cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1 | /* |
| 2 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3 | % % |
| 4 | % % |
| 5 | % % |
| 6 | % RRRR EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| 7 | % R R E SS I ZZ E % |
| 8 | % RRRR EEE SSS I ZZZ EEE % |
| 9 | % R R E SS I ZZ E % |
| 10 | % R R EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| 11 | % % |
| 12 | % % |
| 13 | % MagickCore Image Resize Methods % |
| 14 | % % |
| 15 | % Software Design % |
| 16 | % John Cristy % |
| 17 | % July 1992 % |
| 18 | % % |
| 19 | % % |
cristy | 16af1cb | 2009-12-11 21:38:29 +0000 | [diff] [blame] | 20 | % Copyright 1999-2010 ImageMagick Studio LLC, a non-profit organization % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 21 | % dedicated to making software imaging solutions freely available. % |
| 22 | % % |
| 23 | % You may not use this file except in compliance with the License. You may % |
| 24 | % obtain a copy of the License at % |
| 25 | % % |
| 26 | % http://www.imagemagick.org/script/license.php % |
| 27 | % % |
| 28 | % Unless required by applicable law or agreed to in writing, software % |
| 29 | % distributed under the License is distributed on an "AS IS" BASIS, % |
| 30 | % WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. % |
| 31 | % See the License for the specific language governing permissions and % |
| 32 | % limitations under the License. % |
| 33 | % % |
| 34 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 35 | % |
| 36 | % |
| 37 | */ |
| 38 | |
| 39 | /* |
| 40 | Include declarations. |
| 41 | */ |
| 42 | #include "magick/studio.h" |
| 43 | #include "magick/artifact.h" |
| 44 | #include "magick/blob.h" |
| 45 | #include "magick/cache.h" |
| 46 | #include "magick/cache-view.h" |
| 47 | #include "magick/color.h" |
| 48 | #include "magick/color-private.h" |
| 49 | #include "magick/draw.h" |
| 50 | #include "magick/exception.h" |
| 51 | #include "magick/exception-private.h" |
| 52 | #include "magick/gem.h" |
| 53 | #include "magick/image.h" |
| 54 | #include "magick/image-private.h" |
| 55 | #include "magick/list.h" |
| 56 | #include "magick/memory_.h" |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 57 | #include "magick/magick.h" |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 58 | #include "magick/pixel-private.h" |
| 59 | #include "magick/property.h" |
| 60 | #include "magick/monitor.h" |
| 61 | #include "magick/monitor-private.h" |
| 62 | #include "magick/pixel.h" |
| 63 | #include "magick/option.h" |
| 64 | #include "magick/resample.h" |
| 65 | #include "magick/resize.h" |
| 66 | #include "magick/resize-private.h" |
| 67 | #include "magick/string_.h" |
cristy | f2f2727 | 2009-12-17 14:48:46 +0000 | [diff] [blame] | 68 | #include "magick/string-private.h" |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 69 | #include "magick/thread-private.h" |
| 70 | #include "magick/utility.h" |
| 71 | #include "magick/version.h" |
| 72 | #if defined(MAGICKCORE_LQR_DELEGATE) |
| 73 | #include <lqr.h> |
| 74 | #endif |
| 75 | |
| 76 | /* |
| 77 | Typedef declarations. |
| 78 | */ |
| 79 | struct _ResizeFilter |
| 80 | { |
| 81 | MagickRealType |
| 82 | (*filter)(const MagickRealType,const ResizeFilter *), |
| 83 | (*window)(const MagickRealType,const ResizeFilter *), |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 84 | support, /* filter region of support - the filter support limit */ |
| 85 | window_support, /* window support, usally equal to support (expert only) */ |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 86 | scale, /* dimension scaling to fit window support (usally 1.0) */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 87 | blur, /* x-scale (blur-sharpen) */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 88 | coeff[8]; /* cubic coefficents for smooth Cubic filters */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 89 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 90 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 91 | signature; |
| 92 | }; |
| 93 | |
| 94 | /* |
| 95 | Forward declaractions. |
| 96 | */ |
| 97 | static MagickRealType |
| 98 | I0(MagickRealType x), |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 99 | BesselOrderOne(MagickRealType), |
anthony | 07a3f7f | 2010-09-16 03:03:11 +0000 | [diff] [blame] | 100 | Sinc(const MagickRealType, const ResizeFilter *), |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 101 | SincFast(const MagickRealType, const ResizeFilter *); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 102 | |
| 103 | /* |
| 104 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 105 | % % |
| 106 | % % |
| 107 | % % |
| 108 | + F i l t e r F u n c t i o n s % |
| 109 | % % |
| 110 | % % |
| 111 | % % |
| 112 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 113 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 114 | % These are the various filter and windowing functions that are provided. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 115 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 116 | % They are internal to this module only. See AcquireResizeFilterInfo() for |
| 117 | % details of the access to these functions, via the GetResizeFilterSupport() |
| 118 | % and GetResizeFilterWeight() API interface. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 119 | % |
| 120 | % The individual filter functions have this format... |
| 121 | % |
| 122 | % static MagickRealtype *FilterName(const MagickRealType x, |
| 123 | % const MagickRealType support) |
| 124 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 125 | % A description of each parameter follows: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 126 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 127 | % o x: the distance from the sampling point generally in the range of 0 to |
| 128 | % support. The GetResizeFilterWeight() ensures this a positive value. |
| 129 | % |
| 130 | % o resize_filter: current filter information. This allows function to |
| 131 | % access support, and possibly other pre-calculated information defining |
| 132 | % the functions. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 133 | % |
| 134 | */ |
| 135 | |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 136 | #define MagickPIL ((MagickRealType) 3.14159265358979323846264338327950288420L) |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 137 | |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 138 | static MagickRealType Jinc(const MagickRealType x, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 139 | const ResizeFilter *magick_unused(resize_filter)) |
| 140 | { |
| 141 | /* |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 142 | See Pratt "Digital Image Processing" p.97 for Jinc/Bessel functions. |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 143 | http://mathworld.wolfram.com/JincFunction.html and page 11 of |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 144 | http://www.ph.ed.ac.uk/%7ewjh/teaching/mo/slides/lens/lens.pdf |
| 145 | |
nicolas | e473f72 | 2010-10-07 00:05:13 +0000 | [diff] [blame] | 146 | The original "zoom" program by Paul Heckbert called this "Bessel". |
| 147 | But really it is more accurately named "Jinc". |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 148 | */ |
| 149 | if (x == 0.0) |
nicolas | 5a36f34 | 2010-10-07 00:11:32 +0000 | [diff] [blame] | 150 | return(0.5*MagickPIL); |
| 151 | return(BesselOrderOne(MagickPIL*x)/x); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 152 | } |
| 153 | |
| 154 | static MagickRealType Blackman(const MagickRealType x, |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 155 | const ResizeFilter *magick_unused(resize_filter)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 156 | { |
| 157 | /* |
cristy | 8301792 | 2010-09-05 20:45:15 +0000 | [diff] [blame] | 158 | Blackman: 2nd order cosine windowing function: |
cristy | 21ce88a | 2010-09-05 01:37:25 +0000 | [diff] [blame] | 159 | 0.42 + 0.5 cos(pi x) + 0.08 cos(2pi x) |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 160 | Refactored by Chantal Racette and Nicolas Robidoux to one trig |
| 161 | call and five flops. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 162 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 163 | const MagickRealType cospix = cos((double) (MagickPIL*x)); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 164 | return(0.34+cospix*(0.5+cospix*0.16)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 165 | } |
| 166 | |
| 167 | static MagickRealType Bohman(const MagickRealType x, |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 168 | const ResizeFilter *magick_unused(resize_filter)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 169 | { |
| 170 | /* |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 171 | Bohman: 2rd Order cosine windowing function: |
| 172 | (1-x) cos(pi x) + sin(pi x) / pi. |
nicolas | a4f7b4a | 2010-09-20 20:28:38 +0000 | [diff] [blame] | 173 | Refactored by Nicolas Robidoux to one trig call, one sqrt call, |
| 174 | and 7 flops, taking advantage of the fact that the support of |
| 175 | Bohman is 1 (so that we know that sin(pi x) >= 0). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 176 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 177 | const double cospix = cos((double) (MagickPIL*x)); |
nicolas | a4f7b4a | 2010-09-20 20:28:38 +0000 | [diff] [blame] | 178 | const double sinpix = sqrt(1.0-cospix*cospix); |
nicolas | 2ffd3b2 | 2010-09-24 20:27:31 +0000 | [diff] [blame] | 179 | return((1.0-x)*cospix+(1.0/MagickPIL)*sinpix); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 180 | } |
| 181 | |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 182 | static MagickRealType Box(const MagickRealType magick_unused(x), |
| 183 | const ResizeFilter *magick_unused(resize_filter)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 184 | { |
| 185 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 186 | A Box filter is a equal weighting function (all weights equal). |
anthony | c331dec | 2010-09-26 01:30:14 +0000 | [diff] [blame] | 187 | DO NOT LIMIT results by support or resize point sampling will work |
| 188 | as it requests points beyond its normal 0.0 support size. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 189 | */ |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 190 | return(1.0); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 191 | } |
| 192 | |
| 193 | static MagickRealType CubicBC(const MagickRealType x, |
| 194 | const ResizeFilter *resize_filter) |
| 195 | { |
| 196 | /* |
| 197 | Cubic Filters using B,C determined values: |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 198 | Mitchell-Netravali B=1/3 C=1/3 Qualitively ideal Cubic Filter |
| 199 | Catmull-Rom B= 0 C=1/2 Cublic Interpolation Function |
| 200 | Cubic B-Spline B= 1 C= 0 Spline Approximation of Gaussian |
| 201 | Hermite B= 0 C= 0 Quadratic Spline (support = 1) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 202 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 203 | See paper by Mitchell and Netravali, Reconstruction Filters in Computer |
| 204 | Graphics Computer Graphics, Volume 22, Number 4, August 1988 |
| 205 | http://www.cs.utexas.edu/users/fussell/courses/cs384g/lectures/mitchell/ |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 206 | Mitchell.pdf. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 207 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 208 | Coefficents are determined from B,C values: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 209 | P0 = ( 6 - 2*B )/6 |
| 210 | P1 = 0 |
| 211 | P2 = (-18 +12*B + 6*C )/6 |
| 212 | P3 = ( 12 - 9*B - 6*C )/6 |
| 213 | Q0 = ( 8*B +24*C )/6 |
| 214 | Q1 = ( -12*B -48*C )/6 |
| 215 | Q2 = ( 6*B +30*C )/6 |
| 216 | Q3 = ( - 1*B - 6*C )/6 |
| 217 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 218 | which are used to define the filter: |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 219 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 220 | P0 + P1*x + P2*x^2 + P3*x^3 0 <= x < 1 |
| 221 | Q0 + Q1*x + Q2*x^2 + Q3*x^3 1 <= x <= 2 |
| 222 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 223 | which ensures function is continuous in value and derivative (slope). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 224 | */ |
| 225 | if (x < 1.0) |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 226 | return(resize_filter->coeff[0]+x*(resize_filter->coeff[1]+x* |
| 227 | (resize_filter->coeff[2]+x*resize_filter->coeff[3]))); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 228 | if (x < 2.0) |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 229 | return(resize_filter->coeff[4]+x*(resize_filter->coeff[5]+x* |
| 230 | (resize_filter->coeff[6]+x*resize_filter->coeff[7]))); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 231 | return(0.0); |
| 232 | } |
| 233 | |
| 234 | static MagickRealType Gaussian(const MagickRealType x, |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 235 | const ResizeFilter *resize_filter) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 236 | { |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 237 | /* |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 238 | Gaussian with a fixed sigma = 1/2 |
| 239 | |
| 240 | Gaussian Formula... |
| 241 | exp( -(x^2)/((2.0*sigma^2) ) / sqrt(2*PI*sigma^2))) |
| 242 | The constants are pre-calculated... |
| 243 | exp( -coeff[0]*(x^2)) ) * coeff[1] |
| 244 | However the multiplier coefficent is not needed and not used. |
| 245 | |
| 246 | This separates the gaussian 'sigma' value from the 'blur/support' settings |
| 247 | allows for its use in special 'small sigma' gaussians, without the filter |
| 248 | 'missing' pixels when blur and thus support becomes too small. |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 249 | */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 250 | return(exp((double)(-resize_filter->coeff[0]*x*x))); } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 251 | |
| 252 | static MagickRealType Hanning(const MagickRealType x, |
| 253 | const ResizeFilter *magick_unused(resize_filter)) |
| 254 | { |
| 255 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 256 | Cosine window function: |
| 257 | .5+.5cos(pi x). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 258 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 259 | const MagickRealType cospix = cos((double) (MagickPIL*x)); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 260 | return(0.5+0.5*cospix); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 261 | } |
| 262 | |
| 263 | static MagickRealType Hamming(const MagickRealType x, |
| 264 | const ResizeFilter *magick_unused(resize_filter)) |
| 265 | { |
| 266 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 267 | Offset cosine window function: |
| 268 | .54 + .46 cos(pi x). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 269 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 270 | const MagickRealType cospix = cos((double) (MagickPIL*x)); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 271 | return(0.54+0.46*cospix); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 272 | } |
| 273 | |
| 274 | static MagickRealType Kaiser(const MagickRealType x, |
| 275 | const ResizeFilter *magick_unused(resize_filter)) |
| 276 | { |
| 277 | #define Alpha 6.5 |
| 278 | #define I0A (1.0/I0(Alpha)) |
| 279 | |
| 280 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 281 | Kaiser Windowing Function (bessel windowing): Alpha is a free |
| 282 | value from 5 to 8 (currently hardcoded to 6.5). |
| 283 | Future: make alpha the IOA pre-calculation, an 'expert' setting. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 284 | */ |
| 285 | return(I0A*I0(Alpha*sqrt((double) (1.0-x*x)))); |
| 286 | } |
| 287 | |
| 288 | static MagickRealType Lagrange(const MagickRealType x, |
| 289 | const ResizeFilter *resize_filter) |
| 290 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 291 | MagickRealType |
| 292 | value; |
| 293 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 294 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 295 | i; |
| 296 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 297 | ssize_t |
| 298 | n, |
| 299 | order; |
| 300 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 301 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 302 | Lagrange piecewise polynomial fit of sinc: N is the 'order' of the |
| 303 | lagrange function and depends on the overall support window size |
| 304 | of the filter. That is: for a support of 2, it gives a lagrange-4 |
| 305 | (piecewise cubic function). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 306 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 307 | "n" identifies the piece of the piecewise polynomial. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 308 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 309 | See Survey: Interpolation Methods, IEEE Transactions on Medical |
| 310 | Imaging, Vol 18, No 11, November 1999, p1049-1075, -- Equation 27 |
| 311 | on p1064. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 312 | */ |
| 313 | if (x > resize_filter->support) |
| 314 | return(0.0); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 315 | order=(ssize_t) (2.0*resize_filter->window_support); /* number of pieces */ |
anthony | c2d07db | 2010-09-15 23:47:40 +0000 | [diff] [blame] | 316 | /*n=(ssize_t)((1.0*order)/2.0+x); -- which piece does x belong to */ |
| 317 | n = (ssize_t)(resize_filter->window_support + x); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 318 | value=1.0f; |
| 319 | for (i=0; i < order; i++) |
| 320 | if (i != n) |
| 321 | value*=(n-i-x)/(n-i); |
| 322 | return(value); |
| 323 | } |
| 324 | |
| 325 | static MagickRealType Quadratic(const MagickRealType x, |
| 326 | const ResizeFilter *magick_unused(resize_filter)) |
| 327 | { |
| 328 | /* |
| 329 | 2rd order (quadratic) B-Spline approximation of Gaussian. |
| 330 | */ |
| 331 | if (x < 0.5) |
| 332 | return(0.75-x*x); |
| 333 | if (x < 1.5) |
| 334 | return(0.5*(x-1.5)*(x-1.5)); |
| 335 | return(0.0); |
| 336 | } |
| 337 | |
anthony | 07a3f7f | 2010-09-16 03:03:11 +0000 | [diff] [blame] | 338 | static MagickRealType Sinc(const MagickRealType x, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 339 | const ResizeFilter *magick_unused(resize_filter)) |
| 340 | { |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 341 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 342 | Scaled sinc(x) function using a trig call: |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 343 | sinc(x) == sin(pi x)/(pi x). |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 344 | */ |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 345 | if (x != 0.0) |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 346 | { |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 347 | const MagickRealType pix = (MagickRealType) (MagickPIL*x); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 348 | return(sin((double) pix)/pix); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 349 | } |
nicolas | 2ffd3b2 | 2010-09-24 20:27:31 +0000 | [diff] [blame] | 350 | return((MagickRealType) 1.0); |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 351 | } |
| 352 | |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 353 | static MagickRealType SincFast(const MagickRealType x, |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 354 | const ResizeFilter *magick_unused(resize_filter)) |
| 355 | { |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 356 | /* |
| 357 | Approximations of the sinc function sin(pi x)/(pi x) over the |
| 358 | interval [-4,4] constructed by Nicolas Robidoux and Chantal |
| 359 | Racette with funding from the Natural Sciences and Engineering |
| 360 | Research Council of Canada. |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 361 | |
| 362 | Although the approximations are polynomials (for low order of |
| 363 | approximation) and quotients of polynomials (for higher order of |
| 364 | approximation) and consequently are similar in form to Taylor |
| 365 | polynomials/Pade approximants, the approximations are computed |
| 366 | with a completely different technique. |
| 367 | |
| 368 | Summary: These approximations are "the best" in terms of bang |
| 369 | (accuracy) for the buck (flops). More specifically: Among the |
| 370 | polynomial quotients that can be computed using a fixed number of |
| 371 | flops (with a given "+ - * / budget"), the chosen polynomial |
| 372 | quotient is the one closest to the approximated function with |
