x0005, TA1_LEN);
+ mddi_writel(MDDI_HOST_TA2_LEN, TA2_LEN);
+ mddi_writel(0x0096, DRIVE_HI);
+ /* 0x32 normal, 0x50 for Toshiba display */
+ mddi_writel(0x0050, DRIVE_LO);
+ mddi_writel(0x003C, DISP_WAKE); /* wakeup counter */
+ mddi_writel(MDDI_HOST_REV_RATE_DIV, REV_RATE_DIV);
+
+ mddi_writel(MDDI_REV_BUFFER_SIZE, REV_SIZE);
+ mddi_writel(MDDI_MAX_REV_PKT_SIZE, REV_ENCAP_SZ);
+
+ /* disable periodic rev encap */
+ mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+ if (mddi_readl(PAD_CTL) == 0) {
+ /* If we are turning on band gap, need to wait 5us before
+ * turning on the rest of the PAD */
+ mddi_writel(0x08000, PAD_CTL);
+ udelay(5);
+ }
+
+ /* Recommendation from PAD hw team */
+ mddi_writel(0xa850f, PAD_CTL);
+
+
+ /* Need an even number for counts */
+ mddi_writel(0x60006, DRIVER_START_CNT);
+
+ mddi_set_auto_hibernate(&mddi->client_data, 0);
+
+ mddi_writel(MDDI_CMD_DISP_IGNORE, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+ mddi_init_rev_encap(mddi);
+ return mddi_readl(CORE_VER) & 0xffff;
+}
+
+static void mddi_suspend(struct msm_mddi_client_data *cdata)
+{
+ struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+ client_data);
+ /* turn off the client */
+ if (mddi->power_client)
+ mddi->power_client(&mddi->client_data, 0);
+ /* turn off the link */
+ mddi_writel(MDDI_CMD_RESET, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ /* turn off the clock */
+ clk_disable(mddi->clk);
+}
+
+static void mddi_resume(struct msm_mddi_client_data *cdata)
+{
+ struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+ client_data);
+ mddi_set_auto_hibernate(&mddi->client_data, 0);
+ /* turn on the client */
+ if (mddi->power_client)
+ mddi->power_client(&mddi->client_data, 1);
+ /* turn on the clock */
+ clk_enable(mddi->clk);
+ /* set up the local registers */
+ mddi->rev_data_curr = 0;
+ mddi_init_registers(mddi);
+ mddi_writel(mddi->int_enable, INTEN);
+ mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+ mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ mddi_set_auto_hibernate(&mddi->client_data, 1);
+}
+
+static int __init mddi_get_client_caps(struct mddi_info *mddi)
+{
+ int i, j;
+
+ /* clear any stale interrupts */
+ mddi_writel(0xffffffff, INT);
+
+ mddi->int_enable = MDDI_INT_LINK_ACTIVE |
+ MDDI_INT_IN_HIBERNATION |
+ MDDI_INT_PRI_LINK_LIST_DONE |
+ MDDI_INT_REV_DATA_AVAIL |
+ MDDI_INT_REV_OVERFLOW |
+ MDDI_INT_REV_OVERWRITE |
+ MDDI_INT_RTD_FAILURE;
+ mddi_writel(mddi->int_enable, INTEN);
+
+ mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+ for (j = 0; j < 3; j++) {
+ /* the toshiba vga panel does not respond to get
+ * caps unless you SEND_RTD, but the first SEND_RTD
+ * will fail...
+ */
+ for (i = 0; i < 4; i++) {
+ uint32_t stat;
+
+ mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ stat = mddi_readl(STAT);
+ printk(KERN_INFO "mddi cmd send rtd: int %x, stat %x, "
+ "rtd val %x\n", mddi_readl(INT), stat,
+ mddi_readl(RTD_VAL));
+ if ((stat & MDDI_STAT_RTD_MEAS_FAIL) == 0)
+ break;
+ msleep(1);
+ }
+
+ mddi_writel(CMD_GET_CLIENT_CAP, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ wait_event_timeout(mddi->int_wait, mddi->flags & FLAG_HAVE_CAPS,
+ HZ / 100);
+
+ if (mddi->flags & FLAG_HAVE_CAPS)
+ break;
+ printk(KERN_INFO KERN_ERR "mddi_init, timeout waiting for "
+ "caps\n");
+ }
+ return mddi->flags & FLAG_HAVE_CAPS;
+}
+
+/* link must be active when this is called */
+int mddi_check_status(struct mddi_info *mddi)
+{
+ int ret = -1, retry = 3;
+ mutex_lock(&mddi->reg_read_lock);
+ mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 1, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+ do {
+ mddi->flags &= ~FLAG_HAVE_STATUS;
+ mddi_writel(CMD_GET_CLIENT_STATUS, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ wait_event_timeout(mddi->int_wait,
+ mddi->flags & FLAG_HAVE_STATUS,
+ HZ / 100);
+
+ if (mddi->flags & FLAG_HAVE_STATUS) {
+ if (mddi->status.crc_error_count)
+ printk(KERN_INFO "mddi status: crc_error "
+ "count: %d\n",
+ mddi->status.crc_error_count);
+ else
+ ret = 0;
+ break;
+ } else
+ printk(KERN_INFO "mddi status: failed to get client "
+ "status\n");
+ mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ } while (--retry);
+
+ mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 0, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ mutex_unlock(&mddi->reg_read_lock);
+ return ret;
+}
+
+
+void mddi_remote_write(struct msm_mddi_client_data *cdata, uint32_t val,
+ uint32_t reg)
+{
+ struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+ client_data);
+ struct mddi_llentry *ll;
+ struct mddi_register_access *ra;
+
+ mutex_lock(&mddi->reg_write_lock);
+
+ ll = mddi->reg_write_data;
+
+ ra = &(ll->u.r);
+ ra->length = 14 + 4;
+ ra->type = TYPE_REGISTER_ACCESS;
+ ra->client_id = 0;
+ ra->read_write_info = MDDI_WRITE | 1;
+ ra->crc16 = 0;
+
+ ra->register_address = reg;
+ ra->register_data_list = val;
+
+ ll->flags = 1;
+ ll->header_count = 14;
+ ll->data_count = 4;
+ ll->data = mddi->reg_write_addr + offsetof(struct mddi_llentry,
+ u.r.register_data_list);
+ ll->next = 0;
+ ll->reserved = 0;
+
+ mddi_writel(mddi->reg_write_addr, PRI_PTR);
+
+ mddi_wait_interrupt(mddi, MDDI_INT_PRI_LINK_LIST_DONE);
+ mutex_unlock(&mddi->reg_write_lock);
+}
+
+uint32_t mddi_remote_read(struct msm_mddi_client_data *cdata, uint32_t reg)
+{
+ struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+ client_data);
+ struct mddi_llentry *ll;
+ struct mddi_register_access *ra;
+ struct reg_read_info ri;
+ unsigned s;
+ int retry_count = 2;
+ unsigned long irq_flags;
+
+ mutex_lock(&mddi->reg_read_lock);
+
+ ll = mddi->reg_read_data;
+
+ ra = &(ll->u.r);
+ ra->length = 14;
+ ra->type = TYPE_REGISTER_ACCESS;
+ ra->client_id = 0;
+ ra->read_write_info = MDDI_READ | 1;
+ ra->crc16 = 0;
+
+ ra->register_address = reg;
+
+ ll->flags = 0x11;
+ ll->header_count = 14;
+ ll->data_count = 0;
+ ll->data = 0;
+ ll->next = 0;
+ ll->reserved = 0;
+
+ s = mddi_readl(STAT);
+
+ ri.reg = reg;
+ ri.status = -1;
+
+ do {
+ init_completion(&ri.done);
+ mddi->reg_read = &ri;
+ mddi_writel(mddi->reg_read_addr, PRI_PTR);
+
+ mddi_wait_interrupt(mddi, MDDI_INT_PRI_LINK_LIST_DONE);
+
+ /* Enable Periodic Reverse Encapsulation. */
+ mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 1, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ if (wait_for_completion_timeout(&ri.done, HZ/10) == 0 &&
+ !ri.done.done) {
+ printk(KERN_INFO "mddi_remote_read(%x) timeout "
+ "(%d %d %d)\n",
+ reg, ri.status, ri.result, ri.done.done);
+ spin_lock_irqsave(&mddi->int_lock, irq_flags);
+ mddi->reg_read = NULL;
+ spin_unlock_irqrestore(&mddi->int_lock, irq_flags);
+ ri.status = -1;
+ ri.result = -1;
+ }
+ if (ri.status == 0)
+ break;
+
+ mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+ mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ printk(KERN_INFO "mddi_remote_read: failed, sent "
+ "MDDI_CMD_SEND_RTD: int %x, stat %x, rtd val %x "
+ "curr_rev_ptr %x\n", mddi_readl(INT), mddi_readl(STAT),
+ mddi_readl(RTD_VAL), mddi_readl(CURR_REV_PTR));
+ } while (retry_count-- > 0);
+ /* Disable Periodic Reverse Encapsulation. */
+ mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 0, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ mddi->reg_read = NULL;
+ mutex_unlock(&mddi->reg_read_lock);
+ return ri.result;
+}
+
+static struct mddi_info mddi_info[2];
+
+static int __init mddi_clk_setup(struct platform_device *pdev,
+ struct mddi_info *mddi,
+ unsigned long clk_rate)
+{
+ int ret;
+
+ /* set up the clocks */
+ mddi->clk = clk_get(&pdev->dev, "mddi_clk");
+ if (IS_ERR(mddi->clk)) {
+ printk(KERN_INFO "mddi: failed to get clock\n");
+ return PTR_ERR(mddi->clk);
+ }
+ ret = clk_enable(mddi->clk);
+ if (ret)
+ goto fail;
+ ret = clk_set_rate(mddi->clk, clk_rate);
+ if (ret)
+ goto fail;
+ return 0;
+
+fail:
+ clk_put(mddi->clk);
+ return ret;
+}
+
+static int __init mddi_rev_data_setup(struct mddi_info *mddi)
+{
+ void *dma;
+ dma_addr_t dma_addr;
+
+ /* set up dma buffer */
+ dma = dma_alloc_coherent(NULL, 0x1000, &dma_addr, GFP_KERNEL);
+ if (dma == 0)
+ return -ENOMEM;
+ mddi->rev_data = dma;
+ mddi->rev_data_curr = 0;
+ mddi->rev_addr = dma_addr;
+ mddi->reg_write_data = dma + MDDI_REV_BUFFER_SIZE;
+ mddi->reg_write_addr = dma_addr + MDDI_REV_BUFFER_SIZE;
+ mddi->reg_read_data = mddi->reg_write_data + 1;
+ mddi->reg_read_addr = mddi->reg_write_addr +
+ sizeof(*mddi->reg_write_data);
+ return 0;
+}
+
+static int __init mddi_probe(struct platform_device *pdev)
+{
+ struct msm_mddi_platform_data *pdata = pdev->dev.platform_data;
+ struct mddi_info *mddi = &mddi_info[pdev->id];
+ struct resource *resource;
+ int ret, i;
+
+ resource = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ if (!resource) {
+ printk(KERN_ERR "mddi: no associated mem resource!\n");
+ return -ENOMEM;
+ }
+ mddi->base = ioremap(resource->start, resource->end - resource->start);
+ if (!mddi->base) {
+ printk(KERN_ERR "mddi: failed to remap base!\n");
+ ret = -EINVAL;
+ goto error_ioremap;
+ }
+ resource = platform_get_resource(pdev, IORESOURCE_IRQ, 0);
+ if (!resource) {
+ printk(KERN_ERR "mddi: no associated irq resource!\n");
+ ret = -EINVAL;
+ goto error_get_irq_resource;
+ }
+ mddi->irq = resource->start;
+ printk(KERN_INFO "mddi: init() base=0x%p irq=%d\n", mddi->base,
+ mddi->irq);
+ mddi->power_client = pdata->power_client;
+
+ mutex_init(&mddi->reg_write_lock);
+ mutex_init(&mddi->reg_read_lock);
+ spin_lock_init(&mddi->int_lock);
+ init_waitqueue_head(&mddi->int_wait);
+
+ ret = mddi_clk_setup(pdev, mddi, pdata->clk_rate);
+ if (ret) {
+ printk(KERN_ERR "mddi: failed to setup clock!\n");
+ goto error_clk_setup;
+ }
+
+ ret = mddi_rev_data_setup(mddi);
+ if (ret) {
+ printk(KERN_ERR "mddi: failed to setup rev data!\n");
+ goto error_rev_data;
+ }
+
+ mddi->int_enable = 0;
+ mddi_writel(mddi->int_enable, INTEN);
+ ret = request_irq(mddi->irq, mddi_isr, IRQF_DISABLED, "mddi",
+ &mddi->client_data);
+ if (ret) {
+ printk(KERN_ERR "mddi: failed to request enable irq!\n");
+ goto error_request_irq;
+ }
+
+ /* turn on the mddi client bridge chip */
+ if (mddi->power_client)
+ mddi->power_client(&mddi->client_data, 1);
+
+ /* initialize the mddi registers */
+ mddi_set_auto_hibernate(&mddi->client_data, 0);
+ mddi_writel(MDDI_CMD_RESET, CMD);
+ mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+ mddi->version = mddi_init_registers(mddi);
+ if (mddi->version < 0x20) {
+ printk(KERN_ERR "mddi: unsupported version 0x%x\n",
+ mddi->version);
+ ret = -ENODEV;
+ goto error_mddi_version;
+ }
+
+ /* read the capabilities off the client */
+ if (!mddi_get_client_caps(mddi)) {
+ printk(KERN_INFO "mddi: no client found\n");
+ /* power down the panel */
+ mddi_writel(MDDI_CMD_POWERDOWN, CMD);
+ printk(KERN_INFO "mddi powerdown: stat %x\n", mddi_readl(STAT));
+ msleep(100);
+ printk(KERN_INFO "mddi powerdown: stat %x\n", mddi_readl(STAT));
+ return 0;
+ }
+ mddi_set_auto_hibernate(&mddi->client_data, 1);
+
+ if (mddi->caps.Mfr_Name == 0 && mddi->caps.Product_Code == 0)
+ pdata->fixup(&mddi->caps.Mfr_Name, &mddi->caps.Product_Code);
+
+ mddi->client_pdev.id = 0;
+ for (i = 0; i < pdata->num_clients; i++) {
+ if (pdata->client_platform_data[i].product_id ==
+ (mddi->caps.Mfr_Name << 16 | mddi->caps.Product_Code)) {
+ mddi->client_data.private_client_data =
+ pdata->client_platform_data[i].client_data;
+ mddi->client_pdev.name =
+ pdata->client_platform_data[i].name;
+ mddi->client_pdev.id =
+ pdata->client_platform_data[i].id;
+ /* XXX: possibly set clock */
+ break;
+ }
+ }
+
+ if (i >= pdata->num_clients)
+ mddi->client_pdev.name = "mddi_c_dummy";
+ printk(KERN_INFO "mddi: registering panel %s\n",
+ mddi->client_pdev.name);
+
+ mddi->client_data.suspend = mddi_suspend;
+ mddi->client_data.resume = mddi_resume;
+ mddi->client_data.activate_link = mddi_activate_link;
+ mddi->client_data.remote_write = mddi_remote_write;
+ mddi->client_data.remote_read = mddi_remote_read;
+ mddi->client_data.auto_hibernate = mddi_set_auto_hibernate;
+ mddi->client_data.fb_resource = pdata->fb_resource;
+ if (pdev->id == 0)
+ mddi->client_data.interface_type = MSM_MDDI_PMDH_INTERFACE;
+ else if (pdev->id == 1)
+ mddi->client_data.interface_type = MSM_MDDI_EMDH_INTERFACE;
+ else {
+ printk(KERN_ERR "mddi: can not determine interface %d!\n",
+ pdev->id);
+ ret = -EINVAL;
+ goto error_mddi_interface;
+ }
+
+ mddi->client_pdev.dev.platform_data = &mddi->client_data;
+ printk(KERN_INFO "mddi: publish: %s\n", mddi->client_name);
+ platform_device_register(&mddi->client_pdev);
+ return 0;
+
+error_mddi_interface:
+error_mddi_version:
+ free_irq(mddi->irq, 0);
+error_request_irq:
+ dma_free_coherent(NULL, 0x1000, mddi->rev_data, mddi->rev_addr);
+error_rev_data:
+error_clk_setup:
+error_get_irq_resource:
+ iounmap(mddi->base);
+error_ioremap:
+
+ printk(KERN_INFO "mddi: mddi_init() failed (%d)\n", ret);
+ return ret;
+}
+
+
+static struct platform_driver mddi_driver = {
+ .probe = mddi_probe,
+ .driver = { .name = "msm_mddi" },
+};
+
+static int __init _mddi_init(void)
+{
+ return platform_driver_register(&mddi_driver);
+}
+
+module_init(_mddi_init);
diff --git a/drivers/video/msm/mddi_client_dummy.c b/drivers/video/msm/mddi_client_dummy.c
new file mode 100644
index 0000000..ebbae87
--- /dev/null
+++ b/drivers/video/msm/mddi_client_dummy.c
@@ -0,0 +1,97 @@
+/* drivers/video/msm_fb/mddi_client_dummy.c
+ *
+ * Support for "dummy" mddi client devices which require no
+ * special initialization code.
+ *
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/platform_device.h>
+
+#include <mach/msm_fb.h>
+
+struct panel_info {
+ struct platform_device pdev;
+ struct msm_panel_data panel_data;
+};
+
+static int mddi_dummy_suspend(struct msm_panel_data *panel_data)
+{
+ return 0;
+}
+
+static int mddi_dummy_resume(struct msm_panel_data *panel_data)
+{
+ return 0;
+}
+
+static int mddi_dummy_blank(struct msm_panel_data *panel_data)
+{
+ return 0;
+}
+
+static int mddi_dummy_unblank(struct msm_panel_data *panel_data)
+{
+ return 0;
+}
+
+static int mddi_dummy_probe(struct platform_device *pdev)
+{
+ struct msm_mddi_client_data *client_data = pdev->dev.platform_data;
+ struct panel_info *panel =
+ kzalloc(sizeof(struct panel_info), GFP_KERNEL);
+ int ret;
+ if (!panel)
+ return -ENOMEM;
+ platform_set_drvdata(pdev, panel);
+ panel->panel_data.suspend = mddi_dummy_suspend;
+ panel->panel_data.resume = mddi_dummy_resume;
+ panel->panel_data.blank = mddi_dummy_blank;
+ panel->panel_data.unblank = mddi_dummy_unblank;
+ panel->panel_data.caps = MSMFB_CAP_PARTIAL_UPDATES;
+ panel->pdev.name = "msm_panel";
+ panel->pdev.id = pdev->id;
+ platform_device_add_resources(&panel->pdev,
+ client_data->fb_resource, 1);
+ panel->panel_data.fb_data = client_data->private_client_data;
+ panel->pdev.dev.platform_data = &panel->panel_data;
+ ret = platform_device_register(&panel->pdev);
+ if (ret) {
+ kfree(panel);
+ return ret;
+ }
+ return 0;
+}
+
+static int mddi_dummy_remove(struct platform_device *pdev)
+{
+ struct panel_info *panel = platform_get_drvdata(pdev);
+ kfree(panel);
+ return 0;
+}
+
+static struct platform_driver mddi_client_dummy = {
+ .probe = mddi_dummy_probe,
+ .remove = mddi_dummy_remove,
+ .driver = { .name = "mddi_c_dummy" },
+};
+
+static int __init mddi_client_dummy_init(void)
+{
+ platform_driver_register(&mddi_client_dummy);
+ return 0;
+}
+
+module_init(mddi_client_dummy_init);
+
diff --git a/drivers/video/msm/mddi_client_nt35399.c b/drivers/video/msm/mddi_client_nt35399.c
new file mode 100644
index 0000000..9c78050
--- /dev/null
+++ b/drivers/video/msm/mddi_client_nt35399.c
@@ -0,0 +1,255 @@
+/* drivers/video/msm_fb/mddi_client_nt35399.c
+ *
+ * Support for Novatek NT35399 MDDI client of Sapphire
+ *
+ * Copyright (C) 2008 HTC Incorporated
+ * Author: Solomon Chiu (solomon_chiu@htc.com)
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/platform_device.h>
+#include <linux/interrupt.h>
+#include <linux/gpio.h>
+#include <mach/msm_fb.h>
+
+static DECLARE_WAIT_QUEUE_HEAD(nt35399_vsync_wait);
+
+struct panel_info {
+ struct msm_mddi_client_data *client_data;
+ struct platform_device pdev;
+ struct msm_panel_data panel_data;
+ struct msmfb_callback *fb_callback;
+ struct work_struct panel_work;
+ struct workqueue_struct *fb_wq;
+ int nt35399_got_int;
+};
+
+static void
+nt35399_request_vsync(struct msm_panel_data *panel_data,
+ struct msmfb_callback *callback)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+
+ panel->fb_callback = callback;
+ if (panel->nt35399_got_int) {
+ panel->nt35399_got_int = 0;
+ client_data->activate_link(client_data); /* clears interrupt */
+ }
+}
+
+static void nt35399_wait_vsync(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+
+ if (panel->nt35399_got_int) {
+ panel->nt35399_got_int = 0;
+ client_data->activate_link(client_data); /* clears interrupt */
+ }
+
+ if (wait_event_timeout(nt35399_vsync_wait, panel->nt35399_got_int,
+ HZ/2) == 0)
+ printk(KERN_ERR "timeout waiting for VSYNC\n");
+
+ panel->nt35399_got_int = 0;
+ /* interrupt clears when screen dma starts */
+}
+
+static int nt35399_suspend(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+ int ret;
+
+ ret = bridge_data->uninit(bridge_data, client_data);
+ if (ret) {
+ printk(KERN_INFO "mddi nt35399 client: non zero return from "
+ "uninit\n");
+ return ret;
+ }
+ client_data->suspend(client_data);
+ return 0;
+}
+
+static int nt35399_resume(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+ int ret;
+
+ client_data->resume(client_data);
+ ret = bridge_data->init(bridge_data, client_data);
+ if (ret)
+ return ret;
+ return 0;
+}
+
+static int nt35399_blank(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+
+ return bridge_data->blank(bridge_data, client_data);
+}
+
+static int nt35399_unblank(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+
+ return bridge_data->unblank(bridge_data, client_data);
+}
+
+irqreturn_t nt35399_vsync_interrupt(int irq, void *data)
+{
+ struct panel_info *panel = data;
+
+ panel->nt35399_got_int = 1;
+
+ if (panel->fb_callback) {
+ panel->fb_callback->func(panel->fb_callback);
+ panel->fb_callback = NULL;
+ }
+
+ wake_up(&nt35399_vsync_wait);
+
+ return IRQ_HANDLED;
+}
+
+static int setup_vsync(struct panel_info *panel, int init)
+{
+ int ret;
+ int gpio = 97;
+ unsigned int irq;
+
+ if (!init) {
+ ret = 0;
+ goto uninit;
+ }
+ ret = gpio_request(gpio, "vsync");
+ if (ret)
+ goto err_request_gpio_failed;
+
+ ret = gpio_direction_input(gpio);
+ if (ret)
+ goto err_gpio_direction_input_failed;
+
+ ret = irq = gpio_to_irq(gpio);
+ if (ret < 0)
+ goto err_get_irq_num_failed;
+
+ ret = request_irq(irq, nt35399_vsync_interrupt, IRQF_TRIGGER_RISING,
+ "vsync", panel);
+ if (ret)
+ goto err_request_irq_failed;
+
+ printk(KERN_INFO "vsync on gpio %d now %d\n",
+ gpio, gpio_get_value(gpio));
+ return 0;
+
+uninit:
+ free_irq(gpio_to_irq(gpio), panel->client_data);
+err_request_irq_failed:
+err_get_irq_num_failed:
+err_gpio_direction_input_failed:
+ gpio_free(gpio);
+err_request_gpio_failed:
+ return ret;
+}
+
+static int mddi_nt35399_probe(struct platform_device *pdev)
+{
+ struct msm_mddi_client_data *client_data = pdev->dev.platform_data;
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+
+ int ret;
+
+ struct panel_info *panel = kzalloc(sizeof(struct panel_info),
+ GFP_KERNEL);
+
+ printk(KERN_DEBUG "%s: enter.\n", __func__);
+
+ if (!panel)
+ return -ENOMEM;
+ platform_set_drvdata(pdev, panel);
+
+ ret = setup_vsync(panel, 1);
+ if (ret) {
+ dev_err(&pdev->dev, "mddi_nt35399_setup_vsync failed\n");
+ return ret;
+ }
+
+ panel->client_data = client_data;
+ panel->panel_data.suspend = nt35399_suspend;
+ panel->panel_data.resume = nt35399_resume;
+ panel->panel_data.wait_vsync = nt35399_wait_vsync;
+ panel->panel_data.request_vsync = nt35399_request_vsync;
+ panel->panel_data.blank = nt35399_blank;
+ panel->panel_data.unblank = nt35399_unblank;
+ panel->panel_data.fb_data = &bridge_data->fb_data;
+ panel->panel_data.caps = 0;
+
+ panel->pdev.name = "msm_panel";
+ panel->pdev.id = pdev->id;
+ panel->pdev.resource = client_data->fb_resource;
+ panel->pdev.num_resources = 1;
+ panel->pdev.dev.platform_data = &panel->panel_data;
+
+ if (bridge_data->init)
+ bridge_data->init(bridge_data, client_data);
+
+ platform_device_register(&panel->pdev);
+
+ return 0;
+}
+
+static int mddi_nt35399_remove(struct platform_device *pdev)
+{
+ struct panel_info *panel = platform_get_drvdata(pdev);
+
+ setup_vsync(panel, 0);
+ kfree(panel);
+ return 0;
+}
+
+static struct platform_driver mddi_client_0bda_8a47 = {
+ .probe = mddi_nt35399_probe,
+ .remove = mddi_nt35399_remove,
+ .driver = { .name = "mddi_c_0bda_8a47" },
+};
+
+static int __init mddi_client_nt35399_init(void)
+{
+ return platform_driver_register(&mddi_client_0bda_8a47);
+}
+
+module_init(mddi_client_nt35399_init);
+
diff --git a/drivers/video/msm/mddi_client_toshiba.c b/drivers/video/msm/mddi_client_toshiba.c
new file mode 100644
index 0000000..80d0f5f
--- /dev/null
+++ b/drivers/video/msm/mddi_client_toshiba.c
@@ -0,0 +1,283 @@
+/* drivers/video/msm_fb/mddi_client_toshiba.c
+ *
+ * Support for Toshiba TC358720XBG mddi client devices which require no
+ * special initialization code.
+ *
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/platform_device.h>
+#include <linux/interrupt.h>
+#include <linux/gpio.h>
+#include <mach/msm_fb.h>
+
+
+#define LCD_CONTROL_BLOCK_BASE 0x110000
+#define CMN (LCD_CONTROL_BLOCK_BASE|0x10)
+#define INTFLG (LCD_CONTROL_BLOCK_BASE|0x18)
+#define HCYCLE (LCD_CONTROL_BLOCK_BASE|0x34)
+#define HDE_START (LCD_CONTROL_BLOCK_BASE|0x3C)
+#define VPOS (LCD_CONTROL_BLOCK_BASE|0xC0)
+#define MPLFBUF (LCD_CONTROL_BLOCK_BASE|0x20)
+#define WAKEUP (LCD_CONTROL_BLOCK_BASE|0x54)
+#define WSYN_DLY (LCD_CONTROL_BLOCK_BASE|0x58)
+#define REGENB (LCD_CONTROL_BLOCK_BASE|0x5C)
+
+#define BASE5 0x150000
+#define BASE6 0x160000
+#define BASE7 0x170000
+
+#define GPIOIEV (BASE5 + 0x10)
+#define GPIOIE (BASE5 + 0x14)
+#define GPIORIS (BASE5 + 0x18)
+#define GPIOMIS (BASE5 + 0x1C)
+#define GPIOIC (BASE5 + 0x20)
+
+#define INTMASK (BASE6 + 0x0C)
+#define INTMASK_VWAKEOUT (1U << 0)
+#define INTMASK_VWAKEOUT_ACTIVE_LOW (1U << 8)
+#define GPIOSEL (BASE7 + 0x00)
+#define GPIOSEL_VWAKEINT (1U << 0)
+
+static DECLARE_WAIT_QUEUE_HEAD(toshiba_vsync_wait);
+
+struct panel_info {
+ struct msm_mddi_client_data *client_data;
+ struct platform_device pdev;
+ struct msm_panel_data panel_data;
+ struct msmfb_callback *toshiba_callback;
+ int toshiba_got_int;
+};
+
+
+static void toshiba_request_vsync(struct msm_panel_data *panel_data,
+ struct msmfb_callback *callback)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+
+ panel->toshiba_callback = callback;
+ if (panel->toshiba_got_int) {
+ panel->toshiba_got_int = 0;
+ client_data->activate_link(client_data);
+ }
+}
+
+static void toshiba_clear_vsync(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+
+ client_data->activate_link(client_data);
+}
+
+static void toshiba_wait_vsync(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+
+ if (panel->toshiba_got_int) {
+ panel->toshiba_got_int = 0;
+ client_data->activate_link(client_data); /* clears interrupt */
+ }
+ if (wait_event_timeout(toshiba_vsync_wait, panel->toshiba_got_int,
+ HZ/2) == 0)
+ printk(KERN_ERR "timeout waiting for VSYNC\n");
+ panel->toshiba_got_int = 0;
+ /* interrupt clears when screen dma starts */
+}
+
+static int toshiba_suspend(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+ int ret;
+
+ ret = bridge_data->uninit(bridge_data, client_data);
+ if (ret) {
+ printk(KERN_INFO "mddi toshiba client: non zero return from "
+ "uninit\n");
+ return ret;
+ }
+ client_data->suspend(client_data);
+ return 0;
+}
+
+static int toshiba_resume(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+ int ret;
+
+ client_data->resume(client_data);
+ ret = bridge_data->init(bridge_data, client_data);
+ if (ret)
+ return ret;
+ return 0;
+}
+
+static int toshiba_blank(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+
+ return bridge_data->blank(bridge_data, client_data);
+}
+
+static int toshiba_unblank(struct msm_panel_data *panel_data)
+{
+ struct panel_info *panel = container_of(panel_data, struct panel_info,
+ panel_data);
+ struct msm_mddi_client_data *client_data = panel->client_data;
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+
+ return bridge_data->unblank(bridge_data, client_data);
+}
+
+irqreturn_t toshiba_vsync_interrupt(int irq, void *data)
+{
+ struct panel_info *panel = data;
+
+ panel->toshiba_got_int = 1;
+ if (panel->toshiba_callback) {
+ panel->toshiba_callback->func(panel->toshiba_callback);
+ panel->toshiba_callback = 0;
+ }
+ wake_up(&toshiba_vsync_wait);
+ return IRQ_HANDLED;
+}
+
+static int setup_vsync(struct panel_info *panel,
+ int init)
+{
+ int ret;
+ int gpio = 97;
+ unsigned int irq;
+
+ if (!init) {
+ ret = 0;
+ goto uninit;
+ }
+ ret = gpio_request(gpio, "vsync");
+ if (ret)
+ goto err_request_gpio_failed;
+
+ ret = gpio_direction_input(gpio);
+ if (ret)
+ goto err_gpio_direction_input_failed;
+
+ ret = irq = gpio_to_irq(gpio);
+ if (ret < 0)
+ goto err_get_irq_num_failed;
+
+ ret = request_irq(irq, toshiba_vsync_interrupt, IRQF_TRIGGER_RISING,
+ "vsync", panel);
+ if (ret)
+ goto err_request_irq_failed;
+ printk(KERN_INFO "vsync on gpio %d now %d\n",
+ gpio, gpio_get_value(gpio));
+ return 0;
+
+uninit:
+ free_irq(gpio_to_irq(gpio), panel);
+err_request_irq_failed:
+err_get_irq_num_failed:
+err_gpio_direction_input_failed:
+ gpio_free(gpio);
+err_request_gpio_failed:
+ return ret;
+}
+
+static int mddi_toshiba_probe(struct platform_device *pdev)
+{
+ int ret;
+ struct msm_mddi_client_data *client_data = pdev->dev.platform_data;
+ struct msm_mddi_bridge_platform_data *bridge_data =
+ client_data->private_client_data;
+ struct panel_info *panel =
+ kzalloc(sizeof(struct panel_info), GFP_KERNEL);
+ if (!panel)
+ return -ENOMEM;
+ platform_set_drvdata(pdev, panel);
+
+ /* mddi_remote_write(mddi, 0, WAKEUP); */
+ client_data->remote_write(client_data, GPIOSEL_VWAKEINT, GPIOSEL);
+ client_data->remote_write(client_data, INTMASK_VWAKEOUT, INTMASK);
+
+ ret = setup_vsync(panel, 1);
+ if (ret) {
+ dev_err(&pdev->dev, "mddi_bridge_setup_vsync failed\n");
+ return ret;
+ }
+
+ panel->client_data = client_data;
+ panel->panel_data.suspend = toshiba_suspend;
+ panel->panel_data.resume = toshiba_resume;
+ panel->panel_data.wait_vsync = toshiba_wait_vsync;
+ panel->panel_data.request_vsync = toshiba_request_vsync;
+ panel->panel_data.clear_vsync = toshiba_clear_vsync;
+ panel->panel_data.blank = toshiba_blank;
+ panel->panel_data.unblank = toshiba_unblank;
+ panel->panel_data.fb_data = &bridge_data->fb_data;
+ panel->panel_data.caps = MSMFB_CAP_PARTIAL_UPDATES;
+
+ panel->pdev.name = "msm_panel";
+ panel->pdev.id = pdev->id;
+ panel->pdev.resource = client_data->fb_resource;
+ panel->pdev.num_resources = 1;
+ panel->pdev.dev.platform_data = &panel->panel_data;
+ bridge_data->init(bridge_data, client_data);
+ platform_device_register(&panel->pdev);
+
+ return 0;
+}
+
+static int mddi_toshiba_remove(struct platform_device *pdev)
+{
+ struct panel_info *panel = platform_get_drvdata(pdev);
+
+ setup_vsync(panel, 0);
+ kfree(panel);
+ return 0;
+}
+
+static struct platform_driver mddi_client_d263_0000 = {
+ .probe = mddi_toshiba_probe,
+ .remove = mddi_toshiba_remove,
+ .driver = { .name = "mddi_c_d263_0000" },
+};
+
+static int __init mddi_client_toshiba_init(void)
+{
+ platform_driver_register(&mddi_client_d263_0000);
+ return 0;
+}
+
+module_init(mddi_client_toshiba_init);
+
diff --git a/drivers/video/msm/mddi_hw.h b/drivers/video/msm/mddi_hw.h
new file mode 100644
index 0000000..45cc01f
--- /dev/null
+++ b/drivers/video/msm/mddi_hw.h
@@ -0,0 +1,305 @@
+/* drivers/video/msm_fb/mddi_hw.h
+ *
+ * MSM MDDI Hardware Registers and Structures
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+#ifndef _MDDI_HW_H_
+#define _MDDI_HW_H_
+
+#include <linux/types.h>
+
+#define MDDI_CMD 0x0000
+#define MDDI_VERSION 0x0004
+#define MDDI_PRI_PTR 0x0008
+#define MDDI_SEC_PTR 0x000c
+#define MDDI_BPS 0x0010
+#define MDDI_SPM 0x0014
+#define MDDI_INT 0x0018
+#define MDDI_INTEN 0x001c
+#define MDDI_REV_PTR 0x0020
+#define MDDI_REV_SIZE 0x0024
+#define MDDI_STAT 0x0028
+#define MDDI_REV_RATE_DIV 0x002c
+#define MDDI_REV_CRC_ERR 0x0030
+#define MDDI_TA1_LEN 0x0034
+#define MDDI_TA2_LEN 0x0038
+#define MDDI_TEST_BUS 0x003c
+#define MDDI_TEST 0x0040
+#define MDDI_REV_PKT_CNT 0x0044
+#define MDDI_DRIVE_HI 0x0048
+#define MDDI_DRIVE_LO 0x004c
+#define MDDI_DISP_WAKE 0x0050
+#define MDDI_REV_ENCAP_SZ 0x0054
+#define MDDI_RTD_VAL 0x0058
+#define MDDI_PAD_CTL 0x0068
+#define MDDI_DRIVER_START_CNT 0x006c
+#define MDDI_NEXT_PRI_PTR 0x0070
+#define MDDI_NEXT_SEC_PTR 0x0074
+#define MDDI_MISR_CTL 0x0078
+#define MDDI_MISR_DATA 0x007c
+#define MDDI_SF_CNT 0x0080
+#define MDDI_MF_CNT 0x0084
+#define MDDI_CURR_REV_PTR 0x0088
+#define MDDI_CORE_VER 0x008c
+
+#define MDDI_INT_PRI_PTR_READ 0x0001
+#define MDDI_INT_SEC_PTR_READ 0x0002
+#define MDDI_INT_REV_DATA_AVAIL 0x0004
+#define MDDI_INT_DISP_REQ 0x0008
+#define MDDI_INT_PRI_UNDERFLOW 0x0010
+#define MDDI_INT_SEC_UNDERFLOW 0x0020
+#define MDDI_INT_REV_OVERFLOW 0x0040
+#define MDDI_INT_CRC_ERROR 0x0080
+#define MDDI_INT_MDDI_IN 0x0100
+#define MDDI_INT_PRI_OVERWRITE 0x0200
+#define MDDI_INT_SEC_OVERWRITE 0x0400
+#define MDDI_INT_REV_OVERWRITE 0x0800
+#define MDDI_INT_DMA_FAILURE 0x1000
+#define MDDI_INT_LINK_ACTIVE 0x2000
+#define MDDI_INT_IN_HIBERNATION 0x4000
+#define MDDI_INT_PRI_LINK_LIST_DONE 0x8000
+#define MDDI_INT_SEC_LINK_LIST_DONE 0x10000
+#define MDDI_INT_NO_CMD_PKTS_PEND 0x20000
+#define MDDI_INT_RTD_FAILURE 0x40000
+#define MDDI_INT_REV_PKT_RECEIVED 0x80000
+#define MDDI_INT_REV_PKTS_AVAIL 0x100000
+
+#define MDDI_INT_NEED_CLEAR ( \
+ MDDI_INT_REV_DATA_AVAIL | \
+ MDDI_INT_PRI_UNDERFLOW | \
+ MDDI_INT_SEC_UNDERFLOW | \
+ MDDI_INT_REV_OVERFLOW | \
+ MDDI_INT_CRC_ERROR | \
+ MDDI_INT_REV_PKT_RECEIVED)
+
+
+#define MDDI_STAT_LINK_ACTIVE 0x0001
+#define MDDI_STAT_NEW_REV_PTR 0x0002
+#define MDDI_STAT_NEW_PRI_PTR 0x0004
+#define MDDI_STAT_NEW_SEC_PTR 0x0008
+#define MDDI_STAT_IN_HIBERNATION 0x0010
+#define MDDI_STAT_PRI_LINK_LIST_DONE 0x0020
+#define MDDI_STAT_SEC_LINK_LIST_DONE 0x0040
+#define MDDI_STAT_PENDING_TIMING_PKT 0x0080
+#define MDDI_STAT_PENDING_REV_ENCAP 0x0100
+#define MDDI_STAT_PENDING_POWERDOWN 0x0200
+#define MDDI_STAT_RTD_MEAS_FAIL 0x0800
+#define MDDI_STAT_CLIENT_WAKEUP_REQ 0x1000
+
+
+#define MDDI_CMD_POWERDOWN 0x0100
+#define MDDI_CMD_POWERUP 0x0200
+#define MDDI_CMD_HIBERNATE 0x0300
+#define MDDI_CMD_RESET 0x0400
+#define MDDI_CMD_DISP_IGNORE 0x0501
+#define MDDI_CMD_DISP_LISTEN 0x0500
+#define MDDI_CMD_SEND_REV_ENCAP 0x0600
+#define MDDI_CMD_GET_CLIENT_CAP 0x0601
+#define MDDI_CMD_GET_CLIENT_STATUS 0x0602
+#define MDDI_CMD_SEND_RTD 0x0700
+#define MDDI_CMD_LINK_ACTIVE 0x0900
+#define MDDI_CMD_PERIODIC_REV_ENCAP 0x0A00
+#define MDDI_CMD_FORCE_NEW_REV_PTR 0x0C00
+
+
+
+#define MDDI_VIDEO_REV_PKT_SIZE 0x40
+#define MDDI_CLIENT_CAPABILITY_REV_PKT_SIZE 0x60
+#define MDDI_MAX_REV_PKT_SIZE 0x60
+
+/* #define MDDI_REV_BUFFER_SIZE 128 */
+#define MDDI_REV_BUFFER_SIZE (MDDI_MAX_REV_PKT_SIZE * 4)
+
+/* MDP sends 256 pixel packets, so lower value hibernates more without
+ * significantly increasing latency of waiting for next subframe */
+#define MDDI_HOST_BYTES_PER_SUBFRAME 0x3C00
+#define MDDI_HOST_TA2_LEN 0x000c
+#define MDDI_HOST_REV_RATE_DIV 0x0002
+
+
+struct __attribute__((packed)) mddi_rev_packet {
+ uint16_t length;
+ uint16_t type;
+ uint16_t client_id;
+};
+
+struct __attribute__((packed)) mddi_client_status {
+ uint16_t length;
+ uint16_t type;
+ uint16_t client_id;
+ uint16_t reverse_link_request; /* bytes needed in rev encap message */
+ uint8_t crc_error_count;
+ uint8_t capability_change;
+ uint16_t graphics_busy_flags;
+ uint16_t crc16;
+};
+
+struct __attribute__((packed)) mddi_client_caps {
+ uint16_t length; /* length, exclusive of this field */
+ uint16_t type; /* 66 */
+ uint16_t client_id;
+
+ uint16_t Protocol_Version;
+ uint16_t Minimum_Protocol_Version;
+ uint16_t Data_Rate_Capability;
+ uint8_t Interface_Type_Capability;
+ uint8_t Number_of_Alt_Displays;
+ uint16_t PostCal_Data_Rate;
+ uint16_t Bitmap_Width;
+ uint16_t Bitmap_Height;
+ uint16_t Display_Window_Width;
+ uint16_t Display_Window_Height;
+ uint32_t Color_Map_Size;
+ uint16_t Color_Map_RGB_Width;
+ uint16_t RGB_Capability;
+ uint8_t Monochrome_Capability;
+ uint8_t Reserved_1;
+ uint16_t Y_Cb_Cr_Capability;
+ uint16_t Bayer_Capability;
+ uint16_t Alpha_Cursor_Image_Planes;
+ uint32_t Client_Feature_Capability_Indicators;
+ uint8_t Maximum_Video_Frame_Rate_Capability;
+ uint8_t Minimum_Video_Frame_Rate_Capability;
+ uint16_t Minimum_Sub_frame_Rate;
+ uint16_t Audio_Buffer_Depth;
+ uint16_t Audio_Channel_Capability;
+ uint16_t Audio_Sample_Rate_Capability;
+ uint8_t Audio_Sample_Resolution;
+ uint8_t Mic_Audio_Sample_Resolution;
+ uint16_t Mic_Sample_Rate_Capability;
+ uint8_t Keyboard_Data_Format;
+ uint8_t pointing_device_data_format;
+ uint16_t content_protection_type;
+ uint16_t Mfr_Name;
+ uint16_t Product_Code;
+ uint16_t Reserved_3;
+ uint32_t Serial_Number;
+ uint8_t Week_of_Manufacture;
+ uint8_t Year_of_Manufacture;
+
+ uint16_t crc16;
+} mddi_client_capability_type;
+
+
+struct __attribute__((packed)) mddi_video_stream {
+ uint16_t length;
+ uint16_t type; /* 16 */
+ uint16_t client_id; /* 0 */
+
+ uint16_t video_data_format_descriptor;
+/* format of each pixel in the Pixel Data in the present stream in the
+ * present packet.
+ * If bits [15:13] = 000 monochrome
+ * If bits [15:13] = 001 color pixels (palette).
+ * If bits [15:13] = 010 color pixels in raw RGB
+ * If bits [15:13] = 011 data in 4:2:2 Y Cb Cr format
+ * If bits [15:13] = 100 Bayer pixels
+ */
+
+ uint16_t pixel_data_attributes;
+/* interpreted as follows:
+ * Bits [1:0] = 11 pixel data is displayed to both eyes
+ * Bits [1:0] = 10 pixel data is routed to the left eye only.
+ * Bits [1:0] = 01 pixel data is routed to the right eye only.
+ * Bits [1:0] = 00 pixel data is routed to the alternate display.
+ * Bit 2 is 0 Pixel Data is in the standard progressive format.
+ * Bit 2 is 1 Pixel Data is in interlace format.
+ * Bit 3 is 0 Pixel Data is in the standard progressive format.
+ * Bit 3 is 1 Pixel Data is in alternate pixel format.
+ * Bit 4 is 0 Pixel Data is to or from the display frame buffer.
+ * Bit 4 is 1 Pixel Data is to or from the camera.
+ * Bit 5 is 0 pixel data contains the next consecutive row of pixels.
+ * Bit 5 is 1 X Left Edge, Y Top Edge, X Right Edge, Y Bottom Edge,
+ * X Start, and Y Start parameters are not defined and
+ * shall be ignored by the client.
+ * Bits [7:6] = 01 Pixel data is written to the offline image buffer.
+ * Bits [7:6] = 00 Pixel data is written to the buffer to refresh display.
+ * Bits [7:6] = 11 Pixel data is written to all image buffers.
+ * Bits [7:6] = 10 Invalid. Reserved for future use.
+ * Bits 8 through 11 alternate display number.
+ * Bits 12 through 14 are reserved for future use and shall be set to zero.
+ * Bit 15 is 1 the row of pixels is the last row of pixels in a frame.
+ */
+
+ uint16_t x_left_edge;
+ uint16_t y_top_edge;
+ /* X,Y coordinate of the top left edge of the screen window */
+
+ uint16_t x_right_edge;
+ uint16_t y_bottom_edge;
+ /* X,Y coordinate of the bottom right edge of the window being
+ * updated. */
+
+ uint16_t x_start;
+ uint16_t y_start;
+ /* (X Start, Y Start) is the first pixel in the Pixel Data field
+ * below. */
+
+ uint16_t pixel_count;
+ /* number of pixels in the Pixel Data field below. */
+
+ uint16_t parameter_CRC;
+ /* 16-bit CRC of all bytes from the Packet Length to the Pixel Count. */
+
+ uint16_t reserved;
+ /* 16-bit variable to make structure align on 4 byte boundary */
+};
+
+#define TYPE_VIDEO_STREAM 16
+#define TYPE_CLIENT_CAPS 66
+#define TYPE_REGISTER_ACCESS 146
+#define TYPE_CLIENT_STATUS 70
+
+struct __attribute__((packed)) mddi_register_access {
+ uint16_t length;
+ uint16_t type; /* 146 */
+ uint16_t client_id;
+
+ uint16_t read_write_info;
+ /* Bits 13:0 a 14-bit unsigned integer that specifies the number of
+ * 32-bit Register Data List items to be transferred in the
+ * Register Data List field.
+ * Bits[15:14] = 00 Write to register(s);
+ * Bits[15:14] = 10 Read from register(s);
+ * Bits[15:14] = 11 Response to a Read.
+ * Bits[15:14] = 01 this value is reserved for future use. */
+#define MDDI_WRITE (0 << 14)
+#define MDDI_READ (2 << 14)
+#define MDDI_READ_RESP (3 << 14)
+
+ uint32_t register_address;
+ /* the register address that is to be written to or read from. */
+
+ uint16_t crc16;
+
+ uint32_t register_data_list;
+ /* list of 4-byte register data values for/from client registers */
+};
+
+struct __attribute__((packed)) mddi_llentry {
+ uint16_t flags;
+ uint16_t header_count;
+ uint16_t data_count;
+ dma_addr_t data; /* 32 bit */
+ struct mddi_llentry *next;
+ uint16_t reserved;
+ union {
+ struct mddi_video_stream v;
+ struct mddi_register_access r;
+ uint32_t _[12];
+ } u;
+};
+
+#endif
diff --git a/drivers/video/msm/mdp.c b/drivers/video/msm/mdp.c
new file mode 100644
index 0000000..99636a2
--- /dev/null
+++ b/drivers/video/msm/mdp.c
@@ -0,0 +1,538 @@
+/* drivers/video/msm_fb/mdp.c
+ *
+ * MSM MDP Interface (used by framebuffer core)
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/kernel.h>
+#include <linux/fb.h>
+#include <linux/msm_mdp.h>
+#include <linux/interrupt.h>
+#include <linux/wait.h>
+#include <linux/clk.h>
+#include <linux/file.h>
+#ifdef CONFIG_ANDROID_PMEM
+#include <linux/android_pmem.h>
+#endif
+#include <linux/major.h>
+
+#include <mach/msm_iomap.h>
+#include <mach/msm_fb.h>
+#include <linux/platform_device.h>
+
+#include "mdp_hw.h"
+
+struct class *mdp_class;
+
+#define MDP_CMD_DEBUG_ACCESS_BASE (0x10000)
+
+static uint16_t mdp_default_ccs[] = {
+ 0x254, 0x000, 0x331, 0x254, 0xF38, 0xE61, 0x254, 0x409, 0x000,
+ 0x010, 0x080, 0x080
+};
+
+static DECLARE_WAIT_QUEUE_HEAD(mdp_dma2_waitqueue);
+static DECLARE_WAIT_QUEUE_HEAD(mdp_ppp_waitqueue);
+static struct msmfb_callback *dma_callback;
+static struct clk *clk;
+static unsigned int mdp_irq_mask;
+static DEFINE_SPINLOCK(mdp_lock);
+DEFINE_MUTEX(mdp_mutex);
+
+static int enable_mdp_irq(struct mdp_info *mdp, uint32_t mask)
+{
+ unsigned long irq_flags;
+ int ret = 0;
+
+ BUG_ON(!mask);
+
+ spin_lock_irqsave(&mdp_lock, irq_flags);
+ /* if the mask bits are already set return an error, this interrupt
+ * is already enabled */
+ if (mdp_irq_mask & mask) {
+ printk(KERN_ERR "mdp irq already on already on %x %x\n",
+ mdp_irq_mask, mask);
+ ret = -1;
+ }
+ /* if the mdp irq is not already enabled enable it */
+ if (!mdp_irq_mask) {
+ if (clk)
+ clk_enable(clk);
+ enable_irq(mdp->irq);
+ }
+
+ /* update the irq mask to reflect the fact that the interrupt is
+ * enabled */
+ mdp_irq_mask |= mask;
+ spin_unlock_irqrestore(&mdp_lock, irq_flags);
+ return ret;
+}
+
+static int locked_disable_mdp_irq(struct mdp_info *mdp, uint32_t mask)
+{
+ /* this interrupt is already disabled! */
+ if (!(mdp_irq_mask & mask)) {
+ printk(KERN_ERR "mdp irq already off %x %x\n",
+ mdp_irq_mask, mask);
+ return -1;
+ }
+ /* update the irq mask to reflect the fact that the interrupt is
+ * disabled */
+ mdp_irq_mask &= ~(mask);
+ /* if no one is waiting on the interrupt, disable it */
+ if (!mdp_irq_mask) {
+ disable_irq(mdp->irq);
+ if (clk)
+ clk_disable(clk);
+ }
+ return 0;
+}
+
+static int disable_mdp_irq(struct mdp_info *mdp, uint32_t mask)
+{
+ unsigned long irq_flags;
+ int ret;
+
+ spin_lock_irqsave(&mdp_lock, irq_flags);
+ ret = locked_disable_mdp_irq(mdp, mask);
+ spin_unlock_irqrestore(&mdp_lock, irq_flags);
+ return ret;
+}
+
+static irqreturn_t mdp_isr(int irq, void *data)
+{
+ uint32_t status;
+ unsigned long irq_flags;
+ struct mdp_info *mdp = data;
+
+ spin_lock_irqsave(&mdp_lock, irq_flags);
+
+ status = mdp_readl(mdp, MDP_INTR_STATUS);
+ mdp_writel(mdp, status, MDP_INTR_CLEAR);
+
+ status &= mdp_irq_mask;
+ if (status & DL0_DMA2_TERM_DONE) {
+ if (dma_callback) {
+ dma_callback->func(dma_callback);
+ dma_callback = NULL;
+ }
+ wake_up(&mdp_dma2_waitqueue);
+ }
+
+ if (status & DL0_ROI_DONE)
+ wake_up(&mdp_ppp_waitqueue);
+
+ if (status)
+ locked_disable_mdp_irq(mdp, status);
+
+ spin_unlock_irqrestore(&mdp_lock, irq_flags);
+ return IRQ_HANDLED;
+}
+
+static uint32_t mdp_check_mask(uint32_t mask)
+{
+ uint32_t ret;
+ unsigned long irq_flags;
+
+ spin_lock_irqsave(&mdp_lock, irq_flags);
+ ret = mdp_irq_mask & mask;
+ spin_unlock_irqrestore(&mdp_lock, irq_flags);
+ return ret;
+}
+
+static int mdp_wait(struct mdp_info *mdp, uint32_t mask, wait_queue_head_t *wq)
+{
+ int ret = 0;
+ unsigned long irq_flags;
+
+ wait_event_timeout(*wq, !mdp_check_mask(mask), HZ);
+
+ spin_lock_irqsave(&mdp_lock, irq_flags);
+ if (mdp_irq_mask & mask) {
+ locked_disable_mdp_irq(mdp, mask);
+ printk(KERN_WARNING "timeout waiting for mdp to complete %x\n",
+ mask);
+ ret = -ETIMEDOUT;
+ }
+ spin_unlock_irqrestore(&mdp_lock, irq_flags);
+
+ return ret;
+}
+
+void mdp_dma_wait(struct mdp_device *mdp_dev)
+{
+#define MDP_MAX_TIMEOUTS 20
+ static int timeout_count;
+ struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+
+ if (mdp_wait(mdp, DL0_DMA2_TERM_DONE, &mdp_dma2_waitqueue) == -ETIMEDOUT)
+ timeout_count++;
+ else
+ timeout_count = 0;
+
+ if (timeout_count > MDP_MAX_TIMEOUTS) {
+ printk(KERN_ERR "mdp: dma failed %d times, somethings wrong!\n",
+ MDP_MAX_TIMEOUTS);
+ BUG();
+ }
+}
+
+static int mdp_ppp_wait(struct mdp_info *mdp)
+{
+ return mdp_wait(mdp, DL0_ROI_DONE, &mdp_ppp_waitqueue);
+}
+
+void mdp_dma_to_mddi(struct mdp_info *mdp, uint32_t addr, uint32_t stride,
+ uint32_t width, uint32_t height, uint32_t x, uint32_t y,
+ struct msmfb_callback *callback)
+{
+ uint32_t dma2_cfg;
+ uint16_t ld_param = 0; /* 0=PRIM, 1=SECD, 2=EXT */
+
+ if (enable_mdp_irq(mdp, DL0_DMA2_TERM_DONE)) {
+ printk(KERN_ERR "mdp_dma_to_mddi: busy\n");
+ return;
+ }
+
+ dma_callback = callback;
+
+ dma2_cfg = DMA_PACK_TIGHT |
+ DMA_PACK_ALIGN_LSB |
+ DMA_PACK_PATTERN_RGB |
+ DMA_OUT_SEL_AHB |
+ DMA_IBUF_NONCONTIGUOUS;
+
+ dma2_cfg |= DMA_IBUF_FORMAT_RGB565;
+
+ dma2_cfg |= DMA_OUT_SEL_MDDI;
+
+ dma2_cfg |= DMA_MDDI_DMAOUT_LCD_SEL_PRIMARY;
+
+ dma2_cfg |= DMA_DITHER_EN;
+
+ /* setup size, address, and stride */
+ mdp_writel(mdp, (height << 16) | (width),
+ MDP_CMD_DEBUG_ACCESS_BASE + 0x0184);
+ mdp_writel(mdp, addr, MDP_CMD_DEBUG_ACCESS_BASE + 0x0188);
+ mdp_writel(mdp, stride, MDP_CMD_DEBUG_ACCESS_BASE + 0x018C);
+
+ /* 666 18BPP */
+ dma2_cfg |= DMA_DSTC0G_6BITS | DMA_DSTC1B_6BITS | DMA_DSTC2R_6BITS;
+
+ /* set y & x offset and MDDI transaction parameters */
+ mdp_writel(mdp, (y << 16) | (x), MDP_CMD_DEBUG_ACCESS_BASE + 0x0194);
+ mdp_writel(mdp, ld_param, MDP_CMD_DEBUG_ACCESS_BASE + 0x01a0);
+ mdp_writel(mdp, (MDDI_VDO_PACKET_DESC << 16) | MDDI_VDO_PACKET_PRIM,
+ MDP_CMD_DEBUG_ACCESS_BASE + 0x01a4);
+
+ mdp_writel(mdp, dma2_cfg, MDP_CMD_DEBUG_ACCESS_BASE + 0x0180);
+
+ /* start DMA2 */
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0044);
+}
+
+void mdp_dma(struct mdp_device *mdp_dev, uint32_t addr, uint32_t stride,
+ uint32_t width, uint32_t height, uint32_t x, uint32_t y,
+ struct msmfb_callback *callback, int interface)
+{
+ struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+
+ if (interface == MSM_MDDI_PMDH_INTERFACE) {
+ mdp_dma_to_mddi(mdp, addr, stride, width, height, x, y,
+ callback);
+ }
+}
+
+int get_img(struct mdp_img *img, struct fb_info *info,
+ unsigned long *start, unsigned long *len,
+ struct file **filep)
+{
+ int put_needed, ret = 0;
+ struct file *file;
+ unsigned long vstart;
+
+#ifdef CONFIG_ANDROID_PMEM
+ if (!get_pmem_file(img->memory_id, start, &vstart, len, filep))
+ return 0;
+#endif
+
+ file = fget_light(img->memory_id, &put_needed);
+ if (file == NULL)
+ return -1;
+
+ if (MAJOR(file->f_dentry->d_inode->i_rdev) == FB_MAJOR) {
+ *start = info->fix.smem_start;
+ *len = info->fix.smem_len;
+ } else
+ ret = -1;
+ fput_light(file, put_needed);
+
+ return ret;
+}
+
+void put_img(struct file *src_file, struct file *dst_file)
+{
+#ifdef CONFIG_ANDROID_PMEM
+ if (src_file)
+ put_pmem_file(src_file);
+ if (dst_file)
+ put_pmem_file(dst_file);
+#endif
+}
+
+int mdp_blit(struct mdp_device *mdp_dev, struct fb_info *fb,
+ struct mdp_blit_req *req)
+{
+ int ret;
+ unsigned long src_start = 0, src_len = 0, dst_start = 0, dst_len = 0;
+ struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+ struct file *src_file = 0, *dst_file = 0;
+
+ /* WORKAROUND FOR HARDWARE BUG IN BG TILE FETCH */
+ if (unlikely(req->src_rect.h == 0 ||
+ req->src_rect.w == 0)) {
+ printk(KERN_ERR "mpd_ppp: src img of zero size!\n");
+ return -EINVAL;
+ }
+ if (unlikely(req->dst_rect.h == 0 ||
+ req->dst_rect.w == 0))
+ return -EINVAL;
+
+ /* do this first so that if this fails, the caller can always
+ * safely call put_img */
+ if (unlikely(get_img(&req->src, fb, &src_start, &src_len, &src_file))) {
+ printk(KERN_ERR "mpd_ppp: could not retrieve src image from "
+ "memory\n");
+ return -EINVAL;
+ }
+
+ if (unlikely(get_img(&req->dst, fb, &dst_start, &dst_len, &dst_file))) {
+ printk(KERN_ERR "mpd_ppp: could not retrieve dst image from "
+ "memory\n");
+#ifdef CONFIG_ANDROID_PMEM
+ put_pmem_file(src_file);
+#endif
+ return -EINVAL;
+ }
+ mutex_lock(&mdp_mutex);
+
+ /* transp_masking unimplemented */
+ req->transp_mask = MDP_TRANSP_NOP;
+ if (unlikely((req->transp_mask != MDP_TRANSP_NOP ||
+ req->alpha != MDP_ALPHA_NOP ||
+ HAS_ALPHA(req->src.format)) &&
+ (req->flags & MDP_ROT_90 &&
+ req->dst_rect.w <= 16 && req->dst_rect.h >= 16))) {
+ int i;
+ unsigned int tiles = req->dst_rect.h / 16;
+ unsigned int remainder = req->dst_rect.h % 16;
+ req->src_rect.w = 16*req->src_rect.w / req->dst_rect.h;
+ req->dst_rect.h = 16;
+ for (i = 0; i < tiles; i++) {
+ enable_mdp_irq(mdp, DL0_ROI_DONE);
+ ret = mdp_ppp_blit(mdp, req, src_file, src_start,
+ src_len, dst_file, dst_start,
+ dst_len);
+ if (ret)
+ goto err_bad_blit;
+ ret = mdp_ppp_wait(mdp);
+ if (ret)
+ goto err_wait_failed;
+ req->dst_rect.y += 16;
+ req->src_rect.x += req->src_rect.w;
+ }
+ if (!remainder)
+ goto end;
+ req->src_rect.w = remainder*req->src_rect.w / req->dst_rect.h;
+ req->dst_rect.h = remainder;
+ }
+ enable_mdp_irq(mdp, DL0_ROI_DONE);
+ ret = mdp_ppp_blit(mdp, req, src_file, src_start, src_len, dst_file,
+ dst_start,
+ dst_len);
+ if (ret)
+ goto err_bad_blit;
+ ret = mdp_ppp_wait(mdp);
+ if (ret)
+ goto err_wait_failed;
+end:
+ put_img(src_file, dst_file);
+ mutex_unlock(&mdp_mutex);
+ return 0;
+err_bad_blit:
+ disable_mdp_irq(mdp, DL0_ROI_DONE);
+err_wait_failed:
+ put_img(src_file, dst_file);
+ mutex_unlock(&mdp_mutex);
+ return ret;
+}
+
+void mdp_set_grp_disp(struct mdp_device *mdp_dev, unsigned disp_id)
+{
+ struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+
+ disp_id &= 0xf;
+ mdp_writel(mdp, disp_id, MDP_FULL_BYPASS_WORD43);
+}
+
+int register_mdp_client(struct class_interface *cint)
+{
+ if (!mdp_class) {
+ pr_err("mdp: no mdp_class when registering mdp client\n");
+ return -ENODEV;
+ }
+ cint->class = mdp_class;
+ return class_interface_register(cint);
+}
+
+#include "mdp_csc_table.h"
+#include "mdp_scale_tables.h"
+
+int mdp_probe(struct platform_device *pdev)
+{
+ struct resource *resource;
+ int ret;
+ int n;
+ struct mdp_info *mdp;
+
+ resource = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ if (!resource) {
+ pr_err("mdp: can not get mdp mem resource!\n");
+ return -ENOMEM;
+ }
+
+ mdp = kzalloc(sizeof(struct mdp_info), GFP_KERNEL);
+ if (!mdp)
+ return -ENOMEM;
+
+ mdp->irq = platform_get_irq(pdev, 0);
+ if (mdp->irq < 0) {
+ pr_err("mdp: can not get mdp irq\n");
+ ret = mdp->irq;
+ goto error_get_irq;
+ }
+
+ mdp->base = ioremap(resource->start,
+ resource->end - resource->start);
+ if (mdp->base == 0) {
+ printk(KERN_ERR "msmfb: cannot allocate mdp regs!\n");
+ ret = -ENOMEM;
+ goto error_ioremap;
+ }
+
+ mdp->mdp_dev.dma = mdp_dma;
+ mdp->mdp_dev.dma_wait = mdp_dma_wait;
+ mdp->mdp_dev.blit = mdp_blit;
+ mdp->mdp_dev.set_grp_disp = mdp_set_grp_disp;
+
+ clk = clk_get(&pdev->dev, "mdp_clk");
+ if (IS_ERR(clk)) {
+ printk(KERN_INFO "mdp: failed to get mdp clk");
+ return PTR_ERR(clk);
+ }
+
+ ret = request_irq(mdp->irq, mdp_isr, IRQF_DISABLED, "msm_mdp", mdp);
+ if (ret)
+ goto error_request_irq;
+ disable_irq(mdp->irq);
+ mdp_irq_mask = 0;
+
+ /* debug interface write access */
+ mdp_writel(mdp, 1, 0x60);
+
+ mdp_writel(mdp, MDP_ANY_INTR_MASK, MDP_INTR_ENABLE);
+ mdp_writel(mdp, 1, MDP_EBI2_PORTMAP_MODE);
+
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01f8);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01fc);
+
+ for (n = 0; n < ARRAY_SIZE(csc_table); n++)
+ mdp_writel(mdp, csc_table[n].val, csc_table[n].reg);
+
+ /* clear up unused fg/main registers */
+ /* comp.plane 2&3 ystride */
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0120);
+
+ /* unpacked pattern */
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x012c);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0130);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0134);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0158);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x015c);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0160);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0170);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0174);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x017c);
+
+ /* comp.plane 2 & 3 */
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0114);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0118);
+
+ /* clear unused bg registers */
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01c8);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01d0);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01dc);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01e0);
+ mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01e4);
+
+ for (n = 0; n < ARRAY_SIZE(mdp_upscale_table); n++)
+ mdp_writel(mdp, mdp_upscale_table[n].val,
+ mdp_upscale_table[n].reg);
+
+ for (n = 0; n < 9; n++)
+ mdp_writel(mdp, mdp_default_ccs[n], 0x40440 + 4 * n);
+ mdp_writel(mdp, mdp_default_ccs[9], 0x40500 + 4 * 0);
+ mdp_writel(mdp, mdp_default_ccs[10], 0x40500 + 4 * 0);
+ mdp_writel(mdp, mdp_default_ccs[11], 0x40500 + 4 * 0);
+
+ /* register mdp device */
+ mdp->mdp_dev.dev.parent = &pdev->dev;
+ mdp->mdp_dev.dev.class = mdp_class;
+ snprintf(mdp->mdp_dev.dev.bus_id, BUS_ID_SIZE, "mdp%d", pdev->id);
+
+ /* if you can remove the platform device you'd have to implement
+ * this:
+ mdp_dev.release = mdp_class; */
+
+ ret = device_register(&mdp->mdp_dev.dev);
+ if (ret)
+ goto error_device_register;
+ return 0;
+
+error_device_register:
+ free_irq(mdp->irq, mdp);
+error_request_irq:
+ iounmap(mdp->base);
+error_get_irq:
+error_ioremap:
+ kfree(mdp);
+ return ret;
+}
+
+static struct platform_driver msm_mdp_driver = {
+ .probe = mdp_probe,
+ .driver = {.name = "msm_mdp"},
+};
+
+static int __init mdp_init(void)
+{
+ mdp_class = class_create(THIS_MODULE, "msm_mdp");
+ if (IS_ERR(mdp_class)) {
+ printk(KERN_ERR "Error creating mdp class\n");
+ return PTR_ERR(mdp_class);
+ }
+ return platform_driver_register(&msm_mdp_driver);
+}
+
+subsys_initcall(mdp_init);
diff --git a/drivers/video/msm/mdp_csc_table.h b/drivers/video/msm/mdp_csc_table.h
new file mode 100644
index 0000000..d1cde30
--- /dev/null
+++ b/drivers/video/msm/mdp_csc_table.h
@@ -0,0 +1,582 @@
+/* drivers/video/msm_fb/mdp_csc_table.h
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+static struct {
+ uint32_t reg;
+ uint32_t val;
+} csc_table[] = {
+ { 0x40400, 0x83 },
+ { 0x40404, 0x102 },
+ { 0x40408, 0x32 },
+ { 0x4040c, 0xffffffb5 },
+ { 0x40410, 0xffffff6c },
+ { 0x40414, 0xe1 },
+ { 0x40418, 0xe1 },
+ { 0x4041c, 0xffffff45 },
+ { 0x40420, 0xffffffdc },
+ { 0x40440, 0x254 },
+ { 0x40444, 0x0 },
+ { 0x40448, 0x331 },
+ { 0x4044c, 0x254 },
+ { 0x40450, 0xffffff38 },
+ { 0x40454, 0xfffffe61 },
+ { 0x40458, 0x254 },
+ { 0x4045c, 0x409 },
+ { 0x40460, 0x0 },
+ { 0x40480, 0x5d },
+ { 0x40484, 0x13a },
+ { 0x40488, 0x20 },
+ { 0x4048c, 0xffffffcd },
+ { 0x40490, 0xffffff54 },
+ { 0x40494, 0xe1 },
+ { 0x40498, 0xe1 },
+ { 0x4049c, 0xffffff35 },
+ { 0x404a0, 0xffffffec },
+ { 0x404c0, 0x254 },
+ { 0x404c4, 0x0 },
+ { 0x404c8, 0x396 },
+ { 0x404cc, 0x254 },
+ { 0x404d0, 0xffffff94 },
+ { 0x404d4, 0xfffffef0 },
+ { 0x404d8, 0x254 },
+ { 0x404dc, 0x43a },
+ { 0x404e0, 0x0 },
+ { 0x40500, 0x10 },
+ { 0x40504, 0x80 },
+ { 0x40508, 0x80 },
+ { 0x40540, 0x10 },
+ { 0x40544, 0x80 },
+ { 0x40548, 0x80 },
+ { 0x40580, 0x10 },
+ { 0x40584, 0xeb },
+ { 0x40588, 0x10 },
+ { 0x4058c, 0xf0 },
+ { 0x405c0, 0x10 },
+ { 0x405c4, 0xeb },
+ { 0x405c8, 0x10 },
+ { 0x405cc, 0xf0 },
+ { 0x40800, 0x0 },
+ { 0x40804, 0x151515 },
+ { 0x40808, 0x1d1d1d },
+ { 0x4080c, 0x232323 },
+ { 0x40810, 0x272727 },
+ { 0x40814, 0x2b2b2b },
+ { 0x40818, 0x2f2f2f },
+ { 0x4081c, 0x333333 },
+ { 0x40820, 0x363636 },
+ { 0x40824, 0x393939 },
+ { 0x40828, 0x3b3b3b },
+ { 0x4082c, 0x3e3e3e },
+ { 0x40830, 0x404040 },
+ { 0x40834, 0x434343 },
+ { 0x40838, 0x454545 },
+ { 0x4083c, 0x474747 },
+ { 0x40840, 0x494949 },
+ { 0x40844, 0x4b4b4b },
+ { 0x40848, 0x4d4d4d },
+ { 0x4084c, 0x4f4f4f },
+ { 0x40850, 0x515151 },
+ { 0x40854, 0x535353 },
+ { 0x40858, 0x555555 },
+ { 0x4085c, 0x565656 },
+ { 0x40860, 0x585858 },
+ { 0x40864, 0x5a5a5a },
+ { 0x40868, 0x5b5b5b },
+ { 0x4086c, 0x5d5d5d },
+ { 0x40870, 0x5e5e5e },
+ { 0x40874, 0x606060 },
+ { 0x40878, 0x616161 },
+ { 0x4087c, 0x636363 },
+ { 0x40880, 0x646464 },
+ { 0x40884, 0x666666 },
+ { 0x40888, 0x676767 },
+ { 0x4088c, 0x686868 },
+ { 0x40890, 0x6a6a6a },
+ { 0x40894, 0x6b6b6b },
+ { 0x40898, 0x6c6c6c },
+ { 0x4089c, 0x6e6e6e },
+ { 0x408a0, 0x6f6f6f },
+ { 0x408a4, 0x707070 },
+ { 0x408a8, 0x717171 },
+ { 0x408ac, 0x727272 },
+ { 0x408b0, 0x747474 },
+ { 0x408b4, 0x757575 },
+ { 0x408b8, 0x767676 },
+ { 0x408bc, 0x777777 },
+ { 0x408c0, 0x787878 },
+ { 0x408c4, 0x797979 },
+ { 0x408c8, 0x7a7a7a },
+ { 0x408cc, 0x7c7c7c },
+ { 0x408d0, 0x7d7d7d },
+ { 0x408d4, 0x7e7e7e },
+ { 0x408d8, 0x7f7f7f },
+ { 0x408dc, 0x808080 },
+ { 0x408e0, 0x818181 },
+ { 0x408e4, 0x828282 },
+ { 0x408e8, 0x838383 },
+ { 0x408ec, 0x848484 },
+ { 0x408f0, 0x858585 },
+ { 0x408f4, 0x868686 },
+ { 0x408f8, 0x878787 },
+ { 0x408fc, 0x888888 },
+ { 0x40900, 0x898989 },
+ { 0x40904, 0x8a8a8a },
+ { 0x40908, 0x8b8b8b },
+ { 0x4090c, 0x8c8c8c },
+ { 0x40910, 0x8d8d8d },
+ { 0x40914, 0x8e8e8e },
+ { 0x40918, 0x8f8f8f },
+ { 0x4091c, 0x8f8f8f },
+ { 0x40920, 0x909090 },
+ { 0x40924, 0x919191 },
+ { 0x40928, 0x929292 },
+ { 0x4092c, 0x939393 },
+ { 0x40930, 0x949494 },
+ { 0x40934, 0x959595 },
+ { 0x40938, 0x969696 },
+ { 0x4093c, 0x969696 },
+ { 0x40940, 0x979797 },
+ { 0x40944, 0x989898 },
+ { 0x40948, 0x999999 },
+ { 0x4094c, 0x9a9a9a },
+ { 0x40950, 0x9b9b9b },
+ { 0x40954, 0x9c9c9c },
+ { 0x40958, 0x9c9c9c },
+ { 0x4095c, 0x9d9d9d },
+ { 0x40960, 0x9e9e9e },
+ { 0x40964, 0x9f9f9f },
+ { 0x40968, 0xa0a0a0 },
+ { 0x4096c, 0xa0a0a0 },
+ { 0x40970, 0xa1a1a1 },
+ { 0x40974, 0xa2a2a2 },
+ { 0x40978, 0xa3a3a3 },
+ { 0x4097c, 0xa4a4a4 },
+ { 0x40980, 0xa4a4a4 },
+ { 0x40984, 0xa5a5a5 },
+ { 0x40988, 0xa6a6a6 },
+ { 0x4098c, 0xa7a7a7 },
+ { 0x40990, 0xa7a7a7 },
+ { 0x40994, 0xa8a8a8 },
+ { 0x40998, 0xa9a9a9 },
+ { 0x4099c, 0xaaaaaa },
+ { 0x409a0, 0xaaaaaa },
+ { 0x409a4, 0xababab },
+ { 0x409a8, 0xacacac },
+ { 0x409ac, 0xadadad },
+ { 0x409b0, 0xadadad },
+ { 0x409b4, 0xaeaeae },
+ { 0x409b8, 0xafafaf },
+ { 0x409bc, 0xafafaf },
+ { 0x409c0, 0xb0b0b0 },
+ { 0x409c4, 0xb1b1b1 },
+ { 0x409c8, 0xb2b2b2 },
+ { 0x409cc, 0xb2b2b2 },
+ { 0x409d0, 0xb3b3b3 },
+ { 0x409d4, 0xb4b4b4 },
+ { 0x409d8, 0xb4b4b4 },
+ { 0x409dc, 0xb5b5b5 },
+ { 0x409e0, 0xb6b6b6 },
+ { 0x409e4, 0xb6b6b6 },
+ { 0x409e8, 0xb7b7b7 },
+ { 0x409ec, 0xb8b8b8 },
+ { 0x409f0, 0xb8b8b8 },
+ { 0x409f4, 0xb9b9b9 },
+ { 0x409f8, 0xbababa },
+ { 0x409fc, 0xbababa },
+ { 0x40a00, 0xbbbbbb },
+ { 0x40a04, 0xbcbcbc },
+ { 0x40a08, 0xbcbcbc },
+ { 0x40a0c, 0xbdbdbd },
+ { 0x40a10, 0xbebebe },
+ { 0x40a14, 0xbebebe },
+ { 0x40a18, 0xbfbfbf },
+ { 0x40a1c, 0xc0c0c0 },
+ { 0x40a20, 0xc0c0c0 },
+ { 0x40a24, 0xc1c1c1 },
+ { 0x40a28, 0xc1c1c1 },
+ { 0x40a2c, 0xc2c2c2 },
