Merge "AudioService: modify logic for independent a11y volume"
diff --git a/api/current.txt b/api/current.txt
index b9cd7d0..cc8e709 100644
--- a/api/current.txt
+++ b/api/current.txt
@@ -989,6 +989,7 @@
     field public static final int preferenceStyle = 16842894; // 0x101008e
     field public static final int presentationTheme = 16843712; // 0x10103c0
     field public static final int previewImage = 16843482; // 0x10102da
+    field public static final int primaryContentAlpha = 16843367; // 0x1010267
     field public static final int priority = 16842780; // 0x101001c
     field public static final int privateImeOptions = 16843299; // 0x1010223
     field public static final int process = 16842769; // 0x1010011
@@ -4591,6 +4592,7 @@
 
   public abstract class FragmentContainer {
     ctor public FragmentContainer();
+    method public android.app.Fragment instantiate(android.content.Context, java.lang.String, android.os.Bundle);
     method public abstract android.view.View onFindViewById(int);
     method public abstract boolean onHasView();
   }
@@ -5025,6 +5027,7 @@
     field public static final int DEFAULT_LIGHTS = 4; // 0x4
     field public static final int DEFAULT_SOUND = 1; // 0x1
     field public static final int DEFAULT_VIBRATE = 2; // 0x2
+    field public static final java.lang.String EXTRA_AUDIO_CONTENTS_URI = "android.audioContents";
     field public static final java.lang.String EXTRA_BACKGROUND_IMAGE_URI = "android.backgroundImageUri";
     field public static final java.lang.String EXTRA_BIG_TEXT = "android.bigText";
     field public static final java.lang.String EXTRA_CHRONOMETER_COUNT_DOWN = "android.chronometerCountDown";
@@ -5108,6 +5111,7 @@
     method public android.app.Notification.Action clone();
     method public int describeContents();
     method public boolean getAllowGeneratedReplies();
+    method public android.app.RemoteInput[] getDataOnlyRemoteInputs();
     method public android.os.Bundle getExtras();
     method public android.graphics.drawable.Icon getIcon();
     method public android.app.RemoteInput[] getRemoteInputs();
@@ -5573,14 +5577,18 @@
   }
 
   public final class RemoteInput implements android.os.Parcelable {
+    method public static void addDataResultToIntent(android.app.RemoteInput, android.content.Intent, java.util.Map<java.lang.String, android.net.Uri>);
     method public static void addResultsToIntent(android.app.RemoteInput[], android.content.Intent, android.os.Bundle);
     method public int describeContents();
     method public boolean getAllowFreeFormInput();
+    method public java.util.Set<java.lang.String> getAllowedDataTypes();
     method public java.lang.CharSequence[] getChoices();
+    method public static java.util.Map<java.lang.String, android.net.Uri> getDataResultsFromIntent(android.content.Intent, java.lang.String);
     method public android.os.Bundle getExtras();
     method public java.lang.CharSequence getLabel();
     method public java.lang.String getResultKey();
     method public static android.os.Bundle getResultsFromIntent(android.content.Intent);
+    method public boolean isDataOnly();
     method public void writeToParcel(android.os.Parcel, int);
     field public static final android.os.Parcelable.Creator<android.app.RemoteInput> CREATOR;
     field public static final java.lang.String EXTRA_RESULTS_DATA = "android.remoteinput.resultsData";
@@ -5592,6 +5600,7 @@
     method public android.app.RemoteInput.Builder addExtras(android.os.Bundle);
     method public android.app.RemoteInput build();
     method public android.os.Bundle getExtras();
+    method public android.app.RemoteInput.Builder setAllowDataType(java.lang.String, boolean);
     method public android.app.RemoteInput.Builder setAllowFreeFormInput(boolean);
     method public android.app.RemoteInput.Builder setChoices(java.lang.CharSequence[]);
     method public android.app.RemoteInput.Builder setLabel(java.lang.CharSequence);
@@ -8999,10 +9008,10 @@
     field public static final java.lang.String EXTRA_RESTRICTIONS_LIST = "android.intent.extra.restrictions_list";
     field public static final java.lang.String EXTRA_RESULT_RECEIVER = "android.intent.extra.RESULT_RECEIVER";
     field public static final java.lang.String EXTRA_RETURN_RESULT = "android.intent.extra.RETURN_RESULT";
-    field public static final java.lang.String EXTRA_SHORTCUT_ICON = "android.intent.extra.shortcut.ICON";
-    field public static final java.lang.String EXTRA_SHORTCUT_ICON_RESOURCE = "android.intent.extra.shortcut.ICON_RESOURCE";
-    field public static final java.lang.String EXTRA_SHORTCUT_INTENT = "android.intent.extra.shortcut.INTENT";
-    field public static final java.lang.String EXTRA_SHORTCUT_NAME = "android.intent.extra.shortcut.NAME";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_ICON = "android.intent.extra.shortcut.ICON";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_ICON_RESOURCE = "android.intent.extra.shortcut.ICON_RESOURCE";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_INTENT = "android.intent.extra.shortcut.INTENT";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_NAME = "android.intent.extra.shortcut.NAME";
     field public static final java.lang.String EXTRA_SHUTDOWN_USERSPACE_ONLY = "android.intent.extra.SHUTDOWN_USERSPACE_ONLY";
     field public static final java.lang.String EXTRA_STREAM = "android.intent.extra.STREAM";
     field public static final java.lang.String EXTRA_SUBJECT = "android.intent.extra.SUBJECT";
@@ -9787,6 +9796,8 @@
     method public android.content.pm.ApplicationInfo getApplicationInfo(java.lang.String, int, android.os.UserHandle);
     method public android.content.pm.LauncherApps.PinItemRequest getPinItemRequest(android.content.Intent);
     method public android.graphics.drawable.Drawable getShortcutBadgedIconDrawable(android.content.pm.ShortcutInfo, int);
+    method public android.content.IntentSender getShortcutConfigActivityIntent(android.content.pm.LauncherActivityInfo);
+    method public java.util.List<android.content.pm.LauncherActivityInfo> getShortcutConfigActivityList(java.lang.String, android.os.UserHandle);
     method public android.graphics.drawable.Drawable getShortcutIconDrawable(android.content.pm.ShortcutInfo, int);
     method public java.util.List<android.content.pm.ShortcutInfo> getShortcuts(android.content.pm.LauncherApps.ShortcutQuery, android.os.UserHandle);
     method public boolean hasShortcutHostPermission();
@@ -10390,6 +10401,7 @@
 
   public class ShortcutManager {
     method public boolean addDynamicShortcuts(java.util.List<android.content.pm.ShortcutInfo>);
+    method public android.content.Intent createShortcutResultIntent(android.content.pm.ShortcutInfo);
     method public void disableShortcuts(java.util.List<java.lang.String>);
     method public void disableShortcuts(java.util.List<java.lang.String>, java.lang.CharSequence);
     method public void enableShortcuts(java.util.List<java.lang.String>);
@@ -12121,15 +12133,57 @@
     method public static int HSVToColor(float[]);
     method public static int HSVToColor(int, float[]);
     method public static void RGBToHSV(int, int, int, float[]);
+    method public float alpha();
+    method public static float alpha(long);
     method public static int alpha(int);
     method public static int argb(int, int, int, int);
+    method public static int argb(float, float, float, float);
+    method public float blue();
+    method public static float blue(long);
     method public static int blue(int);
+    method public static android.graphics.ColorSpace colorSpace(long);
     method public static void colorToHSV(int, float[]);
+    method public android.graphics.Color convert(android.graphics.ColorSpace);
+    method public static long convert(int, android.graphics.ColorSpace);
+    method public static long convert(long, android.graphics.ColorSpace);
+    method public static long convert(float, float, float, float, android.graphics.ColorSpace, android.graphics.ColorSpace);
+    method public static long convert(long, android.graphics.ColorSpace.Connector);
+    method public static long convert(float, float, float, float, android.graphics.ColorSpace.Connector);
+    method public android.graphics.ColorSpace getColorSpace();
+    method public float getComponent(int);
+    method public int getComponentCount();
+    method public float[] getComponents();
+    method public android.graphics.ColorSpace.Model getModel();
+    method public float green();
+    method public static float green(long);
     method public static int green(int);
+    method public static boolean isInColorSpace(long, android.graphics.ColorSpace);
+    method public boolean isSrgb();
+    method public static boolean isSrgb(long);
+    method public boolean isWideGamut();
+    method public static boolean isWideGamut(long);
+    method public float luminance();
+    method public static float luminance(long);
     method public static float luminance(int);
+    method public long pack();
+    method public static long pack(int);
+    method public static long pack(float, float, float);
+    method public static long pack(float, float, float, float);
+    method public static long pack(float, float, float, float, android.graphics.ColorSpace);
     method public static int parseColor(java.lang.String);
+    method public float red();
+    method public static float red(long);
     method public static int red(int);
     method public static int rgb(int, int, int);
+    method public static int rgb(float, float, float);
+    method public int toArgb();
+    method public static int toArgb(long);
+    method public static android.graphics.Color valueOf(int);
+    method public static android.graphics.Color valueOf(long);
+    method public static android.graphics.Color valueOf(float, float, float);
+    method public static android.graphics.Color valueOf(float, float, float, float);
+    method public static android.graphics.Color valueOf(float, float, float, float, android.graphics.ColorSpace);
+    method public static android.graphics.Color valueOf(float[], android.graphics.ColorSpace);
     field public static final int BLACK = -16777216; // 0xff000000
     field public static final int BLUE = -16776961; // 0xff0000ff
     field public static final int CYAN = -16711681; // 0xff00ffff
@@ -12201,7 +12255,7 @@
     field public static final float[] ILLUMINANT_D65;
     field public static final float[] ILLUMINANT_D75;
     field public static final float[] ILLUMINANT_E;
-    field public static final int MAX_ID = 64; // 0x40
+    field public static final int MAX_ID = 63; // 0x3f
     field public static final int MIN_ID = -1; // 0xffffffff
   }
 
@@ -29846,6 +29900,15 @@
     field public static final int THREAD_PRIORITY_URGENT_DISPLAY = -8; // 0xfffffff8
   }
 
+  public abstract class ProxyFileDescriptorCallback {
+    ctor public ProxyFileDescriptorCallback();
+    method public void onFsync() throws android.system.ErrnoException;
+    method public long onGetSize() throws android.system.ErrnoException;
+    method public int onRead(long, int, byte[]) throws android.system.ErrnoException;
+    method public abstract void onRelease();
+    method public int onWrite(long, int, byte[]) throws android.system.ErrnoException;
+  }
+
   public class RecoverySystem {
     method public static void installPackage(android.content.Context, java.io.File) throws java.io.IOException;
     method public static void rebootWipeCache(android.content.Context) throws java.io.IOException;
@@ -30263,6 +30326,7 @@
     method public boolean isEncrypted(java.io.File);
     method public boolean isObbMounted(java.lang.String);
     method public boolean mountObb(java.lang.String, java.lang.String, android.os.storage.OnObbStateChangeListener);
+    method public android.os.ParcelFileDescriptor openProxyFileDescriptor(int, android.os.ProxyFileDescriptorCallback) throws java.io.IOException;
     method public boolean unmountObb(java.lang.String, boolean, android.os.storage.OnObbStateChangeListener);
     field public static final java.lang.String ACTION_MANAGE_STORAGE = "android.os.storage.action.MANAGE_STORAGE";
   }
@@ -32360,7 +32424,7 @@
     ctor public ContactsContract.Intents();
     field public static final java.lang.String ACTION_VOICE_SEND_MESSAGE_TO_CONTACTS = "android.provider.action.VOICE_SEND_MESSAGE_TO_CONTACTS";
     field public static final java.lang.String ATTACH_IMAGE = "com.android.contacts.action.ATTACH_IMAGE";
-    field public static final java.lang.String CONTACTS_DATABASE_CREATED = "android.provider.Contacts.DATABASE_CREATED";
+    field public static final deprecated java.lang.String CONTACTS_DATABASE_CREATED = "android.provider.Contacts.DATABASE_CREATED";
     field public static final java.lang.String EXTRA_CREATE_DESCRIPTION = "com.android.contacts.action.CREATE_DESCRIPTION";
     field public static final java.lang.String EXTRA_FORCE_CREATE = "com.android.contacts.action.FORCE_CREATE";
     field public static final java.lang.String EXTRA_RECIPIENT_CONTACT_CHAT_ID = "android.provider.extra.RECIPIENT_CONTACT_CHAT_ID";
@@ -32470,8 +32534,10 @@
   public static final class ContactsContract.ProviderStatus {
     field public static final java.lang.String CONTENT_TYPE = "vnd.android.cursor.dir/provider_status";
     field public static final android.net.Uri CONTENT_URI;
+    field public static final java.lang.String DATABASE_CREATION_TIMESTAMP = "database_creation_timestamp";
     field public static final java.lang.String STATUS = "status";
     field public static final int STATUS_BUSY = 1; // 0x1
+    field public static final android.net.Uri STATUS_CHANGE_NOTIFICATION_CONTENT_URI;
     field public static final int STATUS_EMPTY = 2; // 0x2
     field public static final int STATUS_NORMAL = 0; // 0x0
   }
@@ -35410,7 +35476,6 @@
     field public static final java.lang.String EXTRA_OFFLINE = "android.service.media.extra.OFFLINE";
     field public static final java.lang.String EXTRA_RECENT = "android.service.media.extra.RECENT";
     field public static final java.lang.String EXTRA_SUGGESTED = "android.service.media.extra.SUGGESTED";
-    field public static final java.lang.String EXTRA_SUGGESTION_KEYWORDS = "android.service.media.extra.SUGGESTION_KEYWORDS";
   }
 
   public class MediaBrowserService.Result<T> {
@@ -53120,6 +53185,133 @@
 
 }
 
+package java.lang.invoke {
+
+  public class LambdaConversionException extends java.lang.Exception {
+    ctor public LambdaConversionException();
+    ctor public LambdaConversionException(java.lang.String);
+    ctor public LambdaConversionException(java.lang.String, java.lang.Throwable);
+    ctor public LambdaConversionException(java.lang.Throwable);
+    ctor public LambdaConversionException(java.lang.String, java.lang.Throwable, boolean, boolean);
+  }
+
+  public abstract class MethodHandle {
+    method public java.lang.invoke.MethodHandle asFixedArity();
+    method public java.lang.invoke.MethodHandle asType(java.lang.invoke.MethodType);
+    method public java.lang.invoke.MethodHandle asVarargsCollector(java.lang.Class<?>);
+    method public java.lang.invoke.MethodHandle bindTo(java.lang.Object);
+    method public final java.lang.Object invoke(java.lang.Object...) throws java.lang.Throwable;
+    method public final java.lang.Object invokeExact(java.lang.Object...) throws java.lang.Throwable;
+    method public java.lang.Object invokeWithArguments(java.util.List<?>) throws java.lang.Throwable;
+    method public boolean isVarargsCollector();
+    method public java.lang.invoke.MethodType type();
+  }
+
+  public abstract interface MethodHandleInfo {
+    method public abstract java.lang.Class<?> getDeclaringClass();
+    method public abstract java.lang.invoke.MethodType getMethodType();
+    method public abstract int getModifiers();
+    method public abstract java.lang.String getName();
+    method public abstract int getReferenceKind();
+    method public default boolean isVarArgs();
+    method public static boolean refKindIsField(int);
+    method public static boolean refKindIsValid(int);
+    method public static java.lang.String refKindName(int);
+    method public static java.lang.String referenceKindToString(int);
+    method public abstract <T extends java.lang.reflect.Member> T reflectAs(java.lang.Class<T>, java.lang.invoke.MethodHandles.Lookup);
+    method public static java.lang.String toString(int, java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType);
+    field public static final int REF_getField = 1; // 0x1
+    field public static final int REF_getStatic = 2; // 0x2
+    field public static final int REF_invokeInterface = 9; // 0x9
+    field public static final int REF_invokeSpecial = 7; // 0x7
+    field public static final int REF_invokeStatic = 6; // 0x6
+    field public static final int REF_invokeVirtual = 5; // 0x5
+    field public static final int REF_newInvokeSpecial = 8; // 0x8
+    field public static final int REF_putField = 3; // 0x3
+    field public static final int REF_putStatic = 4; // 0x4
+  }
+
+  public class MethodHandles {
+    method public static java.lang.invoke.MethodHandle arrayElementGetter(java.lang.Class<?>) throws java.lang.IllegalArgumentException;
+    method public static java.lang.invoke.MethodHandle arrayElementSetter(java.lang.Class<?>) throws java.lang.IllegalArgumentException;
+    method public static java.lang.invoke.MethodHandle catchException(java.lang.invoke.MethodHandle, java.lang.Class<? extends java.lang.Throwable>, java.lang.invoke.MethodHandle);
+    method public static java.lang.invoke.MethodHandle constant(java.lang.Class<?>, java.lang.Object);
+    method public static java.lang.invoke.MethodHandle dropArguments(java.lang.invoke.MethodHandle, int, java.util.List<java.lang.Class<?>>);
+    method public static java.lang.invoke.MethodHandle dropArguments(java.lang.invoke.MethodHandle, int, java.lang.Class<?>...);
+    method public static java.lang.invoke.MethodHandle exactInvoker(java.lang.invoke.MethodType);
+    method public static java.lang.invoke.MethodHandle filterReturnValue(java.lang.invoke.MethodHandle, java.lang.invoke.MethodHandle);
+    method public static java.lang.invoke.MethodHandle guardWithTest(java.lang.invoke.MethodHandle, java.lang.invoke.MethodHandle, java.lang.invoke.MethodHandle);
+    method public static java.lang.invoke.MethodHandle identity(java.lang.Class<?>);
+    method public static java.lang.invoke.MethodHandle invoker(java.lang.invoke.MethodType);
+    method public static java.lang.invoke.MethodHandles.Lookup lookup();
+    method public static java.lang.invoke.MethodHandle permuteArguments(java.lang.invoke.MethodHandle, java.lang.invoke.MethodType, int...);
+    method public static java.lang.invoke.MethodHandles.Lookup publicLookup();
+    method public static java.lang.invoke.MethodHandle throwException(java.lang.Class<?>, java.lang.Class<? extends java.lang.Throwable>);
+  }
+
+  public static final class MethodHandles.Lookup {
+    method public java.lang.invoke.MethodHandle bind(java.lang.Object, java.lang.String, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findConstructor(java.lang.Class<?>, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findGetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findSetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findSpecial(java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findStatic(java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findStaticGetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findStaticSetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findVirtual(java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandles.Lookup in(java.lang.Class<?>);
+    method public java.lang.Class<?> lookupClass();
+    method public int lookupModes();
+    method public void throwMakeAccessException(java.lang.String, java.lang.Object) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflect(java.lang.reflect.Method) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectConstructor(java.lang.reflect.Constructor<?>) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectGetter(java.lang.reflect.Field) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectSetter(java.lang.reflect.Field) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectSpecial(java.lang.reflect.Method, java.lang.Class<?>) throws java.lang.IllegalAccessException;
+    field public static final int PACKAGE = 8; // 0x8
+    field public static final int PRIVATE = 2; // 0x2
+    field public static final int PROTECTED = 4; // 0x4
+    field public static final int PUBLIC = 1; // 0x1
+  }
+
+  public final class MethodType implements java.io.Serializable {
+    method public java.lang.invoke.MethodType appendParameterTypes(java.lang.Class<?>...);
+    method public java.lang.invoke.MethodType appendParameterTypes(java.util.List<java.lang.Class<?>>);
+    method public java.lang.invoke.MethodType changeParameterType(int, java.lang.Class<?>);
+    method public java.lang.invoke.MethodType changeReturnType(java.lang.Class<?>);
+    method public java.lang.invoke.MethodType dropParameterTypes(int, int);
+    method public java.lang.invoke.MethodType erase();
+    method public static java.lang.invoke.MethodType fromMethodDescriptorString(java.lang.String, java.lang.ClassLoader) throws java.lang.IllegalArgumentException, java.lang.TypeNotPresentException;
+    method public java.lang.invoke.MethodType generic();
+    method public static java.lang.invoke.MethodType genericMethodType(int, boolean);
+    method public static java.lang.invoke.MethodType genericMethodType(int);
+    method public boolean hasPrimitives();
+    method public boolean hasWrappers();
+    method public java.lang.invoke.MethodType insertParameterTypes(int, java.lang.Class<?>...);
+    method public java.lang.invoke.MethodType insertParameterTypes(int, java.util.List<java.lang.Class<?>>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.Class<?>[]);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.util.List<java.lang.Class<?>>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.Class<?>, java.lang.Class<?>...);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.Class<?>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.invoke.MethodType);
+    method public java.lang.Class<?>[] parameterArray();
+    method public int parameterCount();
+    method public java.util.List<java.lang.Class<?>> parameterList();
+    method public java.lang.Class<?> parameterType(int);
+    method public java.lang.Class<?> returnType();
+    method public java.lang.String toMethodDescriptorString();
+    method public java.lang.invoke.MethodType unwrap();
+    method public java.lang.invoke.MethodType wrap();
+  }
+
+  public class WrongMethodTypeException extends java.lang.RuntimeException {
+    ctor public WrongMethodTypeException();
+    ctor public WrongMethodTypeException(java.lang.String);
+  }
+
+}
+
 package java.lang.ref {
 
   public class PhantomReference<T> extends java.lang.ref.Reference {
diff --git a/api/system-current.txt b/api/system-current.txt
index 87df130..d5d84a0 100644
--- a/api/system-current.txt
+++ b/api/system-current.txt
@@ -1098,6 +1098,7 @@
     field public static final int preferenceStyle = 16842894; // 0x101008e
     field public static final int presentationTheme = 16843712; // 0x10103c0
     field public static final int previewImage = 16843482; // 0x10102da
+    field public static final int primaryContentAlpha = 16843367; // 0x1010267
     field public static final int priority = 16842780; // 0x101001c
     field public static final int privateImeOptions = 16843299; // 0x1010223
     field public static final int process = 16842769; // 0x1010011
@@ -4748,6 +4749,7 @@
 
   public abstract class FragmentContainer {
     ctor public FragmentContainer();
+    method public android.app.Fragment instantiate(android.content.Context, java.lang.String, android.os.Bundle);
     method public abstract android.view.View onFindViewById(int);
     method public abstract boolean onHasView();
   }
@@ -5183,6 +5185,7 @@
     field public static final int DEFAULT_LIGHTS = 4; // 0x4
     field public static final int DEFAULT_SOUND = 1; // 0x1
     field public static final int DEFAULT_VIBRATE = 2; // 0x2
+    field public static final java.lang.String EXTRA_AUDIO_CONTENTS_URI = "android.audioContents";
     field public static final java.lang.String EXTRA_BACKGROUND_IMAGE_URI = "android.backgroundImageUri";
     field public static final java.lang.String EXTRA_BIG_TEXT = "android.bigText";
     field public static final java.lang.String EXTRA_CHRONOMETER_COUNT_DOWN = "android.chronometerCountDown";
@@ -5268,6 +5271,7 @@
     method public android.app.Notification.Action clone();
     method public int describeContents();
     method public boolean getAllowGeneratedReplies();
+    method public android.app.RemoteInput[] getDataOnlyRemoteInputs();
     method public android.os.Bundle getExtras();
     method public android.graphics.drawable.Icon getIcon();
     method public android.app.RemoteInput[] getRemoteInputs();
@@ -5484,6 +5488,17 @@
     field protected android.app.Notification.Builder mBuilder;
   }
 
+  public static final class Notification.TvExtender implements android.app.Notification.Extender {
+    ctor public Notification.TvExtender();
+    ctor public Notification.TvExtender(android.app.Notification);
+    method public android.app.Notification.Builder extend(android.app.Notification.Builder);
+    method public android.app.PendingIntent getContentIntent();
+    method public android.app.PendingIntent getDeleteIntent();
+    method public boolean isAvailableOnTv();
+    method public android.app.Notification.TvExtender setContentIntent(android.app.PendingIntent);
+    method public android.app.Notification.TvExtender setDeleteIntent(android.app.PendingIntent);
+  }
+
   public static final class Notification.WearableExtender implements android.app.Notification.Extender {
     ctor public Notification.WearableExtender();
     ctor public Notification.WearableExtender(android.app.Notification);
@@ -5747,14 +5762,18 @@
   }
 
   public final class RemoteInput implements android.os.Parcelable {
+    method public static void addDataResultToIntent(android.app.RemoteInput, android.content.Intent, java.util.Map<java.lang.String, android.net.Uri>);
     method public static void addResultsToIntent(android.app.RemoteInput[], android.content.Intent, android.os.Bundle);
     method public int describeContents();
     method public boolean getAllowFreeFormInput();
+    method public java.util.Set<java.lang.String> getAllowedDataTypes();
     method public java.lang.CharSequence[] getChoices();
+    method public static java.util.Map<java.lang.String, android.net.Uri> getDataResultsFromIntent(android.content.Intent, java.lang.String);
     method public android.os.Bundle getExtras();
     method public java.lang.CharSequence getLabel();
     method public java.lang.String getResultKey();
     method public static android.os.Bundle getResultsFromIntent(android.content.Intent);
+    method public boolean isDataOnly();
     method public void writeToParcel(android.os.Parcel, int);
     field public static final android.os.Parcelable.Creator<android.app.RemoteInput> CREATOR;
     field public static final java.lang.String EXTRA_RESULTS_DATA = "android.remoteinput.resultsData";
@@ -5766,6 +5785,7 @@
     method public android.app.RemoteInput.Builder addExtras(android.os.Bundle);
     method public android.app.RemoteInput build();
     method public android.os.Bundle getExtras();
+    method public android.app.RemoteInput.Builder setAllowDataType(java.lang.String, boolean);
     method public android.app.RemoteInput.Builder setAllowFreeFormInput(boolean);
     method public android.app.RemoteInput.Builder setChoices(java.lang.CharSequence[]);
     method public android.app.RemoteInput.Builder setLabel(java.lang.CharSequence);
@@ -9381,10 +9401,10 @@
     field public static final java.lang.String EXTRA_RESULT_NEEDED = "android.intent.extra.RESULT_NEEDED";
     field public static final java.lang.String EXTRA_RESULT_RECEIVER = "android.intent.extra.RESULT_RECEIVER";
     field public static final java.lang.String EXTRA_RETURN_RESULT = "android.intent.extra.RETURN_RESULT";
-    field public static final java.lang.String EXTRA_SHORTCUT_ICON = "android.intent.extra.shortcut.ICON";
-    field public static final java.lang.String EXTRA_SHORTCUT_ICON_RESOURCE = "android.intent.extra.shortcut.ICON_RESOURCE";
-    field public static final java.lang.String EXTRA_SHORTCUT_INTENT = "android.intent.extra.shortcut.INTENT";
-    field public static final java.lang.String EXTRA_SHORTCUT_NAME = "android.intent.extra.shortcut.NAME";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_ICON = "android.intent.extra.shortcut.ICON";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_ICON_RESOURCE = "android.intent.extra.shortcut.ICON_RESOURCE";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_INTENT = "android.intent.extra.shortcut.INTENT";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_NAME = "android.intent.extra.shortcut.NAME";
     field public static final java.lang.String EXTRA_SHUTDOWN_USERSPACE_ONLY = "android.intent.extra.SHUTDOWN_USERSPACE_ONLY";
     field public static final java.lang.String EXTRA_SPLIT_NAME = "android.intent.extra.SPLIT_NAME";
     field public static final java.lang.String EXTRA_STREAM = "android.intent.extra.STREAM";
@@ -10204,6 +10224,8 @@
     method public android.content.pm.ApplicationInfo getApplicationInfo(java.lang.String, int, android.os.UserHandle);
     method public android.content.pm.LauncherApps.PinItemRequest getPinItemRequest(android.content.Intent);
     method public android.graphics.drawable.Drawable getShortcutBadgedIconDrawable(android.content.pm.ShortcutInfo, int);
+    method public android.content.IntentSender getShortcutConfigActivityIntent(android.content.pm.LauncherActivityInfo);
+    method public java.util.List<android.content.pm.LauncherActivityInfo> getShortcutConfigActivityList(java.lang.String, android.os.UserHandle);
     method public android.graphics.drawable.Drawable getShortcutIconDrawable(android.content.pm.ShortcutInfo, int);
     method public java.util.List<android.content.pm.ShortcutInfo> getShortcuts(android.content.pm.LauncherApps.ShortcutQuery, android.os.UserHandle);
     method public boolean hasShortcutHostPermission();
@@ -10880,6 +10902,7 @@
 
   public class ShortcutManager {
     method public boolean addDynamicShortcuts(java.util.List<android.content.pm.ShortcutInfo>);
+    method public android.content.Intent createShortcutResultIntent(android.content.pm.ShortcutInfo);
     method public void disableShortcuts(java.util.List<java.lang.String>);
     method public void disableShortcuts(java.util.List<java.lang.String>, java.lang.CharSequence);
     method public void enableShortcuts(java.util.List<java.lang.String>);
@@ -12625,15 +12648,57 @@
     method public static int HSVToColor(float[]);
     method public static int HSVToColor(int, float[]);
     method public static void RGBToHSV(int, int, int, float[]);
+    method public float alpha();
+    method public static float alpha(long);
     method public static int alpha(int);
     method public static int argb(int, int, int, int);
+    method public static int argb(float, float, float, float);
+    method public float blue();
+    method public static float blue(long);
     method public static int blue(int);
+    method public static android.graphics.ColorSpace colorSpace(long);
     method public static void colorToHSV(int, float[]);
+    method public android.graphics.Color convert(android.graphics.ColorSpace);
+    method public static long convert(int, android.graphics.ColorSpace);
+    method public static long convert(long, android.graphics.ColorSpace);
+    method public static long convert(float, float, float, float, android.graphics.ColorSpace, android.graphics.ColorSpace);
+    method public static long convert(long, android.graphics.ColorSpace.Connector);
+    method public static long convert(float, float, float, float, android.graphics.ColorSpace.Connector);
+    method public android.graphics.ColorSpace getColorSpace();
+    method public float getComponent(int);
+    method public int getComponentCount();
+    method public float[] getComponents();
+    method public android.graphics.ColorSpace.Model getModel();
+    method public float green();
+    method public static float green(long);
     method public static int green(int);
+    method public static boolean isInColorSpace(long, android.graphics.ColorSpace);
+    method public boolean isSrgb();
+    method public static boolean isSrgb(long);
+    method public boolean isWideGamut();
+    method public static boolean isWideGamut(long);
+    method public float luminance();
+    method public static float luminance(long);
     method public static float luminance(int);
+    method public long pack();
+    method public static long pack(int);
+    method public static long pack(float, float, float);
+    method public static long pack(float, float, float, float);
+    method public static long pack(float, float, float, float, android.graphics.ColorSpace);
     method public static int parseColor(java.lang.String);
+    method public float red();
+    method public static float red(long);
     method public static int red(int);
     method public static int rgb(int, int, int);
+    method public static int rgb(float, float, float);
+    method public int toArgb();
+    method public static int toArgb(long);
+    method public static android.graphics.Color valueOf(int);
+    method public static android.graphics.Color valueOf(long);
+    method public static android.graphics.Color valueOf(float, float, float);
+    method public static android.graphics.Color valueOf(float, float, float, float);
+    method public static android.graphics.Color valueOf(float, float, float, float, android.graphics.ColorSpace);
+    method public static android.graphics.Color valueOf(float[], android.graphics.ColorSpace);
     field public static final int BLACK = -16777216; // 0xff000000
     field public static final int BLUE = -16776961; // 0xff0000ff
     field public static final int CYAN = -16711681; // 0xff00ffff
@@ -12705,7 +12770,7 @@
     field public static final float[] ILLUMINANT_D65;
     field public static final float[] ILLUMINANT_D75;
     field public static final float[] ILLUMINANT_E;
-    field public static final int MAX_ID = 64; // 0x40
+    field public static final int MAX_ID = 63; // 0x3f
     field public static final int MIN_ID = -1; // 0xffffffff
   }
 
@@ -32456,6 +32521,15 @@
     field public static final int THREAD_PRIORITY_URGENT_DISPLAY = -8; // 0xfffffff8
   }
 
+  public abstract class ProxyFileDescriptorCallback {
+    ctor public ProxyFileDescriptorCallback();
+    method public void onFsync() throws android.system.ErrnoException;
+    method public long onGetSize() throws android.system.ErrnoException;
+    method public int onRead(long, int, byte[]) throws android.system.ErrnoException;
+    method public abstract void onRelease();
+    method public int onWrite(long, int, byte[]) throws android.system.ErrnoException;
+  }
+
   public class RecoverySystem {
     method public static void cancelScheduledUpdate(android.content.Context) throws java.io.IOException;
     method public static void installPackage(android.content.Context, java.io.File) throws java.io.IOException;
@@ -32703,7 +32777,8 @@
     method public android.os.UserHandle getUserForSerialNumber(long);
     method public java.lang.String getUserName();
     method public java.util.List<android.os.UserHandle> getUserProfiles();
-    method public int getUserRestrictionSource(java.lang.String, android.os.UserHandle);
+    method public deprecated int getUserRestrictionSource(java.lang.String, android.os.UserHandle);
+    method public java.util.List<android.os.UserManager.EnforcingUser> getUserRestrictionSources(java.lang.String, android.os.UserHandle);
     method public android.os.Bundle getUserRestrictions();
     method public android.os.Bundle getUserRestrictions(android.os.UserHandle);
     method public boolean hasUserRestriction(java.lang.String);
@@ -32769,6 +32844,14 @@
     field public static final int USER_CREATION_FAILED_NO_MORE_USERS = 2; // 0x2
   }
 
+  public static final class UserManager.EnforcingUser implements android.os.Parcelable {
+    method public int describeContents();
+    method public android.os.UserHandle getUserHandle();
+    method public int getUserRestrictionSource();
+    method public void writeToParcel(android.os.Parcel, int);
+    field public static final android.os.Parcelable.Creator<android.os.UserManager.EnforcingUser> CREATOR;
+  }
+
   public static abstract class UserManager.UserRestrictionSource implements java.lang.annotation.Annotation {
   }
 
@@ -32959,6 +33042,7 @@
     method public boolean isEncrypted(java.io.File);
     method public boolean isObbMounted(java.lang.String);
     method public boolean mountObb(java.lang.String, java.lang.String, android.os.storage.OnObbStateChangeListener);
+    method public android.os.ParcelFileDescriptor openProxyFileDescriptor(int, android.os.ProxyFileDescriptorCallback) throws java.io.IOException;
     method public boolean unmountObb(java.lang.String, boolean, android.os.storage.OnObbStateChangeListener);
     field public static final java.lang.String ACTION_MANAGE_STORAGE = "android.os.storage.action.MANAGE_STORAGE";
   }
@@ -35095,7 +35179,7 @@
     ctor public ContactsContract.Intents();
     field public static final java.lang.String ACTION_VOICE_SEND_MESSAGE_TO_CONTACTS = "android.provider.action.VOICE_SEND_MESSAGE_TO_CONTACTS";
     field public static final java.lang.String ATTACH_IMAGE = "com.android.contacts.action.ATTACH_IMAGE";
-    field public static final java.lang.String CONTACTS_DATABASE_CREATED = "android.provider.Contacts.DATABASE_CREATED";
+    field public static final deprecated java.lang.String CONTACTS_DATABASE_CREATED = "android.provider.Contacts.DATABASE_CREATED";
     field public static final java.lang.String EXTRA_CREATE_DESCRIPTION = "com.android.contacts.action.CREATE_DESCRIPTION";
     field public static final java.lang.String EXTRA_FORCE_CREATE = "com.android.contacts.action.FORCE_CREATE";
     field public static final java.lang.String EXTRA_RECIPIENT_CONTACT_CHAT_ID = "android.provider.extra.RECIPIENT_CONTACT_CHAT_ID";
@@ -35235,8 +35319,10 @@
   public static final class ContactsContract.ProviderStatus {
     field public static final java.lang.String CONTENT_TYPE = "vnd.android.cursor.dir/provider_status";
     field public static final android.net.Uri CONTENT_URI;
+    field public static final java.lang.String DATABASE_CREATION_TIMESTAMP = "database_creation_timestamp";
     field public static final java.lang.String STATUS = "status";
     field public static final int STATUS_BUSY = 1; // 0x1
+    field public static final android.net.Uri STATUS_CHANGE_NOTIFICATION_CONTENT_URI;
     field public static final int STATUS_EMPTY = 2; // 0x2
     field public static final int STATUS_NORMAL = 0; // 0x0
   }
@@ -38289,7 +38375,6 @@
     field public static final java.lang.String EXTRA_OFFLINE = "android.service.media.extra.OFFLINE";
     field public static final java.lang.String EXTRA_RECENT = "android.service.media.extra.RECENT";
     field public static final java.lang.String EXTRA_SUGGESTED = "android.service.media.extra.SUGGESTED";
-    field public static final java.lang.String EXTRA_SUGGESTION_KEYWORDS = "android.service.media.extra.SUGGESTION_KEYWORDS";
   }
 
   public class MediaBrowserService.Result<T> {
@@ -56716,6 +56801,133 @@
 
 }
 
+package java.lang.invoke {
+
+  public class LambdaConversionException extends java.lang.Exception {
+    ctor public LambdaConversionException();
+    ctor public LambdaConversionException(java.lang.String);
+    ctor public LambdaConversionException(java.lang.String, java.lang.Throwable);
+    ctor public LambdaConversionException(java.lang.Throwable);
+    ctor public LambdaConversionException(java.lang.String, java.lang.Throwable, boolean, boolean);
+  }
+
+  public abstract class MethodHandle {
+    method public java.lang.invoke.MethodHandle asFixedArity();
+    method public java.lang.invoke.MethodHandle asType(java.lang.invoke.MethodType);
+    method public java.lang.invoke.MethodHandle asVarargsCollector(java.lang.Class<?>);
+    method public java.lang.invoke.MethodHandle bindTo(java.lang.Object);
+    method public final java.lang.Object invoke(java.lang.Object...) throws java.lang.Throwable;
+    method public final java.lang.Object invokeExact(java.lang.Object...) throws java.lang.Throwable;
+    method public java.lang.Object invokeWithArguments(java.util.List<?>) throws java.lang.Throwable;
+    method public boolean isVarargsCollector();
+    method public java.lang.invoke.MethodType type();
+  }
+
+  public abstract interface MethodHandleInfo {
+    method public abstract java.lang.Class<?> getDeclaringClass();
+    method public abstract java.lang.invoke.MethodType getMethodType();
+    method public abstract int getModifiers();
+    method public abstract java.lang.String getName();
+    method public abstract int getReferenceKind();
+    method public default boolean isVarArgs();
+    method public static boolean refKindIsField(int);
+    method public static boolean refKindIsValid(int);
+    method public static java.lang.String refKindName(int);
+    method public static java.lang.String referenceKindToString(int);
+    method public abstract <T extends java.lang.reflect.Member> T reflectAs(java.lang.Class<T>, java.lang.invoke.MethodHandles.Lookup);
+    method public static java.lang.String toString(int, java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType);
+    field public static final int REF_getField = 1; // 0x1
+    field public static final int REF_getStatic = 2; // 0x2
+    field public static final int REF_invokeInterface = 9; // 0x9
+    field public static final int REF_invokeSpecial = 7; // 0x7
+    field public static final int REF_invokeStatic = 6; // 0x6
+    field public static final int REF_invokeVirtual = 5; // 0x5
+    field public static final int REF_newInvokeSpecial = 8; // 0x8
+    field public static final int REF_putField = 3; // 0x3
+    field public static final int REF_putStatic = 4; // 0x4
+  }
+
+  public class MethodHandles {
+    method public static java.lang.invoke.MethodHandle arrayElementGetter(java.lang.Class<?>) throws java.lang.IllegalArgumentException;
+    method public static java.lang.invoke.MethodHandle arrayElementSetter(java.lang.Class<?>) throws java.lang.IllegalArgumentException;
+    method public static java.lang.invoke.MethodHandle catchException(java.lang.invoke.MethodHandle, java.lang.Class<? extends java.lang.Throwable>, java.lang.invoke.MethodHandle);
+    method public static java.lang.invoke.MethodHandle constant(java.lang.Class<?>, java.lang.Object);
+    method public static java.lang.invoke.MethodHandle dropArguments(java.lang.invoke.MethodHandle, int, java.util.List<java.lang.Class<?>>);
+    method public static java.lang.invoke.MethodHandle dropArguments(java.lang.invoke.MethodHandle, int, java.lang.Class<?>...);
+    method public static java.lang.invoke.MethodHandle exactInvoker(java.lang.invoke.MethodType);
+    method public static java.lang.invoke.MethodHandle filterReturnValue(java.lang.invoke.MethodHandle, java.lang.invoke.MethodHandle);
+    method public static java.lang.invoke.MethodHandle guardWithTest(java.lang.invoke.MethodHandle, java.lang.invoke.MethodHandle, java.lang.invoke.MethodHandle);
+    method public static java.lang.invoke.MethodHandle identity(java.lang.Class<?>);
+    method public static java.lang.invoke.MethodHandle invoker(java.lang.invoke.MethodType);
+    method public static java.lang.invoke.MethodHandles.Lookup lookup();
+    method public static java.lang.invoke.MethodHandle permuteArguments(java.lang.invoke.MethodHandle, java.lang.invoke.MethodType, int...);
+    method public static java.lang.invoke.MethodHandles.Lookup publicLookup();
+    method public static java.lang.invoke.MethodHandle throwException(java.lang.Class<?>, java.lang.Class<? extends java.lang.Throwable>);
+  }
+
+  public static final class MethodHandles.Lookup {
+    method public java.lang.invoke.MethodHandle bind(java.lang.Object, java.lang.String, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findConstructor(java.lang.Class<?>, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findGetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findSetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findSpecial(java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findStatic(java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findStaticGetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findStaticSetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findVirtual(java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandles.Lookup in(java.lang.Class<?>);
+    method public java.lang.Class<?> lookupClass();
+    method public int lookupModes();
+    method public void throwMakeAccessException(java.lang.String, java.lang.Object) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflect(java.lang.reflect.Method) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectConstructor(java.lang.reflect.Constructor<?>) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectGetter(java.lang.reflect.Field) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectSetter(java.lang.reflect.Field) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectSpecial(java.lang.reflect.Method, java.lang.Class<?>) throws java.lang.IllegalAccessException;
+    field public static final int PACKAGE = 8; // 0x8
+    field public static final int PRIVATE = 2; // 0x2
+    field public static final int PROTECTED = 4; // 0x4
+    field public static final int PUBLIC = 1; // 0x1
+  }
+
+  public final class MethodType implements java.io.Serializable {
+    method public java.lang.invoke.MethodType appendParameterTypes(java.lang.Class<?>...);
+    method public java.lang.invoke.MethodType appendParameterTypes(java.util.List<java.lang.Class<?>>);
+    method public java.lang.invoke.MethodType changeParameterType(int, java.lang.Class<?>);
+    method public java.lang.invoke.MethodType changeReturnType(java.lang.Class<?>);
+    method public java.lang.invoke.MethodType dropParameterTypes(int, int);
+    method public java.lang.invoke.MethodType erase();
+    method public static java.lang.invoke.MethodType fromMethodDescriptorString(java.lang.String, java.lang.ClassLoader) throws java.lang.IllegalArgumentException, java.lang.TypeNotPresentException;
+    method public java.lang.invoke.MethodType generic();
+    method public static java.lang.invoke.MethodType genericMethodType(int, boolean);
+    method public static java.lang.invoke.MethodType genericMethodType(int);
+    method public boolean hasPrimitives();
+    method public boolean hasWrappers();
+    method public java.lang.invoke.MethodType insertParameterTypes(int, java.lang.Class<?>...);
+    method public java.lang.invoke.MethodType insertParameterTypes(int, java.util.List<java.lang.Class<?>>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.Class<?>[]);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.util.List<java.lang.Class<?>>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.Class<?>, java.lang.Class<?>...);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.Class<?>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.invoke.MethodType);
+    method public java.lang.Class<?>[] parameterArray();
+    method public int parameterCount();
+    method public java.util.List<java.lang.Class<?>> parameterList();
+    method public java.lang.Class<?> parameterType(int);
+    method public java.lang.Class<?> returnType();
+    method public java.lang.String toMethodDescriptorString();
+    method public java.lang.invoke.MethodType unwrap();
+    method public java.lang.invoke.MethodType wrap();
+  }
+
+  public class WrongMethodTypeException extends java.lang.RuntimeException {
+    ctor public WrongMethodTypeException();
+    ctor public WrongMethodTypeException(java.lang.String);
+  }
+
+}
+
 package java.lang.ref {
 
   public class PhantomReference<T> extends java.lang.ref.Reference {
diff --git a/api/test-current.txt b/api/test-current.txt
index de86022..7933890 100644
--- a/api/test-current.txt
+++ b/api/test-current.txt
@@ -989,6 +989,7 @@
     field public static final int preferenceStyle = 16842894; // 0x101008e
     field public static final int presentationTheme = 16843712; // 0x10103c0
     field public static final int previewImage = 16843482; // 0x10102da
+    field public static final int primaryContentAlpha = 16843367; // 0x1010267
     field public static final int priority = 16842780; // 0x101001c
     field public static final int privateImeOptions = 16843299; // 0x1010223
     field public static final int process = 16842769; // 0x1010011
@@ -4601,6 +4602,7 @@
 
   public abstract class FragmentContainer {
     ctor public FragmentContainer();
+    method public android.app.Fragment instantiate(android.content.Context, java.lang.String, android.os.Bundle);
     method public abstract android.view.View onFindViewById(int);
     method public abstract boolean onHasView();
   }
@@ -5035,6 +5037,7 @@
     field public static final int DEFAULT_LIGHTS = 4; // 0x4
     field public static final int DEFAULT_SOUND = 1; // 0x1
     field public static final int DEFAULT_VIBRATE = 2; // 0x2
+    field public static final java.lang.String EXTRA_AUDIO_CONTENTS_URI = "android.audioContents";
     field public static final java.lang.String EXTRA_BACKGROUND_IMAGE_URI = "android.backgroundImageUri";
     field public static final java.lang.String EXTRA_BIG_TEXT = "android.bigText";
     field public static final java.lang.String EXTRA_CHRONOMETER_COUNT_DOWN = "android.chronometerCountDown";
@@ -5118,6 +5121,7 @@
     method public android.app.Notification.Action clone();
     method public int describeContents();
     method public boolean getAllowGeneratedReplies();
+    method public android.app.RemoteInput[] getDataOnlyRemoteInputs();
     method public android.os.Bundle getExtras();
     method public android.graphics.drawable.Icon getIcon();
     method public android.app.RemoteInput[] getRemoteInputs();
@@ -5584,14 +5588,18 @@
   }
 
   public final class RemoteInput implements android.os.Parcelable {
+    method public static void addDataResultToIntent(android.app.RemoteInput, android.content.Intent, java.util.Map<java.lang.String, android.net.Uri>);
     method public static void addResultsToIntent(android.app.RemoteInput[], android.content.Intent, android.os.Bundle);
     method public int describeContents();
     method public boolean getAllowFreeFormInput();
+    method public java.util.Set<java.lang.String> getAllowedDataTypes();
     method public java.lang.CharSequence[] getChoices();
+    method public static java.util.Map<java.lang.String, android.net.Uri> getDataResultsFromIntent(android.content.Intent, java.lang.String);
     method public android.os.Bundle getExtras();
     method public java.lang.CharSequence getLabel();
     method public java.lang.String getResultKey();
     method public static android.os.Bundle getResultsFromIntent(android.content.Intent);
+    method public boolean isDataOnly();
     method public void writeToParcel(android.os.Parcel, int);
     field public static final android.os.Parcelable.Creator<android.app.RemoteInput> CREATOR;
     field public static final java.lang.String EXTRA_RESULTS_DATA = "android.remoteinput.resultsData";
@@ -5603,6 +5611,7 @@
     method public android.app.RemoteInput.Builder addExtras(android.os.Bundle);
     method public android.app.RemoteInput build();
     method public android.os.Bundle getExtras();
+    method public android.app.RemoteInput.Builder setAllowDataType(java.lang.String, boolean);
     method public android.app.RemoteInput.Builder setAllowFreeFormInput(boolean);
     method public android.app.RemoteInput.Builder setChoices(java.lang.CharSequence[]);
     method public android.app.RemoteInput.Builder setLabel(java.lang.CharSequence);
@@ -9024,10 +9033,10 @@
     field public static final java.lang.String EXTRA_RESTRICTIONS_LIST = "android.intent.extra.restrictions_list";
     field public static final java.lang.String EXTRA_RESULT_RECEIVER = "android.intent.extra.RESULT_RECEIVER";
     field public static final java.lang.String EXTRA_RETURN_RESULT = "android.intent.extra.RETURN_RESULT";
-    field public static final java.lang.String EXTRA_SHORTCUT_ICON = "android.intent.extra.shortcut.ICON";
-    field public static final java.lang.String EXTRA_SHORTCUT_ICON_RESOURCE = "android.intent.extra.shortcut.ICON_RESOURCE";
-    field public static final java.lang.String EXTRA_SHORTCUT_INTENT = "android.intent.extra.shortcut.INTENT";
-    field public static final java.lang.String EXTRA_SHORTCUT_NAME = "android.intent.extra.shortcut.NAME";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_ICON = "android.intent.extra.shortcut.ICON";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_ICON_RESOURCE = "android.intent.extra.shortcut.ICON_RESOURCE";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_INTENT = "android.intent.extra.shortcut.INTENT";
+    field public static final deprecated java.lang.String EXTRA_SHORTCUT_NAME = "android.intent.extra.shortcut.NAME";
     field public static final java.lang.String EXTRA_SHUTDOWN_USERSPACE_ONLY = "android.intent.extra.SHUTDOWN_USERSPACE_ONLY";
     field public static final java.lang.String EXTRA_STREAM = "android.intent.extra.STREAM";
     field public static final java.lang.String EXTRA_SUBJECT = "android.intent.extra.SUBJECT";
@@ -9815,6 +9824,8 @@
     method public android.content.pm.ApplicationInfo getApplicationInfo(java.lang.String, int, android.os.UserHandle);
     method public android.content.pm.LauncherApps.PinItemRequest getPinItemRequest(android.content.Intent);
     method public android.graphics.drawable.Drawable getShortcutBadgedIconDrawable(android.content.pm.ShortcutInfo, int);
+    method public android.content.IntentSender getShortcutConfigActivityIntent(android.content.pm.LauncherActivityInfo);
+    method public java.util.List<android.content.pm.LauncherActivityInfo> getShortcutConfigActivityList(java.lang.String, android.os.UserHandle);
     method public android.graphics.drawable.Drawable getShortcutIconDrawable(android.content.pm.ShortcutInfo, int);
     method public java.util.List<android.content.pm.ShortcutInfo> getShortcuts(android.content.pm.LauncherApps.ShortcutQuery, android.os.UserHandle);
     method public boolean hasShortcutHostPermission();
@@ -10422,6 +10433,7 @@
   public class ShortcutManager {
     ctor public ShortcutManager(android.content.Context);
     method public boolean addDynamicShortcuts(java.util.List<android.content.pm.ShortcutInfo>);
+    method public android.content.Intent createShortcutResultIntent(android.content.pm.ShortcutInfo);
     method public void disableShortcuts(java.util.List<java.lang.String>);
     method public void disableShortcuts(java.util.List<java.lang.String>, java.lang.CharSequence);
     method public void enableShortcuts(java.util.List<java.lang.String>);
@@ -12153,15 +12165,57 @@
     method public static int HSVToColor(float[]);
     method public static int HSVToColor(int, float[]);
     method public static void RGBToHSV(int, int, int, float[]);
+    method public float alpha();
+    method public static float alpha(long);
     method public static int alpha(int);
     method public static int argb(int, int, int, int);
+    method public static int argb(float, float, float, float);
+    method public float blue();
+    method public static float blue(long);
     method public static int blue(int);
+    method public static android.graphics.ColorSpace colorSpace(long);
     method public static void colorToHSV(int, float[]);
+    method public android.graphics.Color convert(android.graphics.ColorSpace);
+    method public static long convert(int, android.graphics.ColorSpace);
+    method public static long convert(long, android.graphics.ColorSpace);
+    method public static long convert(float, float, float, float, android.graphics.ColorSpace, android.graphics.ColorSpace);
+    method public static long convert(long, android.graphics.ColorSpace.Connector);
+    method public static long convert(float, float, float, float, android.graphics.ColorSpace.Connector);
+    method public android.graphics.ColorSpace getColorSpace();
+    method public float getComponent(int);
+    method public int getComponentCount();
+    method public float[] getComponents();
+    method public android.graphics.ColorSpace.Model getModel();
+    method public float green();
+    method public static float green(long);
     method public static int green(int);
+    method public static boolean isInColorSpace(long, android.graphics.ColorSpace);
+    method public boolean isSrgb();
+    method public static boolean isSrgb(long);
+    method public boolean isWideGamut();
+    method public static boolean isWideGamut(long);
+    method public float luminance();
+    method public static float luminance(long);
     method public static float luminance(int);
+    method public long pack();
+    method public static long pack(int);
+    method public static long pack(float, float, float);
+    method public static long pack(float, float, float, float);
+    method public static long pack(float, float, float, float, android.graphics.ColorSpace);
     method public static int parseColor(java.lang.String);
+    method public float red();
+    method public static float red(long);
     method public static int red(int);
     method public static int rgb(int, int, int);
+    method public static int rgb(float, float, float);
+    method public int toArgb();
+    method public static int toArgb(long);
+    method public static android.graphics.Color valueOf(int);
+    method public static android.graphics.Color valueOf(long);
+    method public static android.graphics.Color valueOf(float, float, float);
+    method public static android.graphics.Color valueOf(float, float, float, float);
+    method public static android.graphics.Color valueOf(float, float, float, float, android.graphics.ColorSpace);
+    method public static android.graphics.Color valueOf(float[], android.graphics.ColorSpace);
     field public static final int BLACK = -16777216; // 0xff000000
     field public static final int BLUE = -16776961; // 0xff0000ff
     field public static final int CYAN = -16711681; // 0xff00ffff
@@ -12233,7 +12287,7 @@
     field public static final float[] ILLUMINANT_D65;
     field public static final float[] ILLUMINANT_D75;
     field public static final float[] ILLUMINANT_E;
-    field public static final int MAX_ID = 64; // 0x40
+    field public static final int MAX_ID = 63; // 0x3f
     field public static final int MIN_ID = -1; // 0xffffffff
   }
 
@@ -29956,6 +30010,15 @@
     field public static final int THREAD_PRIORITY_URGENT_DISPLAY = -8; // 0xfffffff8
   }
 
+  public abstract class ProxyFileDescriptorCallback {
+    ctor public ProxyFileDescriptorCallback();
+    method public void onFsync() throws android.system.ErrnoException;
+    method public long onGetSize() throws android.system.ErrnoException;
+    method public int onRead(long, int, byte[]) throws android.system.ErrnoException;
+    method public abstract void onRelease();
+    method public int onWrite(long, int, byte[]) throws android.system.ErrnoException;
+  }
+
   public class RecoverySystem {
     method public static void installPackage(android.content.Context, java.io.File) throws java.io.IOException;
     method public static void rebootWipeCache(android.content.Context) throws java.io.IOException;
@@ -30374,6 +30437,7 @@
     method public boolean isEncrypted(java.io.File);
     method public boolean isObbMounted(java.lang.String);
     method public boolean mountObb(java.lang.String, java.lang.String, android.os.storage.OnObbStateChangeListener);
+    method public android.os.ParcelFileDescriptor openProxyFileDescriptor(int, android.os.ProxyFileDescriptorCallback) throws java.io.IOException;
     method public boolean unmountObb(java.lang.String, boolean, android.os.storage.OnObbStateChangeListener);
     field public static final java.lang.String ACTION_MANAGE_STORAGE = "android.os.storage.action.MANAGE_STORAGE";
   }
@@ -32474,7 +32538,7 @@
     ctor public ContactsContract.Intents();
     field public static final java.lang.String ACTION_VOICE_SEND_MESSAGE_TO_CONTACTS = "android.provider.action.VOICE_SEND_MESSAGE_TO_CONTACTS";
     field public static final java.lang.String ATTACH_IMAGE = "com.android.contacts.action.ATTACH_IMAGE";
-    field public static final java.lang.String CONTACTS_DATABASE_CREATED = "android.provider.Contacts.DATABASE_CREATED";
+    field public static final deprecated java.lang.String CONTACTS_DATABASE_CREATED = "android.provider.Contacts.DATABASE_CREATED";
     field public static final java.lang.String EXTRA_CREATE_DESCRIPTION = "com.android.contacts.action.CREATE_DESCRIPTION";
     field public static final java.lang.String EXTRA_FORCE_CREATE = "com.android.contacts.action.FORCE_CREATE";
     field public static final java.lang.String EXTRA_RECIPIENT_CONTACT_CHAT_ID = "android.provider.extra.RECIPIENT_CONTACT_CHAT_ID";
@@ -32584,8 +32648,10 @@
   public static final class ContactsContract.ProviderStatus {
     field public static final java.lang.String CONTENT_TYPE = "vnd.android.cursor.dir/provider_status";
     field public static final android.net.Uri CONTENT_URI;
+    field public static final java.lang.String DATABASE_CREATION_TIMESTAMP = "database_creation_timestamp";
     field public static final java.lang.String STATUS = "status";
     field public static final int STATUS_BUSY = 1; // 0x1
+    field public static final android.net.Uri STATUS_CHANGE_NOTIFICATION_CONTENT_URI;
     field public static final int STATUS_EMPTY = 2; // 0x2
     field public static final int STATUS_NORMAL = 0; // 0x0
   }
@@ -35529,7 +35595,6 @@
     field public static final java.lang.String EXTRA_OFFLINE = "android.service.media.extra.OFFLINE";
     field public static final java.lang.String EXTRA_RECENT = "android.service.media.extra.RECENT";
     field public static final java.lang.String EXTRA_SUGGESTED = "android.service.media.extra.SUGGESTED";
-    field public static final java.lang.String EXTRA_SUGGESTION_KEYWORDS = "android.service.media.extra.SUGGESTION_KEYWORDS";
   }
 
   public class MediaBrowserService.Result<T> {
@@ -53430,6 +53495,133 @@
 
 }
 
+package java.lang.invoke {
+
+  public class LambdaConversionException extends java.lang.Exception {
+    ctor public LambdaConversionException();
+    ctor public LambdaConversionException(java.lang.String);
+    ctor public LambdaConversionException(java.lang.String, java.lang.Throwable);
+    ctor public LambdaConversionException(java.lang.Throwable);
+    ctor public LambdaConversionException(java.lang.String, java.lang.Throwable, boolean, boolean);
+  }
+
+  public abstract class MethodHandle {
+    method public java.lang.invoke.MethodHandle asFixedArity();
+    method public java.lang.invoke.MethodHandle asType(java.lang.invoke.MethodType);
+    method public java.lang.invoke.MethodHandle asVarargsCollector(java.lang.Class<?>);
+    method public java.lang.invoke.MethodHandle bindTo(java.lang.Object);
+    method public final java.lang.Object invoke(java.lang.Object...) throws java.lang.Throwable;
+    method public final java.lang.Object invokeExact(java.lang.Object...) throws java.lang.Throwable;
+    method public java.lang.Object invokeWithArguments(java.util.List<?>) throws java.lang.Throwable;
+    method public boolean isVarargsCollector();
+    method public java.lang.invoke.MethodType type();
+  }
+
+  public abstract interface MethodHandleInfo {
+    method public abstract java.lang.Class<?> getDeclaringClass();
+    method public abstract java.lang.invoke.MethodType getMethodType();
+    method public abstract int getModifiers();
+    method public abstract java.lang.String getName();
+    method public abstract int getReferenceKind();
+    method public default boolean isVarArgs();
+    method public static boolean refKindIsField(int);
+    method public static boolean refKindIsValid(int);
+    method public static java.lang.String refKindName(int);
+    method public static java.lang.String referenceKindToString(int);
+    method public abstract <T extends java.lang.reflect.Member> T reflectAs(java.lang.Class<T>, java.lang.invoke.MethodHandles.Lookup);
+    method public static java.lang.String toString(int, java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType);
+    field public static final int REF_getField = 1; // 0x1
+    field public static final int REF_getStatic = 2; // 0x2
+    field public static final int REF_invokeInterface = 9; // 0x9
+    field public static final int REF_invokeSpecial = 7; // 0x7
+    field public static final int REF_invokeStatic = 6; // 0x6
+    field public static final int REF_invokeVirtual = 5; // 0x5
+    field public static final int REF_newInvokeSpecial = 8; // 0x8
+    field public static final int REF_putField = 3; // 0x3
+    field public static final int REF_putStatic = 4; // 0x4
+  }
+
+  public class MethodHandles {
+    method public static java.lang.invoke.MethodHandle arrayElementGetter(java.lang.Class<?>) throws java.lang.IllegalArgumentException;
+    method public static java.lang.invoke.MethodHandle arrayElementSetter(java.lang.Class<?>) throws java.lang.IllegalArgumentException;
+    method public static java.lang.invoke.MethodHandle catchException(java.lang.invoke.MethodHandle, java.lang.Class<? extends java.lang.Throwable>, java.lang.invoke.MethodHandle);
+    method public static java.lang.invoke.MethodHandle constant(java.lang.Class<?>, java.lang.Object);
+    method public static java.lang.invoke.MethodHandle dropArguments(java.lang.invoke.MethodHandle, int, java.util.List<java.lang.Class<?>>);
+    method public static java.lang.invoke.MethodHandle dropArguments(java.lang.invoke.MethodHandle, int, java.lang.Class<?>...);
+    method public static java.lang.invoke.MethodHandle exactInvoker(java.lang.invoke.MethodType);
+    method public static java.lang.invoke.MethodHandle filterReturnValue(java.lang.invoke.MethodHandle, java.lang.invoke.MethodHandle);
+    method public static java.lang.invoke.MethodHandle guardWithTest(java.lang.invoke.MethodHandle, java.lang.invoke.MethodHandle, java.lang.invoke.MethodHandle);
+    method public static java.lang.invoke.MethodHandle identity(java.lang.Class<?>);
+    method public static java.lang.invoke.MethodHandle invoker(java.lang.invoke.MethodType);
+    method public static java.lang.invoke.MethodHandles.Lookup lookup();
+    method public static java.lang.invoke.MethodHandle permuteArguments(java.lang.invoke.MethodHandle, java.lang.invoke.MethodType, int...);
+    method public static java.lang.invoke.MethodHandles.Lookup publicLookup();
+    method public static java.lang.invoke.MethodHandle throwException(java.lang.Class<?>, java.lang.Class<? extends java.lang.Throwable>);
+  }
+
+  public static final class MethodHandles.Lookup {
+    method public java.lang.invoke.MethodHandle bind(java.lang.Object, java.lang.String, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findConstructor(java.lang.Class<?>, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findGetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findSetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findSpecial(java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findStatic(java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandle findStaticGetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findStaticSetter(java.lang.Class<?>, java.lang.String, java.lang.Class<?>) throws java.lang.IllegalAccessException, java.lang.NoSuchFieldException;
+    method public java.lang.invoke.MethodHandle findVirtual(java.lang.Class<?>, java.lang.String, java.lang.invoke.MethodType) throws java.lang.IllegalAccessException, java.lang.NoSuchMethodException;
+    method public java.lang.invoke.MethodHandles.Lookup in(java.lang.Class<?>);
+    method public java.lang.Class<?> lookupClass();
+    method public int lookupModes();
+    method public void throwMakeAccessException(java.lang.String, java.lang.Object) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflect(java.lang.reflect.Method) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectConstructor(java.lang.reflect.Constructor<?>) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectGetter(java.lang.reflect.Field) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectSetter(java.lang.reflect.Field) throws java.lang.IllegalAccessException;
+    method public java.lang.invoke.MethodHandle unreflectSpecial(java.lang.reflect.Method, java.lang.Class<?>) throws java.lang.IllegalAccessException;
+    field public static final int PACKAGE = 8; // 0x8
+    field public static final int PRIVATE = 2; // 0x2
+    field public static final int PROTECTED = 4; // 0x4
+    field public static final int PUBLIC = 1; // 0x1
+  }
+
+  public final class MethodType implements java.io.Serializable {
+    method public java.lang.invoke.MethodType appendParameterTypes(java.lang.Class<?>...);
+    method public java.lang.invoke.MethodType appendParameterTypes(java.util.List<java.lang.Class<?>>);
+    method public java.lang.invoke.MethodType changeParameterType(int, java.lang.Class<?>);
+    method public java.lang.invoke.MethodType changeReturnType(java.lang.Class<?>);
+    method public java.lang.invoke.MethodType dropParameterTypes(int, int);
+    method public java.lang.invoke.MethodType erase();
+    method public static java.lang.invoke.MethodType fromMethodDescriptorString(java.lang.String, java.lang.ClassLoader) throws java.lang.IllegalArgumentException, java.lang.TypeNotPresentException;
+    method public java.lang.invoke.MethodType generic();
+    method public static java.lang.invoke.MethodType genericMethodType(int, boolean);
+    method public static java.lang.invoke.MethodType genericMethodType(int);
+    method public boolean hasPrimitives();
+    method public boolean hasWrappers();
+    method public java.lang.invoke.MethodType insertParameterTypes(int, java.lang.Class<?>...);
+    method public java.lang.invoke.MethodType insertParameterTypes(int, java.util.List<java.lang.Class<?>>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.Class<?>[]);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.util.List<java.lang.Class<?>>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.Class<?>, java.lang.Class<?>...);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.Class<?>);
+    method public static java.lang.invoke.MethodType methodType(java.lang.Class<?>, java.lang.invoke.MethodType);
+    method public java.lang.Class<?>[] parameterArray();
+    method public int parameterCount();
+    method public java.util.List<java.lang.Class<?>> parameterList();
+    method public java.lang.Class<?> parameterType(int);
+    method public java.lang.Class<?> returnType();
+    method public java.lang.String toMethodDescriptorString();
+    method public java.lang.invoke.MethodType unwrap();
+    method public java.lang.invoke.MethodType wrap();
+  }
+
+  public class WrongMethodTypeException extends java.lang.RuntimeException {
+    ctor public WrongMethodTypeException();
+    ctor public WrongMethodTypeException(java.lang.String);
+  }
+
+}
+
 package java.lang.ref {
 
   public class PhantomReference<T> extends java.lang.ref.Reference {
diff --git a/cmds/app_process/app_main.cpp b/cmds/app_process/app_main.cpp
index d5580ac..0ea141c 100644
--- a/cmds/app_process/app_main.cpp
+++ b/cmds/app_process/app_main.cpp
@@ -184,10 +184,6 @@
 
 int main(int argc, char* const argv[])
 {
-    if (prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0) < 0) {
-        LOG_ALWAYS_FATAL("PR_SET_NO_NEW_PRIVS failed: %s", strerror(errno));
-    }
-
     if (!LOG_NDEBUG) {
       String8 argv_String;
       for (int i = 0; i < argc; ++i) {
diff --git a/cmds/svc/src/com/android/commands/svc/NfcCommand.java b/cmds/svc/src/com/android/commands/svc/NfcCommand.java
index 8e9791f..02a92b9 100644
--- a/cmds/svc/src/com/android/commands/svc/NfcCommand.java
+++ b/cmds/svc/src/com/android/commands/svc/NfcCommand.java
@@ -58,7 +58,8 @@
                 IPackageManager pm = IPackageManager.Stub.asInterface(
                         ServiceManager.getService("package"));
                 try {
-                    if (pm.hasSystemFeature(PackageManager.FEATURE_NFC, 0)) {
+                    if (pm.hasSystemFeature(PackageManager.FEATURE_NFC, 0) ||
+			pm.hasSystemFeature(PackageManager.FEATURE_NFC_HOST_CARD_EMULATION, 0)) {
                         INfcAdapter nfc = INfcAdapter.Stub
                                 .asInterface(ServiceManager.getService(Context.NFC_SERVICE));
                         try {
diff --git a/core/java/android/accessibilityservice/AccessibilityServiceInfo.java b/core/java/android/accessibilityservice/AccessibilityServiceInfo.java
index 07a8253..b76aeb7 100644
--- a/core/java/android/accessibilityservice/AccessibilityServiceInfo.java
+++ b/core/java/android/accessibilityservice/AccessibilityServiceInfo.java
@@ -414,9 +414,9 @@
     public int flags;
 
     /**
-     * The unique string Id to identify the accessibility service.
+     * The component name the accessibility service.
      */
-    private String mId;
+    private ComponentName mComponentName;
 
