| # | 
 | # turtle.py: a Tkinter based turtle graphics module for Python | 
 | # Version 1.1b - 4. 5. 2009 | 
 | # | 
 | # Copyright (C) 2006 - 2010  Gregor Lingl | 
 | # email: glingl@aon.at | 
 | # | 
 | # This software is provided 'as-is', without any express or implied | 
 | # warranty.  In no event will the authors be held liable for any damages | 
 | # arising from the use of this software. | 
 | # | 
 | # Permission is granted to anyone to use this software for any purpose, | 
 | # including commercial applications, and to alter it and redistribute it | 
 | # freely, subject to the following restrictions: | 
 | # | 
 | # 1. The origin of this software must not be misrepresented; you must not | 
 | #    claim that you wrote the original software. If you use this software | 
 | #    in a product, an acknowledgment in the product documentation would be | 
 | #    appreciated but is not required. | 
 | # 2. Altered source versions must be plainly marked as such, and must not be | 
 | #    misrepresented as being the original software. | 
 | # 3. This notice may not be removed or altered from any source distribution. | 
 |  | 
 |  | 
 | """ | 
 | Turtle graphics is a popular way for introducing programming to | 
 | kids. It was part of the original Logo programming language developed | 
 | by Wally Feurzig and Seymour Papert in 1966. | 
 |  | 
 | Imagine a robotic turtle starting at (0, 0) in the x-y plane. After an ``import turtle``, give it | 
 | the command turtle.forward(15), and it moves (on-screen!) 15 pixels in | 
 | the direction it is facing, drawing a line as it moves. Give it the | 
 | command turtle.right(25), and it rotates in-place 25 degrees clockwise. | 
 |  | 
 | By combining together these and similar commands, intricate shapes and | 
 | pictures can easily be drawn. | 
 |  | 
 | ----- turtle.py | 
 |  | 
 | This module is an extended reimplementation of turtle.py from the | 
 | Python standard distribution up to Python 2.5. (See: http://www.python.org) | 
 |  | 
 | It tries to keep the merits of turtle.py and to be (nearly) 100% | 
 | compatible with it. This means in the first place to enable the | 
 | learning programmer to use all the commands, classes and methods | 
 | interactively when using the module from within IDLE run with | 
 | the -n switch. | 
 |  | 
 | Roughly it has the following features added: | 
 |  | 
 | - Better animation of the turtle movements, especially of turning the | 
 |   turtle. So the turtles can more easily be used as a visual feedback | 
 |   instrument by the (beginning) programmer. | 
 |  | 
 | - Different turtle shapes, gif-images as turtle shapes, user defined | 
 |   and user controllable turtle shapes, among them compound | 
 |   (multicolored) shapes. Turtle shapes can be stretched and tilted, which | 
 |   makes turtles very versatile geometrical objects. | 
 |  | 
 | - Fine control over turtle movement and screen updates via delay(), | 
 |   and enhanced tracer() and speed() methods. | 
 |  | 
 | - Aliases for the most commonly used commands, like fd for forward etc., | 
 |   following the early Logo traditions. This reduces the boring work of | 
 |   typing long sequences of commands, which often occur in a natural way | 
 |   when kids try to program fancy pictures on their first encounter with | 
 |   turtle graphics. | 
 |  | 
 | - Turtles now have an undo()-method with configurable undo-buffer. | 
 |  | 
 | - Some simple commands/methods for creating event driven programs | 
 |   (mouse-, key-, timer-events). Especially useful for programming games. | 
 |  | 
 | - A scrollable Canvas class. The default scrollable Canvas can be | 
 |   extended interactively as needed while playing around with the turtle(s). | 
 |  | 
 | - A TurtleScreen class with methods controlling background color or | 
 |   background image, window and canvas size and other properties of the | 
 |   TurtleScreen. | 
 |  | 
 | - There is a method, setworldcoordinates(), to install a user defined | 
 |   coordinate-system for the TurtleScreen. | 
 |  | 
 | - The implementation uses a 2-vector class named Vec2D, derived from tuple. | 
 |   This class is public, so it can be imported by the application programmer, | 
 |   which makes certain types of computations very natural and compact. | 
 |  | 
 | - Appearance of the TurtleScreen and the Turtles at startup/import can be | 
 |   configured by means of a turtle.cfg configuration file. | 
 |   The default configuration mimics the appearance of the old turtle module. | 
 |  | 
 | - If configured appropriately the module reads in docstrings from a docstring | 
 |   dictionary in some different language, supplied separately  and replaces | 
 |   the English ones by those read in. There is a utility function | 
 |   write_docstringdict() to write a dictionary with the original (English) | 
 |   docstrings to disc, so it can serve as a template for translations. | 
 |  | 
 | Behind the scenes there are some features included with possible | 
 | extensions in mind. These will be commented and documented elsewhere. | 
 |  | 
 | """ | 
 |  | 
 | _ver = "turtle 1.1b- - for Python 3.1   -  4. 5. 2009" | 
 |  | 
 | # print(_ver) | 
 |  | 
 | import tkinter as TK | 
 | import types | 
 | import math | 
 | import time | 
 | import inspect | 
 |  | 
 | from os.path import isfile, split, join | 
 | from copy import deepcopy | 
 | from tkinter import simpledialog | 
 |  | 
 | _tg_classes = ['ScrolledCanvas', 'TurtleScreen', 'Screen', | 
 |                'RawTurtle', 'Turtle', 'RawPen', 'Pen', 'Shape', 'Vec2D'] | 
 | _tg_screen_functions = ['addshape', 'bgcolor', 'bgpic', 'bye', | 
 |         'clearscreen', 'colormode', 'delay', 'exitonclick', 'getcanvas', | 
 |         'getshapes', 'listen', 'mainloop', 'mode', 'numinput', | 
 |         'onkey', 'onkeypress', 'onkeyrelease', 'onscreenclick', 'ontimer', | 
 |         'register_shape', 'resetscreen', 'screensize', 'setup', | 
 |         'setworldcoordinates', 'textinput', 'title', 'tracer', 'turtles', 'update', | 
 |         'window_height', 'window_width'] | 
 | _tg_turtle_functions = ['back', 'backward', 'begin_fill', 'begin_poly', 'bk', | 
 |         'circle', 'clear', 'clearstamp', 'clearstamps', 'clone', 'color', | 
 |         'degrees', 'distance', 'dot', 'down', 'end_fill', 'end_poly', 'fd', | 
 |         'fillcolor', 'filling', 'forward', 'get_poly', 'getpen', 'getscreen', 'get_shapepoly', | 
 |         'getturtle', 'goto', 'heading', 'hideturtle', 'home', 'ht', 'isdown', | 
 |         'isvisible', 'left', 'lt', 'onclick', 'ondrag', 'onrelease', 'pd', | 
 |         'pen', 'pencolor', 'pendown', 'pensize', 'penup', 'pos', 'position', | 
 |         'pu', 'radians', 'right', 'reset', 'resizemode', 'rt', | 
 |         'seth', 'setheading', 'setpos', 'setposition', 'settiltangle', | 
 |         'setundobuffer', 'setx', 'sety', 'shape', 'shapesize', 'shapetransform', 'shearfactor', 'showturtle', | 
 |         'speed', 'st', 'stamp', 'tilt', 'tiltangle', 'towards', | 
 |         'turtlesize', 'undo', 'undobufferentries', 'up', 'width', | 
 |         'write', 'xcor', 'ycor'] | 
 | _tg_utilities = ['write_docstringdict', 'done'] | 
 |  | 
 | __all__ = (_tg_classes + _tg_screen_functions + _tg_turtle_functions + | 
 |            _tg_utilities) # + _math_functions) | 
 |  | 
 | _alias_list = ['addshape', 'backward', 'bk', 'fd', 'ht', 'lt', 'pd', 'pos', | 
 |                'pu', 'rt', 'seth', 'setpos', 'setposition', 'st', | 
 |                'turtlesize', 'up', 'width'] | 
 |  | 
 | _CFG = {"width" : 0.5,               # Screen | 
 |         "height" : 0.75, | 
 |         "canvwidth" : 400, | 
 |         "canvheight": 300, | 
 |         "leftright": None, | 
 |         "topbottom": None, | 
 |         "mode": "standard",          # TurtleScreen | 
 |         "colormode": 1.0, | 
 |         "delay": 10, | 
 |         "undobuffersize": 1000,      # RawTurtle | 
 |         "shape": "classic", | 
 |         "pencolor" : "black", | 
 |         "fillcolor" : "black", | 
 |         "resizemode" : "noresize", | 
 |         "visible" : True, | 
 |         "language": "english",        # docstrings | 
 |         "exampleturtle": "turtle", | 
 |         "examplescreen": "screen", | 
 |         "title": "Python Turtle Graphics", | 
 |         "using_IDLE": False | 
 |        } | 
 |  | 
 | def config_dict(filename): | 
 |     """Convert content of config-file into dictionary.""" | 
 |     with open(filename, "r") as f: | 
 |         cfglines = f.readlines() | 
 |     cfgdict = {} | 
 |     for line in cfglines: | 
 |         line = line.strip() | 
 |         if not line or line.startswith("#"): | 
 |             continue | 
 |         try: | 
 |             key, value = line.split("=") | 
 |         except: | 
 |             print("Bad line in config-file %s:\n%s" % (filename,line)) | 
 |             continue | 
 |         key = key.strip() | 
 |         value = value.strip() | 
 |         if value in ["True", "False", "None", "''", '""']: | 
 |             value = eval(value) | 
 |         else: | 
 |             try: | 
 |                 if "." in value: | 
 |                     value = float(value) | 
 |                 else: | 
 |                     value = int(value) | 
 |             except: | 
 |                 pass # value need not be converted | 
 |         cfgdict[key] = value | 
 |     return cfgdict | 
 |  | 
 | def readconfig(cfgdict): | 
 |     """Read config-files, change configuration-dict accordingly. | 
 |  | 
 |     If there is a turtle.cfg file in the current working directory, | 
 |     read it from there. If this contains an importconfig-value, | 
 |     say 'myway', construct filename turtle_mayway.cfg else use | 
 |     turtle.cfg and read it from the import-directory, where | 
 |     turtle.py is located. | 
 |     Update configuration dictionary first according to config-file, | 
 |     in the import directory, then according to config-file in the | 
 |     current working directory. | 
 |     If no config-file is found, the default configuration is used. | 
 |     """ | 
 |     default_cfg = "turtle.cfg" | 
 |     cfgdict1 = {} | 
 |     cfgdict2 = {} | 
 |     if isfile(default_cfg): | 
 |         cfgdict1 = config_dict(default_cfg) | 
 |     if "importconfig" in cfgdict1: | 
 |         default_cfg = "turtle_%s.cfg" % cfgdict1["importconfig"] | 
 |     try: | 
 |         head, tail = split(__file__) | 
 |         cfg_file2 = join(head, default_cfg) | 
 |     except: | 
 |         cfg_file2 = "" | 
 |     if isfile(cfg_file2): | 
 |         cfgdict2 = config_dict(cfg_file2) | 
 |     _CFG.update(cfgdict2) | 
 |     _CFG.update(cfgdict1) | 
 |  | 
 | try: | 
 |     readconfig(_CFG) | 
 | except: | 
 |     print ("No configfile read, reason unknown") | 
 |  | 
 |  | 
 | class Vec2D(tuple): | 
 |     """A 2 dimensional vector class, used as a helper class | 
 |     for implementing turtle graphics. | 
 |     May be useful for turtle graphics programs also. | 
 |     Derived from tuple, so a vector is a tuple! | 
 |  | 
 |     Provides (for a, b vectors, k number): | 
 |        a+b vector addition | 
 |        a-b vector subtraction | 
 |        a*b inner product | 
 |        k*a and a*k multiplication with scalar | 
 |        |a| absolute value of a | 
 |        a.rotate(angle) rotation | 
 |     """ | 
 |     def __new__(cls, x, y): | 
 |         return tuple.__new__(cls, (x, y)) | 
 |     def __add__(self, other): | 
 |         return Vec2D(self[0]+other[0], self[1]+other[1]) | 
 |     def __mul__(self, other): | 
 |         if isinstance(other, Vec2D): | 
 |             return self[0]*other[0]+self[1]*other[1] | 
 |         return Vec2D(self[0]*other, self[1]*other) | 
 |     def __rmul__(self, other): | 
 |         if isinstance(other, int) or isinstance(other, float): | 
 |             return Vec2D(self[0]*other, self[1]*other) | 
 |     def __sub__(self, other): | 
 |         return Vec2D(self[0]-other[0], self[1]-other[1]) | 
 |     def __neg__(self): | 
 |         return Vec2D(-self[0], -self[1]) | 
 |     def __abs__(self): | 
 |         return (self[0]**2 + self[1]**2)**0.5 | 
 |     def rotate(self, angle): | 
 |         """rotate self counterclockwise by angle | 
 |         """ | 
 |         perp = Vec2D(-self[1], self[0]) | 
 |         angle = angle * math.pi / 180.0 | 
 |         c, s = math.cos(angle), math.sin(angle) | 
 |         return Vec2D(self[0]*c+perp[0]*s, self[1]*c+perp[1]*s) | 
 |     def __getnewargs__(self): | 
 |         return (self[0], self[1]) | 
 |     def __repr__(self): | 
 |         return "(%.2f,%.2f)" % self | 
 |  | 
 |  | 
 | ############################################################################## | 
 | ### From here up to line    : Tkinter - Interface for turtle.py            ### | 
 | ### May be replaced by an interface to some different graphics toolkit     ### | 
 | ############################################################################## | 
 |  | 
 | ## helper functions for Scrolled Canvas, to forward Canvas-methods | 
 | ## to ScrolledCanvas class | 
 |  | 
 | def __methodDict(cls, _dict): | 
 |     """helper function for Scrolled Canvas""" | 
 |     baseList = list(cls.__bases__) | 
 |     baseList.reverse() | 
 |     for _super in baseList: | 
 |         __methodDict(_super, _dict) | 
 |     for key, value in cls.__dict__.items(): | 
 |         if type(value) == types.FunctionType: | 
 |             _dict[key] = value | 
 |  | 
 | def __methods(cls): | 
 |     """helper function for Scrolled Canvas""" | 
 |     _dict = {} | 
 |     __methodDict(cls, _dict) | 
 |     return _dict.keys() | 
 |  | 
 | __stringBody = ( | 
 |     'def %(method)s(self, *args, **kw): return ' + | 
 |     'self.%(attribute)s.%(method)s(*args, **kw)') | 
 |  | 
 | def __forwardmethods(fromClass, toClass, toPart, exclude = ()): | 
 |     ### MANY CHANGES ### | 
 |     _dict_1 = {} | 
 |     __methodDict(toClass, _dict_1) | 
 |     _dict = {} | 
 |     mfc = __methods(fromClass) | 
 |     for ex in _dict_1.keys(): | 
 |         if ex[:1] == '_' or ex[-1:] == '_' or ex in exclude or ex in mfc: | 
 |             pass | 
 |         else: | 
 |             _dict[ex] = _dict_1[ex] | 
 |  | 
 |     for method, func in _dict.items(): | 
 |         d = {'method': method, 'func': func} | 
 |         if isinstance(toPart, str): | 
 |             execString = \ | 
 |                 __stringBody % {'method' : method, 'attribute' : toPart} | 
 |         exec(execString, d) | 
 |         setattr(fromClass, method, d[method])   ### NEWU! | 
 |  | 
 |  | 
 | class ScrolledCanvas(TK.Frame): | 
 |     """Modeled after the scrolled canvas class from Grayons's Tkinter book. | 
 |  | 
 |     Used as the default canvas, which pops up automatically when | 
 |     using turtle graphics functions or the Turtle class. | 
 |     """ | 
 |     def __init__(self, master, width=500, height=350, | 
 |                                           canvwidth=600, canvheight=500): | 
 |         TK.Frame.__init__(self, master, width=width, height=height) | 
 |         self._rootwindow = self.winfo_toplevel() | 
 |         self.width, self.height = width, height | 
 |         self.canvwidth, self.canvheight = canvwidth, canvheight | 
 |         self.bg = "white" | 
 |         self._canvas = TK.Canvas(master, width=width, height=height, | 
 |                                  bg=self.bg, relief=TK.SUNKEN, borderwidth=2) | 
 |         self.hscroll = TK.Scrollbar(master, command=self._canvas.xview, | 
 |                                     orient=TK.HORIZONTAL) | 
 |         self.vscroll = TK.Scrollbar(master, command=self._canvas.yview) | 
 |         self._canvas.configure(xscrollcommand=self.hscroll.set, | 
 |                                yscrollcommand=self.vscroll.set) | 
 |         self.rowconfigure(0, weight=1, minsize=0) | 
 |         self.columnconfigure(0, weight=1, minsize=0) | 
 |         self._canvas.grid(padx=1, in_ = self, pady=1, row=0, | 
 |                 column=0, rowspan=1, columnspan=1, sticky='news') | 
 |         self.vscroll.grid(padx=1, in_ = self, pady=1, row=0, | 
 |                 column=1, rowspan=1, columnspan=1, sticky='news') | 
 |         self.hscroll.grid(padx=1, in_ = self, pady=1, row=1, | 
 |                 column=0, rowspan=1, columnspan=1, sticky='news') | 
 |         self.reset() | 
 |         self._rootwindow.bind('<Configure>', self.onResize) | 
 |  | 
 |     def reset(self, canvwidth=None, canvheight=None, bg = None): | 
 |         """Adjust canvas and scrollbars according to given canvas size.""" | 
 |         if canvwidth: | 
 |             self.canvwidth = canvwidth | 
 |         if canvheight: | 
 |             self.canvheight = canvheight | 
 |         if bg: | 
 |             self.bg = bg | 
 |         self._canvas.config(bg=bg, | 
 |                         scrollregion=(-self.canvwidth//2, -self.canvheight//2, | 
 |                                        self.canvwidth//2, self.canvheight//2)) | 
 |         self._canvas.xview_moveto(0.5*(self.canvwidth - self.width + 30) / | 
 |                                                                self.canvwidth) | 
 |         self._canvas.yview_moveto(0.5*(self.canvheight- self.height + 30) / | 
 |                                                               self.canvheight) | 
 |         self.adjustScrolls() | 
 |  | 
 |  | 
 |     def adjustScrolls(self): | 
 |         """ Adjust scrollbars according to window- and canvas-size. | 
 |         """ | 
 |         cwidth = self._canvas.winfo_width() | 
 |         cheight = self._canvas.winfo_height() | 
 |         self._canvas.xview_moveto(0.5*(self.canvwidth-cwidth)/self.canvwidth) | 
 |         self._canvas.yview_moveto(0.5*(self.canvheight-cheight)/self.canvheight) | 
 |         if cwidth < self.canvwidth or cheight < self.canvheight: | 
 |             self.hscroll.grid(padx=1, in_ = self, pady=1, row=1, | 
 |                               column=0, rowspan=1, columnspan=1, sticky='news') | 
 |             self.vscroll.grid(padx=1, in_ = self, pady=1, row=0, | 
 |                               column=1, rowspan=1, columnspan=1, sticky='news') | 
 |         else: | 
 |             self.hscroll.grid_forget() | 
 |             self.vscroll.grid_forget() | 
 |  | 
 |     def onResize(self, event): | 
 |         """self-explanatory""" | 
 |         self.adjustScrolls() | 
 |  | 
 |     def bbox(self, *args): | 
 |         """ 'forward' method, which canvas itself has inherited... | 
 |         """ | 
 |         return self._canvas.bbox(*args) | 
 |  | 
 |     def cget(self, *args, **kwargs): | 
 |         """ 'forward' method, which canvas itself has inherited... | 
 |         """ | 
 |         return self._canvas.cget(*args, **kwargs) | 
 |  | 
 |     def config(self, *args, **kwargs): | 
 |         """ 'forward' method, which canvas itself has inherited... | 
 |         """ | 
 |         self._canvas.config(*args, **kwargs) | 
 |  | 
 |     def bind(self, *args, **kwargs): | 
 |         """ 'forward' method, which canvas itself has inherited... | 
 |         """ | 
 |         self._canvas.bind(*args, **kwargs) | 
 |  | 
 |     def unbind(self, *args, **kwargs): | 
 |         """ 'forward' method, which canvas itself has inherited... | 
 |         """ | 
 |         self._canvas.unbind(*args, **kwargs) | 
 |  | 
 |     def focus_force(self): | 
 |         """ 'forward' method, which canvas itself has inherited... | 
 |         """ | 
 |         self._canvas.focus_force() | 
 |  | 
 | __forwardmethods(ScrolledCanvas, TK.Canvas, '_canvas') | 
 |  | 
 |  | 
 | class _Root(TK.Tk): | 
 |     """Root class for Screen based on Tkinter.""" | 
 |     def __init__(self): | 
 |         TK.Tk.__init__(self) | 
 |  | 
 |     def setupcanvas(self, width, height, cwidth, cheight): | 
 |         self._canvas = ScrolledCanvas(self, width, height, cwidth, cheight) | 
 |         self._canvas.pack(expand=1, fill="both") | 
 |  | 
 |     def _getcanvas(self): | 
 |         return self._canvas | 
 |  | 
 |     def set_geometry(self, width, height, startx, starty): | 
 |         self.geometry("%dx%d%+d%+d"%(width, height, startx, starty)) | 
 |  | 
 |     def ondestroy(self, destroy): | 
 |         self.wm_protocol("WM_DELETE_WINDOW", destroy) | 
 |  | 
 |     def win_width(self): | 
 |         return self.winfo_screenwidth() | 
 |  | 
 |     def win_height(self): | 
 |         return self.winfo_screenheight() | 
 |  | 
 | Canvas = TK.Canvas | 
 |  | 
 |  | 
 | class TurtleScreenBase(object): | 
 |     """Provide the basic graphics functionality. | 