+ { 0x40a30, 0xc3c3c3 },
+ { 0x40a34, 0xc3c3c3 },
+ { 0x40a38, 0xc4c4c4 },
+ { 0x40a3c, 0xc5c5c5 },
+ { 0x40a40, 0xc5c5c5 },
+ { 0x40a44, 0xc6c6c6 },
+ { 0x40a48, 0xc6c6c6 },
+ { 0x40a4c, 0xc7c7c7 },
+ { 0x40a50, 0xc8c8c8 },
+ { 0x40a54, 0xc8c8c8 },
+ { 0x40a58, 0xc9c9c9 },
+ { 0x40a5c, 0xc9c9c9 },
+ { 0x40a60, 0xcacaca },
+ { 0x40a64, 0xcbcbcb },
+ { 0x40a68, 0xcbcbcb },
+ { 0x40a6c, 0xcccccc },
+ { 0x40a70, 0xcccccc },
+ { 0x40a74, 0xcdcdcd },
+ { 0x40a78, 0xcecece },
+ { 0x40a7c, 0xcecece },
+ { 0x40a80, 0xcfcfcf },
+ { 0x40a84, 0xcfcfcf },
+ { 0x40a88, 0xd0d0d0 },
+ { 0x40a8c, 0xd0d0d0 },
+ { 0x40a90, 0xd1d1d1 },
+ { 0x40a94, 0xd2d2d2 },
+ { 0x40a98, 0xd2d2d2 },
+ { 0x40a9c, 0xd3d3d3 },
+ { 0x40aa0, 0xd3d3d3 },
+ { 0x40aa4, 0xd4d4d4 },
+ { 0x40aa8, 0xd4d4d4 },
+ { 0x40aac, 0xd5d5d5 },
+ { 0x40ab0, 0xd6d6d6 },
+ { 0x40ab4, 0xd6d6d6 },
+ { 0x40ab8, 0xd7d7d7 },
+ { 0x40abc, 0xd7d7d7 },
+ { 0x40ac0, 0xd8d8d8 },
+ { 0x40ac4, 0xd8d8d8 },
+ { 0x40ac8, 0xd9d9d9 },
+ { 0x40acc, 0xd9d9d9 },
+ { 0x40ad0, 0xdadada },
+ { 0x40ad4, 0xdbdbdb },
+ { 0x40ad8, 0xdbdbdb },
+ { 0x40adc, 0xdcdcdc },
+ { 0x40ae0, 0xdcdcdc },
+ { 0x40ae4, 0xdddddd },
+ { 0x40ae8, 0xdddddd },
+ { 0x40aec, 0xdedede },
+ { 0x40af0, 0xdedede },
+ { 0x40af4, 0xdfdfdf },
+ { 0x40af8, 0xdfdfdf },
+ { 0x40afc, 0xe0e0e0 },
+ { 0x40b00, 0xe0e0e0 },
+ { 0x40b04, 0xe1e1e1 },
+ { 0x40b08, 0xe1e1e1 },
+ { 0x40b0c, 0xe2e2e2 },
+ { 0x40b10, 0xe3e3e3 },
+ { 0x40b14, 0xe3e3e3 },
+ { 0x40b18, 0xe4e4e4 },
+ { 0x40b1c, 0xe4e4e4 },
+ { 0x40b20, 0xe5e5e5 },
+ { 0x40b24, 0xe5e5e5 },
+ { 0x40b28, 0xe6e6e6 },
+ { 0x40b2c, 0xe6e6e6 },
+ { 0x40b30, 0xe7e7e7 },
+ { 0x40b34, 0xe7e7e7 },
+ { 0x40b38, 0xe8e8e8 },
+ { 0x40b3c, 0xe8e8e8 },
+ { 0x40b40, 0xe9e9e9 },
+ { 0x40b44, 0xe9e9e9 },
+ { 0x40b48, 0xeaeaea },
+ { 0x40b4c, 0xeaeaea },
+ { 0x40b50, 0xebebeb },
+ { 0x40b54, 0xebebeb },
+ { 0x40b58, 0xececec },
+ { 0x40b5c, 0xececec },
+ { 0x40b60, 0xededed },
+ { 0x40b64, 0xededed },
+ { 0x40b68, 0xeeeeee },
+ { 0x40b6c, 0xeeeeee },
+ { 0x40b70, 0xefefef },
+ { 0x40b74, 0xefefef },
+ { 0x40b78, 0xf0f0f0 },
+ { 0x40b7c, 0xf0f0f0 },
+ { 0x40b80, 0xf1f1f1 },
+ { 0x40b84, 0xf1f1f1 },
+ { 0x40b88, 0xf2f2f2 },
+ { 0x40b8c, 0xf2f2f2 },
+ { 0x40b90, 0xf2f2f2 },
+ { 0x40b94, 0xf3f3f3 },
+ { 0x40b98, 0xf3f3f3 },
+ { 0x40b9c, 0xf4f4f4 },
+ { 0x40ba0, 0xf4f4f4 },
+ { 0x40ba4, 0xf5f5f5 },
+ { 0x40ba8, 0xf5f5f5 },
+ { 0x40bac, 0xf6f6f6 },
+ { 0x40bb0, 0xf6f6f6 },
+ { 0x40bb4, 0xf7f7f7 },
+ { 0x40bb8, 0xf7f7f7 },
+ { 0x40bbc, 0xf8f8f8 },
+ { 0x40bc0, 0xf8f8f8 },
+ { 0x40bc4, 0xf9f9f9 },
+ { 0x40bc8, 0xf9f9f9 },
+ { 0x40bcc, 0xfafafa },
+ { 0x40bd0, 0xfafafa },
+ { 0x40bd4, 0xfafafa },
+ { 0x40bd8, 0xfbfbfb },
+ { 0x40bdc, 0xfbfbfb },
+ { 0x40be0, 0xfcfcfc },
+ { 0x40be4, 0xfcfcfc },
+ { 0x40be8, 0xfdfdfd },
+ { 0x40bec, 0xfdfdfd },
+ { 0x40bf0, 0xfefefe },
+ { 0x40bf4, 0xfefefe },
+ { 0x40bf8, 0xffffff },
+ { 0x40bfc, 0xffffff },
+ { 0x40c00, 0x0 },
+ { 0x40c04, 0x0 },
+ { 0x40c08, 0x0 },
+ { 0x40c0c, 0x0 },
+ { 0x40c10, 0x0 },
+ { 0x40c14, 0x0 },
+ { 0x40c18, 0x0 },
+ { 0x40c1c, 0x0 },
+ { 0x40c20, 0x0 },
+ { 0x40c24, 0x0 },
+ { 0x40c28, 0x0 },
+ { 0x40c2c, 0x0 },
+ { 0x40c30, 0x0 },
+ { 0x40c34, 0x0 },
+ { 0x40c38, 0x0 },
+ { 0x40c3c, 0x0 },
+ { 0x40c40, 0x10101 },
+ { 0x40c44, 0x10101 },
+ { 0x40c48, 0x10101 },
+ { 0x40c4c, 0x10101 },
+ { 0x40c50, 0x10101 },
+ { 0x40c54, 0x10101 },
+ { 0x40c58, 0x10101 },
+ { 0x40c5c, 0x10101 },
+ { 0x40c60, 0x10101 },
+ { 0x40c64, 0x10101 },
+ { 0x40c68, 0x20202 },
+ { 0x40c6c, 0x20202 },
+ { 0x40c70, 0x20202 },
+ { 0x40c74, 0x20202 },
+ { 0x40c78, 0x20202 },
+ { 0x40c7c, 0x20202 },
+ { 0x40c80, 0x30303 },
+ { 0x40c84, 0x30303 },
+ { 0x40c88, 0x30303 },
+ { 0x40c8c, 0x30303 },
+ { 0x40c90, 0x30303 },
+ { 0x40c94, 0x40404 },
+ { 0x40c98, 0x40404 },
+ { 0x40c9c, 0x40404 },
+ { 0x40ca0, 0x40404 },
+ { 0x40ca4, 0x40404 },
+ { 0x40ca8, 0x50505 },
+ { 0x40cac, 0x50505 },
+ { 0x40cb0, 0x50505 },
+ { 0x40cb4, 0x50505 },
+ { 0x40cb8, 0x60606 },
+ { 0x40cbc, 0x60606 },
+ { 0x40cc0, 0x60606 },
+ { 0x40cc4, 0x70707 },
+ { 0x40cc8, 0x70707 },
+ { 0x40ccc, 0x70707 },
+ { 0x40cd0, 0x70707 },
+ { 0x40cd4, 0x80808 },
+ { 0x40cd8, 0x80808 },
+ { 0x40cdc, 0x80808 },
+ { 0x40ce0, 0x90909 },
+ { 0x40ce4, 0x90909 },
+ { 0x40ce8, 0xa0a0a },
+ { 0x40cec, 0xa0a0a },
+ { 0x40cf0, 0xa0a0a },
+ { 0x40cf4, 0xb0b0b },
+ { 0x40cf8, 0xb0b0b },
+ { 0x40cfc, 0xb0b0b },
+ { 0x40d00, 0xc0c0c },
+ { 0x40d04, 0xc0c0c },
+ { 0x40d08, 0xd0d0d },
+ { 0x40d0c, 0xd0d0d },
+ { 0x40d10, 0xe0e0e },
+ { 0x40d14, 0xe0e0e },
+ { 0x40d18, 0xe0e0e },
+ { 0x40d1c, 0xf0f0f },
+ { 0x40d20, 0xf0f0f },
+ { 0x40d24, 0x101010 },
+ { 0x40d28, 0x101010 },
+ { 0x40d2c, 0x111111 },
+ { 0x40d30, 0x111111 },
+ { 0x40d34, 0x121212 },
+ { 0x40d38, 0x121212 },
+ { 0x40d3c, 0x131313 },
+ { 0x40d40, 0x131313 },
+ { 0x40d44, 0x141414 },
+ { 0x40d48, 0x151515 },
+ { 0x40d4c, 0x151515 },
+ { 0x40d50, 0x161616 },
+ { 0x40d54, 0x161616 },
+ { 0x40d58, 0x171717 },
+ { 0x40d5c, 0x171717 },
+ { 0x40d60, 0x181818 },
+ { 0x40d64, 0x191919 },
+ { 0x40d68, 0x191919 },
+ { 0x40d6c, 0x1a1a1a },
+ { 0x40d70, 0x1b1b1b },
+ { 0x40d74, 0x1b1b1b },
+ { 0x40d78, 0x1c1c1c },
+ { 0x40d7c, 0x1c1c1c },
+ { 0x40d80, 0x1d1d1d },
+ { 0x40d84, 0x1e1e1e },
+ { 0x40d88, 0x1f1f1f },
+ { 0x40d8c, 0x1f1f1f },
+ { 0x40d90, 0x202020 },
+ { 0x40d94, 0x212121 },
+ { 0x40d98, 0x212121 },
+ { 0x40d9c, 0x222222 },
+ { 0x40da0, 0x232323 },
+ { 0x40da4, 0x242424 },
+ { 0x40da8, 0x242424 },
+ { 0x40dac, 0x252525 },
+ { 0x40db0, 0x262626 },
+ { 0x40db4, 0x272727 },
+ { 0x40db8, 0x272727 },
+ { 0x40dbc, 0x282828 },
+ { 0x40dc0, 0x292929 },
+ { 0x40dc4, 0x2a2a2a },
+ { 0x40dc8, 0x2b2b2b },
+ { 0x40dcc, 0x2c2c2c },
+ { 0x40dd0, 0x2c2c2c },
+ { 0x40dd4, 0x2d2d2d },
+ { 0x40dd8, 0x2e2e2e },
+ { 0x40ddc, 0x2f2f2f },
+ { 0x40de0, 0x303030 },
+ { 0x40de4, 0x313131 },
+ { 0x40de8, 0x323232 },
+ { 0x40dec, 0x333333 },
+ { 0x40df0, 0x333333 },
+ { 0x40df4, 0x343434 },
+ { 0x40df8, 0x353535 },
+ { 0x40dfc, 0x363636 },
+ { 0x40e00, 0x373737 },
+ { 0x40e04, 0x383838 },
+ { 0x40e08, 0x393939 },
+ { 0x40e0c, 0x3a3a3a },
+ { 0x40e10, 0x3b3b3b },
+ { 0x40e14, 0x3c3c3c },
+ { 0x40e18, 0x3d3d3d },
+ { 0x40e1c, 0x3e3e3e },
+ { 0x40e20, 0x3f3f3f },
+ { 0x40e24, 0x404040 },
+ { 0x40e28, 0x414141 },
+ { 0x40e2c, 0x424242 },
+ { 0x40e30, 0x434343 },
+ { 0x40e34, 0x444444 },
+ { 0x40e38, 0x464646 },
+ { 0x40e3c, 0x474747 },
+ { 0x40e40, 0x484848 },
+ { 0x40e44, 0x494949 },
+ { 0x40e48, 0x4a4a4a },
+ { 0x40e4c, 0x4b4b4b },
+ { 0x40e50, 0x4c4c4c },
+ { 0x40e54, 0x4d4d4d },
+ { 0x40e58, 0x4f4f4f },
+ { 0x40e5c, 0x505050 },
+ { 0x40e60, 0x515151 },
+ { 0x40e64, 0x525252 },
+ { 0x40e68, 0x535353 },
+ { 0x40e6c, 0x545454 },
+ { 0x40e70, 0x565656 },
+ { 0x40e74, 0x575757 },
+ { 0x40e78, 0x585858 },
+ { 0x40e7c, 0x595959 },
+ { 0x40e80, 0x5b5b5b },
+ { 0x40e84, 0x5c5c5c },
+ { 0x40e88, 0x5d5d5d },
+ { 0x40e8c, 0x5e5e5e },
+ { 0x40e90, 0x606060 },
+ { 0x40e94, 0x616161 },
+ { 0x40e98, 0x626262 },
+ { 0x40e9c, 0x646464 },
+ { 0x40ea0, 0x656565 },
+ { 0x40ea4, 0x666666 },
+ { 0x40ea8, 0x686868 },
+ { 0x40eac, 0x696969 },
+ { 0x40eb0, 0x6a6a6a },
+ { 0x40eb4, 0x6c6c6c },
+ { 0x40eb8, 0x6d6d6d },
+ { 0x40ebc, 0x6f6f6f },
+ { 0x40ec0, 0x707070 },
+ { 0x40ec4, 0x717171 },
+ { 0x40ec8, 0x737373 },
+ { 0x40ecc, 0x747474 },
+ { 0x40ed0, 0x767676 },
+ { 0x40ed4, 0x777777 },
+ { 0x40ed8, 0x797979 },
+ { 0x40edc, 0x7a7a7a },
+ { 0x40ee0, 0x7c7c7c },
+ { 0x40ee4, 0x7d7d7d },
+ { 0x40ee8, 0x7f7f7f },
+ { 0x40eec, 0x808080 },
+ { 0x40ef0, 0x828282 },
+ { 0x40ef4, 0x838383 },
+ { 0x40ef8, 0x858585 },
+ { 0x40efc, 0x868686 },
+ { 0x40f00, 0x888888 },
+ { 0x40f04, 0x898989 },
+ { 0x40f08, 0x8b8b8b },
+ { 0x40f0c, 0x8d8d8d },
+ { 0x40f10, 0x8e8e8e },
+ { 0x40f14, 0x909090 },
+ { 0x40f18, 0x919191 },
+ { 0x40f1c, 0x939393 },
+ { 0x40f20, 0x959595 },
+ { 0x40f24, 0x969696 },
+ { 0x40f28, 0x989898 },
+ { 0x40f2c, 0x9a9a9a },
+ { 0x40f30, 0x9b9b9b },
+ { 0x40f34, 0x9d9d9d },
+ { 0x40f38, 0x9f9f9f },
+ { 0x40f3c, 0xa1a1a1 },
+ { 0x40f40, 0xa2a2a2 },
+ { 0x40f44, 0xa4a4a4 },
+ { 0x40f48, 0xa6a6a6 },
+ { 0x40f4c, 0xa7a7a7 },
+ { 0x40f50, 0xa9a9a9 },
+ { 0x40f54, 0xababab },
+ { 0x40f58, 0xadadad },
+ { 0x40f5c, 0xafafaf },
+ { 0x40f60, 0xb0b0b0 },
+ { 0x40f64, 0xb2b2b2 },
+ { 0x40f68, 0xb4b4b4 },
+ { 0x40f6c, 0xb6b6b6 },
+ { 0x40f70, 0xb8b8b8 },
+ { 0x40f74, 0xbababa },
+ { 0x40f78, 0xbbbbbb },
+ { 0x40f7c, 0xbdbdbd },
+ { 0x40f80, 0xbfbfbf },
+ { 0x40f84, 0xc1c1c1 },
+ { 0x40f88, 0xc3c3c3 },
+ { 0x40f8c, 0xc5c5c5 },
+ { 0x40f90, 0xc7c7c7 },
+ { 0x40f94, 0xc9c9c9 },
+ { 0x40f98, 0xcbcbcb },
+ { 0x40f9c, 0xcdcdcd },
+ { 0x40fa0, 0xcfcfcf },
+ { 0x40fa4, 0xd1d1d1 },
+ { 0x40fa8, 0xd3d3d3 },
+ { 0x40fac, 0xd5d5d5 },
+ { 0x40fb0, 0xd7d7d7 },
+ { 0x40fb4, 0xd9d9d9 },
+ { 0x40fb8, 0xdbdbdb },
+ { 0x40fbc, 0xdddddd },
+ { 0x40fc0, 0xdfdfdf },
+ { 0x40fc4, 0xe1e1e1 },
+ { 0x40fc8, 0xe3e3e3 },
+ { 0x40fcc, 0xe5e5e5 },
+ { 0x40fd0, 0xe7e7e7 },
+ { 0x40fd4, 0xe9e9e9 },
+ { 0x40fd8, 0xebebeb },
+ { 0x40fdc, 0xeeeeee },
+ { 0x40fe0, 0xf0f0f0 },
+ { 0x40fe4, 0xf2f2f2 },
+ { 0x40fe8, 0xf4f4f4 },
+ { 0x40fec, 0xf6f6f6 },
+ { 0x40ff0, 0xf8f8f8 },
+ { 0x40ff4, 0xfbfbfb },
+ { 0x40ff8, 0xfdfdfd },
+ { 0x40ffc, 0xffffff },
+};
diff --git a/drivers/video/msm/mdp_hw.h b/drivers/video/msm/mdp_hw.h
new file mode 100644
index 0000000..4e3deb4
--- /dev/null
+++ b/drivers/video/msm/mdp_hw.h
@@ -0,0 +1,621 @@
+/* drivers/video/msm_fb/mdp_hw.h
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+#ifndef _MDP_HW_H_
+#define _MDP_HW_H_
+
+#include <mach/msm_iomap.h>
+#include <mach/msm_fb.h>
+
+struct mdp_info {
+ struct mdp_device mdp_dev;
+ char * __iomem base;
+ int irq;
+};
+struct mdp_blit_req;
+struct mdp_device;
+int mdp_ppp_blit(const struct mdp_info *mdp, struct mdp_blit_req *req,
+ struct file *src_file, unsigned long src_start,
+ unsigned long src_len, struct file *dst_file,
+ unsigned long dst_start, unsigned long dst_len);
+#define mdp_writel(mdp, value, offset) writel(value, mdp->base + offset)
+#define mdp_readl(mdp, offset) readl(mdp->base + offset)
+
+#define MDP_SYNC_CONFIG_0 (0x00000)
+#define MDP_SYNC_CONFIG_1 (0x00004)
+#define MDP_SYNC_CONFIG_2 (0x00008)
+#define MDP_SYNC_STATUS_0 (0x0000c)
+#define MDP_SYNC_STATUS_1 (0x00010)
+#define MDP_SYNC_STATUS_2 (0x00014)
+#define MDP_SYNC_THRESH_0 (0x00018)
+#define MDP_SYNC_THRESH_1 (0x0001c)
+#define MDP_INTR_ENABLE (0x00020)
+#define MDP_INTR_STATUS (0x00024)
+#define MDP_INTR_CLEAR (0x00028)
+#define MDP_DISPLAY0_START (0x00030)
+#define MDP_DISPLAY1_START (0x00034)
+#define MDP_DISPLAY_STATUS (0x00038)
+#define MDP_EBI2_LCD0 (0x0003c)
+#define MDP_EBI2_LCD1 (0x00040)
+#define MDP_DISPLAY0_ADDR (0x00054)
+#define MDP_DISPLAY1_ADDR (0x00058)
+#define MDP_EBI2_PORTMAP_MODE (0x0005c)
+#define MDP_MODE (0x00060)
+#define MDP_TV_OUT_STATUS (0x00064)
+#define MDP_HW_VERSION (0x00070)
+#define MDP_SW_RESET (0x00074)
+#define MDP_AXI_ERROR_MASTER_STOP (0x00078)
+#define MDP_SEL_CLK_OR_HCLK_TEST_BUS (0x0007c)
+#define MDP_PRIMARY_VSYNC_OUT_CTRL (0x00080)
+#define MDP_SECONDARY_VSYNC_OUT_CTRL (0x00084)
+#define MDP_EXTERNAL_VSYNC_OUT_CTRL (0x00088)
+#define MDP_VSYNC_CTRL (0x0008c)
+#define MDP_CGC_EN (0x00100)
+#define MDP_CMD_STATUS (0x10008)
+#define MDP_PROFILE_EN (0x10010)
+#define MDP_PROFILE_COUNT (0x10014)
+#define MDP_DMA_START (0x10044)
+#define MDP_FULL_BYPASS_WORD0 (0x10100)
+#define MDP_FULL_BYPASS_WORD1 (0x10104)
+#define MDP_COMMAND_CONFIG (0x10104)
+#define MDP_FULL_BYPASS_WORD2 (0x10108)
+#define MDP_FULL_BYPASS_WORD3 (0x1010c)
+#define MDP_FULL_BYPASS_WORD4 (0x10110)
+#define MDP_FULL_BYPASS_WORD6 (0x10118)
+#define MDP_FULL_BYPASS_WORD7 (0x1011c)
+#define MDP_FULL_BYPASS_WORD8 (0x10120)
+#define MDP_FULL_BYPASS_WORD9 (0x10124)
+#define MDP_PPP_SOURCE_CONFIG (0x10124)
+#define MDP_FULL_BYPASS_WORD10 (0x10128)
+#define MDP_FULL_BYPASS_WORD11 (0x1012c)
+#define MDP_FULL_BYPASS_WORD12 (0x10130)
+#define MDP_FULL_BYPASS_WORD13 (0x10134)
+#define MDP_FULL_BYPASS_WORD14 (0x10138)
+#define MDP_PPP_OPERATION_CONFIG (0x10138)
+#define MDP_FULL_BYPASS_WORD15 (0x1013c)
+#define MDP_FULL_BYPASS_WORD16 (0x10140)
+#define MDP_FULL_BYPASS_WORD17 (0x10144)
+#define MDP_FULL_BYPASS_WORD18 (0x10148)
+#define MDP_FULL_BYPASS_WORD19 (0x1014c)
+#define MDP_FULL_BYPASS_WORD20 (0x10150)
+#define MDP_PPP_DESTINATION_CONFIG (0x10150)
+#define MDP_FULL_BYPASS_WORD21 (0x10154)
+#define MDP_FULL_BYPASS_WORD22 (0x10158)
+#define MDP_FULL_BYPASS_WORD23 (0x1015c)
+#define MDP_FULL_BYPASS_WORD24 (0x10160)
+#define MDP_FULL_BYPASS_WORD25 (0x10164)
+#define MDP_FULL_BYPASS_WORD26 (0x10168)
+#define MDP_FULL_BYPASS_WORD27 (0x1016c)
+#define MDP_FULL_BYPASS_WORD29 (0x10174)
+#define MDP_FULL_BYPASS_WORD30 (0x10178)
+#define MDP_FULL_BYPASS_WORD31 (0x1017c)
+#define MDP_FULL_BYPASS_WORD32 (0x10180)
+#define MDP_DMA_CONFIG (0x10180)
+#define MDP_FULL_BYPASS_WORD33 (0x10184)
+#define MDP_FULL_BYPASS_WORD34 (0x10188)
+#define MDP_FULL_BYPASS_WORD35 (0x1018c)
+#define MDP_FULL_BYPASS_WORD37 (0x10194)
+#define MDP_FULL_BYPASS_WORD39 (0x1019c)
+#define MDP_FULL_BYPASS_WORD40 (0x101a0)
+#define MDP_FULL_BYPASS_WORD41 (0x101a4)
+#define MDP_FULL_BYPASS_WORD43 (0x101ac)
+#define MDP_FULL_BYPASS_WORD46 (0x101b8)
+#define MDP_FULL_BYPASS_WORD47 (0x101bc)
+#define MDP_FULL_BYPASS_WORD48 (0x101c0)
+#define MDP_FULL_BYPASS_WORD49 (0x101c4)
+#define MDP_FULL_BYPASS_WORD50 (0x101c8)
+#define MDP_FULL_BYPASS_WORD51 (0x101cc)
+#define MDP_FULL_BYPASS_WORD52 (0x101d0)
+#define MDP_FULL_BYPASS_WORD53 (0x101d4)
+#define MDP_FULL_BYPASS_WORD54 (0x101d8)
+#define MDP_FULL_BYPASS_WORD55 (0x101dc)
+#define MDP_FULL_BYPASS_WORD56 (0x101e0)
+#define MDP_FULL_BYPASS_WORD57 (0x101e4)
+#define MDP_FULL_BYPASS_WORD58 (0x101e8)
+#define MDP_FULL_BYPASS_WORD59 (0x101ec)
+#define MDP_FULL_BYPASS_WORD60 (0x101f0)
+#define MDP_VSYNC_THRESHOLD (0x101f0)
+#define MDP_FULL_BYPASS_WORD61 (0x101f4)
+#define MDP_FULL_BYPASS_WORD62 (0x101f8)
+#define MDP_FULL_BYPASS_WORD63 (0x101fc)
+#define MDP_TFETCH_TEST_MODE (0x20004)
+#define MDP_TFETCH_STATUS (0x20008)
+#define MDP_TFETCH_TILE_COUNT (0x20010)
+#define MDP_TFETCH_FETCH_COUNT (0x20014)
+#define MDP_TFETCH_CONSTANT_COLOR (0x20040)
+#define MDP_CSC_BYPASS (0x40004)
+#define MDP_SCALE_COEFF_LSB (0x5fffc)
+#define MDP_TV_OUT_CTL (0xc0000)
+#define MDP_TV_OUT_FIR_COEFF (0xc0004)
+#define MDP_TV_OUT_BUF_ADDR (0xc0008)
+#define MDP_TV_OUT_CC_DATA (0xc000c)
+#define MDP_TV_OUT_SOBEL (0xc0010)
+#define MDP_TV_OUT_Y_CLAMP (0xc0018)
+#define MDP_TV_OUT_CB_CLAMP (0xc001c)
+#define MDP_TV_OUT_CR_CLAMP (0xc0020)
+#define MDP_TEST_MODE_CLK (0xd0000)
+#define MDP_TEST_MISR_RESET_CLK (0xd0004)
+#define MDP_TEST_EXPORT_MISR_CLK (0xd0008)
+#define MDP_TEST_MISR_CURR_VAL_CLK (0xd000c)
+#define MDP_TEST_MODE_HCLK (0xd0100)
+#define MDP_TEST_MISR_RESET_HCLK (0xd0104)
+#define MDP_TEST_EXPORT_MISR_HCLK (0xd0108)
+#define MDP_TEST_MISR_CURR_VAL_HCLK (0xd010c)
+#define MDP_TEST_MODE_DCLK (0xd0200)
+#define MDP_TEST_MISR_RESET_DCLK (0xd0204)
+#define MDP_TEST_EXPORT_MISR_DCLK (0xd0208)
+#define MDP_TEST_MISR_CURR_VAL_DCLK (0xd020c)
+#define MDP_TEST_CAPTURED_DCLK (0xd0210)
+#define MDP_TEST_MISR_CAPT_VAL_DCLK (0xd0214)
+#define MDP_LCDC_CTL (0xe0000)
+#define MDP_LCDC_HSYNC_CTL (0xe0004)
+#define MDP_LCDC_VSYNC_CTL (0xe0008)
+#define MDP_LCDC_ACTIVE_HCTL (0xe000c)
+#define MDP_LCDC_ACTIVE_VCTL (0xe0010)
+#define MDP_LCDC_BORDER_CLR (0xe0014)
+#define MDP_LCDC_H_BLANK (0xe0018)
+#define MDP_LCDC_V_BLANK (0xe001c)
+#define MDP_LCDC_UNDERFLOW_CLR (0xe0020)
+#define MDP_LCDC_HSYNC_SKEW (0xe0024)
+#define MDP_LCDC_TEST_CTL (0xe0028)
+#define MDP_LCDC_LINE_IRQ (0xe002c)
+#define MDP_LCDC_CTL_POLARITY (0xe0030)
+#define MDP_LCDC_DMA_CONFIG (0xe1000)
+#define MDP_LCDC_DMA_SIZE (0xe1004)
+#define MDP_LCDC_DMA_IBUF_ADDR (0xe1008)
+#define MDP_LCDC_DMA_IBUF_Y_STRIDE (0xe100c)
+
+
+#define MDP_DMA2_TERM 0x1
+#define MDP_DMA3_TERM 0x2
+#define MDP_PPP_TERM 0x3
+
+/* MDP_INTR_ENABLE */
+#define DL0_ROI_DONE (1<<0)
+#define DL1_ROI_DONE (1<<1)
+#define DL0_DMA2_TERM_DONE (1<<2)
+#define DL1_DMA2_TERM_DONE (1<<3)
+#define DL0_PPP_TERM_DONE (1<<4)
+#define DL1_PPP_TERM_DONE (1<<5)
+#define TV_OUT_DMA3_DONE (1<<6)
+#define TV_ENC_UNDERRUN (1<<7)
+#define DL0_FETCH_DONE (1<<11)
+#define DL1_FETCH_DONE (1<<12)
+
+#define MDP_PPP_BUSY_STATUS (DL0_ROI_DONE| \
+ DL1_ROI_DONE| \
+ DL0_PPP_TERM_DONE| \
+ DL1_PPP_TERM_DONE)
+
+#define MDP_ANY_INTR_MASK (DL0_ROI_DONE| \
+ DL1_ROI_DONE| \
+ DL0_DMA2_TERM_DONE| \
+ DL1_DMA2_TERM_DONE| \
+ DL0_PPP_TERM_DONE| \
+ DL1_PPP_TERM_DONE| \
+ DL0_FETCH_DONE| \
+ DL1_FETCH_DONE| \
+ TV_ENC_UNDERRUN)
+
+#define MDP_TOP_LUMA 16
+#define MDP_TOP_CHROMA 0
+#define MDP_BOTTOM_LUMA 19
+#define MDP_BOTTOM_CHROMA 3
+#define MDP_LEFT_LUMA 22
+#define MDP_LEFT_CHROMA 6
+#define MDP_RIGHT_LUMA 25
+#define MDP_RIGHT_CHROMA 9
+
+#define CLR_G 0x0
+#define CLR_B 0x1
+#define CLR_R 0x2
+#define CLR_ALPHA 0x3
+
+#define CLR_Y CLR_G
+#define CLR_CB CLR_B
+#define CLR_CR CLR_R
+
+/* from lsb to msb */
+#define MDP_GET_PACK_PATTERN(a, x, y, z, bit) \
+ (((a)<<(bit*3))|((x)<<(bit*2))|((y)<<bit)|(z))
+
+/* MDP_SYNC_CONFIG_0/1/2 */
+#define MDP_SYNCFG_HGT_LOC 22
+#define MDP_SYNCFG_VSYNC_EXT_EN (1<<21)
+#define MDP_SYNCFG_VSYNC_INT_EN (1<<20)
+
+/* MDP_SYNC_THRESH_0 */
+#define MDP_PRIM_BELOW_LOC 0
+#define MDP_PRIM_ABOVE_LOC 8
+
+/* MDP_{PRIMARY,SECONDARY,EXTERNAL}_VSYNC_OUT_CRL */
+#define VSYNC_PULSE_EN (1<<31)
+#define VSYNC_PULSE_INV (1<<30)
+
+/* MDP_VSYNC_CTRL */
+#define DISP0_VSYNC_MAP_VSYNC0 0
+#define DISP0_VSYNC_MAP_VSYNC1 (1<<0)
+#define DISP0_VSYNC_MAP_VSYNC2 ((1<<0)|(1<<1))
+
+#define DISP1_VSYNC_MAP_VSYNC0 0
+#define DISP1_VSYNC_MAP_VSYNC1 (1<<2)
+#define DISP1_VSYNC_MAP_VSYNC2 ((1<<2)|(1<<3))
+
+#define PRIMARY_LCD_SYNC_EN (1<<4)
+#define PRIMARY_LCD_SYNC_DISABLE 0
+
+#define SECONDARY_LCD_SYNC_EN (1<<5)
+#define SECONDARY_LCD_SYNC_DISABLE 0
+
+#define EXTERNAL_LCD_SYNC_EN (1<<6)
+#define EXTERNAL_LCD_SYNC_DISABLE 0
+
+/* MDP_VSYNC_THRESHOLD / MDP_FULL_BYPASS_WORD60 */
+#define VSYNC_THRESHOLD_ABOVE_LOC 0
+#define VSYNC_THRESHOLD_BELOW_LOC 16
+#define VSYNC_ANTI_TEAR_EN (1<<31)
+
+/* MDP_COMMAND_CONFIG / MDP_FULL_BYPASS_WORD1 */
+#define MDP_CMD_DBGBUS_EN (1<<0)
+
+/* MDP_PPP_SOURCE_CONFIG / MDP_FULL_BYPASS_WORD9&53 */
+#define PPP_SRC_C0G_8BIT ((1<<1)|(1<<0))
+#define PPP_SRC_C1B_8BIT ((1<<3)|(1<<2))
+#define PPP_SRC_C2R_8BIT ((1<<5)|(1<<4))
+#define PPP_SRC_C3A_8BIT ((1<<7)|(1<<6))
+
+#define PPP_SRC_C0G_6BIT (1<<1)
+#define PPP_SRC_C1B_6BIT (1<<3)
+#define PPP_SRC_C2R_6BIT (1<<5)
+
+#define PPP_SRC_C0G_5BIT (1<<0)
+#define PPP_SRC_C1B_5BIT (1<<2)
+#define PPP_SRC_C2R_5BIT (1<<4)
+
+#define PPP_SRC_C3ALPHA_EN (1<<8)
+
+#define PPP_SRC_BPP_1BYTES 0
+#define PPP_SRC_BPP_2BYTES (1<<9)
+#define PPP_SRC_BPP_3BYTES (1<<10)
+#define PPP_SRC_BPP_4BYTES ((1<<10)|(1<<9))
+
+#define PPP_SRC_BPP_ROI_ODD_X (1<<11)
+#define PPP_SRC_BPP_ROI_ODD_Y (1<<12)
+#define PPP_SRC_INTERLVD_2COMPONENTS (1<<13)
+#define PPP_SRC_INTERLVD_3COMPONENTS (1<<14)
+#define PPP_SRC_INTERLVD_4COMPONENTS ((1<<14)|(1<<13))
+
+
+/* RGB666 unpack format
+** TIGHT means R6+G6+B6 together
+** LOOSE means R6+2 +G6+2+ B6+2 (with MSB)
+** or 2+R6 +2+G6 +2+B6 (with LSB)
+*/
+#define PPP_SRC_PACK_TIGHT (1<<17)
+#define PPP_SRC_PACK_LOOSE 0
+#define PPP_SRC_PACK_ALIGN_LSB 0
+#define PPP_SRC_PACK_ALIGN_MSB (1<<18)
+
+#define PPP_SRC_PLANE_INTERLVD 0
+#define PPP_SRC_PLANE_PSEUDOPLNR (1<<20)
+
+#define PPP_SRC_WMV9_MODE (1<<21)
+
+/* MDP_PPP_OPERATION_CONFIG / MDP_FULL_BYPASS_WORD14 */
+#define PPP_OP_SCALE_X_ON (1<<0)
+#define PPP_OP_SCALE_Y_ON (1<<1)
+
+#define PPP_OP_CONVERT_RGB2YCBCR 0
+#define PPP_OP_CONVERT_YCBCR2RGB (1<<2)
+#define PPP_OP_CONVERT_ON (1<<3)
+
+#define PPP_OP_CONVERT_MATRIX_PRIMARY 0
+#define PPP_OP_CONVERT_MATRIX_SECONDARY (1<<4)
+
+#define PPP_OP_LUT_C0_ON (1<<5)
+#define PPP_OP_LUT_C1_ON (1<<6)
+#define PPP_OP_LUT_C2_ON (1<<7)
+
+/* rotate or blend enable */
+#define PPP_OP_ROT_ON (1<<8)
+
+#define PPP_OP_ROT_90 (1<<9)
+#define PPP_OP_FLIP_LR (1<<10)
+#define PPP_OP_FLIP_UD (1<<11)
+
+#define PPP_OP_BLEND_ON (1<<12)
+
+#define PPP_OP_BLEND_SRCPIXEL_ALPHA 0
+#define PPP_OP_BLEND_DSTPIXEL_ALPHA (1<<13)
+#define PPP_OP_BLEND_CONSTANT_ALPHA (1<<14)
+#define PPP_OP_BLEND_SRCPIXEL_TRANSP ((1<<13)|(1<<14))
+
+#define PPP_OP_BLEND_ALPHA_BLEND_NORMAL 0
+#define PPP_OP_BLEND_ALPHA_BLEND_REVERSE (1<<15)
+
+#define PPP_OP_DITHER_EN (1<<16)
+
+#define PPP_OP_COLOR_SPACE_RGB 0
+#define PPP_OP_COLOR_SPACE_YCBCR (1<<17)
+
+#define PPP_OP_SRC_CHROMA_RGB 0
+#define PPP_OP_SRC_CHROMA_H2V1 (1<<18)
+#define PPP_OP_SRC_CHROMA_H1V2 (1<<19)
+#define PPP_OP_SRC_CHROMA_420 ((1<<18)|(1<<19))
+#define PPP_OP_SRC_CHROMA_COSITE 0
+#define PPP_OP_SRC_CHROMA_OFFSITE (1<<20)
+
+#define PPP_OP_DST_CHROMA_RGB 0
+#define PPP_OP_DST_CHROMA_H2V1 (1<<21)
+#define PPP_OP_DST_CHROMA_H1V2 (1<<22)
+#define PPP_OP_DST_CHROMA_420 ((1<<21)|(1<<22))
+#define PPP_OP_DST_CHROMA_COSITE 0
+#define PPP_OP_DST_CHROMA_OFFSITE (1<<23)
+
+#define PPP_BLEND_ALPHA_TRANSP (1<<24)
+
+#define PPP_OP_BG_CHROMA_RGB 0
+#define PPP_OP_BG_CHROMA_H2V1 (1<<25)
+#define PPP_OP_BG_CHROMA_H1V2 (1<<26)
+#define PPP_OP_BG_CHROMA_420 ((1<<25)|(1<<26))
+#define PPP_OP_BG_CHROMA_SITE_COSITE 0
+#define PPP_OP_BG_CHROMA_SITE_OFFSITE (1<<27)
+
+/* MDP_PPP_DESTINATION_CONFIG / MDP_FULL_BYPASS_WORD20 */
+#define PPP_DST_C0G_8BIT ((1<<0)|(1<<1))
+#define PPP_DST_C1B_8BIT ((1<<3)|(1<<2))
+#define PPP_DST_C2R_8BIT ((1<<5)|(1<<4))
+#define PPP_DST_C3A_8BIT ((1<<7)|(1<<6))
+
+#define PPP_DST_C0G_6BIT (1<<1)
+#define PPP_DST_C1B_6BIT (1<<3)
+#define PPP_DST_C2R_6BIT (1<<5)
+
+#define PPP_DST_C0G_5BIT (1<<0)
+#define PPP_DST_C1B_5BIT (1<<2)
+#define PPP_DST_C2R_5BIT (1<<4)
+
+#define PPP_DST_C3A_8BIT ((1<<7)|(1<<6))
+#define PPP_DST_C3ALPHA_EN (1<<8)
+
+#define PPP_DST_INTERLVD_2COMPONENTS (1<<9)
+#define PPP_DST_INTERLVD_3COMPONENTS (1<<10)
+#define PPP_DST_INTERLVD_4COMPONENTS ((1<<10)|(1<<9))
+#define PPP_DST_INTERLVD_6COMPONENTS ((1<<11)|(1<<9))
+
+#define PPP_DST_PACK_LOOSE 0
+#define PPP_DST_PACK_TIGHT (1<<13)
+#define PPP_DST_PACK_ALIGN_LSB 0
+#define PPP_DST_PACK_ALIGN_MSB (1<<14)
+
+#define PPP_DST_OUT_SEL_AXI 0
+#define PPP_DST_OUT_SEL_MDDI (1<<15)
+
+#define PPP_DST_BPP_2BYTES (1<<16)
+#define PPP_DST_BPP_3BYTES (1<<17)
+#define PPP_DST_BPP_4BYTES ((1<<17)|(1<<16))
+
+#define PPP_DST_PLANE_INTERLVD 0
+#define PPP_DST_PLANE_PLANAR (1<<18)
+#define PPP_DST_PLANE_PSEUDOPLNR (1<<19)
+
+#define PPP_DST_TO_TV (1<<20)
+
+#define PPP_DST_MDDI_PRIMARY 0
+#define PPP_DST_MDDI_SECONDARY (1<<21)
+#define PPP_DST_MDDI_EXTERNAL (1<<22)
+
+/* image configurations by image type */
+#define PPP_CFG_MDP_RGB_565(dir) (PPP_##dir##_C2R_5BIT | \
+ PPP_##dir##_C0G_6BIT | \
+ PPP_##dir##_C1B_5BIT | \
+ PPP_##dir##_BPP_2BYTES | \
+ PPP_##dir##_INTERLVD_3COMPONENTS | \
+ PPP_##dir##_PACK_TIGHT | \
+ PPP_##dir##_PACK_ALIGN_LSB | \
+ PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_RGB_888(dir) (PPP_##dir##_C2R_8BIT | \
+ PPP_##dir##_C0G_8BIT | \
+ PPP_##dir##_C1B_8BIT | \
+ PPP_##dir##_BPP_3BYTES | \
+ PPP_##dir##_INTERLVD_3COMPONENTS | \
+ PPP_##dir##_PACK_TIGHT | \
+ PPP_##dir##_PACK_ALIGN_LSB | \
+ PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_ARGB_8888(dir) (PPP_##dir##_C2R_8BIT | \
+ PPP_##dir##_C0G_8BIT | \
+ PPP_##dir##_C1B_8BIT | \
+ PPP_##dir##_C3A_8BIT | \
+ PPP_##dir##_C3ALPHA_EN | \
+ PPP_##dir##_BPP_4BYTES | \
+ PPP_##dir##_INTERLVD_4COMPONENTS | \
+ PPP_##dir##_PACK_TIGHT | \
+ PPP_##dir##_PACK_ALIGN_LSB | \
+ PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_XRGB_8888(dir) PPP_CFG_MDP_ARGB_8888(dir)
+#define PPP_CFG_MDP_RGBA_8888(dir) PPP_CFG_MDP_ARGB_8888(dir)
+#define PPP_CFG_MDP_BGRA_8888(dir) PPP_CFG_MDP_ARGB_8888(dir)
+
+#define PPP_CFG_MDP_Y_CBCR_H2V2(dir) (PPP_##dir##_C2R_8BIT | \
+ PPP_##dir##_C0G_8BIT | \
+ PPP_##dir##_C1B_8BIT | \
+ PPP_##dir##_C3A_8BIT | \
+ PPP_##dir##_BPP_2BYTES | \
+ PPP_##dir##_INTERLVD_2COMPONENTS | \
+ PPP_##dir##_PACK_TIGHT | \
+ PPP_##dir##_PACK_ALIGN_LSB | \
+ PPP_##dir##_PLANE_PSEUDOPLNR)
+
+#define PPP_CFG_MDP_Y_CRCB_H2V2(dir) PPP_CFG_MDP_Y_CBCR_H2V2(dir)
+
+#define PPP_CFG_MDP_YCRYCB_H2V1(dir) (PPP_##dir##_C2R_8BIT | \
+ PPP_##dir##_C0G_8BIT | \
+ PPP_##dir##_C1B_8BIT | \
+ PPP_##dir##_C3A_8BIT | \
+ PPP_##dir##_BPP_2BYTES | \
+ PPP_##dir##_INTERLVD_4COMPONENTS | \
+ PPP_##dir##_PACK_TIGHT | \
+ PPP_##dir##_PACK_ALIGN_LSB |\
+ PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_Y_CBCR_H2V1(dir) (PPP_##dir##_C2R_8BIT | \
+ PPP_##dir##_C0G_8BIT | \
+ PPP_##dir##_C1B_8BIT | \
+ PPP_##dir##_C3A_8BIT | \
+ PPP_##dir##_BPP_2BYTES | \
+ PPP_##dir##_INTERLVD_2COMPONENTS | \
+ PPP_##dir##_PACK_TIGHT | \
+ PPP_##dir##_PACK_ALIGN_LSB | \
+ PPP_##dir##_PLANE_PSEUDOPLNR)
+
+#define PPP_CFG_MDP_Y_CRCB_H2V1(dir) PPP_CFG_MDP_Y_CBCR_H2V1(dir)
+
+#define PPP_PACK_PATTERN_MDP_RGB_565 \
+ MDP_GET_PACK_PATTERN(0, CLR_R, CLR_G, CLR_B, 8)
+#define PPP_PACK_PATTERN_MDP_RGB_888 PPP_PACK_PATTERN_MDP_RGB_565
+#define PPP_PACK_PATTERN_MDP_XRGB_8888 \
+ MDP_GET_PACK_PATTERN(CLR_ALPHA, CLR_R, CLR_G, CLR_B, 8)
+#define PPP_PACK_PATTERN_MDP_ARGB_8888 PPP_PACK_PATTERN_MDP_XRGB_8888
+#define PPP_PACK_PATTERN_MDP_RGBA_8888 \
+ MDP_GET_PACK_PATTERN(CLR_ALPHA, CLR_B, CLR_G, CLR_R, 8)
+#define PPP_PACK_PATTERN_MDP_BGRA_8888 \
+ MDP_GET_PACK_PATTERN(CLR_ALPHA, CLR_R, CLR_G, CLR_B, 8)
+#define PPP_PACK_PATTERN_MDP_Y_CBCR_H2V1 \
+ MDP_GET_PACK_PATTERN(0, 0, CLR_CB, CLR_CR, 8)
+#define PPP_PACK_PATTERN_MDP_Y_CBCR_H2V2 PPP_PACK_PATTERN_MDP_Y_CBCR_H2V1
+#define PPP_PACK_PATTERN_MDP_Y_CRCB_H2V1 \
+ MDP_GET_PACK_PATTERN(0, 0, CLR_CR, CLR_CB, 8)
+#define PPP_PACK_PATTERN_MDP_Y_CRCB_H2V2 PPP_PACK_PATTERN_MDP_Y_CRCB_H2V1
+#define PPP_PACK_PATTERN_MDP_YCRYCB_H2V1 \
+ MDP_GET_PACK_PATTERN(CLR_Y, CLR_R, CLR_Y, CLR_B, 8)
+
+#define PPP_CHROMA_SAMP_MDP_RGB_565(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_RGB_888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_XRGB_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_ARGB_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_RGBA_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_BGRA_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_Y_CBCR_H2V1(dir) PPP_OP_##dir##_CHROMA_H2V1
+#define PPP_CHROMA_SAMP_MDP_Y_CBCR_H2V2(dir) PPP_OP_##dir##_CHROMA_420
+#define PPP_CHROMA_SAMP_MDP_Y_CRCB_H2V1(dir) PPP_OP_##dir##_CHROMA_H2V1
+#define PPP_CHROMA_SAMP_MDP_Y_CRCB_H2V2(dir) PPP_OP_##dir##_CHROMA_420
+#define PPP_CHROMA_SAMP_MDP_YCRYCB_H2V1(dir) PPP_OP_##dir##_CHROMA_H2V1
+
+/* Helpful array generation macros */
+#define PPP_ARRAY0(name) \
+ [MDP_RGB_565] = PPP_##name##_MDP_RGB_565,\
+ [MDP_RGB_888] = PPP_##name##_MDP_RGB_888,\
+ [MDP_XRGB_8888] = PPP_##name##_MDP_XRGB_8888,\
+ [MDP_ARGB_8888] = PPP_##name##_MDP_ARGB_8888,\
+ [MDP_RGBA_8888] = PPP_##name##_MDP_RGBA_8888,\
+ [MDP_BGRA_8888] = PPP_##name##_MDP_BGRA_8888,\
+ [MDP_Y_CBCR_H2V1] = PPP_##name##_MDP_Y_CBCR_H2V1,\
+ [MDP_Y_CBCR_H2V2] = PPP_##name##_MDP_Y_CBCR_H2V2,\
+ [MDP_Y_CRCB_H2V1] = PPP_##name##_MDP_Y_CRCB_H2V1,\
+ [MDP_Y_CRCB_H2V2] = PPP_##name##_MDP_Y_CRCB_H2V2,\
+ [MDP_YCRYCB_H2V1] = PPP_##name##_MDP_YCRYCB_H2V1
+
+#define PPP_ARRAY1(name, dir) \
+ [MDP_RGB_565] = PPP_##name##_MDP_RGB_565(dir),\
+ [MDP_RGB_888] = PPP_##name##_MDP_RGB_888(dir),\
+ [MDP_XRGB_8888] = PPP_##name##_MDP_XRGB_8888(dir),\
+ [MDP_ARGB_8888] = PPP_##name##_MDP_ARGB_8888(dir),\
+ [MDP_RGBA_8888] = PPP_##name##_MDP_RGBA_8888(dir),\
+ [MDP_BGRA_8888] = PPP_##name##_MDP_BGRA_8888(dir),\
+ [MDP_Y_CBCR_H2V1] = PPP_##name##_MDP_Y_CBCR_H2V1(dir),\
+ [MDP_Y_CBCR_H2V2] = PPP_##name##_MDP_Y_CBCR_H2V2(dir),\
+ [MDP_Y_CRCB_H2V1] = PPP_##name##_MDP_Y_CRCB_H2V1(dir),\
+ [MDP_Y_CRCB_H2V2] = PPP_##name##_MDP_Y_CRCB_H2V2(dir),\
+ [MDP_YCRYCB_H2V1] = PPP_##name##_MDP_YCRYCB_H2V1(dir)
+
+#define IS_YCRCB(img) ((img == MDP_Y_CRCB_H2V2) | (img == MDP_Y_CBCR_H2V2) | \
+ (img == MDP_Y_CRCB_H2V1) | (img == MDP_Y_CBCR_H2V1) | \
+ (img == MDP_YCRYCB_H2V1))
+#define IS_RGB(img) ((img == MDP_RGB_565) | (img == MDP_RGB_888) | \
+ (img == MDP_ARGB_8888) | (img == MDP_RGBA_8888) | \
+ (img == MDP_XRGB_8888) | (img == MDP_BGRA_8888))
+#define HAS_ALPHA(img) ((img == MDP_ARGB_8888) | (img == MDP_RGBA_8888) | \
+ (img == MDP_BGRA_8888))
+
+#define IS_PSEUDOPLNR(img) ((img == MDP_Y_CRCB_H2V2) | \
+ (img == MDP_Y_CBCR_H2V2) | \
+ (img == MDP_Y_CRCB_H2V1) | \
+ (img == MDP_Y_CBCR_H2V1))
+
+/* Mappings from addr to purpose */
+#define PPP_ADDR_SRC_ROI MDP_FULL_BYPASS_WORD2
+#define PPP_ADDR_SRC0 MDP_FULL_BYPASS_WORD3
+#define PPP_ADDR_SRC1 MDP_FULL_BYPASS_WORD4
+#define PPP_ADDR_SRC_YSTRIDE MDP_FULL_BYPASS_WORD7
+#define PPP_ADDR_SRC_CFG MDP_FULL_BYPASS_WORD9
+#define PPP_ADDR_SRC_PACK_PATTERN MDP_FULL_BYPASS_WORD10
+#define PPP_ADDR_OPERATION MDP_FULL_BYPASS_WORD14
+#define PPP_ADDR_PHASEX_INIT MDP_FULL_BYPASS_WORD15
+#define PPP_ADDR_PHASEY_INIT MDP_FULL_BYPASS_WORD16
+#define PPP_ADDR_PHASEX_STEP MDP_FULL_BYPASS_WORD17
+#define PPP_ADDR_PHASEY_STEP MDP_FULL_BYPASS_WORD18
+#define PPP_ADDR_ALPHA_TRANSP MDP_FULL_BYPASS_WORD19
+#define PPP_ADDR_DST_CFG MDP_FULL_BYPASS_WORD20
+#define PPP_ADDR_DST_PACK_PATTERN MDP_FULL_BYPASS_WORD21
+#define PPP_ADDR_DST_ROI MDP_FULL_BYPASS_WORD25
+#define PPP_ADDR_DST0 MDP_FULL_BYPASS_WORD26
+#define PPP_ADDR_DST1 MDP_FULL_BYPASS_WORD27
+#define PPP_ADDR_DST_YSTRIDE MDP_FULL_BYPASS_WORD30
+#define PPP_ADDR_EDGE MDP_FULL_BYPASS_WORD46
+#define PPP_ADDR_BG0 MDP_FULL_BYPASS_WORD48
+#define PPP_ADDR_BG1 MDP_FULL_BYPASS_WORD49
+#define PPP_ADDR_BG_YSTRIDE MDP_FULL_BYPASS_WORD51
+#define PPP_ADDR_BG_CFG MDP_FULL_BYPASS_WORD53
+#define PPP_ADDR_BG_PACK_PATTERN MDP_FULL_BYPASS_WORD54
+
+/* MDP_DMA_CONFIG / MDP_FULL_BYPASS_WORD32 */
+#define DMA_DSTC0G_6BITS (1<<1)
+#define DMA_DSTC1B_6BITS (1<<3)
+#define DMA_DSTC2R_6BITS (1<<5)
+#define DMA_DSTC0G_5BITS (1<<0)
+#define DMA_DSTC1B_5BITS (1<<2)
+#define DMA_DSTC2R_5BITS (1<<4)
+
+#define DMA_PACK_TIGHT (1<<6)
+#define DMA_PACK_LOOSE 0
+#define DMA_PACK_ALIGN_LSB 0
+#define DMA_PACK_ALIGN_MSB (1<<7)
+#define DMA_PACK_PATTERN_RGB \
+ (MDP_GET_PACK_PATTERN(0, CLR_R, CLR_G, CLR_B, 2)<<8)
+
+#define DMA_OUT_SEL_AHB 0
+#define DMA_OUT_SEL_MDDI (1<<14)
+#define DMA_AHBM_LCD_SEL_PRIMARY 0
+#define DMA_AHBM_LCD_SEL_SECONDARY (1<<15)
+#define DMA_IBUF_C3ALPHA_EN (1<<16)
+#define DMA_DITHER_EN (1<<17)
+
+#define DMA_MDDI_DMAOUT_LCD_SEL_PRIMARY 0
+#define DMA_MDDI_DMAOUT_LCD_SEL_SECONDARY (1<<18)
+#define DMA_MDDI_DMAOUT_LCD_SEL_EXTERNAL (1<<19)
+
+#define DMA_IBUF_FORMAT_RGB565 (1<<20)
+#define DMA_IBUF_FORMAT_RGB888_OR_ARGB8888 0
+
+#define DMA_IBUF_NONCONTIGUOUS (1<<21)
+
+/* MDDI REGISTER ? */
+#define MDDI_VDO_PACKET_DESC 0x5666
+#define MDDI_VDO_PACKET_PRIM 0xC3
+#define MDDI_VDO_PACKET_SECD 0xC0
+
+#endif
diff --git a/drivers/video/msm/mdp_ppp.c b/drivers/video/msm/mdp_ppp.c
new file mode 100644
index 0000000..ba2c467
--- /dev/null
+++ b/drivers/video/msm/mdp_ppp.c
@@ -0,0 +1,750 @@
+/* drivers/video/msm/mdp_ppp.c
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+#include <linux/fb.h>
+#include <linux/file.h>
+#include <linux/delay.h>
+#include <linux/msm_mdp.h>
+#include <linux/android_pmem.h>
+#include <mach/msm_fb.h>
+
+#include "mdp_hw.h"
+#include "mdp_scale_tables.h"
+
+#define DLOG(x...) do {} while (0)
+
+#define MDP_DOWNSCALE_BLUR (MDP_DOWNSCALE_MAX + 1)
+static int downscale_y_table = MDP_DOWNSCALE_MAX;
+static int downscale_x_table = MDP_DOWNSCALE_MAX;
+
+struct mdp_regs {
+ uint32_t src0;
+ uint32_t src1;
+ uint32_t dst0;
+ uint32_t dst1;
+ uint32_t src_cfg;
+ uint32_t dst_cfg;
+ uint32_t src_pack;
+ uint32_t dst_pack;
+ uint32_t src_rect;
+ uint32_t dst_rect;
+ uint32_t src_ystride;
+ uint32_t dst_ystride;
+ uint32_t op;
+ uint32_t src_bpp;
+ uint32_t dst_bpp;
+ uint32_t edge;
+ uint32_t phasex_init;
+ uint32_t phasey_init;
+ uint32_t phasex_step;
+ uint32_t phasey_step;
+};
+
+static uint32_t pack_pattern[] = {
+ PPP_ARRAY0(PACK_PATTERN)
+};
+
+static uint32_t src_img_cfg[] = {
+ PPP_ARRAY1(CFG, SRC)
+};
+
+static uint32_t dst_img_cfg[] = {
+ PPP_ARRAY1(CFG, DST)
+};
+
+static uint32_t bytes_per_pixel[] = {
+ [MDP_RGB_565] = 2,
+ [MDP_RGB_888] = 3,
+ [MDP_XRGB_8888] = 4,
+ [MDP_ARGB_8888] = 4,
+ [MDP_RGBA_8888] = 4,
+ [MDP_BGRA_8888] = 4,
+ [MDP_Y_CBCR_H2V1] = 1,
+ [MDP_Y_CBCR_H2V2] = 1,
+ [MDP_Y_CRCB_H2V1] = 1,
+ [MDP_Y_CRCB_H2V2] = 1,
+ [MDP_YCRYCB_H2V1] = 2
+};
+
+static uint32_t dst_op_chroma[] = {
+ PPP_ARRAY1(CHROMA_SAMP, DST)
+};
+
+static uint32_t src_op_chroma[] = {
+ PPP_ARRAY1(CHROMA_SAMP, SRC)
+};
+
+static uint32_t bg_op_chroma[] = {
+ PPP_ARRAY1(CHROMA_SAMP, BG)
+};
+
+static void rotate_dst_addr_x(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+ regs->dst0 += (req->dst_rect.w -
+ min((uint32_t)16, req->dst_rect.w)) * regs->dst_bpp;
+ regs->dst1 += (req->dst_rect.w -
+ min((uint32_t)16, req->dst_rect.w)) * regs->dst_bpp;
+}
+
+static void rotate_dst_addr_y(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+ regs->dst0 += (req->dst_rect.h -
+ min((uint32_t)16, req->dst_rect.h)) *
+ regs->dst_ystride;
+ regs->dst1 += (req->dst_rect.h -
+ min((uint32_t)16, req->dst_rect.h)) *
+ regs->dst_ystride;
+}
+
+static void blit_rotate(struct mdp_blit_req *req,
+ struct mdp_regs *regs)
+{
+ if (req->flags == MDP_ROT_NOP)
+ return;
+
+ regs->op |= PPP_OP_ROT_ON;
+ if ((req->flags & MDP_ROT_90 || req->flags & MDP_FLIP_LR) &&
+ !(req->flags & MDP_ROT_90 && req->flags & MDP_FLIP_LR))
+ rotate_dst_addr_x(req, regs);
+ if (req->flags & MDP_ROT_90)
+ regs->op |= PPP_OP_ROT_90;
+ if (req->flags & MDP_FLIP_UD) {
+ regs->op |= PPP_OP_FLIP_UD;
+ rotate_dst_addr_y(req, regs);
+ }
+ if (req->flags & MDP_FLIP_LR)
+ regs->op |= PPP_OP_FLIP_LR;
+}
+
+static void blit_convert(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+ if (req->src.format == req->dst.format)
+ return;
+ if (IS_RGB(req->src.format) && IS_YCRCB(req->dst.format)) {
+ regs->op |= PPP_OP_CONVERT_RGB2YCBCR | PPP_OP_CONVERT_ON;
+ } else if (IS_YCRCB(req->src.format) && IS_RGB(req->dst.format)) {
+ regs->op |= PPP_OP_CONVERT_YCBCR2RGB | PPP_OP_CONVERT_ON;
+ if (req->dst.format == MDP_RGB_565)
+ regs->op |= PPP_OP_CONVERT_MATRIX_SECONDARY;
+ }
+}
+
+#define GET_BIT_RANGE(value, high, low) \
+ (((1 << (high - low + 1)) - 1) & (value >> low))
+static uint32_t transp_convert(struct mdp_blit_req *req)
+{
+ uint32_t transp = 0;
+ if (req->src.format == MDP_RGB_565) {
+ /* pad each value to 8 bits by copying the high bits into the
+ * low end, convert RGB to RBG by switching low 2 components */
+ transp |= ((GET_BIT_RANGE(req->transp_mask, 15, 11) << 3) |
+ (GET_BIT_RANGE(req->transp_mask, 15, 13))) << 16;
+
+ transp |= ((GET_BIT_RANGE(req->transp_mask, 4, 0) << 3) |
+ (GET_BIT_RANGE(req->transp_mask, 4, 2))) << 8;
+
+ transp |= (GET_BIT_RANGE(req->transp_mask, 10, 5) << 2) |
+ (GET_BIT_RANGE(req->transp_mask, 10, 9));
+ } else {
+ /* convert RGB to RBG */
+ transp |= (GET_BIT_RANGE(req->transp_mask, 15, 8)) |
+ (GET_BIT_RANGE(req->transp_mask, 23, 16) << 16) |
+ (GET_BIT_RANGE(req->transp_mask, 7, 0) << 8);
+ }
+ return transp;
+}
+#undef GET_BIT_RANGE
+
+static void blit_blend(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+ /* TRANSP BLEND */
+ if (req->transp_mask != MDP_TRANSP_NOP) {
+ req->transp_mask = transp_convert(req);
+ if (req->alpha != MDP_ALPHA_NOP) {
+ /* use blended transparancy mode
+ * pixel = (src == transp) ? dst : blend
+ * blend is combo of blend_eq_sel and
+ * blend_alpha_sel */
+ regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+ PPP_OP_BLEND_ALPHA_BLEND_NORMAL |
+ PPP_OP_BLEND_CONSTANT_ALPHA |
+ PPP_BLEND_ALPHA_TRANSP;
+ } else {
+ /* simple transparancy mode
+ * pixel = (src == transp) ? dst : src */
+ regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+ PPP_OP_BLEND_SRCPIXEL_TRANSP;
+ }
+ }
+
+ req->alpha &= 0xff;
+ /* ALPHA BLEND */
+ if (HAS_ALPHA(req->src.format)) {
+ regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+ PPP_OP_BLEND_SRCPIXEL_ALPHA;
+ } else if (req->alpha < MDP_ALPHA_NOP) {
+ /* just blend by alpha */
+ regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+ PPP_OP_BLEND_ALPHA_BLEND_NORMAL |
+ PPP_OP_BLEND_CONSTANT_ALPHA;
+ }
+
+ regs->op |= bg_op_chroma[req->dst.format];
+}
+
+#define ONE_HALF (1LL << 32)
+#define ONE (1LL << 33)
+#define TWO (2LL << 33)
+#define THREE (3LL << 33)
+#define FRAC_MASK (ONE - 1)
+#define INT_MASK (~FRAC_MASK)
+
+static int scale_params(uint32_t dim_in, uint32_t dim_out, uint32_t origin,
+ uint32_t *phase_init, uint32_t *phase_step)
+{
+ /* to improve precicsion calculations are done in U31.33 and converted
+ * to U3.29 at the end */
+ int64_t k1, k2, k3, k4, tmp;
+ uint64_t n, d, os, os_p, od, od_p, oreq;
+ unsigned rpa = 0;
+ int64_t ip64, delta;
+
+ if (dim_out % 3 == 0)
+ rpa = !(dim_in % (dim_out / 3));
+
+ n = ((uint64_t)dim_out) << 34;
+ d = dim_in;
+ if (!d)
+ return -1;
+ do_div(n, d);
+ k3 = (n + 1) >> 1;
+ if ((k3 >> 4) < (1LL << 27) || (k3 >> 4) > (1LL << 31)) {
+ DLOG("crap bad scale\n");
+ return -1;
+ }
+ n = ((uint64_t)dim_in) << 34;
+ d = (uint64_t)dim_out;
+ if (!d)
+ return -1;
+ do_div(n, d);
+ k1 = (n + 1) >> 1;
+ k2 = (k1 - ONE) >> 1;
+
+ *phase_init = (int)(k2 >> 4);
+ k4 = (k3 - ONE) >> 1;
+
+ if (rpa) {
+ os = ((uint64_t)origin << 33) - ONE_HALF;
+ tmp = (dim_out * os) + ONE_HALF;
+ if (!dim_in)
+ return -1;
+ do_div(tmp, dim_in);
+ od = tmp - ONE_HALF;
+ } else {
+ os = ((uint64_t)origin << 1) - 1;
+ od = (((k3 * os) >> 1) + k4);
+ }
+
+ od_p = od & INT_MASK;
+ if (od_p != od)
+ od_p += ONE;
+
+ if (rpa) {
+ tmp = (dim_in * od_p) + ONE_HALF;
+ if (!dim_in)
+ return -1;
+ do_div(tmp, dim_in);
+ os_p = tmp - ONE_HALF;
+ } else {
+ os_p = ((k1 * (od_p >> 33)) + k2);
+ }
+
+ oreq = (os_p & INT_MASK) - ONE;
+
+ ip64 = os_p - oreq;
+ delta = ((int64_t)(origin) << 33) - oreq;
+ ip64 -= delta;
+ /* limit to valid range before the left shift */
+ delta = (ip64 & (1LL << 63)) ? 4 : -4;
+ delta <<= 33;
+ while (abs((int)(ip64 >> 33)) > 4)
+ ip64 += delta;
+ *phase_init = (int)(ip64 >> 4);
+ *phase_step = (uint32_t)(k1 >> 4);
+ return 0;
+}
+
+static void load_scale_table(const struct mdp_info *mdp,
+ struct mdp_table_entry *table, int len)
+{
+ int i;
+ for (i = 0; i < len; i++)
+ mdp_writel(mdp, table[i].val, table[i].reg);
+}
+
+enum {
+IMG_LEFT,
+IMG_RIGHT,
+IMG_TOP,
+IMG_BOTTOM,
+};
+
+static void get_edge_info(uint32_t src, uint32_t src_coord, uint32_t dst,
+ uint32_t *interp1, uint32_t *interp2,
+ uint32_t *repeat1, uint32_t *repeat2) {
+ if (src > 3 * dst) {
+ *interp1 = 0;
+ *interp2 = src - 1;
+ *repeat1 = 0;
+ *repeat2 = 0;
+ } else if (src == 3 * dst) {
+ *interp1 = 0;
+ *interp2 = src;
+ *repeat1 = 0;
+ *repeat2 = 1;
+ } else if (src > dst && src < 3 * dst) {
+ *interp1 = -1;
+ *interp2 = src;
+ *repeat1 = 1;
+ *repeat2 = 1;
+ } else if (src == dst) {
+ *interp1 = -1;
+ *interp2 = src + 1;
+ *repeat1 = 1;
+ *repeat2 = 2;
+ } else {
+ *interp1 = -2;
+ *interp2 = src + 1;
+ *repeat1 = 2;
+ *repeat2 = 2;
+ }
+ *interp1 += src_coord;
+ *interp2 += src_coord;
+}
+
+static int get_edge_cond(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+ int32_t luma_interp[4];
+ int32_t luma_repeat[4];
+ int32_t chroma_interp[4];
+ int32_t chroma_bound[4];
+ int32_t chroma_repeat[4];
+ uint32_t dst_w, dst_h;
+
+ memset(&luma_interp, 0, sizeof(int32_t) * 4);
+ memset(&luma_repeat, 0, sizeof(int32_t) * 4);
+ memset(&chroma_interp, 0, sizeof(int32_t) * 4);
+ memset(&chroma_bound, 0, sizeof(int32_t) * 4);
+ memset(&chroma_repeat, 0, sizeof(int32_t) * 4);
+ regs->edge = 0;
+
+ if (req->flags & MDP_ROT_90) {
+ dst_w = req->dst_rect.h;
+ dst_h = req->dst_rect.w;
+ } else {
+ dst_w = req->dst_rect.w;
+ dst_h = req->dst_rect.h;
+ }
+
+ if (regs->op & (PPP_OP_SCALE_Y_ON | PPP_OP_SCALE_X_ON)) {
+ get_edge_info(req->src_rect.h, req->src_rect.y, dst_h,
+ &luma_interp[IMG_TOP], &luma_interp[IMG_BOTTOM],
+ &luma_repeat[IMG_TOP], &luma_repeat[IMG_BOTTOM]);
+ get_edge_info(req->src_rect.w, req->src_rect.x, dst_w,
+ &luma_interp[IMG_LEFT], &luma_interp[IMG_RIGHT],
+ &luma_repeat[IMG_LEFT], &luma_repeat[IMG_RIGHT]);
+ } else {
+ luma_interp[IMG_LEFT] = req->src_rect.x;
+ luma_interp[IMG_RIGHT] = req->src_rect.x + req->src_rect.w - 1;
+ luma_interp[IMG_TOP] = req->src_rect.y;
+ luma_interp[IMG_BOTTOM] = req->src_rect.y + req->src_rect.h - 1;
+ luma_repeat[IMG_LEFT] = 0;
+ luma_repeat[IMG_TOP] = 0;
+ luma_repeat[IMG_RIGHT] = 0;
+ luma_repeat[IMG_BOTTOM] = 0;
+ }
+
+ chroma_interp[IMG_LEFT] = luma_interp[IMG_LEFT];
+ chroma_interp[IMG_RIGHT] = luma_interp[IMG_RIGHT];
+ chroma_interp[IMG_TOP] = luma_interp[IMG_TOP];
+ chroma_interp[IMG_BOTTOM] = luma_interp[IMG_BOTTOM];
+
+ chroma_bound[IMG_LEFT] = req->src_rect.x;
+ chroma_bound[IMG_RIGHT] = req->src_rect.x + req->src_rect.w - 1;
+ chroma_bound[IMG_TOP] = req->src_rect.y;
+ chroma_bound[IMG_BOTTOM] = req->src_rect.y + req->src_rect.h - 1;
+
+ if (IS_YCRCB(req->src.format)) {
+ chroma_interp[IMG_LEFT] = chroma_interp[IMG_LEFT] >> 1;
+ chroma_interp[IMG_RIGHT] = (chroma_interp[IMG_RIGHT] + 1) >> 1;
+
+ chroma_bound[IMG_LEFT] = chroma_bound[IMG_LEFT] >> 1;
+ chroma_bound[IMG_RIGHT] = chroma_bound[IMG_RIGHT] >> 1;
+ }
+
+ if (req->src.format == MDP_Y_CBCR_H2V2 ||
+ req->src.format == MDP_Y_CRCB_H2V2) {
+ chroma_interp[IMG_TOP] = (chroma_interp[IMG_TOP] - 1) >> 1;
+ chroma_interp[IMG_BOTTOM] = (chroma_interp[IMG_BOTTOM] + 1)
+ >> 1;
+ chroma_bound[IMG_TOP] = (chroma_bound[IMG_TOP] + 1) >> 1;
+ chroma_bound[IMG_BOTTOM] = chroma_bound[IMG_BOTTOM] >> 1;
+ }
+
+ chroma_repeat[IMG_LEFT] = chroma_bound[IMG_LEFT] -
+ chroma_interp[IMG_LEFT];
+ chroma_repeat[IMG_RIGHT] = chroma_interp[IMG_RIGHT] -
+ chroma_bound[IMG_RIGHT];
+ chroma_repeat[IMG_TOP] = chroma_bound[IMG_TOP] -
+ chroma_interp[IMG_TOP];
+ chroma_repeat[IMG_BOTTOM] = chroma_interp[IMG_BOTTOM] -
+ chroma_bound[IMG_BOTTOM];
+
+ if (chroma_repeat[IMG_LEFT] < 0 || chroma_repeat[IMG_LEFT] > 3 ||
+ chroma_repeat[IMG_RIGHT] < 0 || chroma_repeat[IMG_RIGHT] > 3 ||
+ chroma_repeat[IMG_TOP] < 0 || chroma_repeat[IMG_TOP] > 3 ||
+ chroma_repeat[IMG_BOTTOM] < 0 || chroma_repeat[IMG_BOTTOM] > 3 ||
+ luma_repeat[IMG_LEFT] < 0 || luma_repeat[IMG_LEFT] > 3 ||
+ luma_repeat[IMG_RIGHT] < 0 || luma_repeat[IMG_RIGHT] > 3 ||
+ luma_repeat[IMG_TOP] < 0 || luma_repeat[IMG_TOP] > 3 ||
+ luma_repeat[IMG_BOTTOM] < 0 || luma_repeat[IMG_BOTTOM] > 3)
+ return -1;
+
+ regs->edge |= (chroma_repeat[IMG_LEFT] & 3) << MDP_LEFT_CHROMA;
+ regs->edge |= (chroma_repeat[IMG_RIGHT] & 3) << MDP_RIGHT_CHROMA;
+ regs->edge |= (chroma_repeat[IMG_TOP] & 3) << MDP_TOP_CHROMA;
+ regs->edge |= (chroma_repeat[IMG_BOTTOM] & 3) << MDP_BOTTOM_CHROMA;
+ regs->edge |= (luma_repeat[IMG_LEFT] & 3) << MDP_LEFT_LUMA;
+ regs->edge |= (luma_repeat[IMG_RIGHT] & 3) << MDP_RIGHT_LUMA;
+ regs->edge |= (luma_repeat[IMG_TOP] & 3) << MDP_TOP_LUMA;
+ regs->edge |= (luma_repeat[IMG_BOTTOM] & 3) << MDP_BOTTOM_LUMA;
+ return 0;
+}
+
+static int blit_scale(const struct mdp_info *mdp, struct mdp_blit_req *req,
+ struct mdp_regs *regs)
+{
+ uint32_t phase_init_x, phase_init_y, phase_step_x, phase_step_y;
+ uint32_t scale_factor_x, scale_factor_y;
+ uint32_t downscale;
+ uint32_t dst_w, dst_h;
+
+ if (req->flags & MDP_ROT_90) {
+ dst_w = req->dst_rect.h;
+ dst_h = req->dst_rect.w;
+ } else {
+ dst_w = req->dst_rect.w;
+ dst_h = req->dst_rect.h;
+ }
+ if ((req->src_rect.w == dst_w) && (req->src_rect.h == dst_h) &&
+ !(req->flags & MDP_BLUR)) {
+ regs->phasex_init = 0;
+ regs->phasey_init = 0;
+ regs->phasex_step = 0;
+ regs->phasey_step = 0;
+ return 0;
+ }
+
+ if (scale_params(req->src_rect.w, dst_w, 1, &phase_init_x,
+ &phase_step_x) ||
+ scale_params(req->src_rect.h, dst_h, 1, &phase_init_y,
+ &phase_step_y))
+ return -1;
+
+ scale_factor_x = (dst_w * 10) / req->src_rect.w;
+ scale_factor_y = (dst_h * 10) / req->src_rect.h;
+
+ if (scale_factor_x > 8)
+ downscale = MDP_DOWNSCALE_PT8TO1;
+ else if (scale_factor_x > 6)
+ downscale = MDP_DOWNSCALE_PT6TOPT8;
+ else if (scale_factor_x > 4)
+ downscale = MDP_DOWNSCALE_PT4TOPT6;
+ else
+ downscale = MDP_DOWNSCALE_PT2TOPT4;
+ if (downscale != downscale_x_table) {
+ load_scale_table(mdp, mdp_downscale_x_table[downscale], 64);
+ downscale_x_table = downscale;
+ }
+
+ if (scale_factor_y > 8)
+ downscale = MDP_DOWNSCALE_PT8TO1;
+ else if (scale_factor_y > 6)
+ downscale = MDP_DOWNSCALE_PT6TOPT8;
+ else if (scale_factor_y > 4)
+ downscale = MDP_DOWNSCALE_PT4TOPT6;
+ else
+ downscale = MDP_DOWNSCALE_PT2TOPT4;
+ if (downscale != downscale_y_table) {
+ load_scale_table(mdp, mdp_downscale_y_table[downscale], 64);
+ downscale_y_table = downscale;
+ }
+
+ regs->phasex_init = phase_init_x;
+ regs->phasey_init = phase_init_y;
+ regs->phasex_step = phase_step_x;
+ regs->phasey_step = phase_step_y;
+ regs->op |= (PPP_OP_SCALE_Y_ON | PPP_OP_SCALE_X_ON);
+ return 0;
+
+}
+
+static void blit_blur(const struct mdp_info *mdp, struct mdp_blit_req *req,
+ struct mdp_regs *regs)
+{
+ if (!(req->flags & MDP_BLUR))
+ return;
+
+ if (!(downscale_x_table == MDP_DOWNSCALE_BLUR &&
+ downscale_y_table == MDP_DOWNSCALE_BLUR)) {
+ load_scale_table(mdp, mdp_gaussian_blur_table, 128);
+ downscale_x_table = MDP_DOWNSCALE_BLUR;
+ downscale_y_table = MDP_DOWNSCALE_BLUR;
+ }
+
+ regs->op |= (PPP_OP_SCALE_Y_ON | PPP_OP_SCALE_X_ON);
+}
+
+
+#define IMG_LEN(rect_h, w, rect_w, bpp) (((rect_h) * w) * bpp)
+
+#define Y_TO_CRCB_RATIO(format) \
+ ((format == MDP_Y_CBCR_H2V2 || format == MDP_Y_CRCB_H2V2) ? 2 :\
+ (format == MDP_Y_CBCR_H2V1 || format == MDP_Y_CRCB_H2V1) ? 1 : 1)
+
+static void get_len(struct mdp_img *img, struct mdp_rect *rect, uint32_t bpp,
+ uint32_t *len0, uint32_t *len1)
+{
+ *len0 = IMG_LEN(rect->h, img->width, rect->w, bpp);
+ if (IS_PSEUDOPLNR(img->format))
+ *len1 = *len0/Y_TO_CRCB_RATIO(img->format);
+ else
+ *len1 = 0;
+}
+
+static int valid_src_dst(unsigned long src_start, unsigned long src_len,
+ unsigned long dst_start, unsigned long dst_len,
+ struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+ unsigned long src_min_ok = src_start;
+ unsigned long src_max_ok = src_start + src_len;
+ unsigned long dst_min_ok = dst_start;
+ unsigned long dst_max_ok = dst_start + dst_len;
+ uint32_t src0_len, src1_len, dst0_len, dst1_len;
+ get_len(&req->src, &req->src_rect, regs->src_bpp, &src0_len,
+ &src1_len);
+ get_len(&req->dst, &req->dst_rect, regs->dst_bpp, &dst0_len,
+ &dst1_len);
+
+ if (regs->src0 < src_min_ok || regs->src0 > src_max_ok ||
+ regs->src0 + src0_len > src_max_ok) {
+ DLOG("invalid_src %x %x %lx %lx\n", regs->src0,
+ src0_len, src_min_ok, src_max_ok);
+ return 0;
+ }
+ if (regs->src_cfg & PPP_SRC_PLANE_PSEUDOPLNR) {
+ if (regs->src1 < src_min_ok || regs->src1 > src_max_ok ||
+ regs->src1 + src1_len > src_max_ok) {
+ DLOG("invalid_src1");
+ return 0;
+ }
+ }
+ if (regs->dst0 < dst_min_ok || regs->dst0 > dst_max_ok ||
+ regs->dst0 + dst0_len > dst_max_ok) {
+ DLOG("invalid_dst");
+ return 0;
+ }
+ if (regs->dst_cfg & PPP_SRC_PLANE_PSEUDOPLNR) {
+ if (regs->dst1 < dst_min_ok || regs->dst1 > dst_max_ok ||
+ regs->dst1 + dst1_len > dst_max_ok) {
+ DLOG("invalid_dst1");
+ return 0;
+ }
+ }
+ return 1;
+}
+
+
+static void flush_imgs(struct mdp_blit_req *req, struct mdp_regs *regs,
+ struct file *src_file, struct file *dst_file)
+{
+#ifdef CONFIG_ANDROID_PMEM
+ uint32_t src0_len, src1_len, dst0_len, dst1_len;
+
+ /* flush src images to memory before dma to mdp */
+ get_len(&req->src, &req->src_rect, regs->src_bpp, &src0_len,
+ &src1_len);
+ flush_pmem_file(src_file, req->src.offset, src0_len);
+ if (IS_PSEUDOPLNR(req->src.format))
+ flush_pmem_file(src_file, req->src.offset + src0_len,
+ src1_len);
+
+ /* flush dst images */
+ get_len(&req->dst, &req->dst_rect, regs->dst_bpp, &dst0_len,
+ &dst1_len);
+ flush_pmem_file(dst_file, req->dst.offset, dst0_len);
+ if (IS_PSEUDOPLNR(req->dst.format))
+ flush_pmem_file(dst_file, req->dst.offset + dst0_len,
+ dst1_len);
+#endif
+}
+
+static void get_chroma_addr(struct mdp_img *img, struct mdp_rect *rect,
+ uint32_t base, uint32_t bpp, uint32_t cfg,
+ uint32_t *addr, uint32_t *ystride)
+{
+ uint32_t compress_v = Y_TO_CRCB_RATIO(img->format);
+ uint32_t compress_h = 2;
+ uint32_t offset;
+
+ if (IS_PSEUDOPLNR(img->format)) {
+ offset = (rect->x / compress_h) * compress_h;
+ offset += rect->y == 0 ? 0 :
+ ((rect->y + 1) / compress_v) * img->width;
+ *addr = base + (img->width * img->height * bpp);
+ *addr += offset * bpp;
+ *ystride |= *ystride << 16;
+ } else {
+ *addr = 0;
+ }
+}
+
+static int send_blit(const struct mdp_info *mdp, struct mdp_blit_req *req,
+ struct mdp_regs *regs, struct file *src_file,
+ struct file *dst_file)
+{
+ mdp_writel(mdp, 1, 0x060);
+ mdp_writel(mdp, regs->src_rect, PPP_ADDR_SRC_ROI);
+ mdp_writel(mdp, regs->src0, PPP_ADDR_SRC0);
+ mdp_writel(mdp, regs->src1, PPP_ADDR_SRC1);
+ mdp_writel(mdp, regs->src_ystride, PPP_ADDR_SRC_YSTRIDE);
+ mdp_writel(mdp, regs->src_cfg, PPP_ADDR_SRC_CFG);
+ mdp_writel(mdp, regs->src_pack, PPP_ADDR_SRC_PACK_PATTERN);
+
+ mdp_writel(mdp, regs->op, PPP_ADDR_OPERATION);
+ mdp_writel(mdp, regs->phasex_init, PPP_ADDR_PHASEX_INIT);
+ mdp_writel(mdp, regs->phasey_init, PPP_ADDR_PHASEY_INIT);
+ mdp_writel(mdp, regs->phasex_step, PPP_ADDR_PHASEX_STEP);
+ mdp_writel(mdp, regs->phasey_step, PPP_ADDR_PHASEY_STEP);
+
+ mdp_writel(mdp, (req->alpha << 24) | (req->transp_mask & 0xffffff),
+ PPP_ADDR_ALPHA_TRANSP);
+
+ mdp_writel(mdp, regs->dst_cfg, PPP_ADDR_DST_CFG);
+ mdp_writel(mdp, regs->dst_pack, PPP_ADDR_DST_PACK_PATTERN);
+ mdp_writel(mdp, regs->dst_rect, PPP_ADDR_DST_ROI);
+ mdp_writel(mdp, regs->dst0, PPP_ADDR_DST0);
+ mdp_writel(mdp, regs->dst1, PPP_ADDR_DST1);
+ mdp_writel(mdp, regs->dst_ystride, PPP_ADDR_DST_YSTRIDE);
+
+ mdp_writel(mdp, regs->edge, PPP_ADDR_EDGE);
+ if (regs->op & PPP_OP_BLEND_ON) {
+ mdp_writel(mdp, regs->dst0, PPP_ADDR_BG0);
+ mdp_writel(mdp, regs->dst1, PPP_ADDR_BG1);
+ mdp_writel(mdp, regs->dst_ystride, PPP_ADDR_BG_YSTRIDE);
+ mdp_writel(mdp, src_img_cfg[req->dst.format], PPP_ADDR_BG_CFG);
+ mdp_writel(mdp, pack_pattern[req->dst.format],
+ PPP_ADDR_BG_PACK_PATTERN);
+ }
+ flush_imgs(req, regs, src_file, dst_file);
+ mdp_writel(mdp, 0x1000, MDP_DISPLAY0_START);
+ return 0;
+}
+
+int mdp_ppp_blit(const struct mdp_info *mdp, struct mdp_blit_req *req,
+ struct file *src_file, unsigned long src_start, unsigned long src_len,
+ struct file *dst_file, unsigned long dst_start, unsigned long dst_len)
+{
+ struct mdp_regs regs = {0};
+
+ if (unlikely(req->src.format >= MDP_IMGTYPE_LIMIT ||
+ req->dst.format >= MDP_IMGTYPE_LIMIT)) {
+ printk(KERN_ERR "mpd_ppp: img is of wrong format\n");
+ return -EINVAL;
+ }
+
+ if (unlikely(req->src_rect.x > req->src.width ||
+ req->src_rect.y > req->src.height ||
+ req->dst_rect.x > req->dst.width ||
+ req->dst_rect.y > req->dst.height)) {
+ printk(KERN_ERR "mpd_ppp: img rect is outside of img!\n");
+ return -EINVAL;
+ }
+
+ /* set the src image configuration */
+ regs.src_cfg = src_img_cfg[req->src.format];
+ regs.src_cfg |= (req->src_rect.x & 0x1) ? PPP_SRC_BPP_ROI_ODD_X : 0;
+ regs.src_cfg |= (req->src_rect.y & 0x1) ? PPP_SRC_BPP_ROI_ODD_Y : 0;
+ regs.src_rect = (req->src_rect.h << 16) | req->src_rect.w;
+ regs.src_pack = pack_pattern[req->src.format];
+
+ /* set the dest image configuration */
+ regs.dst_cfg = dst_img_cfg[req->dst.format] | PPP_DST_OUT_SEL_AXI;
+ regs.dst_rect = (req->dst_rect.h << 16) | req->dst_rect.w;
+ regs.dst_pack = pack_pattern[req->dst.format];
+
+ /* set src, bpp, start pixel and ystride */
+ regs.src_bpp = bytes_per_pixel[req->src.format];
+ regs.src0 = src_start + req->src.offset;
+ regs.src_ystride = req->src.width * regs.src_bpp;
+ get_chroma_addr(&req->src, &req->src_rect, regs.src0, regs.src_bpp,
+ regs.src_cfg, ®s.src1, ®s.src_ystride);
+ regs.src0 += (req->src_rect.x + (req->src_rect.y * req->src.width)) *
+ regs.src_bpp;
+
+ /* set dst, bpp, start pixel and ystride */
+ regs.dst_bpp = bytes_per_pixel[req->dst.format];
+ regs.dst0 = dst_start + req->dst.offset;
+ regs.dst_ystride = req->dst.width * regs.dst_bpp;
+ get_chroma_addr(&req->dst, &req->dst_rect, regs.dst0, regs.dst_bpp,
+ regs.dst_cfg, ®s.dst1, ®s.dst_ystride);
+ regs.dst0 += (req->dst_rect.x + (req->dst_rect.y * req->dst.width)) *
+ regs.dst_bpp;
+
+ if (!valid_src_dst(src_start, src_len, dst_start, dst_len, req,
+ ®s)) {
+ printk(KERN_ERR "mpd_ppp: final src or dst location is "
+ "invalid, are you trying to make an image too large "
+ "or to place it outside the screen?\n");
+ return -EINVAL;
+ }
+
+ /* set up operation register */
+ regs.op = 0;
+ blit_rotate(req, ®s);
+ blit_convert(req, ®s);
+ if (req->flags & MDP_DITHER)
+ regs.op |= PPP_OP_DITHER_EN;
+ blit_blend(req, ®s);
+ if (blit_scale(mdp, req, ®s)) {
+ printk(KERN_ERR "mpd_ppp: error computing scale for img.\n");
+ return -EINVAL;
+ }
+ blit_blur(mdp, req, ®s);
+ regs.op |= dst_op_chroma[req->dst.format] |
+ src_op_chroma[req->src.format];
+
+ /* if the image is YCRYCB, the x and w must be even */
+ if (unlikely(req->src.format == MDP_YCRYCB_H2V1)) {
+ req->src_rect.x = req->src_rect.x & (~0x1);
+ req->src_rect.w = req->src_rect.w & (~0x1);
+ req->dst_rect.x = req->dst_rect.x & (~0x1);
+ req->dst_rect.w = req->dst_rect.w & (~0x1);
+ }
+ if (get_edge_cond(req, ®s))
+ return -EINVAL;
+
+ send_blit(mdp, req, ®s, src_file, dst_file);
+ return 0;
+}
diff --git a/drivers/video/msm/mdp_scale_tables.c b/drivers/video/msm/mdp_scale_tables.c
new file mode 100644
index 0000000..604783b
--- /dev/null
+++ b/drivers/video/msm/mdp_scale_tables.c
@@ -0,0 +1,766 @@
+/* drivers/video/msm_fb/mdp_scale_tables.c
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+#include "mdp_scale_tables.h"
+#include "mdp_hw.h"
+
+struct mdp_table_entry mdp_upscale_table[] = {
+ { 0x5fffc, 0x0 },
+ { 0x50200, 0x7fc00000 },
+ { 0x5fffc, 0xff80000d },
+ { 0x50204, 0x7ec003f9 },
+ { 0x5fffc, 0xfec0001c },
+ { 0x50208, 0x7d4003f3 },
+ { 0x5fffc, 0xfe40002b },
+ { 0x5020c, 0x7b8003ed },
+ { 0x5fffc, 0xfd80003c },
+ { 0x50210, 0x794003e8 },
+ { 0x5fffc, 0xfcc0004d },
+ { 0x50214, 0x76c003e4 },
+ { 0x5fffc, 0xfc40005f },
+ { 0x50218, 0x73c003e0 },
+ { 0x5fffc, 0xfb800071 },
+ { 0x5021c, 0x708003de },
+ { 0x5fffc, 0xfac00085 },
+ { 0x50220, 0x6d0003db },
+ { 0x5fffc, 0xfa000098 },
+ { 0x50224, 0x698003d9 },
+ { 0x5fffc, 0xf98000ac },
+ { 0x50228, 0x654003d8 },
+ { 0x5fffc, 0xf8c000c1 },
+ { 0x5022c, 0x610003d7 },
+ { 0x5fffc, 0xf84000d5 },
+ { 0x50230, 0x5c8003d7 },
+ { 0x5fffc, 0xf7c000e9 },
+ { 0x50234, 0x580003d7 },
+ { 0x5fffc, 0xf74000fd },
+ { 0x50238, 0x534003d8 },
+ { 0x5fffc, 0xf6c00112 },
+ { 0x5023c, 0x4e8003d8 },
+ { 0x5fffc, 0xf6800126 },
+ { 0x50240, 0x494003da },
+ { 0x5fffc, 0xf600013a },
+ { 0x50244, 0x448003db },
+ { 0x5fffc, 0xf600014d },
+ { 0x50248, 0x3f4003dd },
+ { 0x5fffc, 0xf5c00160 },
+ { 0x5024c, 0x3a4003df },
+ { 0x5fffc, 0xf5c00172 },
+ { 0x50250, 0x354003e1 },
+ { 0x5fffc, 0xf5c00184 },
+ { 0x50254, 0x304003e3 },
+ { 0x5fffc, 0xf6000195 },
+ { 0x50258, 0x2b0003e6 },
+ { 0x5fffc, 0xf64001a6 },
+ { 0x5025c, 0x260003e8 },
+ { 0x5fffc, 0xf6c001b4 },
+ { 0x50260, 0x214003eb },
+ { 0x5fffc, 0xf78001c2 },
+ { 0x50264, 0x1c4003ee },
+ { 0x5fffc, 0xf80001cf },
+ { 0x50268, 0x17c003f1 },
+ { 0x5fffc, 0xf90001db },
+ { 0x5026c, 0x134003f3 },
+ { 0x5fffc, 0xfa0001e5 },
+ { 0x50270, 0xf0003f6 },
+ { 0x5fffc, 0xfb4001ee },
+ { 0x50274, 0xac003f9 },
+ { 0x5fffc, 0xfcc001f5 },
+ { 0x50278, 0x70003fb },
+ { 0x5fffc, 0xfe4001fb },
+ { 0x5027c, 0x34003fe },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT2TOPT4[] = {
+ { 0x5fffc, 0x740008c },
+ { 0x50280, 0x33800088 },
+ { 0x5fffc, 0x800008e },
+ { 0x50284, 0x33400084 },
+ { 0x5fffc, 0x8400092 },
+ { 0x50288, 0x33000080 },
+ { 0x5fffc, 0x9000094 },
+ { 0x5028c, 0x3300007b },
+ { 0x5fffc, 0x9c00098 },
+ { 0x50290, 0x32400077 },
+ { 0x5fffc, 0xa40009b },
+ { 0x50294, 0x32000073 },
+ { 0x5fffc, 0xb00009d },
+ { 0x50298, 0x31c0006f },
+ { 0x5fffc, 0xbc000a0 },
+ { 0x5029c, 0x3140006b },
+ { 0x5fffc, 0xc8000a2 },
+ { 0x502a0, 0x31000067 },
+ { 0x5fffc, 0xd8000a5 },
+ { 0x502a4, 0x30800062 },
+ { 0x5fffc, 0xe4000a8 },
+ { 0x502a8, 0x2fc0005f },
+ { 0x5fffc, 0xec000aa },
+ { 0x502ac, 0x2fc0005b },
+ { 0x5fffc, 0xf8000ad },
+ { 0x502b0, 0x2f400057 },
+ { 0x5fffc, 0x108000b0 },
+ { 0x502b4, 0x2e400054 },
+ { 0x5fffc, 0x114000b2 },
+ { 0x502b8, 0x2e000050 },
+ { 0x5fffc, 0x124000b4 },
+ { 0x502bc, 0x2d80004c },
+ { 0x5fffc, 0x130000b6 },
+ { 0x502c0, 0x2d000049 },
+ { 0x5fffc, 0x140000b8 },
+ { 0x502c4, 0x2c800045 },
+ { 0x5fffc, 0x150000b9 },
+ { 0x502c8, 0x2c000042 },
+ { 0x5fffc, 0x15c000bd },
+ { 0x502cc, 0x2b40003e },