     /**
      * The Service that implements this accessibility service component.
@@ -464,7 +464,7 @@
     public AccessibilityServiceInfo(ResolveInfo resolveInfo, Context context)
             throws XmlPullParserException, IOException {
         ServiceInfo serviceInfo = resolveInfo.serviceInfo;
-        mId = new ComponentName(serviceInfo.packageName, serviceInfo.name).flattenToShortString();
+        mComponentName = new ComponentName(serviceInfo.packageName, serviceInfo.name);
         mResolveInfo = resolveInfo;
 
         XmlResourceParser parser = null;
@@ -574,7 +574,14 @@
      * @hide
      */
     public void setComponentName(ComponentName component) {
-        mId = component.flattenToShortString();
+        mComponentName = component;
+    }
+
+    /**
+     * @hide
+     */
+    public ComponentName getComponentName() {
+        return mComponentName;
     }
 
     /**
@@ -585,7 +592,7 @@
      * @return The id.
      */
     public String getId() {
-        return mId;
+        return mComponentName.flattenToShortString();
     }
 
     /**
@@ -715,7 +722,7 @@
         parcel.writeInt(feedbackType);
         parcel.writeLong(notificationTimeout);
         parcel.writeInt(flags);
-        parcel.writeString(mId);
+        parcel.writeParcelable(mComponentName, flagz);
         parcel.writeParcelable(mResolveInfo, 0);
         parcel.writeString(mSettingsActivityName);
         parcel.writeInt(mCapabilities);
@@ -729,7 +736,7 @@
         feedbackType = parcel.readInt();
         notificationTimeout = parcel.readLong();
         flags = parcel.readInt();
-        mId = parcel.readString();
+        mComponentName = parcel.readParcelable(this.getClass().getClassLoader());
         mResolveInfo = parcel.readParcelable(null);
         mSettingsActivityName = parcel.readString();
         mCapabilities = parcel.readInt();
@@ -739,7 +746,7 @@
 
     @Override
     public int hashCode() {
-        return 31 * 1 + ((mId == null) ? 0 : mId.hashCode());
+        return 31 * 1 + ((mComponentName == null) ? 0 : mComponentName.hashCode());
     }
 
     @Override
@@ -754,11 +761,11 @@
             return false;
         }
         AccessibilityServiceInfo other = (AccessibilityServiceInfo) obj;
-        if (mId == null) {
-            if (other.mId != null) {
+        if (mComponentName == null) {
+            if (other.mComponentName != null) {
                 return false;
             }
-        } else if (!mId.equals(other.mId)) {
+        } else if (!mComponentName.equals(other.mComponentName)) {
             return false;
         }
         return true;
@@ -777,7 +784,7 @@
         stringBuilder.append(", ");
         appendFlags(stringBuilder, flags);
         stringBuilder.append(", ");
-        stringBuilder.append("id: ").append(mId);
+        stringBuilder.append("id: ").append(getId());
         stringBuilder.append(", ");
         stringBuilder.append("resolveInfo: ").append(mResolveInfo);
         stringBuilder.append(", ");
diff --git a/core/java/android/app/ActivityManager.java b/core/java/android/app/ActivityManager.java
index f1f6e7b..2e3c100 100644
--- a/core/java/android/app/ActivityManager.java
+++ b/core/java/android/app/ActivityManager.java
@@ -2176,6 +2176,12 @@
             dest.writeParcelable(mContentInsets, 0);
         }
 
+        @Override
+        public String toString() {
+            return "TaskSnapshot{mSnapshot=" + mSnapshot + " mOrientation=" + mOrientation
+                    + " mContentInsets=" + mContentInsets.toShortString();
+        }
+
         public static final Creator<TaskSnapshot> CREATOR = new Creator<TaskSnapshot>() {
             public TaskSnapshot createFromParcel(Parcel source) {
                 return new TaskSnapshot(source);
diff --git a/core/java/android/app/Fragment.java b/core/java/android/app/Fragment.java
index 10ab2bc..62d6898 100644
--- a/core/java/android/app/Fragment.java
+++ b/core/java/android/app/Fragment.java
@@ -102,15 +102,19 @@
         mSavedFragmentState = in.readBundle();
     }
 
-    public Fragment instantiate(FragmentHostCallback host, Fragment parent,
-            FragmentManagerNonConfig childNonConfig) {
+    public Fragment instantiate(FragmentHostCallback host, FragmentContainer container,
+            Fragment parent, FragmentManagerNonConfig childNonConfig) {
         if (mInstance == null) {
             final Context context = host.getContext();
             if (mArguments != null) {
                 mArguments.setClassLoader(context.getClassLoader());
             }
 
-            mInstance = Fragment.instantiate(context, mClassName, mArguments);
+            if (container != null) {
+                mInstance = container.instantiate(context, mClassName, mArguments);
+            } else {
+                mInstance = Fragment.instantiate(context, mClassName, mArguments);
+            }
 
             if (mSavedFragmentState != null) {
                 mSavedFragmentState.setClassLoader(context.getClassLoader());
diff --git a/core/java/android/app/FragmentContainer.java b/core/java/android/app/FragmentContainer.java
index b2e0300..6ed54dc 100644
--- a/core/java/android/app/FragmentContainer.java
+++ b/core/java/android/app/FragmentContainer.java
@@ -18,6 +18,8 @@
 
 import android.annotation.IdRes;
 import android.annotation.Nullable;
+import android.content.Context;
+import android.os.Bundle;
 import android.view.View;
 
 /**
@@ -35,4 +37,13 @@
      * Return {@code true} if the container holds any view.
      */
     public abstract boolean onHasView();
+
+    /**
+     * Creates an instance of the specified fragment, can be overridden to construct fragments
+     * with dependencies, or change the fragment being constructed. By default just calls
+     * {@link Fragment#instantiate(Context, String, Bundle)}.
+     */
+    public Fragment instantiate(Context context, String className, Bundle arguments) {
+        return Fragment.instantiate(context, className, arguments);
+    }
 }
diff --git a/core/java/android/app/FragmentManager.java b/core/java/android/app/FragmentManager.java
index efd2b69..44f1322 100644
--- a/core/java/android/app/FragmentManager.java
+++ b/core/java/android/app/FragmentManager.java
@@ -1984,11 +1984,13 @@
                 if (startIndex != recordNum) {
                     executeOpsTogether(records, isRecordPop, startIndex, recordNum);
                 }
-                // execute all unoptimized together
-                int optimizeEnd;
-                for (optimizeEnd = recordNum + 1; optimizeEnd < numRecords; optimizeEnd++) {
-                    if (records.get(optimizeEnd).mAllowOptimization) {
-                        break;
+                // execute all unoptimized pop operations together or one add operation
+                int optimizeEnd = recordNum + 1;
+                if (isRecordPop.get(recordNum)) {
+                    while (optimizeEnd < numRecords
+                            && isRecordPop.get(optimizeEnd)
+                            && !records.get(optimizeEnd).mAllowOptimization) {
+                        optimizeEnd++;
                     }
                 }
                 executeOpsTogether(records, isRecordPop, recordNum, optimizeEnd);
@@ -2651,7 +2653,7 @@
                 if (childNonConfigs != null && i < childNonConfigs.size()) {
                     childNonConfig = childNonConfigs.get(i);
                 }
-                Fragment f = fs.instantiate(mHost, mParent, childNonConfig);
+                Fragment f = fs.instantiate(mHost, mContainer, mParent, childNonConfig);
                 if (DEBUG) Log.v(TAG, "restoreAllState: active #" + i + ": " + f);
                 mActive.add(f);
                 // Now that the fragment is instantiated (or came from being
@@ -3270,7 +3272,7 @@
                 + Integer.toHexString(id) + " fname=" + fname
                 + " existing=" + fragment);
         if (fragment == null) {
-            fragment = Fragment.instantiate(context, fname);
+            fragment = mContainer.instantiate(context, fname, null);
             fragment.mFromLayout = true;
             fragment.mFragmentId = id != 0 ? id : containerId;
             fragment.mContainerId = containerId;
diff --git a/core/java/android/app/FragmentTransition.java b/core/java/android/app/FragmentTransition.java
index 6d57cd4..80a5aac 100644
--- a/core/java/android/app/FragmentTransition.java
+++ b/core/java/android/app/FragmentTransition.java
@@ -188,7 +188,10 @@
     private static void configureTransitionsOptimized(FragmentManagerImpl fragmentManager,
             int containerId, FragmentContainerTransition fragments,
             View nonExistentView, ArrayMap<String, String> nameOverrides) {
-        ViewGroup sceneRoot = (ViewGroup) fragmentManager.mContainer.onFindViewById(containerId);
+        ViewGroup sceneRoot = null;
+        if (fragmentManager.mContainer.onHasView()) {
+            sceneRoot = (ViewGroup) fragmentManager.mContainer.onFindViewById(containerId);
+        }
         if (sceneRoot == null) {
             return;
         }
@@ -257,7 +260,10 @@
     private static void configureTransitionsUnoptimized(FragmentManagerImpl fragmentManager,
             int containerId, FragmentContainerTransition fragments,
             View nonExistentView, ArrayMap<String, String> nameOverrides) {
-        ViewGroup sceneRoot = (ViewGroup) fragmentManager.mContainer.onFindViewById(containerId);
+        ViewGroup sceneRoot = null;
+        if (fragmentManager.mContainer.onHasView()) {
+            sceneRoot = (ViewGroup) fragmentManager.mContainer.onFindViewById(containerId);
+        }
         if (sceneRoot == null) {
             return;
         }
diff --git a/core/java/android/app/IActivityManager.aidl b/core/java/android/app/IActivityManager.aidl
index 21ae853..5824c32 100644
--- a/core/java/android/app/IActivityManager.aidl
+++ b/core/java/android/app/IActivityManager.aidl
@@ -31,7 +31,6 @@
 import android.app.ITaskStackListener;
 import android.app.IUiAutomationConnection;
 import android.app.IUidObserver;
-
 import android.app.IUserSwitchObserver;
 import android.app.Notification;
 import android.app.PendingIntent;
diff --git a/core/java/android/app/ITaskStackListener.aidl b/core/java/android/app/ITaskStackListener.aidl
index ef997c9..6deedb6 100644
--- a/core/java/android/app/ITaskStackListener.aidl
+++ b/core/java/android/app/ITaskStackListener.aidl
@@ -102,4 +102,9 @@
      * been locked.
      */
     void onTaskProfileLocked(int taskId, int userId);
+
+    /**
+     * Called when a task snapshot got updated.
+     */
+    void onTaskSnapshotChanged(int taskId, in ActivityManager.TaskSnapshot snapshot);
 }
diff --git a/core/java/android/app/Notification.java b/core/java/android/app/Notification.java
index da57873..ab0b68d 100644
--- a/core/java/android/app/Notification.java
+++ b/core/java/android/app/Notification.java
@@ -988,6 +988,32 @@
      */
     public static final String EXTRA_CONTAINS_CUSTOM_VIEW = "android.contains.customView";
 
+    /**
+     * {@link #extras} key: the audio contents of this notification.
+     *
+     * This is for use when rendering the notification on an audio-focused interface;
+     * the audio contents are a complete sound sample that contains the contents/body of the
+     * notification. This may be used in substitute of a Text-to-Speech reading of the
+     * notification. For example if the notification represents a voice message this should point
+     * to the audio of that message.
+     *
+     * The data stored under this key should be a String representation of a Uri that contains the
+     * audio contents in one of the following formats: WAV, PCM 16-bit, AMR-WB.
+     *
+     * This extra is unnecessary if you are using {@code MessagingStyle} since each {@code Message}
+     * has a field for holding data URI. That field can be used for audio.
+     * See {@code Message#setData}.
+     *
+     * Example usage:
+     * <pre>
+     * {@code
+     * Notification.Builder myBuilder = (build your Notification as normal);
+     * myBuilder.getExtras().putString(EXTRA_AUDIO_CONTENTS_URI, myAudioUri.toString());
+     * }
+     * </pre>
+     */
+    public static final String EXTRA_AUDIO_CONTENTS_URI = "android.audioContents";
+
     /** @hide */
     @SystemApi
     public static final String EXTRA_SUBSTITUTE_APP_NAME = "android.substName";
@@ -1007,6 +1033,21 @@
      * to attach actions.
      */
     public static class Action implements Parcelable {
+        /**
+         * {@link #extras} key: Keys to a {@link Parcelable} {@link ArrayList} of
+         * {@link RemoteInput}s.
+         *
+         * This is intended for {@link RemoteInput}s that only accept data, meaning
+         * {@link RemoteInput#getAllowFreeFormInput} is false, {@link RemoteInput#getChoices}
+         * is null or empty, and {@link RemoteInput#getAllowedDataTypes is non-null and not
+         * empty. These {@link RemoteInput}s will be ignored by devices that do not
+         * support non-text-based {@link RemoteInput}s. See {@link Builder#build}.
+         *
+         * You can test if a RemoteInput matches these constraints using
+         * {@link RemoteInput#isDataOnly}.
+         */
+        private static final String EXTRA_DATA_ONLY_INPUTS = "android.extra.DATA_ONLY_INPUTS";
+
         private final Bundle mExtras;
         private Icon mIcon;
         private final RemoteInput[] mRemoteInputs;
@@ -1097,13 +1138,28 @@
 
         /**
          * Get the list of inputs to be collected from the user when this action is sent.
-         * May return null if no remote inputs were added.
+         * May return null if no remote inputs were added. Only returns inputs which accept
+         * a text input. For inputs which only accept data use {@link #getDataOnlyRemoteInputs}.
          */
         public RemoteInput[] getRemoteInputs() {
             return mRemoteInputs;
         }
 
         /**
+         * Get the list of inputs to be collected from the user that ONLY accept data when this
+         * action is sent. These remote inputs are guaranteed to return true on a call to
+         * {@link RemoteInput#isDataOnly}.
+         *
+         * May return null if no data-only remote inputs were added.
+         *
+         * This method exists so that legacy RemoteInput collectors that pre-date the addition
+         * of non-textual RemoteInputs do not access these remote inputs.
+         */
+        public RemoteInput[] getDataOnlyRemoteInputs() {
+            return (RemoteInput[]) mExtras.getParcelableArray(EXTRA_DATA_ONLY_INPUTS);
+        }
+
+        /**
          * Builder class for {@link Action} objects.
          */
         public static final class Builder {
@@ -1226,9 +1282,32 @@
              * @return the built action
              */
             public Action build() {
-                RemoteInput[] remoteInputs = mRemoteInputs != null
-                        ? mRemoteInputs.toArray(new RemoteInput[mRemoteInputs.size()]) : null;
-                return new Action(mIcon, mTitle, mIntent, mExtras, remoteInputs,
+                ArrayList<RemoteInput> dataOnlyInputs = new ArrayList<>();
+                RemoteInput[] previousDataInputs =
+                    (RemoteInput[]) mExtras.getParcelableArray(EXTRA_DATA_ONLY_INPUTS);
+                if (previousDataInputs == null) {
+                    for (RemoteInput input : previousDataInputs) {
+                        dataOnlyInputs.add(input);
+                    }
+                }
+                List<RemoteInput> textInputs = new ArrayList<>();
+                if (mRemoteInputs != null) {
+                    for (RemoteInput input : mRemoteInputs) {
+                        if (input.isDataOnly()) {
+                            dataOnlyInputs.add(input);
+                        } else {
+                            textInputs.add(input);
+                        }
+                    }
+                }
+                if (!dataOnlyInputs.isEmpty()) {
+                    RemoteInput[] dataInputsArr =
+                            dataOnlyInputs.toArray(new RemoteInput[dataOnlyInputs.size()]);
+                    mExtras.putParcelableArray(EXTRA_DATA_ONLY_INPUTS, dataInputsArr);
+                }
+                RemoteInput[] textInputsArr = textInputs.isEmpty()
+                        ? null : textInputs.toArray(new RemoteInput[textInputs.size()]);
+                return new Action(mIcon, mTitle, mIntent, mExtras, textInputsArr,
                         mAllowGeneratedReplies);
             }
         }
@@ -1521,7 +1600,7 @@
             /**
              * Get a hint that this Action should be displayed inline.
              *
-             * @return {@code true} if the Action should be displayed inline, {@code false} 
+             * @return {@code true} if the Action should be displayed inline, {@code false}
              *         otherwise. The default value is {@code false} if this was never set.
              */
             public boolean getHintDisplayActionInline() {
@@ -6975,6 +7054,142 @@
     }
 
     /**
+     * <p>Helper class to add Android TV extensions to notifications. To create a notification
+     * with a TV extension:
+     *
+     * <ol>
+     *  <li>Create an {@link Notification.Builder}, setting any desired properties.
+     *  <li>Create a {@link TvExtender}.
+     *  <li>Set TV-specific properties using the {@code set} methods of
+     *  {@link TvExtender}.
+     *  <li>Call {@link Notification.Builder#extend(Notification.Extender)}
+     *  to apply the extension to a notification.
+     * </ol>
+     *
+     * <pre class="prettyprint">
+     * Notification notification = new Notification.Builder(context)
+     *         ...
+     *         .extend(new TvExtender()
+     *                 .set*(...))
+     *         .build();
+     * </pre>
+     *
+     * <p>TV extensions can be accessed on an existing notification by using the
+     * {@code TvExtender(Notification)} constructor, and then using the {@code get} methods
+     * to access values.
+     *
+     * @hide
+     */
+    @SystemApi
+    public static final class TvExtender implements Extender {
+        private static final String TAG = "TvExtender";
+
+        private static final String EXTRA_TV_EXTENDER = "android.tv.EXTENSIONS";
+        private static final String EXTRA_FLAGS = "flags";
+        private static final String EXTRA_CONTENT_INTENT = "content_intent";
+        private static final String EXTRA_DELETE_INTENT = "delete_intent";
+
+        // Flags bitwise-ored to mFlags
+        private static final int FLAG_AVAILABLE_ON_TV = 0x1;
+
+        private int mFlags;
+        private PendingIntent mContentIntent;
+        private PendingIntent mDeleteIntent;
+
+        /**
+         * Create a {@link TvExtender} with default options.
+         */
+        public TvExtender() {
+            mFlags = FLAG_AVAILABLE_ON_TV;
+        }
+
+        /**
+         * Create a {@link TvExtender} from the TvExtender options of an existing Notification.
+         *
+         * @param notif The notification from which to copy options.
+         */
+        public TvExtender(Notification notif) {
+            Bundle bundle = notif.extras == null ?
+                null : notif.extras.getBundle(EXTRA_TV_EXTENDER);
+            if (bundle != null) {
+                mFlags = bundle.getInt(EXTRA_FLAGS);
+                mContentIntent = bundle.getParcelable(EXTRA_CONTENT_INTENT);
+                mDeleteIntent = bundle.getParcelable(EXTRA_DELETE_INTENT);
+            }
+        }
+
+        /**
+         * Apply a TV extension to a notification that is being built. This is typically called by
+         * the {@link Notification.Builder#extend(Notification.Extender)}
+         * method of {@link Notification.Builder}.
+         */
+        @Override
+        public Notification.Builder extend(Notification.Builder builder) {
+            Bundle bundle = new Bundle();
+
+            bundle.putInt(EXTRA_FLAGS, mFlags);
+            if (mContentIntent != null) {
+                bundle.putParcelable(EXTRA_CONTENT_INTENT, mContentIntent);
+            }
+
+            if (mDeleteIntent != null) {
+                bundle.putParcelable(EXTRA_DELETE_INTENT, mDeleteIntent);
+            }
+
+            builder.getExtras().putBundle(EXTRA_TV_EXTENDER, bundle);
+            return builder;
+        }
+
+        /**
+         * Returns true if this notification should be shown on TV. This method return true
+         * if the notification was extended with a TvExtender.
+         */
+        public boolean isAvailableOnTv() {
+            return (mFlags & FLAG_AVAILABLE_ON_TV) != 0;
+        }
+
+        /**
+         * Supplies a {@link PendingIntent} to be sent when the notification is selected on TV.
+         * If provided, it is used instead of the content intent specified
+         * at the level of Notification.
+         */
+        public TvExtender setContentIntent(PendingIntent intent) {
+            mContentIntent = intent;
+            return this;
+        }
+
+        /**
+         * Returns the TV-specific content intent.  If this method returns null, the
+         * main content intent on the notification should be used.
+         *
+         * @see {@link Notification#contentIntent}
+         */
+        public PendingIntent getContentIntent() {
+            return mContentIntent;
+        }
+
+        /**
+         * Supplies a {@link PendingIntent} to send when the notification is cleared explicitly
+         * by the user on TV.  If provided, it is used instead of the delete intent specified
+         * at the level of Notification.
+         */
+        public TvExtender setDeleteIntent(PendingIntent intent) {
+            mDeleteIntent = intent;
+            return this;
+        }
+
+        /**
+         * Returns the TV-specific delete intent.  If this method returns null, the
+         * main delete intent on the notification should be used.
+         *
+         * @see {@link Notification#deleteIntent}
+         */
+        public PendingIntent getDeleteIntent() {
+            return mDeleteIntent;
+        }
+    }
+
+    /**
      * Get an array of Notification objects from a parcelable array bundle field.
      * Update the bundle to have a typed array so fetches in the future don't need
      * to do an array copy.
diff --git a/core/java/android/app/RemoteInput.java b/core/java/android/app/RemoteInput.java
index 11420c5..d1dc859 100644
--- a/core/java/android/app/RemoteInput.java
+++ b/core/java/android/app/RemoteInput.java
@@ -19,9 +19,14 @@
 import android.content.ClipData;
 import android.content.ClipDescription;
 import android.content.Intent;
+import android.net.Uri;
 import android.os.Bundle;
 import android.os.Parcel;
 import android.os.Parcelable;
+import android.util.ArraySet;
+import java.util.HashMap;
+import java.util.Map;
+import java.util.Set;
 
 /**
  * A {@code RemoteInput} object specifies input to be collected from a user to be passed along with
@@ -61,9 +66,13 @@
     /** Label used to denote the clip data type used for remote input transport */
     public static final String RESULTS_CLIP_LABEL = "android.remoteinput.results";
 
-    /** Extra added to a clip data intent object to hold the results bundle. */
+    /** Extra added to a clip data intent object to hold the text results bundle. */
     public static final String EXTRA_RESULTS_DATA = "android.remoteinput.resultsData";
 
+    /** Extra added to a clip data intent object to hold the data results bundle. */
+    private static final String EXTRA_DATA_TYPE_RESULTS_DATA =
+            "android.remoteinput.dataTypeResultsData";
+
     // Flags bitwise-ored to mFlags
     private static final int FLAG_ALLOW_FREE_FORM_INPUT = 0x1;
 
@@ -75,14 +84,16 @@
     private final CharSequence[] mChoices;
     private final int mFlags;
     private final Bundle mExtras;
+    private final ArraySet<String> mAllowedDataTypes;
 
     private RemoteInput(String resultKey, CharSequence label, CharSequence[] choices,
-            int flags, Bundle extras) {
+            int flags, Bundle extras, ArraySet<String> allowedDataTypes) {
         this.mResultKey = resultKey;
         this.mLabel = label;
         this.mChoices = choices;
         this.mFlags = flags;
         this.mExtras = extras;
+        this.mAllowedDataTypes = allowedDataTypes;
     }
 
     /**
@@ -107,6 +118,21 @@
         return mChoices;
     }
 
+    public Set<String> getAllowedDataTypes() {
+        return mAllowedDataTypes;
+    }
+
+    /**
+     * Returns true if the input only accepts data, meaning {@link #getAllowFreeFormInput}
+     * is false, {@link #getChoices} is null or empty, and {@link #getAllowedDataTypes is
+     * non-null and not empty.
+     */
+    public boolean isDataOnly() {
+        return !getAllowFreeFormInput()
+                && (getChoices() == null || getChoices().length == 0)
+                && !getAllowedDataTypes().isEmpty();
+    }
+
     /**
      * Get whether or not users can provide an arbitrary value for
      * input. If you set this to {@code false}, users must select one of the
@@ -133,6 +159,7 @@
         private CharSequence[] mChoices;
         private int mFlags = DEFAULT_FLAGS;
         private Bundle mExtras = new Bundle();
+        private final ArraySet<String> mAllowedDataTypes = new ArraySet<>();
 
         /**
          * Create a builder object for {@link RemoteInput} objects.
@@ -177,14 +204,34 @@
         /**
          * Specifies whether the user can provide arbitrary values.
          *
-         * @param allowFreeFormInput The default is {@code true}.
-         *         If you specify {@code false}, you must provide a non-null
-         *         and non-empty array to {@link #setChoices} or an
+         * @param mimeType A mime type that results are allowed to come in.
+         *         Be aware that text results (see {@link #setAllowFreeFormInput}
+         *         are allowed by default. If you do not want text results you will have to
+         *         pass false to {@code setAllowFreeFormInput}.
+         * @param doAllow Whether the mime type should be allowed or not.
+         * @return this object for method chaining
+         */
+        public Builder setAllowDataType(String mimeType, boolean doAllow) {
+            if (doAllow) {
+                mAllowedDataTypes.add(mimeType);
+            } else {
+                mAllowedDataTypes.remove(mimeType);
+            }
+            return this;
+        }
+
+        /**
+         * Specifies whether the user can provide arbitrary text values.
+         *
+         * @param allowFreeFormTextInput The default is {@code true}.
+         *         If you specify {@code false}, you must either provide a non-null
+         *         and non-empty array to {@link #setChoices}, or enable a data result
+         *         in {@code setAllowDataType}. Otherwise an
          *         {@link IllegalArgumentException} is thrown.
          * @return this object for method chaining
          */
-        public Builder setAllowFreeFormInput(boolean allowFreeFormInput) {
-            setFlag(mFlags, allowFreeFormInput);
+        public Builder setAllowFreeFormInput(boolean allowFreeFormTextInput) {
+            setFlag(mFlags, allowFreeFormTextInput);
             return this;
         }
 
@@ -224,7 +271,8 @@
          * object.
          */
         public RemoteInput build() {
-            return new RemoteInput(mResultKey, mLabel, mChoices, mFlags, mExtras);
+            return new RemoteInput(
+                    mResultKey, mLabel, mChoices, mFlags, mExtras, mAllowedDataTypes);
         }
     }
 
@@ -234,32 +282,68 @@
         mChoices = in.readCharSequenceArray();
         mFlags = in.readInt();
         mExtras = in.readBundle();
+        mAllowedDataTypes = (ArraySet<String>) in.readArraySet(null);
     }
 
     /**
-     * Get the remote input results bundle from an intent. The returned Bundle will
-     * contain a key/value for every result key populated by remote input collector.
-     * Use the {@link Bundle#getCharSequence(String)} method to retrieve a value.
+     * Similar as {@link #getResultsFromIntent} but retrieves data results for a
+     * specific RemoteInput result. To retrieve a value use:
+     * <pre>
+     * {@code
+     * Map<String, Uri> results =
+     *     RemoteInput.getDataResultsFromIntent(intent, REMOTE_INPUT_KEY);
+     * if (results != null) {
+     *   Uri data = results.get(MIME_TYPE_OF_INTEREST);
+     * }
+     * }
+     * </pre>
+     * @param intent The intent object that fired in response to an action or content intent
+     *               which also had one or more remote input requested.
+     * @param remoteInputResultKey The result key for the RemoteInput you want results for.
+     */
+    public static Map<String, Uri> getDataResultsFromIntent(
+            Intent intent, String remoteInputResultKey) {
+        Intent clipDataIntent = getClipDataIntentFromIntent(intent);
+        if (clipDataIntent == null) {
+            return null;
+        }
+        Map<String, Uri> results = new HashMap<>();
+        Bundle extras = clipDataIntent.getExtras();
+        for (String key : extras.keySet()) {
+          if (key.startsWith(EXTRA_DATA_TYPE_RESULTS_DATA)) {
+              String mimeType = key.substring(EXTRA_DATA_TYPE_RESULTS_DATA.length());
+              if (mimeType == null || mimeType.isEmpty()) {
+                  continue;
+              }
+              Bundle bundle = clipDataIntent.getBundleExtra(key);
+              String uriStr = bundle.getString(remoteInputResultKey);
+              if (uriStr == null || uriStr.isEmpty()) {
+                  continue;
+              }
+              results.put(mimeType, Uri.parse(uriStr));
+          }
+        }
+        return results.isEmpty() ? null : results;
+    }
+
+    /**
+     * Get the remote input text results bundle from an intent. The returned Bundle will
+     * contain a key/value for every result key populated with text by remote input collector.
+     * Use the {@link Bundle#getCharSequence(String)} method to retrieve a value. For non-text
+     * results use {@link #getDataResultsFromIntent}.
      * @param intent The intent object that fired in response to an action or content intent
      *               which also had one or more remote input requested.
      */
     public static Bundle getResultsFromIntent(Intent intent) {
-        ClipData clipData = intent.getClipData();
-        if (clipData == null) {
+        Intent clipDataIntent = getClipDataIntentFromIntent(intent);
+        if (clipDataIntent == null) {
             return null;
         }
-        ClipDescription clipDescription = clipData.getDescription();
-        if (!clipDescription.hasMimeType(ClipDescription.MIMETYPE_TEXT_INTENT)) {
-            return null;
-        }
-        if (clipDescription.getLabel().equals(RESULTS_CLIP_LABEL)) {
-            return clipData.getItemAt(0).getIntent().getExtras().getParcelable(EXTRA_RESULTS_DATA);
-        }
-        return null;
+        return clipDataIntent.getExtras().getParcelable(EXTRA_RESULTS_DATA);
     }
 
     /**
-     * Populate an intent object with the results gathered from remote input. This method
+     * Populate an intent object with the text results gathered from remote input. This method
      * should only be called by remote input collection services when sending results to a
      * pending intent.
      * @param remoteInputs The remote inputs for which results are being provided
@@ -267,20 +351,61 @@
      *               field of the intent will be modified to contain the results.
      * @param results A bundle holding the remote input results. This bundle should
      *                be populated with keys matching the result keys specified in
-     *                {@code remoteInputs} with values being the result per key.
+     *                {@code remoteInputs} with values being the CharSequence results per key.
      */
     public static void addResultsToIntent(RemoteInput[] remoteInputs, Intent intent,
             Bundle results) {
-        Bundle resultsBundle = new Bundle();
+        Intent clipDataIntent = getClipDataIntentFromIntent(intent);
+        if (clipDataIntent == null) {
+            clipDataIntent = new Intent();  // First time we've added a result.
+        }
+        Bundle resultsBundle = clipDataIntent.getBundleExtra(EXTRA_RESULTS_DATA);
+        if (resultsBundle == null) {
+            resultsBundle = new Bundle();
+        }
         for (RemoteInput remoteInput : remoteInputs) {
             Object result = results.get(remoteInput.getResultKey());
             if (result instanceof CharSequence) {
                 resultsBundle.putCharSequence(remoteInput.getResultKey(), (CharSequence) result);
             }
         }
-        Intent clipIntent = new Intent();
-        clipIntent.putExtra(EXTRA_RESULTS_DATA, resultsBundle);
-        intent.setClipData(ClipData.newIntent(RESULTS_CLIP_LABEL, clipIntent));
+        clipDataIntent.putExtra(EXTRA_RESULTS_DATA, resultsBundle);
+        intent.setClipData(ClipData.newIntent(RESULTS_CLIP_LABEL, clipDataIntent));
+    }
+
+    /**
+     * Same as {@link #addResultsToIntent} but for setting data results.
+     * @param remoteInput The remote input for which results are being provided
+     * @param intent The intent to add remote input results to. The {@link ClipData}
+     *               field of the intent will be modified to contain the results.
+     * @param results A map of mime type to the Uri result for that mime type.
+     */
+    public static void addDataResultToIntent(RemoteInput remoteInput, Intent intent,
+            Map<String, Uri> results) {
+        Intent clipDataIntent = getClipDataIntentFromIntent(intent);
+        if (clipDataIntent == null) {
+            clipDataIntent = new Intent();  // First time we've added a result.
+        }
+        for (Map.Entry<String, Uri> entry : results.entrySet()) {
+            String mimeType = entry.getKey();
+            Uri uri = entry.getValue();
+            if (mimeType == null) {
+                continue;
+            }
+            Bundle resultsBundle =
+                    clipDataIntent.getBundleExtra(getExtraResultsKeyForData(mimeType));
+            if (resultsBundle == null) {
+                resultsBundle = new Bundle();
+            }
+            resultsBundle.putString(remoteInput.getResultKey(), uri.toString());
+
+            clipDataIntent.putExtra(getExtraResultsKeyForData(mimeType), resultsBundle);
+        }
+        intent.setClipData(ClipData.newIntent(RESULTS_CLIP_LABEL, clipDataIntent));
+    }
+
+    private static String getExtraResultsKeyForData(String mimeType) {
+        return EXTRA_DATA_TYPE_RESULTS_DATA + mimeType;
     }
 
     @Override
@@ -295,6 +420,7 @@
         out.writeCharSequenceArray(mChoices);
         out.writeInt(mFlags);
         out.writeBundle(mExtras);
+        out.writeArraySet(mAllowedDataTypes);
     }
 
     public static final Creator<RemoteInput> CREATOR = new Creator<RemoteInput>() {
@@ -308,4 +434,19 @@
             return new RemoteInput[size];
         }
     };
+
+    private static Intent getClipDataIntentFromIntent(Intent intent) {
+        ClipData clipData = intent.getClipData();
+        if (clipData == null) {
+            return null;
+        }
+        ClipDescription clipDescription = clipData.getDescription();
+        if (!clipDescription.hasMimeType(ClipDescription.MIMETYPE_TEXT_INTENT)) {
+            return null;
+        }
+        if (!clipDescription.getLabel().equals(RESULTS_CLIP_LABEL)) {
+            return null;
+        }
+        return clipData.getItemAt(0).getIntent();
+    }
 }
diff --git a/core/java/android/app/TaskStackListener.java b/core/java/android/app/TaskStackListener.java
index ad5e69b..fd766bf 100644
--- a/core/java/android/app/TaskStackListener.java
+++ b/core/java/android/app/TaskStackListener.java
@@ -16,6 +16,7 @@
 
 package android.app;
 
+import android.app.ActivityManager.TaskSnapshot;
 import android.content.ComponentName;
 import android.os.RemoteException;
 
@@ -78,4 +79,9 @@
     @Override
     public void onTaskProfileLocked(int taskId, int userId) {
     }
+
+    @Override
+    public void onTaskSnapshotChanged(int taskId, TaskSnapshot snapshot)
+            throws RemoteException {
+    }
 }
diff --git a/core/java/android/app/admin/DevicePolicyManager.java b/core/java/android/app/admin/DevicePolicyManager.java
index c95e011..b8b9793 100644
--- a/core/java/android/app/admin/DevicePolicyManager.java
+++ b/core/java/android/app/admin/DevicePolicyManager.java
@@ -6317,7 +6317,7 @@
      * @see #setPermissionGrantState(ComponentName, String, String, int)
      * @see PackageManager#checkPermission(String, String)
      */
-    public int getPermissionGrantState(@NonNull ComponentName admin, String packageName,
+    public int getPermissionGrantState(@Nullable ComponentName admin, String packageName,
             String permission) {
         throwIfParentInstance("getPermissionGrantState");
         try {
diff --git a/core/java/android/content/ContextWrapper.java b/core/java/android/content/ContextWrapper.java
index 4b6076b..e437de0 100644
--- a/core/java/android/content/ContextWrapper.java
+++ b/core/java/android/content/ContextWrapper.java
@@ -653,6 +653,13 @@
         return mBase.bindServiceAsUser(service, conn, flags, user);
     }
 
+    /** @hide */
+    @Override
+    public boolean bindServiceAsUser(Intent service, ServiceConnection conn, int flags,
+            Handler handler, UserHandle user) {
+        return mBase.bindServiceAsUser(service, conn, flags, handler, user);
+    }
+
     @Override
     public void unbindService(ServiceConnection conn) {
         mBase.unbindService(conn);
diff --git a/core/java/android/content/Intent.java b/core/java/android/content/Intent.java
index d8358f9..8cc9a3a 100644
--- a/core/java/android/content/Intent.java
+++ b/core/java/android/content/Intent.java
@@ -715,11 +715,13 @@
     /**
      * Activity Action: Creates a shortcut.
      * <p>Input: Nothing.</p>
-     * <p>Output: An Intent representing the shortcut. The intent must contain three
+     * <p>Output: An Intent representing the {@link android.content.pm.ShortcutInfo} result.</p>
+     * <p>For compatibility with older versions of android the intent may also contain three
      * extras: SHORTCUT_INTENT (value: Intent), SHORTCUT_NAME (value: String),
      * and SHORTCUT_ICON (value: Bitmap) or SHORTCUT_ICON_RESOURCE
      * (value: ShortcutIconResource).</p>
      *
+     * @see android.content.pm.ShortcutManager#createShortcutResultIntent
      * @see #EXTRA_SHORTCUT_INTENT
      * @see #EXTRA_SHORTCUT_NAME
      * @see #EXTRA_SHORTCUT_ICON
@@ -733,26 +735,34 @@
      * The name of the extra used to define the Intent of a shortcut.
      *
      * @see #ACTION_CREATE_SHORTCUT
+     * @deprecated Replaced with {@link android.content.pm.ShortcutManager#createShortcutResultIntent}
      */
+    @Deprecated
     public static final String EXTRA_SHORTCUT_INTENT = "android.intent.extra.shortcut.INTENT";
     /**
      * The name of the extra used to define the name of a shortcut.
      *
      * @see #ACTION_CREATE_SHORTCUT
+     * @deprecated Replaced with {@link android.content.pm.ShortcutManager#createShortcutResultIntent}
      */
+    @Deprecated
     public static final String EXTRA_SHORTCUT_NAME = "android.intent.extra.shortcut.NAME";
     /**
      * The name of the extra used to define the icon, as a Bitmap, of a shortcut.
      *
      * @see #ACTION_CREATE_SHORTCUT
+     * @deprecated Replaced with {@link android.content.pm.ShortcutManager#createShortcutResultIntent}
      */
+    @Deprecated
     public static final String EXTRA_SHORTCUT_ICON = "android.intent.extra.shortcut.ICON";
     /**
      * The name of the extra used to define the icon, as a ShortcutIconResource, of a shortcut.
      *
      * @see #ACTION_CREATE_SHORTCUT
      * @see android.content.Intent.ShortcutIconResource
+     * @deprecated Replaced with {@link android.content.pm.ShortcutManager#createShortcutResultIntent}
      */
+    @Deprecated
     public static final String EXTRA_SHORTCUT_ICON_RESOURCE =
             "android.intent.extra.shortcut.ICON_RESOURCE";
 
diff --git a/core/java/android/content/pm/ILauncherApps.aidl b/core/java/android/content/pm/ILauncherApps.aidl
index 430c7e7..5152416 100644
--- a/core/java/android/content/pm/ILauncherApps.aidl
+++ b/core/java/android/content/pm/ILauncherApps.aidl
@@ -18,6 +18,7 @@
 
 import android.content.ComponentName;
 import android.content.Intent;
+import android.content.IntentSender;
 import android.content.pm.ActivityInfo;
 import android.content.pm.ApplicationInfo;
 import android.content.pm.IOnAppsChangedListener;
@@ -60,4 +61,8 @@
             int userId);
 
     boolean hasShortcutHostPermission(String callingPackage);
+
+    ParceledListSlice getShortcutConfigActivities(String packageName, in UserHandle user);
+    IntentSender getShortcutConfigActivityIntent(String callingPackage, in ComponentName component,
+            in UserHandle user);
 }
diff --git a/core/java/android/content/pm/IShortcutService.aidl b/core/java/android/content/pm/IShortcutService.aidl
index 91df8e8..c90134a 100644
--- a/core/java/android/content/pm/IShortcutService.aidl
+++ b/core/java/android/content/pm/IShortcutService.aidl
@@ -15,6 +15,7 @@
  */
 package android.content.pm;
 
+import android.content.Intent;
 import android.content.IntentSender;
 import android.content.pm.ParceledListSlice;
 import android.content.pm.ShortcutInfo;
@@ -45,6 +46,8 @@
     boolean requestPinShortcut(String packageName, in ShortcutInfo shortcut,
             in IntentSender resultIntent, int userId);
 
+    Intent createShortcutResultIntent(String packageName, in ShortcutInfo shortcut, int userId);
+
     void disableShortcuts(String packageName, in List shortcutIds, CharSequence disabledMessage,
             int disabledMessageResId, int userId);
 
diff --git a/core/java/android/content/pm/LauncherApps.java b/core/java/android/content/pm/LauncherApps.java
index 4cdd653..cf873b0 100644
--- a/core/java/android/content/pm/LauncherApps.java
+++ b/core/java/android/content/pm/LauncherApps.java
@@ -27,6 +27,7 @@
 import android.content.ComponentName;
 import android.content.Context;
 import android.content.Intent;
+import android.content.IntentSender;
 import android.content.pm.PackageManager.ApplicationInfoFlags;
 import android.content.pm.PackageManager.NameNotFoundException;
 import android.content.res.Resources;
@@ -384,25 +385,11 @@
      * @return List of launchable activities. Can be an empty list but will not be null.
      */
     public List<LauncherActivityInfo> getActivityList(String packageName, UserHandle user) {
-        ParceledListSlice<ResolveInfo> activities = null;
         try {
-            activities = mService.getLauncherActivities(packageName, user);
+            return convertToActivityList(mService.getLauncherActivities(packageName, user), user);
         } catch (RemoteException re) {
             throw re.rethrowFromSystemServer();
         }
-        if (activities == null) {
-            return Collections.EMPTY_LIST;
-        }
-        ArrayList<LauncherActivityInfo> lais = new ArrayList<LauncherActivityInfo>();
-        for (ResolveInfo ri : activities.getList()) {
-            LauncherActivityInfo lai = new LauncherActivityInfo(mContext, ri.activityInfo, user);
-            if (DEBUG) {
-                Log.v(TAG, "Returning activity for profile " + user + " : "
-                        + lai.getComponentName());
-            }
-            lais.add(lai);
-        }
-        return lais;
     }
 
     /**
@@ -465,6 +452,73 @@
     }
 
     /**
+     * Retrieves a list of config activities for creating {@link ShortcutInfo}.
+     *
+     * @param packageName The specific package to query. If null, it checks all installed packages
+     *            in the profile.
+     * @param user The UserHandle of the profile.
+     * @return List of config activities. Can be an empty list but will not be null.
+     *
+     * @see Intent#ACTION_CREATE_SHORTCUT
+     * @see #getShortcutConfigActivityIntent(LauncherActivityInfo)
+     */
+    public List<LauncherActivityInfo> getShortcutConfigActivityList(@Nullable String packageName,
+            @NonNull UserHandle user) {
+        try {
+            return convertToActivityList(mService.getShortcutConfigActivities(packageName, user),
+                    user);
+        } catch (RemoteException re) {
+            throw re.rethrowFromSystemServer();
+        }
+    }
+
+    private List<LauncherActivityInfo> convertToActivityList(
+            @Nullable ParceledListSlice<ResolveInfo> activities, UserHandle user) {
+        if (activities == null) {
+            return Collections.EMPTY_LIST;
+        }
+        ArrayList<LauncherActivityInfo> lais = new ArrayList<>();
+        for (ResolveInfo ri : activities.getList()) {
+            LauncherActivityInfo lai = new LauncherActivityInfo(mContext, ri.activityInfo, user);
+            if (DEBUG) {
+                Log.v(TAG, "Returning activity for profile " + user + " : "
+                        + lai.getComponentName());
+            }
+            lais.add(lai);
+        }
+        return lais;
+    }
+
+    /**
+     * Returns an intent sender which can be used to start the configure activity for creating
+     * custom shortcuts. Use this method if the provider is in another profile as you are not
+     * allowed to start an activity in another profile.
+     *
+     * <p>The caller should receive {@link PinItemRequest} in onActivityResult on
+     * {@link android.app.Activity#RESULT_OK}.
+     *
+     * <p>Callers must be allowed to access the shortcut information, as defined in {@link
+     * #hasShortcutHostPermission()}.
+     *
+     * @param info a configuration activity returned by {@link #getShortcutConfigActivityList}
+     *
+     * @throws IllegalStateException when the user is locked or not running.
+     * @throws SecurityException if {@link #hasShortcutHostPermission()} is false.
+     *
+     * @see #getPinItemRequest(Intent)
+     * @see Intent#ACTION_CREATE_SHORTCUT
+     * @see android.app.Activity#startIntentSenderForResult
+     */
+    public IntentSender getShortcutConfigActivityIntent(@NonNull LauncherActivityInfo info) {
+        try {
+            return mService.getShortcutConfigActivityIntent(
+                    mContext.getPackageName(), info.getComponentName(), info.getUser());
+        } catch (RemoteException re) {
+            throw re.rethrowFromSystemServer();
+        }
+    }
+
+    /**
      * Checks if the package is installed and enabled for a profile.
      *
      * @param packageName The package to check.
diff --git a/core/java/android/content/pm/ShortcutManager.java b/core/java/android/content/pm/ShortcutManager.java
index 3853400..805054f 100644
--- a/core/java/android/content/pm/ShortcutManager.java
+++ b/core/java/android/content/pm/ShortcutManager.java
@@ -881,6 +881,31 @@
     }
 
     /**
+     * Returns an Intent which can be used by the default launcher to pin {@param shortcut}.
+     * This should be used by an Activity to set result in response to
+     * {@link Intent#ACTION_CREATE_SHORTCUT}.
+     *
+     * @param shortcut New shortcut to pin.  If an app wants to pin an existing (either dynamic
+     *     or manifest) shortcut, then it only needs to have an ID, and other fields don't have to
+     *     be set, in which case, the target shortcut must be enabled.
+     *     If it's a new shortcut, all the mandatory fields, such as a short label, must be
+     *     set.
+     * @return The intent that should be set as the result for the calling activity or null.
+     *
+     * @see Intent#ACTION_CREATE_SHORTCUT
+     *
+     * @throws IllegalArgumentException if a shortcut with the same ID exists and is disabled.
+     */
+    public Intent createShortcutResultIntent(@NonNull ShortcutInfo shortcut) {
+        try {
+            return mService.createShortcutResultIntent(mContext.getPackageName(), shortcut,
+                    injectMyUserId());
+        } catch (RemoteException e) {
+            throw e.rethrowFromSystemServer();
+        }
+    }
+
+    /**
      * Called internally when an app is considered to have come to the foreground
      * even when technically it's not.  This method resets the throttling for this package.
      * For example, when the user sends an "inline reply" on a notification, the system UI will
diff --git a/core/java/android/hardware/SensorManager.java b/core/java/android/hardware/SensorManager.java
index 04ee1e6..3ccac69 100644
--- a/core/java/android/hardware/SensorManager.java
+++ b/core/java/android/hardware/SensorManager.java
@@ -492,7 +492,7 @@
         if (type == Sensor.TYPE_PROXIMITY || type == Sensor.TYPE_SIGNIFICANT_MOTION ||
                 type == Sensor.TYPE_TILT_DETECTOR || type == Sensor.TYPE_WAKE_GESTURE ||
                 type == Sensor.TYPE_GLANCE_GESTURE || type == Sensor.TYPE_PICK_UP_GESTURE ||
-                type == Sensor.TYPE_WRIST_TILT_GESTURE) {
+                type == Sensor.TYPE_WRIST_TILT_GESTURE || type == Sensor.TYPE_DYNAMIC_SENSOR_META) {
             wakeUpSensor = true;
         }
 
diff --git a/core/java/android/hardware/camera2/impl/CameraCaptureSessionImpl.java b/core/java/android/hardware/camera2/impl/CameraCaptureSessionImpl.java
index 5e9fd66..4befb29 100644
--- a/core/java/android/hardware/camera2/impl/CameraCaptureSessionImpl.java
+++ b/core/java/android/hardware/camera2/impl/CameraCaptureSessionImpl.java
@@ -48,8 +48,6 @@
 
     /** Input surface configured by native camera framework based on user-specified configuration */
     private final Surface mInput;
-    /** User-specified set of surfaces used as the configuration outputs */
-    private final List<Surface> mOutputs;
     /**
      * User-specified state callback, used for outgoing events; calls to this object will be
      * automatically {@link Handler#post(Runnable) posted} to {@code mStateHandler}.
@@ -87,21 +85,17 @@
      * There must be no pending actions
      * (e.g. no pending captures, no repeating requests, no flush).</p>
      */
-    CameraCaptureSessionImpl(int id, Surface input, List<Surface> outputs,
+    CameraCaptureSessionImpl(int id, Surface input,
             CameraCaptureSession.StateCallback callback, Handler stateHandler,
             android.hardware.camera2.impl.CameraDeviceImpl deviceImpl,
             Handler deviceStateHandler, boolean configureSuccess) {
-        if (outputs == null || outputs.isEmpty()) {
-            throw new IllegalArgumentException("outputs must be a non-null, non-empty list");
-        } else if (callback == null) {
+        if (callback == null) {
             throw new IllegalArgumentException("callback must not be null");
         }
 
         mId = id;
         mIdString = String.format("Session %d: ", mId);
 
-        // TODO: extra verification of outputs
-        mOutputs = outputs;
         mInput = input;
         mStateHandler = checkHandler(stateHandler);
         mStateCallback = createUserStateCallbackProxy(mStateHandler, callback);
diff --git a/core/java/android/hardware/camera2/impl/CameraConstrainedHighSpeedCaptureSessionImpl.java b/core/java/android/hardware/camera2/impl/CameraConstrainedHighSpeedCaptureSessionImpl.java
index 4481a74..01e58f4 100644
--- a/core/java/android/hardware/camera2/impl/CameraConstrainedHighSpeedCaptureSessionImpl.java
+++ b/core/java/android/hardware/camera2/impl/CameraConstrainedHighSpeedCaptureSessionImpl.java
@@ -58,14 +58,14 @@
      * There must be no pending actions
      * (e.g. no pending captures, no repeating requests, no flush).</p>
      */
-    CameraConstrainedHighSpeedCaptureSessionImpl(int id, List<Surface> outputs,
+    CameraConstrainedHighSpeedCaptureSessionImpl(int id,
             CameraCaptureSession.StateCallback callback, Handler stateHandler,
             android.hardware.camera2.impl.CameraDeviceImpl deviceImpl,
             Handler deviceStateHandler, boolean configureSuccess,
             CameraCharacteristics characteristics) {
         mCharacteristics = characteristics;
         CameraCaptureSession.StateCallback wrapperCallback = new WrapperCallback(callback);
-        mSessionImpl = new CameraCaptureSessionImpl(id, /*input*/null, outputs, wrapperCallback,
+        mSessionImpl = new CameraCaptureSessionImpl(id, /*input*/null, wrapperCallback,
                 stateHandler, deviceImpl, deviceStateHandler, configureSuccess);
     }
 
diff --git a/core/java/android/hardware/camera2/impl/CameraDeviceImpl.java b/core/java/android/hardware/camera2/impl/CameraDeviceImpl.java
index 97ca56ef..d2aeaea 100644
--- a/core/java/android/hardware/camera2/impl/CameraDeviceImpl.java
+++ b/core/java/android/hardware/camera2/impl/CameraDeviceImpl.java
@@ -501,7 +501,7 @@
             CameraCaptureSession.StateCallback callback, Handler handler)
             throws CameraAccessException {
         if (DEBUG) {
-            Log.d(TAG, "createCaptureSessionByOutputConfiguration");
+            Log.d(TAG, "createCaptureSessionByOutputConfigurations");
         }
 
         // OutputConfiguration objects are immutable, but need to have our own array
@@ -621,19 +621,15 @@
                 }
             }
 
-            List<Surface> outSurfaces = new ArrayList<>(outputConfigurations.size());
-            for (OutputConfiguration config : outputConfigurations) {
-                outSurfaces.add(config.getSurface());
-            }
             // Fire onConfigured if configureOutputs succeeded, fire onConfigureFailed otherwise.
             CameraCaptureSessionCore newSession = null;
             if (isConstrainedHighSpeed) {
                 newSession = new CameraConstrainedHighSpeedCaptureSessionImpl(mNextSessionId++,
-                        outSurfaces, callback, handler, this, mDeviceHandler, configureSuccess,
+                        callback, handler, this, mDeviceHandler, configureSuccess,
                         mCharacteristics);
             } else {
                 newSession = new CameraCaptureSessionImpl(mNextSessionId++, input,
-                        outSurfaces, callback, handler, this, mDeviceHandler,
+                        callback, handler, this, mDeviceHandler,
                         configureSuccess);
             }
 
@@ -1946,24 +1942,33 @@
 
             Runnable failureDispatch = null;
             if (errorCode == ERROR_CAMERA_BUFFER) {
-                final Surface outputSurface =
-                        mConfiguredOutputs.get(resultExtras.getErrorStreamId()).getSurface();
-                if (DEBUG) {
-                    Log.v(TAG, String.format("Lost output buffer reported for frame %d, target %s",
-                            frameNumber, outputSurface));
-                }
-                failureDispatch = new Runnable() {
-                    @Override
-                    public void run() {
-                        if (!CameraDeviceImpl.this.isClosed()){
-                            holder.getCallback().onCaptureBufferLost(
-                                CameraDeviceImpl.this,
-                                request,
-                                outputSurface,
-                                frameNumber);
-                        }
+                // Because 1 stream id could map to multiple surfaces, we need to specify both
+                // streamId and surfaceId.
+                List<Surface> surfaces =
+                        mConfiguredOutputs.get(resultExtras.getErrorStreamId()).getSurfaces();
+                for (Surface surface : surfaces) {
+                    if (!request.containsTarget(surface)) {
+                        continue;
                     }
-                };
+                    if (DEBUG) {
+                        Log.v(TAG, String.format("Lost output buffer reported for frame %d, target %s",
+                                frameNumber, surface));
+                    }
+                    failureDispatch = new Runnable() {
+                        @Override
+                        public void run() {
+                            if (!CameraDeviceImpl.this.isClosed()){
+                                holder.getCallback().onCaptureBufferLost(
+                                    CameraDeviceImpl.this,
+                                    request,
+                                    surface,
+                                    frameNumber);
+                            }
+                        }
+                    };
+                    // Dispatch the failure callback
+                    holder.getHandler().post(failureDispatch);
+                }
             } else {
                 boolean mayHaveBuffers = (errorCode == ERROR_CAMERA_RESULT);
 
@@ -2000,10 +2005,11 @@
                 }
                 mFrameNumberTracker.updateTracker(frameNumber, /*error*/true, request.isReprocess());
                 checkAndFireSequenceComplete();
+
+                // Dispatch the failure callback
+                holder.getHandler().post(failureDispatch);
             }
 
-            // Dispatch the failure callback
-            holder.getHandler().post(failureDispatch);
         }
 
     } // public class CameraDeviceCallbacks
diff --git a/core/java/android/hardware/camera2/params/OutputConfiguration.java b/core/java/android/hardware/camera2/params/OutputConfiguration.java
index f897d85..4654fc2 100644
--- a/core/java/android/hardware/camera2/params/OutputConfiguration.java
+++ b/core/java/android/hardware/camera2/params/OutputConfiguration.java
@@ -31,13 +31,17 @@
 import android.util.Size;
 import android.view.Surface;
 
+import java.util.Arrays;
+import java.util.List;
+import java.util.Collections;
+
 import static com.android.internal.util.Preconditions.*;
 
 /**
  * A class for describing camera output, which contains a {@link Surface} and its specific
  * configuration for creating capture session.
  *
- * @see CameraDevice#createCaptureSessionByOutputConfiguration
+ * @see CameraDevice#createCaptureSessionByOutputConfigurations
  *
  */
 public final class OutputConfiguration implements Parcelable {
@@ -147,6 +151,50 @@
     }
 
     /**
+     * Create a new {@link OutputConfiguration} instance with two surfaces sharing the same stream,
+     * with a surface group ID.
+     *
+     * <p>For advanced use cases, a camera application may require more streams than the combination
+     * guaranteed by {@link CameraDevice#createCaptureSession}. In this case, two compatible
+     * surfaces can be attached to one OutputConfiguration so that they map to one camera stream,
+     * and buffers are reference counted when being consumed by both surfaces. </p>
+     *
+     * <p>Two surfaces are compatible in below 2 cases:</p>
+     *
+     * <ol>
+     * <li> Surfaces with the same size, format, dataSpace, and Surface source class. In this case,
+     * {@link CameraDevice#createCaptureSessionByOutputConfigurations} is guaranteed to succeed.
+     *
+     * <li> Surfaces with the same size, format, and dataSpace, but different Surface
+     * source classes. However, on some devices, the underlying camera device is able to use the
+     * same buffer layout for both surfaces. The only way to discover if this is the case is to
+     * create a capture session with that output configuration. For example, if the camera device
+     * uses the same private buffer format between a SurfaceView/SurfaceTexture and a
+     * MediaRecorder/MediaCodec, {@link CameraDevice#createCaptureSessionByOutputConfigurations}
+     * will succeed. Otherwise, it throws {@code IllegalArgumentException}.
+     * </ol>
+     *
+     * @param surfaceGroupId
+     *          A group ID for this output, used for sharing memory between multiple outputs.
+     * @param surface
+     *          A Surface for camera to output to.
+     * @param surface2
+     *          Second surface for camera to output to.
+     * @throws IllegalArgumentException if the two surfaces have different size, format, or
+     * dataSpace.
+     *
+     * @hide
+     */
+    public OutputConfiguration(int surfaceGroupId, @NonNull Surface surface,
+            @NonNull Surface surface2) {
+        this(surfaceGroupId, surface, ROTATION_0, surface2);
+
+        checkNotNull(surface2, "Surface must not be null");
+        checkMatchingSurfaces(mConfiguredSize, mConfiguredFormat, mConfiguredDataspace,
+                mConfiguredGenerationId, surface2);
+    }
+
+    /**
      * Create a new {@link OutputConfiguration} instance.
      *
      * <p>This constructor takes an argument for desired camera rotation</p>
@@ -169,7 +217,6 @@
         this(SURFACE_GROUP_ID_NONE, surface, rotation);
     }
 
-
     /**
      * Create a new {@link OutputConfiguration} instance, with rotation and a group ID.
      *
@@ -193,17 +240,68 @@
      */
     @SystemApi
     public OutputConfiguration(int surfaceGroupId, @NonNull Surface surface, int rotation) {
+        this(surfaceGroupId, surface, rotation, null /*surface2*/);
+    }
+
+    /**
+     * Create a new {@link OutputConfiguration} instance, with rotation, a group ID, and a secondary
+     * surface.
+     *
+     * <p>This constructor takes an argument for desired camera rotation, the surface group
+     * ID, and a secondary surface.  See {@link #OutputConfiguration(int, Surface)} for details
+     * of the group ID.</p>
+     *
+     * <p>surface2 should be compatible with surface. See {@link #OutputConfiguration(int, Surface,
+     * Surface} for details of compatibility between surfaces.</p>
+     *
+     * <p>Since the rotation is done by the CameraDevice, both surfaces will receive buffers with
+     * the same rotation applied. This means that if the application needs two compatible surfaces
+     * to have different rotations, these surfaces cannot be shared within one OutputConfiguration.
+     * </p>
+     *
+     * @param surfaceGroupId
+     *          A group ID for this output, used for sharing memory between multiple outputs.
+     * @param surface
+     *          A Surface for camera to output to.
+     * @param rotation
+     *          The desired rotation to be applied on camera output. Value must be one of
+     *          ROTATION_[0, 90, 180, 270]. Note that when the rotation is 90 or 270 degrees,
+     *          application should make sure corresponding surface size has width and height
+     *          transposed relative to the width and height without rotation. For example,
+     *          if application needs camera to capture 1280x720 picture and rotate it by 90 degree,
+     *          application should set rotation to {@code ROTATION_90} and make sure the
+     *          corresponding Surface size is 720x1280. Note that {@link CameraDevice} might
+     *          throw {@code IllegalArgumentException} if device cannot perform such rotation.
+     * @param surface2
+     *          Second surface for camera to output to.
+
+     * @throws IllegalArgumentException if the two surfaces are not compatible to be shared in
+     *                                  one OutputConfiguration.
+     *
+     * @hide
+     */
+    private OutputConfiguration(int surfaceGroupId, @NonNull Surface surface, int rotation,
+            @Nullable Surface surface2) {
         checkNotNull(surface, "Surface must not be null");
         checkArgumentInRange(rotation, ROTATION_0, ROTATION_270, "Rotation constant");
+
         mSurfaceGroupId = surfaceGroupId;
         mSurfaceType = SURFACE_TYPE_UNKNOWN;
-        mSurface = surface;
         mRotation = rotation;
         mConfiguredSize = SurfaceUtils.getSurfaceSize(surface);
         mConfiguredFormat = SurfaceUtils.getSurfaceFormat(surface);
         mConfiguredDataspace = SurfaceUtils.getSurfaceDataspace(surface);
         mConfiguredGenerationId = surface.getGenerationId();
         mIsDeferredConfig = false;
+
+        if (surface2 == null) {
+            mSurfaces = new Surface[1];
+            mSurfaces[0] = surface;
+        } else {
+            mSurfaces = new Surface[MAX_SURFACES_COUNT];
+            mSurfaces[0] = surface;
+            mSurfaces[1] = surface2;
+        }
     }
 
     /**
@@ -231,25 +329,34 @@
      *            {@link android.graphics.SurfaceTexture SurfaceTexture.class} are supported.
      */
     public <T> OutputConfiguration(@NonNull Size surfaceSize, @NonNull Class<T> klass) {
-        checkNotNull(klass, "surfaceSize must not be null");
-        checkNotNull(klass, "klass must not be null");
-        if (klass == android.view.SurfaceHolder.class) {
-            mSurfaceType = SURFACE_TYPE_SURFACE_VIEW;
-        } else if (klass == android.graphics.SurfaceTexture.class) {
-            mSurfaceType = SURFACE_TYPE_SURFACE_TEXTURE;
-        } else {
-            mSurfaceType = SURFACE_TYPE_UNKNOWN;
-            throw new IllegalArgumentException("Unknow surface source class type");
-        }
+        this(surfaceSize, klass, true /* dummy */);
 
-        mSurfaceGroupId = SURFACE_GROUP_ID_NONE;
-        mSurface = null;
-        mRotation = ROTATION_0;
-        mConfiguredSize = surfaceSize;
-        mConfiguredFormat = StreamConfigurationMap.imageFormatToInternal(ImageFormat.PRIVATE);
-        mConfiguredDataspace = StreamConfigurationMap.imageFormatToDataspace(ImageFormat.PRIVATE);
-        mConfiguredGenerationId = 0;
-        mIsDeferredConfig = true;
+        mSurfaces = new Surface[1];
+    }
+
+    /**
+     * Create a new {@link OutputConfiguration} instance, with desired Surface size and Surface
+     * source class for the deferred surface, and a secondary surface.
+     *
+     * <p>This constructor takes an argument for desired surface size and surface source class of
+     * the deferred surface, and a secondary surface. See {@link #OutputConfiguration(Size, Class)}
+     * for details of the surface size and surface source class.</p>
+     *
+     * <p> The deferred surface and secondary surface should be compatible. See
+     * {@link #OutputConfiguration(int, Surface, Surface)} for details of compatible surfaces.
+     *
+     * @hide
+     */
+    public <T> OutputConfiguration(@NonNull Size surfaceSize, @NonNull Class<T> klass,
+            @NonNull Surface surface2) {
+        this(surfaceSize, klass, true /* dummy */);
+
+        checkMatchingSurfaces(mConfiguredSize, mConfiguredFormat, mConfiguredDataspace,
+                mConfiguredGenerationId, surface2);
+
+        mSurfaces = new Surface[MAX_SURFACES_COUNT];
+        mSurfaces[0] = null;
+        mSurfaces[1] = surface2;
     }
 
     /**
@@ -285,7 +392,7 @@
      */
     public void setDeferredSurface(@NonNull Surface surface) {
         checkNotNull(surface, "Surface must not be null");
-        if (mSurface != null) {
+        if (mSurfaces[0] != null) {
             throw new IllegalStateException("Deferred surface is already set!");
         }
 
@@ -297,7 +404,7 @@
                     ", the pre-configured size will be used.");
         }
 
-        mSurface = surface;
+        mSurfaces[0] = surface;
     }
 
     /**
@@ -313,7 +420,7 @@
             throw new IllegalArgumentException("OutputConfiguration shouldn't be null");
         }
 
-        this.mSurface = other.mSurface;
+        this.mSurfaces = other.mSurfaces;
         this.mRotation = other.mRotation;
         this.mSurfaceGroupId = other.mSurfaceGroupId;
         this.mSurfaceType = other.mSurfaceType;
@@ -325,6 +432,49 @@
     }
 
     /**
+     * Private constructor to initialize Configuration based on surface size and class
+     */
+    private <T> OutputConfiguration(@NonNull Size surfaceSize, @NonNull Class<T> klass,
+            boolean dummy) {
+        checkNotNull(surfaceSize, "surfaceSize must not be null");
+        checkNotNull(klass, "klass must not be null");
+        if (klass == android.view.SurfaceHolder.class) {
+            mSurfaceType = SURFACE_TYPE_SURFACE_VIEW;
+        } else if (klass == android.graphics.SurfaceTexture.class) {
+            mSurfaceType = SURFACE_TYPE_SURFACE_TEXTURE;
+        } else {
+            mSurfaceType = SURFACE_TYPE_UNKNOWN;
+            throw new IllegalArgumentException("Unknow surface source class type");
+        }
+
+        mSurfaceGroupId = SURFACE_GROUP_ID_NONE;
+        mRotation = ROTATION_0;
+        mConfiguredSize = surfaceSize;
+        mConfiguredFormat = StreamConfigurationMap.imageFormatToInternal(ImageFormat.PRIVATE);
+        mConfiguredDataspace = StreamConfigurationMap.imageFormatToDataspace(ImageFormat.PRIVATE);
+        mConfiguredGenerationId = 0;
+        mIsDeferredConfig = true;
+    }
+
+    /**
+     * Check if the surface properties match that of the given surface.
+     *
+     * @return true if the properties and the surface match.
+     */
+    private void checkMatchingSurfaces(Size size, int format, int dataSpace, int generationId,
+            @NonNull Surface surface) {
+        if (!size.equals(SurfaceUtils.getSurfaceSize(surface))) {
+            throw new IllegalArgumentException("Secondary surface size doesn't match");
+        }
+        if (dataSpace != SurfaceUtils.getSurfaceDataspace(surface)) {
+            throw new IllegalArgumentException("Secondary surface dataspace doesn't match");
+        }
+        if (format != SurfaceUtils.getSurfaceFormat(surface)) {
+            throw new IllegalArgumentException("Secondary surface format doesn't match");
+        }
+    }
+
+    /**
      * Create an OutputConfiguration from Parcel.
      */
     private OutputConfiguration(@NonNull Parcel source) {
@@ -333,25 +483,52 @@
         int surfaceType = source.readInt();
         int width = source.readInt();
         int height = source.readInt();
-        Surface surface = Surface.CREATOR.createFromParcel(source);
+        int surfaceCnt = source.readInt();
+
+        if (surfaceCnt <= 0) {
+            throw new IllegalArgumentException(
+                    "Surface count in OutputConfiguration must be greater than 0");
+        }
+        if (surfaceCnt > MAX_SURFACES_COUNT) {
+            throw new IllegalArgumentException(
+                    "Surface count in OutputConfiguration must not be more than "
+                    + MAX_SURFACES_COUNT);
+        }
+
+        Surface[] surfaces = new Surface[surfaceCnt];
+        for (int i = 0; i < surfaceCnt; i++) {
+            Surface surface = Surface.CREATOR.createFromParcel(source);
+            surfaces[i] = surface;
+
+            if (surface == null && i > 0) {
+                throw new IllegalArgumentException("Only the first surface can be deferred");
+            }
+        }
+
         checkArgumentInRange(rotation, ROTATION_0, ROTATION_270, "Rotation constant");
+
         mSurfaceGroupId = surfaceSetId;
-        mSurface = surface;
         mRotation = rotation;
-        if (surface != null) {
+        mSurfaces = surfaces;
+        mConfiguredSize = new Size(width, height);
+        // First surface could be null (being deferred). Use last surface to look up surface
+        // characteristics.
+        if (mSurfaces[surfaceCnt-1] != null) {
             mSurfaceType = SURFACE_TYPE_UNKNOWN;
-            mConfiguredSize = SurfaceUtils.getSurfaceSize(mSurface);
-            mConfiguredFormat = SurfaceUtils.getSurfaceFormat(mSurface);
-            mConfiguredDataspace = SurfaceUtils.getSurfaceDataspace(mSurface);
-            mConfiguredGenerationId = mSurface.getGenerationId();
-            mIsDeferredConfig = true;
+            mConfiguredFormat = SurfaceUtils.getSurfaceFormat(mSurfaces[surfaceCnt-1]);
+            mConfiguredDataspace = SurfaceUtils.getSurfaceDataspace(mSurfaces[surfaceCnt-1]);
+            mConfiguredGenerationId = mSurfaces[surfaceCnt-1].getGenerationId();
         } else {
             mSurfaceType = surfaceType;
-            mConfiguredSize = new Size(width, height);
             mConfiguredFormat = StreamConfigurationMap.imageFormatToInternal(ImageFormat.PRIVATE);
-            mConfiguredGenerationId = 0;
             mConfiguredDataspace =
                     StreamConfigurationMap.imageFormatToDataspace(ImageFormat.PRIVATE);
+            mConfiguredGenerationId = 0;
+        }
+
+        if (mSurfaces[0] == null) {
+            mIsDeferredConfig = true;
+        } else {
             mIsDeferredConfig = false;
         }
     }
@@ -359,11 +536,27 @@
     /**
      * Get the {@link Surface} associated with this {@link OutputConfiguration}.
      *
-     * @return the {@link Surface} associated with this {@link OutputConfiguration}.
+     * @return the {@link Surface} associated with this {@link OutputConfiguration}. If more than
+     * one surface is associated with this {@link OutputConfiguration}, return the first one as
+     * specified in the constructor. If there is a deferred surface, null will be returned.
+     */
+    public @Nullable Surface getSurface() {
+        return mSurfaces[0];
+    }
+
+    /**
+     * Get the immutable list of surfaces associated with this {@link OutputConfiguration}.
+     *
+     * @return the list of surfaces associated with this {@link OutputConfiguration} in the order
+     * specified in the constructor. If there is a deferred surface in the {@link
+     * OutputConfiguration}, it is returned as null as first element of the list. The list should
+     * not be modified.
+     *
+     * @hide
      */
     @NonNull
-    public Surface getSurface() {
-        return mSurface;
+    public List<Surface> getSurfaces() {
+        return Collections.unmodifiableList(Arrays.asList(mSurfaces));
     }
 