 |        Interface between Tkinter and turtle.py. | 
 |  | 
 |        To port turtle.py to some different graphics toolkit | 
 |        a corresponding TurtleScreenBase class has to be implemented. | 
 |     """ | 
 |  | 
 |     @staticmethod | 
 |     def _blankimage(): | 
 |         """return a blank image object | 
 |         """ | 
 |         img = TK.PhotoImage(width=1, height=1) | 
 |         img.blank() | 
 |         return img | 
 |  | 
 |     @staticmethod | 
 |     def _image(filename): | 
 |         """return an image object containing the | 
 |         imagedata from a gif-file named filename. | 
 |         """ | 
 |         return TK.PhotoImage(file=filename) | 
 |  | 
 |     def __init__(self, cv): | 
 |         self.cv = cv | 
 |         if isinstance(cv, ScrolledCanvas): | 
 |             w = self.cv.canvwidth | 
 |             h = self.cv.canvheight | 
 |         else:  # expected: ordinary TK.Canvas | 
 |             w = int(self.cv.cget("width")) | 
 |             h = int(self.cv.cget("height")) | 
 |             self.cv.config(scrollregion = (-w//2, -h//2, w//2, h//2 )) | 
 |         self.canvwidth = w | 
 |         self.canvheight = h | 
 |         self.xscale = self.yscale = 1.0 | 
 |  | 
 |     def _createpoly(self): | 
 |         """Create an invisible polygon item on canvas self.cv) | 
 |         """ | 
 |         return self.cv.create_polygon((0, 0, 0, 0, 0, 0), fill="", outline="") | 
 |  | 
 |     def _drawpoly(self, polyitem, coordlist, fill=None, | 
 |                   outline=None, width=None, top=False): | 
 |         """Configure polygonitem polyitem according to provided | 
 |         arguments: | 
 |         coordlist is sequence of coordinates | 
 |         fill is filling color | 
 |         outline is outline color | 
 |         top is a boolean value, which specifies if polyitem | 
 |         will be put on top of the canvas' displaylist so it | 
 |         will not be covered by other items. | 
 |         """ | 
 |         cl = [] | 
 |         for x, y in coordlist: | 
 |             cl.append(x * self.xscale) | 
 |             cl.append(-y * self.yscale) | 
 |         self.cv.coords(polyitem, *cl) | 
 |         if fill is not None: | 
 |             self.cv.itemconfigure(polyitem, fill=fill) | 
 |         if outline is not None: | 
 |             self.cv.itemconfigure(polyitem, outline=outline) | 
 |         if width is not None: | 
 |             self.cv.itemconfigure(polyitem, width=width) | 
 |         if top: | 
 |             self.cv.tag_raise(polyitem) | 
 |  | 
 |     def _createline(self): | 
 |         """Create an invisible line item on canvas self.cv) | 
 |         """ | 
 |         return self.cv.create_line(0, 0, 0, 0, fill="", width=2, | 
 |                                    capstyle = TK.ROUND) | 
 |  | 
 |     def _drawline(self, lineitem, coordlist=None, | 
 |                   fill=None, width=None, top=False): | 
 |         """Configure lineitem according to provided arguments: | 
 |         coordlist is sequence of coordinates | 
 |         fill is drawing color | 
 |         width is width of drawn line. | 
 |         top is a boolean value, which specifies if polyitem | 
 |         will be put on top of the canvas' displaylist so it | 
 |         will not be covered by other items. | 
 |         """ | 
 |         if coordlist is not None: | 
 |             cl = [] | 
 |             for x, y in coordlist: | 
 |                 cl.append(x * self.xscale) | 
 |                 cl.append(-y * self.yscale) | 
 |             self.cv.coords(lineitem, *cl) | 
 |         if fill is not None: | 
 |             self.cv.itemconfigure(lineitem, fill=fill) | 
 |         if width is not None: | 
 |             self.cv.itemconfigure(lineitem, width=width) | 
 |         if top: | 
 |             self.cv.tag_raise(lineitem) | 
 |  | 
 |     def _delete(self, item): | 
 |         """Delete graphics item from canvas. | 
 |         If item is"all" delete all graphics items. | 
 |         """ | 
 |         self.cv.delete(item) | 
 |  | 
 |     def _update(self): | 
 |         """Redraw graphics items on canvas | 
 |         """ | 
 |         self.cv.update() | 
 |  | 
 |     def _delay(self, delay): | 
 |         """Delay subsequent canvas actions for delay ms.""" | 
 |         self.cv.after(delay) | 
 |  | 
 |     def _iscolorstring(self, color): | 
 |         """Check if the string color is a legal Tkinter color string. | 
 |         """ | 
 |         try: | 
 |             rgb = self.cv.winfo_rgb(color) | 
 |             ok = True | 
 |         except TK.TclError: | 
 |             ok = False | 
 |         return ok | 
 |  | 
 |     def _bgcolor(self, color=None): | 
 |         """Set canvas' backgroundcolor if color is not None, | 
 |         else return backgroundcolor.""" | 
 |         if color is not None: | 
 |             self.cv.config(bg = color) | 
 |             self._update() | 
 |         else: | 
 |             return self.cv.cget("bg") | 
 |  | 
 |     def _write(self, pos, txt, align, font, pencolor): | 
 |         """Write txt at pos in canvas with specified font | 
 |         and color. | 
 |         Return text item and x-coord of right bottom corner | 
 |         of text's bounding box.""" | 
 |         x, y = pos | 
 |         x = x * self.xscale | 
 |         y = y * self.yscale | 
 |         anchor = {"left":"sw", "center":"s", "right":"se" } | 
 |         item = self.cv.create_text(x-1, -y, text = txt, anchor = anchor[align], | 
 |                                         fill = pencolor, font = font) | 
 |         x0, y0, x1, y1 = self.cv.bbox(item) | 
 |         self.cv.update() | 
 |         return item, x1-1 | 
 |  | 
 | ##    def _dot(self, pos, size, color): | 
 | ##        """may be implemented for some other graphics toolkit""" | 
 |  | 
 |     def _onclick(self, item, fun, num=1, add=None): | 
 |         """Bind fun to mouse-click event on turtle. | 
 |         fun must be a function with two arguments, the coordinates | 
 |         of the clicked point on the canvas. | 
 |         num, the number of the mouse-button defaults to 1 | 
 |         """ | 
 |         if fun is None: | 
 |             self.cv.tag_unbind(item, "<Button-%s>" % num) | 
 |         else: | 
 |             def eventfun(event): | 
 |                 x, y = (self.cv.canvasx(event.x)/self.xscale, | 
 |                         -self.cv.canvasy(event.y)/self.yscale) | 
 |                 fun(x, y) | 
 |             self.cv.tag_bind(item, "<Button-%s>" % num, eventfun, add) | 
 |  | 
 |     def _onrelease(self, item, fun, num=1, add=None): | 
 |         """Bind fun to mouse-button-release event on turtle. | 
 |         fun must be a function with two arguments, the coordinates | 
 |         of the point on the canvas where mouse button is released. | 
 |         num, the number of the mouse-button defaults to 1 | 
 |  | 
 |         If a turtle is clicked, first _onclick-event will be performed, | 
 |         then _onscreensclick-event. | 
 |         """ | 
 |         if fun is None: | 
 |             self.cv.tag_unbind(item, "<Button%s-ButtonRelease>" % num) | 
 |         else: | 
 |             def eventfun(event): | 
 |                 x, y = (self.cv.canvasx(event.x)/self.xscale, | 
 |                         -self.cv.canvasy(event.y)/self.yscale) | 
 |                 fun(x, y) | 
 |             self.cv.tag_bind(item, "<Button%s-ButtonRelease>" % num, | 
 |                              eventfun, add) | 
 |  | 
 |     def _ondrag(self, item, fun, num=1, add=None): | 
 |         """Bind fun to mouse-move-event (with pressed mouse button) on turtle. | 
 |         fun must be a function with two arguments, the coordinates of the | 
 |         actual mouse position on the canvas. | 
 |         num, the number of the mouse-button defaults to 1 | 
 |  | 
 |         Every sequence of mouse-move-events on a turtle is preceded by a | 
 |         mouse-click event on that turtle. | 
 |         """ | 
 |         if fun is None: | 
 |             self.cv.tag_unbind(item, "<Button%s-Motion>" % num) | 
 |         else: | 
 |             def eventfun(event): | 
 |                 try: | 
 |                     x, y = (self.cv.canvasx(event.x)/self.xscale, | 
 |                            -self.cv.canvasy(event.y)/self.yscale) | 
 |                     fun(x, y) | 
 |                 except: | 
 |                     pass | 
 |             self.cv.tag_bind(item, "<Button%s-Motion>" % num, eventfun, add) | 
 |  | 
 |     def _onscreenclick(self, fun, num=1, add=None): | 
 |         """Bind fun to mouse-click event on canvas. | 
 |         fun must be a function with two arguments, the coordinates | 
 |         of the clicked point on the canvas. | 
 |         num, the number of the mouse-button defaults to 1 | 
 |  | 
 |         If a turtle is clicked, first _onclick-event will be performed, | 
 |         then _onscreensclick-event. | 
 |         """ | 
 |         if fun is None: | 
 |             self.cv.unbind("<Button-%s>" % num) | 
 |         else: | 
 |             def eventfun(event): | 
 |                 x, y = (self.cv.canvasx(event.x)/self.xscale, | 
 |                         -self.cv.canvasy(event.y)/self.yscale) | 
 |                 fun(x, y) | 
 |             self.cv.bind("<Button-%s>" % num, eventfun, add) | 
 |  | 
 |     def _onkeyrelease(self, fun, key): | 
 |         """Bind fun to key-release event of key. | 
 |         Canvas must have focus. See method listen | 
 |         """ | 
 |         if fun is None: | 
 |             self.cv.unbind("<KeyRelease-%s>" % key, None) | 
 |         else: | 
 |             def eventfun(event): | 
 |                 fun() | 
 |             self.cv.bind("<KeyRelease-%s>" % key, eventfun) | 
 |  | 
 |     def _onkeypress(self, fun, key=None): | 
 |         """If key is given, bind fun to key-press event of key. | 
 |         Otherwise bind fun to any key-press. | 
 |         Canvas must have focus. See method listen. | 
 |         """ | 
 |         if fun is None: | 
 |             if key is None: | 
 |                 self.cv.unbind("<KeyPress>", None) | 
 |             else: | 
 |                 self.cv.unbind("<KeyPress-%s>" % key, None) | 
 |         else: | 
 |             def eventfun(event): | 
 |                 fun() | 
 |             if key is None: | 
 |                 self.cv.bind("<KeyPress>", eventfun) | 
 |             else: | 
 |                 self.cv.bind("<KeyPress-%s>" % key, eventfun) | 
 |  | 
 |     def _listen(self): | 
 |         """Set focus on canvas (in order to collect key-events) | 
 |         """ | 
 |         self.cv.focus_force() | 
 |  | 
 |     def _ontimer(self, fun, t): | 
 |         """Install a timer, which calls fun after t milliseconds. | 
 |         """ | 
 |         if t == 0: | 
 |             self.cv.after_idle(fun) | 
 |         else: | 
 |             self.cv.after(t, fun) | 
 |  | 
 |     def _createimage(self, image): | 
 |         """Create and return image item on canvas. | 
 |         """ | 
 |         return self.cv.create_image(0, 0, image=image) | 
 |  | 
 |     def _drawimage(self, item, pos, image): | 
 |         """Configure image item as to draw image object | 
 |         at position (x,y) on canvas) | 
 |         """ | 
 |         x, y = pos | 
 |         self.cv.coords(item, (x * self.xscale, -y * self.yscale)) | 
 |         self.cv.itemconfig(item, image=image) | 
 |  | 
 |     def _setbgpic(self, item, image): | 
 |         """Configure image item as to draw image object | 
 |         at center of canvas. Set item to the first item | 
 |         in the displaylist, so it will be drawn below | 
 |         any other item .""" | 
 |         self.cv.itemconfig(item, image=image) | 
 |         self.cv.tag_lower(item) | 
 |  | 
 |     def _type(self, item): | 
 |         """Return 'line' or 'polygon' or 'image' depending on | 
 |         type of item. | 
 |         """ | 
 |         return self.cv.type(item) | 
 |  | 
 |     def _pointlist(self, item): | 
 |         """returns list of coordinate-pairs of points of item | 
 |         Example (for insiders): | 
 |         >>> from turtle import * | 
 |         >>> getscreen()._pointlist(getturtle().turtle._item) | 
 |         [(0.0, 9.9999999999999982), (0.0, -9.9999999999999982), | 
 |         (9.9999999999999982, 0.0)] | 
 |         >>> """ | 
 |         cl = self.cv.coords(item) | 
 |         pl = [(cl[i], -cl[i+1]) for i in range(0, len(cl), 2)] | 
 |         return  pl | 
 |  | 
 |     def _setscrollregion(self, srx1, sry1, srx2, sry2): | 
 |         self.cv.config(scrollregion=(srx1, sry1, srx2, sry2)) | 
 |  | 
 |     def _rescale(self, xscalefactor, yscalefactor): | 
 |         items = self.cv.find_all() | 
 |         for item in items: | 
 |             coordinates = list(self.cv.coords(item)) | 
 |             newcoordlist = [] | 
 |             while coordinates: | 
 |                 x, y = coordinates[:2] | 
 |                 newcoordlist.append(x * xscalefactor) | 
 |                 newcoordlist.append(y * yscalefactor) | 
 |                 coordinates = coordinates[2:] | 
 |             self.cv.coords(item, *newcoordlist) | 
 |  | 
 |     def _resize(self, canvwidth=None, canvheight=None, bg=None): | 
 |         """Resize the canvas the turtles are drawing on. Does | 
 |         not alter the drawing window. | 
 |         """ | 
 |         # needs amendment | 
 |         if not isinstance(self.cv, ScrolledCanvas): | 
 |             return self.canvwidth, self.canvheight | 
 |         if canvwidth is canvheight is bg is None: | 
 |             return self.cv.canvwidth, self.cv.canvheight | 
 |         if canvwidth is not None: | 
 |             self.canvwidth = canvwidth | 
 |         if canvheight is not None: | 
 |             self.canvheight = canvheight | 
 |         self.cv.reset(canvwidth, canvheight, bg) | 
 |  | 
 |     def _window_size(self): | 
 |         """ Return the width and height of the turtle window. | 
 |         """ | 
 |         width = self.cv.winfo_width() | 
 |         if width <= 1:  # the window isn't managed by a geometry manager | 
 |             width = self.cv['width'] | 
 |         height = self.cv.winfo_height() | 
 |         if height <= 1: # the window isn't managed by a geometry manager | 
 |             height = self.cv['height'] | 
 |         return width, height | 
 |  | 
 |     def mainloop(self): | 
 |         """Starts event loop - calling Tkinter's mainloop function. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Must be last statement in a turtle graphics program. | 
 |         Must NOT be used if a script is run from within IDLE in -n mode | 
 |         (No subprocess) - for interactive use of turtle graphics. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.mainloop() | 
 |  | 
 |         """ | 
 |         TK.mainloop() | 
 |  | 
 |     def textinput(self, title, prompt): | 
 |         """Pop up a dialog window for input of a string. | 
 |  | 
 |         Arguments: title is the title of the dialog window, | 
 |         prompt is a text mostly describing what information to input. | 
 |  | 
 |         Return the string input | 
 |         If the dialog is canceled, return None. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.textinput("NIM", "Name of first player:") | 
 |  | 
 |         """ | 
 |         return simpledialog.askstring(title, prompt) | 
 |  | 
 |     def numinput(self, title, prompt, default=None, minval=None, maxval=None): | 
 |         """Pop up a dialog window for input of a number. | 
 |  | 
 |         Arguments: title is the title of the dialog window, | 
 |         prompt is a text mostly describing what numerical information to input. | 
 |         default: default value | 
 |         minval: minimum value for imput | 
 |         maxval: maximum value for input | 
 |  | 
 |         The number input must be in the range minval .. maxval if these are | 
 |         given. If not, a hint is issued and the dialog remains open for | 
 |         correction. Return the number input. | 
 |         If the dialog is canceled,  return None. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.numinput("Poker", "Your stakes:", 1000, minval=10, maxval=10000) | 
 |  | 
 |         """ | 
 |         return simpledialog.askfloat(title, prompt, initialvalue=default, | 
 |                                      minvalue=minval, maxvalue=maxval) | 
 |  | 
 |  | 
 | ############################################################################## | 
 | ###                  End of Tkinter - interface                            ### | 
 | ############################################################################## | 
 |  | 
 |  | 
 | class Terminator (Exception): | 
 |     """Will be raised in TurtleScreen.update, if _RUNNING becomes False. | 
 |  | 
 |     Thus stops execution of turtle graphics script. Main purpose: use in | 
 |     in the Demo-Viewer turtle.Demo.py. | 
 |     """ | 
 |     pass | 
 |  | 
 |  | 
 | class TurtleGraphicsError(Exception): | 
 |     """Some TurtleGraphics Error | 
 |     """ | 
 |  | 
 |  | 
 | class Shape(object): | 
 |     """Data structure modeling shapes. | 
 |  | 
 |     attribute _type is one of "polygon", "image", "compound" | 
 |     attribute _data is - depending on _type a poygon-tuple, | 
 |     an image or a list constructed using the addcomponent method. | 
 |     """ | 
 |     def __init__(self, type_, data=None): | 
 |         self._type = type_ | 
 |         if type_ == "polygon": | 
 |             if isinstance(data, list): | 
 |                 data = tuple(data) | 
 |         elif type_ == "image": | 
 |             if isinstance(data, str): | 
 |                 if data.lower().endswith(".gif") and isfile(data): | 
 |                     data = TurtleScreen._image(data) | 
 |                 # else data assumed to be Photoimage | 
 |         elif type_ == "compound": | 
 |             data = [] | 
 |         else: | 
 |             raise TurtleGraphicsError("There is no shape type %s" % type_) | 
 |         self._data = data | 
 |  | 
 |     def addcomponent(self, poly, fill, outline=None): | 
 |         """Add component to a shape of type compound. | 
 |  | 
 |         Arguments: poly is a polygon, i. e. a tuple of number pairs. | 
 |         fill is the fillcolor of the component, | 
 |         outline is the outline color of the component. | 
 |  | 
 |         call (for a Shapeobject namend s): | 
 |         --   s.addcomponent(((0,0), (10,10), (-10,10)), "red", "blue") | 
 |  | 
 |         Example: | 
 |         >>> poly = ((0,0),(10,-5),(0,10),(-10,-5)) | 
 |         >>> s = Shape("compound") | 
 |         >>> s.addcomponent(poly, "red", "blue") | 
 |         ### .. add more components and then use register_shape() | 
 |         """ | 
 |         if self._type != "compound": | 
 |             raise TurtleGraphicsError("Cannot add component to %s Shape" | 
 |                                                                 % self._type) | 
 |         if outline is None: | 
 |             outline = fill | 
 |         self._data.append([poly, fill, outline]) | 
 |  | 
 |  | 
 | class Tbuffer(object): | 
 |     """Ring buffer used as undobuffer for RawTurtle objects.""" | 
 |     def __init__(self, bufsize=10): | 
 |         self.bufsize = bufsize | 
 |         self.buffer = [[None]] * bufsize | 
 |         self.ptr = -1 | 
 |         self.cumulate = False | 
 |     def reset(self, bufsize=None): | 
 |         if bufsize is None: | 
 |             for i in range(self.bufsize): | 
 |                 self.buffer[i] = [None] | 
 |         else: | 
 |             self.bufsize = bufsize | 
 |             self.buffer = [[None]] * bufsize | 
 |         self.ptr = -1 | 
 |     def push(self, item): | 
 |         if self.bufsize > 0: | 
 |             if not self.cumulate: | 
 |                 self.ptr = (self.ptr + 1) % self.bufsize | 
 |                 self.buffer[self.ptr] = item | 
 |             else: | 
 |                 self.buffer[self.ptr].append(item) | 
 |     def pop(self): | 
 |         if self.bufsize > 0: | 
 |             item = self.buffer[self.ptr] | 
 |             if item is None: | 
 |                 return None | 
 |             else: | 
 |                 self.buffer[self.ptr] = [None] | 
 |                 self.ptr = (self.ptr - 1) % self.bufsize | 
 |                 return (item) | 
 |     def nr_of_items(self): | 
 |         return self.bufsize - self.buffer.count([None]) | 
 |     def __repr__(self): | 
 |         return str(self.buffer) + " " + str(self.ptr) | 
