cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1 | /* |
| 2 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3 | % % |
| 4 | % % |
| 5 | % % |
| 6 | % RRRR EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| 7 | % R R E SS I ZZ E % |
| 8 | % RRRR EEE SSS I ZZZ EEE % |
| 9 | % R R E SS I ZZ E % |
| 10 | % R R EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| 11 | % % |
| 12 | % % |
| 13 | % MagickCore Image Resize Methods % |
| 14 | % % |
| 15 | % Software Design % |
| 16 | % John Cristy % |
| 17 | % July 1992 % |
| 18 | % % |
| 19 | % % |
| 20 | % Copyright 1999-2009 ImageMagick Studio LLC, a non-profit organization % |
| 21 | % dedicated to making software imaging solutions freely available. % |
| 22 | % % |
| 23 | % You may not use this file except in compliance with the License. You may % |
| 24 | % obtain a copy of the License at % |
| 25 | % % |
| 26 | % http://www.imagemagick.org/script/license.php % |
| 27 | % % |
| 28 | % Unless required by applicable law or agreed to in writing, software % |
| 29 | % distributed under the License is distributed on an "AS IS" BASIS, % |
| 30 | % WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. % |
| 31 | % See the License for the specific language governing permissions and % |
| 32 | % limitations under the License. % |
| 33 | % % |
| 34 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 35 | % |
| 36 | % |
| 37 | */ |
| 38 | |
| 39 | /* |
| 40 | Include declarations. |
| 41 | */ |
| 42 | #include "magick/studio.h" |
| 43 | #include "magick/artifact.h" |
| 44 | #include "magick/blob.h" |
| 45 | #include "magick/cache.h" |
| 46 | #include "magick/cache-view.h" |
| 47 | #include "magick/color.h" |
| 48 | #include "magick/color-private.h" |
| 49 | #include "magick/draw.h" |
| 50 | #include "magick/exception.h" |
| 51 | #include "magick/exception-private.h" |
| 52 | #include "magick/gem.h" |
| 53 | #include "magick/image.h" |
| 54 | #include "magick/image-private.h" |
| 55 | #include "magick/list.h" |
| 56 | #include "magick/memory_.h" |
| 57 | #include "magick/pixel-private.h" |
| 58 | #include "magick/property.h" |
| 59 | #include "magick/monitor.h" |
| 60 | #include "magick/monitor-private.h" |
| 61 | #include "magick/pixel.h" |
| 62 | #include "magick/option.h" |
| 63 | #include "magick/resample.h" |
| 64 | #include "magick/resize.h" |
| 65 | #include "magick/resize-private.h" |
| 66 | #include "magick/string_.h" |
| 67 | #include "magick/thread-private.h" |
| 68 | #include "magick/utility.h" |
| 69 | #include "magick/version.h" |
| 70 | #if defined(MAGICKCORE_LQR_DELEGATE) |
| 71 | #include <lqr.h> |
| 72 | #endif |
| 73 | |
| 74 | /* |
| 75 | Typedef declarations. |
| 76 | */ |
| 77 | struct _ResizeFilter |
| 78 | { |
| 79 | MagickRealType |
| 80 | (*filter)(const MagickRealType,const ResizeFilter *), |
| 81 | (*window)(const MagickRealType,const ResizeFilter *), |
| 82 | support, /* filter region of support - the filter support limit */ |
| 83 | window_support, /* window support, usally equal to support (expert only) */ |
| 84 | scale, /* dimension to scale to fit window support (usally 1.0) */ |
| 85 | blur, /* x-scale (blur-sharpen) */ |
| 86 | cubic[8]; /* cubic coefficents for smooth Cubic filters */ |
| 87 | |
| 88 | unsigned long |
| 89 | signature; |
| 90 | }; |
| 91 | |
| 92 | /* |
| 93 | Forward declaractions. |
| 94 | */ |
| 95 | static MagickRealType |
| 96 | I0(MagickRealType x), |
| 97 | BesselOrderOne(MagickRealType); |
| 98 | |
| 99 | /* |
| 100 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 101 | % % |
| 102 | % % |
| 103 | % % |
| 104 | + F i l t e r F u n c t i o n s % |
| 105 | % % |
| 106 | % % |
| 107 | % % |
| 108 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 109 | % |
| 110 | % These are the various filter and windowing functions that are provided, |
| 111 | % |
| 112 | % They are all internal to this module only. See AcquireResizeFilterInfo() |
| 113 | % for details of the access to these functions, via the |
| 114 | % GetResizeFilterSupport() and GetResizeFilterWeight() API interface. |
| 115 | % |
| 116 | % The individual filter functions have this format... |
| 117 | % |
| 118 | % static MagickRealtype *FilterName(const MagickRealType x, |
| 119 | % const MagickRealType support) |
| 120 | % |
| 121 | % o x: the distance from the sampling point |
| 122 | % generally in the range of 0 to support |
| 123 | % The GetResizeFilterWeight() ensures this a positive value. |
| 124 | % |
| 125 | % o resize_filter: Current Filter Information |
| 126 | % This allows function to access support, and posibly other |
| 127 | % pre-calculated information defineding the functions. |
| 128 | % |
| 129 | */ |
| 130 | |
| 131 | static MagickRealType Bessel(const MagickRealType x, |
| 132 | const ResizeFilter *magick_unused(resize_filter)) |
| 133 | { |
| 134 | /* |
| 135 | See Pratt "Digital Image Processing" p.97 for Bessel functions |
| 136 | |
| 137 | This function actually a X-scaled Jinc(x) function. |
| 138 | http://mathworld.wolfram.com/JincFunction.html |
| 139 | And on page 11 of... |
| 140 | http://www.ph.ed.ac.uk/%7ewjh/teaching/mo/slides/lens/lens.pdf |
| 141 | */ |
| 142 | if (x == 0.0) |
| 143 | return((MagickRealType) (MagickPI/4.0)); |
| 144 | return(BesselOrderOne(MagickPI*x)/(2.0*x)); |
| 145 | } |
| 146 | |
| 147 | static MagickRealType Blackman(const MagickRealType x, |
| 148 | const ResizeFilter *magick_unused(resize_filter)) |
| 149 | { |
| 150 | /* |
| 151 | Blackman: 2rd Order cosine windowing function. |
| 152 | */ |
| 153 | return(0.42+0.5*cos(MagickPI*(double) x)+0.08*cos(2.0*MagickPI*(double) x)); |
| 154 | } |
| 155 | |
| 156 | static MagickRealType Bohman(const MagickRealType x, |
| 157 | const ResizeFilter *magick_unused(resize_filter)) |
| 158 | { |
| 159 | /* |
| 160 | Bohman: 2rd Order cosine windowing function. |
| 161 | */ |
| 162 | return((1-x)*cos(MagickPI*(double) x)+sin(MagickPI*(double) x)/MagickPI); |
| 163 | } |
| 164 | |
| 165 | static MagickRealType Box(const MagickRealType magick_unused(x), |
| 166 | const ResizeFilter *magick_unused(resize_filter)) |
| 167 | { |
| 168 | /* |
| 169 | Just return 1.0, filter will still be clipped by its support window. |
| 170 | */ |
| 171 | return(1.0); |
| 172 | } |
| 173 | |
| 174 | static MagickRealType CubicBC(const MagickRealType x, |
| 175 | const ResizeFilter *resize_filter) |
| 176 | { |
| 177 | /* |
| 178 | Cubic Filters using B,C determined values: |
| 179 | |
| 180 | Mitchell-Netravali B=1/3 C=1/3 Qualitively ideal Cubic Filter |
| 181 | Catmull-Rom B= 0 C=1/2 Cublic Interpolation Function |
| 182 | Cubic B-Spline B= 1 C= 0 Spline Approximation of Gaussian |
| 183 | Hermite B= 0 C= 0 Quadratic Spline (support = 1) |
| 184 | |
| 185 | See paper by Mitchell and Netravali, |
| 186 | Reconstruction Filters in Computer Graphics |
| 187 | Computer Graphics, Volume 22, Number 4, August 1988 |
| 188 | http://www.cs.utexas.edu/users/fussell/courses/cs384g/ |
| 189 | lectures/mitchell/Mitchell.pdf |
| 190 | |
| 191 | Coefficents are determined from B,C values |
| 192 | P0 = ( 6 - 2*B )/6 |
| 193 | P1 = 0 |
| 194 | P2 = (-18 +12*B + 6*C )/6 |
| 195 | P3 = ( 12 - 9*B - 6*C )/6 |
| 196 | Q0 = ( 8*B +24*C )/6 |
| 197 | Q1 = ( -12*B -48*C )/6 |
| 198 | Q2 = ( 6*B +30*C )/6 |
| 199 | Q3 = ( - 1*B - 6*C )/6 |
| 200 | |
| 201 | Which is used to define the filter... |
| 202 | P0 + P1*x + P2*x^2 + P3*x^3 0 <= x < 1 |
| 203 | Q0 + Q1*x + Q2*x^2 + Q3*x^3 1 <= x <= 2 |
| 204 | |
| 205 | Which ensures function is continuous in value and derivative (slope). |
| 206 | */ |
| 207 | if (x < 1.0) |
| 208 | return(resize_filter->cubic[0]+x*(resize_filter->cubic[1]+x* |
| 209 | (resize_filter->cubic[2]+x*resize_filter->cubic[3]))); |
| 210 | if (x < 2.0) |
| 211 | return(resize_filter->cubic[4] +x*(resize_filter->cubic[5]+x* |
| 212 | (resize_filter->cubic[6] +x*resize_filter->cubic[7]))); |
| 213 | return(0.0); |
| 214 | } |
| 215 | |
| 216 | static MagickRealType Gaussian(const MagickRealType x, |
| 217 | const ResizeFilter *magick_unused(resize_filter)) |
| 218 | { |
| 219 | return(exp((double) (-2.0*x*x))*sqrt(2.0/MagickPI)); |
| 220 | } |
| 221 | |
| 222 | static MagickRealType Hanning(const MagickRealType x, |
| 223 | const ResizeFilter *magick_unused(resize_filter)) |
| 224 | { |
| 225 | /* |
| 226 | A Cosine windowing function. |
| 227 | */ |
| 228 | return(0.5+0.5*cos(MagickPI*(double) x)); |
| 229 | } |
| 230 | |
| 231 | static MagickRealType Hamming(const MagickRealType x, |
| 232 | const ResizeFilter *magick_unused(resize_filter)) |
| 233 | { |
| 234 | /* |
| 235 | A offset Cosine windowing function. |
| 236 | */ |
| 237 | return(0.54+0.46*cos(MagickPI*(double) x)); |
| 238 | } |
| 239 | |
| 240 | static MagickRealType Kaiser(const MagickRealType x, |
| 241 | const ResizeFilter *magick_unused(resize_filter)) |
| 242 | { |
| 243 | #define Alpha 6.5 |
| 244 | #define I0A (1.0/I0(Alpha)) |
| 245 | |
| 246 | /* |
| 247 | Kaiser Windowing Function (bessel windowing): |
| 248 | Alpha is a free value from 5 to 8 (currently hardcoded to 6.5) |
| 249 | Future: make alphand the IOA pre-calculation, a 'expert' setting. |
| 250 | */ |
| 251 | return(I0A*I0(Alpha*sqrt((double) (1.0-x*x)))); |
| 252 | } |
| 253 | |
| 254 | static MagickRealType Lagrange(const MagickRealType x, |
| 255 | const ResizeFilter *resize_filter) |
| 256 | { |
| 257 | long |
| 258 | n, |
| 259 | order; |
| 260 | |
| 261 | MagickRealType |
| 262 | value; |
| 263 | |
| 264 | register long |
| 265 | i; |
| 266 | |
| 267 | /* |
| 268 | Lagrange Piece-Wise polynomial fit of Sinc: |
| 269 | N is the 'order' of the lagrange function and depends on |
| 270 | the overall support window size of the filter. That is for |
| 271 | a support of 2, gives a lagrange-4 or piece-wise cubic functions |
| 272 | |
| 273 | Note that n is the specific piece of the piece-wise function to calculate. |
| 274 | |
| 275 | See Survey: Interpolation Methods, IEEE Transactions on Medical Imaging, |
| 276 | Vol 18, No 11, November 1999, p1049-1075, -- Equation 27 on p1064 |
| 277 | */ |
| 278 | if (x > resize_filter->support) |
| 279 | return(0.0); |
| 280 | order=(long) (2.0*resize_filter->window_support); /* number of pieces */ |
| 281 | n=(long) ((1.0*order)/2.0+x); /* which piece does x belong to */ |
| 282 | value=1.0f; |
| 283 | for (i=0; i < order; i++) |
| 284 | if (i != n) |
| 285 | value*=(n-i-x)/(n-i); |
| 286 | return(value); |
| 287 | } |
| 288 | |
| 289 | static MagickRealType Quadratic(const MagickRealType x, |
| 290 | const ResizeFilter *magick_unused(resize_filter)) |
| 291 | { |
| 292 | /* |
| 293 | 2rd order (quadratic) B-Spline approximation of Gaussian. |
| 294 | */ |
| 295 | if (x < 0.5) |
| 296 | return(0.75-x*x); |
| 297 | if (x < 1.5) |
| 298 | return(0.5*(x-1.5)*(x-1.5)); |
| 299 | return(0.0); |
| 300 | } |
| 301 | |
| 302 | static MagickRealType Sinc(const MagickRealType x, |
| 303 | const ResizeFilter *magick_unused(resize_filter)) |
| 304 | { |
| 305 | /* |
| 306 | This function actually a X-scaled Sinc(x) function. |
| 307 | */ |
| 308 | if (x == 0.0) |
| 309 | return(1.0); |
| 310 | return(sin(MagickPI*(double) x)/(MagickPI*(double) x)); |
| 311 | } |
| 312 | |
| 313 | static MagickRealType Triangle(const MagickRealType x, |
| 314 | const ResizeFilter *magick_unused(resize_filter)) |
| 315 | { |
| 316 | /* |
| 317 | 1rd order (linear) B-Spline, bilinear interpolation, |
| 318 | Tent 1D filter, or a Bartlett 2D Cone filter |
| 319 | */ |
| 320 | if (x < 1.0) |
| 321 | return(1.0-x); |
| 322 | return(0.0); |
| 323 | } |
| 324 | |
| 325 | static MagickRealType Welsh(const MagickRealType x, |
| 326 | const ResizeFilter *magick_unused(resize_filter)) |
| 327 | { |
| 328 | /* |
| 329 | Welsh parabolic windowing filter. |
| 330 | */ |
| 331 | if (x < 1.0) |
| 332 | return(1.0-x*x); |
| 333 | return(0.0); |
| 334 | } |
| 335 | |
| 336 | /* |
| 337 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 338 | % % |
| 339 | % % |
| 340 | % % |
| 341 | + A c q u i r e R e s i z e F i l t e r % |
| 342 | % % |
| 343 | % % |
| 344 | % % |
| 345 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 346 | % |
| 347 | % AcquireResizeFilter() allocates the ResizeFilter structure. Choose from |
| 348 | % these filters: |
| 349 | % |
| 350 | % FIR (Finite impulse Response) Filters |
| 351 | % Box Triangle Quadratic |
| 352 | % Cubic Hermite Catrom |
| 353 | % Mitchell |
| 354 | % |
| 355 | % IIR (Infinite impulse Response) Filters |
| 356 | % Gaussian Sinc Bessel |
| 357 | % |
| 358 | % Windowed Sinc/Bessel Method |
| 359 | % Blackman Hanning Hamming |
| 360 | % Kaiser Lancos (Sinc) |
| 361 | % |
| 362 | % FIR filters are used as is, and are limited by that filters support window |
| 363 | % (unless over-ridden). 'Gaussian' while classed as an IIR filter, is also |
| 364 | % simply clipped by its support size (1.5). |
| 365 | % |
| 366 | % Requesting a windowed filter will return either a windowed Sinc, for a one |
| 367 | % dimentional orthogonal filtering method, such as ResizeImage(), or a |
| 368 | % windowed Bessel for image operations requiring a two dimentional |
| 369 | % cylindrical filtering method, such a DistortImage(). Which function is |
| 370 | % is used set by the "cylindrical" boolean argument. |
| 371 | % |
| 372 | % Directly requesting 'Sinc' or 'Bessel' will force the use of that filter |
| 373 | % function, with a default 'Blackman' windowing method. This not however |
| 374 | % recommended as it removes the correct filter selection for different |
| 375 | % filtering image operations. Selecting a window filtering method is better. |
| 376 | % |
| 377 | % Lanczos is purely special case of a Sinc windowed Sinc, but defulting to |
| 378 | % a 3 lobe support, rather that the default 4 lobe support. |
| 379 | % |
| 380 | % Special options can be used to override specific, or all the filter |