     /**
@@ -423,8 +616,11 @@
         dest.writeInt(mSurfaceType);
         dest.writeInt(mConfiguredSize.getWidth());
         dest.writeInt(mConfiguredSize.getHeight());
-        if (mSurface != null) {
-            mSurface.writeToParcel(dest, flags);
+        dest.writeInt(mSurfaces.length);
+        for (int i = 0; i < mSurfaces.length; i++) {
+            if (mSurfaces[i] != null) {
+                mSurfaces[i].writeToParcel(dest, flags);
+            }
         }
     }
 
@@ -445,20 +641,26 @@
             return true;
         } else if (obj instanceof OutputConfiguration) {
             final OutputConfiguration other = (OutputConfiguration) obj;
-            boolean iSSurfaceEqual = mSurface == other.mSurface &&
-                    mConfiguredGenerationId == other.mConfiguredGenerationId ;
-            if (mIsDeferredConfig) {
-                Log.i(TAG, "deferred config has the same surface");
-                iSSurfaceEqual = true;
+            if (mRotation != other.mRotation ||
+                    !mConfiguredSize.equals(other.mConfiguredSize) ||
+                    mConfiguredFormat != other.mConfiguredFormat ||
+                    mSurfaceGroupId != other.mSurfaceGroupId ||
+                    mSurfaceType != other.mSurfaceType ||
+                    mIsDeferredConfig != other.mIsDeferredConfig ||
+                    mConfiguredFormat != other.mConfiguredFormat ||
+                    mConfiguredDataspace != other.mConfiguredDataspace ||
+                    mSurfaces.length != other.mSurfaces.length ||
+                    mConfiguredGenerationId != other.mConfiguredGenerationId)
+                return false;
+
+            // If deferred, skip the first surface of mSurfaces when comparing.
+            int minIndex = (mIsDeferredConfig ? 1 : 0);
+            for (int i = minIndex;  i < mSurfaces.length; i++) {
+                if (mSurfaces[i] != other.mSurfaces[i])
+                    return false;
             }
-            return mRotation == other.mRotation &&
-                   iSSurfaceEqual&&
-                   mConfiguredSize.equals(other.mConfiguredSize) &&
-                   mConfiguredFormat == other.mConfiguredFormat &&
-                   mConfiguredDataspace == other.mConfiguredDataspace &&
-                   mSurfaceGroupId == other.mSurfaceGroupId &&
-                   mSurfaceType == other.mSurfaceType &&
-                   mIsDeferredConfig == other.mIsDeferredConfig;
+
+            return true;
         }
         return false;
     }
@@ -469,21 +671,22 @@
     @Override
     public int hashCode() {
         // Need ensure that the hashcode remains unchanged after set a deferred surface. Otherwise
-        // The deferred output configuration will be lost in the camera streammap after the deferred
+        // the deferred output configuration will be lost in the camera streammap after the deferred
         // surface is set.
-        if (mIsDeferredConfig) {
-            return HashCodeHelpers.hashCode(
-                    mRotation, mConfiguredSize.hashCode(), mConfiguredFormat, mConfiguredDataspace,
-                    mSurfaceGroupId, mSurfaceType);
-        }
+        int minIndex = (mIsDeferredConfig ? 1 : 0);
+        Surface nonDeferredSurfaces[] = Arrays.copyOfRange(mSurfaces,
+                minIndex, mSurfaces.length);
+        int surfaceHash = HashCodeHelpers.hashCodeGeneric(nonDeferredSurfaces);
 
         return HashCodeHelpers.hashCode(
-            mRotation, mSurface.hashCode(), mConfiguredGenerationId,
-            mConfiguredSize.hashCode(), mConfiguredFormat, mConfiguredDataspace, mSurfaceGroupId);
+                mRotation, surfaceHash, mConfiguredGenerationId,
+                mConfiguredSize.hashCode(), mConfiguredFormat,
+                mConfiguredDataspace, mSurfaceGroupId);
     }
 
     private static final String TAG = "OutputConfiguration";
-    private Surface mSurface;
+    private static final int MAX_SURFACES_COUNT = 2;
+    private Surface mSurfaces[];
     private final int mRotation;
     private final int mSurfaceGroupId;
     // Surface source type, this is only used by the deferred surface configuration objects.
diff --git a/core/java/android/net/NetworkIdentity.java b/core/java/android/net/NetworkIdentity.java
index c704ef0..0775bda 100644
--- a/core/java/android/net/NetworkIdentity.java
+++ b/core/java/android/net/NetworkIdentity.java
@@ -24,8 +24,10 @@
 import android.net.wifi.WifiInfo;
 import android.net.wifi.WifiManager;
 import android.os.Build;
+import android.service.NetworkIdentityProto;
 import android.telephony.TelephonyManager;
 import android.util.Slog;
+import android.util.proto.ProtoOutputStream;
 
 import java.util.Objects;
 
@@ -110,6 +112,23 @@
         return builder.append("}").toString();
     }
 
+    public void writeToProto(ProtoOutputStream proto, long tag) {
+        final long start = proto.start(tag);
+
+        proto.write(NetworkIdentityProto.TYPE, mType);
+
+        // Not dumping mSubType, subtypes are no longer supported.
+
+        if (mSubscriberId != null) {
+            proto.write(NetworkIdentityProto.SUBSCRIBER_ID, scrubSubscriberId(mSubscriberId));
+        }
+        proto.write(NetworkIdentityProto.NETWORK_ID, mNetworkId);
+        proto.write(NetworkIdentityProto.ROAMING, mRoaming);
+        proto.write(NetworkIdentityProto.METERED, mMetered);
+
+        proto.end(start);
+    }
+
     public int getType() {
         return mType;
     }
diff --git a/core/java/android/net/NetworkScoreManager.java b/core/java/android/net/NetworkScoreManager.java
index 7a832d1..57cf1a5 100644
--- a/core/java/android/net/NetworkScoreManager.java
+++ b/core/java/android/net/NetworkScoreManager.java
@@ -21,6 +21,7 @@
 import android.Manifest;
 import android.annotation.IntDef;
 import android.annotation.NonNull;
+import android.annotation.Nullable;
 import android.annotation.SdkConstant;
 import android.annotation.SdkConstant.SdkConstantType;
 import android.annotation.SystemApi;
@@ -36,6 +37,7 @@
 
 import java.lang.annotation.Retention;
 import java.lang.annotation.RetentionPolicy;
+import java.util.concurrent.CompletableFuture;
 
 /**
  * Class that manages communication between network subsystems and a network scorer.
@@ -370,25 +372,26 @@
      *
      * @param request a {@link RecommendationRequest} instance containing additional
      *                request details
-     * @param callback a {@link RecommendationCallback} instance that will be invoked when
-     *                 the {@link RecommendationResult} is available
-     * @param handler a {@link Handler} instance representing the thread to run the callback on.
+     * @param handler a {@link Handler} instance representing the thread to complete the future on.
+     *                If null the responding binder thread will be used.
+     * @return a {@link CompletableFuture} instance that will eventually receive the
+     *         {@link RecommendationResult}.
      * @throws SecurityException
      * @hide
      */
-    public void requestRecommendation(
+    public CompletableFuture<RecommendationResult> requestRecommendation(
             final @NonNull RecommendationRequest request,
-            final @NonNull RecommendationCallback callback,
-            final @NonNull Handler handler) {
+            final @Nullable Handler handler) {
         Preconditions.checkNotNull(request, "RecommendationRequest cannot be null.");
-        Preconditions.checkNotNull(callback, "RecommendationCallback cannot be null.");
-        Preconditions.checkNotNull(handler, "Handler cannot be null.");
+
+        final CompletableFuture<RecommendationResult> futureResult =
+                new CompletableFuture<>();
 
         RemoteCallback remoteCallback = new RemoteCallback(new RemoteCallback.OnResultListener() {
             @Override
             public void onResult(Bundle data) {
                 RecommendationResult result = data.getParcelable(EXTRA_RECOMMENDATION_RESULT);
-                callback.onRecommendationAvailable(result);
+                futureResult.complete(result);
             }
         }, handler);
 
@@ -397,18 +400,7 @@
         } catch (RemoteException e) {
             throw e.rethrowFromSystemServer();
         }
-    }
 
-    /**
-     * Callers of {@link #requestRecommendation(RecommendationRequest, RecommendationCallback, Handler)}
-     * must pass in an implementation of this class.
-     * @hide
-     */
-    public abstract static class RecommendationCallback {
-        /**
-         * Invoked when a {@link RecommendationResult} is available.
-         * @param result a {@link RecommendationResult} instance.
-         */
-        public abstract void onRecommendationAvailable(RecommendationResult result);
+        return futureResult;
     }
 }
diff --git a/core/java/android/net/NetworkStatsHistory.java b/core/java/android/net/NetworkStatsHistory.java
index 4a4accb..5f521de 100644
--- a/core/java/android/net/NetworkStatsHistory.java
+++ b/core/java/android/net/NetworkStatsHistory.java
@@ -31,7 +31,10 @@
 
 import android.os.Parcel;
 import android.os.Parcelable;
+import android.service.NetworkStatsHistoryBucketProto;
+import android.service.NetworkStatsHistoryProto;
 import android.util.MathUtils;
+import android.util.proto.ProtoOutputStream;
 
 import com.android.internal.util.IndentingPrintWriter;
 
@@ -628,6 +631,33 @@
         }
     }
 
+    public void writeToProto(ProtoOutputStream proto, long tag) {
+        final long start = proto.start(tag);
+
+        proto.write(NetworkStatsHistoryProto.BUCKET_DURATION_MS, bucketDuration);
+
+        for (int i = 0; i < bucketCount; i++) {
+            final long startBucket = proto.start(NetworkStatsHistoryProto.BUCKETS);
+
+            proto.write(NetworkStatsHistoryBucketProto.BUCKET_START_MS, bucketStart[i]);
+            writeToProto(proto, NetworkStatsHistoryBucketProto.RX_BYTES, rxBytes, i);
+            writeToProto(proto, NetworkStatsHistoryBucketProto.RX_PACKETS, rxPackets, i);
+            writeToProto(proto, NetworkStatsHistoryBucketProto.TX_BYTES, txBytes, i);
+            writeToProto(proto, NetworkStatsHistoryBucketProto.TX_PACKETS, txPackets, i);
+            writeToProto(proto, NetworkStatsHistoryBucketProto.OPERATIONS, operations, i);
+
+            proto.end(startBucket);
+        }
+
+        proto.end(start);
+    }
+
+    private static void writeToProto(ProtoOutputStream proto, long tag, long[] array, int index) {
+        if (array != null) {
+            proto.write(tag, array[index]);
+        }
+    }
+
     @Override
     public String toString() {
         final CharArrayWriter writer = new CharArrayWriter();
diff --git a/core/java/android/os/Build.java b/core/java/android/os/Build.java
index daf8b2d..80ecf97 100644
--- a/core/java/android/os/Build.java
+++ b/core/java/android/os/Build.java
@@ -887,6 +887,21 @@
             "eng".equals(getString("ro.build.type"));
 
     /**
+     * Whether this build is running inside a container.
+     *
+     * We should try to avoid checking this flag if possible to minimize
+     * unnecessarily diverging from non-container Android behavior.
+     * Checking this flag is acceptable when low-level resources being
+     * different, e.g. the availability of certain capabilities, access to
+     * system resources being restricted, and the fact that the host OS might
+     * handle some features for us.
+     * For higher-level behavior differences, other checks should be preferred.
+     * @hide
+     */
+    public static final boolean IS_CONTAINER =
+            SystemProperties.getBoolean("ro.boot.container", false);
+
+    /**
      * Specifies whether the permissions needed by a legacy app should be
      * reviewed before any of its components can run. A legacy app is one
      * with targetSdkVersion < 23, i.e apps using the old permission model.
diff --git a/core/java/android/os/IRecoverySystem.aidl b/core/java/android/os/IRecoverySystem.aidl
index 1ee83ae..c5ceecd 100644
--- a/core/java/android/os/IRecoverySystem.aidl
+++ b/core/java/android/os/IRecoverySystem.aidl
@@ -25,5 +25,5 @@
     boolean uncrypt(in String packageFile, IRecoverySystemProgressListener listener);
     boolean setupBcb(in String command);
     boolean clearBcb();
-    void rebootRecoveryWithCommand(in String command, in boolean update);
+    void rebootRecoveryWithCommand(in String command);
 }
diff --git a/core/java/android/os/IUserManager.aidl b/core/java/android/os/IUserManager.aidl
index 9513854..1c2588a 100644
--- a/core/java/android/os/IUserManager.aidl
+++ b/core/java/android/os/IUserManager.aidl
@@ -19,6 +19,7 @@
 
 import android.os.Bundle;
 import android.os.PersistableBundle;
+import android.os.UserManager;
 import android.content.pm.UserInfo;
 import android.content.IntentSender;
 import android.content.RestrictionEntry;
@@ -61,6 +62,7 @@
     int getUserSerialNumber(int userHandle);
     int getUserHandle(int userSerialNumber);
     int getUserRestrictionSource(String restrictionKey, int userHandle);
+    List<UserManager.EnforcingUser> getUserRestrictionSources(String restrictionKey, int userHandle);
     Bundle getUserRestrictions(int userHandle);
     boolean hasBaseUserRestriction(String restrictionKey, int userHandle);
     boolean hasUserRestriction(in String restrictionKey, int userHandle);
diff --git a/core/java/android/os/IProxyFileDescriptorCallback.java b/core/java/android/os/ProxyFileDescriptorCallback.java
similarity index 69%
rename from core/java/android/os/IProxyFileDescriptorCallback.java
rename to core/java/android/os/ProxyFileDescriptorCallback.java
index e41e194..2e9f8d9 100644
--- a/core/java/android/os/IProxyFileDescriptorCallback.java
+++ b/core/java/android/os/ProxyFileDescriptorCallback.java
@@ -17,18 +17,20 @@
 package android.os;
 
 import android.system.ErrnoException;
+import android.system.OsConstants;
 
 /**
  * Callback that handles file system requests from ProxyFileDescriptor.
- * @hide
  */
-public interface IProxyFileDescriptorCallback {
+public abstract class ProxyFileDescriptorCallback {
     /**
      * Returns size of bytes provided by the file descriptor.
      * @return Size of bytes
      * @throws ErrnoException
      */
-    long onGetSize() throws ErrnoException;
+    public long onGetSize() throws ErrnoException {
+        throw new ErrnoException("onGetSize", OsConstants.EBADF);
+    }
 
     /**
      * Provides bytes read from file descriptor.
@@ -39,7 +41,9 @@
      * @return Size of bytes returned by the function.
      * @throws ErrnoException
      */
-    int onRead(long offset, int size, byte[] data) throws ErrnoException;
+    public int onRead(long offset, int size, byte[] data) throws ErrnoException {
+        throw new ErrnoException("onRead", OsConstants.EBADF);
+    }
 
     /**
      * Handles bytes written to file descriptor.
@@ -49,11 +53,20 @@
      * @return Size of bytes processed by the function.
      * @throws ErrnoException
      */
-    int onWrite(long offset, int size, byte[] data) throws ErrnoException;
+    public int onWrite(long offset, int size, byte[] data) throws ErrnoException {
+        throw new ErrnoException("onWrite", OsConstants.EBADF);
+    }
 
     /**
      * Processes fsync request.
      * @throws ErrnoException
      */
-    void onFsync() throws ErrnoException;
+    public void onFsync() throws ErrnoException {
+        throw new ErrnoException("onFsync", OsConstants.EINVAL);
+    }
+
+    /**
+     * Invoked after the file is closed.
+     */
+    abstract public void onRelease();
 }
diff --git a/core/java/android/os/RecoverySystem.java b/core/java/android/os/RecoverySystem.java
index 7f9ea438..d48431a 100644
--- a/core/java/android/os/RecoverySystem.java
+++ b/core/java/android/os/RecoverySystem.java
@@ -491,10 +491,15 @@
                 command += securityArg;
             }
 
-            // RECOVERY_SERVICE writes to BCB (bootloader control block) and triggers the reboot.
             RecoverySystem rs = (RecoverySystem) context.getSystemService(
                     Context.RECOVERY_SERVICE);
-            rs.rebootRecoveryWithCommand(command, true /* update */);
+            if (!rs.setupBcb(command)) {
+                throw new IOException("Setup BCB failed");
+            }
+
+            // Having set up the BCB (bootloader control block), go ahead and reboot
+            PowerManager pm = (PowerManager) context.getSystemService(Context.POWER_SERVICE);
+            pm.reboot(PowerManager.REBOOT_RECOVERY_UPDATE);
 
             throw new IOException("Reboot failed (no permissions?)");
         }
@@ -708,7 +713,7 @@
         // Write the command into BCB (bootloader control block) and boot from
         // there. Will not return unless failed.
         RecoverySystem rs = (RecoverySystem) context.getSystemService(Context.RECOVERY_SERVICE);
-        rs.rebootRecoveryWithCommand(command.toString(), false);
+        rs.rebootRecoveryWithCommand(command.toString());
 
         throw new IOException("Reboot failed (no permissions?)");
     }
@@ -908,9 +913,9 @@
      * Talks to RecoverySystemService via Binder to set up the BCB command and
      * reboot into recovery accordingly.
      */
-    private void rebootRecoveryWithCommand(String command, boolean update) {
+    private void rebootRecoveryWithCommand(String command) {
         try {
-            mService.rebootRecoveryWithCommand(command, update);
+            mService.rebootRecoveryWithCommand(command);
         } catch (RemoteException ignored) {
         }
     }
diff --git a/core/java/android/os/UserManager.aidl b/core/java/android/os/UserManager.aidl
new file mode 100644
index 0000000..2611b0f
--- /dev/null
+++ b/core/java/android/os/UserManager.aidl
@@ -0,0 +1,20 @@
+/*
+**
+** Copyright 2016, The Android Open Source Project
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+**
+**     http://www.apache.org/licenses/LICENSE-2.0
+**
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+*/
+
+package android.os;
+
+parcelable UserManager.EnforcingUser;
\ No newline at end of file
diff --git a/core/java/android/os/UserManager.java b/core/java/android/os/UserManager.java
index 3478eaa..efacb20 100644
--- a/core/java/android/os/UserManager.java
+++ b/core/java/android/os/UserManager.java
@@ -1187,7 +1187,9 @@
      * @return The source of user restriction. Any combination of {@link #RESTRICTION_NOT_SET},
      *         {@link #RESTRICTION_SOURCE_SYSTEM}, {@link #RESTRICTION_SOURCE_DEVICE_OWNER}
      *         and {@link #RESTRICTION_SOURCE_PROFILE_OWNER}
+     * @deprecated use {@link #getUserRestrictionSources(String, int)} instead.
      */
+    @Deprecated
     @SystemApi
     @UserRestrictionSource
     public int getUserRestrictionSource(String restrictionKey, UserHandle userHandle) {
@@ -1199,6 +1201,25 @@
     }
 
     /**
+     * @hide
+     *
+     * Returns a list of users who set a user restriction on a given user.
+     * Requires {@link android.Manifest.permission#MANAGE_USERS} permission.
+     * @param restrictionKey the string key representing the restriction
+     * @param userHandle the UserHandle of the user for whom to retrieve the restrictions.
+     * @return a list of user ids enforcing this restriction.
+     */
+    @SystemApi
+    public List<EnforcingUser> getUserRestrictionSources(
+            String restrictionKey, UserHandle userHandle) {
+        try {
+            return mService.getUserRestrictionSources(restrictionKey, userHandle.getIdentifier());
+        } catch (RemoteException re) {
+            throw re.rethrowFromSystemServer();
+        }
+    }
+
+    /**
      * Returns the user-wide restrictions imposed on this user.
      * @return a Bundle containing all the restrictions.
      */
@@ -2310,8 +2331,8 @@
      * @hide
      * Checks if any uninitialized user has the specific seed account name and type.
      *
-     * @param mAccountName The account name to check for
-     * @param mAccountType The account type of the account to check for
+     * @param accountName The account name to check for
+     * @param accountType The account type of the account to check for
      * @return whether the seed account was found
      */
     public boolean someUserHasSeedAccount(String accountName, String accountType) {
@@ -2321,4 +2342,73 @@
             throw re.rethrowFromSystemServer();
         }
     }
+
+    /**
+     * @hide
+     * User that enforces a restriction.
+     *
+     * @see #getUserRestrictionSources(String, UserHandle)
+     */
+    @SystemApi
+    public static final class EnforcingUser implements Parcelable {
+        private final @UserIdInt int userId;
+        private final @UserRestrictionSource int userRestrictionSource;
+
+        /**
+         * @hide
+         */
+        public EnforcingUser(
+                @UserIdInt int userId, @UserRestrictionSource int userRestrictionSource) {
+            this.userId = userId;
+            this.userRestrictionSource = userRestrictionSource;
+        }
+
+        private EnforcingUser(Parcel in) {
+            userId = in.readInt();
+            userRestrictionSource = in.readInt();
+        }
+
+        public static final Creator<EnforcingUser> CREATOR = new Creator<EnforcingUser>() {
+            @Override
+            public EnforcingUser createFromParcel(Parcel in) {
+                return new EnforcingUser(in);
+            }
+
+            @Override
+            public EnforcingUser[] newArray(int size) {
+                return new EnforcingUser[size];
+            }
+        };
+
+        @Override
+        public int describeContents() {
+            return 0;
+        }
+
+        @Override
+        public void writeToParcel(Parcel dest, int flags) {
+            dest.writeInt(userId);
+            dest.writeInt(userRestrictionSource);
+        }
+
+        /**
+         * Returns an id of the enforcing user.
+         *
+         * <p> Will be UserHandle.USER_NULL when restriction is set by the system.
+         */
+        public UserHandle getUserHandle() {
+            return UserHandle.of(userId);
+        }
+
+        /**
+         * Returns the status of the enforcing user.
+         *
+         * <p> One of {@link #RESTRICTION_SOURCE_SYSTEM},
+         * {@link #RESTRICTION_SOURCE_DEVICE_OWNER} and
+         * {@link #RESTRICTION_SOURCE_PROFILE_OWNER}
+         */
+        public @UserRestrictionSource int getUserRestrictionSource() {
+            return userRestrictionSource;
+        }
+    }
 }
diff --git a/core/java/android/os/UserManagerInternal.java b/core/java/android/os/UserManagerInternal.java
index 466a7e3..97da588 100644
--- a/core/java/android/os/UserManagerInternal.java
+++ b/core/java/android/os/UserManagerInternal.java
@@ -15,7 +15,6 @@
  */
 package android.os;
 
-import android.annotation.NonNull;
 import android.annotation.Nullable;
 import android.content.pm.UserInfo;
 import android.graphics.Bitmap;
@@ -24,6 +23,10 @@
  * @hide Only for use within the system server.
  */
 public abstract class UserManagerInternal {
+    public static final int CAMERA_NOT_DISABLED = 0;
+    public static final int CAMERA_DISABLED_LOCALLY = 1;
+    public static final int CAMERA_DISABLED_GLOBALLY = 2;
+
     public interface UserRestrictionsListener {
         /**
          * Called when a user restriction changes.
@@ -36,18 +39,19 @@
     }
 
     /**
-     * Called by {@link com.android.server.devicepolicy.DevicePolicyManagerService}
-     * to set per-user as well as global user restrictions.
+     * Called by {@link com.android.server.devicepolicy.DevicePolicyManagerService} to set
+     * restrictions enforced by the user.
      *
      * @param userId target user id for the local restrictions.
-     * @param localRestrictions per-user restrictions.
-     *     Caller must not change it once passed to this method.
-     * @param globalRestrictions global restrictions set by DO.  Must be null when PO changed user
-     *     restrictions, in which case global restrictions won't change.
-     *     Caller must not change it once passed to this method.
+     * @param restrictions a bundle of user restrictions.
+     * @param isDeviceOwner whether {@code userId} corresponds to device owner user id.
+     * @param cameraRestrictionScope is camera disabled and if so what is the scope of restriction.
+     *        Should be one of {@link #CAMERA_NOT_DISABLED}, {@link #CAMERA_DISABLED_LOCALLY} or
+     *                               {@link #CAMERA_DISABLED_GLOBALLY}
      */
-    public abstract void setDevicePolicyUserRestrictions(int userId,
-            @NonNull Bundle localRestrictions, @Nullable Bundle globalRestrictions);
+    public abstract void setDevicePolicyUserRestrictions(int userId, @Nullable Bundle restrictions,
+            boolean isDeviceOwner, int cameraRestrictionScope);
+
     /**
      * Returns the "base" user restrictions.
      *
diff --git a/core/java/android/os/storage/IStorageManager.aidl b/core/java/android/os/storage/IStorageManager.aidl
index 27c0526..59394b2 100644
--- a/core/java/android/os/storage/IStorageManager.aidl
+++ b/core/java/android/os/storage/IStorageManager.aidl
@@ -25,6 +25,7 @@
 import android.os.storage.StorageVolume;
 import android.os.storage.VolumeInfo;
 import android.os.storage.VolumeRecord;
+import com.android.internal.os.AppFuseMount;
 
 /**
  * WARNING! Update IMountService.h and IMountService.cpp if you change this
@@ -289,4 +290,6 @@
     void addUserKeyAuth(int userId, int serialNumber, in byte[] token, in byte[] secret) = 70;
     void fixateNewestUserKeyAuth(int userId) = 71;
     void fstrim(int flags) = 72;
+    AppFuseMount mountProxyFileDescriptorBridge() = 73;
+    ParcelFileDescriptor openProxyFileDescriptor(int mountPointId, int fileId, int mode) = 74;
 }
diff --git a/core/java/android/os/storage/StorageManager.java b/core/java/android/os/storage/StorageManager.java
index 03fd8d3..85df48f 100644
--- a/core/java/android/os/storage/StorageManager.java
+++ b/core/java/android/os/storage/StorageManager.java
@@ -30,6 +30,7 @@
 import android.os.Environment;
 import android.os.FileUtils;
 import android.os.Handler;
+import android.os.ProxyFileDescriptorCallback;
 import android.os.Looper;
 import android.os.Message;
 import android.os.ParcelFileDescriptor;
@@ -44,7 +45,10 @@
 import android.util.Pair;
 import android.util.Slog;
 import android.util.SparseArray;
-
+import com.android.internal.annotations.GuardedBy;
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.internal.os.AppFuseMount;
+import com.android.internal.os.FuseAppLoop;
 import com.android.internal.os.RoSystemProperties;
 import com.android.internal.os.SomeArgs;
 import com.android.internal.util.Preconditions;
@@ -62,6 +66,7 @@
 import java.util.Iterator;
 import java.util.List;
 import java.util.Objects;
+import java.util.concurrent.ThreadFactory;
 import java.util.concurrent.atomic.AtomicInteger;
 
 /**
@@ -1322,6 +1327,90 @@
         }
     }
 
+
+    /** {@hide} */
+    @VisibleForTesting
+    public @NonNull ParcelFileDescriptor openProxyFileDescriptor(
+            int mode, ProxyFileDescriptorCallback callback, ThreadFactory factory)
+                    throws IOException {
+        // Retry is needed because the mount point mFuseAppLoop is using may be unmounted before
+        // invoking StorageManagerService#openProxyFileDescriptor. In this case, we need to re-mount
+        // the bridge by calling mountProxyFileDescriptorBridge.
+        int retry = 3;
+        while (retry-- > 0) {
+            try {
+                synchronized (mFuseAppLoopLock) {
+                    if (mFuseAppLoop == null) {
+                        final AppFuseMount mount = mStorageManager.mountProxyFileDescriptorBridge();
+                        if (mount == null) {
+                            Log.e(TAG, "Failed to open proxy file bridge.");
+                            throw new IOException("Failed to open proxy file bridge.");
+                        }
+                        mFuseAppLoop = FuseAppLoop.open(mount.mountPointId, mount.fd, factory);
+                    }
+
+                    try {
+                        final int fileId = mFuseAppLoop.registerCallback(callback);
+                        final ParcelFileDescriptor pfd =
+                                mStorageManager.openProxyFileDescriptor(
+                                        mFuseAppLoop.getMountPointId(), fileId, mode);
+                        if (pfd != null) {
+                            return pfd;
+                        }
+                        // Probably the bridge is being unmounted but mFuseAppLoop has not been
+                        // noticed it yet.
+                        mFuseAppLoop.unregisterCallback(fileId);
+                    } catch (FuseAppLoop.UnmountedException error) {
+                        Log.d(TAG, "mFuseAppLoop has been already unmounted.");
+                        mFuseAppLoop = null;
+                        continue;
+                    }
+                }
+                try {
+                    Thread.sleep(100);
+                } catch (InterruptedException e) {
+                    break;
+                }
+            } catch (RemoteException e) {
+                e.rethrowFromSystemServer();
+            }
+        }
+
+        throw new IOException("Failed to mount bridge.");
+    }
+
+    /**
+     * Opens seekable ParcelFileDescriptor that routes file operation requests to
+     * ProxyFileDescriptorCallback.
+     *
+     * @param mode The desired access mode, must be one of
+     *     {@link ParcelFileDescriptor#MODE_READ_ONLY},
+     *     {@link ParcelFileDescriptor#MODE_WRITE_ONLY}, or
+     *     {@link ParcelFileDescriptor#MODE_READ_WRITE}
+     * @param callback Callback to process file operation requests issued on returned file
+     *     descriptor. The callback is invoked on a thread managed by the framework.
+     * @return Seekable ParcelFileDescriptor.
+     * @throws IOException
+     */
+    public @NonNull ParcelFileDescriptor openProxyFileDescriptor(
+            int mode, ProxyFileDescriptorCallback callback)
+                    throws IOException {
+        return openProxyFileDescriptor(mode, callback, null);
+    }
+
+    /** {@hide} */
+    @VisibleForTesting
+    public int getProxyFileDescriptorMountPointId() {
+        synchronized (mFuseAppLoopLock) {
+            return mFuseAppLoop != null ? mFuseAppLoop.getMountPointId() : -1;
+        }
+    }
+
+    private final Object mFuseAppLoopLock = new Object();
+
+    @GuardedBy("mFuseAppLoopLock")
+    private @Nullable FuseAppLoop mFuseAppLoop = null;
+
     /// Consts to match the password types in cryptfs.h
     /** @hide */
     public static final int CRYPT_TYPE_PASSWORD = 0;
diff --git a/core/java/android/provider/ContactsContract.java b/core/java/android/provider/ContactsContract.java
index a07aee5..1b512c6 100644
--- a/core/java/android/provider/ContactsContract.java
+++ b/core/java/android/provider/ContactsContract.java
@@ -8170,11 +8170,29 @@
         /**
          * The content:// style URI for this table.  Requests to this URI can be
          * performed on the UI thread because they are always unblocking.
+         *
+         * <p>Note when you listen on this URI (or any other sub-URIs), you'll be notified for
+         * regular contact change notifications too, which will be sent on the root URI.
+         * If you only want to be notified for provider status change notifications, listen on
+         * {@link #STATUS_CHANGE_NOTIFICATION_CONTENT_URI} instead.
          */
         public static final Uri CONTENT_URI =
                 Uri.withAppendedPath(AUTHORITY_URI, "provider_status");
 
         /**
+         * URI to listen to provider status changes without listening to regular
+         * contact changes.  If a client only wants to monitor {@link ProviderStatus} with
+         * {@link android.app.job.JobScheduler}, then this URI should be used instead of
+         * {@link #CONTENT_URI}, because a job on {@link #CONTENT_URI} will also be invoked
+         * when contacts are changed.
+         *
+         * <p>Note this URI cannot be queried.  A query should be always made on
+         * {@link #CONTENT_URI}.
+         */
+        public static final Uri STATUS_CHANGE_NOTIFICATION_CONTENT_URI =
+                Uri.parse("content://com.android.contacts.provider_status");
+
+        /**
          * The MIME-type of {@link #CONTENT_URI} providing a directory of
          * settings.
          */
@@ -8201,6 +8219,13 @@
          * on the device.
          */
         public static final int STATUS_EMPTY = 2;
+
+        /**
+         * Timestamp (milliseconds since epoch) of when the provider's database was created.
+         *
+         * <P>Type: long
+         */
+        public static final String DATABASE_CREATION_TIMESTAMP = "database_creation_timestamp";
     }
 
     /**
@@ -8768,7 +8793,14 @@
         /**
          * This is the intent that is fired when the contacts database is created. <p> The
          * READ_CONTACT permission is required to receive these broadcasts.
+         *
+         * <p>As of O, this broadcast will no longer be sent.  Applications can use
+         * use {@link android.app.job.JobScheduler} to monitor
+         * {@link ProviderStatus#STATUS_CHANGE_NOTIFICATION_CONTENT_URI}, and read
+         * {@link ProviderStatus#DATABASE_CREATION_TIMESTAMP} to get when
+         * the contacts database was initialized.
          */
+        @Deprecated
         public static final String CONTACTS_DATABASE_CREATED =
                 "android.provider.Contacts.DATABASE_CREATED";
 
diff --git a/core/java/android/provider/Settings.java b/core/java/android/provider/Settings.java
index 893e53c..371c0f3 100755
--- a/core/java/android/provider/Settings.java
+++ b/core/java/android/provider/Settings.java
@@ -5313,6 +5313,21 @@
         public static final String ACCESSIBILITY_ENABLED = "accessibility_enabled";
 
         /**
+         * Setting specifying if the accessibility shortcut dialog has been shown to this user.
+         * @hide
+         */
+        public static final String ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN =
+                "accessibility_shortcut_dialog_shown";
+
+        /**
+         * Setting specifying the the accessibility service to be toggled via the accessibility
+         * shortcut. Must be its flattened {@link ComponentName}.
+         * @hide
+         */
+        public static final String ACCESSIBILITY_SHORTCUT_TARGET_SERVICE =
+                "accessibility_shortcut_target_service";
+
+        /**
          * If touch exploration is enabled.
          */
         public static final String TOUCH_EXPLORATION_ENABLED = "touch_exploration_enabled";
@@ -6782,6 +6797,8 @@
             TOUCH_EXPLORATION_GRANTED_ACCESSIBILITY_SERVICES,
             TOUCH_EXPLORATION_ENABLED,
             ACCESSIBILITY_ENABLED,
+            ACCESSIBILITY_SHORTCUT_TARGET_SERVICE,
+            ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN,
             ACCESSIBILITY_SPEAK_PASSWORD,
             ACCESSIBILITY_HIGH_TEXT_CONTRAST_ENABLED,
             ACCESSIBILITY_CAPTIONING_PRESET,
@@ -7071,7 +7088,9 @@
          * Setting whether the global gesture for enabling accessibility is enabled.
          * If this gesture is enabled the user will be able to perfrom it to enable
          * the accessibility state without visiting the settings app.
+         *
          * @hide
+         * No longer used. Should be removed once all dependencies have been updated.
          */
         public static final String ENABLE_ACCESSIBILITY_GLOBAL_GESTURE_ENABLED =
                 "enable_accessibility_global_gesture_enabled";
@@ -9372,7 +9391,6 @@
             DOCK_SOUNDS_ENABLED,
             CHARGING_SOUNDS_ENABLED,
             USB_MASS_STORAGE_ENABLED,
-            ENABLE_ACCESSIBILITY_GLOBAL_GESTURE_ENABLED,
             WIFI_NETWORKS_AVAILABLE_NOTIFICATION_ON,
             WIFI_NETWORKS_AVAILABLE_REPEAT_DELAY,
             WIFI_WATCHDOG_POOR_NETWORK_TEST_ENABLED,
diff --git a/core/java/android/view/View.java b/core/java/android/view/View.java
index 9d1af50..37dfdb9 100644
--- a/core/java/android/view/View.java
+++ b/core/java/android/view/View.java
@@ -6934,8 +6934,7 @@
                 & (View.AUTO_FILL_FLAG_TYPE_FILL
                         | View.AUTO_FILL_FLAG_TYPE_SAVE)) != 0;
         final int id = mID;
-        if (id > 0 && (id&0xff000000) != 0 && (id&0x00ff0000) != 0
-                && (id&0x0000ffff) != 0) {
+        if (id != NO_ID && !isViewIdGenerated(id)) {
             String pkg, type, entry;
             try {
                 final Resources res = getResources();
@@ -22640,6 +22639,10 @@
         }
     }
 
+    private static boolean isViewIdGenerated(int id) {
+        return (id & 0xFF000000) == 0 && (id & 0x00FFFFFF) != 0;
+    }
+
     /**
      * Gets the Views in the hierarchy affected by entering and exiting Activity Scene transitions.
      * @param transitioningViews This View will be added to transitioningViews if it is VISIBLE and
diff --git a/core/java/android/view/ViewConfiguration.java b/core/java/android/view/ViewConfiguration.java
index 6d2f850..0e753f3 100644
--- a/core/java/android/view/ViewConfiguration.java
+++ b/core/java/android/view/ViewConfiguration.java
@@ -83,6 +83,13 @@
     private static final int GLOBAL_ACTIONS_KEY_TIMEOUT = 500;
 
     /**
+     * Defines the duration in milliseconds a user needs to hold down the
+     * appropriate button to bring up the accessibility shortcut (first time) or enable it
+     * (once shortcut is configured).
+     */
+    private static final int A11Y_SHORTCUT_KEY_TIMEOUT = 3000;
+
+    /**
      * Defines the duration in milliseconds we will wait to see if a touch event
      * is a tap or a scroll. If the user does not move within this interval, it is
      * considered to be a tap.
@@ -785,6 +792,18 @@
     }
 
     /**
+     * The amount of time a user needs to press the relevant keys to activate the accessibility
+     * shortcut.
+     *
+     * @return how long a user needs to press the relevant keys to activate the accessibility
+     *   shortcut.
+     * @hide
+     */
+    public long getAccessibilityShortcutKeyTimeout() {
+        return A11Y_SHORTCUT_KEY_TIMEOUT;
+    }
+
+    /**
      * The amount of friction applied to scrolls and flings.
      *
      * @return A scalar dimensionless value representing the coefficient of
diff --git a/core/java/android/view/ViewGroup.java b/core/java/android/view/ViewGroup.java
index 1b42a90..a479bb3 100644
--- a/core/java/android/view/ViewGroup.java
+++ b/core/java/android/view/ViewGroup.java
@@ -1788,15 +1788,15 @@
             for (int i = childrenCount - 1; i >= 0; i--) {
                 final int childIndex = getAndVerifyPreorderedIndex(childrenCount, i, customOrder);
                 final View child = getAndVerifyPreorderedView(preorderedList, children, childIndex);
-                final PointF point = getLocalPoint();
-                if (isTransformedTouchPointInView(x, y, child, point)) {
-                    final PointerIcon pointerIcon =
-                            dispatchResolvePointerIcon(event, pointerIndex, child);
-                    if (pointerIcon != null) {
-                        if (preorderedList != null) preorderedList.clear();
-                        return pointerIcon;
-                    }
-                    break;
+                if (!canViewReceivePointerEvents(child)
+                        || !isTransformedTouchPointInView(x, y, child, null)) {
+                    continue;
+                }
+                final PointerIcon pointerIcon =
+                        dispatchResolvePointerIcon(event, pointerIndex, child);
+                if (pointerIcon != null) {
+                    if (preorderedList != null) preorderedList.clear();
+                    return pointerIcon;
                 }
             }
             if (preorderedList != null) preorderedList.clear();
@@ -2091,11 +2091,12 @@
                                 getAndVerifyPreorderedIndex(childrenCount, i, customOrder);
                         final View child =
                                 getAndVerifyPreorderedView(preorderedList, children, childIndex);
-                        final PointF point = getLocalPoint();
-                        if (isTransformedTouchPointInView(x, y, child, point)) {
-                            if (dispatchTooltipHoverEvent(event, child)) {
-                                newTarget = child;
-                            }
+                        if (!canViewReceivePointerEvents(child)
+                                || !isTransformedTouchPointInView(x, y, child, null)) {
+                            continue;
+                        }
+                        if (dispatchTooltipHoverEvent(event, child)) {
+                            newTarget = child;
                             break;
                         }
                     }
diff --git a/core/java/android/view/accessibility/AccessibilityManager.java b/core/java/android/view/accessibility/AccessibilityManager.java
index 7f940f1..bfb8d83 100644
--- a/core/java/android/view/accessibility/AccessibilityManager.java
+++ b/core/java/android/view/accessibility/AccessibilityManager.java
@@ -21,6 +21,7 @@
 import android.Manifest;
 import android.accessibilityservice.AccessibilityServiceInfo;
 import android.annotation.NonNull;
+import android.content.ComponentName;
 import android.content.Context;
 import android.content.pm.PackageManager;
 import android.content.pm.ServiceInfo;
@@ -241,6 +242,8 @@
      * @hide
      */
     public AccessibilityManager(Context context, IAccessibilityManager service, int userId) {
+        // Constructor can't be chained because we can't create an instance of an inner class
+        // before calling another constructor.
         mHandler = new MyHandler(context.getMainLooper());
         mUserId = userId;
         synchronized (mLock) {
@@ -249,6 +252,23 @@
     }
 
     /**
+     * Create an instance.
+     *
+     * @param handler The handler to use
+     * @param service An interface to the backing service.
+     * @param userId User id under which to run.
+     *
+     * @hide
+     */
+    public AccessibilityManager(Handler handler, IAccessibilityManager service, int userId) {
+        mHandler = handler;
+        mUserId = userId;
+        synchronized (mLock) {
+            tryConnectToServiceLocked(service);
+        }
+    }
+
+    /**
      * @hide
      */
     public IAccessibilityManagerClient getClient() {
@@ -647,6 +667,30 @@
     }
 
     /**
+     * Find an installed service with the specified {@link ComponentName}.
+     *
+     * @param componentName The name to match to the service.
+     *
+     * @return The info corresponding to the installed service, or {@code null} if no such service
+     * is installed.
+     * @hide
+     */
+    public AccessibilityServiceInfo getInstalledServiceInfoWithComponentName(
+            ComponentName componentName) {
+        final List<AccessibilityServiceInfo> installedServiceInfos =
+                getInstalledAccessibilityServiceList();
+        if ((installedServiceInfos == null) || (componentName == null)) {
+            return null;
+        }
+        for (int i = 0; i < installedServiceInfos.size(); i++) {
+            if (componentName.equals(installedServiceInfos.get(i).getComponentName())) {
+                return installedServiceInfos.get(i);
+            }
+        }
+        return null;
+    }
+
+    /**
      * Adds an accessibility interaction connection interface for a given window.
      * @param windowToken The window token to which a connection is added.
      * @param connection The connection.
@@ -693,6 +737,26 @@
         }
     }
 
+    /**
+     * Perform the accessibility shortcut if the caller has permission.
+     *
+     * @hide
+     */
+    public void performAccessibilityShortcut() {
+        final IAccessibilityManager service;
+        synchronized (mLock) {
+            service = getServiceLocked();
+            if (service == null) {
+                return;
+            }
+        }
+        try {
+            service.performAccessibilityShortcut();
+        } catch (RemoteException re) {
+            Log.e(LOG_TAG, "Error performing accessibility shortcut. ", re);
+        }
+    }
+
     private IAccessibilityManager getServiceLocked() {
         if (mService == null) {
             tryConnectToServiceLocked(null);
diff --git a/core/java/android/view/accessibility/IAccessibilityManager.aidl b/core/java/android/view/accessibility/IAccessibilityManager.aidl
index 2829744..ed77f68 100644
--- a/core/java/android/view/accessibility/IAccessibilityManager.aidl
+++ b/core/java/android/view/accessibility/IAccessibilityManager.aidl
@@ -60,7 +60,6 @@
 
     IBinder getWindowToken(int windowId, int userId);
 
-    void enableAccessibilityService(in ComponentName service, int userId);
-
-    void disableAccessibilityService(in ComponentName service, int userId);
+    // Requires WRITE_SECURE_SETTINGS
+    void performAccessibilityShortcut();
 }
diff --git a/core/java/android/webkit/IWebViewUpdateService.aidl b/core/java/android/webkit/IWebViewUpdateService.aidl
index 894f080..dbca7ff 100644
--- a/core/java/android/webkit/IWebViewUpdateService.aidl
+++ b/core/java/android/webkit/IWebViewUpdateService.aidl
@@ -78,4 +78,14 @@
      * Enable or disable the WebView package fallback mechanism.
      */
     void enableFallbackLogic(boolean enable);
+
+    /**
+     * Used by Settings to determine whether multiprocess is enabled.
+     */
+    boolean isMultiProcessEnabled();
+
+    /**
+     * Used by Settings to enable/disable multiprocess.
+     */
+    void enableMultiProcess(boolean enable);
 }
diff --git a/core/java/android/widget/TextView.java b/core/java/android/widget/TextView.java
index 345896a..b6693c7 100644
--- a/core/java/android/widget/TextView.java
+++ b/core/java/android/widget/TextView.java
@@ -7740,14 +7740,25 @@
             desired = Math.max(desired, dr.mDrawableHeightRight);
         }
 
-        desired += getCompoundPaddingTop() + getCompoundPaddingBottom();
+        int linecount = layout.getLineCount();
+        final int padding = getCompoundPaddingTop() + getCompoundPaddingBottom();
+        desired += padding;
 
         if (mMaxMode != LINES) {
             desired = Math.min(desired, mMaximum);
+        } else if (cap && linecount > mMaximum && layout instanceof DynamicLayout) {
+            desired = layout.getLineTop(mMaximum);
+
+            if (dr != null) {
+                desired = Math.max(desired, dr.mDrawableHeightLeft);
+                desired = Math.max(desired, dr.mDrawableHeightRight);
+            }
+
+            desired += padding;
+            linecount = mMaximum;
         }
 
         if (mMinMode == LINES) {
-            int linecount = layout.getLineCount();
             if (linecount < mMinimum) {
                 desired += getLineHeight() * (mMinimum - linecount);
             }
diff --git a/core/java/com/android/internal/os/AppFuseMount.aidl b/core/java/com/android/internal/os/AppFuseMount.aidl
new file mode 100644
index 0000000..66cf95b
--- /dev/null
+++ b/core/java/com/android/internal/os/AppFuseMount.aidl
@@ -0,0 +1,19 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.internal.os;
+
+parcelable AppFuseMount;
diff --git a/core/java/com/android/internal/os/AppFuseMount.java b/core/java/com/android/internal/os/AppFuseMount.java
index b392186..04d7211 100644
--- a/core/java/com/android/internal/os/AppFuseMount.java
+++ b/core/java/com/android/internal/os/AppFuseMount.java
@@ -19,14 +19,26 @@
 import android.os.Parcel;
 import android.os.ParcelFileDescriptor;
 import android.os.Parcelable;
-import java.io.File;
+import android.os.storage.IStorageManager;
+import com.android.internal.util.Preconditions;
 
+/**
+ * Parcelable class representing AppFuse mount.
+ * This conveys the result for IStorageManager#openProxyFileDescriptor.
+ * @see IStorageManager#openProxyFileDescriptor
+ */
 public class AppFuseMount implements Parcelable {
-    final public File mountPoint;
+    final public int mountPointId;
     final public ParcelFileDescriptor fd;
 
-    public AppFuseMount(File mountPoint, ParcelFileDescriptor fd) {
-        this.mountPoint = mountPoint;
+    /**
+     * @param mountPointId Integer number for mount point that is unique in the lifetime of
+     *     StorageManagerService.
+     * @param fd File descriptor pointing /dev/fuse and tagged with the mount point.
+     */
+    public AppFuseMount(int mountPointId, ParcelFileDescriptor fd) {
+        Preconditions.checkNotNull(fd);
+        this.mountPointId = mountPointId;
         this.fd = fd;
     }
 
@@ -37,7 +49,7 @@
 
     @Override
     public void writeToParcel(Parcel dest, int flags) {
-        dest.writeString(this.mountPoint.getPath());
+        dest.writeInt(this.mountPointId);
         dest.writeParcelable(fd, flags);
     }
 
@@ -45,7 +57,7 @@
             new Parcelable.Creator<AppFuseMount>() {
         @Override
         public AppFuseMount createFromParcel(Parcel in) {
-            return new AppFuseMount(new File(in.readString()), in.readParcelable(null));
+            return new AppFuseMount(in.readInt(), in.readParcelable(null));
         }
 
         @Override
diff --git a/core/java/com/android/internal/os/FuseAppLoop.java b/core/java/com/android/internal/os/FuseAppLoop.java
index 34253ce..3603b6d 100644
--- a/core/java/com/android/internal/os/FuseAppLoop.java
+++ b/core/java/com/android/internal/os/FuseAppLoop.java
@@ -18,34 +18,38 @@
 
 import android.annotation.NonNull;
 import android.annotation.Nullable;
-import android.os.IProxyFileDescriptorCallback;
+import android.os.ProxyFileDescriptorCallback;
 import android.os.ParcelFileDescriptor;
 import android.system.ErrnoException;
 import android.system.OsConstants;
 import android.util.Log;
 import android.util.SparseArray;
 import com.android.internal.annotations.GuardedBy;
+import com.android.internal.annotations.VisibleForTesting;
 import com.android.internal.util.Preconditions;
 
-import java.io.File;
-import java.io.FileNotFoundException;
 import java.io.IOException;
+import java.util.concurrent.ThreadFactory;
 
 public class FuseAppLoop {
     private static final String TAG = "FuseAppLoop";
     private static final boolean DEBUG = Log.isLoggable(TAG, Log.DEBUG);
     public static final int ROOT_INODE = 1;
     private static final int MIN_INODE = 2;
+    private static final ThreadFactory sDefaultThreadFactory = new ThreadFactory() {
+        @Override
+        public Thread newThread(Runnable r) {
+            return new Thread(r, TAG);
+        }
+    };
 
     private final Object mLock = new Object();
-    private final File mParent;
+    private final int mMountPointId;
+    private final Thread mThread;
 
     @GuardedBy("mLock")
     private final SparseArray<CallbackEntry> mCallbackMap = new SparseArray<>();
 
-    @GuardedBy("mLock")
-    private boolean mActive = true;
-
     /**
      * Sequential number can be used as file name and inode in AppFuse.
      * 0 is regarded as an error, 1 is mount point. So we start the number from 2.
@@ -53,35 +57,40 @@
     @GuardedBy("mLock")
     private int mNextInode = MIN_INODE;
 
-    private FuseAppLoop(@NonNull File parent) {
-        mParent = parent;
-    }
-
-    public static @NonNull FuseAppLoop open(
-            @NonNull File parent, @NonNull ParcelFileDescriptor fd) {
-        Preconditions.checkNotNull(parent);
-        Preconditions.checkNotNull(fd);
-        final FuseAppLoop bridge = new FuseAppLoop(parent);
+    private FuseAppLoop(
+            int mountPointId, @NonNull ParcelFileDescriptor fd, @Nullable ThreadFactory factory) {
+        mMountPointId = mountPointId;
         final int rawFd = fd.detachFd();
-        new Thread(new Runnable() {
+        if (factory == null) {
+            factory = sDefaultThreadFactory;
+        }
+        mThread = factory.newThread(new Runnable() {
             @Override
             public void run() {
-                bridge.native_start_loop(rawFd);
+                // rawFd is closed by native_start_loop. Java code does not need to close it.
+                native_start_loop(rawFd);
             }
-        }, TAG).start();
-        return bridge;
+        });
     }
 
-    public @NonNull ParcelFileDescriptor openFile(int mode, IProxyFileDescriptorCallback callback)
+    public static @NonNull FuseAppLoop open(int mountPointId, @NonNull ParcelFileDescriptor fd,
+            @Nullable ThreadFactory factory) {
+        Preconditions.checkNotNull(fd);
+        final FuseAppLoop loop = new FuseAppLoop(mountPointId, fd, factory);
+        loop.mThread.start();
+        return loop;
+    }
+
+    public int registerCallback(@NonNull ProxyFileDescriptorCallback callback)
             throws UnmountedException, IOException {
-        int id;
+        if (mThread.getState() == Thread.State.TERMINATED) {
+            throw new UnmountedException();
+        }
         synchronized (mLock) {
-            if (!mActive) {
-                throw new UnmountedException();
-            }
             if (mCallbackMap.size() >= Integer.MAX_VALUE - MIN_INODE) {
                 throw new IOException("Too many opened files.");
             }
+            int id;
             while (true) {
                 id = mNextInode;
                 mNextInode++;
@@ -92,24 +101,17 @@
                     break;
                 }
             }
-
-            // Register callback after we succeed to create pfd.
             mCallbackMap.put(id, new CallbackEntry(callback));
-        }
-        try {
-            return ParcelFileDescriptor.open(new File(mParent, String.valueOf(id)), mode);
-        } catch (FileNotFoundException error) {
-            synchronized (mLock) {
-                mCallbackMap.remove(id);
-            }
-            throw error;
+            return id;
         }
     }
 
-    public @Nullable File getMountPoint() {
-        synchronized (mLock) {
-            return mActive ? mParent : null;
-        }
+    public void unregisterCallback(int id) {
+        mCallbackMap.remove(id);
+    }
+
+    public int getMountPointId() {
+        return mMountPointId;
     }
 
     private CallbackEntry getCallbackEntryOrThrowLocked(long inode) throws ErrnoException {
@@ -128,7 +130,7 @@
             try {
                 return getCallbackEntryOrThrowLocked(inode).callback.onGetSize();
             } catch (ErrnoException exp) {
-                return -exp.errno;
+                return getError(exp);
             }
         }
     }
@@ -147,7 +149,7 @@
                 // file twice.
                 return (int) inode;
             } catch (ErrnoException exp) {
-                return -exp.errno;
+                return getError(exp);
             }
         }
     }
@@ -160,7 +162,7 @@
                 getCallbackEntryOrThrowLocked(inode).callback.onFsync();
                 return 0;
             } catch (ErrnoException exp) {
-                return -exp.errno;
+                return getError(exp);
             }
         }
     }
@@ -169,12 +171,14 @@
     @SuppressWarnings("unused")
     private int onRelease(long inode) {
         synchronized(mLock) {
-            mCallbackMap.remove(checkInode(inode));
-            if (mCallbackMap.size() == 0) {
-                mActive = false;
-                return -1;
+            try {
+                getCallbackEntryOrThrowLocked(inode).callback.onRelease();
+                return 0;
+            } catch (ErrnoException exp) {
+                return getError(exp);
+            } finally {
+                mCallbackMap.remove(checkInode(inode));
             }
-            return 0;
         }
     }
 
@@ -185,7 +189,7 @@
             try {
                 return getCallbackEntryOrThrowLocked(inode).callback.onRead(offset, size, bytes);
             } catch (ErrnoException exp) {
-                return -exp.errno;
+                return getError(exp);
             }
         }
     }
@@ -197,11 +201,17 @@
             try {
                 return getCallbackEntryOrThrowLocked(inode).callback.onWrite(offset, size, bytes);
             } catch (ErrnoException exp) {
-                return -exp.errno;
+                return getError(exp);
             }
         }
     }
 
+    private static int getError(@NonNull ErrnoException exp) {
+        // Should not return ENOSYS because the kernel stops
+        // dispatching the FUSE action once FUSE implementation returns ENOSYS for the action.
+        return exp.errno != OsConstants.ENOSYS ? -exp.errno : -OsConstants.EIO;
+    }
+
     native boolean native_start_loop(int fd);
 
     private static int checkInode(long inode) {
@@ -212,9 +222,9 @@
     public static class UnmountedException extends Exception {}
 
     private static class CallbackEntry {
-        final IProxyFileDescriptorCallback callback;
+        final ProxyFileDescriptorCallback callback;
         boolean opened;
-        CallbackEntry(IProxyFileDescriptorCallback callback) {
+        CallbackEntry(ProxyFileDescriptorCallback callback) {
             Preconditions.checkNotNull(callback);
             this.callback = callback;
         }
diff --git a/core/java/com/android/internal/widget/CachingIconView.java b/core/java/com/android/internal/widget/CachingIconView.java
index 20230cd..b172dbc 100644
--- a/core/java/com/android/internal/widget/CachingIconView.java
+++ b/core/java/com/android/internal/widget/CachingIconView.java
@@ -187,6 +187,7 @@
     }
 
     @Override
+    @RemotableViewMethod
     public void setVisibility(int visibility) {
         mDesiredVisibility = visibility;
         updateVisibility();
diff --git a/core/jni/Android.mk b/core/jni/Android.mk
index 68034f6..6a9ed8e 100644
--- a/core/jni/Android.mk
+++ b/core/jni/Android.mk
@@ -238,6 +238,7 @@
     libnativehelper \
     liblog \
     libcutils \
+    libdebuggerd_client \
     libutils \
     libbinder \
     libui \
diff --git a/core/jni/android_os_Debug.cpp b/core/jni/android_os_Debug.cpp
index 14d7e81..be3a87b 100644
--- a/core/jni/android_os_Debug.cpp
+++ b/core/jni/android_os_Debug.cpp
@@ -33,7 +33,7 @@
 #include <string>
 
 #include <android-base/stringprintf.h>
-#include <cutils/debugger.h>
+#include <debuggerd/client.h>
 #include <log/log.h>
 #include <utils/misc.h>
 #include <utils/String8.h>
diff --git a/core/jni/android_view_PointerIcon.cpp b/core/jni/android_view_PointerIcon.cpp
index 6b634df..4150636 100644
--- a/core/jni/android_view_PointerIcon.cpp
+++ b/core/jni/android_view_PointerIcon.cpp
@@ -78,6 +78,9 @@
 
 status_t android_view_PointerIcon_getLoadedIcon(JNIEnv* env, jobject pointerIconObj,
         PointerIcon* outPointerIcon) {
+    if (!pointerIconObj) {
+        return BAD_VALUE;
+    }
     outPointerIcon->style = env->GetIntField(pointerIconObj, gPointerIconClassInfo.mType);
     outPointerIcon->hotSpotX = env->GetFloatField(pointerIconObj, gPointerIconClassInfo.mHotSpotX);
     outPointerIcon->hotSpotY = env->GetFloatField(pointerIconObj, gPointerIconClassInfo.mHotSpotY);
diff --git a/core/jni/com_android_internal_os_FuseAppLoop.cpp b/core/jni/com_android_internal_os_FuseAppLoop.cpp
index 92a6934..dd003eb 100644
--- a/core/jni/com_android_internal_os_FuseAppLoop.cpp
+++ b/core/jni/com_android_internal_os_FuseAppLoop.cpp
@@ -51,7 +51,6 @@
     JNIEnv* const mEnv;
     jobject const mSelf;
     ScopedLocalRef<jbyteArray> mJniBuffer;
-    bool mActive;
 
     template <typename T>
     T checkException(T result) const {
@@ -67,8 +66,7 @@
     Callback(JNIEnv* env, jobject self) :
         mEnv(env),
         mSelf(self),
-        mJniBuffer(env, nullptr),
-        mActive(true) {}
+        mJniBuffer(env, nullptr) {}
 
     bool Init() {
         mJniBuffer.reset(mEnv->NewByteArray(kBufferSize));
@@ -76,7 +74,7 @@
     }
 
     bool IsActive() override {
-        return mActive;
+        return true;
     }
 
     int64_t OnGetSize(uint64_t inode) override {
@@ -92,10 +90,7 @@
     }
 
     int32_t OnRelease(uint64_t inode) override {
-        if (checkException(mEnv->CallIntMethod(mSelf, gOnReleaseMethod, inode)) == -1) {
-            mActive = false;
-        }
-        return fuse::kFuseSuccess;
+        return checkException(mEnv->CallIntMethod(mSelf, gOnReleaseMethod, inode));
     }
 
     int32_t OnRead(uint64_t inode, uint64_t offset, uint32_t size, void* buffer) override {
diff --git a/core/proto/android/os/incident.proto b/core/proto/android/os/incident.proto
index ec2f32b..c3b0ff1 100644
--- a/core/proto/android/os/incident.proto
+++ b/core/proto/android/os/incident.proto
@@ -21,6 +21,7 @@
 
 import "frameworks/base/libs/incident/proto/android/privacy.proto";
 import "frameworks/base/core/proto/android/service/fingerprint.proto";
+import "frameworks/base/core/proto/android/service/netstats.proto";
 
 package android.os;
 
@@ -49,4 +50,5 @@
 
     // System Services
     android.service.fingerprint.FingerprintServiceDumpProto fingerprint = 3000;
+    android.service.NetworkStatsServiceDumpProto netstats = 3001;
 }
diff --git a/core/proto/android/service/netstats.proto b/core/proto/android/service/netstats.proto
new file mode 100644
index 0000000..5cca6ab
--- /dev/null
+++ b/core/proto/android/service/netstats.proto
@@ -0,0 +1,117 @@
+/*
+ * Copyright (C) 2017 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+syntax = "proto3";
+
+package android.service;
+
+option java_multiple_files = true;
+option java_outer_classname = "NetworkStatsServiceProto";
+
+// Represents dumpsys from NetworkStatsService (netstats).
+message NetworkStatsServiceDumpProto {
+    repeated NetworkInterfaceProto active_interfaces = 1;
+
+    repeated NetworkInterfaceProto active_uid_interfaces = 2;
+
+    NetworkStatsRecorderProto dev_stats = 3;
+
+    NetworkStatsRecorderProto xt_stats = 4;
+
+    NetworkStatsRecorderProto uid_stats = 5;
+
+    NetworkStatsRecorderProto uid_tag_stats = 6;
+}
+
+// Corresponds to NetworkStatsService.mActiveIfaces/mActiveUidIfaces.
+message NetworkInterfaceProto {
+    string interface = 1;
+
+    NetworkIdentitySetProto identities = 2;
+}
+
+// Corresponds to NetworkIdentitySet.
+message NetworkIdentitySetProto {
+    repeated NetworkIdentityProto identities = 1;
+}
+
+// Corresponds to NetworkIdentity.
+message NetworkIdentityProto {
+    // Constats from ConnectivityManager.TYPE_*.
+    int32 type = 1;
+
+    string subscriber_id = 2;
+
+    string network_id = 3;
+
+    bool roaming = 4;
+
+    bool metered = 5;
+}
+
+// Corresponds to NetworkStatsRecorder.
+message NetworkStatsRecorderProto {
+    int64 pending_total_bytes = 1;
+
+    NetworkStatsCollectionProto complete_history = 2;
+}
+
+// Corresponds to NetworkStatsCollection.
+message NetworkStatsCollectionProto {
+    repeated NetworkStatsCollectionStatsProto stats = 1;
+}
+
+// Corresponds to NetworkStatsCollection.mStats.
+message NetworkStatsCollectionStatsProto {
+    NetworkStatsCollectionKeyProto key = 1;
+
+    NetworkStatsHistoryProto history = 2;
+}
+
+// Corresponds to NetworkStatsCollection.Key.
+message NetworkStatsCollectionKeyProto {
+    NetworkIdentitySetProto identity = 1;
+
+    int32 uid = 2;
+
+    int32 set = 3;
+
+    int32 tag = 4;
+}
+
+// Corresponds to NetworkStatsHistory.
+message NetworkStatsHistoryProto {
+    // Duration for this bucket in milliseconds.
+    int64 bucket_duration_ms = 1;
+
+    repeated NetworkStatsHistoryBucketProto buckets = 2;
+}
+
+// Corresponds to each bucket in NetworkStatsHistory.
+message NetworkStatsHistoryBucketProto {
+    // Bucket start time in milliseconds since epoch.
+    int64 bucket_start_ms = 1;
+
+    int64 rx_bytes = 2;
+
+    int64 rx_packets = 3;
+
+    int64 tx_bytes = 4;
+
+    int64 tx_packets = 5;
+
+    int64 operations = 6;
+}
diff --git a/core/res/res/color/text_color_primary.xml b/core/res/res/color/text_color_primary.xml
new file mode 100644
index 0000000..831a9c4
--- /dev/null
+++ b/core/res/res/color/text_color_primary.xml
@@ -0,0 +1,23 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!-- Copyright (C) 2017 The Android Open Source Project
+
+     Licensed under the Apache License, Version 2.0 (the "License");
+     you may not use this file except in compliance with the License.
+     You may obtain a copy of the License at
+
+          http://www.apache.org/licenses/LICENSE-2.0
+
+     Unless required by applicable law or agreed to in writing, software
+     distributed under the License is distributed on an "AS IS" BASIS,
+     WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+     See the License for the specific language governing permissions and
+     limitations under the License.
+-->
+
+<selector xmlns:android="http://schemas.android.com/apk/res/android">
+    <item android:state_enabled="false"
+        android:alpha="?attr/disabledAlpha"
+        android:color="?attr/colorForeground"/>
+    <item android:alpha="?attr/primaryContentAlpha"
+        android:color="?attr/colorForeground"/>
+</selector>
diff --git a/core/res/res/values/attrs.xml b/core/res/res/values/attrs.xml
index dd33718..8e9959f 100644
--- a/core/res/res/values/attrs.xml
+++ b/core/res/res/values/attrs.xml
@@ -62,6 +62,8 @@
 
         <!-- Default disabled alpha for widgets that set enabled/disabled alpha programmatically. -->
         <attr name="disabledAlpha" format="float" />
+        <!-- The alpha applied to the foreground color to create the primary text color. -->
+        <attr name="primaryContentAlpha" format="float" />
         <!-- Default background dim amount when a menu, dialog, or something similar pops up. -->
         <attr name="backgroundDimAmount" format="float" />
         <!-- Control whether dimming behind the window is enabled.  The default
diff --git a/core/res/res/values/colors_material.xml b/core/res/res/values/colors_material.xml
index 40e7341..835b8b60 100644
--- a/core/res/res/values/colors_material.xml
+++ b/core/res/res/values/colors_material.xml
@@ -73,6 +73,8 @@
 
     <item name="disabled_alpha_material_light" format="float" type="dimen">0.26</item>
     <item name="disabled_alpha_material_dark" format="float" type="dimen">0.30</item>
+    <item name="primary_content_alpha_material_light" format="float" type="dimen">1</item>
+    <item name="primary_content_alpha_material_dark" format="float" type="dimen">0.87</item>
 
     <item name="highlight_alpha_material_light" format="float" type="dimen">0.12</item>
     <item name="highlight_alpha_material_dark" format="float" type="dimen">0.20</item>
diff --git a/core/res/res/values/config.xml b/core/res/res/values/config.xml
index db157bf..7de48d3 100644
--- a/core/res/res/values/config.xml
+++ b/core/res/res/values/config.xml
@@ -2710,4 +2710,10 @@
 