 |  | 
 |  | 
 |  | 
 | class TurtleScreen(TurtleScreenBase): | 
 |     """Provides screen oriented methods like setbg etc. | 
 |  | 
 |     Only relies upon the methods of TurtleScreenBase and NOT | 
 |     upon components of the underlying graphics toolkit - | 
 |     which is Tkinter in this case. | 
 |     """ | 
 |     _RUNNING = True | 
 |  | 
 |     def __init__(self, cv, mode=_CFG["mode"], | 
 |                  colormode=_CFG["colormode"], delay=_CFG["delay"]): | 
 |         self._shapes = { | 
 |                    "arrow" : Shape("polygon", ((-10,0), (10,0), (0,10))), | 
 |                   "turtle" : Shape("polygon", ((0,16), (-2,14), (-1,10), (-4,7), | 
 |                               (-7,9), (-9,8), (-6,5), (-7,1), (-5,-3), (-8,-6), | 
 |                               (-6,-8), (-4,-5), (0,-7), (4,-5), (6,-8), (8,-6), | 
 |                               (5,-3), (7,1), (6,5), (9,8), (7,9), (4,7), (1,10), | 
 |                               (2,14))), | 
 |                   "circle" : Shape("polygon", ((10,0), (9.51,3.09), (8.09,5.88), | 
 |                               (5.88,8.09), (3.09,9.51), (0,10), (-3.09,9.51), | 
 |                               (-5.88,8.09), (-8.09,5.88), (-9.51,3.09), (-10,0), | 
 |                               (-9.51,-3.09), (-8.09,-5.88), (-5.88,-8.09), | 
 |                               (-3.09,-9.51), (-0.00,-10.00), (3.09,-9.51), | 
 |                               (5.88,-8.09), (8.09,-5.88), (9.51,-3.09))), | 
 |                   "square" : Shape("polygon", ((10,-10), (10,10), (-10,10), | 
 |                               (-10,-10))), | 
 |                 "triangle" : Shape("polygon", ((10,-5.77), (0,11.55), | 
 |                               (-10,-5.77))), | 
 |                   "classic": Shape("polygon", ((0,0),(-5,-9),(0,-7),(5,-9))), | 
 |                    "blank" : Shape("image", self._blankimage()) | 
 |                   } | 
 |  | 
 |         self._bgpics = {"nopic" : ""} | 
 |  | 
 |         TurtleScreenBase.__init__(self, cv) | 
 |         self._mode = mode | 
 |         self._delayvalue = delay | 
 |         self._colormode = _CFG["colormode"] | 
 |         self._keys = [] | 
 |         self.clear() | 
 |  | 
 |     def clear(self): | 
 |         """Delete all drawings and all turtles from the TurtleScreen. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Reset empty TurtleScreen to its initial state: white background, | 
 |         no backgroundimage, no eventbindings and tracing on. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         screen.clear() | 
 |  | 
 |         Note: this method is not available as function. | 
 |         """ | 
 |         self._delayvalue = _CFG["delay"] | 
 |         self._colormode = _CFG["colormode"] | 
 |         self._delete("all") | 
 |         self._bgpic = self._createimage("") | 
 |         self._bgpicname = "nopic" | 
 |         self._tracing = 1 | 
 |         self._updatecounter = 0 | 
 |         self._turtles = [] | 
 |         self.bgcolor("white") | 
 |         for btn in 1, 2, 3: | 
 |             self.onclick(None, btn) | 
 |         self.onkeypress(None) | 
 |         for key in self._keys[:]: | 
 |             self.onkey(None, key) | 
 |             self.onkeypress(None, key) | 
 |         Turtle._pen = None | 
 |  | 
 |     def mode(self, mode=None): | 
 |         """Set turtle-mode ('standard', 'logo' or 'world') and perform reset. | 
 |  | 
 |         Optional argument: | 
 |         mode -- on of the strings 'standard', 'logo' or 'world' | 
 |  | 
 |         Mode 'standard' is compatible with turtle.py. | 
 |         Mode 'logo' is compatible with most Logo-Turtle-Graphics. | 
 |         Mode 'world' uses userdefined 'worldcoordinates'. *Attention*: in | 
 |         this mode angles appear distorted if x/y unit-ratio doesn't equal 1. | 
 |         If mode is not given, return the current mode. | 
 |  | 
 |              Mode      Initial turtle heading     positive angles | 
 |          ------------|-------------------------|------------------- | 
 |           'standard'    to the right (east)       counterclockwise | 
 |             'logo'        upward    (north)         clockwise | 
 |  | 
 |         Examples: | 
 |         >>> mode('logo')   # resets turtle heading to north | 
 |         >>> mode() | 
 |         'logo' | 
 |         """ | 
 |         if mode is None: | 
 |             return self._mode | 
 |         mode = mode.lower() | 
 |         if mode not in ["standard", "logo", "world"]: | 
 |             raise TurtleGraphicsError("No turtle-graphics-mode %s" % mode) | 
 |         self._mode = mode | 
 |         if mode in ["standard", "logo"]: | 
 |             self._setscrollregion(-self.canvwidth//2, -self.canvheight//2, | 
 |                                        self.canvwidth//2, self.canvheight//2) | 
 |             self.xscale = self.yscale = 1.0 | 
 |         self.reset() | 
 |  | 
 |     def setworldcoordinates(self, llx, lly, urx, ury): | 
 |         """Set up a user defined coordinate-system. | 
 |  | 
 |         Arguments: | 
 |         llx -- a number, x-coordinate of lower left corner of canvas | 
 |         lly -- a number, y-coordinate of lower left corner of canvas | 
 |         urx -- a number, x-coordinate of upper right corner of canvas | 
 |         ury -- a number, y-coordinate of upper right corner of canvas | 
 |  | 
 |         Set up user coodinat-system and switch to mode 'world' if necessary. | 
 |         This performs a screen.reset. If mode 'world' is already active, | 
 |         all drawings are redrawn according to the new coordinates. | 
 |  | 
 |         But ATTENTION: in user-defined coordinatesystems angles may appear | 
 |         distorted. (see Screen.mode()) | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.setworldcoordinates(-10,-0.5,50,1.5) | 
 |         >>> for _ in range(36): | 
 |                 left(10) | 
 |                 forward(0.5) | 
 |         """ | 
 |         if self.mode() != "world": | 
 |             self.mode("world") | 
 |         xspan = float(urx - llx) | 
 |         yspan = float(ury - lly) | 
 |         wx, wy = self._window_size() | 
 |         self.screensize(wx-20, wy-20) | 
 |         oldxscale, oldyscale = self.xscale, self.yscale | 
 |         self.xscale = self.canvwidth / xspan | 
 |         self.yscale = self.canvheight / yspan | 
 |         srx1 = llx * self.xscale | 
 |         sry1 = -ury * self.yscale | 
 |         srx2 = self.canvwidth + srx1 | 
 |         sry2 = self.canvheight + sry1 | 
 |         self._setscrollregion(srx1, sry1, srx2, sry2) | 
 |         self._rescale(self.xscale/oldxscale, self.yscale/oldyscale) | 
 |         self.update() | 
 |  | 
 |     def register_shape(self, name, shape=None): | 
 |         """Adds a turtle shape to TurtleScreen's shapelist. | 
 |  | 
 |         Arguments: | 
 |         (1) name is the name of a gif-file and shape is None. | 
 |             Installs the corresponding image shape. | 
 |             !! Image-shapes DO NOT rotate when turning the turtle, | 
 |             !! so they do not display the heading of the turtle! | 
 |         (2) name is an arbitrary string and shape is a tuple | 
 |             of pairs of coordinates. Installs the corresponding | 
 |             polygon shape | 
 |         (3) name is an arbitrary string and shape is a | 
 |             (compound) Shape object. Installs the corresponding | 
 |             compound shape. | 
 |         To use a shape, you have to issue the command shape(shapename). | 
 |  | 
 |         call: register_shape("turtle.gif") | 
 |         --or: register_shape("tri", ((0,0), (10,10), (-10,10))) | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.register_shape("triangle", ((5,-3),(0,5),(-5,-3))) | 
 |  | 
 |         """ | 
 |         if shape is None: | 
 |             # image | 
 |             if name.lower().endswith(".gif"): | 
 |                 shape = Shape("image", self._image(name)) | 
 |             else: | 
 |                 raise TurtleGraphicsError("Bad arguments for register_shape.\n" | 
 |                                           + "Use  help(register_shape)" ) | 
 |         elif isinstance(shape, tuple): | 
 |             shape = Shape("polygon", shape) | 
 |         ## else shape assumed to be Shape-instance | 
 |         self._shapes[name] = shape | 
 |  | 
 |     def _colorstr(self, color): | 
 |         """Return color string corresponding to args. | 
 |  | 
 |         Argument may be a string or a tuple of three | 
 |         numbers corresponding to actual colormode, | 
 |         i.e. in the range 0<=n<=colormode. | 
 |  | 
 |         If the argument doesn't represent a color, | 
 |         an error is raised. | 
 |         """ | 
 |         if len(color) == 1: | 
 |             color = color[0] | 
 |         if isinstance(color, str): | 
 |             if self._iscolorstring(color) or color == "": | 
 |                 return color | 
 |             else: | 
 |                 raise TurtleGraphicsError("bad color string: %s" % str(color)) | 
 |         try: | 
 |             r, g, b = color | 
 |         except: | 
 |             raise TurtleGraphicsError("bad color arguments: %s" % str(color)) | 
 |         if self._colormode == 1.0: | 
 |             r, g, b = [round(255.0*x) for x in (r, g, b)] | 
 |         if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)): | 
 |             raise TurtleGraphicsError("bad color sequence: %s" % str(color)) | 
 |         return "#%02x%02x%02x" % (r, g, b) | 
 |  | 
 |     def _color(self, cstr): | 
 |         if not cstr.startswith("#"): | 
 |             return cstr | 
 |         if len(cstr) == 7: | 
 |             cl = [int(cstr[i:i+2], 16) for i in (1, 3, 5)] | 
 |         elif len(cstr) == 4: | 
 |             cl = [16*int(cstr[h], 16) for h in cstr[1:]] | 
 |         else: | 
 |             raise TurtleGraphicsError("bad colorstring: %s" % cstr) | 
 |         return tuple([c * self._colormode/255 for c in cl]) | 
 |  | 
 |     def colormode(self, cmode=None): | 
 |         """Return the colormode or set it to 1.0 or 255. | 
 |  | 
 |         Optional argument: | 
 |         cmode -- one of the values 1.0 or 255 | 
 |  | 
 |         r, g, b values of colortriples have to be in range 0..cmode. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.colormode() | 
 |         1.0 | 
 |         >>> screen.colormode(255) | 
 |         >>> turtle.pencolor(240,160,80) | 
 |         """ | 
 |         if cmode is None: | 
 |             return self._colormode | 
 |         if cmode == 1.0: | 
 |             self._colormode = float(cmode) | 
 |         elif cmode == 255: | 
 |             self._colormode = int(cmode) | 
 |  | 
 |     def reset(self): | 
 |         """Reset all Turtles on the Screen to their initial state. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.reset() | 
 |         """ | 
 |         for turtle in self._turtles: | 
 |             turtle._setmode(self._mode) | 
 |             turtle.reset() | 
 |  | 
 |     def turtles(self): | 
 |         """Return the list of turtles on the screen. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.turtles() | 
 |         [<turtle.Turtle object at 0x00E11FB0>] | 
 |         """ | 
 |         return self._turtles | 
 |  | 
 |     def bgcolor(self, *args): | 
 |         """Set or return backgroundcolor of the TurtleScreen. | 
 |  | 
 |         Arguments (if given): a color string or three numbers | 
 |         in the range 0..colormode or a 3-tuple of such numbers. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.bgcolor("orange") | 
 |         >>> screen.bgcolor() | 
 |         'orange' | 
 |         >>> screen.bgcolor(0.5,0,0.5) | 
 |         >>> screen.bgcolor() | 
 |         '#800080' | 
 |         """ | 
 |         if args: | 
 |             color = self._colorstr(args) | 
 |         else: | 
 |             color = None | 
 |         color = self._bgcolor(color) | 
 |         if color is not None: | 
 |             color = self._color(color) | 
 |         return color | 
 |  | 
 |     def tracer(self, n=None, delay=None): | 
 |         """Turns turtle animation on/off and set delay for update drawings. | 
 |  | 
 |         Optional arguments: | 
 |         n -- nonnegative  integer | 
 |         delay -- nonnegative  integer | 
 |  | 
 |         If n is given, only each n-th regular screen update is really performed. | 
 |         (Can be used to accelerate the drawing of complex graphics.) | 
 |         Second arguments sets delay value (see RawTurtle.delay()) | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.tracer(8, 25) | 
 |         >>> dist = 2 | 
 |         >>> for i in range(200): | 
 |                 fd(dist) | 
 |                 rt(90) | 
 |                 dist += 2 | 
 |         """ | 
 |         if n is None: | 
 |             return self._tracing | 
 |         self._tracing = int(n) | 
 |         self._updatecounter = 0 | 
 |         if delay is not None: | 
 |             self._delayvalue = int(delay) | 
 |         if self._tracing: | 
 |             self.update() | 
 |  | 
 |     def delay(self, delay=None): | 
 |         """ Return or set the drawing delay in milliseconds. | 
 |  | 
 |         Optional argument: | 
 |         delay -- positive integer | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.delay(15) | 
 |         >>> screen.delay() | 
 |         15 | 
 |         """ | 
 |         if delay is None: | 
 |             return self._delayvalue | 
 |         self._delayvalue = int(delay) | 
 |  | 
 |     def _incrementudc(self): | 
 |         "Increment upadate counter.""" | 
 |         if not TurtleScreen._RUNNING: | 
 |             TurtleScreen._RUNNNING = True | 
 |             raise Terminator | 
 |         if self._tracing > 0: | 
 |             self._updatecounter += 1 | 
 |             self._updatecounter %= self._tracing | 
 |  | 
 |     def update(self): | 
 |         """Perform a TurtleScreen update. | 
 |         """ | 
 |         tracing = self._tracing | 
 |         self._tracing = True | 
 |         for t in self.turtles(): | 
 |             t._update_data() | 
 |             t._drawturtle() | 
 |         self._tracing = tracing | 
 |         self._update() | 
 |  | 
 |     def window_width(self): | 
 |         """ Return the width of the turtle window. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.window_width() | 
 |         640 | 
 |         """ | 
 |         return self._window_size()[0] | 
 |  | 
 |     def window_height(self): | 
 |         """ Return the height of the turtle window. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.window_height() | 
 |         480 | 
 |         """ | 
 |         return self._window_size()[1] | 
 |  | 
 |     def getcanvas(self): | 
 |         """Return the Canvas of this TurtleScreen. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Screen instance named screen): | 
 |         >>> cv = screen.getcanvas() | 
 |         >>> cv | 
 |         <turtle.ScrolledCanvas instance at 0x010742D8> | 
 |         """ | 
 |         return self.cv | 
 |  | 
 |     def getshapes(self): | 
 |         """Return a list of names of all currently available turtle shapes. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.getshapes() | 
 |         ['arrow', 'blank', 'circle', ... , 'turtle'] | 
 |         """ | 
 |         return sorted(self._shapes.keys()) | 
 |  | 
 |     def onclick(self, fun, btn=1, add=None): | 
 |         """Bind fun to mouse-click event on canvas. | 
 |  | 
 |         Arguments: | 
 |         fun -- a function with two arguments, the coordinates of the | 
 |                clicked point on the canvas. | 
 |         num -- the number of the mouse-button, defaults to 1 | 
 |  | 
 |         Example (for a TurtleScreen instance named screen | 
 |         and a Turtle instance named turtle): | 
 |  | 
 |         >>> screen.onclick(turtle.goto) | 
 |  | 
 |         ### Subsequently clicking into the TurtleScreen will | 
 |         ### make the turtle move to the clicked point. | 
 |         >>> screen.onclick(None) | 
 |  | 
 |         ### event-binding will be removed | 
 |         """ | 
 |         self._onscreenclick(fun, btn, add) | 
 |  | 
 |     def onkey(self, fun, key): | 
 |         """Bind fun to key-release event of key. | 
 |  | 
 |         Arguments: | 
 |         fun -- a function with no arguments | 
 |         key -- a string: key (e.g. "a") or key-symbol (e.g. "space") | 
 |  | 
 |         In order to be able to register key-events, TurtleScreen | 
 |         must have focus. (See method listen.) | 
 |  | 
 |         Example (for a TurtleScreen instance named screen | 
 |         and a Turtle instance named turtle): | 
 |  | 
 |         >>> def f(): | 
 |                 fd(50) | 
 |                 lt(60) | 
 |  | 
 |  | 
 |         >>> screen.onkey(f, "Up") | 
 |         >>> screen.listen() | 
 |  | 
 |         ### Subsequently the turtle can be moved by | 
 |         ### repeatedly pressing the up-arrow key, | 
 |         ### consequently drawing a hexagon | 
 |         """ | 
 |         if fun is None: | 
 |             if key in self._keys: | 
 |                 self._keys.remove(key) | 
 |         elif key not in self._keys: | 
 |             self._keys.append(key) | 
 |         self._onkeyrelease(fun, key) | 
 |  | 
 |     def onkeypress(self, fun, key=None): | 
 |         """Bind fun to key-press event of key if key is given, | 
 |         or to any key-press-event if no key is given. | 
 |  | 
 |         Arguments: | 
 |         fun -- a function with no arguments | 
 |         key -- a string: key (e.g. "a") or key-symbol (e.g. "space") | 
 |  | 
 |         In order to be able to register key-events, TurtleScreen | 
 |         must have focus. (See method listen.) | 
 |  | 
 |         Example (for a TurtleScreen instance named screen | 
 |         and a Turtle instance named turtle): | 
 |  | 
 |         >>> def f(): | 
 |                 fd(50) | 
 |  | 
 |  | 
 |         >>> screen.onkey(f, "Up") | 
 |         >>> screen.listen() | 
 |  | 
 |         ### Subsequently the turtle can be moved by | 
 |         ### repeatedly pressing the up-arrow key, | 
 |         ### or by keeping pressed the up-arrow key. | 
 |         ### consequently drawing a hexagon. | 
 |         """ | 
 |         if fun is None: | 
 |             if key in self._keys: | 
 |                 self._keys.remove(key) | 
 |         elif key is not None and key not in self._keys: | 
 |             self._keys.append(key) | 
 |         self._onkeypress(fun, key) | 
 |  | 
 |     def listen(self, xdummy=None, ydummy=None): | 
 |         """Set focus on TurtleScreen (in order to collect key-events) | 
 |  | 
 |         No arguments. | 
 |         Dummy arguments are provided in order | 
 |         to be able to pass listen to the onclick method. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.listen() | 
 |         """ | 
 |         self._listen() | 
 |  | 
 |     def ontimer(self, fun, t=0): | 
 |         """Install a timer, which calls fun after t milliseconds. | 
 |  | 
 |         Arguments: | 
 |         fun -- a function with no arguments. | 
 |         t -- a number >= 0 | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |  | 
 |         >>> running = True | 
 |         >>> def f(): | 
 |                 if running: | 
 |                         fd(50) | 
 |                         lt(60) | 
 |                         screen.ontimer(f, 250) | 
 |  | 
 |         >>> f()   ### makes the turtle marching around | 
 |         >>> running = False | 
 |         """ | 
 |         self._ontimer(fun, t) | 
 |  | 
 |     def bgpic(self, picname=None): | 
 |         """Set background image or return name of current backgroundimage. | 
 |  | 
 |         Optional argument: | 
 |         picname -- a string, name of a gif-file or "nopic". | 
 |  | 
 |         If picname is a filename, set the corresponding image as background. | 
 |         If picname is "nopic", delete backgroundimage, if present. | 
 |         If picname is None, return the filename of the current backgroundimage. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.bgpic() | 
 |         'nopic' | 
 |         >>> screen.bgpic("landscape.gif") | 
 |         >>> screen.bgpic() | 
 |         'landscape.gif' | 
 |         """ | 
 |         if picname is None: | 
 |             return self._bgpicname | 
 |         if picname not in self._bgpics: | 
 |             self._bgpics[picname] = self._image(picname) | 
 |         self._setbgpic(self._bgpic, self._bgpics[picname]) | 