| 381 | % settings. However doing so is not advisible unless you have expert |
| 382 | % knowledge of the use of resampling filtered techniques. Extreme caution is |
| 383 | % advised. |
| 384 | % |
| 385 | % "filter:filter" Select this function as the filter. |
| 386 | % If a "filter:window" operation is not provided, then no windowing |
| 387 | % will be performed on the selected filter, (support clipped) |
| 388 | % |
| 389 | % This can be used to force the use of a windowing method as filter, |
| 390 | % request a 'Sinc' filter in a radially filtered operation, or the |
| 391 | % 'Bessel' filter for a othogonal filtered operation. |
| 392 | % |
| 393 | % "filter:window" Select this windowing function for the filter. |
| 394 | % While any filter could be used as a windowing function, |
| 395 | % using that filters first lobe over the whole support window, |
| 396 | % using a non-windowing method is not advisible. |
| 397 | % |
| 398 | % "filter:lobes" Number of lobes to use for the Sinc/Bessel filter. |
| 399 | % This a simper method of setting filter support size that will |
| 400 | % correctly handle the Sinc/Bessel switch for an operators filtering |
| 401 | % requirements. |
| 402 | % |
| 403 | % "filter:support" Set the support size for filtering to the size given |
| 404 | % This not recomented for Sinc/Bessel windowed filters, but is |
| 405 | % used for simple filters like FIR filters, and the Gaussian Filter. |
| 406 | % This will override any 'filter:lobes' option. |
| 407 | % |
| 408 | % "filter:blur" Scale the filter and support window by this amount. |
| 409 | % A value >1 will generally result in a more burred image with |
| 410 | % more ringing effects, while a value <1 will sharpen the |
| 411 | % resulting image with more aliasing and Morie effects. |
| 412 | % |
| 413 | % "filter:win-support" Scale windowing function to this size instead. |
| 414 | % This causes the windowing (or self-windowing Lagrange filter) |
| 415 | % to act is if the support winodw it much much larger than what |
| 416 | % is actually supplied to the calling operator. The filter however |
| 417 | % is still clipped to the real support size given. If unset this |
| 418 | % will equal the normal filter support size. |
| 419 | % |
| 420 | % "filter:b" |
| 421 | % "filter:c" Override the preset B,C values for a Cubic type of filter |
| 422 | % If only one of these are given it is assumes to be a 'Keys' |
| 423 | % type of filter such that B+2C=1, where Keys 'alpha' value = C |
| 424 | % |
| 425 | % "filter:verbose" Output verbose plotting data for graphing the |
| 426 | % resulting filter over the whole support range (with blur effect). |
| 427 | % |
| 428 | % Set a true un-windowed Sinc filter with 10 lobes (very slow) |
| 429 | % -set option:filter:filter Sinc |
| 430 | % -set option:filter:lobes 8 |
| 431 | % |
| 432 | % For example force an 8 lobe Lanczos (Sinc or Bessel) filter... |
| 433 | % -filter Lanczos |
| 434 | % -set option:filter:lobes 8 |
| 435 | % |
| 436 | % The format of the AcquireResizeFilter method is: |
| 437 | % |
| 438 | % ResizeFilter *AcquireResizeFilter(const Image *image, |
| 439 | % const FilterTypes filter_type, const MagickBooleanType radial, |
| 440 | % ExceptionInfo *exception) |
| 441 | % |
| 442 | % o image: the image. |
| 443 | % |
| 444 | % o filter: the filter type, defining a preset filter, window and support. |
| 445 | % |
| 446 | % o blur: blur the filter by this amount, use 1.0 if unknown. |
| 447 | % Image artifact "filter:blur" will override this old usage |
| 448 | % |
| 449 | % o radial: 1D orthogonal filter (Sinc) or 2D radial filter (Bessel) |
| 450 | % |
| 451 | % o exception: return any errors or warnings in this structure. |
| 452 | % |
| 453 | */ |
| 454 | MagickExport ResizeFilter *AcquireResizeFilter(const Image *image, |
| 455 | const FilterTypes filter, const MagickRealType blur, |
| 456 | const MagickBooleanType cylindrical,ExceptionInfo *exception) |
| 457 | { |
| 458 | const char |
| 459 | *artifact; |
| 460 | |
| 461 | FilterTypes |
| 462 | filter_type, |
| 463 | window_type; |
| 464 | |
| 465 | long |
| 466 | filter_artifact; |
| 467 | |
| 468 | MagickRealType |
| 469 | B, |
| 470 | C; |
| 471 | |
| 472 | register ResizeFilter |
| 473 | *resize_filter; |
| 474 | |
| 475 | /* |
| 476 | Table Mapping given Filter, into Weighting and Windowing functions. |
| 477 | A 'Box' windowing function means its a simble non-windowed filter. |
| 478 | A 'Sinc' filter function (must be windowed) could be upgraded to a |
| 479 | 'Bessel' filter if a "cylindrical" filter is requested, unless a "Sinc" |
| 480 | filter specifically request. |
| 481 | */ |
| 482 | static struct |
| 483 | { |
| 484 | FilterTypes |
| 485 | filter, |
| 486 | window; |
| 487 | } const mapping[SentinelFilter] = |
| 488 | { |
| 489 | { UndefinedFilter, BoxFilter }, /* undefined */ |
| 490 | { PointFilter, BoxFilter }, /* special, nearest-neighbour filter */ |
| 491 | { BoxFilter, BoxFilter }, /* Box averaging Filter */ |
| 492 | { TriangleFilter, BoxFilter }, /* Linear Interpolation Filter */ |
| 493 | { HermiteFilter, BoxFilter }, /* Hermite interpolation filter */ |
| 494 | { SincFilter, HanningFilter }, /* Hanning -- Cosine-Sinc */ |
| 495 | { SincFilter, HammingFilter }, /* Hamming -- '' variation */ |
| 496 | { SincFilter, BlackmanFilter }, /* Blackman -- 2*Cosine-Sinc */ |
| 497 | { GaussianFilter, BoxFilter }, /* Gaussain Blurring filter */ |
| 498 | { QuadraticFilter, BoxFilter }, /* Quadratic Gaussian approximation */ |
| 499 | { CubicFilter, BoxFilter }, /* Cubic Gaussian approximation */ |
| 500 | { CatromFilter, BoxFilter }, /* Cubic Interpolator */ |
| 501 | { MitchellFilter, BoxFilter }, /* 'ideal' Cubic Filter */ |
| 502 | { LanczosFilter, SincFilter }, /* Special, 3 lobed Sinc-Sinc */ |
| 503 | { BesselFilter, BlackmanFilter }, /* 3 lobed bessel -specific request */ |
| 504 | { SincFilter, BlackmanFilter }, /* 4 lobed sinc - specific request */ |
| 505 | { SincFilter, KaiserFilter }, /* Kaiser -- SqRoot-Sinc */ |
| 506 | { SincFilter, WelshFilter }, /* Welsh -- Parabolic-Sinc */ |
| 507 | { SincFilter, CubicFilter }, /* Parzen -- Cubic-Sinc */ |
| 508 | { LagrangeFilter, BoxFilter }, /* Lagrange self-windowing filter */ |
| 509 | { SincFilter, BohmanFilter }, /* Bohman -- 2*Cosine-Sinc */ |
| 510 | { SincFilter, TriangleFilter } /* Bartlett -- Triangle-Sinc */ |
| 511 | }; |
| 512 | /* |
| 513 | Table maping the filter/window function from the above table to the actual |
| 514 | filter/window function call to use. The default support size for that |
| 515 | filter as a weighting function, and the point to scale when that function |
| 516 | is used as a windowing function (typ 1.0). |
| 517 | */ |
| 518 | static struct |
| 519 | { |
| 520 | MagickRealType |
| 521 | (*function)(const MagickRealType, const ResizeFilter*), |
| 522 | support, /* default support size for function as a filter */ |
| 523 | scale, /* size windowing function, for scaling windowing function */ |
| 524 | B, |
| 525 | C; /* Cubic Filter factors for a CubicBC function, else ignored */ |
| 526 | } const filters[SentinelFilter] = |
| 527 | { |
| 528 | { Box, 0.0f, 0.5f, 0.0f, 0.0f }, /* Undefined */ |
| 529 | { Box, 0.0f, 0.5f, 0.0f, 0.0f }, /* Point */ |
| 530 | { Box, 0.5f, 0.5f, 0.0f, 0.0f }, /* Box */ |
| 531 | { Triangle, 1.0f, 1.0f, 0.0f, 0.0f }, /* Triangle */ |
| 532 | { CubicBC, 1.0f, 1.0f, 0.0f, 0.0f }, /* Hermite, Cubic B=C=0 */ |
| 533 | { Hanning, 1.0f, 1.0f, 0.0f, 0.0f }, /* Hanning, Cosine window */ |
| 534 | { Hamming, 1.0f, 1.0f, 0.0f, 0.0f }, /* Hamming, '' variation */ |
| 535 | { Blackman, 1.0f, 1.0f, 0.0f, 0.0f }, /* Blackman, 2*cos window */ |
| 536 | { Gaussian, 1.5f, 1.5f, 0.0f, 0.0f }, /* Gaussian */ |
| 537 | { Quadratic, 1.5f, 1.5f, 0.0f, 0.0f }, /* Quadratic Gaussian */ |
| 538 | { CubicBC, 2.0f, 2.0f, 1.0f, 0.0f }, /* B-Spline of Gaussian B=1 C=0 */ |
| 539 | { CubicBC, 2.0f, 1.0f, 0.0f, 0.5f }, /* Catmull-Rom B=0 C=1/2 */ |
| 540 | { CubicBC, 2.0f, 1.0f, 1.0f/3.0f, 1.0f/3.0f }, /* Mitchel B=C=1/3 */ |
| 541 | { Sinc, 3.0f, 1.0f, 0.0f, 0.0f }, /* Lanczos, 3 lobed Sinc-Sinc */ |
| 542 | { Bessel, 3.2383f,1.2197f,.0f,.0f }, /* 3 lobed Blackman-Bessel */ |
| 543 | { Sinc, 4.0f, 1.0f, 0.0f, 0.0f }, /* 4 lobed Blackman-Sinc */ |
| 544 | { Kaiser, 1.0f, 1.0f, 0.0f, 0.0f }, /* Kaiser, sq-root windowing */ |
| 545 | { Welsh, 1.0f, 1.0f, 0.0f, 0.0f }, /* Welsh, Parabolic windowing */ |
| 546 | { CubicBC, 2.0f, 2.0f, 1.0f, 0.0f }, /* Parzen, B-Spline windowing */ |
| 547 | { Lagrange, 2.0f, 1.0f, 0.0f, 0.0f }, /* Lagrangian Filter */ |
| 548 | { Bohman, 1.0f, 1.0f, 0.0f, 0.0f }, /* Bohman, 2*Cosine windowing */ |
| 549 | { Triangle, 1.0f, 1.0f, 0.0f, 0.0f } /* Bartlett, Triangle windowing */ |
| 550 | }; |
| 551 | /* |
| 552 | The known zero crossings of the Bessel() or the Jinc(x*PI) function |
| 553 | Found by using |
| 554 | http://cose.math.bas.bg/webMathematica/webComputing/BesselZeros.jsp |
| 555 | for Jv-function with v=1, then dividing X-roots by PI (tabled below) |
| 556 | */ |
| 557 | static MagickRealType |
| 558 | bessel_zeros[16] = |
| 559 | { |
| 560 | 1.21966989126651f, |
| 561 | 2.23313059438153f, |
| 562 | 3.23831548416624f, |
| 563 | 4.24106286379607f, |
| 564 | 5.24276437687019f, |
| 565 | 6.24392168986449f, |
| 566 | 7.24475986871996f, |
| 567 | 8.24539491395205f, |
| 568 | 9.24589268494948f, |
| 569 | 10.2462933487549f, |
| 570 | 11.2466227948779f, |
| 571 | 12.2468984611381f, |
| 572 | 13.2471325221811f, |
| 573 | 14.2473337358069f, |
| 574 | 15.2475085630373f, |
| 575 | 16.247661874701f |
| 576 | }; |
| 577 | |
| 578 | assert(image != (const Image *) NULL); |
| 579 | assert(image->signature == MagickSignature); |
| 580 | if (image->debug != MagickFalse) |
| 581 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 582 | assert(UndefinedFilter < filter && filter < SentinelFilter); |
| 583 | assert(exception != (ExceptionInfo *) NULL); |
| 584 | assert(exception->signature == MagickSignature); |
| 585 | |
| 586 | resize_filter=(ResizeFilter *) AcquireMagickMemory(sizeof(*resize_filter)); |
| 587 | if (resize_filter == (ResizeFilter *) NULL) |
| 588 | ThrowFatalException(ResourceLimitFatalError,"MemoryAllocationFailed"); |
| 589 | |
| 590 | /* defaults for the requested filter */ |
| 591 | filter_type = mapping[filter].filter; |
| 592 | window_type = mapping[filter].window; |
| 593 | |
| 594 | |
| 595 | /* Filter blur -- scaling both filter and support window */ |
| 596 | resize_filter->blur = blur; |
| 597 | artifact=GetImageArtifact(image,"filter:blur"); |
| 598 | if (artifact != (const char *) NULL) |
| 599 | resize_filter->blur = atof(artifact); |
| 600 | if ( resize_filter->blur < MagickEpsilon ) |
| 601 | resize_filter->blur = (MagickRealType) MagickEpsilon; |
| 602 | |
| 603 | /* Modifications for Cylindrical filter use */ |
| 604 | if ( cylindrical != MagickFalse && filter != SincFilter ) { |
| 605 | /* promote 1D Sinc Filter to a 2D Bessel filter */ |
| 606 | if ( filter_type == SincFilter ) |
| 607 | filter_type = BesselFilter; |
| 608 | /* Prompote Lanczos (Sinc-Sinc) to Lanczos (Bessel-Bessel) */ |
| 609 | else if ( filter_type == LanczosFilter ) { |
| 610 | filter_type = BesselFilter; |
| 611 | window_type = BesselFilter; |
| 612 | } |
| 613 | /* Blur other filters appropriatally correct cylindrical usage */ |
| 614 | else if ( filter_type == GaussianFilter ) |
| 615 | /* Gaussian is scaled by 4*ln(2) and not 4*sqrt(2/MagickPI) |
| 616 | - according to Paul Heckbert's paper on EWA resampling */ |
| 617 | resize_filter->blur *= 2.0*log(2.0)/sqrt(2.0/MagickPI); |
| 618 | else if ( filter_type != BesselFilter ) |
| 619 | /* filters with a 1.0 zero root crossing by the first bessel_zero */ |
| 620 | resize_filter->blur *= bessel_zeros[0]; |
| 621 | } |
| 622 | |
| 623 | /* Override Filter Selection */ |
| 624 | artifact=GetImageArtifact(image,"filter:filter"); |
| 625 | if (artifact != (const char *) NULL) { |
| 626 | /* raw filter request - no window function */ |
| 627 | filter_artifact=ParseMagickOption(MagickFilterOptions, |
| 628 | MagickFalse,artifact); |
| 629 | if ( UndefinedFilter < filter_artifact && |
| 630 | filter_artifact < SentinelFilter ) { |
| 631 | filter_type = (FilterTypes) filter_artifact; |
| 632 | window_type = BoxFilter; |
| 633 | } |
| 634 | /* Lanczos is nor a real filter but a self windowing Sinc/Bessel */ |
| 635 | if ( filter_artifact == LanczosFilter ) { |
| 636 | filter_type = (cylindrical!=MagickFalse) ? BesselFilter : LanczosFilter; |
| 637 | window_type = (cylindrical!=MagickFalse) ? BesselFilter : SincFilter; |
| 638 | } |
| 639 | /* Filter overwide with a specific window function? */ |
| 640 | artifact=GetImageArtifact(image,"filter:window"); |
| 641 | if (artifact != (const char *) NULL) { |
| 642 | filter_artifact=ParseMagickOption(MagickFilterOptions, |
| 643 | MagickFalse,artifact); |
| 644 | if ( UndefinedFilter < filter_artifact && |
| 645 | filter_artifact < SentinelFilter ) { |
| 646 | if ( filter_artifact != LanczosFilter ) |
| 647 | window_type = (FilterTypes) filter_artifact; |
| 648 | else |
| 649 | window_type = (cylindrical!=MagickFalse) ? BesselFilter : SincFilter; |
| 650 | } |
| 651 | } |
| 652 | } |
| 653 | else { |
| 654 | /* window specified, but no filter function? Assume Sinc/Bessel */ |
| 655 | artifact=GetImageArtifact(image,"filter:window"); |
| 656 | if (artifact != (const char *) NULL) { |
| 657 | filter_artifact=ParseMagickOption(MagickFilterOptions,MagickFalse, |
| 658 | artifact); |
| 659 | if ( UndefinedFilter < filter_artifact && |
| 660 | filter_artifact < SentinelFilter ) { |
| 661 | filter_type = (cylindrical!=MagickFalse) ? BesselFilter : SincFilter; |
| 662 | if ( filter_artifact != LanczosFilter ) |
| 663 | window_type = (FilterTypes) filter_artifact; |
| 664 | else |