     <!-- Component name of the default cell broadcast receiver -->
     <string name="config_defaultCellBroadcastReceiverComponent" translatable="false">com.android.cellbroadcastreceiver/.PrivilegedCellBroadcastReceiver</string>
+
+    <!-- The component name, flattened to a string, for the default accessibility service to be
+         enabled by the accessibility shortcut. This service must be trusted, as it can be activated
+         without explicit consent of the user. If no accessibility service with the specified name
+         exists on the device, the accessibility shortcut will be disabled by default. -->
+    <string name="config_defaultAccessibilityService" translatable="false"></string>
 </resources>
diff --git a/core/res/res/values/public.xml b/core/res/res/values/public.xml
index 064d31e..099fe08 100644
--- a/core/res/res/values/public.xml
+++ b/core/res/res/values/public.xml
@@ -2793,6 +2793,8 @@
     <public-group type="id" first-id="0x01020041">
     </public-group>
 
+    <public type="attr" name="primaryContentAlpha" />
+
   <!-- ===============================================================
        DO NOT ADD UN-GROUPED ITEMS HERE
 
diff --git a/core/res/res/values/strings.xml b/core/res/res/values/strings.xml
index 87a4732..0204e93 100644
--- a/core/res/res/values/strings.xml
+++ b/core/res/res/values/strings.xml
@@ -3818,12 +3818,35 @@
        "Raise volume above recommended level?\n\nListening at high volume for long periods may damage your hearing."
     </string>
 
-    <!-- Text spoken when the user is performing a gesture that will enable accessibility. [CHAR LIMIT=none] -->
-    <string name="continue_to_enable_accessibility">Keep holding down two fingers to enable accessibility.</string>
-    <!-- Text spoken when the user enabled accessibility. [CHAR LIMIT=none] -->
-    <string name="accessibility_enabled">Accessibility enabled.</string>
-    <!-- Text spoken when the user stops preforming a gesture that would enable accessibility. [CHAR LIMIT=none] -->
-    <string name="enable_accessibility_canceled">Accessibility canceled.</string>
+    <!-- Dialog title for dialog shown when the accessibility shortcut is activated, and we want
+     to confirm that the user understands what's going to happen-->
+    <string name="accessibility_shortcut_warning_dialog_title">Accessibility Shortcut is ON</string>
+
+    <!-- Message shown in dialog when user is in the process of enabling the accessibility
+    service via the volume buttons shortcut for the first time. [CHAR LIMIT=none] -->
+    <string name="accessibility_shortcut_toogle_warning">
+        Turn <xliff:g id="service_name" example="TalkBack">%1$s</xliff:g> on or off by holding down
+        both volume buttons for 3 seconds.\n\nYou can change the service in
+        Settings > Accessibility.
+    </string>
+
+    <!-- Text in button that turns off the accessibility shortcut -->
+    <string name="disable_accessibility_shortcut">Turn Off Shortcut</string>
+
+    <!-- Text in button that closes the warning dialog about the accessibility shortcut, leaving the
+    shortcut enabled.-->
+    <string name="leave_accessibility_shortcut_on">Leave on</string>
+
+    <!-- Text in toast to alert the user that the accessibility shortcut turned on an accessibility
+    service.-->
+    <string name="accessibility_shortcut_enabling_service">Accessibility Shortcut turned
+        <xliff:g id="service_name" example="TalkBack">%1$s</xliff:g> on</string>
+
+    <!-- Text in toast to alert the user that the accessibility shortcut turned off an accessibility
+    service.-->
+    <string name="accessibility_shortcut_disabling_service">Accessibility Shortcut turned
+        <xliff:g id="service_name" example="TalkBack">%1$s</xliff:g> off</string>
+
     <!-- Text spoken when the current user is switched if accessibility is enabled. [CHAR LIMIT=none] -->
     <string name="user_switched">Current user <xliff:g id="name" example="Bob">%1$s</xliff:g>.</string>
     <!-- Message shown when switching to a user [CHAR LIMIT=none] -->
diff --git a/core/res/res/values/symbols.xml b/core/res/res/values/symbols.xml
index b923dff..c370ef7 100644
--- a/core/res/res/values/symbols.xml
+++ b/core/res/res/values/symbols.xml
@@ -1139,7 +1139,6 @@
   <java-symbol type="string" name="conference_call" />
   <java-symbol type="string" name="tooltip_popup_title" />
 
-
   <java-symbol type="plurals" name="bugreport_countdown" />
   <java-symbol type="plurals" name="last_num_days" />
   <java-symbol type="plurals" name="matches_found" />
@@ -2797,4 +2796,14 @@
 
   <java-symbol type="raw" name="fallback_categories" />
 
+  <java-symbol type="attr" name="primaryContentAlpha" />
+
+  <!-- Accessibility Shortcut -->
+  <java-symbol type="string" name="accessibility_shortcut_warning_dialog_title" />
+  <java-symbol type="string" name="accessibility_shortcut_toogle_warning" />
+  <java-symbol type="string" name="accessibility_shortcut_enabling_service" />
+  <java-symbol type="string" name="accessibility_shortcut_disabling_service" />
+  <java-symbol type="string" name="disable_accessibility_shortcut" />
+  <java-symbol type="string" name="leave_accessibility_shortcut_on" />
+  <java-symbol type="string" name="config_defaultAccessibilityService" />
 </resources>
diff --git a/core/res/res/values/themes_material.xml b/core/res/res/values/themes_material.xml
index 5f0ad8e..d0f202b 100644
--- a/core/res/res/values/themes_material.xml
+++ b/core/res/res/values/themes_material.xml
@@ -48,13 +48,14 @@
         <item name="colorBackgroundFloating">@color/background_floating_material_dark</item>
         <item name="colorBackgroundCacheHint">@color/background_cache_hint_selector_material_dark</item>
         <item name="disabledAlpha">@dimen/disabled_alpha_material_dark</item>
+        <item name="primaryContentAlpha">@dimen/primary_content_alpha_material_dark</item>
         <item name="backgroundDimAmount">0.6</item>
 
         <!-- Text styles -->
         <item name="textAppearance">@style/TextAppearance.Material</item>
         <item name="textAppearanceInverse">@style/TextAppearance.Material.Inverse</item>
 
-        <item name="textColorPrimary">@color/primary_text_material_dark</item>
+        <item name="textColorPrimary">@color/text_color_primary</item>
         <item name="textColorPrimaryInverse">@color/primary_text_material_light</item>
         <item name="textColorPrimaryActivated">@color/primary_text_inverse_when_activated_material</item>
         <item name="textColorPrimaryDisableOnly">@color/primary_text_disable_only_material_dark</item>
@@ -413,13 +414,14 @@
         <item name="colorBackgroundFloating">@color/background_floating_material_light</item>
         <item name="colorBackgroundCacheHint">@color/background_cache_hint_selector_material_light</item>
         <item name="disabledAlpha">@dimen/disabled_alpha_material_light</item>
+        <item name="primaryContentAlpha">@dimen/primary_content_alpha_material_light</item>
         <item name="backgroundDimAmount">0.6</item>
 
         <!-- Text styles -->
         <item name="textAppearance">@style/TextAppearance.Material</item>
         <item name="textAppearanceInverse">@style/TextAppearance.Material.Inverse</item>
 
-        <item name="textColorPrimary">@color/primary_text_material_light</item>
+        <item name="textColorPrimary">@color/text_color_primary</item>
         <item name="textColorPrimaryInverse">@color/primary_text_material_dark</item>
         <item name="textColorPrimaryActivated">@color/primary_text_inverse_when_activated_material</item>
         <item name="textColorSecondary">@color/secondary_text_material_light</item>
@@ -805,7 +807,7 @@
         <item name="colorBackgroundFloating">@color/background_floating_material_light</item>
         <item name="colorBackgroundCacheHint">@color/background_cache_hint_selector_material_light</item>
 
-        <item name="textColorPrimary">@color/primary_text_material_light</item>
+        <item name="textColorPrimary">@color/text_color_primary</item>
         <item name="textColorPrimaryInverse">@color/primary_text_material_dark</item>
         <item name="textColorSecondary">@color/secondary_text_material_light</item>
         <item name="textColorSecondaryInverse">@color/secondary_text_material_dark</item>
@@ -839,7 +841,7 @@
         <item name="colorBackgroundFloating">@color/background_floating_material_dark</item>
         <item name="colorBackgroundCacheHint">@color/background_cache_hint_selector_material_dark</item>
 
-        <item name="textColorPrimary">@color/primary_text_material_dark</item>
+        <item name="textColorPrimary">@color/text_color_primary</item>
         <item name="textColorPrimaryInverse">@color/primary_text_material_light</item>
         <item name="textColorPrimaryDisableOnly">@color/primary_text_disable_only_material_dark</item>
         <item name="textColorSecondary">@color/secondary_text_material_dark</item>
diff --git a/core/tests/coretests/src/android/os/storage/StorageManagerIntegrationTest.java b/core/tests/coretests/src/android/os/storage/StorageManagerIntegrationTest.java
index 37f0007..ff98eb7 100644
--- a/core/tests/coretests/src/android/os/storage/StorageManagerIntegrationTest.java
+++ b/core/tests/coretests/src/android/os/storage/StorageManagerIntegrationTest.java
@@ -18,15 +18,20 @@
 
 import android.content.Context;
 import android.os.Environment;
+import android.os.ProxyFileDescriptorCallback;
+import android.os.ParcelFileDescriptor;
+import android.system.ErrnoException;
+import android.system.Os;
 import android.test.InstrumentationTestCase;
 import android.test.suitebuilder.annotation.LargeTest;
 import android.test.suitebuilder.annotation.Suppress;
 import android.util.Log;
 
 import com.android.frameworks.coretests.R;
-
+import com.android.internal.os.FuseAppLoop;
 import java.io.DataInputStream;
 import java.io.IOException;
+import java.util.concurrent.ThreadFactory;
 import java.io.File;
 import java.io.FileInputStream;
 
@@ -243,4 +248,47 @@
         verifyObb1Contents(filePath);
         unmountObb(filePath, DONT_FORCE);
     }
+
+    @LargeTest
+    public void testOpenProxyFileDescriptor() throws Exception {
+        final ProxyFileDescriptorCallback callback = new ProxyFileDescriptorCallback() {
+            @Override
+            public long onGetSize() throws ErrnoException {
+                return 0;
+            }
+
+            @Override
+            public void onRelease() {}
+        };
+
+        final MyThreadFactory factory = new MyThreadFactory();
+        int firstMountId;
+        try (final ParcelFileDescriptor fd = mSm.openProxyFileDescriptor(
+                ParcelFileDescriptor.MODE_READ_ONLY, callback, factory)) {
+            assertNotSame(Thread.State.TERMINATED, factory.thread.getState());
+            firstMountId = mSm.getProxyFileDescriptorMountPointId();
+            assertNotSame(-1, firstMountId);
+        }
+
+        // After closing descriptor, the loop should terminate.
+        factory.thread.join(3000);
+        assertEquals(Thread.State.TERMINATED, factory.thread.getState());
+
+        // StorageManager should mount another bridge on the next open request.
+        try (final ParcelFileDescriptor fd = mSm.openProxyFileDescriptor(
+                ParcelFileDescriptor.MODE_WRITE_ONLY, callback, factory)) {
+            assertNotSame(Thread.State.TERMINATED, factory.thread.getState());
+            assertNotSame(firstMountId, mSm.getProxyFileDescriptorMountPointId());
+        }
+    }
+
+    private static class MyThreadFactory implements ThreadFactory {
+        Thread thread = null;
+
+        @Override
+        public Thread newThread(Runnable r) {
+            thread = new Thread(r);
+            return thread;
+        }
+    }
 }
\ No newline at end of file
diff --git a/data/etc/privapp-permissions-platform.xml b/data/etc/privapp-permissions-platform.xml
index 05db9b0..f1be4a9 100644
--- a/data/etc/privapp-permissions-platform.xml
+++ b/data/etc/privapp-permissions-platform.xml
@@ -110,11 +110,21 @@
         <permission name="android.permission.WRITE_SECURE_SETTINGS"/>
     </privapp-permissions>
 
+    <privapp-permissions package="com.android.omadm.service">
+        <permission name="android.permission.CHANGE_CONFIGURATION"/>
+        <permission name="android.permission.CONNECTIVITY_INTERNAL"/>
+        <permission name="android.permission.MODIFY_PHONE_STATE"/>
+        <permission name="android.permission.READ_PRIVILEGED_PHONE_STATE"/>
+        <permission name="android.permission.WRITE_APN_SETTINGS"/>
+        <permission name="android.permission.WRITE_SECURE_SETTINGS"/>
+    </privapp-permissions>
+
     <privapp-permissions package="com.android.packageinstaller">
         <permission name="android.permission.CLEAR_APP_CACHE"/>
         <permission name="android.permission.DELETE_PACKAGES"/>
         <permission name="android.permission.INSTALL_PACKAGES"/>
         <permission name="android.permission.MANAGE_USERS"/>
+        <permission name="android.permission.OBSERVE_GRANT_REVOKE_PERMISSIONS"/>
         <permission name="android.permission.UPDATE_APP_OPS_STATS"/>
     </privapp-permissions>
 
@@ -122,6 +132,7 @@
         <permission name="android.permission.ACCESS_IMS_CALL_SERVICE"/>
         <permission name="android.permission.BIND_CARRIER_MESSAGING_SERVICE"/>
         <permission name="android.permission.BIND_CARRIER_SERVICES"/>
+        <permission name="android.permission.BIND_VISUAL_VOICEMAIL_SERVICE"/>
         <permission name="android.permission.CALL_PRIVILEGED"/>
         <permission name="android.permission.CHANGE_COMPONENT_ENABLED_STATE"/>
         <permission name="android.permission.CHANGE_CONFIGURATION"/>
@@ -327,4 +338,4 @@
         <permission name="android.permission.CONTROL_VPN"/>
     </privapp-permissions>
 
-</permissions>
+</permissions>
\ No newline at end of file
diff --git a/graphics/java/android/graphics/Color.java b/graphics/java/android/graphics/Color.java
index a2c104a..ff21cac 100644
--- a/graphics/java/android/graphics/Color.java
+++ b/graphics/java/android/graphics/Color.java
@@ -16,27 +16,278 @@
 
 package android.graphics;
 
+import android.annotation.AnyThread;
 import android.annotation.ColorInt;
+import android.annotation.ColorLong;
+import android.annotation.HalfFloat;
+import android.annotation.IntRange;
+import android.annotation.NonNull;
 import android.annotation.Size;
 
+import android.util.Half;
 import com.android.internal.util.XmlUtils;
 
+import java.util.Arrays;
 import java.util.HashMap;
 import java.util.Locale;
 import java.util.function.DoubleUnaryOperator;
 
 /**
- * The Color class defines methods for creating and converting color ints.
- * Colors are represented as packed ints, made up of 4 bytes: alpha, red,
- * green, blue. The values are unpremultiplied, meaning any transparency is
- * stored solely in the alpha component, and not in the color components. The
- * components are stored as follows (alpha << 24) | (red << 16) |
- * (green << 8) | blue. Each component ranges between 0..255 with 0
- * meaning no contribution for that component, and 255 meaning 100%
- * contribution. Thus opaque-black would be 0xFF000000 (100% opaque but
- * no contributions from red, green, or blue), and opaque-white would be
- * 0xFFFFFFFF
+ * {@usesMathJax}
+ *
+ * <p>The <code>Color</code> class provides methods for creating, converting and
+ * manipulating colors. Colors have three different representations:</p>
+ * <ul>
+ *     <li>Color ints, the most common representation</li>
+ *     <li>Color longs</li>
+ *     <li><code>Color</code> instances</li>
+ * </ul>
+ * <p>The section below describe each representation in detail.</p>
+ *
+ * <h3>Color ints</h3>
+ * <p>Color ints are the most common representation of colors on Android and
+ * have been used since {@link android.os.Build.VERSION_CODES#BASE API level 1}.</p>
+ *
+ * <p>A color int always defines a color in the {@link ColorSpace.Named#SRGB sRGB}
+ * color space using 4 components packed in a single 32 bit integer value:</p>
+ *
+ * <table summary="Color int definition">
+ *     <tr>
+ *         <th>Component</th><th>Name</th><th>Size</th><th>Range</th>
+ *     </tr>
+ *     <tr><td>A</td><td>Alpha</td><td>8 bits</td><td>\([0..255]\)</td></tr>
+ *     <tr><td>R</td><td>Red</td><td>8 bits</td><td>\([0..255]\)</td></tr>
+ *     <tr><td>G</td><td>Green</td><td>8 bits</td><td>\([0..255]\)</td></tr>
+ *     <tr><td>B</td><td>Blue</td><td>8 bits</td><td>\([0..255]\)</td></tr>
+ * </table>
+ *
+ * <p>The components in this table are listed in encoding order (see below),
+ * which is why color ints are called ARGB colors.</p>
+ *
+ * <h4>Usage in code</h4>
+ * <p>To avoid confusing color ints with arbitrary integer values, it is a
+ * good practice to annotate them with the <code>@ColorInt</code> annotation
+ * found in the Android Support Library.</p>
+ *
+ * <h4>Encoding</h4>
+ * <p>The four components of a color int are encoded in the following way:</p>
+ * <pre class="prettyprint">
+ * int color = (A & 0xff) << 24 | (R & 0xff) << 16 | (G & 0xff) << 16 | (B & 0xff);
+ * </pre>
+ *
+ * <p>Because of this encoding, color ints can easily be described as an integer
+ * constant in source. For instance, opaque blue is <code>0xff0000ff</code>
+ * and yellow is <code>0xffffff00</code>.</p>
+ *
+ * <p>To easily encode color ints, it is recommended to use the static methods
+ * {@link #argb(int, int, int, int)} and {@link #rgb(int, int, int)}. The second
+ * method omits the alpha component and assumes the color is opaque (alpha is 255).
+ * As a convenience this class also offers methods to encode color ints from components
+ * defined in the \([0..1]\) range: {@link #argb(float, float, float, float)} and
+ * {@link #rgb(float, float, float)}.</p>
+ *
+ * <p>Color longs (defined below) can be easily converted to color ints by invoking
+ * the {@link #toArgb(long)} method. This method performs a color space conversion
+ * if needed.</p>
+ *
+ * <p>It is also possible to create a color int by invoking the method {@link #toArgb()}
+ * on a color instance.</p>
+ *
+ * <h4>Decoding</h4>
+ * <p>The four ARGB components can be individually extracted from a color int
+ * using the following expressions:</p>
+ * <pre class="prettyprint">
+ * int A = (color >> 24) & 0xff; // or color >>> 24
+ * int R = (color >> 16) & 0xff;
+ * int G = (color >>  8) & 0xff;
+ * int B = (color      ) & 0xff;
+ * </pre>
+ *
+ * <p>This class offers convenience methods to easily extract these components:</p>
+ * <ul>
+ *     <li>{@link #alpha(int)} to extract the alpha component</li>
+ *     <li>{@link #red(int)} to extract the red component</li>
+ *     <li>{@link #green(int)} to extract the green component</li>
+ *     <li>{@link #blue(int)} to extract the blue component</li>
+ * </ul>
+ *
+ * <h3>Color longs</h3>
+ * <p>Color longs are a representation introduced in
+ * {@link android.os.Build.VERSION_CODES#O Android O} to store colors in different
+ * {@link ColorSpace color spaces}, with more precision than color ints.</p>
+ *
+ * <p>A color long always defines a color using 4 components packed in a single
+ * 64 bit long value. One of these components is always alpha while the other
+ * three components depend on the color space's {@link ColorSpace.Model color model}.
+ * The most common color model is the {@link ColorSpace.Model#RGB RGB} model in
+ * which the components represent red, green and blue values.</p>
+ *
+ * <p class="note"><b>Component ranges:</b> the ranges defined in the tables
+ * below indicate the ranges that can be encoded in a color long. They do not
+ * represent the actual ranges as they may differ per color space. For instance,
+ * the RGB components of a color in the {@link ColorSpace.Named#DISPLAY_P3 Display P3}
+ * color space use the \([0..1]\) range. Please refer to the documentation of the
+ * various {@link ColorSpace.Named color spaces} to find their respective ranges.</p>
+ *
+ * <p class="note"><b>Alpha range:</b> while alpha is encoded in a color long using
+ * a 10 bit integer (thus using a range of \([0..1023]\)), it is converted to and
+ * from \([0..1]\) float values when decoding and encoding color longs.</p>
+ *
+ * <p class="note"><b>sRGB color space:</b> for compatibility reasons and ease of
+ * use, color longs encoding {@link ColorSpace.Named#SRGB sRGB} colors do not
+ * use the same encoding as other color longs.</p>
+ *
+ * <table summary="Color long definition">
+ *     <tr>
+ *         <th>Component</th><th>Name</th><th>Size</th><th>Range</th>
+ *     </tr>
+ *     <tr><td colspan="4">{@link ColorSpace.Model#RGB RGB} color model</td></tr>
+ *     <tr><td>R</td><td>Red</td><td>16 bits</td><td>\([-65504.0, 65504.0]\)</td></tr>
+ *     <tr><td>G</td><td>Green</td><td>16 bits</td><td>\([-65504.0, 65504.0]\)</td></tr>
+ *     <tr><td>B</td><td>Blue</td><td>16 bits</td><td>\([-65504.0, 65504.0]\)</td></tr>
+ *     <tr><td>A</td><td>Alpha</td><td>10 bits</td><td>\([0..1023]\)</td></tr>
+ *     <tr><td></td><td>Color space</td><td>6 bits</td><td>\([0..63]\)</td></tr>
+ *     <tr><td colspan="4">{@link ColorSpace.Named#SRGB sRGB} color space</td></tr>
+ *     <tr><td>A</td><td>Alpha</td><td>8 bits</td><td>\([0..255]\)</td></tr>
+ *     <tr><td>R</td><td>Red</td><td>8 bits</td><td>\([0..255]\)</td></tr>
+ *     <tr><td>G</td><td>Green</td><td>8 bits</td><td>\([0..255]\)</td></tr>
+ *     <tr><td>B</td><td>Blue</td><td>8 bits</td><td>\([0..255]\)</td></tr>
+ *     <tr><td>X</td><td>Unused</td><td>32 bits</td><td>\(0\)</td></tr>
+ *     <tr><td colspan="4">{@link ColorSpace.Model#XYZ XYZ} color model</td></tr>
+ *     <tr><td>X</td><td>X</td><td>16 bits</td><td>\([-65504.0, 65504.0]\)</td></tr>
+ *     <tr><td>Y</td><td>Y</td><td>16 bits</td><td>\([-65504.0, 65504.0]\)</td></tr>
+ *     <tr><td>Z</td><td>Z</td><td>16 bits</td><td>\([-65504.0, 65504.0]\)</td></tr>
+ *     <tr><td>A</td><td>Alpha</td><td>10 bits</td><td>\([0..1023]\)</td></tr>
+ *     <tr><td></td><td>Color space</td><td>6 bits</td><td>\([0..63]\)</td></tr>
+ *     <tr><td colspan="4">{@link ColorSpace.Model#XYZ Lab} color model</td></tr>
+ *     <tr><td>L</td><td>L</td><td>16 bits</td><td>\([-65504.0, 65504.0]\)</td></tr>
+ *     <tr><td>a</td><td>a</td><td>16 bits</td><td>\([-65504.0, 65504.0]\)</td></tr>
+ *     <tr><td>b</td><td>b</td><td>16 bits</td><td>\([-65504.0, 65504.0]\)</td></tr>
+ *     <tr><td>A</td><td>Alpha</td><td>10 bits</td><td>\([0..1023]\)</td></tr>
+ *     <tr><td></td><td>Color space</td><td>6 bits</td><td>\([0..63]\)</td></tr>
+ *     <tr><td colspan="4">{@link ColorSpace.Model#CMYK CMYK} color model</td></tr>
+ *     <tr><td colspan="4">Unsupported</td></tr>
+ * </table>
+ *
+ * <p>The components in this table are listed in encoding order (see below),
+ * which is why color longs in the RGB model are called RGBA colors (even if
+ * this doesn't quite hold for the special case of sRGB colors).</p>
+ *
+ * <p>The color long encoding relies on half-precision float values (fp16). If you
+ * wish to know more about the limitations of half-precision float values, please
+ * refer to the documentation of the {@link Half} class.</p>
+ *
+ * <h4>Usage in code</h4>
+ * <p>To avoid confusing color longs with arbitrary long values, it is a
+ * good practice to annotate them with the <code>@ColorLong</code> annotation
+ * found in the Android Support Library.</p>
+ *
+ * <h4>Encoding</h4>
+ *
+ * <p>Given the complex nature of color longs, it is strongly encouraged to use
+ * the various methods provided by this class to encode them.</p>
+ *
+ * <p>The most flexible way to encode a color long is to use the method
+ * {@link #pack(float, float, float, float, ColorSpace)}. This method allows you
+ * to specify three color components (typically RGB), an alpha component and a
+ * color space. To encode sRGB colors, use {@link #pack(float, float, float)}
+ * and {@link #pack(float, float, float, float)} which are the
+ * equivalent of {@link #rgb(int, int, int)} and {@link #argb(int, int, int, int)}
+ * for color ints. If you simply need to convert a color int into a color long,
+ * use {@link #pack(int)}.</p>
+ *
+ * <p>It is also possible to create a color long value by invoking the method
+ * {@link #pack()} on a color instance.</p>
+ *
+ * <h4>Decoding</h4>
+ *
+ * <p>This class offers convenience methods to easily extract the components
+ * of a color long:</p>
+ * <ul>
+ *     <li>{@link #alpha(long)} to extract the alpha component</li>
+ *     <li>{@link #red(long)} to extract the red/X/L component</li>
+ *     <li>{@link #green(long)} to extract the green/Y/a component</li>
+ *     <li>{@link #blue(long)} to extract the blue/Z/b component</li>
+ * </ul>
+ *
+ * <p>The values returned by these methods depend on the color space encoded
+ * in the color long. The values are however typically in the \([0..1]\) range
+ * for RGB colors. Please refer to the documentation of the various
+ * {@link ColorSpace.Named color spaces} for the exact ranges.</p>
+ *
+ * <h3>Color instances</h3>
+ * <p>Color instances are a representation introduced in
+ * {@link android.os.Build.VERSION_CODES#O Android O} to store colors in different
+ * {@link ColorSpace color spaces}, with more precision than both color ints and
+ * color longs. Color instances also offer the ability to store more than 4
+ * components if necessary.</p>
+ *
+ * <p>Colors instances are immutable and can be created using one of the various
+ * <code>valueOf</code> methods. For instance:</p>
+ * <pre class="prettyprint">
+ * // sRGB
+ * Color opaqueRed = Color.valueOf(0xffff0000); // from a color int
+ * Color translucentRed = Color.valueOf(1.0f, 0.0f, 0.0f, 0.5f);
+ *
+ * // Wide gamut color
+ * {@literal @}ColorLong long p3 = pack(1.0f, 1.0f, 0.0f, 1.0f, colorSpaceP3);
+ * Color opaqueYellow = Color.valueOf(p3); // from a color long
+ *
+ * // CIE L*a*b* color space
+ * ColorSpace lab = ColorSpace.get(ColorSpace.Named.LAB);
+ * Color green = Color.valueOf(100.0f, -128.0f, 128.0f, 1.0f, lab);
+ * </pre>
+ *
+ * <p>Color instances can be converted to color ints ({@link #toArgb()}) or
+ * color longs ({@link #pack()}). They also offer easy access to their various
+ * components using the following methods:</p>
+ * <ul>
+ *     <li>{@link #alpha()}, returns the alpha component value</li>
+ *     <li>{@link #red()}, returns the red component value (or first
+ *     component value in non-RGB models)</li>
+ *     <li>{@link #green()}, returns the green component value (or second
+ *     component value in non-RGB models)</li>
+ *     <li>{@link #blue()}, returns the blue component value (or third
+ *     component value in non-RGB models)</li>
+ *     <li>{@link #getComponent(int)}, returns a specific component value</li>
+ *     <li>{@link #getComponents()}, returns all component values as an array</li>
+ * </ul>
+ *
+ * <h3>Color space conversions</h3>
+ * <p>You can convert colors from one color space to another using
+ * {@link ColorSpace#connect(ColorSpace, ColorSpace)} and its variants. However,
+ * the <code>Color</code> class provides a few convenience methods to simplify
+ * the process. Here is a brief description of some of them:</p>
+ * <ul>
+ *     <li>{@link #convert(ColorSpace)} to convert a color instance in a color
+ *     space to a new color instance in a different color space</li>
+ *     <li>{@link #convert(float, float, float, float, ColorSpace, ColorSpace)} to
+ *     convert a color from a source color space to a destination color space</li>
+ *     <li>{@link #convert(long, ColorSpace)} to convert a color long from its
+ *     built-in color space to a destination color space</li>
+ *     <li>{@link #convert(int, ColorSpace)} to convert a color int from sRGB
+ *     to a destination color space</li>
+ * </ul>
+ *
+ * <p>Please refere to the {@link ColorSpace} documentation for more
+ * information.</p>
+ *
+ * <h3>Alpha and transparency</h3>
+ * <p>The alpha component of a color defines the level of transparency of a
+ * color. When the alpha component is 0, the color is completely transparent.
+ * When the alpha is component is 1 (in the \([0..1]\) range) or 255 (in the
+ * \([0..255]\) range), the color is completely opaque.</p>
+ *
+ * <p>The color representations described above do not use pre-multiplied
+ * color components (a pre-multiplied color component is a color component
+ * that has been multiplied by the value of the alpha component).
+ * For instance, the color int representation of opaque red is
+ * <code>0xffff0000</code>. For semi-transparent (50%) red, the
+ * representation becomes <code>0x80ff0000</code>. The equivalent color
+ * instance representations would be <code>(1.0, 0.0, 0.0, 1.0)</code>
+ * and <code>(1.0, 0.0, 0.0, 0.5)</code>.</p>
  */
+@AnyThread
 public class Color {
     @ColorInt public static final int BLACK       = 0xFF000000;
     @ColorInt public static final int DKGRAY      = 0xFF444444;
@@ -51,10 +302,905 @@
     @ColorInt public static final int MAGENTA     = 0xFFFF00FF;
     @ColorInt public static final int TRANSPARENT = 0;
 
+    @NonNull
+    @Size(min = 4, max = 5)
+    private final float[] mComponents;
+
+    @NonNull
+    private final ColorSpace mColorSpace;
+
+    /**
+     * Creates a new color instance set to opaque black in the
+     * {@link ColorSpace.Named#SRGB sRGB} color space.
+     *
+     * @see #valueOf(float, float, float)
+     * @see #valueOf(float, float, float, float)
+     * @see #valueOf(float, float, float, float, ColorSpace)
+     * @see #valueOf(float[], ColorSpace)
+     * @see #valueOf(int)
+     * @see #valueOf(long)
+     */
+    public Color() {
+        // This constructor is required for compatibility with previous APIs
+        mComponents = new float[] { 0.0f, 0.0f, 0.0f, 1.0f };
+        mColorSpace = ColorSpace.get(ColorSpace.Named.SRGB);
+    }
+
+    /**
+     * Creates a new color instance in the {@link ColorSpace.Named#SRGB sRGB}
+     * color space.
+     *
+     * @param r The value of the red channel, must be in [0..1] range
+     * @param g The value of the green channel, must be in [0..1] range
+     * @param b The value of the blue channel, must be in [0..1] range
+     * @param a The value of the alpha channel, must be in [0..1] range
+     */
+    private Color(float r, float g, float b, float a) {
+        this(r, g, b, a, ColorSpace.get(ColorSpace.Named.SRGB));
+    }
+
+    /**
+     * Creates a new color instance in the specified color space. The color space
+     * must have a 3 components model.
+     *
+     * @param r The value of the red channel, must be in the color space defined range
+     * @param g The value of the green channel, must be in the color space defined range
+     * @param b The value of the blue channel, must be in the color space defined range
+     * @param a The value of the alpha channel, must be in [0..1] range
+     * @param colorSpace This color's color space, cannot be null
+     */
+    private Color(float r, float g, float b, float a, @NonNull ColorSpace colorSpace) {
+        mComponents = new float[] { r, g, b, a };
+        mColorSpace = colorSpace;
+    }
+
+    /**
+     * Creates a new color instance in the specified color space.
+     *
+     * @param components An array of color components, plus alpha
+     * @param colorSpace This color's color space, cannot be null
+     */
+    private Color(@Size(min = 4, max = 5) float[] components, @NonNull ColorSpace colorSpace) {
+        mComponents = components;
+        mColorSpace = colorSpace;
+    }
+
+    /**
+     * Returns this color's color space.
+     *
+     * @return A non-null instance of {@link ColorSpace}
+     */
+    @NonNull
+    public ColorSpace getColorSpace() {
+        return mColorSpace;
+    }
+
+    /**
+     * Returns the color model of this color.
+     *
+     * @return A non-null {@link ColorSpace.Model}
+     */
+    public ColorSpace.Model getModel() {
+        return mColorSpace.getModel();
+    }
+
+    /**
+     * Indicates whether this color color is in a wide-gamut color space.
+     * See {@link ColorSpace#isWideGamut()} for a definition of a wide-gamut
+     * color space.
+     *
+     * @return True if this color is in a wide-gamut color space, false otherwise
+     *
+     * @see #isSrgb()
+     * @see ColorSpace#isWideGamut()
+     */
+    public boolean isWideGamut() {
+        return getColorSpace().isWideGamut();
+    }
+
+    /**
+     * Indicates whether this color is in the {@link ColorSpace.Named#SRGB sRGB}
+     * color space.
+     *
+     * @return True if this color is in the sRGB color space, false otherwise
+     *
+     * @see #isWideGamut()
+     */
+    public boolean isSrgb() {
+        return getColorSpace().isSrgb();
+    }
+
+    /**
+     * Returns the number of components that form a color value according
+     * to this color space's color model, plus one extra component for
+     * alpha.
+     *
+     * @return An integer between 4 and 5
+     */
+    @IntRange(from = 4, to = 5)
+    public int getComponentCount() {
+        return mColorSpace.getComponentCount() + 1;
+    }
+
+    /**
+     * Packs this color into a color long. See the documentation of this class
+     * for a description of the color long format.
+     *
+     * @return A color long
+     *
+     * @throws IllegalArgumentException If this color's color space has the id
+     * {@link ColorSpace#MIN_ID} or if this color has more than 4 components
+     */
+    @ColorLong
+    public long pack() {
+        return pack(mComponents[0], mComponents[1], mComponents[2], mComponents[3], mColorSpace);
+    }
+
+    /**
+     * Converts this color from its color space to the specified color space.
+     * The conversion is done using the default rendering intent as specified
+     * by {@link ColorSpace#connect(ColorSpace, ColorSpace)}.
+     *
+     * @param colorSpace The destination color space, cannot be null
+     *
+     * @return A non-null color instance in the specified color space
+     */
+    @NonNull
+    public Color convert(@NonNull ColorSpace colorSpace) {
+        ColorSpace.Connector connector = ColorSpace.connect(mColorSpace, colorSpace);
+        float[] color = new float[] {
+                mComponents[0], mComponents[1], mComponents[2], mComponents[3]
+        };
+        connector.transform(color);
+        return new Color(color, colorSpace);
+    }
+
+    /**
+     * Converts this color to an ARGB color int. A color int is always in
+     * the {@link ColorSpace.Named#SRGB sRGB} color space. This implies
+     * a color space conversion is applied if needed.
+     *
+     * @return An ARGB color in the sRGB color space
+     */
+    @ColorInt
+    public int toArgb() {
+        if (mColorSpace.isSrgb()) {
+            return ((int) (mComponents[3] * 255.0f + 0.5f) << 24) |
+                   ((int) (mComponents[0] * 255.0f + 0.5f) << 16) |
+                   ((int) (mComponents[1] * 255.0f + 0.5f) <<  8) |
+                    (int) (mComponents[2] * 255.0f + 0.5f);
+        }
+
+        float[] color = new float[] {
+                mComponents[0], mComponents[1], mComponents[2], mComponents[3]
+        };
+        // The transformation saturates the output
+        ColorSpace.connect(mColorSpace).transform(color);
+
+        return ((int) (color[3] * 255.0f + 0.5f) << 24) |
+               ((int) (color[0] * 255.0f + 0.5f) << 16) |
+               ((int) (color[1] * 255.0f + 0.5f) <<  8) |
+                (int) (color[2] * 255.0f + 0.5f);
+    }
+
+    /**
+     * <p>Returns the value of the red component in the range defined by this
+     * color's color space (see {@link ColorSpace#getMinValue(int)} and
+     * {@link ColorSpace#getMaxValue(int)}).</p>
+     *
+     * <p>If this color's color model is not {@link ColorSpace.Model#RGB RGB},
+     * calling this method is equivalent to <code>getComponent(0)</code>.</p>
+     *
+     * @see #alpha()
+     * @see #red()
+     * @see #green
+     * @see #getComponents()
+     */
+    public float red() {
+        return mComponents[0];
+    }
+
+    /**
+     * <p>Returns the value of the green component in the range defined by this
+     * color's color space (see {@link ColorSpace#getMinValue(int)} and
+     * {@link ColorSpace#getMaxValue(int)}).</p>
+     *
+     * <p>If this color's color model is not {@link ColorSpace.Model#RGB RGB},
+     * calling this method is equivalent to <code>getComponent(1)</code>.</p>
+     *
+     * @see #alpha()
+     * @see #red()
+     * @see #green
+     * @see #getComponents()
+     */
+    public float green() {
+        return mComponents[1];
+    }
+
+    /**
+     * <p>Returns the value of the blue component in the range defined by this
+     * color's color space (see {@link ColorSpace#getMinValue(int)} and
+     * {@link ColorSpace#getMaxValue(int)}).</p>
+     *
+     * <p>If this color's color model is not {@link ColorSpace.Model#RGB RGB},
+     * calling this method is equivalent to <code>getComponent(2)</code>.</p>
+     *
+     * @see #alpha()
+     * @see #red()
+     * @see #green
+     * @see #getComponents()
+     */
+    public float blue() {
+        return mComponents[2];
+    }
+
+    /**
+     * Returns the value of the alpha component in the range \([0..1]\).
+     * Calling this method is equivalent to
+     * <code>getComponent(getComponentCount())</code>.
+     *
+     * @see #red()
+     * @see #green()
+     * @see #blue()
+     * @see #getComponents()
+     * @see #getComponent(int)
+     */
+    public float alpha() {
+        return mComponents[mComponents.length - 1];
+    }
+
+    /**
+     * Returns this color's components as a new array. The last element of the
+     * array is always the alpha component.
+     *
+     * @return A new, non-null array whose size is equal to {@link #getComponentCount()}
+     *
+     * @see #getComponent(int)
+     */
+    @NonNull
+    @Size(min = 4, max = 5)
+    public float[] getComponents() {
+        return Arrays.copyOf(mComponents, mColorSpace.getComponentCount() + 1);
+    }
+
+    /**
+     * <p>Returns the value of the specified component in the range defined by
+     * this color's color space (see {@link ColorSpace#getMinValue(int)} and
+     * {@link ColorSpace#getMaxValue(int)}).</p>
+     *
+     * <p>If the requested component index is {@link #getComponentCount()},
+     * this method returns the alpha component, always in the range
+     * \([0..1\).</p>
+     *
+     * @see #getComponents()
+     *
+     * @throws ArrayIndexOutOfBoundsException If the specified component index
+     * is < 0 or >= {@link #getComponentCount()}
+     */
+    public float getComponent(@IntRange(from = 0, to = 4) int component) {
+        return mComponents[component];
+    }
+
+    /**
+     * <p>Returns the relative luminance of this color.</p>
+     *
+     * <p>Based on the formula for relative luminance defined in WCAG 2.0,
+     * W3C Recommendation 11 December 2008.</p>
+     *
+     * @return A value between 0 (darkest black) and 1 (lightest white)
+     *
+     * @throws IllegalArgumentException If the this color's color space
+     * does not use the {@link ColorSpace.Model#RGB RGB} color model
+     */
+    public float luminance() {
+        if (mColorSpace.getModel() != ColorSpace.Model.RGB) {
+            throw new IllegalArgumentException("The specified color must be encoded in an RGB " +
+                    "color space. The supplied color space is " + mColorSpace.getModel());
+        }
+
+        DoubleUnaryOperator eotf = ((ColorSpace.Rgb) mColorSpace).getEotf();
+        double r = eotf.applyAsDouble(mComponents[0]);
+        double g = eotf.applyAsDouble(mComponents[1]);
+        double b = eotf.applyAsDouble(mComponents[2]);
+
+        return saturate((float) ((0.2126 * r) + (0.7152 * g) + (0.0722 * b)));
+    }
+
+    @Override
+    public boolean equals(Object o) {
+        if (this == o) return true;
+        if (o == null || getClass() != o.getClass()) return false;
+
+        Color color = (Color) o;
+
+        //noinspection SimplifiableIfStatement
+        if (!Arrays.equals(mComponents, color.mComponents)) return false;
+        return mColorSpace.equals(color.mColorSpace);
+    }
+
+    @Override
+    public int hashCode() {
+        int result = Arrays.hashCode(mComponents);
+        result = 31 * result + mColorSpace.hashCode();
+        return result;
+    }
+
+    /**
+     * <p>Returns a string representation of the object. This method returns
+     * a string equal to the value of:</p>
+     *
+     * <pre class="prettyprint">
+     * "Color(" + r + ", " + g + ", " + b + ", " + a +
+     *         ", " + getColorSpace().getName + ')'
+     * </pre>
+     *
+     * <p>For instance, the string representation of opaque black in the sRGB
+     * color space is equal to the following value:</p>
+     *
+     * <pre>
+     * Color(0.0, 0.0, 0.0, 1.0, sRGB IEC61966-2.1)
+     * </pre>
+     *
+     * @return A non-null string representation of the object
+     */
+    @Override
+    @NonNull
+    public String toString() {
+        StringBuilder b = new StringBuilder("Color(");
+        for (float c : mComponents) {
+            b.append(c).append(", ");
+        }
+        b.append(mColorSpace.getName());
+        b.append(')');
+        return b.toString();
+    }
+
+    /**
+     * Returns the color space encoded in the specified color long.
+     *
+     * @param color The color long whose color space to extract
+     * @return A non-null color space instance. If the color long encodes
+     * an unknown or invalid color space, the {@link ColorSpace.Named#SRGB sRGB}
+     * color space is returned
+     *
+     * @see #red(long)
+     * @see #green(long)
+     * @see #blue(long)
+     * @see #alpha(long)
+     */
+    @NonNull
+    public static ColorSpace colorSpace(@ColorLong long color) {
+        return ColorSpace.get((int) (color & 0x3fL));
+    }
+
+    /**
+     * Returns the red component encoded in the specified color long.
+     * The range of the returned value depends on the color space
+     * associated with the specified color. The color space can be
+     * queried by calling {@link #colorSpace(long)}.
+     *
+     * @param color The color long whose red channel to extract
+     * @return A float value with a range defined by the specified color's
+     * color space
+     *
+     * @see #colorSpace(long)
+     * @see #green(long)
+     * @see #blue(long)
+     * @see #alpha(long)
+     */
+    public static float red(@ColorLong long color) {
+        if ((color & 0x3fL) == 0L) return ((color >> 48) & 0xff) / 255.0f;
+        return Half.toFloat((short) ((color >> 48) & 0xffff));
+    }
+
+    /**
+     * Returns the green component encoded in the specified color long.
+     * The range of the returned value depends on the color space
+     * associated with the specified color. The color space can be
+     * queried by calling {@link #colorSpace(long)}.
+     *
+     * @param color The color long whose green channel to extract
+     * @return A float value with a range defined by the specified color's
+     * color space
+     *
+     * @see #colorSpace(long)
+     * @see #red(long)
+     * @see #blue(long)
+     * @see #alpha(long)
+     */
+    public static float green(@ColorLong long color) {
+        if ((color & 0x3fL) == 0L) return ((color >> 40) & 0xff) / 255.0f;
+        return Half.toFloat((short) ((color >> 32) & 0xffff));
+    }
+
+    /**
+     * Returns the blue component encoded in the specified color long.
+     * The range of the returned value depends on the color space
+     * associated with the specified color. The color space can be
+     * queried by calling {@link #colorSpace(long)}.
+     *
+     * @param color The color long whose blue channel to extract
+     * @return A float value with a range defined by the specified color's
+     * color space
+     *
+     * @see #colorSpace(long)
+     * @see #red(long)
+     * @see #green(long)
+     * @see #alpha(long)
+     */
+    public static float blue(@ColorLong long color) {
+        if ((color & 0x3fL) == 0L) return ((color >> 32) & 0xff) / 255.0f;
+        return Half.toFloat((short) ((color >> 16) & 0xffff));
+    }
+
+    /**
+     * Returns the alpha component encoded in the specified color long.
+     * The returned value is always in the range \([0..1]\).
+     *
+     * @param color The color long whose blue channel to extract
+     * @return A float value in the range \([0..1]\)
+     *
+     * @see #colorSpace(long)
+     * @see #red(long)
+     * @see #green(long)
+     * @see #blue(long)
+     */
+    public static float alpha(@ColorLong long color) {
+        if ((color & 0x3fL) == 0L) return ((color >> 56) & 0xff) / 255.0f;
+        return ((color >> 6) & 0x3ff) / 1023.0f;
+    }
+
+    /**
+     * Indicates whether the specified color is in the
+     * {@link ColorSpace.Named#SRGB sRGB} color space.
+     *
+     * @param color The color to test
+     * @return True if the color is in the sRGB color space, false otherwise
+     *
+     * @see #isInColorSpace(long, ColorSpace)
+     * @see #isWideGamut(long)
+     */
+    public static boolean isSrgb(@ColorLong long color) {
+        return colorSpace(color).isSrgb();
+    }
+
+    /**
+     * Indicates whether the specified color is in a wide-gamut color space.
+     * See {@link ColorSpace#isWideGamut()} for a definition of a wide-gamut
+     * color space.
+     *
+     * @param color The color to test
+     * @return True if the color is in a wide-gamut color space, false otherwise
+     *
+     * @see #isInColorSpace(long, ColorSpace)
+     * @see #isSrgb(long)
+     * @see ColorSpace#isWideGamut()
+     */
+    public static boolean isWideGamut(@ColorLong long color) {
+        return colorSpace(color).isWideGamut();
+    }
+
+    /**
+     * Indicates whether the specified color is in the specified color space.
+     *
+     * @param color The color to test
+     * @param colorSpace The color space to test against
+     * @return True if the color is in the specified color space, false otherwise
+     *
+     * @see #isSrgb(long)
+     * @see #isWideGamut(long)
+     */
+    public static boolean isInColorSpace(@ColorLong long color, @NonNull ColorSpace colorSpace) {
+        return (int) (color & 0x3fL) == colorSpace.getId();
+    }
+
+    /**
+     * Converts the specified color long to an ARGB color int. A color int is
+     * always in the {@link ColorSpace.Named#SRGB sRGB} color space. This implies
+     * a color space conversion is applied if needed.
+     *
+     * @return An ARGB color in the sRGB color space
+     */
+    @ColorInt
+    public static int toArgb(@ColorLong long color) {
+        if ((color & 0x3fL) == 0L) return (int) (color >> 32);
+
+        float r = red(color);
+        float g = green(color);
+        float b = blue(color);
+        float a = alpha(color);
+
+        // The transformation saturates the output
+        float[] c = ColorSpace.connect(colorSpace(color)).transform(r, g, b);
+
+        return ((int) (a    * 255.0f + 0.5f) << 24) |
+               ((int) (c[0] * 255.0f + 0.5f) << 16) |
+               ((int) (c[1] * 255.0f + 0.5f) <<  8) |
+                (int) (c[2] * 255.0f + 0.5f);
+    }
+
+    /**
+     * Creates a new <code>Color</code> instance from an ARGB color int.
+     * The resulting color is in the {@link ColorSpace.Named#SRGB sRGB}
+     * color space.
+     *
+     * @param color The ARGB color int to create a <code>Color</code> from
+     * @return A non-null instance of {@link Color}
+     */
+    @NonNull
+    public static Color valueOf(@ColorInt int color) {
+        float r = ((color >> 16) & 0xff) / 255.0f;
+        float g = ((color >>  8) & 0xff) / 255.0f;
+        float b = ((color      ) & 0xff) / 255.0f;
+        float a = ((color >> 24) & 0xff) / 255.0f;
+        return new Color(r, g, b, a, ColorSpace.get(ColorSpace.Named.SRGB));
+    }
+
+    /**
+     * Creates a new <code>Color</code> instance from a color long.
+     * The resulting color is in the same color space as the specified color long.
+     *
+     * @param color The color long to create a <code>Color</code> from
+     * @return A non-null instance of {@link Color}
+     */
+    @NonNull
+    public static Color valueOf(@ColorLong long color) {
+        return new Color(red(color), green(color), blue(color), alpha(color), colorSpace(color));
+    }
+
+    /**
+     * Creates a new opaque <code>Color</code> in the {@link ColorSpace.Named#SRGB sRGB}
+     * color space with the specified red, green and blue component values. The component
+     * values must be in the range \([0..1]\).
+     *
+     * @param r The red component of the opaque sRGB color to create, in \([0..1]\)
+     * @param g The green component of the opaque sRGB color to create, in \([0..1]\)
+     * @param b The blue component of the opaque sRGB color to create, in \([0..1]\)
+     * @return A non-null instance of {@link Color}
+     */
+    @NonNull
+    public static Color valueOf(float r, float g, float b) {
+        return new Color(r, g, b, 1.0f);
+    }
+
+    /**
+     * Creates a new <code>Color</code> in the {@link ColorSpace.Named#SRGB sRGB}
+     * color space with the specified red, green, blue and alpha component values.
+     * The component values must be in the range \([0..1]\).
+     *
+     * @param r The red component of the sRGB color to create, in \([0..1]\)
+     * @param g The green component of the sRGB color to create, in \([0..1]\)
+     * @param b The blue component of the sRGB color to create, in \([0..1]\)
+     * @param a The alpha component of the sRGB color to create, in \([0..1]\)
+     * @return A non-null instance of {@link Color}
+     */
+    @NonNull
+    public static Color valueOf(float r, float g, float b, float a) {
+        return new Color(saturate(r), saturate(g), saturate(b), saturate(a));
+    }
+
+    /**
+     * Creates a new <code>Color</code> in the specified color space with the
+     * specified red, green, blue and alpha component values. The range of the
+     * components is defined by {@link ColorSpace#getMinValue(int)} and
+     * {@link ColorSpace#getMaxValue(int)}. The values passed to this method
+     * must be in the proper range.
+     *
+     * @param r The red component of the color to create
+     * @param g The green component of the color to create
+     * @param b The blue component of the color to create
+     * @param a The alpha component of the color to create, in \([0..1]\)
+     * @param colorSpace The color space of the color to create
+     * @return A non-null instance of {@link Color}
+     *
+     * @throws IllegalArgumentException If the specified color space uses a
+     * color model with more than 3 components
+     */
+    @NonNull
+    public static Color valueOf(float r, float g, float b, float a, @NonNull ColorSpace colorSpace) {
+        if (colorSpace.getComponentCount() > 3) {
+            throw new IllegalArgumentException("The specified color space must use a color model " +
+                    "with at most 3 color components");
+        }
+        return new Color(r, g, b, a, colorSpace);
+    }
+
+    /**
+     * <p>Creates a new <code>Color</code> in the specified color space with the
+     * specified component values. The range of the components is defined by
+     * {@link ColorSpace#getMinValue(int)} and {@link ColorSpace#getMaxValue(int)}.
+     * The values passed to this method must be in the proper range. The alpha
+     * component is always in the range \([0..1]\).</p>
+     *
+     * <p>The length of the array of components must be at least
+     * <code>{@link ColorSpace#getComponentCount()} + 1</code>. The component at index
+     * {@link ColorSpace#getComponentCount()} is always alpha.</p>
+     *
+     * @param components The components of the color to create, with alpha as the last component
+     * @param colorSpace The color space of the color to create
+     * @return A non-null instance of {@link Color}
+     *
+     * @throws IllegalArgumentException If the array of components is smaller than
+     * required by the color space
+     */
+    @NonNull
+    public static Color valueOf(@NonNull @Size(min = 4, max = 5) float[] components,
+            @NonNull ColorSpace colorSpace) {
+        if (components.length < colorSpace.getComponentCount() + 1) {
+            throw new IllegalArgumentException("Received a component array of length " +
+                    components.length + " but the color model requires " +
+                    (colorSpace.getComponentCount() + 1) + " (including alpha)");
+        }
+        return new Color(Arrays.copyOf(components, colorSpace.getComponentCount() + 1), colorSpace);
+    }
+
+    /**
+     * Converts the specified ARGB color int to an RGBA color long in the sRGB
+     * color space. See the documentation of this class for a description of
+     * the color long format.
+     *
+     * @param color The ARGB color int to convert to an RGBA color long in sRGB
+     *
+     * @return A color long
+     */
+    @ColorLong
+    public static long pack(@ColorInt int color) {
+        return (color & 0xffffffffL) << 32;
+    }
+
+    /**
+     * Packs the sRGB color defined by the specified red, green and blue component
+     * values into an RGBA color long in the sRGB color space. The alpha component
+     * is set to 1.0. See the documentation of this class for a description of the
+     * color long format.
+     *
+     * @param red The red component of the sRGB color to create, in \([0..1]\)
+     * @param green The green component of the sRGB color to create, in \([0..1]\)
+     * @param blue The blue component of the sRGB color to create, in \([0..1]\)
+     *
+     * @return A color long
+     */
+    @ColorLong
+    public static long pack(float red, float green, float blue) {
+        return pack(red, green, blue, 1.0f, ColorSpace.get(ColorSpace.Named.SRGB));
+    }
+
+    /**
+     * Packs the sRGB color defined by the specified red, green, blue and alpha
+     * component values into an RGBA color long in the sRGB color space. See the
+     * documentation of this class for a description of the color long format.
+     *
+     * @param red The red component of the sRGB color to create, in \([0..1]\)
+     * @param green The green component of the sRGB color to create, in \([0..1]\)
+     * @param blue The blue component of the sRGB color to create, in \([0..1]\)
+     * @param alpha The alpha component of the sRGB color to create, in \([0..1]\)
+     *
+     * @return A color long
+     */
+    @ColorLong
+    public static long pack(float red, float green, float blue, float alpha) {
+        return pack(red, green, blue, alpha, ColorSpace.get(ColorSpace.Named.SRGB));
+    }
+
+    /**
+     * <p>Packs the 3 component color defined by the specified red, green, blue and
+     * alpha component values into a color long in the specified color space. See the
+     * documentation of this class for a description of the color long format.</p>
+     *
+     * <p>The red, green and blue components must be in the range defined by the
+     * specified color space. See {@link ColorSpace#getMinValue(int)} and
+     * {@link ColorSpace#getMaxValue(int)}.</p>
+     *
+     * @param red The red component of the color to create
+     * @param green The green component of the color to create
+     * @param blue The blue component of the color to create
+     * @param alpha The alpha component of the color to create, in \([0..1]\)
+     *
+     * @return A color long
+     *
+     * @throws IllegalArgumentException If the color space's id is {@link ColorSpace#MIN_ID}
+     * or if the color space's color model has more than 3 components
+     */
+    @ColorLong
+    public static long pack(float red, float green, float blue, float alpha,
+            @NonNull ColorSpace colorSpace) {
+        if (colorSpace.isSrgb()) {
+            int argb =
+                    ((int) (alpha * 255.0f + 0.5f) << 24) |
+                    ((int) (red   * 255.0f + 0.5f) << 16) |
+                    ((int) (green * 255.0f + 0.5f) <<  8) |
+                     (int) (blue  * 255.0f + 0.5f);
+            return (argb & 0xffffffffL) << 32;
+        }
+
+        int id = colorSpace.getId();
+        if (id == ColorSpace.MIN_ID) {
+            throw new IllegalArgumentException(
+                    "Unknown color space, please use a color space returned by ColorSpace.get()");
+        }
+        if (colorSpace.getComponentCount() > 3) {
+            throw new IllegalArgumentException(
+                    "The color space must use a color model with at most 3 components");
+        }
+
+        @HalfFloat short r = Half.valueOf(red);
+        @HalfFloat short g = Half.valueOf(green);
+        @HalfFloat short b = Half.valueOf(blue);
+
+        int a = (int) (Math.max(0.0f, Math.min(alpha, 1.0f)) * 1023.0f + 0.5f);
+
+        // Suppress sign extension
+        return  (r & 0xffffL) << 48 |
+                (g & 0xffffL) << 32 |
+                (b & 0xffffL) << 16 |
+                (a & 0x3ffL ) <<  6 |
+                id & 0x3fL;
+    }
+
+    /**
+     * Converts the specified ARGB color int from the {@link ColorSpace.Named#SRGB sRGB}
+     * color space into the specified destination color space. The resulting color is
+     * returned as a color long. See the documentation of this class for a description
+     * of the color long format.
+     *
+     * @param color The sRGB color int to convert
+     * @param colorSpace The destination color space
+     * @return A color long in the destination color space
+     */
+    @ColorLong
+    public static long convert(@ColorInt int color, @NonNull ColorSpace colorSpace) {
+        float r = ((color >> 16) & 0xff) / 255.0f;
+        float g = ((color >>  8) & 0xff) / 255.0f;
+        float b = ((color      ) & 0xff) / 255.0f;
+        float a = ((color >> 24) & 0xff) / 255.0f;
+        ColorSpace source = ColorSpace.get(ColorSpace.Named.SRGB);
+        return convert(r, g, b, a, source, colorSpace);
+    }
+
+    /**
+     * <p>Converts the specified color long from its color space into the specified
+     * destination color space. The resulting color is returned as a color long. See
+     * the documentation of this class for a description of the color long format.</p>
+     *
+     * <p>When converting several colors in a row, it is recommended to use
+     * {@link #convert(long, ColorSpace.Connector)} instead to
+     * avoid the creation of a {@link ColorSpace.Connector} on every invocation.</p>
+     *
+     * @param color The color long to convert
+     * @param colorSpace The destination color space
+     * @return A color long in the destination color space
+     */
+    @ColorLong
+    public static long convert(@ColorLong long color, @NonNull ColorSpace colorSpace) {
+        float r = red(color);
+        float g = green(color);
+        float b = blue(color);
+        float a = alpha(color);
+        ColorSpace source = colorSpace(color);
+        return convert(r, g, b, a, source, colorSpace);
+    }
+
+    /**
+     * <p>Converts the specified 3 component color from the source color space to the
+     * destination color space. The resulting color is returned as a color long. See
+     * the documentation of this class for a description of the color long format.</p>
+     *
+     * <p>When converting multiple colors in a row, it is recommended to use
+     * {@link #convert(float, float, float, float, ColorSpace.Connector)} instead to
+     * avoid the creation of a {@link ColorSpace.Connector} on every invocation.</p>
+     *
+     * <p>The red, green and blue components must be in the range defined by the
+     * specified color space. See {@link ColorSpace#getMinValue(int)} and
+     * {@link ColorSpace#getMaxValue(int)}.</p>
+     *
+     * @param r The red component of the color to convert
+     * @param g The green component of the color to convert
+     * @param b The blue component of the color to convert
+     * @param a The alpha component of the color to convert, in \([0..1]\)
+     * @param source The source color space, cannot be null
+     * @param destination The destination color space, cannot be null
+     * @return A color long in the destination color space
+     *
+     * @see #convert(float, float, float, float, ColorSpace.Connector)
+     */
+    @ColorLong
+    public static long convert(float r, float g, float b, float a,
+            @NonNull ColorSpace source, @NonNull ColorSpace destination) {
+        float[] c = ColorSpace.connect(source, destination).transform(r, g, b);
+        return pack(c[0], c[1], c[2], a, destination);
+    }
+
+    /**
+     * <p>Converts the specified color long from a color space to another using the
+     * specified color space {@link ColorSpace.Connector connector}. The resulting
+     * color is returned as a color long. See the documentation of this class for a
+     * description of the color long format.</p>
+     *
+     * <p>When converting several colors in a row, this method is preferable to
+     * {@link #convert(long, ColorSpace)} as it prevents a new connector from being
+     * created on every invocation.</p>
+     *
+     * <p class="note">The connector's source color space should match the color long's
+     * color space.</p>
+     *
+     * @param color The color long to convert
+     * @param connector A color space connector, cannot be null
+     * @return A color long in the destination color space of the connector
+     */
+    @ColorLong
+    public static long convert(@ColorLong long color, @NonNull ColorSpace.Connector connector) {
+        float r = red(color);
+        float g = green(color);
+        float b = blue(color);
+        float a = alpha(color);
+        return convert(r, g, b, a, connector);
+    }
+
+    /**
+     * <p>Converts the specified 3 component color from a color space to another using
+     * the specified color space {@link ColorSpace.Connector connector}. The resulting
+     * color is returned as a color long. See the documentation of this class for a
+     * description of the color long format.</p>
+     *
+     * <p>When converting several colors in a row, this method is preferable to
+     * {@link #convert(float, float, float, float, ColorSpace, ColorSpace)} as
+     * it prevents a new connector from being created on every invocation.</p>
+     *
+     * <p>The red, green and blue components must be in the range defined by the
+     * source color space of the connector. See {@link ColorSpace#getMinValue(int)}
+     * and {@link ColorSpace#getMaxValue(int)}.</p>
+     *
+     * @param r The red component of the color to convert
+     * @param g The green component of the color to convert
+     * @param b The blue component of the color to convert
+     * @param a The alpha component of the color to convert, in \([0..1]\)
+     * @param connector A color space connector, cannot be null
+     * @return A color long in the destination color space of the connector
+     *
+     * @see #convert(float, float, float, float, ColorSpace, ColorSpace)
+     */
+    @ColorLong
+    public static long convert(float r, float g, float b, float a,
+            @NonNull ColorSpace.Connector connector) {
+        float[] c = connector.transform(r, g, b);
+        return pack(c[0], c[1], c[2], a, connector.getDestination());
+    }
+
+    /**
+     * <p>Returns the relative luminance of a color.</p>
+     *
+     * <p>Based on the formula for relative luminance defined in WCAG 2.0,
+     * W3C Recommendation 11 December 2008.</p>
+     *
+     * @return A value between 0 (darkest black) and 1 (lightest white)
+     *
+     * @throws IllegalArgumentException If the specified color's color space
+     * does not use the {@link ColorSpace.Model#RGB RGB} color model
+     */
+    public static float luminance(@ColorLong long color) {
+        ColorSpace colorSpace = colorSpace(color);
+        if (colorSpace.getModel() != ColorSpace.Model.RGB) {
+            throw new IllegalArgumentException("The specified color must be encoded in an RGB " +
+                    "color space. The supplied color space is " + colorSpace.getModel());
+        }
+
+        DoubleUnaryOperator eotf = ((ColorSpace.Rgb) colorSpace).getEotf();
+        double r = eotf.applyAsDouble(red(color));
+        double g = eotf.applyAsDouble(green(color));
+        double b = eotf.applyAsDouble(blue(color));
+
+        return saturate((float) ((0.2126 * r) + (0.7152 * g) + (0.0722 * b)));
+    }
+
+    private static float saturate(float v) {
+        return v <= 0.0f ? 0.0f : (v >= 1.0f ? 1.0f : v);
+    }
+
     /**
      * Return the alpha component of a color int. This is the same as saying
      * color >>> 24
      */
+    @IntRange(from = 0, to = 255)
     public static int alpha(int color) {
         return color >>> 24;
     }
@@ -63,6 +1209,7 @@
      * Return the red component of a color int. This is the same as saying
      * (color >> 16) & 0xFF
      */
+    @IntRange(from = 0, to = 255)
     public static int red(int color) {
         return (color >> 16) & 0xFF;
     }
@@ -71,6 +1218,7 @@
      * Return the green component of a color int. This is the same as saying
      * (color >> 8) & 0xFF
      */
+    @IntRange(from = 0, to = 255)
     public static int green(int color) {
         return (color >> 8) & 0xFF;
     }
@@ -79,41 +1227,86 @@
      * Return the blue component of a color int. This is the same as saying
      * color & 0xFF
      */
+    @IntRange(from = 0, to = 255)
     public static int blue(int color) {
         return color & 0xFF;
     }
 
     /**
      * Return a color-int from red, green, blue components.
-     * The alpha component is implicity 255 (fully opaque).
-     * These component values should be [0..255], but there is no
+     * The alpha component is implicitly 255 (fully opaque).
+     * These component values should be \([0..255]\), but there is no
      * range check performed, so if they are out of range, the
      * returned color is undefined.
-     * @param red  Red component [0..255] of the color
-     * @param green Green component [0..255] of the color
-     * @param blue  Blue component [0..255] of the color
+     *
+     * @param red  Red component \([0..255]\) of the color
+     * @param green Green component \([0..255]\) of the color
+     * @param blue  Blue component \([0..255]\) of the color
      */
     @ColorInt
-    public static int rgb(int red, int green, int blue) {
+    public static int rgb(
+            @IntRange(from = 0, to = 255) int red,
+            @IntRange(from = 0, to = 255) int green,
+            @IntRange(from = 0, to = 255) int blue) {
         return 0xff000000 | (red << 16) | (green << 8) | blue;
     }
 
     /**
-     * Return a color-int from alpha, red, green, blue components.
-     * These component values should be [0..255], but there is no
-     * range check performed, so if they are out of range, the
+     * Return a color-int from red, green, blue float components
+     * in the range \([0..1]\). The alpha component is implicitly
+     * 1.0 (fully opaque). If the components are out of range, the
      * returned color is undefined.
-     * @param alpha Alpha component [0..255] of the color
-     * @param red   Red component [0..255] of the color
-     * @param green Green component [0..255] of the color
-     * @param blue  Blue component [0..255] of the color
+     *
+     * @param red Red component \([0..1]\) of the color
+     * @param green Green component \([0..1]\) of the color
+     * @param blue Blue component \([0..1]\) of the color
      */
     @ColorInt
-    public static int argb(int alpha, int red, int green, int blue) {
+    public static int rgb(float red, float green, float blue) {
+        return 0xff000000 |
+               ((int) (red   * 255.0f + 0.5f) << 16) |
+               ((int) (green * 255.0f + 0.5f) <<  8) |
+                (int) (blue  * 255.0f + 0.5f);
+    }
+
+    /**
+     * Return a color-int from alpha, red, green, blue components.
+     * These component values should be \([0..255]\), but there is no
+     * range check performed, so if they are out of range, the
+     * returned color is undefined.
+     * @param alpha Alpha component \([0..255]\) of the color
+     * @param red Red component \([0..255]\) of the color
+     * @param green Green component \([0..255]\) of the color
+     * @param blue Blue component \([0..255]\) of the color
+     */
+    @ColorInt
+    public static int argb(
+            @IntRange(from = 0, to = 255) int alpha,
+            @IntRange(from = 0, to = 255) int red,
+            @IntRange(from = 0, to = 255) int green,
+            @IntRange(from = 0, to = 255) int blue) {
         return (alpha << 24) | (red << 16) | (green << 8) | blue;
     }
 
     /**
+     * Return a color-int from alpha, red, green, blue float components
+     * in the range \([0..1]\). If the components are out of range, the
+     * returned color is undefined.
+     *
+     * @param alpha Alpha component \([0..1]\) of the color
+     * @param red Red component \([0..1]\) of the color
+     * @param green Green component \([0..1]\) of the color
+     * @param blue Blue component \([0..1]\) of the color
+     */
+    @ColorInt
+    public static int argb(float alpha, float red, float green, float blue) {
+        return ((int) (alpha * 255.0f + 0.5f) << 24) |
+               ((int) (red   * 255.0f + 0.5f) << 16) |
+               ((int) (green * 255.0f + 0.5f) <<  8) |
+                (int) (blue  * 255.0f + 0.5f);
+    }
+
+    /**
      * Returns the relative luminance of a color.
      * <p>
      * Assumes sRGB encoding. Based on the formula for relative luminance
@@ -124,23 +1317,31 @@
     public static float luminance(@ColorInt int color) {
         ColorSpace.Rgb cs = (ColorSpace.Rgb) ColorSpace.get(ColorSpace.Named.SRGB);
         DoubleUnaryOperator eotf = cs.getEotf();
-        double red = eotf.applyAsDouble(Color.red(color) / 255.0);
-        double green = eotf.applyAsDouble(Color.green(color) / 255.0);
-        double blue = eotf.applyAsDouble(Color.blue(color) / 255.0);
-        return (float) ((0.2126 * red) + (0.7152 * green) + (0.0722 * blue));
+
+        double r = eotf.applyAsDouble(red(color) / 255.0);
+        double g = eotf.applyAsDouble(green(color) / 255.0);
+        double b = eotf.applyAsDouble(blue(color) / 255.0);
+
+        return (float) ((0.2126 * r) + (0.7152 * g) + (0.0722 * b));
     }
 