 |         self._bgpicname = picname | 
 |  | 
 |     def screensize(self, canvwidth=None, canvheight=None, bg=None): | 
 |         """Resize the canvas the turtles are drawing on. | 
 |  | 
 |         Optional arguments: | 
 |         canvwidth -- positive integer, new width of canvas in pixels | 
 |         canvheight --  positive integer, new height of canvas in pixels | 
 |         bg -- colorstring or color-tuple, new backgroundcolor | 
 |         If no arguments are given, return current (canvaswidth, canvasheight) | 
 |  | 
 |         Do not alter the drawing window. To observe hidden parts of | 
 |         the canvas use the scrollbars. (Can make visible those parts | 
 |         of a drawing, which were outside the canvas before!) | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.screensize(2000,1500) | 
 |             ### e. g. to search for an erroneously escaped turtle ;-) | 
 |         """ | 
 |         return self._resize(canvwidth, canvheight, bg) | 
 |  | 
 |     onscreenclick = onclick | 
 |     resetscreen = reset | 
 |     clearscreen = clear | 
 |     addshape = register_shape | 
 |     onkeyrelease = onkey | 
 |  | 
 | class TNavigator(object): | 
 |     """Navigation part of the RawTurtle. | 
 |     Implements methods for turtle movement. | 
 |     """ | 
 |     START_ORIENTATION = { | 
 |         "standard": Vec2D(1.0, 0.0), | 
 |         "world"   : Vec2D(1.0, 0.0), | 
 |         "logo"    : Vec2D(0.0, 1.0)  } | 
 |     DEFAULT_MODE = "standard" | 
 |     DEFAULT_ANGLEOFFSET = 0 | 
 |     DEFAULT_ANGLEORIENT = 1 | 
 |  | 
 |     def __init__(self, mode=DEFAULT_MODE): | 
 |         self._angleOffset = self.DEFAULT_ANGLEOFFSET | 
 |         self._angleOrient = self.DEFAULT_ANGLEORIENT | 
 |         self._mode = mode | 
 |         self.undobuffer = None | 
 |         self.degrees() | 
 |         self._mode = None | 
 |         self._setmode(mode) | 
 |         TNavigator.reset(self) | 
 |  | 
 |     def reset(self): | 
 |         """reset turtle to its initial values | 
 |  | 
 |         Will be overwritten by parent class | 
 |         """ | 
 |         self._position = Vec2D(0.0, 0.0) | 
 |         self._orient =  TNavigator.START_ORIENTATION[self._mode] | 
 |  | 
 |     def _setmode(self, mode=None): | 
 |         """Set turtle-mode to 'standard', 'world' or 'logo'. | 
 |         """ | 
 |         if mode is None: | 
 |             return self._mode | 
 |         if mode not in ["standard", "logo", "world"]: | 
 |             return | 
 |         self._mode = mode | 
 |         if mode in ["standard", "world"]: | 
 |             self._angleOffset = 0 | 
 |             self._angleOrient = 1 | 
 |         else: # mode == "logo": | 
 |             self._angleOffset = self._fullcircle/4. | 
 |             self._angleOrient = -1 | 
 |  | 
 |     def _setDegreesPerAU(self, fullcircle): | 
 |         """Helper function for degrees() and radians()""" | 
 |         self._fullcircle = fullcircle | 
 |         self._degreesPerAU = 360/fullcircle | 
 |         if self._mode == "standard": | 
 |             self._angleOffset = 0 | 
 |         else: | 
 |             self._angleOffset = fullcircle/4. | 
 |  | 
 |     def degrees(self, fullcircle=360.0): | 
 |         """ Set angle measurement units to degrees. | 
 |  | 
 |         Optional argument: | 
 |         fullcircle -  a number | 
 |  | 
 |         Set angle measurement units, i. e. set number | 
 |         of 'degrees' for a full circle. Dafault value is | 
 |         360 degrees. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.left(90) | 
 |         >>> turtle.heading() | 
 |         90 | 
 |  | 
 |         Change angle measurement unit to grad (also known as gon, | 
 |         grade, or gradian and equals 1/100-th of the right angle.) | 
 |         >>> turtle.degrees(400.0) | 
 |         >>> turtle.heading() | 
 |         100 | 
 |  | 
 |         """ | 
 |         self._setDegreesPerAU(fullcircle) | 
 |  | 
 |     def radians(self): | 
 |         """ Set the angle measurement units to radians. | 
 |  | 
 |         No arguments. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.heading() | 
 |         90 | 
 |         >>> turtle.radians() | 
 |         >>> turtle.heading() | 
 |         1.5707963267948966 | 
 |         """ | 
 |         self._setDegreesPerAU(2*math.pi) | 
 |  | 
 |     def _go(self, distance): | 
 |         """move turtle forward by specified distance""" | 
 |         ende = self._position + self._orient * distance | 
 |         self._goto(ende) | 
 |  | 
 |     def _rotate(self, angle): | 
 |         """Turn turtle counterclockwise by specified angle if angle > 0.""" | 
 |         angle *= self._degreesPerAU | 
 |         self._orient = self._orient.rotate(angle) | 
 |  | 
 |     def _goto(self, end): | 
 |         """move turtle to position end.""" | 
 |         self._position = end | 
 |  | 
 |     def forward(self, distance): | 
 |         """Move the turtle forward by the specified distance. | 
 |  | 
 |         Aliases: forward | fd | 
 |  | 
 |         Argument: | 
 |         distance -- a number (integer or float) | 
 |  | 
 |         Move the turtle forward by the specified distance, in the direction | 
 |         the turtle is headed. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.position() | 
 |         (0.00, 0.00) | 
 |         >>> turtle.forward(25) | 
 |         >>> turtle.position() | 
 |         (25.00,0.00) | 
 |         >>> turtle.forward(-75) | 
 |         >>> turtle.position() | 
 |         (-50.00,0.00) | 
 |         """ | 
 |         self._go(distance) | 
 |  | 
 |     def back(self, distance): | 
 |         """Move the turtle backward by distance. | 
 |  | 
 |         Aliases: back | backward | bk | 
 |  | 
 |         Argument: | 
 |         distance -- a number | 
 |  | 
 |         Move the turtle backward by distance ,opposite to the direction the | 
 |         turtle is headed. Do not change the turtle's heading. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.position() | 
 |         (0.00, 0.00) | 
 |         >>> turtle.backward(30) | 
 |         >>> turtle.position() | 
 |         (-30.00, 0.00) | 
 |         """ | 
 |         self._go(-distance) | 
 |  | 
 |     def right(self, angle): | 
 |         """Turn turtle right by angle units. | 
 |  | 
 |         Aliases: right | rt | 
 |  | 
 |         Argument: | 
 |         angle -- a number (integer or float) | 
 |  | 
 |         Turn turtle right by angle units. (Units are by default degrees, | 
 |         but can be set via the degrees() and radians() functions.) | 
 |         Angle orientation depends on mode. (See this.) | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.heading() | 
 |         22.0 | 
 |         >>> turtle.right(45) | 
 |         >>> turtle.heading() | 
 |         337.0 | 
 |         """ | 
 |         self._rotate(-angle) | 
 |  | 
 |     def left(self, angle): | 
 |         """Turn turtle left by angle units. | 
 |  | 
 |         Aliases: left | lt | 
 |  | 
 |         Argument: | 
 |         angle -- a number (integer or float) | 
 |  | 
 |         Turn turtle left by angle units. (Units are by default degrees, | 
 |         but can be set via the degrees() and radians() functions.) | 
 |         Angle orientation depends on mode. (See this.) | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.heading() | 
 |         22.0 | 
 |         >>> turtle.left(45) | 
 |         >>> turtle.heading() | 
 |         67.0 | 
 |         """ | 
 |         self._rotate(angle) | 
 |  | 
 |     def pos(self): | 
 |         """Return the turtle's current location (x,y), as a Vec2D-vector. | 
 |  | 
 |         Aliases: pos | position | 
 |  | 
 |         No arguments. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.pos() | 
 |         (0.00, 240.00) | 
 |         """ | 
 |         return self._position | 
 |  | 
 |     def xcor(self): | 
 |         """ Return the turtle's x coordinate. | 
 |  | 
 |         No arguments. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> reset() | 
 |         >>> turtle.left(60) | 
 |         >>> turtle.forward(100) | 
 |         >>> print turtle.xcor() | 
 |         50.0 | 
 |         """ | 
 |         return self._position[0] | 
 |  | 
 |     def ycor(self): | 
 |         """ Return the turtle's y coordinate | 
 |         --- | 
 |         No arguments. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> reset() | 
 |         >>> turtle.left(60) | 
 |         >>> turtle.forward(100) | 
 |         >>> print turtle.ycor() | 
 |         86.6025403784 | 
 |         """ | 
 |         return self._position[1] | 
 |  | 
 |  | 
 |     def goto(self, x, y=None): | 
 |         """Move turtle to an absolute position. | 
 |  | 
 |         Aliases: setpos | setposition | goto: | 
 |  | 
 |         Arguments: | 
 |         x -- a number      or     a pair/vector of numbers | 
 |         y -- a number             None | 
 |  | 
 |         call: goto(x, y)         # two coordinates | 
 |         --or: goto((x, y))       # a pair (tuple) of coordinates | 
 |         --or: goto(vec)          # e.g. as returned by pos() | 
 |  | 
 |         Move turtle to an absolute position. If the pen is down, | 
 |         a line will be drawn. The turtle's orientation does not change. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> tp = turtle.pos() | 
 |         >>> tp | 
 |         (0.00, 0.00) | 
 |         >>> turtle.setpos(60,30) | 
 |         >>> turtle.pos() | 
 |         (60.00,30.00) | 
 |         >>> turtle.setpos((20,80)) | 
 |         >>> turtle.pos() | 
 |         (20.00,80.00) | 
 |         >>> turtle.setpos(tp) | 
 |         >>> turtle.pos() | 
 |         (0.00,0.00) | 
 |         """ | 
 |         if y is None: | 
 |             self._goto(Vec2D(*x)) | 
 |         else: | 
 |             self._goto(Vec2D(x, y)) | 
 |  | 
 |     def home(self): | 
 |         """Move turtle to the origin - coordinates (0,0). | 
 |  | 
 |         No arguments. | 
 |  | 
 |         Move turtle to the origin - coordinates (0,0) and set its | 
 |         heading to its start-orientation (which depends on mode). | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.home() | 
 |         """ | 
 |         self.goto(0, 0) | 
 |         self.setheading(0) | 
 |  | 
 |     def setx(self, x): | 
 |         """Set the turtle's first coordinate to x | 
 |  | 
 |         Argument: | 
 |         x -- a number (integer or float) | 
 |  | 
 |         Set the turtle's first coordinate to x, leave second coordinate | 
 |         unchanged. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.position() | 
 |         (0.00, 240.00) | 
 |         >>> turtle.setx(10) | 
 |         >>> turtle.position() | 
 |         (10.00, 240.00) | 
 |         """ | 
 |         self._goto(Vec2D(x, self._position[1])) | 
 |  | 
 |     def sety(self, y): | 
 |         """Set the turtle's second coordinate to y | 
 |  | 
 |         Argument: | 
 |         y -- a number (integer or float) | 
 |  | 
 |         Set the turtle's first coordinate to x, second coordinate remains | 
 |         unchanged. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.position() | 
 |         (0.00, 40.00) | 
 |         >>> turtle.sety(-10) | 
 |         >>> turtle.position() | 
 |         (0.00, -10.00) | 
 |         """ | 
 |         self._goto(Vec2D(self._position[0], y)) | 
 |  | 
 |     def distance(self, x, y=None): | 
 |         """Return the distance from the turtle to (x,y) in turtle step units. | 
 |  | 
 |         Arguments: | 
 |         x -- a number   or  a pair/vector of numbers   or   a turtle instance | 
 |         y -- a number       None                            None | 
 |  | 
 |         call: distance(x, y)         # two coordinates | 
 |         --or: distance((x, y))       # a pair (tuple) of coordinates | 
 |         --or: distance(vec)          # e.g. as returned by pos() | 
 |         --or: distance(mypen)        # where mypen is another turtle | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.pos() | 
 |         (0.00, 0.00) | 
 |         >>> turtle.distance(30,40) | 
 |         50.0 | 
 |         >>> pen = Turtle() | 
 |         >>> pen.forward(77) | 
 |         >>> turtle.distance(pen) | 
 |         77.0 | 
 |         """ | 
 |         if y is not None: | 
 |             pos = Vec2D(x, y) | 
 |         if isinstance(x, Vec2D): | 
 |             pos = x | 
 |         elif isinstance(x, tuple): | 
 |             pos = Vec2D(*x) | 
 |         elif isinstance(x, TNavigator): | 
 |             pos = x._position | 
 |         return abs(pos - self._position) | 
 |  | 
 |     def towards(self, x, y=None): | 
 |         """Return the angle of the line from the turtle's position to (x, y). | 
 |  | 
 |         Arguments: | 
 |         x -- a number   or  a pair/vector of numbers   or   a turtle instance | 
 |         y -- a number       None                            None | 
 |  | 
 |         call: distance(x, y)         # two coordinates | 
 |         --or: distance((x, y))       # a pair (tuple) of coordinates | 
 |         --or: distance(vec)          # e.g. as returned by pos() | 
 |         --or: distance(mypen)        # where mypen is another turtle | 
 |  | 
 |         Return the angle, between the line from turtle-position to position | 
 |         specified by x, y and the turtle's start orientation. (Depends on | 
 |         modes - "standard" or "logo") | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.pos() | 
 |         (10.00, 10.00) | 
 |         >>> turtle.towards(0,0) | 
 |         225.0 | 
 |         """ | 
 |         if y is not None: | 
 |             pos = Vec2D(x, y) | 
 |         if isinstance(x, Vec2D): | 
 |             pos = x | 
 |         elif isinstance(x, tuple): | 
 |             pos = Vec2D(*x) | 
 |         elif isinstance(x, TNavigator): | 
 |             pos = x._position | 
 |         x, y = pos - self._position | 
 |         result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0 | 
 |         result /= self._degreesPerAU | 
 |         return (self._angleOffset + self._angleOrient*result) % self._fullcircle | 
 |  | 
 |     def heading(self): | 
 |         """ Return the turtle's current heading. | 
 |  | 
 |         No arguments. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.left(67) | 
 |         >>> turtle.heading() | 
 |         67.0 | 
 |         """ | 
 |         x, y = self._orient | 
 |         result = round(math.atan2(y, x)*180.0/math.pi, 10) % 360.0 | 
 |         result /= self._degreesPerAU | 
 |         return (self._angleOffset + self._angleOrient*result) % self._fullcircle | 
 |  | 
 |     def setheading(self, to_angle): | 
 |         """Set the orientation of the turtle to to_angle. | 
 |  | 
 |         Aliases:  setheading | seth | 
 |  | 
 |         Argument: | 
 |         to_angle -- a number (integer or float) | 
 |  | 
 |         Set the orientation of the turtle to to_angle. | 
 |         Here are some common directions in degrees: | 
 |  | 
 |          standard - mode:          logo-mode: | 
 |         -------------------|-------------------- | 
 |            0 - east                0 - north | 
 |           90 - north              90 - east | 
 |          180 - west              180 - south | 
 |          270 - south             270 - west | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.setheading(90) | 
 |         >>> turtle.heading() | 
 |         90 | 
 |         """ | 
 |         angle = (to_angle - self.heading())*self._angleOrient | 
 |         full = self._fullcircle | 
 |         angle = (angle+full/2.)%full - full/2. | 
 |         self._rotate(angle) | 
 |  | 
 |     def circle(self, radius, extent = None, steps = None): | 
 |         """ Draw a circle with given radius. | 
 |  | 
 |         Arguments: | 
 |         radius -- a number | 
 |         extent (optional) -- a number | 
 |         steps (optional) -- an integer | 
 |  | 
 |         Draw a circle with given radius. The center is radius units left | 
 |         of the turtle; extent - an angle - determines which part of the | 
 |         circle is drawn. If extent is not given, draw the entire circle. | 
 |         If extent is not a full circle, one endpoint of the arc is the | 
 |         current pen position. Draw the arc in counterclockwise direction | 
 |         if radius is positive, otherwise in clockwise direction. Finally | 
 |         the direction of the turtle is changed by the amount of extent. | 
 |  | 
 |         As the circle is approximated by an inscribed regular polygon, | 
 |         steps determines the number of steps to use. If not given, | 
 |         it will be calculated automatically. Maybe used to draw regular | 
 |         polygons. | 
 |  | 
 |         call: circle(radius)                  # full circle | 
 |         --or: circle(radius, extent)          # arc | 
 |         --or: circle(radius, extent, steps) | 
 |         --or: circle(radius, steps=6)         # 6-sided polygon | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.circle(50) | 
 |         >>> turtle.circle(120, 180)  # semicircle | 
 |         """ | 
 |         if self.undobuffer: | 
 |             self.undobuffer.push(["seq"]) | 
 |             self.undobuffer.cumulate = True | 
 |         speed = self.speed() | 
 |         if extent is None: | 
 |             extent = self._fullcircle | 
 |         if steps is None: | 
 |             frac = abs(extent)/self._fullcircle | 
 |             steps = 1+int(min(11+abs(radius)/6.0, 59.0)*frac) | 
 |         w = 1.0 * extent / steps | 
 |         w2 = 0.5 * w | 
 |         l = 2.0 * radius * math.sin(w2*math.pi/180.0*self._degreesPerAU) | 
 |         if radius < 0: | 
 |             l, w, w2 = -l, -w, -w2 | 
 |         tr = self._tracer() | 
 |         dl = self._delay() | 
 |         if speed == 0: | 
 |             self._tracer(0, 0) | 
 |         else: | 
 |             self.speed(0) | 
 |         self._rotate(w2) | 
 |         for i in range(steps): | 
 |             self.speed(speed) | 
 |             self._go(l) | 
 |             self.speed(0) | 
 |             self._rotate(w) | 
 |         self._rotate(-w2) | 
 |         if speed == 0: | 
 |             self._tracer(tr, dl) | 
 |         self.speed(speed) | 
 |         if self.undobuffer: | 
 |             self.undobuffer.cumulate = False | 
 |  | 
 | ## three dummy methods to be implemented by child class: | 
 |  | 
 |     def speed(self, s=0): | 
 |         """dummy method - to be overwritten by child class""" | 
 |     def _tracer(self, a=None, b=None): | 
 |         """dummy method - to be overwritten by child class""" | 
 |     def _delay(self, n=None): | 
 |         """dummy method - to be overwritten by child class""" | 
 |  | 
 |     fd = forward | 
 |     bk = back | 
 |     backward = back | 
 |     rt = right | 
 |     lt = left | 
 |     position = pos | 
 |     setpos = goto | 
 |     setposition = goto | 
 |     seth = setheading | 
 |  | 
 |  | 
 | class TPen(object): | 
 |     """Drawing part of the RawTurtle. | 
 |     Implements drawing properties. | 
 |     """ | 
 |     def __init__(self, resizemode=_CFG["resizemode"]): | 
 |         self._resizemode = resizemode # or "user" or "noresize" | 
 |         self.undobuffer = None | 
 |         TPen._reset(self) | 
 |  | 
 |     def _reset(self, pencolor=_CFG["pencolor"], | 
 |                      fillcolor=_CFG["fillcolor"]): | 
 |         self._pensize = 1 | 
 |         self._shown = True | 
 |         self._pencolor = pencolor | 
 |         self._fillcolor = fillcolor | 
 |         self._drawing = True | 
 |         self._speed = 3 | 
 |         self._stretchfactor = (1., 1.) | 
 |         self._shearfactor = 0. | 
 |         self._tilt = 0. | 
 |         self._shapetrafo = (1., 0., 0., 1.) | 
 |         self._outlinewidth = 1 | 
 |  | 
 |     def resizemode(self, rmode=None): | 
 |         """Set resizemode to one of the values: "auto", "user", "noresize". | 
 |  | 
 |         (Optional) Argument: | 
 |         rmode -- one of the strings "auto", "user", "noresize" | 
 |  | 
 |         Different resizemodes have the following effects: | 
 |           - "auto" adapts the appearance of the turtle | 
 |                    corresponding to the value of pensize. | 
 |           - "user" adapts the appearance of the turtle according to the | 
 |                    values of stretchfactor and outlinewidth (outline), | 
 |                    which are set by shapesize() | 
 |           - "noresize" no adaption of the turtle's appearance takes place. | 