| 665 | window_type = filter_type; |
| 666 | } |
| 667 | } |
| 668 | } |
| 669 | |
| 670 | resize_filter->filter = filters[filter_type].function; |
| 671 | resize_filter->support = filters[filter_type].support; |
| 672 | resize_filter->window = filters[window_type].function; |
| 673 | resize_filter->scale = filters[window_type].scale; |
| 674 | resize_filter->signature=MagickSignature; |
| 675 | |
| 676 | /* Filter support overrides */ |
| 677 | artifact=GetImageArtifact(image,"filter:lobes"); |
| 678 | if (artifact != (const char *) NULL) { |
| 679 | long lobes = atol(artifact); |
| 680 | if ( lobes < 1 ) lobes = 1; |
| 681 | resize_filter->support = (MagickRealType) lobes; |
| 682 | if ( filter_type == BesselFilter ) { |
| 683 | if ( lobes > 16 ) lobes = 16; |
| 684 | resize_filter->support = bessel_zeros[lobes-1]; |
| 685 | } |
| 686 | } |
| 687 | artifact=GetImageArtifact(image,"filter:support"); |
| 688 | if (artifact != (const char *) NULL) |
| 689 | resize_filter->support = fabs(atof(artifact)); |
| 690 | |
| 691 | /* Scale windowing function separatally to the support 'clipping' window |
| 692 | that calling operator is planning to actually use. - Expert Use Only |
| 693 | */ |
| 694 | resize_filter->window_support = resize_filter->support; |
| 695 | artifact=GetImageArtifact(image,"filter:win-support"); |
| 696 | if (artifact != (const char *) NULL) |
| 697 | resize_filter->window_support = fabs(atof(artifact)); |
| 698 | |
| 699 | /* Set Cubic Spline B,C values, calculate Cubic coefficents */ |
| 700 | B=0.0; |
| 701 | C=0.0; |
| 702 | if ( filters[filter_type].function == CubicBC |
| 703 | || filters[window_type].function == CubicBC ) { |
| 704 | if ( filters[filter_type].function == CubicBC ) { |
| 705 | B=filters[filter_type].B; |
| 706 | C=filters[filter_type].C; |
| 707 | } |
| 708 | else if ( filters[window_type].function == CubicBC ) { |
| 709 | B=filters[window_type].B; |
| 710 | C=filters[window_type].C; |
| 711 | } |
| 712 | artifact=GetImageArtifact(image,"filter:b"); |
| 713 | if (artifact != (const char *) NULL) { |
| 714 | B=atof(artifact); |
| 715 | C=(1.0-B)/2.0; /* Calculate C as if it is a Keys cubic filter */ |
| 716 | artifact=GetImageArtifact(image,"filter:c"); |
| 717 | if (artifact != (const char *) NULL) |
| 718 | C=atof(artifact); |
| 719 | } |
| 720 | else { |
| 721 | artifact=GetImageArtifact(image,"filter:c"); |
| 722 | if (artifact != (const char *) NULL) { |
| 723 | C=atof(artifact); |
| 724 | B=1.0-2.0*C; /* Calculate B as if it is a Keys cubic filter */ |
| 725 | } |
| 726 | } |
| 727 | /* Convert B,C values into Cubic Coefficents - See CubicBC() */ |
| 728 | resize_filter->cubic[0]=( 6.0 -2.0*B )/6.0; |
| 729 | resize_filter->cubic[1]=0.0; |
| 730 | resize_filter->cubic[2]=(-18.0+12.0*B+ 6.0*C)/6.0; |
| 731 | resize_filter->cubic[3]=( 12.0- 9.0*B- 6.0*C)/6.0; |
| 732 | resize_filter->cubic[4]=( 8.0*B+24.0*C)/6.0; |
| 733 | resize_filter->cubic[5]=( -12.0*B-48.0*C)/6.0; |
| 734 | resize_filter->cubic[6]=( 6.0*B+30.0*C)/6.0; |
| 735 | resize_filter->cubic[7]=( - 1.0*B- 6.0*C)/6.0; |
| 736 | } |
| 737 | artifact=GetImageArtifact(image,"filter:verbose"); |
| 738 | if (artifact != (const char *) NULL) |
| 739 | { |
| 740 | double |
| 741 | support, |
| 742 | x; |
| 743 | |
| 744 | /* |
| 745 | Output filter graph -- for graphing filter result. |
| 746 | */ |
| 747 | support=GetResizeFilterSupport(resize_filter); |
| 748 | (void) printf("# support = %lg\n",support); |
| 749 | for (x=0.0; x <= support; x+=0.01f) |
| 750 | (void) printf("%5.2lf\t%lf\n",x,GetResizeFilterWeight(resize_filter,x)); |
| 751 | (void) printf("%5.2lf\t%lf\n",support,0.0); |
| 752 | } |
| 753 | return(resize_filter); |
| 754 | } |
| 755 | |
| 756 | /* |
| 757 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 758 | % % |
| 759 | % % |
| 760 | % % |
| 761 | % A d a p t i v e R e s i z e I m a g e % |
| 762 | % % |
| 763 | % % |
| 764 | % % |
| 765 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 766 | % |
| 767 | % AdaptiveResizeImage() adaptively resize image with pixel resampling. |
| 768 | % |
| 769 | % The format of the AdaptiveResizeImage method is: |
| 770 | % |
| 771 | % Image *AdaptiveResizeImage(const Image *image, |
| 772 | % const unsigned long columns,const unsigned long rows, |
| 773 | % ExceptionInfo *exception) |
| 774 | % |
| 775 | % A description of each parameter follows: |
| 776 | % |
| 777 | % o image: the image. |
| 778 | % |
| 779 | % o columns: the number of columns in the resized image. |
| 780 | % |
| 781 | % o rows: the number of rows in the resized image. |
| 782 | % |
| 783 | % o exception: return any errors or warnings in this structure. |
| 784 | % |
| 785 | */ |
| 786 | MagickExport Image *AdaptiveResizeImage(const Image *image, |
| 787 | const unsigned long columns,const unsigned long rows,ExceptionInfo *exception) |
| 788 | { |
| 789 | #define AdaptiveResizeImageTag "Resize/Image" |
| 790 | |
| 791 | Image |
| 792 | *resize_image; |
| 793 | |
| 794 | long |
| 795 | y; |
| 796 | |
| 797 | MagickBooleanType |
| 798 | proceed; |
| 799 | |
| 800 | MagickPixelPacket |
| 801 | pixel; |
| 802 | |
| 803 | PointInfo |
| 804 | offset; |
| 805 | |
| 806 | ResampleFilter |
| 807 | *resample_filter; |
| 808 | |
| 809 | CacheView |
| 810 | *resize_view; |
| 811 | |
| 812 | /* |
| 813 | Adaptively resize image. |
| 814 | */ |
| 815 | assert(image != (const Image *) NULL); |
| 816 | assert(image->signature == MagickSignature); |
| 817 | if (image->debug != MagickFalse) |
| 818 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 819 | assert(exception != (ExceptionInfo *) NULL); |
| 820 | assert(exception->signature == MagickSignature); |
| 821 | if ((columns == 0) || (rows == 0)) |
| 822 | return((Image *) NULL); |
| 823 | if ((columns == image->columns) && (rows == image->rows)) |
| 824 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 825 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 826 | if (resize_image == (Image *) NULL) |
| 827 | return((Image *) NULL); |
| 828 | if (SetImageStorageClass(resize_image,DirectClass) == MagickFalse) |
| 829 | { |
| 830 | InheritException(exception,&resize_image->exception); |
| 831 | resize_image=DestroyImage(resize_image); |
| 832 | return((Image *) NULL); |
| 833 | } |
| 834 | GetMagickPixelPacket(image,&pixel); |
| 835 | resample_filter=AcquireResampleFilter(image,exception); |
| 836 | if (image->interpolate == UndefinedInterpolatePixel) |
| 837 | (void) SetResampleFilterInterpolateMethod(resample_filter, |
| 838 | MeshInterpolatePixel); |
| 839 | resize_view=AcquireCacheView(resize_image); |
| 840 | for (y=0; y < (long) resize_image->rows; y++) |
| 841 | { |
| 842 | register IndexPacket |
| 843 | *__restrict resize_indexes; |
| 844 | |
| 845 | register long |
| 846 | x; |
| 847 | |
| 848 | register PixelPacket |
| 849 | *__restrict q; |
| 850 | |
| 851 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| 852 | exception); |
| 853 | if (q == (PixelPacket *) NULL) |
| 854 | break; |
| 855 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
| 856 | offset.y=((MagickRealType) y*image->rows/resize_image->rows); |
| 857 | for (x=0; x < (long) resize_image->columns; x++) |
| 858 | { |
| 859 | offset.x=((MagickRealType) x*image->columns/resize_image->columns); |
| 860 | (void) ResamplePixelColor(resample_filter,offset.x-0.5,offset.y-0.5, |
| 861 | &pixel); |
| 862 | SetPixelPacket(resize_image,&pixel,q,resize_indexes+x); |
| 863 | q++; |
| 864 | } |
| 865 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 866 | break; |
| 867 | proceed=SetImageProgress(image,AdaptiveResizeImageTag,y,image->rows); |
| 868 | if (proceed == MagickFalse) |
| 869 | break; |
| 870 | } |
| 871 | resample_filter=DestroyResampleFilter(resample_filter); |
| 872 | resize_view=DestroyCacheView(resize_view); |
| 873 | return(resize_image); |
| 874 | } |
| 875 | |
| 876 | /* |
| 877 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 878 | % % |
| 879 | % % |
| 880 | % % |
| 881 | + B e s s e l O r d e r O n e % |
| 882 | % % |
| 883 | % % |
| 884 | % % |
| 885 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 886 | % |
| 887 | % BesselOrderOne() computes the Bessel function of x of the first kind of |
| 888 | % order 0: |
| 889 | % |
| 890 | % Reduce x to |x| since j1(x)= -j1(-x), and for x in (0,8] |
| 891 | % |
| 892 | % j1(x) = x*j1(x); |
| 893 | % |
| 894 | % For x in (8,inf) |
| 895 | % |
| 896 | % j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) |
| 897 | % |
| 898 | % where x1 = x-3*pi/4. Compute sin(x1) and cos(x1) as follow: |
| 899 | % |
| 900 | % cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) |
| 901 | % = 1/sqrt(2) * (sin(x) - cos(x)) |
| 902 | % sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) |
| 903 | % = -1/sqrt(2) * (sin(x) + cos(x)) |
| 904 | % |
| 905 | % The format of the BesselOrderOne method is: |
| 906 | % |
| 907 | % MagickRealType BesselOrderOne(MagickRealType x) |
| 908 | % |
| 909 | % A description of each parameter follows: |
| 910 | % |
| 911 | % o x: MagickRealType value. |
| 912 | % |
| 913 | */ |
| 914 | |
| 915 | #undef I0 |
| 916 | static MagickRealType I0(MagickRealType x) |
| 917 | { |
| 918 | MagickRealType |
| 919 | sum, |
| 920 | t, |
| 921 | y; |
| 922 | |
| 923 | register long |
| 924 | i; |
| 925 | |
| 926 | /* |
| 927 | Zeroth order Bessel function of the first kind. |
| 928 | */ |
| 929 | sum=1.0; |
| 930 | y=x*x/4.0; |
| 931 | t=y; |
| 932 | for (i=2; t > MagickEpsilon; i++) |
| 933 | { |
| 934 | sum+=t; |
| 935 | t*=y/((MagickRealType) i*i); |
| 936 | } |
| 937 | return(sum); |
| 938 | } |
| 939 | |
| 940 | #undef J1 |
| 941 | static MagickRealType J1(MagickRealType x) |
| 942 | { |
| 943 | MagickRealType |
| 944 | p, |
| 945 | q; |
| 946 | |
| 947 | register long |
| 948 | i; |
| 949 | |
| 950 | static const double |
| 951 | Pone[] = |
| 952 | { |
| 953 | 0.581199354001606143928050809e+21, |
| 954 | -0.6672106568924916298020941484e+20, |
| 955 | 0.2316433580634002297931815435e+19, |
| 956 | -0.3588817569910106050743641413e+17, |
| 957 | 0.2908795263834775409737601689e+15, |
| 958 | -0.1322983480332126453125473247e+13, |
| 959 | 0.3413234182301700539091292655e+10, |
| 960 | -0.4695753530642995859767162166e+7, |
| 961 | 0.270112271089232341485679099e+4 |
| 962 | }, |
| 963 | Qone[] = |
| 964 | { |
| 965 | 0.11623987080032122878585294e+22, |
| 966 | 0.1185770712190320999837113348e+20, |
| 967 | 0.6092061398917521746105196863e+17, |
| 968 | 0.2081661221307607351240184229e+15, |
| 969 | 0.5243710262167649715406728642e+12, |
| 970 | 0.1013863514358673989967045588e+10, |
| 971 | 0.1501793594998585505921097578e+7, |
| 972 | 0.1606931573481487801970916749e+4, |
| 973 | 0.1e+1 |
| 974 | }; |
| 975 | |
| 976 | p=Pone[8]; |
| 977 | q=Qone[8]; |
| 978 | for (i=7; i >= 0; i--) |
| 979 | { |
| 980 | p=p*x*x+Pone[i]; |
| 981 | q=q*x*x+Qone[i]; |
| 982 | } |
| 983 | return(p/q); |
| 984 | } |
| 985 | |
| 986 | #undef P1 |
| 987 | static MagickRealType P1(MagickRealType x) |
| 988 | { |
| 989 | MagickRealType |
| 990 | p, |
| 991 | q; |
| 992 | |
| 993 | register long |
| 994 | i; |
| 995 | |
| 996 | static const double |
| 997 | Pone[] = |
| 998 | { |
| 999 | 0.352246649133679798341724373e+5, |
| 1000 | 0.62758845247161281269005675e+5, |
| 1001 | 0.313539631109159574238669888e+5, |
| 1002 | 0.49854832060594338434500455e+4, |
| 1003 | 0.2111529182853962382105718e+3, |
| 1004 | 0.12571716929145341558495e+1 |
| 1005 | }, |
| 1006 | Qone[] = |
| 1007 | { |
| 1008 | 0.352246649133679798068390431e+5, |
| 1009 | 0.626943469593560511888833731e+5, |
| 1010 | 0.312404063819041039923015703e+5, |
| 1011 | 0.4930396490181088979386097e+4, |
| 1012 | 0.2030775189134759322293574e+3, |
| 1013 | 0.1e+1 |
| 1014 | }; |
| 1015 | |
| 1016 | p=Pone[5]; |
| 1017 | q=Qone[5]; |
| 1018 | for (i=4; i >= 0; i--) |
| 1019 | { |
| 1020 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| 1021 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| 1022 | } |
| 1023 | return(p/q); |
| 1024 | } |
| 1025 | |
| 1026 | #undef Q1 |
| 1027 | static MagickRealType Q1(MagickRealType x) |
| 1028 | { |
| 1029 | MagickRealType |
| 1030 | p, |
| 1031 | q; |
| 1032 | |
| 1033 | register long |
| 1034 | i; |
| 1035 | |
| 1036 | static const double |
| 1037 | Pone[] = |
| 1038 | { |
| 1039 | 0.3511751914303552822533318e+3, |
| 1040 | 0.7210391804904475039280863e+3, |
| 1041 | 0.4259873011654442389886993e+3, |
| 1042 | 0.831898957673850827325226e+2, |
| 1043 | 0.45681716295512267064405e+1, |
| 1044 | 0.3532840052740123642735e-1 |
| 1045 | }, |
| 1046 | Qone[] = |
| 1047 | { |
| 1048 | 0.74917374171809127714519505e+4, |
| 1049 | 0.154141773392650970499848051e+5, |
| 1050 | 0.91522317015169922705904727e+4, |
| 1051 | 0.18111867005523513506724158e+4, |
| 1052 | 0.1038187585462133728776636e+3, |
| 1053 | 0.1e+1 |
| 1054 | }; |
| 1055 | |
| 1056 | p=Pone[5]; |
| 1057 | q=Qone[5]; |
| 1058 | for (i=4; i >= 0; i--) |
| 1059 | { |
| 1060 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| 1061 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| 1062 | } |
| 1063 | return(p/q); |
| 1064 | } |
| 1065 | |
| 1066 | static MagickRealType BesselOrderOne(MagickRealType x) |
| 1067 | { |
| 1068 | MagickRealType |
| 1069 | p, |
| 1070 | q; |
| 1071 | |
| 1072 | if (x == 0.0) |
| 1073 | return(0.0); |
| 1074 | p=x; |
| 1075 | if (x < 0.0) |
| 1076 | x=(-x); |
| 1077 | if (x < 8.0) |
| 1078 | return(p*J1(x)); |
| 1079 | q=sqrt((double) (2.0/(MagickPI*x)))*(P1(x)*(1.0/sqrt(2.0)*(sin((double) x)- |
| 1080 | cos((double) x)))-8.0/x*Q1(x)*(-1.0/sqrt(2.0)*(sin((double) x)+ |
| 1081 | cos((double) x)))); |
| 1082 | if (p < 0.0) |
| 1083 | q=(-q); |
| 1084 | return(q); |
| 1085 | } |
| 1086 | |
| 1087 | /* |
| 1088 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1089 | % % |
| 1090 | % % |
| 1091 | % % |
| 1092 | + D e s t r o y R e s i z e F i l t e r % |