+ { 0x5fffc, 0x16c000bf },
+ { 0x502d0, 0x2a80003b },
+ { 0x5fffc, 0x17c000bf },
+ { 0x502d4, 0x2a000039 },
+ { 0x5fffc, 0x188000c2 },
+ { 0x502d8, 0x29400036 },
+ { 0x5fffc, 0x19c000c4 },
+ { 0x502dc, 0x28800032 },
+ { 0x5fffc, 0x1ac000c5 },
+ { 0x502e0, 0x2800002f },
+ { 0x5fffc, 0x1bc000c7 },
+ { 0x502e4, 0x2740002c },
+ { 0x5fffc, 0x1cc000c8 },
+ { 0x502e8, 0x26c00029 },
+ { 0x5fffc, 0x1dc000c9 },
+ { 0x502ec, 0x26000027 },
+ { 0x5fffc, 0x1ec000cc },
+ { 0x502f0, 0x25000024 },
+ { 0x5fffc, 0x200000cc },
+ { 0x502f4, 0x24800021 },
+ { 0x5fffc, 0x210000cd },
+ { 0x502f8, 0x23800020 },
+ { 0x5fffc, 0x220000ce },
+ { 0x502fc, 0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT4TOPT6[] = {
+ { 0x5fffc, 0x740008c },
+ { 0x50280, 0x33800088 },
+ { 0x5fffc, 0x800008e },
+ { 0x50284, 0x33400084 },
+ { 0x5fffc, 0x8400092 },
+ { 0x50288, 0x33000080 },
+ { 0x5fffc, 0x9000094 },
+ { 0x5028c, 0x3300007b },
+ { 0x5fffc, 0x9c00098 },
+ { 0x50290, 0x32400077 },
+ { 0x5fffc, 0xa40009b },
+ { 0x50294, 0x32000073 },
+ { 0x5fffc, 0xb00009d },
+ { 0x50298, 0x31c0006f },
+ { 0x5fffc, 0xbc000a0 },
+ { 0x5029c, 0x3140006b },
+ { 0x5fffc, 0xc8000a2 },
+ { 0x502a0, 0x31000067 },
+ { 0x5fffc, 0xd8000a5 },
+ { 0x502a4, 0x30800062 },
+ { 0x5fffc, 0xe4000a8 },
+ { 0x502a8, 0x2fc0005f },
+ { 0x5fffc, 0xec000aa },
+ { 0x502ac, 0x2fc0005b },
+ { 0x5fffc, 0xf8000ad },
+ { 0x502b0, 0x2f400057 },
+ { 0x5fffc, 0x108000b0 },
+ { 0x502b4, 0x2e400054 },
+ { 0x5fffc, 0x114000b2 },
+ { 0x502b8, 0x2e000050 },
+ { 0x5fffc, 0x124000b4 },
+ { 0x502bc, 0x2d80004c },
+ { 0x5fffc, 0x130000b6 },
+ { 0x502c0, 0x2d000049 },
+ { 0x5fffc, 0x140000b8 },
+ { 0x502c4, 0x2c800045 },
+ { 0x5fffc, 0x150000b9 },
+ { 0x502c8, 0x2c000042 },
+ { 0x5fffc, 0x15c000bd },
+ { 0x502cc, 0x2b40003e },
+ { 0x5fffc, 0x16c000bf },
+ { 0x502d0, 0x2a80003b },
+ { 0x5fffc, 0x17c000bf },
+ { 0x502d4, 0x2a000039 },
+ { 0x5fffc, 0x188000c2 },
+ { 0x502d8, 0x29400036 },
+ { 0x5fffc, 0x19c000c4 },
+ { 0x502dc, 0x28800032 },
+ { 0x5fffc, 0x1ac000c5 },
+ { 0x502e0, 0x2800002f },
+ { 0x5fffc, 0x1bc000c7 },
+ { 0x502e4, 0x2740002c },
+ { 0x5fffc, 0x1cc000c8 },
+ { 0x502e8, 0x26c00029 },
+ { 0x5fffc, 0x1dc000c9 },
+ { 0x502ec, 0x26000027 },
+ { 0x5fffc, 0x1ec000cc },
+ { 0x502f0, 0x25000024 },
+ { 0x5fffc, 0x200000cc },
+ { 0x502f4, 0x24800021 },
+ { 0x5fffc, 0x210000cd },
+ { 0x502f8, 0x23800020 },
+ { 0x5fffc, 0x220000ce },
+ { 0x502fc, 0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT6TOPT8[] = {
+ { 0x5fffc, 0xfe000070 },
+ { 0x50280, 0x4bc00068 },
+ { 0x5fffc, 0xfe000078 },
+ { 0x50284, 0x4bc00060 },
+ { 0x5fffc, 0xfe000080 },
+ { 0x50288, 0x4b800059 },
+ { 0x5fffc, 0xfe000089 },
+ { 0x5028c, 0x4b000052 },
+ { 0x5fffc, 0xfe400091 },
+ { 0x50290, 0x4a80004b },
+ { 0x5fffc, 0xfe40009a },
+ { 0x50294, 0x4a000044 },
+ { 0x5fffc, 0xfe8000a3 },
+ { 0x50298, 0x4940003d },
+ { 0x5fffc, 0xfec000ac },
+ { 0x5029c, 0x48400037 },
+ { 0x5fffc, 0xff0000b4 },
+ { 0x502a0, 0x47800031 },
+ { 0x5fffc, 0xff8000bd },
+ { 0x502a4, 0x4640002b },
+ { 0x5fffc, 0xc5 },
+ { 0x502a8, 0x45000026 },
+ { 0x5fffc, 0x8000ce },
+ { 0x502ac, 0x43800021 },
+ { 0x5fffc, 0x10000d6 },
+ { 0x502b0, 0x4240001c },
+ { 0x5fffc, 0x18000df },
+ { 0x502b4, 0x40800018 },
+ { 0x5fffc, 0x24000e6 },
+ { 0x502b8, 0x3f000014 },
+ { 0x5fffc, 0x30000ee },
+ { 0x502bc, 0x3d400010 },
+ { 0x5fffc, 0x40000f5 },
+ { 0x502c0, 0x3b80000c },
+ { 0x5fffc, 0x50000fc },
+ { 0x502c4, 0x39800009 },
+ { 0x5fffc, 0x6000102 },
+ { 0x502c8, 0x37c00006 },
+ { 0x5fffc, 0x7000109 },
+ { 0x502cc, 0x35800004 },
+ { 0x5fffc, 0x840010e },
+ { 0x502d0, 0x33800002 },
+ { 0x5fffc, 0x9800114 },
+ { 0x502d4, 0x31400000 },
+ { 0x5fffc, 0xac00119 },
+ { 0x502d8, 0x2f4003fe },
+ { 0x5fffc, 0xc40011e },
+ { 0x502dc, 0x2d0003fc },
+ { 0x5fffc, 0xdc00121 },
+ { 0x502e0, 0x2b0003fb },
+ { 0x5fffc, 0xf400125 },
+ { 0x502e4, 0x28c003fa },
+ { 0x5fffc, 0x11000128 },
+ { 0x502e8, 0x268003f9 },
+ { 0x5fffc, 0x12c0012a },
+ { 0x502ec, 0x244003f9 },
+ { 0x5fffc, 0x1480012c },
+ { 0x502f0, 0x224003f8 },
+ { 0x5fffc, 0x1640012e },
+ { 0x502f4, 0x200003f8 },
+ { 0x5fffc, 0x1800012f },
+ { 0x502f8, 0x1e0003f8 },
+ { 0x5fffc, 0x1a00012f },
+ { 0x502fc, 0x1c0003f8 },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT8TO1[] = {
+ { 0x5fffc, 0x0 },
+ { 0x50280, 0x7fc00000 },
+ { 0x5fffc, 0xff80000d },
+ { 0x50284, 0x7ec003f9 },
+ { 0x5fffc, 0xfec0001c },
+ { 0x50288, 0x7d4003f3 },
+ { 0x5fffc, 0xfe40002b },
+ { 0x5028c, 0x7b8003ed },
+ { 0x5fffc, 0xfd80003c },
+ { 0x50290, 0x794003e8 },
+ { 0x5fffc, 0xfcc0004d },
+ { 0x50294, 0x76c003e4 },
+ { 0x5fffc, 0xfc40005f },
+ { 0x50298, 0x73c003e0 },
+ { 0x5fffc, 0xfb800071 },
+ { 0x5029c, 0x708003de },
+ { 0x5fffc, 0xfac00085 },
+ { 0x502a0, 0x6d0003db },
+ { 0x5fffc, 0xfa000098 },
+ { 0x502a4, 0x698003d9 },
+ { 0x5fffc, 0xf98000ac },
+ { 0x502a8, 0x654003d8 },
+ { 0x5fffc, 0xf8c000c1 },
+ { 0x502ac, 0x610003d7 },
+ { 0x5fffc, 0xf84000d5 },
+ { 0x502b0, 0x5c8003d7 },
+ { 0x5fffc, 0xf7c000e9 },
+ { 0x502b4, 0x580003d7 },
+ { 0x5fffc, 0xf74000fd },
+ { 0x502b8, 0x534003d8 },
+ { 0x5fffc, 0xf6c00112 },
+ { 0x502bc, 0x4e8003d8 },
+ { 0x5fffc, 0xf6800126 },
+ { 0x502c0, 0x494003da },
+ { 0x5fffc, 0xf600013a },
+ { 0x502c4, 0x448003db },
+ { 0x5fffc, 0xf600014d },
+ { 0x502c8, 0x3f4003dd },
+ { 0x5fffc, 0xf5c00160 },
+ { 0x502cc, 0x3a4003df },
+ { 0x5fffc, 0xf5c00172 },
+ { 0x502d0, 0x354003e1 },
+ { 0x5fffc, 0xf5c00184 },
+ { 0x502d4, 0x304003e3 },
+ { 0x5fffc, 0xf6000195 },
+ { 0x502d8, 0x2b0003e6 },
+ { 0x5fffc, 0xf64001a6 },
+ { 0x502dc, 0x260003e8 },
+ { 0x5fffc, 0xf6c001b4 },
+ { 0x502e0, 0x214003eb },
+ { 0x5fffc, 0xf78001c2 },
+ { 0x502e4, 0x1c4003ee },
+ { 0x5fffc, 0xf80001cf },
+ { 0x502e8, 0x17c003f1 },
+ { 0x5fffc, 0xf90001db },
+ { 0x502ec, 0x134003f3 },
+ { 0x5fffc, 0xfa0001e5 },
+ { 0x502f0, 0xf0003f6 },
+ { 0x5fffc, 0xfb4001ee },
+ { 0x502f4, 0xac003f9 },
+ { 0x5fffc, 0xfcc001f5 },
+ { 0x502f8, 0x70003fb },
+ { 0x5fffc, 0xfe4001fb },
+ { 0x502fc, 0x34003fe },
+};
+
+struct mdp_table_entry *mdp_downscale_x_table[MDP_DOWNSCALE_MAX] = {
+ [MDP_DOWNSCALE_PT2TOPT4] = mdp_downscale_x_table_PT2TOPT4,
+ [MDP_DOWNSCALE_PT4TOPT6] = mdp_downscale_x_table_PT4TOPT6,
+ [MDP_DOWNSCALE_PT6TOPT8] = mdp_downscale_x_table_PT6TOPT8,
+ [MDP_DOWNSCALE_PT8TO1] = mdp_downscale_x_table_PT8TO1,
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT2TOPT4[] = {
+ { 0x5fffc, 0x740008c },
+ { 0x50300, 0x33800088 },
+ { 0x5fffc, 0x800008e },
+ { 0x50304, 0x33400084 },
+ { 0x5fffc, 0x8400092 },
+ { 0x50308, 0x33000080 },
+ { 0x5fffc, 0x9000094 },
+ { 0x5030c, 0x3300007b },
+ { 0x5fffc, 0x9c00098 },
+ { 0x50310, 0x32400077 },
+ { 0x5fffc, 0xa40009b },
+ { 0x50314, 0x32000073 },
+ { 0x5fffc, 0xb00009d },
+ { 0x50318, 0x31c0006f },
+ { 0x5fffc, 0xbc000a0 },
+ { 0x5031c, 0x3140006b },
+ { 0x5fffc, 0xc8000a2 },
+ { 0x50320, 0x31000067 },
+ { 0x5fffc, 0xd8000a5 },
+ { 0x50324, 0x30800062 },
+ { 0x5fffc, 0xe4000a8 },
+ { 0x50328, 0x2fc0005f },
+ { 0x5fffc, 0xec000aa },
+ { 0x5032c, 0x2fc0005b },
+ { 0x5fffc, 0xf8000ad },
+ { 0x50330, 0x2f400057 },
+ { 0x5fffc, 0x108000b0 },
+ { 0x50334, 0x2e400054 },
+ { 0x5fffc, 0x114000b2 },
+ { 0x50338, 0x2e000050 },
+ { 0x5fffc, 0x124000b4 },
+ { 0x5033c, 0x2d80004c },
+ { 0x5fffc, 0x130000b6 },
+ { 0x50340, 0x2d000049 },
+ { 0x5fffc, 0x140000b8 },
+ { 0x50344, 0x2c800045 },
+ { 0x5fffc, 0x150000b9 },
+ { 0x50348, 0x2c000042 },
+ { 0x5fffc, 0x15c000bd },
+ { 0x5034c, 0x2b40003e },
+ { 0x5fffc, 0x16c000bf },
+ { 0x50350, 0x2a80003b },
+ { 0x5fffc, 0x17c000bf },
+ { 0x50354, 0x2a000039 },
+ { 0x5fffc, 0x188000c2 },
+ { 0x50358, 0x29400036 },
+ { 0x5fffc, 0x19c000c4 },
+ { 0x5035c, 0x28800032 },
+ { 0x5fffc, 0x1ac000c5 },
+ { 0x50360, 0x2800002f },
+ { 0x5fffc, 0x1bc000c7 },
+ { 0x50364, 0x2740002c },
+ { 0x5fffc, 0x1cc000c8 },
+ { 0x50368, 0x26c00029 },
+ { 0x5fffc, 0x1dc000c9 },
+ { 0x5036c, 0x26000027 },
+ { 0x5fffc, 0x1ec000cc },
+ { 0x50370, 0x25000024 },
+ { 0x5fffc, 0x200000cc },
+ { 0x50374, 0x24800021 },
+ { 0x5fffc, 0x210000cd },
+ { 0x50378, 0x23800020 },
+ { 0x5fffc, 0x220000ce },
+ { 0x5037c, 0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT4TOPT6[] = {
+ { 0x5fffc, 0x740008c },
+ { 0x50300, 0x33800088 },
+ { 0x5fffc, 0x800008e },
+ { 0x50304, 0x33400084 },
+ { 0x5fffc, 0x8400092 },
+ { 0x50308, 0x33000080 },
+ { 0x5fffc, 0x9000094 },
+ { 0x5030c, 0x3300007b },
+ { 0x5fffc, 0x9c00098 },
+ { 0x50310, 0x32400077 },
+ { 0x5fffc, 0xa40009b },
+ { 0x50314, 0x32000073 },
+ { 0x5fffc, 0xb00009d },
+ { 0x50318, 0x31c0006f },
+ { 0x5fffc, 0xbc000a0 },
+ { 0x5031c, 0x3140006b },
+ { 0x5fffc, 0xc8000a2 },
+ { 0x50320, 0x31000067 },
+ { 0x5fffc, 0xd8000a5 },
+ { 0x50324, 0x30800062 },
+ { 0x5fffc, 0xe4000a8 },
+ { 0x50328, 0x2fc0005f },
+ { 0x5fffc, 0xec000aa },
+ { 0x5032c, 0x2fc0005b },
+ { 0x5fffc, 0xf8000ad },
+ { 0x50330, 0x2f400057 },
+ { 0x5fffc, 0x108000b0 },
+ { 0x50334, 0x2e400054 },
+ { 0x5fffc, 0x114000b2 },
+ { 0x50338, 0x2e000050 },
+ { 0x5fffc, 0x124000b4 },
+ { 0x5033c, 0x2d80004c },
+ { 0x5fffc, 0x130000b6 },
+ { 0x50340, 0x2d000049 },
+ { 0x5fffc, 0x140000b8 },
+ { 0x50344, 0x2c800045 },
+ { 0x5fffc, 0x150000b9 },
+ { 0x50348, 0x2c000042 },
+ { 0x5fffc, 0x15c000bd },
+ { 0x5034c, 0x2b40003e },
+ { 0x5fffc, 0x16c000bf },
+ { 0x50350, 0x2a80003b },
+ { 0x5fffc, 0x17c000bf },
+ { 0x50354, 0x2a000039 },
+ { 0x5fffc, 0x188000c2 },
+ { 0x50358, 0x29400036 },
+ { 0x5fffc, 0x19c000c4 },
+ { 0x5035c, 0x28800032 },
+ { 0x5fffc, 0x1ac000c5 },
+ { 0x50360, 0x2800002f },
+ { 0x5fffc, 0x1bc000c7 },
+ { 0x50364, 0x2740002c },
+ { 0x5fffc, 0x1cc000c8 },
+ { 0x50368, 0x26c00029 },
+ { 0x5fffc, 0x1dc000c9 },
+ { 0x5036c, 0x26000027 },
+ { 0x5fffc, 0x1ec000cc },
+ { 0x50370, 0x25000024 },
+ { 0x5fffc, 0x200000cc },
+ { 0x50374, 0x24800021 },
+ { 0x5fffc, 0x210000cd },
+ { 0x50378, 0x23800020 },
+ { 0x5fffc, 0x220000ce },
+ { 0x5037c, 0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT6TOPT8[] = {
+ { 0x5fffc, 0xfe000070 },
+ { 0x50300, 0x4bc00068 },
+ { 0x5fffc, 0xfe000078 },
+ { 0x50304, 0x4bc00060 },
+ { 0x5fffc, 0xfe000080 },
+ { 0x50308, 0x4b800059 },
+ { 0x5fffc, 0xfe000089 },
+ { 0x5030c, 0x4b000052 },
+ { 0x5fffc, 0xfe400091 },
+ { 0x50310, 0x4a80004b },
+ { 0x5fffc, 0xfe40009a },
+ { 0x50314, 0x4a000044 },
+ { 0x5fffc, 0xfe8000a3 },
+ { 0x50318, 0x4940003d },
+ { 0x5fffc, 0xfec000ac },
+ { 0x5031c, 0x48400037 },
+ { 0x5fffc, 0xff0000b4 },
+ { 0x50320, 0x47800031 },
+ { 0x5fffc, 0xff8000bd },
+ { 0x50324, 0x4640002b },
+ { 0x5fffc, 0xc5 },
+ { 0x50328, 0x45000026 },
+ { 0x5fffc, 0x8000ce },
+ { 0x5032c, 0x43800021 },
+ { 0x5fffc, 0x10000d6 },
+ { 0x50330, 0x4240001c },
+ { 0x5fffc, 0x18000df },
+ { 0x50334, 0x40800018 },
+ { 0x5fffc, 0x24000e6 },
+ { 0x50338, 0x3f000014 },
+ { 0x5fffc, 0x30000ee },
+ { 0x5033c, 0x3d400010 },
+ { 0x5fffc, 0x40000f5 },
+ { 0x50340, 0x3b80000c },
+ { 0x5fffc, 0x50000fc },
+ { 0x50344, 0x39800009 },
+ { 0x5fffc, 0x6000102 },
+ { 0x50348, 0x37c00006 },
+ { 0x5fffc, 0x7000109 },
+ { 0x5034c, 0x35800004 },
+ { 0x5fffc, 0x840010e },
+ { 0x50350, 0x33800002 },
+ { 0x5fffc, 0x9800114 },
+ { 0x50354, 0x31400000 },
+ { 0x5fffc, 0xac00119 },
+ { 0x50358, 0x2f4003fe },
+ { 0x5fffc, 0xc40011e },
+ { 0x5035c, 0x2d0003fc },
+ { 0x5fffc, 0xdc00121 },
+ { 0x50360, 0x2b0003fb },
+ { 0x5fffc, 0xf400125 },
+ { 0x50364, 0x28c003fa },
+ { 0x5fffc, 0x11000128 },
+ { 0x50368, 0x268003f9 },
+ { 0x5fffc, 0x12c0012a },
+ { 0x5036c, 0x244003f9 },
+ { 0x5fffc, 0x1480012c },
+ { 0x50370, 0x224003f8 },
+ { 0x5fffc, 0x1640012e },
+ { 0x50374, 0x200003f8 },
+ { 0x5fffc, 0x1800012f },
+ { 0x50378, 0x1e0003f8 },
+ { 0x5fffc, 0x1a00012f },
+ { 0x5037c, 0x1c0003f8 },
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT8TO1[] = {
+ { 0x5fffc, 0x0 },
+ { 0x50300, 0x7fc00000 },
+ { 0x5fffc, 0xff80000d },
+ { 0x50304, 0x7ec003f9 },
+ { 0x5fffc, 0xfec0001c },
+ { 0x50308, 0x7d4003f3 },
+ { 0x5fffc, 0xfe40002b },
+ { 0x5030c, 0x7b8003ed },
+ { 0x5fffc, 0xfd80003c },
+ { 0x50310, 0x794003e8 },
+ { 0x5fffc, 0xfcc0004d },
+ { 0x50314, 0x76c003e4 },
+ { 0x5fffc, 0xfc40005f },
+ { 0x50318, 0x73c003e0 },
+ { 0x5fffc, 0xfb800071 },
+ { 0x5031c, 0x708003de },
+ { 0x5fffc, 0xfac00085 },
+ { 0x50320, 0x6d0003db },
+ { 0x5fffc, 0xfa000098 },
+ { 0x50324, 0x698003d9 },
+ { 0x5fffc, 0xf98000ac },
+ { 0x50328, 0x654003d8 },
+ { 0x5fffc, 0xf8c000c1 },
+ { 0x5032c, 0x610003d7 },
+ { 0x5fffc, 0xf84000d5 },
+ { 0x50330, 0x5c8003d7 },
+ { 0x5fffc, 0xf7c000e9 },
+ { 0x50334, 0x580003d7 },
+ { 0x5fffc, 0xf74000fd },
+ { 0x50338, 0x534003d8 },
+ { 0x5fffc, 0xf6c00112 },
+ { 0x5033c, 0x4e8003d8 },
+ { 0x5fffc, 0xf6800126 },
+ { 0x50340, 0x494003da },
+ { 0x5fffc, 0xf600013a },
+ { 0x50344, 0x448003db },
+ { 0x5fffc, 0xf600014d },
+ { 0x50348, 0x3f4003dd },
+ { 0x5fffc, 0xf5c00160 },
+ { 0x5034c, 0x3a4003df },
+ { 0x5fffc, 0xf5c00172 },
+ { 0x50350, 0x354003e1 },
+ { 0x5fffc, 0xf5c00184 },
+ { 0x50354, 0x304003e3 },
+ { 0x5fffc, 0xf6000195 },
+ { 0x50358, 0x2b0003e6 },
+ { 0x5fffc, 0xf64001a6 },
+ { 0x5035c, 0x260003e8 },
+ { 0x5fffc, 0xf6c001b4 },
+ { 0x50360, 0x214003eb },
+ { 0x5fffc, 0xf78001c2 },
+ { 0x50364, 0x1c4003ee },
+ { 0x5fffc, 0xf80001cf },
+ { 0x50368, 0x17c003f1 },
+ { 0x5fffc, 0xf90001db },
+ { 0x5036c, 0x134003f3 },
+ { 0x5fffc, 0xfa0001e5 },
+ { 0x50370, 0xf0003f6 },
+ { 0x5fffc, 0xfb4001ee },
+ { 0x50374, 0xac003f9 },
+ { 0x5fffc, 0xfcc001f5 },
+ { 0x50378, 0x70003fb },
+ { 0x5fffc, 0xfe4001fb },
+ { 0x5037c, 0x34003fe },
+};
+
+struct mdp_table_entry *mdp_downscale_y_table[MDP_DOWNSCALE_MAX] = {
+ [MDP_DOWNSCALE_PT2TOPT4] = mdp_downscale_y_table_PT2TOPT4,
+ [MDP_DOWNSCALE_PT4TOPT6] = mdp_downscale_y_table_PT4TOPT6,
+ [MDP_DOWNSCALE_PT6TOPT8] = mdp_downscale_y_table_PT6TOPT8,
+ [MDP_DOWNSCALE_PT8TO1] = mdp_downscale_y_table_PT8TO1,
+};
+
+struct mdp_table_entry mdp_gaussian_blur_table[] = {
+ /* max variance */
+ { 0x5fffc, 0x20000080 },
+ { 0x50280, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50284, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50288, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5028c, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50290, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50294, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50298, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5029c, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502a0, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502a4, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502a8, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502ac, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502b0, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502b4, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502b8, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502bc, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502c0, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502c4, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502c8, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502cc, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502d0, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502d4, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502d8, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502dc, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502e0, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502e4, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502e8, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502ec, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502f0, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502f4, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502f8, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x502fc, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50300, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50304, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50308, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5030c, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50310, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50314, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50318, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5031c, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50320, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50324, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50328, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5032c, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50330, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50334, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50338, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5033c, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50340, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50344, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50348, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5034c, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50350, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50354, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50358, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5035c, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50360, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50364, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50368, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5036c, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50370, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50374, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x50378, 0x20000080 },
+ { 0x5fffc, 0x20000080 },
+ { 0x5037c, 0x20000080 },
+};
diff --git a/drivers/video/msm/mdp_scale_tables.h b/drivers/video/msm/mdp_scale_tables.h
new file mode 100644
index 0000000..34077b1
--- /dev/null
+++ b/drivers/video/msm/mdp_scale_tables.h
@@ -0,0 +1,38 @@
+/* drivers/video/msm_fb/mdp_scale_tables.h
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+#ifndef _MDP_SCALE_TABLES_H_
+#define _MDP_SCALE_TABLES_H_
+
+#include <linux/types.h>
+struct mdp_table_entry {
+ uint32_t reg;
+ uint32_t val;
+};
+
+extern struct mdp_table_entry mdp_upscale_table[64];
+
+enum {
+ MDP_DOWNSCALE_PT2TOPT4,
+ MDP_DOWNSCALE_PT4TOPT6,
+ MDP_DOWNSCALE_PT6TOPT8,
+ MDP_DOWNSCALE_PT8TO1,
+ MDP_DOWNSCALE_MAX,
+};
+
+extern struct mdp_table_entry *mdp_downscale_x_table[MDP_DOWNSCALE_MAX];
+extern struct mdp_table_entry *mdp_downscale_y_table[MDP_DOWNSCALE_MAX];
+extern struct mdp_table_entry mdp_gaussian_blur_table[];
+
+#endif
diff --git a/drivers/video/msm/msm_fb.c b/drivers/video/msm/msm_fb.c
new file mode 100644
index 0000000..49101dd
--- /dev/null
+++ b/drivers/video/msm/msm_fb.c
@@ -0,0 +1,636 @@
+/* drivers/video/msm/msm_fb.c
+ *
+ * Core MSM framebuffer driver.
+ *
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/platform_device.h>
+#include <linux/module.h>
+#include <linux/fb.h>
+#include <linux/delay.h>
+
+#include <linux/freezer.h>
+#include <linux/wait.h>
+#include <linux/msm_mdp.h>
+#include <linux/io.h>
+#include <linux/uaccess.h>
+#include <mach/msm_fb.h>
+#include <mach/board.h>
+#include <linux/workqueue.h>
+#include <linux/clk.h>
+#include <linux/debugfs.h>
+#include <linux/dma-mapping.h>
+
+#define PRINT_FPS 0
+#define PRINT_BLIT_TIME 0
+
+#define SLEEPING 0x4
+#define UPDATING 0x3
+#define FULL_UPDATE_DONE 0x2
+#define WAKING 0x1
+#define AWAKE 0x0
+
+#define NONE 0
+#define SUSPEND_RESUME 0x1
+#define FPS 0x2
+#define BLIT_TIME 0x4
+#define SHOW_UPDATES 0x8
+
+#define DLOG(mask, fmt, args...) \
+do { \
+ if (msmfb_debug_mask & mask) \
+ printk(KERN_INFO "msmfb: "fmt, ##args); \
+} while (0)
+
+static int msmfb_debug_mask;
+module_param_named(msmfb_debug_mask, msmfb_debug_mask, int,
+ S_IRUGO | S_IWUSR | S_IWGRP);
+
+struct mdp_device *mdp;
+
+struct msmfb_info {
+ struct fb_info *fb;
+ struct msm_panel_data *panel;
+ int xres;
+ int yres;
+ unsigned output_format;
+ unsigned yoffset;
+ unsigned frame_requested;
+ unsigned frame_done;
+ int sleeping;
+ unsigned update_frame;
+ struct {
+ int left;
+ int top;
+ int eright; /* exclusive */
+ int ebottom; /* exclusive */
+ } update_info;
+ char *black;
+
+ spinlock_t update_lock;
+ struct mutex panel_init_lock;
+ wait_queue_head_t frame_wq;
+ struct workqueue_struct *resume_workqueue;
+ struct work_struct resume_work;
+ struct msmfb_callback dma_callback;
+ struct msmfb_callback vsync_callback;
+ struct hrtimer fake_vsync;
+ ktime_t vsync_request_time;
+};
+
+static int msmfb_open(struct fb_info *info, int user)
+{
+ return 0;
+}
+
+static int msmfb_release(struct fb_info *info, int user)
+{
+ return 0;
+}
+
+/* Called from dma interrupt handler, must not sleep */
+static void msmfb_handle_dma_interrupt(struct msmfb_callback *callback)
+{
+ unsigned long irq_flags;
+ struct msmfb_info *msmfb = container_of(callback, struct msmfb_info,
+ dma_callback);
+
+ spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+ msmfb->frame_done = msmfb->frame_requested;
+ if (msmfb->sleeping == UPDATING &&
+ msmfb->frame_done == msmfb->update_frame) {
+ DLOG(SUSPEND_RESUME, "full update completed\n");
+ queue_work(msmfb->resume_workqueue, &msmfb->resume_work);
+ }
+ spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+ wake_up(&msmfb->frame_wq);
+}
+
+static int msmfb_start_dma(struct msmfb_info *msmfb)
+{
+ uint32_t x, y, w, h;
+ unsigned addr;
+ unsigned long irq_flags;
+ uint32_t yoffset;
+ s64 time_since_request;
+ struct msm_panel_data *panel = msmfb->panel;
+
+ spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+ time_since_request = ktime_to_ns(ktime_sub(ktime_get(),
+ msmfb->vsync_request_time));
+ if (time_since_request > 20 * NSEC_PER_MSEC) {
+ uint32_t us;
+ us = do_div(time_since_request, NSEC_PER_MSEC) / NSEC_PER_USEC;
+ printk(KERN_WARNING "msmfb_start_dma %lld.%03u ms after vsync "
+ "request\n", time_since_request, us);
+ }
+ if (msmfb->frame_done == msmfb->frame_requested) {
+ spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+ return -1;
+ }
+ if (msmfb->sleeping == SLEEPING) {
+ DLOG(SUSPEND_RESUME, "tried to start dma while asleep\n");
+ spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+ return -1;
+ }
+ x = msmfb->update_info.left;
+ y = msmfb->update_info.top;
+ w = msmfb->update_info.eright - x;
+ h = msmfb->update_info.ebottom - y;
+ yoffset = msmfb->yoffset;
+ msmfb->update_info.left = msmfb->xres + 1;
+ msmfb->update_info.top = msmfb->yres + 1;
+ msmfb->update_info.eright = 0;
+ msmfb->update_info.ebottom = 0;
+ if (unlikely(w > msmfb->xres || h > msmfb->yres ||
+ w == 0 || h == 0)) {
+ printk(KERN_INFO "invalid update: %d %d %d "
+ "%d\n", x, y, w, h);
+ msmfb->frame_done = msmfb->frame_requested;
+ goto error;
+ }
+ spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+
+ addr = ((msmfb->xres * (yoffset + y) + x) * 2);
+ mdp->dma(mdp, addr + msmfb->fb->fix.smem_start,
+ msmfb->xres * 2, w, h, x, y, &msmfb->dma_callback,
+ panel->interface_type);
+ return 0;
+error:
+ spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+ /* some clients need to clear their vsync interrupt */
+ if (panel->clear_vsync)
+ panel->clear_vsync(panel);
+ wake_up(&msmfb->frame_wq);
+ return 0;
+}
+
+/* Called from esync interrupt handler, must not sleep */
+static void msmfb_handle_vsync_interrupt(struct msmfb_callback *callback)
+{
+ struct msmfb_info *msmfb = container_of(callback, struct msmfb_info,
+ vsync_callback);
+ msmfb_start_dma(msmfb);
+}
+
+static enum hrtimer_restart msmfb_fake_vsync(struct hrtimer *timer)
+{
+ struct msmfb_info *msmfb = container_of(timer, struct msmfb_info,
+ fake_vsync);
+ msmfb_start_dma(msmfb);
+ return HRTIMER_NORESTART;
+}
+
+static void msmfb_pan_update(struct fb_info *info, uint32_t left, uint32_t top,
+ uint32_t eright, uint32_t ebottom,
+ uint32_t yoffset, int pan_display)
+{
+ struct msmfb_info *msmfb = info->par;
+ struct msm_panel_data *panel = msmfb->panel;
+ unsigned long irq_flags;
+ int sleeping;
+ int retry = 1;
+
+ DLOG(SHOW_UPDATES, "update %d %d %d %d %d %d\n",
+ left, top, eright, ebottom, yoffset, pan_display);
+restart:
+ spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+
+ /* if we are sleeping, on a pan_display wait 10ms (to throttle back
+ * drawing otherwise return */
+ if (msmfb->sleeping == SLEEPING) {
+ DLOG(SUSPEND_RESUME, "drawing while asleep\n");
+ spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+ if (pan_display)
+ wait_event_interruptible_timeout(msmfb->frame_wq,
+ msmfb->sleeping != SLEEPING, HZ/10);
+ return;
+ }
+
+ sleeping = msmfb->sleeping;
+ /* on a full update, if the last frame has not completed, wait for it */
+ if (pan_display && (msmfb->frame_requested != msmfb->frame_done ||
+ sleeping == UPDATING)) {
+ int ret;
+ spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+ ret = wait_event_interruptible_timeout(msmfb->frame_wq,
+ msmfb->frame_done == msmfb->frame_requested &&
+ msmfb->sleeping != UPDATING, 5 * HZ);
+ if (ret <= 0 && (msmfb->frame_requested != msmfb->frame_done ||
+ msmfb->sleeping == UPDATING)) {
+ if (retry && panel->request_vsync &&
+ (sleeping == AWAKE)) {
+ panel->request_vsync(panel,
+ &msmfb->vsync_callback);
+ retry = 0;
+ printk(KERN_WARNING "msmfb_pan_display timeout "
+ "rerequest vsync\n");
+ } else {
+ printk(KERN_WARNING "msmfb_pan_display timeout "
+ "waiting for frame start, %d %d\n",
+ msmfb->frame_requested,
+ msmfb->frame_done);
+ return;
+ }
+ }
+ goto restart;
+ }
+
+
+ msmfb->frame_requested++;
+ /* if necessary, update the y offset, if this is the
+ * first full update on resume, set the sleeping state */
+ if (pan_display) {
+ msmfb->yoffset = yoffset;
+ if (left == 0 && top == 0 && eright == info->var.xres &&
+ ebottom == info->var.yres) {
+ if (sleeping == WAKING) {
+ msmfb->update_frame = msmfb->frame_requested;
+ DLOG(SUSPEND_RESUME, "full update starting\n");
+ msmfb->sleeping = UPDATING;
+ }
+ }
+ }
+
+ /* set the update request */
+ if (left < msmfb->update_info.left)
+ msmfb->update_info.left = left;
+ if (top < msmfb->update_info.top)
+ msmfb->update_info.top = top;
+ if (eright > msmfb->update_info.eright)
+ msmfb->update_info.eright = eright;
+ if (ebottom > msmfb->update_info.ebottom)
+ msmfb->update_info.ebottom = ebottom;
+ DLOG(SHOW_UPDATES, "update queued %d %d %d %d %d\n",
+ msmfb->update_info.left, msmfb->update_info.top,
+ msmfb->update_info.eright, msmfb->update_info.ebottom,
+ msmfb->yoffset);
+ spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+
+ /* if the panel is all the way on wait for vsync, otherwise sleep
+ * for 16 ms (long enough for the dma to panel) and then begin dma */
+ msmfb->vsync_request_time = ktime_get();
+ if (panel->request_vsync && (sleeping == AWAKE)) {
+ panel->request_vsync(panel, &msmfb->vsync_callback);
+ } else {
+ if (!hrtimer_active(&msmfb->fake_vsync)) {
+ hrtimer_start(&msmfb->fake_vsync,
+ ktime_set(0, NSEC_PER_SEC/60),
+ HRTIMER_MODE_REL);
+ }
+ }
+}
+
+static void msmfb_update(struct fb_info *info, uint32_t left, uint32_t top,
+ uint32_t eright, uint32_t ebottom)
+{
+ msmfb_pan_update(info, left, top, eright, ebottom, 0, 0);
+}
+
+static void power_on_panel(struct work_struct *work)
+{
+ struct msmfb_info *msmfb =
+ container_of(work, struct msmfb_info, resume_work);
+ struct msm_panel_data *panel = msmfb->panel;
+ unsigned long irq_flags;
+
+ mutex_lock(&msmfb->panel_init_lock);
+ DLOG(SUSPEND_RESUME, "turning on panel\n");
+ if (msmfb->sleeping == UPDATING) {
+ if (panel->unblank(panel)) {
+ printk(KERN_INFO "msmfb: panel unblank failed,"
+ "not starting drawing\n");
+ goto error;
+ }
+ spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+ msmfb->sleeping = AWAKE;
+ wake_up(&msmfb->frame_wq);
+ spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+ }
+error:
+ mutex_unlock(&msmfb->panel_init_lock);
+}
+
+
+static int msmfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
+{
+ if ((var->xres != info->var.xres) ||
+ (var->yres != info->var.yres) ||
+ (var->xres_virtual != info->var.xres_virtual) ||
+ (var->yres_virtual != info->var.yres_virtual) ||
+ (var->xoffset != info->var.xoffset) ||
+ (var->bits_per_pixel != info->var.bits_per_pixel) ||
+ (var->grayscale != info->var.grayscale))
+ return -EINVAL;
+ return 0;
+}
+
+int msmfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info)
+{
+ struct msmfb_info *msmfb = info->par;
+ struct msm_panel_data *panel = msmfb->panel;
+
+ /* "UPDT" */
+ if ((panel->caps & MSMFB_CAP_PARTIAL_UPDATES) &&
+ (var->reserved[0] == 0x54445055)) {
+ msmfb_pan_update(info, var->reserved[1] & 0xffff,
+ var->reserved[1] >> 16,
+ var->reserved[2] & 0xffff,
+ var->reserved[2] >> 16, var->yoffset, 1);
+ } else {
+ msmfb_pan_update(info, 0, 0, info->var.xres, info->var.yres,
+ var->yoffset, 1);
+ }
+ return 0;
+}
+
+static void msmfb_fillrect(struct fb_info *p, const struct fb_fillrect *rect)
+{
+ cfb_fillrect(p, rect);
+ msmfb_update(p, rect->dx, rect->dy, rect->dx + rect->width,
+ rect->dy + rect->height);
+}
+
+static void msmfb_copyarea(struct fb_info *p, const struct fb_copyarea *area)
+{
+ cfb_copyarea(p, area);
+ msmfb_update(p, area->dx, area->dy, area->dx + area->width,
+ area->dy + area->height);
+}
+
+static void msmfb_imageblit(struct fb_info *p, const struct fb_image *image)
+{
+ cfb_imageblit(p, image);
+ msmfb_update(p, image->dx, image->dy, image->dx + image->width,
+ image->dy + image->height);
+}
+
+
+static int msmfb_blit(struct fb_info *info,
+ void __user *p)
+{
+ struct mdp_blit_req req;
+ struct mdp_blit_req_list req_list;
+ int i;
+ int ret;
+
+ if (copy_from_user(&req_list, p, sizeof(req_list)))
+ return -EFAULT;
+
+ for (i = 0; i < req_list.count; i++) {
+ struct mdp_blit_req_list *list =
+ (struct mdp_blit_req_list *)p;
+ if (copy_from_user(&req, &list->req[i], sizeof(req)))
+ return -EFAULT;
+ ret = mdp->blit(mdp, info, &req);
+ if (ret)
+ return ret;
+ }
+ return 0;
+}
+
+
+DEFINE_MUTEX(mdp_ppp_lock);
+
+static int msmfb_ioctl(struct fb_info *p, unsigned int cmd, unsigned long arg)
+{
+ void __user *argp = (void __user *)arg;
+ int ret;
+
+ switch (cmd) {
+ case MSMFB_GRP_DISP:
+ mdp->set_grp_disp(mdp, arg);
+ break;
+ case MSMFB_BLIT:
+ ret = msmfb_blit(p, argp);
+ if (ret)
+ return ret;
+ break;
+ default:
+ printk(KERN_INFO "msmfb unknown ioctl: %d\n", cmd);
+ return -EINVAL;
+ }
+ return 0;
+}
+
+static struct fb_ops msmfb_ops = {
+ .owner = THIS_MODULE,
+ .fb_open = msmfb_open,
+ .fb_release = msmfb_release,
+ .fb_check_var = msmfb_check_var,
+ .fb_pan_display = msmfb_pan_display,
+ .fb_fillrect = msmfb_fillrect,
+ .fb_copyarea = msmfb_copyarea,
+ .fb_imageblit = msmfb_imageblit,
+ .fb_ioctl = msmfb_ioctl,
+};
+
+static unsigned PP[16];
+
+
+
+#define BITS_PER_PIXEL 16
+
+static void setup_fb_info(struct msmfb_info *msmfb)
+{
+ struct fb_info *fb_info = msmfb->fb;
+ int r;
+
+ /* finish setting up the fb_info struct */
+ strncpy(fb_info->fix.id, "msmfb", 16);
+ fb_info->fix.ypanstep = 1;
+
+ fb_info->fbops = &msmfb_ops;
+ fb_info->flags = FBINFO_DEFAULT;
+
+ fb_info->fix.type = FB_TYPE_PACKED_PIXELS;
+ fb_info->fix.visual = FB_VISUAL_TRUECOLOR;
+ fb_info->fix.line_length = msmfb->xres * 2;
+
+ fb_info->var.xres = msmfb->xres;
+ fb_info->var.yres = msmfb->yres;
+ fb_info->var.width = msmfb->panel->fb_data->width;
+ fb_info->var.height = msmfb->panel->fb_data->height;
+ fb_info->var.xres_virtual = msmfb->xres;
+ fb_info->var.yres_virtual = msmfb->yres * 2;
+ fb_info->var.bits_per_pixel = BITS_PER_PIXEL;
+ fb_info->var.accel_flags = 0;
+
+ fb_info->var.yoffset = 0;
+
+ if (msmfb->panel->caps & MSMFB_CAP_PARTIAL_UPDATES) {
+ fb_info->var.reserved[0] = 0x54445055;
+ fb_info->var.reserved[1] = 0;
+ fb_info->var.reserved[2] = (uint16_t)msmfb->xres |
+ ((uint32_t)msmfb->yres << 16);
+ }
+
+ fb_info->var.red.offset = 11;
+ fb_info->var.red.length = 5;
+ fb_info->var.red.msb_right = 0;
+ fb_info->var.green.offset = 5;
+ fb_info->var.green.length = 6;
+ fb_info->var.green.msb_right = 0;
+ fb_info->var.blue.offset = 0;
+ fb_info->var.blue.length = 5;
+ fb_info->var.blue.msb_right = 0;
+
+ r = fb_alloc_cmap(&fb_info->cmap, 16, 0);
+ fb_info->pseudo_palette = PP;
+
+ PP[0] = 0;
+ for (r = 1; r < 16; r++)
+ PP[r] = 0xffffffff;
+}
+
+static int setup_fbmem(struct msmfb_info *msmfb, struct platform_device *pdev)
+{
+ struct fb_info *fb = msmfb->fb;
+ struct resource *resource;
+ unsigned long size = msmfb->xres * msmfb->yres *
+ (BITS_PER_PIXEL >> 3) * 2;
+ unsigned char *fbram;
+
+ /* board file might have attached a resource describing an fb */
+ resource = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+ if (!resource)
+ return -EINVAL;
+
+ /* check the resource is large enough to fit the fb */
+ if (resource->end - resource->start < size) {
+ printk(KERN_ERR "allocated resource is too small for "
+ "fb\n");
+ return -ENOMEM;
+ }
+ fb->fix.smem_start = resource->start;
+ fb->fix.smem_len = resource->end - resource->start;
+ fbram = ioremap(resource->start,
+ resource->end - resource->start);
+ if (fbram == 0) {
+ printk(KERN_ERR "msmfb: cannot allocate fbram!\n");
+ return -ENOMEM;
+ }
+ fb->screen_base = fbram;
+ return 0;
+}
+
+static int msmfb_probe(struct platform_device *pdev)
+{
+ struct fb_info *fb;
+ struct msmfb_info *msmfb;
+ struct msm_panel_data *panel = pdev->dev.platform_data;
+ int ret;
+
+ if (!panel) {
+ pr_err("msmfb_probe: no platform data\n");
+ return -EINVAL;
+ }
+ if (!panel->fb_data) {
+ pr_err("msmfb_probe: no fb_data\n");
+ return -EINVAL;
+ }
+
+ fb = framebuffer_alloc(sizeof(struct msmfb_info), &pdev->dev);
+ if (!fb)
+ return -ENOMEM;
+ msmfb = fb->par;
+ msmfb->fb = fb;
+ msmfb->panel = panel;
+ msmfb->xres = panel->fb_data->xres;
+ msmfb->yres = panel->fb_data->yres;
+
+ ret = setup_fbmem(msmfb, pdev);
+ if (ret)
+ goto error_setup_fbmem;
+
+ setup_fb_info(msmfb);
+
+ spin_lock_init(&msmfb->update_lock);
+ mutex_init(&msmfb->panel_init_lock);
+ init_waitqueue_head(&msmfb->frame_wq);
+ msmfb->resume_workqueue = create_workqueue("panel_on");
+ if (msmfb->resume_workqueue == NULL) {
+ printk(KERN_ERR "failed to create panel_on workqueue\n");
+ ret = -ENOMEM;
+ goto error_create_workqueue;
+ }
+ INIT_WORK(&msmfb->resume_work, power_on_panel);
+ msmfb->black = kzalloc(msmfb->fb->var.bits_per_pixel*msmfb->xres,
+ GFP_KERNEL);
+
+ printk(KERN_INFO "msmfb_probe() installing %d x %d panel\n",
+ msmfb->xres, msmfb->yres);
+
+ msmfb->dma_callback.func = msmfb_handle_dma_interrupt;
+ msmfb->vsync_callback.func = msmfb_handle_vsync_interrupt;
+ hrtimer_init(&msmfb->fake_vsync, CLOCK_MONOTONIC,
+ HRTIMER_MODE_REL);
+
+
+ msmfb->fake_vsync.function = msmfb_fake_vsync;
+
+ ret = register_framebuffer(fb);
+ if (ret)
+ goto error_register_framebuffer;
+
+ msmfb->sleeping = WAKING;
+
+ return 0;
+
+error_register_framebuffer:
+ destroy_workqueue(msmfb->resume_workqueue);
+error_create_workqueue:
+ iounmap(fb->screen_base);
+error_setup_fbmem:
+ framebuffer_release(msmfb->fb);
+ return ret;
+}
+
+static struct platform_driver msm_panel_driver = {
+ /* need to write remove */
+ .probe = msmfb_probe,
+ .driver = {.name = "msm_panel"},
+};
+
+
+static int msmfb_add_mdp_device(struct device *dev,
+ struct class_interface *class_intf)
+{
+ /* might need locking if mulitple mdp devices */
+ if (mdp)
+ return 0;
+ mdp = container_of(dev, struct mdp_device, dev);
+ return platform_driver_register(&msm_panel_driver);
+}
+
+static void msmfb_remove_mdp_device(struct device *dev,
+ struct class_interface *class_intf)
+{
+ /* might need locking if mulitple mdp devices */
+ if (dev != &mdp->dev)
+ return;
+ platform_driver_unregister(&msm_panel_driver);
+ mdp = NULL;
+}
+
+static struct class_interface msm_fb_interface = {
+ .add_dev = &msmfb_add_mdp_device,
+ .remove_dev = &msmfb_remove_mdp_device,
+};
+
+static int __init msmfb_init(void)
+{
+ return register_mdp_client(&msm_fb_interface);
+}
+
+module_init(msmfb_init);
diff --git a/drivers/video/omap/Kconfig b/drivers/video/omap/Kconfig
index 4440885..551e3e9 100644
--- a/drivers/video/omap/Kconfig
+++ b/drivers/video/omap/Kconfig
@@ -7,6 +7,69 @@
help
Frame buffer driver for OMAP based boards.
+config FB_OMAP_LCD_VGA
+ bool "Use LCD in VGA mode"
+ depends on MACH_OMAP_3430SDP || MACH_OMAP_LDP
+
+choice
+ depends on FB_OMAP && MACH_OVERO
+ prompt "Screen resolution"
+ default FB_OMAP_079M3R
+ help
+ Selected desired screen resolution
+
+config FB_OMAP_031M3R
+ boolean "640 x 480 @ 60 Hz Reduced blanking"
+
+config FB_OMAP_048M3R
+ boolean "800 x 600 @ 60 Hz Reduced blanking"
+
+config FB_OMAP_079M3R
+ boolean "1024 x 768 @ 60 Hz Reduced blanking"
+
+config FB_OMAP_092M9R
+ boolean "1280 x 720 @ 60 Hz Reduced blanking"
+
+endchoice
+
+config FB_OMAP_LCDC_EXTERNAL
+ bool "External LCD controller support"
+ depends on FB_OMAP
+ help
+ Say Y here, if you want to have support for boards with an
+ external LCD controller connected to the SoSSI/RFBI interface.
+
+config FB_OMAP_LCDC_HWA742
+ bool "Epson HWA742 LCD controller support"
+ depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
+ help
+ Say Y here if you want to have support for the external
+ Epson HWA742 LCD controller.
+
+config FB_OMAP_LCDC_BLIZZARD
+ bool "Epson Blizzard LCD controller support"
+ depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
+ help
+ Say Y here if you want to have support for the external
+ Epson Blizzard LCD controller.
+
+config FB_OMAP_MANUAL_UPDATE
+ bool "Default to manual update mode"
+ depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
+ help
+ Say Y here, if your user-space applications are capable of
+ notifying the frame buffer driver when a change has occured in
+ the frame buffer content and thus a reload of the image data to
+ the external frame buffer is required. If unsure, say N.
+
+config FB_OMAP_LCD_MIPID
+ bool "MIPI DBI-C/DCS compatible LCD support"
+ depends on FB_OMAP && SPI_MASTER
+ help
+ Say Y here if you want to have support for LCDs compatible with
+ the Mobile Industry Processor Interface DBI-C/DCS
+ specification. (Supported LCDs: Philips LPH8923, Sharp LS041Y3)
+
config FB_OMAP_BOOTLOADER_INIT
bool "Check bootloader initialization"
depends on FB_OMAP
@@ -36,23 +99,4 @@
answer yes. Answer no if you have a dedicated video
memory, or don't use any of the accelerated features.
-config FB_OMAP_LCDC_EXTERNAL
- bool "External LCD controller support"
- depends on FB_OMAP
- help
- Say Y here, if you want to have support for boards with an
- external LCD controller connected to the SoSSI/RFBI interface.
-config FB_OMAP_LCDC_HWA742
- bool "Epson HWA742 LCD controller support"
- depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
- help
- Say Y here if you want to have support for the external
- Epson HWA742 LCD controller.
-
-config FB_OMAP_LCDC_BLIZZARD
- bool "Epson Blizzard LCD controller support"
- depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
- help
- Say Y here if you want to have support for the external
- Epson Blizzard LCD controller.
diff --git a/drivers/video/omap/Makefile b/drivers/video/omap/Makefile
index ed13889..b63b198 100644
--- a/drivers/video/omap/Makefile
+++ b/drivers/video/omap/Makefile
@@ -8,6 +8,7 @@
objs-y$(CONFIG_ARCH_OMAP1) += lcdc.o
objs-y$(CONFIG_ARCH_OMAP2) += dispc.o
+objs-y$(CONFIG_ARCH_OMAP3) += dispc.o
objs-$(CONFIG_ARCH_OMAP1)$(CONFIG_FB_OMAP_LCDC_EXTERNAL) += sossi.o
objs-$(CONFIG_ARCH_OMAP2)$(CONFIG_FB_OMAP_LCDC_EXTERNAL) += rfbi.o
@@ -15,6 +16,7 @@
objs-y$(CONFIG_FB_OMAP_LCDC_HWA742) += hwa742.o
objs-y$(CONFIG_FB_OMAP_LCDC_BLIZZARD) += blizzard.o
+objs-y$(CONFIG_MACH_AMS_DELTA) += lcd_ams_delta.o
objs-y$(CONFIG_MACH_OMAP_H4) += lcd_h4.o
objs-y$(CONFIG_MACH_OMAP_H3) += lcd_h3.o
objs-y$(CONFIG_MACH_OMAP_PALMTE) += lcd_palmte.o
@@ -24,5 +26,15 @@
objs-$(CONFIG_ARCH_OMAP15XX)$(CONFIG_MACH_OMAP_INNOVATOR) += lcd_inn1510.o
objs-y$(CONFIG_MACH_OMAP_OSK) += lcd_osk.o
+objs-y$(CONFIG_MACH_OMAP_APOLLON) += lcd_apollon.o
+objs-y$(CONFIG_MACH_OMAP_2430SDP) += lcd_2430sdp.o
+objs-y$(CONFIG_MACH_OMAP_3430SDP) += lcd_2430sdp.o
+objs-y$(CONFIG_MACH_OMAP_LDP) += lcd_ldp.o
+objs-y$(CONFIG_MACH_OMAP2EVM) += lcd_omap2evm.o
+objs-y$(CONFIG_MACH_OMAP3EVM) += lcd_omap3evm.o
+objs-y$(CONFIG_MACH_OMAP3_BEAGLE) += lcd_omap3beagle.o
+objs-y$(CONFIG_FB_OMAP_LCD_MIPID) += lcd_mipid.o
+objs-y$(CONFIG_MACH_OVERO) += lcd_overo.o
+
omapfb-objs := $(objs-yy)
diff --git a/drivers/video/omap/blizzard.c b/drivers/video/omap/blizzard.c
index 9dfcf39..d5e5955 100644
--- a/drivers/video/omap/blizzard.c
+++ b/drivers/video/omap/blizzard.c
@@ -44,6 +44,7 @@
#define BLIZZARD_CLK_SRC 0x0e
#define BLIZZARD_MEM_BANK0_ACTIVATE 0x10
#define BLIZZARD_MEM_BANK0_STATUS 0x14
+#define BLIZZARD_PANEL_CONFIGURATION 0x28
#define BLIZZARD_HDISP 0x2a
#define BLIZZARD_HNDP 0x2c
#define BLIZZARD_VDISP0 0x2e
@@ -162,6 +163,10 @@
int vid_scaled;
int last_color_mode;
int zoom_on;
+ int zoom_area_gx1;
+ int zoom_area_gx2;
+ int zoom_area_gy1;
+ int zoom_area_gy2;
int screen_width;
int screen_height;
unsigned te_connected:1;
@@ -513,6 +518,13 @@
return REQ_PENDING;
}
+static int check_1d_intersect(int a1, int a2, int b1, int b2)
+{
+ if (a2 <= b1 || b2 <= a1)
+ return 0;
+ return 1;
+}
+
/* Setup all planes with an overlapping area with the update window. */
static int do_partial_update(struct blizzard_request *req, int plane,
int x, int y, int w, int h,
@@ -525,6 +537,7 @@
int color_mode;
int flags;
int zoom_off;
+ int have_zoom_for_this_update = 0;
/* Global coordinates, relative to pixel 0,0 of the LCD */
gx1 = x + blizzard.plane[plane].pos_x;
@@ -544,10 +557,6 @@
gx2_out = gx1_out + w_out;
gy2_out = gy1_out + h_out;
}
- zoom_off = blizzard.zoom_on && gx1 == 0 && gy1 == 0 &&
- w == blizzard.screen_width && h == blizzard.screen_height;
- blizzard.zoom_on = (!zoom_off && blizzard.zoom_on) ||
- (w < w_out || h < h_out);
for (i = 0; i < OMAPFB_PLANE_NUM; i++) {
struct plane_info *p = &blizzard.plane[i];
@@ -653,8 +662,49 @@
else
disable_tearsync();
+ if ((gx2_out - gx1_out) != (gx2 - gx1) ||
+ (gy2_out - gy1_out) != (gy2 - gy1))
+ have_zoom_for_this_update = 1;
+
+ /* 'background' type of screen update (as opposed to 'destructive')
+ can be used to disable scaling if scaling is active */
+ zoom_off = blizzard.zoom_on && !have_zoom_for_this_update &&
+ (gx1_out == 0) && (gx2_out == blizzard.screen_width) &&
+ (gy1_out == 0) && (gy2_out == blizzard.screen_height) &&
+ (gx1 == 0) && (gy1 == 0);
+
+ if (blizzard.zoom_on && !have_zoom_for_this_update && !zoom_off &&
+ check_1d_intersect(blizzard.zoom_area_gx1, blizzard.zoom_area_gx2,
+ gx1_out, gx2_out) &&
+ check_1d_intersect(blizzard.zoom_area_gy1, blizzard.zoom_area_gy2,
+ gy1_out, gy2_out)) {
+ /* Previous screen update was using scaling, current update
+ * is not using it. Additionally, current screen update is
+ * going to overlap with the scaled area. Scaling needs to be
+ * disabled in order to avoid 'magnifying glass' effect.
+ * Dummy setup of background window can be used for this.
+ */
+ set_window_regs(0, 0, blizzard.screen_width,
+ blizzard.screen_height,
+ 0, 0, blizzard.screen_width,
+ blizzard.screen_height,
+ BLIZZARD_COLOR_RGB565, 1, flags);
+ blizzard.zoom_on = 0;
+ }
+
+ /* remember scaling settings if we have scaled update */
+ if (have_zoom_for_this_update) {
+ blizzard.zoom_on = 1;
+ blizzard.zoom_area_gx1 = gx1_out;
+ blizzard.zoom_area_gx2 = gx2_out;
+ blizzard.zoom_area_gy1 = gy1_out;
+ blizzard.zoom_area_gy2 = gy2_out;
+ }
+
set_window_regs(gx1, gy1, gx2, gy2, gx1_out, gy1_out, gx2_out, gy2_out,
color_mode, zoom_off, flags);
+ if (zoom_off)
+ blizzard.zoom_on = 0;
blizzard.extif->set_bits_per_cycle(16);
/* set_window_regs has left the register index at the right
@@ -908,6 +958,35 @@
return 0;
}
+static int blizzard_set_rotate(int angle)
+{
+ u32 l;
+
+ l = blizzard_read_reg(BLIZZARD_PANEL_CONFIGURATION);
+ l &= ~0x03;
+
+ switch (angle) {
+ case 0:
+ l = l | 0x00;
+ break;
+ case 90:
+ l = l | 0x03;
+ break;
+ case 180:
+ l = l | 0x02;
+ break;
+ case 270:
+ l = l | 0x01;
+ break;
+ default:
+ return -EINVAL;
+ }
+
+ blizzard_write_reg(BLIZZARD_PANEL_CONFIGURATION, l);
+
+ return 0;
+}
+
static int blizzard_enable_plane(int plane, int enable)
{
if (enable)
@@ -1285,7 +1364,8 @@
caps->ctrl |= OMAPFB_CAPS_MANUAL_UPDATE |
OMAPFB_CAPS_WINDOW_PIXEL_DOUBLE |
OMAPFB_CAPS_WINDOW_SCALE |
- OMAPFB_CAPS_WINDOW_OVERLAY;
+ OMAPFB_CAPS_WINDOW_OVERLAY |
+ OMAPFB_CAPS_WINDOW_ROTATE;
if (blizzard.te_connected)
caps->ctrl |= OMAPFB_CAPS_TEARSYNC;
caps->wnd_color |= (1 << OMAPFB_COLOR_RGB565) |
@@ -1560,6 +1640,7 @@
.setup_plane = blizzard_setup_plane,
.set_scale = blizzard_set_scale,
.enable_plane = blizzard_enable_plane,
+ .set_rotate = blizzard_set_rotate,
.update_window = blizzard_update_window_async,
.sync = blizzard_sync,
.suspend = blizzard_suspend,
diff --git a/drivers/video/omap/dispc.c b/drivers/video/omap/dispc.c
index 915439d..80a11d0 100644
--- a/drivers/video/omap/dispc.c
+++ b/drivers/video/omap/dispc.c
@@ -155,6 +155,8 @@
unsigned long *map;
};
+#define MAX_IRQ_HANDLERS 4
+
static struct {
void __iomem *base;
@@ -167,9 +169,11 @@
int ext_mode;
- unsigned long enabled_irqs;
- void (*irq_callback)(void *);
- void *irq_callback_data;
+ struct {
+ u32 irq_mask;
+ void (*callback)(void *);
+ void *data;
+ } irq_handlers[MAX_IRQ_HANDLERS];
struct completion frame_done;
int fir_hinc[OMAPFB_PLANE_NUM];
@@ -286,7 +290,7 @@
BUG_ON(plane > 2);
l = dispc_read_reg(fsz_reg[plane]);
- l &= FLD_MASK(0, 9);
+ l &= FLD_MASK(0, 11);
if (ext_mode) {
low = l * 3 / 4;
high = l;
@@ -294,7 +298,7 @@
low = l / 4;
high = l * 3 / 4;
}
- MOD_REG_FLD(ftrs_reg[plane], FLD_MASK(16, 9) | FLD_MASK(0, 9),
+ MOD_REG_FLD(ftrs_reg[plane], FLD_MASK(16, 12) | FLD_MASK(0, 12),
(high << 16) | low);
}
@@ -809,57 +813,74 @@
panel->pixel_clock = fck / lck_div / pck_div / 1000;
}
-int omap_dispc_request_irq(void (*callback)(void *data), void *data)
+static void recalc_irq_mask(void)
{
- int r = 0;
+ int i;
+ unsigned long irq_mask = DISPC_IRQ_MASK_ERROR;
+
+ for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+ if (!dispc.irq_handlers[i].callback)
+ continue;
+
+ irq_mask |= dispc.irq_handlers[i].irq_mask;
+ }
+
+ enable_lcd_clocks(1);
+ MOD_REG_FLD(DISPC_IRQENABLE, 0x7fff, irq_mask);
+ enable_lcd_clocks(0);
+}
+
+int omap_dispc_request_irq(unsigned long irq_mask, void (*callback)(void *data),
+ void *data)
+{
+ int i;
BUG_ON(callback == NULL);
- if (dispc.irq_callback)
- r = -EBUSY;
- else {
- dispc.irq_callback = callback;
- dispc.irq_callback_data = data;
+ for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+ if (dispc.irq_handlers[i].callback)
+ continue;
+
+ dispc.irq_handlers[i].irq_mask = irq_mask;
+ dispc.irq_handlers[i].callback = callback;
+ dispc.irq_handlers[i].data = data;
+ recalc_irq_mask();
+
+ return 0;
}
- return r;
+ return -EBUSY;
}
EXPORT_SYMBOL(omap_dispc_request_irq);
-void omap_dispc_enable_irqs(int irq_mask)
+void omap_dispc_free_irq(unsigned long irq_mask, void (*callback)(void *data),
+ void *data)
{
- enable_lcd_clocks(1);
- dispc.enabled_irqs = irq_mask;
- irq_mask |= DISPC_IRQ_MASK_ERROR;
- MOD_REG_FLD(DISPC_IRQENABLE, 0x7fff, irq_mask);
- enable_lcd_clocks(0);
-}
-EXPORT_SYMBOL(omap_dispc_enable_irqs);
+ int i;
-void omap_dispc_disable_irqs(int irq_mask)
-{
- enable_lcd_clocks(1);
- dispc.enabled_irqs &= ~irq_mask;
- irq_mask &= ~DISPC_IRQ_MASK_ERROR;
- MOD_REG_FLD(DISPC_IRQENABLE, 0x7fff, irq_mask);
- enable_lcd_clocks(0);
-}
-EXPORT_SYMBOL(omap_dispc_disable_irqs);
+ for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+ if (dispc.irq_handlers[i].callback == callback &&
+ dispc.irq_handlers[i].data == data) {
+ dispc.irq_handlers[i].irq_mask = 0;
+ dispc.irq_handlers[i].callback = NULL;
+ dispc.irq_handlers[i].data = NULL;
+ recalc_irq_mask();
+ return;
+ }
+ }
-void omap_dispc_free_irq(void)
-{
- enable_lcd_clocks(1);
- omap_dispc_disable_irqs(DISPC_IRQ_MASK_ALL);
- dispc.irq_callback = NULL;
- dispc.irq_callback_data = NULL;
- enable_lcd_clocks(0);
+ BUG();
}
EXPORT_SYMBOL(omap_dispc_free_irq);
static irqreturn_t omap_dispc_irq_handler(int irq, void *dev)
{
- u32 stat = dispc_read_reg(DISPC_IRQSTATUS);
+ u32 stat;
+ int i = 0;
+ enable_lcd_clocks(1);
+
+ stat = dispc_read_reg(DISPC_IRQSTATUS);
if (stat & DISPC_IRQ_FRAMEMASK)
complete(&dispc.frame_done);
@@ -870,11 +891,17 @@
}
}
- if ((stat & dispc.enabled_irqs) && dispc.irq_callback)
- dispc.irq_callback(dispc.irq_callback_data);
+ for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+ if (unlikely(dispc.irq_handlers[i].callback &&
+ (stat & dispc.irq_handlers[i].irq_mask)))
+ dispc.irq_handlers[i].callback(
+ dispc.irq_handlers[i].data);
+ }
dispc_write_reg(DISPC_IRQSTATUS, stat);
+ enable_lcd_clocks(0);
+
return IRQ_HANDLED;
}
@@ -913,18 +940,13 @@
static void enable_lcd_clocks(int enable)
{
- if (enable)
- clk_enable(dispc.dss1_fck);
- else
- clk_disable(dispc.dss1_fck);
-}
-
-static void enable_interface_clocks(int enable)
-{
- if (enable)
+ if (enable) {
clk_enable(dispc.dss_ick);
- else
+ clk_enable(dispc.dss1_fck);
+ } else {
+ clk_disable(dispc.dss1_fck);
clk_disable(dispc.dss_ick);
+ }
}
static void enable_digit_clocks(int enable)
@@ -1365,7 +1387,6 @@
if ((r = get_dss_clocks()) < 0)
goto fail0;
- enable_interface_clocks(1);
enable_lcd_clocks(1);
#ifdef CONFIG_FB_OMAP_BOOTLOADER_INIT
@@ -1396,10 +1417,10 @@
enable_digit_clocks(0);
}
- /* Enable smart idle and autoidle */
- l = dispc_read_reg(DISPC_CONTROL);
+ /* Enable smart standby/idle, autoidle and wakeup */
+ l = dispc_read_reg(DISPC_SYSCONFIG);
l &= ~((3 << 12) | (3 << 3));
- l |= (2 << 12) | (2 << 3) | (1 << 0);
+ l |= (2 << 12) | (2 << 3) | (1 << 2) | (1 << 0);
dispc_write_reg(DISPC_SYSCONFIG, l);
omap_writel(1 << 0, DSS_BASE + DSS_SYSCONFIG);
@@ -1409,10 +1430,9 @@
dispc_write_reg(DISPC_CONFIG, l);
l = dispc_read_reg(DISPC_IRQSTATUS);
- dispc_write_reg(l, DISPC_IRQSTATUS);
+ dispc_write_reg(DISPC_IRQSTATUS, l);
- /* Enable those that we handle always */
- omap_dispc_enable_irqs(DISPC_IRQ_FRAMEMASK);
+ recalc_irq_mask();
if ((r = request_irq(INT_24XX_DSS_IRQ, omap_dispc_irq_handler,
0, MODULE_NAME, fbdev)) < 0) {
@@ -1469,7 +1489,6 @@
free_irq(INT_24XX_DSS_IRQ, fbdev);
fail1:
enable_lcd_clocks(0);
- enable_interface_clocks(0);
put_dss_clocks();
fail0:
iounmap(dispc.base);
@@ -1487,7 +1506,6 @@
cleanup_fbmem();
free_palette_ram();
free_irq(INT_24XX_DSS_IRQ, dispc.fbdev);
- enable_interface_clocks(0);
put_dss_clocks();
iounmap(dispc.base);
}
diff --git a/drivers/video/omap/dispc.h b/drivers/video/omap/dispc.h
index ef720a7..c15ea77 100644
--- a/drivers/video/omap/dispc.h
+++ b/drivers/video/omap/dispc.h
@@ -37,9 +37,10 @@
extern void omap_dispc_enable_lcd_out(int enable);
extern void omap_dispc_enable_digit_out(int enable);
-extern int omap_dispc_request_irq(void (*callback)(void *data), void *data);
-extern void omap_dispc_free_irq(void);
+extern int omap_dispc_request_irq(unsigned long irq_mask,
+ void (*callback)(void *data), void *data);
+extern void omap_dispc_free_irq(unsigned long irq_mask,
+ void (*callback)(void *data), void *data);
extern const struct lcd_ctrl omap2_int_ctrl;
-
#endif
diff --git a/drivers/video/omap/hwa742.c b/drivers/video/omap/hwa742.c
index 5d4f348..ca51583 100644
--- a/drivers/video/omap/hwa742.c
+++ b/drivers/video/omap/hwa742.c
@@ -131,7 +131,7 @@
struct omapfb_device *fbdev;
struct lcd_ctrl_extif *extif;
- struct lcd_ctrl *int_ctrl;
+ const struct lcd_ctrl *int_ctrl;
struct clk *sys_ck;
} hwa742;
diff --git a/drivers/video/omap/lcd_2430sdp.c b/drivers/video/omap/lcd_2430sdp.c
new file mode 100644
index 0000000..393712b
--- /dev/null
+++ b/drivers/video/omap/lcd_2430sdp.c
@@ -0,0 +1,202 @@
+/*
+ * LCD panel support for the TI 2430SDP board
+ *
+ * Copyright (C) 2007 MontaVista
+ * Author: Hunyue Yau <hyau@mvista.com>
+ *
+ * Derived from drivers/video/omap/lcd-apollon.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/delay.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define SDP2430_LCD_PANEL_BACKLIGHT_GPIO 91
+#define SDP2430_LCD_PANEL_ENABLE_GPIO 154
+#define SDP3430_LCD_PANEL_BACKLIGHT_GPIO 24
+#define SDP3430_LCD_PANEL_ENABLE_GPIO 28
+
+static unsigned backlight_gpio;
+static unsigned enable_gpio;
+
+#define LCD_PIXCLOCK_MAX 5400 /* freq 5.4 MHz */
+#define PM_RECEIVER TWL4030_MODULE_PM_RECEIVER
+#define ENABLE_VAUX2_DEDICATED 0x09
+#define ENABLE_VAUX2_DEV_GRP 0x20
+#define ENABLE_VAUX3_DEDICATED 0x03
+#define ENABLE_VAUX3_DEV_GRP 0x20
+
+#define ENABLE_VPLL2_DEDICATED 0x05
+#define ENABLE_VPLL2_DEV_GRP 0xE0
+#define TWL4030_VPLL2_DEV_GRP 0x33
+#define TWL4030_VPLL2_DEDICATED 0x36
+
+#define t2_out(c, r, v) twl4030_i2c_write_u8(c, r, v)
+
+
+static int sdp2430_panel_init(struct lcd_panel *panel,
+ struct omapfb_device *fbdev)
+{
+ if (machine_is_omap_3430sdp()) {
+ enable_gpio = SDP3430_LCD_PANEL_ENABLE_GPIO;
+ backlight_gpio = SDP3430_LCD_PANEL_BACKLIGHT_GPIO;
+ } else {
+ enable_gpio = SDP2430_LCD_PANEL_ENABLE_GPIO;
+ backlight_gpio = SDP2430_LCD_PANEL_BACKLIGHT_GPIO;
+ }
+
+ gpio_request(enable_gpio, "LCD enable"); /* LCD panel */
+ gpio_request(backlight_gpio, "LCD bl"); /* LCD backlight */
+ gpio_direction_output(enable_gpio, 0);
+ gpio_direction_output(backlight_gpio, 0);
+
+ return 0;
+}
+
+static void sdp2430_panel_cleanup(struct lcd_panel *panel)
+{
+ gpio_free(backlight_gpio);
+ gpio_free(enable_gpio);
+}
+
+static int sdp2430_panel_enable(struct lcd_panel *panel)
+{
+ u8 ded_val, ded_reg;
+ u8 grp_val, grp_reg;
+
+ if (machine_is_omap_3430sdp()) {
+ ded_reg = TWL4030_VAUX3_DEDICATED;
+ ded_val = ENABLE_VAUX3_DEDICATED;
+ grp_reg = TWL4030_VAUX3_DEV_GRP;
+ grp_val = ENABLE_VAUX3_DEV_GRP;
+
+ if (omap_rev() > OMAP3430_REV_ES1_0) {
+ t2_out(PM_RECEIVER, ENABLE_VPLL2_DEDICATED,
+ TWL4030_VPLL2_DEDICATED);
+ t2_out(PM_RECEIVER, ENABLE_VPLL2_DEV_GRP,
+ TWL4030_VPLL2_DEV_GRP);
+ }
+ } else {
+ ded_reg = TWL4030_VAUX2_DEDICATED;
+ ded_val = ENABLE_VAUX2_DEDICATED;
+ grp_reg = TWL4030_VAUX2_DEV_GRP;
+ grp_val = ENABLE_VAUX2_DEV_GRP;
+ }
+
+ gpio_set_value(enable_gpio, 1);
+ gpio_set_value(backlight_gpio, 1);
+
+ if (0 != t2_out(PM_RECEIVER, ded_val, ded_reg))
+ return -EIO;
+ if (0 != t2_out(PM_RECEIVER, grp_val, grp_reg))
+ return -EIO;
+
+ return 0;
+}
+
+static void sdp2430_panel_disable(struct lcd_panel *panel)
+{
+ gpio_set_value(enable_gpio, 0);
+ gpio_set_value(backlight_gpio, 0);
+ if (omap_rev() > OMAP3430_REV_ES1_0) {
+ t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEDICATED);
+ t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEV_GRP);
+ msleep(4);
+ }
+}
+
+static unsigned long sdp2430_panel_get_caps(struct lcd_panel *panel)
+{
+ return 0;
+}
+
+struct lcd_panel sdp2430_panel = {
+ .name = "sdp2430",
+ .config = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+ OMAP_LCDC_INV_HSYNC,
+
+ .bpp = 16,
+ .data_lines = 16,
+ .x_res = 240,
+ .y_res = 320,
+ .hsw = 3, /* hsync_len (4) - 1 */
+ .hfp = 3, /* right_margin (4) - 1 */
+ .hbp = 39, /* left_margin (40) - 1 */
+ .vsw = 1, /* vsync_len (2) - 1 */
+ .vfp = 2, /* lower_margin */
+ .vbp = 7, /* upper_margin (8) - 1 */
+
+ .pixel_clock = LCD_PIXCLOCK_MAX,
+
+ .init = sdp2430_panel_init,
+ .cleanup = sdp2430_panel_cleanup,
+ .enable = sdp2430_panel_enable,
+ .disable = sdp2430_panel_disable,
+ .get_caps = sdp2430_panel_get_caps,
+};
+
+static int sdp2430_panel_probe(struct platform_device *pdev)
+{
+ omapfb_register_panel(&sdp2430_panel);
+ return 0;
+}
+
+static int sdp2430_panel_remove(struct platform_device *pdev)
+{
+ return 0;
+}
+
+static int sdp2430_panel_suspend(struct platform_device *pdev,
+ pm_message_t mesg)
+{
+ return 0;
+}
+
+static int sdp2430_panel_resume(struct platform_device *pdev)
+{
+ return 0;
+}
+
+struct platform_driver sdp2430_panel_driver = {
+ .probe = sdp2430_panel_probe,
+ .remove = sdp2430_panel_remove,
+ .suspend = sdp2430_panel_suspend,
+ .resume = sdp2430_panel_resume,
+ .driver = {
+ .name = "sdp2430_lcd",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init sdp2430_panel_drv_init(void)
+{
+ return platform_driver_register(&sdp2430_panel_driver);
+}
+
+static void __exit sdp2430_panel_drv_exit(void)
+{
+ platform_driver_unregister(&sdp2430_panel_driver);
+}
+
+module_init(sdp2430_panel_drv_init);
+module_exit(sdp2430_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_ams_delta.c b/drivers/video/omap/lcd_ams_delta.c
new file mode 100644
index 0000000..1f74399
--- /dev/null
+++ b/drivers/video/omap/lcd_ams_delta.c
@@ -0,0 +1,137 @@
+/*
+ * Based on drivers/video/omap/lcd_inn1510.c
+ *
+ * LCD panel support for the Amstrad E3 (Delta) videophone.