| 373 | respect to maximum absolute relative error over the given |
| 374 | interval. |
| 375 | |
| 376 | The Remez algorithm, as implemented in the boost library's minimax |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 377 | package, is the key to the construction: |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 378 | http://www.boost.org/doc/libs/1_36_0/libs/math/doc/... |
| 379 | ...sf_and_dist/html/math_toolkit/backgrounders/remez.html |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 380 | */ |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 381 | /* |
| 382 | If outside of the interval of approximation, use the standard trig |
| 383 | formula. |
| 384 | */ |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 385 | if (x > 4.0) |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 386 | { |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 387 | const MagickRealType pix = (MagickRealType) (MagickPIL*x); |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 388 | return(sin((double) pix)/pix); |
| 389 | } |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 390 | { |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 391 | /* |
| 392 | The approximations only depend on x^2 (sinc is an even |
| 393 | function). |
| 394 | */ |
| 395 | const MagickRealType xx = x*x; |
cristy | 8301792 | 2010-09-05 20:45:15 +0000 | [diff] [blame] | 396 | #if MAGICKCORE_QUANTUM_DEPTH <= 8 |
| 397 | /* |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 398 | Maximum absolute relative error 6.3e-6 < 1/2^17. |
cristy | 738e756 | 2010-09-01 12:48:07 +0000 | [diff] [blame] | 399 | */ |
| 400 | const MagickRealType c0 = 0.173610016489197553621906385078711564924e-2L; |
| 401 | const MagickRealType c1 = -0.384186115075660162081071290162149315834e-3L; |
| 402 | const MagickRealType c2 = 0.393684603287860108352720146121813443561e-4L; |
| 403 | const MagickRealType c3 = -0.248947210682259168029030370205389323899e-5L; |
| 404 | const MagickRealType c4 = 0.107791837839662283066379987646635416692e-6L; |
| 405 | const MagickRealType c5 = -0.324874073895735800961260474028013982211e-8L; |
| 406 | const MagickRealType c6 = 0.628155216606695311524920882748052490116e-10L; |
| 407 | const MagickRealType c7 = -0.586110644039348333520104379959307242711e-12L; |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 408 | const MagickRealType p = |
| 409 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*c7)))))); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 410 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)*p); |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 411 | #elif MAGICKCORE_QUANTUM_DEPTH <= 16 |
cristy | dbeb3eb | 2010-09-09 13:41:36 +0000 | [diff] [blame] | 412 | /* |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 413 | Max. abs. rel. error 2.2e-8 < 1/2^25. |
cristy | dbeb3eb | 2010-09-09 13:41:36 +0000 | [diff] [blame] | 414 | */ |
| 415 | const MagickRealType c0 = 0.173611107357320220183368594093166520811e-2L; |
| 416 | const MagickRealType c1 = -0.384240921114946632192116762889211361285e-3L; |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 417 | const MagickRealType c2 = 0.394201182359318128221229891724947048771e-4L; |
| 418 | const MagickRealType c3 = -0.250963301609117217660068889165550534856e-5L; |
| 419 | const MagickRealType c4 = 0.111902032818095784414237782071368805120e-6L; |
| 420 | const MagickRealType c5 = -0.372895101408779549368465614321137048875e-8L; |
| 421 | const MagickRealType c6 = 0.957694196677572570319816780188718518330e-10L; |
cristy | dbeb3eb | 2010-09-09 13:41:36 +0000 | [diff] [blame] | 422 | const MagickRealType c7 = -0.187208577776590710853865174371617338991e-11L; |
| 423 | const MagickRealType c8 = 0.253524321426864752676094495396308636823e-13L; |
| 424 | const MagickRealType c9 = -0.177084805010701112639035485248501049364e-15L; |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 425 | const MagickRealType p = |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 426 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*(c7+xx*(c8+xx*c9)))))))); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 427 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)*p); |
nicolas | c2d28f0 | 2010-09-27 18:56:15 +0000 | [diff] [blame] | 428 | #else |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 429 | /* |
| 430 | Max. abs. rel. error 1.2e-12 < 1/2^39. |
| 431 | */ |
| 432 | const MagickRealType c0 = 0.173611111110910715186413700076827593074e-2L; |
| 433 | const MagickRealType c1 = -0.289105544717893415815859968653611245425e-3L; |
| 434 | const MagickRealType c2 = 0.206952161241815727624413291940849294025e-4L; |
| 435 | const MagickRealType c3 = -0.834446180169727178193268528095341741698e-6L; |
| 436 | const MagickRealType c4 = 0.207010104171026718629622453275917944941e-7L; |
| 437 | const MagickRealType c5 = -0.319724784938507108101517564300855542655e-9L; |
| 438 | const MagickRealType c6 = 0.288101675249103266147006509214934493930e-11L; |
| 439 | const MagickRealType c7 = -0.118218971804934245819960233886876537953e-13L; |
| 440 | const MagickRealType p = |
| 441 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*c7)))))); |
| 442 | const MagickRealType d0 = 1.0L; |
| 443 | const MagickRealType d1 = 0.547981619622284827495856984100563583948e-1L; |
| 444 | const MagickRealType d2 = 0.134226268835357312626304688047086921806e-2L; |
| 445 | const MagickRealType d3 = 0.178994697503371051002463656833597608689e-4L; |
| 446 | const MagickRealType d4 = 0.114633394140438168641246022557689759090e-6L; |
| 447 | const MagickRealType q = d0+xx*(d1+xx*(d2+xx*(d3+xx*d4))); |
| 448 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)/q*p); |
cristy | 657c635 | 2010-08-29 14:05:08 +0000 | [diff] [blame] | 449 | #endif |
cristy | 8301792 | 2010-09-05 20:45:15 +0000 | [diff] [blame] | 450 | } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 451 | } |
| 452 | |
| 453 | static MagickRealType Triangle(const MagickRealType x, |
| 454 | const ResizeFilter *magick_unused(resize_filter)) |
| 455 | { |
| 456 | /* |
nicolas | 0edb086 | 2010-09-19 18:56:19 +0000 | [diff] [blame] | 457 | 1st order (linear) B-Spline, bilinear interpolation, Tent 1D |
| 458 | filter, or a Bartlett 2D Cone filter. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 459 | */ |
| 460 | if (x < 1.0) |
| 461 | return(1.0-x); |
| 462 | return(0.0); |
| 463 | } |
| 464 | |
| 465 | static MagickRealType Welsh(const MagickRealType x, |
| 466 | const ResizeFilter *magick_unused(resize_filter)) |
| 467 | { |
| 468 | /* |
| 469 | Welsh parabolic windowing filter. |
| 470 | */ |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 471 | if (x < 1.0) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 472 | return(1.0-x*x); |
| 473 | return(0.0); |
| 474 | } |
| 475 | |
| 476 | /* |
| 477 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 478 | % % |
| 479 | % % |
| 480 | % % |
| 481 | + A c q u i r e R e s i z e F i l t e r % |
| 482 | % % |
| 483 | % % |
| 484 | % % |
| 485 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 486 | % |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 487 | % AcquireResizeFilter() allocates the ResizeFilter structure. Choose |
| 488 | % from these filters: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 489 | % |
| 490 | % FIR (Finite impulse Response) Filters |
| 491 | % Box Triangle Quadratic |
| 492 | % Cubic Hermite Catrom |
| 493 | % Mitchell |
| 494 | % |
| 495 | % IIR (Infinite impulse Response) Filters |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 496 | % Gaussian Sinc Jinc (Bessel) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 497 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 498 | % Windowed Sinc/Jinc Filters |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 499 | % Blackman Hanning Hamming |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 500 | % Kaiser Lanczos |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 501 | % |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 502 | % Special purpose Filters |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 503 | % SincFast Lanczos2D Robidoux |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 504 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 505 | % The users "-filter" selection is used to lookup the default 'expert' |
| 506 | % settings for that filter from a internal table. However any provided |
| 507 | % 'expert' settings (see below) may override this selection. |
| 508 | % |
| 509 | % FIR filters are used as is, and are limited to that filters support |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 510 | % window (unless over-ridden). 'Gaussian' while classed as an IIR |
anthony | c331dec | 2010-09-26 01:30:14 +0000 | [diff] [blame] | 511 | % filter, is also simply clipped by its support size (currently 1.5 |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 512 | % or approximatally 3*sigma as recommended by many references) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 513 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 514 | % The selection is typically either a windowed Sinc, or interpolated |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 515 | % filter, for use by functions such as ResizeImage(). However if a |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 516 | % 'cylindrical' filter flag is requested, any default Sinc weighting |
| 517 | % and windowing functions will be promoted to cylindrical Jinc form of |
| 518 | % function. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 519 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 520 | % Directly requesting 'Sinc' or 'Jinc' will force the use of that |
| 521 | % filter function without any windowing. This is not recommended, |
| 522 | % except by image processing experts or in expert options. Selecting a |
| 523 | % window filtering version of these functions is better. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 524 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 525 | % Lanczos is a special case of a Sinc-windowed Sinc, (or Jinc-Jinc for |
| 526 | % the cylindrical case) but defaulting to 3-lobe support, rather that |
| 527 | % the default 4 lobe support of the other windowed sinc/jinc filters. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 528 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 529 | % Two forms of the 'Sinc' function are available: Sinc and SincFast. |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 530 | % Sinc is computed using the traditional sin(pi*x)/(pi*x); it is |
| 531 | % selected if the user specifically specifies the use of a Sinc |
| 532 | % filter. SincFast uses highly accurate (and fast) polynomial (low Q) |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 533 | % and rational (high Q) approximations, and will be used by default in |
| 534 | % most cases. |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 535 | % |
nicolas | 1eb2fcf | 2010-10-10 20:45:17 +0000 | [diff] [blame] | 536 | % The Lanczos2D and Robidoux filters are tuned for cylindrical |
| 537 | % (radial) EWA (Elliptical Weighted Average) distortion. Lanczos2D |
nicolas | dff19b4 | 2010-10-10 20:53:13 +0000 | [diff] [blame] | 538 | % is a 2 lobe Lanczos-like filter using Jinc (for EWA) or Sinc. |
nicolas | 6ca6e96 | 2010-10-10 20:49:01 +0000 | [diff] [blame] | 539 | % Robidoux used to be a sharpened version of Lanczos2D (with |
nicolas | dff19b4 | 2010-10-10 20:53:13 +0000 | [diff] [blame] | 540 | % blur=0.958033808). Now, it is the unique Cubic 'Keys' filter that |
| 541 | % exactly preserves images with only vertical or horizontal features |
| 542 | % when performing 'no-op" with EWA distortion. It turns out to be |
nicolas | 219dd84 | 2010-10-10 21:02:40 +0000 | [diff] [blame] | 543 | % close to both plain Mitchell and "sharpened" Lanczos2D. |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 544 | % |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 545 | % Special 'expert' options can be used to override any and all filter |
| 546 | % settings. This is not advised unless you have expert knowledge of |
| 547 | % the use of resampling filtered techniques. Check on the results of |
| 548 | % your selections using the "filter:verbose" setting to make sure you |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 549 | % get the exact filter that you are tring to achieve. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 550 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 551 | % "filter:filter" Select the main function associated with |
| 552 | % this filter name, as the weighting function of the filter. |
| 553 | % This can be used to set a windowing function as a weighting |
| 554 | % function, for special purposes, such as graphing. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 555 | % |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 556 | % If a "filter:window" operation has not been provided, then a 'Box' |
| 557 | % windowing function will be set to denote that no windowing function |
| 558 | % is being used. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 559 | % |
| 560 | % "filter:window" Select this windowing function for the filter. |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 561 | % While any filter could be used as a windowing function, using the |
| 562 | % 'first lobe' of that filter over the whole support window, using a |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 563 | % non-windowing function is not advisible. If no weighting filter |
| 564 | % function is specifed a 'SincFast' filter will be used. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 565 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 566 | % "filter:lobes" Number of lobes to use for the Sinc/Jinc filter. |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 567 | % This a simpler method of setting filter support size that will |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 568 | % correctly handle the Sinc/Jinc switch for an operators filtering |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 569 | % requirements. Only integers should be given. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 570 | % |
| 571 | % "filter:support" Set the support size for filtering to the size given |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 572 | % This not recommended for Sinc/Jinc windowed filters (lobes should |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 573 | % be used instead). This will override any 'filter:lobes' option. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 574 | % |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 575 | % "filter:win-support" Scale windowing function to this size instead. |
| 576 | % This causes the windowing (or self-windowing Lagrange filter) to act |
| 577 | % is if the support window it much much larger than what is actually |
| 578 | % supplied to the calling operator. The filter however is still |
| 579 | % clipped to the real support size given, by the support range suppiled |
| 580 | % to the caller. If unset this will equal the normal filter support |
| 581 | % size. |
| 582 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 583 | % "filter:blur" Scale the filter and support window by this amount. |
| 584 | % A value >1 will generally result in a more burred image with |
| 585 | % more ringing effects, while a value <1 will sharpen the |
| 586 | % resulting image with more aliasing and Morie effects. |
| 587 | % |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 588 | % "filter:sigma" The sigma value to use for the Gaussian filter only. |
| 589 | % Defaults to '1/2' for orthogonal and 'sqrt(2)/2' for cylindrical |
| 590 | % usage. It effectially provides a alturnative to 'blur' for Gaussians |
| 591 | % without it also effecting the final 'practical support' size. |
| 592 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 593 | % "filter:b" |
| 594 | % "filter:c" Override the preset B,C values for a Cubic type of filter |
| 595 | % If only one of these are given it is assumes to be a 'Keys' |
| 596 | % type of filter such that B+2C=1, where Keys 'alpha' value = C |
| 597 | % |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 598 | % "filter:verbose" Output the exact results of the filter selections |
| 599 | % made, as well as plotting data for graphing the resulting filter |
| 600 | % over support range (blur adjusted). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 601 | % |
| 602 | % Set a true un-windowed Sinc filter with 10 lobes (very slow) |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 603 | % -define filter:filter=Sinc |
| 604 | % -define filter:lobes=8 |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 605 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 606 | % For example force an 8 lobe Lanczos (Sinc or Jinc) filter... |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 607 | % -filter Lanczos |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 608 | % -define filter:lobes=8 |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 609 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 610 | % The format of the AcquireResizeFilter method is: |
| 611 | % |
| 612 | % ResizeFilter *AcquireResizeFilter(const Image *image, |
| 613 | % const FilterTypes filter_type, const MagickBooleanType radial, |
| 614 | % ExceptionInfo *exception) |
| 615 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 616 | % A description of each parameter follows: |
| 617 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 618 | % o image: the image. |
| 619 | % |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 620 | % o filter: the filter type, defining a preset filter, window and |
| 621 | % support. The artifact settings listed above will override |
| 622 | % those selections. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 623 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 624 | % o blur: blur the filter by this amount, use 1.0 if unknown. Image |
| 625 | % artifact "filter:blur" will override this API call usage, including |
| 626 | % any internal change (such as for cylindrical usage). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 627 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 628 | % o radial: use a 1D orthogonal filter (Sinc) or 2D cylindrical |
| 629 | % (radial) filter (Jinc) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 630 | % |
| 631 | % o exception: return any errors or warnings in this structure. |
| 632 | % |
| 633 | */ |
| 634 | MagickExport ResizeFilter *AcquireResizeFilter(const Image *image, |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 635 | const FilterTypes filter,const MagickRealType blur, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 636 | const MagickBooleanType cylindrical,ExceptionInfo *exception) |
| 637 | { |
| 638 | const char |
| 639 | *artifact; |
| 640 | |
| 641 | FilterTypes |
| 642 | filter_type, |
| 643 | window_type; |
| 644 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 645 | MagickRealType |
| 646 | B, |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 647 | C, |
| 648 | sigma; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 649 | |
| 650 | register ResizeFilter |
| 651 | *resize_filter; |
| 652 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 653 | ssize_t |
| 654 | option; |
| 655 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 656 | /* |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 657 | Table Mapping given Filter, into Weighting and Windowing functions. |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 658 | A 'Box' windowing function means its a simble non-windowed filter. |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 659 | An 'SincFast' filter function could be upgraded to a 'Jinc' filter |
| 660 | if a "cylindrical", unless a 'Sinc' or 'SincFast' filter was |
| 661 | specifically requested. |
anthony | 449887b | 2010-09-10 02:23:33 +0000 | [diff] [blame] | 662 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 663 | WARNING: The order of this tabel must match the order of the |
| 664 | FilterTypes enumeration specified in "resample.h", or the filter |
| 665 | names will not match the filter being setup. |
anthony | 1e2d5ca | 2010-09-10 02:24:35 +0000 | [diff] [blame] | 666 | |
| 667 | You can check filter setups with the "filter:verbose" setting. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 668 | */ |
| 669 | static struct |
| 670 | { |
| 671 | FilterTypes |
| 672 | filter, |
| 673 | window; |