| 1093 | % % |
| 1094 | % % |
| 1095 | % % |
| 1096 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1097 | % |
| 1098 | % DestroyResizeFilter() destroy the resize filter. |
| 1099 | % |
| 1100 | % The format of the AcquireResizeFilter method is: |
| 1101 | % |
| 1102 | % ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| 1103 | % |
| 1104 | % A description of each parameter follows: |
| 1105 | % |
| 1106 | % o resize_filter: the resize filter. |
| 1107 | % |
| 1108 | */ |
| 1109 | MagickExport ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| 1110 | { |
| 1111 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1112 | assert(resize_filter->signature == MagickSignature); |
| 1113 | resize_filter->signature=(~MagickSignature); |
| 1114 | resize_filter=(ResizeFilter *) RelinquishMagickMemory(resize_filter); |
| 1115 | return(resize_filter); |
| 1116 | } |
| 1117 | |
| 1118 | /* |
| 1119 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1120 | % % |
| 1121 | % % |
| 1122 | % % |
| 1123 | + G e t R e s i z e F i l t e r S u p p o r t % |
| 1124 | % % |
| 1125 | % % |
| 1126 | % % |
| 1127 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1128 | % |
| 1129 | % GetResizeFilterSupport() return the current support window size for this |
| 1130 | % filter. Note that this may have been enlarged by filter:blur factor. |
| 1131 | % |
| 1132 | % The format of the GetResizeFilterSupport method is: |
| 1133 | % |
| 1134 | % MagickRealType GetResizeFilterSupport(const ResizeFilter *resize_filter) |
| 1135 | % |
| 1136 | % A description of each parameter follows: |
| 1137 | % |
| 1138 | % o filter: Image filter to use. |
| 1139 | % |
| 1140 | */ |
| 1141 | MagickExport MagickRealType GetResizeFilterSupport( |
| 1142 | const ResizeFilter *resize_filter) |
| 1143 | { |
| 1144 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1145 | assert(resize_filter->signature == MagickSignature); |
| 1146 | return(resize_filter->support*resize_filter->blur); |
| 1147 | } |
| 1148 | |
| 1149 | /* |
| 1150 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1151 | % % |
| 1152 | % % |
| 1153 | % % |
| 1154 | + G e t R e s i z e F i l t e r W e i g h t % |
| 1155 | % % |
| 1156 | % % |
| 1157 | % % |
| 1158 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1159 | % |
| 1160 | % GetResizeFilterWeight evaluates the specified resize filter at the point x |
| 1161 | % which usally lies between zero and the filters current 'support' and |
| 1162 | % returns the weight of the filter function at that point. |
| 1163 | % |
| 1164 | % The format of the GetResizeFilterWeight method is: |
| 1165 | % |
| 1166 | % MagickRealType GetResizeFilterWeight(const ResizeFilter *resize_filter, |
| 1167 | % const MagickRealType x) |
| 1168 | % |
| 1169 | % A description of each parameter follows: |
| 1170 | % |
| 1171 | % o filter: the filter type. |
| 1172 | % |
| 1173 | % o x: the point. |
| 1174 | % |
| 1175 | */ |
| 1176 | MagickExport MagickRealType GetResizeFilterWeight( |
| 1177 | const ResizeFilter *resize_filter,const MagickRealType x) |
| 1178 | { |
| 1179 | MagickRealType |
| 1180 | blur, |
| 1181 | scale; |
| 1182 | |
| 1183 | /* |
| 1184 | Windowing function - scale the weighting filter by this amount. |
| 1185 | */ |
| 1186 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1187 | assert(resize_filter->signature == MagickSignature); |
| 1188 | blur=fabs(x)/resize_filter->blur; /* X offset with blur scaling */ |
| 1189 | if ((resize_filter->window_support < MagickEpsilon) || |
| 1190 | (resize_filter->window == Box)) |
| 1191 | scale=1.0; /* Point/Box Filter -- avoid division by zero */ |
| 1192 | else |
| 1193 | { |
| 1194 | scale=resize_filter->scale/resize_filter->window_support; |
| 1195 | scale=resize_filter->window(blur*scale,resize_filter); |
| 1196 | } |
| 1197 | return(scale*resize_filter->filter(blur,resize_filter)); |
| 1198 | } |
| 1199 | |
| 1200 | /* |
| 1201 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1202 | % % |
| 1203 | % % |
| 1204 | % % |
| 1205 | % M a g n i f y I m a g e % |
| 1206 | % % |
| 1207 | % % |
| 1208 | % % |
| 1209 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1210 | % |
| 1211 | % MagnifyImage() is a convenience method that scales an image proportionally |
| 1212 | % to twice its size. |
| 1213 | % |
| 1214 | % The format of the MagnifyImage method is: |
| 1215 | % |
| 1216 | % Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| 1217 | % |
| 1218 | % A description of each parameter follows: |
| 1219 | % |
| 1220 | % o image: the image. |
| 1221 | % |
| 1222 | % o exception: return any errors or warnings in this structure. |
| 1223 | % |
| 1224 | */ |
| 1225 | MagickExport Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| 1226 | { |
| 1227 | Image |
| 1228 | *magnify_image; |
| 1229 | |
| 1230 | assert(image != (Image *) NULL); |
| 1231 | assert(image->signature == MagickSignature); |
| 1232 | if (image->debug != MagickFalse) |
| 1233 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1234 | assert(exception != (ExceptionInfo *) NULL); |
| 1235 | assert(exception->signature == MagickSignature); |
| 1236 | magnify_image=ResizeImage(image,2*image->columns,2*image->rows,CubicFilter, |
| 1237 | 1.0,exception); |
| 1238 | return(magnify_image); |
| 1239 | } |
| 1240 | |
| 1241 | /* |
| 1242 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1243 | % % |
| 1244 | % % |
| 1245 | % % |
| 1246 | % M i n i f y I m a g e % |
| 1247 | % % |
| 1248 | % % |
| 1249 | % % |
| 1250 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1251 | % |
| 1252 | % MinifyImage() is a convenience method that scales an image proportionally |
| 1253 | % to half its size. |
| 1254 | % |
| 1255 | % The format of the MinifyImage method is: |
| 1256 | % |
| 1257 | % Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| 1258 | % |
| 1259 | % A description of each parameter follows: |
| 1260 | % |
| 1261 | % o image: the image. |
| 1262 | % |
| 1263 | % o exception: return any errors or warnings in this structure. |
| 1264 | % |
| 1265 | */ |
| 1266 | MagickExport Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| 1267 | { |
| 1268 | Image |
| 1269 | *minify_image; |
| 1270 | |
| 1271 | assert(image != (Image *) NULL); |
| 1272 | assert(image->signature == MagickSignature); |
| 1273 | if (image->debug != MagickFalse) |
| 1274 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1275 | assert(exception != (ExceptionInfo *) NULL); |
| 1276 | assert(exception->signature == MagickSignature); |
| 1277 | minify_image=ResizeImage(image,image->columns/2,image->rows/2,CubicFilter, |
| 1278 | 1.0,exception); |
| 1279 | return(minify_image); |
| 1280 | } |
| 1281 | |
| 1282 | /* |
| 1283 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1284 | % % |
| 1285 | % % |
| 1286 | % % |
| 1287 | % R e s a m p l e I m a g e % |
| 1288 | % % |
| 1289 | % % |
| 1290 | % % |
| 1291 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1292 | % |
| 1293 | % ResampleImage() resize image in terms of its pixel size, so that when |
| 1294 | % displayed at the given resolution it will be the same size in terms of |
| 1295 | % real world units as the original image at the original resolution. |
| 1296 | % |
| 1297 | % The format of the ResampleImage method is: |
| 1298 | % |
| 1299 | % Image *ResampleImage(Image *image,const double x_resolution, |
| 1300 | % const double y_resolution,const FilterTypes filter,const double blur, |
| 1301 | % ExceptionInfo *exception) |
| 1302 | % |
| 1303 | % A description of each parameter follows: |
| 1304 | % |
| 1305 | % o image: the image to be resized to fit the given resolution. |
| 1306 | % |
| 1307 | % o x_resolution: the new image x resolution. |
| 1308 | % |
| 1309 | % o y_resolution: the new image y resolution. |
| 1310 | % |
| 1311 | % o filter: Image filter to use. |
| 1312 | % |
| 1313 | % o blur: the blur factor where > 1 is blurry, < 1 is sharp. |
| 1314 | % |
| 1315 | */ |
| 1316 | MagickExport Image *ResampleImage(const Image *image,const double x_resolution, |
| 1317 | const double y_resolution,const FilterTypes filter,const double blur, |
| 1318 | ExceptionInfo *exception) |
| 1319 | { |
| 1320 | #define ResampleImageTag "Resample/Image" |
| 1321 | |
| 1322 | Image |
| 1323 | *resample_image; |
| 1324 | |
| 1325 | unsigned long |
| 1326 | height, |
| 1327 | width; |
| 1328 | |
| 1329 | /* |
| 1330 | Initialize sampled image attributes. |
| 1331 | */ |
| 1332 | assert(image != (const Image *) NULL); |
| 1333 | assert(image->signature == MagickSignature); |
| 1334 | if (image->debug != MagickFalse) |
| 1335 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1336 | assert(exception != (ExceptionInfo *) NULL); |
| 1337 | assert(exception->signature == MagickSignature); |
| 1338 | width=(unsigned long) (x_resolution*image->columns/ |
| 1339 | (image->x_resolution == 0.0 ? 72.0 : image->x_resolution)+0.5); |
| 1340 | height=(unsigned long) (y_resolution*image->rows/ |
| 1341 | (image->y_resolution == 0.0 ? 72.0 : image->y_resolution)+0.5); |
| 1342 | resample_image=ResizeImage(image,width,height,filter,blur,exception); |
| 1343 | if (resample_image != (Image *) NULL) |
| 1344 | { |
| 1345 | resample_image->x_resolution=x_resolution; |
| 1346 | resample_image->y_resolution=y_resolution; |
| 1347 | } |
| 1348 | return(resample_image); |
| 1349 | } |
| 1350 | #if defined(MAGICKCORE_LQR_DELEGATE) |
| 1351 | |
| 1352 | /* |
| 1353 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1354 | % % |
| 1355 | % % |
| 1356 | % % |
| 1357 | % L i q u i d R e s c a l e I m a g e % |
| 1358 | % % |
| 1359 | % % |
| 1360 | % % |
| 1361 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1362 | % |
| 1363 | % LiquidRescaleImage() rescales image with seam carving. |
| 1364 | % |
| 1365 | % The format of the LiquidRescaleImage method is: |
| 1366 | % |
| 1367 | % Image *LiquidRescaleImage(const Image *image, |
| 1368 | % const unsigned long columns,const unsigned long rows, |
| 1369 | % const double delta_x,const double rigidity,ExceptionInfo *exception) |
| 1370 | % |
| 1371 | % A description of each parameter follows: |
| 1372 | % |
| 1373 | % o image: the image. |
| 1374 | % |
| 1375 | % o columns: the number of columns in the rescaled image. |
| 1376 | % |
| 1377 | % o rows: the number of rows in the rescaled image. |
| 1378 | % |
| 1379 | % o delta_x: maximum seam transversal step (0 means straight seams). |
| 1380 | % |
| 1381 | % o rigidity: introduce a bias for non-straight seams (typically 0). |
| 1382 | % |
| 1383 | % o exception: return any errors or warnings in this structure. |
| 1384 | % |
| 1385 | */ |
| 1386 | MagickExport Image *LiquidRescaleImage(const Image *image, |
| 1387 | const unsigned long columns,const unsigned long rows, |
| 1388 | const double delta_x,const double rigidity,ExceptionInfo *exception) |
| 1389 | { |
| 1390 | #define LiquidRescaleImageTag "Rescale/Image" |
| 1391 | |
| 1392 | const char |
| 1393 | *map; |
| 1394 | |
| 1395 | guchar |
| 1396 | *packet; |
| 1397 | |
| 1398 | Image |
| 1399 | *rescale_image; |
| 1400 | |
| 1401 | int |
| 1402 | x, |
| 1403 | y; |
| 1404 | |
| 1405 | LqrCarver |
| 1406 | *carver; |
| 1407 | |
| 1408 | LqrRetVal |
| 1409 | lqr_status; |
| 1410 | |
| 1411 | MagickBooleanType |
| 1412 | status; |
| 1413 | |
| 1414 | MagickPixelPacket |
| 1415 | pixel; |
| 1416 | |
| 1417 | unsigned char |
| 1418 | *pixels; |
| 1419 | |
| 1420 | /* |
| 1421 | Liquid rescale image. |
| 1422 | */ |
| 1423 | assert(image != (const Image *) NULL); |
| 1424 | assert(image->signature == MagickSignature); |
| 1425 | if (image->debug != MagickFalse) |
| 1426 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1427 | assert(exception != (ExceptionInfo *) NULL); |
| 1428 | assert(exception->signature == MagickSignature); |
| 1429 | if ((columns == 0) || (rows == 0)) |
| 1430 | return((Image *) NULL); |
| 1431 | if ((columns == image->columns) && (rows == image->rows)) |
| 1432 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 1433 | if ((columns <= 2) || (rows <= 2)) |
| 1434 | return(ZoomImage(image,columns,rows,exception)); |
| 1435 | if ((columns >= (2*image->columns)) || (rows >= (2*image->rows))) |
| 1436 | { |
| 1437 | Image |
| 1438 | *resize_image; |
| 1439 | |
| 1440 | unsigned long |
| 1441 | height, |
| 1442 | width; |
| 1443 | |
| 1444 | /* |
| 1445 | Honor liquid resize size limitations. |
| 1446 | */ |
| 1447 | for (width=image->columns; columns >= (2*width-1); width*=2); |
| 1448 | for (height=image->rows; rows >= (2*height-1); height*=2); |
| 1449 | resize_image=ResizeImage(image,width,height,image->filter,image->blur, |
| 1450 | exception); |
| 1451 | if (resize_image == (Image *) NULL) |
| 1452 | return((Image *) NULL); |
| 1453 | rescale_image=LiquidRescaleImage(resize_image,columns,rows,delta_x, |
| 1454 | rigidity,exception); |
| 1455 | resize_image=DestroyImage(resize_image); |
| 1456 | return(rescale_image); |
| 1457 | } |
| 1458 | map="RGB"; |
| 1459 | if (image->matte == MagickFalse) |
| 1460 | map="RGBA"; |
| 1461 | if (image->colorspace == CMYKColorspace) |
| 1462 | { |
| 1463 | map="CMYK"; |
| 1464 | if (image->matte == MagickFalse) |
| 1465 | map="CMYKA"; |
| 1466 | } |
| 1467 | pixels=(unsigned char *) AcquireQuantumMemory(image->columns,image->rows* |
| 1468 | strlen(map)*sizeof(*pixels)); |
| 1469 | if (pixels == (unsigned char *) NULL) |
| 1470 | return((Image *) NULL); |
| 1471 | status=ExportImagePixels(image,0,0,image->columns,image->rows,map,CharPixel, |
| 1472 | pixels,exception); |
| 1473 | if (status == MagickFalse) |
| 1474 | { |
| 1475 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1476 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 1477 | } |
| 1478 | carver=lqr_carver_new(pixels,image->columns,image->rows,strlen(map)); |
| 1479 | if (carver == (LqrCarver *) NULL) |