+ *
+ * Copyright (C) 2006 Jonathan McDowell <noodles@earth.li>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/io.h>
+#include <linux/delay.h>
+
+#include <mach/board-ams-delta.h>
+#include <mach/hardware.h>
+#include <mach/omapfb.h>
+
+#define AMS_DELTA_DEFAULT_CONTRAST 112
+
+static int ams_delta_panel_init(struct lcd_panel *panel,
+ struct omapfb_device *fbdev)
+{
+ return 0;
+}
+
+static void ams_delta_panel_cleanup(struct lcd_panel *panel)
+{
+}
+
+static int ams_delta_panel_enable(struct lcd_panel *panel)
+{
+ ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_NDISP,
+ AMS_DELTA_LATCH2_LCD_NDISP);
+ ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_VBLEN,
+ AMS_DELTA_LATCH2_LCD_VBLEN);
+
+ omap_writeb(1, OMAP_PWL_CLK_ENABLE);
+ omap_writeb(AMS_DELTA_DEFAULT_CONTRAST, OMAP_PWL_ENABLE);
+
+ return 0;
+}
+
+static void ams_delta_panel_disable(struct lcd_panel *panel)
+{
+ ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_VBLEN, 0);
+ ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_NDISP, 0);
+}
+
+static unsigned long ams_delta_panel_get_caps(struct lcd_panel *panel)
+{
+ return 0;
+}
+
+static struct lcd_panel ams_delta_panel = {
+ .name = "ams-delta",
+ .config = 0,
+
+ .bpp = 12,
+ .data_lines = 16,
+ .x_res = 480,
+ .y_res = 320,
+ .pixel_clock = 4687,
+ .hsw = 3,
+ .hfp = 1,
+ .hbp = 1,
+ .vsw = 1,
+ .vfp = 0,
+ .vbp = 0,
+ .pcd = 0,
+ .acb = 37,
+
+ .init = ams_delta_panel_init,
+ .cleanup = ams_delta_panel_cleanup,
+ .enable = ams_delta_panel_enable,
+ .disable = ams_delta_panel_disable,
+ .get_caps = ams_delta_panel_get_caps,
+};
+
+static int ams_delta_panel_probe(struct platform_device *pdev)
+{
+ omapfb_register_panel(&ams_delta_panel);
+ return 0;
+}
+
+static int ams_delta_panel_remove(struct platform_device *pdev)
+{
+ return 0;
+}
+
+static int ams_delta_panel_suspend(struct platform_device *pdev,
+ pm_message_t mesg)
+{
+ return 0;
+}
+
+static int ams_delta_panel_resume(struct platform_device *pdev)
+{
+ return 0;
+}
+
+struct platform_driver ams_delta_panel_driver = {
+ .probe = ams_delta_panel_probe,
+ .remove = ams_delta_panel_remove,
+ .suspend = ams_delta_panel_suspend,
+ .resume = ams_delta_panel_resume,
+ .driver = {
+ .name = "lcd_ams_delta",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int ams_delta_panel_drv_init(void)
+{
+ return platform_driver_register(&ams_delta_panel_driver);
+}
+
+static void ams_delta_panel_drv_cleanup(void)
+{
+ platform_driver_unregister(&ams_delta_panel_driver);
+}
+
+module_init(ams_delta_panel_drv_init);
+module_exit(ams_delta_panel_drv_cleanup);
diff --git a/drivers/video/omap/lcd_apollon.c b/drivers/video/omap/lcd_apollon.c
new file mode 100644
index 0000000..626ae3a
--- /dev/null
+++ b/drivers/video/omap/lcd_apollon.c
@@ -0,0 +1,138 @@
+/*
+ * LCD panel support for the Samsung OMAP2 Apollon board
+ *
+ * Copyright (C) 2005,2006 Samsung Electronics
+ * Author: Kyungmin Park <kyungmin.park@samsung.com>
+ *
+ * Derived from drivers/video/omap/lcd-h4.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+
+#include <mach/gpio.h>
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+
+/* #define USE_35INCH_LCD 1 */
+
+static int apollon_panel_init(struct lcd_panel *panel,
+ struct omapfb_device *fbdev)
+{
+ /* configure LCD PWR_EN */
+ omap_cfg_reg(M21_242X_GPIO11);
+ return 0;
+}
+
+static void apollon_panel_cleanup(struct lcd_panel *panel)
+{
+}
+
+static int apollon_panel_enable(struct lcd_panel *panel)
+{
+ return 0;
+}
+
+static void apollon_panel_disable(struct lcd_panel *panel)
+{
+}
+
+static unsigned long apollon_panel_get_caps(struct lcd_panel *panel)
+{
+ return 0;
+}
+
+struct lcd_panel apollon_panel = {
+ .name = "apollon",
+ .config = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+ OMAP_LCDC_INV_HSYNC,
+
+ .bpp = 16,
+ .data_lines = 18,
+#ifdef USE_35INCH_LCD
+ .x_res = 240,
+ .y_res = 320,
+ .hsw = 2,
+ .hfp = 3,
+ .hbp = 9,
+ .vsw = 4,
+ .vfp = 3,
+ .vbp = 5,
+#else
+ .x_res = 480,
+ .y_res = 272,
+ .hsw = 41,
+ .hfp = 2,
+ .hbp = 2,
+ .vsw = 10,
+ .vfp = 2,
+ .vbp = 2,
+#endif
+ .pixel_clock = 6250,
+
+ .init = apollon_panel_init,
+ .cleanup = apollon_panel_cleanup,
+ .enable = apollon_panel_enable,
+ .disable = apollon_panel_disable,
+ .get_caps = apollon_panel_get_caps,
+};
+
+static int apollon_panel_probe(struct platform_device *pdev)
+{
+ omapfb_register_panel(&apollon_panel);
+ return 0;
+}
+
+static int apollon_panel_remove(struct platform_device *pdev)
+{
+ return 0;
+}
+
+static int apollon_panel_suspend(struct platform_device *pdev,
+ pm_message_t mesg)
+{
+ return 0;
+}
+
+static int apollon_panel_resume(struct platform_device *pdev)
+{
+ return 0;
+}
+
+struct platform_driver apollon_panel_driver = {
+ .probe = apollon_panel_probe,
+ .remove = apollon_panel_remove,
+ .suspend = apollon_panel_suspend,
+ .resume = apollon_panel_resume,
+ .driver = {
+ .name = "apollon_lcd",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init apollon_panel_drv_init(void)
+{
+ return platform_driver_register(&apollon_panel_driver);
+}
+
+static void __exit apollon_panel_drv_exit(void)
+{
+ platform_driver_unregister(&apollon_panel_driver);
+}
+
+module_init(apollon_panel_drv_init);
+module_exit(apollon_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_ldp.c b/drivers/video/omap/lcd_ldp.c
new file mode 100644
index 0000000..dbfe897
--- /dev/null
+++ b/drivers/video/omap/lcd_ldp.c
@@ -0,0 +1,200 @@
+/*
+ * LCD panel support for the TI LDP board
+ *
+ * Copyright (C) 2007 WindRiver
+ * Author: Stanley Miao <stanley.miao@windriver.com>
+ *
+ * Derived from drivers/video/omap/lcd-2430sdp.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/delay.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/gpio.h>
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_BACKLIGHT_GPIO (15 + OMAP_MAX_GPIO_LINES)
+#define LCD_PANEL_ENABLE_GPIO (7 + OMAP_MAX_GPIO_LINES)
+
+#define LCD_PANEL_RESET_GPIO 55
+#define LCD_PANEL_QVGA_GPIO 56
+
+#ifdef CONFIG_FB_OMAP_LCD_VGA
+#define LCD_XRES 480
+#define LCD_YRES 640
+#define LCD_PIXCLOCK_MAX 41700
+#else
+#define LCD_XRES 240
+#define LCD_YRES 320
+#define LCD_PIXCLOCK_MAX 185186
+#endif
+
+#define PM_RECEIVER TWL4030_MODULE_PM_RECEIVER
+#define ENABLE_VAUX2_DEDICATED 0x09
+#define ENABLE_VAUX2_DEV_GRP 0x20
+#define ENABLE_VAUX3_DEDICATED 0x03
+#define ENABLE_VAUX3_DEV_GRP 0x20
+
+#define ENABLE_VPLL2_DEDICATED 0x05
+#define ENABLE_VPLL2_DEV_GRP 0xE0
+#define TWL4030_VPLL2_DEV_GRP 0x33
+#define TWL4030_VPLL2_DEDICATED 0x36
+
+#define t2_out(c, r, v) twl4030_i2c_write_u8(c, r, v)
+
+
+static int ldp_panel_init(struct lcd_panel *panel,
+ struct omapfb_device *fbdev)
+{
+ gpio_request(LCD_PANEL_RESET_GPIO, "lcd reset");
+ gpio_request(LCD_PANEL_QVGA_GPIO, "lcd qvga");
+ gpio_request(LCD_PANEL_ENABLE_GPIO, "lcd panel");
+ gpio_request(LCD_PANEL_BACKLIGHT_GPIO, "lcd backlight");
+
+ gpio_direction_output(LCD_PANEL_QVGA_GPIO, 0);
+ gpio_direction_output(LCD_PANEL_RESET_GPIO, 0);
+ gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 0);
+ gpio_direction_output(LCD_PANEL_BACKLIGHT_GPIO, 0);
+
+#ifdef CONFIG_FB_OMAP_LCD_VGA
+ gpio_set_value(LCD_PANEL_QVGA_GPIO, 0);
+#else
+ gpio_set_value(LCD_PANEL_QVGA_GPIO, 1);
+#endif
+ gpio_set_value(LCD_PANEL_RESET_GPIO, 1);
+
+ return 0;
+}
+
+static void ldp_panel_cleanup(struct lcd_panel *panel)
+{
+ gpio_free(LCD_PANEL_BACKLIGHT_GPIO);
+ gpio_free(LCD_PANEL_ENABLE_GPIO);
+ gpio_free(LCD_PANEL_QVGA_GPIO);
+ gpio_free(LCD_PANEL_RESET_GPIO);
+}
+
+static int ldp_panel_enable(struct lcd_panel *panel)
+{
+ if (0 != t2_out(PM_RECEIVER, ENABLE_VPLL2_DEDICATED,
+ TWL4030_VPLL2_DEDICATED))
+ return -EIO;
+ if (0 != t2_out(PM_RECEIVER, ENABLE_VPLL2_DEV_GRP,
+ TWL4030_VPLL2_DEV_GRP))
+ return -EIO;
+
+ gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 1);
+ gpio_direction_output(LCD_PANEL_BACKLIGHT_GPIO, 1);
+
+ if (0 != t2_out(PM_RECEIVER, ENABLE_VAUX3_DEDICATED,
+ TWL4030_VAUX3_DEDICATED))
+ return -EIO;
+ if (0 != t2_out(PM_RECEIVER, ENABLE_VAUX3_DEV_GRP,
+ TWL4030_VAUX3_DEV_GRP))
+ return -EIO;
+
+ return 0;
+}
+
+static void ldp_panel_disable(struct lcd_panel *panel)
+{
+ gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 0);
+ gpio_direction_output(LCD_PANEL_BACKLIGHT_GPIO, 0);
+
+ t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEDICATED);
+ t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEV_GRP);
+ msleep(4);
+}
+
+static unsigned long ldp_panel_get_caps(struct lcd_panel *panel)
+{
+ return 0;
+}
+
+struct lcd_panel ldp_panel = {
+ .name = "ldp",
+ .config = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+ OMAP_LCDC_INV_HSYNC,
+
+ .bpp = 16,
+ .data_lines = 18,
+ .x_res = LCD_XRES,
+ .y_res = LCD_YRES,
+ .hsw = 3, /* hsync_len (4) - 1 */
+ .hfp = 3, /* right_margin (4) - 1 */
+ .hbp = 39, /* left_margin (40) - 1 */
+ .vsw = 1, /* vsync_len (2) - 1 */
+ .vfp = 2, /* lower_margin */
+ .vbp = 7, /* upper_margin (8) - 1 */
+
+ .pixel_clock = LCD_PIXCLOCK_MAX,
+
+ .init = ldp_panel_init,
+ .cleanup = ldp_panel_cleanup,
+ .enable = ldp_panel_enable,
+ .disable = ldp_panel_disable,
+ .get_caps = ldp_panel_get_caps,
+};
+
+static int ldp_panel_probe(struct platform_device *pdev)
+{
+ omapfb_register_panel(&ldp_panel);
+ return 0;
+}
+
+static int ldp_panel_remove(struct platform_device *pdev)
+{
+ return 0;
+}
+
+static int ldp_panel_suspend(struct platform_device *pdev, pm_message_t mesg)
+{
+ return 0;
+}
+
+static int ldp_panel_resume(struct platform_device *pdev)
+{
+ return 0;
+}
+
+struct platform_driver ldp_panel_driver = {
+ .probe = ldp_panel_probe,
+ .remove = ldp_panel_remove,
+ .suspend = ldp_panel_suspend,
+ .resume = ldp_panel_resume,
+ .driver = {
+ .name = "ldp_lcd",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init ldp_panel_drv_init(void)
+{
+ return platform_driver_register(&ldp_panel_driver);
+}
+
+static void __exit ldp_panel_drv_exit(void)
+{
+ platform_driver_unregister(&ldp_panel_driver);
+}
+
+module_init(ldp_panel_drv_init);
+module_exit(ldp_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_mipid.c b/drivers/video/omap/lcd_mipid.c
new file mode 100644
index 0000000..918ee89
--- /dev/null
+++ b/drivers/video/omap/lcd_mipid.c
@@ -0,0 +1,625 @@
+/*
+ * LCD driver for MIPI DBI-C / DCS compatible LCDs
+ *
+ * Copyright (C) 2006 Nokia Corporation
+ * Author: Imre Deak <imre.deak@nokia.com>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+ */
+#include <linux/device.h>
+#include <linux/delay.h>
+#include <linux/workqueue.h>
+#include <linux/spi/spi.h>
+
+#include <mach/omapfb.h>
+#include <mach/lcd_mipid.h>
+
+#define MIPID_MODULE_NAME "lcd_mipid"
+
+#define MIPID_CMD_READ_DISP_ID 0x04
+#define MIPID_CMD_READ_RED 0x06
+#define MIPID_CMD_READ_GREEN 0x07
+#define MIPID_CMD_READ_BLUE 0x08
+#define MIPID_CMD_READ_DISP_STATUS 0x09
+#define MIPID_CMD_RDDSDR 0x0F
+#define MIPID_CMD_SLEEP_IN 0x10
+#define MIPID_CMD_SLEEP_OUT 0x11
+#define MIPID_CMD_DISP_OFF 0x28
+#define MIPID_CMD_DISP_ON 0x29
+
+#define MIPID_ESD_CHECK_PERIOD msecs_to_jiffies(5000)
+
+#define to_mipid_device(p) container_of(p, struct mipid_device, \
+ panel)
+struct mipid_device {
+ int enabled;
+ int revision;
+ unsigned int saved_bklight_level;
+ unsigned long hw_guard_end; /* next value of jiffies
+ when we can issue the
+ next sleep in/out command */
+ unsigned long hw_guard_wait; /* max guard time in jiffies */
+
+ struct omapfb_device *fbdev;
+ struct spi_device *spi;
+ struct mutex mutex;
+ struct lcd_panel panel;
+
+ struct workqueue_struct *esd_wq;
+ struct delayed_work esd_work;
+ void (*esd_check)(struct mipid_device *m);
+};
+
+static void mipid_transfer(struct mipid_device *md, int cmd, const u8 *wbuf,
+ int wlen, u8 *rbuf, int rlen)
+{
+ struct spi_message m;
+ struct spi_transfer *x, xfer[4];
+ u16 w;
+ int r;
+
+ BUG_ON(md->spi == NULL);
+
+ spi_message_init(&m);
+
+ memset(xfer, 0, sizeof(xfer));
+ x = &xfer[0];
+
+ cmd &= 0xff;
+ x->tx_buf = &cmd;
+ x->bits_per_word = 9;
+ x->len = 2;
+ spi_message_add_tail(x, &m);
+
+ if (wlen) {
+ x++;
+ x->tx_buf = wbuf;
+ x->len = wlen;
+ x->bits_per_word = 9;
+ spi_message_add_tail(x, &m);
+ }
+
+ if (rlen) {
+ x++;
+ x->rx_buf = &w;
+ x->len = 1;
+ spi_message_add_tail(x, &m);
+
+ if (rlen > 1) {
+ /* Arrange for the extra clock before the first
+ * data bit.
+ */
+ x->bits_per_word = 9;
+ x->len = 2;
+
+ x++;
+ x->rx_buf = &rbuf[1];
+ x->len = rlen - 1;
+ spi_message_add_tail(x, &m);
+ }
+ }
+
+ r = spi_sync(md->spi, &m);
+ if (r < 0)
+ dev_dbg(&md->spi->dev, "spi_sync %d\n", r);
+
+ if (rlen)
+ rbuf[0] = w & 0xff;
+}
+
+static inline void mipid_cmd(struct mipid_device *md, int cmd)
+{
+ mipid_transfer(md, cmd, NULL, 0, NULL, 0);
+}
+
+static inline void mipid_write(struct mipid_device *md,
+ int reg, const u8 *buf, int len)
+{
+ mipid_transfer(md, reg, buf, len, NULL, 0);
+}
+
+static inline void mipid_read(struct mipid_device *md,
+ int reg, u8 *buf, int len)
+{
+ mipid_transfer(md, reg, NULL, 0, buf, len);
+}
+
+static void set_data_lines(struct mipid_device *md, int data_lines)
+{
+ u16 par;
+
+ switch (data_lines) {
+ case 16:
+ par = 0x150;
+ break;
+ case 18:
+ par = 0x160;
+ break;
+ case 24:
+ par = 0x170;
+ break;
+ }
+ mipid_write(md, 0x3a, (u8 *)&par, 2);
+}
+
+static void send_init_string(struct mipid_device *md)
+{
+ u16 initpar[] = { 0x0102, 0x0100, 0x0100 };
+
+ mipid_write(md, 0xc2, (u8 *)initpar, sizeof(initpar));
+ set_data_lines(md, md->panel.data_lines);
+}
+
+static void hw_guard_start(struct mipid_device *md, int guard_msec)
+{
+ md->hw_guard_wait = msecs_to_jiffies(guard_msec);
+ md->hw_guard_end = jiffies + md->hw_guard_wait;
+}
+
+static void hw_guard_wait(struct mipid_device *md)
+{
+ unsigned long wait = md->hw_guard_end - jiffies;
+
+ if ((long)wait > 0 && wait <= md->hw_guard_wait) {
+ set_current_state(TASK_UNINTERRUPTIBLE);
+ schedule_timeout(wait);
+ }
+}
+
+static void set_sleep_mode(struct mipid_device *md, int on)
+{
+ int cmd, sleep_time = 50;
+
+ if (on)
+ cmd = MIPID_CMD_SLEEP_IN;
+ else
+ cmd = MIPID_CMD_SLEEP_OUT;
+ hw_guard_wait(md);
+ mipid_cmd(md, cmd);
+ hw_guard_start(md, 120);
+ /*
+ * When we enable the panel, it seems we _have_ to sleep
+ * 120 ms before sending the init string. When disabling the
+ * panel we'll sleep for the duration of 2 frames, so that the
+ * controller can still provide the PCLK,HS,VS signals.
+ */
+ if (!on)
+ sleep_time = 120;
+ msleep(sleep_time);
+}
+
+static void set_display_state(struct mipid_device *md, int enabled)
+{
+ int cmd = enabled ? MIPID_CMD_DISP_ON : MIPID_CMD_DISP_OFF;
+
+ mipid_cmd(md, cmd);
+}
+
+static int mipid_set_bklight_level(struct lcd_panel *panel, unsigned int level)
+{
+ struct mipid_device *md = to_mipid_device(panel);
+ struct mipid_platform_data *pd = md->spi->dev.platform_data;
+
+ if (pd->get_bklight_max == NULL || pd->set_bklight_level == NULL)
+ return -ENODEV;
+ if (level > pd->get_bklight_max(pd))
+ return -EINVAL;
+ if (!md->enabled) {
+ md->saved_bklight_level = level;
+ return 0;
+ }
+ pd->set_bklight_level(pd, level);
+
+ return 0;
+}
+
+static unsigned int mipid_get_bklight_level(struct lcd_panel *panel)
+{
+ struct mipid_device *md = to_mipid_device(panel);
+ struct mipid_platform_data *pd = md->spi->dev.platform_data;
+
+ if (pd->get_bklight_level == NULL)
+ return -ENODEV;
+ return pd->get_bklight_level(pd);
+}
+
+static unsigned int mipid_get_bklight_max(struct lcd_panel *panel)
+{
+ struct mipid_device *md = to_mipid_device(panel);
+ struct mipid_platform_data *pd = md->spi->dev.platform_data;
+
+ if (pd->get_bklight_max == NULL)
+ return -ENODEV;
+
+ return pd->get_bklight_max(pd);
+}
+
+static unsigned long mipid_get_caps(struct lcd_panel *panel)
+{
+ return OMAPFB_CAPS_SET_BACKLIGHT;
+}
+
+static u16 read_first_pixel(struct mipid_device *md)
+{
+ u16 pixel;
+ u8 red, green, blue;
+
+ mutex_lock(&md->mutex);
+ mipid_read(md, MIPID_CMD_READ_RED, &red, 1);
+ mipid_read(md, MIPID_CMD_READ_GREEN, &green, 1);
+ mipid_read(md, MIPID_CMD_READ_BLUE, &blue, 1);
+ mutex_unlock(&md->mutex);
+
+ switch (md->panel.data_lines) {
+ case 16:
+ pixel = ((red >> 1) << 11) | (green << 5) | (blue >> 1);
+ break;
+ case 24:
+ /* 24 bit -> 16 bit */
+ pixel = ((red >> 3) << 11) | ((green >> 2) << 5) |
+ (blue >> 3);
+ break;
+ default:
+ pixel = 0;
+ BUG();
+ }
+
+ return pixel;
+}
+
+static int mipid_run_test(struct lcd_panel *panel, int test_num)
+{
+ struct mipid_device *md = to_mipid_device(panel);
+ static const u16 test_values[4] = {
+ 0x0000, 0xffff, 0xaaaa, 0x5555,
+ };
+ int i;
+
+ if (test_num != MIPID_TEST_RGB_LINES)
+ return MIPID_TEST_INVALID;
+
+ for (i = 0; i < ARRAY_SIZE(test_values); i++) {
+ int delay;
+ unsigned long tmo;
+
+ omapfb_write_first_pixel(md->fbdev, test_values[i]);
+ tmo = jiffies + msecs_to_jiffies(100);
+ delay = 25;
+ while (1) {
+ u16 pixel;
+
+ msleep(delay);
+ pixel = read_first_pixel(md);
+ if (pixel == test_values[i])
+ break;
+ if (time_after(jiffies, tmo)) {
+ dev_err(&md->spi->dev,
+ "MIPI LCD RGB I/F test failed: "
+ "expecting %04x, got %04x\n",
+ test_values[i], pixel);
+ return MIPID_TEST_FAILED;
+ }
+ delay = 10;
+ }
+ }
+
+ return 0;
+}
+
+static void ls041y3_esd_recover(struct mipid_device *md)
+{
+ dev_err(&md->spi->dev, "performing LCD ESD recovery\n");
+ set_sleep_mode(md, 1);
+ set_sleep_mode(md, 0);
+}
+
+static void ls041y3_esd_check_mode1(struct mipid_device *md)
+{
+ u8 state1, state2;
+
+ mipid_read(md, MIPID_CMD_RDDSDR, &state1, 1);
+ set_sleep_mode(md, 0);
+ mipid_read(md, MIPID_CMD_RDDSDR, &state2, 1);
+ dev_dbg(&md->spi->dev, "ESD mode 1 state1 %02x state2 %02x\n",
+ state1, state2);
+ /* Each sleep out command will trigger a self diagnostic and flip
+ * Bit6 if the test passes.
+ */
+ if (!((state1 ^ state2) & (1 << 6)))
+ ls041y3_esd_recover(md);
+}
+
+static void ls041y3_esd_check_mode2(struct mipid_device *md)
+{
+ int i;
+ u8 rbuf[2];
+ static const struct {
+ int cmd;
+ int wlen;
+ u16 wbuf[3];
+ } *rd, rd_ctrl[7] = {
+ { 0xb0, 4, { 0x0101, 0x01fe, } },
+ { 0xb1, 4, { 0x01de, 0x0121, } },
+ { 0xc2, 4, { 0x0100, 0x0100, } },
+ { 0xbd, 2, { 0x0100, } },
+ { 0xc2, 4, { 0x01fc, 0x0103, } },
+ { 0xb4, 0, },
+ { 0x00, 0, },
+ };
+
+ rd = rd_ctrl;
+ for (i = 0; i < 3; i++, rd++)
+ mipid_write(md, rd->cmd, (u8 *)rd->wbuf, rd->wlen);
+
+ udelay(10);
+ mipid_read(md, rd->cmd, rbuf, 2);
+ rd++;
+
+ for (i = 0; i < 3; i++, rd++) {
+ udelay(10);
+ mipid_write(md, rd->cmd, (u8 *)rd->wbuf, rd->wlen);
+ }
+
+ dev_dbg(&md->spi->dev, "ESD mode 2 state %02x\n", rbuf[1]);
+ if (rbuf[1] == 0x00)
+ ls041y3_esd_recover(md);
+}
+
+static void ls041y3_esd_check(struct mipid_device *md)
+{
+ ls041y3_esd_check_mode1(md);
+ if (md->revision >= 0x88)
+ ls041y3_esd_check_mode2(md);
+}
+
+static void mipid_esd_start_check(struct mipid_device *md)
+{
+ if (md->esd_check != NULL)
+ queue_delayed_work(md->esd_wq, &md->esd_work,
+ MIPID_ESD_CHECK_PERIOD);
+}
+
+static void mipid_esd_stop_check(struct mipid_device *md)
+{
+ if (md->esd_check != NULL)
+ cancel_rearming_delayed_workqueue(md->esd_wq, &md->esd_work);
+}
+
+static void mipid_esd_work(struct work_struct *work)
+{
+ struct mipid_device *md = container_of(work, struct mipid_device,
+ esd_work.work);
+
+ mutex_lock(&md->mutex);
+ md->esd_check(md);
+ mutex_unlock(&md->mutex);
+ mipid_esd_start_check(md);
+}
+
+static int mipid_enable(struct lcd_panel *panel)
+{
+ struct mipid_device *md = to_mipid_device(panel);
+
+ mutex_lock(&md->mutex);
+
+ if (md->enabled) {
+ mutex_unlock(&md->mutex);
+ return 0;
+ }
+ set_sleep_mode(md, 0);
+ md->enabled = 1;
+ send_init_string(md);
+ set_display_state(md, 1);
+ mipid_set_bklight_level(panel, md->saved_bklight_level);
+ mipid_esd_start_check(md);
+
+ mutex_unlock(&md->mutex);
+ return 0;
+}
+
+static void mipid_disable(struct lcd_panel *panel)
+{
+ struct mipid_device *md = to_mipid_device(panel);
+
+ /*
+ * A final ESD work might be called before returning,
+ * so do this without holding the lock.
+ */
+ mipid_esd_stop_check(md);
+ mutex_lock(&md->mutex);
+
+ if (!md->enabled) {
+ mutex_unlock(&md->mutex);
+ return;
+ }
+ md->saved_bklight_level = mipid_get_bklight_level(panel);
+ mipid_set_bklight_level(panel, 0);
+ set_display_state(md, 0);
+ set_sleep_mode(md, 1);
+ md->enabled = 0;
+
+ mutex_unlock(&md->mutex);
+}
+
+static int panel_enabled(struct mipid_device *md)
+{
+ u32 disp_status;
+ int enabled;
+
+ mipid_read(md, MIPID_CMD_READ_DISP_STATUS, (u8 *)&disp_status, 4);
+ disp_status = __be32_to_cpu(disp_status);
+ enabled = (disp_status & (1 << 17)) && (disp_status & (1 << 10));
+ dev_dbg(&md->spi->dev,
+ "LCD panel %senabled by bootloader (status 0x%04x)\n",
+ enabled ? "" : "not ", disp_status);
+ return enabled;
+}
+
+static int mipid_init(struct lcd_panel *panel,
+ struct omapfb_device *fbdev)
+{
+ struct mipid_device *md = to_mipid_device(panel);
+
+ md->fbdev = fbdev;
+ md->esd_wq = create_singlethread_workqueue("mipid_esd");
+ if (md->esd_wq == NULL) {
+ dev_err(&md->spi->dev, "can't create ESD workqueue\n");
+ return -ENOMEM;
+ }
+ INIT_DELAYED_WORK(&md->esd_work, mipid_esd_work);
+ mutex_init(&md->mutex);
+
+ md->enabled = panel_enabled(md);
+
+ if (md->enabled)
+ mipid_esd_start_check(md);
+ else
+ md->saved_bklight_level = mipid_get_bklight_level(panel);
+
+ return 0;
+}
+
+static void mipid_cleanup(struct lcd_panel *panel)
+{
+ struct mipid_device *md = to_mipid_device(panel);
+
+ if (md->enabled)
+ mipid_esd_stop_check(md);
+ destroy_workqueue(md->esd_wq);
+}
+
+static struct lcd_panel mipid_panel = {
+ .config = OMAP_LCDC_PANEL_TFT,
+
+ .bpp = 16,
+ .x_res = 800,
+ .y_res = 480,
+ .pixel_clock = 21940,
+ .hsw = 50,
+ .hfp = 20,
+ .hbp = 15,
+ .vsw = 2,
+ .vfp = 1,
+ .vbp = 3,
+
+ .init = mipid_init,
+ .cleanup = mipid_cleanup,
+ .enable = mipid_enable,
+ .disable = mipid_disable,
+ .get_caps = mipid_get_caps,
+ .set_bklight_level = mipid_set_bklight_level,
+ .get_bklight_level = mipid_get_bklight_level,
+ .get_bklight_max = mipid_get_bklight_max,
+ .run_test = mipid_run_test,
+};
+
+static int mipid_detect(struct mipid_device *md)
+{
+ struct mipid_platform_data *pdata;
+ u8 display_id[3];
+
+ pdata = md->spi->dev.platform_data;
+ if (pdata == NULL) {
+ dev_err(&md->spi->dev, "missing platform data\n");
+ return -ENOENT;
+ }
+
+ mipid_read(md, MIPID_CMD_READ_DISP_ID, display_id, 3);
+ dev_dbg(&md->spi->dev, "MIPI display ID: %02x%02x%02x\n",
+ display_id[0], display_id[1], display_id[2]);
+
+ switch (display_id[0]) {
+ case 0x45:
+ md->panel.name = "lph8923";
+ break;
+ case 0x83:
+ md->panel.name = "ls041y3";
+ md->esd_check = ls041y3_esd_check;
+ break;
+ default:
+ md->panel.name = "unknown";
+ dev_err(&md->spi->dev, "invalid display ID\n");
+ return -ENODEV;
+ }
+
+ md->revision = display_id[1];
+ md->panel.data_lines = pdata->data_lines;
+ pr_info("omapfb: %s rev %02x LCD detected, %d data lines\n",
+ md->panel.name, md->revision, md->panel.data_lines);
+
+ return 0;
+}
+
+static int mipid_spi_probe(struct spi_device *spi)
+{
+ struct mipid_device *md;
+ int r;
+
+ md = kzalloc(sizeof(*md), GFP_KERNEL);
+ if (md == NULL) {
+ dev_err(&spi->dev, "out of memory\n");
+ return -ENOMEM;
+ }
+
+ spi->mode = SPI_MODE_0;
+ md->spi = spi;
+ dev_set_drvdata(&spi->dev, md);
+ md->panel = mipid_panel;
+
+ r = mipid_detect(md);
+ if (r < 0)
+ return r;
+
+ omapfb_register_panel(&md->panel);
+
+ return 0;
+}
+
+static int mipid_spi_remove(struct spi_device *spi)
+{
+ struct mipid_device *md = dev_get_drvdata(&spi->dev);
+
+ mipid_disable(&md->panel);
+ kfree(md);
+
+ return 0;
+}
+
+static struct spi_driver mipid_spi_driver = {
+ .driver = {
+ .name = MIPID_MODULE_NAME,
+ .bus = &spi_bus_type,
+ .owner = THIS_MODULE,
+ },
+ .probe = mipid_spi_probe,
+ .remove = __devexit_p(mipid_spi_remove),
+};
+
+static int mipid_drv_init(void)
+{
+ spi_register_driver(&mipid_spi_driver);
+
+ return 0;
+}
+module_init(mipid_drv_init);
+
+static void mipid_drv_cleanup(void)
+{
+ spi_unregister_driver(&mipid_spi_driver);
+}
+module_exit(mipid_drv_cleanup);
+
+MODULE_DESCRIPTION("MIPI display driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/omap/lcd_omap2evm.c b/drivers/video/omap/lcd_omap2evm.c
new file mode 100644
index 0000000..7a2bbe2
--- /dev/null
+++ b/drivers/video/omap/lcd_omap2evm.c
@@ -0,0 +1,191 @@
+/*
+ * LCD panel support for the MISTRAL OMAP2EVM board
+ *
+ * Author: Arun C <arunedarath@mistralsolutions.com>
+ *
+ * Derived from drivers/video/omap/lcd_omap3evm.c
+ * Derived from drivers/video/omap/lcd-apollon.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_ENABLE_GPIO 154
+#define LCD_PANEL_LR 128
+#define LCD_PANEL_UD 129
+#define LCD_PANEL_INI 152
+#define LCD_PANEL_QVGA 148
+#define LCD_PANEL_RESB 153
+
+#define TWL_LED_LEDEN 0x00
+#define TWL_PWMA_PWMAON 0x00
+#define TWL_PWMA_PWMAOFF 0x01
+
+static unsigned int bklight_level;
+
+static int omap2evm_panel_init(struct lcd_panel *panel,
+ struct omapfb_device *fbdev)
+{
+ gpio_request(LCD_PANEL_ENABLE_GPIO, "LCD enable");
+ gpio_request(LCD_PANEL_LR, "LCD lr");
+ gpio_request(LCD_PANEL_UD, "LCD ud");
+ gpio_request(LCD_PANEL_INI, "LCD ini");
+ gpio_request(LCD_PANEL_QVGA, "LCD qvga");
+ gpio_request(LCD_PANEL_RESB, "LCD resb");
+
+ gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 1);
+ gpio_direction_output(LCD_PANEL_RESB, 1);
+ gpio_direction_output(LCD_PANEL_INI, 1);
+ gpio_direction_output(LCD_PANEL_QVGA, 0);
+ gpio_direction_output(LCD_PANEL_LR, 1);
+ gpio_direction_output(LCD_PANEL_UD, 1);
+
+ twl4030_i2c_write_u8(TWL4030_MODULE_LED, 0x11, TWL_LED_LEDEN);
+ twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x01, TWL_PWMA_PWMAON);
+ twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x02, TWL_PWMA_PWMAOFF);
+ bklight_level = 100;
+
+ return 0;
+}
+
+static void omap2evm_panel_cleanup(struct lcd_panel *panel)
+{
+ gpio_free(LCD_PANEL_RESB);
+ gpio_free(LCD_PANEL_QVGA);
+ gpio_free(LCD_PANEL_INI);
+ gpio_free(LCD_PANEL_UD);
+ gpio_free(LCD_PANEL_LR);
+ gpio_free(LCD_PANEL_ENABLE_GPIO);
+}
+
+static int omap2evm_panel_enable(struct lcd_panel *panel)
+{
+ gpio_set_value(LCD_PANEL_ENABLE_GPIO, 0);
+ return 0;
+}
+
+static void omap2evm_panel_disable(struct lcd_panel *panel)
+{
+ gpio_set_value(LCD_PANEL_ENABLE_GPIO, 1);
+}
+
+static unsigned long omap2evm_panel_get_caps(struct lcd_panel *panel)
+{
+ return 0;
+}
+
+static int omap2evm_bklight_setlevel(struct lcd_panel *panel,
+ unsigned int level)
+{
+ u8 c;
+ if ((level >= 0) && (level <= 100)) {
+ c = (125 * (100 - level)) / 100 + 2;
+ twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, c, TWL_PWMA_PWMAOFF);
+ bklight_level = level;
+ }
+ return 0;
+}
+
+static unsigned int omap2evm_bklight_getlevel(struct lcd_panel *panel)
+{
+ return bklight_level;
+}
+
+static unsigned int omap2evm_bklight_getmaxlevel(struct lcd_panel *panel)
+{
+ return 100;
+}
+
+struct lcd_panel omap2evm_panel = {
+ .name = "omap2evm",
+ .config = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+ OMAP_LCDC_INV_HSYNC,
+
+ .bpp = 16,
+ .data_lines = 18,
+ .x_res = 480,
+ .y_res = 640,
+ .hsw = 3,
+ .hfp = 0,
+ .hbp = 28,
+ .vsw = 2,
+ .vfp = 1,
+ .vbp = 0,
+
+ .pixel_clock = 20000,
+
+ .init = omap2evm_panel_init,
+ .cleanup = omap2evm_panel_cleanup,
+ .enable = omap2evm_panel_enable,
+ .disable = omap2evm_panel_disable,
+ .get_caps = omap2evm_panel_get_caps,
+ .set_bklight_level = omap2evm_bklight_setlevel,
+ .get_bklight_level = omap2evm_bklight_getlevel,
+ .get_bklight_max = omap2evm_bklight_getmaxlevel,
+};
+
+static int omap2evm_panel_probe(struct platform_device *pdev)
+{
+ omapfb_register_panel(&omap2evm_panel);
+ return 0;
+}
+
+static int omap2evm_panel_remove(struct platform_device *pdev)
+{
+ return 0;
+}
+
+static int omap2evm_panel_suspend(struct platform_device *pdev,
+ pm_message_t mesg)
+{
+ return 0;
+}
+
+static int omap2evm_panel_resume(struct platform_device *pdev)
+{
+ return 0;
+}
+
+struct platform_driver omap2evm_panel_driver = {
+ .probe = omap2evm_panel_probe,
+ .remove = omap2evm_panel_remove,
+ .suspend = omap2evm_panel_suspend,
+ .resume = omap2evm_panel_resume,
+ .driver = {
+ .name = "omap2evm_lcd",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init omap2evm_panel_drv_init(void)
+{
+ return platform_driver_register(&omap2evm_panel_driver);
+}
+
+static void __exit omap2evm_panel_drv_exit(void)
+{
+ platform_driver_unregister(&omap2evm_panel_driver);
+}
+
+module_init(omap2evm_panel_drv_init);
+module_exit(omap2evm_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_omap3beagle.c b/drivers/video/omap/lcd_omap3beagle.c
new file mode 100644
index 0000000..4011910
--- /dev/null
+++ b/drivers/video/omap/lcd_omap3beagle.c
@@ -0,0 +1,130 @@
+/*
+ * LCD panel support for the TI OMAP3 Beagle board
+ *
+ * Author: Koen Kooi <koen@openembedded.org>
+ *
+ * Derived from drivers/video/omap/lcd-omap3evm.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_ENABLE_GPIO 170
+
+static int omap3beagle_panel_init(struct lcd_panel *panel,
+ struct omapfb_device *fbdev)
+{
+ gpio_request(LCD_PANEL_ENABLE_GPIO, "LCD enable");
+ return 0;
+}
+
+static void omap3beagle_panel_cleanup(struct lcd_panel *panel)
+{
+ gpio_free(LCD_PANEL_ENABLE_GPIO);
+}
+
+static int omap3beagle_panel_enable(struct lcd_panel *panel)
+{
+ gpio_set_value(LCD_PANEL_ENABLE_GPIO, 1);
+ return 0;
+}
+
+static void omap3beagle_panel_disable(struct lcd_panel *panel)
+{
+ gpio_set_value(LCD_PANEL_ENABLE_GPIO, 0);
+}
+
+static unsigned long omap3beagle_panel_get_caps(struct lcd_panel *panel)
+{
+ return 0;
+}
+
+struct lcd_panel omap3beagle_panel = {
+ .name = "omap3beagle",
+ .config = OMAP_LCDC_PANEL_TFT,
+
+ .bpp = 16,
+ .data_lines = 24,
+ .x_res = 1024,
+ .y_res = 768,
+ .hsw = 3, /* hsync_len (4) - 1 */
+ .hfp = 3, /* right_margin (4) - 1 */
+ .hbp = 39, /* left_margin (40) - 1 */
+ .vsw = 1, /* vsync_len (2) - 1 */
+ .vfp = 2, /* lower_margin */
+ .vbp = 7, /* upper_margin (8) - 1 */
+
+ .pixel_clock = 64000,
+
+ .init = omap3beagle_panel_init,
+ .cleanup = omap3beagle_panel_cleanup,
+ .enable = omap3beagle_panel_enable,
+ .disable = omap3beagle_panel_disable,
+ .get_caps = omap3beagle_panel_get_caps,
+};
+
+static int omap3beagle_panel_probe(struct platform_device *pdev)
+{
+ omapfb_register_panel(&omap3beagle_panel);
+ return 0;
+}
+
+static int omap3beagle_panel_remove(struct platform_device *pdev)
+{
+ return 0;
+}
+
+static int omap3beagle_panel_suspend(struct platform_device *pdev,
+ pm_message_t mesg)
+{
+ return 0;
+}
+
+static int omap3beagle_panel_resume(struct platform_device *pdev)
+{
+ return 0;
+}
+
+struct platform_driver omap3beagle_panel_driver = {
+ .probe = omap3beagle_panel_probe,
+ .remove = omap3beagle_panel_remove,
+ .suspend = omap3beagle_panel_suspend,
+ .resume = omap3beagle_panel_resume,
+ .driver = {
+ .name = "omap3beagle_lcd",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init omap3beagle_panel_drv_init(void)
+{
+ return platform_driver_register(&omap3beagle_panel_driver);
+}
+
+static void __exit omap3beagle_panel_drv_exit(void)
+{
+ platform_driver_unregister(&omap3beagle_panel_driver);
+}
+
+module_init(omap3beagle_panel_drv_init);
+module_exit(omap3beagle_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_omap3evm.c b/drivers/video/omap/lcd_omap3evm.c
new file mode 100644
index 0000000..b6a4c2c
--- /dev/null
+++ b/drivers/video/omap/lcd_omap3evm.c
@@ -0,0 +1,192 @@
+/*
+ * LCD panel support for the TI OMAP3 EVM board
+ *
+ * Author: Steve Sakoman <steve@sakoman.com>
+ *
+ * Derived from drivers/video/omap/lcd-apollon.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_ENABLE_GPIO 153
+#define LCD_PANEL_LR 2
+#define LCD_PANEL_UD 3
+#define LCD_PANEL_INI 152
+#define LCD_PANEL_QVGA 154
+#define LCD_PANEL_RESB 155
+
+#define ENABLE_VDAC_DEDICATED 0x03
+#define ENABLE_VDAC_DEV_GRP 0x20
+#define ENABLE_VPLL2_DEDICATED 0x05
+#define ENABLE_VPLL2_DEV_GRP 0xE0
+
+#define TWL_LED_LEDEN 0x00
+#define TWL_PWMA_PWMAON 0x00
+#define TWL_PWMA_PWMAOFF 0x01
+
+static unsigned int bklight_level;
+
+static int omap3evm_panel_init(struct lcd_panel *panel,
+ struct omapfb_device *fbdev)
+{
+ gpio_request(LCD_PANEL_LR, "LCD lr");
+ gpio_request(LCD_PANEL_UD, "LCD ud");
+ gpio_request(LCD_PANEL_INI, "LCD ini");
+ gpio_request(LCD_PANEL_RESB, "LCD resb");
+ gpio_request(LCD_PANEL_QVGA, "LCD qvga");
+
+ gpio_direction_output(LCD_PANEL_RESB, 1);
+ gpio_direction_output(LCD_PANEL_INI, 1);
+ gpio_direction_output(LCD_PANEL_QVGA, 0);
+ gpio_direction_output(LCD_PANEL_LR, 1);
+ gpio_direction_output(LCD_PANEL_UD, 1);
+
+ twl4030_i2c_write_u8(TWL4030_MODULE_LED, 0x11, TWL_LED_LEDEN);
+ twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x01, TWL_PWMA_PWMAON);
+ twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x02, TWL_PWMA_PWMAOFF);
+ bklight_level = 100;
+
+ return 0;
+}
+
+static void omap3evm_panel_cleanup(struct lcd_panel *panel)
+{
+ gpio_free(LCD_PANEL_QVGA);
+ gpio_free(LCD_PANEL_RESB);
+ gpio_free(LCD_PANEL_INI);
+ gpio_free(LCD_PANEL_UD);
+ gpio_free(LCD_PANEL_LR);
+}
+
+static int omap3evm_panel_enable(struct lcd_panel *panel)
+{
+ gpio_set_value(LCD_PANEL_ENABLE_GPIO, 0);
+ return 0;
+}
+
+static void omap3evm_panel_disable(struct lcd_panel *panel)
+{
+ gpio_set_value(LCD_PANEL_ENABLE_GPIO, 1);
+}
+
+static unsigned long omap3evm_panel_get_caps(struct lcd_panel *panel)
+{
+ return 0;
+}
+
+static int omap3evm_bklight_setlevel(struct lcd_panel *panel,
+ unsigned int level)
+{
+ u8 c;
+ if ((level >= 0) && (level <= 100)) {
+ c = (125 * (100 - level)) / 100 + 2;
+ twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, c, TWL_PWMA_PWMAOFF);
+ bklight_level = level;
+ }
+ return 0;
+}
+
+static unsigned int omap3evm_bklight_getlevel(struct lcd_panel *panel)
+{
+ return bklight_level;
+}
+
+static unsigned int omap3evm_bklight_getmaxlevel(struct lcd_panel *panel)
+{
+ return 100;
+}
+
+struct lcd_panel omap3evm_panel = {
+ .name = "omap3evm",
+ .config = OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+ OMAP_LCDC_INV_HSYNC,
+
+ .bpp = 16,
+ .data_lines = 18,
+ .x_res = 480,
+ .y_res = 640,
+ .hsw = 3, /* hsync_len (4) - 1 */
+ .hfp = 3, /* right_margin (4) - 1 */
+ .hbp = 39, /* left_margin (40) - 1 */
+ .vsw = 1, /* vsync_len (2) - 1 */
+ .vfp = 2, /* lower_margin */
+ .vbp = 7, /* upper_margin (8) - 1 */
+
+ .pixel_clock = 26000,
+
+ .init = omap3evm_panel_init,
+ .cleanup = omap3evm_panel_cleanup,
+ .enable = omap3evm_panel_enable,
+ .disable = omap3evm_panel_disable,
+ .get_caps = omap3evm_panel_get_caps,
+ .set_bklight_level = omap3evm_bklight_setlevel,
+ .get_bklight_level = omap3evm_bklight_getlevel,
+ .get_bklight_max = omap3evm_bklight_getmaxlevel,
+};
+
+static int omap3evm_panel_probe(struct platform_device *pdev)
+{
+ omapfb_register_panel(&omap3evm_panel);
+ return 0;
+}
+
+static int omap3evm_panel_remove(struct platform_device *pdev)
+{
+ return 0;
+}
+
+static int omap3evm_panel_suspend(struct platform_device *pdev,
+ pm_message_t mesg)
+{
+ return 0;
+}
+
+static int omap3evm_panel_resume(struct platform_device *pdev)
+{
+ return 0;
+}
+
+struct platform_driver omap3evm_panel_driver = {
+ .probe = omap3evm_panel_probe,
+ .remove = omap3evm_panel_remove,
+ .suspend = omap3evm_panel_suspend,
+ .resume = omap3evm_panel_resume,
+ .driver = {
+ .name = "omap3evm_lcd",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init omap3evm_panel_drv_init(void)
+{
+ return platform_driver_register(&omap3evm_panel_driver);
+}
+
+static void __exit omap3evm_panel_drv_exit(void)
+{
+ platform_driver_unregister(&omap3evm_panel_driver);
+}
+
+module_init(omap3evm_panel_drv_init);
+module_exit(omap3evm_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_overo.c b/drivers/video/omap/lcd_overo.c
new file mode 100644
index 0000000..2bc5c92
--- /dev/null
+++ b/drivers/video/omap/lcd_overo.c
@@ -0,0 +1,179 @@
+/*
+ * LCD panel support for the Gumstix Overo
+ *
+ * Author: Steve Sakoman <steve@sakoman.com>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/gpio.h>
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_ENABLE 144
+
+static int overo_panel_init(struct lcd_panel *panel,
+ struct omapfb_device *fbdev)
+{
+ if ((gpio_request(LCD_ENABLE, "LCD_ENABLE") == 0) &&
+ (gpio_direction_output(LCD_ENABLE, 1) == 0))
+ gpio_export(LCD_ENABLE, 0);
+ else
+ printk(KERN_ERR "could not obtain gpio for LCD_ENABLE\n");
+
+ return 0;
+}
+
+static void overo_panel_cleanup(struct lcd_panel *panel)
+{
+ gpio_free(LCD_ENABLE);
+}
+
+static int overo_panel_enable(struct lcd_panel *panel)
+{
+ gpio_set_value(LCD_ENABLE, 1);
+ return 0;
+}
+
+static void overo_panel_disable(struct lcd_panel *panel)
+{
+ gpio_set_value(LCD_ENABLE, 0);
+}
+
+static unsigned long overo_panel_get_caps(struct lcd_panel *panel)
+{
+ return 0;
+}
+
+struct lcd_panel overo_panel = {
+ .name = "overo",
+ .config = OMAP_LCDC_PANEL_TFT,
+ .bpp = 16,
+ .data_lines = 24,
+
+#if defined CONFIG_FB_OMAP_031M3R
+
+ /* 640 x 480 @ 60 Hz Reduced blanking VESA CVT 0.31M3-R */
+ .x_res = 640,
+ .y_res = 480,
+ .hfp = 48,
+ .hsw = 32,
+ .hbp = 80,
+ .vfp = 3,
+ .vsw = 4,
+ .vbp = 7,
+ .pixel_clock = 23500,
+
+#elif defined CONFIG_FB_OMAP_048M3R
+
+ /* 800 x 600 @ 60 Hz Reduced blanking VESA CVT 0.48M3-R */
+ .x_res = 800,
+ .y_res = 600,
+ .hfp = 48,
+ .hsw = 32,
+ .hbp = 80,
+ .vfp = 3,
+ .vsw = 4,
+ .vbp = 11,
+ .pixel_clock = 35500,
+
+#elif defined CONFIG_FB_OMAP_079M3R
+
+ /* 1024 x 768 @ 60 Hz Reduced blanking VESA CVT 0.79M3-R */
+ .x_res = 1024,
+ .y_res = 768,
+ .hfp = 48,
+ .hsw = 32,
+ .hbp = 80,
+ .vfp = 3,
+ .vsw = 4,
+ .vbp = 15,
+ .pixel_clock = 56000,
+
+#elif defined CONFIG_FB_OMAP_092M9R
+
+ /* 1280 x 720 @ 60 Hz Reduced blanking VESA CVT 0.92M9-R */
+ .x_res = 1280,
+ .y_res = 720,
+ .hfp = 48,
+ .hsw = 32,
+ .hbp = 80,
+ .vfp = 3,
+ .vsw = 5,
+ .vbp = 13,
+ .pixel_clock = 64000,
+
+#else
+
+ /* use 640 x 480 if no config option */
+ /* 640 x 480 @ 60 Hz Reduced blanking VESA CVT 0.31M3-R */
+ .x_res = 640,
+ .y_res = 480,
+ .hfp = 48,
+ .hsw = 32,
+ .hbp = 80,
+ .vfp = 3,
+ .vsw = 4,
+ .vbp = 7,
+ .pixel_clock = 23500,
+
+#endif
+
+ .init = overo_panel_init,
+ .cleanup = overo_panel_cleanup,
+ .enable = overo_panel_enable,
+ .disable = overo_panel_disable,
+ .get_caps = overo_panel_get_caps,
+};
+
+static int overo_panel_probe(struct platform_device *pdev)
+{
+ omapfb_register_panel(&overo_panel);
+ return 0;
+}
+
+static int overo_panel_remove(struct platform_device *pdev)
+{
+ /* omapfb does not have unregister_panel */
+ return 0;
+}
+
+static struct platform_driver overo_panel_driver = {
+ .probe = overo_panel_probe,
+ .remove = overo_panel_remove,
+ .driver = {
+ .name = "overo_lcd",
+ .owner = THIS_MODULE,
+ },
+};
+
+static int __init overo_panel_drv_init(void)
+{
+ return platform_driver_register(&overo_panel_driver);
+}
+
+static void __exit overo_panel_drv_exit(void)
+{
+ platform_driver_unregister(&overo_panel_driver);
+}
+
+module_init(overo_panel_drv_init);
+module_exit(overo_panel_drv_exit);
diff --git a/drivers/video/omap/omapfb_main.c b/drivers/video/omap/omapfb_main.c
index 8862233..125e605 100644
--- a/drivers/video/omap/omapfb_main.c
+++ b/drivers/video/omap/omapfb_main.c
@@ -67,6 +67,7 @@
{ OMAPFB_CAPS_WINDOW_PIXEL_DOUBLE, "pixel double window" },
{ OMAPFB_CAPS_WINDOW_SCALE, "scale window" },
{ OMAPFB_CAPS_WINDOW_OVERLAY, "overlay window" },
+ { OMAPFB_CAPS_WINDOW_ROTATE, "rotate window" },
{ OMAPFB_CAPS_SET_BACKLIGHT, "backlight setting" },
};
@@ -215,6 +216,15 @@
offset, var->xres_virtual,
plane->info.pos_x, plane->info.pos_y,
var->xres, var->yres, plane->color_mode);
+ if (r < 0)
+ return r;
+
+ if (fbdev->ctrl->set_rotate != NULL) {
+ r = fbdev->ctrl->set_rotate(var->rotate);
+ if (r < 0)
+ return r;
+ }
+
if (fbdev->ctrl->set_scale != NULL)
r = fbdev->ctrl->set_scale(plane->idx,
var->xres, var->yres,
@@ -554,7 +564,6 @@
var->xoffset = var->xres_virtual - var->xres;
if (var->yres + var->yoffset > var->yres_virtual)
var->yoffset = var->yres_virtual - var->yres;
- line_size = var->xres * bpp / 8;
if (plane->color_mode == OMAPFB_COLOR_RGB444) {
var->red.offset = 8; var->red.length = 4;
@@ -600,7 +609,7 @@
struct omapfb_device *fbdev = plane->fbdev;
omapfb_rqueue_lock(fbdev);
- if (cpu_is_omap15xx() && rotate != fbi->var.rotate) {
+ if (rotate != fbi->var.rotate) {
struct fb_var_screeninfo *new_var = &fbdev->new_var;
memcpy(new_var, &fbi->var, sizeof(*new_var));
@@ -707,28 +716,42 @@
void (*callback)(void *),
void *callback_data)
{
+ int xres, yres;
struct omapfb_plane_struct *plane = fbi->par;
struct omapfb_device *fbdev = plane->fbdev;
- struct fb_var_screeninfo *var;
+ struct fb_var_screeninfo *var = &fbi->var;
- var = &fbi->var;
- if (win->x >= var->xres || win->y >= var->yres ||
- win->out_x > var->xres || win->out_y >= var->yres)
+ switch (var->rotate) {
+ case 0:
+ case 180:
+ xres = fbdev->panel->x_res;
+ yres = fbdev->panel->y_res;
+ break;
+ case 90:
+ case 270:
+ xres = fbdev->panel->y_res;
+ yres = fbdev->panel->x_res;
+ break;
+ default:
+ return -EINVAL;
+ }
+
+ if (win->x >= xres || win->y >= yres ||
+ win->out_x > xres || win->out_y > yres)
return -EINVAL;
if (!fbdev->ctrl->update_window ||
fbdev->ctrl->get_update_mode() != OMAPFB_MANUAL_UPDATE)
return -ENODEV;
- if (win->x + win->width >= var->xres)
- win->width = var->xres - win->x;
- if (win->y + win->height >= var->yres)
- win->height = var->yres - win->y;
- /* The out sizes should be cropped to the LCD size */
- if (win->out_x + win->out_width > fbdev->panel->x_res)
- win->out_width = fbdev->panel->x_res - win->out_x;
- if (win->out_y + win->out_height > fbdev->panel->y_res)
- win->out_height = fbdev->panel->y_res - win->out_y;
+ if (win->x + win->width > xres)
+ win->width = xres - win->x;
+ if (win->y + win->height > yres)
+ win->height = yres - win->y;
+ if (win->out_x + win->out_width > xres)
+ win->out_width = xres - win->out_x;
+ if (win->out_y + win->out_height > yres)
+ win->out_height = yres - win->out_y;
if (!win->width || !win->height || !win->out_width || !win->out_height)
return 0;
@@ -1699,8 +1722,8 @@
pr_info("omapfb: configured for panel %s\n", fbdev->panel->name);
- def_vxres = def_vxres ? : fbdev->panel->x_res;
- def_vyres = def_vyres ? : fbdev->panel->y_res;
+ def_vxres = def_vxres ? def_vxres : fbdev->panel->x_res;
+ def_vyres = def_vyres ? def_vyres : fbdev->panel->y_res;
init_state++;
@@ -1822,8 +1845,8 @@
{
struct omapfb_device *fbdev = platform_get_drvdata(pdev);
- omapfb_blank(FB_BLANK_POWERDOWN, fbdev->fb_info[0]);
-
+ if (fbdev != NULL)
+ omapfb_blank(FB_BLANK_POWERDOWN, fbdev->fb_info[0]);
return 0;
}
@@ -1832,7 +1855,8 @@
{
struct omapfb_device *fbdev = platform_get_drvdata(pdev);
- omapfb_blank(FB_BLANK_UNBLANK, fbdev->fb_info[0]);
+ if (fbdev != NULL)
+ omapfb_blank(FB_BLANK_UNBLANK, fbdev->fb_info[0]);
return 0;
}
diff --git a/drivers/video/omap/rfbi.c b/drivers/video/omap/rfbi.c
index 9332d6c..ee01e84 100644
--- a/drivers/video/omap/rfbi.c
+++ b/drivers/video/omap/rfbi.c
@@ -57,6 +57,7 @@
#define DISPC_BASE 0x48050400
#define DISPC_CONTROL 0x0040
+#define DISPC_IRQ_FRAMEMASK 0x0001
static struct {
void __iomem *base;
@@ -553,7 +554,9 @@
l = (0x01 << 2);
rfbi_write_reg(RFBI_CONTROL, l);
- if ((r = omap_dispc_request_irq(rfbi_dma_callback, NULL)) < 0) {
+ r = omap_dispc_request_irq(DISPC_IRQ_FRAMEMASK, rfbi_dma_callback,
+ NULL);
+ if (r < 0) {
dev_err(fbdev->dev, "can't get DISPC irq\n");
rfbi_enable_clocks(0);
return r;
@@ -570,7 +573,7 @@
static void rfbi_cleanup(void)
{
- omap_dispc_free_irq();
+ omap_dispc_free_irq(DISPC_IRQ_FRAMEMASK, rfbi_dma_callback, NULL);
rfbi_put_clocks();
iounmap(rfbi.base);
}
diff --git a/drivers/video/platinumfb.c b/drivers/video/platinumfb.c
index bacfabd..0a366d8 100644
--- a/drivers/video/platinumfb.c
+++ b/drivers/video/platinumfb.c
@@ -223,10 +223,14 @@
static inline int platinum_vram_reqd(int video_mode, int color_mode)
{
- return vmode_attrs[video_mode-1].vres *
- (vmode_attrs[video_mode-1].hres * (1<<color_mode) +
- ((video_mode == VMODE_832_624_75) &&
- (color_mode > CMODE_8)) ? 0x10 : 0x20) + 0x1000;
+ int baseval = vmode_attrs[video_mode-1].hres * (1<<color_mode);
+
+ if ((video_mode == VMODE_832_624_75) && (color_mode > CMODE_8))
+ baseval += 0x10;
+ else
+ baseval += 0x20;
+
+ return vmode_attrs[video_mode-1].vres * baseval + 0x1000;
}
#define STORE_D2(a, d) { \
diff --git a/drivers/video/s3c-fb.c b/drivers/video/s3c-fb.c
index 5a72083..adf9632 100644
--- a/drivers/video/s3c-fb.c
+++ b/drivers/video/s3c-fb.c
@@ -1036,7 +1036,7 @@
static struct platform_driver s3c_fb_driver = {
.probe = s3c_fb_probe,
- .remove = s3c_fb_remove,
+ .remove = __devexit_p(s3c_fb_remove),
.suspend = s3c_fb_suspend,
.resume = s3c_fb_resume,
.driver = {
diff --git a/drivers/video/s3c2410fb.c b/drivers/video/s3c2410fb.c
index 5ffca2a..aac6612 100644
--- a/drivers/video/s3c2410fb.c
+++ b/drivers/video/s3c2410fb.c
@@ -369,7 +369,9 @@
void __iomem *regs = fbi->io;
int type = fbi->regs.lcdcon1 & S3C2410_LCDCON1_TFT;
struct fb_var_screeninfo *var = &info->var;
- int clkdiv = s3c2410fb_calc_pixclk(fbi, var->pixclock) / 2;
+ int clkdiv;
+
+ clkdiv = DIV_ROUND_UP(s3c2410fb_calc_pixclk(fbi, var->pixclock), 2);
dprintk("%s: var->xres = %d\n", __func__, var->xres);
dprintk("%s: var->yres = %d\n", __func__, var->yres);
diff --git a/drivers/video/sis/sis_main.c b/drivers/video/sis/sis_main.c
index 4a067f0..a4e05e4 100644
--- a/drivers/video/sis/sis_main.c
+++ b/drivers/video/sis/sis_main.c
@@ -698,8 +698,8 @@
rate, sisfb_vrate[i].refresh);
ivideo->rate_idx = sisfb_vrate[i].idx;
ivideo->refresh_rate = sisfb_vrate[i].refresh;
- } else if(((rate - sisfb_vrate[i-1].refresh) <= 2)
- && (sisfb_vrate[i].idx != 1)) {
+ } else if((sisfb_vrate[i].idx != 1) &&
+ ((rate - sisfb_vrate[i-1].refresh) <= 2)) {
DPRINTK("sisfb: Adjusting rate from %d down to %d\n",
rate, sisfb_vrate[i-1].refresh);
ivideo->rate_idx = sisfb_vrate[i-1].idx;
diff --git a/drivers/video/sis/vstruct.h b/drivers/video/sis/vstruct.h
index 705c853..bef4aae 100644
--- a/drivers/video/sis/vstruct.h
+++ b/drivers/video/sis/vstruct.h
@@ -342,7 +342,7 @@
unsigned short SiS_RY4COE;
unsigned short SiS_LCDHDES;
unsigned short SiS_LCDVDES;
- unsigned short SiS_DDC_Port;
+ SISIOADDRESS SiS_DDC_Port;
unsigned short SiS_DDC_Index;
unsigned short SiS_DDC_Data;
unsigned short SiS_DDC_NData;
diff --git a/drivers/video/tmiofb.c b/drivers/video/tmiofb.c
index a1eb086..6913fe1 100644
--- a/drivers/video/tmiofb.c
+++ b/drivers/video/tmiofb.c
@@ -974,7 +974,7 @@
{
struct fb_info *info = platform_get_drvdata(dev);
struct mfd_cell *cell = dev->dev.platform_data;
- int retval;
+ int retval = 0;
acquire_console_sem();
diff --git a/drivers/video/via/accel.c b/drivers/video/via/accel.c
index 45c54bf..9d4f3a4 100644
--- a/drivers/video/via/accel.c
+++ b/drivers/video/via/accel.c
@@ -20,229 +20,430 @@
*/
#include "global.h"
-void viafb_init_accel(void)
+static int hw_bitblt_1(void __iomem *engine, u8 op, u32 width, u32 height,
+ u8 dst_bpp, u32 dst_addr, u32 dst_pitch, u32 dst_x, u32 dst_y,
+ u32 *src_mem, u32 src_addr, u32 src_pitch, u32 src_x, u32 src_y,
+ u32 fg_color, u32 bg_color, u8 fill_rop)
{
- viaparinfo->fbmem_free -= CURSOR_SIZE;
- viaparinfo->cursor_start = viaparinfo->fbmem_free;
- viaparinfo->fbmem_used += CURSOR_SIZE;
+ u32 ge_cmd = 0, tmp, i;
- /* Reverse 8*1024 memory space for cursor image */
- viaparinfo->fbmem_free -= (CURSOR_SIZE + VQ_SIZE);
- viaparinfo->VQ_start = viaparinfo->fbmem_free;
- viaparinfo->VQ_end = viaparinfo->VQ_start + VQ_SIZE - 1;
- viaparinfo->fbmem_used += (CURSOR_SIZE + VQ_SIZE); }
-
-void viafb_init_2d_engine(void)
-{
- u32 dwVQStartAddr, dwVQEndAddr;
- u32 dwVQLen, dwVQStartL, dwVQEndL, dwVQStartEndH;
-
- /* init 2D engine regs to reset 2D engine */
- writel(0x0, viaparinfo->io_virt + VIA_REG_GEMODE);
- writel(0x0, viaparinfo->io_virt + VIA_REG_SRCPOS);
- writel(0x0, viaparinfo->io_virt + VIA_REG_DSTPOS);
- writel(0x0, viaparinfo->io_virt + VIA_REG_DIMENSION);
- writel(0x0, viaparinfo->io_virt + VIA_REG_PATADDR);
- writel(0x0, viaparinfo->io_virt + VIA_REG_FGCOLOR);
- writel(0x0, viaparinfo->io_virt + VIA_REG_BGCOLOR);
- writel(0x0, viaparinfo->io_virt + VIA_REG_CLIPTL);
- writel(0x0, viaparinfo->io_virt + VIA_REG_CLIPBR);
- writel(0x0, viaparinfo->io_virt + VIA_REG_OFFSET);
- writel(0x0, viaparinfo->io_virt + VIA_REG_KEYCONTROL);
- writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
- writel(0x0, viaparinfo->io_virt + VIA_REG_DSTBASE);
- writel(0x0, viaparinfo->io_virt + VIA_REG_PITCH);
- writel(0x0, viaparinfo->io_virt + VIA_REG_MONOPAT1);
-
- /* Init AGP and VQ regs */
- switch (viaparinfo->chip_info->gfx_chip_name) {
- case UNICHROME_K8M890:
- case UNICHROME_P4M900:
- writel(0x00100000, viaparinfo->io_virt + VIA_REG_CR_TRANSET);
- writel(0x680A0000, viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
- writel(0x02000000, viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
- break;
-
- default:
- writel(0x00100000, viaparinfo->io_virt + VIA_REG_TRANSET);
- writel(0x00000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x00333004, viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x60000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x61000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x62000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x63000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x64000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x7D000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-
- writel(0xFE020000, viaparinfo->io_virt + VIA_REG_TRANSET);
- writel(0x00000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
- break;
+ if (!op || op > 3) {
+ printk(KERN_WARNING "hw_bitblt_1: Invalid operation: %d\n", op);
+ return -EINVAL;
}
- if (viaparinfo->VQ_start != 0) {
- /* Enable VQ */
- dwVQStartAddr = viaparinfo->VQ_start;
- dwVQEndAddr = viaparinfo->VQ_end;
- dwVQStartL = 0x50000000 | (dwVQStartAddr & 0xFFFFFF);
- dwVQEndL = 0x51000000 | (dwVQEndAddr & 0xFFFFFF);
- dwVQStartEndH = 0x52000000 |
- ((dwVQStartAddr & 0xFF000000) >> 24) |
- ((dwVQEndAddr & 0xFF000000) >> 16);
- dwVQLen = 0x53000000 | (VQ_SIZE >> 3);
- switch (viaparinfo->chip_info->gfx_chip_name) {
- case UNICHROME_K8M890:
- case UNICHROME_P4M900:
- dwVQStartL |= 0x20000000;
- dwVQEndL |= 0x20000000;
- dwVQStartEndH |= 0x20000000;
- dwVQLen |= 0x20000000;
- break;
- default:
- break;
+ if (op != VIA_BITBLT_FILL && !src_mem && src_addr == dst_addr) {
+ if (src_x < dst_x) {
+ ge_cmd |= 0x00008000;
+ src_x += width - 1;
+ dst_x += width - 1;
}
-
- switch (viaparinfo->chip_info->gfx_chip_name) {
- case UNICHROME_K8M890:
- case UNICHROME_P4M900:
- writel(0x00100000,
- viaparinfo->io_virt + VIA_REG_CR_TRANSET);
- writel(dwVQStartEndH,
- viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
- writel(dwVQStartL,
- viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
- writel(dwVQEndL,
- viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
- writel(dwVQLen,
- viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
- writel(0x74301001,
- viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
- writel(0x00000000,
- viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
- break;
- default:
- writel(0x00FE0000,
- viaparinfo->io_virt + VIA_REG_TRANSET);
- writel(0x080003FE,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x0A00027C,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x0B000260,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x0C000274,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x0D000264,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x0E000000,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x0F000020,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x1000027E,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x110002FE,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x200F0060,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
-
- writel(0x00000006,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x40008C0F,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x44000000,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x45080C04,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x46800408,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
-
- writel(dwVQStartEndH,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(dwVQStartL,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(dwVQEndL,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(dwVQLen,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- break;
- }
- } else {
- /* Disable VQ */
- switch (viaparinfo->chip_info->gfx_chip_name) {
- case UNICHROME_K8M890:
- case UNICHROME_P4M900:
- writel(0x00100000,
- viaparinfo->io_virt + VIA_REG_CR_TRANSET);
- writel(0x74301000,
- viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
- break;
- default:
- writel(0x00FE0000,
- viaparinfo->io_virt + VIA_REG_TRANSET);
- writel(0x00000004,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x40008C0F,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x44000000,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x45080C04,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- writel(0x46800408,
- viaparinfo->io_virt + VIA_REG_TRANSPACE);
- break;
+ if (src_y < dst_y) {
+ ge_cmd |= 0x00004000;
+ src_y += height - 1;
+ dst_y += height - 1;
}
}
- viafb_set_2d_color_depth(viaparinfo->bpp);
+ if (op == VIA_BITBLT_FILL) {
+ switch (fill_rop) {
+ case 0x00: /* blackness */
+ case 0x5A: /* pattern inversion */
+ case 0xF0: /* pattern copy */
+ case 0xFF: /* whiteness */
+ break;
+ default:
+ printk(KERN_WARNING "hw_bitblt_1: Invalid fill rop: "
+ "%u\n", fill_rop);
+ return -EINVAL;
+ }
+ }
- writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
- writel(0x0, viaparinfo->io_virt + VIA_REG_DSTBASE);
-
- writel(VIA_PITCH_ENABLE |
- (((viaparinfo->hres *
- viaparinfo->bpp >> 3) >> 3) | (((viaparinfo->hres *
- viaparinfo->
- bpp >> 3) >> 3) << 16)),
- viaparinfo->io_virt + VIA_REG_PITCH);
-}
-
-void viafb_set_2d_color_depth(int bpp)
-{
- u32 dwGEMode;
-
- dwGEMode = readl(viaparinfo->io_virt + 0x04) & 0xFFFFFCFF;
-
- switch (bpp) {
+ switch (dst_bpp) {
+ case 8:
+ tmp = 0x00000000;
+ break;
case 16:
- dwGEMode |= VIA_GEM_16bpp;
+ tmp = 0x00000100;
break;
case 32:
- dwGEMode |= VIA_GEM_32bpp;
+ tmp = 0x00000300;
break;
default:
- dwGEMode |= VIA_GEM_8bpp;
+ printk(KERN_WARNING "hw_bitblt_1: Unsupported bpp %d\n",
+ dst_bpp);
+ return -EINVAL;
+ }
+ writel(tmp, engine + 0x04);
+
+ if (op != VIA_BITBLT_FILL) {
+ if (src_x & (op == VIA_BITBLT_MONO ? 0xFFFF8000 : 0xFFFFF000)
+ || src_y & 0xFFFFF000) {
+ printk(KERN_WARNING "hw_bitblt_1: Unsupported source "
+ "x/y %d %d\n", src_x, src_y);
+ return -EINVAL;
+ }
+ tmp = src_x | (src_y << 16);
+ writel(tmp, engine + 0x08);
+ }
+
+ if (dst_x & 0xFFFFF000 || dst_y & 0xFFFFF000) {
+ printk(KERN_WARNING "hw_bitblt_1: Unsupported destination x/y "
+ "%d %d\n", dst_x, dst_y);
+ return -EINVAL;
+ }
+ tmp = dst_x | (dst_y << 16);
+ writel(tmp, engine + 0x0C);
+
+ if ((width - 1) & 0xFFFFF000 || (height - 1) & 0xFFFFF000) {
+ printk(KERN_WARNING "hw_bitblt_1: Unsupported width/height "
+ "%d %d\n", width, height);
+ return -EINVAL;
+ }
+ tmp = (width - 1) | ((height - 1) << 16);
+ writel(tmp, engine + 0x10);
+
+ if (op != VIA_BITBLT_COLOR)
+ writel(fg_color, engine + 0x18);
+
+ if (op == VIA_BITBLT_MONO)
+ writel(bg_color, engine + 0x1C);
+
+ if (op != VIA_BITBLT_FILL) {
+ tmp = src_mem ? 0 : src_addr;
+ if (dst_addr & 0xE0000007) {
+ printk(KERN_WARNING "hw_bitblt_1: Unsupported source "
+ "address %X\n", tmp);
+ return -EINVAL;
+ }
+ tmp >>= 3;
+ writel(tmp, engine + 0x30);
+ }
+
+ if (dst_addr & 0xE0000007) {
+ printk(KERN_WARNING "hw_bitblt_1: Unsupported destination "
+ "address %X\n", dst_addr);
+ return -EINVAL;
+ }
+ tmp = dst_addr >> 3;
+ writel(tmp, engine + 0x34);
+
+ if (op == VIA_BITBLT_FILL)
+ tmp = 0;
+ else
+ tmp = src_pitch;
+ if (tmp & 0xFFFFC007 || dst_pitch & 0xFFFFC007) {
+ printk(KERN_WARNING "hw_bitblt_1: Unsupported pitch %X %X\n",
+ tmp, dst_pitch);
+ return -EINVAL;
+ }
+ tmp = (tmp >> 3) | (dst_pitch << (16 - 3));
+ writel(tmp, engine + 0x38);
+
+ if (op == VIA_BITBLT_FILL)
+ ge_cmd |= fill_rop << 24 | 0x00002000 | 0x00000001;
+ else {
+ ge_cmd |= 0xCC000000; /* ROP=SRCCOPY */
+ if (src_mem)
+ ge_cmd |= 0x00000040;
+ if (op == VIA_BITBLT_MONO)
+ ge_cmd |= 0x00000002 | 0x00000100 | 0x00020000;
+ else
+ ge_cmd |= 0x00000001;
+ }
+ writel(ge_cmd, engine);
+
+ if (op == VIA_BITBLT_FILL || !src_mem)
+ return 0;
+
+ tmp = (width * height * (op == VIA_BITBLT_MONO ? 1 : (dst_bpp >> 3)) +
+ 3) >> 2;
+
+ for (i = 0; i < tmp; i++)
+ writel(src_mem[i], engine + VIA_MMIO_BLTBASE);
+
+ return 0;
+}
+
+static int hw_bitblt_2(void __iomem *engine, u8 op, u32 width, u32 height,
+ u8 dst_bpp, u32 dst_addr, u32 dst_pitch, u32 dst_x, u32 dst_y,
+ u32 *src_mem, u32 src_addr, u32 src_pitch, u32 src_x, u32 src_y,
+ u32 fg_color, u32 bg_color, u8 fill_rop)
+{
+ u32 ge_cmd = 0, tmp, i;
+
+ if (!op || op > 3) {
+ printk(KERN_WARNING "hw_bitblt_2: Invalid operation: %d\n", op);
+ return -EINVAL;
+ }
+
+ if (op != VIA_BITBLT_FILL && !src_mem && src_addr == dst_addr) {
+ if (src_x < dst_x) {
+ ge_cmd |= 0x00008000;
+ src_x += width - 1;
+ dst_x += width - 1;
+ }
+ if (src_y < dst_y) {
+ ge_cmd |= 0x00004000;
+ src_y += height - 1;
+ dst_y += height - 1;
+ }
+ }
+
+ if (op == VIA_BITBLT_FILL) {
+ switch (fill_rop) {
+ case 0x00: /* blackness */
+ case 0x5A: /* pattern inversion */
+ case 0xF0: /* pattern copy */
+ case 0xFF: /* whiteness */
+ break;
+ default:
+ printk(KERN_WARNING "hw_bitblt_2: Invalid fill rop: "
+ "%u\n", fill_rop);
+ return -EINVAL;
+ }
+ }
+
+ switch (dst_bpp) {
+ case 8:
+ tmp = 0x00000000;
+ break;
+ case 16:
+ tmp = 0x00000100;
+ break;
+ case 32:
+ tmp = 0x00000300;
+ break;
+ default:
+ printk(KERN_WARNING "hw_bitblt_2: Unsupported bpp %d\n",
+ dst_bpp);
+ return -EINVAL;
+ }
+ writel(tmp, engine + 0x04);
+
+ if (op == VIA_BITBLT_FILL)
+ tmp = 0;
+ else
+ tmp = src_pitch;
+ if (tmp & 0xFFFFC007 || dst_pitch & 0xFFFFC007) {
+ printk(KERN_WARNING "hw_bitblt_2: Unsupported pitch %X %X\n",
+ tmp, dst_pitch);
+ return -EINVAL;
+ }
+ tmp = (tmp >> 3) | (dst_pitch << (16 - 3));
+ writel(tmp, engine + 0x08);
+
+ if ((width - 1) & 0xFFFFF000 || (height - 1) & 0xFFFFF000) {
+ printk(KERN_WARNING "hw_bitblt_2: Unsupported width/height "
+ "%d %d\n", width, height);
+ return -EINVAL;
+ }
+ tmp = (width - 1) | ((height - 1) << 16);
+ writel(tmp, engine + 0x0C);
+
+ if (dst_x & 0xFFFFF000 || dst_y & 0xFFFFF000) {
+ printk(KERN_WARNING "hw_bitblt_2: Unsupported destination x/y "
+ "%d %d\n", dst_x, dst_y);
+ return -EINVAL;
+ }
+ tmp = dst_x | (dst_y << 16);
+ writel(tmp, engine + 0x10);
+
+ if (dst_addr & 0xE0000007) {
+ printk(KERN_WARNING "hw_bitblt_2: Unsupported destination "
+ "address %X\n", dst_addr);
+ return -EINVAL;
+ }
+ tmp = dst_addr >> 3;
+ writel(tmp, engine + 0x14);
+
+ if (op != VIA_BITBLT_FILL) {
+ if (src_x & (op == VIA_BITBLT_MONO ? 0xFFFF8000 : 0xFFFFF000)
+ || src_y & 0xFFFFF000) {
+ printk(KERN_WARNING "hw_bitblt_2: Unsupported source "
+ "x/y %d %d\n", src_x, src_y);
+ return -EINVAL;
+ }
+ tmp = src_x | (src_y << 16);
+ writel(tmp, engine + 0x18);
+
+ tmp = src_mem ? 0 : src_addr;
+ if (dst_addr & 0xE0000007) {
+ printk(KERN_WARNING "hw_bitblt_2: Unsupported source "
+ "address %X\n", tmp);
+ return -EINVAL;
+ }
+ tmp >>= 3;
+ writel(tmp, engine + 0x1C);
+ }
+
+ if (op != VIA_BITBLT_COLOR)
+ writel(fg_color, engine + 0x4C);
+
+ if (op == VIA_BITBLT_MONO)
+ writel(bg_color, engine + 0x50);
+
+ if (op == VIA_BITBLT_FILL)
+ ge_cmd |= fill_rop << 24 | 0x00002000 | 0x00000001;
+ else {
+ ge_cmd |= 0xCC000000; /* ROP=SRCCOPY */
+ if (src_mem)
+ ge_cmd |= 0x00000040;
+ if (op == VIA_BITBLT_MONO)
+ ge_cmd |= 0x00000002 | 0x00000100 | 0x00020000;
+ else
+ ge_cmd |= 0x00000001;
+ }
+ writel(ge_cmd, engine);
+
+ if (op == VIA_BITBLT_FILL || !src_mem)
+ return 0;
+
+ tmp = (width * height * (op == VIA_BITBLT_MONO ? 1 : (dst_bpp >> 3)) +
+ 3) >> 2;
+
+ for (i = 0; i < tmp; i++)
+ writel(src_mem[i], engine + VIA_MMIO_BLTBASE);
+
+ return 0;
+}
+
+int viafb_init_engine(struct fb_info *info)
+{
+ struct viafb_par *viapar = info->par;
+ void __iomem *engine;
+ u32 vq_start_addr, vq_end_addr, vq_start_low, vq_end_low, vq_high,
+ vq_len, chip_name = viapar->shared->chip_info.gfx_chip_name;
+
+ engine = ioremap_nocache(info->fix.mmio_start, info->fix.mmio_len);
+ viapar->shared->engine_mmio = engine;
+ if (!engine) {
+ printk(KERN_WARNING "viafb_init_accel: ioremap failed, "
+ "hardware acceleration disabled\n");
+ return -ENOMEM;
+ }
+
+ switch (chip_name) {
+ case UNICHROME_CLE266:
+ case UNICHROME_K400:
+ case UNICHROME_K800:
+ case UNICHROME_PM800:
+ case UNICHROME_CN700:
+ case UNICHROME_CX700:
+ case UNICHROME_CN750:
+ case UNICHROME_K8M890:
+ case UNICHROME_P4M890:
+ case UNICHROME_P4M900:
+ viapar->shared->hw_bitblt = hw_bitblt_1;
+ break;
+ case UNICHROME_VX800:
+ case UNICHROME_VX855:
+ viapar->shared->hw_bitblt = hw_bitblt_2;
+ break;
+ default:
+ viapar->shared->hw_bitblt = NULL;
+ }
+
+ viapar->fbmem_free -= CURSOR_SIZE;
+ viapar->shared->cursor_vram_addr = viapar->fbmem_free;
+ viapar->fbmem_used += CURSOR_SIZE;
+
+ viapar->fbmem_free -= VQ_SIZE;
+ viapar->shared->vq_vram_addr = viapar->fbmem_free;
+ viapar->fbmem_used += VQ_SIZE;
+
+ /* Init AGP and VQ regs */
+ switch (chip_name) {
+ case UNICHROME_K8M890:
+ case UNICHROME_P4M900:
+ writel(0x00100000, engine + VIA_REG_CR_TRANSET);
+ writel(0x680A0000, engine + VIA_REG_CR_TRANSPACE);
+ writel(0x02000000, engine + VIA_REG_CR_TRANSPACE);
+ break;
+
+ default:
+ writel(0x00100000, engine + VIA_REG_TRANSET);
+ writel(0x00000000, engine + VIA_REG_TRANSPACE);
+ writel(0x00333004, engine + VIA_REG_TRANSPACE);
+ writel(0x60000000, engine + VIA_REG_TRANSPACE);
+ writel(0x61000000, engine + VIA_REG_TRANSPACE);
+ writel(0x62000000, engine + VIA_REG_TRANSPACE);
+ writel(0x63000000, engine + VIA_REG_TRANSPACE);
+ writel(0x64000000, engine + VIA_REG_TRANSPACE);
+ writel(0x7D000000, engine + VIA_REG_TRANSPACE);
+
+ writel(0xFE020000, engine + VIA_REG_TRANSET);
+ writel(0x00000000, engine + VIA_REG_TRANSPACE);
break;
}
- /* Set BPP and Pitch */
- writel(dwGEMode, viaparinfo->io_virt + VIA_REG_GEMODE);
-}
+ /* Enable VQ */
+ vq_start_addr = viapar->shared->vq_vram_addr;
+ vq_end_addr = viapar->shared->vq_vram_addr + VQ_SIZE - 1;
-void viafb_hw_cursor_init(void)
-{
+ vq_start_low = 0x50000000 | (vq_start_addr & 0xFFFFFF);
+ vq_end_low = 0x51000000 | (vq_end_addr & 0xFFFFFF);
+ vq_high = 0x52000000 | ((vq_start_addr & 0xFF000000) >> 24) |
+ ((vq_end_addr & 0xFF000000) >> 16);
+ vq_len = 0x53000000 | (VQ_SIZE >> 3);
+
+ switch (chip_name) {
+ case UNICHROME_K8M890:
+ case UNICHROME_P4M900:
+ vq_start_low |= 0x20000000;
+ vq_end_low |= 0x20000000;
+ vq_high |= 0x20000000;
+ vq_len |= 0x20000000;
+
+ writel(0x00100000, engine + VIA_REG_CR_TRANSET);
+ writel(vq_high, engine + VIA_REG_CR_TRANSPACE);
+ writel(vq_start_low, engine + VIA_REG_CR_TRANSPACE);
+ writel(vq_end_low, engine + VIA_REG_CR_TRANSPACE);
+ writel(vq_len, engine + VIA_REG_CR_TRANSPACE);
+ writel(0x74301001, engine + VIA_REG_CR_TRANSPACE);
+ writel(0x00000000, engine + VIA_REG_CR_TRANSPACE);
+ break;
+ default:
+ writel(0x00FE0000, engine + VIA_REG_TRANSET);
+ writel(0x080003FE, engine + VIA_REG_TRANSPACE);
+ writel(0x0A00027C, engine + VIA_REG_TRANSPACE);
+ writel(0x0B000260, engine + VIA_REG_TRANSPACE);
+ writel(0x0C000274, engine + VIA_REG_TRANSPACE);
+ writel(0x0D000264, engine + VIA_REG_TRANSPACE);
+ writel(0x0E000000, engine + VIA_REG_TRANSPACE);
+ writel(0x0F000020, engine + VIA_REG_TRANSPACE);
+ writel(0x1000027E, engine + VIA_REG_TRANSPACE);
+ writel(0x110002FE, engine + VIA_REG_TRANSPACE);
+ writel(0x200F0060, engine + VIA_REG_TRANSPACE);
+
+ writel(0x00000006, engine + VIA_REG_TRANSPACE);
+ writel(0x40008C0F, engine + VIA_REG_TRANSPACE);
+ writel(0x44000000, engine + VIA_REG_TRANSPACE);
+ writel(0x45080C04, engine + VIA_REG_TRANSPACE);
+ writel(0x46800408, engine + VIA_REG_TRANSPACE);
+
+ writel(vq_high, engine + VIA_REG_TRANSPACE);
+ writel(vq_start_low, engine + VIA_REG_TRANSPACE);
+ writel(vq_end_low, engine + VIA_REG_TRANSPACE);
+ writel(vq_len, engine + VIA_REG_TRANSPACE);
+ break;
+ }
+
/* Set Cursor Image Base Address */
- writel(viaparinfo->cursor_start,
- viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
- writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_POS);
- writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_ORG);
- writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_BG);
- writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_FG);
+ writel(viapar->shared->cursor_vram_addr, engine + VIA_REG_CURSOR_MODE);
+ writel(0x0, engine + VIA_REG_CURSOR_POS);
+ writel(0x0, engine + VIA_REG_CURSOR_ORG);
+ writel(0x0, engine + VIA_REG_CURSOR_BG);
+ writel(0x0, engine + VIA_REG_CURSOR_FG);
+ return 0;
}
void viafb_show_hw_cursor(struct fb_info *info, int Status)
{
- u32 temp;
- u32 iga_path = ((struct viafb_par *)(info->par))->iga_path;
+ struct viafb_par *viapar = info->par;
+ u32 temp, iga_path = viapar->iga_path;
- temp = readl(viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+ temp = readl(viapar->shared->engine_mmio + VIA_REG_CURSOR_MODE);
switch (Status) {
case HW_Cursor_ON:
temp |= 0x1;
@@ -259,25 +460,27 @@
default:
temp &= 0x7FFFFFFF;
}
- writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+ writel(temp, viapar->shared->engine_mmio + VIA_REG_CURSOR_MODE);
}
-int viafb_wait_engine_idle(void)
+void viafb_wait_engine_idle(struct fb_info *info)
{
+ struct viafb_par *viapar = info->par;
int loop = 0;
- while (!(readl(viaparinfo->io_virt + VIA_REG_STATUS) &
+ while (!(readl(viapar->shared->engine_mmio + VIA_REG_STATUS) &
VIA_VR_QUEUE_BUSY) && (loop < MAXLOOP)) {
loop++;
cpu_relax();
}
- while ((readl(viaparinfo->io_virt + VIA_REG_STATUS) &
+ while ((readl(viapar->shared->engine_mmio + VIA_REG_STATUS) &
(VIA_CMD_RGTR_BUSY | VIA_2D_ENG_BUSY | VIA_3D_ENG_BUSY)) &&
(loop < MAXLOOP)) {
loop++;
cpu_relax();
}
- return loop >= MAXLOOP;
+ if (loop >= MAXLOOP)
+ printk(KERN_ERR "viafb_wait_engine_idle: not syncing\n");
}
diff --git a/drivers/video/via/accel.h b/drivers/video/via/accel.h
index 29bf854..615c84a 100644
--- a/drivers/video/via/accel.h
+++ b/drivers/video/via/accel.h
@@ -159,11 +159,12 @@
#define MAXLOOP 0xFFFFFF
-void viafb_init_accel(void);
-void viafb_init_2d_engine(void);
-void set_2d_color_depth(int);
-void viafb_hw_cursor_init(void);
-void viafb_show_hw_cursor(struct fb_info *info, int Status); int
-viafb_wait_engine_idle(void); void viafb_set_2d_color_depth(int bpp);
+#define VIA_BITBLT_COLOR 1
+#define VIA_BITBLT_MONO 2
+#define VIA_BITBLT_FILL 3
+
+int viafb_init_engine(struct fb_info *info);
+void viafb_show_hw_cursor(struct fb_info *info, int Status);
+void viafb_wait_engine_idle(struct fb_info *info);
#endif /* __ACCEL_H__ */
diff --git a/drivers/video/via/chip.h b/drivers/video/via/chip.h
index dde95ed..474f428 100644
--- a/drivers/video/via/chip.h
+++ b/drivers/video/via/chip.h
@@ -68,6 +68,9 @@
#define UNICHROME_VX800 11
#define UNICHROME_VX800_DID 0x1122
+#define UNICHROME_VX855 12
+#define UNICHROME_VX855_DID 0x5122
+
/**************************************************/
/* Definition TMDS Trasmitter Information */
/**************************************************/
@@ -122,7 +125,6 @@
struct chip_information {
int gfx_chip_name;
int gfx_chip_revision;
- int chip_on_slot;
struct tmds_chip_information tmds_chip_info;
struct lvds_chip_information lvds_chip_info;
struct lvds_chip_information lvds_chip_info2;
diff --git a/drivers/video/via/dvi.c b/drivers/video/via/dvi.c
index d696544..c5c32b6 100644
--- a/drivers/video/via/dvi.c
+++ b/drivers/video/via/dvi.c
@@ -160,7 +160,7 @@
static void tmds_register_write(int index, u8 data)
{
- viaparinfo->i2c_stuff.i2c_port =
+ viaparinfo->shared->i2c_stuff.i2c_port =
viaparinfo->chip_info->tmds_chip_info.i2c_port;
viafb_i2c_writebyte(viaparinfo->chip_info->tmds_chip_info.