     /**
-     * Parse the color string, and return the corresponding color-int.
+     * </p>Parse the color string, and return the corresponding color-int.
      * If the string cannot be parsed, throws an IllegalArgumentException
-     * exception. Supported formats are:
-     * #RRGGBB
-     * #AARRGGBB
-     * or one of the following names:
-     * 'red', 'blue', 'green', 'black', 'white', 'gray', 'cyan', 'magenta',
-     * 'yellow', 'lightgray', 'darkgray', 'grey', 'lightgrey', 'darkgrey',
-     * 'aqua', 'fuchsia', 'lime', 'maroon', 'navy', 'olive', 'purple',
-     * 'silver', 'teal'.
+     * exception. Supported formats are:</p>
+     *
+     * <ul>
+     *   <li><code>#RRGGBB</code></li>
+     *   <li><code>#AARRGGBB</code></li>
+     * </ul>
+     *
+     * <p>The following names are also accepted: <code>red</code>, <code>blue</code>,
+     * <code>green</code>, <code>black</code>, <code>white</code>, <code>gray</code>,
+     * <code>cyan</code>, <code>magenta</code>, <code>yellow</code>, <code>lightgray</code>,
+     * <code>darkgray</code>, <code>grey</code>, <code>lightgrey</code>, <code>darkgrey</code>,
+     * <code>aqua</code>, <code>fuchsia</code>, <code>lime</code>, <code>maroon</code>,
+     * <code>navy</code>, <code>olive</code>, <code>purple</code>, <code>silver</code>,
+     * and <code>teal</code>.</p>
      */
     @ColorInt
     public static int parseColor(@Size(min=1) String colorString) {
@@ -165,15 +1366,20 @@
 
     /**
      * Convert RGB components to HSV.
-     *     hsv[0] is Hue [0 .. 360)
-     *     hsv[1] is Saturation [0...1]
-     *     hsv[2] is Value [0...1]
-     * @param red  red component value [0..255]
-     * @param green  green component value [0..255]
-     * @param blue  blue component value [0..255]
+     * <ul>
+     *   <li><code>hsv[0]</code> is Hue \([0..360[\)</li>
+     *   <li><code>hsv[1]</code> is Saturation \([0...1]\)</li>
+     *   <li><code>hsv[2]</code> is Value \([0...1]\)</li>
+     * </ul>
+     * @param red  red component value \([0..255]\)
+     * @param green  green component value \([0..255]\)
+     * @param blue  blue component value \([0..255]\)
      * @param hsv  3 element array which holds the resulting HSV components.
      */
-    public static void RGBToHSV(int red, int green, int blue, @Size(3) float hsv[]) {
+    public static void RGBToHSV(
+            @IntRange(from = 0, to = 255) int red,
+            @IntRange(from = 0, to = 255) int green,
+            @IntRange(from = 0, to = 255) int blue, @Size(3) float hsv[]) {
         if (hsv.length < 3) {
             throw new RuntimeException("3 components required for hsv");
         }
@@ -181,10 +1387,12 @@
     }
 
     /**
-     * Convert the argb color to its HSV components.
-     *     hsv[0] is Hue [0 .. 360)
-     *     hsv[1] is Saturation [0...1]
-     *     hsv[2] is Value [0...1]
+     * Convert the ARGB color to its HSV components.
+     * <ul>
+     *   <li><code>hsv[0]</code> is Hue \([0..360[\)</li>
+     *   <li><code>hsv[1]</code> is Saturation \([0...1]\)</li>
+     *   <li><code>hsv[2]</code> is Value \([0...1]\)</li>
+     * </ul>
      * @param color the argb color to convert. The alpha component is ignored.
      * @param hsv  3 element array which holds the resulting HSV components.
      */
@@ -194,13 +1402,16 @@
 
     /**
      * Convert HSV components to an ARGB color. Alpha set to 0xFF.
-     *     hsv[0] is Hue [0 .. 360)
-     *     hsv[1] is Saturation [0...1]
-     *     hsv[2] is Value [0...1]
+     * <ul>
+     *   <li><code>hsv[0]</code> is Hue \([0..360[\)</li>
+     *   <li><code>hsv[1]</code> is Saturation \([0...1]\)</li>
+     *   <li><code>hsv[2]</code> is Value \([0...1]\)</li>
+     * </ul>
      * If hsv values are out of range, they are pinned.
      * @param hsv  3 element array which holds the input HSV components.
      * @return the resulting argb color
     */
+    @ColorInt
     public static int HSVToColor(@Size(3) float hsv[]) {
         return HSVToColor(0xFF, hsv);
     }
@@ -208,15 +1419,18 @@
     /**
      * Convert HSV components to an ARGB color. The alpha component is passed
      * through unchanged.
-     *     hsv[0] is Hue [0 .. 360)
-     *     hsv[1] is Saturation [0...1]
-     *     hsv[2] is Value [0...1]
+     * <ul>
+     *   <li><code>hsv[0]</code> is Hue \([0..360[\)</li>
+     *   <li><code>hsv[1]</code> is Saturation \([0...1]\)</li>
+     *   <li><code>hsv[2]</code> is Value \([0...1]\)</li>
+     * </ul>
      * If hsv values are out of range, they are pinned.
      * @param alpha the alpha component of the returned argb color.
      * @param hsv  3 element array which holds the input HSV components.
      * @return the resulting argb color
-    */
-    public static int HSVToColor(int alpha, @Size(3) float hsv[]) {
+     */
+    @ColorInt
+    public static int HSVToColor(@IntRange(from = 0, to = 255) int alpha, @Size(3) float hsv[]) {
         if (hsv.length < 3) {
             throw new RuntimeException("3 components required for hsv");
         }
@@ -236,7 +1450,7 @@
      * @hide
      */
     @ColorInt
-    public static int getHtmlColor(String color) {
+    public static int getHtmlColor(@NonNull String color) {
         Integer i = sColorNameMap.get(color.toLowerCase(Locale.ROOT));
         if (i != null) {
             return i;
diff --git a/graphics/java/android/graphics/ColorSpace.java b/graphics/java/android/graphics/ColorSpace.java
index d968516..ec00c45 100644
--- a/graphics/java/android/graphics/ColorSpace.java
+++ b/graphics/java/android/graphics/ColorSpace.java
@@ -16,6 +16,7 @@
 
 package android.graphics;
 
+import android.annotation.AnyThread;
 import android.annotation.ColorInt;
 import android.annotation.IntRange;
 import android.annotation.NonNull;
@@ -126,7 +127,8 @@
  *
  * <p>To visualize and debug color spaces, you can call {@link #createRenderer()}.
  * The {@link Renderer} created by calling this method can be used to compare
- * color spaces and locate specific colors on a CIE 1931 chromaticity diagram.</p>
+ * color spaces and locate specific colors on a CIE 1931 or CIE 1976 UCS
+ * chromaticity diagram.</p>
  *
  * <p>The following code snippet shows how to render a bitmap that compares
  * the color gamuts and white points of {@link Named#DCI_P3} and
@@ -155,6 +157,7 @@
  * @see Adaptation
  * @see Renderer
  */
+@AnyThread
 @SuppressWarnings("StaticInitializerReferencesSubClass")
 public abstract class ColorSpace {
     /**
@@ -216,7 +219,7 @@
      *
      * @see #getId()
      */
-    public static final int MAX_ID = 64; // Do not change, used to encode in longs
+    public static final int MAX_ID = 63; // Do not change, used to encode in longs
 
     private static final float[] SRGB_PRIMARIES = { 0.640f, 0.330f, 0.300f, 0.600f, 0.150f, 0.060f };
     private static final float[] NTSC_1953_PRIMARIES = { 0.67f, 0.33f, 0.21f, 0.71f, 0.14f, 0.08f };
@@ -341,11 +344,11 @@
          *             \end{equation}\)
          *         </td>
          *     </tr>
-         *     <tr><td>Range</td><td colspan="4">\([-0.5..7.5[\)</td></tr>
+         *     <tr><td>Range</td><td colspan="4">\([-0.799..2.399[\)</td></tr>
          * </table>
          * <p>
          *     <img src="{@docRoot}reference/android/images/graphics/colorspace_scrgb.png" />
-         *     <figcaption style="text-align: center;">Extended RGB (orange) vs sRGB (white)</figcaption>
+         *     <figcaption style="text-align: center;">Extended sRGB (orange) vs sRGB (white)</figcaption>
          * </p>
          */
         EXTENDED_SRGB,
@@ -368,11 +371,11 @@
          *         <td>Electro-optical transfer function</td>
          *         <td colspan="4">\(C_{linear} = C_{scRGB}\)</td>
          *     </tr>
-         *     <tr><td>Range</td><td colspan="4">\([-0.5..7.5[\)</td></tr>
+         *     <tr><td>Range</td><td colspan="4">\([-0.5..7.499[\)</td></tr>
          * </table>
          * <p>
          *     <img src="{@docRoot}reference/android/images/graphics/colorspace_scrgb.png" />
-         *     <figcaption style="text-align: center;">Extended RGB (orange) vs sRGB (white)</figcaption>
+         *     <figcaption style="text-align: center;">Extended sRGB (orange) vs sRGB (white)</figcaption>
          * </p>
          */
         LINEAR_EXTENDED_SRGB,
@@ -1090,7 +1093,7 @@
      * space's color model. The resulting value is passed back in the specified
      * array.</p>
      *
-     * <p class="note>The specified array's length  must be at least equal to
+     * <p class="note">The specified array's length  must be at least equal to
      * to the number of color components as returned by
      * {@link Model#getComponentCount()}, and its first 3 values must
      * be the XYZ components to convert from.</p>
@@ -1125,6 +1128,7 @@
      * @return A string representation of the object
      */
     @Override
+    @NonNull
     public String toString() {
         return mName + " (id=" + mId + ", model=" + mModel + ")";
     }
@@ -1403,7 +1407,7 @@
                 ILLUMINANT_D65,
                 x -> absRcpResponse(x, 2.4, 1 / 1.055, 0.055 / 1.055, 1 / 12.92, 0.04045),
                 x -> absResponse(x, 2.4, 1 / 1.055, 0.055 / 1.055, 1 / 12.92, 0.04045),
-                -0.5f, 7.5f,
+                -0.799f, 2.399f,
                 Named.EXTENDED_SRGB.ordinal()
         );
         sNamedColorSpaces[Named.LINEAR_EXTENDED_SRGB.ordinal()] = new ColorSpace.Rgb(
@@ -1412,7 +1416,7 @@
                 ILLUMINANT_D65,
                 DoubleUnaryOperator.identity(),
                 DoubleUnaryOperator.identity(),
-                -0.5f, 7.5f,
+                -0.5f, 7.499f,
                 Named.LINEAR_EXTENDED_SRGB.ordinal()
         );
         sNamedColorSpaces[Named.BT709.ordinal()] = new ColorSpace.Rgb(
@@ -1437,8 +1441,8 @@
                 "SMPTE RP 431-2-2007 DCI (P3)",
                 new float[] { 0.680f, 0.320f, 0.265f, 0.690f, 0.150f, 0.060f },
                 new float[] { 0.314f, 0.351f },
-                x -> Math.pow(x, 1 / 2.6),
-                x -> Math.pow(x, 2.6),
+                x -> Math.pow(x < 0.0f ? 0.0f : x, 1 / 2.6),
+                x -> Math.pow(x < 0.0f ? 0.0f : x, 2.6),
                 0.0f, 1.0f,
                 Named.DCI_P3.ordinal()
         );
@@ -1473,8 +1477,8 @@
                 "Adobe RGB (1998)",
                 new float[] { 0.64f, 0.33f, 0.21f, 0.71f, 0.15f, 0.06f },
                 ILLUMINANT_D65,
-                x -> Math.pow(x, 1 / 2.2),
-                x -> Math.pow(x, 2.2),
+                x -> Math.pow(x < 0.0f ? 0.0f : x, 1 / 2.2),
+                x -> Math.pow(x < 0.0f ? 0.0f : x, 2.2),
                 0.0f, 1.0f,
                 Named.ADOBE_RGB.ordinal()
         );
@@ -1720,6 +1724,7 @@
     /**
      * Implementation of the CIE XYZ color space. Assumes the white point is D50.
      */
+    @AnyThread
     private static final class Xyz extends ColorSpace {
         private Xyz(@NonNull String name, @IntRange(from = MIN_ID, to = MAX_ID) int id) {
             super(name, Model.XYZ, id);
@@ -1765,6 +1770,7 @@
      * Implementation of the CIE L*a*b* color space. Its PCS is CIE XYZ
      * with a white point of D50.
      */
+    @AnyThread
     private static final class Lab extends ColorSpace {
         private static final float A = 216.0f / 24389.0f;
         private static final float B = 841.0f / 108.0f;
@@ -1949,6 +1955,7 @@
      * <p>To learn more about the white point adaptation process, refer to the
      * documentation of {@link Adaptation}.</p>
      */
+    @AnyThread
     public static class Rgb extends ColorSpace {
         @NonNull private final float[] mWhitePoint;
         @NonNull private final float[] mPrimaries;
@@ -2337,7 +2344,7 @@
          * to "gamma space" (gamma encoded). The terms gamma space and gamma encoded
          * are frequently used because many OETFs can be closely approximated using
          * a simple power function of the form \(x^{\frac{1}{\gamma}}\) (the
-         * approximation of the {@link Named#SRGB sRGB} EOTF uses \(\gamma=2.2\)
+         * approximation of the {@link Named#SRGB sRGB} OETF uses \(\gamma=2.2\)
          * for instance).</p>
          *
          * @return A transfer function that converts from linear space to "gamma space"
@@ -2346,7 +2353,7 @@
          */
         @NonNull
         public DoubleUnaryOperator getOetf() {
-            return mOetf;
+            return mClampedOetf;
         }
 
         /**
@@ -2369,7 +2376,7 @@
          */
         @NonNull
         public DoubleUnaryOperator getEotf() {
-            return mEotf;
+            return mClampedEotf;
         }
 
         @Override
@@ -2924,6 +2931,7 @@
      * @see ColorSpace#connect(ColorSpace, RenderIntent)
      * @see ColorSpace#connect(ColorSpace)
      */
+    @AnyThread
     public static class Connector {
         @NonNull private final ColorSpace mSource;
         @NonNull private final ColorSpace mDestination;
diff --git a/legacy-test/Android.mk b/legacy-test/Android.mk
index 5e72a0d..0a814f3 100644
--- a/legacy-test/Android.mk
+++ b/legacy-test/Android.mk
@@ -18,7 +18,8 @@
 
 # Build the legacy-test library
 # =============================
-# This contains the junit.framework classes that were in Android API level 25.
+# This contains the junit.framework and android.test classes that were in
+# Android API level 25.
 include $(CLEAR_VARS)
 
 LOCAL_SRC_FILES := $(call all-java-files-under, src)
@@ -28,6 +29,18 @@
 
 include $(BUILD_JAVA_LIBRARY)
 
+# Build the legacy-android-test library
+# =============================
+# This contains the android.test classes that were in Android API level 25.
+include $(CLEAR_VARS)
+
+LOCAL_SRC_FILES := $(call all-java-files-under, src/android)
+LOCAL_MODULE := legacy-android-test
+LOCAL_NO_STANDARD_LIBRARIES := true
+LOCAL_JAVA_LIBRARIES := core-oj core-libart framework junit
+
+include $(BUILD_STATIC_JAVA_LIBRARY)
+
 ifeq ($(HOST_OS),linux)
 # Build the legacy-performance-test-hostdex library
 # =================================================
diff --git a/libs/androidfw/Android.bp b/libs/androidfw/Android.bp
index d501d25..fb89835 100644
--- a/libs/androidfw/Android.bp
+++ b/libs/androidfw/Android.bp
@@ -24,10 +24,14 @@
         "-Wunreachable-code",
     ],
     srcs: [
+        "ApkAssets.cpp",
         "Asset.cpp",
         "AssetDir.cpp",
         "AssetManager.cpp",
+        "AssetManager2.cpp",
         "AttributeResolution.cpp",
+        "ChunkIterator.cpp",
+        "LoadedArsc.cpp",
         "LocaleData.cpp",
         "misc.cpp",
         "ObbFile.cpp",
@@ -65,7 +69,16 @@
             shared: {
                 enabled: false,
             },
-            shared_libs: ["libz-host"],
+            static_libs: [
+                "libziparchive",
+                "libbase",
+                "liblog",
+                "libcutils",
+                "libutils",
+            ],
+            shared_libs: [
+                "libz-host",
+            ],
         },
         windows: {
             enabled: true,
diff --git a/libs/androidfw/ApkAssets.cpp b/libs/androidfw/ApkAssets.cpp
new file mode 100644
index 0000000..55f4c3c
--- /dev/null
+++ b/libs/androidfw/ApkAssets.cpp
@@ -0,0 +1,104 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define ATRACE_TAG ATRACE_TAG_RESOURCES
+
+#include "androidfw/ApkAssets.h"
+
+#include "android-base/logging.h"
+#include "utils/Trace.h"
+#include "ziparchive/zip_archive.h"
+
+#include "androidfw/Asset.h"
+#include "androidfw/Util.h"
+
+namespace android {
+
+std::unique_ptr<ApkAssets> ApkAssets::Load(const std::string& path) {
+  ATRACE_NAME("ApkAssets::Load");
+  ::ZipArchiveHandle unmanaged_handle;
+  int32_t result = ::OpenArchive(path.c_str(), &unmanaged_handle);
+  if (result != 0) {
+    LOG(ERROR) << ::ErrorCodeString(result);
+    return {};
+  }
+
+  // Wrap the handle in a unique_ptr so it gets automatically closed.
+  std::unique_ptr<ApkAssets> loaded_apk(new ApkAssets());
+  loaded_apk->zip_handle_.reset(unmanaged_handle);
+
+  ::ZipString entry_name("resources.arsc");
+  ::ZipEntry entry;
+  result = ::FindEntry(loaded_apk->zip_handle_.get(), entry_name, &entry);
+  if (result != 0) {
+    LOG(ERROR) << ::ErrorCodeString(result);
+    return {};
+  }
+
+  if (entry.method == kCompressDeflated) {
+    LOG(WARNING) << "resources.arsc is compressed.";
+  }
+
+  loaded_apk->resources_asset_ =
+      loaded_apk->Open("resources.arsc", Asset::AccessMode::ACCESS_BUFFER);
+  if (loaded_apk->resources_asset_ == nullptr) {
+    return {};
+  }
+
+  loaded_apk->path_ = path;
+  loaded_apk->loaded_arsc_ =
+      LoadedArsc::Load(loaded_apk->resources_asset_->getBuffer(true /*wordAligned*/),
+                       loaded_apk->resources_asset_->getLength());
+  if (loaded_apk->loaded_arsc_ == nullptr) {
+    return {};
+  }
+  return loaded_apk;
+}
+
+std::unique_ptr<Asset> ApkAssets::Open(const std::string& path, Asset::AccessMode /*mode*/) const {
+  ATRACE_NAME("ApkAssets::Open");
+  CHECK(zip_handle_ != nullptr);
+
+  ::ZipString name(path.c_str());
+  ::ZipEntry entry;
+  int32_t result = ::FindEntry(zip_handle_.get(), name, &entry);
+  if (result != 0) {
+    LOG(ERROR) << "No entry '" << path << "' found in APK.";
+    return {};
+  }
+
+  if (entry.method == kCompressDeflated) {
+    auto compressed_asset = util::make_unique<_CompressedAsset>();
+    if (compressed_asset->openChunk(::GetFileDescriptor(zip_handle_.get()), entry.offset,
+                                    entry.method, entry.uncompressed_length,
+                                    entry.compressed_length) != NO_ERROR) {
+      LOG(ERROR) << "Failed to decompress '" << path << "'.";
+      return {};
+    }
+    return std::move(compressed_asset);
+  } else {
+    auto uncompressed_asset = util::make_unique<_FileAsset>();
+    if (uncompressed_asset->openChunk(path.c_str(), ::GetFileDescriptor(zip_handle_.get()),
+                                      entry.offset, entry.uncompressed_length) != NO_ERROR) {
+      LOG(ERROR) << "Failed to mmap '" << path << "'.";
+      return {};
+    }
+    return std::move(uncompressed_asset);
+  }
+  return {};
+}
+
+}  // namespace android
diff --git a/libs/androidfw/AssetManager2.cpp b/libs/androidfw/AssetManager2.cpp
new file mode 100644
index 0000000..8d65925
--- /dev/null
+++ b/libs/androidfw/AssetManager2.cpp
@@ -0,0 +1,576 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define ATRACE_TAG ATRACE_TAG_RESOURCES
+
+#include "androidfw/AssetManager2.h"
+
+#include "android-base/logging.h"
+#include "android-base/stringprintf.h"
+#include "utils/ByteOrder.h"
+#include "utils/Trace.h"
+
+#ifdef _WIN32
+#ifdef ERROR
+#undef ERROR
+#endif
+#endif
+
+namespace android {
+
+AssetManager2::AssetManager2() { memset(&configuration_, 0, sizeof(configuration_)); }
+
+bool AssetManager2::SetApkAssets(const std::vector<const ApkAssets*>& apk_assets,
+                                 bool invalidate_caches) {
+  apk_assets_ = apk_assets;
+  if (invalidate_caches) {
+    InvalidateCaches(static_cast<uint32_t>(-1));
+  }
+  return true;
+}
+
+const std::vector<const ApkAssets*> AssetManager2::GetApkAssets() const { return apk_assets_; }
+
+const ResStringPool* AssetManager2::GetStringPoolForCookie(ApkAssetsCookie cookie) const {
+  if (cookie < 0 || static_cast<size_t>(cookie) >= apk_assets_.size()) {
+    return nullptr;
+  }
+  return apk_assets_[cookie]->GetLoadedArsc()->GetStringPool();
+}
+
+void AssetManager2::SetConfiguration(const ResTable_config& configuration) {
+  const int diff = configuration_.diff(configuration);
+  configuration_ = configuration;
+
+  if (diff) {
+    InvalidateCaches(static_cast<uint32_t>(diff));
+  }
+}
+
+const ResTable_config& AssetManager2::GetConfiguration() const { return configuration_; }
+
+std::unique_ptr<Asset> AssetManager2::Open(const std::string& filename, Asset::AccessMode mode) {
+  const std::string new_path = "assets/" + filename;
+  return OpenNonAsset(new_path, mode);
+}
+
+std::unique_ptr<Asset> AssetManager2::Open(const std::string& filename, ApkAssetsCookie cookie,
+                                           Asset::AccessMode mode) {
+  const std::string new_path = "assets/" + filename;
+  return OpenNonAsset(new_path, cookie, mode);
+}
+
+// Search in reverse because that's how we used to do it and we need to preserve behaviour.
+// This is unfortunate, because ClassLoaders delegate to the parent first, so the order
+// is inconsistent for split APKs.
+std::unique_ptr<Asset> AssetManager2::OpenNonAsset(const std::string& filename,
+                                                   Asset::AccessMode mode,
+                                                   ApkAssetsCookie* out_cookie) {
+  ATRACE_CALL();
+  for (int32_t i = apk_assets_.size() - 1; i >= 0; i--) {
+    std::unique_ptr<Asset> asset = apk_assets_[i]->Open(filename, mode);
+    if (asset) {
+      if (out_cookie != nullptr) {
+        *out_cookie = i;
+      }
+      return asset;
+    }
+  }
+
+  if (out_cookie != nullptr) {
+    *out_cookie = kInvalidCookie;
+  }
+  return {};
+}
+
+std::unique_ptr<Asset> AssetManager2::OpenNonAsset(const std::string& filename,
+                                                   ApkAssetsCookie cookie, Asset::AccessMode mode) {
+  ATRACE_CALL();
+  if (cookie < 0 || static_cast<size_t>(cookie) >= apk_assets_.size()) {
+    return {};
+  }
+  return apk_assets_[cookie]->Open(filename, mode);
+}
+
+ApkAssetsCookie AssetManager2::FindEntry(uint32_t resid, uint16_t density_override,
+                                         bool stop_at_first_match, LoadedArsc::Entry* out_entry,
+                                         ResTable_config* out_selected_config,
+                                         uint32_t* out_flags) {
+  ATRACE_CALL();
+
+  // Might use this if density_override != 0.
+  ResTable_config density_override_config;
+
+  // Select our configuration or generate a density override configuration.
+  ResTable_config* desired_config = &configuration_;
+  if (density_override != 0 && density_override != configuration_.density) {
+    density_override_config = configuration_;
+    density_override_config.density = density_override;
+    desired_config = &density_override_config;
+  }
+
+  LoadedArsc::Entry best_entry;
+  ResTable_config best_config;
+  int32_t best_index = -1;
+  uint32_t cumulated_flags = 0;
+
+  const size_t apk_asset_count = apk_assets_.size();
+  for (size_t i = 0; i < apk_asset_count; i++) {
+    const LoadedArsc* loaded_arsc = apk_assets_[i]->GetLoadedArsc();
+
+    LoadedArsc::Entry current_entry;
+    ResTable_config current_config;
+    uint32_t flags = 0;
+    if (!loaded_arsc->FindEntry(resid, *desired_config, &current_entry, &current_config, &flags)) {
+      continue;
+    }
+
+    cumulated_flags |= flags;
+
+    if (best_index == -1 || current_config.isBetterThan(best_config, desired_config)) {
+      best_entry = current_entry;
+      best_config = current_config;
+      best_index = static_cast<int32_t>(i);
+      if (stop_at_first_match) {
+        break;
+      }
+    }
+  }
+
+  if (best_index == -1) {
+    return kInvalidCookie;
+  }
+
+  *out_entry = best_entry;
+  *out_selected_config = best_config;
+  *out_flags = cumulated_flags;
+  return best_index;
+}
+
+bool AssetManager2::GetResourceName(uint32_t resid, ResourceName* out_name) {
+  ATRACE_CALL();
+
+  LoadedArsc::Entry entry;
+  ResTable_config config;
+  uint32_t flags = 0u;
+  ApkAssetsCookie cookie = FindEntry(resid, 0u /* density_override */,
+                                     true /* stop_at_first_match */, &entry, &config, &flags);
+  if (cookie == kInvalidCookie) {
+    return false;
+  }
+
+  const std::string* package_name =
+      apk_assets_[cookie]->GetLoadedArsc()->GetPackageNameForId(resid);
+  if (package_name == nullptr) {
+    return false;
+  }
+
+  out_name->package = package_name->data();
+  out_name->package_len = package_name->size();
+
+  out_name->type = entry.type_string_ref.string8(&out_name->type_len);
+  out_name->type16 = nullptr;
+  if (out_name->type == nullptr) {
+    out_name->type16 = entry.type_string_ref.string16(&out_name->type_len);
+    if (out_name->type16 == nullptr) {
+      return false;
+    }
+  }
+
+  out_name->entry = entry.entry_string_ref.string8(&out_name->entry_len);
+  out_name->entry16 = nullptr;
+  if (out_name->entry == nullptr) {
+    out_name->entry16 = entry.entry_string_ref.string16(&out_name->entry_len);
+    if (out_name->entry16 == nullptr) {
+      return false;
+    }
+  }
+  return true;
+}
+
+bool AssetManager2::GetResourceFlags(uint32_t resid, uint32_t* out_flags) {
+  LoadedArsc::Entry entry;
+  ResTable_config config;
+  ApkAssetsCookie cookie = FindEntry(resid, 0u /* density_override */,
+                                     false /* stop_at_first_match */, &entry, &config, out_flags);
+  return cookie != kInvalidCookie;
+}
+
+ApkAssetsCookie AssetManager2::GetResource(uint32_t resid, bool may_be_bag,
+                                           uint16_t density_override, Res_value* out_value,
+                                           ResTable_config* out_selected_config,
+                                           uint32_t* out_flags) {
+  ATRACE_CALL();
+
+  LoadedArsc::Entry entry;
+  ResTable_config config;
+  uint32_t flags = 0u;
+  ApkAssetsCookie cookie =
+      FindEntry(resid, density_override, false /* stop_at_first_match */, &entry, &config, &flags);
+  if (cookie == kInvalidCookie) {
+    return kInvalidCookie;
+  }
+
+  if (dtohl(entry.entry->flags) & ResTable_entry::FLAG_COMPLEX) {
+    if (!may_be_bag) {
+      LOG(ERROR) << base::StringPrintf("Resource %08x is a complex map type.", resid);
+    }
+    return kInvalidCookie;
+  }
+
+  const Res_value* device_value = reinterpret_cast<const Res_value*>(
+      reinterpret_cast<const uint8_t*>(entry.entry) + dtohs(entry.entry->size));
+  out_value->copyFrom_dtoh(*device_value);
+  *out_selected_config = config;
+  *out_flags = flags;
+  return cookie;
+}
+
+const ResolvedBag* AssetManager2::GetBag(uint32_t resid) {
+  ATRACE_CALL();
+
+  auto cached_iter = cached_bags_.find(resid);
+  if (cached_iter != cached_bags_.end()) {
+    return cached_iter->second.get();
+  }
+
+  LoadedArsc::Entry entry;
+  ResTable_config config;
+  uint32_t flags = 0u;
+  ApkAssetsCookie cookie = FindEntry(resid, 0u /* density_override */,
+                                     false /* stop_at_first_match */, &entry, &config, &flags);
+  if (cookie == kInvalidCookie) {
+    return nullptr;
+  }
+
+  // Check that the size of the entry header is at least as big as
+  // the desired ResTable_map_entry. Also verify that the entry
+  // was intended to be a map.
+  if (dtohs(entry.entry->size) < sizeof(ResTable_map_entry) ||
+      (dtohs(entry.entry->flags) & ResTable_entry::FLAG_COMPLEX) == 0) {
+    // Not a bag, nothing to do.
+    return nullptr;
+  }
+
+  const ResTable_map_entry* map = reinterpret_cast<const ResTable_map_entry*>(entry.entry);
+  const ResTable_map* map_entry =
+      reinterpret_cast<const ResTable_map*>(reinterpret_cast<const uint8_t*>(map) + map->size);
+  const ResTable_map* const map_entry_end = map_entry + dtohl(map->count);
+
+  const uint32_t parent = dtohl(map->parent.ident);
+  if (parent == 0) {
+    // There is no parent, meaning there is nothing to inherit and we can do a simple
+    // copy of the entries in the map.
+    const size_t entry_count = map_entry_end - map_entry;
+    util::unique_cptr<ResolvedBag> new_bag{reinterpret_cast<ResolvedBag*>(
+        malloc(sizeof(ResolvedBag) + (entry_count * sizeof(ResolvedBag::Entry))))};
+    ResolvedBag::Entry* new_entry = new_bag->entries;
+    for (; map_entry != map_entry_end; ++map_entry) {
+      new_entry->cookie = cookie;
+      new_entry->value.copyFrom_dtoh(map_entry->value);
+      new_entry->key = dtohl(map_entry->name.ident);
+      new_entry->key_pool = nullptr;
+      new_entry->type_pool = nullptr;
+      ++new_entry;
+    }
+    new_bag->type_spec_flags = flags;
+    new_bag->entry_count = static_cast<uint32_t>(entry_count);
+    ResolvedBag* result = new_bag.get();
+    cached_bags_[resid] = std::move(new_bag);
+    return result;
+  }
+
+  // Get the parent and do a merge of the keys.
+  const ResolvedBag* parent_bag = GetBag(parent);
+  if (parent_bag == nullptr) {
+    // Failed to get the parent that should exist.
+    return nullptr;
+  }
+
+  // Combine flags from the parent and our own bag.
+  flags |= parent_bag->type_spec_flags;
+
+  // Create the max possible entries we can make. Once we construct the bag,
+  // we will realloc to fit to size.
+  const size_t max_count = parent_bag->entry_count + dtohl(map->count);
+  ResolvedBag* new_bag = reinterpret_cast<ResolvedBag*>(
+      malloc(sizeof(ResolvedBag) + (max_count * sizeof(ResolvedBag::Entry))));
+  ResolvedBag::Entry* new_entry = new_bag->entries;
+
+  const ResolvedBag::Entry* parent_entry = parent_bag->entries;
+  const ResolvedBag::Entry* const parent_entry_end = parent_entry + parent_bag->entry_count;
+
+  // The keys are expected to be in sorted order. Merge the two bags.
+  while (map_entry != map_entry_end && parent_entry != parent_entry_end) {
+    const uint32_t child_key = dtohl(map_entry->name.ident);
+    if (child_key <= parent_entry->key) {
+      // Use the child key if it comes before the parent
+      // or is equal to the parent (overrides).
+      new_entry->cookie = cookie;
+      new_entry->value.copyFrom_dtoh(map_entry->value);
+      new_entry->key = child_key;
+      new_entry->key_pool = nullptr;
+      new_entry->type_pool = nullptr;
+      ++map_entry;
+    } else {
+      // Take the parent entry as-is.
+      memcpy(new_entry, parent_entry, sizeof(*new_entry));
+    }
+
+    if (child_key >= parent_entry->key) {
+      // Move to the next parent entry if we used it or it was overridden.
+      ++parent_entry;
+    }
+    // Increment to the next entry to fill.
+    ++new_entry;
+  }
+
+  // Finish the child entries if they exist.
+  while (map_entry != map_entry_end) {
+    new_entry->cookie = cookie;
+    new_entry->value.copyFrom_dtoh(map_entry->value);
+    new_entry->key = dtohl(map_entry->name.ident);
+    new_entry->key_pool = nullptr;
+    new_entry->type_pool = nullptr;
+    ++map_entry;
+    ++new_entry;
+  }
+
+  // Finish the parent entries if they exist.
+  if (parent_entry != parent_entry_end) {
+    // Take the rest of the parent entries as-is.
+    const size_t num_entries_to_copy = parent_entry_end - parent_entry;
+    memcpy(new_entry, parent_entry, num_entries_to_copy * sizeof(*new_entry));
+    new_entry += num_entries_to_copy;
+  }
+
+  // Resize the resulting array to fit.
+  const size_t actual_count = new_entry - new_bag->entries;
+  if (actual_count != max_count) {
+    new_bag = reinterpret_cast<ResolvedBag*>(
+        realloc(new_bag, sizeof(ResolvedBag) + (actual_count * sizeof(ResolvedBag::Entry))));
+  }
+
+  util::unique_cptr<ResolvedBag> final_bag{new_bag};
+  final_bag->type_spec_flags = flags;
+  final_bag->entry_count = static_cast<uint32_t>(actual_count);
+  ResolvedBag* result = final_bag.get();
+  cached_bags_[resid] = std::move(final_bag);
+  return result;
+}
+
+void AssetManager2::InvalidateCaches(uint32_t diff) {
+  if (diff == 0xffffffffu) {
+    // Everything must go.
+    cached_bags_.clear();
+    return;
+  }
+
+  // Be more conservative with what gets purged. Only if the bag has other possible
+  // variations with respect to what changed (diff) should we remove it.
+  for (auto iter = cached_bags_.cbegin(); iter != cached_bags_.cend();) {
+    if (diff & iter->second->type_spec_flags) {
+      iter = cached_bags_.erase(iter);
+    } else {
+      ++iter;
+    }
+  }
+}
+
+std::unique_ptr<Theme> AssetManager2::NewTheme() { return std::unique_ptr<Theme>(new Theme(this)); }
+
+bool Theme::ApplyStyle(uint32_t resid, bool force) {
+  ATRACE_CALL();
+
+  const ResolvedBag* bag = asset_manager_->GetBag(resid);
+  if (bag == nullptr) {
+    return false;
+  }
+
+  // Merge the flags from this style.
+  type_spec_flags_ |= bag->type_spec_flags;
+
+  // On the first iteration, verify the attribute IDs and
+  // update the entry count in each type.
+  const auto bag_iter_end = end(bag);
+  for (auto bag_iter = begin(bag); bag_iter != bag_iter_end; ++bag_iter) {
+    const uint32_t attr_resid = bag_iter->key;
+
+    // If the resource ID passed in is not a style, the key can be
+    // some other identifier that is not a resource ID.
+    if (!util::is_valid_resid(attr_resid)) {
+      return false;
+    }
+
+    const uint32_t package_idx = util::get_package_id(attr_resid);
+
+    // The type ID is 1-based, so subtract 1 to get an index.
+    const uint32_t type_idx = util::get_type_id(attr_resid) - 1;
+    const uint32_t entry_idx = util::get_entry_id(attr_resid);
+
+    std::unique_ptr<Package>& package = packages_[package_idx];
+    if (package == nullptr) {
+      package.reset(new Package());
+    }
+
+    util::unique_cptr<Type>& type = package->types[type_idx];
+    if (type == nullptr) {
+      // Set the initial capacity to take up a total amount of 1024 bytes.
+      constexpr uint32_t kInitialCapacity = (1024u - sizeof(Type)) / sizeof(Entry);
+      const uint32_t initial_capacity = std::max(entry_idx, kInitialCapacity);
+      type.reset(
+          reinterpret_cast<Type*>(calloc(sizeof(Type) + (initial_capacity * sizeof(Entry)), 1)));
+      type->entry_capacity = initial_capacity;
+    }
+
+    // Set the entry_count to include this entry. We will populate
+    // and resize the array as necessary in the next pass.
+    if (entry_idx + 1 > type->entry_count) {
+      // Increase the entry count to include this.
+      type->entry_count = entry_idx + 1;
+    }
+  }
+
+  // On the second pass, we will realloc to fit the entry counts
+  // and populate the structures.
+  for (auto bag_iter = begin(bag); bag_iter != bag_iter_end; ++bag_iter) {
+    const uint32_t attr_resid = bag_iter->key;
+    const uint32_t package_idx = util::get_package_id(attr_resid);
+    const uint32_t type_idx = util::get_type_id(attr_resid) - 1;
+    const uint32_t entry_idx = util::get_entry_id(attr_resid);
+    Package* package = packages_[package_idx].get();
+    util::unique_cptr<Type>& type = package->types[type_idx];
+    if (type->entry_count != type->entry_capacity) {
+      // Resize to fit the actual entries that will be included.
+      Type* type_ptr = type.release();
+      type.reset(reinterpret_cast<Type*>(
+          realloc(type_ptr, sizeof(Type) + (type_ptr->entry_count * sizeof(Entry)))));
+      if (type->entry_capacity < type->entry_count) {
+        // Clear the newly allocated memory (which does not get zero initialized).
+        // We need to do this because we |= type_spec_flags.
+        memset(type->entries + type->entry_capacity, 0,
+               sizeof(Entry) * (type->entry_count - type->entry_capacity));
+      }
+      type->entry_capacity = type->entry_count;
+    }
+    Entry& entry = type->entries[entry_idx];
+    if (force || entry.value.dataType == Res_value::TYPE_NULL) {
+      entry.cookie = bag_iter->cookie;
+      entry.type_spec_flags |= bag->type_spec_flags;
+      entry.value = bag_iter->value;
+    }
+  }
+  return true;
+}
+
+ApkAssetsCookie Theme::GetAttribute(uint32_t resid, Res_value* out_value,
+                                    uint32_t* out_flags) const {
+  constexpr const int kMaxIterations = 20;
+
+  uint32_t type_spec_flags = 0u;
+
+  for (int iterations_left = kMaxIterations; iterations_left > 0; iterations_left--) {
+    if (!util::is_valid_resid(resid)) {
+      return kInvalidCookie;
+    }
+
+    const uint32_t package_idx = util::get_package_id(resid);
+
+    // Type ID is 1-based, subtract 1 to get the index.
+    const uint32_t type_idx = util::get_type_id(resid) - 1;
+    const uint32_t entry_idx = util::get_entry_id(resid);
+
+    const Package* package = packages_[package_idx].get();
+    if (package == nullptr) {
+      return kInvalidCookie;
+    }
+
+    const Type* type = package->types[type_idx].get();
+    if (type == nullptr) {
+      return kInvalidCookie;
+    }
+
+    if (entry_idx >= type->entry_count) {
+      return kInvalidCookie;
+    }
+
+    const Entry& entry = type->entries[entry_idx];
+    type_spec_flags |= entry.type_spec_flags;
+
+    switch (entry.value.dataType) {
+      case Res_value::TYPE_ATTRIBUTE:
+        resid = entry.value.data;
+        break;
+
+      case Res_value::TYPE_NULL:
+        return kInvalidCookie;
+
+      default:
+        *out_value = entry.value;
+        if (out_flags != nullptr) {
+          *out_flags = type_spec_flags;
+        }
+        return entry.cookie;
+    }
+  }
+
+  LOG(WARNING) << base::StringPrintf("Too many (%d) attribute references, stopped at: 0x%08x",
+                                     kMaxIterations, resid);
+  return kInvalidCookie;
+}
+
+void Theme::Clear() {
+  type_spec_flags_ = 0u;
+  for (std::unique_ptr<Package>& package : packages_) {
+    package.reset();
+  }
+}
+
+bool Theme::SetTo(const Theme& o) {
+  if (this == &o) {
+    return true;
+  }
+
+  if (asset_manager_ != o.asset_manager_) {
+    return false;
+  }
+
+  type_spec_flags_ = o.type_spec_flags_;
+
+  for (size_t p = 0; p < arraysize(packages_); p++) {
+    const Package* package = o.packages_[p].get();
+    if (package == nullptr) {
+      packages_[p].reset();
+      continue;
+    }
+
+    for (size_t t = 0; t < arraysize(package->types); t++) {
+      const Type* type = package->types[t].get();
+      if (type == nullptr) {
+        packages_[p]->types[t].reset();
+        continue;
+      }
+
+      const size_t type_alloc_size = sizeof(Type) + (type->entry_capacity * sizeof(Entry));
+      void* copied_data = malloc(type_alloc_size);
+      memcpy(copied_data, type, type_alloc_size);
+      packages_[p]->types[t].reset(reinterpret_cast<Type*>(copied_data));
+    }
+  }
+  return true;
+}
+
+}  // namespace android
diff --git a/libs/androidfw/Chunk.h b/libs/androidfw/Chunk.h
new file mode 100644
index 0000000..e87b940
--- /dev/null
+++ b/libs/androidfw/Chunk.h
@@ -0,0 +1,113 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef CHUNK_H_
+#define CHUNK_H_
+
+#include "android-base/logging.h"
+#include "android-base/macros.h"
+#include "utils/ByteOrder.h"
+
+#ifdef _WIN32
+#ifdef ERROR
+#undef ERROR
+#endif
+#endif
+
+#include "androidfw/ResourceTypes.h"
+
+namespace android {
+
+// Helpful wrapper around a ResChunk_header that provides getter methods
+// that handle endianness conversions and provide access to the data portion
+// of the chunk.
+class Chunk {
+ public:
+  explicit Chunk(const ResChunk_header* chunk) : device_chunk_(chunk) {}
+
+  // Returns the type of the chunk. Caller need not worry about endianness.
+  inline int type() const { return dtohs(device_chunk_->type); }
+
+  // Returns the size of the entire chunk. This can be useful for skipping
+  // over the entire chunk. Caller need not worry about endianness.
+  inline size_t size() const { return dtohl(device_chunk_->size); }
+
+  // Returns the size of the header. Caller need not worry about endianness.
+  inline size_t header_size() const { return dtohs(device_chunk_->headerSize); }
+
+  template <typename T>
+  inline const T* header() const {
+    if (header_size() >= sizeof(T)) {
+      return reinterpret_cast<const T*>(device_chunk_);
+    }
+    return nullptr;
+  }
+
+  inline const void* data_ptr() const {
+    return reinterpret_cast<const uint8_t*>(device_chunk_) + header_size();
+  }
+
+  inline size_t data_size() const { return size() - header_size(); }
+
+ private:
+  const ResChunk_header* device_chunk_;
+};
+
+// Provides a Java style iterator over an array of ResChunk_header's.
+// Validation is performed while iterating.
+// The caller should check if there was an error during chunk validation
+// by calling HadError() and GetLastError() to get the reason for failure.
+// Example:
+//
+//   ChunkIterator iter(data_ptr, data_len);
+//   while (iter.HasNext()) {
+//     const Chunk chunk = iter.Next();
+//     ...
+//   }
+//
+//   if (iter.HadError()) {
+//     LOG(ERROR) << iter.GetLastError();
+//   }
+//
+class ChunkIterator {
+ public:
+  ChunkIterator(const void* data, size_t len)
+      : next_chunk_(reinterpret_cast<const ResChunk_header*>(data)),
+        len_(len),
+        last_error_(nullptr) {
+    CHECK(next_chunk_ != nullptr) << "data can't be nullptr";
+    VerifyNextChunk();
+  }
+
+  Chunk Next();
+  inline bool HasNext() const { return !HadError() && len_ != 0; };
+  inline bool HadError() const { return last_error_ != nullptr; }
+  inline std::string GetLastError() const { return last_error_; }
+
+ private:
+  DISALLOW_COPY_AND_ASSIGN(ChunkIterator);
+
+  // Returns false if there was an error.
+  bool VerifyNextChunk();
+
+  const ResChunk_header* next_chunk_;
+  size_t len_;
+  const char* last_error_;
+};
+
+}  // namespace android
+
+#endif /* CHUNK_H_ */
diff --git a/libs/androidfw/ChunkIterator.cpp b/libs/androidfw/ChunkIterator.cpp
new file mode 100644
index 0000000..747aa4a
--- /dev/null
+++ b/libs/androidfw/ChunkIterator.cpp
@@ -0,0 +1,81 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "Chunk.h"
+
+#include "android-base/logging.h"
+
+namespace android {
+
+Chunk ChunkIterator::Next() {
+  CHECK(len_ != 0) << "called Next() after last chunk";
+
+  const ResChunk_header* this_chunk = next_chunk_;
+
+  // We've already checked the values of this_chunk, so safely increment.
+  next_chunk_ = reinterpret_cast<const ResChunk_header*>(
+      reinterpret_cast<const uint8_t*>(this_chunk) + dtohl(this_chunk->size));
+  len_ -= dtohl(this_chunk->size);
+
+  if (len_ != 0) {
+    // Prepare the next chunk.
+    VerifyNextChunk();
+  }
+  return Chunk(this_chunk);
+}
+
+// Returns false if there was an error.
+bool ChunkIterator::VerifyNextChunk() {
+  const uintptr_t header_start = reinterpret_cast<uintptr_t>(next_chunk_);
+
+  // This data must be 4-byte aligned, since we directly
+  // access 32-bit words, which must be aligned on
+  // certain architectures.
+  if (header_start & 0x03) {
+    last_error_ = "header not aligned on 4-byte boundary";
+    return false;
+  }
+
+  if (len_ < sizeof(ResChunk_header)) {
+    last_error_ = "not enough space for header";
+    return false;
+  }
+
+  const size_t header_size = dtohs(next_chunk_->headerSize);
+  const size_t size = dtohl(next_chunk_->size);
+  if (header_size < sizeof(ResChunk_header)) {
+    last_error_ = "header size too small";
+    return false;
+  }
+
+  if (header_size > size) {
+    last_error_ = "header size is larger than entire chunk";
+    return false;
+  }
+
+  if (size > len_) {
+    last_error_ = "chunk size is bigger than given data";
+    return false;
+  }
+
+  if ((size | header_size) & 0x03) {
+    last_error_ = "header sizes are not aligned on 4-byte boundary";
+    return false;
+  }
+  return true;
+}
+
+}  // namespace android
diff --git a/libs/androidfw/LoadedArsc.cpp b/libs/androidfw/LoadedArsc.cpp
new file mode 100644
index 0000000..94d0d46
--- /dev/null
+++ b/libs/androidfw/LoadedArsc.cpp
@@ -0,0 +1,572 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define ATRACE_TAG ATRACE_TAG_RESOURCES
+
+#include "androidfw/LoadedArsc.h"
+
+#include <cstddef>
+#include <limits>
+
+#include "android-base/logging.h"
+#include "android-base/stringprintf.h"
+#include "utils/ByteOrder.h"
+#include "utils/Trace.h"
+
+#ifdef _WIN32
+#ifdef ERROR
+#undef ERROR
+#endif
+#endif
+
+#include "Chunk.h"
+#include "androidfw/ByteBucketArray.h"
+#include "androidfw/Util.h"
+
+using android::base::StringPrintf;
+
+namespace android {
+
+namespace {
+
+// Element of a TypeSpec array. See TypeSpec.
+struct Type {
+  // The configuration for which this type defines entries.
+  // This is already converted to host endianness.
+  ResTable_config configuration;
+
+  // Pointer to the mmapped data where entry definitions are kept.
+  const ResTable_type* type;
+};
+
+// TypeSpec is going to be immediately proceeded by
+// an array of Type structs, all in the same block of memory.
+struct TypeSpec {
+  // Pointer to the mmapped data where flags are kept.
+  // Flags denote whether the resource entry is public
+  // and under which configurations it varies.
+  const ResTable_typeSpec* type_spec;
+
+  // The number of types that follow this struct.
+  // There is a type for each configuration
+  // that entries are defined for.
+  size_t type_count;
+
+  // Trick to easily access a variable number of Type structs
+  // proceeding this struct, and to ensure their alignment.
+  const Type types[0];
+};
+
+// TypeSpecPtr points to the block of memory that holds
+// a TypeSpec struct, followed by an array of Type structs.
+// TypeSpecPtr is a managed pointer that knows how to delete
+// itself.
+using TypeSpecPtr = util::unique_cptr<TypeSpec>;
+
+// Builder that helps accumulate Type structs and then create a single
+// contiguous block of memory to store both the TypeSpec struct and
+// the Type structs.
+class TypeSpecPtrBuilder {
+ public:
+  TypeSpecPtrBuilder(const ResTable_typeSpec* header) : header_(header) {}
+
+  void AddType(const ResTable_type* type) {
+    ResTable_config config;
+    config.copyFromDtoH(type->config);
+    types_.push_back(Type{config, type});
+  }
+
+  TypeSpecPtr Build() {
+    // Check for overflow.
+    if ((std::numeric_limits<size_t>::max() - sizeof(TypeSpec)) / sizeof(Type) < types_.size()) {
+      return {};
+    }
+    TypeSpec* type_spec = (TypeSpec*)::malloc(sizeof(TypeSpec) + (types_.size() * sizeof(Type)));
+    type_spec->type_spec = header_;
+    type_spec->type_count = types_.size();
+    memcpy(type_spec + 1, types_.data(), types_.size() * sizeof(Type));
+    return TypeSpecPtr(type_spec);
+  }
+
+ private:
+  DISALLOW_COPY_AND_ASSIGN(TypeSpecPtrBuilder);
+
+  const ResTable_typeSpec* header_;
+  std::vector<Type> types_;
+};
+
+}  // namespace
+
+class LoadedPackage {
+ public:
+  LoadedPackage() = default;
+
+  bool FindEntry(uint8_t type_id, uint16_t entry_id, const ResTable_config& config,
+                 LoadedArsc::Entry* out_entry, ResTable_config* out_selected_config,
+                 uint32_t* out_flags) const;
+
+  ResStringPool type_string_pool_;
+  ResStringPool key_string_pool_;
+  std::string package_name_;
+  int package_id_ = -1;
+
+  ByteBucketArray<TypeSpecPtr> type_specs_;
+
+ private:
+  DISALLOW_COPY_AND_ASSIGN(LoadedPackage);
+};
+
+bool LoadedPackage::FindEntry(uint8_t type_id, uint16_t entry_id, const ResTable_config& config,
+                              LoadedArsc::Entry* out_entry, ResTable_config* out_selected_config,
+                              uint32_t* out_flags) const {
+  ATRACE_NAME("LoadedPackage::FindEntry");
+  const TypeSpecPtr& ptr = type_specs_[type_id];
+  if (ptr == nullptr) {
+    return false;
+  }
+
+  // Don't bother checking if the entry ID is larger than
+  // the number of entries.
+  if (entry_id >= dtohl(ptr->type_spec->entryCount)) {
+    return false;
+  }
+
+  const ResTable_config* best_config = nullptr;
+  const ResTable_type* best_type = nullptr;
+  uint32_t best_offset = 0;
+
+  for (uint32_t i = 0; i < ptr->type_count; i++) {
+    const Type* type = &ptr->types[i];
+
+    if (type->configuration.match(config) &&
+        (best_config == nullptr || type->configuration.isBetterThan(*best_config, &config))) {
+      // The configuration matches and is better than the previous selection.
+      // Find the entry value if it exists for this configuration.
+      size_t entry_count = dtohl(type->type->entryCount);
+      if (entry_id < entry_count) {
+        const uint32_t* entry_offsets = reinterpret_cast<const uint32_t*>(
+            reinterpret_cast<const uint8_t*>(type->type) + dtohs(type->type->header.headerSize));
+        const uint32_t offset = dtohl(entry_offsets[entry_id]);
+        if (offset != ResTable_type::NO_ENTRY) {
+          // There is an entry for this resource, record it.
+          best_config = &type->configuration;
+          best_type = type->type;
+          best_offset = offset + dtohl(type->type->entriesStart);
+        }
+      }
+    }
+  }
+
+  if (best_type == nullptr) {
+    return false;
+  }
+
+  const uint32_t* flags = reinterpret_cast<const uint32_t*>(ptr->type_spec + 1);
+  *out_flags = dtohl(flags[entry_id]);
+  *out_selected_config = *best_config;
+
+  const ResTable_entry* best_entry = reinterpret_cast<const ResTable_entry*>(
+      reinterpret_cast<const uint8_t*>(best_type) + best_offset);
+  out_entry->entry = best_entry;
+  out_entry->type_string_ref = StringPoolRef(&type_string_pool_, best_type->id - 1);
+  out_entry->entry_string_ref = StringPoolRef(&key_string_pool_, dtohl(best_entry->key.index));
+  return true;
+}
+
+// The destructor gets generated into arbitrary translation units
+// if left implicit, which causes the compiler to complain about
+// forward declarations and incomplete types.
+LoadedArsc::~LoadedArsc() {}
+
+bool LoadedArsc::FindEntry(uint32_t resid, const ResTable_config& config, Entry* out_entry,
+                           ResTable_config* out_selected_config, uint32_t* out_flags) const {
+  ATRACE_NAME("LoadedArsc::FindEntry");
+  const uint8_t package_id = util::get_package_id(resid);
+  const uint8_t type_id = util::get_type_id(resid);
+  const uint16_t entry_id = util::get_entry_id(resid);
+
+  if (type_id == 0) {
+    LOG(ERROR) << "Invalid ID 0x" << std::hex << resid << std::dec << ".";
+    return false;
+  }
+
+  for (const auto& loaded_package : packages_) {
+    if (loaded_package->package_id_ == package_id) {
+      return loaded_package->FindEntry(type_id - 1, entry_id, config, out_entry,
+                                       out_selected_config, out_flags);
+    }
+  }
+  return false;
+}
+
+const std::string* LoadedArsc::GetPackageNameForId(uint32_t resid) const {
+  const uint8_t package_id = util::get_package_id(resid);
+  for (const auto& loaded_package : packages_) {
+    if (loaded_package->package_id_ == package_id) {
+      return &loaded_package->package_name_;
+    }
+  }
+  return nullptr;
+}
+
+static bool VerifyType(const Chunk& chunk) {
+  ATRACE_CALL();
+  const ResTable_type* header = chunk.header<ResTable_type>();
+
+  const size_t entry_count = dtohl(header->entryCount);
+  if (entry_count > std::numeric_limits<uint16_t>::max()) {
+    LOG(ERROR) << "Too many entries in RES_TABLE_TYPE_TYPE.";
+    return false;
+  }
+
+  // Make sure that there is enough room for the entry offsets.
+  const size_t offsets_offset = chunk.header_size();
+  const size_t entries_offset = dtohl(header->entriesStart);
+  const size_t offsets_length = sizeof(uint32_t) * entry_count;
+
+  if (offsets_offset + offsets_length > entries_offset) {
+    LOG(ERROR) << "Entry offsets overlap actual entry data.";
+    return false;
+  }
+
+  if (entries_offset > chunk.size()) {
+    LOG(ERROR) << "Entry offsets extend beyond chunk.";
+    return false;
+  }
+
+  if (entries_offset & 0x03) {
+    LOG(ERROR) << "Entries start at unaligned address.";
+    return false;
+  }
+
+  // Check each entry offset.
+  const uint32_t* offsets =
+      reinterpret_cast<const uint32_t*>(reinterpret_cast<const uint8_t*>(header) + offsets_offset);
+  for (size_t i = 0; i < entry_count; i++) {
+    uint32_t offset = dtohl(offsets[i]);
+    if (offset != ResTable_type::NO_ENTRY) {
+      // Check that the offset is aligned.
+      if (offset & 0x03) {
+        LOG(ERROR) << "Entry offset at index " << i << " is not 4-byte aligned.";
+        return false;
+      }
+
+      // Check that the offset doesn't overflow.
+      if (offset > std::numeric_limits<uint32_t>::max() - entries_offset) {
+        // Overflow in offset.
+        LOG(ERROR) << "Entry offset at index " << i << " is too large.";
+        return false;
+      }
+
+      offset += entries_offset;
+      if (offset > chunk.size() - sizeof(ResTable_entry)) {
+        LOG(ERROR) << "Entry offset at index " << i << " is too large. No room for ResTable_entry.";
+        return false;
+      }
+
+      const ResTable_entry* entry = reinterpret_cast<const ResTable_entry*>(
+          reinterpret_cast<const uint8_t*>(header) + offset);
+      const size_t entry_size = dtohs(entry->size);
+      if (entry_size < sizeof(*entry)) {
+        LOG(ERROR) << "ResTable_entry size " << entry_size << " is too small.";
+        return false;
+      }
+
+      // Check the declared entrySize.
+      if (entry_size > chunk.size() || offset > chunk.size() - entry_size) {
+        LOG(ERROR) << "ResTable_entry size " << entry_size << " is too large.";
+        return false;
+      }
+
+      // If this is a map entry, then keep validating.
+      if (entry_size >= sizeof(ResTable_map_entry)) {
+        const ResTable_map_entry* map = reinterpret_cast<const ResTable_map_entry*>(entry);
+        const size_t map_entry_count = dtohl(map->count);
+
+        size_t map_entries_start = offset + entry_size;
+        if (map_entries_start & 0x03) {
+          LOG(ERROR) << "Map entries start at unaligned offset.";
+          return false;
+        }
+
+        // Each entry is sizeof(ResTable_map) big.
+        if (map_entry_count > ((chunk.size() - map_entries_start) / sizeof(ResTable_map))) {
+          LOG(ERROR) << "Too many map entries in ResTable_map_entry.";
+          return false;
+        }
+
+        // Great, all the map entries fit!.
+      } else {
+        // There needs to be room for one Res_value struct.
+        if (offset + entry_size > chunk.size() - sizeof(Res_value)) {
+          LOG(ERROR) << "No room for Res_value after ResTable_entry.";
+          return false;
+        }
+
+        const Res_value* value = reinterpret_cast<const Res_value*>(
+            reinterpret_cast<const uint8_t*>(entry) + entry_size);
+        const size_t value_size = dtohs(value->size);
+        if (value_size < sizeof(Res_value)) {
+          LOG(ERROR) << "Res_value is too small.";
+          return false;
+        }
+
+        if (value_size > chunk.size() || offset + entry_size > chunk.size() - value_size) {
+          LOG(ERROR) << "Res_value size is too large.";
+          return false;
+        }
+      }
+    }
+  }
+  return true;
+}
+
+static bool LoadPackage(const Chunk& chunk, LoadedPackage* loaded_package) {
+  ATRACE_CALL();
+  const ResTable_package* header = chunk.header<ResTable_package>();
+  if (header == nullptr) {
+    LOG(ERROR) << "Chunk RES_TABLE_PACKAGE_TYPE is too small.";
+    return false;
+  }
+
+  loaded_package->package_id_ = dtohl(header->id);
+
+  // A TypeSpec builder. We use this to accumulate the set of Types
+  // available for a TypeSpec, and later build a single, contiguous block
+  // of memory that holds all the Types together with the TypeSpec.
+  std::unique_ptr<TypeSpecPtrBuilder> types_builder;
+
+  // Keep track of the last seen type index. Since type IDs are 1-based,
+  // this records their index, which is 0-based (type ID - 1).
+  uint8_t last_type_idx = 0;
+
+  ChunkIterator iter(chunk.data_ptr(), chunk.data_size());
+  while (iter.HasNext()) {
+    const Chunk child_chunk = iter.Next();
+    switch (child_chunk.type()) {
+      case RES_STRING_POOL_TYPE: {
+        const uintptr_t pool_address =
+            reinterpret_cast<uintptr_t>(child_chunk.header<ResChunk_header>());
+        const uintptr_t header_address = reinterpret_cast<uintptr_t>(header);
+        if (pool_address == header_address + dtohl(header->typeStrings)) {
+          // This string pool is the type string pool.
+          status_t err = loaded_package->type_string_pool_.setTo(
+              child_chunk.header<ResStringPool_header>(), child_chunk.size());
+          if (err != NO_ERROR) {
+            LOG(ERROR) << "Corrupt package type string pool.";
+            return false;
+          }
+        } else if (pool_address == header_address + dtohl(header->keyStrings)) {
+          // This string pool is the key string pool.
+          status_t err = loaded_package->key_string_pool_.setTo(
+              child_chunk.header<ResStringPool_header>(), child_chunk.size());
+          if (err != NO_ERROR) {
+            LOG(ERROR) << "Corrupt package key string pool.";
+            return false;
+          }
+        } else {
+          LOG(WARNING) << "Too many string pool chunks found in package.";
+        }
+      } break;
+
+      case RES_TABLE_TYPE_SPEC_TYPE: {
+        ATRACE_NAME("LoadTableTypeSpec");
+
+        // Starting a new TypeSpec, so finish the old one if there was one.
+        if (types_builder) {
+          TypeSpecPtr type_spec_ptr = types_builder->Build();
+          if (type_spec_ptr == nullptr) {
+            LOG(ERROR) << "Too many type configurations, overflow detected.";
+            return false;
+          }
+
+          loaded_package->type_specs_.editItemAt(last_type_idx) = std::move(type_spec_ptr);
+
+          types_builder = {};
+          last_type_idx = 0;
+        }
+
+        const ResTable_typeSpec* type_spec = child_chunk.header<ResTable_typeSpec>();
+        if (type_spec == nullptr) {
+          LOG(ERROR) << "Chunk RES_TABLE_TYPE_SPEC_TYPE is too small.";
+          return false;
+        }
+
+        if (type_spec->id == 0) {
+          LOG(ERROR) << "Chunk RES_TABLE_TYPE_SPEC_TYPE has invalid ID 0.";
+          return false;
+        }
+
+        // The data portion of this chunk contains entry_count 32bit entries,
+        // each one representing a set of flags.
+        // Here we only validate that the chunk is well formed.
+        const size_t entry_count = dtohl(type_spec->entryCount);
+
+        // There can only be 2^16 entries in a type, because that is the ID
+        // space for entries (EEEE) in the resource ID 0xPPTTEEEE.
+        if (entry_count > std::numeric_limits<uint16_t>::max()) {
+          LOG(ERROR) << "Too many entries in RES_TABLE_TYPE_SPEC_TYPE: " << entry_count << ".";
+          return false;
+        }
+
+        if (entry_count * sizeof(uint32_t) > chunk.data_size()) {
+          LOG(ERROR) << "Chunk too small to hold entries in RES_TABLE_TYPE_SPEC_TYPE.";
+          return false;
+        }
+
+        last_type_idx = type_spec->id - 1;
+        types_builder = util::make_unique<TypeSpecPtrBuilder>(type_spec);
+      } break;
+
+      case RES_TABLE_TYPE_TYPE: {
+        const ResTable_type* type = child_chunk.header<ResTable_type>();
+        if (type == nullptr) {
+          LOG(ERROR) << "Chunk RES_TABLE_TYPE_TYPE is too small.";
+          return false;
+        }
+
+        if (type->id == 0) {
+          LOG(ERROR) << "Chunk RES_TABLE_TYPE_TYPE has invalid ID 0.";
+          return false;
+        }
+
+        // Type chunks must be preceded by their TypeSpec chunks.
+        if (!types_builder || type->id - 1 != last_type_idx) {
+          LOG(ERROR) << "Found RES_TABLE_TYPE_TYPE chunk without "
+                        "RES_TABLE_TYPE_SPEC_TYPE.";
+          return false;
+        }
+
+        if (!VerifyType(child_chunk)) {
+          return false;
+        }
+
+        types_builder->AddType(type);
+      } break;
+
+      default:
+        LOG(WARNING) << base::StringPrintf("Unknown chunk type '%02x'.", chunk.type());
+        break;
+    }
+  }
+
+  // Finish the last TypeSpec.
+  if (types_builder) {
+    TypeSpecPtr type_spec_ptr = types_builder->Build();
+    if (type_spec_ptr == nullptr) {
+      LOG(ERROR) << "Too many type configurations, overflow detected.";
+      return false;
+    }
+    loaded_package->type_specs_.editItemAt(last_type_idx) = std::move(type_spec_ptr);
+  }
+
+  if (iter.HadError()) {
+    LOG(ERROR) << iter.GetLastError();
+    return false;
+  }
+  return true;
+}
+
+bool LoadedArsc::LoadTable(const Chunk& chunk) {
+  ATRACE_CALL();
+  const ResTable_header* header = chunk.header<ResTable_header>();
+  if (header == nullptr) {
+    LOG(ERROR) << "Chunk RES_TABLE_TYPE is too small.";
+    return false;
+  }
+
+  const size_t package_count = dtohl(header->packageCount);
+  size_t packages_seen = 0;
+
+  packages_.reserve(package_count);
+
+  ChunkIterator iter(chunk.data_ptr(), chunk.data_size());
+  while (iter.HasNext()) {
+    const Chunk child_chunk = iter.Next();
+    switch (child_chunk.type()) {
+      case RES_STRING_POOL_TYPE:
+        // Only use the first string pool. Ignore others.
+        if (global_string_pool_.getError() == NO_INIT) {
+          status_t err = global_string_pool_.setTo(child_chunk.header<ResStringPool_header>(),
+                                                   child_chunk.size());
+          if (err != NO_ERROR) {
+            LOG(ERROR) << "Corrupt string pool.";
+            return false;
+          }
+        } else {
+          LOG(WARNING) << "Multiple string pool chunks found in resource table.";
+        }
+        break;
+
+      case RES_TABLE_PACKAGE_TYPE: {
+        if (packages_seen + 1 > package_count) {
+          LOG(ERROR) << "More package chunks were found than the " << package_count
+                     << " declared in the "
+                        "header.";
+          return false;
+        }
+        packages_seen++;
+
+        std::unique_ptr<LoadedPackage> loaded_package = util::make_unique<LoadedPackage>();
+        if (!LoadPackage(child_chunk, loaded_package.get())) {
+          return false;
+        }
+        packages_.push_back(std::move(loaded_package));
+      } break;
+
+      default:
+        LOG(WARNING) << base::StringPrintf("Unknown chunk type '%02x'.", chunk.type());
+        break;
+    }
+  }
+
+  if (iter.HadError()) {
+    LOG(ERROR) << iter.GetLastError();
+    return false;
+  }
+  return true;
+}
+
+std::unique_ptr<LoadedArsc> LoadedArsc::Load(const void* data, size_t len) {
+  ATRACE_CALL();
+
+  // Not using make_unique because the constructor is private.
+  std::unique_ptr<LoadedArsc> loaded_arsc(new LoadedArsc());
+
+  ChunkIterator iter(data, len);
+  while (iter.HasNext()) {
+    const Chunk chunk = iter.Next();
+    switch (chunk.type()) {
+      case RES_TABLE_TYPE:
+        if (!loaded_arsc->LoadTable(chunk)) {
+          return {};
+        }
+        break;
+
+      default:
+        LOG(WARNING) << base::StringPrintf("Unknown chunk type '%02x'.", chunk.type());
+        break;
+    }
+  }
+
+  if (iter.HadError()) {
+    LOG(ERROR) << iter.GetLastError();
+    return {};
+  }
+  return loaded_arsc;
+}
+
+}  // namespace android
diff --git a/libs/androidfw/LocaleDataTables.cpp b/libs/androidfw/LocaleDataTables.cpp
index 1ac5085..7c381ef 100644
--- a/libs/androidfw/LocaleDataTables.cpp
+++ b/libs/androidfw/LocaleDataTables.cpp
@@ -1,4 +1,4 @@
-// Auto-generated by frameworks/base/tools/localedata/extract_icu_data.py
+// Auto-generated by ./tools/localedata/extract_icu_data.py
 