| 674 | } const mapping[SentinelFilter] = |
| 675 | { |
anthony | 462ee07 | 2010-09-27 12:34:02 +0000 | [diff] [blame] | 676 | { UndefinedFilter, BoxFilter }, /* Undefined (default to Box) */ |
| 677 | { PointFilter, BoxFilter }, /* SPECIAL: Nearest neighbour */ |
| 678 | { BoxFilter, BoxFilter }, /* Box averaging filter */ |
| 679 | { TriangleFilter, BoxFilter }, /* Linear interpolation filter */ |
| 680 | { HermiteFilter, BoxFilter }, /* Hermite interpolation filter */ |
| 681 | { SincFastFilter, HanningFilter }, /* Hanning -- cosine-sinc */ |
| 682 | { SincFastFilter, HammingFilter }, /* Hamming -- '' variation */ |
| 683 | { SincFastFilter, BlackmanFilter }, /* Blackman -- 2*cosine-sinc */ |
| 684 | { GaussianFilter, BoxFilter }, /* Gaussian blur filter */ |
| 685 | { QuadraticFilter, BoxFilter }, /* Quadratic Gaussian approximation */ |
| 686 | { CubicFilter, BoxFilter }, /* Cubic B-Spline */ |
| 687 | { CatromFilter, BoxFilter }, /* Cubic interpolator */ |
| 688 | { MitchellFilter, BoxFilter }, /* 'Ideal' cubic filter */ |
| 689 | { LanczosFilter, SincFastFilter }, /* SPECIAL: 3-lobed sinc-sinc */ |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 690 | { JincFilter, BoxFilter }, /* Raw 3-lobed Jinc function */ |
| 691 | { SincFilter, BoxFilter }, /* Raw 4-lobed Sinc function */ |
anthony | 462ee07 | 2010-09-27 12:34:02 +0000 | [diff] [blame] | 692 | { SincFastFilter, KaiserFilter }, /* Kaiser -- square root-sinc */ |
| 693 | { SincFastFilter, WelshFilter }, /* Welsh -- parabolic-sinc */ |
| 694 | { SincFastFilter, CubicFilter }, /* Parzen -- cubic-sinc */ |
| 695 | { LagrangeFilter, BoxFilter }, /* Lagrange self-windowing filter */ |
| 696 | { SincFastFilter, BohmanFilter }, /* Bohman -- 2*cosine-sinc */ |
| 697 | { SincFastFilter, TriangleFilter }, /* Bartlett -- triangle-sinc */ |
| 698 | { SincFastFilter, BoxFilter }, /* Raw fast sinc ("Pade"-type) */ |
nicolas | 5835ee0 | 2010-10-10 20:40:15 +0000 | [diff] [blame] | 699 | { Lanczos2DFilter, JincFilter }, /* SPECIAL: 2-lobed jinc-jinc */ |
anthony | e5f0645 | 2010-10-12 05:48:17 +0000 | [diff] [blame^] | 700 | { Lanczos2DSharpFilter, JincFilter },/* SPECIAL: ditto sharpened */ |
| 701 | { RobidouxFilter, BoxFilter }, /* SPECIAL: Keys cubic tuned for EWA */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 702 | }; |
| 703 | /* |
nicolas | 32f44eb | 2010-09-20 01:23:12 +0000 | [diff] [blame] | 704 | Table mapping the filter/window from the above table to an actual |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 705 | function. The default support size for that filter as a weighting |
| 706 | function, the range to scale with to use that function as a sinc |
| 707 | windowing function, (typ 1.0). |
anthony | 933b4bf | 2010-09-10 02:31:37 +0000 | [diff] [blame] | 708 | |
anthony | 07a3f7f | 2010-09-16 03:03:11 +0000 | [diff] [blame] | 709 | Note that the filter_type -> function is 1 to 1 except for Sinc(), |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 710 | SincFast(), and CubicBC() functions, which may have multiple |
| 711 | filter to function associations. |
| 712 | |
| 713 | See "filter:verbose" handling below for the function -> filter |
| 714 | mapping. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 715 | */ |
| 716 | static struct |
| 717 | { |
| 718 | MagickRealType |
| 719 | (*function)(const MagickRealType, const ResizeFilter*), |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 720 | lobes, /* default lobes/support size of the weighting filter */ |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 721 | scale, /* windowing function range, for scaling windowing function */ |
anthony | 933b4bf | 2010-09-10 02:31:37 +0000 | [diff] [blame] | 722 | B,C; /* Cubic Filter factors for a CubicBC function, else ignored */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 723 | } const filters[SentinelFilter] = |
| 724 | { |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 725 | { Box, 0.5, 0.5, 0.0, 0.0 }, /* Undefined (default to Box) */ |
| 726 | { Box, 0.0, 0.5, 0.0, 0.0 }, /* Point (special handling) */ |
| 727 | { Box, 0.5, 0.5, 0.0, 0.0 }, /* Box */ |
| 728 | { Triangle, 1.0, 1.0, 0.0, 0.0 }, /* Triangle */ |
| 729 | { CubicBC, 1.0, 1.0, 0.0, 0.0 }, /* Hermite (cubic B=C=0) */ |
| 730 | { Hanning, 1.0, 1.0, 0.0, 0.0 }, /* Hanning, cosine window */ |
| 731 | { Hamming, 1.0, 1.0, 0.0, 0.0 }, /* Hamming, '' variation */ |
| 732 | { Blackman, 1.0, 1.0, 0.0, 0.0 }, /* Blackman, 2*cosine window */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 733 | { Gaussian, 2.0, 1.5, 0.0, 0.0 }, /* Gaussian */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 734 | { Quadratic, 1.5, 1.5, 0.0, 0.0 }, /* Quadratic gaussian */ |
| 735 | { CubicBC, 2.0, 2.0, 1.0, 0.0 }, /* Cubic B-Spline (B=1,C=0) */ |
| 736 | { CubicBC, 2.0, 1.0, 0.0, 0.5 }, /* Catmull-Rom (B=0,C=1/2) */ |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 737 | { CubicBC, 2.0, 1.0, 1./3., 1./3. }, /* Mitchell (B=C=1/3) */ |
| 738 | { SincFast, 3.0, 1.0, 0.0, 0.0 }, /* Lanczos, 3-lobed Sinc-Sinc */ |
| 739 | { Jinc, 3.0, 1.21967, 0.0, 0.0 }, /* Raw 3-lobed Jinc */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 740 | { Sinc, 4.0, 1.0, 0.0, 0.0 }, /* Raw 4-lobed Sinc */ |
| 741 | { Kaiser, 1.0, 1.0, 0.0, 0.0 }, /* Kaiser (square root window) */ |
| 742 | { Welsh, 1.0, 1.0, 0.0, 0.0 }, /* Welsh (parabolic window) */ |
| 743 | { CubicBC, 2.0, 2.0, 1.0, 0.0 }, /* Parzen (B-Spline window) */ |
| 744 | { Lagrange, 2.0, 1.0, 0.0, 0.0 }, /* Lagrange sinc approximation */ |
| 745 | { Bohman, 1.0, 1.0, 0.0, 0.0 }, /* Bohman, 2*Cosine window */ |
| 746 | { Triangle, 1.0, 1.0, 0.0, 0.0 }, /* Bartlett (triangle window) */ |
| 747 | { SincFast, 4.0, 1.0, 0.0, 0.0 }, /* Raw fast sinc ("Pade"-type) */ |
nicolas | 0134bbe | 2010-10-10 15:55:42 +0000 | [diff] [blame] | 748 | { Jinc, 2.0, 1.0, 0.0, 0.0 }, /* Lanczos2D (Jinc-Jinc) */ |
anthony | e5f0645 | 2010-10-12 05:48:17 +0000 | [diff] [blame^] | 749 | { Jinc, 2.0, 1.0, 0.0, 0.0 }, /* Lanczos2D Sharpened */ |
anthony | 02b4cb4 | 2010-10-10 04:54:35 +0000 | [diff] [blame] | 750 | { CubicBC, 2.0, 1.0, 0.37821575509399862, 0.31089212245300069 } |
nicolas | 0134bbe | 2010-10-10 15:55:42 +0000 | [diff] [blame] | 751 | /* Robidoux: Keys cubic close to Lanczos2D with blur=0.958033808 */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 752 | }; |
| 753 | /* |
anthony | 9a98fc6 | 2010-10-11 02:47:19 +0000 | [diff] [blame] | 754 | The known zero crossings of the Jinc() or more accurately the Jinc(x*PI) |
| 755 | function being used as a filter. It is used by the "filter:lobes" and for |
| 756 | the 'lobes' number in the above, the for support selection, so users do |
| 757 | not have to deal with the highly irrational sizes of the 'lobes' of the |
| 758 | Jinc filter. |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 759 | |
nicolas | e473f72 | 2010-10-07 00:05:13 +0000 | [diff] [blame] | 760 | Values taken from |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 761 | http://cose.math.bas.bg/webMathematica/webComputing/BesselZeros.jsp |
nicolas | e473f72 | 2010-10-07 00:05:13 +0000 | [diff] [blame] | 762 | using Jv-function with v=1, then dividing by PI. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 763 | */ |
| 764 | static MagickRealType |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 765 | jinc_zeros[16] = |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 766 | { |
anthony | c2d07db | 2010-09-15 23:47:40 +0000 | [diff] [blame] | 767 | 1.21966989126651, |
| 768 | 2.23313059438153, |
| 769 | 3.23831548416624, |
| 770 | 4.24106286379607, |
| 771 | 5.24276437687019, |
| 772 | 6.24392168986449, |
| 773 | 7.24475986871996, |
| 774 | 8.24539491395205, |
| 775 | 9.24589268494948, |
| 776 | 10.2462933487549, |
| 777 | 11.2466227948779, |
| 778 | 12.2468984611381, |
| 779 | 13.2471325221811, |
| 780 | 14.2473337358069, |
| 781 | 15.2475085630373, |
| 782 | 16.247661874701 |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 783 | }; |
| 784 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 785 | /* |
| 786 | Allocate resize filter. |
| 787 | */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 788 | assert(image != (const Image *) NULL); |
| 789 | assert(image->signature == MagickSignature); |
| 790 | if (image->debug != MagickFalse) |
| 791 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 792 | assert(UndefinedFilter < filter && filter < SentinelFilter); |
| 793 | assert(exception != (ExceptionInfo *) NULL); |
| 794 | assert(exception->signature == MagickSignature); |
cristy | 73bd4a5 | 2010-10-05 11:24:23 +0000 | [diff] [blame] | 795 | resize_filter=(ResizeFilter *) AcquireMagickMemory(sizeof(*resize_filter)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 796 | if (resize_filter == (ResizeFilter *) NULL) |
| 797 | ThrowFatalException(ResourceLimitFatalError,"MemoryAllocationFailed"); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 798 | /* |
| 799 | Defaults for the requested filter. |
| 800 | */ |
| 801 | filter_type=mapping[filter].filter; |
| 802 | window_type=mapping[filter].window; |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 803 | resize_filter->blur = blur; |
| 804 | sigma = 0.5; |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 805 | /* Cylindrical Filters should use Jinc instead of Sinc */ |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 806 | if (cylindrical != MagickFalse) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 807 | switch (filter_type) |
| 808 | { |
| 809 | case SincFilter: |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 810 | /* Promote 1D Sinc Filter to a 2D Jinc filter. */ |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 811 | if ( filter != SincFilter ) |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 812 | filter_type=JincFilter; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 813 | break; |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 814 | case SincFastFilter: |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 815 | /* Ditto for SincFast variant */ |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 816 | if ( filter != SincFastFilter ) |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 817 | filter_type=JincFilter; |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 818 | break; |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 819 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 820 | case LanczosFilter: |
nicolas | 45b58a9 | 2010-10-07 15:46:39 +0000 | [diff] [blame] | 821 | /* Promote Lanczos from a Sinc-Sinc to a Jinc-Jinc. */ |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 822 | filter_type=JincFilter; |
| 823 | window_type=JincFilter; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 824 | break; |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 825 | case GaussianFilter: |
| 826 | sigma = MagickSQ2/2; /* Cylindrical Gaussian sigma is sqrt(2)/2 */ |
| 827 | break; |
cristy | a782ecf | 2010-01-25 02:59:14 +0000 | [diff] [blame] | 828 | default: |
| 829 | break; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 830 | } |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 831 | else |
| 832 | switch (filter_type) |
| 833 | { |
| 834 | case Lanczos2DFilter: |
anthony | e5f0645 | 2010-10-12 05:48:17 +0000 | [diff] [blame^] | 835 | case Lanczos2DSharpFilter: |
nicolas | 45b58a9 | 2010-10-07 15:46:39 +0000 | [diff] [blame] | 836 | /* Demote to a 2-lobe Sinc-Sinc for orthogonal use. */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 837 | window_type=SincFastFilter; |
| 838 | break; |
| 839 | default: |
| 840 | break; |
| 841 | } |
| 842 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 843 | artifact=GetImageArtifact(image,"filter:filter"); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 844 | if (artifact != (const char *) NULL) |
| 845 | { |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 846 | option=ParseMagickOption(MagickFilterOptions,MagickFalse,artifact); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 847 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 848 | { /* Raw filter request - no window function. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 849 | filter_type=(FilterTypes) option; |
| 850 | window_type=BoxFilter; |
| 851 | } |
| 852 | if (option == LanczosFilter) |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 853 | { /* Lanczos is not a real filter but a self windowing Sinc/Jinc. */ |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 854 | filter_type=cylindrical != MagickFalse ? JincFilter : LanczosFilter; |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 855 | window_type=cylindrical != MagickFalse ? JincFilter : SincFastFilter; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 856 | } |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 857 | /* Filter override with a specific window function. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 858 | artifact=GetImageArtifact(image,"filter:window"); |
| 859 | if (artifact != (const char *) NULL) |
| 860 | { |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 861 | option=ParseMagickOption(MagickFilterOptions,MagickFalse,artifact); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 862 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
| 863 | { |
| 864 | if (option != LanczosFilter) |
| 865 | window_type=(FilterTypes) option; |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 866 | else |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 867 | window_type=cylindrical != MagickFalse ? JincFilter : |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 868 | SincFastFilter; |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 869 | } |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 870 | } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 871 | } |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 872 | else |
| 873 | { |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 874 | /* Window specified, but no filter function? Assume Sinc/Jinc. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 875 | artifact=GetImageArtifact(image,"filter:window"); |
| 876 | if (artifact != (const char *) NULL) |
| 877 | { |
| 878 | option=ParseMagickOption(MagickFilterOptions,MagickFalse, |
| 879 | artifact); |
| 880 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
| 881 | { |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 882 | filter_type=cylindrical != MagickFalse ? |
| 883 | JincFilter : SincFastFilter; |
cristy | 19eb641 | 2010-04-23 14:42:29 +0000 | [diff] [blame] | 884 | window_type=(FilterTypes) option; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 885 | } |
| 886 | } |
| 887 | } |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 888 | /* Assign the real functions to use for the filters selected. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 889 | resize_filter->filter=filters[filter_type].function; |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 890 | resize_filter->support=filters[filter_type].lobes; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 891 | resize_filter->window=filters[window_type].function; |
| 892 | resize_filter->scale=filters[window_type].scale; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 893 | resize_filter->signature=MagickSignature; |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 894 | |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 895 | /* Filter Modifications for orthogonal/cylindrical usage */ |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 896 | if (cylindrical != MagickFalse) |
| 897 | switch (filter_type) |
| 898 | { |
| 899 | case PointFilter: |
| 900 | case BoxFilter: |
| 901 | /* Support for Cylindrical Box should be sqrt(2)/2 */ |
cristy | 1c9bb45 | 2010-10-03 16:48:33 +0000 | [diff] [blame] | 902 | resize_filter->support=(MagickRealType) MagickSQ1_2; |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 903 | break; |
anthony | e5f0645 | 2010-10-12 05:48:17 +0000 | [diff] [blame^] | 904 | case Lanczos2DSharpFilter: |
| 905 | /* Sharpened by Nicholas Robidoux so as to optimize for |
| 906 | * minimal blurring of orthogonal lines |
| 907 | */ |
| 908 | resize_filter->blur *= 0.958033808; |
| 909 | break; |
anthony | 81b8bf9 | 2010-10-02 13:54:34 +0000 | [diff] [blame] | 910 | default: |
| 911 | break; |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 912 | } |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 913 | else |
| 914 | switch (filter_type) |
| 915 | { |
| 916 | case Lanczos2DFilter: |
anthony | e5f0645 | 2010-10-12 05:48:17 +0000 | [diff] [blame^] | 917 | case Lanczos2DSharpFilter: |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 918 | /* Demote to a 2-lobe Lanczos (Sinc-Sinc) for orthogonal use. */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 919 | resize_filter->filter=SincFast; |
| 920 | break; |
| 921 | default: |
| 922 | break; |
| 923 | } |
| 924 | |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 925 | /* |
| 926 | ** More Expert Option Modifications |
| 927 | */ |
| 928 | |
| 929 | /* User Sigma Override - no support change */ |
| 930 | artifact=GetImageArtifact(image,"filter:sigma"); |
| 931 | if (artifact != (const char *) NULL) |
| 932 | sigma=StringToDouble(artifact); |
| 933 | /* Define coefficents for Gaussian (assumes no cubic window) */ |
| 934 | if ( GaussianFilter ) { |
| 935 | resize_filter->coeff[0] = 1.0/(2.0*sigma*sigma); |
| 936 | resize_filter->coeff[1] = 1.0/(Magick2PI*sigma*sigma); /* unused */ |
| 937 | } |
| 938 | |
| 939 | /* Blur Override */ |
| 940 | artifact=GetImageArtifact(image,"filter:blur"); |
| 941 | if (artifact != (const char *) NULL) |
| 942 | resize_filter->blur=StringToDouble(artifact); |
| 943 | if (resize_filter->blur < MagickEpsilon) |
| 944 | resize_filter->blur=(MagickRealType) MagickEpsilon; |
| 945 | |
| 946 | /* Support Overrides */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 947 | artifact=GetImageArtifact(image,"filter:lobes"); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 948 | if (artifact != (const char *) NULL) |
| 949 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 950 | ssize_t |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 951 | lobes; |
| 952 | |
cristy | 96b1613 | 2010-08-29 17:19:52 +0000 | [diff] [blame] | 953 | lobes=(ssize_t) StringToLong(artifact); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 954 | if (lobes < 1) |
| 955 | lobes=1; |
| 956 | resize_filter->support=(MagickRealType) lobes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 957 | } |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 958 | /* convert Jinc lobes to a real support value */ |
| 959 | if (resize_filter->filter == Jinc) |
| 960 | { |
| 961 | if (resize_filter->support > 16) |
| 962 | resize_filter->support=jinc_zeros[15]; /* largest entry in table */ |
| 963 | else |
| 964 | resize_filter->support = jinc_zeros[((long)resize_filter->support)-1]; |
| 965 | } |
| 966 | /* expert override of the support setting */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 967 | artifact=GetImageArtifact(image,"filter:support"); |
| 968 | if (artifact != (const char *) NULL) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 969 | resize_filter->support=fabs(StringToDouble(artifact)); |
| 970 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 971 | Scale windowing function separatally to the support 'clipping' |
| 972 | window that calling operator is planning to actually use. (Expert |
| 973 | override) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 974 | */ |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 975 | resize_filter->window_support=resize_filter->support; /* default */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 976 | artifact=GetImageArtifact(image,"filter:win-support"); |
| 977 | if (artifact != (const char *) NULL) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 978 | resize_filter->window_support=fabs(StringToDouble(artifact)); |
| 979 | /* |
anthony | 1f90a6b | 2010-09-14 08:56:31 +0000 | [diff] [blame] | 980 | Adjust window function scaling to the windowing support for |
| 981 | weighting function. This avoids a division on every filter call. |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 982 | */ |
| 983 | resize_filter->scale /= resize_filter->window_support; |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 984 | |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 985 | /* |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 986 | * Set Cubic Spline B,C values, calculate Cubic coefficients. |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 987 | */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 988 | B=0.0; |