@@ -172,7 +172,7 @@
{
u8 data;
- viaparinfo->i2c_stuff.i2c_port =
+ viaparinfo->shared->i2c_stuff.i2c_port =
viaparinfo->chip_info->tmds_chip_info.i2c_port;
viafb_i2c_readbyte((u8) viaparinfo->chip_info->
tmds_chip_info.tmds_chip_slave_addr,
@@ -182,7 +182,7 @@
static int tmds_register_read_bytes(int index, u8 *buff, int buff_len)
{
- viaparinfo->i2c_stuff.i2c_port =
+ viaparinfo->shared->i2c_stuff.i2c_port =
viaparinfo->chip_info->tmds_chip_info.i2c_port;
viafb_i2c_readbytes((u8) viaparinfo->chip_info->tmds_chip_info.
tmds_chip_slave_addr, (u8) index, buff, buff_len);
diff --git a/drivers/video/via/global.c b/drivers/video/via/global.c
index 468be2425..b675cdb 100644
--- a/drivers/video/via/global.c
+++ b/drivers/video/via/global.c
@@ -32,7 +32,6 @@
int viafb_lcd_mode = LCD_OPENLDI;
int viafb_bpp = 32;
int viafb_bpp1 = 32;
-int viafb_accel = 1;
int viafb_CRT_ON = 1;
int viafb_DVI_ON;
int viafb_LCD_ON ;
@@ -46,13 +45,11 @@
unsigned int viafb_second_offset;
int viafb_second_size;
int viafb_primary_dev = None_Device;
-void __iomem *viafb_FB_MM;
unsigned int viafb_second_xres = 640;
unsigned int viafb_second_yres = 480;
unsigned int viafb_second_virtual_xres;
unsigned int viafb_second_virtual_yres;
int viafb_lcd_panel_id = LCD_PANEL_ID_MAXIMUM + 1;
-struct fb_cursor viacursor;
struct fb_info *viafbinfo;
struct fb_info *viafbinfo1;
struct viafb_par *viaparinfo;
diff --git a/drivers/video/via/global.h b/drivers/video/via/global.h
index 7543d5f..d69d0ca 100644
--- a/drivers/video/via/global.h
+++ b/drivers/video/via/global.h
@@ -77,8 +77,6 @@
extern int viafb_hotplug_bpp;
extern int viafb_hotplug_refresh;
extern int viafb_primary_dev;
-extern void __iomem *viafb_FB_MM;
-extern struct fb_cursor viacursor;
extern unsigned int viafb_second_xres;
extern unsigned int viafb_second_yres;
diff --git a/drivers/video/via/hw.c b/drivers/video/via/hw.c
index c896000..3e083ff 100644
--- a/drivers/video/via/hw.c
+++ b/drivers/video/via/hw.c
@@ -21,125 +21,143 @@
#include "global.h"
-static const struct pci_device_id_info pciidlist[] = {
- {PCI_VIA_VENDOR_ID, UNICHROME_CLE266_DID, UNICHROME_CLE266},
- {PCI_VIA_VENDOR_ID, UNICHROME_PM800_DID, UNICHROME_PM800},
- {PCI_VIA_VENDOR_ID, UNICHROME_K400_DID, UNICHROME_K400},
- {PCI_VIA_VENDOR_ID, UNICHROME_K800_DID, UNICHROME_K800},
- {PCI_VIA_VENDOR_ID, UNICHROME_CN700_DID, UNICHROME_CN700},
- {PCI_VIA_VENDOR_ID, UNICHROME_P4M890_DID, UNICHROME_P4M890},
- {PCI_VIA_VENDOR_ID, UNICHROME_K8M890_DID, UNICHROME_K8M890},
- {PCI_VIA_VENDOR_ID, UNICHROME_CX700_DID, UNICHROME_CX700},
- {PCI_VIA_VENDOR_ID, UNICHROME_P4M900_DID, UNICHROME_P4M900},
- {PCI_VIA_VENDOR_ID, UNICHROME_CN750_DID, UNICHROME_CN750},
- {PCI_VIA_VENDOR_ID, UNICHROME_VX800_DID, UNICHROME_VX800},
- {0, 0, 0}
-};
-
-struct offset offset_reg = {
- /* IGA1 Offset Register */
- {IGA1_OFFSET_REG_NUM, {{CR13, 0, 7}, {CR35, 5, 7} } },
- /* IGA2 Offset Register */
- {IGA2_OFFSET_REG_NUM, {{CR66, 0, 7}, {CR67, 0, 1} } }
-};
-
static struct pll_map pll_value[] = {
- {CLK_25_175M, CLE266_PLL_25_175M, K800_PLL_25_175M, CX700_25_175M},
- {CLK_29_581M, CLE266_PLL_29_581M, K800_PLL_29_581M, CX700_29_581M},
- {CLK_26_880M, CLE266_PLL_26_880M, K800_PLL_26_880M, CX700_26_880M},
- {CLK_31_490M, CLE266_PLL_31_490M, K800_PLL_31_490M, CX700_31_490M},
- {CLK_31_500M, CLE266_PLL_31_500M, K800_PLL_31_500M, CX700_31_500M},
- {CLK_31_728M, CLE266_PLL_31_728M, K800_PLL_31_728M, CX700_31_728M},
- {CLK_32_668M, CLE266_PLL_32_668M, K800_PLL_32_668M, CX700_32_668M},
- {CLK_36_000M, CLE266_PLL_36_000M, K800_PLL_36_000M, CX700_36_000M},
- {CLK_40_000M, CLE266_PLL_40_000M, K800_PLL_40_000M, CX700_40_000M},
- {CLK_41_291M, CLE266_PLL_41_291M, K800_PLL_41_291M, CX700_41_291M},
- {CLK_43_163M, CLE266_PLL_43_163M, K800_PLL_43_163M, CX700_43_163M},
- {CLK_45_250M, CLE266_PLL_45_250M, K800_PLL_45_250M, CX700_45_250M},
- {CLK_46_000M, CLE266_PLL_46_000M, K800_PLL_46_000M, CX700_46_000M},
- {CLK_46_996M, CLE266_PLL_46_996M, K800_PLL_46_996M, CX700_46_996M},
- {CLK_48_000M, CLE266_PLL_48_000M, K800_PLL_48_000M, CX700_48_000M},
- {CLK_48_875M, CLE266_PLL_48_875M, K800_PLL_48_875M, CX700_48_875M},
- {CLK_49_500M, CLE266_PLL_49_500M, K800_PLL_49_500M, CX700_49_500M},
- {CLK_52_406M, CLE266_PLL_52_406M, K800_PLL_52_406M, CX700_52_406M},
- {CLK_52_977M, CLE266_PLL_52_977M, K800_PLL_52_977M, CX700_52_977M},
- {CLK_56_250M, CLE266_PLL_56_250M, K800_PLL_56_250M, CX700_56_250M},
- {CLK_60_466M, CLE266_PLL_60_466M, K800_PLL_60_466M, CX700_60_466M},
- {CLK_61_500M, CLE266_PLL_61_500M, K800_PLL_61_500M, CX700_61_500M},
- {CLK_65_000M, CLE266_PLL_65_000M, K800_PLL_65_000M, CX700_65_000M},
- {CLK_65_178M, CLE266_PLL_65_178M, K800_PLL_65_178M, CX700_65_178M},
- {CLK_66_750M, CLE266_PLL_66_750M, K800_PLL_66_750M, CX700_66_750M},
- {CLK_68_179M, CLE266_PLL_68_179M, K800_PLL_68_179M, CX700_68_179M},
- {CLK_69_924M, CLE266_PLL_69_924M, K800_PLL_69_924M, CX700_69_924M},
- {CLK_70_159M, CLE266_PLL_70_159M, K800_PLL_70_159M, CX700_70_159M},
- {CLK_72_000M, CLE266_PLL_72_000M, K800_PLL_72_000M, CX700_72_000M},
- {CLK_78_750M, CLE266_PLL_78_750M, K800_PLL_78_750M, CX700_78_750M},
- {CLK_80_136M, CLE266_PLL_80_136M, K800_PLL_80_136M, CX700_80_136M},
- {CLK_83_375M, CLE266_PLL_83_375M, K800_PLL_83_375M, CX700_83_375M},
- {CLK_83_950M, CLE266_PLL_83_950M, K800_PLL_83_950M, CX700_83_950M},
- {CLK_84_750M, CLE266_PLL_84_750M, K800_PLL_84_750M, CX700_84_750M},
- {CLK_85_860M, CLE266_PLL_85_860M, K800_PLL_85_860M, CX700_85_860M},
- {CLK_88_750M, CLE266_PLL_88_750M, K800_PLL_88_750M, CX700_88_750M},
- {CLK_94_500M, CLE266_PLL_94_500M, K800_PLL_94_500M, CX700_94_500M},
- {CLK_97_750M, CLE266_PLL_97_750M, K800_PLL_97_750M, CX700_97_750M},
+ {CLK_25_175M, CLE266_PLL_25_175M, K800_PLL_25_175M,
+ CX700_25_175M, VX855_25_175M},
+ {CLK_29_581M, CLE266_PLL_29_581M, K800_PLL_29_581M,
+ CX700_29_581M, VX855_29_581M},
+ {CLK_26_880M, CLE266_PLL_26_880M, K800_PLL_26_880M,
+ CX700_26_880M, VX855_26_880M},
+ {CLK_31_490M, CLE266_PLL_31_490M, K800_PLL_31_490M,
+ CX700_31_490M, VX855_31_490M},
+ {CLK_31_500M, CLE266_PLL_31_500M, K800_PLL_31_500M,
+ CX700_31_500M, VX855_31_500M},
+ {CLK_31_728M, CLE266_PLL_31_728M, K800_PLL_31_728M,
+ CX700_31_728M, VX855_31_728M},
+ {CLK_32_668M, CLE266_PLL_32_668M, K800_PLL_32_668M,
+ CX700_32_668M, VX855_32_668M},
+ {CLK_36_000M, CLE266_PLL_36_000M, K800_PLL_36_000M,
+ CX700_36_000M, VX855_36_000M},
+ {CLK_40_000M, CLE266_PLL_40_000M, K800_PLL_40_000M,
+ CX700_40_000M, VX855_40_000M},
+ {CLK_41_291M, CLE266_PLL_41_291M, K800_PLL_41_291M,
+ CX700_41_291M, VX855_41_291M},
+ {CLK_43_163M, CLE266_PLL_43_163M, K800_PLL_43_163M,
+ CX700_43_163M, VX855_43_163M},
+ {CLK_45_250M, CLE266_PLL_45_250M, K800_PLL_45_250M,
+ CX700_45_250M, VX855_45_250M},
+ {CLK_46_000M, CLE266_PLL_46_000M, K800_PLL_46_000M,
+ CX700_46_000M, VX855_46_000M},
+ {CLK_46_996M, CLE266_PLL_46_996M, K800_PLL_46_996M,
+ CX700_46_996M, VX855_46_996M},
+ {CLK_48_000M, CLE266_PLL_48_000M, K800_PLL_48_000M,
+ CX700_48_000M, VX855_48_000M},
+ {CLK_48_875M, CLE266_PLL_48_875M, K800_PLL_48_875M,
+ CX700_48_875M, VX855_48_875M},
+ {CLK_49_500M, CLE266_PLL_49_500M, K800_PLL_49_500M,
+ CX700_49_500M, VX855_49_500M},
+ {CLK_52_406M, CLE266_PLL_52_406M, K800_PLL_52_406M,
+ CX700_52_406M, VX855_52_406M},
+ {CLK_52_977M, CLE266_PLL_52_977M, K800_PLL_52_977M,
+ CX700_52_977M, VX855_52_977M},
+ {CLK_56_250M, CLE266_PLL_56_250M, K800_PLL_56_250M,
+ CX700_56_250M, VX855_56_250M},
+ {CLK_60_466M, CLE266_PLL_60_466M, K800_PLL_60_466M,
+ CX700_60_466M, VX855_60_466M},
+ {CLK_61_500M, CLE266_PLL_61_500M, K800_PLL_61_500M,
+ CX700_61_500M, VX855_61_500M},
+ {CLK_65_000M, CLE266_PLL_65_000M, K800_PLL_65_000M,
+ CX700_65_000M, VX855_65_000M},
+ {CLK_65_178M, CLE266_PLL_65_178M, K800_PLL_65_178M,
+ CX700_65_178M, VX855_65_178M},
+ {CLK_66_750M, CLE266_PLL_66_750M, K800_PLL_66_750M,
+ CX700_66_750M, VX855_66_750M},
+ {CLK_68_179M, CLE266_PLL_68_179M, K800_PLL_68_179M,
+ CX700_68_179M, VX855_68_179M},
+ {CLK_69_924M, CLE266_PLL_69_924M, K800_PLL_69_924M,
+ CX700_69_924M, VX855_69_924M},
+ {CLK_70_159M, CLE266_PLL_70_159M, K800_PLL_70_159M,
+ CX700_70_159M, VX855_70_159M},
+ {CLK_72_000M, CLE266_PLL_72_000M, K800_PLL_72_000M,
+ CX700_72_000M, VX855_72_000M},
+ {CLK_78_750M, CLE266_PLL_78_750M, K800_PLL_78_750M,
+ CX700_78_750M, VX855_78_750M},
+ {CLK_80_136M, CLE266_PLL_80_136M, K800_PLL_80_136M,
+ CX700_80_136M, VX855_80_136M},
+ {CLK_83_375M, CLE266_PLL_83_375M, K800_PLL_83_375M,
+ CX700_83_375M, VX855_83_375M},
+ {CLK_83_950M, CLE266_PLL_83_950M, K800_PLL_83_950M,
+ CX700_83_950M, VX855_83_950M},
+ {CLK_84_750M, CLE266_PLL_84_750M, K800_PLL_84_750M,
+ CX700_84_750M, VX855_84_750M},
+ {CLK_85_860M, CLE266_PLL_85_860M, K800_PLL_85_860M,
+ CX700_85_860M, VX855_85_860M},
+ {CLK_88_750M, CLE266_PLL_88_750M, K800_PLL_88_750M,
+ CX700_88_750M, VX855_88_750M},
+ {CLK_94_500M, CLE266_PLL_94_500M, K800_PLL_94_500M,
+ CX700_94_500M, VX855_94_500M},
+ {CLK_97_750M, CLE266_PLL_97_750M, K800_PLL_97_750M,
+ CX700_97_750M, VX855_97_750M},
{CLK_101_000M, CLE266_PLL_101_000M, K800_PLL_101_000M,
- CX700_101_000M},
+ CX700_101_000M, VX855_101_000M},
{CLK_106_500M, CLE266_PLL_106_500M, K800_PLL_106_500M,
- CX700_106_500M},
+ CX700_106_500M, VX855_106_500M},
{CLK_108_000M, CLE266_PLL_108_000M, K800_PLL_108_000M,
- CX700_108_000M},
+ CX700_108_000M, VX855_108_000M},
{CLK_113_309M, CLE266_PLL_113_309M, K800_PLL_113_309M,
- CX700_113_309M},
+ CX700_113_309M, VX855_113_309M},
{CLK_118_840M, CLE266_PLL_118_840M, K800_PLL_118_840M,
- CX700_118_840M},
+ CX700_118_840M, VX855_118_840M},
{CLK_119_000M, CLE266_PLL_119_000M, K800_PLL_119_000M,
- CX700_119_000M},
+ CX700_119_000M, VX855_119_000M},
{CLK_121_750M, CLE266_PLL_121_750M, K800_PLL_121_750M,
- CX700_121_750M},
+ CX700_121_750M, 0},
{CLK_125_104M, CLE266_PLL_125_104M, K800_PLL_125_104M,
- CX700_125_104M},
+ CX700_125_104M, 0},
{CLK_133_308M, CLE266_PLL_133_308M, K800_PLL_133_308M,
- CX700_133_308M},
+ CX700_133_308M, 0},
{CLK_135_000M, CLE266_PLL_135_000M, K800_PLL_135_000M,
- CX700_135_000M},
+ CX700_135_000M, VX855_135_000M},
{CLK_136_700M, CLE266_PLL_136_700M, K800_PLL_136_700M,
- CX700_136_700M},
+ CX700_136_700M, VX855_136_700M},
{CLK_138_400M, CLE266_PLL_138_400M, K800_PLL_138_400M,
- CX700_138_400M},
+ CX700_138_400M, VX855_138_400M},
{CLK_146_760M, CLE266_PLL_146_760M, K800_PLL_146_760M,
- CX700_146_760M},
+ CX700_146_760M, VX855_146_760M},
{CLK_153_920M, CLE266_PLL_153_920M, K800_PLL_153_920M,
- CX700_153_920M},
+ CX700_153_920M, VX855_153_920M},
{CLK_156_000M, CLE266_PLL_156_000M, K800_PLL_156_000M,
- CX700_156_000M},
+ CX700_156_000M, VX855_156_000M},
{CLK_157_500M, CLE266_PLL_157_500M, K800_PLL_157_500M,
- CX700_157_500M},
+ CX700_157_500M, VX855_157_500M},
{CLK_162_000M, CLE266_PLL_162_000M, K800_PLL_162_000M,
- CX700_162_000M},
+ CX700_162_000M, VX855_162_000M},
{CLK_187_000M, CLE266_PLL_187_000M, K800_PLL_187_000M,
- CX700_187_000M},
+ CX700_187_000M, VX855_187_000M},
{CLK_193_295M, CLE266_PLL_193_295M, K800_PLL_193_295M,
- CX700_193_295M},
+ CX700_193_295M, VX855_193_295M},
{CLK_202_500M, CLE266_PLL_202_500M, K800_PLL_202_500M,
- CX700_202_500M},
+ CX700_202_500M, VX855_202_500M},
{CLK_204_000M, CLE266_PLL_204_000M, K800_PLL_204_000M,
- CX700_204_000M},
+ CX700_204_000M, VX855_204_000M},
{CLK_218_500M, CLE266_PLL_218_500M, K800_PLL_218_500M,
- CX700_218_500M},
+ CX700_218_500M, VX855_218_500M},
{CLK_234_000M, CLE266_PLL_234_000M, K800_PLL_234_000M,
- CX700_234_000M},
+ CX700_234_000M, VX855_234_000M},
{CLK_267_250M, CLE266_PLL_267_250M, K800_PLL_267_250M,
- CX700_267_250M},
+ CX700_267_250M, VX855_267_250M},
{CLK_297_500M, CLE266_PLL_297_500M, K800_PLL_297_500M,
- CX700_297_500M},
- {CLK_74_481M, CLE266_PLL_74_481M, K800_PLL_74_481M, CX700_74_481M},
+ CX700_297_500M, VX855_297_500M},
+ {CLK_74_481M, CLE266_PLL_74_481M, K800_PLL_74_481M,
+ CX700_74_481M, VX855_74_481M},
{CLK_172_798M, CLE266_PLL_172_798M, K800_PLL_172_798M,
- CX700_172_798M},
+ CX700_172_798M, VX855_172_798M},
{CLK_122_614M, CLE266_PLL_122_614M, K800_PLL_122_614M,
- CX700_122_614M},
- {CLK_74_270M, CLE266_PLL_74_270M, K800_PLL_74_270M, CX700_74_270M},
+ CX700_122_614M, VX855_122_614M},
+ {CLK_74_270M, CLE266_PLL_74_270M, K800_PLL_74_270M,
+ CX700_74_270M, 0},
{CLK_148_500M, CLE266_PLL_148_500M, K800_PLL_148_500M,
- CX700_148_500M}
+ CX700_148_500M, VX855_148_500M}
};
static struct fifo_depth_select display_fifo_depth_reg = {
@@ -508,7 +526,8 @@
static void set_lcd_output_path(int set_iga, int output_interface);
static int search_mode_setting(int ModeInfoIndex);
static void load_fix_bit_crtc_reg(void);
-static void init_gfx_chip_info(void);
+static void init_gfx_chip_info(struct pci_dev *pdev,
+ const struct pci_device_id *pdi);
static void init_tmds_chip_info(void);
static void init_lvds_chip_info(void);
static void device_screen_off(void);
@@ -518,7 +537,6 @@
static void device_on(void);
static void enable_second_display_channel(void);
static void disable_second_display_channel(void);
-static int get_fb_size_from_pci(void);
void viafb_write_reg(u8 index, u16 io_port, u8 data)
{
@@ -629,70 +647,43 @@
}
}
-void viafb_set_start_addr(void)
+void viafb_set_primary_address(u32 addr)
{
- unsigned long offset = 0, tmp = 0, size = 0;
- unsigned long length;
+ DEBUG_MSG(KERN_DEBUG "viafb_set_primary_address(0x%08X)\n", addr);
+ viafb_write_reg(CR0D, VIACR, addr & 0xFF);
+ viafb_write_reg(CR0C, VIACR, (addr >> 8) & 0xFF);
+ viafb_write_reg(CR34, VIACR, (addr >> 16) & 0xFF);
+ viafb_write_reg_mask(CR48, VIACR, (addr >> 24) & 0x1F, 0x1F);
+}
- DEBUG_MSG(KERN_INFO "viafb_set_start_addr!\n");
- viafb_unlock_crt();
- /* update starting address of IGA1 */
- viafb_write_reg(CR0C, VIACR, 0x00); /*initial starting address */
- viafb_write_reg(CR0D, VIACR, 0x00);
- viafb_write_reg(CR34, VIACR, 0x00);
- viafb_write_reg_mask(CR48, VIACR, 0x00, 0x1F);
+void viafb_set_secondary_address(u32 addr)
+{
+ DEBUG_MSG(KERN_DEBUG "viafb_set_secondary_address(0x%08X)\n", addr);
+ /* secondary display supports only quadword aligned memory */
+ viafb_write_reg_mask(CR62, VIACR, (addr >> 2) & 0xFE, 0xFE);
+ viafb_write_reg(CR63, VIACR, (addr >> 10) & 0xFF);
+ viafb_write_reg(CR64, VIACR, (addr >> 18) & 0xFF);
+ viafb_write_reg_mask(CRA3, VIACR, (addr >> 26) & 0x07, 0x07);
+}
- if (viafb_dual_fb) {
- viaparinfo->iga_path = IGA1;
- viaparinfo1->iga_path = IGA2;
- }
+void viafb_set_primary_pitch(u32 pitch)
+{
+ DEBUG_MSG(KERN_DEBUG "viafb_set_primary_pitch(0x%08X)\n", pitch);
+ /* spec does not say that first adapter skips 3 bits but old
+ * code did it and seems to be reasonable in analogy to 2nd adapter
+ */
+ pitch = pitch >> 3;
+ viafb_write_reg(0x13, VIACR, pitch & 0xFF);
+ viafb_write_reg_mask(0x35, VIACR, (pitch >> (8 - 5)) & 0xE0, 0xE0);
+}
- if (viafb_SAMM_ON == 1) {
- if (!viafb_dual_fb) {
- if (viafb_second_size)
- size = viafb_second_size * 1024 * 1024;
- else
- size = 8 * 1024 * 1024;
- } else {
-
- size = viaparinfo1->memsize;
- }
- offset = viafb_second_offset;
- DEBUG_MSG(KERN_INFO
- "viafb_second_size=%lx, second start_adddress=%lx\n",
- size, offset);
- }
- if (viafb_SAMM_ON == 1) {
- offset = offset >> 3;
-
- tmp = viafb_read_reg(VIACR, 0x62) & 0x01;
- tmp |= (offset & 0x7F) << 1;
- viafb_write_reg(CR62, VIACR, tmp);
- viafb_write_reg(CR63, VIACR, ((offset & 0x7F80) >> 7));
- viafb_write_reg(CR64, VIACR, ((offset & 0x7F8000) >> 15));
- viafb_write_reg(CRA3, VIACR, ((offset & 0x3800000) >> 23));
- } else {
- /* update starting address */
- viafb_write_reg(CR62, VIACR, 0x00);
- viafb_write_reg(CR63, VIACR, 0x00);
- viafb_write_reg(CR64, VIACR, 0x00);
- viafb_write_reg(CRA3, VIACR, 0x00);
- }
-
- if (viafb_SAMM_ON == 1) {
- if (viafb_accel) {
- if (!viafb_dual_fb)
- length = size - viaparinfo->fbmem_used;
- else
- length = size - viaparinfo1->fbmem_used;
- } else
- length = size;
- offset = (unsigned long)(void *)viafb_FB_MM +
- viafb_second_offset;
- memset((void *)offset, 0, length);
- }
-
- viafb_lock_crt();
+void viafb_set_secondary_pitch(u32 pitch)
+{
+ DEBUG_MSG(KERN_DEBUG "viafb_set_secondary_pitch(0x%08X)\n", pitch);
+ pitch = pitch >> 3;
+ viafb_write_reg(0x66, VIACR, pitch & 0xFF);
+ viafb_write_reg_mask(0x67, VIACR, (pitch >> 8) & 0x03, 0x03);
+ viafb_write_reg_mask(0x71, VIACR, (pitch >> (10 - 7)) & 0x80, 0x80);
}
void viafb_set_output_path(int device, int set_iga, int output_interface)
@@ -1123,30 +1114,6 @@
}
}
-void viafb_load_offset_reg(int h_addr, int bpp_byte, int set_iga)
-{
- int reg_value;
- int viafb_load_reg_num;
- struct io_register *reg;
-
- switch (set_iga) {
- case IGA1_IGA2:
- case IGA1:
- reg_value = IGA1_OFFSET_FORMULA(h_addr, bpp_byte);
- viafb_load_reg_num = offset_reg.iga1_offset_reg.reg_num;
- reg = offset_reg.iga1_offset_reg.reg;
- viafb_load_reg(reg_value, viafb_load_reg_num, reg, VIACR);
- if (set_iga == IGA1)
- break;
- case IGA2:
- reg_value = IGA2_OFFSET_FORMULA(h_addr, bpp_byte);
- viafb_load_reg_num = offset_reg.iga2_offset_reg.reg_num;
- reg = offset_reg.iga2_offset_reg.reg;
- viafb_load_reg(reg_value, viafb_load_reg_num, reg, VIACR);
- break;
- }
-}
-
void viafb_load_fetch_count_reg(int h_addr, int bpp_byte, int set_iga)
{
int reg_value;
@@ -1277,6 +1244,15 @@
VX800_IGA1_DISPLAY_QUEUE_EXPIRE_NUM;
}
+ if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_VX855) {
+ iga1_fifo_max_depth = VX855_IGA1_FIFO_MAX_DEPTH;
+ iga1_fifo_threshold = VX855_IGA1_FIFO_THRESHOLD;
+ iga1_fifo_high_threshold =
+ VX855_IGA1_FIFO_HIGH_THRESHOLD;
+ iga1_display_queue_expire_num =
+ VX855_IGA1_DISPLAY_QUEUE_EXPIRE_NUM;
+ }
+
/* Set Display FIFO Depath Select */
reg_value = IGA1_FIFO_DEPTH_SELECT_FORMULA(iga1_fifo_max_depth);
viafb_load_reg_num =
@@ -1408,6 +1384,15 @@
VX800_IGA2_DISPLAY_QUEUE_EXPIRE_NUM;
}
+ if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_VX855) {
+ iga2_fifo_max_depth = VX855_IGA2_FIFO_MAX_DEPTH;
+ iga2_fifo_threshold = VX855_IGA2_FIFO_THRESHOLD;
+ iga2_fifo_high_threshold =
+ VX855_IGA2_FIFO_HIGH_THRESHOLD;
+ iga2_display_queue_expire_num =
+ VX855_IGA2_DISPLAY_QUEUE_EXPIRE_NUM;
+ }
+
if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_K800) {
/* Set Display FIFO Depath Select */
reg_value =
@@ -1496,6 +1481,8 @@
case UNICHROME_P4M900:
case UNICHROME_VX800:
return pll_value[i].cx700_pll;
+ case UNICHROME_VX855:
+ return pll_value[i].vx855_pll;
}
}
}
@@ -1529,6 +1516,7 @@
case UNICHROME_P4M890:
case UNICHROME_P4M900:
case UNICHROME_VX800:
+ case UNICHROME_VX855:
viafb_write_reg(SR44, VIASR, CLK / 0x10000);
DEBUG_MSG(KERN_INFO "\nSR44=%x", CLK / 0x10000);
viafb_write_reg(SR45, VIASR, (CLK & 0xFFFF) / 0x100);
@@ -1557,6 +1545,7 @@
case UNICHROME_P4M890:
case UNICHROME_P4M900:
case UNICHROME_VX800:
+ case UNICHROME_VX855:
viafb_write_reg(SR4A, VIASR, CLK / 0x10000);
viafb_write_reg(SR4B, VIASR, (CLK & 0xFFFF) / 0x100);
viafb_write_reg(SR4C, VIASR, CLK % 0x100);
@@ -1916,7 +1905,6 @@
load_fix_bit_crtc_reg();
viafb_lock_crt();
viafb_write_reg_mask(CR17, VIACR, 0x80, BIT7);
- viafb_load_offset_reg(h_addr, bpp_byte, set_iga);
viafb_load_fetch_count_reg(h_addr, bpp_byte, set_iga);
/* load FIFO */
@@ -1933,9 +1921,10 @@
}
-void viafb_init_chip_info(void)
+void viafb_init_chip_info(struct pci_dev *pdev,
+ const struct pci_device_id *pdi)
{
- init_gfx_chip_info();
+ init_gfx_chip_info(pdev, pdi);
init_tmds_chip_info();
init_lvds_chip_info();
@@ -2008,24 +1997,12 @@
}
}
-static void init_gfx_chip_info(void)
+static void init_gfx_chip_info(struct pci_dev *pdev,
+ const struct pci_device_id *pdi)
{
- struct pci_dev *pdev = NULL;
- u32 i;
u8 tmp;
- /* Indentify GFX Chip Name */
- for (i = 0; pciidlist[i].vendor != 0; i++) {
- pdev = pci_get_device(pciidlist[i].vendor,
- pciidlist[i].device, 0);
- if (pdev)
- break;
- }
-
- if (!pciidlist[i].vendor)
- return ;
-
- viaparinfo->chip_info->gfx_chip_name = pciidlist[i].chip_index;
+ viaparinfo->chip_info->gfx_chip_name = pdi->driver_data;
/* Check revision of CLE266 Chip */
if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_CLE266) {
@@ -2056,8 +2033,6 @@
CX700_REVISION_700;
}
}
-
- pci_dev_put(pdev);
}
static void init_tmds_chip_info(void)
@@ -2271,11 +2246,12 @@
break;
case UNICHROME_CX700:
- viafb_write_regx(CX700_ModeXregs, NUM_TOTAL_CX700_ModeXregs);
-
case UNICHROME_VX800:
- viafb_write_regx(VX800_ModeXregs, NUM_TOTAL_VX800_ModeXregs);
+ viafb_write_regx(CX700_ModeXregs, NUM_TOTAL_CX700_ModeXregs);
+ break;
+ case UNICHROME_VX855:
+ viafb_write_regx(VX855_ModeXregs, NUM_TOTAL_VX855_ModeXregs);
break;
}
@@ -2291,7 +2267,8 @@
outb(VPIT.SR[i - 1], VIASR + 1);
}
- viafb_set_start_addr();
+ viafb_set_primary_address(0);
+ viafb_set_secondary_address(viafb_SAMM_ON ? viafb_second_offset : 0);
viafb_set_iga_path();
/* Write CRTC */
@@ -2371,6 +2348,9 @@
}
}
+ viafb_set_primary_pitch(viafbinfo->fix.line_length);
+ viafb_set_secondary_pitch(viafb_dual_fb ? viafbinfo1->fix.line_length
+ : viafbinfo->fix.line_length);
/* Update Refresh Rate Setting */
/* Clear On Screen */
@@ -2545,38 +2525,6 @@
viafb_write_reg_mask(CR36, VIACR, 0x0, BIT5 + BIT4);
}
-void viafb_get_mmio_info(unsigned long *mmio_base,
- unsigned long *mmio_len)
-{
- struct pci_dev *pdev = NULL;
- u32 vendor, device;
- u32 i;
-
- for (i = 0; pciidlist[i].vendor != 0; i++)
- if (viaparinfo->chip_info->gfx_chip_name ==
- pciidlist[i].chip_index)
- break;
-
- if (!pciidlist[i].vendor)
- return ;
-
- vendor = pciidlist[i].vendor;
- device = pciidlist[i].device;
-
- pdev = pci_get_device(vendor, device, NULL);
-
- if (!pdev) {
- *mmio_base = 0;
- *mmio_len = 0;
- return ;
- }
-
- *mmio_base = pci_resource_start(pdev, 1);
- *mmio_len = pci_resource_len(pdev, 1);
-
- pci_dev_put(pdev);
-}
-
static void enable_second_display_channel(void)
{
/* to enable second display channel. */
@@ -2593,44 +2541,7 @@
viafb_write_reg_mask(CR6A, VIACR, BIT6, BIT6);
}
-void viafb_get_fb_info(unsigned int *fb_base, unsigned int *fb_len)
-{
- struct pci_dev *pdev = NULL;
- u32 vendor, device;
- u32 i;
-
- for (i = 0; pciidlist[i].vendor != 0; i++)
- if (viaparinfo->chip_info->gfx_chip_name ==
- pciidlist[i].chip_index)
- break;
-
- if (!pciidlist[i].vendor)
- return ;
-
- vendor = pciidlist[i].vendor;
- device = pciidlist[i].device;
-
- pdev = pci_get_device(vendor, device, NULL);
-
- if (!pdev) {
- *fb_base = viafb_read_reg(VIASR, SR30) << 24;
- *fb_len = viafb_get_memsize();
- DEBUG_MSG(KERN_INFO "Get FB info from SR30!\n");
- DEBUG_MSG(KERN_INFO "fb_base = %08x\n", *fb_base);
- DEBUG_MSG(KERN_INFO "fb_len = %08x\n", *fb_len);
- return ;
- }
-
- *fb_base = (unsigned int)pci_resource_start(pdev, 0);
- *fb_len = get_fb_size_from_pci();
- DEBUG_MSG(KERN_INFO "Get FB info from PCI system!\n");
- DEBUG_MSG(KERN_INFO "fb_base = %08x\n", *fb_base);
- DEBUG_MSG(KERN_INFO "fb_len = %08x\n", *fb_len);
-
- pci_dev_put(pdev);
-}
-
-static int get_fb_size_from_pci(void)
+int viafb_get_fb_size_from_pci(void)
{
unsigned long configid, deviceid, FBSize = 0;
int VideoMemSize;
@@ -2656,6 +2567,7 @@
case P4M890_FUNCTION3:
case P4M900_FUNCTION3:
case VX800_FUNCTION3:
+ case VX855_FUNCTION3:
/*case CN750_FUNCTION3: */
outl(configid + 0xA0, (unsigned long)0xCF8);
FBSize = inl((unsigned long)0xCFC);
@@ -2719,6 +2631,10 @@
VideoMemSize = (256 << 20); /*256M */
break;
+ case 0x00007000: /* Only on VX855/875 */
+ VideoMemSize = (512 << 20); /*512M */
+ break;
+
default:
VideoMemSize = (32 << 20); /*32M */
break;
@@ -2788,24 +2704,6 @@
}
}
-void viafb_memory_pitch_patch(struct fb_info *info)
-{
- if (info->var.xres != info->var.xres_virtual) {
- viafb_load_offset_reg(info->var.xres_virtual,
- info->var.bits_per_pixel >> 3, IGA1);
-
- if (viafb_SAMM_ON) {
- viafb_load_offset_reg(viafb_second_virtual_xres,
- viafb_bpp1 >> 3,
- IGA2);
- } else {
- viafb_load_offset_reg(info->var.xres_virtual,
- info->var.bits_per_pixel >> 3, IGA2);
- }
-
- }
-}
-
/*According var's xres, yres fill var's other timing information*/
void viafb_fill_var_timing_info(struct fb_var_screeninfo *var, int refresh,
int mode_index)
diff --git a/drivers/video/via/hw.h b/drivers/video/via/hw.h
index 6ff38fa..b874d95 100644
--- a/drivers/video/via/hw.h
+++ b/drivers/video/via/hw.h
@@ -147,14 +147,8 @@
/* location: {CR5F,0,4} */
#define IGA2_VER_SYNC_END_REG_NUM 1
-/* Define Offset and Fetch Count Register*/
+/* Define Fetch Count Register*/
-/* location: {CR13,0,7},{CR35,5,7} */
-#define IGA1_OFFSET_REG_NUM 2
-/* 8 bytes alignment. */
-#define IGA1_OFFSER_ALIGN_BYTE 8
-/* x: H resolution, y: color depth */
-#define IGA1_OFFSET_FORMULA(x, y) ((x*y)/IGA1_OFFSER_ALIGN_BYTE)
/* location: {SR1C,0,7},{SR1D,0,1} */
#define IGA1_FETCH_COUNT_REG_NUM 2
/* 16 bytes alignment. */
@@ -164,11 +158,6 @@
#define IGA1_FETCH_COUNT_FORMULA(x, y) \
(((x*y)/IGA1_FETCH_COUNT_ALIGN_BYTE) + IGA1_FETCH_COUNT_PATCH_VALUE)
-/* location: {CR66,0,7},{CR67,0,1} */
-#define IGA2_OFFSET_REG_NUM 2
-#define IGA2_OFFSET_ALIGN_BYTE 8
-/* x: H resolution, y: color depth */
-#define IGA2_OFFSET_FORMULA(x, y) ((x*y)/IGA2_OFFSET_ALIGN_BYTE)
/* location: {CR65,0,7},{CR67,2,3} */
#define IGA2_FETCH_COUNT_REG_NUM 2
#define IGA2_FETCH_COUNT_ALIGN_BYTE 16
@@ -335,6 +324,17 @@
/* location: {CR94,0,6} */
#define VX800_IGA2_DISPLAY_QUEUE_EXPIRE_NUM 128
+/* For VT3409 */
+#define VX855_IGA1_FIFO_MAX_DEPTH 400
+#define VX855_IGA1_FIFO_THRESHOLD 320
+#define VX855_IGA1_FIFO_HIGH_THRESHOLD 320
+#define VX855_IGA1_DISPLAY_QUEUE_EXPIRE_NUM 160
+
+#define VX855_IGA2_FIFO_MAX_DEPTH 200
+#define VX855_IGA2_FIFO_THRESHOLD 160
+#define VX855_IGA2_FIFO_HIGH_THRESHOLD 160
+#define VX855_IGA2_DISPLAY_QUEUE_EXPIRE_NUM 320
+
#define IGA1_FIFO_DEPTH_SELECT_REG_NUM 1
#define IGA1_FIFO_THRESHOLD_REG_NUM 2
#define IGA1_FIFO_HIGH_THRESHOLD_REG_NUM 2
@@ -617,23 +617,6 @@
struct io_register reg[IGA2_VER_SYNC_END_REG_NUM];
};
-/* IGA1 Offset Register */
-struct iga1_offset {
- int reg_num;
- struct io_register reg[IGA1_OFFSET_REG_NUM];
-};
-
-/* IGA2 Offset Register */
-struct iga2_offset {
- int reg_num;
- struct io_register reg[IGA2_OFFSET_REG_NUM];
-};
-
-struct offset {
- struct iga1_offset iga1_offset_reg;
- struct iga2_offset iga2_offset_reg;
-};
-
/* IGA1 Fetch Count Register */
struct iga1_fetch_count {
int reg_num;
@@ -716,6 +699,7 @@
u32 cle266_pll;
u32 k800_pll;
u32 cx700_pll;
+ u32 vx855_pll;
};
struct rgbLUT {
@@ -860,6 +844,8 @@
#define P4M900_FUNCTION3 0x3364
/* VT3353 chipset*/
#define VX800_FUNCTION3 0x3353
+/* VT3409 chipset*/
+#define VX855_FUNCTION3 0x3409
#define NUM_TOTAL_PLL_TABLE ARRAY_SIZE(pll_value)
@@ -883,7 +869,6 @@
extern int viafb_LCD2_ON;
extern int viafb_LCD_ON;
extern int viafb_DVI_ON;
-extern int viafb_accel;
extern int viafb_hotplug;
void viafb_write_reg_mask(u8 index, int io_port, u8 data, u8 mask);
@@ -904,7 +889,6 @@
u8 viafb_read_reg(int io_port, u8 index);
void viafb_lock_crt(void);
void viafb_unlock_crt(void);
-void viafb_load_offset_reg(int h_addr, int bpp_byte, int set_iga);
void viafb_load_fetch_count_reg(int h_addr, int bpp_byte, int set_iga);
void viafb_write_regx(struct io_reg RegTable[], int ItemNum);
struct VideoModeTable *viafb_get_modetbl_pointer(int Index);
@@ -917,17 +901,20 @@
int viafb_setmode(int vmode_index, int hor_res, int ver_res,
int video_bpp, int vmode_index1, int hor_res1,
int ver_res1, int video_bpp1);
-void viafb_init_chip_info(void);
+void viafb_init_chip_info(struct pci_dev *pdev,
+ const struct pci_device_id *pdi);
void viafb_init_dac(int set_iga);
int viafb_get_pixclock(int hres, int vres, int vmode_refresh);
int viafb_get_refresh(int hres, int vres, u32 float_refresh);
void viafb_update_device_setting(int hres, int vres, int bpp,
int vmode_refresh, int flag);
-void viafb_get_mmio_info(unsigned long *mmio_base,
- unsigned long *mmio_len);
+int viafb_get_fb_size_from_pci(void);
void viafb_set_iga_path(void);
-void viafb_set_start_addr(void);
+void viafb_set_primary_address(u32 addr);
+void viafb_set_secondary_address(u32 addr);
+void viafb_set_primary_pitch(u32 pitch);
+void viafb_set_secondary_pitch(u32 pitch);
void viafb_get_fb_info(unsigned int *fb_base, unsigned int *fb_len);
#endif /* __HW_H__ */
diff --git a/drivers/video/via/ioctl.h b/drivers/video/via/ioctl.h
index 842fe30..de89980 100644
--- a/drivers/video/via/ioctl.h
+++ b/drivers/video/via/ioctl.h
@@ -50,8 +50,6 @@
#define VIAFB_GET_GAMMA_LUT 0x56494124
#define VIAFB_SET_GAMMA_LUT 0x56494125
#define VIAFB_GET_GAMMA_SUPPORT_STATE 0x56494126
-#define VIAFB_SET_VIDEO_DEVICE 0x56494127
-#define VIAFB_GET_VIDEO_DEVICE 0x56494128
#define VIAFB_SET_SECOND_MODE 0x56494129
#define VIAFB_SYNC_SURFACE 0x56494130
#define VIAFB_GET_DRIVER_CAPS 0x56494131
@@ -179,9 +177,7 @@
unsigned short second_dev_bpp;
/* Indicate which device are primary display device. */
unsigned int primary_device;
- /* Indicate which device will show video. only valid in duoview mode */
- unsigned int video_device_status;
- unsigned int struct_reserved[34];
+ unsigned int struct_reserved[35];
struct viafb_ioctl_lcd_attribute lcd_attributes;
};
diff --git a/drivers/video/via/lcd.c b/drivers/video/via/lcd.c
index 78c6b33..e3e597f 100644
--- a/drivers/video/via/lcd.c
+++ b/drivers/video/via/lcd.c
@@ -207,13 +207,13 @@
int viafb_lvds_trasmitter_identify(void)
{
- viaparinfo->i2c_stuff.i2c_port = I2CPORTINDEX;
+ viaparinfo->shared->i2c_stuff.i2c_port = I2CPORTINDEX;
if (viafb_lvds_identify_vt1636()) {
viaparinfo->chip_info->lvds_chip_info.i2c_port = I2CPORTINDEX;
DEBUG_MSG(KERN_INFO
"Found VIA VT1636 LVDS on port i2c 0x31 \n");
} else {
- viaparinfo->i2c_stuff.i2c_port = GPIOPORTINDEX;
+ viaparinfo->shared->i2c_stuff.i2c_port = GPIOPORTINDEX;
if (viafb_lvds_identify_vt1636()) {
viaparinfo->chip_info->lvds_chip_info.i2c_port =
GPIOPORTINDEX;
@@ -470,7 +470,7 @@
{
u8 data;
- viaparinfo->i2c_stuff.i2c_port = GPIOPORTINDEX;
+ viaparinfo->shared->i2c_stuff.i2c_port = GPIOPORTINDEX;
viafb_i2c_readbyte((u8) viaparinfo->chip_info->
lvds_chip_info.lvds_chip_slave_addr,
(u8) index, &data);
@@ -952,13 +952,10 @@
int video_index = plvds_setting_info->lcd_panel_size;
int set_iga = plvds_setting_info->iga_path;
int mode_bpp = plvds_setting_info->bpp;
- int viafb_load_reg_num = 0;
- int reg_value = 0;
int set_hres, set_vres;
int panel_hres, panel_vres;
u32 pll_D_N;
int offset;
- struct io_register *reg = NULL;
struct display_timing mode_crt_reg, panel_crt_reg;
struct crt_mode_table *panel_crt_table = NULL;
struct VideoModeTable *vmode_tbl = NULL;
@@ -1038,16 +1035,11 @@
}
/* Offset for simultaneous */
- reg_value = offset;
- viafb_load_reg_num = offset_reg.iga2_offset_reg.reg_num;
- reg = offset_reg.iga2_offset_reg.reg;
- viafb_load_reg(reg_value, viafb_load_reg_num, reg, VIACR);
+ viafb_set_secondary_pitch(offset << 3);
DEBUG_MSG(KERN_INFO "viafb_load_reg!!\n");
viafb_load_fetch_count_reg(set_hres, 4, IGA2);
/* Fetch count for simultaneous */
} else { /* SAMM */
- /* Offset for IGA2 only */
- viafb_load_offset_reg(set_hres, mode_bpp / 8, set_iga);
/* Fetch count for IGA2 only */
viafb_load_fetch_count_reg(set_hres, mode_bpp / 8, set_iga);
diff --git a/drivers/video/via/share.h b/drivers/video/via/share.h
index 2e1254d..7cd03e2 100644
--- a/drivers/video/via/share.h
+++ b/drivers/video/via/share.h
@@ -167,6 +167,10 @@
#define SR4B 0x4B
#define SR4C 0x4C
#define SR52 0x52
+#define SR57 0x57
+#define SR58 0x58
+#define SR59 0x59
+#define SR5D 0x5D
#define SR5E 0x5E
#define SR65 0x65
@@ -966,6 +970,100 @@
#define CX700_297_500M 0x00CE0403
#define CX700_122_614M 0x00870802
+/* PLL for VX855 */
+#define VX855_22_000M 0x007B1005
+#define VX855_25_175M 0x008D1005
+#define VX855_26_719M 0x00961005
+#define VX855_26_880M 0x00961005
+#define VX855_27_000M 0x00971005
+#define VX855_29_581M 0x00A51005
+#define VX855_29_829M 0x00641003
+#define VX855_31_490M 0x00B01005
+#define VX855_31_500M 0x00B01005
+#define VX855_31_728M 0x008E1004
+#define VX855_32_668M 0x00921004
+#define VX855_36_000M 0x00A11004
+#define VX855_40_000M 0x00700C05
+#define VX855_41_291M 0x00730C05
+#define VX855_43_163M 0x00790C05
+#define VX855_45_250M 0x007F0C05 /* 45.46MHz */
+#define VX855_46_000M 0x00670C04
+#define VX855_46_996M 0x00690C04
+#define VX855_48_000M 0x00860C05
+#define VX855_48_875M 0x00890C05
+#define VX855_49_500M 0x00530C03
+#define VX855_52_406M 0x00580C03
+#define VX855_52_977M 0x00940C05
+#define VX855_56_250M 0x009D0C05
+#define VX855_60_466M 0x00A90C05
+#define VX855_61_500M 0x00AC0C05
+#define VX855_65_000M 0x006D0C03
+#define VX855_65_178M 0x00B60C05
+#define VX855_66_750M 0x00700C03 /*67.116MHz */
+#define VX855_67_295M 0x00BC0C05
+#define VX855_68_179M 0x00BF0C05
+#define VX855_68_369M 0x00BF0C05
+#define VX855_69_924M 0x00C30C05
+#define VX855_70_159M 0x00C30C05
+#define VX855_72_000M 0x00A10C04
+#define VX855_73_023M 0x00CC0C05
+#define VX855_74_481M 0x00D10C05
+#define VX855_78_750M 0x006E0805
+#define VX855_79_466M 0x006F0805
+#define VX855_80_136M 0x00700805
+#define VX855_81_627M 0x00720805
+#define VX855_83_375M 0x00750805
+#define VX855_83_527M 0x00750805
+#define VX855_83_950M 0x00750805
+#define VX855_84_537M 0x00760805
+#define VX855_84_750M 0x00760805 /* 84.537Mhz */
+#define VX855_85_500M 0x00760805 /* 85.909080 MHz*/
+#define VX855_85_860M 0x00760805
+#define VX855_85_909M 0x00760805
+#define VX855_88_750M 0x007C0805
+#define VX855_89_489M 0x007D0805
+#define VX855_94_500M 0x00840805
+#define VX855_96_648M 0x00870805
+#define VX855_97_750M 0x00890805
+#define VX855_101_000M 0x008D0805
+#define VX855_106_500M 0x00950805
+#define VX855_108_000M 0x00970805
+#define VX855_110_125M 0x00990805
+#define VX855_112_000M 0x009D0805
+#define VX855_113_309M 0x009F0805
+#define VX855_115_000M 0x00A10805
+#define VX855_118_840M 0x00A60805
+#define VX855_119_000M 0x00A70805
+#define VX855_121_750M 0x00AA0805 /* 121.704MHz */
+#define VX855_122_614M 0x00AC0805
+#define VX855_126_266M 0x00B10805
+#define VX855_130_250M 0x00B60805 /* 130.250 */
+#define VX855_135_000M 0x00BD0805
+#define VX855_136_700M 0x00BF0805
+#define VX855_137_750M 0x00C10805
+#define VX855_138_400M 0x00C20805
+#define VX855_144_300M 0x00CA0805
+#define VX855_146_760M 0x00CE0805
+#define VX855_148_500M 0x00D00805
+#define VX855_153_920M 0x00540402
+#define VX855_156_000M 0x006C0405
+#define VX855_156_867M 0x006E0405
+#define VX855_157_500M 0x006E0405
+#define VX855_162_000M 0x00710405
+#define VX855_172_798M 0x00790405
+#define VX855_187_000M 0x00830405
+#define VX855_193_295M 0x00870405
+#define VX855_202_500M 0x008E0405
+#define VX855_204_000M 0x008F0405
+#define VX855_218_500M 0x00990405
+#define VX855_229_500M 0x00A10405
+#define VX855_234_000M 0x00A40405
+#define VX855_267_250M 0x00BB0405
+#define VX855_297_500M 0x00D00405
+#define VX855_339_500M 0x00770005
+#define VX855_340_772M 0x00770005
+
+
/* Definition CRTC Timing Index */
#define H_TOTAL_INDEX 0
#define H_ADDR_INDEX 1
diff --git a/drivers/video/via/via_i2c.c b/drivers/video/via/via_i2c.c
index 0f3ed4e..15543e9 100644
--- a/drivers/video/via/via_i2c.c
+++ b/drivers/video/via/via_i2c.c
@@ -97,7 +97,7 @@
mm1[0] = index;
msgs[0].len = 1; msgs[1].len = 1;
msgs[0].buf = mm1; msgs[1].buf = pdata;
- i2c_transfer(&viaparinfo->i2c_stuff.adapter, msgs, 2);
+ i2c_transfer(&viaparinfo->shared->i2c_stuff.adapter, msgs, 2);
return 0;
}
@@ -111,7 +111,7 @@
msgs.addr = slave_addr / 2;
msgs.len = 2;
msgs.buf = msg;
- return i2c_transfer(&viaparinfo->i2c_stuff.adapter, &msgs, 1);
+ return i2c_transfer(&viaparinfo->shared->i2c_stuff.adapter, &msgs, 1);
}
int viafb_i2c_readbytes(u8 slave_addr, u8 index, u8 *buff, int buff_len)
@@ -125,53 +125,53 @@
mm1[0] = index;
msgs[0].len = 1; msgs[1].len = buff_len;
msgs[0].buf = mm1; msgs[1].buf = buff;
- i2c_transfer(&viaparinfo->i2c_stuff.adapter, msgs, 2);
+ i2c_transfer(&viaparinfo->shared->i2c_stuff.adapter, msgs, 2);
return 0;
}
int viafb_create_i2c_bus(void *viapar)
{
int ret;
- struct viafb_par *par = (struct viafb_par *)viapar;
+ struct via_i2c_stuff *i2c_stuff =
+ &((struct viafb_par *)viapar)->shared->i2c_stuff;
- strcpy(par->i2c_stuff.adapter.name, "via_i2c");
- par->i2c_stuff.i2c_port = 0x0;
- par->i2c_stuff.adapter.owner = THIS_MODULE;
- par->i2c_stuff.adapter.id = 0x01FFFF;
- par->i2c_stuff.adapter.class = 0;
- par->i2c_stuff.adapter.algo_data = &par->i2c_stuff.algo;
- par->i2c_stuff.adapter.dev.parent = NULL;
- par->i2c_stuff.algo.setsda = via_i2c_setsda;
- par->i2c_stuff.algo.setscl = via_i2c_setscl;
- par->i2c_stuff.algo.getsda = via_i2c_getsda;
- par->i2c_stuff.algo.getscl = via_i2c_getscl;
- par->i2c_stuff.algo.udelay = 40;
- par->i2c_stuff.algo.timeout = 20;
- par->i2c_stuff.algo.data = &par->i2c_stuff;
+ strcpy(i2c_stuff->adapter.name, "via_i2c");
+ i2c_stuff->i2c_port = 0x0;
+ i2c_stuff->adapter.owner = THIS_MODULE;
+ i2c_stuff->adapter.id = 0x01FFFF;
+ i2c_stuff->adapter.class = 0;
+ i2c_stuff->adapter.algo_data = &i2c_stuff->algo;
+ i2c_stuff->adapter.dev.parent = NULL;
+ i2c_stuff->algo.setsda = via_i2c_setsda;
+ i2c_stuff->algo.setscl = via_i2c_setscl;
+ i2c_stuff->algo.getsda = via_i2c_getsda;
+ i2c_stuff->algo.getscl = via_i2c_getscl;
+ i2c_stuff->algo.udelay = 40;
+ i2c_stuff->algo.timeout = 20;
+ i2c_stuff->algo.data = i2c_stuff;
- i2c_set_adapdata(&par->i2c_stuff.adapter, &par->i2c_stuff);
+ i2c_set_adapdata(&i2c_stuff->adapter, i2c_stuff);
/* Raise SCL and SDA */
- par->i2c_stuff.i2c_port = I2CPORTINDEX;
- via_i2c_setsda(&par->i2c_stuff, 1);
- via_i2c_setscl(&par->i2c_stuff, 1);
+ i2c_stuff->i2c_port = I2CPORTINDEX;
+ via_i2c_setsda(i2c_stuff, 1);
+ via_i2c_setscl(i2c_stuff, 1);
- par->i2c_stuff.i2c_port = GPIOPORTINDEX;
- via_i2c_setsda(&par->i2c_stuff, 1);
- via_i2c_setscl(&par->i2c_stuff, 1);
+ i2c_stuff->i2c_port = GPIOPORTINDEX;
+ via_i2c_setsda(i2c_stuff, 1);
+ via_i2c_setscl(i2c_stuff, 1);
udelay(20);
- ret = i2c_bit_add_bus(&par->i2c_stuff.adapter);
+ ret = i2c_bit_add_bus(&i2c_stuff->adapter);
if (ret == 0)
- DEBUG_MSG("I2C bus %s registered.\n",
- par->i2c_stuff.adapter.name);
+ DEBUG_MSG("I2C bus %s registered.\n", i2c_stuff->adapter.name);
else
DEBUG_MSG("Failed to register I2C bus %s.\n",
- par->i2c_stuff.adapter.name);
+ i2c_stuff->adapter.name);
return ret;
}
void viafb_delete_i2c_buss(void *par)
{
- i2c_del_adapter(&((struct viafb_par *)par)->i2c_stuff.adapter);
+ i2c_del_adapter(&((struct viafb_par *)par)->shared->i2c_stuff.adapter);
}
diff --git a/drivers/video/via/viafbdev.c b/drivers/video/via/viafbdev.c
index 72833f3..56ec696 100644
--- a/drivers/video/via/viafbdev.c
+++ b/drivers/video/via/viafbdev.c
@@ -20,11 +20,12 @@
*/
#include <linux/module.h>
+#include <linux/seq_file.h>
+#include <linux/stat.h>
#define _MASTER_FILE
#include "global.h"
-static int MAX_CURS = 32;
static struct fb_var_screeninfo default_var;
static char *viafb_name = "Via";
static u32 pseudo_pal[17];
@@ -33,12 +34,11 @@
static char *viafb_mode = "640x480";
static char *viafb_mode1 = "640x480";
+static int viafb_accel = 1;
+
/* Added for specifying active devices.*/
char *viafb_active_dev = "";
-/* Added for specifying video on devices.*/
-char *viafb_video_dev = "";
-
/*Added for specify lcd output port*/
char *viafb_lcd_port = "";
char *viafb_dvi_port = "";
@@ -50,71 +50,20 @@
*sec_var);
static void retrieve_device_setting(struct viafb_ioctl_setting
*setting_info);
-static void viafb_set_video_device(u32 video_dev_info);
-static void viafb_get_video_device(u32 *video_dev_info);
-
-/* Mode information */
-static const struct viafb_modeinfo viafb_modentry[] = {
- {480, 640, VIA_RES_480X640},
- {640, 480, VIA_RES_640X480},
- {800, 480, VIA_RES_800X480},
- {800, 600, VIA_RES_800X600},
- {1024, 768, VIA_RES_1024X768},
- {1152, 864, VIA_RES_1152X864},
- {1280, 1024, VIA_RES_1280X1024},
- {1600, 1200, VIA_RES_1600X1200},
- {1440, 1050, VIA_RES_1440X1050},
- {1280, 768, VIA_RES_1280X768,},
- {1280, 800, VIA_RES_1280X800},
- {1280, 960, VIA_RES_1280X960},
- {1920, 1440, VIA_RES_1920X1440},
- {848, 480, VIA_RES_848X480},
- {1400, 1050, VIA_RES_1400X1050},
- {720, 480, VIA_RES_720X480},
- {720, 576, VIA_RES_720X576},
- {1024, 512, VIA_RES_1024X512},
- {1024, 576, VIA_RES_1024X576},
- {1024, 600, VIA_RES_1024X600},
- {1280, 720, VIA_RES_1280X720},
- {1920, 1080, VIA_RES_1920X1080},
- {1366, 768, VIA_RES_1368X768},
- {1680, 1050, VIA_RES_1680X1050},
- {960, 600, VIA_RES_960X600},
- {1000, 600, VIA_RES_1000X600},
- {1024, 576, VIA_RES_1024X576},
- {1024, 600, VIA_RES_1024X600},
- {1088, 612, VIA_RES_1088X612},
- {1152, 720, VIA_RES_1152X720},
- {1200, 720, VIA_RES_1200X720},
- {1280, 600, VIA_RES_1280X600},
- {1360, 768, VIA_RES_1360X768},
- {1440, 900, VIA_RES_1440X900},
- {1600, 900, VIA_RES_1600X900},
- {1600, 1024, VIA_RES_1600X1024},
- {1792, 1344, VIA_RES_1792X1344},
- {1856, 1392, VIA_RES_1856X1392},
- {1920, 1200, VIA_RES_1920X1200},
- {2048, 1536, VIA_RES_2048X1536},
- {0, 0, VIA_RES_INVALID}
-};
static struct fb_ops viafb_ops;
-static int viafb_update_fix(struct fb_fix_screeninfo *fix, struct fb_info *info)
+
+static void viafb_update_fix(struct fb_info *info)
{
- struct viafb_par *ppar;
- ppar = info->par;
+ u32 bpp = info->var.bits_per_pixel;
- DEBUG_MSG(KERN_INFO "viafb_update_fix!\n");
-
- fix->visual =
- ppar->bpp == 8 ? FB_VISUAL_PSEUDOCOLOR : FB_VISUAL_TRUECOLOR;
- fix->line_length = ppar->linelength;
-
- return 0;
+ info->fix.visual =
+ bpp == 8 ? FB_VISUAL_PSEUDOCOLOR : FB_VISUAL_TRUECOLOR;
+ info->fix.line_length =
+ ((info->var.xres_virtual + 7) & ~7) * bpp / 8;
}
-
static void viafb_setup_fixinfo(struct fb_fix_screeninfo *fix,
struct viafb_par *viaparinfo)
{
@@ -123,8 +72,6 @@
fix->smem_start = viaparinfo->fbmem;
fix->smem_len = viaparinfo->fbmem_free;
- fix->mmio_start = viaparinfo->mmio_base;
- fix->mmio_len = viaparinfo->mmio_len;
fix->type = FB_TYPE_PACKED_PIXELS;
fix->type_aux = 0;
@@ -147,28 +94,12 @@
return 0;
}
-static void viafb_update_viafb_par(struct fb_info *info)
-{
- struct viafb_par *ppar;
-
- ppar = info->par;
- ppar->bpp = info->var.bits_per_pixel;
- ppar->linelength = ((info->var.xres_virtual + 7) & ~7) * ppar->bpp / 8;
- ppar->hres = info->var.xres;
- ppar->vres = info->var.yres;
- ppar->xoffset = info->var.xoffset;
- ppar->yoffset = info->var.yoffset;
-}
-
static int viafb_check_var(struct fb_var_screeninfo *var,
struct fb_info *info)
{
int vmode_index, htotal, vtotal;
- struct viafb_par *ppar;
+ struct viafb_par *ppar = info->par;
u32 long_refresh;
- struct viafb_par *p_viafb_par;
- ppar = info->par;
-
DEBUG_MSG(KERN_INFO "viafb_check_var!\n");
/* Sanity check */
@@ -212,23 +143,21 @@
/* Adjust var according to our driver's own table */
viafb_fill_var_timing_info(var, viafb_refresh, vmode_index);
-
- /* This is indeed a patch for VT3353 */
- if (!info->par)
- return -1;
- p_viafb_par = (struct viafb_par *)info->par;
- if (p_viafb_par->chip_info->gfx_chip_name == UNICHROME_VX800)
- var->accel_flags = 0;
+ if (info->var.accel_flags & FB_ACCELF_TEXT &&
+ !ppar->shared->engine_mmio)
+ info->var.accel_flags = 0;
return 0;
}
static int viafb_set_par(struct fb_info *info)
{
+ struct viafb_par *viapar = info->par;
int vmode_index;
int vmode_index1 = 0;
DEBUG_MSG(KERN_INFO "viafb_set_par!\n");
+ viapar->depth = fb_get_color_depth(&info->var, &info->fix);
viafb_update_device_setting(info->var.xres, info->var.yres,
info->var.bits_per_pixel, viafb_refresh, 0);
@@ -252,21 +181,12 @@
info->var.bits_per_pixel, vmode_index1,
viafb_second_xres, viafb_second_yres, viafb_bpp1);
- /*We should set memory offset according virtual_x */
- /*Fix me:put this function into viafb_setmode */
- viafb_memory_pitch_patch(info);
-
- /* Update ***fb_par information */
- viafb_update_viafb_par(info);
-
- /* Update other fixed information */
- viafb_update_fix(&info->fix, info);
+ viafb_update_fix(info);
viafb_bpp = info->var.bits_per_pixel;
- /* Update viafb_accel, it is necessary to our 2D accelerate */
- viafb_accel = info->var.accel_flags;
-
- if (viafb_accel)
- viafb_set_2d_color_depth(info->var.bits_per_pixel);
+ if (info->var.accel_flags & FB_ACCELF_TEXT)
+ info->flags &= ~FBINFO_HWACCEL_DISABLED;
+ else
+ info->flags |= FBINFO_HWACCEL_DISABLED;
}
return 0;
@@ -503,12 +423,7 @@
var->bits_per_pixel / 16;
DEBUG_MSG(KERN_INFO "\nviafb_pan_display,offset =%d ", offset);
-
- viafb_write_reg_mask(0x48, 0x3d4, ((offset >> 24) & 0x3), 0x3);
- viafb_write_reg_mask(0x34, 0x3d4, ((offset >> 16) & 0xff), 0xff);
- viafb_write_reg_mask(0x0c, 0x3d4, ((offset >> 8) & 0xff), 0xff);
- viafb_write_reg_mask(0x0d, 0x3d4, (offset & 0xff), 0xff);
-
+ viafb_set_primary_address(offset);
return 0;
}
@@ -560,7 +475,6 @@
u32 __user *argp = (u32 __user *) arg;
u32 gpu32;
- u32 video_dev_info = 0;
DEBUG_MSG(KERN_INFO "viafb_ioctl: 0x%X !!\n", cmd);
memset(&u, 0, sizeof(u));
@@ -792,15 +706,6 @@
if (put_user(state_info, argp))
return -EFAULT;
break;
- case VIAFB_SET_VIDEO_DEVICE:
- get_user(video_dev_info, argp);
- viafb_set_video_device(video_dev_info);
- break;
- case VIAFB_GET_VIDEO_DEVICE:
- viafb_get_video_device(&video_dev_info);
- if (put_user(video_dev_info, argp))
- return -EFAULT;
- break;
case VIAFB_SYNC_SURFACE:
DEBUG_MSG(KERN_INFO "lobo VIAFB_SYNC_SURFACE\n");
break;
@@ -866,10 +771,12 @@
static void viafb_fillrect(struct fb_info *info,
const struct fb_fillrect *rect)
{
- u32 col = 0, rop = 0;
- int pitch;
+ struct viafb_par *viapar = info->par;
+ struct viafb_shared *shared = viapar->shared;
+ u32 fg_color;
+ u8 rop;
- if (!viafb_accel) {
+ if (info->flags & FBINFO_HWACCEL_DISABLED || !shared->hw_bitblt) {
cfb_fillrect(info, rect);
return;
}
@@ -877,68 +784,31 @@
if (!rect->width || !rect->height)
return;
- switch (rect->rop) {
- case ROP_XOR:
+ if (info->fix.visual == FB_VISUAL_TRUECOLOR)
+ fg_color = ((u32 *)info->pseudo_palette)[rect->color];
+ else
+ fg_color = rect->color;
+
+ if (rect->rop == ROP_XOR)
rop = 0x5A;
- break;
- case ROP_COPY:
- default:
+ else
rop = 0xF0;
- break;
- }
- switch (info->var.bits_per_pixel) {
- case 8:
- col = rect->color;
- break;
- case 16:
- col = ((u32 *) (info->pseudo_palette))[rect->color];
- break;
- case 32:
- col = ((u32 *) (info->pseudo_palette))[rect->color];
- break;
- }
-
- /* BitBlt Source Address */
- writel(0x0, viaparinfo->io_virt + VIA_REG_SRCPOS);
- /* Source Base Address */
- writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
- /* Destination Base Address */
- writel(((unsigned long) (info->screen_base) -
- (unsigned long) viafb_FB_MM) >> 3,
- viaparinfo->io_virt + VIA_REG_DSTBASE);
- /* Pitch */
- pitch = (info->var.xres_virtual + 7) & ~7;
- writel(VIA_PITCH_ENABLE |
- (((pitch *
- info->var.bits_per_pixel >> 3) >> 3) |
- (((pitch * info->
- var.bits_per_pixel >> 3) >> 3) << 16)),
- viaparinfo->io_virt + VIA_REG_PITCH);
- /* BitBlt Destination Address */
- writel(((rect->dy << 16) | rect->dx),
- viaparinfo->io_virt + VIA_REG_DSTPOS);
- /* Dimension: width & height */
- writel((((rect->height - 1) << 16) | (rect->width - 1)),
- viaparinfo->io_virt + VIA_REG_DIMENSION);
- /* Forground color or Destination color */
- writel(col, viaparinfo->io_virt + VIA_REG_FGCOLOR);
- /* GE Command */
- writel((0x01 | 0x2000 | (rop << 24)),
- viaparinfo->io_virt + VIA_REG_GECMD);
-
+ DEBUG_MSG(KERN_DEBUG "viafb 2D engine: fillrect\n");
+ if (shared->hw_bitblt(shared->engine_mmio, VIA_BITBLT_FILL,
+ rect->width, rect->height, info->var.bits_per_pixel,
+ viapar->vram_addr, info->fix.line_length, rect->dx, rect->dy,
+ NULL, 0, 0, 0, 0, fg_color, 0, rop))
+ cfb_fillrect(info, rect);
}
static void viafb_copyarea(struct fb_info *info,
const struct fb_copyarea *area)
{
- u32 dy = area->dy, sy = area->sy, direction = 0x0;
- u32 sx = area->sx, dx = area->dx, width = area->width;
- int pitch;
+ struct viafb_par *viapar = info->par;
+ struct viafb_shared *shared = viapar->shared;
- DEBUG_MSG(KERN_INFO "viafb_copyarea!!\n");
-
- if (!viafb_accel) {
+ if (info->flags & FBINFO_HWACCEL_DISABLED || !shared->hw_bitblt) {
cfb_copyarea(info, area);
return;
}
@@ -946,263 +816,148 @@
if (!area->width || !area->height)
return;
- if (sy < dy) {
- dy += area->height - 1;
- sy += area->height - 1;
- direction |= 0x4000;
- }
-
- if (sx < dx) {
- dx += width - 1;
- sx += width - 1;
- direction |= 0x8000;
- }
-
- /* Source Base Address */
- writel(((unsigned long) (info->screen_base) -
- (unsigned long) viafb_FB_MM) >> 3,
- viaparinfo->io_virt + VIA_REG_SRCBASE);
- /* Destination Base Address */
- writel(((unsigned long) (info->screen_base) -
- (unsigned long) viafb_FB_MM) >> 3,
- viaparinfo->io_virt + VIA_REG_DSTBASE);
- /* Pitch */
- pitch = (info->var.xres_virtual + 7) & ~7;
- /* VIA_PITCH_ENABLE can be omitted now. */
- writel(VIA_PITCH_ENABLE |
- (((pitch *
- info->var.bits_per_pixel >> 3) >> 3) | (((pitch *
- info->var.