| 1480 | { |
| 1481 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1482 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 1483 | } |
| 1484 | lqr_status=lqr_carver_init(carver,(int) delta_x,rigidity); |
| 1485 | lqr_status=lqr_carver_resize(carver,columns,rows); |
| 1486 | rescale_image=CloneImage(image,lqr_carver_get_width(carver), |
| 1487 | lqr_carver_get_height(carver),MagickTrue,exception); |
| 1488 | if (rescale_image == (Image *) NULL) |
| 1489 | { |
| 1490 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1491 | return((Image *) NULL); |
| 1492 | } |
| 1493 | if (SetImageStorageClass(rescale_image,DirectClass) == MagickFalse) |
| 1494 | { |
| 1495 | InheritException(exception,&rescale_image->exception); |
| 1496 | rescale_image=DestroyImage(rescale_image); |
| 1497 | return((Image *) NULL); |
| 1498 | } |
| 1499 | GetMagickPixelPacket(rescale_image,&pixel); |
| 1500 | (void) lqr_carver_scan_reset(carver); |
| 1501 | while (lqr_carver_scan(carver,&x,&y,&packet) != 0) |
| 1502 | { |
| 1503 | register IndexPacket |
| 1504 | *__restrict rescale_indexes; |
| 1505 | |
| 1506 | register PixelPacket |
| 1507 | *__restrict q; |
| 1508 | |
| 1509 | q=QueueAuthenticPixels(rescale_image,x,y,1,1,exception); |
| 1510 | if (q == (PixelPacket *) NULL) |
| 1511 | break; |
| 1512 | rescale_indexes=GetAuthenticIndexQueue(rescale_image); |
| 1513 | pixel.red=QuantumRange*(packet[0]/255.0); |
| 1514 | pixel.green=QuantumRange*(packet[1]/255.0); |
| 1515 | pixel.blue=QuantumRange*(packet[2]/255.0); |
| 1516 | if (image->colorspace != CMYKColorspace) |
| 1517 | { |
| 1518 | if (image->matte == MagickFalse) |
| 1519 | pixel.opacity=QuantumRange*(packet[3]/255.0); |
| 1520 | } |
| 1521 | else |
| 1522 | { |
| 1523 | pixel.index=QuantumRange*(packet[3]/255.0); |
| 1524 | if (image->matte == MagickFalse) |
| 1525 | pixel.opacity=QuantumRange*(packet[4]/255.0); |
| 1526 | } |
| 1527 | SetPixelPacket(rescale_image,&pixel,q,rescale_indexes); |
| 1528 | if (SyncAuthenticPixels(rescale_image,exception) == MagickFalse) |
| 1529 | break; |
| 1530 | } |
| 1531 | /* |
| 1532 | Relinquish resources. |
| 1533 | */ |
| 1534 | lqr_carver_destroy(carver); |
| 1535 | return(rescale_image); |
| 1536 | } |
| 1537 | #else |
| 1538 | MagickExport Image *LiquidRescaleImage(const Image *image, |
| 1539 | const unsigned long magick_unused(columns), |
| 1540 | const unsigned long magick_unused(rows),const double magick_unused(delta_x), |
| 1541 | const double magick_unused(rigidity),ExceptionInfo *exception) |
| 1542 | { |
| 1543 | assert(image != (const Image *) NULL); |
| 1544 | assert(image->signature == MagickSignature); |
| 1545 | if (image->debug != MagickFalse) |
| 1546 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1547 | assert(exception != (ExceptionInfo *) NULL); |
| 1548 | assert(exception->signature == MagickSignature); |
| 1549 | (void) ThrowMagickException(exception,GetMagickModule(),MissingDelegateError, |
| 1550 | "DelegateLibrarySupportNotBuiltIn","`%s' (LQR)",image->filename); |
| 1551 | return((Image *) NULL); |
| 1552 | } |
| 1553 | #endif |
| 1554 | |
| 1555 | /* |
| 1556 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1557 | % % |
| 1558 | % % |
| 1559 | % % |
| 1560 | % R e s i z e I m a g e % |
| 1561 | % % |
| 1562 | % % |
| 1563 | % % |
| 1564 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1565 | % |
| 1566 | % ResizeImage() scales an image to the desired dimensions, using the given |
| 1567 | % filter (see AcquireFilterInfo() ). |
| 1568 | % |
| 1569 | % If an undefined filter is given the filter defaults to Mitchell for a |
| 1570 | % colormapped image, a image with a matte channel, or if the image is |
| 1571 | % enlarged. Otherwise the filter defaults to a Lanczos. |
| 1572 | % |
| 1573 | % ResizeImage() was inspired by Paul Heckbert's "zoom" program. |
| 1574 | % |
| 1575 | % The format of the ResizeImage method is: |
| 1576 | % |
| 1577 | % Image *ResizeImage(Image *image,const unsigned long columns, |
| 1578 | % const unsigned long rows,const FilterTypes filter,const double blur, |
| 1579 | % ExceptionInfo *exception) |
| 1580 | % |
| 1581 | % A description of each parameter follows: |
| 1582 | % |
| 1583 | % o image: the image. |
| 1584 | % |
| 1585 | % o columns: the number of columns in the scaled image. |
| 1586 | % |
| 1587 | % o rows: the number of rows in the scaled image. |
| 1588 | % |
| 1589 | % o filter: Image filter to use. |
| 1590 | % |
| 1591 | % o blur: the blur factor where > 1 is blurry, < 1 is sharp. |
| 1592 | % Typically set this to 1.0. |
| 1593 | % |
| 1594 | % o exception: return any errors or warnings in this structure. |
| 1595 | % |
| 1596 | */ |
| 1597 | |
| 1598 | typedef struct _ContributionInfo |
| 1599 | { |
| 1600 | MagickRealType |
| 1601 | weight; |
| 1602 | |
| 1603 | long |
| 1604 | pixel; |
| 1605 | } ContributionInfo; |
| 1606 | |
| 1607 | static ContributionInfo **DestroyContributionThreadSet( |
| 1608 | ContributionInfo **contribution) |
| 1609 | { |
| 1610 | register long |
| 1611 | i; |
| 1612 | |
| 1613 | assert(contribution != (ContributionInfo **) NULL); |
| 1614 | for (i=0; i < (long) GetOpenMPMaximumThreads(); i++) |
| 1615 | if (contribution[i] != (ContributionInfo *) NULL) |
| 1616 | contribution[i]=(ContributionInfo *) RelinquishMagickMemory( |
| 1617 | contribution[i]); |
| 1618 | contribution=(ContributionInfo **) RelinquishAlignedMemory(contribution); |
| 1619 | return(contribution); |
| 1620 | } |
| 1621 | |
| 1622 | static ContributionInfo **AcquireContributionThreadSet(const size_t count) |
| 1623 | { |
| 1624 | register long |
| 1625 | i; |
| 1626 | |
| 1627 | ContributionInfo |
| 1628 | **contribution; |
| 1629 | |
| 1630 | unsigned long |
| 1631 | number_threads; |
| 1632 | |
| 1633 | number_threads=GetOpenMPMaximumThreads(); |
| 1634 | contribution=(ContributionInfo **) AcquireAlignedMemory(number_threads, |
| 1635 | sizeof(*contribution)); |
| 1636 | if (contribution == (ContributionInfo **) NULL) |
| 1637 | return((ContributionInfo **) NULL); |
| 1638 | (void) ResetMagickMemory(contribution,0,number_threads*sizeof(*contribution)); |
| 1639 | for (i=0; i < (long) number_threads; i++) |
| 1640 | { |
| 1641 | contribution[i]=(ContributionInfo *) AcquireQuantumMemory(count, |
| 1642 | sizeof(**contribution)); |
| 1643 | if (contribution[i] == (ContributionInfo *) NULL) |
| 1644 | return(DestroyContributionThreadSet(contribution)); |
| 1645 | } |
| 1646 | return(contribution); |
| 1647 | } |
| 1648 | |
| 1649 | static inline double MagickMax(const double x,const double y) |
| 1650 | { |
| 1651 | if (x > y) |
| 1652 | return(x); |
| 1653 | return(y); |
| 1654 | } |
| 1655 | |
| 1656 | static inline double MagickMin(const double x,const double y) |
| 1657 | { |
| 1658 | if (x < y) |
| 1659 | return(x); |
| 1660 | return(y); |
| 1661 | } |
| 1662 | |
| 1663 | static MagickBooleanType HorizontalFilter(const ResizeFilter *resize_filter, |
| 1664 | const Image *image,Image *resize_image,const MagickRealType x_factor, |
| 1665 | const MagickSizeType span,MagickOffsetType *quantum,ExceptionInfo *exception) |
| 1666 | { |
| 1667 | #define ResizeImageTag "Resize/Image" |
| 1668 | |
| 1669 | ClassType |
| 1670 | storage_class; |
| 1671 | |
| 1672 | ContributionInfo |
| 1673 | **contributions; |
| 1674 | |
| 1675 | long |
| 1676 | x; |
| 1677 | |
| 1678 | MagickBooleanType |
| 1679 | status; |
| 1680 | |
| 1681 | MagickPixelPacket |
| 1682 | zero; |
| 1683 | |
| 1684 | MagickRealType |
| 1685 | scale, |
| 1686 | support; |
| 1687 | |
| 1688 | CacheView |
| 1689 | *image_view, |
| 1690 | *resize_view; |
| 1691 | |
| 1692 | /* |
| 1693 | Apply filter to resize horizontally from image to resize image. |
| 1694 | */ |
| 1695 | scale=MagickMax(1.0/x_factor,1.0); |
| 1696 | support=scale*GetResizeFilterSupport(resize_filter); |
| 1697 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| 1698 | if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| 1699 | { |
| 1700 | InheritException(exception,&resize_image->exception); |
| 1701 | return(MagickFalse); |
| 1702 | } |
| 1703 | if (support < 0.5) |
| 1704 | { |
| 1705 | /* |
| 1706 | Support too small even for nearest neighbour: reduce to point sampling. |
| 1707 | */ |
| 1708 | support=(MagickRealType) 0.5; |
| 1709 | scale=1.0; |
| 1710 | } |
| 1711 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| 1712 | if (contributions == (ContributionInfo **) NULL) |
| 1713 | { |
| 1714 | (void) ThrowMagickException(exception,GetMagickModule(), |
| 1715 | ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| 1716 | return(MagickFalse); |
| 1717 | } |
| 1718 | status=MagickTrue; |
| 1719 | scale=1.0/scale; |
| 1720 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 1721 | image_view=AcquireCacheView(image); |
| 1722 | resize_view=AcquireCacheView(resize_image); |
| 1723 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 1724 | #pragma omp parallel for shared(status) |
| 1725 | #endif |
| 1726 | for (x=0; x < (long) resize_image->columns; x++) |
| 1727 | { |
| 1728 | long |
| 1729 | n, |
| 1730 | start, |
| 1731 | stop; |
| 1732 | |
| 1733 | MagickRealType |
| 1734 | center, |
| 1735 | density; |
| 1736 | |
| 1737 | register const IndexPacket |
| 1738 | *__restrict indexes; |
| 1739 | |
| 1740 | register const PixelPacket |
| 1741 | *__restrict p; |
| 1742 | |
| 1743 | register ContributionInfo |
| 1744 | *__restrict contribution; |
| 1745 | |
| 1746 | register IndexPacket |
| 1747 | *__restrict resize_indexes; |
| 1748 | |
| 1749 | register long |
| 1750 | y; |
| 1751 | |
| 1752 | register PixelPacket |
| 1753 | *__restrict q; |
| 1754 | |
| 1755 | if (status == MagickFalse) |
| 1756 | continue; |
| 1757 | center=(MagickRealType) (x+0.5)/x_factor; |
| 1758 | start=(long) (MagickMax(center-support-MagickEpsilon,0.0)+0.5); |
| 1759 | stop=(long) (MagickMin(center+support,(double) image->columns)+0.5); |
| 1760 | density=0.0; |
| 1761 | contribution=contributions[GetOpenMPThreadId()]; |
| 1762 | for (n=0; n < (stop-start); n++) |
| 1763 | { |
| 1764 | contribution[n].pixel=start+n; |
| 1765 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| 1766 | ((MagickRealType) (start+n)-center+0.5)); |
| 1767 | density+=contribution[n].weight; |
| 1768 | } |
| 1769 | if ((density != 0.0) && (density != 1.0)) |
| 1770 | { |
| 1771 | register long |
| 1772 | i; |
| 1773 | |
| 1774 | /* |
| 1775 | Normalize. |
| 1776 | */ |
| 1777 | density=1.0/density; |
| 1778 | for (i=0; i < n; i++) |
| 1779 | contribution[i].weight*=density; |
| 1780 | } |
| 1781 | p=GetCacheViewVirtualPixels(image_view,contribution[0].pixel,0, |
| 1782 | (unsigned long) (contribution[n-1].pixel-contribution[0].pixel+1), |
| 1783 | image->rows,exception); |
| 1784 | q=QueueCacheViewAuthenticPixels(resize_view,x,0,1,resize_image->rows, |
| 1785 | exception); |
| 1786 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 1787 | { |
| 1788 | status=MagickFalse; |
| 1789 | continue; |
| 1790 | } |
| 1791 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
| 1792 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
| 1793 | for (y=0; y < (long) resize_image->rows; y++) |
| 1794 | { |
| 1795 | long |
| 1796 | j; |
| 1797 | |
| 1798 | MagickPixelPacket |
| 1799 | pixel; |
| 1800 | |
| 1801 | MagickRealType |
| 1802 | alpha; |
| 1803 | |
| 1804 | register long |
| 1805 | i; |
| 1806 | |
| 1807 | pixel=zero; |
| 1808 | if (image->matte == MagickFalse) |
| 1809 | { |
| 1810 | for (i=0; i < n; i++) |
| 1811 | { |
| 1812 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 1813 | (contribution[i].pixel-contribution[0].pixel); |
| 1814 | alpha=contribution[i].weight; |
| 1815 | pixel.red+=alpha*(p+j)->red; |
| 1816 | pixel.green+=alpha*(p+j)->green; |
| 1817 | pixel.blue+=alpha*(p+j)->blue; |
| 1818 | pixel.opacity+=alpha*(p+j)->opacity; |
| 1819 | } |
| 1820 | q->red=RoundToQuantum(pixel.red); |
| 1821 | q->green=RoundToQuantum(pixel.green); |
| 1822 | q->blue=RoundToQuantum(pixel.blue); |
| 1823 | q->opacity=RoundToQuantum(pixel.opacity); |
| 1824 | if ((image->colorspace == CMYKColorspace) && |
| 1825 | (resize_image->colorspace == CMYKColorspace)) |
| 1826 | { |
| 1827 | for (i=0; i < n; i++) |
| 1828 | { |
| 1829 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 1830 | (contribution[i].pixel-contribution[0].pixel); |
| 1831 | alpha=contribution[i].weight; |
| 1832 | pixel.index+=alpha*indexes[j]; |
| 1833 | } |
| 1834 | resize_indexes[y]=(IndexPacket) RoundToQuantum(pixel.index); |
| 1835 | } |
| 1836 | } |
| 1837 | else |
| 1838 | { |
| 1839 | MagickRealType |
| 1840 | gamma; |
| 1841 | |
| 1842 | gamma=0.0; |
| 1843 | for (i=0; i < n; i++) |
| 1844 | { |
| 1845 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 1846 | (contribution[i].pixel-contribution[0].pixel); |
| 1847 | alpha=contribution[i].weight*QuantumScale*((MagickRealType) |
| 1848 | QuantumRange-(p+j)->opacity); |
| 1849 | pixel.red+=alpha*(p+j)->red; |
| 1850 | pixel.green+=alpha*(p+j)->green; |
| 1851 | pixel.blue+=alpha*(p+j)->blue; |
| 1852 | pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| 1853 | gamma+=alpha; |
| 1854 | } |
| 1855 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
| 1856 | q->red=RoundToQuantum(gamma*pixel.red); |
| 1857 | q->green=RoundToQuantum(gamma*pixel.green); |
| 1858 | q->blue=RoundToQuantum(gamma*pixel.blue); |
| 1859 | q->opacity=RoundToQuantum(pixel.opacity); |
| 1860 | if ((image->colorspace == CMYKColorspace) && |
| 1861 | (resize_image->colorspace == CMYKColorspace)) |
| 1862 | { |
| 1863 | for (i=0; i < n; i++) |
| 1864 | { |
| 1865 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 1866 | (contribution[i].pixel-contribution[0].pixel); |
| 1867 | alpha=contribution[i].weight*QuantumScale*((MagickRealType) |
| 1868 | QuantumRange-(p+j)->opacity); |
| 1869 | gamma+=alpha; |
| 1870 | } |