| 989 | C=0.0; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 990 | if ((filters[filter_type].function == CubicBC) || |
| 991 | (filters[window_type].function == CubicBC)) |
| 992 | { |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 993 | B=filters[filter_type].B; |
| 994 | C=filters[filter_type].C; |
| 995 | if (filters[window_type].function == CubicBC) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 996 | { |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 997 | B=filters[window_type].B; |
| 998 | C=filters[window_type].C; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 999 | } |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1000 | artifact=GetImageArtifact(image,"filter:b"); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1001 | if (artifact != (const char *) NULL) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1002 | { |
| 1003 | B=StringToDouble(artifact); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 1004 | C=(1.0-B)/2.0; /* Calculate C as if it is a Keys cubic filter. */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1005 | artifact=GetImageArtifact(image,"filter:c"); /* user C override */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1006 | if (artifact != (const char *) NULL) |
| 1007 | C=StringToDouble(artifact); |
| 1008 | } |
| 1009 | else |
| 1010 | { |
| 1011 | artifact=GetImageArtifact(image,"filter:c"); |
| 1012 | if (artifact != (const char *) NULL) |
| 1013 | { |
| 1014 | C=StringToDouble(artifact); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 1015 | B=1.0-2.0*C; /* Calculate B as if it is a Keys cubic filter. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1016 | } |
| 1017 | } |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1018 | /* Convert B,C values into Cubic Coefficents. See CubicBC(). */ |
| 1019 | resize_filter->coeff[0]=(6.0-2.0*B)/6.0; |
| 1020 | resize_filter->coeff[1]=0.0; |
| 1021 | resize_filter->coeff[2]=(-18.0+12.0*B+6.0*C)/6.0; |
| 1022 | resize_filter->coeff[3]=(12.0-9.0*B-6.0*C)/6.0; |
| 1023 | resize_filter->coeff[4]=(8.0*B+24.0*C)/6.0; |
| 1024 | resize_filter->coeff[5]=(-12.0*B-48.0*C)/6.0; |
| 1025 | resize_filter->coeff[6]=(6.0*B+30.0*C)/6.0; |
| 1026 | resize_filter->coeff[7]=(-B-6.0*C)/6.0; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1027 | } |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1028 | |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1029 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 1030 | Expert Option Request for verbose details of the resulting filter. |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1031 | */ |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1032 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
anthony | 7294979 | 2010-10-08 04:44:56 +0000 | [diff] [blame] | 1033 | #pragma omp single |
| 1034 | { |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1035 | #endif |
| 1036 | artifact=GetImageArtifact(image,"filter:verbose"); |
| 1037 | if (artifact != (const char *) NULL) |
| 1038 | { |
| 1039 | double |
| 1040 | support, |
| 1041 | x; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1042 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 1043 | /* |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 1044 | Set the weighting function properly when the weighting |
| 1045 | function may not exactly match the filter of the same name. |
| 1046 | EG: a Point filter really uses a Box weighting function |
| 1047 | with a different support than is typically used. |
| 1048 | |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1049 | */ |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 1050 | if (resize_filter->filter == Box) filter_type=BoxFilter; |
| 1051 | if (resize_filter->filter == Sinc) filter_type=SincFilter; |
| 1052 | if (resize_filter->filter == SincFast) filter_type=SincFastFilter; |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 1053 | if (resize_filter->filter == Jinc) filter_type=JincFilter; |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 1054 | if (resize_filter->filter == CubicBC) filter_type=CubicFilter; |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1055 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 1056 | Report Filter Details. |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1057 | */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1058 | support=GetResizeFilterSupport(resize_filter); /* practical_support */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 1059 | (void) fprintf(stdout,"# Resize Filter (for graphing)\n#\n"); |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 1060 | (void) fprintf(stdout,"# filter = %s\n",MagickOptionToMnemonic( |
| 1061 | MagickFilterOptions,filter_type)); |
| 1062 | (void) fprintf(stdout,"# window = %s\n",MagickOptionToMnemonic( |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 1063 | MagickFilterOptions, window_type)); |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 1064 | (void) fprintf(stdout,"# support = %.*g\n",GetMagickPrecision(), |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 1065 | (double) resize_filter->support); |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 1066 | (void) fprintf(stdout,"# win-support = %.*g\n",GetMagickPrecision(), |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 1067 | (double) resize_filter->window_support); |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1068 | (void) fprintf(stdout,"# scale_blur = %.*g\n",GetMagickPrecision(), |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 1069 | (double) resize_filter->blur); |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1070 | if ( filter_type == GaussianFilter ) |
| 1071 | (void) fprintf(stdout,"# gaussian_sigma = %.*g\n",GetMagickPrecision(), |
| 1072 | (double) sigma); |
| 1073 | (void) fprintf(stdout,"# practical_support = %.*g\n",GetMagickPrecision(), |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 1074 | (double) support); |
anthony | dc59243 | 2010-10-12 02:59:44 +0000 | [diff] [blame] | 1075 | if ( filter_type == CubicFilter || window_type == CubicFilter ) |
| 1076 | (void) fprintf(stdout,"# B,C = %.*g,%.*g\n",GetMagickPrecision(), |
| 1077 | (double) B,GetMagickPrecision(),(double) C); |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 1078 | (void) fprintf(stdout,"\n"); |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1079 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 1080 | Output values of resulting filter graph -- for graphing |
| 1081 | filter result. |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1082 | */ |
| 1083 | for (x=0.0; x <= support; x+=0.01f) |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 1084 | (void) fprintf(stdout,"%5.2lf\t%.*g\n",x,GetMagickPrecision(), |
| 1085 | (double) GetResizeFilterWeight(resize_filter,x)); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 1086 | /* A final value so gnuplot can graph the 'stop' properly. */ |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 1087 | (void) fprintf(stdout,"%5.2lf\t%.*g\n",support,GetMagickPrecision(), |
| 1088 | 0.0); |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1089 | } |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1090 | /* Output the above once only for each image - remove setting */ |
cristy | bb66d9c | 2010-10-09 01:40:31 +0000 | [diff] [blame] | 1091 | (void) DeleteImageArtifact((Image *) image,"filter:verbose"); |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1092 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 1093 | } |
anthony | e06e4c1 | 2010-09-15 04:03:52 +0000 | [diff] [blame] | 1094 | #endif |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1095 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1096 | return(resize_filter); |
| 1097 | } |
| 1098 | |
| 1099 | /* |
| 1100 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1101 | % % |
| 1102 | % % |
| 1103 | % % |
| 1104 | % A d a p t i v e R e s i z e I m a g e % |
| 1105 | % % |
| 1106 | % % |
| 1107 | % % |
| 1108 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1109 | % |
| 1110 | % AdaptiveResizeImage() adaptively resize image with pixel resampling. |
| 1111 | % |
| 1112 | % The format of the AdaptiveResizeImage method is: |
| 1113 | % |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1114 | % Image *AdaptiveResizeImage(const Image *image,const size_t columns, |
| 1115 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1116 | % |
| 1117 | % A description of each parameter follows: |
| 1118 | % |
| 1119 | % o image: the image. |
| 1120 | % |
| 1121 | % o columns: the number of columns in the resized image. |
| 1122 | % |
| 1123 | % o rows: the number of rows in the resized image. |
| 1124 | % |
| 1125 | % o exception: return any errors or warnings in this structure. |
| 1126 | % |
| 1127 | */ |
| 1128 | MagickExport Image *AdaptiveResizeImage(const Image *image, |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1129 | const size_t columns,const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1130 | { |
| 1131 | #define AdaptiveResizeImageTag "Resize/Image" |
| 1132 | |
cristy | c4c8d13 | 2010-01-07 01:58:38 +0000 | [diff] [blame] | 1133 | CacheView |
| 1134 | *resize_view; |
| 1135 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1136 | Image |
| 1137 | *resize_image; |
| 1138 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1139 | MagickBooleanType |
| 1140 | proceed; |
| 1141 | |
| 1142 | MagickPixelPacket |
| 1143 | pixel; |
| 1144 | |
| 1145 | PointInfo |
| 1146 | offset; |
| 1147 | |
| 1148 | ResampleFilter |
| 1149 | *resample_filter; |
| 1150 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1151 | ssize_t |
| 1152 | y; |
| 1153 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1154 | /* |
| 1155 | Adaptively resize image. |
| 1156 | */ |
| 1157 | assert(image != (const Image *) NULL); |
| 1158 | assert(image->signature == MagickSignature); |
| 1159 | if (image->debug != MagickFalse) |
| 1160 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1161 | assert(exception != (ExceptionInfo *) NULL); |
| 1162 | assert(exception->signature == MagickSignature); |
| 1163 | if ((columns == 0) || (rows == 0)) |
| 1164 | return((Image *) NULL); |
| 1165 | if ((columns == image->columns) && (rows == image->rows)) |
| 1166 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 1167 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 1168 | if (resize_image == (Image *) NULL) |
| 1169 | return((Image *) NULL); |
| 1170 | if (SetImageStorageClass(resize_image,DirectClass) == MagickFalse) |
| 1171 | { |
| 1172 | InheritException(exception,&resize_image->exception); |
| 1173 | resize_image=DestroyImage(resize_image); |
| 1174 | return((Image *) NULL); |
| 1175 | } |
| 1176 | GetMagickPixelPacket(image,&pixel); |
| 1177 | resample_filter=AcquireResampleFilter(image,exception); |
cristy | 0c7e9eb | 2010-09-30 14:23:37 +0000 | [diff] [blame] | 1178 | (void) SetResampleFilter(resample_filter,PointFilter,1.0); |
anthony | ccf239d | 2010-09-30 04:23:46 +0000 | [diff] [blame] | 1179 | (void) SetResampleFilterInterpolateMethod(resample_filter, |
cristy | 0c7e9eb | 2010-09-30 14:23:37 +0000 | [diff] [blame] | 1180 | MeshInterpolatePixel); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1181 | resize_view=AcquireCacheView(resize_image); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1182 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1183 | { |
| 1184 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1185 | *restrict resize_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1186 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1187 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1188 | x; |
| 1189 | |
| 1190 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1191 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1192 | |
| 1193 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| 1194 | exception); |
| 1195 | if (q == (PixelPacket *) NULL) |
| 1196 | break; |
| 1197 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
| 1198 | offset.y=((MagickRealType) y*image->rows/resize_image->rows); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1199 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1200 | { |
| 1201 | offset.x=((MagickRealType) x*image->columns/resize_image->columns); |
| 1202 | (void) ResamplePixelColor(resample_filter,offset.x-0.5,offset.y-0.5, |
| 1203 | &pixel); |
| 1204 | SetPixelPacket(resize_image,&pixel,q,resize_indexes+x); |
| 1205 | q++; |
| 1206 | } |
| 1207 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 1208 | break; |
cristy | 96b1613 | 2010-08-29 17:19:52 +0000 | [diff] [blame] | 1209 | proceed=SetImageProgress(image,AdaptiveResizeImageTag,(MagickOffsetType) y, |
| 1210 | image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1211 | if (proceed == MagickFalse) |
| 1212 | break; |
| 1213 | } |
| 1214 | resample_filter=DestroyResampleFilter(resample_filter); |
| 1215 | resize_view=DestroyCacheView(resize_view); |
| 1216 | return(resize_image); |
| 1217 | } |
| 1218 | |
| 1219 | /* |
| 1220 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1221 | % % |
| 1222 | % % |
| 1223 | % % |
| 1224 | + B e s s e l O r d e r O n e % |
| 1225 | % % |
| 1226 | % % |
| 1227 | % % |
| 1228 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1229 | % |
| 1230 | % BesselOrderOne() computes the Bessel function of x of the first kind of |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 1231 | % order 0. This is used to create the Jinc() filter function below. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1232 | % |
| 1233 | % Reduce x to |x| since j1(x)= -j1(-x), and for x in (0,8] |
| 1234 | % |
| 1235 | % j1(x) = x*j1(x); |
| 1236 | % |
| 1237 | % For x in (8,inf) |
| 1238 | % |
| 1239 | % j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) |
| 1240 | % |
| 1241 | % where x1 = x-3*pi/4. Compute sin(x1) and cos(x1) as follow: |
| 1242 | % |
| 1243 | % cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) |
| 1244 | % = 1/sqrt(2) * (sin(x) - cos(x)) |
| 1245 | % sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) |
| 1246 | % = -1/sqrt(2) * (sin(x) + cos(x)) |
| 1247 | % |
| 1248 | % The format of the BesselOrderOne method is: |
| 1249 | % |
| 1250 | % MagickRealType BesselOrderOne(MagickRealType x) |
| 1251 | % |
| 1252 | % A description of each parameter follows: |
| 1253 | % |
| 1254 | % o x: MagickRealType value. |
| 1255 | % |
| 1256 | */ |
| 1257 | |
| 1258 | #undef I0 |
| 1259 | static MagickRealType I0(MagickRealType x) |
| 1260 | { |
| 1261 | MagickRealType |
| 1262 | sum, |
| 1263 | t, |
| 1264 | y; |
| 1265 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1266 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1267 | i; |
| 1268 | |
| 1269 | /* |
| 1270 | Zeroth order Bessel function of the first kind. |
| 1271 | */ |
| 1272 | sum=1.0; |
| 1273 | y=x*x/4.0; |
| 1274 | t=y; |
| 1275 | for (i=2; t > MagickEpsilon; i++) |
| 1276 | { |
| 1277 | sum+=t; |
| 1278 | t*=y/((MagickRealType) i*i); |
| 1279 | } |
| 1280 | return(sum); |
| 1281 | } |
| 1282 | |
| 1283 | #undef J1 |
| 1284 | static MagickRealType J1(MagickRealType x) |
| 1285 | { |
| 1286 | MagickRealType |
| 1287 | p, |
| 1288 | q; |
| 1289 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1290 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1291 | i; |
| 1292 | |
| 1293 | static const double |
| 1294 | Pone[] = |
| 1295 | { |
| 1296 | 0.581199354001606143928050809e+21, |
| 1297 | -0.6672106568924916298020941484e+20, |
| 1298 | 0.2316433580634002297931815435e+19, |
| 1299 | -0.3588817569910106050743641413e+17, |
| 1300 | 0.2908795263834775409737601689e+15, |
| 1301 | -0.1322983480332126453125473247e+13, |
| 1302 | 0.3413234182301700539091292655e+10, |
| 1303 | -0.4695753530642995859767162166e+7, |
| 1304 | 0.270112271089232341485679099e+4 |
| 1305 | }, |
| 1306 | Qone[] = |
| 1307 | { |
| 1308 | 0.11623987080032122878585294e+22, |
| 1309 | 0.1185770712190320999837113348e+20, |
| 1310 | 0.6092061398917521746105196863e+17, |
| 1311 | 0.2081661221307607351240184229e+15, |
| 1312 | 0.5243710262167649715406728642e+12, |
| 1313 | 0.1013863514358673989967045588e+10, |
| 1314 | 0.1501793594998585505921097578e+7, |
| 1315 | 0.1606931573481487801970916749e+4, |
| 1316 | 0.1e+1 |
| 1317 | }; |
| 1318 | |
| 1319 | p=Pone[8]; |
| 1320 | q=Qone[8]; |
| 1321 | for (i=7; i >= 0; i--) |
| 1322 | { |
| 1323 | p=p*x*x+Pone[i]; |
| 1324 | q=q*x*x+Qone[i]; |
| 1325 | } |
| 1326 | return(p/q); |
| 1327 | } |
| 1328 | |
| 1329 | #undef P1 |
| 1330 | static MagickRealType P1(MagickRealType x) |
| 1331 | { |
| 1332 | MagickRealType |
| 1333 | p, |
| 1334 | q; |
| 1335 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1336 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1337 | i; |
| 1338 | |
| 1339 | static const double |
| 1340 | Pone[] = |
| 1341 | { |
| 1342 | 0.352246649133679798341724373e+5, |
| 1343 | 0.62758845247161281269005675e+5, |
| 1344 | 0.313539631109159574238669888e+5, |
| 1345 | 0.49854832060594338434500455e+4, |
| 1346 | 0.2111529182853962382105718e+3, |
| 1347 | 0.12571716929145341558495e+1 |
| 1348 | }, |
| 1349 | Qone[] = |
| 1350 | { |
| 1351 | 0.352246649133679798068390431e+5, |
| 1352 | 0.626943469593560511888833731e+5, |
| 1353 | 0.312404063819041039923015703e+5, |
| 1354 | 0.4930396490181088979386097e+4, |
| 1355 | 0.2030775189134759322293574e+3, |
| 1356 | 0.1e+1 |
| 1357 | }; |
| 1358 | |
| 1359 | p=Pone[5]; |
| 1360 | q=Qone[5]; |
| 1361 | for (i=4; i >= 0; i--) |
| 1362 | { |
| 1363 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| 1364 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| 1365 | } |
| 1366 | return(p/q); |
| 1367 | } |
| 1368 | |
| 1369 | #undef Q1 |
| 1370 | static MagickRealType Q1(MagickRealType x) |
| 1371 | { |
| 1372 | MagickRealType |
| 1373 | p, |
| 1374 | q; |
| 1375 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1376 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1377 | i; |
| 1378 | |
| 1379 | static const double |
| 1380 | Pone[] = |
| 1381 | { |
| 1382 | 0.3511751914303552822533318e+3, |
| 1383 | 0.7210391804904475039280863e+3, |
| 1384 | 0.4259873011654442389886993e+3, |
| 1385 | 0.831898957673850827325226e+2, |
| 1386 | 0.45681716295512267064405e+1, |
| 1387 | 0.3532840052740123642735e-1 |
| 1388 | }, |
| 1389 | Qone[] = |
| 1390 | { |
| 1391 | 0.74917374171809127714519505e+4, |
| 1392 | 0.154141773392650970499848051e+5, |
| 1393 | 0.91522317015169922705904727e+4, |
| 1394 | 0.18111867005523513506724158e+4, |
| 1395 | 0.1038187585462133728776636e+3, |
| 1396 | 0.1e+1 |
| 1397 | }; |
| 1398 | |
| 1399 | p=Pone[5]; |
| 1400 | q=Qone[5]; |
| 1401 | for (i=4; i >= 0; i--) |
| 1402 | { |
| 1403 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| 1404 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| 1405 | } |
| 1406 | return(p/q); |
| 1407 | } |
| 1408 | |
| 1409 | static MagickRealType BesselOrderOne(MagickRealType x) |
| 1410 | { |
| 1411 | MagickRealType |
| 1412 | p, |
| 1413 | q; |
| 1414 | |
| 1415 | if (x == 0.0) |
| 1416 | return(0.0); |
| 1417 | p=x; |
| 1418 | if (x < 0.0) |
| 1419 | x=(-x); |
| 1420 | if (x < 8.0) |
| 1421 | return(p*J1(x)); |
| 1422 | q=sqrt((double) (2.0/(MagickPI*x)))*(P1(x)*(1.0/sqrt(2.0)*(sin((double) x)- |
| 1423 | cos((double) x)))-8.0/x*Q1(x)*(-1.0/sqrt(2.0)*(sin((double) x)+ |
| 1424 | cos((double) x)))); |
| 1425 | if (p < 0.0) |
| 1426 | q=(-q); |
| 1427 | return(q); |
| 1428 | } |
| 1429 | |
| 1430 | /* |
| 1431 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1432 | % % |
| 1433 | % % |
| 1434 | % % |
| 1435 | + D e s t r o y R e s i z e F i l t e r % |
| 1436 | % % |
| 1437 | % % |
| 1438 | % % |
| 1439 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1440 | % |
| 1441 | % DestroyResizeFilter() destroy the resize filter. |
| 1442 | % |
cristy | a2ffd7e | 2010-03-10 20:50:30 +0000 | [diff] [blame] | 1443 | % The format of the DestroyResizeFilter method is: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1444 | % |
| 1445 | % ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| 1446 | % |
| 1447 | % A description of each parameter follows: |
| 1448 | % |
| 1449 | % o resize_filter: the resize filter. |
| 1450 | % |
| 1451 | */ |
| 1452 | MagickExport ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| 1453 | { |
| 1454 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1455 | assert(resize_filter->signature == MagickSignature); |
| 1456 | resize_filter->signature=(~MagickSignature); |
| 1457 | resize_filter=(ResizeFilter *) RelinquishMagickMemory(resize_filter); |