- bits_per_pixel
- >> 3) >> 3)
- << 16)),
- viaparinfo->io_virt + VIA_REG_PITCH);
- /* BitBlt Source Address */
- writel(((sy << 16) | sx), viaparinfo->io_virt + VIA_REG_SRCPOS);
- /* BitBlt Destination Address */
- writel(((dy << 16) | dx), viaparinfo->io_virt + VIA_REG_DSTPOS);
- /* Dimension: width & height */
- writel((((area->height - 1) << 16) | (area->width - 1)),
- viaparinfo->io_virt + VIA_REG_DIMENSION);
- /* GE Command */
- writel((0x01 | direction | (0xCC << 24)),
- viaparinfo->io_virt + VIA_REG_GECMD);
-
+ DEBUG_MSG(KERN_DEBUG "viafb 2D engine: copyarea\n");
+ if (shared->hw_bitblt(shared->engine_mmio, VIA_BITBLT_COLOR,
+ area->width, area->height, info->var.bits_per_pixel,
+ viapar->vram_addr, info->fix.line_length, area->dx, area->dy,
+ NULL, viapar->vram_addr, info->fix.line_length,
+ area->sx, area->sy, 0, 0, 0))
+ cfb_copyarea(info, area);
}
static void viafb_imageblit(struct fb_info *info,
const struct fb_image *image)
{
- u32 size, bg_col = 0, fg_col = 0, *udata;
- int i;
- int pitch;
+ struct viafb_par *viapar = info->par;
+ struct viafb_shared *shared = viapar->shared;
+ u32 fg_color = 0, bg_color = 0;
+ u8 op;
- if (!viafb_accel) {
+ if (info->flags & FBINFO_HWACCEL_DISABLED || !shared->hw_bitblt ||
+ (image->depth != 1 && image->depth != viapar->depth)) {
cfb_imageblit(info, image);
return;
}
- udata = (u32 *) image->data;
+ if (image->depth == 1) {
+ op = VIA_BITBLT_MONO;
+ if (info->fix.visual == FB_VISUAL_TRUECOLOR) {
+ fg_color =
+ ((u32 *)info->pseudo_palette)[image->fg_color];
+ bg_color =
+ ((u32 *)info->pseudo_palette)[image->bg_color];
+ } else {
+ fg_color = image->fg_color;
+ bg_color = image->bg_color;
+ }
+ } else
+ op = VIA_BITBLT_COLOR;
- switch (info->var.bits_per_pixel) {
- case 8:
- bg_col = image->bg_color;
- fg_col = image->fg_color;
- break;
- case 16:
- bg_col = ((u32 *) (info->pseudo_palette))[image->bg_color];
- fg_col = ((u32 *) (info->pseudo_palette))[image->fg_color];
- break;
- case 32:
- bg_col = ((u32 *) (info->pseudo_palette))[image->bg_color];
- fg_col = ((u32 *) (info->pseudo_palette))[image->fg_color];
- break;
- }
- size = image->width * image->height;
-
- /* Source Base Address */
- writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
- /* Destination Base Address */
- writel(((unsigned long) (info->screen_base) -
- (unsigned long) viafb_FB_MM) >> 3,
- viaparinfo->io_virt + VIA_REG_DSTBASE);
- /* Pitch */
- pitch = (info->var.xres_virtual + 7) & ~7;
- writel(VIA_PITCH_ENABLE |
- (((pitch *
- info->var.bits_per_pixel >> 3) >> 3) | (((pitch *
- info->var.
- bits_per_pixel
- >> 3) >> 3)
- << 16)),
- viaparinfo->io_virt + VIA_REG_PITCH);
- /* BitBlt Source Address */
- writel(0x0, viaparinfo->io_virt + VIA_REG_SRCPOS);
- /* BitBlt Destination Address */
- writel(((image->dy << 16) | image->dx),
- viaparinfo->io_virt + VIA_REG_DSTPOS);
- /* Dimension: width & height */
- writel((((image->height - 1) << 16) | (image->width - 1)),
- viaparinfo->io_virt + VIA_REG_DIMENSION);
- /* fb color */
- writel(fg_col, viaparinfo->io_virt + VIA_REG_FGCOLOR);
- /* bg color */
- writel(bg_col, viaparinfo->io_virt + VIA_REG_BGCOLOR);
- /* GE Command */
- writel(0xCC020142, viaparinfo->io_virt + VIA_REG_GECMD);
-
- for (i = 0; i < size / 4; i++) {
- writel(*udata, viaparinfo->io_virt + VIA_MMIO_BLTBASE);
- udata++;
- }
-
+ DEBUG_MSG(KERN_DEBUG "viafb 2D engine: imageblit\n");
+ if (shared->hw_bitblt(shared->engine_mmio, op,
+ image->width, image->height, info->var.bits_per_pixel,
+ viapar->vram_addr, info->fix.line_length, image->dx, image->dy,
+ (u32 *)image->data, 0, 0, 0, 0, fg_color, bg_color, 0))
+ cfb_imageblit(info, image);
}
static int viafb_cursor(struct fb_info *info, struct fb_cursor *cursor)
{
- u32 temp, xx, yy, bg_col = 0, fg_col = 0;
- int i, j = 0;
- static int hw_cursor;
- struct viafb_par *p_viafb_par;
+ struct viafb_par *viapar = info->par;
+ void __iomem *engine = viapar->shared->engine_mmio;
+ u32 temp, xx, yy, bg_color = 0, fg_color = 0,
+ chip_name = viapar->shared->chip_info.gfx_chip_name;
+ int i, j = 0, cur_size = 64;
- if (viafb_accel)
- hw_cursor = 1;
-
- if (!viafb_accel) {
- if (hw_cursor) {
- viafb_show_hw_cursor(info, HW_Cursor_OFF);
- hw_cursor = 0;
- }
- return -ENODEV;
- }
-
- if ((((struct viafb_par *)(info->par))->iga_path == IGA2)
- && (viaparinfo->chip_info->gfx_chip_name == UNICHROME_CLE266))
+ if (info->flags & FBINFO_HWACCEL_DISABLED || info != viafbinfo)
return -ENODEV;
- /* When duoview and using lcd , use soft cursor */
- if (viafb_LCD_ON || ((struct viafb_par *)(info->par))->duoview)
+ if (chip_name == UNICHROME_CLE266 && viapar->iga_path == IGA2)
return -ENODEV;
viafb_show_hw_cursor(info, HW_Cursor_OFF);
- viacursor = *cursor;
if (cursor->set & FB_CUR_SETHOT) {
- viacursor.hot = cursor->hot;
- temp = ((viacursor.hot.x) << 16) + viacursor.hot.y;
- writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_ORG);
+ temp = (cursor->hot.x << 16) + cursor->hot.y;
+ writel(temp, engine + VIA_REG_CURSOR_ORG);
}
if (cursor->set & FB_CUR_SETPOS) {
- viacursor.image.dx = cursor->image.dx;
- viacursor.image.dy = cursor->image.dy;
yy = cursor->image.dy - info->var.yoffset;
xx = cursor->image.dx - info->var.xoffset;
temp = yy & 0xFFFF;
temp |= (xx << 16);
- writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_POS);
+ writel(temp, engine + VIA_REG_CURSOR_POS);
+ }
+
+ if (cursor->image.width <= 32 && cursor->image.height <= 32)
+ cur_size = 32;
+ else if (cursor->image.width <= 64 && cursor->image.height <= 64)
+ cur_size = 64;
+ else {
+ printk(KERN_WARNING "viafb_cursor: The cursor is too large "
+ "%dx%d", cursor->image.width, cursor->image.height);
+ return -ENXIO;
}
if (cursor->set & FB_CUR_SETSIZE) {
- temp = readl(viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
-
- if ((cursor->image.width <= 32)
- && (cursor->image.height <= 32)) {
- MAX_CURS = 32;
+ temp = readl(engine + VIA_REG_CURSOR_MODE);
+ if (cur_size == 32)
temp |= 0x2;
- } else if ((cursor->image.width <= 64)
- && (cursor->image.height <= 64)) {
- MAX_CURS = 64;
- temp &= 0xFFFFFFFD;
- } else {
- DEBUG_MSG(KERN_INFO
- "The cursor image is biger than 64x64 bits...\n");
- return -ENXIO;
- }
- writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+ else
+ temp &= ~0x2;
- viacursor.image.height = cursor->image.height;
- viacursor.image.width = cursor->image.width;
+ writel(temp, engine + VIA_REG_CURSOR_MODE);
}
if (cursor->set & FB_CUR_SETCMAP) {
- viacursor.image.fg_color = cursor->image.fg_color;
- viacursor.image.bg_color = cursor->image.bg_color;
-
- switch (info->var.bits_per_pixel) {
- case 8:
- case 16:
- case 32:
- bg_col =
- (0xFF << 24) |
- (((info->cmap.red)[viacursor.image.bg_color] &
- 0xFF00) << 8) |
- ((info->cmap.green)[viacursor.image.bg_color] &
- 0xFF00) |
- (((info->cmap.blue)[viacursor.image.bg_color] &
- 0xFF00) >> 8);
- fg_col =
- (0xFF << 24) |
- (((info->cmap.red)[viacursor.image.fg_color] &
- 0xFF00) << 8) |
- ((info->cmap.green)[viacursor.image.fg_color] &
- 0xFF00) |
- (((info->cmap.blue)[viacursor.image.fg_color] &
- 0xFF00) >> 8);
- break;
- default:
- return 0;
+ fg_color = cursor->image.fg_color;
+ bg_color = cursor->image.bg_color;
+ if (chip_name == UNICHROME_CX700 ||
+ chip_name == UNICHROME_VX800 ||
+ chip_name == UNICHROME_VX855) {
+ fg_color =
+ ((info->cmap.red[fg_color] & 0xFFC0) << 14) |
+ ((info->cmap.green[fg_color] & 0xFFC0) << 4) |
+ ((info->cmap.blue[fg_color] & 0xFFC0) >> 6);
+ bg_color =
+ ((info->cmap.red[bg_color] & 0xFFC0) << 14) |
+ ((info->cmap.green[bg_color] & 0xFFC0) << 4) |
+ ((info->cmap.blue[bg_color] & 0xFFC0) >> 6);
+ } else {
+ fg_color =
+ ((info->cmap.red[fg_color] & 0xFF00) << 8) |
+ (info->cmap.green[fg_color] & 0xFF00) |
+ ((info->cmap.blue[fg_color] & 0xFF00) >> 8);
+ bg_color =
+ ((info->cmap.red[bg_color] & 0xFF00) << 8) |
+ (info->cmap.green[bg_color] & 0xFF00) |
+ ((info->cmap.blue[bg_color] & 0xFF00) >> 8);
}
- /* This is indeed a patch for VT3324/VT3353 */
- if (!info->par)
- return 0;
- p_viafb_par = (struct viafb_par *)info->par;
-
- if ((p_viafb_par->chip_info->gfx_chip_name ==
- UNICHROME_CX700) ||
- ((p_viafb_par->chip_info->gfx_chip_name ==
- UNICHROME_VX800))) {
- bg_col =
- (((info->cmap.red)[viacursor.image.bg_color] &
- 0xFFC0) << 14) |
- (((info->cmap.green)[viacursor.image.bg_color] &
- 0xFFC0) << 4) |
- (((info->cmap.blue)[viacursor.image.bg_color] &
- 0xFFC0) >> 6);
- fg_col =
- (((info->cmap.red)[viacursor.image.fg_color] &
- 0xFFC0) << 14) |
- (((info->cmap.green)[viacursor.image.fg_color] &
- 0xFFC0) << 4) |
- (((info->cmap.blue)[viacursor.image.fg_color] &
- 0xFFC0) >> 6);
- }
-
- writel(bg_col, viaparinfo->io_virt + VIA_REG_CURSOR_BG);
- writel(fg_col, viaparinfo->io_virt + VIA_REG_CURSOR_FG);
+ writel(bg_color, engine + VIA_REG_CURSOR_BG);
+ writel(fg_color, engine + VIA_REG_CURSOR_FG);
}
if (cursor->set & FB_CUR_SETSHAPE) {
struct {
- u8 data[CURSOR_SIZE / 8];
- u32 bak[CURSOR_SIZE / 32];
+ u8 data[CURSOR_SIZE];
+ u32 bak[CURSOR_SIZE / 4];
} *cr_data = kzalloc(sizeof(*cr_data), GFP_ATOMIC);
- int size =
- ((viacursor.image.width + 7) >> 3) *
- viacursor.image.height;
+ int size = ((cursor->image.width + 7) >> 3) *
+ cursor->image.height;
- if (cr_data == NULL)
- goto out;
+ if (!cr_data)
+ return -ENOMEM;
- if (MAX_CURS == 32) {
- for (i = 0; i < (CURSOR_SIZE / 32); i++) {
+ if (cur_size == 32) {
+ for (i = 0; i < (CURSOR_SIZE / 4); i++) {
cr_data->bak[i] = 0x0;
cr_data->bak[i + 1] = 0xFFFFFFFF;
i += 1;
}
- } else if (MAX_CURS == 64) {
- for (i = 0; i < (CURSOR_SIZE / 32); i++) {
+ } else {
+ for (i = 0; i < (CURSOR_SIZE / 4); i++) {
cr_data->bak[i] = 0x0;
cr_data->bak[i + 1] = 0x0;
cr_data->bak[i + 2] = 0xFFFFFFFF;
@@ -1211,27 +966,27 @@
}
}
- switch (viacursor.rop) {
+ switch (cursor->rop) {
case ROP_XOR:
for (i = 0; i < size; i++)
- cr_data->data[i] = viacursor.mask[i];
+ cr_data->data[i] = cursor->mask[i];
break;
case ROP_COPY:
for (i = 0; i < size; i++)
- cr_data->data[i] = viacursor.mask[i];
+ cr_data->data[i] = cursor->mask[i];
break;
default:
break;
}
- if (MAX_CURS == 32) {
+ if (cur_size == 32) {
for (i = 0; i < size; i++) {
cr_data->bak[j] = (u32) cr_data->data[i];
cr_data->bak[j + 1] = ~cr_data->bak[j];
j += 2;
}
- } else if (MAX_CURS == 64) {
+ } else {
for (i = 0; i < size; i++) {
cr_data->bak[j] = (u32) cr_data->data[i];
cr_data->bak[j + 1] = 0x0;
@@ -1241,14 +996,12 @@
}
}
- memcpy(((struct viafb_par *)(info->par))->fbmem_virt +
- ((struct viafb_par *)(info->par))->cursor_start,
- cr_data->bak, CURSOR_SIZE);
-out:
+ memcpy_toio(viafbinfo->screen_base + viapar->shared->
+ cursor_vram_addr, cr_data->bak, CURSOR_SIZE);
kfree(cr_data);
}
- if (viacursor.enable)
+ if (cursor->enable)
viafb_show_hw_cursor(info, HW_Cursor_ON);
return 0;
@@ -1256,8 +1009,8 @@
static int viafb_sync(struct fb_info *info)
{
- if (viafb_accel)
- viafb_wait_engine_idle();
+ if (!(info->flags & FBINFO_HWACCEL_DISABLED))
+ viafb_wait_engine_idle(info);
return 0;
}
@@ -1266,12 +1019,16 @@
u32 i;
DEBUG_MSG(KERN_INFO "viafb_get_mode_index!\n");
- for (i = 0; viafb_modentry[i].mode_index != VIA_RES_INVALID; i++)
- if (viafb_modentry[i].xres == hres &&
- viafb_modentry[i].yres == vres)
+ for (i = 0; i < NUM_TOTAL_MODETABLE; i++)
+ if (CLE266Modes[i].mode_array &&
+ CLE266Modes[i].crtc[0].crtc.hor_addr == hres &&
+ CLE266Modes[i].crtc[0].crtc.ver_addr == vres)
break;
- return viafb_modentry[i].mode_index;
+ if (i == NUM_TOTAL_MODETABLE)
+ return VIA_RES_INVALID;
+
+ return CLE266Modes[i].ModeIndex;
}
static void check_available_device_to_enable(int device_id)
@@ -1375,36 +1132,11 @@
viafb_SAMM_ON = active_dev.samm;
viafb_primary_dev = active_dev.primary_dev;
- viafb_set_start_addr();
+ viafb_set_primary_address(0);
+ viafb_set_secondary_address(viafb_SAMM_ON ? viafb_second_offset : 0);
viafb_set_iga_path();
}
-static void viafb_set_video_device(u32 video_dev_info)
-{
- viaparinfo->video_on_crt = STATE_OFF;
- viaparinfo->video_on_dvi = STATE_OFF;
- viaparinfo->video_on_lcd = STATE_OFF;
-
- /* Check available device to enable: */
- if ((video_dev_info & CRT_Device) == CRT_Device)
- viaparinfo->video_on_crt = STATE_ON;
- else if ((video_dev_info & DVI_Device) == DVI_Device)
- viaparinfo->video_on_dvi = STATE_ON;
- else if ((video_dev_info & LCD_Device) == LCD_Device)
- viaparinfo->video_on_lcd = STATE_ON;
-}
-
-static void viafb_get_video_device(u32 *video_dev_info)
-{
- *video_dev_info = None_Device;
- if (viaparinfo->video_on_crt == STATE_ON)
- *video_dev_info |= CRT_Device;
- else if (viaparinfo->video_on_dvi == STATE_ON)
- *video_dev_info |= DVI_Device;
- else if (viaparinfo->video_on_lcd == STATE_ON)
- *video_dev_info |= LCD_Device;
-}
-
static int get_primary_device(void)
{
int primary_device = 0;
@@ -1446,18 +1178,6 @@
return primary_device;
}
-static u8 is_duoview(void)
-{
- if (0 == viafb_SAMM_ON) {
- if (viafb_LCD_ON + viafb_LCD2_ON +
- viafb_DVI_ON + viafb_CRT_ON == 2)
- return true;
- return false;
- } else {
- return false;
- }
-}
-
static void apply_second_mode_setting(struct fb_var_screeninfo
*sec_var)
{
@@ -1559,14 +1279,13 @@
if (viafb_SAMM_ON)
viafb_primary_dev = setting_info.primary_device;
- viafb_set_start_addr();
+ viafb_set_primary_address(0);
+ viafb_set_secondary_address(viafb_SAMM_ON ? viafb_second_offset : 0);
viafb_set_iga_path();
}
need_set_mode = 1;
}
- viaparinfo->duoview = is_duoview();
-
if (!need_set_mode) {
;
} else {
@@ -1589,18 +1308,6 @@
setting_info->device_status |= LCD_Device;
if (viafb_LCD2_ON == 1)
setting_info->device_status |= LCD2_Device;
- if ((viaparinfo->video_on_crt == 1) && (viafb_CRT_ON == 1)) {
- setting_info->video_device_status =
- viaparinfo->crt_setting_info->iga_path;
- } else if ((viaparinfo->video_on_dvi == 1) && (viafb_DVI_ON == 1)) {
- setting_info->video_device_status =
- viaparinfo->tmds_setting_info->iga_path;
- } else if ((viaparinfo->video_on_lcd == 1) && (viafb_LCD_ON == 1)) {
- setting_info->video_device_status =
- viaparinfo->lvds_setting_info->iga_path;
- } else {
- setting_info->video_device_status = 0;
- }
setting_info->samm_status = viafb_SAMM_ON;
setting_info->primary_device = get_primary_device();
@@ -1687,25 +1394,6 @@
viafb_CRT_ON = STATE_ON;
viafb_SAMM_ON = STATE_OFF;
}
- viaparinfo->duoview = is_duoview();
-}
-
-static void parse_video_dev(void)
-{
- viaparinfo->video_on_crt = STATE_OFF;
- viaparinfo->video_on_dvi = STATE_OFF;
- viaparinfo->video_on_lcd = STATE_OFF;
-
- if (!strncmp(viafb_video_dev, "CRT", 3)) {
- /* Video on CRT */
- viaparinfo->video_on_crt = STATE_ON;
- } else if (!strncmp(viafb_video_dev, "DVI", 3)) {
- /* Video on DVI */
- viaparinfo->video_on_dvi = STATE_ON;
- } else if (!strncmp(viafb_video_dev, "LCD", 3)) {
- /* Video on LCD */
- viaparinfo->video_on_lcd = STATE_ON;
- }
}
static int parse_port(char *opt_str, int *output_interface)
@@ -1754,10 +1442,8 @@
* DVP1Driving, DFPHigh, DFPLow CR96, SR2A[5], SR1B[1], SR2A[4], SR1E[2],
* CR9B, SR65, CR97, CR99
*/
-static int viafb_dvp0_proc_read(char *buf, char **start, off_t offset,
-int count, int *eof, void *data)
+static int viafb_dvp0_proc_show(struct seq_file *m, void *v)
{
- int len = 0;
u8 dvp0_data_dri = 0, dvp0_clk_dri = 0, dvp0 = 0;
dvp0_data_dri =
(viafb_read_reg(VIASR, SR2A) & BIT5) >> 4 |
@@ -1766,13 +1452,17 @@
(viafb_read_reg(VIASR, SR2A) & BIT4) >> 3 |
(viafb_read_reg(VIASR, SR1E) & BIT2) >> 2;
dvp0 = viafb_read_reg(VIACR, CR96) & 0x0f;
- len +=
- sprintf(buf + len, "%x %x %x\n", dvp0, dvp0_data_dri, dvp0_clk_dri);
- *eof = 1; /*Inform kernel end of data */
- return len;
+ seq_printf(m, "%x %x %x\n", dvp0, dvp0_data_dri, dvp0_clk_dri);
+ return 0;
}
-static int viafb_dvp0_proc_write(struct file *file,
- const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dvp0_proc_open(struct inode *inode, struct file *file)
+{
+ return single_open(file, viafb_dvp0_proc_show, NULL);
+}
+
+static ssize_t viafb_dvp0_proc_write(struct file *file,
+ const char __user *buffer, size_t count, loff_t *pos)
{
char buf[20], *value, *pbuf;
u8 reg_val = 0;
@@ -1816,21 +1506,33 @@
}
return count;
}
-static int viafb_dvp1_proc_read(char *buf, char **start, off_t offset,
- int count, int *eof, void *data)
+
+static const struct file_operations viafb_dvp0_proc_fops = {
+ .owner = THIS_MODULE,
+ .open = viafb_dvp0_proc_open,
+ .read = seq_read,
+ .llseek = seq_lseek,
+ .release = single_release,
+ .write = viafb_dvp0_proc_write,
+};
+
+static int viafb_dvp1_proc_show(struct seq_file *m, void *v)
{
- int len = 0;
u8 dvp1 = 0, dvp1_data_dri = 0, dvp1_clk_dri = 0;
dvp1 = viafb_read_reg(VIACR, CR9B) & 0x0f;
dvp1_data_dri = (viafb_read_reg(VIASR, SR65) & 0x0c) >> 2;
dvp1_clk_dri = viafb_read_reg(VIASR, SR65) & 0x03;
- len +=
- sprintf(buf + len, "%x %x %x\n", dvp1, dvp1_data_dri, dvp1_clk_dri);
- *eof = 1; /*Inform kernel end of data */
- return len;
+ seq_printf(m, "%x %x %x\n", dvp1, dvp1_data_dri, dvp1_clk_dri);
+ return 0;
}
-static int viafb_dvp1_proc_write(struct file *file,
- const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dvp1_proc_open(struct inode *inode, struct file *file)
+{
+ return single_open(file, viafb_dvp1_proc_show, NULL);
+}
+
+static ssize_t viafb_dvp1_proc_write(struct file *file,
+ const char __user *buffer, size_t count, loff_t *pos)
{
char buf[20], *value, *pbuf;
u8 reg_val = 0;
@@ -1869,18 +1571,30 @@
return count;
}
-static int viafb_dfph_proc_read(char *buf, char **start, off_t offset,
- int count, int *eof, void *data)
+static const struct file_operations viafb_dvp1_proc_fops = {
+ .owner = THIS_MODULE,
+ .open = viafb_dvp1_proc_open,
+ .read = seq_read,
+ .llseek = seq_lseek,
+ .release = single_release,
+ .write = viafb_dvp1_proc_write,
+};
+
+static int viafb_dfph_proc_show(struct seq_file *m, void *v)
{
- int len = 0;
u8 dfp_high = 0;
dfp_high = viafb_read_reg(VIACR, CR97) & 0x0f;
- len += sprintf(buf + len, "%x\n", dfp_high);
- *eof = 1; /*Inform kernel end of data */
- return len;
+ seq_printf(m, "%x\n", dfp_high);
+ return 0;
}
-static int viafb_dfph_proc_write(struct file *file,
- const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dfph_proc_open(struct inode *inode, struct file *file)
+{
+ return single_open(file, viafb_dfph_proc_show, NULL);
+}
+
+static ssize_t viafb_dfph_proc_write(struct file *file,
+ const char __user *buffer, size_t count, loff_t *pos)
{
char buf[20];
u8 reg_val = 0;
@@ -1895,18 +1609,31 @@
viafb_write_reg_mask(CR97, VIACR, reg_val, 0x0f);
return count;
}
-static int viafb_dfpl_proc_read(char *buf, char **start, off_t offset,
- int count, int *eof, void *data)
+
+static const struct file_operations viafb_dfph_proc_fops = {
+ .owner = THIS_MODULE,
+ .open = viafb_dfph_proc_open,
+ .read = seq_read,
+ .llseek = seq_lseek,
+ .release = single_release,
+ .write = viafb_dfph_proc_write,
+};
+
+static int viafb_dfpl_proc_show(struct seq_file *m, void *v)
{
- int len = 0;
u8 dfp_low = 0;
dfp_low = viafb_read_reg(VIACR, CR99) & 0x0f;
- len += sprintf(buf + len, "%x\n", dfp_low);
- *eof = 1; /*Inform kernel end of data */
- return len;
+ seq_printf(m, "%x\n", dfp_low);
+ return 0;
}
-static int viafb_dfpl_proc_write(struct file *file,
- const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dfpl_proc_open(struct inode *inode, struct file *file)
+{
+ return single_open(file, viafb_dfpl_proc_show, NULL);
+}
+
+static ssize_t viafb_dfpl_proc_write(struct file *file,
+ const char __user *buffer, size_t count, loff_t *pos)
{
char buf[20];
u8 reg_val = 0;
@@ -1921,10 +1648,18 @@
viafb_write_reg_mask(CR99, VIACR, reg_val, 0x0f);
return count;
}
-static int viafb_vt1636_proc_read(char *buf, char **start,
- off_t offset, int count, int *eof, void *data)
+
+static const struct file_operations viafb_dfpl_proc_fops = {
+ .owner = THIS_MODULE,
+ .open = viafb_dfpl_proc_open,
+ .read = seq_read,
+ .llseek = seq_lseek,
+ .release = single_release,
+ .write = viafb_dfpl_proc_write,
+};
+
+static int viafb_vt1636_proc_show(struct seq_file *m, void *v)
{
- int len = 0;
u8 vt1636_08 = 0, vt1636_09 = 0;
switch (viaparinfo->chip_info->lvds_chip_info.lvds_chip_name) {
case VT1636_LVDS:
@@ -1934,7 +1669,7 @@
vt1636_09 =
viafb_gpio_i2c_read_lvds(viaparinfo->lvds_setting_info,
&viaparinfo->chip_info->lvds_chip_info, 0x09) & 0x1f;
- len += sprintf(buf + len, "%x %x\n", vt1636_08, vt1636_09);
+ seq_printf(m, "%x %x\n", vt1636_08, vt1636_09);
break;
default:
break;
@@ -1947,16 +1682,21 @@
vt1636_09 =
viafb_gpio_i2c_read_lvds(viaparinfo->lvds_setting_info2,
&viaparinfo->chip_info->lvds_chip_info2, 0x09) & 0x1f;
- len += sprintf(buf + len, " %x %x\n", vt1636_08, vt1636_09);
+ seq_printf(m, " %x %x\n", vt1636_08, vt1636_09);
break;
default:
break;
}
- *eof = 1; /*Inform kernel end of data */
- return len;
+ return 0;
}
-static int viafb_vt1636_proc_write(struct file *file,
- const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_vt1636_proc_open(struct inode *inode, struct file *file)
+{
+ return single_open(file, viafb_vt1636_proc_show, NULL);
+}
+
+static ssize_t viafb_vt1636_proc_write(struct file *file,
+ const char __user *buffer, size_t count, loff_t *pos)
{
char buf[30], *value, *pbuf;
struct IODATA reg_val;
@@ -2045,39 +1785,27 @@
return count;
}
+static const struct file_operations viafb_vt1636_proc_fops = {
+ .owner = THIS_MODULE,
+ .open = viafb_vt1636_proc_open,
+ .read = seq_read,
+ .llseek = seq_lseek,
+ .release = single_release,
+ .write = viafb_vt1636_proc_write,
+};
+
static void viafb_init_proc(struct proc_dir_entry **viafb_entry)
{
- struct proc_dir_entry *entry;
*viafb_entry = proc_mkdir("viafb", NULL);
if (viafb_entry) {
- entry = create_proc_entry("dvp0", 0, *viafb_entry);
- if (entry) {
- entry->read_proc = viafb_dvp0_proc_read;
- entry->write_proc = viafb_dvp0_proc_write;
- }
- entry = create_proc_entry("dvp1", 0, *viafb_entry);
- if (entry) {
- entry->read_proc = viafb_dvp1_proc_read;
- entry->write_proc = viafb_dvp1_proc_write;
- }
- entry = create_proc_entry("dfph", 0, *viafb_entry);
- if (entry) {
- entry->read_proc = viafb_dfph_proc_read;
- entry->write_proc = viafb_dfph_proc_write;
- }
- entry = create_proc_entry("dfpl", 0, *viafb_entry);
- if (entry) {
- entry->read_proc = viafb_dfpl_proc_read;
- entry->write_proc = viafb_dfpl_proc_write;
- }
+ proc_create("dvp0", 0, *viafb_entry, &viafb_dvp0_proc_fops);
+ proc_create("dvp1", 0, *viafb_entry, &viafb_dvp1_proc_fops);
+ proc_create("dfph", 0, *viafb_entry, &viafb_dfph_proc_fops);
+ proc_create("dfpl", 0, *viafb_entry, &viafb_dfpl_proc_fops);
if (VT1636_LVDS == viaparinfo->chip_info->lvds_chip_info.
lvds_chip_name || VT1636_LVDS ==
viaparinfo->chip_info->lvds_chip_info2.lvds_chip_name) {
- entry = create_proc_entry("vt1636", 0, *viafb_entry);
- if (entry) {
- entry->read_proc = viafb_vt1636_proc_read;
- entry->write_proc = viafb_vt1636_proc_write;
- }
+ proc_create("vt1636", 0, *viafb_entry, &viafb_vt1636_proc_fops);
}
}
@@ -2094,51 +1822,61 @@
remove_proc_entry("viafb", NULL);
}
-static int __devinit via_pci_probe(void)
+static void parse_mode(const char *str, u32 *xres, u32 *yres)
{
- unsigned long default_xres, default_yres;
- char *tmpc, *tmpm;
- char *tmpc_sec, *tmpm_sec;
+ char *ptr;
+
+ *xres = simple_strtoul(str, &ptr, 10);
+ if (ptr[0] != 'x')
+ goto out_default;
+
+ *yres = simple_strtoul(&ptr[1], &ptr, 10);
+ if (ptr[0])
+ goto out_default;
+
+ return;
+
+out_default:
+ printk(KERN_WARNING "viafb received invalid mode string: %s\n", str);
+ *xres = 640;
+ *yres = 480;
+}
+
+static int __devinit via_pci_probe(struct pci_dev *pdev,
+ const struct pci_device_id *ent)
+{
+ u32 default_xres, default_yres;
int vmode_index;
- u32 tmds_length, lvds_length, crt_length, chip_length, viafb_par_length;
+ u32 viafb_par_length;
DEBUG_MSG(KERN_INFO "VIAFB PCI Probe!!\n");
viafb_par_length = ALIGN(sizeof(struct viafb_par), BITS_PER_LONG/8);
- tmds_length = ALIGN(sizeof(struct tmds_setting_information),
- BITS_PER_LONG/8);
- lvds_length = ALIGN(sizeof(struct lvds_setting_information),
- BITS_PER_LONG/8);
- crt_length = ALIGN(sizeof(struct lvds_setting_information),
- BITS_PER_LONG/8);
- chip_length = ALIGN(sizeof(struct chip_information), BITS_PER_LONG/8);
/* Allocate fb_info and ***_par here, also including some other needed
* variables
*/
- viafbinfo = framebuffer_alloc(viafb_par_length + 2 * lvds_length +
- tmds_length + crt_length + chip_length, NULL);
+ viafbinfo = framebuffer_alloc(viafb_par_length +
+ ALIGN(sizeof(struct viafb_shared), BITS_PER_LONG/8),
+ &pdev->dev);
if (!viafbinfo) {
printk(KERN_ERR"Could not allocate memory for viafb_info.\n");
return -ENODEV;
}
viaparinfo = (struct viafb_par *)viafbinfo->par;
- viaparinfo->tmds_setting_info = (struct tmds_setting_information *)
- ((unsigned long)viaparinfo + viafb_par_length);
- viaparinfo->lvds_setting_info = (struct lvds_setting_information *)
- ((unsigned long)viaparinfo->tmds_setting_info + tmds_length);
- viaparinfo->lvds_setting_info2 = (struct lvds_setting_information *)
- ((unsigned long)viaparinfo->lvds_setting_info + lvds_length);
- viaparinfo->crt_setting_info = (struct crt_setting_information *)
- ((unsigned long)viaparinfo->lvds_setting_info2 + lvds_length);
- viaparinfo->chip_info = (struct chip_information *)
- ((unsigned long)viaparinfo->crt_setting_info + crt_length);
+ viaparinfo->shared = viafbinfo->par + viafb_par_length;
+ viaparinfo->vram_addr = 0;
+ viaparinfo->tmds_setting_info = &viaparinfo->shared->tmds_setting_info;
+ viaparinfo->lvds_setting_info = &viaparinfo->shared->lvds_setting_info;
+ viaparinfo->lvds_setting_info2 =
+ &viaparinfo->shared->lvds_setting_info2;
+ viaparinfo->crt_setting_info = &viaparinfo->shared->crt_setting_info;
+ viaparinfo->chip_info = &viaparinfo->shared->chip_info;
if (viafb_dual_fb)
viafb_SAMM_ON = 1;
parse_active_dev();
- parse_video_dev();
parse_lcd_port();
parse_dvi_port();
@@ -2149,32 +1887,32 @@
/* Set up I2C bus stuff */
viafb_create_i2c_bus(viaparinfo);
- viafb_init_chip_info();
- viafb_get_fb_info(&viaparinfo->fbmem, &viaparinfo->memsize);
+ viafb_init_chip_info(pdev, ent);
+ viaparinfo->fbmem = pci_resource_start(pdev, 0);
+ viaparinfo->memsize = viafb_get_fb_size_from_pci();
viaparinfo->fbmem_free = viaparinfo->memsize;
viaparinfo->fbmem_used = 0;
- viaparinfo->fbmem_virt = ioremap_nocache(viaparinfo->fbmem,
+ viafbinfo->screen_base = ioremap_nocache(viaparinfo->fbmem,
viaparinfo->memsize);
- viafbinfo->screen_base = (char *)viaparinfo->fbmem_virt;
-
- if (!viaparinfo->fbmem_virt) {
+ if (!viafbinfo->screen_base) {
printk(KERN_INFO "ioremap failed\n");
- return -1;
+ return -ENOMEM;
}
- viafb_get_mmio_info(&viaparinfo->mmio_base, &viaparinfo->mmio_len);
- viaparinfo->io_virt = ioremap_nocache(viaparinfo->mmio_base,
- viaparinfo->mmio_len);
-
+ viafbinfo->fix.mmio_start = pci_resource_start(pdev, 1);
+ viafbinfo->fix.mmio_len = pci_resource_len(pdev, 1);
viafbinfo->node = 0;
viafbinfo->fbops = &viafb_ops;
viafbinfo->flags = FBINFO_DEFAULT | FBINFO_HWACCEL_YPAN;
viafbinfo->pseudo_palette = pseudo_pal;
- if (viafb_accel) {
- viafb_init_accel();
- viafb_init_2d_engine();
- viafb_hw_cursor_init();
+ if (viafb_accel && !viafb_init_engine(viafbinfo)) {
+ viafbinfo->flags |= FBINFO_HWACCEL_COPYAREA |
+ FBINFO_HWACCEL_FILLRECT | FBINFO_HWACCEL_IMAGEBLIT;
+ default_var.accel_flags = FB_ACCELF_TEXT;
+ } else {
+ viafbinfo->flags |= FBINFO_HWACCEL_DISABLED;
+ default_var.accel_flags = 0;
}
if (viafb_second_size && (viafb_second_size < 8)) {
@@ -2186,27 +1924,14 @@
viafb_second_size * 1024 * 1024;
}
- viafb_FB_MM = viaparinfo->fbmem_virt;
- tmpm = viafb_mode;
- tmpc = strsep(&tmpm, "x");
- strict_strtoul(tmpc, 0, &default_xres);
- strict_strtoul(tmpm, 0, &default_yres);
-
+ parse_mode(viafb_mode, &default_xres, &default_yres);
vmode_index = viafb_get_mode_index(default_xres, default_yres);
DEBUG_MSG(KERN_INFO "0->index=%d\n", vmode_index);
if (viafb_SAMM_ON == 1) {
- if (strcmp(viafb_mode, viafb_mode1)) {
- tmpm_sec = viafb_mode1;
- tmpc_sec = strsep(&tmpm_sec, "x");
- strict_strtoul(tmpc_sec, 0,
- (unsigned long *)&viafb_second_xres);
- strict_strtoul(tmpm_sec, 0,
- (unsigned long *)&viafb_second_yres);
- } else {
- viafb_second_xres = default_xres;
- viafb_second_yres = default_yres;
- }
+ parse_mode(viafb_mode1, &viafb_second_xres,
+ &viafb_second_yres);
+
if (0 == viafb_second_virtual_xres) {
switch (viafb_second_xres) {
case 1400:
@@ -2256,18 +1981,9 @@
default_var.lower_margin = 4;
default_var.hsync_len = default_var.left_margin;
default_var.vsync_len = 4;
- default_var.accel_flags = 0;
-
- if (viafb_accel) {
- viafbinfo->flags |=
- (FBINFO_HWACCEL_COPYAREA | FBINFO_HWACCEL_FILLRECT |
- FBINFO_HWACCEL_IMAGEBLIT);
- default_var.accel_flags |= FB_ACCELF_TEXT;
- } else
- viafbinfo->flags |= FBINFO_HWACCEL_DISABLED;
if (viafb_dual_fb) {
- viafbinfo1 = framebuffer_alloc(viafb_par_length, NULL);
+ viafbinfo1 = framebuffer_alloc(viafb_par_length, &pdev->dev);
if (!viafbinfo1) {
printk(KERN_ERR
"allocate the second framebuffer struct error\n");
@@ -2276,11 +1992,10 @@
}
viaparinfo1 = viafbinfo1->par;
memcpy(viaparinfo1, viaparinfo, viafb_par_length);
+ viaparinfo1->vram_addr = viafb_second_offset;
viaparinfo1->memsize = viaparinfo->memsize -
viafb_second_offset;
viaparinfo->memsize = viafb_second_offset;
- viaparinfo1->fbmem_virt = viaparinfo->fbmem_virt +
- viafb_second_offset;
viaparinfo1->fbmem = viaparinfo->fbmem + viafb_second_offset;
viaparinfo1->fbmem_used = viaparinfo->fbmem_used;
@@ -2288,20 +2003,13 @@
viaparinfo1->fbmem_used;
viaparinfo->fbmem_free = viaparinfo->memsize;
viaparinfo->fbmem_used = 0;
- if (viafb_accel) {
- viaparinfo1->cursor_start =
- viaparinfo->cursor_start - viafb_second_offset;
- viaparinfo1->VQ_start = viaparinfo->VQ_start -
- viafb_second_offset;
- viaparinfo1->VQ_end = viaparinfo->VQ_end -
- viafb_second_offset;
- }
+ viaparinfo->iga_path = IGA1;
+ viaparinfo1->iga_path = IGA2;
memcpy(viafbinfo1, viafbinfo, sizeof(struct fb_info));
+ viafbinfo1->par = viaparinfo1;
viafbinfo1->screen_base = viafbinfo->screen_base +
viafb_second_offset;
- viafbinfo1->fix.smem_start = viaparinfo1->fbmem;
- viafbinfo1->fix.smem_len = viaparinfo1->fbmem_free;
default_var.xres = viafb_second_xres;
default_var.yres = viafb_second_yres;
@@ -2323,15 +2031,17 @@
viafb_setup_fixinfo(&viafbinfo1->fix, viaparinfo1);
viafb_check_var(&default_var, viafbinfo1);
viafbinfo1->var = default_var;
- viafb_update_viafb_par(viafbinfo);
- viafb_update_fix(&viafbinfo1->fix, viafbinfo1);
+ viafb_update_fix(viafbinfo1);
+ viaparinfo1->depth = fb_get_color_depth(&viafbinfo1->var,
+ &viafbinfo1->fix);
}
viafb_setup_fixinfo(&viafbinfo->fix, viaparinfo);
viafb_check_var(&default_var, viafbinfo);
viafbinfo->var = default_var;
- viafb_update_viafb_par(viafbinfo);
- viafb_update_fix(&viafbinfo->fix, viafbinfo);
+ viafb_update_fix(viafbinfo);
+ viaparinfo->depth = fb_get_color_depth(&viafbinfo->var,
+ &viafbinfo->fix);
default_var.activate = FB_ACTIVATE_NOW;
fb_alloc_cmap(&viafbinfo->cmap, 256, 0);
@@ -2353,20 +2063,20 @@
viafbinfo->node, viafbinfo->fix.id, default_var.xres,
default_var.yres, default_var.bits_per_pixel);
- viafb_init_proc(&viaparinfo->proc_entry);
+ viafb_init_proc(&viaparinfo->shared->proc_entry);
viafb_init_dac(IGA2);
return 0;
}
-static void __devexit via_pci_remove(void)
+static void __devexit via_pci_remove(struct pci_dev *pdev)
{
DEBUG_MSG(KERN_INFO "via_pci_remove!\n");
fb_dealloc_cmap(&viafbinfo->cmap);
unregister_framebuffer(viafbinfo);
if (viafb_dual_fb)
unregister_framebuffer(viafbinfo1);
- iounmap((void *)viaparinfo->fbmem_virt);
- iounmap(viaparinfo->io_virt);
+ iounmap((void *)viafbinfo->screen_base);
+ iounmap(viaparinfo->shared->engine_mmio);
viafb_delete_i2c_buss(viaparinfo);
@@ -2374,7 +2084,7 @@
if (viafb_dual_fb)
framebuffer_release(viafbinfo1);
- viafb_remove_proc(viaparinfo->proc_entry);
+ viafb_remove_proc(viaparinfo->shared->proc_entry);
}
#ifndef MODULE
@@ -2441,8 +2151,6 @@
else if (!strncmp(this_opt, "viafb_lcd_mode=", 15))
strict_strtoul(this_opt + 15, 0,
(unsigned long *)&viafb_lcd_mode);
- else if (!strncmp(this_opt, "viafb_video_dev=", 16))
- viafb_video_dev = kstrdup(this_opt + 16, GFP_KERNEL);
else if (!strncmp(this_opt, "viafb_lcd_port=", 15))
viafb_lcd_port = kstrdup(this_opt + 15, GFP_KERNEL);
else if (!strncmp(this_opt, "viafb_dvi_port=", 15))
@@ -2452,6 +2160,40 @@
}
#endif
+static struct pci_device_id viafb_pci_table[] __devinitdata = {
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_CLE266_DID),
+ .driver_data = UNICHROME_CLE266 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_PM800_DID),
+ .driver_data = UNICHROME_PM800 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_K400_DID),
+ .driver_data = UNICHROME_K400 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_K800_DID),
+ .driver_data = UNICHROME_K800 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_P4M890_DID),
+ .driver_data = UNICHROME_CN700 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_K8M890_DID),
+ .driver_data = UNICHROME_K8M890 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_CX700_DID),
+ .driver_data = UNICHROME_CX700 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_P4M900_DID),
+ .driver_data = UNICHROME_P4M900 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_CN750_DID),
+ .driver_data = UNICHROME_CN750 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_VX800_DID),
+ .driver_data = UNICHROME_VX800 },
+ { PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_VX855_DID),
+ .driver_data = UNICHROME_VX855 },
+ { }
+};
+MODULE_DEVICE_TABLE(pci, viafb_pci_table);
+
+static struct pci_driver viafb_driver = {
+ .name = "viafb",
+ .id_table = viafb_pci_table,
+ .probe = via_pci_probe,
+ .remove = __devexit_p(via_pci_remove),
+};
+
static int __init viafb_init(void)
{
#ifndef MODULE
@@ -2463,13 +2205,13 @@
printk(KERN_INFO
"VIA Graphics Intergration Chipset framebuffer %d.%d initializing\n",
VERSION_MAJOR, VERSION_MINOR);
- return via_pci_probe();
+ return pci_register_driver(&viafb_driver);
}
static void __exit viafb_exit(void)
{
DEBUG_MSG(KERN_INFO "viafb_exit!\n");
- via_pci_remove();
+ pci_unregister_driver(&viafb_driver);
}
static struct fb_ops viafb_ops = {
@@ -2494,82 +2236,79 @@
module_exit(viafb_exit);
#ifdef MODULE
-module_param(viafb_memsize, int, 0);
+module_param(viafb_memsize, int, S_IRUSR);
-module_param(viafb_mode, charp, 0);
+module_param(viafb_mode, charp, S_IRUSR);
MODULE_PARM_DESC(viafb_mode, "Set resolution (default=640x480)");
-module_param(viafb_mode1, charp, 0);
+module_param(viafb_mode1, charp, S_IRUSR);
MODULE_PARM_DESC(viafb_mode1, "Set resolution (default=640x480)");
-module_param(viafb_bpp, int, 0);
+module_param(viafb_bpp, int, S_IRUSR);
MODULE_PARM_DESC(viafb_bpp, "Set color depth (default=32bpp)");
-module_param(viafb_bpp1, int, 0);
+module_param(viafb_bpp1, int, S_IRUSR);
MODULE_PARM_DESC(viafb_bpp1, "Set color depth (default=32bpp)");
-module_param(viafb_refresh, int, 0);
+module_param(viafb_refresh, int, S_IRUSR);
MODULE_PARM_DESC(viafb_refresh,
"Set CRT viafb_refresh rate (default = 60)");
-module_param(viafb_refresh1, int, 0);
+module_param(viafb_refresh1, int, S_IRUSR);
MODULE_PARM_DESC(viafb_refresh1,
"Set CRT refresh rate (default = 60)");
-module_param(viafb_lcd_panel_id, int, 0);
+module_param(viafb_lcd_panel_id, int, S_IRUSR);
MODULE_PARM_DESC(viafb_lcd_panel_id,
"Set Flat Panel type(Default=1024x768)");
-module_param(viafb_lcd_dsp_method, int, 0);
+module_param(viafb_lcd_dsp_method, int, S_IRUSR);
MODULE_PARM_DESC(viafb_lcd_dsp_method,
"Set Flat Panel display scaling method.(Default=Expandsion)");
-module_param(viafb_SAMM_ON, int, 0);
+module_param(viafb_SAMM_ON, int, S_IRUSR);
MODULE_PARM_DESC(viafb_SAMM_ON,
"Turn on/off flag of SAMM(Default=OFF)");
-module_param(viafb_accel, int, 0);
+module_param(viafb_accel, int, S_IRUSR);
MODULE_PARM_DESC(viafb_accel,
- "Set 2D Hardware Acceleration.(Default = OFF)");
+ "Set 2D Hardware Acceleration: 0 = OFF, 1 = ON (default)");
-module_param(viafb_active_dev, charp, 0);
+module_param(viafb_active_dev, charp, S_IRUSR);
MODULE_PARM_DESC(viafb_active_dev, "Specify active devices.");
-module_param(viafb_display_hardware_layout, int, 0);
+module_param(viafb_display_hardware_layout, int, S_IRUSR);
MODULE_PARM_DESC(viafb_display_hardware_layout,
"Display Hardware Layout (LCD Only, DVI Only...,etc)");
-module_param(viafb_second_size, int, 0);
+module_param(viafb_second_size, int, S_IRUSR);
MODULE_PARM_DESC(viafb_second_size,
"Set secondary device memory size");
-module_param(viafb_dual_fb, int, 0);
+module_param(viafb_dual_fb, int, S_IRUSR);
MODULE_PARM_DESC(viafb_dual_fb,
"Turn on/off flag of dual framebuffer devices.(Default = OFF)");
-module_param(viafb_platform_epia_dvi, int, 0);
+module_param(viafb_platform_epia_dvi, int, S_IRUSR);
MODULE_PARM_DESC(viafb_platform_epia_dvi,
"Turn on/off flag of DVI devices on EPIA board.(Default = OFF)");
-module_param(viafb_device_lcd_dualedge, int, 0);
+module_param(viafb_device_lcd_dualedge, int, S_IRUSR);
MODULE_PARM_DESC(viafb_device_lcd_dualedge,
"Turn on/off flag of dual edge panel.(Default = OFF)");
-module_param(viafb_bus_width, int, 0);
+module_param(viafb_bus_width, int, S_IRUSR);
MODULE_PARM_DESC(viafb_bus_width,
"Set bus width of panel.(Default = 12)");
-module_param(viafb_lcd_mode, int, 0);
+module_param(viafb_lcd_mode, int, S_IRUSR);
MODULE_PARM_DESC(viafb_lcd_mode,
"Set Flat Panel mode(Default=OPENLDI)");
-module_param(viafb_video_dev, charp, 0);
-MODULE_PARM_DESC(viafb_video_dev, "Specify video devices.");
-
-module_param(viafb_lcd_port, charp, 0);
+module_param(viafb_lcd_port, charp, S_IRUSR);
MODULE_PARM_DESC(viafb_lcd_port, "Specify LCD output port.");
-module_param(viafb_dvi_port, charp, 0);
+module_param(viafb_dvi_port, charp, S_IRUSR);
MODULE_PARM_DESC(viafb_dvi_port, "Specify DVI output port.");
MODULE_LICENSE("GPL");
diff --git a/drivers/video/via/viafbdev.h b/drivers/video/via/viafbdev.h
index 227b000..0c94d24 100644
--- a/drivers/video/via/viafbdev.h
+++ b/drivers/video/via/viafbdev.h
@@ -37,51 +37,50 @@
#define VERSION_OS 0 /* 0: for 32 bits OS, 1: for 64 bits OS */
#define VERSION_MINOR 4
-struct viafb_par {
- int bpp;
- int hres;
- int vres;
- int linelength;
- u32 xoffset;
- u32 yoffset;
-
- void __iomem *fbmem_virt; /*framebuffer virtual memory address */
- void __iomem *io_virt; /*iospace virtual memory address */
- unsigned int fbmem; /*framebuffer physical memory address */
- unsigned int memsize; /*size of fbmem */
- unsigned int io; /*io space address */
- unsigned long mmio_base; /*mmio base address */
- unsigned long mmio_len; /*mmio base length */
- u32 fbmem_free; /* Free FB memory */
- u32 fbmem_used; /* Use FB memory size */
- u32 cursor_start; /* Cursor Start Address */
- u32 VQ_start; /* Virtual Queue Start Address */
- u32 VQ_end; /* Virtual Queue End Address */
- u32 iga_path;
+struct viafb_shared {
struct proc_dir_entry *proc_entry; /*viafb proc entry */
- u8 duoview; /*Is working in duoview mode? */
/* I2C stuff */
struct via_i2c_stuff i2c_stuff;
/* All the information will be needed to set engine */
+ struct tmds_setting_information tmds_setting_info;
+ struct crt_setting_information crt_setting_info;
+ struct lvds_setting_information lvds_setting_info;
+ struct lvds_setting_information lvds_setting_info2;
+ struct chip_information chip_info;
+
+ /* hardware acceleration stuff */
+ void __iomem *engine_mmio;
+ u32 cursor_vram_addr;
+ u32 vq_vram_addr; /* virtual queue address in video ram */
+ int (*hw_bitblt)(void __iomem *engine, u8 op, u32 width, u32 height,
+ u8 dst_bpp, u32 dst_addr, u32 dst_pitch, u32 dst_x, u32 dst_y,
+ u32 *src_mem, u32 src_addr, u32 src_pitch, u32 src_x, u32 src_y,
+ u32 fg_color, u32 bg_color, u8 fill_rop);
+};
+
+struct viafb_par {
+ u8 depth;
+ u32 vram_addr;
+
+ unsigned int fbmem; /*framebuffer physical memory address */
+ unsigned int memsize; /*size of fbmem */
+ u32 fbmem_free; /* Free FB memory */
+ u32 fbmem_used; /* Use FB memory size */
+ u32 iga_path;
+
+ struct viafb_shared *shared;
+
+ /* All the information will be needed to set engine */
+ /* depreciated, use the ones in shared directly */
struct tmds_setting_information *tmds_setting_info;
struct crt_setting_information *crt_setting_info;
struct lvds_setting_information *lvds_setting_info;
struct lvds_setting_information *lvds_setting_info2;
struct chip_information *chip_info;
-
- /* some information related to video playing */
- int video_on_crt;
- int video_on_dvi;
- int video_on_lcd;
-
};
-struct viafb_modeinfo {
- u32 xres;
- u32 yres;
- int mode_index;
-};
+
extern unsigned int viafb_second_virtual_yres;
extern unsigned int viafb_second_virtual_xres;
extern unsigned int viafb_second_offset;
@@ -91,14 +90,12 @@
extern int viafb_LCD2_ON;
extern int viafb_LCD_ON;
extern int viafb_DVI_ON;
-extern int viafb_accel;
extern int viafb_hotplug;
extern int viafb_memsize;
extern int strict_strtoul(const char *cp, unsigned int base,
unsigned long *res);
-void viafb_memory_pitch_patch(struct fb_info *info);
void viafb_fill_var_timing_info(struct fb_var_screeninfo *var, int refresh,
int mode_index);
int viafb_get_mode_index(int hres, int vres);
diff --git a/drivers/video/via/viamode.c b/drivers/video/via/viamode.c
index 6dcf583..b74f8a6 100644
--- a/drivers/video/via/viamode.c
+++ b/drivers/video/via/viamode.c
@@ -100,12 +100,8 @@
{VIACR, CR0F, 0xFF, 0x00}, /* Cursor Localtion Low */
{VIACR, CR32, 0xFF, 0x00},
{VIACR, CR33, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
{VIACR, CR35, 0xFF, 0x00},
{VIACR, CR36, 0x08, 0x00},
-{VIACR, CR62, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CR63, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CR64, 0xFF, 0x00}, /* Secondary Display Starting Address */
{VIACR, CR69, 0xFF, 0x00},
{VIACR, CR6A, 0xFF, 0x40},
{VIACR, CR6B, 0xFF, 0x00},
@@ -159,16 +155,12 @@
{VIASR, CR30, 0xFF, 0x04},
{VIACR, CR32, 0xFF, 0x00},
{VIACR, CR33, 0x7F, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
{VIACR, CR35, 0xFF, 0x00},
{VIACR, CR36, 0xFF, 0x31},
{VIACR, CR41, 0xFF, 0x80},
{VIACR, CR42, 0xFF, 0x00},
{VIACR, CR55, 0x80, 0x00},
{VIACR, CR5D, 0x80, 0x00}, /*Horizontal Retrace Start bit[11] should be 0*/
-{VIACR, CR62, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CR63, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CR64, 0xFF, 0x00}, /* Secondary Display Starting Address */
{VIACR, CR68, 0xFF, 0x67}, /* Default FIFO For IGA2 */
{VIACR, CR69, 0xFF, 0x00},
{VIACR, CR6A, 0xFD, 0x40},
@@ -233,9 +225,6 @@
{VIACR, CR55, 0x80, 0x00},
{VIACR, CR5D, 0x80, 0x00},
{VIACR, CR36, 0xFF, 0x01}, /* Power Mangement 3 */
- {VIACR, CR62, 0xFF, 0x00}, /* Secondary Display Starting Address */
- {VIACR, CR63, 0xFF, 0x00}, /* Secondary Display Starting Address */
- {VIACR, CR64, 0xFF, 0x00}, /* Secondary Display Starting Address */
{VIACR, CR68, 0xFF, 0x67}, /* Default FIFO For IGA2 */
{VIACR, CR6A, 0x20, 0x20}, /* Extended FIFO On */
{VIACR, CR7A, 0xFF, 0x01}, /* LCD Scaling Parameter 1 */
@@ -285,14 +274,9 @@
{VIACR, CR0F, 0xFF, 0x00}, /* Cursor Localtion Low */
{VIACR, CR32, 0xFF, 0x00},
{VIACR, CR33, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
{VIACR, CR35, 0xFF, 0x00},
{VIACR, CR36, 0x08, 0x00},
{VIACR, CR47, 0xC8, 0x00}, /* Clear VCK Plus. */
-{VIACR, CR62, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CR63, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CR64, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CRA3, 0xFF, 0x00}, /* Secondary Display Starting Address */
{VIACR, CR69, 0xFF, 0x00},
{VIACR, CR6A, 0xFF, 0x40},
{VIACR, CR6B, 0xFF, 0x00},
@@ -325,69 +309,61 @@
{VIACR, CR96, 0xFF, 0x00},
{VIACR, CR97, 0xFF, 0x00},
{VIACR, CR99, 0xFF, 0x00},
-{VIACR, CR9B, 0xFF, 0x00},
-{VIACR, CRD2, 0xFF, 0xFF} /* TMDS/LVDS control register. */
+{VIACR, CR9B, 0xFF, 0x00}
};
-/* For VT3353: Common Setting for Video Mode */
-struct io_reg VX800_ModeXregs[] = { {VIASR, SR10, 0xFF, 0x01},
+struct io_reg VX855_ModeXregs[] = {
+{VIASR, SR10, 0xFF, 0x01},
{VIASR, SR15, 0x02, 0x02},
{VIASR, SR16, 0xBF, 0x08},
{VIASR, SR17, 0xFF, 0x1F},
{VIASR, SR18, 0xFF, 0x4E},
{VIASR, SR1A, 0xFB, 0x08},
{VIASR, SR1B, 0xFF, 0xF0},
-{VIASR, SR1E, 0xFF, 0x01},
-{VIASR, SR2A, 0xFF, 0x00},
+{VIASR, SR1E, 0x07, 0x01},
+{VIASR, SR2A, 0xF0, 0x00},
+{VIASR, SR58, 0xFF, 0x00},
+{VIASR, SR59, 0xFF, 0x00},
{VIASR, SR2D, 0xFF, 0xFF}, /* VCK and LCK PLL power on. */
+{VIACR, CR09, 0xFF, 0x00}, /* Initial CR09=0*/
+{VIACR, CR11, 0x8F, 0x00}, /* IGA1 initial Vertical end */
+{VIACR, CR17, 0x7F, 0x00}, /* IGA1 CRT Mode control init */
{VIACR, CR0A, 0xFF, 0x1E}, /* Cursor Start */
{VIACR, CR0B, 0xFF, 0x00}, /* Cursor End */
{VIACR, CR0E, 0xFF, 0x00}, /* Cursor Location High */
{VIACR, CR0F, 0xFF, 0x00}, /* Cursor Localtion Low */
{VIACR, CR32, 0xFF, 0x00},
-{VIACR, CR33, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
+{VIACR, CR33, 0x7F, 0x00},
{VIACR, CR35, 0xFF, 0x00},
{VIACR, CR36, 0x08, 0x00},
-{VIACR, CR47, 0xC8, 0x00}, /* Clear VCK Plus. */
-{VIACR, CR62, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CR63, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CR64, 0xFF, 0x00}, /* Secondary Display Starting Address */
-{VIACR, CRA3, 0xFF, 0x00}, /* Secondary Display Starting Address */
{VIACR, CR69, 0xFF, 0x00},
-{VIACR, CR6A, 0xFF, 0x40},
+{VIACR, CR6A, 0xFD, 0x60},
{VIACR, CR6B, 0xFF, 0x00},
{VIACR, CR6C, 0xFF, 0x00},
-{VIACR, CR7A, 0xFF, 0x01}, /* LCD Scaling Parameter 1 */
-{VIACR, CR7B, 0xFF, 0x02}, /* LCD Scaling Parameter 2 */
-{VIACR, CR7C, 0xFF, 0x03}, /* LCD Scaling Parameter 3 */
-{VIACR, CR7D, 0xFF, 0x04}, /* LCD Scaling Parameter 4 */
-{VIACR, CR7E, 0xFF, 0x07}, /* LCD Scaling Parameter 5 */
-{VIACR, CR7F, 0xFF, 0x0A}, /* LCD Scaling Parameter 6 */
-{VIACR, CR80, 0xFF, 0x0D}, /* LCD Scaling Parameter 7 */
-{VIACR, CR81, 0xFF, 0x13}, /* LCD Scaling Parameter 8 */
-{VIACR, CR82, 0xFF, 0x16}, /* LCD Scaling Parameter 9 */
-{VIACR, CR83, 0xFF, 0x19}, /* LCD Scaling Parameter 10 */
-{VIACR, CR84, 0xFF, 0x1C}, /* LCD Scaling Parameter 11 */
-{VIACR, CR85, 0xFF, 0x1D}, /* LCD Scaling Parameter 12 */
-{VIACR, CR86, 0xFF, 0x1E}, /* LCD Scaling Parameter 13 */
-{VIACR, CR87, 0xFF, 0x1F}, /* LCD Scaling Parameter 14 */
-{VIACR, CR88, 0xFF, 0x40}, /* LCD Panel Type */
-{VIACR, CR89, 0xFF, 0x00}, /* LCD Timing Control 0 */
-{VIACR, CR8A, 0xFF, 0x88}, /* LCD Timing Control 1 */
-{VIACR, CRD4, 0xFF, 0x81}, /* Second power sequence control */
-{VIACR, CR8B, 0xFF, 0x5D}, /* LCD Power Sequence Control 0 */
-{VIACR, CR8C, 0xFF, 0x2B}, /* LCD Power Sequence Control 1 */
-{VIACR, CR8D, 0xFF, 0x6F}, /* LCD Power Sequence Control 2 */
-{VIACR, CR8E, 0xFF, 0x2B}, /* LCD Power Sequence Control 3 */
-{VIACR, CR8F, 0xFF, 0x01}, /* LCD Power Sequence Control 4 */
-{VIACR, CR90, 0xFF, 0x01}, /* LCD Power Sequence Control 5 */
-{VIACR, CR91, 0xFF, 0x80}, /* 24/12 bit LVDS Data off */
+{VIACR, CR7A, 0xFF, 0x01}, /* LCD Scaling Parameter 1 */
+{VIACR, CR7B, 0xFF, 0x02}, /* LCD Scaling Parameter 2 */
+{VIACR, CR7C, 0xFF, 0x03}, /* LCD Scaling Parameter 3 */
+{VIACR, CR7D, 0xFF, 0x04}, /* LCD Scaling Parameter 4 */
+{VIACR, CR7E, 0xFF, 0x07}, /* LCD Scaling Parameter 5 */
+{VIACR, CR7F, 0xFF, 0x0A}, /* LCD Scaling Parameter 6 */
+{VIACR, CR80, 0xFF, 0x0D}, /* LCD Scaling Parameter 7 */
+{VIACR, CR81, 0xFF, 0x13}, /* LCD Scaling Parameter 8 */
+{VIACR, CR82, 0xFF, 0x16}, /* LCD Scaling Parameter 9 */
+{VIACR, CR83, 0xFF, 0x19}, /* LCD Scaling Parameter 10 */
+{VIACR, CR84, 0xFF, 0x1C}, /* LCD Scaling Parameter 11 */
+{VIACR, CR85, 0xFF, 0x1D}, /* LCD Scaling Parameter 12 */
+{VIACR, CR86, 0xFF, 0x1E}, /* LCD Scaling Parameter 13 */
+{VIACR, CR87, 0xFF, 0x1F}, /* LCD Scaling Parameter 14 */
+{VIACR, CR88, 0xFF, 0x40}, /* LCD Panel Type */
+{VIACR, CR89, 0xFF, 0x00}, /* LCD Timing Control 0 */
+{VIACR, CR8A, 0xFF, 0x88}, /* LCD Timing Control 1 */
+{VIACR, CRD4, 0xFF, 0x81}, /* Second power sequence control */
+{VIACR, CR91, 0xFF, 0x80}, /* 24/12 bit LVDS Data off */
{VIACR, CR96, 0xFF, 0x00},
{VIACR, CR97, 0xFF, 0x00},
{VIACR, CR99, 0xFF, 0x00},
{VIACR, CR9B, 0xFF, 0x00},
-{VIACR, CRD2, 0xFF, 0xFF} /* TMDS/LVDS control register. */
+{VIACR, CRD2, 0xFF, 0xFF} /* TMDS/LVDS control register. */
};
/* Video Mode Table */
@@ -401,7 +377,6 @@
{VIASR, SR1A, 0xFB, 0x08},
{VIACR, CR32, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
{VIACR, CR35, 0xFF, 0x00},
{VIACR, CR36, 0x08, 0x00},
{VIACR, CR6A, 0xFF, 0x80},
@@ -1084,3 +1059,14 @@
{VIA_RES_1280X720, CEAM1280x720, ARRAY_SIZE(CEAM1280x720)},
{VIA_RES_1920X1080, CEAM1920x1080, ARRAY_SIZE(CEAM1920x1080)}
};
+
+int NUM_TOTAL_RES_MAP_REFRESH = ARRAY_SIZE(res_map_refresh_tbl);
+int NUM_TOTAL_CEA_MODES = ARRAY_SIZE(CEA_HDMI_Modes);
+int NUM_TOTAL_CN400_ModeXregs = ARRAY_SIZE(CN400_ModeXregs);
+int NUM_TOTAL_CN700_ModeXregs = ARRAY_SIZE(CN700_ModeXregs);
+int NUM_TOTAL_KM400_ModeXregs = ARRAY_SIZE(KM400_ModeXregs);
+int NUM_TOTAL_CX700_ModeXregs = ARRAY_SIZE(CX700_ModeXregs);
+int NUM_TOTAL_VX855_ModeXregs = ARRAY_SIZE(VX855_ModeXregs);
+int NUM_TOTAL_CLE266_ModeXregs = ARRAY_SIZE(CLE266_ModeXregs);
+int NUM_TOTAL_PATCH_MODE = ARRAY_SIZE(res_patch_table);
+int NUM_TOTAL_MODETABLE = ARRAY_SIZE(CLE266Modes);
diff --git a/drivers/video/via/viamode.h b/drivers/video/via/viamode.h
index 1a5de50..a9d6554 100644
--- a/drivers/video/via/viamode.h
+++ b/drivers/video/via/viamode.h
@@ -50,128 +50,35 @@
int vmode_refresh;
};
-#define NUM_TOTAL_RES_MAP_REFRESH ARRAY_SIZE(res_map_refresh_tbl)
-#define NUM_TOTAL_CEA_MODES ARRAY_SIZE(CEA_HDMI_Modes)
-#define NUM_TOTAL_CN400_ModeXregs ARRAY_SIZE(CN400_ModeXregs)
-#define NUM_TOTAL_CN700_ModeXregs ARRAY_SIZE(CN700_ModeXregs)
-#define NUM_TOTAL_KM400_ModeXregs ARRAY_SIZE(KM400_ModeXregs)
-#define NUM_TOTAL_CX700_ModeXregs ARRAY_SIZE(CX700_ModeXregs)
-#define NUM_TOTAL_VX800_ModeXregs ARRAY_SIZE(VX800_ModeXregs)
-#define NUM_TOTAL_CLE266_ModeXregs ARRAY_SIZE(CLE266_ModeXregs)
-#define NUM_TOTAL_PATCH_MODE ARRAY_SIZE(res_patch_table)
-#define NUM_TOTAL_MODETABLE ARRAY_SIZE(CLE266Modes)
+extern int NUM_TOTAL_RES_MAP_REFRESH;
+extern int NUM_TOTAL_CEA_MODES;
+extern int NUM_TOTAL_CN400_ModeXregs;
+extern int NUM_TOTAL_CN700_ModeXregs;
+extern int NUM_TOTAL_KM400_ModeXregs;
+extern int NUM_TOTAL_CX700_ModeXregs;
+extern int NUM_TOTAL_VX855_ModeXregs;
+extern int NUM_TOTAL_CLE266_ModeXregs;
+extern int NUM_TOTAL_PATCH_MODE;
+extern int NUM_TOTAL_MODETABLE;
/********************/
/* Mode Table */
/********************/
-/* 480x640 */
-extern struct crt_mode_table CRTM480x640[1];
-/* 640x480*/
-extern struct crt_mode_table CRTM640x480[5];
-/*720x480 (GTF)*/
-extern struct crt_mode_table CRTM720x480[1];
-/*720x576 (GTF)*/
-extern struct crt_mode_table CRTM720x576[1];
-/* 800x480 (CVT) */
-extern struct crt_mode_table CRTM800x480[1];
-/* 800x600*/
-extern struct crt_mode_table CRTM800x600[5];
-/* 848x480 (CVT) */
-extern struct crt_mode_table CRTM848x480[1];
-/*856x480 (GTF) convert to 852x480*/
-extern struct crt_mode_table CRTM852x480[1];
-/*1024x512 (GTF)*/
-extern struct crt_mode_table CRTM1024x512[1];
-/* 1024x600*/
-extern struct crt_mode_table CRTM1024x600[1];
-/* 1024x768*/
-extern struct crt_mode_table CRTM1024x768[4];
-/* 1152x864*/
-extern struct crt_mode_table CRTM1152x864[1];
-/* 1280x720 (HDMI 720P)*/
-extern struct crt_mode_table CRTM1280x720[2];
-/*1280x768 (GTF)*/
-extern struct crt_mode_table CRTM1280x768[2];
-/* 1280x800 (CVT) */
-extern struct crt_mode_table CRTM1280x800[1];
-/*1280x960*/
-extern struct crt_mode_table CRTM1280x960[1];
-/* 1280x1024*/
-extern struct crt_mode_table CRTM1280x1024[3];
-/* 1368x768 (GTF) */
-extern struct crt_mode_table CRTM1368x768[1];
-/*1440x1050 (GTF)*/
-extern struct crt_mode_table CRTM1440x1050[1];
-/* 1600x1200*/
-extern struct crt_mode_table CRTM1600x1200[2];
-/* 1680x1050 (CVT) */
-extern struct crt_mode_table CRTM1680x1050[2];
-/* 1680x1050 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1680x1050_RB[1];
-/* 1920x1080 (CVT)*/
-extern struct crt_mode_table CRTM1920x1080[1];
-/* 1920x1080 (CVT with Reduce Blanking) */
-extern struct crt_mode_table CRTM1920x1080_RB[1];
-/* 1920x1440*/
-extern struct crt_mode_table CRTM1920x1440[2];
-/* 1400x1050 (CVT) */
-extern struct crt_mode_table CRTM1400x1050[2];
-/* 1400x1050 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1400x1050_RB[1];
-/* 960x600 (CVT) */
-extern struct crt_mode_table CRTM960x600[1];
-/* 1000x600 (GTF) */
-extern struct crt_mode_table CRTM1000x600[1];
-/* 1024x576 (GTF) */
-extern struct crt_mode_table CRTM1024x576[1];
-/* 1088x612 (CVT) */
-extern struct crt_mode_table CRTM1088x612[1];
-/* 1152x720 (CVT) */
-extern struct crt_mode_table CRTM1152x720[1];
-/* 1200x720 (GTF) */
-extern struct crt_mode_table CRTM1200x720[1];
-/* 1280x600 (GTF) */
-extern struct crt_mode_table CRTM1280x600[1];
-/* 1360x768 (CVT) */
-extern struct crt_mode_table CRTM1360x768[1];
-/* 1360x768 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1360x768_RB[1];
-/* 1366x768 (GTF) */
-extern struct crt_mode_table CRTM1366x768[2];
-/* 1440x900 (CVT) */
-extern struct crt_mode_table CRTM1440x900[2];
-/* 1440x900 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1440x900_RB[1];
-/* 1600x900 (CVT) */
-extern struct crt_mode_table CRTM1600x900[1];
-/* 1600x900 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1600x900_RB[1];
-/* 1600x1024 (GTF) */
-extern struct crt_mode_table CRTM1600x1024[1];
-/* 1792x1344 (DMT) */
-extern struct crt_mode_table CRTM1792x1344[1];
-/* 1856x1392 (DMT) */
-extern struct crt_mode_table CRTM1856x1392[1];
-/* 1920x1200 (CVT) */
-extern struct crt_mode_table CRTM1920x1200[1];
-/* 1920x1200 (CVT with Reduce Blanking) */
-extern struct crt_mode_table CRTM1920x1200_RB[1];
-/* 2048x1536 (CVT) */
-extern struct crt_mode_table CRTM2048x1536[1];
-extern struct VideoModeTable CLE266Modes[47];
-extern struct crt_mode_table CEAM1280x720[1];
-extern struct crt_mode_table CEAM1920x1080[1];
-extern struct VideoModeTable CEA_HDMI_Modes[2];
+extern struct VideoModeTable CLE266Modes[];
+extern struct crt_mode_table CEAM1280x720[];
+extern struct crt_mode_table CEAM1920x1080[];
+extern struct VideoModeTable CEA_HDMI_Modes[];
-extern struct res_map_refresh res_map_refresh_tbl[61];
-extern struct io_reg CN400_ModeXregs[52];
-extern struct io_reg CN700_ModeXregs[66];
-extern struct io_reg KM400_ModeXregs[55];
-extern struct io_reg CX700_ModeXregs[58];
-extern struct io_reg VX800_ModeXregs[58];
-extern struct io_reg CLE266_ModeXregs[32];
-extern struct io_reg PM1024x768[2];
-extern struct patch_table res_patch_table[1];
+extern struct res_map_refresh res_map_refresh_tbl[];
+extern struct io_reg CN400_ModeXregs[];
+extern struct io_reg CN700_ModeXregs[];
+extern struct io_reg KM400_ModeXregs[];
+extern struct io_reg CX700_ModeXregs[];
+extern struct io_reg VX800_ModeXregs[];
+extern struct io_reg VX855_ModeXregs[];
+extern struct io_reg CLE266_ModeXregs[];
+extern struct io_reg PM1024x768[];
+extern struct patch_table res_patch_table[];
extern struct VPITTable VPIT;
#endif /* __VIAMODE_H__ */
diff --git a/drivers/video/via/vt1636.c b/drivers/video/via/vt1636.c
index 322a9f9..a6b3749 100644
--- a/drivers/video/via/vt1636.c
+++ b/drivers/video/via/vt1636.c
@@ -27,7 +27,7 @@
{
u8 data;
- viaparinfo->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
+ viaparinfo->shared->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
viafb_i2c_readbyte(plvds_chip_info->lvds_chip_slave_addr, index, &data);
return data;
@@ -39,7 +39,7 @@
{
int index, data;
- viaparinfo->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
+ viaparinfo->shared->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
index = io_data.Index;
data = viafb_gpio_i2c_read_lvds(plvds_setting_info, plvds_chip_info,
diff --git a/drivers/virtio/virtio_balloon.c b/drivers/virtio/virtio_balloon.c
index 26b2782..200c22f 100644
--- a/drivers/virtio/virtio_balloon.c
+++ b/drivers/virtio/virtio_balloon.c
@@ -19,6 +19,7 @@
*/
//#define DEBUG
#include <linux/virtio.h>
+#include <linux/virtio_ids.h>
#include <linux/virtio_balloon.h>
#include <linux/swap.h>
#include <linux/kthread.h>
@@ -84,7 +85,7 @@
init_completion(&vb->acked);
/* We should always be able to add one buffer to an empty queue. */
- if (vq->vq_ops->add_buf(vq, &sg, 1, 0, vb) != 0)
+ if (vq->vq_ops->add_buf(vq, &sg, 1, 0, vb) < 0)
BUG();
vq->vq_ops->kick(vq);
diff --git a/drivers/virtio/virtio_pci.c b/drivers/virtio/virtio_pci.c
index 248e00e..4a1f1eb 100644
--- a/drivers/virtio/virtio_pci.c
+++ b/drivers/virtio/virtio_pci.c
@@ -84,7 +84,7 @@
struct list_head node;
/* MSI-X vector (or none) */
- unsigned vector;
+ unsigned msix_vector;
};
/* Qumranet donated their vendor ID for devices 0x1000 thru 0x10FF. */
@@ -280,25 +280,14 @@
vp_dev->msix_entries = NULL;
}
-static int vp_request_vectors(struct virtio_device *vdev, int nvectors,
- bool per_vq_vectors)
+static int vp_request_msix_vectors(struct virtio_device *vdev, int nvectors,
+ bool per_vq_vectors)
{
struct virtio_pci_device *vp_dev = to_vp_device(vdev);
const char *name = dev_name(&vp_dev->vdev.dev);
unsigned i, v;
int err = -ENOMEM;
- if (!nvectors) {
- /* Can't allocate MSI-X vectors, use regular interrupt */
- vp_dev->msix_vectors = 0;
- err = request_irq(vp_dev->pci_dev->irq, vp_interrupt,
- IRQF_SHARED, name, vp_dev);
- if (err)
- return err;
- vp_dev->intx_enabled = 1;
- return 0;
- }
-
vp_dev->msix_entries = kmalloc(nvectors * sizeof *vp_dev->msix_entries,
GFP_KERNEL);
if (!vp_dev->msix_entries)
@@ -311,6 +300,7 @@
for (i = 0; i < nvectors; ++i)
vp_dev->msix_entries[i].entry = i;
+ /* pci_enable_msix returns positive if we can't get this many. */
err = pci_enable_msix(vp_dev->pci_dev, vp_dev->msix_entries, nvectors);
if (err > 0)
err = -ENOSPC;
@@ -356,10 +346,22 @@
return err;
}
-static struct virtqueue *vp_find_vq(struct virtio_device *vdev, unsigned index,
- void (*callback)(struct virtqueue *vq),
- const char *name,
- u16 vector)
+static int vp_request_intx(struct virtio_device *vdev)
+{
+ int err;
+ struct virtio_pci_device *vp_dev = to_vp_device(vdev);
+
+ err = request_irq(vp_dev->pci_dev->irq, vp_interrupt,
+ IRQF_SHARED, dev_name(&vdev->dev), vp_dev);
+ if (!err)
+ vp_dev->intx_enabled = 1;
+ return err;
+}
+
+static struct virtqueue *setup_vq(struct virtio_device *vdev, unsigned index,
+ void (*callback)(struct virtqueue *vq),
+ const char *name,
+ u16 msix_vec)
{
struct virtio_pci_device *vp_dev = to_vp_device(vdev);
struct virtio_pci_vq_info *info;
@@ -384,7 +386,7 @@
info->queue_index = index;
info->num = num;
- info->vector = vector;
+ info->msix_vector = msix_vec;
size = PAGE_ALIGN(vring_size(num, VIRTIO_PCI_VRING_ALIGN));
info->queue = alloc_pages_exact(size, GFP_KERNEL|__GFP_ZERO);
@@ -408,10 +410,10 @@
vq->priv = info;
info->vq = vq;
- if (vector != VIRTIO_MSI_NO_VECTOR) {
- iowrite16(vector, vp_dev->ioaddr + VIRTIO_MSI_QUEUE_VECTOR);
- vector = ioread16(vp_dev->ioaddr + VIRTIO_MSI_QUEUE_VECTOR);
- if (vector == VIRTIO_MSI_NO_VECTOR) {
+ if (msix_vec != VIRTIO_MSI_NO_VECTOR) {
+ iowrite16(msix_vec, vp_dev->ioaddr + VIRTIO_MSI_QUEUE_VECTOR);
+ msix_vec = ioread16(vp_dev->ioaddr + VIRTIO_MSI_QUEUE_VECTOR);
+ if (msix_vec == VIRTIO_MSI_NO_VECTOR) {
err = -EBUSY;
goto out_assign;
}
@@ -472,7 +474,8 @@
list_for_each_entry_safe(vq, n, &vdev->vqs, list) {
info = vq->priv;
if (vp_dev->per_vq_vectors)
- free_irq(vp_dev->msix_entries[info->vector].vector, vq);
+ free_irq(vp_dev->msix_entries[info->msix_vector].vector,
+ vq);
vp_del_vq(vq);
}
vp_dev->per_vq_vectors = false;
@@ -484,38 +487,58 @@
struct virtqueue *vqs[],
vq_callback_t *callbacks[],
const char *names[],
- int nvectors,
+ bool use_msix,
bool per_vq_vectors)
{
struct virtio_pci_device *vp_dev = to_vp_device(vdev);
- u16 vector;
- int i, err, allocated_vectors;
+ u16 msix_vec;
+ int i, err, nvectors, allocated_vectors;
- err = vp_request_vectors(vdev, nvectors, per_vq_vectors);
- if (err)
- goto error_request;
+ if (!use_msix) {
+ /* Old style: one normal interrupt for change and all vqs. */
+ err = vp_request_intx(vdev);
+ if (err)
+ goto error_request;
+ } else {
+ if (per_vq_vectors) {
+ /* Best option: one for change interrupt, one per vq. */
+ nvectors = 1;
+ for (i = 0; i < nvqs; ++i)
+ if (callbacks[i])
+ ++nvectors;
+ } else {
+ /* Second best: one for change, shared for all vqs. */
+ nvectors = 2;
+ }
+
+ err = vp_request_msix_vectors(vdev, nvectors, per_vq_vectors);
+ if (err)
+ goto error_request;
+ }
vp_dev->per_vq_vectors = per_vq_vectors;
allocated_vectors = vp_dev->msix_used_vectors;
for (i = 0; i < nvqs; ++i) {
if (!callbacks[i] || !vp_dev->msix_enabled)
- vector = VIRTIO_MSI_NO_VECTOR;
+ msix_vec = VIRTIO_MSI_NO_VECTOR;
else if (vp_dev->per_vq_vectors)
- vector = allocated_vectors++;
+ msix_vec = allocated_vectors++;
else
- vector = VP_MSIX_VQ_VECTOR;
- vqs[i] = vp_find_vq(vdev, i, callbacks[i], names[i], vector);
+ msix_vec = VP_MSIX_VQ_VECTOR;
+ vqs[i] = setup_vq(vdev, i, callbacks[i], names[i], msix_vec);
if (IS_ERR(vqs[i])) {
err = PTR_ERR(vqs[i]);
goto error_find;
}
/* allocate per-vq irq if available and necessary */
- if (vp_dev->per_vq_vectors && vector != VIRTIO_MSI_NO_VECTOR) {
- snprintf(vp_dev->msix_names[vector], sizeof *vp_dev->msix_names,
- "%s-%s", dev_name(&vp_dev->vdev.dev), names[i]);
- err = request_irq(vp_dev->msix_entries[vector].vector,
- vring_interrupt, 0,
- vp_dev->msix_names[vector], vqs[i]);
+ if (vp_dev->per_vq_vectors) {
+ snprintf(vp_dev->msix_names[msix_vec],
+ sizeof *vp_dev->msix_names,
+ "%s-%s",
+ dev_name(&vp_dev->vdev.dev), names[i]);
+ err = request_irq(msix_vec, vring_interrupt, 0,
+ vp_dev->msix_names[msix_vec],
+ vqs[i]);
if (err) {
vp_del_vq(vqs[i]);
goto error_find;
@@ -537,28 +560,20 @@
vq_callback_t *callbacks[],
const char *names[])
{
- int vectors = 0;
- int i, uninitialized_var(err);
+ int err;
- /* How many vectors would we like? */
- for (i = 0; i < nvqs; ++i)
- if (callbacks[i])
- ++vectors;
-
- /* We want at most one vector per queue and one for config changes. */
- err = vp_try_to_find_vqs(vdev, nvqs, vqs, callbacks, names,
- vectors + 1, true);
+ /* Try MSI-X with one vector per queue. */
+ err = vp_try_to_find_vqs(vdev, nvqs, vqs, callbacks, names, true, true);
if (!err)
return 0;
- /* Fallback to separate vectors for config and a shared for queues. */
+ /* Fallback: MSI-X with one vector for config, one shared for queues. */
err = vp_try_to_find_vqs(vdev, nvqs, vqs, callbacks, names,
- 2, false);
+ true, false);
if (!err)
return 0;
/* Finally fall back to regular interrupts. */
- err = vp_try_to_find_vqs(vdev, nvqs, vqs, callbacks, names,
- 0, false);
- return err;
+ return vp_try_to_find_vqs(vdev, nvqs, vqs, callbacks, names,
+ false, false);
}
static struct virtio_config_ops virtio_pci_config_ops = {
diff --git a/drivers/virtio/virtio_ring.c b/drivers/virtio/virtio_ring.c
index a882f26..f536005 100644
--- a/drivers/virtio/virtio_ring.c
+++ b/drivers/virtio/virtio_ring.c
@@ -208,7 +208,11 @@
pr_debug("Added buffer head %i to %p\n", head, vq);
END_USE(vq);
- return 0;
+
+ /* If we're indirect, we can fit many (assuming not OOM). */
+ if (vq->indirect)
+ return vq->num_free ? vq->vring.num : 0;
+ return vq->num_free;
}
static void vring_kick(struct virtqueue *_vq)
diff --git a/drivers/vlynq/vlynq.c b/drivers/vlynq/vlynq.c
index f05d2a3..ba3d71f 100644
--- a/drivers/vlynq/vlynq.c
+++ b/drivers/vlynq/vlynq.c
@@ -28,7 +28,6 @@
#include <linux/errno.h>
#include <linux/platform_device.h>
#include <linux/interrupt.h>
-#include <linux/device.h>
#include <linux/delay.h>
#include <linux/io.h>
diff --git a/firmware/ihex2fw.c b/firmware/ihex2fw.c
index 8f7fdaa9..5a03ba8 100644
--- a/firmware/ihex2fw.c
+++ b/firmware/ihex2fw.c
@@ -56,7 +56,7 @@
static int sort_records = 0;
static int wide_records = 0;
-int usage(void)
+static int usage(void)
{
fprintf(stderr, "ihex2fw: Convert ihex files into binary "
"representation for use by Linux kernel\n");
diff --git a/fs/afs/proc.c b/fs/afs/proc.c
index 8630615..852739d 100644
--- a/fs/afs/proc.c
+++ b/fs/afs/proc.c
@@ -28,7 +28,7 @@
static ssize_t afs_proc_cells_write(struct file *file, const char __user *buf,
size_t size, loff_t *_pos);
-static struct seq_operations afs_proc_cells_ops = {
+static const struct seq_operations afs_proc_cells_ops = {
.start = afs_proc_cells_start,
.next = afs_proc_cells_next,
.stop = afs_proc_cells_stop,
@@ -70,7 +70,7 @@
static void afs_proc_cell_volumes_stop(struct seq_file *p, void *v);
static int afs_proc_cell_volumes_show(struct seq_file *m, void *v);
-static struct seq_operations afs_proc_cell_volumes_ops = {
+static const struct seq_operations afs_proc_cell_volumes_ops = {
.start = afs_proc_cell_volumes_start,
.next = afs_proc_cell_volumes_next,
.stop = afs_proc_cell_volumes_stop,
@@ -95,7 +95,7 @@
static void afs_proc_cell_vlservers_stop(struct seq_file *p, void *v);
static int afs_proc_cell_vlservers_show(struct seq_file *m, void *v);
-static struct seq_operations afs_proc_cell_vlservers_ops = {
+static const struct seq_operations afs_proc_cell_vlservers_ops = {
.start = afs_proc_cell_vlservers_start,
.next = afs_proc_cell_vlservers_next,
.stop = afs_proc_cell_vlservers_stop,
@@ -119,7 +119,7 @@
static void afs_proc_cell_servers_stop(struct seq_file *p, void *v);
static int afs_proc_cell_servers_show(struct seq_file *m, void *v);
-static struct seq_operations afs_proc_cell_servers_ops = {
+static const struct seq_operations afs_proc_cell_servers_ops = {
.start = afs_proc_cell_servers_start,
.next = afs_proc_cell_servers_next,
.stop = afs_proc_cell_servers_stop,
diff --git a/fs/aio.c b/fs/aio.c
index fc21c23..02a2c93 100644
--- a/fs/aio.c
+++ b/fs/aio.c
@@ -78,6 +78,7 @@
return 0;
}
+__initcall(aio_setup);
static void aio_free_ring(struct kioctx *ctx)
{
@@ -380,6 +381,7 @@
__set_current_state(TASK_RUNNING);
return iocb->ki_user_data;
}
+EXPORT_SYMBOL(wait_on_sync_kiocb);
/* exit_aio: called when the last user of mm goes away. At this point,
* there is no way for any new requests to be submited or any of the
@@ -573,6 +575,7 @@
spin_unlock_irq(&ctx->ctx_lock);
return ret;
}
+EXPORT_SYMBOL(aio_put_req);
static struct kioctx *lookup_ioctx(unsigned long ctx_id)
{
@@ -992,6 +995,7 @@
spin_unlock_irqrestore(&ctx->ctx_lock, flags);
return ret;
}
+EXPORT_SYMBOL(aio_complete);
/* aio_read_evt
* Pull an event off of the ioctx's event ring. Returns the number of
@@ -1780,9 +1784,3 @@
asmlinkage_protect(5, ret, ctx_id, min_nr, nr, events, timeout);
return ret;
}
-
-__initcall(aio_setup);
-
-EXPORT_SYMBOL(aio_complete);
-EXPORT_SYMBOL(aio_put_req);
-EXPORT_SYMBOL(wait_on_sync_kiocb);
diff --git a/fs/anon_inodes.c b/fs/anon_inodes.c
index 47d4a01..d11c51f 100644
--- a/fs/anon_inodes.c
+++ b/fs/anon_inodes.c
@@ -77,28 +77,24 @@
*
* Creates a new file by hooking it on a single inode. This is useful for files
* that do not need to have a full-fledged inode in order to operate correctly.