 |         If no argument is given, return current resizemode. | 
 |         resizemode("user") is called by a call of shapesize with arguments. | 
 |  | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.resizemode("noresize") | 
 |         >>> turtle.resizemode() | 
 |         'noresize' | 
 |         """ | 
 |         if rmode is None: | 
 |             return self._resizemode | 
 |         rmode = rmode.lower() | 
 |         if rmode in ["auto", "user", "noresize"]: | 
 |             self.pen(resizemode=rmode) | 
 |  | 
 |     def pensize(self, width=None): | 
 |         """Set or return the line thickness. | 
 |  | 
 |         Aliases:  pensize | width | 
 |  | 
 |         Argument: | 
 |         width -- positive number | 
 |  | 
 |         Set the line thickness to width or return it. If resizemode is set | 
 |         to "auto" and turtleshape is a polygon, that polygon is drawn with | 
 |         the same line thickness. If no argument is given, current pensize | 
 |         is returned. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.pensize() | 
 |         1 | 
 |         turtle.pensize(10)   # from here on lines of width 10 are drawn | 
 |         """ | 
 |         if width is None: | 
 |             return self._pensize | 
 |         self.pen(pensize=width) | 
 |  | 
 |  | 
 |     def penup(self): | 
 |         """Pull the pen up -- no drawing when moving. | 
 |  | 
 |         Aliases: penup | pu | up | 
 |  | 
 |         No argument | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.penup() | 
 |         """ | 
 |         if not self._drawing: | 
 |             return | 
 |         self.pen(pendown=False) | 
 |  | 
 |     def pendown(self): | 
 |         """Pull the pen down -- drawing when moving. | 
 |  | 
 |         Aliases: pendown | pd | down | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.pendown() | 
 |         """ | 
 |         if self._drawing: | 
 |             return | 
 |         self.pen(pendown=True) | 
 |  | 
 |     def isdown(self): | 
 |         """Return True if pen is down, False if it's up. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.penup() | 
 |         >>> turtle.isdown() | 
 |         False | 
 |         >>> turtle.pendown() | 
 |         >>> turtle.isdown() | 
 |         True | 
 |         """ | 
 |         return self._drawing | 
 |  | 
 |     def speed(self, speed=None): | 
 |         """ Return or set the turtle's speed. | 
 |  | 
 |         Optional argument: | 
 |         speed -- an integer in the range 0..10 or a speedstring (see below) | 
 |  | 
 |         Set the turtle's speed to an integer value in the range 0 .. 10. | 
 |         If no argument is given: return current speed. | 
 |  | 
 |         If input is a number greater than 10 or smaller than 0.5, | 
 |         speed is set to 0. | 
 |         Speedstrings  are mapped to speedvalues in the following way: | 
 |             'fastest' :  0 | 
 |             'fast'    :  10 | 
 |             'normal'  :  6 | 
 |             'slow'    :  3 | 
 |             'slowest' :  1 | 
 |         speeds from 1 to 10 enforce increasingly faster animation of | 
 |         line drawing and turtle turning. | 
 |  | 
 |         Attention: | 
 |         speed = 0 : *no* animation takes place. forward/back makes turtle jump | 
 |         and likewise left/right make the turtle turn instantly. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.speed(3) | 
 |         """ | 
 |         speeds = {'fastest':0, 'fast':10, 'normal':6, 'slow':3, 'slowest':1 } | 
 |         if speed is None: | 
 |             return self._speed | 
 |         if speed in speeds: | 
 |             speed = speeds[speed] | 
 |         elif 0.5 < speed < 10.5: | 
 |             speed = int(round(speed)) | 
 |         else: | 
 |             speed = 0 | 
 |         self.pen(speed=speed) | 
 |  | 
 |     def color(self, *args): | 
 |         """Return or set the pencolor and fillcolor. | 
 |  | 
 |         Arguments: | 
 |         Several input formats are allowed. | 
 |         They use 0, 1, 2, or 3 arguments as follows: | 
 |  | 
 |         color() | 
 |             Return the current pencolor and the current fillcolor | 
 |             as a pair of color specification strings as are returned | 
 |             by pencolor and fillcolor. | 
 |         color(colorstring), color((r,g,b)), color(r,g,b) | 
 |             inputs as in pencolor, set both, fillcolor and pencolor, | 
 |             to the given value. | 
 |         color(colorstring1, colorstring2), | 
 |         color((r1,g1,b1), (r2,g2,b2)) | 
 |             equivalent to pencolor(colorstring1) and fillcolor(colorstring2) | 
 |             and analogously, if the other input format is used. | 
 |  | 
 |         If turtleshape is a polygon, outline and interior of that polygon | 
 |         is drawn with the newly set colors. | 
 |         For mor info see: pencolor, fillcolor | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.color('red', 'green') | 
 |         >>> turtle.color() | 
 |         ('red', 'green') | 
 |         >>> colormode(255) | 
 |         >>> color((40, 80, 120), (160, 200, 240)) | 
 |         >>> color() | 
 |         ('#285078', '#a0c8f0') | 
 |         """ | 
 |         if args: | 
 |             l = len(args) | 
 |             if l == 1: | 
 |                 pcolor = fcolor = args[0] | 
 |             elif l == 2: | 
 |                 pcolor, fcolor = args | 
 |             elif l == 3: | 
 |                 pcolor = fcolor = args | 
 |             pcolor = self._colorstr(pcolor) | 
 |             fcolor = self._colorstr(fcolor) | 
 |             self.pen(pencolor=pcolor, fillcolor=fcolor) | 
 |         else: | 
 |             return self._color(self._pencolor), self._color(self._fillcolor) | 
 |  | 
 |     def pencolor(self, *args): | 
 |         """ Return or set the pencolor. | 
 |  | 
 |         Arguments: | 
 |         Four input formats are allowed: | 
 |           - pencolor() | 
 |             Return the current pencolor as color specification string, | 
 |             possibly in hex-number format (see example). | 
 |             May be used as input to another color/pencolor/fillcolor call. | 
 |           - pencolor(colorstring) | 
 |             s is a Tk color specification string, such as "red" or "yellow" | 
 |           - pencolor((r, g, b)) | 
 |             *a tuple* of r, g, and b, which represent, an RGB color, | 
 |             and each of r, g, and b are in the range 0..colormode, | 
 |             where colormode is either 1.0 or 255 | 
 |           - pencolor(r, g, b) | 
 |             r, g, and b represent an RGB color, and each of r, g, and b | 
 |             are in the range 0..colormode | 
 |  | 
 |         If turtleshape is a polygon, the outline of that polygon is drawn | 
 |         with the newly set pencolor. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.pencolor('brown') | 
 |         >>> tup = (0.2, 0.8, 0.55) | 
 |         >>> turtle.pencolor(tup) | 
 |         >>> turtle.pencolor() | 
 |         '#33cc8c' | 
 |         """ | 
 |         if args: | 
 |             color = self._colorstr(args) | 
 |             if color == self._pencolor: | 
 |                 return | 
 |             self.pen(pencolor=color) | 
 |         else: | 
 |             return self._color(self._pencolor) | 
 |  | 
 |     def fillcolor(self, *args): | 
 |         """ Return or set the fillcolor. | 
 |  | 
 |         Arguments: | 
 |         Four input formats are allowed: | 
 |           - fillcolor() | 
 |             Return the current fillcolor as color specification string, | 
 |             possibly in hex-number format (see example). | 
 |             May be used as input to another color/pencolor/fillcolor call. | 
 |           - fillcolor(colorstring) | 
 |             s is a Tk color specification string, such as "red" or "yellow" | 
 |           - fillcolor((r, g, b)) | 
 |             *a tuple* of r, g, and b, which represent, an RGB color, | 
 |             and each of r, g, and b are in the range 0..colormode, | 
 |             where colormode is either 1.0 or 255 | 
 |           - fillcolor(r, g, b) | 
 |             r, g, and b represent an RGB color, and each of r, g, and b | 
 |             are in the range 0..colormode | 
 |  | 
 |         If turtleshape is a polygon, the interior of that polygon is drawn | 
 |         with the newly set fillcolor. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.fillcolor('violet') | 
 |         >>> col = turtle.pencolor() | 
 |         >>> turtle.fillcolor(col) | 
 |         >>> turtle.fillcolor(0, .5, 0) | 
 |         """ | 
 |         if args: | 
 |             color = self._colorstr(args) | 
 |             if color == self._fillcolor: | 
 |                 return | 
 |             self.pen(fillcolor=color) | 
 |         else: | 
 |             return self._color(self._fillcolor) | 
 |  | 
 |     def showturtle(self): | 
 |         """Makes the turtle visible. | 
 |  | 
 |         Aliases: showturtle | st | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.hideturtle() | 
 |         >>> turtle.showturtle() | 
 |         """ | 
 |         self.pen(shown=True) | 
 |  | 
 |     def hideturtle(self): | 
 |         """Makes the turtle invisible. | 
 |  | 
 |         Aliases: hideturtle | ht | 
 |  | 
 |         No argument. | 
 |  | 
 |         It's a good idea to do this while you're in the | 
 |         middle of a complicated drawing, because hiding | 
 |         the turtle speeds up the drawing observably. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.hideturtle() | 
 |         """ | 
 |         self.pen(shown=False) | 
 |  | 
 |     def isvisible(self): | 
 |         """Return True if the Turtle is shown, False if it's hidden. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.hideturtle() | 
 |         >>> print turtle.isvisible(): | 
 |         False | 
 |         """ | 
 |         return self._shown | 
 |  | 
 |     def pen(self, pen=None, **pendict): | 
 |         """Return or set the pen's attributes. | 
 |  | 
 |         Arguments: | 
 |             pen -- a dictionary with some or all of the below listed keys. | 
 |             **pendict -- one or more keyword-arguments with the below | 
 |                          listed keys as keywords. | 
 |  | 
 |         Return or set the pen's attributes in a 'pen-dictionary' | 
 |         with the following key/value pairs: | 
 |            "shown"      :   True/False | 
 |            "pendown"    :   True/False | 
 |            "pencolor"   :   color-string or color-tuple | 
 |            "fillcolor"  :   color-string or color-tuple | 
 |            "pensize"    :   positive number | 
 |            "speed"      :   number in range 0..10 | 
 |            "resizemode" :   "auto" or "user" or "noresize" | 
 |            "stretchfactor": (positive number, positive number) | 
 |            "shearfactor":   number | 
 |            "outline"    :   positive number | 
 |            "tilt"       :   number | 
 |  | 
 |         This dictionary can be used as argument for a subsequent | 
 |         pen()-call to restore the former pen-state. Moreover one | 
 |         or more of these attributes can be provided as keyword-arguments. | 
 |         This can be used to set several pen attributes in one statement. | 
 |  | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.pen(fillcolor="black", pencolor="red", pensize=10) | 
 |         >>> turtle.pen() | 
 |         {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1, | 
 |         'pencolor': 'red', 'pendown': True, 'fillcolor': 'black', | 
 |         'stretchfactor': (1,1), 'speed': 3, 'shearfactor': 0.0} | 
 |         >>> penstate=turtle.pen() | 
 |         >>> turtle.color("yellow","") | 
 |         >>> turtle.penup() | 
 |         >>> turtle.pen() | 
 |         {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1, | 
 |         'pencolor': 'yellow', 'pendown': False, 'fillcolor': '', | 
 |         'stretchfactor': (1,1), 'speed': 3, 'shearfactor': 0.0} | 
 |         >>> p.pen(penstate, fillcolor="green") | 
 |         >>> p.pen() | 
 |         {'pensize': 10, 'shown': True, 'resizemode': 'auto', 'outline': 1, | 
 |         'pencolor': 'red', 'pendown': True, 'fillcolor': 'green', | 
 |         'stretchfactor': (1,1), 'speed': 3, 'shearfactor': 0.0} | 
 |         """ | 
 |         _pd =  {"shown"         : self._shown, | 
 |                 "pendown"       : self._drawing, | 
 |                 "pencolor"      : self._pencolor, | 
 |                 "fillcolor"     : self._fillcolor, | 
 |                 "pensize"       : self._pensize, | 
 |                 "speed"         : self._speed, | 
 |                 "resizemode"    : self._resizemode, | 
 |                 "stretchfactor" : self._stretchfactor, | 
 |                 "shearfactor"   : self._shearfactor, | 
 |                 "outline"       : self._outlinewidth, | 
 |                 "tilt"          : self._tilt | 
 |                } | 
 |  | 
 |         if not (pen or pendict): | 
 |             return _pd | 
 |  | 
 |         if isinstance(pen, dict): | 
 |             p = pen | 
 |         else: | 
 |             p = {} | 
 |         p.update(pendict) | 
 |  | 
 |         _p_buf = {} | 
 |         for key in p: | 
 |             _p_buf[key] = _pd[key] | 
 |  | 
 |         if self.undobuffer: | 
 |             self.undobuffer.push(("pen", _p_buf)) | 
 |  | 
 |         newLine = False | 
 |         if "pendown" in p: | 
 |             if self._drawing != p["pendown"]: | 
 |                 newLine = True | 
 |         if "pencolor" in p: | 
 |             if isinstance(p["pencolor"], tuple): | 
 |                 p["pencolor"] = self._colorstr((p["pencolor"],)) | 
 |             if self._pencolor != p["pencolor"]: | 
 |                 newLine = True | 
 |         if "pensize" in p: | 
 |             if self._pensize != p["pensize"]: | 
 |                 newLine = True | 
 |         if newLine: | 
 |             self._newLine() | 
 |         if "pendown" in p: | 
 |             self._drawing = p["pendown"] | 
 |         if "pencolor" in p: | 
 |             self._pencolor = p["pencolor"] | 
 |         if "pensize" in p: | 
 |             self._pensize = p["pensize"] | 
 |         if "fillcolor" in p: | 
 |             if isinstance(p["fillcolor"], tuple): | 
 |                 p["fillcolor"] = self._colorstr((p["fillcolor"],)) | 
 |             self._fillcolor = p["fillcolor"] | 
 |         if "speed" in p: | 
 |             self._speed = p["speed"] | 
 |         if "resizemode" in p: | 
 |             self._resizemode = p["resizemode"] | 
 |         if "stretchfactor" in p: | 
 |             sf = p["stretchfactor"] | 
 |             if isinstance(sf, (int, float)): | 
 |                 sf = (sf, sf) | 
 |             self._stretchfactor = sf | 
 |         if "shearfactor" in p: | 
 |             self._shearfactor = p["shearfactor"] | 
 |         if "outline" in p: | 
 |             self._outlinewidth = p["outline"] | 
 |         if "shown" in p: | 
 |             self._shown = p["shown"] | 
 |         if "tilt" in p: | 
 |             self._tilt = p["tilt"] | 
 |         if "stretchfactor" in p or "tilt" in p or "shearfactor" in p: | 
 |             scx, scy = self._stretchfactor | 
 |             shf = self._shearfactor | 
 |             sa, ca = math.sin(self._tilt), math.cos(self._tilt) | 
 |             self._shapetrafo = ( scx*ca, scy*(shf*ca + sa), | 
 |                                 -scx*sa, scy*(ca - shf*sa)) | 
 |         self._update() | 
 |  | 
 | ## three dummy methods to be implemented by child class: | 
 |  | 
 |     def _newLine(self, usePos = True): | 
 |         """dummy method - to be overwritten by child class""" | 
 |     def _update(self, count=True, forced=False): | 
 |         """dummy method - to be overwritten by child class""" | 
 |     def _color(self, args): | 
 |         """dummy method - to be overwritten by child class""" | 
 |     def _colorstr(self, args): | 
 |         """dummy method - to be overwritten by child class""" | 
 |  | 
 |     width = pensize | 
 |     up = penup | 
 |     pu = penup | 
 |     pd = pendown | 
 |     down = pendown | 
 |     st = showturtle | 
 |     ht = hideturtle | 
 |  | 
 |  | 
 | class _TurtleImage(object): | 
 |     """Helper class: Datatype to store Turtle attributes | 
 |     """ | 
 |  | 
 |     def __init__(self, screen, shapeIndex): | 
 |         self.screen = screen | 
 |         self._type = None | 
 |         self._setshape(shapeIndex) | 
 |  | 
 |     def _setshape(self, shapeIndex): | 
 |         screen = self.screen | 
 |         self.shapeIndex = shapeIndex | 
 |         if self._type == "polygon" == screen._shapes[shapeIndex]._type: | 
 |             return | 
 |         if self._type == "image" == screen._shapes[shapeIndex]._type: | 
 |             return | 
 |         if self._type in ["image", "polygon"]: | 
 |             screen._delete(self._item) | 
 |         elif self._type == "compound": | 
 |             for item in self._item: | 
 |                 screen._delete(item) | 
 |         self._type = screen._shapes[shapeIndex]._type | 
 |         if self._type == "polygon": | 
 |             self._item = screen._createpoly() | 
 |         elif self._type == "image": | 
 |             self._item = screen._createimage(screen._shapes["blank"]._data) | 
 |         elif self._type == "compound": | 
 |             self._item = [screen._createpoly() for item in | 
 |                                           screen._shapes[shapeIndex]._data] | 
 |  | 
 |  | 
 | class RawTurtle(TPen, TNavigator): | 
 |     """Animation part of the RawTurtle. | 
 |     Puts RawTurtle upon a TurtleScreen and provides tools for | 
 |     its animation. | 
 |     """ | 
 |     screens = [] | 
 |  | 
 |     def __init__(self, canvas=None, | 
 |                  shape=_CFG["shape"], | 
 |                  undobuffersize=_CFG["undobuffersize"], | 
 |                  visible=_CFG["visible"]): | 
 |         if isinstance(canvas, _Screen): | 
 |             self.screen = canvas | 
 |         elif isinstance(canvas, TurtleScreen): | 
 |             if canvas not in RawTurtle.screens: | 
 |                 RawTurtle.screens.append(canvas) | 
 |             self.screen = canvas | 
 |         elif isinstance(canvas, (ScrolledCanvas, Canvas)): | 
 |             for screen in RawTurtle.screens: | 
 |                 if screen.cv == canvas: | 
 |                     self.screen = screen | 
 |                     break | 
 |             else: | 
 |                 self.screen = TurtleScreen(canvas) | 
 |                 RawTurtle.screens.append(self.screen) | 
 |         else: | 
 |             raise TurtleGraphicsError("bad cavas argument %s" % canvas) | 
 |  | 
 |         screen = self.screen | 
 |         TNavigator.__init__(self, screen.mode()) | 
 |         TPen.__init__(self) | 
 |         screen._turtles.append(self) | 
 |         self.drawingLineItem = screen._createline() | 
 |         self.turtle = _TurtleImage(screen, shape) | 
 |         self._poly = None | 
 |         self._creatingPoly = False | 
 |         self._fillitem = self._fillpath = None | 
 |         self._shown = visible | 
 |         self._hidden_from_screen = False | 
 |         self.currentLineItem = screen._createline() | 
 |         self.currentLine = [self._position] | 
 |         self.items = [self.currentLineItem] | 
 |         self.stampItems = [] | 
 |         self._undobuffersize = undobuffersize | 
 |         self.undobuffer = Tbuffer(undobuffersize) | 
 |         self._update() | 
 |  | 
 |     def reset(self): | 
 |         """Delete the turtle's drawings and restore its default values. | 
 |  | 
 |         No argument. | 
 | , | 
 |         Delete the turtle's drawings from the screen, re-center the turtle | 
 |         and set variables to the default values. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.position() | 
 |         (0.00,-22.00) | 
 |         >>> turtle.heading() | 
 |         100.0 | 
 |         >>> turtle.reset() | 
 |         >>> turtle.position() | 
 |         (0.00,0.00) | 
 |         >>> turtle.heading() | 
 |         0.0 | 
 |         """ | 
 |         TNavigator.reset(self) | 
 |         TPen._reset(self) | 
 |         self._clear() | 
 |         self._drawturtle() | 
 |         self._update() | 
 |  | 
 |     def setundobuffer(self, size): | 
 |         """Set or disable undobuffer. | 
 |  | 
 |         Argument: | 
 |         size -- an integer or None | 
 |  | 