| 1458 | return(resize_filter); |
| 1459 | } |
| 1460 | |
| 1461 | /* |
| 1462 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1463 | % % |
| 1464 | % % |
| 1465 | % % |
| 1466 | + G e t R e s i z e F i l t e r S u p p o r t % |
| 1467 | % % |
| 1468 | % % |
| 1469 | % % |
| 1470 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1471 | % |
| 1472 | % GetResizeFilterSupport() return the current support window size for this |
| 1473 | % filter. Note that this may have been enlarged by filter:blur factor. |
| 1474 | % |
| 1475 | % The format of the GetResizeFilterSupport method is: |
| 1476 | % |
| 1477 | % MagickRealType GetResizeFilterSupport(const ResizeFilter *resize_filter) |
| 1478 | % |
| 1479 | % A description of each parameter follows: |
| 1480 | % |
| 1481 | % o filter: Image filter to use. |
| 1482 | % |
| 1483 | */ |
| 1484 | MagickExport MagickRealType GetResizeFilterSupport( |
| 1485 | const ResizeFilter *resize_filter) |
| 1486 | { |
| 1487 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1488 | assert(resize_filter->signature == MagickSignature); |
| 1489 | return(resize_filter->support*resize_filter->blur); |
| 1490 | } |
| 1491 | |
| 1492 | /* |
| 1493 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1494 | % % |
| 1495 | % % |
| 1496 | % % |
| 1497 | + G e t R e s i z e F i l t e r W e i g h t % |
| 1498 | % % |
| 1499 | % % |
| 1500 | % % |
| 1501 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1502 | % |
| 1503 | % GetResizeFilterWeight evaluates the specified resize filter at the point x |
| 1504 | % which usally lies between zero and the filters current 'support' and |
| 1505 | % returns the weight of the filter function at that point. |
| 1506 | % |
| 1507 | % The format of the GetResizeFilterWeight method is: |
| 1508 | % |
| 1509 | % MagickRealType GetResizeFilterWeight(const ResizeFilter *resize_filter, |
| 1510 | % const MagickRealType x) |
| 1511 | % |
| 1512 | % A description of each parameter follows: |
| 1513 | % |
| 1514 | % o filter: the filter type. |
| 1515 | % |
| 1516 | % o x: the point. |
| 1517 | % |
| 1518 | */ |
| 1519 | MagickExport MagickRealType GetResizeFilterWeight( |
| 1520 | const ResizeFilter *resize_filter,const MagickRealType x) |
| 1521 | { |
| 1522 | MagickRealType |
cristy | b838586 | 2010-09-26 01:27:51 +0000 | [diff] [blame] | 1523 | scale, |
| 1524 | x_blur; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1525 | |
| 1526 | /* |
| 1527 | Windowing function - scale the weighting filter by this amount. |
| 1528 | */ |
| 1529 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1530 | assert(resize_filter->signature == MagickSignature); |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1531 | x_blur=fabs((double) x)/resize_filter->blur; /* X offset with blur scaling */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1532 | if ((resize_filter->window_support < MagickEpsilon) || |
| 1533 | (resize_filter->window == Box)) |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1534 | scale=1.0; /* Point or Box Filter -- avoid division by zero */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1535 | else |
| 1536 | { |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1537 | scale=resize_filter->scale; |
| 1538 | scale=resize_filter->window(x_blur*scale,resize_filter); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1539 | } |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1540 | return(scale*resize_filter->filter(x_blur,resize_filter)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1541 | } |
| 1542 | |
| 1543 | /* |
| 1544 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1545 | % % |
| 1546 | % % |
| 1547 | % % |
| 1548 | % M a g n i f y I m a g e % |
| 1549 | % % |
| 1550 | % % |
| 1551 | % % |
| 1552 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1553 | % |
| 1554 | % MagnifyImage() is a convenience method that scales an image proportionally |
| 1555 | % to twice its size. |
| 1556 | % |
| 1557 | % The format of the MagnifyImage method is: |
| 1558 | % |
| 1559 | % Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| 1560 | % |
| 1561 | % A description of each parameter follows: |
| 1562 | % |
| 1563 | % o image: the image. |
| 1564 | % |
| 1565 | % o exception: return any errors or warnings in this structure. |
| 1566 | % |
| 1567 | */ |
| 1568 | MagickExport Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| 1569 | { |
| 1570 | Image |
| 1571 | *magnify_image; |
| 1572 | |
| 1573 | assert(image != (Image *) NULL); |
| 1574 | assert(image->signature == MagickSignature); |
| 1575 | if (image->debug != MagickFalse) |
| 1576 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1577 | assert(exception != (ExceptionInfo *) NULL); |
| 1578 | assert(exception->signature == MagickSignature); |
| 1579 | magnify_image=ResizeImage(image,2*image->columns,2*image->rows,CubicFilter, |
| 1580 | 1.0,exception); |
| 1581 | return(magnify_image); |
| 1582 | } |
| 1583 | |
| 1584 | /* |
| 1585 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1586 | % % |
| 1587 | % % |
| 1588 | % % |
| 1589 | % M i n i f y I m a g e % |
| 1590 | % % |
| 1591 | % % |
| 1592 | % % |
| 1593 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1594 | % |
| 1595 | % MinifyImage() is a convenience method that scales an image proportionally |
| 1596 | % to half its size. |
| 1597 | % |
| 1598 | % The format of the MinifyImage method is: |
| 1599 | % |
| 1600 | % Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| 1601 | % |
| 1602 | % A description of each parameter follows: |
| 1603 | % |
| 1604 | % o image: the image. |
| 1605 | % |
| 1606 | % o exception: return any errors or warnings in this structure. |
| 1607 | % |
| 1608 | */ |
| 1609 | MagickExport Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| 1610 | { |
| 1611 | Image |
| 1612 | *minify_image; |
| 1613 | |
| 1614 | assert(image != (Image *) NULL); |
| 1615 | assert(image->signature == MagickSignature); |
| 1616 | if (image->debug != MagickFalse) |
| 1617 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1618 | assert(exception != (ExceptionInfo *) NULL); |
| 1619 | assert(exception->signature == MagickSignature); |
| 1620 | minify_image=ResizeImage(image,image->columns/2,image->rows/2,CubicFilter, |
| 1621 | 1.0,exception); |
| 1622 | return(minify_image); |
| 1623 | } |
| 1624 | |
| 1625 | /* |
| 1626 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1627 | % % |
| 1628 | % % |
| 1629 | % % |
| 1630 | % R e s a m p l e I m a g e % |
| 1631 | % % |
| 1632 | % % |
| 1633 | % % |
| 1634 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1635 | % |
| 1636 | % ResampleImage() resize image in terms of its pixel size, so that when |
| 1637 | % displayed at the given resolution it will be the same size in terms of |
| 1638 | % real world units as the original image at the original resolution. |
| 1639 | % |
| 1640 | % The format of the ResampleImage method is: |
| 1641 | % |
| 1642 | % Image *ResampleImage(Image *image,const double x_resolution, |
| 1643 | % const double y_resolution,const FilterTypes filter,const double blur, |
| 1644 | % ExceptionInfo *exception) |
| 1645 | % |
| 1646 | % A description of each parameter follows: |
| 1647 | % |
| 1648 | % o image: the image to be resized to fit the given resolution. |
| 1649 | % |
| 1650 | % o x_resolution: the new image x resolution. |
| 1651 | % |
| 1652 | % o y_resolution: the new image y resolution. |
| 1653 | % |
| 1654 | % o filter: Image filter to use. |
| 1655 | % |
| 1656 | % o blur: the blur factor where > 1 is blurry, < 1 is sharp. |
| 1657 | % |
| 1658 | */ |
| 1659 | MagickExport Image *ResampleImage(const Image *image,const double x_resolution, |
| 1660 | const double y_resolution,const FilterTypes filter,const double blur, |
| 1661 | ExceptionInfo *exception) |
| 1662 | { |
| 1663 | #define ResampleImageTag "Resample/Image" |
| 1664 | |
| 1665 | Image |
| 1666 | *resample_image; |
| 1667 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1668 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1669 | height, |
| 1670 | width; |
| 1671 | |
| 1672 | /* |
| 1673 | Initialize sampled image attributes. |
| 1674 | */ |
| 1675 | assert(image != (const Image *) NULL); |
| 1676 | assert(image->signature == MagickSignature); |
| 1677 | if (image->debug != MagickFalse) |
| 1678 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1679 | assert(exception != (ExceptionInfo *) NULL); |
| 1680 | assert(exception->signature == MagickSignature); |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1681 | width=(size_t) (x_resolution*image->columns/(image->x_resolution == 0.0 ? |
| 1682 | 72.0 : image->x_resolution)+0.5); |
| 1683 | height=(size_t) (y_resolution*image->rows/(image->y_resolution == 0.0 ? |
| 1684 | 72.0 : image->y_resolution)+0.5); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1685 | resample_image=ResizeImage(image,width,height,filter,blur,exception); |
| 1686 | if (resample_image != (Image *) NULL) |
| 1687 | { |
| 1688 | resample_image->x_resolution=x_resolution; |
| 1689 | resample_image->y_resolution=y_resolution; |
| 1690 | } |
| 1691 | return(resample_image); |
| 1692 | } |
| 1693 | #if defined(MAGICKCORE_LQR_DELEGATE) |
| 1694 | |
| 1695 | /* |
| 1696 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1697 | % % |
| 1698 | % % |
| 1699 | % % |
| 1700 | % L i q u i d R e s c a l e I m a g e % |
| 1701 | % % |
| 1702 | % % |
| 1703 | % % |
| 1704 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1705 | % |
| 1706 | % LiquidRescaleImage() rescales image with seam carving. |
| 1707 | % |
| 1708 | % The format of the LiquidRescaleImage method is: |
| 1709 | % |
| 1710 | % Image *LiquidRescaleImage(const Image *image, |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1711 | % const size_t columns,const size_t rows, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1712 | % const double delta_x,const double rigidity,ExceptionInfo *exception) |
| 1713 | % |
| 1714 | % A description of each parameter follows: |
| 1715 | % |
| 1716 | % o image: the image. |
| 1717 | % |
| 1718 | % o columns: the number of columns in the rescaled image. |
| 1719 | % |
| 1720 | % o rows: the number of rows in the rescaled image. |
| 1721 | % |
| 1722 | % o delta_x: maximum seam transversal step (0 means straight seams). |
| 1723 | % |
| 1724 | % o rigidity: introduce a bias for non-straight seams (typically 0). |
| 1725 | % |
| 1726 | % o exception: return any errors or warnings in this structure. |
| 1727 | % |
| 1728 | */ |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1729 | MagickExport Image *LiquidRescaleImage(const Image *image,const size_t columns, |
| 1730 | const size_t rows,const double delta_x,const double rigidity, |
| 1731 | ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1732 | { |
| 1733 | #define LiquidRescaleImageTag "Rescale/Image" |
| 1734 | |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1735 | CacheView |
| 1736 | *rescale_view; |
| 1737 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1738 | const char |
| 1739 | *map; |
| 1740 | |
| 1741 | guchar |
| 1742 | *packet; |
| 1743 | |
| 1744 | Image |
| 1745 | *rescale_image; |
| 1746 | |
| 1747 | int |
| 1748 | x, |
| 1749 | y; |
| 1750 | |
| 1751 | LqrCarver |
| 1752 | *carver; |
| 1753 | |
| 1754 | LqrRetVal |
| 1755 | lqr_status; |
| 1756 | |
| 1757 | MagickBooleanType |
| 1758 | status; |
| 1759 | |
| 1760 | MagickPixelPacket |
| 1761 | pixel; |
| 1762 | |
| 1763 | unsigned char |
| 1764 | *pixels; |
| 1765 | |
| 1766 | /* |
| 1767 | Liquid rescale image. |
| 1768 | */ |
| 1769 | assert(image != (const Image *) NULL); |
| 1770 | assert(image->signature == MagickSignature); |
| 1771 | if (image->debug != MagickFalse) |
| 1772 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1773 | assert(exception != (ExceptionInfo *) NULL); |
| 1774 | assert(exception->signature == MagickSignature); |
| 1775 | if ((columns == 0) || (rows == 0)) |
| 1776 | return((Image *) NULL); |
| 1777 | if ((columns == image->columns) && (rows == image->rows)) |
| 1778 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 1779 | if ((columns <= 2) || (rows <= 2)) |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 1780 | return(ResizeImage(image,columns,rows,image->filter,image->blur,exception)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1781 | if ((columns >= (2*image->columns)) || (rows >= (2*image->rows))) |
| 1782 | { |
| 1783 | Image |
| 1784 | *resize_image; |
| 1785 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1786 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1787 | height, |
| 1788 | width; |
| 1789 | |
| 1790 | /* |
| 1791 | Honor liquid resize size limitations. |
| 1792 | */ |
| 1793 | for (width=image->columns; columns >= (2*width-1); width*=2); |
| 1794 | for (height=image->rows; rows >= (2*height-1); height*=2); |
| 1795 | resize_image=ResizeImage(image,width,height,image->filter,image->blur, |
| 1796 | exception); |
| 1797 | if (resize_image == (Image *) NULL) |
| 1798 | return((Image *) NULL); |
| 1799 | rescale_image=LiquidRescaleImage(resize_image,columns,rows,delta_x, |
| 1800 | rigidity,exception); |
| 1801 | resize_image=DestroyImage(resize_image); |
| 1802 | return(rescale_image); |
| 1803 | } |
| 1804 | map="RGB"; |
| 1805 | if (image->matte == MagickFalse) |
| 1806 | map="RGBA"; |
| 1807 | if (image->colorspace == CMYKColorspace) |
| 1808 | { |
| 1809 | map="CMYK"; |
| 1810 | if (image->matte == MagickFalse) |
| 1811 | map="CMYKA"; |
| 1812 | } |
| 1813 | pixels=(unsigned char *) AcquireQuantumMemory(image->columns,image->rows* |
| 1814 | strlen(map)*sizeof(*pixels)); |
| 1815 | if (pixels == (unsigned char *) NULL) |
| 1816 | return((Image *) NULL); |
| 1817 | status=ExportImagePixels(image,0,0,image->columns,image->rows,map,CharPixel, |
| 1818 | pixels,exception); |
| 1819 | if (status == MagickFalse) |
| 1820 | { |
| 1821 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1822 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 1823 | } |
| 1824 | carver=lqr_carver_new(pixels,image->columns,image->rows,strlen(map)); |
| 1825 | if (carver == (LqrCarver *) NULL) |
| 1826 | { |
| 1827 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1828 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 1829 | } |
| 1830 | lqr_status=lqr_carver_init(carver,(int) delta_x,rigidity); |
| 1831 | lqr_status=lqr_carver_resize(carver,columns,rows); |
| 1832 | rescale_image=CloneImage(image,lqr_carver_get_width(carver), |
| 1833 | lqr_carver_get_height(carver),MagickTrue,exception); |
| 1834 | if (rescale_image == (Image *) NULL) |
| 1835 | { |
| 1836 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1837 | return((Image *) NULL); |
| 1838 | } |
| 1839 | if (SetImageStorageClass(rescale_image,DirectClass) == MagickFalse) |
| 1840 | { |
| 1841 | InheritException(exception,&rescale_image->exception); |
| 1842 | rescale_image=DestroyImage(rescale_image); |
| 1843 | return((Image *) NULL); |
| 1844 | } |
| 1845 | GetMagickPixelPacket(rescale_image,&pixel); |
| 1846 | (void) lqr_carver_scan_reset(carver); |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1847 | rescale_view=AcquireCacheView(rescale_image); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1848 | while (lqr_carver_scan(carver,&x,&y,&packet) != 0) |
| 1849 | { |
| 1850 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1851 | *restrict rescale_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1852 | |
| 1853 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1854 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1855 | |
anthony | 22aad25 | 2010-09-23 06:59:07 +0000 | [diff] [blame] | 1856 | q=QueueCacheViewAuthenticPixels(rescale_view,x,y,1,1,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1857 | if (q == (PixelPacket *) NULL) |
| 1858 | break; |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1859 | rescale_indexes=GetCacheViewAuthenticIndexQueue(rescale_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1860 | pixel.red=QuantumRange*(packet[0]/255.0); |
| 1861 | pixel.green=QuantumRange*(packet[1]/255.0); |
| 1862 | pixel.blue=QuantumRange*(packet[2]/255.0); |
| 1863 | if (image->colorspace != CMYKColorspace) |
| 1864 | { |
| 1865 | if (image->matte == MagickFalse) |
| 1866 | pixel.opacity=QuantumRange*(packet[3]/255.0); |
| 1867 | } |
| 1868 | else |
| 1869 | { |
| 1870 | pixel.index=QuantumRange*(packet[3]/255.0); |
| 1871 | if (image->matte == MagickFalse) |
| 1872 | pixel.opacity=QuantumRange*(packet[4]/255.0); |
| 1873 | } |
| 1874 | SetPixelPacket(rescale_image,&pixel,q,rescale_indexes); |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1875 | if (SyncCacheViewAuthenticPixels(rescale_view,exception) == MagickFalse) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1876 | break; |
| 1877 | } |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1878 | rescale_view=DestroyCacheView(rescale_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1879 | /* |
| 1880 | Relinquish resources. |
| 1881 | */ |
| 1882 | lqr_carver_destroy(carver); |
| 1883 | return(rescale_image); |
| 1884 | } |
| 1885 | #else |
| 1886 | MagickExport Image *LiquidRescaleImage(const Image *image, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1887 | const size_t magick_unused(columns),const size_t magick_unused(rows), |
| 1888 | const double magick_unused(delta_x),const double magick_unused(rigidity), |
| 1889 | ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1890 | { |
| 1891 | assert(image != (const Image *) NULL); |
| 1892 | assert(image->signature == MagickSignature); |
| 1893 | if (image->debug != MagickFalse) |
| 1894 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1895 | assert(exception != (ExceptionInfo *) NULL); |
| 1896 | assert(exception->signature == MagickSignature); |
| 1897 | (void) ThrowMagickException(exception,GetMagickModule(),MissingDelegateError, |
| 1898 | "DelegateLibrarySupportNotBuiltIn","`%s' (LQR)",image->filename); |
| 1899 | return((Image *) NULL); |
| 1900 | } |
| 1901 | #endif |
| 1902 | |
| 1903 | /* |
| 1904 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1905 | % % |
| 1906 | % % |
| 1907 | % % |
| 1908 | % R e s i z e I m a g e % |
| 1909 | % % |
| 1910 | % % |
| 1911 | % % |
| 1912 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1913 | % |
| 1914 | % ResizeImage() scales an image to the desired dimensions, using the given |
cristy | 5d82438 | 2010-09-06 14:00:17 +0000 | [diff] [blame] | 1915 | % filter (see AcquireFilterInfo()). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1916 | % |
| 1917 | % If an undefined filter is given the filter defaults to Mitchell for a |
| 1918 | % colormapped image, a image with a matte channel, or if the image is |
| 1919 | % enlarged. Otherwise the filter defaults to a Lanczos. |
| 1920 | % |
| 1921 | % ResizeImage() was inspired by Paul Heckbert's "zoom" program. |
| 1922 | % |
| 1923 | % The format of the ResizeImage method is: |
| 1924 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1925 | % Image *ResizeImage(Image *image,const size_t columns, |
| 1926 | % const size_t rows,const FilterTypes filter,const double blur, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1927 | % ExceptionInfo *exception) |
| 1928 | % |
| 1929 | % A description of each parameter follows: |
| 1930 | % |
| 1931 | % o image: the image. |
| 1932 | % |
| 1933 | % o columns: the number of columns in the scaled image. |
| 1934 | % |
| 1935 | % o rows: the number of rows in the scaled image. |
| 1936 | % |
| 1937 | % o filter: Image filter to use. |
| 1938 | % |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1939 | % o blur: the blur factor where > 1 is blurry, < 1 is sharp. Typically set |
| 1940 | % this to 1.0. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1941 | % |
| 1942 | % o exception: return any errors or warnings in this structure. |
| 1943 | % |
| 1944 | */ |
| 1945 | |
| 1946 | typedef struct _ContributionInfo |
| 1947 | { |
| 1948 | MagickRealType |
| 1949 | weight; |
| 1950 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1951 | ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1952 | pixel; |
| 1953 | } ContributionInfo; |
| 1954 | |
| 1955 | static ContributionInfo **DestroyContributionThreadSet( |
| 1956 | ContributionInfo **contribution) |
| 1957 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1958 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1959 | i; |
| 1960 | |
| 1961 | assert(contribution != (ContributionInfo **) NULL); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1962 | for (i=0; i < (ssize_t) GetOpenMPMaximumThreads(); i++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1963 | if (contribution[i] != (ContributionInfo *) NULL) |