| 1871 | resize_indexes[y]=(IndexPacket) RoundToQuantum(gamma*pixel.index); |
| 1872 | } |
| 1873 | } |
| 1874 | if ((resize_image->storage_class == PseudoClass) && |
| 1875 | (image->storage_class == PseudoClass)) |
| 1876 | { |
| 1877 | i=(long) (MagickMin(MagickMax(center,(double) start),(double) stop- |
| 1878 | 1.0)+0.5); |
| 1879 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 1880 | (contribution[i-start].pixel-contribution[0].pixel); |
| 1881 | resize_indexes[y]=indexes[j]; |
| 1882 | } |
| 1883 | q++; |
| 1884 | } |
| 1885 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 1886 | status=MagickFalse; |
| 1887 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 1888 | { |
| 1889 | MagickBooleanType |
| 1890 | proceed; |
| 1891 | |
| 1892 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 1893 | #pragma omp critical (MagickCore_HorizontalFilter) |
| 1894 | #endif |
| 1895 | proceed=SetImageProgress(image,ResizeImageTag,(*quantum)++,span); |
| 1896 | if (proceed == MagickFalse) |
| 1897 | status=MagickFalse; |
| 1898 | } |
| 1899 | } |
| 1900 | resize_view=DestroyCacheView(resize_view); |
| 1901 | image_view=DestroyCacheView(image_view); |
| 1902 | contributions=DestroyContributionThreadSet(contributions); |
| 1903 | return(status); |
| 1904 | } |
| 1905 | |
| 1906 | static MagickBooleanType VerticalFilter(const ResizeFilter *resize_filter, |
| 1907 | const Image *image,Image *resize_image,const MagickRealType y_factor, |
| 1908 | const MagickSizeType span,MagickOffsetType *quantum,ExceptionInfo *exception) |
| 1909 | { |
| 1910 | ClassType |
| 1911 | storage_class; |
| 1912 | |
| 1913 | ContributionInfo |
| 1914 | **contributions; |
| 1915 | |
| 1916 | long |
| 1917 | y; |
| 1918 | |
| 1919 | MagickBooleanType |
| 1920 | status; |
| 1921 | |
| 1922 | MagickPixelPacket |
| 1923 | zero; |
| 1924 | |
| 1925 | MagickRealType |
| 1926 | scale, |
| 1927 | support; |
| 1928 | |
| 1929 | CacheView |
| 1930 | *image_view, |
| 1931 | *resize_view; |
| 1932 | |
| 1933 | /* |
| 1934 | Apply filter to resize vertically from image to resize_image. |
| 1935 | */ |
| 1936 | scale=MagickMax(1.0/y_factor,1.0); |
| 1937 | support=scale*GetResizeFilterSupport(resize_filter); |
| 1938 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| 1939 | if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| 1940 | { |
| 1941 | InheritException(exception,&resize_image->exception); |
| 1942 | return(MagickFalse); |
| 1943 | } |
| 1944 | if (support < 0.5) |
| 1945 | { |
| 1946 | /* |
| 1947 | Support too small even for nearest neighbour: reduce to point sampling. |
| 1948 | */ |
| 1949 | support=(MagickRealType) 0.5; |
| 1950 | scale=1.0; |
| 1951 | } |
| 1952 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| 1953 | if (contributions == (ContributionInfo **) NULL) |
| 1954 | { |
| 1955 | (void) ThrowMagickException(exception,GetMagickModule(), |
| 1956 | ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| 1957 | return(MagickFalse); |
| 1958 | } |
| 1959 | status=MagickTrue; |
| 1960 | scale=1.0/scale; |
| 1961 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 1962 | image_view=AcquireCacheView(image); |
| 1963 | resize_view=AcquireCacheView(resize_image); |
| 1964 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 1965 | #pragma omp parallel for shared(status) |
| 1966 | #endif |
| 1967 | for (y=0; y < (long) resize_image->rows; y++) |
| 1968 | { |
| 1969 | long |
| 1970 | n, |
| 1971 | start, |
| 1972 | stop; |
| 1973 | |
| 1974 | MagickRealType |
| 1975 | center, |
| 1976 | density; |
| 1977 | |
| 1978 | register const IndexPacket |
| 1979 | *__restrict indexes; |
| 1980 | |
| 1981 | register const PixelPacket |
| 1982 | *__restrict p; |
| 1983 | |
| 1984 | register ContributionInfo |
| 1985 | *__restrict contribution; |
| 1986 | |
| 1987 | register IndexPacket |
| 1988 | *__restrict resize_indexes; |
| 1989 | |
| 1990 | register long |
| 1991 | x; |
| 1992 | |
| 1993 | register PixelPacket |
| 1994 | *__restrict q; |
| 1995 | |
| 1996 | if (status == MagickFalse) |
| 1997 | continue; |
| 1998 | center=(MagickRealType) (y+0.5)/y_factor; |
| 1999 | start=(long) (MagickMax(center-support-MagickEpsilon,0.0)+0.5); |
| 2000 | stop=(long) (MagickMin(center+support,(double) image->rows)+0.5); |
| 2001 | density=0.0; |
| 2002 | contribution=contributions[GetOpenMPThreadId()]; |
| 2003 | for (n=0; n < (stop-start); n++) |
| 2004 | { |
| 2005 | contribution[n].pixel=start+n; |
| 2006 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| 2007 | ((MagickRealType) (start+n)-center+0.5)); |
| 2008 | density+=contribution[n].weight; |
| 2009 | } |
| 2010 | if ((density != 0.0) && (density != 1.0)) |
| 2011 | { |
| 2012 | register long |
| 2013 | i; |
| 2014 | |
| 2015 | /* |
| 2016 | Normalize. |
| 2017 | */ |
| 2018 | density=1.0/density; |
| 2019 | for (i=0; i < n; i++) |
| 2020 | contribution[i].weight*=density; |
| 2021 | } |
| 2022 | p=GetCacheViewVirtualPixels(image_view,0,contribution[0].pixel, |
| 2023 | image->columns,(unsigned long) (contribution[n-1].pixel- |
| 2024 | contribution[0].pixel+1),exception); |
| 2025 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| 2026 | exception); |
| 2027 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2028 | { |
| 2029 | status=MagickFalse; |
| 2030 | continue; |
| 2031 | } |
| 2032 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
| 2033 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
| 2034 | for (x=0; x < (long) resize_image->columns; x++) |
| 2035 | { |
| 2036 | long |
| 2037 | j; |
| 2038 | |
| 2039 | MagickPixelPacket |
| 2040 | pixel; |
| 2041 | |
| 2042 | MagickRealType |
| 2043 | alpha; |
| 2044 | |
| 2045 | register long |
| 2046 | i; |
| 2047 | |
| 2048 | pixel=zero; |
| 2049 | if (image->matte == MagickFalse) |
| 2050 | { |
| 2051 | for (i=0; i < n; i++) |
| 2052 | { |
| 2053 | j=(long) ((contribution[i].pixel-contribution[0].pixel)* |
| 2054 | image->columns+x); |
| 2055 | alpha=contribution[i].weight; |
| 2056 | pixel.red+=alpha*(p+j)->red; |
| 2057 | pixel.green+=alpha*(p+j)->green; |
| 2058 | pixel.blue+=alpha*(p+j)->blue; |
| 2059 | pixel.opacity+=alpha*(p+j)->opacity; |
| 2060 | } |
| 2061 | q->red=RoundToQuantum(pixel.red); |
| 2062 | q->green=RoundToQuantum(pixel.green); |
| 2063 | q->blue=RoundToQuantum(pixel.blue); |
| 2064 | q->opacity=RoundToQuantum(pixel.opacity); |
| 2065 | if ((image->colorspace == CMYKColorspace) && |
| 2066 | (resize_image->colorspace == CMYKColorspace)) |
| 2067 | { |
| 2068 | for (i=0; i < n; i++) |
| 2069 | { |
| 2070 | j=(long) ((contribution[i].pixel-contribution[0].pixel)* |
| 2071 | image->columns+x); |
| 2072 | alpha=contribution[i].weight; |
| 2073 | pixel.index+=alpha*indexes[j]; |
| 2074 | } |
| 2075 | resize_indexes[x]=(IndexPacket) RoundToQuantum(pixel.index); |
| 2076 | } |
| 2077 | } |
| 2078 | else |
| 2079 | { |
| 2080 | MagickRealType |
| 2081 | gamma; |
| 2082 | |
| 2083 | gamma=0.0; |
| 2084 | for (i=0; i < n; i++) |
| 2085 | { |
| 2086 | j=(long) ((contribution[i].pixel-contribution[0].pixel)* |
| 2087 | image->columns+x); |
| 2088 | alpha=contribution[i].weight*QuantumScale*((MagickRealType) |
| 2089 | QuantumRange-(p+j)->opacity); |
| 2090 | pixel.red+=alpha*(p+j)->red; |
| 2091 | pixel.green+=alpha*(p+j)->green; |
| 2092 | pixel.blue+=alpha*(p+j)->blue; |
| 2093 | pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| 2094 | gamma+=alpha; |
| 2095 | } |
| 2096 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
| 2097 | q->red=RoundToQuantum(gamma*pixel.red); |
| 2098 | q->green=RoundToQuantum(gamma*pixel.green); |
| 2099 | q->blue=RoundToQuantum(gamma*pixel.blue); |
| 2100 | q->opacity=RoundToQuantum(pixel.opacity); |
| 2101 | if ((image->colorspace == CMYKColorspace) && |
| 2102 | (resize_image->colorspace == CMYKColorspace)) |
| 2103 | { |
| 2104 | for (i=0; i < n; i++) |
| 2105 | { |
| 2106 | j=(long) ((contribution[i].pixel-contribution[0].pixel)* |
| 2107 | image->columns+x); |
| 2108 | alpha=contribution[i].weight*QuantumScale*((MagickRealType) |
| 2109 | QuantumRange-(p+j)->opacity); |
| 2110 | pixel.index+=alpha*indexes[j]; |
| 2111 | } |
| 2112 | resize_indexes[x]=(IndexPacket) RoundToQuantum(gamma*pixel.index); |
| 2113 | } |
| 2114 | } |
| 2115 | if ((resize_image->storage_class == PseudoClass) && |
| 2116 | (image->storage_class == PseudoClass)) |
| 2117 | { |
| 2118 | i=(long) (MagickMin(MagickMax(center,(double) start),(double) stop- |
| 2119 | 1.0)+0.5); |
| 2120 | j=(long) ((contribution[i-start].pixel-contribution[0].pixel)* |
| 2121 | image->columns+x); |
| 2122 | resize_indexes[x]=indexes[j]; |
| 2123 | } |
| 2124 | q++; |
| 2125 | } |
| 2126 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 2127 | status=MagickFalse; |
| 2128 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2129 | { |
| 2130 | MagickBooleanType |
| 2131 | proceed; |
| 2132 | |
| 2133 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 2134 | #pragma omp critical (MagickCore_VerticalFilter) |
| 2135 | #endif |
| 2136 | proceed=SetImageProgress(image,ResizeImageTag,(*quantum)++,span); |
| 2137 | if (proceed == MagickFalse) |
| 2138 | status=MagickFalse; |
| 2139 | } |
| 2140 | } |
| 2141 | resize_view=DestroyCacheView(resize_view); |
| 2142 | image_view=DestroyCacheView(image_view); |
| 2143 | contributions=DestroyContributionThreadSet(contributions); |
| 2144 | return(status); |
| 2145 | } |
| 2146 | |
| 2147 | MagickExport Image *ResizeImage(const Image *image,const unsigned long columns, |
| 2148 | const unsigned long rows,const FilterTypes filter,const double blur, |
| 2149 | ExceptionInfo *exception) |
| 2150 | { |
| 2151 | #define WorkLoadFactor 0.265 |
| 2152 | |
| 2153 | FilterTypes |
| 2154 | filter_type; |
| 2155 | |
| 2156 | Image |
| 2157 | *filter_image, |
| 2158 | *resize_image; |
| 2159 | |
| 2160 | MagickRealType |
| 2161 | x_factor, |
| 2162 | y_factor; |
| 2163 | |
| 2164 | MagickSizeType |
| 2165 | span; |
| 2166 | |
| 2167 | MagickStatusType |
| 2168 | status; |
| 2169 | |
| 2170 | ResizeFilter |
| 2171 | *resize_filter; |
| 2172 | |
| 2173 | MagickOffsetType |
| 2174 | quantum; |
| 2175 | |
| 2176 | /* |
| 2177 | Acquire resize image. |
| 2178 | */ |
| 2179 | assert(image != (Image *) NULL); |
| 2180 | assert(image->signature == MagickSignature); |
| 2181 | if (image->debug != MagickFalse) |
| 2182 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2183 | assert(exception != (ExceptionInfo *) NULL); |
| 2184 | assert(exception->signature == MagickSignature); |
| 2185 | if ((columns == 0) || (rows == 0)) |
| 2186 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| 2187 | if ((columns == image->columns) && (rows == image->rows) && |
| 2188 | (filter == UndefinedFilter) && (blur == 1.0)) |
| 2189 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2190 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2191 | if (resize_image == (Image *) NULL) |
| 2192 | return(resize_image); |
| 2193 | /* |
| 2194 | Acquire resize filter. |
| 2195 | */ |
| 2196 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| 2197 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| 2198 | if ((x_factor*y_factor) > WorkLoadFactor) |
| 2199 | filter_image=CloneImage(image,columns,image->rows,MagickTrue,exception); |
| 2200 | else |
| 2201 | filter_image=CloneImage(image,image->columns,rows,MagickTrue,exception); |
| 2202 | if (filter_image == (Image *) NULL) |
| 2203 | return(DestroyImage(resize_image)); |
| 2204 | filter_type=LanczosFilter; |
| 2205 | if (filter != UndefinedFilter) |
| 2206 | filter_type=filter; |
| 2207 | else |
| 2208 | if ((x_factor == 1.0) && (y_factor == 1.0)) |
| 2209 | filter_type=PointFilter; |
| 2210 | else |
| 2211 | if ((image->storage_class == PseudoClass) || |
| 2212 | (image->matte != MagickFalse) || ((x_factor*y_factor) > 1.0)) |
| 2213 | filter_type=MitchellFilter; |
| 2214 | resize_filter=AcquireResizeFilter(image,filter_type,blur,MagickFalse, |
| 2215 | exception); |
| 2216 | /* |
| 2217 | Resize image. |
| 2218 | */ |
| 2219 | quantum=0; |
| 2220 | if ((x_factor*y_factor) > WorkLoadFactor) |
| 2221 | { |
| 2222 | span=(MagickSizeType) (filter_image->columns+rows); |
| 2223 | status=HorizontalFilter(resize_filter,image,filter_image,x_factor,span, |
| 2224 | &quantum,exception); |
| 2225 | status&=VerticalFilter(resize_filter,filter_image,resize_image,y_factor, |
| 2226 | span,&quantum,exception); |
| 2227 | } |
| 2228 | else |
| 2229 | { |
| 2230 | span=(MagickSizeType) (filter_image->rows+columns); |
| 2231 | status=VerticalFilter(resize_filter,image,filter_image,y_factor,span, |
| 2232 | &quantum,exception); |
| 2233 | status&=HorizontalFilter(resize_filter,filter_image,resize_image,x_factor, |
| 2234 | span,&quantum,exception); |
| 2235 | } |
| 2236 | /* |
| 2237 | Free resources. |
| 2238 | */ |
| 2239 | filter_image=DestroyImage(filter_image); |
| 2240 | resize_filter=DestroyResizeFilter(resize_filter); |
| 2241 | if ((status == MagickFalse) || (resize_image == (Image *) NULL)) |
| 2242 | return((Image *) NULL); |
| 2243 | resize_image->type=image->type; |
| 2244 | return(resize_image); |
| 2245 | } |
| 2246 | |
| 2247 | /* |
| 2248 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2249 | % % |
| 2250 | % % |
| 2251 | % % |
| 2252 | % S a m p l e I m a g e % |
| 2253 | % % |
| 2254 | % % |
| 2255 | % % |
| 2256 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2257 | % |
| 2258 | % SampleImage() scales an image to the desired dimensions with pixel |
| 2259 | % sampling. Unlike other scaling methods, this method does not introduce |
| 2260 | % any additional color into the scaled image. |
| 2261 | % |
| 2262 | % The format of the SampleImage method is: |
| 2263 | % |
| 2264 | % Image *SampleImage(const Image *image,const unsigned long columns, |
| 2265 | % const unsigned long rows,ExceptionInfo *exception) |
| 2266 | % |