- * All the files created with anon_inode_getfd() will share a single inode,
+ * All the files created with anon_inode_getfile() will share a single inode,
* hence saving memory and avoiding code duplication for the file/inode/dentry
- * setup. Returns new descriptor or -error.
+ * setup. Returns the newly created file* or an error pointer.
*/
-int anon_inode_getfd(const char *name, const struct file_operations *fops,
- void *priv, int flags)
+struct file *anon_inode_getfile(const char *name,
+ const struct file_operations *fops,
+ void *priv, int flags)
{
struct qstr this;
struct dentry *dentry;
struct file *file;
- int error, fd;
+ int error;
if (IS_ERR(anon_inode_inode))
- return -ENODEV;
+ return ERR_PTR(-ENODEV);
if (fops->owner && !try_module_get(fops->owner))
- return -ENOENT;
-
- error = get_unused_fd_flags(flags);
- if (error < 0)
- goto err_module;
- fd = error;
+ return ERR_PTR(-ENOENT);
/*
* Link the inode to a directory entry by creating a unique name
@@ -110,7 +106,7 @@
this.hash = 0;
dentry = d_alloc(anon_inode_mnt->mnt_sb->s_root, &this);
if (!dentry)
- goto err_put_unused_fd;
+ goto err_module;
/*
* We know the anon_inode inode count is always greater than zero,
@@ -136,16 +132,54 @@
file->f_version = 0;
file->private_data = priv;
+ return file;
+
+err_dput:
+ dput(dentry);
+err_module:
+ module_put(fops->owner);
+ return ERR_PTR(error);
+}
+EXPORT_SYMBOL_GPL(anon_inode_getfile);
+
+/**
+ * anon_inode_getfd - creates a new file instance by hooking it up to an
+ * anonymous inode, and a dentry that describe the "class"
+ * of the file
+ *
+ * @name: [in] name of the "class" of the new file
+ * @fops: [in] file operations for the new file
+ * @priv: [in] private data for the new file (will be file's private_data)
+ * @flags: [in] flags
+ *
+ * Creates a new file by hooking it on a single inode. This is useful for files
+ * that do not need to have a full-fledged inode in order to operate correctly.
+ * All the files created with anon_inode_getfd() will share a single inode,
+ * hence saving memory and avoiding code duplication for the file/inode/dentry
+ * setup. Returns new descriptor or an error code.
+ */
+int anon_inode_getfd(const char *name, const struct file_operations *fops,
+ void *priv, int flags)
+{
+ int error, fd;
+ struct file *file;
+
+ error = get_unused_fd_flags(flags);
+ if (error < 0)
+ return error;
+ fd = error;
+
+ file = anon_inode_getfile(name, fops, priv, flags);
+ if (IS_ERR(file)) {
+ error = PTR_ERR(file);
+ goto err_put_unused_fd;
+ }
fd_install(fd, file);
return fd;
-err_dput:
- dput(dentry);
err_put_unused_fd:
put_unused_fd(fd);
-err_module:
- module_put(fops->owner);
return error;
}
EXPORT_SYMBOL_GPL(anon_inode_getfd);
diff --git a/fs/buffer.c b/fs/buffer.c
index 90a9886..209f7f1 100644
--- a/fs/buffer.c
+++ b/fs/buffer.c
@@ -52,6 +52,7 @@
bh->b_end_io = handler;
bh->b_private = private;
}
+EXPORT_SYMBOL(init_buffer);
static int sync_buffer(void *word)
{
@@ -80,6 +81,7 @@
smp_mb__after_clear_bit();
wake_up_bit(&bh->b_state, BH_Lock);
}
+EXPORT_SYMBOL(unlock_buffer);
/*
* Block until a buffer comes unlocked. This doesn't stop it
@@ -90,6 +92,7 @@
{
wait_on_bit(&bh->b_state, BH_Lock, sync_buffer, TASK_UNINTERRUPTIBLE);
}
+EXPORT_SYMBOL(__wait_on_buffer);
static void
__clear_page_buffers(struct page *page)
@@ -144,6 +147,7 @@
__end_buffer_read_notouch(bh, uptodate);
put_bh(bh);
}
+EXPORT_SYMBOL(end_buffer_read_sync);
void end_buffer_write_sync(struct buffer_head *bh, int uptodate)
{
@@ -164,6 +168,7 @@
unlock_buffer(bh);
put_bh(bh);
}
+EXPORT_SYMBOL(end_buffer_write_sync);
/*
* Various filesystems appear to want __find_get_block to be non-blocking.
@@ -272,6 +277,7 @@
invalidate_bh_lrus();
invalidate_mapping_pages(mapping, 0, -1);
}
+EXPORT_SYMBOL(invalidate_bdev);
/*
* Kick pdflush then try to free up some ZONE_NORMAL memory.
@@ -410,6 +416,7 @@
local_irq_restore(flags);
return;
}
+EXPORT_SYMBOL(end_buffer_async_write);
/*
* If a page's buffers are under async readin (end_buffer_async_read
@@ -438,8 +445,8 @@
set_buffer_async_read(bh);
}
-void mark_buffer_async_write_endio(struct buffer_head *bh,
- bh_end_io_t *handler)
+static void mark_buffer_async_write_endio(struct buffer_head *bh,
+ bh_end_io_t *handler)
{
bh->b_end_io = handler;
set_buffer_async_write(bh);
@@ -553,7 +560,7 @@
return err;
}
-void do_thaw_all(struct work_struct *work)
+static void do_thaw_all(struct work_struct *work)
{
struct super_block *sb;
char b[BDEVNAME_SIZE];
@@ -1172,6 +1179,7 @@
}
}
}
+EXPORT_SYMBOL(mark_buffer_dirty);
/*
* Decrement a buffer_head's reference count. If all buffers against a page
@@ -1188,6 +1196,7 @@
}
WARN(1, KERN_ERR "VFS: brelse: Trying to free free buffer\n");
}
+EXPORT_SYMBOL(__brelse);
/*
* bforget() is like brelse(), except it discards any
@@ -1206,6 +1215,7 @@
}
__brelse(bh);
}
+EXPORT_SYMBOL(__bforget);
static struct buffer_head *__bread_slow(struct buffer_head *bh)
{
@@ -2218,6 +2228,7 @@
}
return 0;
}
+EXPORT_SYMBOL(block_read_full_page);
/* utility function for filesystems that need to do work on expanding
* truncates. Uses filesystem pagecache writes to allow the filesystem to
@@ -2252,6 +2263,7 @@
out:
return err;
}
+EXPORT_SYMBOL(generic_cont_expand_simple);
static int cont_expand_zero(struct file *file, struct address_space *mapping,
loff_t pos, loff_t *bytes)
@@ -2352,6 +2364,7 @@
out:
return err;
}
+EXPORT_SYMBOL(cont_write_begin);
int block_prepare_write(struct page *page, unsigned from, unsigned to,
get_block_t *get_block)
@@ -2362,6 +2375,7 @@
ClearPageUptodate(page);
return err;
}
+EXPORT_SYMBOL(block_prepare_write);
int block_commit_write(struct page *page, unsigned from, unsigned to)
{
@@ -2369,6 +2383,7 @@
__block_commit_write(inode,page,from,to);
return 0;
}
+EXPORT_SYMBOL(block_commit_write);
/*
* block_page_mkwrite() is not allowed to change the file size as it gets
@@ -2426,6 +2441,7 @@
out:
return ret;
}
+EXPORT_SYMBOL(block_page_mkwrite);
/*
* nobh_write_begin()'s prereads are special: the buffer_heads are freed
@@ -2849,6 +2865,7 @@
out:
return err;
}
+EXPORT_SYMBOL(block_truncate_page);
/*
* The generic ->writepage function for buffer-backed address_spaces
@@ -2890,6 +2907,7 @@
zero_user_segment(page, offset, PAGE_CACHE_SIZE);
return __block_write_full_page(inode, page, get_block, wbc, handler);
}
+EXPORT_SYMBOL(block_write_full_page_endio);
/*
* The generic ->writepage function for buffer-backed address_spaces
@@ -2900,7 +2918,7 @@
return block_write_full_page_endio(page, get_block, wbc,
end_buffer_async_write);
}
-
+EXPORT_SYMBOL(block_write_full_page);
sector_t generic_block_bmap(struct address_space *mapping, sector_t block,
get_block_t *get_block)
@@ -2913,6 +2931,7 @@
get_block(inode, block, &tmp, 0);
return tmp.b_blocknr;
}
+EXPORT_SYMBOL(generic_block_bmap);
static void end_bio_bh_io_sync(struct bio *bio, int err)
{
@@ -2982,6 +3001,7 @@
bio_put(bio);
return ret;
}
+EXPORT_SYMBOL(submit_bh);
/**
* ll_rw_block: low-level access to block devices (DEPRECATED)
@@ -3043,6 +3063,7 @@
unlock_buffer(bh);
}
}
+EXPORT_SYMBOL(ll_rw_block);
/*
* For a data-integrity writeout, we need to wait upon any in-progress I/O
@@ -3071,6 +3092,7 @@
}
return ret;
}
+EXPORT_SYMBOL(sync_dirty_buffer);
/*
* try_to_free_buffers() checks if all the buffers on this particular page
@@ -3185,6 +3207,7 @@
if (mapping)
blk_run_backing_dev(mapping->backing_dev_info, page);
}
+EXPORT_SYMBOL(block_sync_page);
/*
* There are no bdflush tunables left. But distributions are
@@ -3361,29 +3384,3 @@
max_buffer_heads = nrpages * (PAGE_SIZE / sizeof(struct buffer_head));
hotcpu_notifier(buffer_cpu_notify, 0);
}
-
-EXPORT_SYMBOL(__bforget);
-EXPORT_SYMBOL(__brelse);
-EXPORT_SYMBOL(__wait_on_buffer);
-EXPORT_SYMBOL(block_commit_write);
-EXPORT_SYMBOL(block_prepare_write);
-EXPORT_SYMBOL(block_page_mkwrite);
-EXPORT_SYMBOL(block_read_full_page);
-EXPORT_SYMBOL(block_sync_page);
-EXPORT_SYMBOL(block_truncate_page);
-EXPORT_SYMBOL(block_write_full_page);
-EXPORT_SYMBOL(block_write_full_page_endio);
-EXPORT_SYMBOL(cont_write_begin);
-EXPORT_SYMBOL(end_buffer_read_sync);
-EXPORT_SYMBOL(end_buffer_write_sync);
-EXPORT_SYMBOL(end_buffer_async_write);
-EXPORT_SYMBOL(file_fsync);
-EXPORT_SYMBOL(generic_block_bmap);
-EXPORT_SYMBOL(generic_cont_expand_simple);
-EXPORT_SYMBOL(init_buffer);
-EXPORT_SYMBOL(invalidate_bdev);
-EXPORT_SYMBOL(ll_rw_block);
-EXPORT_SYMBOL(mark_buffer_dirty);
-EXPORT_SYMBOL(submit_bh);
-EXPORT_SYMBOL(sync_dirty_buffer);
-EXPORT_SYMBOL(unlock_buffer);
diff --git a/fs/compat.c b/fs/compat.c
index 6d6f98f..3aa4883 100644
--- a/fs/compat.c
+++ b/fs/compat.c
@@ -100,13 +100,6 @@
get_compat_timespec(&tv[1], &t[1]))
return -EFAULT;
- if ((tv[0].tv_nsec == UTIME_OMIT || tv[0].tv_nsec == UTIME_NOW)
- && tv[0].tv_sec != 0)
- return -EINVAL;
- if ((tv[1].tv_nsec == UTIME_OMIT || tv[1].tv_nsec == UTIME_NOW)
- && tv[1].tv_sec != 0)
- return -EINVAL;
-
if (tv[0].tv_nsec == UTIME_OMIT && tv[1].tv_nsec == UTIME_OMIT)
return 0;
}
diff --git a/fs/devpts/inode.c b/fs/devpts/inode.c
index 75efb02..d5f8c96 100644
--- a/fs/devpts/inode.c
+++ b/fs/devpts/inode.c
@@ -18,14 +18,13 @@
#include <linux/mount.h>
#include <linux/tty.h>
#include <linux/mutex.h>
+#include <linux/magic.h>
#include <linux/idr.h>
#include <linux/devpts_fs.h>
#include <linux/parser.h>
#include <linux/fsnotify.h>
#include <linux/seq_file.h>
-#define DEVPTS_SUPER_MAGIC 0x1cd1
-
#define DEVPTS_DEFAULT_MODE 0600
/*
* ptmx is a new node in /dev/pts and will be unused in legacy (single-
diff --git a/fs/dlm/debug_fs.c b/fs/dlm/debug_fs.c
index 1d1d274..1c8bb8c 100644
--- a/fs/dlm/debug_fs.c
+++ b/fs/dlm/debug_fs.c
@@ -386,9 +386,9 @@
return rv;
}
-static struct seq_operations format1_seq_ops;
-static struct seq_operations format2_seq_ops;
-static struct seq_operations format3_seq_ops;
+static const struct seq_operations format1_seq_ops;
+static const struct seq_operations format2_seq_ops;
+static const struct seq_operations format3_seq_ops;
static void *table_seq_start(struct seq_file *seq, loff_t *pos)
{
@@ -534,21 +534,21 @@
}
}
-static struct seq_operations format1_seq_ops = {
+static const struct seq_operations format1_seq_ops = {
.start = table_seq_start,
.next = table_seq_next,
.stop = table_seq_stop,
.show = table_seq_show,
};
-static struct seq_operations format2_seq_ops = {
+static const struct seq_operations format2_seq_ops = {
.start = table_seq_start,
.next = table_seq_next,
.stop = table_seq_stop,
.show = table_seq_show,
};
-static struct seq_operations format3_seq_ops = {
+static const struct seq_operations format3_seq_ops = {
.start = table_seq_start,
.next = table_seq_next,
.stop = table_seq_stop,
diff --git a/fs/eventfd.c b/fs/eventfd.c
index 31d12de8..8b47e42 100644
--- a/fs/eventfd.c
+++ b/fs/eventfd.c
@@ -68,11 +68,16 @@
}
EXPORT_SYMBOL_GPL(eventfd_signal);
+static void eventfd_free_ctx(struct eventfd_ctx *ctx)
+{
+ kfree(ctx);
+}
+
static void eventfd_free(struct kref *kref)
{
struct eventfd_ctx *ctx = container_of(kref, struct eventfd_ctx, kref);
- kfree(ctx);
+ eventfd_free_ctx(ctx);
}
/**
@@ -298,9 +303,23 @@
}
EXPORT_SYMBOL_GPL(eventfd_ctx_fileget);
-SYSCALL_DEFINE2(eventfd2, unsigned int, count, int, flags)
+/**
+ * eventfd_file_create - Creates an eventfd file pointer.
+ * @count: Initial eventfd counter value.
+ * @flags: Flags for the eventfd file.
+ *
+ * This function creates an eventfd file pointer, w/out installing it into
+ * the fd table. This is useful when the eventfd file is used during the
+ * initialization of data structures that require extra setup after the eventfd
+ * creation. So the eventfd creation is split into the file pointer creation
+ * phase, and the file descriptor installation phase.
+ * In this way races with userspace closing the newly installed file descriptor
+ * can be avoided.
+ * Returns an eventfd file pointer, or a proper error pointer.
+ */
+struct file *eventfd_file_create(unsigned int count, int flags)
{
- int fd;
+ struct file *file;
struct eventfd_ctx *ctx;
/* Check the EFD_* constants for consistency. */
@@ -308,26 +327,48 @@
BUILD_BUG_ON(EFD_NONBLOCK != O_NONBLOCK);
if (flags & ~EFD_FLAGS_SET)
- return -EINVAL;
+ return ERR_PTR(-EINVAL);
ctx = kmalloc(sizeof(*ctx), GFP_KERNEL);
if (!ctx)
- return -ENOMEM;
+ return ERR_PTR(-ENOMEM);
kref_init(&ctx->kref);
init_waitqueue_head(&ctx->wqh);
ctx->count = count;
ctx->flags = flags;
- /*
- * When we call this, the initialization must be complete, since
- * anon_inode_getfd() will install the fd.
- */
- fd = anon_inode_getfd("[eventfd]", &eventfd_fops, ctx,
- flags & EFD_SHARED_FCNTL_FLAGS);
- if (fd < 0)
- kfree(ctx);
+ file = anon_inode_getfile("[eventfd]", &eventfd_fops, ctx,
+ flags & EFD_SHARED_FCNTL_FLAGS);
+ if (IS_ERR(file))
+ eventfd_free_ctx(ctx);
+
+ return file;
+}
+
+SYSCALL_DEFINE2(eventfd2, unsigned int, count, int, flags)
+{
+ int fd, error;
+ struct file *file;
+
+ error = get_unused_fd_flags(flags & EFD_SHARED_FCNTL_FLAGS);
+ if (error < 0)
+ return error;
+ fd = error;
+
+ file = eventfd_file_create(count, flags);
+ if (IS_ERR(file)) {
+ error = PTR_ERR(file);
+ goto err_put_unused_fd;
+ }
+ fd_install(fd, file);
+
return fd;
+
+err_put_unused_fd:
+ put_unused_fd(fd);
+
+ return error;
}
SYSCALL_DEFINE1(eventfd, unsigned int, count)
diff --git a/fs/exec.c b/fs/exec.c
index 434dba7..5c833c1 100644
--- a/fs/exec.c
+++ b/fs/exec.c
@@ -845,6 +845,9 @@
sig->notify_count = 0;
no_thread_group:
+ if (current->mm)
+ setmax_mm_hiwater_rss(&sig->maxrss, current->mm);
+
exit_itimers(sig);
flush_itimer_signals();
@@ -1354,6 +1357,8 @@
if (retval < 0)
goto out;
+ current->stack_start = current->mm->start_stack;
+
/* execve succeeded */
current->fs->in_exec = 0;
current->in_execve = 0;
diff --git a/fs/ext2/namei.c b/fs/ext2/namei.c
index 23701f2..dd7175c 100644
--- a/fs/ext2/namei.c
+++ b/fs/ext2/namei.c
@@ -70,7 +70,7 @@
if (PTR_ERR(inode) == -ESTALE) {
ext2_error(dir->i_sb, __func__,
"deleted inode referenced: %lu",
- ino);
+ (unsigned long) ino);
return ERR_PTR(-EIO);
} else {
return ERR_CAST(inode);
diff --git a/fs/hugetlbfs/inode.c b/fs/hugetlbfs/inode.c
index 06b7c26..eba6d552d 100644
--- a/fs/hugetlbfs/inode.c
+++ b/fs/hugetlbfs/inode.c
@@ -31,12 +31,10 @@
#include <linux/statfs.h>
#include <linux/security.h>
#include <linux/ima.h>
+#include <linux/magic.h>
#include <asm/uaccess.h>
-/* some random number */
-#define HUGETLBFS_MAGIC 0x958458f6
-
static const struct super_operations hugetlbfs_ops;
static const struct address_space_operations hugetlbfs_aops;
const struct file_operations hugetlbfs_file_operations;
diff --git a/fs/inode.c b/fs/inode.c
index f5ff71c..76582b06 100644
--- a/fs/inode.c
+++ b/fs/inode.c
@@ -14,6 +14,7 @@
#include <linux/module.h>
#include <linux/backing-dev.h>
#include <linux/wait.h>
+#include <linux/rwsem.h>
#include <linux/hash.h>
#include <linux/swap.h>
#include <linux/security.h>
@@ -87,14 +88,18 @@
DEFINE_SPINLOCK(inode_lock);
/*
- * iprune_mutex provides exclusion between the kswapd or try_to_free_pages
+ * iprune_sem provides exclusion between the kswapd or try_to_free_pages
* icache shrinking path, and the umount path. Without this exclusion,
* by the time prune_icache calls iput for the inode whose pages it has
* been invalidating, or by the time it calls clear_inode & destroy_inode
* from its final dispose_list, the struct super_block they refer to
* (for inode->i_sb->s_op) may already have been freed and reused.
+ *
+ * We make this an rwsem because the fastpath is icache shrinking. In
+ * some cases a filesystem may be doing a significant amount of work in
+ * its inode reclaim code, so this should improve parallelism.
*/
-static DEFINE_MUTEX(iprune_mutex);
+static DECLARE_RWSEM(iprune_sem);
/*
* Statistics gathering..
@@ -381,7 +386,7 @@
/*
* We can reschedule here without worrying about the list's
* consistency because the per-sb list of inodes must not
- * change during umount anymore, and because iprune_mutex keeps
+ * change during umount anymore, and because iprune_sem keeps
* shrink_icache_memory() away.
*/
cond_resched_lock(&inode_lock);
@@ -420,7 +425,7 @@
int busy;
LIST_HEAD(throw_away);
- mutex_lock(&iprune_mutex);
+ down_write(&iprune_sem);
spin_lock(&inode_lock);
inotify_unmount_inodes(&sb->s_inodes);
fsnotify_unmount_inodes(&sb->s_inodes);
@@ -428,7 +433,7 @@
spin_unlock(&inode_lock);
dispose_list(&throw_away);
- mutex_unlock(&iprune_mutex);
+ up_write(&iprune_sem);
return busy;
}
@@ -467,7 +472,7 @@
int nr_scanned;
unsigned long reap = 0;
- mutex_lock(&iprune_mutex);
+ down_read(&iprune_sem);
spin_lock(&inode_lock);
for (nr_scanned = 0; nr_scanned < nr_to_scan; nr_scanned++) {
struct inode *inode;
@@ -509,7 +514,7 @@
spin_unlock(&inode_lock);
dispose_list(&freeable);
- mutex_unlock(&iprune_mutex);
+ up_read(&iprune_sem);
}
/*
diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c
index a8a358b..53b86e1 100644
--- a/fs/jbd2/journal.c
+++ b/fs/jbd2/journal.c
@@ -768,7 +768,7 @@
{
}
-static struct seq_operations jbd2_seq_history_ops = {
+static const struct seq_operations jbd2_seq_history_ops = {
.start = jbd2_seq_history_start,
.next = jbd2_seq_history_next,
.stop = jbd2_seq_history_stop,
@@ -872,7 +872,7 @@
{
}
-static struct seq_operations jbd2_seq_info_ops = {
+static const struct seq_operations jbd2_seq_info_ops = {
.start = jbd2_seq_info_start,
.next = jbd2_seq_info_next,
.stop = jbd2_seq_info_stop,
diff --git a/fs/minix/dir.c b/fs/minix/dir.c
index d407e7a..6198731 100644
--- a/fs/minix/dir.c
+++ b/fs/minix/dir.c
@@ -308,14 +308,18 @@
struct inode *inode = (struct inode*)mapping->host;
char *kaddr = page_address(page);
loff_t pos = page_offset(page) + (char*)de - kaddr;
- unsigned len = minix_sb(inode->i_sb)->s_dirsize;
+ struct minix_sb_info *sbi = minix_sb(inode->i_sb);
+ unsigned len = sbi->s_dirsize;
int err;
lock_page(page);
err = __minix_write_begin(NULL, mapping, pos, len,
AOP_FLAG_UNINTERRUPTIBLE, &page, NULL);
if (err == 0) {
- de->inode = 0;
+ if (sbi->s_version == MINIX_V3)
+ ((minix3_dirent *) de)->inode = 0;
+ else
+ de->inode = 0;
err = dir_commit_chunk(page, pos, len);
} else {
unlock_page(page);
@@ -440,7 +444,10 @@
err = __minix_write_begin(NULL, mapping, pos, sbi->s_dirsize,
AOP_FLAG_UNINTERRUPTIBLE, &page, NULL);
if (err == 0) {
- de->inode = inode->i_ino;
+ if (sbi->s_version == MINIX_V3)
+ ((minix3_dirent *) de)->inode = inode->i_ino;
+ else
+ de->inode = inode->i_ino;
err = dir_commit_chunk(page, pos, sbi->s_dirsize);
} else {
unlock_page(page);
@@ -470,7 +477,14 @@
ino_t res = 0;
if (de) {
- res = de->inode;
+ struct address_space *mapping = page->mapping;
+ struct inode *inode = mapping->host;
+ struct minix_sb_info *sbi = minix_sb(inode->i_sb);
+
+ if (sbi->s_version == MINIX_V3)
+ res = ((minix3_dirent *) de)->inode;
+ else
+ res = de->inode;
dir_put_page(page);
}
return res;
diff --git a/fs/ncpfs/dir.c b/fs/ncpfs/dir.c
index 9c59072..b8b5b30 100644
--- a/fs/ncpfs/dir.c
+++ b/fs/ncpfs/dir.c
@@ -1241,7 +1241,7 @@
month = 2;
} else {
nl_day = (year & 3) || day <= 59 ? day : day - 1;
- for (month = 0; month < 12; month++)
+ for (month = 1; month < 12; month++)
if (day_n[month] > nl_day)
break;
}
diff --git a/fs/ncpfs/ioctl.c b/fs/ncpfs/ioctl.c
index fa038df..53a7ed7 100644
--- a/fs/ncpfs/ioctl.c
+++ b/fs/ncpfs/ioctl.c
@@ -442,7 +442,7 @@
if (dentry) {
struct inode* s_inode = dentry->d_inode;
- if (inode) {
+ if (s_inode) {
NCP_FINFO(s_inode)->volNumber = vnum;
NCP_FINFO(s_inode)->dirEntNum = de;
NCP_FINFO(s_inode)->DosDirNum = dosde;
diff --git a/fs/nfs/client.c b/fs/nfs/client.c
index a7ce15d..1520253 100644
--- a/fs/nfs/client.c
+++ b/fs/nfs/client.c
@@ -1531,7 +1531,7 @@
static void nfs_server_list_stop(struct seq_file *p, void *v);
static int nfs_server_list_show(struct seq_file *m, void *v);
-static struct seq_operations nfs_server_list_ops = {
+static const struct seq_operations nfs_server_list_ops = {
.start = nfs_server_list_start,
.next = nfs_server_list_next,
.stop = nfs_server_list_stop,
@@ -1552,7 +1552,7 @@
static void nfs_volume_list_stop(struct seq_file *p, void *v);
static int nfs_volume_list_show(struct seq_file *m, void *v);
-static struct seq_operations nfs_volume_list_ops = {
+static const struct seq_operations nfs_volume_list_ops = {
.start = nfs_volume_list_start,
.next = nfs_volume_list_next,
.stop = nfs_volume_list_stop,
diff --git a/fs/nfsd/export.c b/fs/nfsd/export.c
index 984a5eb..c1c9e03 100644
--- a/fs/nfsd/export.c
+++ b/fs/nfsd/export.c
@@ -1517,7 +1517,7 @@
return svc_export_show(m, &svc_export_cache, cp);
}
-struct seq_operations nfs_exports_op = {
+const struct seq_operations nfs_exports_op = {
.start = e_start,
.next = e_next,
.stop = e_stop,
diff --git a/fs/ntfs/file.c b/fs/ntfs/file.c
index 4350d499..663c0e3 100644
--- a/fs/ntfs/file.c
+++ b/fs/ntfs/file.c
@@ -2146,46 +2146,6 @@
}
/**
- * ntfs_file_writev -
- *
- * Basically the same as generic_file_writev() except that it ends up calling
- * ntfs_file_aio_write_nolock() instead of __generic_file_aio_write_nolock().
- */
-static ssize_t ntfs_file_writev(struct file *file, const struct iovec *iov,
- unsigned long nr_segs, loff_t *ppos)
-{
- struct address_space *mapping = file->f_mapping;
- struct inode *inode = mapping->host;
- struct kiocb kiocb;
- ssize_t ret;
-
- mutex_lock(&inode->i_mutex);
- init_sync_kiocb(&kiocb, file);
- ret = ntfs_file_aio_write_nolock(&kiocb, iov, nr_segs, ppos);
- if (ret == -EIOCBQUEUED)
- ret = wait_on_sync_kiocb(&kiocb);
- mutex_unlock(&inode->i_mutex);
- if (ret > 0) {
- int err = generic_write_sync(file, *ppos - ret, ret);
- if (err < 0)
- ret = err;
- }
- return ret;
-}
-
-/**
- * ntfs_file_write - simple wrapper for ntfs_file_writev()
- */
-static ssize_t ntfs_file_write(struct file *file, const char __user *buf,
- size_t count, loff_t *ppos)
-{
- struct iovec local_iov = { .iov_base = (void __user *)buf,
- .iov_len = count };
-
- return ntfs_file_writev(file, &local_iov, 1, ppos);
-}
-
-/**
* ntfs_file_fsync - sync a file to disk
* @filp: file to be synced
* @dentry: dentry describing the file to sync
@@ -2247,7 +2207,7 @@
.read = do_sync_read, /* Read from file. */
.aio_read = generic_file_aio_read, /* Async read from file. */
#ifdef NTFS_RW
- .write = ntfs_file_write, /* Write to file. */
+ .write = do_sync_write, /* Write to file. */
.aio_write = ntfs_file_aio_write, /* Async write to file. */
/*.release = ,*/ /* Last file is closed. See
fs/ext2/file.c::
diff --git a/fs/ocfs2/cluster/netdebug.c b/fs/ocfs2/cluster/netdebug.c
index f842487..cfb2be7 100644
--- a/fs/ocfs2/cluster/netdebug.c
+++ b/fs/ocfs2/cluster/netdebug.c
@@ -163,7 +163,7 @@
{
}
-static struct seq_operations nst_seq_ops = {
+static const struct seq_operations nst_seq_ops = {
.start = nst_seq_start,
.next = nst_seq_next,
.stop = nst_seq_stop,
@@ -344,7 +344,7 @@
{
}
-static struct seq_operations sc_seq_ops = {
+static const struct seq_operations sc_seq_ops = {
.start = sc_seq_start,
.next = sc_seq_next,
.stop = sc_seq_stop,
diff --git a/fs/ocfs2/dlm/dlmdebug.c b/fs/ocfs2/dlm/dlmdebug.c
index df52f70..c5c8812 100644
--- a/fs/ocfs2/dlm/dlmdebug.c
+++ b/fs/ocfs2/dlm/dlmdebug.c
@@ -683,7 +683,7 @@
return 0;
}
-static struct seq_operations debug_lockres_ops = {
+static const struct seq_operations debug_lockres_ops = {
.start = lockres_seq_start,
.stop = lockres_seq_stop,
.next = lockres_seq_next,
diff --git a/fs/open.c b/fs/open.c
index 31191bf..4f01e06 100644
--- a/fs/open.c
+++ b/fs/open.c
@@ -290,10 +290,9 @@
return error;
}
-SYSCALL_DEFINE2(truncate, const char __user *, path, unsigned long, length)
+SYSCALL_DEFINE2(truncate, const char __user *, path, long, length)
{
- /* on 32-bit boxen it will cut the range 2^31--2^32-1 off */
- return do_sys_truncate(path, (long)length);
+ return do_sys_truncate(path, length);
}
static long do_sys_ftruncate(unsigned int fd, loff_t length, int small)
diff --git a/fs/proc/array.c b/fs/proc/array.c
index 725a650..0c6bc60 100644
--- a/fs/proc/array.c
+++ b/fs/proc/array.c
@@ -82,6 +82,7 @@
#include <linux/pid_namespace.h>
#include <linux/ptrace.h>
#include <linux/tracehook.h>
+#include <linux/swapops.h>
#include <asm/pgtable.h>
#include <asm/processor.h>
@@ -321,6 +322,87 @@
p->nivcsw);
}
+struct stack_stats {
+ struct vm_area_struct *vma;
+ unsigned long startpage;
+ unsigned long usage;
+};
+
+static int stack_usage_pte_range(pmd_t *pmd, unsigned long addr,
+ unsigned long end, struct mm_walk *walk)
+{
+ struct stack_stats *ss = walk->private;
+ struct vm_area_struct *vma = ss->vma;
+ pte_t *pte, ptent;
+ spinlock_t *ptl;
+ int ret = 0;
+
+ pte = pte_offset_map_lock(vma->vm_mm, pmd, addr, &ptl);
+ for (; addr != end; pte++, addr += PAGE_SIZE) {
+ ptent = *pte;
+
+#ifdef CONFIG_STACK_GROWSUP
+ if (pte_present(ptent) || is_swap_pte(ptent))
+ ss->usage = addr - ss->startpage + PAGE_SIZE;
+#else
+ if (pte_present(ptent) || is_swap_pte(ptent)) {
+ ss->usage = ss->startpage - addr + PAGE_SIZE;
+ pte++;
+ ret = 1;
+ break;
+ }
+#endif
+ }
+ pte_unmap_unlock(pte - 1, ptl);
+ cond_resched();
+ return ret;
+}
+
+static inline unsigned long get_stack_usage_in_bytes(struct vm_area_struct *vma,
+ struct task_struct *task)
+{
+ struct stack_stats ss;
+ struct mm_walk stack_walk = {
+ .pmd_entry = stack_usage_pte_range,
+ .mm = vma->vm_mm,
+ .private = &ss,
+ };
+
+ if (!vma->vm_mm || is_vm_hugetlb_page(vma))
+ return 0;
+
+ ss.vma = vma;
+ ss.startpage = task->stack_start & PAGE_MASK;
+ ss.usage = 0;
+
+#ifdef CONFIG_STACK_GROWSUP
+ walk_page_range(KSTK_ESP(task) & PAGE_MASK, vma->vm_end,
+ &stack_walk);
+#else
+ walk_page_range(vma->vm_start, (KSTK_ESP(task) & PAGE_MASK) + PAGE_SIZE,
+ &stack_walk);
+#endif
+ return ss.usage;
+}
+
+static inline void task_show_stack_usage(struct seq_file *m,
+ struct task_struct *task)
+{
+ struct vm_area_struct *vma;
+ struct mm_struct *mm = get_task_mm(task);
+
+ if (mm) {
+ down_read(&mm->mmap_sem);
+ vma = find_vma(mm, task->stack_start);
+ if (vma)
+ seq_printf(m, "Stack usage:\t%lu kB\n",
+ get_stack_usage_in_bytes(vma, task) >> 10);
+
+ up_read(&mm->mmap_sem);
+ mmput(mm);
+ }
+}
+
int proc_pid_status(struct seq_file *m, struct pid_namespace *ns,
struct pid *pid, struct task_struct *task)
{
@@ -340,6 +422,7 @@
task_show_regs(m, task);
#endif
task_context_switch_counts(m, task);
+ task_show_stack_usage(m, task);
return 0;
}
@@ -481,7 +564,7 @@
rsslim,
mm ? mm->start_code : 0,
mm ? mm->end_code : 0,
- (permitted && mm) ? mm->start_stack : 0,
+ (permitted) ? task->stack_start : 0,
esp,
eip,
/* The signal information here is obsolete.
diff --git a/fs/proc/base.c b/fs/proc/base.c
index 55c4c80..837469a 100644
--- a/fs/proc/base.c
+++ b/fs/proc/base.c
@@ -458,7 +458,7 @@
};
static const struct limit_names lnames[RLIM_NLIMITS] = {
- [RLIMIT_CPU] = {"Max cpu time", "ms"},
+ [RLIMIT_CPU] = {"Max cpu time", "seconds"},
[RLIMIT_FSIZE] = {"Max file size", "bytes"},
[RLIMIT_DATA] = {"Max data size", "bytes"},
[RLIMIT_STACK] = {"Max stack size", "bytes"},
@@ -1187,17 +1187,16 @@
count = sizeof(buffer) - 1;
if (copy_from_user(buffer, buf, count))
return -EFAULT;
- make_it_fail = simple_strtol(buffer, &end, 0);
- if (*end == '\n')
- end++;
+ make_it_fail = simple_strtol(strstrip(buffer), &end, 0);
+ if (*end)
+ return -EINVAL;
task = get_proc_task(file->f_dentry->d_inode);
if (!task)
return -ESRCH;
task->make_it_fail = make_it_fail;
put_task_struct(task);
- if (end - buffer == 0)
- return -EIO;
- return end - buffer;
+
+ return count;
}
static const struct file_operations proc_fault_inject_operations = {
@@ -2604,9 +2603,6 @@
dput(dentry);
}
- if (tgid == 0)
- goto out;
-
name.name = buf;
name.len = snprintf(buf, sizeof(buf), "%d", tgid);
leader = d_hash_and_lookup(mnt->mnt_root, &name);
@@ -2663,17 +2659,16 @@
void proc_flush_task(struct task_struct *task)
{
int i;
- struct pid *pid, *tgid = NULL;
+ struct pid *pid, *tgid;
struct upid *upid;
pid = task_pid(task);
- if (thread_group_leader(task))
- tgid = task_tgid(task);
+ tgid = task_tgid(task);
for (i = 0; i <= pid->level; i++) {
upid = &pid->numbers[i];
proc_flush_task_mnt(upid->ns->proc_mnt, upid->nr,
- tgid ? tgid->numbers[i].nr : 0);
+ tgid->numbers[i].nr);
}
upid = &pid->numbers[pid->level];
diff --git a/fs/proc/kcore.c b/fs/proc/kcore.c
index f06f45b4..5601337 100644
--- a/fs/proc/kcore.c
+++ b/fs/proc/kcore.c
@@ -17,9 +17,15 @@
#include <linux/elfcore.h>
#include <linux/vmalloc.h>
#include <linux/highmem.h>
+#include <linux/bootmem.h>
#include <linux/init.h>
#include <asm/uaccess.h>
#include <asm/io.h>
+#include <linux/list.h>
+#include <linux/ioport.h>
+#include <linux/mm.h>
+#include <linux/memory.h>
+#include <asm/sections.h>
#define CORE_STR "CORE"
@@ -29,17 +35,6 @@
static struct proc_dir_entry *proc_root_kcore;
-static int open_kcore(struct inode * inode, struct file * filp)
-{
- return capable(CAP_SYS_RAWIO) ? 0 : -EPERM;
-}
-
-static ssize_t read_kcore(struct file *, char __user *, size_t, loff_t *);
-
-static const struct file_operations proc_kcore_operations = {
- .read = read_kcore,
- .open = open_kcore,
-};
#ifndef kc_vaddr_to_offset
#define kc_vaddr_to_offset(v) ((v) - PAGE_OFFSET)
@@ -57,18 +52,19 @@
void *data;
};
-static struct kcore_list *kclist;
+static LIST_HEAD(kclist_head);
static DEFINE_RWLOCK(kclist_lock);
+static int kcore_need_update = 1;
void
-kclist_add(struct kcore_list *new, void *addr, size_t size)
+kclist_add(struct kcore_list *new, void *addr, size_t size, int type)
{
new->addr = (unsigned long)addr;
new->size = size;
+ new->type = type;
write_lock(&kclist_lock);
- new->next = kclist;
- kclist = new;
+ list_add_tail(&new->list, &kclist_head);
write_unlock(&kclist_lock);
}
@@ -80,7 +76,7 @@
*nphdr = 1; /* PT_NOTE */
size = 0;
- for (m=kclist; m; m=m->next) {
+ list_for_each_entry(m, &kclist_head, list) {
try = kc_vaddr_to_offset((size_t)m->addr + m->size);
if (try > size)
size = try;
@@ -97,6 +93,177 @@
return size + *elf_buflen;
}
+static void free_kclist_ents(struct list_head *head)
+{
+ struct kcore_list *tmp, *pos;
+
+ list_for_each_entry_safe(pos, tmp, head, list) {
+ list_del(&pos->list);
+ kfree(pos);
+ }
+}
+/*
+ * Replace all KCORE_RAM/KCORE_VMEMMAP information with passed list.
+ */
+static void __kcore_update_ram(struct list_head *list)
+{
+ int nphdr;
+ size_t size;
+ struct kcore_list *tmp, *pos;
+ LIST_HEAD(garbage);
+
+ write_lock(&kclist_lock);
+ if (kcore_need_update) {
+ list_for_each_entry_safe(pos, tmp, &kclist_head, list) {
+ if (pos->type == KCORE_RAM
+ || pos->type == KCORE_VMEMMAP)
+ list_move(&pos->list, &garbage);
+ }
+ list_splice_tail(list, &kclist_head);
+ } else
+ list_splice(list, &garbage);
+ kcore_need_update = 0;
+ proc_root_kcore->size = get_kcore_size(&nphdr, &size);
+ write_unlock(&kclist_lock);
+
+ free_kclist_ents(&garbage);
+}
+
+
+#ifdef CONFIG_HIGHMEM
+/*
+ * If no highmem, we can assume [0...max_low_pfn) continuous range of memory
+ * because memory hole is not as big as !HIGHMEM case.
+ * (HIGHMEM is special because part of memory is _invisible_ from the kernel.)
+ */
+static int kcore_update_ram(void)
+{
+ LIST_HEAD(head);
+ struct kcore_list *ent;
+ int ret = 0;
+
+ ent = kmalloc(sizeof(*ent), GFP_KERNEL);
+ if (!ent)
+ return -ENOMEM;
+ ent->addr = (unsigned long)__va(0);
+ ent->size = max_low_pfn << PAGE_SHIFT;
+ ent->type = KCORE_RAM;
+ list_add(&ent->list, &head);
+ __kcore_update_ram(&head);
+ return ret;
+}
+
+#else /* !CONFIG_HIGHMEM */
+
+#ifdef CONFIG_SPARSEMEM_VMEMMAP
+/* calculate vmemmap's address from given system ram pfn and register it */
+int get_sparsemem_vmemmap_info(struct kcore_list *ent, struct list_head *head)
+{
+ unsigned long pfn = __pa(ent->addr) >> PAGE_SHIFT;
+ unsigned long nr_pages = ent->size >> PAGE_SHIFT;
+ unsigned long start, end;
+ struct kcore_list *vmm, *tmp;
+
+
+ start = ((unsigned long)pfn_to_page(pfn)) & PAGE_MASK;
+ end = ((unsigned long)pfn_to_page(pfn + nr_pages)) - 1;
+ end = ALIGN(end, PAGE_SIZE);
+ /* overlap check (because we have to align page */
+ list_for_each_entry(tmp, head, list) {
+ if (tmp->type != KCORE_VMEMMAP)
+ continue;
+ if (start < tmp->addr + tmp->size)
+ if (end > tmp->addr)
+ end = tmp->addr;
+ }
+ if (start < end) {
+ vmm = kmalloc(sizeof(*vmm), GFP_KERNEL);
+ if (!vmm)
+ return 0;
+ vmm->addr = start;
+ vmm->size = end - start;
+ vmm->type = KCORE_VMEMMAP;
+ list_add_tail(&vmm->list, head);
+ }
+ return 1;
+
+}
+#else
+int get_sparsemem_vmemmap_info(struct kcore_list *ent, struct list_head *head)
+{
+ return 1;
+}
+
+#endif
+
+static int
+kclist_add_private(unsigned long pfn, unsigned long nr_pages, void *arg)
+{
+ struct list_head *head = (struct list_head *)arg;
+ struct kcore_list *ent;
+
+ ent = kmalloc(sizeof(*ent), GFP_KERNEL);
+ if (!ent)
+ return -ENOMEM;
+ ent->addr = (unsigned long)__va((pfn << PAGE_SHIFT));
+ ent->size = nr_pages << PAGE_SHIFT;
+
+ /* Sanity check: Can happen in 32bit arch...maybe */
+ if (ent->addr < (unsigned long) __va(0))
+ goto free_out;
+
+ /* cut not-mapped area. ....from ppc-32 code. */
+ if (ULONG_MAX - ent->addr < ent->size)
+ ent->size = ULONG_MAX - ent->addr;
+
+ /* cut when vmalloc() area is higher than direct-map area */
+ if (VMALLOC_START > (unsigned long)__va(0)) {
+ if (ent->addr > VMALLOC_START)
+ goto free_out;
+ if (VMALLOC_START - ent->addr < ent->size)
+ ent->size = VMALLOC_START - ent->addr;
+ }
+
+ ent->type = KCORE_RAM;
+ list_add_tail(&ent->list, head);
+
+ if (!get_sparsemem_vmemmap_info(ent, head)) {
+ list_del(&ent->list);
+ goto free_out;
+ }
+
+ return 0;
+free_out:
+ kfree(ent);
+ return 1;
+}
+
+static int kcore_update_ram(void)
+{
+ int nid, ret;
+ unsigned long end_pfn;
+ LIST_HEAD(head);
+
+ /* Not inialized....update now */
+ /* find out "max pfn" */
+ end_pfn = 0;
+ for_each_node_state(nid, N_HIGH_MEMORY) {
+ unsigned long node_end;
+ node_end = NODE_DATA(nid)->node_start_pfn +
+ NODE_DATA(nid)->node_spanned_pages;
+ if (end_pfn < node_end)
+ end_pfn = node_end;
+ }
+ /* scan 0 to max_pfn */
+ ret = walk_system_ram_range(0, end_pfn, &head, kclist_add_private);
+ if (ret) {
+ free_kclist_ents(&head);
+ return -ENOMEM;
+ }
+ __kcore_update_ram(&head);
+ return ret;
+}
+#endif /* CONFIG_HIGHMEM */
/*****************************************************************************/
/*
@@ -192,7 +359,7 @@
nhdr->p_align = 0;
/* setup ELF PT_LOAD program header for every area */
- for (m=kclist; m; m=m->next) {
+ list_for_each_entry(m, &kclist_head, list) {
phdr = (struct elf_phdr *) bufp;
bufp += sizeof(struct elf_phdr);
offset += sizeof(struct elf_phdr);
@@ -265,7 +432,8 @@
unsigned long start;
read_lock(&kclist_lock);
- proc_root_kcore->size = size = get_kcore_size(&nphdr, &elf_buflen);
+ size = get_kcore_size(&nphdr, &elf_buflen);
+
if (buflen == 0 || *fpos >= size) {
read_unlock(&kclist_lock);
return 0;
@@ -317,7 +485,7 @@
struct kcore_list *m;
read_lock(&kclist_lock);
- for (m=kclist; m; m=m->next) {
+ list_for_each_entry(m, &kclist_head, list) {
if (start >= m->addr && start < (m->addr+m->size))
break;
}
@@ -326,7 +494,7 @@
if (m == NULL) {
if (clear_user(buffer, tsz))
return -EFAULT;
- } else if (is_vmalloc_addr((void *)start)) {
+ } else if (is_vmalloc_or_module_addr((void *)start)) {
char * elf_buf;
elf_buf = kzalloc(tsz, GFP_KERNEL);
@@ -371,12 +539,96 @@
return acc;
}
+
+static int open_kcore(struct inode *inode, struct file *filp)
+{
+ if (!capable(CAP_SYS_RAWIO))
+ return -EPERM;
+ if (kcore_need_update)
+ kcore_update_ram();
+ if (i_size_read(inode) != proc_root_kcore->size) {
+ mutex_lock(&inode->i_mutex);
+ i_size_write(inode, proc_root_kcore->size);
+ mutex_unlock(&inode->i_mutex);
+ }
+ return 0;
+}
+
+
+static const struct file_operations proc_kcore_operations = {
+ .read = read_kcore,
+ .open = open_kcore,
+};
+
+#ifdef CONFIG_MEMORY_HOTPLUG
+/* just remember that we have to update kcore */
+static int __meminit kcore_callback(struct notifier_block *self,
+ unsigned long action, void *arg)
+{
+ switch (action) {
+ case MEM_ONLINE:
+ case MEM_OFFLINE:
+ write_lock(&kclist_lock);
+ kcore_need_update = 1;
+ write_unlock(&kclist_lock);
+ }
+ return NOTIFY_OK;
+}
+#endif
+
+
+static struct kcore_list kcore_vmalloc;
+
+#ifdef CONFIG_ARCH_PROC_KCORE_TEXT
+static struct kcore_list kcore_text;
+/*
+ * If defined, special segment is used for mapping kernel text instead of
+ * direct-map area. We need to create special TEXT section.
+ */
+static void __init proc_kcore_text_init(void)
+{
+ kclist_add(&kcore_text, _stext, _end - _stext, KCORE_TEXT);
+}
+#else
+static void __init proc_kcore_text_init(void)
+{
+}
+#endif
+
+#if defined(CONFIG_MODULES) && defined(MODULES_VADDR)
+/*
+ * MODULES_VADDR has no intersection with VMALLOC_ADDR.
+ */
+struct kcore_list kcore_modules;
+static void __init add_modules_range(void)
+{
+ kclist_add(&kcore_modules, (void *)MODULES_VADDR,
+ MODULES_END - MODULES_VADDR, KCORE_VMALLOC);
+}
+#else
+static void __init add_modules_range(void)
+{
+}
+#endif
+
static int __init proc_kcore_init(void)
{
- proc_root_kcore = proc_create("kcore", S_IRUSR, NULL, &proc_kcore_operations);
- if (proc_root_kcore)
- proc_root_kcore->size =
- (size_t)high_memory - PAGE_OFFSET + PAGE_SIZE;
+ proc_root_kcore = proc_create("kcore", S_IRUSR, NULL,
+ &proc_kcore_operations);
+ if (!proc_root_kcore) {
+ printk(KERN_ERR "couldn't create /proc/kcore\n");
+ return 0; /* Always returns 0. */
+ }
+ /* Store text area if it's special */
+ proc_kcore_text_init();
+ /* Store vmalloc area */
+ kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
+ VMALLOC_END - VMALLOC_START, KCORE_VMALLOC);
+ add_modules_range();
+ /* Store direct-map area from physical memory map */
+ kcore_update_ram();
+ hotplug_memory_notifier(kcore_callback, 0);
+
return 0;
}
module_init(proc_kcore_init);
diff --git a/fs/proc/nommu.c b/fs/proc/nommu.c
index 7e14d1a..9fe7d7e 100644
--- a/fs/proc/nommu.c
+++ b/fs/proc/nommu.c
@@ -109,7 +109,7 @@
return rb_next((struct rb_node *) v);
}
-static struct seq_operations proc_nommu_region_list_seqop = {
+static const struct seq_operations proc_nommu_region_list_seqop = {
.start = nommu_region_list_start,
.next = nommu_region_list_next,
.stop = nommu_region_list_stop,
diff --git a/fs/proc/task_mmu.c b/fs/proc/task_mmu.c
index 59e98fe..2a1bef9 100644
--- a/fs/proc/task_mmu.c
+++ b/fs/proc/task_mmu.c
@@ -243,6 +243,25 @@
} else if (vma->vm_start <= mm->start_stack &&
vma->vm_end >= mm->start_stack) {
name = "[stack]";
+ } else {
+ unsigned long stack_start;
+ struct proc_maps_private *pmp;
+
+ pmp = m->private;
+ stack_start = pmp->task->stack_start;
+
+ if (vma->vm_start <= stack_start &&
+ vma->vm_end >= stack_start) {
+ pad_len_spaces(m, len);
+ seq_printf(m,
+ "[threadstack:%08lx]",
+#ifdef CONFIG_STACK_GROWSUP
+ vma->vm_end - stack_start
+#else
+ stack_start - vma->vm_start
+#endif
+ );
+ }
}
} else {
name = "[vdso]";
@@ -473,21 +492,20 @@
size_t count, loff_t *ppos)
{
struct task_struct *task;
- char buffer[PROC_NUMBUF], *end;
+ char buffer[PROC_NUMBUF];
struct mm_struct *mm;
struct vm_area_struct *vma;
- int type;
+ long type;
memset(buffer, 0, sizeof(buffer));
if (count > sizeof(buffer) - 1)
count = sizeof(buffer) - 1;
if (copy_from_user(buffer, buf, count))
return -EFAULT;
- type = simple_strtol(buffer, &end, 0);
+ if (strict_strtol(strstrip(buffer), 10, &type))
+ return -EINVAL;
if (type < CLEAR_REFS_ALL || type > CLEAR_REFS_MAPPED)
return -EINVAL;
- if (*end == '\n')
- end++;
task = get_proc_task(file->f_path.dentry->d_inode);
if (!task)
return -ESRCH;
@@ -523,9 +541,8 @@
mmput(mm);
}
put_task_struct(task);
- if (end - buffer == 0)
- return -EIO;
- return end - buffer;
+
+ return count;
}
const struct file_operations proc_clear_refs_operations = {
diff --git a/fs/qnx4/Kconfig b/fs/qnx4/Kconfig
index be8e0e1..5f60899 100644
--- a/fs/qnx4/Kconfig
+++ b/fs/qnx4/Kconfig
@@ -6,20 +6,9 @@
QNX 4 and QNX 6 (the latter is also called QNX RTP).
Further information is available at <http://www.qnx.com/>.
Say Y if you intend to mount QNX hard disks or floppies.
- Unless you say Y to "QNX4FS read-write support" below, you will
- only be able to read these file systems.
To compile this file system support as a module, choose M here: the
module will be called qnx4.
If you don't know whether you need it, then you don't need it:
answer N.
-
-config QNX4FS_RW
- bool "QNX4FS write support (DANGEROUS)"
- depends on QNX4FS_FS && EXPERIMENTAL && BROKEN
- help
- Say Y if you want to test write support for QNX4 file systems.
-
- It's currently broken, so for now:
- answer N.
diff --git a/fs/qnx4/Makefile b/fs/qnx4/Makefile
index e4d408c..4a283b3 100644
--- a/fs/qnx4/Makefile
+++ b/fs/qnx4/Makefile
@@ -4,4 +4,4 @@
obj-$(CONFIG_QNX4FS_FS) += qnx4.o
-qnx4-objs := inode.o dir.o namei.o file.o bitmap.o truncate.o
+qnx4-objs := inode.o dir.o namei.o bitmap.o
diff --git a/fs/qnx4/bitmap.c b/fs/qnx4/bitmap.c
index e1cd061..0afba06 100644
--- a/fs/qnx4/bitmap.c
+++ b/fs/qnx4/bitmap.c
@@ -78,84 +78,3 @@
return total_free;
}
-
-#ifdef CONFIG_QNX4FS_RW
-
-int qnx4_is_free(struct super_block *sb, long block)
-{
- int start = le32_to_cpu(qnx4_sb(sb)->BitMap->di_first_xtnt.xtnt_blk) - 1;
- int size = le32_to_cpu(qnx4_sb(sb)->BitMap->di_size);
- struct buffer_head *bh;
- const char *g;
- int ret = -EIO;
-
- start += block / (QNX4_BLOCK_SIZE * 8);
- QNX4DEBUG(("qnx4: is_free requesting block [%lu], bitmap in block [%lu]\n",
- (unsigned long) block, (unsigned long) start));
- (void) size; /* CHECKME */
- bh = sb_bread(sb, start);
- if (bh == NULL) {
- return -EIO;
- }
- g = bh->b_data + (block % QNX4_BLOCK_SIZE);
- if (((*g) & (1 << (block % 8))) == 0) {
- QNX4DEBUG(("qnx4: is_free -> block is free\n"));
- ret = 1;
- } else {
- QNX4DEBUG(("qnx4: is_free -> block is busy\n"));
- ret = 0;
- }
- brelse(bh);
-
- return ret;
-}
-
-int qnx4_set_bitmap(struct super_block *sb, long block, int busy)
-{
- int start = le32_to_cpu(qnx4_sb(sb)->BitMap->di_first_xtnt.xtnt_blk) - 1;
- int size = le32_to_cpu(qnx4_sb(sb)->BitMap->di_size);
- struct buffer_head *bh;
- char *g;
-
- start += block / (QNX4_BLOCK_SIZE * 8);
- QNX4DEBUG(("qnx4: set_bitmap requesting block [%lu], bitmap in block [%lu]\n",
- (unsigned long) block, (unsigned long) start));
- (void) size; /* CHECKME */
- bh = sb_bread(sb, start);
- if (bh == NULL) {
- return -EIO;
- }
- g = bh->b_data + (block % QNX4_BLOCK_SIZE);
- if (busy == 0) {
- (*g) &= ~(1 << (block % 8));
- } else {
- (*g) |= (1 << (block % 8));
- }
- mark_buffer_dirty(bh);
- brelse(bh);
-
- return 0;
-}
-
-static void qnx4_clear_inode(struct inode *inode)
-{
- struct qnx4_inode_entry *qnx4_ino = qnx4_raw_inode(inode);
- /* What for? */
- memset(qnx4_ino->di_fname, 0, sizeof qnx4_ino->di_fname);
- qnx4_ino->di_size = 0;
- qnx4_ino->di_num_xtnts = 0;
- qnx4_ino->di_mode = 0;
- qnx4_ino->di_status = 0;
-}
-
-void qnx4_free_inode(struct inode *inode)
-{
- if (inode->i_ino < 1) {
- printk("free_inode: inode 0 or nonexistent inode\n");
- return;
- }
- qnx4_clear_inode(inode);
- clear_inode(inode);
-}
-
-#endif
diff --git a/fs/qnx4/dir.c b/fs/qnx4/dir.c
index 003c68f..86cc39c 100644
--- a/fs/qnx4/dir.c
+++ b/fs/qnx4/dir.c
@@ -85,9 +85,4 @@
const struct inode_operations qnx4_dir_inode_operations =
{
.lookup = qnx4_lookup,
-#ifdef CONFIG_QNX4FS_RW
- .create = qnx4_create,
- .unlink = qnx4_unlink,
- .rmdir = qnx4_rmdir,
-#endif
};
diff --git a/fs/qnx4/file.c b/fs/qnx4/file.c
deleted file mode 100644
index 09b170a..0000000
--- a/fs/qnx4/file.c
+++ /dev/null
@@ -1,40 +0,0 @@
-/*
- * QNX4 file system, Linux implementation.
- *
- * Version : 0.2.1
- *
- * Using parts of the xiafs filesystem.
- *
- * History :
- *
- * 25-05-1998 by Richard Frowijn : first release.
- * 21-06-1998 by Frank Denis : wrote qnx4_readpage to use generic_file_read.
- * 27-06-1998 by Frank Denis : file overwriting.
- */
-
-#include "qnx4.h"
-
-/*
- * We have mostly NULL's here: the current defaults are ok for
- * the qnx4 filesystem.
- */
-const struct file_operations qnx4_file_operations =
-{
- .llseek = generic_file_llseek,
- .read = do_sync_read,
- .aio_read = generic_file_aio_read,
- .mmap = generic_file_mmap,
- .splice_read = generic_file_splice_read,
-#ifdef CONFIG_QNX4FS_RW
- .write = do_sync_write,
- .aio_write = generic_file_aio_write,
- .fsync = simple_fsync,
-#endif
-};
-
-const struct inode_operations qnx4_file_inode_operations =
-{
-#ifdef CONFIG_QNX4FS_RW
- .truncate = qnx4_truncate,
-#endif
-};
diff --git a/fs/qnx4/inode.c b/fs/qnx4/inode.c
index 681df5f..d2cd179 100644
--- a/fs/qnx4/inode.c
+++ b/fs/qnx4/inode.c
@@ -28,73 +28,6 @@
static const struct super_operations qnx4_sops;
-#ifdef CONFIG_QNX4FS_RW
-
-static void qnx4_delete_inode(struct inode *inode)
-{
- QNX4DEBUG(("qnx4: deleting inode [%lu]\n", (unsigned long) inode->i_ino));
- truncate_inode_pages(&inode->i_data, 0);
- inode->i_size = 0;
- qnx4_truncate(inode);
- lock_kernel();
- qnx4_free_inode(inode);
- unlock_kernel();
-}
-
-static int qnx4_write_inode(struct inode *inode, int do_sync)
-{
- struct qnx4_inode_entry *raw_inode;
- int block, ino;
- struct buffer_head *bh;
- ino = inode->i_ino;
-
- QNX4DEBUG(("qnx4: write inode 1.\n"));
- if (inode->i_nlink == 0) {
- return 0;
- }
- if (!ino) {
- printk("qnx4: bad inode number on dev %s: %d is out of range\n",
- inode->i_sb->s_id, ino);
- return -EIO;
- }
- QNX4DEBUG(("qnx4: write inode 2.\n"));
- block = ino / QNX4_INODES_PER_BLOCK;
- lock_kernel();
- if (!(bh = sb_bread(inode->i_sb, block))) {
- printk("qnx4: major problem: unable to read inode from dev "
- "%s\n", inode->i_sb->s_id);
- unlock_kernel();
- return -EIO;
- }
- raw_inode = ((struct qnx4_inode_entry *) bh->b_data) +
- (ino % QNX4_INODES_PER_BLOCK);
- raw_inode->di_mode = cpu_to_le16(inode->i_mode);
- raw_inode->di_uid = cpu_to_le16(fs_high2lowuid(inode->i_uid));
- raw_inode->di_gid = cpu_to_le16(fs_high2lowgid(inode->i_gid));
- raw_inode->di_nlink = cpu_to_le16(inode->i_nlink);
- raw_inode->di_size = cpu_to_le32(inode->i_size);
- raw_inode->di_mtime = cpu_to_le32(inode->i_mtime.tv_sec);
- raw_inode->di_atime = cpu_to_le32(inode->i_atime.tv_sec);
- raw_inode->di_ctime = cpu_to_le32(inode->i_ctime.tv_sec);
- raw_inode->di_first_xtnt.xtnt_size = cpu_to_le32(inode->i_blocks);
- mark_buffer_dirty(bh);
- if (do_sync) {
- sync_dirty_buffer(bh);
- if (buffer_req(bh) && !buffer_uptodate(bh)) {
- printk("qnx4: IO error syncing inode [%s:%08x]\n",
- inode->i_sb->s_id, ino);
- brelse(bh);
- unlock_kernel();
- return -EIO;
- }
- }
- brelse(bh);
- unlock_kernel();
- return 0;
-}
-
-#endif
-
static void qnx4_put_super(struct super_block *sb);
static struct inode *qnx4_alloc_inode(struct super_block *sb);
static void qnx4_destroy_inode(struct inode *inode);
@@ -108,10 +41,6 @@
.put_super = qnx4_put_super,
.statfs = qnx4_statfs,
.remount_fs = qnx4_remount,
-#ifdef CONFIG_QNX4FS_RW
- .write_inode = qnx4_write_inode,
- .delete_inode = qnx4_delete_inode,
-#endif
};
static int qnx4_remount(struct super_block *sb, int *flags, char *data)
@@ -120,15 +49,7 @@
qs = qnx4_sb(sb);
qs->Version = QNX4_VERSION;
-#ifndef CONFIG_QNX4FS_RW
*flags |= MS_RDONLY;
-#endif
- if (*flags & MS_RDONLY) {
- return 0;
- }
-
- mark_buffer_dirty(qs->sb_buf);
-
return 0;
}
@@ -354,9 +275,7 @@
}
s->s_op = &qnx4_sops;
s->s_magic = QNX4_SUPER_MAGIC;
-#ifndef CONFIG_QNX4FS_RW
s->s_flags |= MS_RDONLY; /* Yup, read-only yet */
-#endif
qnx4_sb(s)->sb_buf = bh;
qnx4_sb(s)->sb = (struct qnx4_super_block *) bh->b_data;
@@ -489,8 +408,7 @@
memcpy(qnx4_inode, raw_inode, QNX4_DIR_ENTRY_SIZE);
if (S_ISREG(inode->i_mode)) {
- inode->i_op = &qnx4_file_inode_operations;
- inode->i_fop = &qnx4_file_operations;
+ inode->i_fop = &generic_ro_fops;
inode->i_mapping->a_ops = &qnx4_aops;
qnx4_i(inode)->mmu_private = inode->i_size;
} else if (S_ISDIR(inode->i_mode)) {
diff --git a/fs/qnx4/namei.c b/fs/qnx4/namei.c
index 5972ed2..ae1e7ed 100644
--- a/fs/qnx4/namei.c
+++ b/fs/qnx4/namei.c
@@ -134,108 +134,3 @@
return NULL;
}
-
-#ifdef CONFIG_QNX4FS_RW
-int qnx4_create(struct inode *dir, struct dentry *dentry, int mode,
- struct nameidata *nd)
-{
- QNX4DEBUG(("qnx4: qnx4_create\n"));
- if (dir == NULL) {
- return -ENOENT;
- }
- return -ENOSPC;
-}
-
-int qnx4_rmdir(struct inode *dir, struct dentry *dentry)
-{
- struct buffer_head *bh;
- struct qnx4_inode_entry *de;
- struct inode *inode;
- int retval;
- int ino;
-
- QNX4DEBUG(("qnx4: qnx4_rmdir [%s]\n", dentry->d_name.name));
- lock_kernel();
- bh = qnx4_find_entry(dentry->d_name.len, dir, dentry->d_name.name,
- &de, &ino);
- if (bh == NULL) {
- unlock_kernel();
- return -ENOENT;
- }
- inode = dentry->d_inode;
- if (inode->i_ino != ino) {
- retval = -EIO;
- goto end_rmdir;
- }
-#if 0
- if (!empty_dir(inode)) {
- retval = -ENOTEMPTY;
- goto end_rmdir;
- }
-#endif
- if (inode->i_nlink != 2) {
- QNX4DEBUG(("empty directory has nlink!=2 (%d)\n", inode->i_nlink));
- }
- QNX4DEBUG(("qnx4: deleting directory\n"));
- de->di_status = 0;
- memset(de->di_fname, 0, sizeof de->di_fname);
- de->di_mode = 0;
- mark_buffer_dirty_inode(bh, dir);
- clear_nlink(inode);
- mark_inode_dirty(inode);
- inode->i_ctime = dir->i_ctime = dir->i_mtime = CURRENT_TIME_SEC;
- inode_dec_link_count(dir);
- retval = 0;
-
- end_rmdir:
- brelse(bh);
-
- unlock_kernel();
- return retval;
-}
-
-int qnx4_unlink(struct inode *dir, struct dentry *dentry)
-{
- struct buffer_head *bh;
- struct qnx4_inode_entry *de;
- struct inode *inode;
- int retval;
- int ino;
-
- QNX4DEBUG(("qnx4: qnx4_unlink [%s]\n", dentry->d_name.name));
- lock_kernel();
- bh = qnx4_find_entry(dentry->d_name.len, dir, dentry->d_name.name,
- &de, &ino);
- if (bh == NULL) {
- unlock_kernel();
- return -ENOENT;
- }
- inode = dentry->d_inode;
- if (inode->i_ino != ino) {
- retval = -EIO;
- goto end_unlink;
- }
- retval = -EPERM;
- if (!inode->i_nlink) {
- QNX4DEBUG(("Deleting nonexistent file (%s:%lu), %d\n",
- inode->i_sb->s_id,
- inode->i_ino, inode->i_nlink));
- inode->i_nlink = 1;
- }
- de->di_status = 0;
- memset(de->di_fname, 0, sizeof de->di_fname);
- de->di_mode = 0;
- mark_buffer_dirty_inode(bh, dir);
- dir->i_ctime = dir->i_mtime = CURRENT_TIME_SEC;
- mark_inode_dirty(dir);
- inode->i_ctime = dir->i_ctime;
- inode_dec_link_count(inode);
- retval = 0;
-
-end_unlink:
- unlock_kernel();
- brelse(bh);
-
- return retval;
-}
-#endif
diff --git a/fs/qnx4/qnx4.h b/fs/qnx4/qnx4.h
index 9efc089..33a6085 100644
--- a/fs/qnx4/qnx4.h
+++ b/fs/qnx4/qnx4.h
@@ -29,17 +29,9 @@
extern struct buffer_head *qnx4_bread(struct inode *, int, int);
-extern const struct inode_operations qnx4_file_inode_operations;
extern const struct inode_operations qnx4_dir_inode_operations;
-extern const struct file_operations qnx4_file_operations;
extern const struct file_operations qnx4_dir_operations;
extern int qnx4_is_free(struct super_block *sb, long block);
-extern int qnx4_set_bitmap(struct super_block *sb, long block, int busy);
-extern int qnx4_create(struct inode *inode, struct dentry *dentry, int mode, struct nameidata *nd);
-extern void qnx4_truncate(struct inode *inode);
-extern void qnx4_free_inode(struct inode *inode);
-extern int qnx4_unlink(struct inode *dir, struct dentry *dentry);
-extern int qnx4_rmdir(struct inode *dir, struct dentry *dentry);
static inline struct qnx4_sb_info *qnx4_sb(struct super_block *sb)
{
diff --git a/fs/qnx4/truncate.c b/fs/qnx4/truncate.c
deleted file mode 100644
index d94d9ee..0000000
--- a/fs/qnx4/truncate.c
+++ /dev/null
@@ -1,34 +0,0 @@
-/*
- * QNX4 file system, Linux implementation.
- *
- * Version : 0.1
- *
- * Using parts of the xiafs filesystem.
- *
- * History :
- *
- * 30-06-1998 by Frank DENIS : ugly filler.