| 1964 | contribution[i]=(ContributionInfo *) RelinquishMagickMemory( |
| 1965 | contribution[i]); |
cristy | b41ee10 | 2010-10-04 16:46:15 +0000 | [diff] [blame] | 1966 | contribution=(ContributionInfo **) RelinquishMagickMemory(contribution); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1967 | return(contribution); |
| 1968 | } |
| 1969 | |
| 1970 | static ContributionInfo **AcquireContributionThreadSet(const size_t count) |
| 1971 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1972 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1973 | i; |
| 1974 | |
| 1975 | ContributionInfo |
| 1976 | **contribution; |
| 1977 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1978 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1979 | number_threads; |
| 1980 | |
| 1981 | number_threads=GetOpenMPMaximumThreads(); |
cristy | b41ee10 | 2010-10-04 16:46:15 +0000 | [diff] [blame] | 1982 | contribution=(ContributionInfo **) AcquireQuantumMemory(number_threads, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1983 | sizeof(*contribution)); |
| 1984 | if (contribution == (ContributionInfo **) NULL) |
| 1985 | return((ContributionInfo **) NULL); |
| 1986 | (void) ResetMagickMemory(contribution,0,number_threads*sizeof(*contribution)); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1987 | for (i=0; i < (ssize_t) number_threads; i++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1988 | { |
| 1989 | contribution[i]=(ContributionInfo *) AcquireQuantumMemory(count, |
| 1990 | sizeof(**contribution)); |
| 1991 | if (contribution[i] == (ContributionInfo *) NULL) |
| 1992 | return(DestroyContributionThreadSet(contribution)); |
| 1993 | } |
| 1994 | return(contribution); |
| 1995 | } |
| 1996 | |
| 1997 | static inline double MagickMax(const double x,const double y) |
| 1998 | { |
| 1999 | if (x > y) |
| 2000 | return(x); |
| 2001 | return(y); |
| 2002 | } |
| 2003 | |
| 2004 | static inline double MagickMin(const double x,const double y) |
| 2005 | { |
| 2006 | if (x < y) |
| 2007 | return(x); |
| 2008 | return(y); |
| 2009 | } |
| 2010 | |
| 2011 | static MagickBooleanType HorizontalFilter(const ResizeFilter *resize_filter, |
| 2012 | const Image *image,Image *resize_image,const MagickRealType x_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2013 | const MagickSizeType span,MagickOffsetType *offset,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2014 | { |
| 2015 | #define ResizeImageTag "Resize/Image" |
| 2016 | |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2017 | CacheView |
| 2018 | *image_view, |
| 2019 | *resize_view; |
| 2020 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2021 | ClassType |
| 2022 | storage_class; |
| 2023 | |
| 2024 | ContributionInfo |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2025 | **restrict contributions; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2026 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2027 | MagickBooleanType |
| 2028 | status; |
| 2029 | |
| 2030 | MagickPixelPacket |
| 2031 | zero; |
| 2032 | |
| 2033 | MagickRealType |
| 2034 | scale, |
| 2035 | support; |
| 2036 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2037 | ssize_t |
| 2038 | x; |
| 2039 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2040 | /* |
| 2041 | Apply filter to resize horizontally from image to resize image. |
| 2042 | */ |
cristy | 5d82438 | 2010-09-06 14:00:17 +0000 | [diff] [blame] | 2043 | scale=MagickMax(1.0/x_factor+MagickEpsilon,1.0); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2044 | support=scale*GetResizeFilterSupport(resize_filter); |
| 2045 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| 2046 | if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| 2047 | { |
| 2048 | InheritException(exception,&resize_image->exception); |
| 2049 | return(MagickFalse); |
| 2050 | } |
| 2051 | if (support < 0.5) |
| 2052 | { |
| 2053 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 2054 | Support too small even for nearest neighbour: Reduce to point |
| 2055 | sampling. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2056 | */ |
| 2057 | support=(MagickRealType) 0.5; |
| 2058 | scale=1.0; |
| 2059 | } |
| 2060 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| 2061 | if (contributions == (ContributionInfo **) NULL) |
| 2062 | { |
| 2063 | (void) ThrowMagickException(exception,GetMagickModule(), |
| 2064 | ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| 2065 | return(MagickFalse); |
| 2066 | } |
| 2067 | status=MagickTrue; |
| 2068 | scale=1.0/scale; |
| 2069 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2070 | image_view=AcquireCacheView(image); |
| 2071 | resize_view=AcquireCacheView(resize_image); |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2072 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2073 | #pragma omp parallel for shared(status) |
| 2074 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2075 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2076 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2077 | MagickRealType |
| 2078 | center, |
| 2079 | density; |
| 2080 | |
| 2081 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2082 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2083 | |
| 2084 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2085 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2086 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2087 | register ContributionInfo |
| 2088 | *restrict contribution; |
| 2089 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2090 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2091 | *restrict resize_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2092 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2093 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2094 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2095 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2096 | register ssize_t |
| 2097 | y; |
| 2098 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2099 | ssize_t |
| 2100 | n, |
| 2101 | start, |
| 2102 | stop; |
| 2103 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2104 | if (status == MagickFalse) |
| 2105 | continue; |
| 2106 | center=(MagickRealType) (x+0.5)/x_factor; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2107 | start=(ssize_t) MagickMax(center-support+0.5,0.0); |
| 2108 | stop=(ssize_t) MagickMin(center+support+0.5,(double) image->columns); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2109 | density=0.0; |
| 2110 | contribution=contributions[GetOpenMPThreadId()]; |
| 2111 | for (n=0; n < (stop-start); n++) |
| 2112 | { |
| 2113 | contribution[n].pixel=start+n; |
| 2114 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| 2115 | ((MagickRealType) (start+n)-center+0.5)); |
| 2116 | density+=contribution[n].weight; |
| 2117 | } |
| 2118 | if ((density != 0.0) && (density != 1.0)) |
| 2119 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2120 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2121 | i; |
| 2122 | |
| 2123 | /* |
| 2124 | Normalize. |
| 2125 | */ |
| 2126 | density=1.0/density; |
| 2127 | for (i=0; i < n; i++) |
| 2128 | contribution[i].weight*=density; |
| 2129 | } |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2130 | p=GetCacheViewVirtualPixels(image_view,contribution[0].pixel,0,(size_t) |
| 2131 | (contribution[n-1].pixel-contribution[0].pixel+1),image->rows,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2132 | q=QueueCacheViewAuthenticPixels(resize_view,x,0,1,resize_image->rows, |
| 2133 | exception); |
| 2134 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2135 | { |
| 2136 | status=MagickFalse; |
| 2137 | continue; |
| 2138 | } |
| 2139 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
| 2140 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2141 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2142 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2143 | MagickPixelPacket |
| 2144 | pixel; |
| 2145 | |
| 2146 | MagickRealType |
| 2147 | alpha; |
| 2148 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2149 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2150 | i; |
| 2151 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2152 | ssize_t |
| 2153 | j; |
| 2154 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2155 | pixel=zero; |
| 2156 | if (image->matte == MagickFalse) |
| 2157 | { |
| 2158 | for (i=0; i < n; i++) |
| 2159 | { |
| 2160 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2161 | (contribution[i].pixel-contribution[0].pixel); |
| 2162 | alpha=contribution[i].weight; |
| 2163 | pixel.red+=alpha*(p+j)->red; |
| 2164 | pixel.green+=alpha*(p+j)->green; |
| 2165 | pixel.blue+=alpha*(p+j)->blue; |
| 2166 | pixel.opacity+=alpha*(p+j)->opacity; |
| 2167 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2168 | SetRedPixelComponent(q,ClampRedPixelComponent(&pixel)); |
| 2169 | SetGreenPixelComponent(q,ClampGreenPixelComponent(&pixel)); |
| 2170 | SetBluePixelComponent(q,ClampBluePixelComponent(&pixel)); |
| 2171 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2172 | if ((image->colorspace == CMYKColorspace) && |
| 2173 | (resize_image->colorspace == CMYKColorspace)) |
| 2174 | { |
| 2175 | for (i=0; i < n; i++) |
| 2176 | { |
| 2177 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2178 | (contribution[i].pixel-contribution[0].pixel); |
| 2179 | alpha=contribution[i].weight; |
| 2180 | pixel.index+=alpha*indexes[j]; |
| 2181 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2182 | resize_indexes[y]=(IndexPacket) ClampToQuantum(pixel.index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2183 | } |
| 2184 | } |
| 2185 | else |
| 2186 | { |
| 2187 | MagickRealType |
| 2188 | gamma; |
| 2189 | |
| 2190 | gamma=0.0; |
| 2191 | for (i=0; i < n; i++) |
| 2192 | { |
| 2193 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2194 | (contribution[i].pixel-contribution[0].pixel); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2195 | alpha=contribution[i].weight*QuantumScale* |
| 2196 | GetAlphaPixelComponent(p+j); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2197 | pixel.red+=alpha*(p+j)->red; |
| 2198 | pixel.green+=alpha*(p+j)->green; |
| 2199 | pixel.blue+=alpha*(p+j)->blue; |
| 2200 | pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| 2201 | gamma+=alpha; |
| 2202 | } |
| 2203 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2204 | q->red=ClampToQuantum(gamma*GetRedPixelComponent(&pixel)); |
| 2205 | q->green=ClampToQuantum(gamma*GetGreenPixelComponent(&pixel)); |
| 2206 | q->blue=ClampToQuantum(gamma*GetBluePixelComponent(&pixel)); |
| 2207 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2208 | if ((image->colorspace == CMYKColorspace) && |
| 2209 | (resize_image->colorspace == CMYKColorspace)) |
| 2210 | { |
| 2211 | for (i=0; i < n; i++) |
| 2212 | { |
| 2213 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2214 | (contribution[i].pixel-contribution[0].pixel); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2215 | alpha=contribution[i].weight*QuantumScale* |
| 2216 | GetAlphaPixelComponent(p+j); |
cristy | c197d1c | 2009-10-13 19:56:53 +0000 | [diff] [blame] | 2217 | pixel.index+=alpha*indexes[j]; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2218 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2219 | resize_indexes[y]=(IndexPacket) ClampToQuantum(gamma* |
| 2220 | GetIndexPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2221 | } |
| 2222 | } |
| 2223 | if ((resize_image->storage_class == PseudoClass) && |
| 2224 | (image->storage_class == PseudoClass)) |
| 2225 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2226 | i=(ssize_t) (MagickMin(MagickMax(center,(double) start),(double) stop- |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2227 | 1.0)+0.5); |
| 2228 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2229 | (contribution[i-start].pixel-contribution[0].pixel); |
| 2230 | resize_indexes[y]=indexes[j]; |
| 2231 | } |
| 2232 | q++; |
| 2233 | } |
| 2234 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 2235 | status=MagickFalse; |
| 2236 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2237 | { |
| 2238 | MagickBooleanType |
| 2239 | proceed; |
| 2240 | |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2241 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2242 | #pragma omp critical (MagickCore_HorizontalFilter) |
| 2243 | #endif |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2244 | proceed=SetImageProgress(image,ResizeImageTag,(*offset)++,span); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2245 | if (proceed == MagickFalse) |
| 2246 | status=MagickFalse; |
| 2247 | } |
| 2248 | } |
| 2249 | resize_view=DestroyCacheView(resize_view); |
| 2250 | image_view=DestroyCacheView(image_view); |
| 2251 | contributions=DestroyContributionThreadSet(contributions); |
| 2252 | return(status); |
| 2253 | } |
| 2254 | |
| 2255 | static MagickBooleanType VerticalFilter(const ResizeFilter *resize_filter, |
| 2256 | const Image *image,Image *resize_image,const MagickRealType y_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2257 | const MagickSizeType span,MagickOffsetType *offset,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2258 | { |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2259 | CacheView |
| 2260 | *image_view, |
| 2261 | *resize_view; |
| 2262 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2263 | ClassType |
| 2264 | storage_class; |
| 2265 | |
| 2266 | ContributionInfo |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2267 | **restrict contributions; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2268 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2269 | MagickBooleanType |
| 2270 | status; |
| 2271 | |
| 2272 | MagickPixelPacket |
| 2273 | zero; |
| 2274 | |
| 2275 | MagickRealType |
| 2276 | scale, |
| 2277 | support; |
| 2278 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2279 | ssize_t |
| 2280 | y; |
| 2281 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2282 | /* |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2283 | Apply filter to resize vertically from image to resize image. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2284 | */ |
cristy | 5d82438 | 2010-09-06 14:00:17 +0000 | [diff] [blame] | 2285 | scale=MagickMax(1.0/y_factor+MagickEpsilon,1.0); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2286 | support=scale*GetResizeFilterSupport(resize_filter); |
| 2287 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| 2288 | if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| 2289 | { |
| 2290 | InheritException(exception,&resize_image->exception); |
| 2291 | return(MagickFalse); |
| 2292 | } |
| 2293 | if (support < 0.5) |
| 2294 | { |
| 2295 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 2296 | Support too small even for nearest neighbour: Reduce to point |
| 2297 | sampling. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2298 | */ |
| 2299 | support=(MagickRealType) 0.5; |
| 2300 | scale=1.0; |
| 2301 | } |
| 2302 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| 2303 | if (contributions == (ContributionInfo **) NULL) |
| 2304 | { |
| 2305 | (void) ThrowMagickException(exception,GetMagickModule(), |
| 2306 | ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| 2307 | return(MagickFalse); |
| 2308 | } |
| 2309 | status=MagickTrue; |
| 2310 | scale=1.0/scale; |
| 2311 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2312 | image_view=AcquireCacheView(image); |
| 2313 | resize_view=AcquireCacheView(resize_image); |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2314 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2315 | #pragma omp parallel for shared(status) |
| 2316 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2317 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2318 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2319 | MagickRealType |
| 2320 | center, |
| 2321 | density; |
| 2322 | |
| 2323 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2324 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2325 | |
| 2326 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2327 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2328 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2329 | register ContributionInfo |
| 2330 | *restrict contribution; |
| 2331 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2332 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2333 | *restrict resize_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2334 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2335 | register PixelPacket |
| 2336 | *restrict q; |
| 2337 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2338 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2339 | x; |
| 2340 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2341 | ssize_t |
| 2342 | n, |
| 2343 | start, |
| 2344 | stop; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2345 | |
| 2346 | if (status == MagickFalse) |
| 2347 | continue; |
cristy | 679e696 | 2010-03-18 00:42:45 +0000 | [diff] [blame] | 2348 | center=(MagickRealType) (y+0.5)/y_factor; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2349 | start=(ssize_t) MagickMax(center-support+0.5,0.0); |
| 2350 | stop=(ssize_t) MagickMin(center+support+0.5,(double) image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2351 | density=0.0; |
| 2352 | contribution=contributions[GetOpenMPThreadId()]; |
| 2353 | for (n=0; n < (stop-start); n++) |
| 2354 | { |
| 2355 | contribution[n].pixel=start+n; |
| 2356 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| 2357 | ((MagickRealType) (start+n)-center+0.5)); |
| 2358 | density+=contribution[n].weight; |
| 2359 | } |
| 2360 | if ((density != 0.0) && (density != 1.0)) |
| 2361 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2362 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2363 | i; |
| 2364 | |
| 2365 | /* |
| 2366 | Normalize. |
| 2367 | */ |
| 2368 | density=1.0/density; |
| 2369 | for (i=0; i < n; i++) |
| 2370 | contribution[i].weight*=density; |
| 2371 | } |
| 2372 | p=GetCacheViewVirtualPixels(image_view,0,contribution[0].pixel, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2373 | image->columns,(size_t) (contribution[n-1].pixel-contribution[0].pixel+1), |
| 2374 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2375 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| 2376 | exception); |
| 2377 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2378 | { |
| 2379 | status=MagickFalse; |
| 2380 | continue; |
| 2381 | } |
| 2382 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
| 2383 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2384 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2385 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2386 | MagickPixelPacket |
| 2387 | pixel; |
| 2388 | |
| 2389 | MagickRealType |
| 2390 | alpha; |
| 2391 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2392 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2393 | i; |
| 2394 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2395 | ssize_t |
| 2396 | j; |
| 2397 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2398 | pixel=zero; |
| 2399 | if (image->matte == MagickFalse) |
| 2400 | { |
| 2401 | for (i=0; i < n; i++) |
| 2402 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2403 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2404 | image->columns+x); |
| 2405 | alpha=contribution[i].weight; |
| 2406 | pixel.red+=alpha*(p+j)->red; |
| 2407 | pixel.green+=alpha*(p+j)->green; |
| 2408 | pixel.blue+=alpha*(p+j)->blue; |
| 2409 | pixel.opacity+=alpha*(p+j)->opacity; |
| 2410 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2411 | SetRedPixelComponent(q,ClampRedPixelComponent(&pixel)); |
| 2412 | SetGreenPixelComponent(q,ClampGreenPixelComponent(&pixel)); |
| 2413 | SetBluePixelComponent(q,ClampBluePixelComponent(&pixel)); |
| 2414 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2415 | if ((image->colorspace == CMYKColorspace) && |
| 2416 | (resize_image->colorspace == CMYKColorspace)) |
| 2417 | { |
| 2418 | for (i=0; i < n; i++) |
| 2419 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2420 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2421 | image->columns+x); |
| 2422 | alpha=contribution[i].weight; |
| 2423 | pixel.index+=alpha*indexes[j]; |
| 2424 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2425 | resize_indexes[x]=(IndexPacket) ClampToQuantum(pixel.index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2426 | } |