| 2267 | % A description of each parameter follows: |
| 2268 | % |
| 2269 | % o image: the image. |
| 2270 | % |
| 2271 | % o columns: the number of columns in the sampled image. |
| 2272 | % |
| 2273 | % o rows: the number of rows in the sampled image. |
| 2274 | % |
| 2275 | % o exception: return any errors or warnings in this structure. |
| 2276 | % |
| 2277 | */ |
| 2278 | MagickExport Image *SampleImage(const Image *image,const unsigned long columns, |
| 2279 | const unsigned long rows,ExceptionInfo *exception) |
| 2280 | { |
| 2281 | #define SampleImageTag "Sample/Image" |
| 2282 | |
| 2283 | Image |
| 2284 | *sample_image; |
| 2285 | |
| 2286 | long |
| 2287 | progress, |
| 2288 | *x_offset, |
| 2289 | y; |
| 2290 | |
| 2291 | MagickBooleanType |
| 2292 | status; |
| 2293 | |
| 2294 | register long |
| 2295 | x; |
| 2296 | |
| 2297 | CacheView |
| 2298 | *image_view, |
| 2299 | *sample_view; |
| 2300 | |
| 2301 | /* |
| 2302 | Initialize sampled image attributes. |
| 2303 | */ |
| 2304 | assert(image != (const Image *) NULL); |
| 2305 | assert(image->signature == MagickSignature); |
| 2306 | if (image->debug != MagickFalse) |
| 2307 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2308 | assert(exception != (ExceptionInfo *) NULL); |
| 2309 | assert(exception->signature == MagickSignature); |
| 2310 | if ((columns == 0) || (rows == 0)) |
| 2311 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| 2312 | if ((columns == image->columns) && (rows == image->rows)) |
| 2313 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2314 | sample_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2315 | if (sample_image == (Image *) NULL) |
| 2316 | return((Image *) NULL); |
| 2317 | /* |
| 2318 | Allocate scan line buffer and column offset buffers. |
| 2319 | */ |
| 2320 | x_offset=(long *) AcquireQuantumMemory((size_t) sample_image->columns, |
| 2321 | sizeof(*x_offset)); |
| 2322 | if (x_offset == (long *) NULL) |
| 2323 | { |
| 2324 | sample_image=DestroyImage(sample_image); |
| 2325 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 2326 | } |
| 2327 | for (x=0; x < (long) sample_image->columns; x++) |
| 2328 | x_offset[x]=(long) (((MagickRealType) x+0.5)*image->columns/ |
| 2329 | sample_image->columns); |
| 2330 | /* |
| 2331 | Sample each row. |
| 2332 | */ |
| 2333 | status=MagickTrue; |
| 2334 | progress=0; |
| 2335 | image_view=AcquireCacheView(image); |
| 2336 | sample_view=AcquireCacheView(sample_image); |
| 2337 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 2338 | #pragma omp parallel for schedule(dynamic) shared(progress,status) |
| 2339 | #endif |
| 2340 | for (y=0; y < (long) sample_image->rows; y++) |
| 2341 | { |
| 2342 | long |
| 2343 | y_offset; |
| 2344 | |
| 2345 | register const IndexPacket |
| 2346 | *__restrict indexes; |
| 2347 | |
| 2348 | register const PixelPacket |
| 2349 | *__restrict p; |
| 2350 | |
| 2351 | register IndexPacket |
| 2352 | *__restrict sample_indexes; |
| 2353 | |
| 2354 | register long |
| 2355 | x; |
| 2356 | |
| 2357 | register PixelPacket |
| 2358 | *__restrict q; |
| 2359 | |
| 2360 | if (status == MagickFalse) |
| 2361 | continue; |
| 2362 | y_offset=(long) (((MagickRealType) y+0.5)*image->rows/sample_image->rows); |
| 2363 | p=GetCacheViewVirtualPixels(image_view,0,y_offset,image->columns,1, |
| 2364 | exception); |
| 2365 | q=QueueCacheViewAuthenticPixels(sample_view,0,y,sample_image->columns,1, |
| 2366 | exception); |
| 2367 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2368 | { |
| 2369 | status=MagickFalse; |
| 2370 | continue; |
| 2371 | } |
| 2372 | indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| 2373 | sample_indexes=GetCacheViewAuthenticIndexQueue(sample_view); |
| 2374 | /* |
| 2375 | Sample each column. |
| 2376 | */ |
| 2377 | for (x=0; x < (long) sample_image->columns; x++) |
| 2378 | *q++=p[x_offset[x]]; |
| 2379 | if ((image->storage_class == PseudoClass) || |
| 2380 | (image->colorspace == CMYKColorspace)) |
| 2381 | for (x=0; x < (long) sample_image->columns; x++) |
| 2382 | sample_indexes[x]=indexes[x_offset[x]]; |
| 2383 | if (SyncCacheViewAuthenticPixels(sample_view,exception) == MagickFalse) |
| 2384 | status=MagickFalse; |
| 2385 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2386 | { |
| 2387 | MagickBooleanType |
| 2388 | proceed; |
| 2389 | |
| 2390 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 2391 | #pragma omp critical (MagickCore_SampleImage) |
| 2392 | #endif |
| 2393 | proceed=SetImageProgress(image,SampleImageTag,progress++,image->rows); |
| 2394 | if (proceed == MagickFalse) |
| 2395 | status=MagickFalse; |
| 2396 | } |
| 2397 | } |
| 2398 | image_view=DestroyCacheView(image_view); |
| 2399 | sample_view=DestroyCacheView(sample_view); |
| 2400 | x_offset=(long *) RelinquishMagickMemory(x_offset); |
| 2401 | sample_image->type=image->type; |
| 2402 | return(sample_image); |
| 2403 | } |
| 2404 | |
| 2405 | /* |
| 2406 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2407 | % % |
| 2408 | % % |
| 2409 | % % |
| 2410 | % S c a l e I m a g e % |
| 2411 | % % |
| 2412 | % % |
| 2413 | % % |
| 2414 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2415 | % |
| 2416 | % ScaleImage() changes the size of an image to the given dimensions. |
| 2417 | % |
| 2418 | % The format of the ScaleImage method is: |
| 2419 | % |
| 2420 | % Image *ScaleImage(const Image *image,const unsigned long columns, |
| 2421 | % const unsigned long rows,ExceptionInfo *exception) |
| 2422 | % |
| 2423 | % A description of each parameter follows: |
| 2424 | % |
| 2425 | % o image: the image. |
| 2426 | % |
| 2427 | % o columns: the number of columns in the scaled image. |
| 2428 | % |
| 2429 | % o rows: the number of rows in the scaled image. |
| 2430 | % |
| 2431 | % o exception: return any errors or warnings in this structure. |
| 2432 | % |
| 2433 | */ |
| 2434 | MagickExport Image *ScaleImage(const Image *image,const unsigned long columns, |
| 2435 | const unsigned long rows,ExceptionInfo *exception) |
| 2436 | { |
| 2437 | #define ScaleImageTag "Scale/Image" |
| 2438 | |
| 2439 | Image |
| 2440 | *scale_image; |
| 2441 | |
| 2442 | long |
| 2443 | number_rows, |
| 2444 | y; |
| 2445 | |
| 2446 | MagickBooleanType |
| 2447 | next_column, |
| 2448 | next_row, |
| 2449 | proceed; |
| 2450 | |
| 2451 | MagickPixelPacket |
| 2452 | pixel, |
| 2453 | *scale_scanline, |
| 2454 | *scanline, |
| 2455 | *x_vector, |
| 2456 | *y_vector, |
| 2457 | zero; |
| 2458 | |
| 2459 | MagickRealType |
| 2460 | alpha, |
| 2461 | gamma; |
| 2462 | |
| 2463 | PointInfo |
| 2464 | scale, |
| 2465 | span; |
| 2466 | |
| 2467 | register long |
| 2468 | i; |
| 2469 | |
| 2470 | /* |
| 2471 | Initialize scaled image attributes. |
| 2472 | */ |
| 2473 | assert(image != (const Image *) NULL); |
| 2474 | assert(image->signature == MagickSignature); |
| 2475 | if (image->debug != MagickFalse) |
| 2476 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2477 | assert(exception != (ExceptionInfo *) NULL); |
| 2478 | assert(exception->signature == MagickSignature); |
| 2479 | if ((columns == 0) || (rows == 0)) |
| 2480 | return((Image *) NULL); |
| 2481 | if ((columns == image->columns) && (rows == image->rows)) |
| 2482 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2483 | scale_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2484 | if (scale_image == (Image *) NULL) |
| 2485 | return((Image *) NULL); |
| 2486 | if (SetImageStorageClass(scale_image,DirectClass) == MagickFalse) |
| 2487 | { |
| 2488 | InheritException(exception,&scale_image->exception); |
| 2489 | scale_image=DestroyImage(scale_image); |
| 2490 | return((Image *) NULL); |
| 2491 | } |
| 2492 | /* |
| 2493 | Allocate memory. |
| 2494 | */ |
| 2495 | x_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2496 | sizeof(*x_vector)); |
| 2497 | scanline=x_vector; |
| 2498 | if (image->rows != scale_image->rows) |
| 2499 | scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2500 | sizeof(*scanline)); |
| 2501 | scale_scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) |
| 2502 | scale_image->columns,sizeof(*scale_scanline)); |
| 2503 | y_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2504 | sizeof(*y_vector)); |
| 2505 | if ((scanline == (MagickPixelPacket *) NULL) || |
| 2506 | (scale_scanline == (MagickPixelPacket *) NULL) || |
| 2507 | (x_vector == (MagickPixelPacket *) NULL) || |
| 2508 | (y_vector == (MagickPixelPacket *) NULL)) |
| 2509 | { |
| 2510 | scale_image=DestroyImage(scale_image); |
| 2511 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 2512 | } |
| 2513 | /* |
| 2514 | Scale image. |
| 2515 | */ |
| 2516 | number_rows=0; |
| 2517 | next_row=MagickTrue; |
| 2518 | span.y=1.0; |
| 2519 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 2520 | (void) ResetMagickMemory(y_vector,0,(size_t) image->columns* |
| 2521 | sizeof(*y_vector)); |
| 2522 | GetMagickPixelPacket(image,&pixel); |
| 2523 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2524 | i=0; |
| 2525 | for (y=0; y < (long) scale_image->rows; y++) |
| 2526 | { |
| 2527 | register const IndexPacket |
| 2528 | *__restrict indexes; |
| 2529 | |
| 2530 | register const PixelPacket |
| 2531 | *__restrict p; |
| 2532 | |
| 2533 | register IndexPacket |
| 2534 | *__restrict scale_indexes; |
| 2535 | |
| 2536 | register long |
| 2537 | x; |
| 2538 | |
| 2539 | register MagickPixelPacket |
| 2540 | *__restrict s, |
| 2541 | *__restrict t; |
| 2542 | |
| 2543 | register PixelPacket |
| 2544 | *__restrict q; |
| 2545 | |
| 2546 | q=QueueAuthenticPixels(scale_image,0,y,scale_image->columns,1,exception); |
| 2547 | if (q == (PixelPacket *) NULL) |
| 2548 | break; |
| 2549 | scale_indexes=GetAuthenticIndexQueue(scale_image); |
| 2550 | if (scale_image->rows == image->rows) |
| 2551 | { |
| 2552 | /* |
| 2553 | Read a new scanline. |
| 2554 | */ |
| 2555 | p=GetVirtualPixels(image,0,i++,image->columns,1,exception); |
| 2556 | if (p == (const PixelPacket *) NULL) |
| 2557 | break; |
| 2558 | indexes=GetVirtualIndexQueue(image); |
| 2559 | for (x=0; x < (long) image->columns; x++) |
| 2560 | { |
| 2561 | x_vector[x].red=(MagickRealType) p->red; |
| 2562 | x_vector[x].green=(MagickRealType) p->green; |
| 2563 | x_vector[x].blue=(MagickRealType) p->blue; |
| 2564 | if (image->matte != MagickFalse) |
| 2565 | x_vector[x].opacity=(MagickRealType) p->opacity; |
| 2566 | if (indexes != (IndexPacket *) NULL) |
| 2567 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2568 | p++; |
| 2569 | } |
| 2570 | } |
| 2571 | else |
| 2572 | { |
| 2573 | /* |
| 2574 | Scale Y direction. |
| 2575 | */ |
| 2576 | while (scale.y < span.y) |
| 2577 | { |
| 2578 | if ((next_row != MagickFalse) && (number_rows < (long) image->rows)) |
| 2579 | { |
| 2580 | /* |
| 2581 | Read a new scanline. |
| 2582 | */ |
| 2583 | p=GetVirtualPixels(image,0,i++,image->columns,1,exception); |
| 2584 | if (p == (const PixelPacket *) NULL) |
| 2585 | break; |
| 2586 | indexes=GetVirtualIndexQueue(image); |
| 2587 | for (x=0; x < (long) image->columns; x++) |
| 2588 | { |
| 2589 | x_vector[x].red=(MagickRealType) p->red; |
| 2590 | x_vector[x].green=(MagickRealType) p->green; |
| 2591 | x_vector[x].blue=(MagickRealType) p->blue; |
| 2592 | if (image->matte != MagickFalse) |
| 2593 | x_vector[x].opacity=(MagickRealType) p->opacity; |
| 2594 | if (indexes != (IndexPacket *) NULL) |
| 2595 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2596 | p++; |
| 2597 | } |
| 2598 | number_rows++; |
| 2599 | } |
| 2600 | for (x=0; x < (long) image->columns; x++) |
| 2601 | { |
| 2602 | y_vector[x].red+=scale.y*x_vector[x].red; |
| 2603 | y_vector[x].green+=scale.y*x_vector[x].green; |
| 2604 | y_vector[x].blue+=scale.y*x_vector[x].blue; |
| 2605 | if (scale_image->matte != MagickFalse) |
| 2606 | y_vector[x].opacity+=scale.y*x_vector[x].opacity; |
| 2607 | if (scale_indexes != (IndexPacket *) NULL) |
| 2608 | y_vector[x].index+=scale.y*x_vector[x].index; |
| 2609 | } |
| 2610 | span.y-=scale.y; |
| 2611 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 2612 | next_row=MagickTrue; |
| 2613 | } |
| 2614 | if ((next_row != MagickFalse) && (number_rows < (long) image->rows)) |
| 2615 | { |
| 2616 | /* |
| 2617 | Read a new scanline. |
| 2618 | */ |
| 2619 | p=GetVirtualPixels(image,0,i++,image->columns,1,exception); |
| 2620 | if (p == (const PixelPacket *) NULL) |
| 2621 | break; |
| 2622 | indexes=GetVirtualIndexQueue(image); |
| 2623 | for (x=0; x < (long) image->columns; x++) |
| 2624 | { |
| 2625 | x_vector[x].red=(MagickRealType) p->red; |
| 2626 | x_vector[x].green=(MagickRealType) p->green; |
| 2627 | x_vector[x].blue=(MagickRealType) p->blue; |
| 2628 | if (image->matte != MagickFalse) |
| 2629 | x_vector[x].opacity=(MagickRealType) p->opacity; |
| 2630 | if (indexes != (IndexPacket *) NULL) |
| 2631 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2632 | p++; |
| 2633 | } |
| 2634 | number_rows++; |
| 2635 | next_row=MagickFalse; |
| 2636 | } |
| 2637 | s=scanline; |
| 2638 | for (x=0; x < (long) image->columns; x++) |
| 2639 | { |
| 2640 | pixel.red=y_vector[x].red+span.y*x_vector[x].red; |
| 2641 | pixel.green=y_vector[x].green+span.y*x_vector[x].green; |
| 2642 | pixel.blue=y_vector[x].blue+span.y*x_vector[x].blue; |
| 2643 | if (image->matte != MagickFalse) |
| 2644 | pixel.opacity=y_vector[x].opacity+span.y*x_vector[x].opacity; |
| 2645 | if (scale_indexes != (IndexPacket *) NULL) |
| 2646 | pixel.index=y_vector[x].index+span.y*x_vector[x].index; |
| 2647 | s->red=pixel.red; |
| 2648 | s->green=pixel.green; |
| 2649 | s->blue=pixel.blue; |
| 2650 | if (scale_image->matte != MagickFalse) |
| 2651 | s->opacity=pixel.opacity; |
| 2652 | if (scale_indexes != (IndexPacket *) NULL) |
| 2653 | s->index=pixel.index; |
| 2654 | s++; |
| 2655 | y_vector[x]=zero; |
| 2656 | } |
| 2657 | scale.y-=span.y; |
| 2658 | if (scale.y <= 0) |