 |         If size is an integer an empty undobuffer of given size is installed. | 
 |         Size gives the maximum number of turtle-actions that can be undone | 
 |         by the undo() function. | 
 |         If size is None, no undobuffer is present. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.setundobuffer(42) | 
 |         """ | 
 |         if size is None: | 
 |             self.undobuffer = None | 
 |         else: | 
 |             self.undobuffer = Tbuffer(size) | 
 |  | 
 |     def undobufferentries(self): | 
 |         """Return count of entries in the undobuffer. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> while undobufferentries(): | 
 |                 undo() | 
 |         """ | 
 |         if self.undobuffer is None: | 
 |             return 0 | 
 |         return self.undobuffer.nr_of_items() | 
 |  | 
 |     def _clear(self): | 
 |         """Delete all of pen's drawings""" | 
 |         self._fillitem = self._fillpath = None | 
 |         for item in self.items: | 
 |             self.screen._delete(item) | 
 |         self.currentLineItem = self.screen._createline() | 
 |         self.currentLine = [] | 
 |         if self._drawing: | 
 |             self.currentLine.append(self._position) | 
 |         self.items = [self.currentLineItem] | 
 |         self.clearstamps() | 
 |         self.setundobuffer(self._undobuffersize) | 
 |  | 
 |  | 
 |     def clear(self): | 
 |         """Delete the turtle's drawings from the screen. Do not move turtle. | 
 |  | 
 |         No arguments. | 
 |  | 
 |         Delete the turtle's drawings from the screen. Do not move turtle. | 
 |         State and position of the turtle as well as drawings of other | 
 |         turtles are not affected. | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.clear() | 
 |         """ | 
 |         self._clear() | 
 |         self._update() | 
 |  | 
 |     def _update_data(self): | 
 |         self.screen._incrementudc() | 
 |         if self.screen._updatecounter != 0: | 
 |             return | 
 |         if len(self.currentLine)>1: | 
 |             self.screen._drawline(self.currentLineItem, self.currentLine, | 
 |                                   self._pencolor, self._pensize) | 
 |  | 
 |     def _update(self): | 
 |         """Perform a Turtle-data update. | 
 |         """ | 
 |         screen = self.screen | 
 |         if screen._tracing == 0: | 
 |             return | 
 |         elif screen._tracing == 1: | 
 |             self._update_data() | 
 |             self._drawturtle() | 
 |             screen._update()                  # TurtleScreenBase | 
 |             screen._delay(screen._delayvalue) # TurtleScreenBase | 
 |         else: | 
 |             self._update_data() | 
 |             if screen._updatecounter == 0: | 
 |                 for t in screen.turtles(): | 
 |                     t._drawturtle() | 
 |                 screen._update() | 
 |  | 
 |     def _tracer(self, flag=None, delay=None): | 
 |         """Turns turtle animation on/off and set delay for update drawings. | 
 |  | 
 |         Optional arguments: | 
 |         n -- nonnegative  integer | 
 |         delay -- nonnegative  integer | 
 |  | 
 |         If n is given, only each n-th regular screen update is really performed. | 
 |         (Can be used to accelerate the drawing of complex graphics.) | 
 |         Second arguments sets delay value (see RawTurtle.delay()) | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.tracer(8, 25) | 
 |         >>> dist = 2 | 
 |         >>> for i in range(200): | 
 |                 turtle.fd(dist) | 
 |                 turtle.rt(90) | 
 |                 dist += 2 | 
 |         """ | 
 |         return self.screen.tracer(flag, delay) | 
 |  | 
 |     def _color(self, args): | 
 |         return self.screen._color(args) | 
 |  | 
 |     def _colorstr(self, args): | 
 |         return self.screen._colorstr(args) | 
 |  | 
 |     def _cc(self, args): | 
 |         """Convert colortriples to hexstrings. | 
 |         """ | 
 |         if isinstance(args, str): | 
 |             return args | 
 |         try: | 
 |             r, g, b = args | 
 |         except: | 
 |             raise TurtleGraphicsError("bad color arguments: %s" % str(args)) | 
 |         if self.screen._colormode == 1.0: | 
 |             r, g, b = [round(255.0*x) for x in (r, g, b)] | 
 |         if not ((0 <= r <= 255) and (0 <= g <= 255) and (0 <= b <= 255)): | 
 |             raise TurtleGraphicsError("bad color sequence: %s" % str(args)) | 
 |         return "#%02x%02x%02x" % (r, g, b) | 
 |  | 
 |     def clone(self): | 
 |         """Create and return a clone of the turtle. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Create and return a clone of the turtle with same position, heading | 
 |         and turtle properties. | 
 |  | 
 |         Example (for a Turtle instance named mick): | 
 |         mick = Turtle() | 
 |         joe = mick.clone() | 
 |         """ | 
 |         screen = self.screen | 
 |         self._newLine(self._drawing) | 
 |  | 
 |         turtle = self.turtle | 
 |         self.screen = None | 
 |         self.turtle = None  # too make self deepcopy-able | 
 |  | 
 |         q = deepcopy(self) | 
 |  | 
 |         self.screen = screen | 
 |         self.turtle = turtle | 
 |  | 
 |         q.screen = screen | 
 |         q.turtle = _TurtleImage(screen, self.turtle.shapeIndex) | 
 |  | 
 |         screen._turtles.append(q) | 
 |         ttype = screen._shapes[self.turtle.shapeIndex]._type | 
 |         if ttype == "polygon": | 
 |             q.turtle._item = screen._createpoly() | 
 |         elif ttype == "image": | 
 |             q.turtle._item = screen._createimage(screen._shapes["blank"]._data) | 
 |         elif ttype == "compound": | 
 |             q.turtle._item = [screen._createpoly() for item in | 
 |                               screen._shapes[self.turtle.shapeIndex]._data] | 
 |         q.currentLineItem = screen._createline() | 
 |         q._update() | 
 |         return q | 
 |  | 
 |     def shape(self, name=None): | 
 |         """Set turtle shape to shape with given name / return current shapename. | 
 |  | 
 |         Optional argument: | 
 |         name -- a string, which is a valid shapename | 
 |  | 
 |         Set turtle shape to shape with given name or, if name is not given, | 
 |         return name of current shape. | 
 |         Shape with name must exist in the TurtleScreen's shape dictionary. | 
 |         Initially there are the following polygon shapes: | 
 |         'arrow', 'turtle', 'circle', 'square', 'triangle', 'classic'. | 
 |         To learn about how to deal with shapes see Screen-method register_shape. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.shape() | 
 |         'arrow' | 
 |         >>> turtle.shape("turtle") | 
 |         >>> turtle.shape() | 
 |         'turtle' | 
 |         """ | 
 |         if name is None: | 
 |             return self.turtle.shapeIndex | 
 |         if not name in self.screen.getshapes(): | 
 |             raise TurtleGraphicsError("There is no shape named %s" % name) | 
 |         self.turtle._setshape(name) | 
 |         self._update() | 
 |  | 
 |     def shapesize(self, stretch_wid=None, stretch_len=None, outline=None): | 
 |         """Set/return turtle's stretchfactors/outline. Set resizemode to "user". | 
 |  | 
 |         Optinonal arguments: | 
 |            stretch_wid : positive number | 
 |            stretch_len : positive number | 
 |            outline  : positive number | 
 |  | 
 |         Return or set the pen's attributes x/y-stretchfactors and/or outline. | 
 |         Set resizemode to "user". | 
 |         If and only if resizemode is set to "user", the turtle will be displayed | 
 |         stretched according to its stretchfactors: | 
 |         stretch_wid is stretchfactor perpendicular to orientation | 
 |         stretch_len is stretchfactor in direction of turtles orientation. | 
 |         outline determines the width of the shapes's outline. | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.resizemode("user") | 
 |         >>> turtle.shapesize(5, 5, 12) | 
 |         >>> turtle.shapesize(outline=8) | 
 |         """ | 
 |         if stretch_wid is stretch_len is outline is None: | 
 |             stretch_wid, stretch_len = self._stretchfactor | 
 |             return stretch_wid, stretch_len, self._outlinewidth | 
 |         if stretch_wid == 0 or stretch_len == 0: | 
 |             raise TurtleGraphicsError("stretch_wid/stretch_len must not be zero") | 
 |         if stretch_wid is not None: | 
 |             if stretch_len is None: | 
 |                 stretchfactor = stretch_wid, stretch_wid | 
 |             else: | 
 |                 stretchfactor = stretch_wid, stretch_len | 
 |         elif stretch_len is not None: | 
 |             stretchfactor = self._stretchfactor[0], stretch_len | 
 |         else: | 
 |             stretchfactor = self._stretchfactor | 
 |         if outline is None: | 
 |             outline = self._outlinewidth | 
 |         self.pen(resizemode="user", | 
 |                  stretchfactor=stretchfactor, outline=outline) | 
 |  | 
 |     def shearfactor(self, shear=None): | 
 |         """Set or return the current shearfactor. | 
 |  | 
 |         Optional argument: shear -- number, tangent of the shear angle | 
 |  | 
 |         Shear the turtleshape according to the given shearfactor shear, | 
 |         which is the tangent of the shear angle. DO NOT change the | 
 |         turtle's heading (direction of movement). | 
 |         If shear is not given: return the current shearfactor, i. e. the | 
 |         tangent of the shear angle, by which lines parallel to the | 
 |         heading of the turtle are sheared. | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.shape("circle") | 
 |         >>> turtle.shapesize(5,2) | 
 |         >>> turtle.shearfactor(0.5) | 
 |         >>> turtle.shearfactor() | 
 |         >>> 0.5 | 
 |         """ | 
 |         if shear is None: | 
 |             return self._shearfactor | 
 |         self.pen(resizemode="user", shearfactor=shear) | 
 |  | 
 |     def settiltangle(self, angle): | 
 |         """Rotate the turtleshape to point in the specified direction | 
 |  | 
 |         Argument: angle -- number | 
 |  | 
 |         Rotate the turtleshape to point in the direction specified by angle, | 
 |         regardless of its current tilt-angle. DO NOT change the turtle's | 
 |         heading (direction of movement). | 
 |  | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.shape("circle") | 
 |         >>> turtle.shapesize(5,2) | 
 |         >>> turtle.settiltangle(45) | 
 |         >>> stamp() | 
 |         >>> turtle.fd(50) | 
 |         >>> turtle.settiltangle(-45) | 
 |         >>> stamp() | 
 |         >>> turtle.fd(50) | 
 |         """ | 
 |         tilt = -angle * self._degreesPerAU * self._angleOrient | 
 |         tilt = (tilt * math.pi / 180.0) % (2*math.pi) | 
 |         self.pen(resizemode="user", tilt=tilt) | 
 |  | 
 |     def tiltangle(self, angle=None): | 
 |         """Set or return the current tilt-angle. | 
 |  | 
 |         Optional argument: angle -- number | 
 |  | 
 |         Rotate the turtleshape to point in the direction specified by angle, | 
 |         regardless of its current tilt-angle. DO NOT change the turtle's | 
 |         heading (direction of movement). | 
 |         If angle is not given: return the current tilt-angle, i. e. the angle | 
 |         between the orientation of the turtleshape and the heading of the | 
 |         turtle (its direction of movement). | 
 |  | 
 |         Deprecated since Python 3.1 | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.shape("circle") | 
 |         >>> turtle.shapesize(5,2) | 
 |         >>> turtle.tilt(45) | 
 |         >>> turtle.tiltangle() | 
 |         >>> | 
 |         """ | 
 |         if angle is None: | 
 |             tilt = -self._tilt * (180.0/math.pi) * self._angleOrient | 
 |             return (tilt / self._degreesPerAU) % self._fullcircle | 
 |         else: | 
 |             self.settiltangle(angle) | 
 |  | 
 |     def tilt(self, angle): | 
 |         """Rotate the turtleshape by angle. | 
 |  | 
 |         Argument: | 
 |         angle - a number | 
 |  | 
 |         Rotate the turtleshape by angle from its current tilt-angle, | 
 |         but do NOT change the turtle's heading (direction of movement). | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.shape("circle") | 
 |         >>> turtle.shapesize(5,2) | 
 |         >>> turtle.tilt(30) | 
 |         >>> turtle.fd(50) | 
 |         >>> turtle.tilt(30) | 
 |         >>> turtle.fd(50) | 
 |         """ | 
 |         self.settiltangle(angle + self.tiltangle()) | 
 |  | 
 |     def shapetransform(self, t11=None, t12=None, t21=None, t22=None): | 
 |         """Set or return the current transformation matrix of the turtle shape. | 
 |  | 
 |         Optional arguments: t11, t12, t21, t22 -- numbers. | 
 |  | 
 |         If none of the matrix elements are given, return the transformation | 
 |         matrix. | 
 |         Otherwise set the given elements and transform the turtleshape | 
 |         according to the matrix consisting of first row t11, t12 and | 
 |         second row t21, 22. | 
 |         Modify stretchfactor, shearfactor and tiltangle according to the | 
 |         given matrix. | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.shape("square") | 
 |         >>> turtle.shapesize(4,2) | 
 |         >>> turtle.shearfactor(-0.5) | 
 |         >>> turtle.shapetransform() | 
 |         >>> (4.0, -1.0, -0.0, 2.0) | 
 |         """ | 
 |         if t11 is t12 is t21 is t22 is None: | 
 |             return self._shapetrafo | 
 |         m11, m12, m21, m22 = self._shapetrafo | 
 |         if t11 is not None: m11 = t11 | 
 |         if t12 is not None: m12 = t12 | 
 |         if t21 is not None: m21 = t21 | 
 |         if t22 is not None: m22 = t22 | 
 |         if t11 * t22 - t12 * t21 == 0: | 
 |             raise TurtleGraphicsError("Bad shape transform matrix: must not be singular") | 
 |         self._shapetrafo = (m11, m12, m21, m22) | 
 |         alfa = math.atan2(-m21, m11) % (2 * math.pi) | 
 |         sa, ca = math.sin(alfa), math.cos(alfa) | 
 |         a11, a12, a21, a22 = (ca*m11 - sa*m21, ca*m12 - sa*m22, | 
 |                               sa*m11 + ca*m21, sa*m12 + ca*m22) | 
 |         self._stretchfactor = a11, a22 | 
 |         self._shearfactor = a12/a22 | 
 |         self._tilt = alfa | 
 |         self._update() | 
 |  | 
 |  | 
 |     def _polytrafo(self, poly): | 
 |         """Computes transformed polygon shapes from a shape | 
 |         according to current position and heading. | 
 |         """ | 
 |         screen = self.screen | 
 |         p0, p1 = self._position | 
 |         e0, e1 = self._orient | 
 |         e = Vec2D(e0, e1 * screen.yscale / screen.xscale) | 
 |         e0, e1 = (1.0 / abs(e)) * e | 
 |         return [(p0+(e1*x+e0*y)/screen.xscale, p1+(-e0*x+e1*y)/screen.yscale) | 
 |                                                            for (x, y) in poly] | 
 |  | 
 |     def get_shapepoly(self): | 
 |         """Return the current shape polygon as tuple of coordinate pairs. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Examples (for a Turtle instance named turtle): | 
 |         >>> turtle.shape("square") | 
 |         >>> turtle.shapetransform(4, -1, 0, 2) | 
 |         >>> turtle.get_shapepoly() | 
 |         ((50, -20), (30, 20), (-50, 20), (-30, -20)) | 
 |  | 
 |         """ | 
 |         shape = self.screen._shapes[self.turtle.shapeIndex] | 
 |         if shape._type == "polygon": | 
 |             return self._getshapepoly(shape._data, shape._type == "compound") | 
 |         # else return None | 
 |  | 
 |     def _getshapepoly(self, polygon, compound=False): | 
 |         """Calculate transformed shape polygon according to resizemode | 
 |         and shapetransform. | 
 |         """ | 
 |         if self._resizemode == "user" or compound: | 
 |             t11, t12, t21, t22 = self._shapetrafo | 
 |         elif self._resizemode == "auto": | 
 |             l = max(1, self._pensize/5.0) | 
 |             t11, t12, t21, t22 = l, 0, 0, l | 
 |         elif self._resizemode == "noresize": | 
 |             return polygon | 
 |         return tuple([(t11*x + t12*y, t21*x + t22*y) for (x, y) in polygon]) | 
 |  | 
 |     def _drawturtle(self): | 
 |         """Manages the correct rendering of the turtle with respect to | 
 |         its shape, resizemode, stretch and tilt etc.""" | 
 |         screen = self.screen | 
 |         shape = screen._shapes[self.turtle.shapeIndex] | 
 |         ttype = shape._type | 
 |         titem = self.turtle._item | 
 |         if self._shown and screen._updatecounter == 0 and screen._tracing > 0: | 
 |             self._hidden_from_screen = False | 
 |             tshape = shape._data | 
 |             if ttype == "polygon": | 
 |                 if self._resizemode == "noresize": w = 1 | 
 |                 elif self._resizemode == "auto": w = self._pensize | 
 |                 else: w =self._outlinewidth | 
 |                 shape = self._polytrafo(self._getshapepoly(tshape)) | 
 |                 fc, oc = self._fillcolor, self._pencolor | 
 |                 screen._drawpoly(titem, shape, fill=fc, outline=oc, | 
 |                                                       width=w, top=True) | 
 |             elif ttype == "image": | 
 |                 screen._drawimage(titem, self._position, tshape) | 
 |             elif ttype == "compound": | 
 |                 for item, (poly, fc, oc) in zip(titem, tshape): | 
 |                     poly = self._polytrafo(self._getshapepoly(poly, True)) | 
 |                     screen._drawpoly(item, poly, fill=self._cc(fc), | 
 |                                      outline=self._cc(oc), width=self._outlinewidth, top=True) | 
 |         else: | 
 |             if self._hidden_from_screen: | 
 |                 return | 
 |             if ttype == "polygon": | 
 |                 screen._drawpoly(titem, ((0, 0), (0, 0), (0, 0)), "", "") | 
 |             elif ttype == "image": | 
 |                 screen._drawimage(titem, self._position, | 
 |                                           screen._shapes["blank"]._data) | 
 |             elif ttype == "compound": | 
 |                 for item in titem: | 
 |                     screen._drawpoly(item, ((0, 0), (0, 0), (0, 0)), "", "") | 
 |             self._hidden_from_screen = True | 
 |  | 
 | ##############################  stamp stuff  ############################### | 
 |  | 
 |     def stamp(self): | 
 |         """Stamp a copy of the turtleshape onto the canvas and return its id. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Stamp a copy of the turtle shape onto the canvas at the current | 
 |         turtle position. Return a stamp_id for that stamp, which can be | 
 |         used to delete it by calling clearstamp(stamp_id). | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.color("blue") | 
 |         >>> turtle.stamp() | 
 |         13 | 
 |         >>> turtle.fd(50) | 
 |         """ | 
 |         screen = self.screen | 
 |         shape = screen._shapes[self.turtle.shapeIndex] | 
 |         ttype = shape._type | 
 |         tshape = shape._data | 
 |         if ttype == "polygon": | 
 |             stitem = screen._createpoly() | 
 |             if self._resizemode == "noresize": w = 1 | 
 |             elif self._resizemode == "auto": w = self._pensize | 
 |             else: w =self._outlinewidth | 
 |             shape = self._polytrafo(self._getshapepoly(tshape)) | 
 |             fc, oc = self._fillcolor, self._pencolor | 
 |             screen._drawpoly(stitem, shape, fill=fc, outline=oc, | 
 |                                                   width=w, top=True) | 
 |         elif ttype == "image": | 
 |             stitem = screen._createimage("") | 
 |             screen._drawimage(stitem, self._position, tshape) | 
 |         elif ttype == "compound": | 
 |             stitem = [] | 
 |             for element in tshape: | 
 |                 item = screen._createpoly() | 
 |                 stitem.append(item) | 
 |             stitem = tuple(stitem) | 
 |             for item, (poly, fc, oc) in zip(stitem, tshape): | 
 |                 poly = self._polytrafo(self._getshapepoly(poly, True)) | 
 |                 screen._drawpoly(item, poly, fill=self._cc(fc), | 