| 2427 | } |
| 2428 | else |
| 2429 | { |
| 2430 | MagickRealType |
| 2431 | gamma; |
| 2432 | |
| 2433 | gamma=0.0; |
| 2434 | for (i=0; i < n; i++) |
| 2435 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2436 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2437 | image->columns+x); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2438 | alpha=contribution[i].weight*QuantumScale* |
| 2439 | GetAlphaPixelComponent(p+j); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2440 | pixel.red+=alpha*(p+j)->red; |
| 2441 | pixel.green+=alpha*(p+j)->green; |
| 2442 | pixel.blue+=alpha*(p+j)->blue; |
| 2443 | pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| 2444 | gamma+=alpha; |
| 2445 | } |
| 2446 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2447 | q->red=ClampToQuantum(gamma*GetRedPixelComponent(&pixel)); |
| 2448 | q->green=ClampToQuantum(gamma*GetGreenPixelComponent(&pixel)); |
| 2449 | q->blue=ClampToQuantum(gamma*GetBluePixelComponent(&pixel)); |
| 2450 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2451 | if ((image->colorspace == CMYKColorspace) && |
| 2452 | (resize_image->colorspace == CMYKColorspace)) |
| 2453 | { |
| 2454 | for (i=0; i < n; i++) |
| 2455 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2456 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2457 | image->columns+x); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2458 | alpha=contribution[i].weight*QuantumScale* |
| 2459 | GetAlphaPixelComponent(p+j); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2460 | pixel.index+=alpha*indexes[j]; |
| 2461 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2462 | resize_indexes[x]=(IndexPacket) ClampToQuantum(gamma* |
| 2463 | GetIndexPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2464 | } |
| 2465 | } |
| 2466 | if ((resize_image->storage_class == PseudoClass) && |
| 2467 | (image->storage_class == PseudoClass)) |
| 2468 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2469 | i=(ssize_t) (MagickMin(MagickMax(center,(double) start),(double) stop- |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2470 | 1.0)+0.5); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2471 | j=(ssize_t) ((contribution[i-start].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2472 | image->columns+x); |
| 2473 | resize_indexes[x]=indexes[j]; |
| 2474 | } |
| 2475 | q++; |
| 2476 | } |
| 2477 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 2478 | status=MagickFalse; |
| 2479 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2480 | { |
| 2481 | MagickBooleanType |
| 2482 | proceed; |
| 2483 | |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2484 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2485 | #pragma omp critical (MagickCore_VerticalFilter) |
| 2486 | #endif |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2487 | proceed=SetImageProgress(image,ResizeImageTag,(*offset)++,span); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2488 | if (proceed == MagickFalse) |
| 2489 | status=MagickFalse; |
| 2490 | } |
| 2491 | } |
| 2492 | resize_view=DestroyCacheView(resize_view); |
| 2493 | image_view=DestroyCacheView(image_view); |
| 2494 | contributions=DestroyContributionThreadSet(contributions); |
| 2495 | return(status); |
| 2496 | } |
| 2497 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2498 | MagickExport Image *ResizeImage(const Image *image,const size_t columns, |
| 2499 | const size_t rows,const FilterTypes filter,const double blur, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2500 | ExceptionInfo *exception) |
| 2501 | { |
| 2502 | #define WorkLoadFactor 0.265 |
| 2503 | |
| 2504 | FilterTypes |
| 2505 | filter_type; |
| 2506 | |
| 2507 | Image |
| 2508 | *filter_image, |
| 2509 | *resize_image; |
| 2510 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2511 | MagickOffsetType |
| 2512 | offset; |
| 2513 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2514 | MagickRealType |
| 2515 | x_factor, |
| 2516 | y_factor; |
| 2517 | |
| 2518 | MagickSizeType |
| 2519 | span; |
| 2520 | |
| 2521 | MagickStatusType |
| 2522 | status; |
| 2523 | |
| 2524 | ResizeFilter |
| 2525 | *resize_filter; |
| 2526 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2527 | /* |
| 2528 | Acquire resize image. |
| 2529 | */ |
| 2530 | assert(image != (Image *) NULL); |
| 2531 | assert(image->signature == MagickSignature); |
| 2532 | if (image->debug != MagickFalse) |
| 2533 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2534 | assert(exception != (ExceptionInfo *) NULL); |
| 2535 | assert(exception->signature == MagickSignature); |
| 2536 | if ((columns == 0) || (rows == 0)) |
| 2537 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| 2538 | if ((columns == image->columns) && (rows == image->rows) && |
| 2539 | (filter == UndefinedFilter) && (blur == 1.0)) |
| 2540 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2541 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2542 | if (resize_image == (Image *) NULL) |
| 2543 | return(resize_image); |
| 2544 | /* |
| 2545 | Acquire resize filter. |
| 2546 | */ |
| 2547 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| 2548 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| 2549 | if ((x_factor*y_factor) > WorkLoadFactor) |
| 2550 | filter_image=CloneImage(image,columns,image->rows,MagickTrue,exception); |
| 2551 | else |
| 2552 | filter_image=CloneImage(image,image->columns,rows,MagickTrue,exception); |
| 2553 | if (filter_image == (Image *) NULL) |
| 2554 | return(DestroyImage(resize_image)); |
| 2555 | filter_type=LanczosFilter; |
| 2556 | if (filter != UndefinedFilter) |
| 2557 | filter_type=filter; |
| 2558 | else |
| 2559 | if ((x_factor == 1.0) && (y_factor == 1.0)) |
| 2560 | filter_type=PointFilter; |
| 2561 | else |
| 2562 | if ((image->storage_class == PseudoClass) || |
| 2563 | (image->matte != MagickFalse) || ((x_factor*y_factor) > 1.0)) |
| 2564 | filter_type=MitchellFilter; |
| 2565 | resize_filter=AcquireResizeFilter(image,filter_type,blur,MagickFalse, |
| 2566 | exception); |
| 2567 | /* |
| 2568 | Resize image. |
| 2569 | */ |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2570 | offset=0; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2571 | if ((x_factor*y_factor) > WorkLoadFactor) |
| 2572 | { |
| 2573 | span=(MagickSizeType) (filter_image->columns+rows); |
| 2574 | status=HorizontalFilter(resize_filter,image,filter_image,x_factor,span, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2575 | &offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2576 | status&=VerticalFilter(resize_filter,filter_image,resize_image,y_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2577 | span,&offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2578 | } |
| 2579 | else |
| 2580 | { |
| 2581 | span=(MagickSizeType) (filter_image->rows+columns); |
| 2582 | status=VerticalFilter(resize_filter,image,filter_image,y_factor,span, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2583 | &offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2584 | status&=HorizontalFilter(resize_filter,filter_image,resize_image,x_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2585 | span,&offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2586 | } |
| 2587 | /* |
| 2588 | Free resources. |
| 2589 | */ |
| 2590 | filter_image=DestroyImage(filter_image); |
| 2591 | resize_filter=DestroyResizeFilter(resize_filter); |
| 2592 | if ((status == MagickFalse) || (resize_image == (Image *) NULL)) |
| 2593 | return((Image *) NULL); |
| 2594 | resize_image->type=image->type; |
| 2595 | return(resize_image); |
| 2596 | } |
| 2597 | |
| 2598 | /* |
| 2599 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2600 | % % |
| 2601 | % % |
| 2602 | % % |
| 2603 | % S a m p l e I m a g e % |
| 2604 | % % |
| 2605 | % % |
| 2606 | % % |
| 2607 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2608 | % |
| 2609 | % SampleImage() scales an image to the desired dimensions with pixel |
| 2610 | % sampling. Unlike other scaling methods, this method does not introduce |
| 2611 | % any additional color into the scaled image. |
| 2612 | % |
| 2613 | % The format of the SampleImage method is: |
| 2614 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2615 | % Image *SampleImage(const Image *image,const size_t columns, |
| 2616 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2617 | % |
| 2618 | % A description of each parameter follows: |
| 2619 | % |
| 2620 | % o image: the image. |
| 2621 | % |
| 2622 | % o columns: the number of columns in the sampled image. |
| 2623 | % |
| 2624 | % o rows: the number of rows in the sampled image. |
| 2625 | % |
| 2626 | % o exception: return any errors or warnings in this structure. |
| 2627 | % |
| 2628 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2629 | MagickExport Image *SampleImage(const Image *image,const size_t columns, |
| 2630 | const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2631 | { |
| 2632 | #define SampleImageTag "Sample/Image" |
| 2633 | |
cristy | c4c8d13 | 2010-01-07 01:58:38 +0000 | [diff] [blame] | 2634 | CacheView |
| 2635 | *image_view, |
| 2636 | *sample_view; |
| 2637 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2638 | Image |
| 2639 | *sample_image; |
| 2640 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2641 | MagickBooleanType |
| 2642 | status; |
| 2643 | |
cristy | 5f95947 | 2010-05-27 22:19:46 +0000 | [diff] [blame] | 2644 | MagickOffsetType |
| 2645 | progress; |
| 2646 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2647 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2648 | x; |
| 2649 | |
cristy | 5f95947 | 2010-05-27 22:19:46 +0000 | [diff] [blame] | 2650 | ssize_t |
| 2651 | *x_offset, |
| 2652 | y; |
| 2653 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2654 | /* |
| 2655 | Initialize sampled image attributes. |
| 2656 | */ |
| 2657 | assert(image != (const Image *) NULL); |
| 2658 | assert(image->signature == MagickSignature); |
| 2659 | if (image->debug != MagickFalse) |
| 2660 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2661 | assert(exception != (ExceptionInfo *) NULL); |
| 2662 | assert(exception->signature == MagickSignature); |
| 2663 | if ((columns == 0) || (rows == 0)) |
| 2664 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| 2665 | if ((columns == image->columns) && (rows == image->rows)) |
| 2666 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2667 | sample_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2668 | if (sample_image == (Image *) NULL) |
| 2669 | return((Image *) NULL); |
| 2670 | /* |
| 2671 | Allocate scan line buffer and column offset buffers. |
| 2672 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2673 | x_offset=(ssize_t *) AcquireQuantumMemory((size_t) sample_image->columns, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2674 | sizeof(*x_offset)); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2675 | if (x_offset == (ssize_t *) NULL) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2676 | { |
| 2677 | sample_image=DestroyImage(sample_image); |
| 2678 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 2679 | } |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2680 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
| 2681 | x_offset[x]=(ssize_t) (((MagickRealType) x+0.5)*image->columns/ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2682 | sample_image->columns); |
| 2683 | /* |
| 2684 | Sample each row. |
| 2685 | */ |
| 2686 | status=MagickTrue; |
| 2687 | progress=0; |
| 2688 | image_view=AcquireCacheView(image); |
| 2689 | sample_view=AcquireCacheView(sample_image); |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2690 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 2691 | #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2692 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2693 | for (y=0; y < (ssize_t) sample_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2694 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2695 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2696 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2697 | |
| 2698 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2699 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2700 | |
| 2701 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2702 | *restrict sample_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2703 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2704 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2705 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2706 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2707 | register ssize_t |
| 2708 | x; |
| 2709 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2710 | ssize_t |
| 2711 | y_offset; |
| 2712 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2713 | if (status == MagickFalse) |
| 2714 | continue; |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2715 | y_offset=(ssize_t) (((MagickRealType) y+0.5)*image->rows/ |
| 2716 | sample_image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2717 | p=GetCacheViewVirtualPixels(image_view,0,y_offset,image->columns,1, |
| 2718 | exception); |
| 2719 | q=QueueCacheViewAuthenticPixels(sample_view,0,y,sample_image->columns,1, |
| 2720 | exception); |
| 2721 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2722 | { |
| 2723 | status=MagickFalse; |
| 2724 | continue; |
| 2725 | } |
| 2726 | indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| 2727 | sample_indexes=GetCacheViewAuthenticIndexQueue(sample_view); |
| 2728 | /* |
| 2729 | Sample each column. |
| 2730 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2731 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2732 | *q++=p[x_offset[x]]; |
| 2733 | if ((image->storage_class == PseudoClass) || |
| 2734 | (image->colorspace == CMYKColorspace)) |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2735 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2736 | sample_indexes[x]=indexes[x_offset[x]]; |
| 2737 | if (SyncCacheViewAuthenticPixels(sample_view,exception) == MagickFalse) |
| 2738 | status=MagickFalse; |
| 2739 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2740 | { |
| 2741 | MagickBooleanType |
| 2742 | proceed; |
| 2743 | |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2744 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2745 | #pragma omp critical (MagickCore_SampleImage) |
| 2746 | #endif |
| 2747 | proceed=SetImageProgress(image,SampleImageTag,progress++,image->rows); |
| 2748 | if (proceed == MagickFalse) |
| 2749 | status=MagickFalse; |
| 2750 | } |
| 2751 | } |
| 2752 | image_view=DestroyCacheView(image_view); |
| 2753 | sample_view=DestroyCacheView(sample_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2754 | x_offset=(ssize_t *) RelinquishMagickMemory(x_offset); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2755 | sample_image->type=image->type; |
| 2756 | return(sample_image); |
| 2757 | } |
| 2758 | |
| 2759 | /* |
| 2760 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2761 | % % |
| 2762 | % % |
| 2763 | % % |
| 2764 | % S c a l e I m a g e % |
| 2765 | % % |
| 2766 | % % |
| 2767 | % % |
| 2768 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2769 | % |
| 2770 | % ScaleImage() changes the size of an image to the given dimensions. |
| 2771 | % |
| 2772 | % The format of the ScaleImage method is: |
| 2773 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2774 | % Image *ScaleImage(const Image *image,const size_t columns, |
| 2775 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2776 | % |
| 2777 | % A description of each parameter follows: |
| 2778 | % |
| 2779 | % o image: the image. |
| 2780 | % |
| 2781 | % o columns: the number of columns in the scaled image. |
| 2782 | % |
| 2783 | % o rows: the number of rows in the scaled image. |
| 2784 | % |
| 2785 | % o exception: return any errors or warnings in this structure. |
| 2786 | % |
| 2787 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2788 | MagickExport Image *ScaleImage(const Image *image,const size_t columns, |
| 2789 | const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2790 | { |
| 2791 | #define ScaleImageTag "Scale/Image" |
| 2792 | |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2793 | CacheView |
| 2794 | *image_view, |
| 2795 | *scale_view; |
| 2796 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2797 | Image |
| 2798 | *scale_image; |
| 2799 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2800 | MagickBooleanType |
| 2801 | next_column, |
| 2802 | next_row, |
| 2803 | proceed; |
| 2804 | |
| 2805 | MagickPixelPacket |
| 2806 | pixel, |
| 2807 | *scale_scanline, |
| 2808 | *scanline, |
| 2809 | *x_vector, |
| 2810 | *y_vector, |
| 2811 | zero; |
| 2812 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2813 | PointInfo |
| 2814 | scale, |
| 2815 | span; |
| 2816 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2817 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2818 | i; |
| 2819 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2820 | ssize_t |
| 2821 | number_rows, |
| 2822 | y; |
| 2823 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2824 | /* |
| 2825 | Initialize scaled image attributes. |
| 2826 | */ |
| 2827 | assert(image != (const Image *) NULL); |
| 2828 | assert(image->signature == MagickSignature); |
| 2829 | if (image->debug != MagickFalse) |
| 2830 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2831 | assert(exception != (ExceptionInfo *) NULL); |
| 2832 | assert(exception->signature == MagickSignature); |
| 2833 | if ((columns == 0) || (rows == 0)) |
| 2834 | return((Image *) NULL); |
| 2835 | if ((columns == image->columns) && (rows == image->rows)) |
| 2836 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2837 | scale_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2838 | if (scale_image == (Image *) NULL) |
| 2839 | return((Image *) NULL); |
| 2840 | if (SetImageStorageClass(scale_image,DirectClass) == MagickFalse) |
| 2841 | { |
| 2842 | InheritException(exception,&scale_image->exception); |
| 2843 | scale_image=DestroyImage(scale_image); |
| 2844 | return((Image *) NULL); |
| 2845 | } |
| 2846 | /* |
| 2847 | Allocate memory. |
| 2848 | */ |
| 2849 | x_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2850 | sizeof(*x_vector)); |
| 2851 | scanline=x_vector; |
| 2852 | if (image->rows != scale_image->rows) |
| 2853 | scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2854 | sizeof(*scanline)); |
| 2855 | scale_scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) |
| 2856 | scale_image->columns,sizeof(*scale_scanline)); |
| 2857 | y_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2858 | sizeof(*y_vector)); |
| 2859 | if ((scanline == (MagickPixelPacket *) NULL) || |
| 2860 | (scale_scanline == (MagickPixelPacket *) NULL) || |
| 2861 | (x_vector == (MagickPixelPacket *) NULL) || |
| 2862 | (y_vector == (MagickPixelPacket *) NULL)) |
| 2863 | { |
| 2864 | scale_image=DestroyImage(scale_image); |
| 2865 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 2866 | } |
| 2867 | /* |
| 2868 | Scale image. |
| 2869 | */ |
| 2870 | number_rows=0; |
| 2871 | next_row=MagickTrue; |
| 2872 | span.y=1.0; |
| 2873 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 2874 | (void) ResetMagickMemory(y_vector,0,(size_t) image->columns* |
| 2875 | sizeof(*y_vector)); |
| 2876 | GetMagickPixelPacket(image,&pixel); |
| 2877 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2878 | i=0; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2879 | image_view=AcquireCacheView(image); |
| 2880 | scale_view=AcquireCacheView(scale_image); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2881 | for (y=0; y < (ssize_t) scale_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2882 | { |
| 2883 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2884 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2885 | |
| 2886 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2887 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2888 | |
| 2889 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2890 | *restrict scale_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2891 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2892 | register MagickPixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2893 | *restrict s, |
| 2894 | *restrict t; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2895 | |
| 2896 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2897 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2898 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2899 | register ssize_t |