 const char SCRIPT_CODES[][4] = {
     /* 0  */ {'A', 'h', 'o', 'm'},
@@ -39,27 +39,27 @@
     /* 35 */ {'K', 'h', 'm', 'r'},
     /* 36 */ {'K', 'n', 'd', 'a'},
     /* 37 */ {'K', 'o', 'r', 'e'},
-    /* 38 */ {'K', 't', 'h', 'i'},
-    /* 39 */ {'L', 'a', 'n', 'a'},
-    /* 40 */ {'L', 'a', 'o', 'o'},
-    /* 41 */ {'L', 'a', 't', 'n'},
-    /* 42 */ {'L', 'e', 'p', 'c'},
-    /* 43 */ {'L', 'i', 'n', 'a'},
-    /* 44 */ {'L', 'i', 's', 'u'},
-    /* 45 */ {'L', 'y', 'c', 'i'},
-    /* 46 */ {'L', 'y', 'd', 'i'},
-    /* 47 */ {'M', 'a', 'n', 'd'},
-    /* 48 */ {'M', 'a', 'n', 'i'},
-    /* 49 */ {'M', 'e', 'r', 'c'},
-    /* 50 */ {'M', 'l', 'y', 'm'},
-    /* 51 */ {'M', 'o', 'n', 'g'},
-    /* 52 */ {'M', 'r', 'o', 'o'},
-    /* 53 */ {'M', 'y', 'm', 'r'},
-    /* 54 */ {'N', 'a', 'r', 'b'},
-    /* 55 */ {'N', 'k', 'o', 'o'},
-    /* 56 */ {'O', 'g', 'a', 'm'},
-    /* 57 */ {'O', 'r', 'k', 'h'},
-    /* 58 */ {'O', 'r', 'y', 'a'},
+    /* 38 */ {'L', 'a', 'n', 'a'},
+    /* 39 */ {'L', 'a', 'o', 'o'},
+    /* 40 */ {'L', 'a', 't', 'n'},
+    /* 41 */ {'L', 'e', 'p', 'c'},
+    /* 42 */ {'L', 'i', 'n', 'a'},
+    /* 43 */ {'L', 'i', 's', 'u'},
+    /* 44 */ {'L', 'y', 'c', 'i'},
+    /* 45 */ {'L', 'y', 'd', 'i'},
+    /* 46 */ {'M', 'a', 'n', 'd'},
+    /* 47 */ {'M', 'a', 'n', 'i'},
+    /* 48 */ {'M', 'e', 'r', 'c'},
+    /* 49 */ {'M', 'l', 'y', 'm'},
+    /* 50 */ {'M', 'o', 'n', 'g'},
+    /* 51 */ {'M', 'r', 'o', 'o'},
+    /* 52 */ {'M', 'y', 'm', 'r'},
+    /* 53 */ {'N', 'a', 'r', 'b'},
+    /* 54 */ {'N', 'k', 'o', 'o'},
+    /* 55 */ {'O', 'g', 'a', 'm'},
+    /* 56 */ {'O', 'r', 'k', 'h'},
+    /* 57 */ {'O', 'r', 'y', 'a'},
+    /* 58 */ {'O', 's', 'g', 'e'},
     /* 59 */ {'P', 'a', 'u', 'c'},
     /* 60 */ {'P', 'h', 'l', 'i'},
     /* 61 */ {'P', 'h', 'n', 'x'},
@@ -76,78 +76,147 @@
     /* 72 */ {'T', 'a', 'l', 'e'},
     /* 73 */ {'T', 'a', 'l', 'u'},
     /* 74 */ {'T', 'a', 'm', 'l'},
-    /* 75 */ {'T', 'a', 'v', 't'},
-    /* 76 */ {'T', 'e', 'l', 'u'},
-    /* 77 */ {'T', 'f', 'n', 'g'},
-    /* 78 */ {'T', 'h', 'a', 'a'},
-    /* 79 */ {'T', 'h', 'a', 'i'},
-    /* 80 */ {'T', 'i', 'b', 't'},
-    /* 81 */ {'U', 'g', 'a', 'r'},
-    /* 82 */ {'V', 'a', 'i', 'i'},
-    /* 83 */ {'X', 'p', 'e', 'o'},
-    /* 84 */ {'X', 's', 'u', 'x'},
-    /* 85 */ {'Y', 'i', 'i', 'i'},
-    /* 86 */ {'~', '~', '~', 'A'},
-    /* 87 */ {'~', '~', '~', 'B'},
+    /* 75 */ {'T', 'a', 'n', 'g'},
+    /* 76 */ {'T', 'a', 'v', 't'},
+    /* 77 */ {'T', 'e', 'l', 'u'},
+    /* 78 */ {'T', 'f', 'n', 'g'},
+    /* 79 */ {'T', 'h', 'a', 'a'},
+    /* 80 */ {'T', 'h', 'a', 'i'},
+    /* 81 */ {'T', 'i', 'b', 't'},
+    /* 82 */ {'U', 'g', 'a', 'r'},
+    /* 83 */ {'V', 'a', 'i', 'i'},
+    /* 84 */ {'X', 'p', 'e', 'o'},
+    /* 85 */ {'X', 's', 'u', 'x'},
+    /* 86 */ {'Y', 'i', 'i', 'i'},
+    /* 87 */ {'~', '~', '~', 'A'},
+    /* 88 */ {'~', '~', '~', 'B'},
 };
 
 
 const std::unordered_map<uint32_t, uint8_t> LIKELY_SCRIPTS({
-    {0x61610000u, 41u}, // aa -> Latn
+    {0x61610000u, 40u}, // aa -> Latn
+    {0xA0000000u, 40u}, // aai -> Latn
+    {0xA8000000u, 40u}, // aak -> Latn
+    {0xD0000000u, 40u}, // aau -> Latn
     {0x61620000u, 15u}, // ab -> Cyrl
-    {0xC4200000u, 41u}, // abr -> Latn
-    {0x90400000u, 41u}, // ace -> Latn
-    {0x9C400000u, 41u}, // ach -> Latn
-    {0x80600000u, 41u}, // ada -> Latn
+    {0xA0200000u, 40u}, // abi -> Latn
+    {0xC4200000u, 40u}, // abr -> Latn
+    {0xCC200000u, 40u}, // abt -> Latn
+    {0xE0200000u, 40u}, // aby -> Latn
+    {0x8C400000u, 40u}, // acd -> Latn
+    {0x90400000u, 40u}, // ace -> Latn
+    {0x9C400000u, 40u}, // ach -> Latn
+    {0x80600000u, 40u}, // ada -> Latn
+    {0x90600000u, 40u}, // ade -> Latn
+    {0xA4600000u, 40u}, // adj -> Latn
     {0xE0600000u, 15u}, // ady -> Cyrl
+    {0xE4600000u, 40u}, // adz -> Latn
     {0x61650000u,  4u}, // ae -> Avst
     {0x84800000u,  1u}, // aeb -> Arab
-    {0x61660000u, 41u}, // af -> Latn
-    {0xC0C00000u, 41u}, // agq -> Latn
+    {0xE0800000u, 40u}, // aey -> Latn
+    {0x61660000u, 40u}, // af -> Latn
+    {0x88C00000u, 40u}, // agc -> Latn
+    {0x8CC00000u, 40u}, // agd -> Latn
+    {0x98C00000u, 40u}, // agg -> Latn
+    {0xB0C00000u, 40u}, // agm -> Latn
+    {0xB8C00000u, 40u}, // ago -> Latn
+    {0xC0C00000u, 40u}, // agq -> Latn
+    {0x80E00000u, 40u}, // aha -> Latn
+    {0xACE00000u, 40u}, // ahl -> Latn
     {0xB8E00000u,  0u}, // aho -> Ahom
-    {0x616B0000u, 41u}, // ak -> Latn
-    {0xA9400000u, 84u}, // akk -> Xsux
-    {0xB5600000u, 41u}, // aln -> Latn
+    {0x99200000u, 40u}, // ajg -> Latn
+    {0x616B0000u, 40u}, // ak -> Latn
+    {0xA9400000u, 85u}, // akk -> Xsux
+    {0x81600000u, 40u}, // ala -> Latn
+    {0xA1600000u, 40u}, // ali -> Latn
+    {0xB5600000u, 40u}, // aln -> Latn
     {0xCD600000u, 15u}, // alt -> Cyrl
     {0x616D0000u, 18u}, // am -> Ethi
-    {0xB9800000u, 41u}, // amo -> Latn
-    {0xE5C00000u, 41u}, // aoz -> Latn
+    {0xB1800000u, 40u}, // amm -> Latn
+    {0xB5800000u, 40u}, // amn -> Latn
+    {0xB9800000u, 40u}, // amo -> Latn
+    {0xBD800000u, 40u}, // amp -> Latn
+    {0x89A00000u, 40u}, // anc -> Latn
+    {0xA9A00000u, 40u}, // ank -> Latn
+    {0xB5A00000u, 40u}, // ann -> Latn
+    {0xE1A00000u, 40u}, // any -> Latn
+    {0xA5C00000u, 40u}, // aoj -> Latn
+    {0xB1C00000u, 40u}, // aom -> Latn
+    {0xE5C00000u, 40u}, // aoz -> Latn
+    {0x89E00000u,  1u}, // apc -> Arab
+    {0x8DE00000u,  1u}, // apd -> Arab
+    {0x91E00000u, 40u}, // ape -> Latn
+    {0xC5E00000u, 40u}, // apr -> Latn
+    {0xC9E00000u, 40u}, // aps -> Latn
+    {0xE5E00000u, 40u}, // apz -> Latn
     {0x61720000u,  1u}, // ar -> Arab
-    {0x61725842u, 87u}, // ar-XB -> ~~~B
+    {0x61725842u, 88u}, // ar-XB -> ~~~B
     {0x8A200000u,  2u}, // arc -> Armi
-    {0xB6200000u, 41u}, // arn -> Latn
-    {0xBA200000u, 41u}, // aro -> Latn
+    {0x9E200000u, 40u}, // arh -> Latn
+    {0xB6200000u, 40u}, // arn -> Latn
+    {0xBA200000u, 40u}, // aro -> Latn
     {0xC2200000u,  1u}, // arq -> Arab
     {0xE2200000u,  1u}, // ary -> Arab
     {0xE6200000u,  1u}, // arz -> Arab
     {0x61730000u,  7u}, // as -> Beng
-    {0x82400000u, 41u}, // asa -> Latn
+    {0x82400000u, 40u}, // asa -> Latn
     {0x92400000u, 68u}, // ase -> Sgnw
-    {0xCE400000u, 41u}, // ast -> Latn
-    {0xA6600000u, 41u}, // atj -> Latn
+    {0x9A400000u, 40u}, // asg -> Latn
+    {0xBA400000u, 40u}, // aso -> Latn
+    {0xCE400000u, 40u}, // ast -> Latn
+    {0x82600000u, 40u}, // ata -> Latn
+    {0x9A600000u, 40u}, // atg -> Latn
+    {0xA6600000u, 40u}, // atj -> Latn
+    {0xE2800000u, 40u}, // auy -> Latn
     {0x61760000u, 15u}, // av -> Cyrl
+    {0xAEA00000u,  1u}, // avl -> Arab
+    {0xB6A00000u, 40u}, // avn -> Latn
+    {0xCEA00000u, 40u}, // avt -> Latn
+    {0xD2A00000u, 40u}, // avu -> Latn
     {0x82C00000u, 16u}, // awa -> Deva
-    {0x61790000u, 41u}, // ay -> Latn
-    {0x617A0000u, 41u}, // az -> Latn
+    {0x86C00000u, 40u}, // awb -> Latn
+    {0xBAC00000u, 40u}, // awo -> Latn
+    {0xDEC00000u, 40u}, // awx -> Latn
+    {0x61790000u, 40u}, // ay -> Latn
+    {0x87000000u, 40u}, // ayb -> Latn
+    {0x617A0000u, 40u}, // az -> Latn
     {0x617A4951u,  1u}, // az-IQ -> Arab
     {0x617A4952u,  1u}, // az-IR -> Arab
     {0x617A5255u, 15u}, // az-RU -> Cyrl
     {0x62610000u, 15u}, // ba -> Cyrl
     {0xAC010000u,  1u}, // bal -> Arab
-    {0xB4010000u, 41u}, // ban -> Latn
+    {0xB4010000u, 40u}, // ban -> Latn
     {0xBC010000u, 16u}, // bap -> Deva
-    {0xC4010000u, 41u}, // bar -> Latn
-    {0xC8010000u, 41u}, // bas -> Latn
+    {0xC4010000u, 40u}, // bar -> Latn
+    {0xC8010000u, 40u}, // bas -> Latn
+    {0xD4010000u, 40u}, // bav -> Latn
     {0xDC010000u,  5u}, // bax -> Bamu
-    {0x88210000u, 41u}, // bbc -> Latn
-    {0xA4210000u, 41u}, // bbj -> Latn
-    {0xA0410000u, 41u}, // bci -> Latn
+    {0x80210000u, 40u}, // bba -> Latn
+    {0x84210000u, 40u}, // bbb -> Latn
+    {0x88210000u, 40u}, // bbc -> Latn
+    {0x8C210000u, 40u}, // bbd -> Latn
+    {0xA4210000u, 40u}, // bbj -> Latn
+    {0xBC210000u, 40u}, // bbp -> Latn
+    {0xC4210000u, 40u}, // bbr -> Latn
+    {0x94410000u, 40u}, // bcf -> Latn
+    {0x9C410000u, 40u}, // bch -> Latn
+    {0xA0410000u, 40u}, // bci -> Latn
+    {0xB0410000u, 40u}, // bcm -> Latn
+    {0xB4410000u, 40u}, // bcn -> Latn
+    {0xB8410000u, 40u}, // bco -> Latn
+    {0xC0410000u, 18u}, // bcq -> Ethi
+    {0xD0410000u, 40u}, // bcu -> Latn
+    {0x8C610000u, 40u}, // bdd -> Latn
     {0x62650000u, 15u}, // be -> Cyrl
+    {0x94810000u, 40u}, // bef -> Latn
+    {0x9C810000u, 40u}, // beh -> Latn
     {0xA4810000u,  1u}, // bej -> Arab
-    {0xB0810000u, 41u}, // bem -> Latn
-    {0xD8810000u, 41u}, // bew -> Latn
-    {0xE4810000u, 41u}, // bez -> Latn
-    {0x8CA10000u, 41u}, // bfd -> Latn
+    {0xB0810000u, 40u}, // bem -> Latn
+    {0xCC810000u, 40u}, // bet -> Latn
+    {0xD8810000u, 40u}, // bew -> Latn
+    {0xDC810000u, 40u}, // bex -> Latn
+    {0xE4810000u, 40u}, // bez -> Latn
+    {0x8CA10000u, 40u}, // bfd -> Latn
     {0xC0A10000u, 74u}, // bfq -> Taml
     {0xCCA10000u,  1u}, // bft -> Arab
     {0xE0A10000u, 16u}, // bfy -> Deva
@@ -155,663 +224,1202 @@
     {0x88C10000u, 16u}, // bgc -> Deva
     {0xB4C10000u,  1u}, // bgn -> Arab
     {0xDCC10000u, 21u}, // bgx -> Grek
-    {0x62680000u, 38u}, // bh -> Kthi
     {0x84E10000u, 16u}, // bhb -> Deva
+    {0x98E10000u, 40u}, // bhg -> Latn
     {0xA0E10000u, 16u}, // bhi -> Deva
-    {0xA8E10000u, 41u}, // bhk -> Latn
+    {0xA8E10000u, 40u}, // bhk -> Latn
+    {0xACE10000u, 40u}, // bhl -> Latn
     {0xB8E10000u, 16u}, // bho -> Deva
-    {0x62690000u, 41u}, // bi -> Latn
-    {0xA9010000u, 41u}, // bik -> Latn
-    {0xB5010000u, 41u}, // bin -> Latn
+    {0xE0E10000u, 40u}, // bhy -> Latn
+    {0x62690000u, 40u}, // bi -> Latn
+    {0x85010000u, 40u}, // bib -> Latn
+    {0x99010000u, 40u}, // big -> Latn
+    {0xA9010000u, 40u}, // bik -> Latn
+    {0xB1010000u, 40u}, // bim -> Latn
+    {0xB5010000u, 40u}, // bin -> Latn
+    {0xB9010000u, 40u}, // bio -> Latn
+    {0xC1010000u, 40u}, // biq -> Latn
+    {0x9D210000u, 40u}, // bjh -> Latn
+    {0xA1210000u, 18u}, // bji -> Ethi
     {0xA5210000u, 16u}, // bjj -> Deva
-    {0xB5210000u, 41u}, // bjn -> Latn
-    {0xB1410000u, 41u}, // bkm -> Latn
-    {0xD1410000u, 41u}, // bku -> Latn
-    {0xCD610000u, 75u}, // blt -> Tavt
-    {0x626D0000u, 41u}, // bm -> Latn
-    {0xC1810000u, 41u}, // bmq -> Latn
+    {0xB5210000u, 40u}, // bjn -> Latn
+    {0xB9210000u, 40u}, // bjo -> Latn
+    {0xC5210000u, 40u}, // bjr -> Latn
+    {0xE5210000u, 40u}, // bjz -> Latn
+    {0x89410000u, 40u}, // bkc -> Latn
+    {0xB1410000u, 40u}, // bkm -> Latn
+    {0xC1410000u, 40u}, // bkq -> Latn
+    {0xD1410000u, 40u}, // bku -> Latn
+    {0xD5410000u, 40u}, // bkv -> Latn
+    {0xCD610000u, 76u}, // blt -> Tavt
+    {0x626D0000u, 40u}, // bm -> Latn
+    {0x9D810000u, 40u}, // bmh -> Latn
+    {0xA9810000u, 40u}, // bmk -> Latn
+    {0xC1810000u, 40u}, // bmq -> Latn
+    {0xD1810000u, 40u}, // bmu -> Latn
     {0x626E0000u,  7u}, // bn -> Beng
-    {0x626F0000u, 80u}, // bo -> Tibt
+    {0x99A10000u, 40u}, // bng -> Latn
+    {0xB1A10000u, 40u}, // bnm -> Latn
+    {0xBDA10000u, 40u}, // bnp -> Latn
+    {0x626F0000u, 81u}, // bo -> Tibt
+    {0xA5C10000u, 40u}, // boj -> Latn
+    {0xB1C10000u, 40u}, // bom -> Latn
+    {0xB5C10000u, 40u}, // bon -> Latn
     {0xE1E10000u,  7u}, // bpy -> Beng
+    {0x8A010000u, 40u}, // bqc -> Latn
     {0xA2010000u,  1u}, // bqi -> Arab
-    {0xD6010000u, 41u}, // bqv -> Latn
-    {0x62720000u, 41u}, // br -> Latn
+    {0xBE010000u, 40u}, // bqp -> Latn
+    {0xD6010000u, 40u}, // bqv -> Latn
+    {0x62720000u, 40u}, // br -> Latn
     {0x82210000u, 16u}, // bra -> Deva
     {0x9E210000u,  1u}, // brh -> Arab
     {0xDE210000u, 16u}, // brx -> Deva
-    {0x62730000u, 41u}, // bs -> Latn
+    {0xE6210000u, 40u}, // brz -> Latn
+    {0x62730000u, 40u}, // bs -> Latn
+    {0xA6410000u, 40u}, // bsj -> Latn
     {0xC2410000u,  6u}, // bsq -> Bass
-    {0xCA410000u, 41u}, // bss -> Latn
-    {0xBA610000u, 41u}, // bto -> Latn
+    {0xCA410000u, 40u}, // bss -> Latn
+    {0xCE410000u, 18u}, // bst -> Ethi
+    {0xBA610000u, 40u}, // bto -> Latn
+    {0xCE610000u, 40u}, // btt -> Latn
     {0xD6610000u, 16u}, // btv -> Deva
     {0x82810000u, 15u}, // bua -> Cyrl
-    {0x8A810000u, 41u}, // buc -> Latn
-    {0x9A810000u, 41u}, // bug -> Latn
-    {0xB2810000u, 41u}, // bum -> Latn
-    {0x86A10000u, 41u}, // bvb -> Latn
+    {0x8A810000u, 40u}, // buc -> Latn
+    {0x8E810000u, 40u}, // bud -> Latn
+    {0x9A810000u, 40u}, // bug -> Latn
+    {0xAA810000u, 40u}, // buk -> Latn
+    {0xB2810000u, 40u}, // bum -> Latn
+    {0xBA810000u, 40u}, // buo -> Latn
+    {0xCA810000u, 40u}, // bus -> Latn
+    {0xD2810000u, 40u}, // buu -> Latn
+    {0x86A10000u, 40u}, // bvb -> Latn
+    {0x8EC10000u, 40u}, // bwd -> Latn
+    {0xC6C10000u, 40u}, // bwr -> Latn
+    {0x9EE10000u, 40u}, // bxh -> Latn
+    {0x93010000u, 40u}, // bye -> Latn
     {0xB7010000u, 18u}, // byn -> Ethi
-    {0xD7010000u, 41u}, // byv -> Latn
-    {0x93210000u, 41u}, // bze -> Latn
-    {0x63610000u, 41u}, // ca -> Latn
-    {0x9C420000u, 41u}, // cch -> Latn
+    {0xC7010000u, 40u}, // byr -> Latn
+    {0xCB010000u, 40u}, // bys -> Latn
+    {0xD7010000u, 40u}, // byv -> Latn
+    {0xDF010000u, 40u}, // byx -> Latn
+    {0x83210000u, 40u}, // bza -> Latn
+    {0x93210000u, 40u}, // bze -> Latn
+    {0x97210000u, 40u}, // bzf -> Latn
+    {0x9F210000u, 40u}, // bzh -> Latn
+    {0xDB210000u, 40u}, // bzw -> Latn
+    {0x63610000u, 40u}, // ca -> Latn
+    {0xB4020000u, 40u}, // can -> Latn
+    {0xA4220000u, 40u}, // cbj -> Latn
+    {0x9C420000u, 40u}, // cch -> Latn
     {0xBC420000u,  7u}, // ccp -> Beng
     {0x63650000u, 15u}, // ce -> Cyrl
-    {0x84820000u, 41u}, // ceb -> Latn
-    {0x98C20000u, 41u}, // cgg -> Latn
-    {0x63680000u, 41u}, // ch -> Latn
-    {0xA8E20000u, 41u}, // chk -> Latn
+    {0x84820000u, 40u}, // ceb -> Latn
+    {0x80A20000u, 40u}, // cfa -> Latn
+    {0x98C20000u, 40u}, // cgg -> Latn
+    {0x63680000u, 40u}, // ch -> Latn
+    {0xA8E20000u, 40u}, // chk -> Latn
     {0xB0E20000u, 15u}, // chm -> Cyrl
-    {0xB8E20000u, 41u}, // cho -> Latn
-    {0xBCE20000u, 41u}, // chp -> Latn
+    {0xB8E20000u, 40u}, // cho -> Latn
+    {0xBCE20000u, 40u}, // chp -> Latn
     {0xC4E20000u, 12u}, // chr -> Cher
     {0x81220000u,  1u}, // cja -> Arab
     {0xB1220000u, 11u}, // cjm -> Cham
+    {0xD5220000u, 40u}, // cjv -> Latn
     {0x85420000u,  1u}, // ckb -> Arab
-    {0x636F0000u, 41u}, // co -> Latn
+    {0xAD420000u, 40u}, // ckl -> Latn
+    {0xB9420000u, 40u}, // cko -> Latn
+    {0xE1420000u, 40u}, // cky -> Latn
+    {0x81620000u, 40u}, // cla -> Latn
+    {0x91820000u, 40u}, // cme -> Latn
+    {0x636F0000u, 40u}, // co -> Latn
     {0xBDC20000u, 13u}, // cop -> Copt
-    {0xC9E20000u, 41u}, // cps -> Latn
+    {0xC9E20000u, 40u}, // cps -> Latn
     {0x63720000u,  9u}, // cr -> Cans
     {0xA6220000u,  9u}, // crj -> Cans
     {0xAA220000u,  9u}, // crk -> Cans
     {0xAE220000u,  9u}, // crl -> Cans
     {0xB2220000u,  9u}, // crm -> Cans
-    {0xCA220000u, 41u}, // crs -> Latn
-    {0x63730000u, 41u}, // cs -> Latn
-    {0x86420000u, 41u}, // csb -> Latn
+    {0xCA220000u, 40u}, // crs -> Latn
+    {0x63730000u, 40u}, // cs -> Latn
+    {0x86420000u, 40u}, // csb -> Latn
     {0xDA420000u,  9u}, // csw -> Cans
     {0x8E620000u, 59u}, // ctd -> Pauc
     {0x63750000u, 15u}, // cu -> Cyrl
     {0x63760000u, 15u}, // cv -> Cyrl
-    {0x63790000u, 41u}, // cy -> Latn
-    {0x64610000u, 41u}, // da -> Latn
-    {0xA8030000u, 41u}, // dak -> Latn
+    {0x63790000u, 40u}, // cy -> Latn
+    {0x64610000u, 40u}, // da -> Latn
+    {0x8C030000u, 40u}, // dad -> Latn
+    {0x94030000u, 40u}, // daf -> Latn
+    {0x98030000u, 40u}, // dag -> Latn
+    {0x9C030000u, 40u}, // dah -> Latn
+    {0xA8030000u, 40u}, // dak -> Latn
     {0xC4030000u, 15u}, // dar -> Cyrl
-    {0xD4030000u, 41u}, // dav -> Latn
+    {0xD4030000u, 40u}, // dav -> Latn
+    {0x8C230000u, 40u}, // dbd -> Latn
+    {0xC0230000u, 40u}, // dbq -> Latn
     {0x88430000u,  1u}, // dcc -> Arab
-    {0x64650000u, 41u}, // de -> Latn
-    {0xB4830000u, 41u}, // den -> Latn
-    {0xC4C30000u, 41u}, // dgr -> Latn
-    {0x91230000u, 41u}, // dje -> Latn
-    {0xA5A30000u, 41u}, // dnj -> Latn
+    {0xB4630000u, 40u}, // ddn -> Latn
+    {0x64650000u, 40u}, // de -> Latn
+    {0x8C830000u, 40u}, // ded -> Latn
+    {0xB4830000u, 40u}, // den -> Latn
+    {0x80C30000u, 40u}, // dga -> Latn
+    {0x9CC30000u, 40u}, // dgh -> Latn
+    {0xA0C30000u, 40u}, // dgi -> Latn
+    {0xACC30000u,  1u}, // dgl -> Arab
+    {0xC4C30000u, 40u}, // dgr -> Latn
+    {0xE4C30000u, 40u}, // dgz -> Latn
+    {0x81030000u, 40u}, // dia -> Latn
+    {0x91230000u, 40u}, // dje -> Latn
+    {0xA5A30000u, 40u}, // dnj -> Latn
+    {0x85C30000u, 40u}, // dob -> Latn
     {0xA1C30000u,  1u}, // doi -> Arab
-    {0x86430000u, 41u}, // dsb -> Latn
-    {0xB2630000u, 41u}, // dtm -> Latn
-    {0xBE630000u, 41u}, // dtp -> Latn
-    {0x82830000u, 41u}, // dua -> Latn
-    {0x64760000u, 78u}, // dv -> Thaa
-    {0xBB030000u, 41u}, // dyo -> Latn
-    {0xD3030000u, 41u}, // dyu -> Latn
-    {0x647A0000u, 80u}, // dz -> Tibt
-    {0xD0240000u, 41u}, // ebu -> Latn
-    {0x65650000u, 41u}, // ee -> Latn
-    {0xA0A40000u, 41u}, // efi -> Latn
-    {0xACC40000u, 41u}, // egl -> Latn
+    {0xBDC30000u, 40u}, // dop -> Latn
+    {0xD9C30000u, 40u}, // dow -> Latn
+    {0xA2230000u, 40u}, // dri -> Latn
+    {0xCA230000u, 18u}, // drs -> Ethi
+    {0x86430000u, 40u}, // dsb -> Latn
+    {0xB2630000u, 40u}, // dtm -> Latn
+    {0xBE630000u, 40u}, // dtp -> Latn
+    {0xCA630000u, 40u}, // dts -> Latn
+    {0xE2630000u, 16u}, // dty -> Deva
+    {0x82830000u, 40u}, // dua -> Latn
+    {0x8A830000u, 40u}, // duc -> Latn
+    {0x8E830000u, 40u}, // dud -> Latn
+    {0x9A830000u, 40u}, // dug -> Latn
+    {0x64760000u, 79u}, // dv -> Thaa
+    {0x82A30000u, 40u}, // dva -> Latn
+    {0xDAC30000u, 40u}, // dww -> Latn
+    {0xBB030000u, 40u}, // dyo -> Latn
+    {0xD3030000u, 40u}, // dyu -> Latn
+    {0x647A0000u, 81u}, // dz -> Tibt
+    {0x9B230000u, 40u}, // dzg -> Latn
+    {0xD0240000u, 40u}, // ebu -> Latn
+    {0x65650000u, 40u}, // ee -> Latn
+    {0xA0A40000u, 40u}, // efi -> Latn
+    {0xACC40000u, 40u}, // egl -> Latn
     {0xE0C40000u, 17u}, // egy -> Egyp
     {0xE1440000u, 32u}, // eky -> Kali
     {0x656C0000u, 21u}, // el -> Grek
-    {0x656E0000u, 41u}, // en -> Latn
-    {0x656E5841u, 86u}, // en-XA -> ~~~A
-    {0x656F0000u, 41u}, // eo -> Latn
-    {0x65730000u, 41u}, // es -> Latn
-    {0xD2440000u, 41u}, // esu -> Latn
-    {0x65740000u, 41u}, // et -> Latn
+    {0x81840000u, 40u}, // ema -> Latn
+    {0xA1840000u, 40u}, // emi -> Latn
+    {0x656E0000u, 40u}, // en -> Latn
+    {0x656E5841u, 87u}, // en-XA -> ~~~A
+    {0xB5A40000u, 40u}, // enn -> Latn
+    {0xC1A40000u, 40u}, // enq -> Latn
+    {0x656F0000u, 40u}, // eo -> Latn
+    {0xA2240000u, 40u}, // eri -> Latn
+    {0x65730000u, 40u}, // es -> Latn
+    {0xD2440000u, 40u}, // esu -> Latn
+    {0x65740000u, 40u}, // et -> Latn
+    {0xC6640000u, 40u}, // etr -> Latn
     {0xCE640000u, 30u}, // ett -> Ital
-    {0x65750000u, 41u}, // eu -> Latn
-    {0xBAC40000u, 41u}, // ewo -> Latn
-    {0xCEE40000u, 41u}, // ext -> Latn
+    {0xD2640000u, 40u}, // etu -> Latn
+    {0xDE640000u, 40u}, // etx -> Latn
+    {0x65750000u, 40u}, // eu -> Latn
+    {0xBAC40000u, 40u}, // ewo -> Latn
+    {0xCEE40000u, 40u}, // ext -> Latn
     {0x66610000u,  1u}, // fa -> Arab
-    {0xB4050000u, 41u}, // fan -> Latn
-    {0x66660000u, 41u}, // ff -> Latn
-    {0xB0A50000u, 41u}, // ffm -> Latn
-    {0x66690000u, 41u}, // fi -> Latn
+    {0x80050000u, 40u}, // faa -> Latn
+    {0x84050000u, 40u}, // fab -> Latn
+    {0x98050000u, 40u}, // fag -> Latn
+    {0xA0050000u, 40u}, // fai -> Latn
+    {0xB4050000u, 40u}, // fan -> Latn
+    {0x66660000u, 40u}, // ff -> Latn
+    {0xA0A50000u, 40u}, // ffi -> Latn
+    {0xB0A50000u, 40u}, // ffm -> Latn
+    {0x66690000u, 40u}, // fi -> Latn
     {0x81050000u,  1u}, // fia -> Arab
-    {0xAD050000u, 41u}, // fil -> Latn
-    {0xCD050000u, 41u}, // fit -> Latn
-    {0x666A0000u, 41u}, // fj -> Latn
-    {0x666F0000u, 41u}, // fo -> Latn
-    {0xB5C50000u, 41u}, // fon -> Latn
-    {0x66720000u, 41u}, // fr -> Latn
-    {0x8A250000u, 41u}, // frc -> Latn
-    {0xBE250000u, 41u}, // frp -> Latn
-    {0xC6250000u, 41u}, // frr -> Latn
-    {0xCA250000u, 41u}, // frs -> Latn
-    {0x8E850000u, 41u}, // fud -> Latn
-    {0xC2850000u, 41u}, // fuq -> Latn
-    {0xC6850000u, 41u}, // fur -> Latn
-    {0xD6850000u, 41u}, // fuv -> Latn
-    {0xC6A50000u, 41u}, // fvr -> Latn
-    {0x66790000u, 41u}, // fy -> Latn
-    {0x67610000u, 41u}, // ga -> Latn
-    {0x80060000u, 41u}, // gaa -> Latn
-    {0x98060000u, 41u}, // gag -> Latn
+    {0xAD050000u, 40u}, // fil -> Latn
+    {0xCD050000u, 40u}, // fit -> Latn
+    {0x666A0000u, 40u}, // fj -> Latn
+    {0xC5650000u, 40u}, // flr -> Latn
+    {0xBD850000u, 40u}, // fmp -> Latn
+    {0x666F0000u, 40u}, // fo -> Latn
+    {0x8DC50000u, 40u}, // fod -> Latn
+    {0xB5C50000u, 40u}, // fon -> Latn
+    {0xC5C50000u, 40u}, // for -> Latn
+    {0x91E50000u, 40u}, // fpe -> Latn
+    {0xCA050000u, 40u}, // fqs -> Latn
+    {0x66720000u, 40u}, // fr -> Latn
+    {0x8A250000u, 40u}, // frc -> Latn
+    {0xBE250000u, 40u}, // frp -> Latn
+    {0xC6250000u, 40u}, // frr -> Latn
+    {0xCA250000u, 40u}, // frs -> Latn
+    {0x86850000u,  1u}, // fub -> Arab
+    {0x8E850000u, 40u}, // fud -> Latn
+    {0x92850000u, 40u}, // fue -> Latn
+    {0x96850000u, 40u}, // fuf -> Latn
+    {0x9E850000u, 40u}, // fuh -> Latn
+    {0xC2850000u, 40u}, // fuq -> Latn
+    {0xC6850000u, 40u}, // fur -> Latn
+    {0xD6850000u, 40u}, // fuv -> Latn
+    {0xE2850000u, 40u}, // fuy -> Latn
+    {0xC6A50000u, 40u}, // fvr -> Latn
+    {0x66790000u, 40u}, // fy -> Latn
+    {0x67610000u, 40u}, // ga -> Latn
+    {0x80060000u, 40u}, // gaa -> Latn
+    {0x94060000u, 40u}, // gaf -> Latn
+    {0x98060000u, 40u}, // gag -> Latn
+    {0x9C060000u, 40u}, // gah -> Latn
+    {0xA4060000u, 40u}, // gaj -> Latn
+    {0xB0060000u, 40u}, // gam -> Latn
     {0xB4060000u, 24u}, // gan -> Hans
-    {0xE0060000u, 41u}, // gay -> Latn
+    {0xD8060000u, 40u}, // gaw -> Latn
+    {0xE0060000u, 40u}, // gay -> Latn
+    {0x94260000u, 40u}, // gbf -> Latn
     {0xB0260000u, 16u}, // gbm -> Deva
+    {0xE0260000u, 40u}, // gby -> Latn
     {0xE4260000u,  1u}, // gbz -> Arab
-    {0xC4460000u, 41u}, // gcr -> Latn
-    {0x67640000u, 41u}, // gd -> Latn
+    {0xC4460000u, 40u}, // gcr -> Latn
+    {0x67640000u, 40u}, // gd -> Latn
+    {0x90660000u, 40u}, // gde -> Latn
+    {0xB4660000u, 40u}, // gdn -> Latn
+    {0xC4660000u, 40u}, // gdr -> Latn
+    {0x84860000u, 40u}, // geb -> Latn
+    {0xA4860000u, 40u}, // gej -> Latn
+    {0xAC860000u, 40u}, // gel -> Latn
     {0xE4860000u, 18u}, // gez -> Ethi
+    {0xA8A60000u, 40u}, // gfk -> Latn
     {0xB4C60000u, 16u}, // ggn -> Deva
-    {0xAD060000u, 41u}, // gil -> Latn
+    {0xC8E60000u, 40u}, // ghs -> Latn
+    {0xAD060000u, 40u}, // gil -> Latn
+    {0xB1060000u, 40u}, // gim -> Latn
     {0xA9260000u,  1u}, // gjk -> Arab
+    {0xB5260000u, 40u}, // gjn -> Latn
     {0xD1260000u,  1u}, // gju -> Arab
-    {0x676C0000u, 41u}, // gl -> Latn
+    {0xB5460000u, 40u}, // gkn -> Latn
+    {0xBD460000u, 40u}, // gkp -> Latn
+    {0x676C0000u, 40u}, // gl -> Latn
     {0xA9660000u,  1u}, // glk -> Arab
-    {0x676E0000u, 41u}, // gn -> Latn
+    {0xB1860000u, 40u}, // gmm -> Latn
+    {0xD5860000u, 18u}, // gmv -> Ethi
+    {0x676E0000u, 40u}, // gn -> Latn
+    {0x8DA60000u, 40u}, // gnd -> Latn
+    {0x99A60000u, 40u}, // gng -> Latn
+    {0x8DC60000u, 40u}, // god -> Latn
+    {0x95C60000u, 18u}, // gof -> Ethi
+    {0xA1C60000u, 40u}, // goi -> Latn
     {0xB1C60000u, 16u}, // gom -> Deva
-    {0xB5C60000u, 76u}, // gon -> Telu
-    {0xC5C60000u, 41u}, // gor -> Latn
-    {0xC9C60000u, 41u}, // gos -> Latn
+    {0xB5C60000u, 77u}, // gon -> Telu
+    {0xC5C60000u, 40u}, // gor -> Latn
+    {0xC9C60000u, 40u}, // gos -> Latn
     {0xCDC60000u, 20u}, // got -> Goth
     {0x8A260000u, 14u}, // grc -> Cprt
     {0xCE260000u,  7u}, // grt -> Beng
-    {0xDA460000u, 41u}, // gsw -> Latn
+    {0xDA260000u, 40u}, // grw -> Latn
+    {0xDA460000u, 40u}, // gsw -> Latn
     {0x67750000u, 22u}, // gu -> Gujr
-    {0x86860000u, 41u}, // gub -> Latn
-    {0x8A860000u, 41u}, // guc -> Latn
-    {0xC6860000u, 41u}, // gur -> Latn
-    {0xE6860000u, 41u}, // guz -> Latn
-    {0x67760000u, 41u}, // gv -> Latn
+    {0x86860000u, 40u}, // gub -> Latn
+    {0x8A860000u, 40u}, // guc -> Latn
+    {0x8E860000u, 40u}, // gud -> Latn
+    {0xC6860000u, 40u}, // gur -> Latn
+    {0xDA860000u, 40u}, // guw -> Latn
+    {0xDE860000u, 40u}, // gux -> Latn
+    {0xE6860000u, 40u}, // guz -> Latn
+    {0x67760000u, 40u}, // gv -> Latn
+    {0x96A60000u, 40u}, // gvf -> Latn
     {0xC6A60000u, 16u}, // gvr -> Deva
-    {0xA2C60000u, 41u}, // gwi -> Latn
-    {0x68610000u, 41u}, // ha -> Latn
+    {0xCAA60000u, 40u}, // gvs -> Latn
+    {0x8AC60000u,  1u}, // gwc -> Arab
+    {0xA2C60000u, 40u}, // gwi -> Latn
+    {0xCEC60000u,  1u}, // gwt -> Arab
+    {0xA3060000u, 40u}, // gyi -> Latn
+    {0x68610000u, 40u}, // ha -> Latn
     {0x6861434Du,  1u}, // ha-CM -> Arab
     {0x68615344u,  1u}, // ha-SD -> Arab
+    {0x98070000u, 40u}, // hag -> Latn
     {0xA8070000u, 24u}, // hak -> Hans
-    {0xD8070000u, 41u}, // haw -> Latn
+    {0xB0070000u, 40u}, // ham -> Latn
+    {0xD8070000u, 40u}, // haw -> Latn
     {0xE4070000u,  1u}, // haz -> Arab
+    {0x84270000u, 40u}, // hbb -> Latn
+    {0xE0670000u, 18u}, // hdy -> Ethi
     {0x68650000u, 27u}, // he -> Hebr
+    {0xE0E70000u, 40u}, // hhy -> Latn
     {0x68690000u, 16u}, // hi -> Deva
-    {0x95070000u, 41u}, // hif -> Latn
-    {0xAD070000u, 41u}, // hil -> Latn
+    {0x81070000u, 40u}, // hia -> Latn
+    {0x95070000u, 40u}, // hif -> Latn
+    {0x99070000u, 40u}, // hig -> Latn
+    {0x9D070000u, 40u}, // hih -> Latn
+    {0xAD070000u, 40u}, // hil -> Latn
+    {0x81670000u, 40u}, // hla -> Latn
     {0xD1670000u, 28u}, // hlu -> Hluw
     {0x8D870000u, 62u}, // hmd -> Plrd
+    {0xCD870000u, 40u}, // hmt -> Latn
     {0x8DA70000u,  1u}, // hnd -> Arab
     {0x91A70000u, 16u}, // hne -> Deva
     {0xA5A70000u, 29u}, // hnj -> Hmng
-    {0xB5A70000u, 41u}, // hnn -> Latn
+    {0xB5A70000u, 40u}, // hnn -> Latn
     {0xB9A70000u,  1u}, // hno -> Arab
-    {0x686F0000u, 41u}, // ho -> Latn
+    {0x686F0000u, 40u}, // ho -> Latn
     {0x89C70000u, 16u}, // hoc -> Deva
     {0xA5C70000u, 16u}, // hoj -> Deva
-    {0x68720000u, 41u}, // hr -> Latn
-    {0x86470000u, 41u}, // hsb -> Latn
+    {0xCDC70000u, 40u}, // hot -> Latn
+    {0x68720000u, 40u}, // hr -> Latn
+    {0x86470000u, 40u}, // hsb -> Latn
     {0xB6470000u, 24u}, // hsn -> Hans
-    {0x68740000u, 41u}, // ht -> Latn
-    {0x68750000u, 41u}, // hu -> Latn
+    {0x68740000u, 40u}, // ht -> Latn
+    {0x68750000u, 40u}, // hu -> Latn
+    {0xA2870000u, 40u}, // hui -> Latn
     {0x68790000u,  3u}, // hy -> Armn
-    {0x687A0000u, 41u}, // hz -> Latn
-    {0x69610000u, 41u}, // ia -> Latn
-    {0x80280000u, 41u}, // iba -> Latn
-    {0x84280000u, 41u}, // ibb -> Latn
-    {0x69640000u, 41u}, // id -> Latn
-    {0x69670000u, 41u}, // ig -> Latn
-    {0x69690000u, 85u}, // ii -> Yiii
-    {0x696B0000u, 41u}, // ik -> Latn
-    {0xCD480000u, 41u}, // ikt -> Latn
-    {0xB9680000u, 41u}, // ilo -> Latn
-    {0x696E0000u, 41u}, // in -> Latn
+    {0x687A0000u, 40u}, // hz -> Latn
+    {0x69610000u, 40u}, // ia -> Latn
+    {0xB4080000u, 40u}, // ian -> Latn
+    {0xC4080000u, 40u}, // iar -> Latn
+    {0x80280000u, 40u}, // iba -> Latn
+    {0x84280000u, 40u}, // ibb -> Latn
+    {0xE0280000u, 40u}, // iby -> Latn
+    {0x80480000u, 40u}, // ica -> Latn
+    {0x9C480000u, 40u}, // ich -> Latn
+    {0x69640000u, 40u}, // id -> Latn
+    {0x8C680000u, 40u}, // idd -> Latn
+    {0xA0680000u, 40u}, // idi -> Latn
+    {0xD0680000u, 40u}, // idu -> Latn
+    {0x69670000u, 40u}, // ig -> Latn
+    {0x84C80000u, 40u}, // igb -> Latn
+    {0x90C80000u, 40u}, // ige -> Latn
+    {0x69690000u, 86u}, // ii -> Yiii
+    {0xA5280000u, 40u}, // ijj -> Latn
+    {0x696B0000u, 40u}, // ik -> Latn
+    {0xA9480000u, 40u}, // ikk -> Latn
+    {0xCD480000u, 40u}, // ikt -> Latn
+    {0xD9480000u, 40u}, // ikw -> Latn
+    {0xDD480000u, 40u}, // ikx -> Latn
+    {0xB9680000u, 40u}, // ilo -> Latn
+    {0xB9880000u, 40u}, // imo -> Latn
+    {0x696E0000u, 40u}, // in -> Latn
     {0x9DA80000u, 15u}, // inh -> Cyrl
-    {0x69730000u, 41u}, // is -> Latn
-    {0x69740000u, 41u}, // it -> Latn
+    {0xD1C80000u, 40u}, // iou -> Latn
+    {0xA2280000u, 40u}, // iri -> Latn
+    {0x69730000u, 40u}, // is -> Latn
+    {0x69740000u, 40u}, // it -> Latn
     {0x69750000u,  9u}, // iu -> Cans
     {0x69770000u, 27u}, // iw -> Hebr
-    {0x9F280000u, 41u}, // izh -> Latn
+    {0xB2C80000u, 40u}, // iwm -> Latn
+    {0xCAC80000u, 40u}, // iws -> Latn
+    {0x9F280000u, 40u}, // izh -> Latn
+    {0xA3280000u, 40u}, // izi -> Latn
     {0x6A610000u, 31u}, // ja -> Jpan
-    {0xB0090000u, 41u}, // jam -> Latn
-    {0xB8C90000u, 41u}, // jgo -> Latn
+    {0x84090000u, 40u}, // jab -> Latn
+    {0xB0090000u, 40u}, // jam -> Latn
+    {0xD0290000u, 40u}, // jbu -> Latn
+    {0xB4890000u, 40u}, // jen -> Latn
+    {0xA8C90000u, 40u}, // jgk -> Latn
+    {0xB8C90000u, 40u}, // jgo -> Latn
     {0x6A690000u, 27u}, // ji -> Hebr
-    {0x89890000u, 41u}, // jmc -> Latn
+    {0x85090000u, 40u}, // jib -> Latn
+    {0x89890000u, 40u}, // jmc -> Latn
     {0xAD890000u, 16u}, // jml -> Deva
-    {0xCE890000u, 41u}, // jut -> Latn
-    {0x6A760000u, 41u}, // jv -> Latn
-    {0x6A770000u, 41u}, // jw -> Latn
+    {0x82290000u, 40u}, // jra -> Latn
+    {0xCE890000u, 40u}, // jut -> Latn
+    {0x6A760000u, 40u}, // jv -> Latn
+    {0x6A770000u, 40u}, // jw -> Latn
     {0x6B610000u, 19u}, // ka -> Geor
     {0x800A0000u, 15u}, // kaa -> Cyrl
-    {0x840A0000u, 41u}, // kab -> Latn
-    {0x880A0000u, 41u}, // kac -> Latn
-    {0xA40A0000u, 41u}, // kaj -> Latn
-    {0xB00A0000u, 41u}, // kam -> Latn
-    {0xB80A0000u, 41u}, // kao -> Latn
+    {0x840A0000u, 40u}, // kab -> Latn
+    {0x880A0000u, 40u}, // kac -> Latn
+    {0x8C0A0000u, 40u}, // kad -> Latn
+    {0xA00A0000u, 40u}, // kai -> Latn
+    {0xA40A0000u, 40u}, // kaj -> Latn
+    {0xB00A0000u, 40u}, // kam -> Latn
+    {0xB80A0000u, 40u}, // kao -> Latn
     {0x8C2A0000u, 15u}, // kbd -> Cyrl
-    {0x984A0000u, 41u}, // kcg -> Latn
-    {0xA84A0000u, 41u}, // kck -> Latn
-    {0x906A0000u, 41u}, // kde -> Latn
-    {0xCC6A0000u, 79u}, // kdt -> Thai
-    {0x808A0000u, 41u}, // kea -> Latn
-    {0xB48A0000u, 41u}, // ken -> Latn
-    {0xB8AA0000u, 41u}, // kfo -> Latn
+    {0xB02A0000u, 40u}, // kbm -> Latn
+    {0xBC2A0000u, 40u}, // kbp -> Latn
+    {0xC02A0000u, 40u}, // kbq -> Latn
+    {0xDC2A0000u, 40u}, // kbx -> Latn
+    {0xE02A0000u,  1u}, // kby -> Arab
+    {0x984A0000u, 40u}, // kcg -> Latn
+    {0xA84A0000u, 40u}, // kck -> Latn
+    {0xAC4A0000u, 40u}, // kcl -> Latn
+    {0xCC4A0000u, 40u}, // kct -> Latn
+    {0x906A0000u, 40u}, // kde -> Latn
+    {0x9C6A0000u,  1u}, // kdh -> Arab
+    {0xAC6A0000u, 40u}, // kdl -> Latn
+    {0xCC6A0000u, 80u}, // kdt -> Thai
+    {0x808A0000u, 40u}, // kea -> Latn
+    {0xB48A0000u, 40u}, // ken -> Latn
+    {0xE48A0000u, 40u}, // kez -> Latn
+    {0xB8AA0000u, 40u}, // kfo -> Latn
     {0xC4AA0000u, 16u}, // kfr -> Deva
     {0xE0AA0000u, 16u}, // kfy -> Deva
-    {0x6B670000u, 41u}, // kg -> Latn
-    {0x90CA0000u, 41u}, // kge -> Latn
-    {0xBCCA0000u, 41u}, // kgp -> Latn
-    {0x80EA0000u, 41u}, // kha -> Latn
+    {0x6B670000u, 40u}, // kg -> Latn
+    {0x90CA0000u, 40u}, // kge -> Latn
+    {0x94CA0000u, 40u}, // kgf -> Latn
+    {0xBCCA0000u, 40u}, // kgp -> Latn
+    {0x80EA0000u, 40u}, // kha -> Latn
     {0x84EA0000u, 73u}, // khb -> Talu
     {0xB4EA0000u, 16u}, // khn -> Deva
-    {0xC0EA0000u, 41u}, // khq -> Latn
-    {0xCCEA0000u, 53u}, // kht -> Mymr
+    {0xC0EA0000u, 40u}, // khq -> Latn
+    {0xC8EA0000u, 40u}, // khs -> Latn
+    {0xCCEA0000u, 52u}, // kht -> Mymr
     {0xD8EA0000u,  1u}, // khw -> Arab
-    {0x6B690000u, 41u}, // ki -> Latn
-    {0xD10A0000u, 41u}, // kiu -> Latn
-    {0x6B6A0000u, 41u}, // kj -> Latn
-    {0x992A0000u, 40u}, // kjg -> Laoo
+    {0xE4EA0000u, 40u}, // khz -> Latn
+    {0x6B690000u, 40u}, // ki -> Latn
+    {0xA50A0000u, 40u}, // kij -> Latn
+    {0xD10A0000u, 40u}, // kiu -> Latn
+    {0xD90A0000u, 40u}, // kiw -> Latn
+    {0x6B6A0000u, 40u}, // kj -> Latn
+    {0x8D2A0000u, 40u}, // kjd -> Latn
+    {0x992A0000u, 39u}, // kjg -> Laoo
+    {0xC92A0000u, 40u}, // kjs -> Latn
+    {0xE12A0000u, 40u}, // kjy -> Latn
     {0x6B6B0000u, 15u}, // kk -> Cyrl
     {0x6B6B4146u,  1u}, // kk-AF -> Arab
     {0x6B6B434Eu,  1u}, // kk-CN -> Arab
     {0x6B6B4952u,  1u}, // kk-IR -> Arab
     {0x6B6B4D4Eu,  1u}, // kk-MN -> Arab
-    {0xA54A0000u, 41u}, // kkj -> Latn
-    {0x6B6C0000u, 41u}, // kl -> Latn
-    {0xB56A0000u, 41u}, // kln -> Latn
+    {0x894A0000u, 40u}, // kkc -> Latn
+    {0xA54A0000u, 40u}, // kkj -> Latn
+    {0x6B6C0000u, 40u}, // kl -> Latn
+    {0xB56A0000u, 40u}, // kln -> Latn
+    {0xC16A0000u, 40u}, // klq -> Latn
+    {0xCD6A0000u, 40u}, // klt -> Latn
+    {0xDD6A0000u, 40u}, // klx -> Latn
     {0x6B6D0000u, 35u}, // km -> Khmr
-    {0x858A0000u, 41u}, // kmb -> Latn
+    {0x858A0000u, 40u}, // kmb -> Latn
+    {0x9D8A0000u, 40u}, // kmh -> Latn
+    {0xB98A0000u, 40u}, // kmo -> Latn
+    {0xC98A0000u, 40u}, // kms -> Latn
+    {0xD18A0000u, 40u}, // kmu -> Latn
+    {0xD98A0000u, 40u}, // kmw -> Latn
     {0x6B6E0000u, 36u}, // kn -> Knda
+    {0xBDAA0000u, 40u}, // knp -> Latn
     {0x6B6F0000u, 37u}, // ko -> Kore
     {0xA1CA0000u, 15u}, // koi -> Cyrl
     {0xA9CA0000u, 16u}, // kok -> Deva
-    {0xC9CA0000u, 41u}, // kos -> Latn
-    {0x91EA0000u, 41u}, // kpe -> Latn
+    {0xADCA0000u, 40u}, // kol -> Latn
+    {0xC9CA0000u, 40u}, // kos -> Latn
+    {0xE5CA0000u, 40u}, // koz -> Latn
+    {0x91EA0000u, 40u}, // kpe -> Latn
+    {0x95EA0000u, 40u}, // kpf -> Latn
+    {0xB9EA0000u, 40u}, // kpo -> Latn
+    {0xC5EA0000u, 40u}, // kpr -> Latn
+    {0xDDEA0000u, 40u}, // kpx -> Latn
+    {0x860A0000u, 40u}, // kqb -> Latn
+    {0x960A0000u, 40u}, // kqf -> Latn
+    {0xCA0A0000u, 40u}, // kqs -> Latn
+    {0xE20A0000u, 18u}, // kqy -> Ethi
     {0x8A2A0000u, 15u}, // krc -> Cyrl
-    {0xA22A0000u, 41u}, // kri -> Latn
-    {0xA62A0000u, 41u}, // krj -> Latn
-    {0xAE2A0000u, 41u}, // krl -> Latn
+    {0xA22A0000u, 40u}, // kri -> Latn
+    {0xA62A0000u, 40u}, // krj -> Latn
+    {0xAE2A0000u, 40u}, // krl -> Latn
+    {0xCA2A0000u, 40u}, // krs -> Latn
     {0xD22A0000u, 16u}, // kru -> Deva
     {0x6B730000u,  1u}, // ks -> Arab
-    {0x864A0000u, 41u}, // ksb -> Latn
-    {0x964A0000u, 41u}, // ksf -> Latn
-    {0x9E4A0000u, 41u}, // ksh -> Latn
-    {0x6B750000u, 41u}, // ku -> Latn
+    {0x864A0000u, 40u}, // ksb -> Latn
+    {0x8E4A0000u, 40u}, // ksd -> Latn
+    {0x964A0000u, 40u}, // ksf -> Latn
+    {0x9E4A0000u, 40u}, // ksh -> Latn
+    {0xA64A0000u, 40u}, // ksj -> Latn
+    {0xC64A0000u, 40u}, // ksr -> Latn
+    {0x866A0000u, 18u}, // ktb -> Ethi
+    {0xB26A0000u, 40u}, // ktm -> Latn
+    {0xBA6A0000u, 40u}, // kto -> Latn
+    {0x6B750000u, 40u}, // ku -> Latn
     {0x6B754952u,  1u}, // ku-IR -> Arab
     {0x6B754C42u,  1u}, // ku-LB -> Arab
+    {0x868A0000u, 40u}, // kub -> Latn
+    {0x8E8A0000u, 40u}, // kud -> Latn
+    {0x928A0000u, 40u}, // kue -> Latn
+    {0xA68A0000u, 40u}, // kuj -> Latn
     {0xB28A0000u, 15u}, // kum -> Cyrl
+    {0xB68A0000u, 40u}, // kun -> Latn
+    {0xBE8A0000u, 40u}, // kup -> Latn
+    {0xCA8A0000u, 40u}, // kus -> Latn
     {0x6B760000u, 15u}, // kv -> Cyrl
-    {0xC6AA0000u, 41u}, // kvr -> Latn
+    {0x9AAA0000u, 40u}, // kvg -> Latn
+    {0xC6AA0000u, 40u}, // kvr -> Latn
     {0xDEAA0000u,  1u}, // kvx -> Arab
-    {0x6B770000u, 41u}, // kw -> Latn
-    {0xB2EA0000u, 79u}, // kxm -> Thai
+    {0x6B770000u, 40u}, // kw -> Latn
+    {0xA6CA0000u, 40u}, // kwj -> Latn
+    {0xBACA0000u, 40u}, // kwo -> Latn
+    {0x82EA0000u, 40u}, // kxa -> Latn
+    {0x8AEA0000u, 18u}, // kxc -> Ethi
+    {0xB2EA0000u, 80u}, // kxm -> Thai
     {0xBEEA0000u,  1u}, // kxp -> Arab
+    {0xDAEA0000u, 40u}, // kxw -> Latn
+    {0xE6EA0000u, 40u}, // kxz -> Latn
     {0x6B790000u, 15u}, // ky -> Cyrl
     {0x6B79434Eu,  1u}, // ky-CN -> Arab
-    {0x6B795452u, 41u}, // ky-TR -> Latn
-    {0x6C610000u, 41u}, // la -> Latn
-    {0x840B0000u, 43u}, // lab -> Lina
+    {0x6B795452u, 40u}, // ky-TR -> Latn
+    {0x930A0000u, 40u}, // kye -> Latn
+    {0xDF0A0000u, 40u}, // kyx -> Latn
+    {0xC72A0000u, 40u}, // kzr -> Latn
+    {0x6C610000u, 40u}, // la -> Latn
+    {0x840B0000u, 42u}, // lab -> Lina
     {0x8C0B0000u, 27u}, // lad -> Hebr
-    {0x980B0000u, 41u}, // lag -> Latn
+    {0x980B0000u, 40u}, // lag -> Latn
     {0x9C0B0000u,  1u}, // lah -> Arab
-    {0xA40B0000u, 41u}, // laj -> Latn
-    {0x6C620000u, 41u}, // lb -> Latn
+    {0xA40B0000u, 40u}, // laj -> Latn
+    {0xC80B0000u, 40u}, // las -> Latn
+    {0x6C620000u, 40u}, // lb -> Latn
     {0x902B0000u, 15u}, // lbe -> Cyrl
-    {0xD82B0000u, 41u}, // lbw -> Latn
-    {0xBC4B0000u, 79u}, // lcp -> Thai
-    {0xBC8B0000u, 42u}, // lep -> Lepc
+    {0xD02B0000u, 40u}, // lbu -> Latn
+    {0xD82B0000u, 40u}, // lbw -> Latn
+    {0xB04B0000u, 40u}, // lcm -> Latn
+    {0xBC4B0000u, 80u}, // lcp -> Thai
+    {0x846B0000u, 40u}, // ldb -> Latn
+    {0x8C8B0000u, 40u}, // led -> Latn
+    {0x908B0000u, 40u}, // lee -> Latn
+    {0xB08B0000u, 40u}, // lem -> Latn
+    {0xBC8B0000u, 41u}, // lep -> Lepc
+    {0xC08B0000u, 40u}, // leq -> Latn
+    {0xD08B0000u, 40u}, // leu -> Latn
     {0xE48B0000u, 15u}, // lez -> Cyrl
-    {0x6C670000u, 41u}, // lg -> Latn
-    {0x6C690000u, 41u}, // li -> Latn
+    {0x6C670000u, 40u}, // lg -> Latn
+    {0x98CB0000u, 40u}, // lgg -> Latn
+    {0x6C690000u, 40u}, // li -> Latn
+    {0x810B0000u, 40u}, // lia -> Latn
+    {0x8D0B0000u, 40u}, // lid -> Latn
     {0x950B0000u, 16u}, // lif -> Deva
-    {0xA50B0000u, 41u}, // lij -> Latn
-    {0xC90B0000u, 44u}, // lis -> Lisu
-    {0xBD2B0000u, 41u}, // ljp -> Latn
+    {0x990B0000u, 40u}, // lig -> Latn
+    {0x9D0B0000u, 40u}, // lih -> Latn
+    {0xA50B0000u, 40u}, // lij -> Latn
+    {0xC90B0000u, 43u}, // lis -> Lisu
+    {0xBD2B0000u, 40u}, // ljp -> Latn
     {0xA14B0000u,  1u}, // lki -> Arab
-    {0xCD4B0000u, 41u}, // lkt -> Latn
-    {0xB58B0000u, 76u}, // lmn -> Telu
-    {0xB98B0000u, 41u}, // lmo -> Latn
-    {0x6C6E0000u, 41u}, // ln -> Latn
-    {0x6C6F0000u, 40u}, // lo -> Laoo
-    {0xADCB0000u, 41u}, // lol -> Latn
-    {0xE5CB0000u, 41u}, // loz -> Latn
+    {0xCD4B0000u, 40u}, // lkt -> Latn
+    {0x916B0000u, 40u}, // lle -> Latn
+    {0xB56B0000u, 40u}, // lln -> Latn
+    {0xB58B0000u, 77u}, // lmn -> Telu
+    {0xB98B0000u, 40u}, // lmo -> Latn
+    {0xBD8B0000u, 40u}, // lmp -> Latn
+    {0x6C6E0000u, 40u}, // ln -> Latn
+    {0xC9AB0000u, 40u}, // lns -> Latn
+    {0xD1AB0000u, 40u}, // lnu -> Latn
+    {0x6C6F0000u, 39u}, // lo -> Laoo
+    {0xA5CB0000u, 40u}, // loj -> Latn
+    {0xA9CB0000u, 40u}, // lok -> Latn
+    {0xADCB0000u, 40u}, // lol -> Latn
+    {0xC5CB0000u, 40u}, // lor -> Latn
+    {0xC9CB0000u, 40u}, // los -> Latn
+    {0xE5CB0000u, 40u}, // loz -> Latn
     {0x8A2B0000u,  1u}, // lrc -> Arab
-    {0x6C740000u, 41u}, // lt -> Latn
-    {0x9A6B0000u, 41u}, // ltg -> Latn
-    {0x6C750000u, 41u}, // lu -> Latn
-    {0x828B0000u, 41u}, // lua -> Latn
-    {0xBA8B0000u, 41u}, // luo -> Latn
-    {0xE28B0000u, 41u}, // luy -> Latn
+    {0x6C740000u, 40u}, // lt -> Latn
+    {0x9A6B0000u, 40u}, // ltg -> Latn
+    {0x6C750000u, 40u}, // lu -> Latn
+    {0x828B0000u, 40u}, // lua -> Latn
+    {0xBA8B0000u, 40u}, // luo -> Latn
+    {0xE28B0000u, 40u}, // luy -> Latn
     {0xE68B0000u,  1u}, // luz -> Arab
-    {0x6C760000u, 41u}, // lv -> Latn
-    {0xAECB0000u, 79u}, // lwl -> Thai
+    {0x6C760000u, 40u}, // lv -> Latn
+    {0xAECB0000u, 80u}, // lwl -> Thai
     {0x9F2B0000u, 24u}, // lzh -> Hans
-    {0xE72B0000u, 41u}, // lzz -> Latn
-    {0x8C0C0000u, 41u}, // mad -> Latn
-    {0x940C0000u, 41u}, // maf -> Latn
+    {0xE72B0000u, 40u}, // lzz -> Latn
+    {0x8C0C0000u, 40u}, // mad -> Latn
+    {0x940C0000u, 40u}, // maf -> Latn
     {0x980C0000u, 16u}, // mag -> Deva
     {0xA00C0000u, 16u}, // mai -> Deva
-    {0xA80C0000u, 41u}, // mak -> Latn
-    {0xB40C0000u, 41u}, // man -> Latn
-    {0xB40C474Eu, 55u}, // man-GN -> Nkoo
-    {0xC80C0000u, 41u}, // mas -> Latn
-    {0xE40C0000u, 41u}, // maz -> Latn
+    {0xA80C0000u, 40u}, // mak -> Latn
+    {0xB40C0000u, 40u}, // man -> Latn
+    {0xB40C474Eu, 54u}, // man-GN -> Nkoo
+    {0xC80C0000u, 40u}, // mas -> Latn
+    {0xD80C0000u, 40u}, // maw -> Latn
+    {0xE40C0000u, 40u}, // maz -> Latn
+    {0x9C2C0000u, 40u}, // mbh -> Latn
+    {0xB82C0000u, 40u}, // mbo -> Latn
+    {0xC02C0000u, 40u}, // mbq -> Latn
+    {0xD02C0000u, 40u}, // mbu -> Latn
+    {0xD82C0000u, 40u}, // mbw -> Latn
+    {0xA04C0000u, 40u}, // mci -> Latn
+    {0xBC4C0000u, 40u}, // mcp -> Latn
+    {0xC04C0000u, 40u}, // mcq -> Latn
+    {0xC44C0000u, 40u}, // mcr -> Latn
+    {0xD04C0000u, 40u}, // mcu -> Latn
+    {0x806C0000u, 40u}, // mda -> Latn
+    {0x906C0000u,  1u}, // mde -> Arab
     {0x946C0000u, 15u}, // mdf -> Cyrl
-    {0x9C6C0000u, 41u}, // mdh -> Latn
-    {0xC46C0000u, 41u}, // mdr -> Latn
-    {0xB48C0000u, 41u}, // men -> Latn
-    {0xC48C0000u, 41u}, // mer -> Latn
+    {0x9C6C0000u, 40u}, // mdh -> Latn
+    {0xA46C0000u, 40u}, // mdj -> Latn
+    {0xC46C0000u, 40u}, // mdr -> Latn
+    {0xDC6C0000u, 18u}, // mdx -> Ethi
+    {0x8C8C0000u, 40u}, // med -> Latn
+    {0x908C0000u, 40u}, // mee -> Latn
+    {0xA88C0000u, 40u}, // mek -> Latn
+    {0xB48C0000u, 40u}, // men -> Latn
+    {0xC48C0000u, 40u}, // mer -> Latn
+    {0xCC8C0000u, 40u}, // met -> Latn
+    {0xD08C0000u, 40u}, // meu -> Latn
     {0x80AC0000u,  1u}, // mfa -> Arab
-    {0x90AC0000u, 41u}, // mfe -> Latn
-    {0x6D670000u, 41u}, // mg -> Latn
-    {0x9CCC0000u, 41u}, // mgh -> Latn
-    {0xB8CC0000u, 41u}, // mgo -> Latn
+    {0x90AC0000u, 40u}, // mfe -> Latn
+    {0xB4AC0000u, 40u}, // mfn -> Latn
+    {0xB8AC0000u, 40u}, // mfo -> Latn
+    {0xC0AC0000u, 40u}, // mfq -> Latn
+    {0x6D670000u, 40u}, // mg -> Latn
+    {0x9CCC0000u, 40u}, // mgh -> Latn
+    {0xACCC0000u, 40u}, // mgl -> Latn
+    {0xB8CC0000u, 40u}, // mgo -> Latn
     {0xBCCC0000u, 16u}, // mgp -> Deva
-    {0xE0CC0000u, 41u}, // mgy -> Latn
-    {0x6D680000u, 41u}, // mh -> Latn
-    {0x6D690000u, 41u}, // mi -> Latn
-    {0xB50C0000u, 41u}, // min -> Latn
+    {0xE0CC0000u, 40u}, // mgy -> Latn
+    {0x6D680000u, 40u}, // mh -> Latn
+    {0xA0EC0000u, 40u}, // mhi -> Latn
+    {0xACEC0000u, 40u}, // mhl -> Latn
+    {0x6D690000u, 40u}, // mi -> Latn
+    {0x950C0000u, 40u}, // mif -> Latn
+    {0xB50C0000u, 40u}, // min -> Latn
     {0xC90C0000u, 26u}, // mis -> Hatr
+    {0xD90C0000u, 40u}, // miw -> Latn
     {0x6D6B0000u, 15u}, // mk -> Cyrl
-    {0x6D6C0000u, 50u}, // ml -> Mlym
-    {0xC96C0000u, 41u}, // mls -> Latn
+    {0xA14C0000u,  1u}, // mki -> Arab
+    {0xAD4C0000u, 40u}, // mkl -> Latn
+    {0xBD4C0000u, 40u}, // mkp -> Latn
+    {0xD94C0000u, 40u}, // mkw -> Latn
+    {0x6D6C0000u, 49u}, // ml -> Mlym
+    {0x916C0000u, 40u}, // mle -> Latn
+    {0xBD6C0000u, 40u}, // mlp -> Latn
+    {0xC96C0000u, 40u}, // mls -> Latn
+    {0xB98C0000u, 40u}, // mmo -> Latn
+    {0xD18C0000u, 40u}, // mmu -> Latn
+    {0xDD8C0000u, 40u}, // mmx -> Latn
     {0x6D6E0000u, 15u}, // mn -> Cyrl
-    {0x6D6E434Eu, 51u}, // mn-CN -> Mong
+    {0x6D6E434Eu, 50u}, // mn-CN -> Mong
+    {0x81AC0000u, 40u}, // mna -> Latn
+    {0x95AC0000u, 40u}, // mnf -> Latn
     {0xA1AC0000u,  7u}, // mni -> Beng
-    {0xD9AC0000u, 53u}, // mnw -> Mymr
-    {0x91CC0000u, 41u}, // moe -> Latn
-    {0x9DCC0000u, 41u}, // moh -> Latn
-    {0xC9CC0000u, 41u}, // mos -> Latn
+    {0xD9AC0000u, 52u}, // mnw -> Mymr
+    {0x81CC0000u, 40u}, // moa -> Latn
+    {0x91CC0000u, 40u}, // moe -> Latn
+    {0x9DCC0000u, 40u}, // moh -> Latn
+    {0xC9CC0000u, 40u}, // mos -> Latn
+    {0xDDCC0000u, 40u}, // mox -> Latn
+    {0xBDEC0000u, 40u}, // mpp -> Latn
+    {0xC9EC0000u, 40u}, // mps -> Latn
+    {0xCDEC0000u, 40u}, // mpt -> Latn
+    {0xDDEC0000u, 40u}, // mpx -> Latn
+    {0xAE0C0000u, 40u}, // mql -> Latn
     {0x6D720000u, 16u}, // mr -> Deva
     {0x8E2C0000u, 16u}, // mrd -> Deva
     {0xA62C0000u, 15u}, // mrj -> Cyrl
-    {0xD22C0000u, 52u}, // mru -> Mroo
-    {0x6D730000u, 41u}, // ms -> Latn
+    {0xBA2C0000u, 51u}, // mro -> Mroo
+    {0x6D730000u, 40u}, // ms -> Latn
     {0x6D734343u,  1u}, // ms-CC -> Arab
     {0x6D734944u,  1u}, // ms-ID -> Arab
-    {0x6D740000u, 41u}, // mt -> Latn
+    {0x6D740000u, 40u}, // mt -> Latn
+    {0x8A6C0000u, 40u}, // mtc -> Latn
+    {0x966C0000u, 40u}, // mtf -> Latn
+    {0xA26C0000u, 40u}, // mti -> Latn
     {0xC66C0000u, 16u}, // mtr -> Deva
-    {0x828C0000u, 41u}, // mua -> Latn
-    {0xCA8C0000u, 41u}, // mus -> Latn
+    {0x828C0000u, 40u}, // mua -> Latn
+    {0xC68C0000u, 40u}, // mur -> Latn
+    {0xCA8C0000u, 40u}, // mus -> Latn
+    {0x82AC0000u, 40u}, // mva -> Latn
+    {0xB6AC0000u, 40u}, // mvn -> Latn
     {0xE2AC0000u,  1u}, // mvy -> Arab
-    {0xAACC0000u, 41u}, // mwk -> Latn
+    {0xAACC0000u, 40u}, // mwk -> Latn
     {0xC6CC0000u, 16u}, // mwr -> Deva
-    {0xD6CC0000u, 41u}, // mwv -> Latn
-    {0x8AEC0000u, 41u}, // mxc -> Latn
-    {0x6D790000u, 53u}, // my -> Mymr
+    {0xD6CC0000u, 40u}, // mwv -> Latn
+    {0x8AEC0000u, 40u}, // mxc -> Latn
+    {0xB2EC0000u, 40u}, // mxm -> Latn
+    {0x6D790000u, 52u}, // my -> Mymr
+    {0xAB0C0000u, 40u}, // myk -> Latn
+    {0xB30C0000u, 18u}, // mym -> Ethi
     {0xD70C0000u, 15u}, // myv -> Cyrl
-    {0xDF0C0000u, 41u}, // myx -> Latn
-    {0xE70C0000u, 47u}, // myz -> Mand
+    {0xDB0C0000u, 40u}, // myw -> Latn
+    {0xDF0C0000u, 40u}, // myx -> Latn
+    {0xE70C0000u, 46u}, // myz -> Mand
+    {0xAB2C0000u, 40u}, // mzk -> Latn
+    {0xB32C0000u, 40u}, // mzm -> Latn
     {0xB72C0000u,  1u}, // mzn -> Arab
-    {0x6E610000u, 41u}, // na -> Latn
+    {0xBF2C0000u, 40u}, // mzp -> Latn
+    {0xDB2C0000u, 40u}, // mzw -> Latn
+    {0xE72C0000u, 40u}, // mzz -> Latn
+    {0x6E610000u, 40u}, // na -> Latn
+    {0x880D0000u, 40u}, // nac -> Latn
+    {0x940D0000u, 40u}, // naf -> Latn
+    {0xA80D0000u, 40u}, // nak -> Latn
     {0xB40D0000u, 24u}, // nan -> Hans
-    {0xBC0D0000u, 41u}, // nap -> Latn
-    {0xC00D0000u, 41u}, // naq -> Latn
-    {0x6E620000u, 41u}, // nb -> Latn
-    {0x9C4D0000u, 41u}, // nch -> Latn
-    {0x6E640000u, 41u}, // nd -> Latn
-    {0x886D0000u, 41u}, // ndc -> Latn
-    {0xC86D0000u, 41u}, // nds -> Latn
+    {0xBC0D0000u, 40u}, // nap -> Latn
+    {0xC00D0000u, 40u}, // naq -> Latn
+    {0xC80D0000u, 40u}, // nas -> Latn
+    {0x6E620000u, 40u}, // nb -> Latn
+    {0x804D0000u, 40u}, // nca -> Latn
+    {0x904D0000u, 40u}, // nce -> Latn
+    {0x944D0000u, 40u}, // ncf -> Latn
+    {0x9C4D0000u, 40u}, // nch -> Latn
+    {0xB84D0000u, 40u}, // nco -> Latn
+    {0xD04D0000u, 40u}, // ncu -> Latn
+    {0x6E640000u, 40u}, // nd -> Latn
+    {0x886D0000u, 40u}, // ndc -> Latn
+    {0xC86D0000u, 40u}, // nds -> Latn
     {0x6E650000u, 16u}, // ne -> Deva
+    {0x848D0000u, 40u}, // neb -> Latn
     {0xD88D0000u, 16u}, // new -> Deva
-    {0x6E670000u, 41u}, // ng -> Latn
-    {0xACCD0000u, 41u}, // ngl -> Latn
-    {0x90ED0000u, 41u}, // nhe -> Latn
-    {0xD8ED0000u, 41u}, // nhw -> Latn
-    {0xA50D0000u, 41u}, // nij -> Latn
-    {0xD10D0000u, 41u}, // niu -> Latn
-    {0xB92D0000u, 41u}, // njo -> Latn
-    {0x6E6C0000u, 41u}, // nl -> Latn
-    {0x998D0000u, 41u}, // nmg -> Latn
-    {0x6E6E0000u, 41u}, // nn -> Latn
-    {0x9DAD0000u, 41u}, // nnh -> Latn
-    {0x6E6F0000u, 41u}, // no -> Latn
-    {0x8DCD0000u, 39u}, // nod -> Lana
+    {0xDC8D0000u, 40u}, // nex -> Latn
+    {0xC4AD0000u, 40u}, // nfr -> Latn
+    {0x6E670000u, 40u}, // ng -> Latn
+    {0x80CD0000u, 40u}, // nga -> Latn
+    {0x84CD0000u, 40u}, // ngb -> Latn
+    {0xACCD0000u, 40u}, // ngl -> Latn
+    {0x84ED0000u, 40u}, // nhb -> Latn
+    {0x90ED0000u, 40u}, // nhe -> Latn
+    {0xD8ED0000u, 40u}, // nhw -> Latn
+    {0x950D0000u, 40u}, // nif -> Latn
+    {0xA10D0000u, 40u}, // nii -> Latn
+    {0xA50D0000u, 40u}, // nij -> Latn
+    {0xB50D0000u, 40u}, // nin -> Latn
+    {0xD10D0000u, 40u}, // niu -> Latn
+    {0xE10D0000u, 40u}, // niy -> Latn
+    {0xE50D0000u, 40u}, // niz -> Latn
+    {0xB92D0000u, 40u}, // njo -> Latn
+    {0x994D0000u, 40u}, // nkg -> Latn
+    {0xB94D0000u, 40u}, // nko -> Latn
+    {0x6E6C0000u, 40u}, // nl -> Latn
+    {0x998D0000u, 40u}, // nmg -> Latn
+    {0xE58D0000u, 40u}, // nmz -> Latn
+    {0x6E6E0000u, 40u}, // nn -> Latn
+    {0x95AD0000u, 40u}, // nnf -> Latn
+    {0x9DAD0000u, 40u}, // nnh -> Latn
+    {0xA9AD0000u, 40u}, // nnk -> Latn
+    {0xB1AD0000u, 40u}, // nnm -> Latn
+    {0x6E6F0000u, 40u}, // no -> Latn
+    {0x8DCD0000u, 38u}, // nod -> Lana
     {0x91CD0000u, 16u}, // noe -> Deva
     {0xB5CD0000u, 64u}, // non -> Runr
-    {0xBA0D0000u, 55u}, // nqo -> Nkoo
-    {0x6E720000u, 41u}, // nr -> Latn
+    {0xBDCD0000u, 40u}, // nop -> Latn
+    {0xD1CD0000u, 40u}, // nou -> Latn
+    {0xBA0D0000u, 54u}, // nqo -> Nkoo
+    {0x6E720000u, 40u}, // nr -> Latn
+    {0x862D0000u, 40u}, // nrb -> Latn
     {0xAA4D0000u,  9u}, // nsk -> Cans
-    {0xBA4D0000u, 41u}, // nso -> Latn
-    {0xCA8D0000u, 41u}, // nus -> Latn
-    {0x6E760000u, 41u}, // nv -> Latn
-    {0xC2ED0000u, 41u}, // nxq -> Latn
-    {0x6E790000u, 41u}, // ny -> Latn
-    {0xB30D0000u, 41u}, // nym -> Latn
-    {0xB70D0000u, 41u}, // nyn -> Latn
-    {0xA32D0000u, 41u}, // nzi -> Latn
-    {0x6F630000u, 41u}, // oc -> Latn
-    {0x6F6D0000u, 41u}, // om -> Latn
-    {0x6F720000u, 58u}, // or -> Orya
+    {0xB64D0000u, 40u}, // nsn -> Latn
+    {0xBA4D0000u, 40u}, // nso -> Latn
+    {0xCA4D0000u, 40u}, // nss -> Latn
+    {0xB26D0000u, 40u}, // ntm -> Latn
+    {0xC66D0000u, 40u}, // ntr -> Latn
+    {0xA28D0000u, 40u}, // nui -> Latn
+    {0xBE8D0000u, 40u}, // nup -> Latn
+    {0xCA8D0000u, 40u}, // nus -> Latn
+    {0xD68D0000u, 40u}, // nuv -> Latn
+    {0xDE8D0000u, 40u}, // nux -> Latn
+    {0x6E760000u, 40u}, // nv -> Latn
+    {0x86CD0000u, 40u}, // nwb -> Latn
+    {0xC2ED0000u, 40u}, // nxq -> Latn
+    {0xC6ED0000u, 40u}, // nxr -> Latn
+    {0x6E790000u, 40u}, // ny -> Latn
+    {0xB30D0000u, 40u}, // nym -> Latn
+    {0xB70D0000u, 40u}, // nyn -> Latn
+    {0xA32D0000u, 40u}, // nzi -> Latn
+    {0x6F630000u, 40u}, // oc -> Latn
+    {0x88CE0000u, 40u}, // ogc -> Latn
+    {0xC54E0000u, 40u}, // okr -> Latn
+    {0xD54E0000u, 40u}, // okv -> Latn
+    {0x6F6D0000u, 40u}, // om -> Latn
+    {0x99AE0000u, 40u}, // ong -> Latn
+    {0xB5AE0000u, 40u}, // onn -> Latn
+    {0xC9AE0000u, 40u}, // ons -> Latn
+    {0xB1EE0000u, 40u}, // opm -> Latn
+    {0x6F720000u, 57u}, // or -> Orya
+    {0xBA2E0000u, 40u}, // oro -> Latn
+    {0xD22E0000u,  1u}, // oru -> Arab
     {0x6F730000u, 15u}, // os -> Cyrl
-    {0xAA6E0000u, 57u}, // otk -> Orkh
+    {0x824E0000u, 58u}, // osa -> Osge
+    {0x826E0000u,  1u}, // ota -> Arab
+    {0xAA6E0000u, 56u}, // otk -> Orkh
+    {0xB32E0000u, 40u}, // ozm -> Latn
     {0x70610000u, 23u}, // pa -> Guru
     {0x7061504Bu,  1u}, // pa-PK -> Arab
-    {0x980F0000u, 41u}, // pag -> Latn
+    {0x980F0000u, 40u}, // pag -> Latn
     {0xAC0F0000u, 60u}, // pal -> Phli
-    {0xB00F0000u, 41u}, // pam -> Latn
-    {0xBC0F0000u, 41u}, // pap -> Latn
-    {0xD00F0000u, 41u}, // pau -> Latn
-    {0x8C4F0000u, 41u}, // pcd -> Latn
-    {0xB04F0000u, 41u}, // pcm -> Latn
-    {0x886F0000u, 41u}, // pdc -> Latn
-    {0xCC6F0000u, 41u}, // pdt -> Latn
-    {0xB88F0000u, 83u}, // peo -> Xpeo
-    {0xACAF0000u, 41u}, // pfl -> Latn
+    {0xB00F0000u, 40u}, // pam -> Latn
+    {0xBC0F0000u, 40u}, // pap -> Latn
+    {0xD00F0000u, 40u}, // pau -> Latn
+    {0xA02F0000u, 40u}, // pbi -> Latn
+    {0x8C4F0000u, 40u}, // pcd -> Latn
+    {0xB04F0000u, 40u}, // pcm -> Latn
+    {0x886F0000u, 40u}, // pdc -> Latn
+    {0xCC6F0000u, 40u}, // pdt -> Latn
+    {0x8C8F0000u, 40u}, // ped -> Latn
+    {0xB88F0000u, 84u}, // peo -> Xpeo
+    {0xDC8F0000u, 40u}, // pex -> Latn
+    {0xACAF0000u, 40u}, // pfl -> Latn
+    {0xACEF0000u,  1u}, // phl -> Arab
     {0xB4EF0000u, 61u}, // phn -> Phnx
+    {0xAD0F0000u, 40u}, // pil -> Latn
+    {0xBD0F0000u, 40u}, // pip -> Latn
     {0x814F0000u,  8u}, // pka -> Brah
-    {0xB94F0000u, 41u}, // pko -> Latn
-    {0x706C0000u, 41u}, // pl -> Latn
-    {0xC98F0000u, 41u}, // pms -> Latn
+    {0xB94F0000u, 40u}, // pko -> Latn
+    {0x706C0000u, 40u}, // pl -> Latn
+    {0x816F0000u, 40u}, // pla -> Latn
+    {0xC98F0000u, 40u}, // pms -> Latn
+    {0x99AF0000u, 40u}, // png -> Latn
+    {0xB5AF0000u, 40u}, // pnn -> Latn
     {0xCDAF0000u, 21u}, // pnt -> Grek
-    {0xB5CF0000u, 41u}, // pon -> Latn
+    {0xB5CF0000u, 40u}, // pon -> Latn
+    {0xB9EF0000u, 40u}, // ppo -> Latn
     {0x822F0000u, 34u}, // pra -> Khar
     {0x8E2F0000u,  1u}, // prd -> Arab
-    {0x9A2F0000u, 41u}, // prg -> Latn
+    {0x9A2F0000u, 40u}, // prg -> Latn
     {0x70730000u,  1u}, // ps -> Arab
-    {0x70740000u, 41u}, // pt -> Latn
-    {0xD28F0000u, 41u}, // puu -> Latn
-    {0x71750000u, 41u}, // qu -> Latn
-    {0x8A900000u, 41u}, // quc -> Latn
-    {0x9A900000u, 41u}, // qug -> Latn
+    {0xCA4F0000u, 40u}, // pss -> Latn
+    {0x70740000u, 40u}, // pt -> Latn
+    {0xBE6F0000u, 40u}, // ptp -> Latn
+    {0xD28F0000u, 40u}, // puu -> Latn
+    {0x82CF0000u, 40u}, // pwa -> Latn
+    {0x71750000u, 40u}, // qu -> Latn
+    {0x8A900000u, 40u}, // quc -> Latn
+    {0x9A900000u, 40u}, // qug -> Latn
+    {0xA0110000u, 40u}, // rai -> Latn
     {0xA4110000u, 16u}, // raj -> Deva
-    {0x94510000u, 41u}, // rcf -> Latn
-    {0xA4910000u, 41u}, // rej -> Latn
-    {0xB4D10000u, 41u}, // rgn -> Latn
-    {0x81110000u, 41u}, // ria -> Latn
-    {0x95110000u, 77u}, // rif -> Tfng
-    {0x95114E4Cu, 41u}, // rif-NL -> Latn
+    {0xB8110000u, 40u}, // rao -> Latn
+    {0x94510000u, 40u}, // rcf -> Latn
+    {0xA4910000u, 40u}, // rej -> Latn
+    {0xAC910000u, 40u}, // rel -> Latn
+    {0xC8910000u, 40u}, // res -> Latn
+    {0xB4D10000u, 40u}, // rgn -> Latn
+    {0x98F10000u,  1u}, // rhg -> Arab
+    {0x81110000u, 40u}, // ria -> Latn
+    {0x95110000u, 78u}, // rif -> Tfng
+    {0x95114E4Cu, 40u}, // rif-NL -> Latn
     {0xC9310000u, 16u}, // rjs -> Deva
     {0xCD510000u,  7u}, // rkt -> Beng
-    {0x726D0000u, 41u}, // rm -> Latn
-    {0x95910000u, 41u}, // rmf -> Latn
-    {0xB9910000u, 41u}, // rmo -> Latn
+    {0x726D0000u, 40u}, // rm -> Latn
+    {0x95910000u, 40u}, // rmf -> Latn
+    {0xB9910000u, 40u}, // rmo -> Latn
     {0xCD910000u,  1u}, // rmt -> Arab
-    {0xD1910000u, 41u}, // rmu -> Latn
-    {0x726E0000u, 41u}, // rn -> Latn
-    {0x99B10000u, 41u}, // rng -> Latn
-    {0x726F0000u, 41u}, // ro -> Latn
-    {0x85D10000u, 41u}, // rob -> Latn
-    {0x95D10000u, 41u}, // rof -> Latn
-    {0xB2710000u, 41u}, // rtm -> Latn
+    {0xD1910000u, 40u}, // rmu -> Latn
+    {0x726E0000u, 40u}, // rn -> Latn
+    {0x81B10000u, 40u}, // rna -> Latn
+    {0x99B10000u, 40u}, // rng -> Latn
+    {0x726F0000u, 40u}, // ro -> Latn
+    {0x85D10000u, 40u}, // rob -> Latn
+    {0x95D10000u, 40u}, // rof -> Latn
+    {0xB9D10000u, 40u}, // roo -> Latn
+    {0xBA310000u, 40u}, // rro -> Latn
+    {0xB2710000u, 40u}, // rtm -> Latn
     {0x72750000u, 15u}, // ru -> Cyrl
     {0x92910000u, 15u}, // rue -> Cyrl
-    {0x9A910000u, 41u}, // rug -> Latn
-    {0x72770000u, 41u}, // rw -> Latn
-    {0xAAD10000u, 41u}, // rwk -> Latn
+    {0x9A910000u, 40u}, // rug -> Latn
+    {0x72770000u, 40u}, // rw -> Latn
+    {0xAAD10000u, 40u}, // rwk -> Latn
+    {0xBAD10000u, 40u}, // rwo -> Latn
     {0xD3110000u, 33u}, // ryu -> Kana
     {0x73610000u, 16u}, // sa -> Deva
-    {0x94120000u, 41u}, // saf -> Latn
+    {0x94120000u, 40u}, // saf -> Latn
     {0x9C120000u, 15u}, // sah -> Cyrl
-    {0xC0120000u, 41u}, // saq -> Latn
-    {0xC8120000u, 41u}, // sas -> Latn
-    {0xCC120000u, 41u}, // sat -> Latn
+    {0xC0120000u, 40u}, // saq -> Latn
+    {0xC8120000u, 40u}, // sas -> Latn
+    {0xCC120000u, 40u}, // sat -> Latn
     {0xE4120000u, 67u}, // saz -> Saur
-    {0xBC320000u, 41u}, // sbp -> Latn
-    {0x73630000u, 41u}, // sc -> Latn
+    {0x80320000u, 40u}, // sba -> Latn
+    {0x90320000u, 40u}, // sbe -> Latn
+    {0xBC320000u, 40u}, // sbp -> Latn
+    {0x73630000u, 40u}, // sc -> Latn
     {0xA8520000u, 16u}, // sck -> Deva
-    {0xB4520000u, 41u}, // scn -> Latn
-    {0xB8520000u, 41u}, // sco -> Latn
-    {0xC8520000u, 41u}, // scs -> Latn
+    {0xAC520000u,  1u}, // scl -> Arab
+    {0xB4520000u, 40u}, // scn -> Latn
+    {0xB8520000u, 40u}, // sco -> Latn
+    {0xC8520000u, 40u}, // scs -> Latn
     {0x73640000u,  1u}, // sd -> Arab
-    {0x88720000u, 41u}, // sdc -> Latn
+    {0x88720000u, 40u}, // sdc -> Latn
     {0x9C720000u,  1u}, // sdh -> Arab
-    {0x73650000u, 41u}, // se -> Latn
-    {0x94920000u, 41u}, // sef -> Latn
-    {0x9C920000u, 41u}, // seh -> Latn
-    {0xA0920000u, 41u}, // sei -> Latn
-    {0xC8920000u, 41u}, // ses -> Latn
-    {0x73670000u, 41u}, // sg -> Latn
-    {0x80D20000u, 56u}, // sga -> Ogam
-    {0xC8D20000u, 41u}, // sgs -> Latn
-    {0x73680000u, 41u}, // sh -> Latn
-    {0xA0F20000u, 77u}, // shi -> Tfng
-    {0xB4F20000u, 53u}, // shn -> Mymr
+    {0x73650000u, 40u}, // se -> Latn
+    {0x94920000u, 40u}, // sef -> Latn
+    {0x9C920000u, 40u}, // seh -> Latn
+    {0xA0920000u, 40u}, // sei -> Latn
+    {0xC8920000u, 40u}, // ses -> Latn
+    {0x73670000u, 40u}, // sg -> Latn
+    {0x80D20000u, 55u}, // sga -> Ogam
+    {0xC8D20000u, 40u}, // sgs -> Latn
+    {0xD8D20000u, 18u}, // sgw -> Ethi
+    {0xE4D20000u, 40u}, // sgz -> Latn
+    {0x73680000u, 40u}, // sh -> Latn
+    {0xA0F20000u, 78u}, // shi -> Tfng
+    {0xA8F20000u, 40u}, // shk -> Latn
+    {0xB4F20000u, 52u}, // shn -> Mymr
+    {0xD0F20000u,  1u}, // shu -> Arab
     {0x73690000u, 69u}, // si -> Sinh
-    {0x8D120000u, 41u}, // sid -> Latn
-    {0x736B0000u, 41u}, // sk -> Latn
+    {0x8D120000u, 40u}, // sid -> Latn
+    {0x99120000u, 40u}, // sig -> Latn
+    {0xAD120000u, 40u}, // sil -> Latn
+    {0xB1120000u, 40u}, // sim -> Latn
+    {0xC5320000u, 40u}, // sjr -> Latn
+    {0x736B0000u, 40u}, // sk -> Latn
+    {0x89520000u, 40u}, // skc -> Latn
     {0xC5520000u,  1u}, // skr -> Arab
-    {0x736C0000u, 41u}, // sl -> Latn
-    {0xA1720000u, 41u}, // sli -> Latn
-    {0xE1720000u, 41u}, // sly -> Latn
-    {0x736D0000u, 41u}, // sm -> Latn
-    {0x81920000u, 41u}, // sma -> Latn
-    {0xA5920000u, 41u}, // smj -> Latn
-    {0xB5920000u, 41u}, // smn -> Latn
+    {0xC9520000u, 40u}, // sks -> Latn
+    {0x736C0000u, 40u}, // sl -> Latn
+    {0x8D720000u, 40u}, // sld -> Latn
+    {0xA1720000u, 40u}, // sli -> Latn
+    {0xAD720000u, 40u}, // sll -> Latn
+    {0xE1720000u, 40u}, // sly -> Latn
+    {0x736D0000u, 40u}, // sm -> Latn
+    {0x81920000u, 40u}, // sma -> Latn
+    {0xA5920000u, 40u}, // smj -> Latn
+    {0xB5920000u, 40u}, // smn -> Latn
     {0xBD920000u, 65u}, // smp -> Samr
-    {0xC9920000u, 41u}, // sms -> Latn
-    {0x736E0000u, 41u}, // sn -> Latn
-    {0xA9B20000u, 41u}, // snk -> Latn
-    {0x736F0000u, 41u}, // so -> Latn
-    {0xD1D20000u, 79u}, // sou -> Thai
-    {0x73710000u, 41u}, // sq -> Latn
+    {0xC1920000u, 40u}, // smq -> Latn
+    {0xC9920000u, 40u}, // sms -> Latn
+    {0x736E0000u, 40u}, // sn -> Latn
+    {0x89B20000u, 40u}, // snc -> Latn
+    {0xA9B20000u, 40u}, // snk -> Latn
+    {0xBDB20000u, 40u}, // snp -> Latn
+    {0xDDB20000u, 40u}, // snx -> Latn
+    {0xE1B20000u, 40u}, // sny -> Latn
+    {0x736F0000u, 40u}, // so -> Latn
+    {0xA9D20000u, 40u}, // sok -> Latn
+    {0xC1D20000u, 40u}, // soq -> Latn
+    {0xD1D20000u, 80u}, // sou -> Thai
+    {0xE1D20000u, 40u}, // soy -> Latn
+    {0x8DF20000u, 40u}, // spd -> Latn
+    {0xADF20000u, 40u}, // spl -> Latn
+    {0xC9F20000u, 40u}, // sps -> Latn
+    {0x73710000u, 40u}, // sq -> Latn
     {0x73720000u, 15u}, // sr -> Cyrl
-    {0x73724D45u, 41u}, // sr-ME -> Latn
-    {0x7372524Fu, 41u}, // sr-RO -> Latn
-    {0x73725255u, 41u}, // sr-RU -> Latn
-    {0x73725452u, 41u}, // sr-TR -> Latn
+    {0x73724D45u, 40u}, // sr-ME -> Latn
+    {0x7372524Fu, 40u}, // sr-RO -> Latn
+    {0x73725255u, 40u}, // sr-RU -> Latn
+    {0x73725452u, 40u}, // sr-TR -> Latn
     {0x86320000u, 70u}, // srb -> Sora
-    {0xB6320000u, 41u}, // srn -> Latn
-    {0xC6320000u, 41u}, // srr -> Latn
+    {0xB6320000u, 40u}, // srn -> Latn
+    {0xC6320000u, 40u}, // srr -> Latn
     {0xDE320000u, 16u}, // srx -> Deva
-    {0x73730000u, 41u}, // ss -> Latn
-    {0xE2520000u, 41u}, // ssy -> Latn
-    {0x73740000u, 41u}, // st -> Latn
-    {0xC2720000u, 41u}, // stq -> Latn
-    {0x73750000u, 41u}, // su -> Latn
-    {0xAA920000u, 41u}, // suk -> Latn
-    {0xCA920000u, 41u}, // sus -> Latn
-    {0x73760000u, 41u}, // sv -> Latn
-    {0x73770000u, 41u}, // sw -> Latn
+    {0x73730000u, 40u}, // ss -> Latn
+    {0x8E520000u, 40u}, // ssd -> Latn
+    {0x9A520000u, 40u}, // ssg -> Latn
+    {0xE2520000u, 40u}, // ssy -> Latn
+    {0x73740000u, 40u}, // st -> Latn
+    {0xAA720000u, 40u}, // stk -> Latn
+    {0xC2720000u, 40u}, // stq -> Latn
+    {0x73750000u, 40u}, // su -> Latn
+    {0x82920000u, 40u}, // sua -> Latn
+    {0x92920000u, 40u}, // sue -> Latn
+    {0xAA920000u, 40u}, // suk -> Latn
+    {0xC6920000u, 40u}, // sur -> Latn
+    {0xCA920000u, 40u}, // sus -> Latn
+    {0x73760000u, 40u}, // sv -> Latn
+    {0x73770000u, 40u}, // sw -> Latn
     {0x86D20000u,  1u}, // swb -> Arab
-    {0x8AD20000u, 41u}, // swc -> Latn
-    {0x9AD20000u, 41u}, // swg -> Latn
+    {0x8AD20000u, 40u}, // swc -> Latn
+    {0x9AD20000u, 40u}, // swg -> Latn
+    {0xBED20000u, 40u}, // swp -> Latn
     {0xD6D20000u, 16u}, // swv -> Deva
-    {0xB6F20000u, 41u}, // sxn -> Latn
+    {0xB6F20000u, 40u}, // sxn -> Latn
+    {0xDAF20000u, 40u}, // sxw -> Latn
     {0xAF120000u,  7u}, // syl -> Beng
     {0xC7120000u, 71u}, // syr -> Syrc
-    {0xAF320000u, 41u}, // szl -> Latn
+    {0xAF320000u, 40u}, // szl -> Latn
     {0x74610000u, 74u}, // ta -> Taml
     {0xA4130000u, 16u}, // taj -> Deva
-    {0xD8330000u, 41u}, // tbw -> Latn
+    {0xAC130000u, 40u}, // tal -> Latn
+    {0xB4130000u, 40u}, // tan -> Latn
+    {0xC0130000u, 40u}, // taq -> Latn
+    {0x88330000u, 40u}, // tbc -> Latn
+    {0x8C330000u, 40u}, // tbd -> Latn
+    {0x94330000u, 40u}, // tbf -> Latn
+    {0x98330000u, 40u}, // tbg -> Latn
+    {0xB8330000u, 40u}, // tbo -> Latn
+    {0xD8330000u, 40u}, // tbw -> Latn
+    {0xE4330000u, 40u}, // tbz -> Latn
+    {0xA0530000u, 40u}, // tci -> Latn
     {0xE0530000u, 36u}, // tcy -> Knda
     {0x8C730000u, 72u}, // tdd -> Tale
     {0x98730000u, 16u}, // tdg -> Deva
     {0x9C730000u, 16u}, // tdh -> Deva
-    {0x74650000u, 76u}, // te -> Telu
-    {0xB0930000u, 41u}, // tem -> Latn
-    {0xB8930000u, 41u}, // teo -> Latn
-    {0xCC930000u, 41u}, // tet -> Latn
+    {0x74650000u, 77u}, // te -> Telu
+    {0x8C930000u, 40u}, // ted -> Latn
+    {0xB0930000u, 40u}, // tem -> Latn
+    {0xB8930000u, 40u}, // teo -> Latn
+    {0xCC930000u, 40u}, // tet -> Latn
+    {0xA0B30000u, 40u}, // tfi -> Latn
     {0x74670000u, 15u}, // tg -> Cyrl
     {0x7467504Bu,  1u}, // tg-PK -> Arab
-    {0x74680000u, 79u}, // th -> Thai
+    {0x88D30000u, 40u}, // tgc -> Latn
+    {0xB8D30000u, 40u}, // tgo -> Latn
+    {0xD0D30000u, 40u}, // tgu -> Latn
+    {0x74680000u, 80u}, // th -> Thai
     {0xACF30000u, 16u}, // thl -> Deva
     {0xC0F30000u, 16u}, // thq -> Deva
     {0xC4F30000u, 16u}, // thr -> Deva
     {0x74690000u, 18u}, // ti -> Ethi
+    {0x95130000u, 40u}, // tif -> Latn
     {0x99130000u, 18u}, // tig -> Ethi
-    {0xD5130000u, 41u}, // tiv -> Latn
-    {0x746B0000u, 41u}, // tk -> Latn
-    {0xAD530000u, 41u}, // tkl -> Latn
-    {0xC5530000u, 41u}, // tkr -> Latn
+    {0xA9130000u, 40u}, // tik -> Latn
+    {0xB1130000u, 40u}, // tim -> Latn
+    {0xB9130000u, 40u}, // tio -> Latn
+    {0xD5130000u, 40u}, // tiv -> Latn
+    {0x746B0000u, 40u}, // tk -> Latn
+    {0xAD530000u, 40u}, // tkl -> Latn
+    {0xC5530000u, 40u}, // tkr -> Latn
     {0xCD530000u, 16u}, // tkt -> Deva
-    {0x746C0000u, 41u}, // tl -> Latn
-    {0xE1730000u, 41u}, // tly -> Latn
-    {0x9D930000u, 41u}, // tmh -> Latn
-    {0x746E0000u, 41u}, // tn -> Latn
-    {0x746F0000u, 41u}, // to -> Latn
-    {0x99D30000u, 41u}, // tog -> Latn
-    {0xA1F30000u, 41u}, // tpi -> Latn
-    {0x74720000u, 41u}, // tr -> Latn
-    {0xD2330000u, 41u}, // tru -> Latn
-    {0xD6330000u, 41u}, // trv -> Latn
-    {0x74730000u, 41u}, // ts -> Latn
+    {0x746C0000u, 40u}, // tl -> Latn
+    {0x95730000u, 40u}, // tlf -> Latn
+    {0xDD730000u, 40u}, // tlx -> Latn
+    {0xE1730000u, 40u}, // tly -> Latn
+    {0x9D930000u, 40u}, // tmh -> Latn
+    {0xE1930000u, 40u}, // tmy -> Latn
+    {0x746E0000u, 40u}, // tn -> Latn
+    {0x9DB30000u, 40u}, // tnh -> Latn
+    {0x746F0000u, 40u}, // to -> Latn
+    {0x95D30000u, 40u}, // tof -> Latn
+    {0x99D30000u, 40u}, // tog -> Latn
+    {0xC1D30000u, 40u}, // toq -> Latn
+    {0xA1F30000u, 40u}, // tpi -> Latn
+    {0xB1F30000u, 40u}, // tpm -> Latn
+    {0xE5F30000u, 40u}, // tpz -> Latn
+    {0xBA130000u, 40u}, // tqo -> Latn
+    {0x74720000u, 40u}, // tr -> Latn
+    {0xD2330000u, 40u}, // tru -> Latn
+    {0xD6330000u, 40u}, // trv -> Latn
+    {0xDA330000u,  1u}, // trw -> Arab
+    {0x74730000u, 40u}, // ts -> Latn
     {0x8E530000u, 21u}, // tsd -> Grek
     {0x96530000u, 16u}, // tsf -> Deva
-    {0x9A530000u, 41u}, // tsg -> Latn
-    {0xA6530000u, 80u}, // tsj -> Tibt
+    {0x9A530000u, 40u}, // tsg -> Latn
+    {0xA6530000u, 81u}, // tsj -> Tibt
+    {0xDA530000u, 40u}, // tsw -> Latn
     {0x74740000u, 15u}, // tt -> Cyrl
-    {0xA6730000u, 41u}, // ttj -> Latn
-    {0xCA730000u, 79u}, // tts -> Thai
-    {0xCE730000u, 41u}, // ttt -> Latn
-    {0xB2930000u, 41u}, // tum -> Latn
-    {0xAEB30000u, 41u}, // tvl -> Latn
-    {0xC2D30000u, 41u}, // twq -> Latn
-    {0x74790000u, 41u}, // ty -> Latn
+    {0x8E730000u, 40u}, // ttd -> Latn
+    {0x92730000u, 40u}, // tte -> Latn
+    {0xA6730000u, 40u}, // ttj -> Latn
+    {0xC6730000u, 40u}, // ttr -> Latn
+    {0xCA730000u, 80u}, // tts -> Thai
+    {0xCE730000u, 40u}, // ttt -> Latn
+    {0x9E930000u, 40u}, // tuh -> Latn
+    {0xAE930000u, 40u}, // tul -> Latn
+    {0xB2930000u, 40u}, // tum -> Latn
+    {0xC2930000u, 40u}, // tuq -> Latn
+    {0x8EB30000u, 40u}, // tvd -> Latn
+    {0xAEB30000u, 40u}, // tvl -> Latn
+    {0xD2B30000u, 40u}, // tvu -> Latn
+    {0x9ED30000u, 40u}, // twh -> Latn
+    {0xC2D30000u, 40u}, // twq -> Latn
+    {0x9AF30000u, 75u}, // txg -> Tang
+    {0x74790000u, 40u}, // ty -> Latn
+    {0x83130000u, 40u}, // tya -> Latn
     {0xD7130000u, 15u}, // tyv -> Cyrl
-    {0xB3330000u, 41u}, // tzm -> Latn
+    {0xB3330000u, 40u}, // tzm -> Latn
+    {0xD0340000u, 40u}, // ubu -> Latn
     {0xB0740000u, 15u}, // udm -> Cyrl
     {0x75670000u,  1u}, // ug -> Arab
     {0x75674B5Au, 15u}, // ug-KZ -> Cyrl
     {0x75674D4Eu, 15u}, // ug-MN -> Cyrl
-    {0x80D40000u, 81u}, // uga -> Ugar
+    {0x80D40000u, 82u}, // uga -> Ugar
     {0x756B0000u, 15u}, // uk -> Cyrl
-    {0xA1740000u, 41u}, // uli -> Latn
-    {0x85940000u, 41u}, // umb -> Latn
+    {0xA1740000u, 40u}, // uli -> Latn
+    {0x85940000u, 40u}, // umb -> Latn
     {0xC5B40000u,  7u}, // unr -> Beng
     {0xC5B44E50u, 16u}, // unr-NP -> Deva
     {0xDDB40000u,  7u}, // unx -> Beng
     {0x75720000u,  1u}, // ur -> Arab
-    {0x757A0000u, 41u}, // uz -> Latn
+    {0xA2340000u, 40u}, // uri -> Latn
+    {0xCE340000u, 40u}, // urt -> Latn
+    {0xDA340000u, 40u}, // urw -> Latn
+    {0x82540000u, 40u}, // usa -> Latn
+    {0xC6740000u, 40u}, // utr -> Latn
+    {0x9EB40000u, 40u}, // uvh -> Latn
+    {0xAEB40000u, 40u}, // uvl -> Latn
+    {0x757A0000u, 40u}, // uz -> Latn
     {0x757A4146u,  1u}, // uz-AF -> Arab
     {0x757A434Eu, 15u}, // uz-CN -> Cyrl
-    {0xA0150000u, 82u}, // vai -> Vaii
-    {0x76650000u, 41u}, // ve -> Latn
-    {0x88950000u, 41u}, // vec -> Latn
-    {0xBC950000u, 41u}, // vep -> Latn
-    {0x76690000u, 41u}, // vi -> Latn
-    {0x89150000u, 41u}, // vic -> Latn
-    {0xC9750000u, 41u}, // vls -> Latn
-    {0x95950000u, 41u}, // vmf -> Latn
-    {0xD9950000u, 41u}, // vmw -> Latn
-    {0x766F0000u, 41u}, // vo -> Latn
-    {0xCDD50000u, 41u}, // vot -> Latn
-    {0xBA350000u, 41u}, // vro -> Latn
-    {0xB6950000u, 41u}, // vun -> Latn
-    {0x77610000u, 41u}, // wa -> Latn
-    {0x90160000u, 41u}, // wae -> Latn
+    {0x98150000u, 40u}, // vag -> Latn
+    {0xA0150000u, 83u}, // vai -> Vaii
+    {0xB4150000u, 40u}, // van -> Latn
+    {0x76650000u, 40u}, // ve -> Latn
+    {0x88950000u, 40u}, // vec -> Latn
+    {0xBC950000u, 40u}, // vep -> Latn
+    {0x76690000u, 40u}, // vi -> Latn
+    {0x89150000u, 40u}, // vic -> Latn
+    {0xD5150000u, 40u}, // viv -> Latn
+    {0xC9750000u, 40u}, // vls -> Latn
+    {0x95950000u, 40u}, // vmf -> Latn
+    {0xD9950000u, 40u}, // vmw -> Latn
+    {0x766F0000u, 40u}, // vo -> Latn
+    {0xCDD50000u, 40u}, // vot -> Latn
+    {0xBA350000u, 40u}, // vro -> Latn
+    {0xB6950000u, 40u}, // vun -> Latn
+    {0xCE950000u, 40u}, // vut -> Latn
+    {0x77610000u, 40u}, // wa -> Latn
+    {0x90160000u, 40u}, // wae -> Latn
+    {0xA4160000u, 40u}, // waj -> Latn
     {0xAC160000u, 18u}, // wal -> Ethi
-    {0xC4160000u, 41u}, // war -> Latn
-    {0xBC360000u, 41u}, // wbp -> Latn
-    {0xC0360000u, 76u}, // wbq -> Telu
+    {0xB4160000u, 40u}, // wan -> Latn
+    {0xC4160000u, 40u}, // war -> Latn
+    {0xBC360000u, 40u}, // wbp -> Latn
+    {0xC0360000u, 77u}, // wbq -> Telu
     {0xC4360000u, 16u}, // wbr -> Deva
-    {0xC9760000u, 41u}, // wls -> Latn
+    {0xA0560000u, 40u}, // wci -> Latn
+    {0xC4960000u, 40u}, // wer -> Latn
+    {0xA0D60000u, 40u}, // wgi -> Latn
+    {0x98F60000u, 40u}, // whg -> Latn
+    {0x85160000u, 40u}, // wib -> Latn
+    {0xD1160000u, 40u}, // wiu -> Latn
+    {0xD5160000u, 40u}, // wiv -> Latn
+    {0x81360000u, 40u}, // wja -> Latn
+    {0xA1360000u, 40u}, // wji -> Latn
+    {0xC9760000u, 40u}, // wls -> Latn
+    {0xB9960000u, 40u}, // wmo -> Latn
+    {0x89B60000u, 40u}, // wnc -> Latn
     {0xA1B60000u,  1u}, // wni -> Arab
-    {0x776F0000u, 41u}, // wo -> Latn
+    {0xD1B60000u, 40u}, // wnu -> Latn
+    {0x776F0000u, 40u}, // wo -> Latn
+    {0x85D60000u, 40u}, // wob -> Latn
+    {0xC9D60000u, 40u}, // wos -> Latn
+    {0xCA360000u, 40u}, // wrs -> Latn
+    {0xAA560000u, 40u}, // wsk -> Latn
     {0xB2760000u, 16u}, // wtm -> Deva
     {0xD2960000u, 24u}, // wuu -> Hans
-    {0xD4170000u, 41u}, // xav -> Latn
+    {0xD6960000u, 40u}, // wuv -> Latn
+    {0x82D60000u, 40u}, // wwa -> Latn
+    {0xD4170000u, 40u}, // xav -> Latn
+    {0xA0370000u, 40u}, // xbi -> Latn
     {0xC4570000u, 10u}, // xcr -> Cari
-    {0x78680000u, 41u}, // xh -> Latn
-    {0x89770000u, 45u}, // xlc -> Lyci
-    {0x8D770000u, 46u}, // xld -> Lydi
+    {0xC8970000u, 40u}, // xes -> Latn
+    {0x78680000u, 40u}, // xh -> Latn
+    {0x81770000u, 40u}, // xla -> Latn
+    {0x89770000u, 44u}, // xlc -> Lyci
+    {0x8D770000u, 45u}, // xld -> Lydi
     {0x95970000u, 19u}, // xmf -> Geor
-    {0xB5970000u, 48u}, // xmn -> Mani
-    {0xC5970000u, 49u}, // xmr -> Merc
-    {0x81B70000u, 54u}, // xna -> Narb
+    {0xB5970000u, 47u}, // xmn -> Mani
+    {0xC5970000u, 48u}, // xmr -> Merc
+    {0x81B70000u, 53u}, // xna -> Narb
     {0xC5B70000u, 16u}, // xnr -> Deva
-    {0x99D70000u, 41u}, // xog -> Latn
+    {0x99D70000u, 40u}, // xog -> Latn
+    {0xB5D70000u, 40u}, // xon -> Latn
     {0xC5F70000u, 63u}, // xpr -> Prti
+    {0x86370000u, 40u}, // xrb -> Latn
     {0x82570000u, 66u}, // xsa -> Sarb
+    {0xA2570000u, 40u}, // xsi -> Latn
+    {0xB2570000u, 40u}, // xsm -> Latn
     {0xC6570000u, 16u}, // xsr -> Deva
-    {0xB8180000u, 41u}, // yao -> Latn
-    {0xBC180000u, 41u}, // yap -> Latn
-    {0xD4180000u, 41u}, // yav -> Latn
-    {0x84380000u, 41u}, // ybb -> Latn
+    {0x92D70000u, 40u}, // xwe -> Latn
+    {0xB0180000u, 40u}, // yam -> Latn
+    {0xB8180000u, 40u}, // yao -> Latn
+    {0xBC180000u, 40u}, // yap -> Latn
+    {0xC8180000u, 40u}, // yas -> Latn
+    {0xCC180000u, 40u}, // yat -> Latn
+    {0xD4180000u, 40u}, // yav -> Latn
+    {0xE0180000u, 40u}, // yay -> Latn
+    {0xE4180000u, 40u}, // yaz -> Latn
+    {0x80380000u, 40u}, // yba -> Latn
+    {0x84380000u, 40u}, // ybb -> Latn
+    {0xE0380000u, 40u}, // yby -> Latn
+    {0xC4980000u, 40u}, // yer -> Latn
+    {0xC4D80000u, 40u}, // ygr -> Latn
+    {0xD8D80000u, 40u}, // ygw -> Latn
     {0x79690000u, 27u}, // yi -> Hebr
-    {0x796F0000u, 41u}, // yo -> Latn
-    {0xAE380000u, 41u}, // yrl -> Latn
-    {0x82980000u, 41u}, // yua -> Latn
-    {0x7A610000u, 41u}, // za -> Latn
-    {0x98190000u, 41u}, // zag -> Latn
+    {0xB9580000u, 40u}, // yko -> Latn
+    {0x91780000u, 40u}, // yle -> Latn
+    {0x99780000u, 40u}, // ylg -> Latn
+    {0xAD780000u, 40u}, // yll -> Latn
+    {0xAD980000u, 40u}, // yml -> Latn
+    {0x796F0000u, 40u}, // yo -> Latn
+    {0xB5D80000u, 40u}, // yon -> Latn
+    {0x86380000u, 40u}, // yrb -> Latn
+    {0x92380000u, 40u}, // yre -> Latn
+    {0xAE380000u, 40u}, // yrl -> Latn
+    {0xCA580000u, 40u}, // yss -> Latn
+    {0x82980000u, 40u}, // yua -> Latn
+    {0x92980000u, 25u}, // yue -> Hant
+    {0x9298434Eu, 24u}, // yue-CN -> Hans
+    {0xA6980000u, 40u}, // yuj -> Latn
+    {0xCE980000u, 40u}, // yut -> Latn
+    {0xDA980000u, 40u}, // yuw -> Latn
+    {0x7A610000u, 40u}, // za -> Latn
+    {0x98190000u, 40u}, // zag -> Latn
     {0xA4790000u,  1u}, // zdj -> Arab
-    {0x80990000u, 41u}, // zea -> Latn
-    {0x9CD90000u, 77u}, // zgh -> Tfng
+    {0x80990000u, 40u}, // zea -> Latn
+    {0x9CD90000u, 78u}, // zgh -> Tfng
     {0x7A680000u, 24u}, // zh -> Hans
     {0x7A684155u, 25u}, // zh-AU -> Hant
     {0x7A68424Eu, 25u}, // zh-BN -> Hant
@@ -829,9 +1437,12 @@
     {0x7A685457u, 25u}, // zh-TW -> Hant
     {0x7A685553u, 25u}, // zh-US -> Hant
     {0x7A68564Eu, 25u}, // zh-VN -> Hant
-    {0xA1990000u, 41u}, // zmi -> Latn
-    {0x7A750000u, 41u}, // zu -> Latn
-    {0x83390000u, 41u}, // zza -> Latn
+    {0x81190000u, 40u}, // zia -> Latn
+    {0xB1790000u, 40u}, // zlm -> Latn
+    {0xA1990000u, 40u}, // zmi -> Latn
+    {0x91B90000u, 40u}, // zne -> Latn
+    {0x7A750000u, 40u}, // zu -> Latn
+    {0x83390000u, 40u}, // zza -> Latn
 });
 