 |                                  outline=self._cc(oc), width=self._outlinewidth, top=True) | 
 |         self.stampItems.append(stitem) | 
 |         self.undobuffer.push(("stamp", stitem)) | 
 |         return stitem | 
 |  | 
 |     def _clearstamp(self, stampid): | 
 |         """does the work for clearstamp() and clearstamps() | 
 |         """ | 
 |         if stampid in self.stampItems: | 
 |             if isinstance(stampid, tuple): | 
 |                 for subitem in stampid: | 
 |                     self.screen._delete(subitem) | 
 |             else: | 
 |                 self.screen._delete(stampid) | 
 |             self.stampItems.remove(stampid) | 
 |         # Delete stampitem from undobuffer if necessary | 
 |         # if clearstamp is called directly. | 
 |         item = ("stamp", stampid) | 
 |         buf = self.undobuffer | 
 |         if item not in buf.buffer: | 
 |             return | 
 |         index = buf.buffer.index(item) | 
 |         buf.buffer.remove(item) | 
 |         if index <= buf.ptr: | 
 |             buf.ptr = (buf.ptr - 1) % buf.bufsize | 
 |         buf.buffer.insert((buf.ptr+1)%buf.bufsize, [None]) | 
 |  | 
 |     def clearstamp(self, stampid): | 
 |         """Delete stamp with given stampid | 
 |  | 
 |         Argument: | 
 |         stampid - an integer, must be return value of previous stamp() call. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.color("blue") | 
 |         >>> astamp = turtle.stamp() | 
 |         >>> turtle.fd(50) | 
 |         >>> turtle.clearstamp(astamp) | 
 |         """ | 
 |         self._clearstamp(stampid) | 
 |         self._update() | 
 |  | 
 |     def clearstamps(self, n=None): | 
 |         """Delete all or first/last n of turtle's stamps. | 
 |  | 
 |         Optional argument: | 
 |         n -- an integer | 
 |  | 
 |         If n is None, delete all of pen's stamps, | 
 |         else if n > 0 delete first n stamps | 
 |         else if n < 0 delete last n stamps. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> for i in range(8): | 
 |                 turtle.stamp(); turtle.fd(30) | 
 |         ... | 
 |         >>> turtle.clearstamps(2) | 
 |         >>> turtle.clearstamps(-2) | 
 |         >>> turtle.clearstamps() | 
 |         """ | 
 |         if n is None: | 
 |             toDelete = self.stampItems[:] | 
 |         elif n >= 0: | 
 |             toDelete = self.stampItems[:n] | 
 |         else: | 
 |             toDelete = self.stampItems[n:] | 
 |         for item in toDelete: | 
 |             self._clearstamp(item) | 
 |         self._update() | 
 |  | 
 |     def _goto(self, end): | 
 |         """Move the pen to the point end, thereby drawing a line | 
 |         if pen is down. All other methodes for turtle movement depend | 
 |         on this one. | 
 |         """ | 
 |         ## Version with undo-stuff | 
 |         go_modes = ( self._drawing, | 
 |                      self._pencolor, | 
 |                      self._pensize, | 
 |                      isinstance(self._fillpath, list)) | 
 |         screen = self.screen | 
 |         undo_entry = ("go", self._position, end, go_modes, | 
 |                       (self.currentLineItem, | 
 |                       self.currentLine[:], | 
 |                       screen._pointlist(self.currentLineItem), | 
 |                       self.items[:]) | 
 |                       ) | 
 |         if self.undobuffer: | 
 |             self.undobuffer.push(undo_entry) | 
 |         start = self._position | 
 |         if self._speed and screen._tracing == 1: | 
 |             diff = (end-start) | 
 |             diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2 | 
 |             nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed)) | 
 |             delta = diff * (1.0/nhops) | 
 |             for n in range(1, nhops): | 
 |                 if n == 1: | 
 |                     top = True | 
 |                 else: | 
 |                     top = False | 
 |                 self._position = start + delta * n | 
 |                 if self._drawing: | 
 |                     screen._drawline(self.drawingLineItem, | 
 |                                      (start, self._position), | 
 |                                      self._pencolor, self._pensize, top) | 
 |                 self._update() | 
 |             if self._drawing: | 
 |                 screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)), | 
 |                                                fill="", width=self._pensize) | 
 |         # Turtle now at end, | 
 |         if self._drawing: # now update currentLine | 
 |             self.currentLine.append(end) | 
 |         if isinstance(self._fillpath, list): | 
 |             self._fillpath.append(end) | 
 |         ######    vererbung!!!!!!!!!!!!!!!!!!!!!! | 
 |         self._position = end | 
 |         if self._creatingPoly: | 
 |             self._poly.append(end) | 
 |         if len(self.currentLine) > 42: # 42! answer to the ultimate question | 
 |                                        # of life, the universe and everything | 
 |             self._newLine() | 
 |         self._update() #count=True) | 
 |  | 
 |     def _undogoto(self, entry): | 
 |         """Reverse a _goto. Used for undo() | 
 |         """ | 
 |         old, new, go_modes, coodata = entry | 
 |         drawing, pc, ps, filling = go_modes | 
 |         cLI, cL, pl, items = coodata | 
 |         screen = self.screen | 
 |         if abs(self._position - new) > 0.5: | 
 |             print ("undogoto: HALLO-DA-STIMMT-WAS-NICHT!") | 
 |         # restore former situation | 
 |         self.currentLineItem = cLI | 
 |         self.currentLine = cL | 
 |  | 
 |         if pl == [(0, 0), (0, 0)]: | 
 |             usepc = "" | 
 |         else: | 
 |             usepc = pc | 
 |         screen._drawline(cLI, pl, fill=usepc, width=ps) | 
 |  | 
 |         todelete = [i for i in self.items if (i not in items) and | 
 |                                        (screen._type(i) == "line")] | 
 |         for i in todelete: | 
 |             screen._delete(i) | 
 |             self.items.remove(i) | 
 |  | 
 |         start = old | 
 |         if self._speed and screen._tracing == 1: | 
 |             diff = old - new | 
 |             diffsq = (diff[0]*screen.xscale)**2 + (diff[1]*screen.yscale)**2 | 
 |             nhops = 1+int((diffsq**0.5)/(3*(1.1**self._speed)*self._speed)) | 
 |             delta = diff * (1.0/nhops) | 
 |             for n in range(1, nhops): | 
 |                 if n == 1: | 
 |                     top = True | 
 |                 else: | 
 |                     top = False | 
 |                 self._position = new + delta * n | 
 |                 if drawing: | 
 |                     screen._drawline(self.drawingLineItem, | 
 |                                      (start, self._position), | 
 |                                      pc, ps, top) | 
 |                 self._update() | 
 |             if drawing: | 
 |                 screen._drawline(self.drawingLineItem, ((0, 0), (0, 0)), | 
 |                                                fill="", width=ps) | 
 |         # Turtle now at position old, | 
 |         self._position = old | 
 |         ##  if undo is done during creating a polygon, the last vertex | 
 |         ##  will be deleted. if the polygon is entirely deleted, | 
 |         ##  creatingPoly will be set to False. | 
 |         ##  Polygons created before the last one will not be affected by undo() | 
 |         if self._creatingPoly: | 
 |             if len(self._poly) > 0: | 
 |                 self._poly.pop() | 
 |             if self._poly == []: | 
 |                 self._creatingPoly = False | 
 |                 self._poly = None | 
 |         if filling: | 
 |             if self._fillpath == []: | 
 |                 self._fillpath = None | 
 |                 print("Unwahrscheinlich in _undogoto!") | 
 |             elif self._fillpath is not None: | 
 |                 self._fillpath.pop() | 
 |         self._update() #count=True) | 
 |  | 
 |     def _rotate(self, angle): | 
 |         """Turns pen clockwise by angle. | 
 |         """ | 
 |         if self.undobuffer: | 
 |             self.undobuffer.push(("rot", angle, self._degreesPerAU)) | 
 |         angle *= self._degreesPerAU | 
 |         neworient = self._orient.rotate(angle) | 
 |         tracing = self.screen._tracing | 
 |         if tracing == 1 and self._speed > 0: | 
 |             anglevel = 3.0 * self._speed | 
 |             steps = 1 + int(abs(angle)/anglevel) | 
 |             delta = 1.0*angle/steps | 
 |             for _ in range(steps): | 
 |                 self._orient = self._orient.rotate(delta) | 
 |                 self._update() | 
 |         self._orient = neworient | 
 |         self._update() | 
 |  | 
 |     def _newLine(self, usePos=True): | 
 |         """Closes current line item and starts a new one. | 
 |            Remark: if current line became too long, animation | 
 |            performance (via _drawline) slowed down considerably. | 
 |         """ | 
 |         if len(self.currentLine) > 1: | 
 |             self.screen._drawline(self.currentLineItem, self.currentLine, | 
 |                                       self._pencolor, self._pensize) | 
 |             self.currentLineItem = self.screen._createline() | 
 |             self.items.append(self.currentLineItem) | 
 |         else: | 
 |             self.screen._drawline(self.currentLineItem, top=True) | 
 |         self.currentLine = [] | 
 |         if usePos: | 
 |             self.currentLine = [self._position] | 
 |  | 
 |     def filling(self): | 
 |         """Return fillstate (True if filling, False else). | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.begin_fill() | 
 |         >>> if turtle.filling(): | 
 |                 turtle.pensize(5) | 
 |         else: | 
 |                 turtle.pensize(3) | 
 |         """ | 
 |         return isinstance(self._fillpath, list) | 
 |  | 
 |     def begin_fill(self): | 
 |         """Called just before drawing a shape to be filled. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.color("black", "red") | 
 |         >>> turtle.begin_fill() | 
 |         >>> turtle.circle(60) | 
 |         >>> turtle.end_fill() | 
 |         """ | 
 |         if not self.filling(): | 
 |             self._fillitem = self.screen._createpoly() | 
 |             self.items.append(self._fillitem) | 
 |         self._fillpath = [self._position] | 
 |         self._newLine() | 
 |         if self.undobuffer: | 
 |             self.undobuffer.push(("beginfill", self._fillitem)) | 
 |         self._update() | 
 |  | 
 |  | 
 |     def end_fill(self): | 
 |         """Fill the shape drawn after the call begin_fill(). | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.color("black", "red") | 
 |         >>> turtle.begin_fill() | 
 |         >>> turtle.circle(60) | 
 |         >>> turtle.end_fill() | 
 |         """ | 
 |         if self.filling(): | 
 |             if len(self._fillpath) > 2: | 
 |                 self.screen._drawpoly(self._fillitem, self._fillpath, | 
 |                                       fill=self._fillcolor) | 
 |                 if self.undobuffer: | 
 |                     self.undobuffer.push(("dofill", self._fillitem)) | 
 |             self._fillitem = self._fillpath = None | 
 |             self._update() | 
 |  | 
 |     def dot(self, size=None, *color): | 
 |         """Draw a dot with diameter size, using color. | 
 |  | 
 |         Optional arguments: | 
 |         size -- an integer >= 1 (if given) | 
 |         color -- a colorstring or a numeric color tuple | 
 |  | 
 |         Draw a circular dot with diameter size, using color. | 
 |         If size is not given, the maximum of pensize+4 and 2*pensize is used. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.dot() | 
 |         >>> turtle.fd(50); turtle.dot(20, "blue"); turtle.fd(50) | 
 |         """ | 
 |         if not color: | 
 |             if isinstance(size, (str, tuple)): | 
 |                 color = self._colorstr(size) | 
 |                 size = self._pensize + max(self._pensize, 4) | 
 |             else: | 
 |                 color = self._pencolor | 
 |                 if not size: | 
 |                     size = self._pensize + max(self._pensize, 4) | 
 |         else: | 
 |             if size is None: | 
 |                 size = self._pensize + max(self._pensize, 4) | 
 |             color = self._colorstr(color) | 
 |         if hasattr(self.screen, "_dot"): | 
 |             item = self.screen._dot(self._position, size, color) | 
 |             self.items.append(item) | 
 |             if self.undobuffer: | 
 |                 self.undobuffer.push(("dot", item)) | 
 |         else: | 
 |             pen = self.pen() | 
 |             if self.undobuffer: | 
 |                 self.undobuffer.push(["seq"]) | 
 |                 self.undobuffer.cumulate = True | 
 |             try: | 
 |                 if self.resizemode() == 'auto': | 
 |                     self.ht() | 
 |                 self.pendown() | 
 |                 self.pensize(size) | 
 |                 self.pencolor(color) | 
 |                 self.forward(0) | 
 |             finally: | 
 |                 self.pen(pen) | 
 |             if self.undobuffer: | 
 |                 self.undobuffer.cumulate = False | 
 |  | 
 |     def _write(self, txt, align, font): | 
 |         """Performs the writing for write() | 
 |         """ | 
 |         item, end = self.screen._write(self._position, txt, align, font, | 
 |                                                           self._pencolor) | 
 |         self.items.append(item) | 
 |         if self.undobuffer: | 
 |             self.undobuffer.push(("wri", item)) | 
 |         return end | 
 |  | 
 |     def write(self, arg, move=False, align="left", font=("Arial", 8, "normal")): | 
 |         """Write text at the current turtle position. | 
 |  | 
 |         Arguments: | 
 |         arg -- info, which is to be written to the TurtleScreen | 
 |         move (optional) -- True/False | 
 |         align (optional) -- one of the strings "left", "center" or right" | 
 |         font (optional) -- a triple (fontname, fontsize, fonttype) | 
 |  | 
 |         Write text - the string representation of arg - at the current | 
 |         turtle position according to align ("left", "center" or right") | 
 |         and with the given font. | 
 |         If move is True, the pen is moved to the bottom-right corner | 
 |         of the text. By default, move is False. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.write('Home = ', True, align="center") | 
 |         >>> turtle.write((0,0), True) | 
 |         """ | 
 |         if self.undobuffer: | 
 |             self.undobuffer.push(["seq"]) | 
 |             self.undobuffer.cumulate = True | 
 |         end = self._write(str(arg), align.lower(), font) | 
 |         if move: | 
 |             x, y = self.pos() | 
 |             self.setpos(end, y) | 
 |         if self.undobuffer: | 
 |             self.undobuffer.cumulate = False | 
 |  | 
 |     def begin_poly(self): | 
 |         """Start recording the vertices of a polygon. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Start recording the vertices of a polygon. Current turtle position | 
 |         is first point of polygon. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.begin_poly() | 
 |         """ | 
 |         self._poly = [self._position] | 
 |         self._creatingPoly = True | 
 |  | 
 |     def end_poly(self): | 
 |         """Stop recording the vertices of a polygon. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Stop recording the vertices of a polygon. Current turtle position is | 
 |         last point of polygon. This will be connected with the first point. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.end_poly() | 
 |         """ | 
 |         self._creatingPoly = False | 
 |  | 
 |     def get_poly(self): | 
 |         """Return the lastly recorded polygon. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> p = turtle.get_poly() | 
 |         >>> turtle.register_shape("myFavouriteShape", p) | 
 |         """ | 
 |         ## check if there is any poly? | 
 |         if self._poly is not None: | 
 |             return tuple(self._poly) | 
 |  | 
 |     def getscreen(self): | 
 |         """Return the TurtleScreen object, the turtle is drawing  on. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Return the TurtleScreen object, the turtle is drawing  on. | 
 |         So TurtleScreen-methods can be called for that object. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> ts = turtle.getscreen() | 
 |         >>> ts | 
 |         <turtle.TurtleScreen object at 0x0106B770> | 
 |         >>> ts.bgcolor("pink") | 
 |         """ | 
 |         return self.screen | 
 |  | 
 |     def getturtle(self): | 
 |         """Return the Turtleobject itself. | 
 |  | 
 |         No argument. | 
 |  | 
 |         Only reasonable use: as a function to return the 'anonymous turtle': | 
 |  | 
 |         Example: | 
 |         >>> pet = getturtle() | 
 |         >>> pet.fd(50) | 
 |         >>> pet | 
 |         <turtle.Turtle object at 0x0187D810> | 
 |         >>> turtles() | 
 |         [<turtle.Turtle object at 0x0187D810>] | 
 |         """ | 
 |         return self | 
 |  | 
 |     getpen = getturtle | 
 |  | 
 |  | 
 |     ################################################################ | 
 |     ### screen oriented methods recurring to methods of TurtleScreen | 
 |     ################################################################ | 
 |  | 
 |     def _delay(self, delay=None): | 
 |         """Set delay value which determines speed of turtle animation. | 
 |         """ | 
 |         return self.screen.delay(delay) | 
 |  | 
 |     def onclick(self, fun, btn=1, add=None): | 
 |         """Bind fun to mouse-click event on this turtle on canvas. | 
 |  | 
 |         Arguments: | 
 |         fun --  a function with two arguments, to which will be assigned | 
 |                 the coordinates of the clicked point on the canvas. | 
 |         num --  number of the mouse-button defaults to 1 (left mouse button). | 
 |         add --  True or False. If True, new binding will be added, otherwise | 
 |                 it will replace a former binding. | 
 |  | 
 |         Example for the anonymous turtle, i. e. the procedural way: | 
 |  | 
 |         >>> def turn(x, y): | 
 |                 left(360) | 
 |  | 
 |         >>> onclick(turn) # Now clicking into the turtle will turn it. | 
 |         >>> onclick(None)  # event-binding will be removed | 
 |         """ | 
 |         self.screen._onclick(self.turtle._item, fun, btn, add) | 
 |         self._update() | 
 |  | 
 |     def onrelease(self, fun, btn=1, add=None): | 
 |         """Bind fun to mouse-button-release event on this turtle on canvas. | 
 |  | 
 |         Arguments: | 
 |         fun -- a function with two arguments, to which will be assigned | 
 |                 the coordinates of the clicked point on the canvas. | 
 |         num --  number of the mouse-button defaults to 1 (left mouse button). | 
 |  | 
 |         Example (for a MyTurtle instance named joe): | 
 |         >>> class MyTurtle(Turtle): | 
 |                 def glow(self,x,y): | 
 |                         self.fillcolor("red") | 
 |                 def unglow(self,x,y): | 
 |                         self.fillcolor("") | 
 |  | 
 |         >>> joe = MyTurtle() | 
 |         >>> joe.onclick(joe.glow) | 
 |         >>> joe.onrelease(joe.unglow) | 
 |         ### clicking on joe turns fillcolor red, | 
 |         ### unclicking turns it to transparent. | 
 |         """ | 
 |         self.screen._onrelease(self.turtle._item, fun, btn, add) | 
 |         self._update() | 
 |  | 
 |     def ondrag(self, fun, btn=1, add=None): | 
 |         """Bind fun to mouse-move event on this turtle on canvas. | 
 |  | 
 |         Arguments: | 
 |         fun -- a function with two arguments, to which will be assigned | 
 |                the coordinates of the clicked point on the canvas. | 
 |         num -- number of the mouse-button defaults to 1 (left mouse button). | 
 |  | 
 |         Every sequence of mouse-move-events on a turtle is preceded by a | 
 |         mouse-click event on that turtle. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> turtle.ondrag(turtle.goto) | 
 |  | 
 |         ### Subsequently clicking and dragging a Turtle will | 