| 2900 | x; |
| 2901 | |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2902 | q=QueueCacheViewAuthenticPixels(scale_view,0,y,scale_image->columns,1, |
| 2903 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2904 | if (q == (PixelPacket *) NULL) |
| 2905 | break; |
| 2906 | scale_indexes=GetAuthenticIndexQueue(scale_image); |
| 2907 | if (scale_image->rows == image->rows) |
| 2908 | { |
| 2909 | /* |
| 2910 | Read a new scanline. |
| 2911 | */ |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2912 | p=GetCacheViewVirtualPixels(image_view,0,i++,image->columns,1, |
| 2913 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2914 | if (p == (const PixelPacket *) NULL) |
| 2915 | break; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2916 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2917 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2918 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2919 | x_vector[x].red=(MagickRealType) GetRedPixelComponent(p); |
| 2920 | x_vector[x].green=(MagickRealType) GetGreenPixelComponent(p); |
| 2921 | x_vector[x].blue=(MagickRealType) GetBluePixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2922 | if (image->matte != MagickFalse) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2923 | x_vector[x].opacity=(MagickRealType) GetOpacityPixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2924 | if (indexes != (IndexPacket *) NULL) |
| 2925 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2926 | p++; |
| 2927 | } |
| 2928 | } |
| 2929 | else |
| 2930 | { |
| 2931 | /* |
| 2932 | Scale Y direction. |
| 2933 | */ |
| 2934 | while (scale.y < span.y) |
| 2935 | { |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2936 | if ((next_row != MagickFalse) && |
| 2937 | (number_rows < (ssize_t) image->rows)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2938 | { |
| 2939 | /* |
| 2940 | Read a new scanline. |
| 2941 | */ |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2942 | p=GetCacheViewVirtualPixels(image_view,0,i++,image->columns,1, |
| 2943 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2944 | if (p == (const PixelPacket *) NULL) |
| 2945 | break; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2946 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2947 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2948 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2949 | x_vector[x].red=(MagickRealType) GetRedPixelComponent(p); |
| 2950 | x_vector[x].green=(MagickRealType) GetGreenPixelComponent(p); |
| 2951 | x_vector[x].blue=(MagickRealType) GetBluePixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2952 | if (image->matte != MagickFalse) |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2953 | x_vector[x].opacity=(MagickRealType) |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2954 | GetOpacityPixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2955 | if (indexes != (IndexPacket *) NULL) |
| 2956 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2957 | p++; |
| 2958 | } |
| 2959 | number_rows++; |
| 2960 | } |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2961 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2962 | { |
| 2963 | y_vector[x].red+=scale.y*x_vector[x].red; |
| 2964 | y_vector[x].green+=scale.y*x_vector[x].green; |
| 2965 | y_vector[x].blue+=scale.y*x_vector[x].blue; |
| 2966 | if (scale_image->matte != MagickFalse) |
| 2967 | y_vector[x].opacity+=scale.y*x_vector[x].opacity; |
| 2968 | if (scale_indexes != (IndexPacket *) NULL) |
| 2969 | y_vector[x].index+=scale.y*x_vector[x].index; |
| 2970 | } |
| 2971 | span.y-=scale.y; |
| 2972 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 2973 | next_row=MagickTrue; |
| 2974 | } |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2975 | if ((next_row != MagickFalse) && (number_rows < (ssize_t) image->rows)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2976 | { |
| 2977 | /* |
| 2978 | Read a new scanline. |
| 2979 | */ |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2980 | p=GetCacheViewVirtualPixels(image_view,0,i++,image->columns,1, |
| 2981 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2982 | if (p == (const PixelPacket *) NULL) |
| 2983 | break; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2984 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2985 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2986 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2987 | x_vector[x].red=(MagickRealType) GetRedPixelComponent(p); |
| 2988 | x_vector[x].green=(MagickRealType) GetGreenPixelComponent(p); |
| 2989 | x_vector[x].blue=(MagickRealType) GetBluePixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2990 | if (image->matte != MagickFalse) |
cristy | 2b726bd | 2010-01-11 01:05:39 +0000 | [diff] [blame] | 2991 | x_vector[x].opacity=(MagickRealType) |
| 2992 | GetOpacityPixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2993 | if (indexes != (IndexPacket *) NULL) |
| 2994 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2995 | p++; |
| 2996 | } |
| 2997 | number_rows++; |
| 2998 | next_row=MagickFalse; |
| 2999 | } |
| 3000 | s=scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3001 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3002 | { |
| 3003 | pixel.red=y_vector[x].red+span.y*x_vector[x].red; |
| 3004 | pixel.green=y_vector[x].green+span.y*x_vector[x].green; |
| 3005 | pixel.blue=y_vector[x].blue+span.y*x_vector[x].blue; |
| 3006 | if (image->matte != MagickFalse) |
| 3007 | pixel.opacity=y_vector[x].opacity+span.y*x_vector[x].opacity; |
| 3008 | if (scale_indexes != (IndexPacket *) NULL) |
| 3009 | pixel.index=y_vector[x].index+span.y*x_vector[x].index; |
| 3010 | s->red=pixel.red; |
| 3011 | s->green=pixel.green; |
| 3012 | s->blue=pixel.blue; |
| 3013 | if (scale_image->matte != MagickFalse) |
| 3014 | s->opacity=pixel.opacity; |
| 3015 | if (scale_indexes != (IndexPacket *) NULL) |
| 3016 | s->index=pixel.index; |
| 3017 | s++; |
| 3018 | y_vector[x]=zero; |
| 3019 | } |
| 3020 | scale.y-=span.y; |
| 3021 | if (scale.y <= 0) |
| 3022 | { |
| 3023 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 3024 | next_row=MagickTrue; |
| 3025 | } |
| 3026 | span.y=1.0; |
| 3027 | } |
| 3028 | if (scale_image->columns == image->columns) |
| 3029 | { |
| 3030 | /* |
| 3031 | Transfer scanline to scaled image. |
| 3032 | */ |
| 3033 | s=scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3034 | for (x=0; x < (ssize_t) scale_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3035 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3036 | q->red=ClampToQuantum(s->red); |
| 3037 | q->green=ClampToQuantum(s->green); |
| 3038 | q->blue=ClampToQuantum(s->blue); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3039 | if (scale_image->matte != MagickFalse) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3040 | q->opacity=ClampToQuantum(s->opacity); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3041 | if (scale_indexes != (IndexPacket *) NULL) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3042 | scale_indexes[x]=(IndexPacket) ClampToQuantum(s->index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3043 | q++; |
| 3044 | s++; |
| 3045 | } |
| 3046 | } |
| 3047 | else |
| 3048 | { |
| 3049 | /* |
| 3050 | Scale X direction. |
| 3051 | */ |
| 3052 | pixel=zero; |
| 3053 | next_column=MagickFalse; |
| 3054 | span.x=1.0; |
| 3055 | s=scanline; |
| 3056 | t=scale_scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3057 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3058 | { |
| 3059 | scale.x=(double) scale_image->columns/(double) image->columns; |
| 3060 | while (scale.x >= span.x) |
| 3061 | { |
| 3062 | if (next_column != MagickFalse) |
| 3063 | { |
| 3064 | pixel=zero; |
| 3065 | t++; |
| 3066 | } |
| 3067 | pixel.red+=span.x*s->red; |
| 3068 | pixel.green+=span.x*s->green; |
| 3069 | pixel.blue+=span.x*s->blue; |
| 3070 | if (image->matte != MagickFalse) |
| 3071 | pixel.opacity+=span.x*s->opacity; |
| 3072 | if (scale_indexes != (IndexPacket *) NULL) |
| 3073 | pixel.index+=span.x*s->index; |
| 3074 | t->red=pixel.red; |
| 3075 | t->green=pixel.green; |
| 3076 | t->blue=pixel.blue; |
| 3077 | if (scale_image->matte != MagickFalse) |
| 3078 | t->opacity=pixel.opacity; |
| 3079 | if (scale_indexes != (IndexPacket *) NULL) |
| 3080 | t->index=pixel.index; |
| 3081 | scale.x-=span.x; |
| 3082 | span.x=1.0; |
| 3083 | next_column=MagickTrue; |
| 3084 | } |
| 3085 | if (scale.x > 0) |
| 3086 | { |
| 3087 | if (next_column != MagickFalse) |
| 3088 | { |
| 3089 | pixel=zero; |
| 3090 | next_column=MagickFalse; |
| 3091 | t++; |
| 3092 | } |
| 3093 | pixel.red+=scale.x*s->red; |
| 3094 | pixel.green+=scale.x*s->green; |
| 3095 | pixel.blue+=scale.x*s->blue; |
| 3096 | if (scale_image->matte != MagickFalse) |
| 3097 | pixel.opacity+=scale.x*s->opacity; |
| 3098 | if (scale_indexes != (IndexPacket *) NULL) |
| 3099 | pixel.index+=scale.x*s->index; |
| 3100 | span.x-=scale.x; |
| 3101 | } |
| 3102 | s++; |
| 3103 | } |
| 3104 | if (span.x > 0) |
| 3105 | { |
| 3106 | s--; |
| 3107 | pixel.red+=span.x*s->red; |
| 3108 | pixel.green+=span.x*s->green; |
| 3109 | pixel.blue+=span.x*s->blue; |
| 3110 | if (scale_image->matte != MagickFalse) |
| 3111 | pixel.opacity+=span.x*s->opacity; |
| 3112 | if (scale_indexes != (IndexPacket *) NULL) |
| 3113 | pixel.index+=span.x*s->index; |
| 3114 | } |
| 3115 | if ((next_column == MagickFalse) && |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3116 | ((ssize_t) (t-scale_scanline) < (ssize_t) scale_image->columns)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3117 | { |
| 3118 | t->red=pixel.red; |
| 3119 | t->green=pixel.green; |
| 3120 | t->blue=pixel.blue; |
| 3121 | if (scale_image->matte != MagickFalse) |
| 3122 | t->opacity=pixel.opacity; |
| 3123 | if (scale_indexes != (IndexPacket *) NULL) |
| 3124 | t->index=pixel.index; |
| 3125 | } |
| 3126 | /* |
| 3127 | Transfer scanline to scaled image. |
| 3128 | */ |
| 3129 | t=scale_scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3130 | for (x=0; x < (ssize_t) scale_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3131 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3132 | q->red=ClampToQuantum(t->red); |
| 3133 | q->green=ClampToQuantum(t->green); |
| 3134 | q->blue=ClampToQuantum(t->blue); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3135 | if (scale_image->matte != MagickFalse) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3136 | q->opacity=ClampToQuantum(t->opacity); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3137 | if (scale_indexes != (IndexPacket *) NULL) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3138 | scale_indexes[x]=(IndexPacket) ClampToQuantum(t->index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3139 | t++; |
| 3140 | q++; |
| 3141 | } |
| 3142 | } |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3143 | if (SyncCacheViewAuthenticPixels(scale_view,exception) == MagickFalse) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3144 | break; |
cristy | 96b1613 | 2010-08-29 17:19:52 +0000 | [diff] [blame] | 3145 | proceed=SetImageProgress(image,ScaleImageTag,(MagickOffsetType) y, |
| 3146 | image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3147 | if (proceed == MagickFalse) |
| 3148 | break; |
| 3149 | } |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3150 | scale_view=DestroyCacheView(scale_view); |
| 3151 | image_view=DestroyCacheView(image_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3152 | /* |
| 3153 | Free allocated memory. |
| 3154 | */ |
| 3155 | y_vector=(MagickPixelPacket *) RelinquishMagickMemory(y_vector); |
| 3156 | scale_scanline=(MagickPixelPacket *) RelinquishMagickMemory(scale_scanline); |
| 3157 | if (scale_image->rows != image->rows) |
| 3158 | scanline=(MagickPixelPacket *) RelinquishMagickMemory(scanline); |
| 3159 | x_vector=(MagickPixelPacket *) RelinquishMagickMemory(x_vector); |
| 3160 | scale_image->type=image->type; |
| 3161 | return(scale_image); |
| 3162 | } |
| 3163 | |
anthony | 02b4cb4 | 2010-10-10 04:54:35 +0000 | [diff] [blame] | 3164 | #if 0 |
| 3165 | THIS IS NOT USED -- to be removed |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3166 | /* |
| 3167 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3168 | % % |
| 3169 | % % |
| 3170 | % % |
| 3171 | + S e t R e s i z e F i l t e r S u p p o r t % |
| 3172 | % % |
| 3173 | % % |
| 3174 | % % |
| 3175 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3176 | % |
| 3177 | % SetResizeFilterSupport() specifies which IR filter to use to window |
| 3178 | % |
| 3179 | % The format of the SetResizeFilterSupport method is: |
| 3180 | % |
| 3181 | % void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| 3182 | % const MagickRealType support) |
| 3183 | % |
| 3184 | % A description of each parameter follows: |
| 3185 | % |
| 3186 | % o resize_filter: the resize filter. |
| 3187 | % |
| 3188 | % o support: the filter spport radius. |
| 3189 | % |
| 3190 | */ |
| 3191 | MagickExport void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| 3192 | const MagickRealType support) |
| 3193 | { |
| 3194 | assert(resize_filter != (ResizeFilter *) NULL); |
| 3195 | assert(resize_filter->signature == MagickSignature); |
| 3196 | resize_filter->support=support; |
| 3197 | } |
anthony | 02b4cb4 | 2010-10-10 04:54:35 +0000 | [diff] [blame] | 3198 | #endif |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3199 | |
| 3200 | /* |
| 3201 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3202 | % % |
| 3203 | % % |
| 3204 | % % |
| 3205 | % T h u m b n a i l I m a g e % |
| 3206 | % % |
| 3207 | % % |
| 3208 | % % |
| 3209 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3210 | % |
| 3211 | % ThumbnailImage() changes the size of an image to the given dimensions and |
| 3212 | % removes any associated profiles. The goal is to produce small low cost |
| 3213 | % thumbnail images suited for display on the Web. |
| 3214 | % |
| 3215 | % The format of the ThumbnailImage method is: |
| 3216 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3217 | % Image *ThumbnailImage(const Image *image,const size_t columns, |
| 3218 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3219 | % |
| 3220 | % A description of each parameter follows: |
| 3221 | % |
| 3222 | % o image: the image. |
| 3223 | % |
| 3224 | % o columns: the number of columns in the scaled image. |
| 3225 | % |
| 3226 | % o rows: the number of rows in the scaled image. |
| 3227 | % |
| 3228 | % o exception: return any errors or warnings in this structure. |
| 3229 | % |
| 3230 | */ |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 3231 | MagickExport Image *ThumbnailImage(const Image *image,const size_t columns, |
| 3232 | const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3233 | { |
| 3234 | #define SampleFactor 5 |
| 3235 | |
| 3236 | char |
| 3237 | value[MaxTextExtent]; |
| 3238 | |
| 3239 | const char |
| 3240 | *name; |
| 3241 | |
| 3242 | Image |
| 3243 | *thumbnail_image; |
| 3244 | |
| 3245 | MagickRealType |
| 3246 | x_factor, |
| 3247 | y_factor; |
| 3248 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3249 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3250 | version; |
| 3251 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 3252 | struct stat |
| 3253 | attributes; |
| 3254 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3255 | assert(image != (Image *) NULL); |
| 3256 | assert(image->signature == MagickSignature); |
| 3257 | if (image->debug != MagickFalse) |
| 3258 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 3259 | assert(exception != (ExceptionInfo *) NULL); |
| 3260 | assert(exception->signature == MagickSignature); |
| 3261 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| 3262 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| 3263 | if ((x_factor*y_factor) > 0.1) |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 3264 | thumbnail_image=ResizeImage(image,columns,rows,image->filter,image->blur, |
| 3265 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3266 | else |
| 3267 | if (((SampleFactor*columns) < 128) || ((SampleFactor*rows) < 128)) |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 3268 | thumbnail_image=ResizeImage(image,columns,rows,image->filter, |
| 3269 | image->blur,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3270 | else |
| 3271 | { |
| 3272 | Image |
| 3273 | *sample_image; |
| 3274 | |
| 3275 | sample_image=SampleImage(image,SampleFactor*columns,SampleFactor*rows, |
| 3276 | exception); |
| 3277 | if (sample_image == (Image *) NULL) |
| 3278 | return((Image *) NULL); |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 3279 | thumbnail_image=ResizeImage(sample_image,columns,rows,image->filter, |
| 3280 | image->blur,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3281 | sample_image=DestroyImage(sample_image); |
| 3282 | } |
| 3283 | if (thumbnail_image == (Image *) NULL) |
| 3284 | return(thumbnail_image); |
| 3285 | (void) ParseAbsoluteGeometry("0x0+0+0",&thumbnail_image->page); |
| 3286 | if (thumbnail_image->matte == MagickFalse) |
| 3287 | (void) SetImageAlphaChannel(thumbnail_image,OpaqueAlphaChannel); |
| 3288 | thumbnail_image->depth=8; |
| 3289 | thumbnail_image->interlace=NoInterlace; |
| 3290 | /* |
| 3291 | Strip all profiles except color profiles. |
| 3292 | */ |
| 3293 | ResetImageProfileIterator(thumbnail_image); |
| 3294 | for (name=GetNextImageProfile(thumbnail_image); name != (const char *) NULL; ) |
| 3295 | { |
| 3296 | if ((LocaleCompare(name,"icc") != 0) && (LocaleCompare(name,"icm") != 0)) |
| 3297 | { |
cristy | 2b726bd | 2010-01-11 01:05:39 +0000 | [diff] [blame] | 3298 | (void) DeleteImageProfile(thumbnail_image,name); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3299 | ResetImageProfileIterator(thumbnail_image); |
| 3300 | } |
| 3301 | name=GetNextImageProfile(thumbnail_image); |
| 3302 | } |
| 3303 | (void) DeleteImageProperty(thumbnail_image,"comment"); |
| 3304 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
cristy | 7b63d66 | 2009-11-13 01:58:56 +0000 | [diff] [blame] | 3305 | if (strstr(image->magick_filename,"//") == (char *) NULL) |
| 3306 | (void) FormatMagickString(value,MaxTextExtent,"file://%s", |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3307 | image->magick_filename); |
| 3308 | (void) SetImageProperty(thumbnail_image,"Thumb::URI",value); |
| 3309 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
| 3310 | if (GetPathAttributes(image->filename,&attributes) != MagickFalse) |
| 3311 | { |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3312 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3313 | attributes.st_mtime); |
| 3314 | (void) SetImageProperty(thumbnail_image,"Thumb::MTime",value); |
| 3315 | } |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3316 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3317 | attributes.st_mtime); |
cristy | b9080c9 | 2009-12-01 20:13:26 +0000 | [diff] [blame] | 3318 | (void) FormatMagickSize(GetBlobSize(image),MagickFalse,value); |
cristy | 2ce15c9 | 2010-03-12 14:03:41 +0000 | [diff] [blame] | 3319 | (void) ConcatenateMagickString(value,"B",MaxTextExtent); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3320 | (void) SetImageProperty(thumbnail_image,"Thumb::Size",value); |
| 3321 | (void) FormatMagickString(value,MaxTextExtent,"image/%s",image->magick); |
| 3322 | LocaleLower(value); |
| 3323 | (void) SetImageProperty(thumbnail_image,"Thumb::Mimetype",value); |
| 3324 | (void) SetImageProperty(thumbnail_image,"software", |
| 3325 | GetMagickVersion(&version)); |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3326 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
| 3327 | image->magick_columns); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3328 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::Width",value); |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3329 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
cristy | f2faecf | 2010-05-28 19:19:36 +0000 | [diff] [blame] | 3330 | image->magick_rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3331 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::height",value); |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3332 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
| 3333 | GetImageListLength(image)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3334 | (void) SetImageProperty(thumbnail_image,"Thumb::Document::Pages",value); |
| 3335 | return(thumbnail_image); |
| 3336 | } |