 std::unordered_set<uint64_t> REPRESENTATIVE_LOCALES({
@@ -854,6 +1465,7 @@
     0x616D455445746869llu, // am_Ethi_ET
     0xB9804E474C61746Ellu, // amo_Latn_NG
     0xE5C049444C61746Ellu, // aoz_Latn_ID
+    0x8DE0544741726162llu, // apd_Arab_TG
     0x6172454741726162llu, // ar_Arab_EG
     0x8A20495241726D69llu, // arc_Armi_IR
     0x8A204A4F4E626174llu, // arc_Nbat_JO
@@ -896,7 +1508,6 @@
     0x88C1494E44657661llu, // bgc_Deva_IN
     0xB4C1504B41726162llu, // bgn_Arab_PK
     0xDCC154524772656Bllu, // bgx_Grek_TR
-    0x6268494E4B746869llu, // bh_Kthi_IN
     0x84E1494E44657661llu, // bhb_Deva_IN
     0xA0E1494E44657661llu, // bhi_Deva_IN
     0xA8E150484C61746Ellu, // bhk_Latn_PH
@@ -980,6 +1591,7 @@
     0x864344454C61746Ellu, // dsb_Latn_DE
     0xB2634D4C4C61746Ellu, // dtm_Latn_ML
     0xBE634D594C61746Ellu, // dtp_Latn_MY
+    0xE2634E5044657661llu, // dty_Deva_NP
     0x8283434D4C61746Ellu, // dua_Latn_CM
     0x64764D5654686161llu, // dv_Thaa_MV
     0xBB03534E4C61746Ellu, // dyo_Latn_SN
@@ -1006,6 +1618,7 @@
     0xCEE445534C61746Ellu, // ext_Latn_ES
     0x6661495241726162llu, // fa_Arab_IR
     0xB40547514C61746Ellu, // fan_Latn_GQ
+    0x6666474E41646C6Dllu, // ff_Adlm_GN
     0x6666534E4C61746Ellu, // ff_Latn_SN
     0xB0A54D4C4C61746Ellu, // ffm_Latn_ML
     0x666946494C61746Ellu, // fi_Latn_FI
@@ -1020,7 +1633,9 @@
     0xBE2546524C61746Ellu, // frp_Latn_FR
     0xC62544454C61746Ellu, // frr_Latn_DE
     0xCA2544454C61746Ellu, // frs_Latn_DE
+    0x8685434D41726162llu, // fub_Arab_CM
     0x8E8557464C61746Ellu, // fud_Latn_WF
+    0x9685474E4C61746Ellu, // fuf_Latn_GN
     0xC2854E454C61746Ellu, // fuq_Latn_NE
     0xC68549544C61746Ellu, // fur_Latn_IT
     0xD6854E474C61746Ellu, // fuv_Latn_NG
@@ -1104,7 +1719,6 @@
     0x6A614A504A70616Ellu, // ja_Jpan_JP
     0xB0094A4D4C61746Ellu, // jam_Latn_JM
     0xB8C9434D4C61746Ellu, // jgo_Latn_CM
-    0x6A69554148656272llu, // ji_Hebr_UA
     0x8989545A4C61746Ellu, // jmc_Latn_TZ
     0xAD894E5044657661llu, // jml_Deva_NP
     0xCE89444B4C61746Ellu, // jut_Latn_DK
@@ -1118,9 +1732,11 @@
     0xB00A4B454C61746Ellu, // kam_Latn_KE
     0xB80A4D4C4C61746Ellu, // kao_Latn_ML
     0x8C2A52554379726Cllu, // kbd_Cyrl_RU
+    0xE02A4E4541726162llu, // kby_Arab_NE
     0x984A4E474C61746Ellu, // kcg_Latn_NG
     0xA84A5A574C61746Ellu, // kck_Latn_ZW
     0x906A545A4C61746Ellu, // kde_Latn_TZ
+    0x9C6A544741726162llu, // kdh_Arab_TG
     0xCC6A544854686169llu, // kdt_Thai_TH
     0x808A43564C61746Ellu, // kea_Latn_CV
     0xB48A434D4C61746Ellu, // ken_Latn_CM
@@ -1251,7 +1867,7 @@
     0x6D72494E44657661llu, // mr_Deva_IN
     0x8E2C4E5044657661llu, // mrd_Deva_NP
     0xA62C52554379726Cllu, // mrj_Cyrl_RU
-    0xD22C42444D726F6Fllu, // mru_Mroo_BD
+    0xBA2C42444D726F6Fllu, // mro_Mroo_BD
     0x6D734D594C61746Ellu, // ms_Latn_MY
     0x6D744D544C61746Ellu, // mt_Latn_MT
     0xC66C494E44657661llu, // mtr_Deva_IN
@@ -1308,6 +1924,7 @@
     0x6F6D45544C61746Ellu, // om_Latn_ET
     0x6F72494E4F727961llu, // or_Orya_IN
     0x6F7347454379726Cllu, // os_Cyrl_GE
+    0x824E55534F736765llu, // osa_Osge_US
     0xAA6E4D4E4F726B68llu, // otk_Orkh_MN
     0x7061504B41726162llu, // pa_Arab_PK
     0x7061494E47757275llu, // pa_Guru_IN
@@ -1479,6 +2096,7 @@
     0xB2934D574C61746Ellu, // tum_Latn_MW
     0xAEB354564C61746Ellu, // tvl_Latn_TV
     0xC2D34E454C61746Ellu, // twq_Latn_NE
+    0x9AF3434E54616E67llu, // txg_Tang_CN
     0x747950464C61746Ellu, // ty_Latn_PF
     0xD71352554379726Cllu, // tyv_Cyrl_RU
     0xB3334D414C61746Ellu, // tzm_Latn_MA
@@ -1540,14 +2158,18 @@
     0x796F4E474C61746Ellu, // yo_Latn_NG
     0xAE3842524C61746Ellu, // yrl_Latn_BR
     0x82984D584C61746Ellu, // yua_Latn_MX
+    0x9298434E48616E73llu, // yue_Hans_CN
+    0x9298484B48616E74llu, // yue_Hant_HK
     0x7A61434E4C61746Ellu, // za_Latn_CN
     0x981953444C61746Ellu, // zag_Latn_SD
     0xA4794B4D41726162llu, // zdj_Arab_KM
     0x80994E4C4C61746Ellu, // zea_Latn_NL
     0x9CD94D4154666E67llu, // zgh_Tfng_MA
     0x7A685457426F706Fllu, // zh_Bopo_TW
+    0x7A68545748616E62llu, // zh_Hanb_TW
     0x7A68434E48616E73llu, // zh_Hans_CN
     0x7A68545748616E74llu, // zh_Hant_TW
+    0xB17954474C61746Ellu, // zlm_Latn_TG
     0xA1994D594C61746Ellu, // zmi_Latn_MY
     0x7A755A414C61746Ellu, // zu_Latn_ZA
     0x833954524C61746Ellu, // zza_Latn_TR
@@ -1662,6 +2284,7 @@
     {0x656E5A57u, 0x656E8400u}, // en-ZW -> en-001
     {0x65734152u, 0x6573A424u}, // es-AR -> es-419
     {0x6573424Fu, 0x6573A424u}, // es-BO -> es-419
+    {0x65734252u, 0x6573A424u}, // es-BR -> es-419
     {0x6573434Cu, 0x6573A424u}, // es-CL -> es-419
     {0x6573434Fu, 0x6573A424u}, // es-CO -> es-419
     {0x65734352u, 0x6573A424u}, // es-CR -> es-419
@@ -1681,8 +2304,11 @@
     {0x65735559u, 0x6573A424u}, // es-UY -> es-419
     {0x65735645u, 0x6573A424u}, // es-VE -> es-419
     {0x7074414Fu, 0x70745054u}, // pt-AO -> pt-PT
+    {0x70744348u, 0x70745054u}, // pt-CH -> pt-PT
     {0x70744356u, 0x70745054u}, // pt-CV -> pt-PT
+    {0x70744751u, 0x70745054u}, // pt-GQ -> pt-PT
     {0x70744757u, 0x70745054u}, // pt-GW -> pt-PT
+    {0x70744C55u, 0x70745054u}, // pt-LU -> pt-PT
     {0x70744D4Fu, 0x70745054u}, // pt-MO -> pt-PT
     {0x70744D5Au, 0x70745054u}, // pt-MZ -> pt-PT
     {0x70745354u, 0x70745054u}, // pt-ST -> pt-PT
diff --git a/libs/androidfw/ResourceTypes.cpp b/libs/androidfw/ResourceTypes.cpp
index 7fbfffe..a30c849 100644
--- a/libs/androidfw/ResourceTypes.cpp
+++ b/libs/androidfw/ResourceTypes.cpp
@@ -140,7 +140,7 @@
     patch->colorsOffset = patch->yDivsOffset + (patch->numYDivs * sizeof(int32_t));
 }
 
-inline void Res_value::copyFrom_dtoh(const Res_value& src)
+void Res_value::copyFrom_dtoh(const Res_value& src)
 {
     size = dtohs(src.size);
     res0 = src.res0;
diff --git a/libs/androidfw/include/androidfw/ApkAssets.h b/libs/androidfw/include/androidfw/ApkAssets.h
new file mode 100644
index 0000000..a3d67f0
--- /dev/null
+++ b/libs/androidfw/include/androidfw/ApkAssets.h
@@ -0,0 +1,62 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef APKASSETS_H_
+#define APKASSETS_H_
+
+#include <memory>
+#include <string>
+
+#include "android-base/macros.h"
+#include "ziparchive/zip_archive.h"
+
+#include "androidfw/Asset.h"
+#include "androidfw/LoadedArsc.h"
+
+namespace android {
+
+// Holds an APK.
+class ApkAssets {
+ public:
+  static std::unique_ptr<ApkAssets> Load(const std::string& path);
+
+  std::unique_ptr<Asset> Open(const std::string& path,
+                              Asset::AccessMode mode = Asset::AccessMode::ACCESS_RANDOM) const;
+
+  inline const std::string& GetPath() const { return path_; }
+
+  inline const LoadedArsc* GetLoadedArsc() const { return loaded_arsc_.get(); }
+
+ private:
+  DISALLOW_COPY_AND_ASSIGN(ApkAssets);
+
+  ApkAssets() = default;
+
+  struct ZipArchivePtrCloser {
+    void operator()(::ZipArchiveHandle handle) { ::CloseArchive(handle); }
+  };
+
+  using ZipArchivePtr =
+      std::unique_ptr<typename std::remove_pointer<::ZipArchiveHandle>::type, ZipArchivePtrCloser>;
+  ZipArchivePtr zip_handle_;
+  std::string path_;
+  std::unique_ptr<Asset> resources_asset_;
+  std::unique_ptr<LoadedArsc> loaded_arsc_;
+};
+
+}  // namespace android
+
+#endif /* APKASSETS_H_ */
diff --git a/libs/androidfw/include/androidfw/AssetManager2.h b/libs/androidfw/include/androidfw/AssetManager2.h
new file mode 100644
index 0000000..66d5034
--- /dev/null
+++ b/libs/androidfw/include/androidfw/AssetManager2.h
@@ -0,0 +1,298 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROIDFW_ASSETMANAGER2_H_
+#define ANDROIDFW_ASSETMANAGER2_H_
+
+#include "android-base/macros.h"
+
+#include <limits>
+#include <unordered_map>
+
+#include "androidfw/ApkAssets.h"
+#include "androidfw/Asset.h"
+#include "androidfw/AssetManager.h"
+#include "androidfw/ResourceTypes.h"
+#include "androidfw/Util.h"
+
+namespace android {
+
+class Theme;
+
+using ApkAssetsCookie = int32_t;
+
+enum : ApkAssetsCookie {
+  kInvalidCookie = -1,
+};
+
+// Holds a bag that has been merged with its parent, if one exists.
+struct ResolvedBag {
+  // A single key-value entry in a bag.
+  struct Entry {
+    // The key, as described in ResTable_map::name.
+    uint32_t key;
+
+    Res_value value;
+
+    // Which ApkAssets this entry came from.
+    ApkAssetsCookie cookie;
+
+    ResStringPool* key_pool;
+    ResStringPool* type_pool;
+  };
+
+  // Denotes the configuration axis that this bag varies with.
+  // If a configuration changes with respect to one of these axis,
+  // the bag should be reloaded.
+  uint32_t type_spec_flags;
+
+  // The number of entries in this bag. Access them by indexing into `entries`.
+  uint32_t entry_count;
+
+  // The array of entries for this bag. An empty array is a neat trick to force alignment
+  // of the Entry structs that follow this structure and avoids a bunch of casts.
+  Entry entries[0];
+};
+
+// AssetManager2 is the main entry point for accessing assets and resources.
+// AssetManager2 provides caching of resources retrieved via the underlying
+// ApkAssets.
+class AssetManager2 : public ::AAssetManager {
+ public:
+  struct ResourceName {
+    const char* package = nullptr;
+    size_t package_len = 0u;
+
+    const char* type = nullptr;
+    const char16_t* type16 = nullptr;
+    size_t type_len = 0u;
+
+    const char* entry = nullptr;
+    const char16_t* entry16 = nullptr;
+    size_t entry_len = 0u;
+  };
+
+  AssetManager2();
+
+  // Sets/resets the underlying ApkAssets for this AssetManager. The ApkAssets
+  // are not owned by the AssetManager, and must have a longer lifetime.
+  //
+  // Only pass invalidate_caches=false when it is known that the structure
+  // change in ApkAssets is due to a safe addition of resources with completely
+  // new resource IDs.
+  bool SetApkAssets(const std::vector<const ApkAssets*>& apk_assets, bool invalidate_caches = true);
+
+  const std::vector<const ApkAssets*> GetApkAssets() const;
+
+  // Returns the string pool for the given asset cookie.
+  // Use the string pool returned here with a valid Res_value object of
+  // type Res_value::TYPE_STRING.
+  const ResStringPool* GetStringPoolForCookie(ApkAssetsCookie cookie) const;
+
+  // Sets/resets the configuration for this AssetManager. This will cause all
+  // caches that are related to the configuration change to be invalidated.
+  void SetConfiguration(const ResTable_config& configuration);
+
+  const ResTable_config& GetConfiguration() const;
+
+  // Searches the set of APKs loaded by this AssetManager and opens the first one found located
+  // in the assets/ directory.
+  // `mode` controls how the file is opened.
+  //
+  // NOTE: The loaded APKs are searched in reverse order.
+  std::unique_ptr<Asset> Open(const std::string& filename, Asset::AccessMode mode);
+
+  // Opens a file within the assets/ directory of the APK specified by `cookie`.
+  // `mode` controls how the file is opened.
+  std::unique_ptr<Asset> Open(const std::string& filename, ApkAssetsCookie cookie,
+                              Asset::AccessMode mode);
+
+  // Searches the set of APKs loaded by this AssetManager and opens the first one found.
+  // `mode` controls how the file is opened.
+  // `out_cookie` is populated with the cookie of the APK this file was found in.
+  //
+  // NOTE: The loaded APKs are searched in reverse order.
+  std::unique_ptr<Asset> OpenNonAsset(const std::string& filename, Asset::AccessMode mode,
+                                      ApkAssetsCookie* out_cookie = nullptr);
+
+  // Opens a file in the APK specified by `cookie`. `mode` controls how the file is opened.
+  // This is typically used to open a specific AndroidManifest.xml, or a binary XML file
+  // referenced by a resource lookup with GetResource().
+  std::unique_ptr<Asset> OpenNonAsset(const std::string& filename, ApkAssetsCookie cookie,
+                                      Asset::AccessMode mode);
+
+  // Populates the `out_name` parameter with resource name information.
+  // Utf8 strings are preferred, and only if they are unavailable are
+  // the Utf16 variants populated.
+  // Returns false if the resource was not found or the name was missing/corrupt.
+  bool GetResourceName(uint32_t resid, ResourceName* out_name);
+
+  // Populates `out_flags` with the bitmask of configuration axis that this resource varies with.
+  // See ResTable_config for the list of configuration axis.
+  // Returns false if the resource was not found.
+  bool GetResourceFlags(uint32_t resid, uint32_t* out_flags);
+
+  // Retrieves the best matching resource with ID `resid`. The resource value is filled into
+  // `out_value` and the configuration for the selected value is populated in `out_selected_config`.
+  // `out_flags` holds the same flags as retrieved with GetResourceFlags().
+  // If `density_override` is non-zero, the configuration to match against is overridden with that
+  // density.
+  //
+  // Returns a valid cookie if the resource was found. If the resource was not found, or if the
+  // resource was a map/bag type, then kInvalidCookie is returned. If `may_be_bag` is false,
+  // this function logs if the resource was a map/bag type before returning kInvalidCookie.
+  ApkAssetsCookie GetResource(uint32_t resid, bool may_be_bag, uint16_t density_override,
+                              Res_value* out_value, ResTable_config* out_selected_config,
+                              uint32_t* out_flags);
+
+  // Retrieves the best matching bag/map resource with ID `resid`.
+  // This method will resolve all parent references for this bag and merge keys with the child.
+  // To iterate over the keys, use the following idiom:
+  //
+  //  const AssetManager2::ResolvedBag* bag = asset_manager->GetBag(id);
+  //  if (bag != nullptr) {
+  //    for (auto iter = begin(bag); iter != end(bag); ++iter) {
+  //      ...
+  //    }
+  //  }
+  const ResolvedBag* GetBag(uint32_t resid);
+
+  // Creates a new Theme from this AssetManager.
+  std::unique_ptr<Theme> NewTheme();
+
+ private:
+  DISALLOW_COPY_AND_ASSIGN(AssetManager2);
+
+  // Finds the best entry for `resid` amongst all the ApkAssets. The entry can be a simple
+  // Res_value, or a complex map/bag type.
+  //
+  // `density_override` overrides the density of the current configuration when doing a search.
+  //
+  // When `stop_at_first_match` is true, the first match found is selected and the search
+  // terminates. This is useful for methods that just look up the name of a resource and don't
+  // care about the value. In this case, the value of `out_flags` is incomplete and should not
+  // be used.
+  //
+  // `out_flags` stores the resulting bitmask of configuration axis with which the resource
+  // value varies.
+  ApkAssetsCookie FindEntry(uint32_t resid, uint16_t density_override, bool stop_at_first_match,
+                            LoadedArsc::Entry* out_entry, ResTable_config* out_selected_config,
+                            uint32_t* out_flags);
+
+  // Purge all resources that are cached and vary by the configuration axis denoted by the
+  // bitmask `diff`.
+  void InvalidateCaches(uint32_t diff);
+
+  // The ordered list of ApkAssets to search. These are not owned by the AssetManager, and must
+  // have a longer lifetime.
+  std::vector<const ApkAssets*> apk_assets_;
+
+  // The current configuration set for this AssetManager. When this changes, cached resources
+  // may need to be purged.
+  ResTable_config configuration_;
+
+  // Cached set of bags. These are cached because they can inherit keys from parent bags,
+  // which involves some calculation.
+  std::unordered_map<uint32_t, util::unique_cptr<ResolvedBag>> cached_bags_;
+};
+
+class Theme {
+  friend class AssetManager2;
+
+ public:
+  // Applies the style identified by `resid` to this theme. This can be called
+  // multiple times with different styles. By default, any theme attributes that
+  // are already defined before this call are not overridden. If `force` is set
+  // to true, this behavior is changed and all theme attributes from the style at
+  // `resid` are applied.
+  // Returns false if the style failed to apply.
+  bool ApplyStyle(uint32_t resid, bool force = false);
+
+  // Sets this Theme to be a copy of `o` if `o` has the same AssetManager as this Theme.
+  // Returns false if the AssetManagers of the Themes were not compatible.
+  bool SetTo(const Theme& o);
+
+  void Clear();
+
+  inline const AssetManager2* GetAssetManager() const { return asset_manager_; }
+
+  // Returns a bit mask of configuration changes that will impact this
+  // theme (and thus require completely reloading it).
+  inline uint32_t GetChangingConfigurations() const { return type_spec_flags_; }
+
+  // Retrieve a value in the theme. If the theme defines this value,
+  // returns an asset cookie indicating which ApkAssets it came from
+  // and populates `out_value` with the value. If `out_flags` is non-null,
+  // populates it with a bitmask of the configuration axis the resource
+  // varies with.
+  //
+  // If the attribute is not found, returns kInvalidCookie.
+  //
+  // NOTE: This function does not do reference traversal. If you want
+  // to follow references to other resources to get the "real" value to
+  // use, you need to call ResolveReference() after this function.
+  ApkAssetsCookie GetAttribute(uint32_t resid, Res_value* out_value,
+                               uint32_t* out_flags = nullptr) const;
+
+  // This is like AssetManager2::ResolveReference(), but also takes
+  // care of resolving attribute references to the theme.
+  ApkAssetsCookie ResolveAttributeReference(Res_value* in_out_value, ApkAssetsCookie src_cookie,
+                                            uint32_t* out_last_ref = nullptr,
+                                            uint32_t* in_out_type_spec_flags = nullptr,
+                                            ResTable_config* out_selected_config = nullptr) const;
+
+ private:
+  DISALLOW_COPY_AND_ASSIGN(Theme);
+
+  // Called by AssetManager2.
+  explicit inline Theme(AssetManager2* asset_manager) : asset_manager_(asset_manager) {}
+
+  struct Entry {
+    ApkAssetsCookie cookie;
+    uint32_t type_spec_flags;
+    Res_value value;
+  };
+
+  struct Type {
+    // Use uint32_t for fewer cycles when loading from memory.
+    uint32_t entry_count;
+    uint32_t entry_capacity;
+    Entry entries[0];
+  };
+
+  static constexpr const size_t kPackageCount = std::numeric_limits<uint8_t>::max() + 1;
+  static constexpr const size_t kTypeCount = std::numeric_limits<uint8_t>::max() + 1;
+
+  struct Package {
+    // Each element of Type will be a dynamically sized object
+    // allocated to have the entries stored contiguously with the Type.
+    util::unique_cptr<Type> types[kTypeCount];
+  };
+
+  AssetManager2* asset_manager_;
+  uint32_t type_spec_flags_ = 0u;
+  std::unique_ptr<Package> packages_[kPackageCount];
+};
+
+inline const ResolvedBag::Entry* begin(const ResolvedBag* bag) { return bag->entries; }
+
+inline const ResolvedBag::Entry* end(const ResolvedBag* bag) {
+  return bag->entries + bag->entry_count;
+}
+
+}  // namespace android
+
+#endif /* ANDROIDFW_ASSETMANAGER2_H_ */
diff --git a/libs/androidfw/include/androidfw/ByteBucketArray.h b/libs/androidfw/include/androidfw/ByteBucketArray.h
index 87c6b12..d84a207 100644
--- a/libs/androidfw/include/androidfw/ByteBucketArray.h
+++ b/libs/androidfw/include/androidfw/ByteBucketArray.h
@@ -17,9 +17,10 @@
 #ifndef __BYTE_BUCKET_ARRAY_H
 #define __BYTE_BUCKET_ARRAY_H
 