 |         ### move it across the screen thereby producing handdrawings | 
 |         ### (if pen is down). | 
 |         """ | 
 |         self.screen._ondrag(self.turtle._item, fun, btn, add) | 
 |  | 
 |  | 
 |     def _undo(self, action, data): | 
 |         """Does the main part of the work for undo() | 
 |         """ | 
 |         if self.undobuffer is None: | 
 |             return | 
 |         if action == "rot": | 
 |             angle, degPAU = data | 
 |             self._rotate(-angle*degPAU/self._degreesPerAU) | 
 |             dummy = self.undobuffer.pop() | 
 |         elif action == "stamp": | 
 |             stitem = data[0] | 
 |             self.clearstamp(stitem) | 
 |         elif action == "go": | 
 |             self._undogoto(data) | 
 |         elif action in ["wri", "dot"]: | 
 |             item = data[0] | 
 |             self.screen._delete(item) | 
 |             self.items.remove(item) | 
 |         elif action == "dofill": | 
 |             item = data[0] | 
 |             self.screen._drawpoly(item, ((0, 0),(0, 0),(0, 0)), | 
 |                                   fill="", outline="") | 
 |         elif action == "beginfill": | 
 |             item = data[0] | 
 |             self._fillitem = self._fillpath = None | 
 |             if item in self.items: | 
 |                 self.screen._delete(item) | 
 |                 self.items.remove(item) | 
 |         elif action == "pen": | 
 |             TPen.pen(self, data[0]) | 
 |             self.undobuffer.pop() | 
 |  | 
 |     def undo(self): | 
 |         """undo (repeatedly) the last turtle action. | 
 |  | 
 |         No argument. | 
 |  | 
 |         undo (repeatedly) the last turtle action. | 
 |         Number of available undo actions is determined by the size of | 
 |         the undobuffer. | 
 |  | 
 |         Example (for a Turtle instance named turtle): | 
 |         >>> for i in range(4): | 
 |                 turtle.fd(50); turtle.lt(80) | 
 |  | 
 |         >>> for i in range(8): | 
 |                 turtle.undo() | 
 |         """ | 
 |         if self.undobuffer is None: | 
 |             return | 
 |         item = self.undobuffer.pop() | 
 |         action = item[0] | 
 |         data = item[1:] | 
 |         if action == "seq": | 
 |             while data: | 
 |                 item = data.pop() | 
 |                 self._undo(item[0], item[1:]) | 
 |         else: | 
 |             self._undo(action, data) | 
 |  | 
 |     turtlesize = shapesize | 
 |  | 
 | RawPen = RawTurtle | 
 |  | 
 | ###  Screen - Singleton  ######################## | 
 |  | 
 | def Screen(): | 
 |     """Return the singleton screen object. | 
 |     If none exists at the moment, create a new one and return it, | 
 |     else return the existing one.""" | 
 |     if Turtle._screen is None: | 
 |         Turtle._screen = _Screen() | 
 |     return Turtle._screen | 
 |  | 
 | class _Screen(TurtleScreen): | 
 |  | 
 |     _root = None | 
 |     _canvas = None | 
 |     _title = _CFG["title"] | 
 |  | 
 |     def __init__(self): | 
 |         # XXX there is no need for this code to be conditional, | 
 |         # as there will be only a single _Screen instance, anyway | 
 |         # XXX actually, the turtle demo is injecting root window, | 
 |         # so perhaps the conditional creation of a root should be | 
 |         # preserved (perhaps by passing it as an optional parameter) | 
 |         if _Screen._root is None: | 
 |             _Screen._root = self._root = _Root() | 
 |             self._root.title(_Screen._title) | 
 |             self._root.ondestroy(self._destroy) | 
 |         if _Screen._canvas is None: | 
 |             width = _CFG["width"] | 
 |             height = _CFG["height"] | 
 |             canvwidth = _CFG["canvwidth"] | 
 |             canvheight = _CFG["canvheight"] | 
 |             leftright = _CFG["leftright"] | 
 |             topbottom = _CFG["topbottom"] | 
 |             self._root.setupcanvas(width, height, canvwidth, canvheight) | 
 |             _Screen._canvas = self._root._getcanvas() | 
 |             TurtleScreen.__init__(self, _Screen._canvas) | 
 |             self.setup(width, height, leftright, topbottom) | 
 |  | 
 |     def setup(self, width=_CFG["width"], height=_CFG["height"], | 
 |               startx=_CFG["leftright"], starty=_CFG["topbottom"]): | 
 |         """ Set the size and position of the main window. | 
 |  | 
 |         Arguments: | 
 |         width: as integer a size in pixels, as float a fraction of the screen. | 
 |           Default is 50% of screen. | 
 |         height: as integer the height in pixels, as float a fraction of the | 
 |           screen. Default is 75% of screen. | 
 |         startx: if positive, starting position in pixels from the left | 
 |           edge of the screen, if negative from the right edge | 
 |           Default, startx=None is to center window horizontally. | 
 |         starty: if positive, starting position in pixels from the top | 
 |           edge of the screen, if negative from the bottom edge | 
 |           Default, starty=None is to center window vertically. | 
 |  | 
 |         Examples (for a Screen instance named screen): | 
 |         >>> screen.setup (width=200, height=200, startx=0, starty=0) | 
 |  | 
 |         sets window to 200x200 pixels, in upper left of screen | 
 |  | 
 |         >>> screen.setup(width=.75, height=0.5, startx=None, starty=None) | 
 |  | 
 |         sets window to 75% of screen by 50% of screen and centers | 
 |         """ | 
 |         if not hasattr(self._root, "set_geometry"): | 
 |             return | 
 |         sw = self._root.win_width() | 
 |         sh = self._root.win_height() | 
 |         if isinstance(width, float) and 0 <= width <= 1: | 
 |             width = sw*width | 
 |         if startx is None: | 
 |             startx = (sw - width) / 2 | 
 |         if isinstance(height, float) and 0 <= height <= 1: | 
 |             height = sh*height | 
 |         if starty is None: | 
 |             starty = (sh - height) / 2 | 
 |         self._root.set_geometry(width, height, startx, starty) | 
 |         self.update() | 
 |  | 
 |     def title(self, titlestring): | 
 |         """Set title of turtle-window | 
 |  | 
 |         Argument: | 
 |         titlestring -- a string, to appear in the titlebar of the | 
 |                        turtle graphics window. | 
 |  | 
 |         This is a method of Screen-class. Not available for TurtleScreen- | 
 |         objects. | 
 |  | 
 |         Example (for a Screen instance named screen): | 
 |         >>> screen.title("Welcome to the turtle-zoo!") | 
 |         """ | 
 |         if _Screen._root is not None: | 
 |             _Screen._root.title(titlestring) | 
 |         _Screen._title = titlestring | 
 |  | 
 |     def _destroy(self): | 
 |         root = self._root | 
 |         if root is _Screen._root: | 
 |             Turtle._pen = None | 
 |             Turtle._screen = None | 
 |             _Screen._root = None | 
 |             _Screen._canvas = None | 
 |         TurtleScreen._RUNNING = True | 
 |         root.destroy() | 
 |  | 
 |     def bye(self): | 
 |         """Shut the turtlegraphics window. | 
 |  | 
 |         Example (for a TurtleScreen instance named screen): | 
 |         >>> screen.bye() | 
 |         """ | 
 |         self._destroy() | 
 |  | 
 |     def exitonclick(self): | 
 |         """Go into mainloop until the mouse is clicked. | 
 |  | 
 |         No arguments. | 
 |  | 
 |         Bind bye() method to mouseclick on TurtleScreen. | 
 |         If "using_IDLE" - value in configuration dictionary is False | 
 |         (default value), enter mainloop. | 
 |         If IDLE with -n switch (no subprocess) is used, this value should be | 
 |         set to True in turtle.cfg. In this case IDLE's mainloop | 
 |         is active also for the client script. | 
 |  | 
 |         This is a method of the Screen-class and not available for | 
 |         TurtleScreen instances. | 
 |  | 
 |         Example (for a Screen instance named screen): | 
 |         >>> screen.exitonclick() | 
 |  | 
 |         """ | 
 |         def exitGracefully(x, y): | 
 |             """Screen.bye() with two dummy-parameters""" | 
 |             self.bye() | 
 |         self.onclick(exitGracefully) | 
 |         if _CFG["using_IDLE"]: | 
 |             return | 
 |         try: | 
 |             mainloop() | 
 |         except AttributeError: | 
 |             exit(0) | 
 |  | 
 |  | 
 | class Turtle(RawTurtle): | 
 |     """RawTurtle auto-creating (scrolled) canvas. | 
 |  | 
 |     When a Turtle object is created or a function derived from some | 
 |     Turtle method is called a TurtleScreen object is automatically created. | 
 |     """ | 
 |     _pen = None | 
 |     _screen = None | 
 |  | 
 |     def __init__(self, | 
 |                  shape=_CFG["shape"], | 
 |                  undobuffersize=_CFG["undobuffersize"], | 
 |                  visible=_CFG["visible"]): | 
 |         if Turtle._screen is None: | 
 |             Turtle._screen = Screen() | 
 |         RawTurtle.__init__(self, Turtle._screen, | 
 |                            shape=shape, | 
 |                            undobuffersize=undobuffersize, | 
 |                            visible=visible) | 
 |  | 
 | Pen = Turtle | 
 |  | 
 | def _getpen(): | 
 |     """Create the 'anonymous' turtle if not already present.""" | 
 |     if Turtle._pen is None: | 
 |         Turtle._pen = Turtle() | 
 |     return Turtle._pen | 
 |  | 
 | def _getscreen(): | 
 |     """Create a TurtleScreen if not already present.""" | 
 |     if Turtle._screen is None: | 
 |         Turtle._screen = Screen() | 
 |     return Turtle._screen | 
 |  | 
 | def write_docstringdict(filename="turtle_docstringdict"): | 
 |     """Create and write docstring-dictionary to file. | 
 |  | 
 |     Optional argument: | 
 |     filename -- a string, used as filename | 
 |                 default value is turtle_docstringdict | 
 |  | 
 |     Has to be called explicitly, (not used by the turtle-graphics classes) | 
 |     The docstring dictionary will be written to the Python script <filname>.py | 
 |     It is intended to serve as a template for translation of the docstrings | 
 |     into different languages. | 
 |     """ | 
 |     docsdict = {} | 
 |  | 
 |     for methodname in _tg_screen_functions: | 
 |         key = "_Screen."+methodname | 
 |         docsdict[key] = eval(key).__doc__ | 
 |     for methodname in _tg_turtle_functions: | 
 |         key = "Turtle."+methodname | 
 |         docsdict[key] = eval(key).__doc__ | 
 |  | 
 |     f = open("%s.py" % filename,"w") | 
 |     keys = sorted([x for x in docsdict.keys() | 
 |                         if x.split('.')[1] not in _alias_list]) | 
 |     f.write('docsdict = {\n\n') | 
 |     for key in keys[:-1]: | 
 |         f.write('%s :\n' % repr(key)) | 
 |         f.write('        """%s\n""",\n\n' % docsdict[key]) | 
 |     key = keys[-1] | 
 |     f.write('%s :\n' % repr(key)) | 
 |     f.write('        """%s\n"""\n\n' % docsdict[key]) | 
 |     f.write("}\n") | 
 |     f.close() | 
 |  | 
 | def read_docstrings(lang): | 
 |     """Read in docstrings from lang-specific docstring dictionary. | 
 |  | 
 |     Transfer docstrings, translated to lang, from a dictionary-file | 
 |     to the methods of classes Screen and Turtle and - in revised form - | 
 |     to the corresponding functions. | 
 |     """ | 
 |     modname = "turtle_docstringdict_%(language)s" % {'language':lang.lower()} | 
 |     module = __import__(modname) | 
 |     docsdict = module.docsdict | 
 |     for key in docsdict: | 
 |         try: | 
 | #            eval(key).im_func.__doc__ = docsdict[key] | 
 |             eval(key).__doc__ = docsdict[key] | 
 |         except: | 
 |             print("Bad docstring-entry: %s" % key) | 
 |  | 
 | _LANGUAGE = _CFG["language"] | 
 |  | 
 | try: | 
 |     if _LANGUAGE != "english": | 
 |         read_docstrings(_LANGUAGE) | 
 | except ImportError: | 
 |     print("Cannot find docsdict for", _LANGUAGE) | 
 | except: | 
 |     print ("Unknown Error when trying to import %s-docstring-dictionary" % | 
 |                                                                   _LANGUAGE) | 
 |  | 
 |  | 
 | def getmethparlist(ob): | 
 |     """Get strings describing the arguments for the given object | 
 |  | 
 |     Returns a pair of strings representing function parameter lists | 
 |     including parenthesis.  The first string is suitable for use in | 
 |     function definition and the second is suitable for use in function | 
 |     call.  The "self" parameter is not included. | 
 |     """ | 
 |     defText = callText = "" | 
 |     # bit of a hack for methods - turn it into a function | 
 |     # but we drop the "self" param. | 
 |     # Try and build one for Python defined functions | 
 |     args, varargs, varkw = inspect.getargs(ob.__code__) | 
 |     items2 = args[1:] | 
 |     realArgs = args[1:] | 
 |     defaults = ob.__defaults__ or [] | 
 |     defaults = ["=%r" % (value,) for value in defaults] | 
 |     defaults = [""] * (len(realArgs)-len(defaults)) + defaults | 
 |     items1 = [arg + dflt for arg, dflt in zip(realArgs, defaults)] | 
 |     if varargs is not None: | 
 |         items1.append("*" + varargs) | 
 |         items2.append("*" + varargs) | 
 |     if varkw is not None: | 
 |         items1.append("**" + varkw) | 
 |         items2.append("**" + varkw) | 
 |     defText = ", ".join(items1) | 
 |     defText = "(%s)" % defText | 
 |     callText = ", ".join(items2) | 
 |     callText = "(%s)" % callText | 
 |     return defText, callText | 
 |  | 
 | def _turtle_docrevise(docstr): | 
 |     """To reduce docstrings from RawTurtle class for functions | 
 |     """ | 
 |     import re | 
 |     if docstr is None: | 
 |         return None | 
 |     turtlename = _CFG["exampleturtle"] | 
 |     newdocstr = docstr.replace("%s." % turtlename,"") | 
 |     parexp = re.compile(r' \(.+ %s\):' % turtlename) | 
 |     newdocstr = parexp.sub(":", newdocstr) | 
 |     return newdocstr | 
 |  | 
 | def _screen_docrevise(docstr): | 
 |     """To reduce docstrings from TurtleScreen class for functions | 
 |     """ | 
 |     import re | 
 |     if docstr is None: | 
 |         return None | 
 |     screenname = _CFG["examplescreen"] | 
 |     newdocstr = docstr.replace("%s." % screenname,"") | 
 |     parexp = re.compile(r' \(.+ %s\):' % screenname) | 
 |     newdocstr = parexp.sub(":", newdocstr) | 
 |     return newdocstr | 
 |  | 
 | ## The following mechanism makes all methods of RawTurtle and Turtle available | 
 | ## as functions. So we can enhance, change, add, delete methods to these | 
 | ## classes and do not need to change anything here. | 
 |  | 
 |  | 
 | for methodname in _tg_screen_functions: | 
 |     pl1, pl2 = getmethparlist(eval('_Screen.' + methodname)) | 
 |     if pl1 == "": | 
 |         print(">>>>>>", pl1, pl2) | 
 |         continue | 
 |     defstr = ("def %(key)s%(pl1)s: return _getscreen().%(key)s%(pl2)s" % | 
 |                                    {'key':methodname, 'pl1':pl1, 'pl2':pl2}) | 
 |     exec(defstr) | 
 |     eval(methodname).__doc__ = _screen_docrevise(eval('_Screen.'+methodname).__doc__) | 
 |  | 
 | for methodname in _tg_turtle_functions: | 
 |     pl1, pl2 = getmethparlist(eval('Turtle.' + methodname)) | 
 |     if pl1 == "": | 
 |         print(">>>>>>", pl1, pl2) | 
 |         continue | 
 |     defstr = ("def %(key)s%(pl1)s: return _getpen().%(key)s%(pl2)s" % | 
 |                                    {'key':methodname, 'pl1':pl1, 'pl2':pl2}) | 
 |     exec(defstr) | 
 |     eval(methodname).__doc__ = _turtle_docrevise(eval('Turtle.'+methodname).__doc__) | 
 |  | 
 |  | 
 | done = mainloop | 
 |  | 
 | if __name__ == "__main__": | 
 |     def switchpen(): | 
 |         if isdown(): | 
 |             pu() | 
 |         else: | 
 |             pd() | 
 |  | 
 |     def demo1(): | 
 |         """Demo of old turtle.py - module""" | 
 |         reset() | 
 |         tracer(True) | 
 |         up() | 
 |         backward(100) | 
 |         down() | 
 |         # draw 3 squares; the last filled | 
 |         width(3) | 
 |         for i in range(3): | 
 |             if i == 2: | 
 |                 begin_fill() | 
 |             for _ in range(4): | 
 |                 forward(20) | 
 |                 left(90) | 
 |             if i == 2: | 
 |                 color("maroon") | 
 |                 end_fill() | 
 |             up() | 
 |             forward(30) | 
 |             down() | 
 |         width(1) | 
 |         color("black") | 
 |         # move out of the way | 
 |         tracer(False) | 
 |         up() | 
 |         right(90) | 
 |         forward(100) | 
 |         right(90) | 
 |         forward(100) | 
 |         right(180) | 
 |         down() | 
 |         # some text | 
 |         write("startstart", 1) | 
 |         write("start", 1) | 
 |         color("red") | 
 |         # staircase | 
 |         for i in range(5): | 
 |             forward(20) | 
 |             left(90) | 
 |             forward(20) | 
 |             right(90) | 
 |         # filled staircase | 
 |         tracer(True) | 
 |         begin_fill() | 
 |         for i in range(5): | 
 |             forward(20) | 
 |             left(90) | 
 |             forward(20) | 
 |             right(90) | 
 |         end_fill() | 
 |         # more text | 
 |  | 
 |     def demo2(): | 
 |         """Demo of some new features.""" | 
 |         speed(1) | 
 |         st() | 
 |         pensize(3) | 
 |         setheading(towards(0, 0)) | 
 |         radius = distance(0, 0)/2.0 | 
 |         rt(90) | 
 |         for _ in range(18): | 
 |             switchpen() | 
 |             circle(radius, 10) | 
 |         write("wait a moment...") | 
 |         while undobufferentries(): | 
 |             undo() | 
 |         reset() | 
 |         lt(90) | 
 |         colormode(255) | 
 |         laenge = 10 | 
 |         pencolor("green") | 
 |         pensize(3) | 
 |         lt(180) | 
 |         for i in range(-2, 16): | 
 |             if i > 0: | 
 |                 begin_fill() | 
 |                 fillcolor(255-15*i, 0, 15*i) | 
 |             for _ in range(3): | 
 |                 fd(laenge) | 
 |                 lt(120) | 
 |             end_fill() | 
 |             laenge += 10 | 
 |             lt(15) | 
 |             speed((speed()+1)%12) | 
 |         #end_fill() | 
 |  | 
 |         lt(120) | 
 |         pu() | 
 |         fd(70) | 
 |         rt(30) | 
 |         pd() | 
 |         color("red","yellow") | 
 |         speed(0) | 
 |         begin_fill() | 
 |         for _ in range(4): | 
 |             circle(50, 90) | 
 |             rt(90) | 
 |             fd(30) | 
 |             rt(90) | 
 |         end_fill() | 
 |         lt(90) | 
 |         pu() | 
 |         fd(30) | 
 |         pd() | 
 |         shape("turtle") | 
 |  | 
 |         tri = getturtle() | 
 |         tri.resizemode("auto") | 
 |         turtle = Turtle() | 
 |         turtle.resizemode("auto") | 
 |         turtle.shape("turtle") | 
 |         turtle.reset() | 
 |         turtle.left(90) | 
 |         turtle.speed(0) | 
 |         turtle.up() | 
 |         turtle.goto(280, 40) | 
 |         turtle.lt(30) | 
 |         turtle.down() | 
 |         turtle.speed(6) | 
 |         turtle.color("blue","orange") | 
 |         turtle.pensize(2) | 
 |         tri.speed(6) | 
 |         setheading(towards(turtle)) | 
 |         count = 1 | 
 |         while tri.distance(turtle) > 4: | 
 |             turtle.fd(3.5) | 
 |             turtle.lt(0.6) | 
 |             tri.setheading(tri.towards(turtle)) | 
 |             tri.fd(4) | 
 |             if count % 20 == 0: | 
 |                 turtle.stamp() | 
 |                 tri.stamp() | 
 |                 switchpen() | 
 |             count += 1 | 
 |         tri.write("CAUGHT! ", font=("Arial", 16, "bold"), align="right") | 
 |         tri.pencolor("black") | 
 |         tri.pencolor("red") | 
 |  | 
 |         def baba(xdummy, ydummy): | 
 |             clearscreen() | 
 |             bye() | 
 |  | 
 |         time.sleep(2) | 
 |  | 
 |         while undobufferentries(): | 
 |             tri.undo() | 
 |             turtle.undo() | 
 |         tri.fd(50) | 
 |         tri.write("  Click me!", font = ("Courier", 12, "bold") ) | 
 |         tri.onclick(baba, 1) | 
 |  | 
 |     demo1() | 
 |     demo2() | 
 |     exitonclick() |