- */
-
-#include <linux/smp_lock.h>
-#include "qnx4.h"
-
-#ifdef CONFIG_QNX4FS_RW
-
-void qnx4_truncate(struct inode *inode)
-{
- if (!(S_ISREG(inode->i_mode) || S_ISDIR(inode->i_mode) ||
- S_ISLNK(inode->i_mode))) {
- return;
- }
- lock_kernel();
- if (!(S_ISDIR(inode->i_mode))) {
- /* TODO */
- }
- QNX4DEBUG(("qnx4: qnx4_truncate called\n"));
- inode->i_mtime = inode->i_ctime = CURRENT_TIME_SEC;
- mark_inode_dirty(inode);
- unlock_kernel();
-}
-
-#endif
diff --git a/fs/ramfs/inode.c b/fs/ramfs/inode.c
index a7f0110..a6090aa 100644
--- a/fs/ramfs/inode.c
+++ b/fs/ramfs/inode.c
@@ -34,12 +34,10 @@
#include <linux/ramfs.h>
#include <linux/sched.h>
#include <linux/parser.h>
+#include <linux/magic.h>
#include <asm/uaccess.h>
#include "internal.h"
-/* some random number */
-#define RAMFS_MAGIC 0x858458f6
-
#define RAMFS_DEFAULT_MODE 0755
static const struct super_operations ramfs_ops;
diff --git a/fs/select.c b/fs/select.c
index 8084834..a201fc3 100644
--- a/fs/select.c
+++ b/fs/select.c
@@ -41,22 +41,28 @@
* better solutions..
*/
+#define MAX_SLACK (100 * NSEC_PER_MSEC)
+
static long __estimate_accuracy(struct timespec *tv)
{
long slack;
int divfactor = 1000;
+ if (tv->tv_sec < 0)
+ return 0;
+
if (task_nice(current) > 0)
divfactor = divfactor / 5;
+ if (tv->tv_sec > MAX_SLACK / (NSEC_PER_SEC/divfactor))
+ return MAX_SLACK;
+
slack = tv->tv_nsec / divfactor;
slack += tv->tv_sec * (NSEC_PER_SEC/divfactor);
- if (slack > 100 * NSEC_PER_MSEC)
- slack = 100 * NSEC_PER_MSEC;
+ if (slack > MAX_SLACK)
+ return MAX_SLACK;
- if (slack < 0)
- slack = 0;
return slack;
}
diff --git a/fs/smbfs/proc.c b/fs/smbfs/proc.c
index 9468168..71c29b6 100644
--- a/fs/smbfs/proc.c
+++ b/fs/smbfs/proc.c
@@ -509,7 +509,7 @@
month = 2;
} else {
nl_day = (year & 3) || day <= 59 ? day : day - 1;
- for (month = 0; month < 12; month++)
+ for (month = 1; month < 12; month++)
if (day_n[month] > nl_day)
break;
}
diff --git a/fs/sync.c b/fs/sync.c
index c08467a..d104591 100644
--- a/fs/sync.c
+++ b/fs/sync.c
@@ -183,6 +183,7 @@
ret = err;
return ret;
}
+EXPORT_SYMBOL(file_fsync);
/**
* vfs_fsync_range - helper to sync a range of data & metadata to disk
diff --git a/include/asm-generic/gpio.h b/include/asm-generic/gpio.h
index d6c379d..9cca3785 100644
--- a/include/asm-generic/gpio.h
+++ b/include/asm-generic/gpio.h
@@ -141,6 +141,8 @@
* but more typically is configured entirely from userspace.
*/
extern int gpio_export(unsigned gpio, bool direction_may_change);
+extern int gpio_export_link(struct device *dev, const char *name,
+ unsigned gpio);
extern void gpio_unexport(unsigned gpio);
#endif /* CONFIG_GPIO_SYSFS */
@@ -185,6 +187,12 @@
return -ENOSYS;
}
+static inline int gpio_export_link(struct device *dev, const char *name,
+ unsigned gpio)
+{
+ return -ENOSYS;
+}
+
static inline void gpio_unexport(unsigned gpio)
{
}
diff --git a/include/asm-generic/kmap_types.h b/include/asm-generic/kmap_types.h
index eddbce0..e5f234a 100644
--- a/include/asm-generic/kmap_types.h
+++ b/include/asm-generic/kmap_types.h
@@ -2,34 +2,35 @@
#define _ASM_GENERIC_KMAP_TYPES_H
#ifdef __WITH_KM_FENCE
-# define D(n) __KM_FENCE_##n ,
+# define KMAP_D(n) __KM_FENCE_##n ,
#else
-# define D(n)
+# define KMAP_D(n)
#endif
enum km_type {
-D(0) KM_BOUNCE_READ,
-D(1) KM_SKB_SUNRPC_DATA,
-D(2) KM_SKB_DATA_SOFTIRQ,
-D(3) KM_USER0,
-D(4) KM_USER1,
-D(5) KM_BIO_SRC_IRQ,
-D(6) KM_BIO_DST_IRQ,
-D(7) KM_PTE0,
-D(8) KM_PTE1,
-D(9) KM_IRQ0,
-D(10) KM_IRQ1,
-D(11) KM_SOFTIRQ0,
-D(12) KM_SOFTIRQ1,
-D(13) KM_SYNC_ICACHE,
-D(14) KM_SYNC_DCACHE,
-D(15) KM_UML_USERCOPY, /* UML specific, for copy_*_user - used in do_op_one_page */
-D(16) KM_IRQ_PTE,
-D(17) KM_NMI,
-D(18) KM_NMI_PTE,
-D(19) KM_TYPE_NR
+KMAP_D(0) KM_BOUNCE_READ,
+KMAP_D(1) KM_SKB_SUNRPC_DATA,
+KMAP_D(2) KM_SKB_DATA_SOFTIRQ,
+KMAP_D(3) KM_USER0,
+KMAP_D(4) KM_USER1,
+KMAP_D(5) KM_BIO_SRC_IRQ,
+KMAP_D(6) KM_BIO_DST_IRQ,
+KMAP_D(7) KM_PTE0,
+KMAP_D(8) KM_PTE1,
+KMAP_D(9) KM_IRQ0,
+KMAP_D(10) KM_IRQ1,
+KMAP_D(11) KM_SOFTIRQ0,
+KMAP_D(12) KM_SOFTIRQ1,
+KMAP_D(13) KM_SYNC_ICACHE,
+KMAP_D(14) KM_SYNC_DCACHE,
+/* UML specific, for copy_*_user - used in do_op_one_page */
+KMAP_D(15) KM_UML_USERCOPY,
+KMAP_D(16) KM_IRQ_PTE,
+KMAP_D(17) KM_NMI,
+KMAP_D(18) KM_NMI_PTE,
+KMAP_D(19) KM_TYPE_NR
};
-#undef D
+#undef KMAP_D
#endif
diff --git a/include/asm-generic/sections.h b/include/asm-generic/sections.h
index d083561..b3bfabc 100644
--- a/include/asm-generic/sections.h
+++ b/include/asm-generic/sections.h
@@ -23,4 +23,20 @@
#define dereference_function_descriptor(p) (p)
#endif
+/* random extra sections (if any). Override
+ * in asm/sections.h */
+#ifndef arch_is_kernel_text
+static inline int arch_is_kernel_text(unsigned long addr)
+{
+ return 0;
+}
+#endif
+
+#ifndef arch_is_kernel_data
+static inline int arch_is_kernel_data(unsigned long addr)
+{
+ return 0;
+}
+#endif
+
#endif /* _ASM_GENERIC_SECTIONS_H_ */
diff --git a/include/asm-generic/syscall.h b/include/asm-generic/syscall.h
index ea8087b..5c122ae 100644
--- a/include/asm-generic/syscall.h
+++ b/include/asm-generic/syscall.h
@@ -1,7 +1,7 @@
/*
* Access to user system call parameters and results
*
- * Copyright (C) 2008 Red Hat, Inc. All rights reserved.
+ * Copyright (C) 2008-2009 Red Hat, Inc. All rights reserved.
*
* This copyrighted material is made available to anyone wishing to use,
* modify, copy, or redistribute it subject to the terms and conditions
@@ -32,9 +32,13 @@
* If @task is not executing a system call, i.e. it's blocked
* inside the kernel for a fault or signal, returns -1.
*
+ * Note this returns int even on 64-bit machines. Only 32 bits of
+ * system call number can be meaningful. If the actual arch value
+ * is 64 bits, this truncates to 32 bits so 0xffffffff means -1.
+ *
* It's only valid to call this when @task is known to be blocked.
*/
-long syscall_get_nr(struct task_struct *task, struct pt_regs *regs);
+int syscall_get_nr(struct task_struct *task, struct pt_regs *regs);
/**
* syscall_rollback - roll back registers after an aborted system call
diff --git a/include/linux/anon_inodes.h b/include/linux/anon_inodes.h
index e0a0cdc..69a21e0 100644
--- a/include/linux/anon_inodes.h
+++ b/include/linux/anon_inodes.h
@@ -8,6 +8,9 @@
#ifndef _LINUX_ANON_INODES_H
#define _LINUX_ANON_INODES_H
+struct file *anon_inode_getfile(const char *name,
+ const struct file_operations *fops,
+ void *priv, int flags);
int anon_inode_getfd(const char *name, const struct file_operations *fops,
void *priv, int flags);
diff --git a/include/linux/cn_proc.h b/include/linux/cn_proc.h
index b8125b2..47dac5e 100644
--- a/include/linux/cn_proc.h
+++ b/include/linux/cn_proc.h
@@ -52,6 +52,7 @@
PROC_EVENT_EXEC = 0x00000002,
PROC_EVENT_UID = 0x00000004,
PROC_EVENT_GID = 0x00000040,
+ PROC_EVENT_SID = 0x00000080,
/* "next" should be 0x00000400 */
/* "last" is the last process event: exit */
PROC_EVENT_EXIT = 0x80000000
@@ -89,6 +90,11 @@
} e;
} id;
+ struct sid_proc_event {
+ __kernel_pid_t process_pid;
+ __kernel_pid_t process_tgid;
+ } sid;
+
struct exit_proc_event {
__kernel_pid_t process_pid;
__kernel_pid_t process_tgid;
@@ -102,6 +108,7 @@
void proc_fork_connector(struct task_struct *task);
void proc_exec_connector(struct task_struct *task);
void proc_id_connector(struct task_struct *task, int which_id);
+void proc_sid_connector(struct task_struct *task);
void proc_exit_connector(struct task_struct *task);
#else
static inline void proc_fork_connector(struct task_struct *task)
@@ -114,6 +121,9 @@
int which_id)
{}
+static inline void proc_sid_connector(struct task_struct *task)
+{}
+
static inline void proc_exit_connector(struct task_struct *task)
{}
#endif /* CONFIG_PROC_EVENTS */
diff --git a/include/linux/cpumask.h b/include/linux/cpumask.h
index 796df12..9b1d458 100644
--- a/include/linux/cpumask.h
+++ b/include/linux/cpumask.h
@@ -715,6 +715,18 @@
}
/**
+ * cpumask_test_and_clear_cpu - atomically test and clear a cpu in a cpumask
+ * @cpu: cpu number (< nr_cpu_ids)
+ * @cpumask: the cpumask pointer
+ *
+ * test_and_clear_bit wrapper for cpumasks.
+ */
+static inline int cpumask_test_and_clear_cpu(int cpu, struct cpumask *cpumask)
+{
+ return test_and_clear_bit(cpumask_check(cpu), cpumask_bits(cpumask));
+}
+
+/**
* cpumask_setall - set all cpus (< nr_cpu_ids) in a cpumask
* @dstp: the cpumask pointer
*/
diff --git a/include/linux/eventfd.h b/include/linux/eventfd.h
index 3b85ba6..94dd103 100644
--- a/include/linux/eventfd.h
+++ b/include/linux/eventfd.h
@@ -27,6 +27,7 @@
#ifdef CONFIG_EVENTFD
+struct file *eventfd_file_create(unsigned int count, int flags);
struct eventfd_ctx *eventfd_ctx_get(struct eventfd_ctx *ctx);
void eventfd_ctx_put(struct eventfd_ctx *ctx);
struct file *eventfd_fget(int fd);
@@ -40,6 +41,11 @@
* Ugly ugly ugly error layer to support modules that uses eventfd but
* pretend to work in !CONFIG_EVENTFD configurations. Namely, AIO.
*/
+static inline struct file *eventfd_file_create(unsigned int count, int flags)
+{
+ return ERR_PTR(-ENOSYS);
+}
+
static inline struct eventfd_ctx *eventfd_ctx_fdget(int fd)
{
return ERR_PTR(-ENOSYS);
diff --git a/include/linux/gfp.h b/include/linux/gfp.h
index f53e9b8..557bdad 100644
--- a/include/linux/gfp.h
+++ b/include/linux/gfp.h
@@ -220,7 +220,7 @@
((1 << ZONES_SHIFT) - 1);
if (__builtin_constant_p(bit))
- BUILD_BUG_ON((GFP_ZONE_BAD >> bit) & 1);
+ MAYBE_BUILD_BUG_ON((GFP_ZONE_BAD >> bit) & 1);
else {
#ifdef CONFIG_DEBUG_VM
BUG_ON((GFP_ZONE_BAD >> bit) & 1);
diff --git a/include/linux/gpio.h b/include/linux/gpio.h
index e10c49a..059bd18 100644
--- a/include/linux/gpio.h
+++ b/include/linux/gpio.h
@@ -12,6 +12,8 @@
#include <linux/types.h>
#include <linux/errno.h>
+struct device;
+
/*
* Some platforms don't support the GPIO programming interface.
*
@@ -89,6 +91,15 @@
return -EINVAL;
}
+static inline int gpio_export_link(struct device *dev, const char *name,
+ unsigned gpio)
+{
+ /* GPIO can never have been exported */
+ WARN_ON(1);
+ return -EINVAL;
+}
+
+
static inline void gpio_unexport(unsigned gpio)
{
/* GPIO can never have been exported */
diff --git a/include/linux/ioport.h b/include/linux/ioport.h
index 786e7b8..83aa812 100644
--- a/include/linux/ioport.h
+++ b/include/linux/ioport.h
@@ -184,5 +184,9 @@
extern int iomem_map_sanity_check(resource_size_t addr, unsigned long size);
extern int iomem_is_exclusive(u64 addr);
+extern int
+walk_system_ram_range(unsigned long start_pfn, unsigned long nr_pages,
+ void *arg, int (*func)(unsigned long, unsigned long, void *));
+
#endif /* __ASSEMBLY__ */
#endif /* _LINUX_IOPORT_H */
diff --git a/include/linux/jbd.h b/include/linux/jbd.h
index a1187a0..331530c 100644
--- a/include/linux/jbd.h
+++ b/include/linux/jbd.h
@@ -556,7 +556,7 @@
* This transaction is being forced and some process is
* waiting for it to finish.
*/
- int t_synchronous_commit:1;
+ unsigned int t_synchronous_commit:1;
};
/**
diff --git a/include/linux/kernel.h b/include/linux/kernel.h
index 2b5b1e0..d3cd23f 100644
--- a/include/linux/kernel.h
+++ b/include/linux/kernel.h
@@ -146,7 +146,7 @@
#define might_sleep_if(cond) do { if (cond) might_sleep(); } while (0)
#define abs(x) ({ \
- int __x = (x); \
+ long __x = (x); \
(__x < 0) ? -__x : __x; \
})
@@ -246,14 +246,16 @@
extern bool printk_timed_ratelimit(unsigned long *caller_jiffies,
unsigned int interval_msec);
+extern int printk_delay_msec;
+
/*
* Print a one-time message (analogous to WARN_ONCE() et al):
*/
#define printk_once(x...) ({ \
- static int __print_once = 1; \
+ static bool __print_once = true; \
\
if (__print_once) { \
- __print_once = 0; \
+ __print_once = false; \
printk(x); \
} \
})
@@ -676,13 +678,17 @@
};
/* Force a compilation error if condition is true */
-#define BUILD_BUG_ON(condition) ((void)sizeof(char[1 - 2*!!(condition)]))
+#define BUILD_BUG_ON(condition) ((void)BUILD_BUG_ON_ZERO(condition))
+
+/* Force a compilation error if condition is constant and true */
+#define MAYBE_BUILD_BUG_ON(cond) ((void)sizeof(char[1 - 2 * !!(cond)]))
/* Force a compilation error if condition is true, but also produce a
result (of value 0 and type size_t), so the expression can be used
e.g. in a structure initializer (or where-ever else comma expressions
aren't permitted). */
-#define BUILD_BUG_ON_ZERO(e) (sizeof(char[1 - 2 * !!(e)]) - 1)
+#define BUILD_BUG_ON_ZERO(e) (sizeof(struct { int:-!!(e); }))
+#define BUILD_BUG_ON_NULL(e) ((void *)sizeof(struct { int:-!!(e); }))
/* Trap pasters of __FUNCTION__ at compile-time */
#define __FUNCTION__ (__func__)
diff --git a/include/linux/kmemcheck.h b/include/linux/kmemcheck.h
index c800660..e880d4cf9 100644
--- a/include/linux/kmemcheck.h
+++ b/include/linux/kmemcheck.h
@@ -145,12 +145,14 @@
#define kmemcheck_annotate_bitfield(ptr, name) \
do { \
+ int _n; \
+ \
if (!ptr) \
break; \
\
- int _n = (long) &((ptr)->name##_end) \
+ _n = (long) &((ptr)->name##_end) \
- (long) &((ptr)->name##_begin); \
- BUILD_BUG_ON(_n < 0); \
+ MAYBE_BUILD_BUG_ON(_n < 0); \
\
kmemcheck_mark_initialized(&((ptr)->name##_begin), _n); \
} while (0)
diff --git a/include/linux/magic.h b/include/linux/magic.h
index 1923327..76285e0 100644
--- a/include/linux/magic.h
+++ b/include/linux/magic.h
@@ -12,7 +12,9 @@
#define SYSFS_MAGIC 0x62656572
#define SECURITYFS_MAGIC 0x73636673
#define SELINUX_MAGIC 0xf97cff8c
+#define RAMFS_MAGIC 0x858458f6 /* some random number */
#define TMPFS_MAGIC 0x01021994
+#define HUGETLBFS_MAGIC 0x958458f6 /* some random number */
#define SQUASHFS_MAGIC 0x73717368
#define EFS_SUPER_MAGIC 0x414A53
#define EXT2_SUPER_MAGIC 0xEF53
@@ -53,4 +55,8 @@
#define INOTIFYFS_SUPER_MAGIC 0x2BAD1DEA
#define STACK_END_MAGIC 0x57AC6E9D
+
+#define DEVPTS_SUPER_MAGIC 0x1cd1
+#define SOCKFS_MAGIC 0x534F434B
+
#endif /* __LINUX_MAGIC_H__ */
diff --git a/include/linux/memory_hotplug.h b/include/linux/memory_hotplug.h
index d95f72e..fed9692 100644
--- a/include/linux/memory_hotplug.h
+++ b/include/linux/memory_hotplug.h
@@ -191,14 +191,6 @@
#endif /* ! CONFIG_MEMORY_HOTPLUG */
-/*
- * Walk through all memory which is registered as resource.
- * arg is (start_pfn, nr_pages, private_arg_pointer)
- */
-extern int walk_memory_resource(unsigned long start_pfn,
- unsigned long nr_pages, void *arg,
- int (*func)(unsigned long, unsigned long, void *));
-
#ifdef CONFIG_MEMORY_HOTREMOVE
extern int is_mem_section_removable(unsigned long pfn, unsigned long nr_pages);
diff --git a/include/linux/mm.h b/include/linux/mm.h
index 5946e2f..b6eae5e 100644
--- a/include/linux/mm.h
+++ b/include/linux/mm.h
@@ -285,6 +285,14 @@
return 0;
#endif
}
+#ifdef CONFIG_MMU
+extern int is_vmalloc_or_module_addr(const void *x);
+#else
+static int is_vmalloc_or_module_addr(const void *x)
+{
+ return 0;
+}
+#endif
static inline struct page *compound_head(struct page *page)
{
diff --git a/include/linux/mmc/card.h b/include/linux/mmc/card.h
index 403aa50..2ee22e8 100644
--- a/include/linux/mmc/card.h
+++ b/include/linux/mmc/card.h
@@ -40,6 +40,8 @@
};
struct mmc_ext_csd {
+ u8 rev;
+ unsigned int sa_timeout; /* Units: 100ns */
unsigned int hs_max_dtr;
unsigned int sectors;
};
@@ -62,7 +64,8 @@
low_speed:1,
wide_bus:1,
high_power:1,
- high_speed:1;
+ high_speed:1,
+ disable_cd:1;
};
struct sdio_cis {
@@ -94,6 +97,8 @@
#define MMC_STATE_READONLY (1<<1) /* card is read-only */
#define MMC_STATE_HIGHSPEED (1<<2) /* card is in high speed mode */
#define MMC_STATE_BLOCKADDR (1<<3) /* card uses block-addressing */
+ unsigned int quirks; /* card quirks */
+#define MMC_QUIRK_LENIENT_FN0 (1<<0) /* allow SDIO FN0 writes outside of the VS CCCR range */
u32 raw_cid[4]; /* raw card CID */
u32 raw_csd[4]; /* raw card CSD */
@@ -129,6 +134,11 @@
#define mmc_card_set_highspeed(c) ((c)->state |= MMC_STATE_HIGHSPEED)
#define mmc_card_set_blockaddr(c) ((c)->state |= MMC_STATE_BLOCKADDR)
+static inline int mmc_card_lenient_fn0(const struct mmc_card *c)
+{
+ return c->quirks & MMC_QUIRK_LENIENT_FN0;
+}
+
#define mmc_card_name(c) ((c)->cid.prod_name)
#define mmc_card_id(c) (dev_name(&(c)->dev))
diff --git a/include/linux/mmc/core.h b/include/linux/mmc/core.h
index 7ac8b50..e4898e9 100644
--- a/include/linux/mmc/core.h
+++ b/include/linux/mmc/core.h
@@ -139,6 +139,7 @@
extern int __mmc_claim_host(struct mmc_host *host, atomic_t *abort);
extern void mmc_release_host(struct mmc_host *host);
+extern int mmc_try_claim_host(struct mmc_host *host);
/**
* mmc_claim_host - exclusively claim a host
diff --git a/include/linux/mmc/host.h b/include/linux/mmc/host.h
index 3e7615e..81bb423 100644
--- a/include/linux/mmc/host.h
+++ b/include/linux/mmc/host.h
@@ -51,6 +51,35 @@
};
struct mmc_host_ops {
+ /*
+ * Hosts that support power saving can use the 'enable' and 'disable'
+ * methods to exit and enter power saving states. 'enable' is called
+ * when the host is claimed and 'disable' is called (or scheduled with
+ * a delay) when the host is released. The 'disable' is scheduled if
+ * the disable delay set by 'mmc_set_disable_delay()' is non-zero,
+ * otherwise 'disable' is called immediately. 'disable' may be
+ * scheduled repeatedly, to permit ever greater power saving at the
+ * expense of ever greater latency to re-enable. Rescheduling is
+ * determined by the return value of the 'disable' method. A positive
+ * value gives the delay in milliseconds.
+ *
+ * In the case where a host function (like set_ios) may be called
+ * with or without the host claimed, enabling and disabling can be
+ * done directly and will nest correctly. Call 'mmc_host_enable()' and
+ * 'mmc_host_lazy_disable()' for this purpose, but note that these
+ * functions must be paired.
+ *
+ * Alternatively, 'mmc_host_enable()' may be paired with
+ * 'mmc_host_disable()' which calls 'disable' immediately. In this
+ * case the 'disable' method will be called with 'lazy' set to 0.
+ * This is mainly useful for error paths.
+ *
+ * Because lazy disable may be called from a work queue, the 'disable'
+ * method must claim the host when 'lazy' != 0, which will work
+ * correctly because recursion is detected and handled.
+ */
+ int (*enable)(struct mmc_host *host);
+ int (*disable)(struct mmc_host *host, int lazy);
void (*request)(struct mmc_host *host, struct mmc_request *req);
/*
* Avoid calling these three functions too often or in a "fast path",
@@ -118,6 +147,9 @@
#define MMC_CAP_SPI (1 << 4) /* Talks only SPI protocols */
#define MMC_CAP_NEEDS_POLL (1 << 5) /* Needs polling for card-detection */
#define MMC_CAP_8_BIT_DATA (1 << 6) /* Can the host do 8 bit transfers */
+#define MMC_CAP_DISABLE (1 << 7) /* Can the host be disabled */
+#define MMC_CAP_NONREMOVABLE (1 << 8) /* Nonremovable e.g. eMMC */
+#define MMC_CAP_WAIT_WHILE_BUSY (1 << 9) /* Waits while card is busy */
/* host specific block data */
unsigned int max_seg_size; /* see blk_queue_max_segment_size */
@@ -142,9 +174,18 @@
unsigned int removed:1; /* host is being removed */
#endif
+ /* Only used with MMC_CAP_DISABLE */
+ int enabled; /* host is enabled */
+ int nesting_cnt; /* "enable" nesting count */
+ int en_dis_recurs; /* detect recursion */
+ unsigned int disable_delay; /* disable delay in msecs */
+ struct delayed_work disable; /* disabling work */
+
struct mmc_card *card; /* device attached to this host */
wait_queue_head_t wq;
+ struct task_struct *claimer; /* task that has host claimed */
+ int claim_cnt; /* "claim" nesting count */
struct delayed_work detect;
@@ -183,6 +224,9 @@
extern int mmc_suspend_host(struct mmc_host *, pm_message_t);
extern int mmc_resume_host(struct mmc_host *);
+extern void mmc_power_save_host(struct mmc_host *host);
+extern void mmc_power_restore_host(struct mmc_host *host);
+
extern void mmc_detect_change(struct mmc_host *, unsigned long delay);
extern void mmc_request_done(struct mmc_host *, struct mmc_request *);
@@ -197,5 +241,19 @@
int mmc_regulator_get_ocrmask(struct regulator *supply);
int mmc_regulator_set_ocr(struct regulator *supply, unsigned short vdd_bit);
+int mmc_card_awake(struct mmc_host *host);
+int mmc_card_sleep(struct mmc_host *host);
+int mmc_card_can_sleep(struct mmc_host *host);
+
+int mmc_host_enable(struct mmc_host *host);
+int mmc_host_disable(struct mmc_host *host);
+int mmc_host_lazy_disable(struct mmc_host *host);
+
+static inline void mmc_set_disable_delay(struct mmc_host *host,
+ unsigned int disable_delay)
+{
+ host->disable_delay = disable_delay;
+}
+
#endif
diff --git a/include/linux/mmc/mmc.h b/include/linux/mmc/mmc.h
index 14b81f3..c02c8db 100644
--- a/include/linux/mmc/mmc.h
+++ b/include/linux/mmc/mmc.h
@@ -31,6 +31,7 @@
#define MMC_ALL_SEND_CID 2 /* bcr R2 */
#define MMC_SET_RELATIVE_ADDR 3 /* ac [31:16] RCA R1 */
#define MMC_SET_DSR 4 /* bc [31:16] RCA */
+#define MMC_SLEEP_AWAKE 5 /* ac [31:16] RCA 15:flg R1b */
#define MMC_SWITCH 6 /* ac [31:0] See below R1b */
#define MMC_SELECT_CARD 7 /* ac [31:16] RCA R1 */
#define MMC_SEND_EXT_CSD 8 /* adtc R1 */
@@ -127,6 +128,7 @@
#define R1_STATUS(x) (x & 0xFFFFE000)
#define R1_CURRENT_STATE(x) ((x & 0x00001E00) >> 9) /* sx, b (4 bits) */
#define R1_READY_FOR_DATA (1 << 8) /* sx, a */
+#define R1_SWITCH_ERROR (1 << 7) /* sx, c */
#define R1_APP_CMD (1 << 5) /* sr, c */
/*
@@ -254,6 +256,7 @@
#define EXT_CSD_CARD_TYPE 196 /* RO */
#define EXT_CSD_REV 192 /* RO */
#define EXT_CSD_SEC_CNT 212 /* RO, 4 bytes */
+#define EXT_CSD_S_A_TIMEOUT 217
/*
* EXT_CSD field definitions
diff --git a/include/linux/mmc/sdio_func.h b/include/linux/mmc/sdio_func.h
index 451bdfc..ac3ab68 100644
--- a/include/linux/mmc/sdio_func.h
+++ b/include/linux/mmc/sdio_func.h
@@ -67,6 +67,7 @@
#define sdio_get_drvdata(f) dev_get_drvdata(&(f)->dev)
#define sdio_set_drvdata(f,d) dev_set_drvdata(&(f)->dev, d)
+#define dev_to_sdio_func(d) container_of(d, struct sdio_func, dev)
/*
* SDIO function device driver
@@ -81,6 +82,8 @@
struct device_driver drv;
};
+#define to_sdio_driver(d) container_of(d, struct sdio_driver, drv)
+
/**
* SDIO_DEVICE - macro used to describe a specific SDIO device
* @vend: the 16 bit manufacturer code
diff --git a/include/linux/mod_devicetable.h b/include/linux/mod_devicetable.h
index 1bf5900..f58e9d83 100644
--- a/include/linux/mod_devicetable.h
+++ b/include/linux/mod_devicetable.h
@@ -399,6 +399,17 @@
__attribute__((aligned(sizeof(kernel_ulong_t))));
};
+/* spi */
+
+#define SPI_NAME_SIZE 32
+#define SPI_MODULE_PREFIX "spi:"
+
+struct spi_device_id {
+ char name[SPI_NAME_SIZE];
+ kernel_ulong_t driver_data /* Data private to the driver */
+ __attribute__((aligned(sizeof(kernel_ulong_t))));
+};
+
/* dmi */
enum dmi_field {
DMI_NONE,
diff --git a/include/linux/nfsd/nfsd.h b/include/linux/nfsd/nfsd.h
index 03bbe9039..510ffdd 100644
--- a/include/linux/nfsd/nfsd.h
+++ b/include/linux/nfsd/nfsd.h
@@ -60,7 +60,7 @@
extern unsigned int nfsd_drc_max_mem;
extern unsigned int nfsd_drc_mem_used;
-extern struct seq_operations nfs_exports_op;
+extern const struct seq_operations nfs_exports_op;
/*
* Function prototypes.
diff --git a/include/linux/proc_fs.h b/include/linux/proc_fs.h
index e6e77d3..379eaed 100644
--- a/include/linux/proc_fs.h
+++ b/include/linux/proc_fs.h
@@ -78,10 +78,19 @@
struct list_head pde_openers; /* who did ->open, but not ->release */
};
+enum kcore_type {
+ KCORE_TEXT,
+ KCORE_VMALLOC,
+ KCORE_RAM,
+ KCORE_VMEMMAP,
+ KCORE_OTHER,
+};
+
struct kcore_list {
- struct kcore_list *next;
+ struct list_head list;
unsigned long addr;
size_t size;
+ int type;
};
struct vmcore {
@@ -233,11 +242,12 @@
#endif /* CONFIG_PROC_FS */
#if !defined(CONFIG_PROC_KCORE)
-static inline void kclist_add(struct kcore_list *new, void *addr, size_t size)
+static inline void
+kclist_add(struct kcore_list *new, void *addr, size_t size, int type)
{
}
#else
-extern void kclist_add(struct kcore_list *, void *, size_t);
+extern void kclist_add(struct kcore_list *, void *, size_t, int type);
#endif
union proc_op {
diff --git a/include/linux/sched.h b/include/linux/sched.h
index 97b10da..3cbc6c0 100644
--- a/include/linux/sched.h
+++ b/include/linux/sched.h
@@ -426,6 +426,15 @@
return max(mm->hiwater_rss, get_mm_rss(mm));
}
+static inline void setmax_mm_hiwater_rss(unsigned long *maxrss,
+ struct mm_struct *mm)
+{
+ unsigned long hiwater_rss = get_mm_hiwater_rss(mm);
+
+ if (*maxrss < hiwater_rss)
+ *maxrss = hiwater_rss;
+}
+
static inline unsigned long get_mm_hiwater_vm(struct mm_struct *mm)
{
return max(mm->hiwater_vm, mm->total_vm);
@@ -612,6 +621,7 @@
unsigned long nvcsw, nivcsw, cnvcsw, cnivcsw;
unsigned long min_flt, maj_flt, cmin_flt, cmaj_flt;
unsigned long inblock, oublock, cinblock, coublock;
+ unsigned long maxrss, cmaxrss;
struct task_io_accounting ioac;
/*
@@ -1519,6 +1529,7 @@
/* bitmask of trace recursion */
unsigned long trace_recursion;
#endif /* CONFIG_TRACING */
+ unsigned long stack_start;
};
/* Future-safe accessor for struct task_struct's cpus_allowed. */
diff --git a/include/linux/spi/mc33880.h b/include/linux/spi/mc33880.h
new file mode 100644
index 0000000..82ffccd
--- /dev/null
+++ b/include/linux/spi/mc33880.h
@@ -0,0 +1,10 @@
+#ifndef LINUX_SPI_MC33880_H
+#define LINUX_SPI_MC33880_H
+
+struct mc33880_platform_data {
+ /* number assigned to the first GPIO */
+ unsigned base;
+};
+
+#endif
+
diff --git a/include/linux/spi/spi.h b/include/linux/spi/spi.h
index c47c4b4..97b60b3 100644
--- a/include/linux/spi/spi.h
+++ b/include/linux/spi/spi.h
@@ -20,6 +20,7 @@
#define __LINUX_SPI_H
#include <linux/device.h>
+#include <linux/mod_devicetable.h>
/*
* INTERFACES between SPI master-side drivers and SPI infrastructure.
@@ -86,7 +87,7 @@
int irq;
void *controller_state;
void *controller_data;
- char modalias[32];
+ char modalias[SPI_NAME_SIZE];
/*
* likely need more hooks for more protocol options affecting how
@@ -145,6 +146,7 @@
/**
* struct spi_driver - Host side "protocol" driver
+ * @id_table: List of SPI devices supported by this driver
* @probe: Binds this driver to the spi device. Drivers can verify
* that the device is actually present, and may need to configure
* characteristics (such as bits_per_word) which weren't needed for
@@ -170,6 +172,7 @@
* MMC, RTC, filesystem character device nodes, and hardware monitoring.
*/
struct spi_driver {
+ const struct spi_device_id *id_table;
int (*probe)(struct spi_device *spi);
int (*remove)(struct spi_device *spi);
void (*shutdown)(struct spi_device *spi);
@@ -207,6 +210,8 @@
* each slave has a chipselect signal, but it's common that not
* every chipselect is connected to a slave.
* @dma_alignment: SPI controller constraint on DMA buffers alignment.
+ * @mode_bits: flags understood by this controller driver
+ * @flags: other constraints relevant to this driver
* @setup: updates the device mode and clocking records used by a
* device's SPI controller; protocol code may call this. This
* must fail if an unrecognized or unsupported mode is requested.
@@ -253,6 +258,8 @@
/* other constraints relevant to this driver */
u16 flags;
#define SPI_MASTER_HALF_DUPLEX BIT(0) /* can't do full duplex */
+#define SPI_MASTER_NO_RX BIT(1) /* can't do buffer read */
+#define SPI_MASTER_NO_TX BIT(2) /* can't do buffer write */
/* Setup mode and clock, etc (spi driver may call many times).
*
@@ -533,42 +540,7 @@
}
extern int spi_setup(struct spi_device *spi);
-
-/**
- * spi_async - asynchronous SPI transfer
- * @spi: device with which data will be exchanged
- * @message: describes the data transfers, including completion callback
- * Context: any (irqs may be blocked, etc)
- *
- * This call may be used in_irq and other contexts which can't sleep,
- * as well as from task contexts which can sleep.
- *
- * The completion callback is invoked in a context which can't sleep.
- * Before that invocation, the value of message->status is undefined.
- * When the callback is issued, message->status holds either zero (to
- * indicate complete success) or a negative error code. After that
- * callback returns, the driver which issued the transfer request may
- * deallocate the associated memory; it's no longer in use by any SPI
- * core or controller driver code.
- *
- * Note that although all messages to a spi_device are handled in
- * FIFO order, messages may go to different devices in other orders.
- * Some device might be higher priority, or have various "hard" access
- * time requirements, for example.
- *
- * On detection of any fault during the transfer, processing of
- * the entire message is aborted, and the device is deselected.
- * Until returning from the associated message completion callback,
- * no other spi_message queued to that device will be processed.
- * (This rule applies equally to all the synchronous transfer calls,
- * which are wrappers around this core asynchronous primitive.)
- */
-static inline int
-spi_async(struct spi_device *spi, struct spi_message *message)
-{
- message->spi = spi;
- return spi->master->transfer(spi, message);
-}
+extern int spi_async(struct spi_device *spi, struct spi_message *message);
/*---------------------------------------------------------------------------*/
@@ -732,7 +704,7 @@
* controller_data goes to spi_device.controller_data,
* irq is copied too
*/
- char modalias[32];
+ char modalias[SPI_NAME_SIZE];
const void *platform_data;
void *controller_data;
int irq;
@@ -800,4 +772,7 @@
device_unregister(&spi->dev);
}
+extern const struct spi_device_id *
+spi_get_device_id(const struct spi_device *sdev);
+
#endif /* __LINUX_SPI_H */
diff --git a/include/linux/syscalls.h b/include/linux/syscalls.h
index 8d8285a..a990ace 100644
--- a/include/linux/syscalls.h
+++ b/include/linux/syscalls.h
@@ -460,8 +460,7 @@
void __user *data);
asmlinkage long sys_umount(char __user *name, int flags);
asmlinkage long sys_oldumount(char __user *name);
-asmlinkage long sys_truncate(const char __user *path,
- unsigned long length);
+asmlinkage long sys_truncate(const char __user *path, long length);
asmlinkage long sys_ftruncate(unsigned int fd, unsigned long length);
asmlinkage long sys_stat(char __user *filename,
struct __old_kernel_stat __user *statbuf);
diff --git a/include/linux/ucb1400.h b/include/linux/ucb1400.h
index ae779bb..adb4406 100644
--- a/include/linux/ucb1400.h
+++ b/include/linux/ucb1400.h
@@ -26,6 +26,7 @@
#include <sound/ac97_codec.h>
#include <linux/mutex.h>
#include <linux/platform_device.h>
+#include <linux/gpio.h>
/*
* UCB1400 AC-link registers
@@ -82,6 +83,17 @@
#define UCB_ID 0x7e
#define UCB_ID_1400 0x4304
+struct ucb1400_gpio_data {
+ int gpio_offset;
+ int (*gpio_setup)(struct device *dev, int ngpio);
+ int (*gpio_teardown)(struct device *dev, int ngpio);
+};
+
+struct ucb1400_gpio {
+ struct gpio_chip gc;
+ struct snd_ac97 *ac97;
+};
+
struct ucb1400_ts {
struct input_dev *ts_idev;
struct task_struct *ts_task;
@@ -95,6 +107,7 @@
struct ucb1400 {
struct platform_device *ucb1400_ts;
+ struct platform_device *ucb1400_gpio;
};
static inline u16 ucb1400_reg_read(struct snd_ac97 *ac97, u16 reg)
@@ -147,4 +160,10 @@
unsigned int ucb1400_adc_read(struct snd_ac97 *ac97, u16 adc_channel,
int adcsync);
+#ifdef CONFIG_GPIO_UCB1400
+void __init ucb1400_gpio_set_data(struct ucb1400_gpio_data *data);
+#else
+static inline void ucb1400_gpio_set_data(struct ucb1400_gpio_data *data) {}
+#endif
+
#endif
diff --git a/include/linux/virtio.h b/include/linux/virtio.h
index 4fca4f5..057a2e0 100644
--- a/include/linux/virtio.h
+++ b/include/linux/virtio.h
@@ -34,7 +34,7 @@
* out_num: the number of sg readable by other side
* in_num: the number of sg which are writable (after readable ones)
* data: the token identifying the buffer.
- * Returns 0 or an error.
+ * Returns remaining capacity of queue (sg segments) or a negative error.
* @kick: update after add_buf
* vq: the struct virtqueue
* After one or more add_buf calls, invoke this to kick the other side.
diff --git a/include/linux/virtio_9p.h b/include/linux/virtio_9p.h
index b3c4a60..ea7226a 100644
--- a/include/linux/virtio_9p.h
+++ b/include/linux/virtio_9p.h
@@ -4,8 +4,6 @@
* compatible drivers/servers. */
#include <linux/virtio_config.h>
-/* The ID for virtio console */
-#define VIRTIO_ID_9P 9
/* Maximum number of virtio channels per partition (1 for now) */
#define MAX_9P_CHAN 1
diff --git a/include/linux/virtio_balloon.h b/include/linux/virtio_balloon.h
index 8726ff7..09d7300 100644
--- a/include/linux/virtio_balloon.h
+++ b/include/linux/virtio_balloon.h
@@ -4,9 +4,6 @@
* compatible drivers/servers. */
#include <linux/virtio_config.h>
-/* The ID for virtio_balloon */
-#define VIRTIO_ID_BALLOON 5
-
/* The feature bitmap for virtio balloon */
#define VIRTIO_BALLOON_F_MUST_TELL_HOST 0 /* Tell before reclaiming pages */
diff --git a/include/linux/virtio_blk.h b/include/linux/virtio_blk.h
index 8dab9f2..15cb666 100644
--- a/include/linux/virtio_blk.h
+++ b/include/linux/virtio_blk.h
@@ -5,9 +5,6 @@
#include <linux/types.h>
#include <linux/virtio_config.h>
-/* The ID for virtio_block */
-#define VIRTIO_ID_BLOCK 2
-
/* Feature bits */
#define VIRTIO_BLK_F_BARRIER 0 /* Does host support barriers? */
#define VIRTIO_BLK_F_SIZE_MAX 1 /* Indicates maximum segment size */
@@ -17,6 +14,7 @@
#define VIRTIO_BLK_F_BLK_SIZE 6 /* Block size of disk is available*/
#define VIRTIO_BLK_F_SCSI 7 /* Supports scsi command passthru */
#define VIRTIO_BLK_F_IDENTIFY 8 /* ATA IDENTIFY supported */
+#define VIRTIO_BLK_F_FLUSH 9 /* Cache flush command support */
#define VIRTIO_BLK_ID_BYTES (sizeof(__u16[256])) /* IDENTIFY DATA */
@@ -38,6 +36,17 @@
__u8 identify[VIRTIO_BLK_ID_BYTES];
} __attribute__((packed));
+/*
+ * Command types
+ *
+ * Usage is a bit tricky as some bits are used as flags and some are not.
+ *
+ * Rules:
+ * VIRTIO_BLK_T_OUT may be combined with VIRTIO_BLK_T_SCSI_CMD or
+ * VIRTIO_BLK_T_BARRIER. VIRTIO_BLK_T_FLUSH is a command of its own
+ * and may not be combined with any of the other flags.
+ */
+
/* These two define direction. */
#define VIRTIO_BLK_T_IN 0
#define VIRTIO_BLK_T_OUT 1
@@ -45,6 +54,9 @@
/* This bit says it's a scsi command, not an actual read or write. */
#define VIRTIO_BLK_T_SCSI_CMD 2
+/* Cache flush command */
+#define VIRTIO_BLK_T_FLUSH 4
+
/* Barrier before this op. */
#define VIRTIO_BLK_T_BARRIER 0x80000000
diff --git a/include/linux/virtio_config.h b/include/linux/virtio_config.h
index e547e3c..0093dd7 100644
--- a/include/linux/virtio_config.h
+++ b/include/linux/virtio_config.h
@@ -109,8 +109,7 @@
unsigned int fbit)
{
/* Did you forget to fix assumptions on max features? */
- if (__builtin_constant_p(fbit))
- BUILD_BUG_ON(fbit >= 32);
+ MAYBE_BUILD_BUG_ON(fbit >= 32);
if (fbit < VIRTIO_TRANSPORT_F_START)
virtio_check_driver_offered_feature(vdev, fbit);
diff --git a/include/linux/virtio_console.h b/include/linux/virtio_console.h
index dc16111..b5f5198 100644
--- a/include/linux/virtio_console.h
+++ b/include/linux/virtio_console.h
@@ -5,9 +5,6 @@
/* This header, excluding the #ifdef __KERNEL__ part, is BSD licensed so
* anyone can use the definitions to implement compatible drivers/servers. */
-/* The ID for virtio console */
-#define VIRTIO_ID_CONSOLE 3
-
/* Feature bits */
#define VIRTIO_CONSOLE_F_SIZE 0 /* Does host provide console size? */
diff --git a/include/linux/virtio_ids.h b/include/linux/virtio_ids.h
new file mode 100644
index 0000000..06660c0
--- /dev/null
+++ b/include/linux/virtio_ids.h
@@ -0,0 +1,17 @@
+#ifndef _LINUX_VIRTIO_IDS_H
+#define _LINUX_VIRTIO_IDS_H
+/*
+ * Virtio IDs
+ *
+ * This header is BSD licensed so anyone can use the definitions to implement
+ * compatible drivers/servers.
+ */
+
+#define VIRTIO_ID_NET 1 /* virtio net */
+#define VIRTIO_ID_BLOCK 2 /* virtio block */
+#define VIRTIO_ID_CONSOLE 3 /* virtio console */
+#define VIRTIO_ID_RNG 4 /* virtio ring */
+#define VIRTIO_ID_BALLOON 5 /* virtio balloon */
+#define VIRTIO_ID_9P 9 /* 9p virtio console */
+
+#endif /* _LINUX_VIRTIO_IDS_H */
diff --git a/include/linux/virtio_net.h b/include/linux/virtio_net.h
index d8dd539..1f41734 100644
--- a/include/linux/virtio_net.h
+++ b/include/linux/virtio_net.h
@@ -6,9 +6,6 @@
#include <linux/virtio_config.h>
#include <linux/if_ether.h>
-/* The ID for virtio_net */
-#define VIRTIO_ID_NET 1
-
/* The feature bitmap for virtio net */
#define VIRTIO_NET_F_CSUM 0 /* Host handles pkts w/ partial csum */
#define VIRTIO_NET_F_GUEST_CSUM 1 /* Guest handles pkts w/ partial csum */
diff --git a/include/linux/virtio_rng.h b/include/linux/virtio_rng.h
index 1a85dab..48121c3 100644
--- a/include/linux/virtio_rng.h
+++ b/include/linux/virtio_rng.h
@@ -4,7 +4,4 @@
* compatible drivers/servers. */
#include <linux/virtio_config.h>
-/* The ID for virtio_rng */
-#define VIRTIO_ID_RNG 4
-
#endif /* _LINUX_VIRTIO_RNG_H */
diff --git a/include/video/da8xx-fb.h b/include/video/da8xx-fb.h
new file mode 100644
index 0000000..c051a50
--- /dev/null
+++ b/include/video/da8xx-fb.h
@@ -0,0 +1,103 @@
+/*
+ * Header file for TI DA8XX LCD controller platform data.
+ *
+ * Copyright (C) 2008-2009 MontaVista Software Inc.
+ * Copyright (C) 2008-2009 Texas Instruments Inc
+ *
+ * This file is licensed under the terms of the GNU General Public License
+ * version 2. This program is licensed "as is" without any warranty of any
+ * kind, whether express or implied.
+ */
+
+#ifndef DA8XX_FB_H
+#define DA8XX_FB_H
+
+enum panel_type {
+ QVGA = 0
+};
+
+enum panel_shade {
+ MONOCHROME = 0,
+ COLOR_ACTIVE,
+ COLOR_PASSIVE,
+};
+
+enum raster_load_mode {
+ LOAD_DATA = 1,
+ LOAD_PALETTE,
+};
+
+struct display_panel {
+ enum panel_type panel_type; /* QVGA */
+ int max_bpp;
+ int min_bpp;
+ enum panel_shade panel_shade;
+};
+
+struct da8xx_lcdc_platform_data {
+ const char manu_name[10];
+ void *controller_data;
+ const char type[25];
+};
+
+struct lcd_ctrl_config {
+ const struct display_panel *p_disp_panel;
+
+ /* AC Bias Pin Frequency */
+ int ac_bias;
+
+ /* AC Bias Pin Transitions per Interrupt */
+ int ac_bias_intrpt;
+
+ /* DMA burst size */
+ int dma_burst_sz;
+
+ /* Bits per pixel */
+ int bpp;
+
+ /* FIFO DMA Request Delay */
+ int fdd;
+
+ /* TFT Alternative Signal Mapping (Only for active) */
+ unsigned char tft_alt_mode;
+
+ /* 12 Bit Per Pixel (5-6-5) Mode (Only for passive) */
+ unsigned char stn_565_mode;
+
+ /* Mono 8-bit Mode: 1=D0-D7 or 0=D0-D3 */
+ unsigned char mono_8bit_mode;
+
+ /* Invert line clock */
+ unsigned char invert_line_clock;
+
+ /* Invert frame clock */
+ unsigned char invert_frm_clock;
+
+ /* Horizontal and Vertical Sync Edge: 0=rising 1=falling */
+ unsigned char sync_edge;
+
+ /* Horizontal and Vertical Sync: Control: 0=ignore */
+ unsigned char sync_ctrl;
+
+ /* Raster Data Order Select: 1=Most-to-least 0=Least-to-most */
+ unsigned char raster_order;
+};
+
+struct lcd_sync_arg {
+ int back_porch;
+ int front_porch;
+ int pulse_width;
+};
+
+/* ioctls */
+#define FBIOGET_CONTRAST _IOR('F', 1, int)
+#define FBIOPUT_CONTRAST _IOW('F', 2, int)
+#define FBIGET_BRIGHTNESS _IOR('F', 3, int)
+#define FBIPUT_BRIGHTNESS _IOW('F', 3, int)
+#define FBIGET_COLOR _IOR('F', 5, int)
+#define FBIPUT_COLOR _IOW('F', 6, int)
+#define FBIPUT_HSYNC _IOW('F', 9, int)
+#define FBIPUT_VSYNC _IOW('F', 10, int)
+
+#endif /* ifndef DA8XX_FB_H */
+
diff --git a/ipc/util.c b/ipc/util.c
index b8e4ba9..79ce84e 100644
--- a/ipc/util.c
+++ b/ipc/util.c
@@ -942,7 +942,7 @@
return iface->show(s, it);
}
-static struct seq_operations sysvipc_proc_seqops = {
+static const struct seq_operations sysvipc_proc_seqops = {
.start = sysvipc_proc_start,
.stop = sysvipc_proc_stop,
.next = sysvipc_proc_next,
diff --git a/kernel/cgroup.c b/kernel/cgroup.c
index 213b7f9..cd83d99 100644
--- a/kernel/cgroup.c
+++ b/kernel/cgroup.c
@@ -2314,7 +2314,7 @@
return seq_printf(s, "%d\n", *(int *)v);
}
-static struct seq_operations cgroup_tasks_seq_operations = {
+static const struct seq_operations cgroup_tasks_seq_operations = {
.start = cgroup_tasks_start,
.stop = cgroup_tasks_stop,
.next = cgroup_tasks_next,
diff --git a/kernel/exit.c b/kernel/exit.c
index e47ee8a..60d6fdc 100644
--- a/kernel/exit.c
+++ b/kernel/exit.c
@@ -359,8 +359,10 @@
{
struct task_struct *curr = current->group_leader;
- if (task_session(curr) != pid)
+ if (task_session(curr) != pid) {
change_pid(curr, PIDTYPE_SID, pid);
+ proc_sid_connector(curr);
+ }
if (task_pgrp(curr) != pid)
change_pid(curr, PIDTYPE_PGID, pid);
@@ -945,6 +947,8 @@
if (group_dead) {
hrtimer_cancel(&tsk->signal->real_timer);
exit_itimers(tsk->signal);
+ if (tsk->mm)
+ setmax_mm_hiwater_rss(&tsk->signal->maxrss, tsk->mm);
}
acct_collect(code, group_dead);
if (group_dead)
@@ -1208,6 +1212,7 @@
if (likely(!traced) && likely(!task_detached(p))) {
struct signal_struct *psig;
struct signal_struct *sig;
+ unsigned long maxrss;
/*
* The resource counters for the group leader are in its
@@ -1256,6 +1261,9 @@
psig->coublock +=
task_io_get_oublock(p) +
sig->oublock + sig->coublock;
+ maxrss = max(sig->maxrss, sig->cmaxrss);
+ if (psig->cmaxrss < maxrss)
+ psig->cmaxrss = maxrss;
task_io_accounting_add(&psig->ioac, &p->ioac);
task_io_accounting_add(&psig->ioac, &sig->ioac);
spin_unlock_irq(&p->real_parent->sighand->siglock);
diff --git a/kernel/fork.c b/kernel/fork.c
index 1020977..8f45b0e 100644
--- a/kernel/fork.c
+++ b/kernel/fork.c
@@ -866,6 +866,7 @@
sig->nvcsw = sig->nivcsw = sig->cnvcsw = sig->cnivcsw = 0;
sig->min_flt = sig->maj_flt = sig->cmin_flt = sig->cmaj_flt = 0;
sig->inblock = sig->oublock = sig->cinblock = sig->coublock = 0;
+ sig->maxrss = sig->cmaxrss = 0;
task_io_accounting_init(&sig->ioac);
sig->sum_sched_runtime = 0;
taskstats_tgid_init(sig);
@@ -1094,6 +1095,8 @@
p->bts = NULL;
+ p->stack_start = stack_start;
+
/* Perform scheduler related setup. Assign this task to a CPU. */
sched_fork(p, clone_flags);
diff --git a/kernel/kallsyms.c b/kernel/kallsyms.c
index 3a29dbe..8b6b8b6 100644
--- a/kernel/kallsyms.c
+++ b/kernel/kallsyms.c
@@ -59,7 +59,8 @@
static inline int is_kernel_text(unsigned long addr)
{
- if (addr >= (unsigned long)_stext && addr <= (unsigned long)_etext)
+ if ((addr >= (unsigned long)_stext && addr <= (unsigned long)_etext) ||
+ arch_is_kernel_text(addr))
return 1;
return in_gate_area_no_task(addr);
}
diff --git a/kernel/kmod.c b/kernel/kmod.c
index 9fcb53a..689d20f 100644
--- a/kernel/kmod.c
+++ b/kernel/kmod.c
@@ -143,6 +143,7 @@
static int ____call_usermodehelper(void *data)
{
struct subprocess_info *sub_info = data;
+ enum umh_wait wait = sub_info->wait;
int retval;
BUG_ON(atomic_read(&sub_info->cred->usage) != 1);
@@ -184,10 +185,14 @@
*/
set_user_nice(current, 0);
+ if (wait == UMH_WAIT_EXEC)
+ complete(sub_info->complete);
+
retval = kernel_execve(sub_info->path, sub_info->argv, sub_info->envp);
/* Exec failed? */
- sub_info->retval = retval;
+ if (wait != UMH_WAIT_EXEC)
+ sub_info->retval = retval;
do_exit(0);
}
@@ -266,16 +271,14 @@
switch (wait) {
case UMH_NO_WAIT:
+ case UMH_WAIT_EXEC:
break;
case UMH_WAIT_PROC:
if (pid > 0)
break;
sub_info->retval = pid;
- /* FALLTHROUGH */
-
- case UMH_WAIT_EXEC:
- complete(sub_info->complete);
+ break;
}
}
diff --git a/kernel/kprobes.c b/kernel/kprobes.c
index ef177d6..cfadc12 100644
--- a/kernel/kprobes.c
+++ b/kernel/kprobes.c
@@ -1321,7 +1321,7 @@
return 0;
}
-static struct seq_operations kprobes_seq_ops = {
+static const struct seq_operations kprobes_seq_ops = {
.start = kprobe_seq_start,
.next = kprobe_seq_next,
.stop = kprobe_seq_stop,
diff --git a/kernel/lockdep.c b/kernel/lockdep.c
index f74d2d7..3815ac1d 100644
--- a/kernel/lockdep.c
+++ b/kernel/lockdep.c
@@ -578,6 +578,9 @@
if ((addr >= start) && (addr < end))
return 1;
+ if (arch_is_kernel_data(addr))
+ return 1;
+
#ifdef CONFIG_SMP
/*
* percpu var?
diff --git a/kernel/lockdep_proc.c b/kernel/lockdep_proc.c
index d4b3dbc..d4aba4f 100644
--- a/kernel/lockdep_proc.c
+++ b/kernel/lockdep_proc.c
@@ -594,7 +594,7 @@
return 0;
}
-static struct seq_operations lockstat_ops = {
+static const struct seq_operations lockstat_ops = {
.start = ls_start,
.next = ls_next,
.stop = ls_stop,
diff --git a/kernel/printk.c b/kernel/printk.c
index 602033a..f38b07f 100644
--- a/kernel/printk.c
+++ b/kernel/printk.c
@@ -206,12 +206,11 @@
#ifdef CONFIG_BOOT_PRINTK_DELAY
static unsigned int boot_delay; /* msecs delay after each printk during bootup */
-static unsigned long long printk_delay_msec; /* per msec, based on boot_delay */
+static unsigned long long loops_per_msec; /* based on boot_delay */
static int __init boot_delay_setup(char *str)
{
unsigned long lpj;
- unsigned long long loops_per_msec;
lpj = preset_lpj ? preset_lpj : 1000000; /* some guess */
loops_per_msec = (unsigned long long)lpj / 1000 * HZ;
@@ -220,10 +219,9 @@
if (boot_delay > 10 * 1000)
boot_delay = 0;
- printk_delay_msec = loops_per_msec;
- printk(KERN_DEBUG "boot_delay: %u, preset_lpj: %ld, lpj: %lu, "
- "HZ: %d, printk_delay_msec: %llu\n",
- boot_delay, preset_lpj, lpj, HZ, printk_delay_msec);
+ pr_debug("boot_delay: %u, preset_lpj: %ld, lpj: %lu, "
+ "HZ: %d, loops_per_msec: %llu\n",
+ boot_delay, preset_lpj, lpj, HZ, loops_per_msec);
return 1;
}
__setup("boot_delay=", boot_delay_setup);
@@ -236,7 +234,7 @@
if (boot_delay == 0 || system_state != SYSTEM_BOOTING)
return;
- k = (unsigned long long)printk_delay_msec * boot_delay;
+ k = (unsigned long long)loops_per_msec * boot_delay;
timeout = jiffies + msecs_to_jiffies(boot_delay);
while (k) {
@@ -655,6 +653,20 @@
static int new_text_line = 1;
static char printk_buf[1024];
+int printk_delay_msec __read_mostly;
+
+static inline void printk_delay(void)
+{
+ if (unlikely(printk_delay_msec)) {
+ int m = printk_delay_msec;
+
+ while (m--) {
+ mdelay(1);
+ touch_nmi_watchdog();
+ }
+ }
+}
+
asmlinkage int vprintk(const char *fmt, va_list args)
{
int printed_len = 0;
@@ -664,6 +676,7 @@
char *p;
boot_delay_msec();
+ printk_delay();
preempt_disable();
/* This stops the holder of console_sem just where we want him */
diff --git a/kernel/resource.c b/kernel/resource.c
index 78b0872..fb11a58 100644
--- a/kernel/resource.c
+++ b/kernel/resource.c
@@ -223,13 +223,13 @@
EXPORT_SYMBOL(release_resource);
-#if defined(CONFIG_MEMORY_HOTPLUG) && !defined(CONFIG_ARCH_HAS_WALK_MEMORY)
+#if !defined(CONFIG_ARCH_HAS_WALK_MEMORY)
/*
* Finds the lowest memory reosurce exists within [res->start.res->end)
- * the caller must specify res->start, res->end, res->flags.
+ * the caller must specify res->start, res->end, res->flags and "name".
* If found, returns 0, res is overwritten, if not found, returns -1.
*/
-static int find_next_system_ram(struct resource *res)
+static int find_next_system_ram(struct resource *res, char *name)
{
resource_size_t start, end;
struct resource *p;
@@ -245,6 +245,8 @@
/* system ram is just marked as IORESOURCE_MEM */
if (p->flags != res->flags)
continue;
+ if (name && strcmp(p->name, name))
+ continue;
if (p->start > end) {
p = NULL;
break;
@@ -262,19 +264,26 @@
res->end = p->end;
return 0;
}
-int
-walk_memory_resource(unsigned long start_pfn, unsigned long nr_pages, void *arg,
- int (*func)(unsigned long, unsigned long, void *))
+
+/*
+ * This function calls callback against all memory range of "System RAM"
+ * which are marked as IORESOURCE_MEM and IORESOUCE_BUSY.
+ * Now, this function is only for "System RAM".
+ */
+int walk_system_ram_range(unsigned long start_pfn, unsigned long nr_pages,
+ void *arg, int (*func)(unsigned long, unsigned long, void *))
{
struct resource res;
unsigned long pfn, len;
u64 orig_end;
int ret = -1;
+
res.start = (u64) start_pfn << PAGE_SHIFT;
res.end = ((u64)(start_pfn + nr_pages) << PAGE_SHIFT) - 1;
res.flags = IORESOURCE_MEM | IORESOURCE_BUSY;
orig_end = res.end;
- while ((res.start < res.end) && (find_next_system_ram(&res) >= 0)) {
+ while ((res.start < res.end) &&
+ (find_next_system_ram(&res, "System RAM") >= 0)) {
pfn = (unsigned long)(res.start >> PAGE_SHIFT);
len = (unsigned long)((res.end + 1 - res.start) >> PAGE_SHIFT);
ret = (*func)(pfn, len, arg);
diff --git a/kernel/smp.c b/kernel/smp.c
index 8e21850..fd47a25 100644
--- a/kernel/smp.c
+++ b/kernel/smp.c
@@ -29,8 +29,7 @@
struct call_function_data {
struct call_single_data csd;
- spinlock_t lock;
- unsigned int refs;
+ atomic_t refs;
cpumask_var_t cpumask;
};
@@ -39,9 +38,7 @@
spinlock_t lock;
};
-static DEFINE_PER_CPU(struct call_function_data, cfd_data) = {
- .lock = __SPIN_LOCK_UNLOCKED(cfd_data.lock),
-};
+static DEFINE_PER_CPU(struct call_function_data, cfd_data);
static int
hotplug_cfd(struct notifier_block *nfb, unsigned long action, void *hcpu)
@@ -196,25 +193,18 @@
list_for_each_entry_rcu(data, &call_function.queue, csd.list) {
int refs;
- spin_lock(&data->lock);
- if (!cpumask_test_cpu(cpu, data->cpumask)) {
- spin_unlock(&data->lock);
+ if (!cpumask_test_and_clear_cpu(cpu, data->cpumask))
continue;
- }
- cpumask_clear_cpu(cpu, data->cpumask);
- spin_unlock(&data->lock);
data->csd.func(data->csd.info);
- spin_lock(&data->lock);
- WARN_ON(data->refs == 0);
- refs = --data->refs;
+ refs = atomic_dec_return(&data->refs);
+ WARN_ON(refs < 0);
if (!refs) {
spin_lock(&call_function.lock);
list_del_rcu(&data->csd.list);
spin_unlock(&call_function.lock);
}
- spin_unlock(&data->lock);
if (refs)
continue;
@@ -419,23 +409,20 @@
data = &__get_cpu_var(cfd_data);
csd_lock(&data->csd);
- spin_lock_irqsave(&data->lock, flags);
data->csd.func = func;
data->csd.info = info;
cpumask_and(data->cpumask, mask, cpu_online_mask);
cpumask_clear_cpu(this_cpu, data->cpumask);
- data->refs = cpumask_weight(data->cpumask);
+ atomic_set(&data->refs, cpumask_weight(data->cpumask));
- spin_lock(&call_function.lock);
+ spin_lock_irqsave(&call_function.lock, flags);
/*
* Place entry at the _HEAD_ of the list, so that any cpu still
* observing the entry in generic_smp_call_function_interrupt()
* will not miss any other list entries:
*/
list_add_rcu(&data->csd.list, &call_function.queue);
- spin_unlock(&call_function.lock);
-
- spin_unlock_irqrestore(&data->lock, flags);
+ spin_unlock_irqrestore(&call_function.lock, flags);
/*
* Make the list addition visible before sending the ipi.
diff --git a/kernel/sys.c b/kernel/sys.c
index ea5c3bc..ebcb156 100644
--- a/kernel/sys.c
+++ b/kernel/sys.c
@@ -1338,6 +1338,7 @@
unsigned long flags;
cputime_t utime, stime;
struct task_cputime cputime;
+ unsigned long maxrss = 0;
memset((char *) r, 0, sizeof *r);
utime = stime = cputime_zero;
@@ -1346,6 +1347,7 @@
utime = task_utime(current);
stime = task_stime(current);
accumulate_thread_rusage(p, r);
+ maxrss = p->signal->maxrss;
goto out;
}
@@ -1363,6 +1365,7 @@
r->ru_majflt = p->signal->cmaj_flt;
r->ru_inblock = p->signal->cinblock;
r->ru_oublock = p->signal->coublock;
+ maxrss = p->signal->cmaxrss;
if (who == RUSAGE_CHILDREN)
break;
@@ -1377,6 +1380,8 @@
r->ru_majflt += p->signal->maj_flt;
r->ru_inblock += p->signal->inblock;
r->ru_oublock += p->signal->oublock;
+ if (maxrss < p->signal->maxrss)
+ maxrss = p->signal->maxrss;
t = p;
do {
accumulate_thread_rusage(t, r);
@@ -1392,6 +1397,15 @@
out:
cputime_to_timeval(utime, &r->ru_utime);
cputime_to_timeval(stime, &r->ru_stime);
+
+ if (who != RUSAGE_CHILDREN) {
+ struct mm_struct *mm = get_task_mm(p);
+ if (mm) {
+ setmax_mm_hiwater_rss(&maxrss, mm);
+ mmput(mm);
+ }
+ }
+ r->ru_maxrss = maxrss * (PAGE_SIZE / 1024); /* convert pages to KBs */
}
int getrusage(struct task_struct *p, int who, struct rusage __user *ru)
diff --git a/kernel/sysctl.c b/kernel/sysctl.c
index 6ba49c7..0dfaa47 100644
--- a/kernel/sysctl.c
+++ b/kernel/sysctl.c
@@ -106,6 +106,9 @@
static int __maybe_unused two = 2;
static unsigned long one_ul = 1;
static int one_hundred = 100;
+#ifdef CONFIG_PRINTK
+static int ten_thousand = 10000;
+#endif
/* this is needed for the proc_doulongvec_minmax of vm_dirty_bytes */
static unsigned long dirty_bytes_min = 2 * PAGE_SIZE;
@@ -722,6 +725,17 @@
.mode = 0644,
.proc_handler = &proc_dointvec,
},
+ {
+ .ctl_name = CTL_UNNUMBERED,
+ .procname = "printk_delay",
+ .data = &printk_delay_msec,
+ .maxlen = sizeof(int),
+ .mode = 0644,
+ .proc_handler = &proc_dointvec_minmax,
+ .strategy = &sysctl_intvec,
+ .extra1 = &zero,
+ .extra2 = &ten_thousand,
+ },
#endif
{
.ctl_name = KERN_NGROUPS_MAX,
diff --git a/kernel/trace/ftrace.c b/kernel/trace/ftrace.c
index c71e91b..23df7771 100644
--- a/kernel/trace/ftrace.c
+++ b/kernel/trace/ftrace.c
@@ -1520,7 +1520,7 @@
return 0;
}
-static struct seq_operations show_ftrace_seq_ops = {
+static const struct seq_operations show_ftrace_seq_ops = {
.start = t_start,
.next = t_next,
.stop = t_stop,
@@ -2459,7 +2459,7 @@
return 0;
}
-static struct seq_operations ftrace_graph_seq_ops = {
+static const struct seq_operations ftrace_graph_seq_ops = {
.start = g_start,
.next = g_next,
.stop = g_stop,
diff --git a/kernel/trace/trace.c b/kernel/trace/trace.c
index a35925d..6c0f6a8 100644
--- a/kernel/trace/trace.c
+++ b/kernel/trace/trace.c
@@ -1949,7 +1949,7 @@
return 0;
}
-static struct seq_operations tracer_seq_ops = {
+static const struct seq_operations tracer_seq_ops = {
.start = s_start,
.next = s_next,
.stop = s_stop,
@@ -2163,7 +2163,7 @@
return 0;
}
-static struct seq_operations show_traces_seq_ops = {
+static const struct seq_operations show_traces_seq_ops = {
.start = t_start,
.next = t_next,
.stop = t_stop,
diff --git a/mm/Makefile b/mm/Makefile
index 728a9fd..88193d7 100644
--- a/mm/Makefile
+++ b/mm/Makefile
@@ -11,10 +11,10 @@
maccess.o page_alloc.o page-writeback.o \
readahead.o swap.o truncate.o vmscan.o shmem.o \
prio_tree.o util.o mmzone.o vmstat.o backing-dev.o \
- page_isolation.o mm_init.o mmu_context.o $(mmu-y)
+ page_isolation.o mm_init.o mmu_context.o \
+ pagewalk.o $(mmu-y)
obj-y += init-mm.o
-obj-$(CONFIG_PROC_PAGE_MONITOR) += pagewalk.o
obj-$(CONFIG_BOUNCE) += bounce.o
obj-$(CONFIG_SWAP) += page_io.o swap_state.o swapfile.o thrash.o
obj-$(CONFIG_HAS_DMA) += dmapool.o
diff --git a/mm/memory_hotplug.c b/mm/memory_hotplug.c
index efe3e0e..821dee5 100644
--- a/mm/memory_hotplug.c
+++ b/mm/memory_hotplug.c
@@ -413,7 +413,7 @@
if (!populated_zone(zone))
need_zonelists_rebuild = 1;
- ret = walk_memory_resource(pfn, nr_pages, &onlined_pages,
+ ret = walk_system_ram_range(pfn, nr_pages, &onlined_pages,
online_pages_range);
if (ret) {
printk(KERN_DEBUG "online_pages %lx at %lx failed\n",
@@ -705,7 +705,7 @@
static void
offline_isolated_pages(unsigned long start_pfn, unsigned long end_pfn)
{
- walk_memory_resource(start_pfn, end_pfn - start_pfn, NULL,
+ walk_system_ram_range(start_pfn, end_pfn - start_pfn, NULL,
offline_isolated_pages_cb);
}
@@ -731,7 +731,7 @@
long offlined = 0;
int ret;
- ret = walk_memory_resource(start_pfn, end_pfn - start_pfn, &offlined,
+ ret = walk_system_ram_range(start_pfn, end_pfn - start_pfn, &offlined,
check_pages_isolated_cb);
if (ret < 0)
offlined = (long)ret;
diff --git a/mm/nommu.c b/mm/nommu.c
index 1a4473fa..8d48424 100644
--- a/mm/nommu.c
+++ b/mm/nommu.c
@@ -61,6 +61,7 @@
struct page *mem_map;
unsigned long max_mapnr;
unsigned long num_physpages;
+unsigned long highest_memmap_pfn;
struct percpu_counter vm_committed_as;
int sysctl_overcommit_memory = OVERCOMMIT_GUESS; /* heuristic overcommit */
int sysctl_overcommit_ratio = 50; /* default is 50% */
@@ -169,7 +170,7 @@
}
int __get_user_pages(struct task_struct *tsk, struct mm_struct *mm,
- unsigned long start, int nr_pages, int foll_flags,
+ unsigned long start, int nr_pages, unsigned int foll_flags,
struct page **pages, struct vm_area_struct **vmas)
{
struct vm_area_struct *vma;
diff --git a/mm/vmalloc.c b/mm/vmalloc.c
index 5535da1..69511e6 100644
--- a/mm/vmalloc.c
+++ b/mm/vmalloc.c
@@ -184,7 +184,7 @@
return ret;
}
-static inline int is_vmalloc_or_module_addr(const void *x)
+int is_vmalloc_or_module_addr(const void *x)
{
/*
* ARM, x86-64 and sparc64 put modules in a special place,
diff --git a/net/9p/trans_virtio.c b/net/9p/trans_virtio.c
index 9bf0b73..b2e07f0 100644
--- a/net/9p/trans_virtio.c
+++ b/net/9p/trans_virtio.c
@@ -43,6 +43,7 @@
#include <net/9p/transport.h>
#include <linux/scatterlist.h>
#include <linux/virtio.h>
+#include <linux/virtio_ids.h>
#include <linux/virtio_9p.h>
#define VIRTQUEUE_NUM 128
@@ -200,7 +201,7 @@
req->status = REQ_STATUS_SENT;
- if (chan->vq->vq_ops->add_buf(chan->vq, chan->sg, out, in, req->tc)) {
+ if (chan->vq->vq_ops->add_buf(chan->vq, chan->sg, out, in, req->tc) < 0) {
P9_DPRINTK(P9_DEBUG_TRANS,
"9p debug: virtio rpc add_buf returned failure");
return -EIO;
@@ -334,8 +335,6 @@
}
}
-#define VIRTIO_ID_9P 9
-
static struct virtio_device_id id_table[] = {
{ VIRTIO_ID_9P, VIRTIO_DEV_ANY_ID },
{ 0 },
diff --git a/net/ipv6/ip6mr.c b/net/ipv6/ip6mr.c
index 3907510..090675e 100644
--- a/net/ipv6/ip6mr.c
+++ b/net/ipv6/ip6mr.c
@@ -324,7 +324,7 @@
return 0;
}
-static struct seq_operations ipmr_mfc_seq_ops = {
+static const struct seq_operations ipmr_mfc_seq_ops = {
.start = ipmr_mfc_seq_start,
.next = ipmr_mfc_seq_next,
.stop = ipmr_mfc_seq_stop,
diff --git a/net/socket.c b/net/socket.c
index 0ad02ae..49917a1 100644
--- a/net/socket.c
+++ b/net/socket.c
@@ -86,6 +86,7 @@
#include <linux/audit.h>
#include <linux/wireless.h>
#include <linux/nsproxy.h>
+#include <linux/magic.h>
#include <asm/uaccess.h>
#include <asm/unistd.h>
@@ -235,8 +236,6 @@
return __put_user(klen, ulen);
}
-#define SOCKFS_MAGIC 0x534F434B
-
static struct kmem_cache *sock_inode_cachep __read_mostly;
static struct inode *sock_alloc_inode(struct super_block *sb)
diff --git a/scripts/conmakehash.c b/scripts/conmakehash.c
index e0c6891..263a44d 100644
--- a/scripts/conmakehash.c
+++ b/scripts/conmakehash.c
@@ -24,14 +24,14 @@
typedef unsigned short unicode;
-void usage(char *argv0)
+static void usage(char *argv0)
{
fprintf(stderr, "Usage: \n"
" %s chartable [hashsize] [hashstep] [maxhashlevel]\n", argv0);
exit(EX_USAGE);
}
-int getunicode(char **p0)
+static int getunicode(char **p0)
{
char *p = *p0;
@@ -49,7 +49,7 @@
/* Massive overkill, but who cares? */
int unicount[MAX_FONTLEN];
-void addpair(int fp, int un)
+static void addpair(int fp, int un)
{
int i;
diff --git a/scripts/genksyms/genksyms.c b/scripts/genksyms/genksyms.c
index 3a8297b..af6b836 100644
--- a/scripts/genksyms/genksyms.c
+++ b/scripts/genksyms/genksyms.c
@@ -176,7 +176,7 @@
strcmp(defn->string, "{") == 0);
}
-struct symbol *__add_symbol(const char *name, enum symbol_type type,
+static struct symbol *__add_symbol(const char *name, enum symbol_type type,
struct string_list *defn, int is_extern,
int is_reference)
{
@@ -265,7 +265,7 @@
return __add_symbol(name, type, defn, is_extern, 0);
}
-struct symbol *add_reference_symbol(const char *name, enum symbol_type type,
+static struct symbol *add_reference_symbol(const char *name, enum symbol_type type,
struct string_list *defn, int is_extern)
{
return __add_symbol(name, type, defn, is_extern, 1);
@@ -313,7 +313,7 @@
#define ARRAY_SIZE(arr) (sizeof(arr) / sizeof((arr)[0]))
-struct string_list *read_node(FILE *f)
+static struct string_list *read_node(FILE *f)
{
char buffer[256];
struct string_list node = {
diff --git a/scripts/kallsyms.c b/scripts/kallsyms.c
index 64343cc..86c3896 100644
--- a/scripts/kallsyms.c
+++ b/scripts/kallsyms.c
@@ -585,7 +585,7 @@
{
const char *tail = str;
- while (*tail != '_')
+ while (*tail == '_')
tail++;
return tail - str;
diff --git a/scripts/mod/file2alias.c b/scripts/mod/file2alias.c
index 40e0045..62a9025 100644
--- a/scripts/mod/file2alias.c
+++ b/scripts/mod/file2alias.c
@@ -657,6 +657,15 @@
return 1;
}
+/* Looks like: spi:S */
+static int do_spi_entry(const char *filename, struct spi_device_id *id,
+ char *alias)
+{
+ sprintf(alias, SPI_MODULE_PREFIX "%s", id->name);
+
+ return 1;
+}
+
static const struct dmifield {
const char *prefix;
int field;
@@ -853,6 +862,10 @@
do_table(symval, sym->st_size,
sizeof(struct i2c_device_id), "i2c",
do_i2c_entry, mod);
+ else if (sym_is(symname, "__mod_spi_device_table"))
+ do_table(symval, sym->st_size,
+ sizeof(struct spi_device_id), "spi",
+ do_spi_entry, mod);
else if (sym_is(symname, "__mod_dmi_device_table"))
do_table(symval, sym->st_size,
sizeof(struct dmi_system_id), "dmi",
diff --git a/scripts/mod/modpost.c b/scripts/mod/modpost.c
index 4522948..801a16a 100644
--- a/scripts/mod/modpost.c
+++ b/scripts/mod/modpost.c
@@ -691,7 +691,7 @@
* The $ syntax is for sections where ld append a dot number
* to make section name unique.
*/
-int match(const char *sym, const char * const pat[])
+static int match(const char *sym, const char * const pat[])
{
const char *p;
while (*pat) {
@@ -1746,7 +1746,7 @@
buf_printf(b, "};\n");
}
-void add_staging_flag(struct buffer *b, const char *name)
+static void add_staging_flag(struct buffer *b, const char *name)
{
static const char *staging_dir = "drivers/staging";
diff --git a/scripts/selinux/mdp/mdp.c b/scripts/selinux/mdp/mdp.c
index ca757d4..b4ced85 100644
--- a/scripts/selinux/mdp/mdp.c
+++ b/scripts/selinux/mdp/mdp.c
@@ -31,13 +31,13 @@
#include "flask.h"
-void usage(char *name)
+static void usage(char *name)
{
printf("usage: %s [-m] policy_file context_file\n", name);
exit(1);
}
-void find_common_name(char *cname, char *dest, int len)
+static void find_common_name(char *cname, char *dest, int len)
{
char *start, *end;
diff --git a/security/integrity/ima/ima_fs.c b/security/integrity/ima/ima_fs.c
index 6bfc7ea..8e9777b 100644
--- a/security/integrity/ima/ima_fs.c
+++ b/security/integrity/ima/ima_fs.c
@@ -146,7 +146,7 @@
return 0;
}
-static struct seq_operations ima_measurments_seqops = {
+static const struct seq_operations ima_measurments_seqops = {
.start = ima_measurements_start,
.next = ima_measurements_next,
.stop = ima_measurements_stop,
@@ -221,7 +221,7 @@
return 0;
}
-static struct seq_operations ima_ascii_measurements_seqops = {
+static const struct seq_operations ima_ascii_measurements_seqops = {
.start = ima_measurements_start,
.next = ima_measurements_next,
.stop = ima_measurements_stop,
diff --git a/security/smack/smack_lsm.c b/security/smack/smack_lsm.c
index acae7ef4..c33b6bb 100644
--- a/security/smack/smack_lsm.c
+++ b/security/smack/smack_lsm.c
@@ -30,17 +30,11 @@
#include <net/netlabel.h>
#include <net/cipso_ipv4.h>
#include <linux/audit.h>
+#include <linux/magic.h>
#include "smack.h"
#define task_security(task) (task_cred_xxx((task), security))
-/*
- * I hope these are the hokeyist lines of code in the module. Casey.
- */
-#define DEVPTS_SUPER_MAGIC 0x1cd1
-#define SOCKFS_MAGIC 0x534F434B
-#define TMPFS_MAGIC 0x01021994
-
/**
* smk_fetch - Fetch the smack label from a file.
* @ip: a pointer to the inode
diff --git a/security/smack/smackfs.c b/security/smack/smackfs.c
index f83a809..aeead75 100644
--- a/security/smack/smackfs.c
+++ b/security/smack/smackfs.c
@@ -187,7 +187,7 @@
/* No-op */
}
-static struct seq_operations load_seq_ops = {
+static const struct seq_operations load_seq_ops = {
.start = load_seq_start,
.next = load_seq_next,
.show = load_seq_show,
@@ -503,7 +503,7 @@
/* No-op */
}
-static struct seq_operations cipso_seq_ops = {
+static const struct seq_operations cipso_seq_ops = {
.start = cipso_seq_start,
.stop = cipso_seq_stop,
.next = cipso_seq_next,
@@ -697,7 +697,7 @@
/* No-op */
}
-static struct seq_operations netlbladdr_seq_ops = {
+static const struct seq_operations netlbladdr_seq_ops = {
.start = netlbladdr_seq_start,
.stop = netlbladdr_seq_stop,
.next = netlbladdr_seq_next,
diff --git a/usr/gen_init_cpio.c b/usr/gen_init_cpio.c
index f1d3fe3..83b3dde 100644
--- a/usr/gen_init_cpio.c
+++ b/usr/gen_init_cpio.c
@@ -446,7 +446,7 @@
return rc;
}
-void usage(const char *prog)
+static void usage(const char *prog)
{
fprintf(stderr, "Usage:\n"
"\t%s <cpio_list>\n"