| 2659 | { |
| 2660 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 2661 | next_row=MagickTrue; |
| 2662 | } |
| 2663 | span.y=1.0; |
| 2664 | } |
| 2665 | if (scale_image->columns == image->columns) |
| 2666 | { |
| 2667 | /* |
| 2668 | Transfer scanline to scaled image. |
| 2669 | */ |
| 2670 | s=scanline; |
| 2671 | for (x=0; x < (long) scale_image->columns; x++) |
| 2672 | { |
| 2673 | q->red=RoundToQuantum(s->red); |
| 2674 | q->green=RoundToQuantum(s->green); |
| 2675 | q->blue=RoundToQuantum(s->blue); |
| 2676 | if (scale_image->matte != MagickFalse) |
| 2677 | q->opacity=RoundToQuantum(s->opacity); |
| 2678 | if (scale_indexes != (IndexPacket *) NULL) |
| 2679 | scale_indexes[x]=(IndexPacket) RoundToQuantum(s->index); |
| 2680 | q++; |
| 2681 | s++; |
| 2682 | } |
| 2683 | } |
| 2684 | else |
| 2685 | { |
| 2686 | /* |
| 2687 | Scale X direction. |
| 2688 | */ |
| 2689 | pixel=zero; |
| 2690 | next_column=MagickFalse; |
| 2691 | span.x=1.0; |
| 2692 | s=scanline; |
| 2693 | t=scale_scanline; |
| 2694 | for (x=0; x < (long) image->columns; x++) |
| 2695 | { |
| 2696 | scale.x=(double) scale_image->columns/(double) image->columns; |
| 2697 | while (scale.x >= span.x) |
| 2698 | { |
| 2699 | if (next_column != MagickFalse) |
| 2700 | { |
| 2701 | pixel=zero; |
| 2702 | t++; |
| 2703 | } |
| 2704 | pixel.red+=span.x*s->red; |
| 2705 | pixel.green+=span.x*s->green; |
| 2706 | pixel.blue+=span.x*s->blue; |
| 2707 | if (image->matte != MagickFalse) |
| 2708 | pixel.opacity+=span.x*s->opacity; |
| 2709 | if (scale_indexes != (IndexPacket *) NULL) |
| 2710 | pixel.index+=span.x*s->index; |
| 2711 | t->red=pixel.red; |
| 2712 | t->green=pixel.green; |
| 2713 | t->blue=pixel.blue; |
| 2714 | if (scale_image->matte != MagickFalse) |
| 2715 | t->opacity=pixel.opacity; |
| 2716 | if (scale_indexes != (IndexPacket *) NULL) |
| 2717 | t->index=pixel.index; |
| 2718 | scale.x-=span.x; |
| 2719 | span.x=1.0; |
| 2720 | next_column=MagickTrue; |
| 2721 | } |
| 2722 | if (scale.x > 0) |
| 2723 | { |
| 2724 | if (next_column != MagickFalse) |
| 2725 | { |
| 2726 | pixel=zero; |
| 2727 | next_column=MagickFalse; |
| 2728 | t++; |
| 2729 | } |
| 2730 | pixel.red+=scale.x*s->red; |
| 2731 | pixel.green+=scale.x*s->green; |
| 2732 | pixel.blue+=scale.x*s->blue; |
| 2733 | if (scale_image->matte != MagickFalse) |
| 2734 | pixel.opacity+=scale.x*s->opacity; |
| 2735 | if (scale_indexes != (IndexPacket *) NULL) |
| 2736 | pixel.index+=scale.x*s->index; |
| 2737 | span.x-=scale.x; |
| 2738 | } |
| 2739 | s++; |
| 2740 | } |
| 2741 | if (span.x > 0) |
| 2742 | { |
| 2743 | s--; |
| 2744 | pixel.red+=span.x*s->red; |
| 2745 | pixel.green+=span.x*s->green; |
| 2746 | pixel.blue+=span.x*s->blue; |
| 2747 | if (scale_image->matte != MagickFalse) |
| 2748 | pixel.opacity+=span.x*s->opacity; |
| 2749 | if (scale_indexes != (IndexPacket *) NULL) |
| 2750 | pixel.index+=span.x*s->index; |
| 2751 | } |
| 2752 | if ((next_column == MagickFalse) && |
| 2753 | ((long) (t-scale_scanline) < (long) scale_image->columns)) |
| 2754 | { |
| 2755 | t->red=pixel.red; |
| 2756 | t->green=pixel.green; |
| 2757 | t->blue=pixel.blue; |
| 2758 | if (scale_image->matte != MagickFalse) |
| 2759 | t->opacity=pixel.opacity; |
| 2760 | if (scale_indexes != (IndexPacket *) NULL) |
| 2761 | t->index=pixel.index; |
| 2762 | } |
| 2763 | /* |
| 2764 | Transfer scanline to scaled image. |
| 2765 | */ |
| 2766 | t=scale_scanline; |
| 2767 | for (x=0; x < (long) scale_image->columns; x++) |
| 2768 | { |
| 2769 | alpha=1.0; |
| 2770 | if (image->matte != MagickFalse) |
| 2771 | alpha=(MagickRealType) (QuantumScale*(QuantumRange-t->opacity)); |
| 2772 | gamma=1.0/(fabs((double) alpha) <= MagickEpsilon ? 1.0 : alpha); |
| 2773 | q->red=RoundToQuantum(gamma*t->red); |
| 2774 | q->green=RoundToQuantum(gamma*t->green); |
| 2775 | q->blue=RoundToQuantum(gamma*t->blue); |
| 2776 | if (scale_image->matte != MagickFalse) |
| 2777 | q->opacity=RoundToQuantum(t->opacity); |
| 2778 | if (scale_indexes != (IndexPacket *) NULL) |
| 2779 | scale_indexes[x]=(IndexPacket) RoundToQuantum(gamma*t->index); |
| 2780 | t++; |
| 2781 | q++; |
| 2782 | } |
| 2783 | } |
| 2784 | if (SyncAuthenticPixels(scale_image,exception) == MagickFalse) |
| 2785 | break; |
| 2786 | proceed=SetImageProgress(image,ScaleImageTag,y,image->rows); |
| 2787 | if (proceed == MagickFalse) |
| 2788 | break; |
| 2789 | } |
| 2790 | /* |
| 2791 | Free allocated memory. |
| 2792 | */ |
| 2793 | y_vector=(MagickPixelPacket *) RelinquishMagickMemory(y_vector); |
| 2794 | scale_scanline=(MagickPixelPacket *) RelinquishMagickMemory(scale_scanline); |
| 2795 | if (scale_image->rows != image->rows) |
| 2796 | scanline=(MagickPixelPacket *) RelinquishMagickMemory(scanline); |
| 2797 | x_vector=(MagickPixelPacket *) RelinquishMagickMemory(x_vector); |
| 2798 | scale_image->type=image->type; |
| 2799 | return(scale_image); |
| 2800 | } |
| 2801 | |
| 2802 | /* |
| 2803 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2804 | % % |
| 2805 | % % |
| 2806 | % % |
| 2807 | + S e t R e s i z e F i l t e r S u p p o r t % |
| 2808 | % % |
| 2809 | % % |
| 2810 | % % |
| 2811 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2812 | % |
| 2813 | % SetResizeFilterSupport() specifies which IR filter to use to window |
| 2814 | % |
| 2815 | % The format of the SetResizeFilterSupport method is: |
| 2816 | % |
| 2817 | % void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| 2818 | % const MagickRealType support) |
| 2819 | % |
| 2820 | % A description of each parameter follows: |
| 2821 | % |
| 2822 | % o resize_filter: the resize filter. |
| 2823 | % |
| 2824 | % o support: the filter spport radius. |
| 2825 | % |
| 2826 | */ |
| 2827 | MagickExport void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| 2828 | const MagickRealType support) |
| 2829 | { |
| 2830 | assert(resize_filter != (ResizeFilter *) NULL); |
| 2831 | assert(resize_filter->signature == MagickSignature); |
| 2832 | resize_filter->support=support; |
| 2833 | } |
| 2834 | |
| 2835 | /* |
| 2836 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2837 | % % |
| 2838 | % % |
| 2839 | % % |
| 2840 | % T h u m b n a i l I m a g e % |
| 2841 | % % |
| 2842 | % % |
| 2843 | % % |
| 2844 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2845 | % |
| 2846 | % ThumbnailImage() changes the size of an image to the given dimensions and |
| 2847 | % removes any associated profiles. The goal is to produce small low cost |
| 2848 | % thumbnail images suited for display on the Web. |
| 2849 | % |
| 2850 | % The format of the ThumbnailImage method is: |
| 2851 | % |
| 2852 | % Image *ThumbnailImage(const Image *image,const unsigned long columns, |
| 2853 | % const unsigned long rows,ExceptionInfo *exception) |
| 2854 | % |
| 2855 | % A description of each parameter follows: |
| 2856 | % |
| 2857 | % o image: the image. |
| 2858 | % |
| 2859 | % o columns: the number of columns in the scaled image. |
| 2860 | % |
| 2861 | % o rows: the number of rows in the scaled image. |
| 2862 | % |
| 2863 | % o exception: return any errors or warnings in this structure. |
| 2864 | % |
| 2865 | */ |
| 2866 | MagickExport Image *ThumbnailImage(const Image *image, |
| 2867 | const unsigned long columns,const unsigned long rows,ExceptionInfo *exception) |
| 2868 | { |
| 2869 | #define SampleFactor 5 |
| 2870 | |
| 2871 | char |
| 2872 | value[MaxTextExtent]; |
| 2873 | |
| 2874 | const char |
| 2875 | *name; |
| 2876 | |
| 2877 | Image |
| 2878 | *thumbnail_image; |
| 2879 | |
| 2880 | MagickRealType |
| 2881 | x_factor, |
| 2882 | y_factor; |
| 2883 | |
| 2884 | struct stat |
| 2885 | attributes; |
| 2886 | |
| 2887 | unsigned long |
| 2888 | version; |
| 2889 | |
| 2890 | assert(image != (Image *) NULL); |
| 2891 | assert(image->signature == MagickSignature); |
| 2892 | if (image->debug != MagickFalse) |
| 2893 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2894 | assert(exception != (ExceptionInfo *) NULL); |
| 2895 | assert(exception->signature == MagickSignature); |
| 2896 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| 2897 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| 2898 | if ((x_factor*y_factor) > 0.1) |
| 2899 | thumbnail_image=ZoomImage(image,columns,rows,exception); |
| 2900 | else |
| 2901 | if (((SampleFactor*columns) < 128) || ((SampleFactor*rows) < 128)) |
| 2902 | thumbnail_image=ZoomImage(image,columns,rows,exception); |
| 2903 | else |
| 2904 | { |
| 2905 | Image |
| 2906 | *sample_image; |
| 2907 | |
| 2908 | sample_image=SampleImage(image,SampleFactor*columns,SampleFactor*rows, |
| 2909 | exception); |
| 2910 | if (sample_image == (Image *) NULL) |
| 2911 | return((Image *) NULL); |
| 2912 | thumbnail_image=ZoomImage(sample_image,columns,rows,exception); |
| 2913 | sample_image=DestroyImage(sample_image); |
| 2914 | } |
| 2915 | if (thumbnail_image == (Image *) NULL) |
| 2916 | return(thumbnail_image); |
| 2917 | (void) ParseAbsoluteGeometry("0x0+0+0",&thumbnail_image->page); |
| 2918 | if (thumbnail_image->matte == MagickFalse) |
| 2919 | (void) SetImageAlphaChannel(thumbnail_image,OpaqueAlphaChannel); |
| 2920 | thumbnail_image->depth=8; |
| 2921 | thumbnail_image->interlace=NoInterlace; |
| 2922 | /* |
| 2923 | Strip all profiles except color profiles. |
| 2924 | */ |
| 2925 | ResetImageProfileIterator(thumbnail_image); |
| 2926 | for (name=GetNextImageProfile(thumbnail_image); name != (const char *) NULL; ) |
| 2927 | { |
| 2928 | if ((LocaleCompare(name,"icc") != 0) && (LocaleCompare(name,"icm") != 0)) |
| 2929 | { |
| 2930 | DeleteImageProfile(thumbnail_image,name); |
| 2931 | ResetImageProfileIterator(thumbnail_image); |
| 2932 | } |
| 2933 | name=GetNextImageProfile(thumbnail_image); |
| 2934 | } |
| 2935 | (void) DeleteImageProperty(thumbnail_image,"comment"); |
| 2936 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
| 2937 | if (strstr(image->magick_filename,"///") == (char *) NULL) |
| 2938 | (void) FormatMagickString(value,MaxTextExtent,"file:///%s", |
| 2939 | image->magick_filename); |
| 2940 | (void) SetImageProperty(thumbnail_image,"Thumb::URI",value); |
| 2941 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
| 2942 | if (GetPathAttributes(image->filename,&attributes) != MagickFalse) |
| 2943 | { |
| 2944 | (void) FormatMagickString(value,MaxTextExtent,"%ld",(long) |
| 2945 | attributes.st_mtime); |
| 2946 | (void) SetImageProperty(thumbnail_image,"Thumb::MTime",value); |
| 2947 | } |
| 2948 | (void) FormatMagickString(value,MaxTextExtent,"%ld",(long) |
| 2949 | attributes.st_mtime); |
| 2950 | (void) FormatMagickSize(GetBlobSize(image),value); |
| 2951 | (void) SetImageProperty(thumbnail_image,"Thumb::Size",value); |
| 2952 | (void) FormatMagickString(value,MaxTextExtent,"image/%s",image->magick); |
| 2953 | LocaleLower(value); |
| 2954 | (void) SetImageProperty(thumbnail_image,"Thumb::Mimetype",value); |
| 2955 | (void) SetImageProperty(thumbnail_image,"software", |
| 2956 | GetMagickVersion(&version)); |
| 2957 | (void) FormatMagickString(value,MaxTextExtent,"%lu",image->magick_columns); |
| 2958 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::Width",value); |
| 2959 | (void) FormatMagickString(value,MaxTextExtent,"%lu",image->magick_rows); |
| 2960 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::height",value); |
| 2961 | (void) FormatMagickString(value,MaxTextExtent,"%lu", |
| 2962 | GetImageListLength(image)); |
| 2963 | (void) SetImageProperty(thumbnail_image,"Thumb::Document::Pages",value); |
| 2964 | return(thumbnail_image); |
| 2965 | } |
| 2966 | |
| 2967 | /* |
| 2968 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2969 | % % |
| 2970 | % % |
| 2971 | % % |
| 2972 | % Z o o m I m a g e % |
| 2973 | % % |
| 2974 | % % |
| 2975 | % % |
| 2976 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2977 | % |
| 2978 | % ZoomImage() creates a new image that is a scaled size of an existing one. |
| 2979 | % It allocates the memory necessary for the new Image structure and returns a |
| 2980 | % pointer to the new image. The Point filter gives fast pixel replication, |
| 2981 | % Triangle is equivalent to bi-linear interpolation, and Mitchel giver slower, |
| 2982 | % very high-quality results. See Graphic Gems III for details on this |
| 2983 | % algorithm. |
| 2984 | % |
| 2985 | % The filter member of the Image structure specifies which image filter to |
| 2986 | % use. Blur specifies the blur factor where > 1 is blurry, < 1 is sharp. |
| 2987 | % |
| 2988 | % The format of the ZoomImage method is: |
| 2989 | % |
| 2990 | % Image *ZoomImage(const Image *image,const unsigned long columns, |
| 2991 | % const unsigned long rows,ExceptionInfo *exception) |
| 2992 | % |
| 2993 | % A description of each parameter follows: |
| 2994 | % |
| 2995 | % o image: the image. |
| 2996 | % |
| 2997 | % o columns: An integer that specifies the number of columns in the zoom |
| 2998 | % image. |
| 2999 | % |
| 3000 | % o rows: An integer that specifies the number of rows in the scaled |
| 3001 | % image. |
| 3002 | % |
| 3003 | % o exception: return any errors or warnings in this structure. |
| 3004 | % |
| 3005 | */ |
| 3006 | MagickExport Image *ZoomImage(const Image *image,const unsigned long columns, |
| 3007 | const unsigned long rows,ExceptionInfo *exception) |
| 3008 | { |
| 3009 | Image |
| 3010 | *zoom_image; |
| 3011 | |
| 3012 | assert(image != (const Image *) NULL); |
| 3013 | assert(image->signature == MagickSignature); |
| 3014 | if (image->debug != MagickFalse) |
| 3015 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 3016 | assert(exception != (ExceptionInfo *) NULL); |
| 3017 | assert(exception->signature == MagickSignature); |
| 3018 | zoom_image=ResizeImage(image,columns,rows,image->filter,image->blur, |
| 3019 | exception); |
| 3020 | return(zoom_image); |
| 3021 | } |