-#include <utils/Log.h>
-#include <stdint.h>
-#include <string.h>
+#include <cstdint>
+#include <cstring>
+
+#include "android-base/logging.h"
 
 namespace android {
 
@@ -27,71 +28,65 @@
  * Stores a sparsely populated array. Has a fixed size of 256
  * (number of entries that a byte can represent).
  */
-template<typename T>
+template <typename T>
 class ByteBucketArray {
-public:
-    ByteBucketArray() : mDefault() {
-        memset(mBuckets, 0, sizeof(mBuckets));
+ public:
+  ByteBucketArray() : default_() { memset(buckets_, 0, sizeof(buckets_)); }
+
+  ~ByteBucketArray() {
+    for (size_t i = 0; i < kNumBuckets; i++) {
+      if (buckets_[i] != NULL) {
+        delete[] buckets_[i];
+      }
+    }
+    memset(buckets_, 0, sizeof(buckets_));
+  }
+
+  inline size_t size() const { return kNumBuckets * kBucketSize; }
+
+  inline const T& get(size_t index) const { return (*this)[index]; }
+
+  const T& operator[](size_t index) const {
+    if (index >= size()) {
+      return default_;
     }
 
-    ~ByteBucketArray() {
-        for (size_t i = 0; i < NUM_BUCKETS; i++) {
-            if (mBuckets[i] != NULL) {
-                delete [] mBuckets[i];
-            }
-        }
-        memset(mBuckets, 0, sizeof(mBuckets));
+    uint8_t bucket_index = static_cast<uint8_t>(index) >> 4;
+    T* bucket = buckets_[bucket_index];
+    if (bucket == NULL) {
+      return default_;
+    }
+    return bucket[0x0f & static_cast<uint8_t>(index)];
+  }
+
+  T& editItemAt(size_t index) {
+    CHECK(index < size()) << "ByteBucketArray.getOrCreate(index=" << index
+                          << ") with size=" << size();
+
+    uint8_t bucket_index = static_cast<uint8_t>(index) >> 4;
+    T* bucket = buckets_[bucket_index];
+    if (bucket == NULL) {
+      bucket = buckets_[bucket_index] = new T[kBucketSize]();
+    }
+    return bucket[0x0f & static_cast<uint8_t>(index)];
+  }
+
+  bool set(size_t index, const T& value) {
+    if (index >= size()) {
+      return false;
     }
 
-    inline size_t size() const {
-        return NUM_BUCKETS * BUCKET_SIZE;
-    }
+    editItemAt(index) = value;
+    return true;
+  }
 
-    inline const T& get(size_t index) const {
-        return (*this)[index];
-    }
+ private:
+  enum { kNumBuckets = 16, kBucketSize = 16 };
 
-    const T& operator[](size_t index) const {
-        if (index >= size()) {
-            return mDefault;
-        }
-
-        uint8_t bucketIndex = static_cast<uint8_t>(index) >> 4;
-        T* bucket = mBuckets[bucketIndex];
-        if (bucket == NULL) {
-            return mDefault;
-        }
-        return bucket[0x0f & static_cast<uint8_t>(index)];
-    }
-
-    T& editItemAt(size_t index) {
-        ALOG_ASSERT(index < size(), "ByteBucketArray.getOrCreate(index=%u) with size=%u",
-                (uint32_t) index, (uint32_t) size());
-
-        uint8_t bucketIndex = static_cast<uint8_t>(index) >> 4;
-        T* bucket = mBuckets[bucketIndex];
-        if (bucket == NULL) {
-            bucket = mBuckets[bucketIndex] = new T[BUCKET_SIZE]();
-        }
-        return bucket[0x0f & static_cast<uint8_t>(index)];
-    }
-
-    bool set(size_t index, const T& value) {
-        if (index >= size()) {
-            return false;
-        }
-
-        editItemAt(index) = value;
-        return true;
-    }
-
-private:
-    enum { NUM_BUCKETS = 16, BUCKET_SIZE = 16 };
-
-    T*  mBuckets[NUM_BUCKETS];
-    T   mDefault;
+  T* buckets_[kNumBuckets];
+  T default_;
 };
 
-} // namespace android
+}  // namespace android
 
-#endif // __BYTE_BUCKET_ARRAY_H
+#endif  // __BYTE_BUCKET_ARRAY_H
diff --git a/libs/androidfw/include/androidfw/LoadedArsc.h b/libs/androidfw/include/androidfw/LoadedArsc.h
new file mode 100644
index 0000000..e2e56c8
--- /dev/null
+++ b/libs/androidfw/include/androidfw/LoadedArsc.h
@@ -0,0 +1,83 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef LOADEDARSC_H_
+#define LOADEDARSC_H_
+
+#include <memory>
+#include <vector>
+
+#include "android-base/macros.h"
+
+#include "androidfw/ResourceTypes.h"
+
+namespace android {
+
+class Chunk;
+class LoadedPackage;
+
+// Read-only view into a resource table. This class validates all data
+// when loading, including offsets and lengths.
+class LoadedArsc {
+ public:
+  // Load the resource table from memory. The data's lifetime must out-live the
+  // object returned from this method.
+  static std::unique_ptr<LoadedArsc> Load(const void* data, size_t len);
+
+  ~LoadedArsc();
+
+  // Returns the string pool where all string resource values
+  // (Res_value::dataType == Res_value::TYPE_STRING) are indexed.
+  inline const ResStringPool* GetStringPool() const { return &global_string_pool_; }
+
+  struct Entry {
+    // A pointer to the resource table entry for this resource.
+    // If the size of the entry is > sizeof(ResTable_entry), it can be cast to
+    // a ResTable_map_entry and processed as a bag/map.
+    const ResTable_entry* entry = nullptr;
+
+    // The string pool reference to the type's name. This uses a different string pool than
+    // the global string pool, but this is hidden from the caller.
+    StringPoolRef type_string_ref;
+
+    // The string pool reference to the entry's name. This uses a different string pool than
+    // the global string pool, but this is hidden from the caller.
+    StringPoolRef entry_string_ref;
+  };
+
+  // Finds the resource with ID `resid` with the best value for configuration `config`.
+  // The parameter `out_entry` will be filled with the resulting resource entry.
+  // The resource entry can be a simple entry (ResTable_entry) or a complex bag
+  // (ResTable_entry_map).
+  bool FindEntry(uint32_t resid, const ResTable_config& config, Entry* out_entry,
+                 ResTable_config* selected_config, uint32_t* out_flags) const;
+
+  // Gets a pointer to the name of the package in `resid`, or nullptr if the package doesn't exist.
+  const std::string* GetPackageNameForId(uint32_t resid) const;
+
+ private:
+  DISALLOW_COPY_AND_ASSIGN(LoadedArsc);
+
+  LoadedArsc() = default;
+  bool LoadTable(const Chunk& chunk);
+
+  ResStringPool global_string_pool_;
+  std::vector<std::unique_ptr<LoadedPackage>> packages_;
+};
+
+}  // namespace android
+
+#endif /* LOADEDARSC_H_ */
diff --git a/libs/androidfw/include/androidfw/ResourceTypes.h b/libs/androidfw/include/androidfw/ResourceTypes.h
index 33b91b9..c118b57 100644
--- a/libs/androidfw/include/androidfw/ResourceTypes.h
+++ b/libs/androidfw/include/androidfw/ResourceTypes.h
@@ -265,7 +265,7 @@
     uint8_t res0;
         
     // Type of the data value.
-    enum {
+    enum : uint8_t {
         // The 'data' is either 0 or 1, specifying this resource is either
         // undefined or empty, respectively.
         TYPE_NULL = 0x00,
diff --git a/libs/androidfw/include/androidfw/Util.h b/libs/androidfw/include/androidfw/Util.h
new file mode 100644
index 0000000..5266d09
--- /dev/null
+++ b/libs/androidfw/include/androidfw/Util.h
@@ -0,0 +1,127 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef UTIL_H_
+#define UTIL_H_
+
+#include <cstdlib>
+#include <memory>
+
+#include "android-base/macros.h"
+
+namespace android {
+namespace util {
+
+/**
+ * Makes a std::unique_ptr<> with the template parameter inferred by the
+ * compiler.
+ * This will be present in C++14 and can be removed then.
+ */
+template <typename T, class... Args>
+std::unique_ptr<T> make_unique(Args&&... args) {
+  return std::unique_ptr<T>(new T{std::forward<Args>(args)...});
+}
+
+// Based on std::unique_ptr, but uses free() to release malloc'ed memory
+// without incurring the size increase of holding on to a custom deleter.
+template <typename T>
+class unique_cptr {
+ public:
+  using pointer = typename std::add_pointer<T>::type;
+
+  constexpr unique_cptr() : ptr_(nullptr) {}
+  constexpr unique_cptr(std::nullptr_t) : ptr_(nullptr) {}
+  explicit unique_cptr(pointer ptr) : ptr_(ptr) {}
+  unique_cptr(unique_cptr&& o) : ptr_(o.ptr_) { o.ptr_ = nullptr; }
+
+  ~unique_cptr() { std::free(reinterpret_cast<void*>(ptr_)); }
+
+  inline unique_cptr& operator=(unique_cptr&& o) {
+    if (&o == this) {
+      return *this;
+    }
+
+    std::free(reinterpret_cast<void*>(ptr_));
+    ptr_ = o.ptr_;
+    o.ptr_ = nullptr;
+    return *this;
+  }
+
+  inline unique_cptr& operator=(std::nullptr_t) {
+    std::free(reinterpret_cast<void*>(ptr_));
+    ptr_ = nullptr;
+    return *this;
+  }
+
+  pointer release() {
+    pointer result = ptr_;
+    ptr_ = nullptr;
+    return result;
+  }
+
+  inline pointer get() const { return ptr_; }
+
+  void reset(pointer ptr = pointer()) {
+    if (ptr == ptr_) {
+      return;
+    }
+
+    pointer old_ptr = ptr_;
+    ptr_ = ptr;
+    std::free(reinterpret_cast<void*>(old_ptr));
+  }
+
+  inline void swap(unique_cptr& o) { std::swap(ptr_, o.ptr_); }
+
+  inline explicit operator bool() const { return ptr_ != nullptr; }
+
+  inline typename std::add_lvalue_reference<T>::type operator*() const { return *ptr_; }
+
+  inline pointer operator->() const { return ptr_; }
+
+  inline bool operator==(const unique_cptr& o) const { return ptr_ == o.ptr_; }
+
+  inline bool operator==(std::nullptr_t) const { return ptr_ == nullptr; }
+
+ private:
+  DISALLOW_COPY_AND_ASSIGN(unique_cptr);
+
+  pointer ptr_;
+};
+
+inline uint8_t get_package_id(uint32_t resid) {
+  return static_cast<uint8_t>((resid >> 24) & 0x000000ffu);
+}
+
+// The type ID is 1-based, so if the returned value is 0 it is invalid.
+inline uint8_t get_type_id(uint32_t resid) {
+  return static_cast<uint8_t>((resid >> 16) & 0x000000ffu);
+}
+
+inline uint16_t get_entry_id(uint32_t resid) { return static_cast<uint16_t>(resid & 0x0000ffffu); }
+
+inline bool is_internal_id(uint32_t resid) {
+  return (resid & 0xffff0000u) != 0 && (resid & 0x00ff0000u) == 0;
+}
+
+inline bool is_valid_resid(uint32_t resid) {
+  return (resid & 0x00ff0000u) != 0 && (resid & 0xff000000u) != 0;
+}
+
+}  // namespace util
+}  // namespace android
+
+#endif /* UTIL_H_ */
diff --git a/libs/androidfw/tests/Android.mk b/libs/androidfw/tests/Android.mk
index d91a133..6754cd8 100644
--- a/libs/androidfw/tests/Android.mk
+++ b/libs/androidfw/tests/Android.mk
@@ -21,22 +21,31 @@
 LOCAL_PATH:= $(call my-dir)
 
 testFiles := \
+    ApkAssets_test.cpp \
     AppAsLib_test.cpp \
     Asset_test.cpp \
+    AssetManager2_test.cpp \
     AttributeFinder_test.cpp \
     AttributeResolution_test.cpp \
     ByteBucketArray_test.cpp \
     Config_test.cpp \
     ConfigLocale_test.cpp \
     Idmap_test.cpp \
-    Main.cpp \
+    LoadedArsc_test.cpp \
     ResTable_test.cpp \
     Split_test.cpp \
     TestHelpers.cpp \
+    TestMain.cpp \
     Theme_test.cpp \
     TypeWrappers_test.cpp \
     ZipUtils_test.cpp
 
+benchmarkFiles := \
+    AssetManager2_bench.cpp \
+    BenchMain.cpp \
+    TestHelpers.cpp \
+    Theme_bench.cpp
+
 androidfw_test_cflags := \
     -Wall \
     -Werror \
@@ -89,5 +98,25 @@
 LOCAL_PICKUP_FILES := $(LOCAL_PATH)/data
 
 include $(BUILD_NATIVE_TEST)
+
+# ==========================================================
+# Build the device benchmarks: libandroidfw_benchmarks
+# ==========================================================
+include $(CLEAR_VARS)
+
+LOCAL_MODULE := libandroidfw_benchmarks
+LOCAL_CFLAGS := $(androidfw_test_cflags)
+LOCAL_SRC_FILES := $(benchmarkFiles)
+LOCAL_STATIC_LIBRARIES := \
+    libgoogle-benchmark
+LOCAL_SHARED_LIBRARIES := \
+    libandroidfw \
+    libbase \
+    libcutils \
+    libutils \
+    libziparchive
+LOCAL_PICKUP_FILES := $(LOCAL_PATH)/data
+
+include $(BUILD_NATIVE_TEST)
 endif # Not SDK_ONLY
 
diff --git a/libs/androidfw/tests/ApkAssets_test.cpp b/libs/androidfw/tests/ApkAssets_test.cpp
new file mode 100644
index 0000000..3a1fc8f
--- /dev/null
+++ b/libs/androidfw/tests/ApkAssets_test.cpp
@@ -0,0 +1,34 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "androidfw/ApkAssets.h"
+
+#include "TestHelpers.h"
+#include "data/basic/R.h"
+
+using com::android::basic::R;
+
+namespace android {
+
+TEST(ApkAssetsTest, LoadApk) {
+  std::unique_ptr<ApkAssets> loaded_apk = ApkAssets::Load(GetTestDataPath() + "/basic/basic.apk");
+  ASSERT_NE(nullptr, loaded_apk);
+
+  std::unique_ptr<Asset> asset = loaded_apk->Open("res/layout/main.xml");
+  ASSERT_NE(nullptr, asset);
+}
+
+}  // namespace android
diff --git a/libs/androidfw/tests/AssetManager2_bench.cpp b/libs/androidfw/tests/AssetManager2_bench.cpp
new file mode 100644
index 0000000..9ff9478
--- /dev/null
+++ b/libs/androidfw/tests/AssetManager2_bench.cpp
@@ -0,0 +1,228 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "benchmark/benchmark.h"
+
+#include "androidfw/ApkAssets.h"
+#include "androidfw/AssetManager.h"
+#include "androidfw/AssetManager2.h"
+#include "androidfw/ResourceTypes.h"
+
+#include "TestHelpers.h"
+#include "data/basic/R.h"
+#include "data/styles/R.h"
+
+namespace basic = com::android::basic;
+namespace app = com::android::app;
+
+namespace android {
+
+constexpr const static char* kFrameworkPath = "/system/framework/framework-res.apk";
+
+static void BM_AssetManagerLoadAssets(benchmark::State& state) {
+  std::string path = GetTestDataPath() + "/basic/basic.apk";
+  while (state.KeepRunning()) {
+    std::unique_ptr<ApkAssets> apk = ApkAssets::Load(path);
+    AssetManager2 assets;
+    assets.SetApkAssets({apk.get()});
+  }
+}
+BENCHMARK(BM_AssetManagerLoadAssets);
+
+static void BM_AssetManagerLoadAssetsOld(benchmark::State& state) {
+  String8 path((GetTestDataPath() + "/basic/basic.apk").data());
+  while (state.KeepRunning()) {
+    AssetManager assets;
+    assets.addAssetPath(path, nullptr /* cookie */, false /* appAsLib */,
+                        false /* isSystemAsset */);
+
+    // Force creation.
+    assets.getResources(true);
+  }
+}
+BENCHMARK(BM_AssetManagerLoadAssetsOld);
+
+static void BM_AssetManagerLoadFrameworkAssets(benchmark::State& state) {
+  std::string path = kFrameworkPath;
+  while (state.KeepRunning()) {
+    std::unique_ptr<ApkAssets> apk = ApkAssets::Load(path);
+    AssetManager2 assets;
+    assets.SetApkAssets({apk.get()});
+  }
+}
+BENCHMARK(BM_AssetManagerLoadFrameworkAssets);
+
+static void BM_AssetManagerLoadFrameworkAssetsOld(benchmark::State& state) {
+  String8 path(kFrameworkPath);
+  while (state.KeepRunning()) {
+    AssetManager assets;
+    assets.addAssetPath(path, nullptr /* cookie */, false /* appAsLib */,
+                        false /* isSystemAsset */);
+
+    // Force creation.
+    assets.getResources(true);
+  }
+}
+BENCHMARK(BM_AssetManagerLoadFrameworkAssetsOld);
+
+static void BM_AssetManagerGetResource(benchmark::State& state) {
+  std::unique_ptr<ApkAssets> apk = ApkAssets::Load(GetTestDataPath() + "/basic/basic.apk");
+  if (apk == nullptr) {
+    state.SkipWithError("Failed to load assets");
+    return;
+  }
+
+  AssetManager2 assets;
+  assets.SetApkAssets({apk.get()});
+
+  Res_value value;
+  ResTable_config selected_config;
+  uint32_t flags;
+
+  while (state.KeepRunning()) {
+    assets.GetResource(basic::R::integer::number1, false /* may_be_bag */,
+                       0u /* density_override */, &value, &selected_config, &flags);
+  }
+}
+BENCHMARK(BM_AssetManagerGetResource);
+
+static void BM_AssetManagerGetResourceOld(benchmark::State& state) {
+  AssetManager assets;
+  if (!assets.addAssetPath(String8((GetTestDataPath() + "/basic/basic.apk").data()),
+                           nullptr /* cookie */, false /* appAsLib */,
+                           false /* isSystemAssets */)) {
+    state.SkipWithError("Failed to load assets");
+    return;
+  }
+
+  const ResTable& table = assets.getResources(true);
+
+  Res_value value;
+  ResTable_config selected_config;
+  uint32_t flags;
+
+  while (state.KeepRunning()) {
+    table.getResource(basic::R::integer::number1, &value, false /* may_be_bag */,
+                      0u /* density_override */, &flags, &selected_config);
+  }
+}
+BENCHMARK(BM_AssetManagerGetResourceOld);
+
+constexpr static const uint32_t kStringOkId = 0x0104000au;
+
+static void BM_AssetManagerGetResourceFrameworkLocale(benchmark::State& state) {
+  std::unique_ptr<ApkAssets> apk = ApkAssets::Load(kFrameworkPath);
+  if (apk == nullptr) {
+    state.SkipWithError("Failed to load assets");
+    return;
+  }
+
+  AssetManager2 assets;
+  assets.SetApkAssets({apk.get()});
+
+  ResTable_config config;
+  memset(&config, 0, sizeof(config));
+  memcpy(config.language, "fr", 2);
+  assets.SetConfiguration(config);
+
+  Res_value value;
+  ResTable_config selected_config;
+  uint32_t flags;
+
+  while (state.KeepRunning()) {
+    assets.GetResource(kStringOkId, false /* may_be_bag */, 0u /* density_override */, &value,
+                       &selected_config, &flags);
+  }
+}
+BENCHMARK(BM_AssetManagerGetResourceFrameworkLocale);
+
+static void BM_AssetManagerGetResourceFrameworkLocaleOld(benchmark::State& state) {
+  AssetManager assets;
+  if (!assets.addAssetPath(String8((GetTestDataPath() + "/basic/basic.apk").data()),
+                           nullptr /* cookie */, false /* appAsLib */,
+                           false /* isSystemAssets */)) {
+    state.SkipWithError("Failed to load assets");
+    return;
+  }
+
+  ResTable_config config;
+  memset(&config, 0, sizeof(config));
+  memcpy(config.language, "fr", 2);
+  assets.setConfiguration(config, nullptr);
+
+  const ResTable& table = assets.getResources(true);
+
+  Res_value value;
+  ResTable_config selected_config;
+  uint32_t flags;
+
+  while (state.KeepRunning()) {
+    table.getResource(kStringOkId, &value, false /* may_be_bag */, 0u /* density_override */,
+                      &flags, &selected_config);
+  }
+}
+BENCHMARK(BM_AssetManagerGetResourceFrameworkLocaleOld);
+
+static void BM_AssetManagerGetBag(benchmark::State& state) {
+  std::unique_ptr<ApkAssets> apk = ApkAssets::Load(GetTestDataPath() + "/styles/styles.apk");
+  if (apk == nullptr) {
+    state.SkipWithError("Failed to load assets");
+    return;
+  }
+
+  AssetManager2 assets;
+  assets.SetApkAssets({apk.get()});
+
+  while (state.KeepRunning()) {
+    const ResolvedBag* bag = assets.GetBag(app::R::style::StyleTwo);
+    const auto bag_end = end(bag);
+    for (auto iter = begin(bag); iter != bag_end; ++iter) {
+      uint32_t key = iter->key;
+      Res_value value = iter->value;
+      benchmark::DoNotOptimize(key);
+      benchmark::DoNotOptimize(value);
+    }
+  }
+}
+BENCHMARK(BM_AssetManagerGetBag);
+
+static void BM_AssetManagerGetBagOld(benchmark::State& state) {
+  AssetManager assets;
+  if (!assets.addAssetPath(String8((GetTestDataPath() + "/styles/styles.apk").data()),
+                           nullptr /* cookie */, false /* appAsLib */,
+                           false /* isSystemAssets */)) {
+    state.SkipWithError("Failed to load assets");
+    return;
+  }
+
+  const ResTable& table = assets.getResources(true);
+
+  while (state.KeepRunning()) {
+    const ResTable::bag_entry* bag_begin;
+    const ssize_t N = table.lockBag(app::R::style::StyleTwo, &bag_begin);
+    const ResTable::bag_entry* const bag_end = bag_begin + N;
+    for (auto iter = bag_begin; iter != bag_end; ++iter) {
+      uint32_t key = iter->map.name.ident;
+      Res_value value = iter->map.value;
+      benchmark::DoNotOptimize(key);
+      benchmark::DoNotOptimize(value);
+    }
+    table.unlockBag(bag_begin);
+  }
+}
+BENCHMARK(BM_AssetManagerGetBagOld);
+
+}  // namespace android
diff --git a/libs/androidfw/tests/AssetManager2_test.cpp b/libs/androidfw/tests/AssetManager2_test.cpp
new file mode 100644
index 0000000..39c5381
--- /dev/null
+++ b/libs/androidfw/tests/AssetManager2_test.cpp
@@ -0,0 +1,190 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "androidfw/AssetManager2.h"
+#include "androidfw/AssetManager.h"
+
+#include "android-base/logging.h"
+
+#include "TestHelpers.h"
+#include "data/basic/R.h"
+#include "data/styles/R.h"
+
+namespace basic = com::android::basic;
+namespace app = com::android::app;
+
+namespace android {
+
+class AssetManager2Test : public ::testing::Test {
+ public:
+  void SetUp() override {
+    basic_assets_ = ApkAssets::Load(GetTestDataPath() + "/basic/basic.apk");
+    ASSERT_NE(nullptr, basic_assets_);
+
+    basic_de_fr_assets_ = ApkAssets::Load(GetTestDataPath() + "/basic/basic_de_fr.apk");
+    ASSERT_NE(nullptr, basic_de_fr_assets_);
+
+    style_assets_ = ApkAssets::Load(GetTestDataPath() + "/styles/styles.apk");
+    ASSERT_NE(nullptr, style_assets_);
+  }
+
+ protected:
+  std::unique_ptr<ApkAssets> basic_assets_;
+  std::unique_ptr<ApkAssets> basic_de_fr_assets_;
+  std::unique_ptr<ApkAssets> style_assets_;
+};
+
+TEST_F(AssetManager2Test, FindsResourcesFromSingleApkAssets) {
+  ResTable_config desired_config;
+  memset(&desired_config, 0, sizeof(desired_config));
+  desired_config.language[0] = 'd';
+  desired_config.language[1] = 'e';
+
+  AssetManager2 assetmanager;
+  assetmanager.SetConfiguration(desired_config);
+  assetmanager.SetApkAssets({basic_assets_.get()});
+
+  Res_value value;
+  ResTable_config selected_config;
+  uint32_t flags;
+
+  ApkAssetsCookie cookie =
+      assetmanager.GetResource(basic::R::string::test1, false /*may_be_bag*/,
+                               0 /*density_override*/, &value, &selected_config, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+
+  // Came from our ApkAssets.
+  EXPECT_EQ(0, cookie);
+
+  // It is the default config.
+  EXPECT_EQ(0, selected_config.language[0]);
+  EXPECT_EQ(0, selected_config.language[1]);
+
+  // It is a string.
+  EXPECT_EQ(Res_value::TYPE_STRING, value.dataType);
+}
+
+TEST_F(AssetManager2Test, FindsResourcesFromMultipleApkAssets) {
+  ResTable_config desired_config;
+  memset(&desired_config, 0, sizeof(desired_config));
+  desired_config.language[0] = 'd';
+  desired_config.language[1] = 'e';
+
+  AssetManager2 assetmanager;
+  assetmanager.SetConfiguration(desired_config);
+  assetmanager.SetApkAssets({basic_assets_.get(), basic_de_fr_assets_.get()});
+
+  Res_value value;
+  ResTable_config selected_config;
+  uint32_t flags;
+
+  ApkAssetsCookie cookie =
+      assetmanager.GetResource(basic::R::string::test1, false /*may_be_bag*/,
+                               0 /*density_override*/, &value, &selected_config, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+
+  // Came from our de_fr ApkAssets.
+  EXPECT_EQ(1, cookie);
+
+  // The configuration is german.
+  EXPECT_EQ('d', selected_config.language[0]);
+  EXPECT_EQ('e', selected_config.language[1]);
+
+  // It is a string.
+  EXPECT_EQ(Res_value::TYPE_STRING, value.dataType);
+}
+
+TEST_F(AssetManager2Test, FindsBagResourcesFromSingleApkAssets) {
+  AssetManager2 assetmanager;
+  assetmanager.SetApkAssets({basic_assets_.get()});
+
+  const ResolvedBag* bag = assetmanager.GetBag(basic::R::array::integerArray1);
+  ASSERT_NE(nullptr, bag);
+  ASSERT_EQ(3u, bag->entry_count);
+
+  EXPECT_EQ(static_cast<uint8_t>(Res_value::TYPE_INT_DEC), bag->entries[0].value.dataType);
+  EXPECT_EQ(1u, bag->entries[0].value.data);
+  EXPECT_EQ(0, bag->entries[0].cookie);
+
+  EXPECT_EQ(static_cast<uint8_t>(Res_value::TYPE_INT_DEC), bag->entries[1].value.dataType);
+  EXPECT_EQ(2u, bag->entries[1].value.data);
+  EXPECT_EQ(0, bag->entries[1].cookie);
+
+  EXPECT_EQ(static_cast<uint8_t>(Res_value::TYPE_INT_DEC), bag->entries[2].value.dataType);
+  EXPECT_EQ(3u, bag->entries[2].value.data);
+  EXPECT_EQ(0, bag->entries[2].cookie);
+}
+
+TEST_F(AssetManager2Test, MergesStylesWithParentFromSingleApkAssets) {
+  AssetManager2 assetmanager;
+  assetmanager.SetApkAssets({style_assets_.get()});
+
+  const ResolvedBag* bag_one = assetmanager.GetBag(app::R::style::StyleOne);
+  ASSERT_NE(nullptr, bag_one);
+  ASSERT_EQ(2u, bag_one->entry_count);
+
+  EXPECT_EQ(app::R::attr::attr_one, bag_one->entries[0].key);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, bag_one->entries[0].value.dataType);
+  EXPECT_EQ(1u, bag_one->entries[0].value.data);
+  EXPECT_EQ(0, bag_one->entries[0].cookie);
+
+  EXPECT_EQ(app::R::attr::attr_two, bag_one->entries[1].key);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, bag_one->entries[1].value.dataType);
+  EXPECT_EQ(2u, bag_one->entries[1].value.data);
+  EXPECT_EQ(0, bag_one->entries[1].cookie);
+
+  const ResolvedBag* bag_two = assetmanager.GetBag(app::R::style::StyleTwo);
+  ASSERT_NE(nullptr, bag_two);
+  ASSERT_EQ(5u, bag_two->entry_count);
+
+  // attr_one is inherited from StyleOne.
+  EXPECT_EQ(app::R::attr::attr_one, bag_two->entries[0].key);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, bag_two->entries[0].value.dataType);
+  EXPECT_EQ(1u, bag_two->entries[0].value.data);
+  EXPECT_EQ(0, bag_two->entries[0].cookie);
+
+  // attr_two should be overridden from StyleOne by StyleTwo.
+  EXPECT_EQ(app::R::attr::attr_two, bag_two->entries[1].key);
+  EXPECT_EQ(Res_value::TYPE_STRING, bag_two->entries[1].value.dataType);
+  EXPECT_EQ(0, bag_two->entries[1].cookie);
+  EXPECT_EQ(std::string("string"), GetStringFromPool(assetmanager.GetStringPoolForCookie(0),
+                                                     bag_two->entries[1].value.data));
+
+  // The rest are new attributes.
+
+  EXPECT_EQ(app::R::attr::attr_three, bag_two->entries[2].key);
+  EXPECT_EQ(Res_value::TYPE_ATTRIBUTE, bag_two->entries[2].value.dataType);
+  EXPECT_EQ(app::R::attr::attr_indirect, bag_two->entries[2].value.data);
+  EXPECT_EQ(0, bag_two->entries[2].cookie);
+
+  EXPECT_EQ(app::R::attr::attr_five, bag_two->entries[3].key);
+  EXPECT_EQ(Res_value::TYPE_REFERENCE, bag_two->entries[3].value.dataType);
+  EXPECT_EQ(app::R::string::string_one, bag_two->entries[3].value.data);
+  EXPECT_EQ(0, bag_two->entries[3].cookie);
+
+  EXPECT_EQ(app::R::attr::attr_indirect, bag_two->entries[4].key);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, bag_two->entries[4].value.dataType);
+  EXPECT_EQ(3u, bag_two->entries[4].value.data);
+  EXPECT_EQ(0, bag_two->entries[4].cookie);
+}
+
+TEST_F(AssetManager2Test, FindsBagResourcesFromMultipleApkAssets) {}
+
+TEST_F(AssetManager2Test, OpensFileFromSingleApkAssets) {}
+
+TEST_F(AssetManager2Test, OpensFileFromMultipleApkAssets) {}
+
+}  // namespace android
diff --git a/libs/androidfw/tests/AttributeResolution_test.cpp b/libs/androidfw/tests/AttributeResolution_test.cpp
index 7550517..1ff2ed4 100644
--- a/libs/androidfw/tests/AttributeResolution_test.cpp
+++ b/libs/androidfw/tests/AttributeResolution_test.cpp
@@ -205,4 +205,5 @@
   EXPECT_EQ(public_flag, values_cursor[STYLE_CHANGING_CONFIGURATIONS]);
 }
 
-}  // namespace android
+} // namespace android
+
diff --git a/libs/androidfw/tests/BenchMain.cpp b/libs/androidfw/tests/BenchMain.cpp
new file mode 100644
index 0000000..105c5f9
--- /dev/null
+++ b/libs/androidfw/tests/BenchMain.cpp
@@ -0,0 +1,31 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <iostream>
+
+#include "benchmark/benchmark.h"
+
+#include "TestHelpers.h"
+
+int main(int argc, char** argv) {
+  ::benchmark::Initialize(&argc, argv);
+  ::android::InitializeTest(&argc, argv);
+
+  std::cerr << "using --testdata=" << ::android::GetTestDataPath() << "\n";
+
+  size_t result = ::benchmark::RunSpecifiedBenchmarks();
+  return result == 0 ? 1 : 0;
+}
diff --git a/libs/androidfw/tests/LoadedArsc_test.cpp b/libs/androidfw/tests/LoadedArsc_test.cpp
new file mode 100644
index 0000000..47b3894
--- /dev/null
+++ b/libs/androidfw/tests/LoadedArsc_test.cpp
@@ -0,0 +1,82 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "androidfw/LoadedArsc.h"
+
+#include "android-base/file.h"
+#include "android-base/logging.h"
+#include "android-base/macros.h"
+
+#include "TestHelpers.h"
+#include "data/basic/R.h"
+#include "data/styles/R.h"
+
+namespace app = com::android::app;
+namespace basic = com::android::basic;
+
+namespace android {
+
+TEST(LoadedArscTest, LoadSinglePackageArsc) {
+  base::ScopedLogSeverity _log(base::LogSeverity::DEBUG);
+  std::string contents;
+  ASSERT_TRUE(ReadFileFromZipToString(GetTestDataPath() + "/styles/styles.apk", "resources.arsc",
+                                      &contents));
+
+  std::unique_ptr<LoadedArsc> loaded_arsc = LoadedArsc::Load(contents.data(), contents.size());
+  ASSERT_NE(nullptr, loaded_arsc);
+
+  ResTable_config config;
+  memset(&config, 0, sizeof(config));
+  config.sdkVersion = 24;
+
+  LoadedArsc::Entry entry;
+  ResTable_config selected_config;
+  uint32_t flags;
+
+  ASSERT_TRUE(
+      loaded_arsc->FindEntry(app::R::string::string_one, config, &entry, &selected_config, &flags));
+  ASSERT_NE(nullptr, entry.entry);
+}
+
+TEST(LoadedArscTest, FindDefaultEntry) {
+  base::ScopedLogSeverity _log(base::LogSeverity::DEBUG);
+  std::string contents;
+  ASSERT_TRUE(
+      ReadFileFromZipToString(GetTestDataPath() + "/basic/basic.apk", "resources.arsc", &contents));
+
+  std::unique_ptr<LoadedArsc> loaded_arsc = LoadedArsc::Load(contents.data(), contents.size());
+  ASSERT_NE(nullptr, loaded_arsc);
+
+  ResTable_config desired_config;
+  memset(&desired_config, 0, sizeof(desired_config));
+  desired_config.language[0] = 'd';
+  desired_config.language[1] = 'e';
+
+  LoadedArsc::Entry entry;
+  ResTable_config selected_config;
+  uint32_t flags;
+
+  ASSERT_TRUE(loaded_arsc->FindEntry(basic::R::string::test1, desired_config, &entry,
+                                     &selected_config, &flags));
+  ASSERT_NE(nullptr, entry.entry);
+}
+
+// structs with size fields (like Res_value, ResTable_entry) should be
+// backwards and forwards compatible (aka checking the size field against
+// sizeof(Res_value) might not be backwards compatible.
+TEST(LoadedArscTest, LoadingShouldBeForwardsAndBackwardsCompatible) { ASSERT_TRUE(false); }
+
+}  // namespace android
diff --git a/libs/androidfw/tests/Main.cpp b/libs/androidfw/tests/Main.cpp
deleted file mode 100644
index 6a50691..0000000
--- a/libs/androidfw/tests/Main.cpp
+++ /dev/null
@@ -1,69 +0,0 @@
-/*
- * Copyright (C) 2016 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include <libgen.h>
-
-#include <iostream>
-#include <memory>
-#include <string>
-
-#include "android-base/file.h"
-#include "android-base/strings.h"
-#include "gtest/gtest.h"
-
-#include "TestHelpers.h"
-
-// Extract the directory of the current executable path.
-static std::string GetExecutableDir() {
-  const std::string path = android::base::GetExecutablePath();
-  std::unique_ptr<char, decltype(&std::free)> mutable_path = {
-      strdup(path.c_str()), std::free};
-  std::string executable_dir = dirname(mutable_path.get());
-  return executable_dir;
-}
-
-int main(int argc, char** argv) {
-  ::testing::InitGoogleTest(&argc, argv);
-
-  // Set the default test data path to be the executable path directory.
-  android::SetTestDataPath(GetExecutableDir());
-
-  const char* command = argv[0];
-  ++argv;
-  --argc;
-
-  while (argc > 0) {
-    const std::string arg = *argv;
-    if (android::base::StartsWith(arg, "--testdata=")) {
-      android::SetTestDataPath(arg.substr(strlen("--testdata=")));
-    } else if (arg == "-h" || arg == "--help") {
-      std::cerr
-          << "\nAdditional options specific to this test:\n"
-             "  --testdata=[PATH]\n"
-             "      Specify the location of test data used within the tests.\n";
-      return 1;
-    } else {
-      std::cerr << command << ": Unrecognized argument '" << *argv << "'.\n";
-      return 1;
-    }
-
-    --argc;
-    ++argv;
-  }
-
-  std::cerr << "using --testdata=" << android::GetTestDataPath() << "\n";
-  return RUN_ALL_TESTS();
-}
diff --git a/libs/androidfw/tests/TestHelpers.cpp b/libs/androidfw/tests/TestHelpers.cpp
index 2c834b1..1e763a5 100644
--- a/libs/androidfw/tests/TestHelpers.cpp
+++ b/libs/androidfw/tests/TestHelpers.cpp
@@ -16,15 +16,51 @@
 
 #include "TestHelpers.h"
 
+#include <libgen.h>
 #include <unistd.h>
 
+#include <memory>
+#include <string>
+
+#include "android-base/file.h"
 #include "android-base/logging.h"
+#include "android-base/strings.h"
 #include "ziparchive/zip_archive.h"
 
 namespace android {
 
 static std::string sTestDataPath;
 
+// Extract the directory of the current executable path.
+static std::string GetExecutableDir() {
+  const std::string path = base::GetExecutablePath();
+  std::unique_ptr<char, decltype(&std::free)> mutable_path = {strdup(path.c_str()), std::free};
+  std::string executable_dir = dirname(mutable_path.get());
+  return executable_dir;
+}
+
+void InitializeTest(int* argc, char** argv) {
+  // Set the default test data path to be the executable path directory.
+  SetTestDataPath(GetExecutableDir());
+
+  for (int i = 1; i < *argc; i++) {
+    const std::string arg = argv[i];
+    if (base::StartsWith(arg, "--testdata=")) {
+      SetTestDataPath(arg.substr(strlen("--testdata=")));
+      for (int j = i; j != *argc; j++) {
+        argv[j] = argv[j + 1];
+      }
+      --(*argc);
+      --i;
+    } else if (arg == "-h" || arg == "--help") {
+      std::cerr << "\nAdditional options specific to this test:\n"
+                   "  --testdata=[PATH]\n"
+                   "      Specify the location of test data used within the tests.\n";
+      exit(1);
+    }
+  }
+}
+
 void SetTestDataPath(const std::string& path) { sTestDataPath = path; }
 
 const std::string& GetTestDataPath() {
@@ -90,4 +126,9 @@
   return ::testing::AssertionSuccess() << actual_str.string();
 }
 
+std::string GetStringFromPool(const ResStringPool* pool, uint32_t idx) {
+  String8 str = pool->string8ObjectAt(idx);
+  return std::string(str.string(), str.length());
+}
+
 }  // namespace android
diff --git a/libs/androidfw/tests/TestHelpers.h b/libs/androidfw/tests/TestHelpers.h
index d9cee22..a11ea84 100644
--- a/libs/androidfw/tests/TestHelpers.h
+++ b/libs/androidfw/tests/TestHelpers.h
@@ -35,6 +35,8 @@
 
 namespace android {
 
+void InitializeTest(int* argc, char** argv);
+
 enum { MAY_NOT_BE_BAG = false };
 
 void SetTestDataPath(const std::string& path);
@@ -56,6 +58,8 @@
 ::testing::AssertionResult IsStringEqual(const ResTable& table, uint32_t resource_id,
                                          const char* expected_str);
 
+std::string GetStringFromPool(const ResStringPool* pool, uint32_t idx);
+
 }  // namespace android
 
 #endif  // TEST_HELPERS_H_
diff --git a/libs/androidfw/tests/TestMain.cpp b/libs/androidfw/tests/TestMain.cpp
new file mode 100644
index 0000000..d1c0f60
--- /dev/null
+++ b/libs/androidfw/tests/TestMain.cpp
@@ -0,0 +1,28 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <iostream>
+
+#include "TestHelpers.h"
+
+int main(int argc, char** argv) {
+  ::testing::InitGoogleTest(&argc, argv);
+  ::android::InitializeTest(&argc, argv);
+
+  std::cerr << "using --testdata=" << ::android::GetTestDataPath() << "\n";
+
+  return RUN_ALL_TESTS();
+}
diff --git a/libs/androidfw/tests/Theme_bench.cpp b/libs/androidfw/tests/Theme_bench.cpp
new file mode 100644
index 0000000..c471be6
--- /dev/null
+++ b/libs/androidfw/tests/Theme_bench.cpp
@@ -0,0 +1,99 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "benchmark/benchmark.h"
+
+#include "androidfw/ApkAssets.h"
+#include "androidfw/AssetManager.h"
+#include "androidfw/AssetManager2.h"
+#include "androidfw/ResourceTypes.h"
+
+namespace android {
+
+constexpr const static char* kFrameworkPath = "/system/framework/framework-res.apk";
+constexpr const static uint32_t kStyleId = 0x01030237u;  // android:style/Theme.Material.Light
+constexpr const static uint32_t kAttrId = 0x01010030u;   // android:attr/colorForeground
+
+static void BM_ThemeApplyStyleFramework(benchmark::State& state) {
+  std::unique_ptr<ApkAssets> apk = ApkAssets::Load(kFrameworkPath);
+  if (apk == nullptr) {
+    state.SkipWithError("Failed to load assets");
+    return;
+  }
+
+  AssetManager2 assets;
+  assets.SetApkAssets({apk.get()});
+
+  while (state.KeepRunning()) {
+    auto theme = assets.NewTheme();
+    theme->ApplyStyle(kStyleId, false /* force */);
+  }
+}
+BENCHMARK(BM_ThemeApplyStyleFramework);
+
+static void BM_ThemeApplyStyleFrameworkOld(benchmark::State& state) {
+  AssetManager assets;
+  if (!assets.addAssetPath(String8(kFrameworkPath), nullptr /* cookie */, false /* appAsLib */,
+                           true /* isSystemAsset */)) {
+    state.SkipWithError("Failed to load assets");
+    return;
+  }
+
+  const ResTable& res_table = assets.getResources(true);
+
+  while (state.KeepRunning()) {
+    std::unique_ptr<ResTable::Theme> theme{new ResTable::Theme(res_table)};
+    theme->applyStyle(kStyleId, false /* force */);
+  }
+}
+BENCHMARK(BM_ThemeApplyStyleFrameworkOld);
+
+static void BM_ThemeGetAttribute(benchmark::State& state) {
+  std::unique_ptr<ApkAssets> apk = ApkAssets::Load(kFrameworkPath);
+
+  AssetManager2 assets;
+  assets.SetApkAssets({apk.get()});
+
+  auto theme = assets.NewTheme();
+  theme->ApplyStyle(kStyleId, false /* force */);
+
+  Res_value value;
+  uint32_t flags;
+
+  while (state.KeepRunning()) {
+    theme->GetAttribute(kAttrId, &value, &flags);
+  }
+}
+BENCHMARK(BM_ThemeGetAttribute);
+
+static void BM_ThemeGetAttributeOld(benchmark::State& state) {
+  AssetManager assets;
+  assets.addAssetPath(String8(kFrameworkPath), nullptr /* cookie */, false /* appAsLib */,
+                      true /* isSystemAsset */);
+  const ResTable& res_table = assets.getResources(true);
+  std::unique_ptr<ResTable::Theme> theme{new ResTable::Theme(res_table)};
+  theme->applyStyle(kStyleId, false /* force */);
+
+  Res_value value;
+  uint32_t flags;
+
+  while (state.KeepRunning()) {
+    theme->getAttribute(kAttrId, &value, &flags);
+  }
+}
+BENCHMARK(BM_ThemeGetAttributeOld);
+
+}  // namespace android
diff --git a/libs/androidfw/tests/Theme_test.cpp b/libs/androidfw/tests/Theme_test.cpp
index 3774657..c0011b6d 100644
--- a/libs/androidfw/tests/Theme_test.cpp
+++ b/libs/androidfw/tests/Theme_test.cpp
@@ -1,5 +1,5 @@
 /*
- * Copyright (C) 2014 The Android Open Source Project
+ * Copyright (C) 2016 The Android Open Source Project
  *
  * Licensed under the Apache License, Version 2.0 (the "License");
  * you may not use this file except in compliance with the License.
@@ -14,59 +14,221 @@
  * limitations under the License.
  */
 
-#include "androidfw/ResourceTypes.h"
+#include "androidfw/AssetManager2.h"
 
-#include "utils/String16.h"
-#include "utils/String8.h"
+#include "android-base/logging.h"
 
 #include "TestHelpers.h"
-#include "data/app/R.h"
-#include "data/system/R.h"
+#include "data/styles/R.h"
 
 namespace app = com::android::app;
 
 namespace android {
 
-/**
- * TODO(adamlesinski): Enable when fixed.
- */
-TEST(ThemeTest, DISABLED_shouldCopyThemeFromDifferentResTable) {
-  ResTable table;
+class ThemeTest : public ::testing::Test {
+ public:
+  void SetUp() override {
+    style_assets_ = ApkAssets::Load(GetTestDataPath() + "/styles/styles.apk");
+    ASSERT_NE(nullptr, style_assets_);
+  }
 
-  std::string system_contents;
-  ASSERT_TRUE(ReadFileFromZipToString("/system/system.apk", "resources.arsc",
-                                      &system_contents));
-  ASSERT_EQ(NO_ERROR,
-            table.add(system_contents.data(), system_contents.size()));
+ protected:
+  std::unique_ptr<ApkAssets> style_assets_;
+};
 
-  std::string app_contents;
-  ASSERT_TRUE(ReadFileFromZipToString("/basic/basic.apk", "resources.arsc",
-                                      &app_contents));
-  ASSERT_EQ(NO_ERROR, table.add(app_contents.data(), app_contents.size()));
+TEST_F(ThemeTest, EmptyTheme) {
+  AssetManager2 assetmanager;
+  assetmanager.SetApkAssets({style_assets_.get()});
 
-  ResTable::Theme theme1(table);
-  ASSERT_EQ(NO_ERROR, theme1.applyStyle(app::R::style::Theme_One));
-  Res_value val;
-  ASSERT_GE(theme1.getAttribute(android::R::attr::background, &val), 0);
-  ASSERT_EQ(Res_value::TYPE_INT_COLOR_RGB8, val.dataType);
-  ASSERT_EQ(uint32_t(0xffff0000), val.data);
-  ASSERT_GE(theme1.getAttribute(app::R::attr::number, &val), 0);
-  ASSERT_EQ(Res_value::TYPE_INT_DEC, val.dataType);
-  ASSERT_EQ(uint32_t(1), val.data);
+  std::unique_ptr<Theme> theme = assetmanager.NewTheme();
+  EXPECT_EQ(0u, theme->GetChangingConfigurations());
+  EXPECT_EQ(&assetmanager, theme->GetAssetManager());
 
-  ResTable table2;
-  ASSERT_EQ(NO_ERROR,
-            table2.add(system_contents.data(), system_contents.size()));
-  ASSERT_EQ(NO_ERROR, table2.add(app_contents.data(), app_contents.size()));
+  Res_value value;
+  uint32_t flags;
+  EXPECT_EQ(kInvalidCookie, theme->GetAttribute(app::R::attr::attr_one, &value, &flags));
+}
 
-  ResTable::Theme theme2(table2);
-  ASSERT_EQ(NO_ERROR, theme2.setTo(theme1));
-  ASSERT_GE(theme2.getAttribute(android::R::attr::background, &val), 0);
-  ASSERT_EQ(Res_value::TYPE_INT_COLOR_RGB8, val.dataType);
-  ASSERT_EQ(uint32_t(0xffff0000), val.data);
-  ASSERT_GE(theme2.getAttribute(app::R::attr::number, &val), 0);
-  ASSERT_EQ(Res_value::TYPE_INT_DEC, val.dataType);
-  ASSERT_EQ(uint32_t(1), val.data);
+TEST_F(ThemeTest, SingleThemeNoParent) {
+  AssetManager2 assetmanager;
+  assetmanager.SetApkAssets({style_assets_.get()});
+
+  std::unique_ptr<Theme> theme = assetmanager.NewTheme();
+  ASSERT_TRUE(theme->ApplyStyle(app::R::style::StyleOne));
+
+  Res_value value;
+  uint32_t flags;
+  ApkAssetsCookie cookie;
+
+  cookie = theme->GetAttribute(app::R::attr::attr_one, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(1u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+
+  cookie = theme->GetAttribute(app::R::attr::attr_two, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(2u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+}
+
+TEST_F(ThemeTest, SingleThemeWithParent) {
+  AssetManager2 assetmanager;
+  assetmanager.SetApkAssets({style_assets_.get()});
+
+  std::unique_ptr<Theme> theme = assetmanager.NewTheme();
+  ASSERT_TRUE(theme->ApplyStyle(app::R::style::StyleTwo));
+
+  Res_value value;
+  uint32_t flags;
+  ApkAssetsCookie cookie;
+
+  cookie = theme->GetAttribute(app::R::attr::attr_one, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(1u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+
+  cookie = theme->GetAttribute(app::R::attr::attr_two, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_STRING, value.dataType);
+  EXPECT_EQ(0, cookie);
+  EXPECT_EQ(std::string("string"),
+            GetStringFromPool(assetmanager.GetStringPoolForCookie(0), value.data));
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+
+  // This attribute should point to an attr_indirect, so the result should be 3.
+  cookie = theme->GetAttribute(app::R::attr::attr_three, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(3u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+}
+
+TEST_F(ThemeTest, MultipleThemesOverlaidNotForce) {
+  AssetManager2 assetmanager;
+  assetmanager.SetApkAssets({style_assets_.get()});
+
+  std::unique_ptr<Theme> theme = assetmanager.NewTheme();
+  ASSERT_TRUE(theme->ApplyStyle(app::R::style::StyleTwo));
+  ASSERT_TRUE(theme->ApplyStyle(app::R::style::StyleThree));
+
+  Res_value value;
+  uint32_t flags;
+  ApkAssetsCookie cookie;
+
+  // attr_one is still here from the base.
+  cookie = theme->GetAttribute(app::R::attr::attr_one, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(1u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+
+  // check for the new attr_six
+  cookie = theme->GetAttribute(app::R::attr::attr_six, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(6u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+
+  // check for the old attr_five (force=true was not used).
+  cookie = theme->GetAttribute(app::R::attr::attr_five, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_REFERENCE, value.dataType);
+  EXPECT_EQ(app::R::string::string_one, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+}
+
+TEST_F(ThemeTest, MultipleThemesOverlaidForced) {
+  AssetManager2 assetmanager;
+  assetmanager.SetApkAssets({style_assets_.get()});
+
+  std::unique_ptr<Theme> theme = assetmanager.NewTheme();
+  ASSERT_TRUE(theme->ApplyStyle(app::R::style::StyleTwo));
+  ASSERT_TRUE(theme->ApplyStyle(app::R::style::StyleThree, true /* force */));
+
+  Res_value value;
+  uint32_t flags;
+  ApkAssetsCookie cookie;
+
+  // attr_one is still here from the base.
+  cookie = theme->GetAttribute(app::R::attr::attr_one, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(1u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+
+  // check for the new attr_six
+  cookie = theme->GetAttribute(app::R::attr::attr_six, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(6u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+
+  // check for the new attr_five (force=true was used).
+  cookie = theme->GetAttribute(app::R::attr::attr_five, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(5u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+}
+
+TEST_F(ThemeTest, CopyThemeSameAssetManager) {
+  AssetManager2 assetmanager;
+  assetmanager.SetApkAssets({style_assets_.get()});
+
+  std::unique_ptr<Theme> theme_one = assetmanager.NewTheme();
+  ASSERT_TRUE(theme_one->ApplyStyle(app::R::style::StyleOne));
+
+  Res_value value;
+  uint32_t flags;
+  ApkAssetsCookie cookie;
+
+  // attr_one is still here from the base.
+  cookie = theme_one->GetAttribute(app::R::attr::attr_one, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(1u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+
+  // attr_six is not here.
+  EXPECT_EQ(kInvalidCookie, theme_one->GetAttribute(app::R::attr::attr_six, &value, &flags));
+
+  std::unique_ptr<Theme> theme_two = assetmanager.NewTheme();
+  ASSERT_TRUE(theme_two->ApplyStyle(app::R::style::StyleThree));
+
+  // Copy the theme to theme_one.
+  ASSERT_TRUE(theme_one->SetTo(*theme_two));
+
+  // Clear theme_two to make sure we test that there WAS a copy.
+  theme_two->Clear();
+
+  // attr_one is now not here.
+  EXPECT_EQ(kInvalidCookie, theme_one->GetAttribute(app::R::attr::attr_one, &value, &flags));
+
+  // attr_six is now here because it was copied.
+  cookie = theme_one->GetAttribute(app::R::attr::attr_six, &value, &flags);
+  ASSERT_NE(kInvalidCookie, cookie);
+  EXPECT_EQ(Res_value::TYPE_INT_DEC, value.dataType);
+  EXPECT_EQ(6u, value.data);
+  EXPECT_EQ(static_cast<uint32_t>(ResTable_typeSpec::SPEC_PUBLIC), flags);
+}
+
+TEST_F(ThemeTest, FailToCopyThemeWithDifferentAssetManager) {
+  AssetManager2 assetmanager_one;
+  assetmanager_one.SetApkAssets({style_assets_.get()});
+
+  AssetManager2 assetmanager_two;
+  assetmanager_two.SetApkAssets({style_assets_.get()});
+
+  auto theme_one = assetmanager_one.NewTheme();
+  ASSERT_TRUE(theme_one->ApplyStyle(app::R::style::StyleOne));
+
+  auto theme_two = assetmanager_two.NewTheme();
+  ASSERT_TRUE(theme_two->ApplyStyle(app::R::style::StyleTwo));
+
+  EXPECT_FALSE(theme_one->SetTo(*theme_two));
 }
 
 }  // namespace android
diff --git a/libs/androidfw/tests/data/styles/R.h b/libs/androidfw/tests/data/styles/R.h
index 4127aa0..68527c7 100644
--- a/libs/androidfw/tests/data/styles/R.h
+++ b/libs/androidfw/tests/data/styles/R.h
@@ -32,6 +32,7 @@
       attr_four = 0x7f010003u,
       attr_five = 0x7f010004u,
       attr_indirect = 0x7f010005u,
+      attr_six = 0x7f010006u,
     };
   };
 
@@ -45,6 +46,7 @@
     enum : uint32_t {
       StyleOne = 0x7f020000u,
       StyleTwo = 0x7f020001u,
+      StyleThree = 0x7f020002u,
     };
   };
 };
diff --git a/libs/androidfw/tests/data/styles/res/values/styles.xml b/libs/androidfw/tests/data/styles/res/values/styles.xml
index 70c54f6..da592f8 100644
--- a/libs/androidfw/tests/data/styles/res/values/styles.xml
+++ b/libs/androidfw/tests/data/styles/res/values/styles.xml
@@ -39,6 +39,7 @@
     <public type="style" name="StyleOne" id="0x7f020000" />
     <style name="StyleOne">
         <item name="attr_one">1</item>
+        <item name="attr_two">2</item>
     </style>
 
     <public type="style" name="StyleTwo" id="0x7f020001" />
@@ -48,5 +49,14 @@
         <item name="attr_three">?attr/attr_indirect</item>
         <item name="attr_five">@string/string_one</item>
     </style>
+    
+    <public type="attr" name="attr_six" id="0x7f010006" />
+    <attr name="attr_six" />
+    
+    <public type="style" name="StyleThree" id="0x7f020002" />
+    <style name="StyleThree">
+        <item name="attr_six">6</item>
+        <item name="attr_five">5</item>
+    </style>
 
 </resources>
diff --git a/libs/androidfw/tests/data/styles/styles.apk b/libs/androidfw/tests/data/styles/styles.apk
index 6064c48..d4ccb83 100644
--- a/libs/androidfw/tests/data/styles/styles.apk
+++ b/libs/androidfw/tests/data/styles/styles.apk
Binary files differ
diff --git a/libs/hwui/DeferredLayerUpdater.cpp b/libs/hwui/DeferredLayerUpdater.cpp
index 3e8e8a1..0ae50e9 100644
--- a/libs/hwui/DeferredLayerUpdater.cpp
+++ b/libs/hwui/DeferredLayerUpdater.cpp
@@ -131,7 +131,7 @@
                         mLayer->getApi(), Layer::Api::OpenGL, Layer::Api::Vulkan);
 
     static const mat4 identityMatrix;
-    updateLayer(false, identityMatrix.data);
+    updateLayer(false, GL_NONE, identityMatrix.data);
 
     VkLayer* vkLayer = static_cast<VkLayer*>(mLayer);
     vkLayer->updateTexture();
@@ -139,26 +139,20 @@
 
 void DeferredLayerUpdater::updateLayer(bool forceFilter, GLenum renderTarget,
         const float* textureTransform) {
-    LOG_ALWAYS_FATAL_IF(mLayer->getApi() != Layer::Api::OpenGL,
-                        "updateLayer non GL backend %x, GL %x, VK %x",
-                        mLayer->getApi(), Layer::Api::OpenGL, Layer::Api::Vulkan);
-
-    updateLayer(forceFilter, textureTransform);
-
-    GlLayer* glLayer = static_cast<GlLayer*>(mLayer);
-    if (renderTarget != glLayer->getRenderTarget()) {
-        glLayer->setRenderTarget(renderTarget);
-        glLayer->bindTexture();
-        glLayer->setFilter(GL_NEAREST, false, true);
-        glLayer->setWrap(GL_CLAMP_TO_EDGE, false, true);
-    }
-}
-
-void DeferredLayerUpdater::updateLayer(bool forceFilter, const float* textureTransform) {
     mLayer->setBlend(mBlend);
     mLayer->setForceFilter(forceFilter);
     mLayer->setSize(mWidth, mHeight);
     mLayer->getTexTransform().load(textureTransform);
+
+    if (mLayer->getApi() == Layer::Api::OpenGL) {
+        GlLayer* glLayer = static_cast<GlLayer*>(mLayer);
+        if (renderTarget != glLayer->getRenderTarget()) {
+            glLayer->setRenderTarget(renderTarget);
+            glLayer->bindTexture();
+            glLayer->setFilter(GL_NEAREST, false, true);
+            glLayer->setWrap(GL_CLAMP_TO_EDGE, false, true);
+        }
+    }
 }
 
 void DeferredLayerUpdater::detachSurfaceTexture() {
diff --git a/libs/hwui/DeferredLayerUpdater.h b/libs/hwui/DeferredLayerUpdater.h
index ead8314..3814be2 100644
--- a/libs/hwui/DeferredLayerUpdater.h
+++ b/libs/hwui/DeferredLayerUpdater.h
@@ -114,7 +114,6 @@
 
     void doUpdateTexImage();
     void doUpdateVkTexImage();
-    void updateLayer(bool forceFilter, const float* textureTransform);
 };
 
 } /* namespace uirenderer */
diff --git a/libs/hwui/Properties.cpp b/libs/hwui/Properties.cpp
index 0702010..09e34bf 100644
--- a/libs/hwui/Properties.cpp
+++ b/libs/hwui/Properties.cpp
@@ -222,6 +222,12 @@
     return sRenderPipelineType;
 }
 
+#ifdef HWUI_GLES_WRAP_ENABLED
+void Properties::overrideRenderPipelineType(RenderPipelineType type) {
+    sRenderPipelineType = type;
+}
+#endif
+
 bool Properties::isSkiaEnabled() {
     auto renderType = getRenderPipelineType();
     return RenderPipelineType::SkiaGL == renderType
diff --git a/libs/hwui/Properties.h b/libs/hwui/Properties.h
index b4a3118..6dc0cb3 100644
--- a/libs/hwui/Properties.h
+++ b/libs/hwui/Properties.h
@@ -318,11 +318,15 @@
     // any overhead they add
     static bool filterOutTestOverhead;
 
+    // Used for testing only to change the render pipeline.
+#ifdef HWUI_GLES_WRAP_ENABLED
+    static void overrideRenderPipelineType(RenderPipelineType);
+#endif
+
 private:
     static ProfileType sProfileType;
     static bool sDisableProfileBars;
     static RenderPipelineType sRenderPipelineType;
-
 }; // class Caches
 
 }; // namespace uirenderer
diff --git a/libs/hwui/tests/common/TestUtils.cpp b/libs/hwui/tests/common/TestUtils.cpp
index 5f6bcb3..275ce16 100644
--- a/libs/hwui/tests/common/TestUtils.cpp
+++ b/libs/hwui/tests/common/TestUtils.cpp
@@ -21,6 +21,9 @@
 
 #include <renderthread/EglManager.h>
 #include <renderthread/OpenGLPipeline.h>
+#include <pipeline/skia/SkiaOpenGLPipeline.h>
+#include <pipeline/skia/SkiaVulkanPipeline.h>
+#include <renderthread/VulkanManager.h>
 #include <utils/Unicode.h>
 #include <SkClipStack.h>
 
@@ -47,10 +50,24 @@
 }
 
 sp<DeferredLayerUpdater> TestUtils::createTextureLayerUpdater(
+        renderthread::RenderThread& renderThread) {
+    android::uirenderer::renderthread::IRenderPipeline* pipeline;
+    if (Properties::getRenderPipelineType() == RenderPipelineType::OpenGL) {
+        pipeline = new renderthread::OpenGLPipeline(renderThread);
+    } else if (Properties::getRenderPipelineType() == RenderPipelineType::SkiaGL) {
+        pipeline = new skiapipeline::SkiaOpenGLPipeline(renderThread);
+    } else {
+        pipeline = new skiapipeline::SkiaVulkanPipeline(renderThread);
+    }
+    sp<DeferredLayerUpdater> layerUpdater = pipeline->createTextureLayer();
+    delete pipeline;
+    return layerUpdater;
+}
+
+sp<DeferredLayerUpdater> TestUtils::createTextureLayerUpdater(
         renderthread::RenderThread& renderThread, uint32_t width, uint32_t height,
         const SkMatrix& transform) {
-    renderthread::OpenGLPipeline pipeline(renderThread);
-    sp<DeferredLayerUpdater> layerUpdater = pipeline.createTextureLayer();
+    sp<DeferredLayerUpdater> layerUpdater = createTextureLayerUpdater(renderThread);
     layerUpdater->backingLayer()->getTransform().load(transform);
     layerUpdater->setSize(width, height);
     layerUpdater->setTransform(&transform);
@@ -111,12 +128,20 @@
 void TestUtils::TestTask::run() {
     // RenderState only valid once RenderThread is running, so queried here
     renderthread::RenderThread& renderThread = renderthread::RenderThread::getInstance();
-    renderThread.eglManager().initialize();
+    if (Properties::getRenderPipelineType() == RenderPipelineType::SkiaVulkan) {
+        renderThread.vulkanManager().initialize();
+    } else {
+        renderThread.eglManager().initialize();
+    }
 
     rtCallback(renderThread);
 
-    renderThread.renderState().flush(Caches::FlushMode::Full);
-    renderThread.eglManager().destroy();
+    if (Properties::getRenderPipelineType() == RenderPipelineType::SkiaVulkan) {
+        renderThread.vulkanManager().destroy();
+    } else {
+        renderThread.renderState().flush(Caches::FlushMode::Full);
+        renderThread.eglManager().destroy();
+    }
 }
 
 std::unique_ptr<uint16_t[]> TestUtils::asciiToUtf16(const char* str) {
diff --git a/libs/hwui/tests/common/TestUtils.h b/libs/hwui/tests/common/TestUtils.h
index 80cbb24..8b287de 100644
--- a/libs/hwui/tests/common/TestUtils.h
+++ b/libs/hwui/tests/common/TestUtils.h
@@ -19,6 +19,7 @@
 #include <DeviceInfo.h>
 #include <DisplayList.h>
 #include <Matrix.h>
+#include <Properties.h>
 #include <Rect.h>
 #include <RenderNode.h>
 #include <hwui/Bitmap.h>
@@ -51,6 +52,31 @@
         } else { \
             ADD_FAILURE() << "ClipState not a rect"; \
         }
+
+#define INNER_PIPELINE_TEST(test_case_name, test_name, pipeline, functionCall) \
+    TEST(test_case_name, test_name##_##pipeline) { \
+        RenderPipelineType oldType = Properties::getRenderPipelineType(); \
+        Properties::overrideRenderPipelineType(RenderPipelineType::pipeline); \
+        functionCall; \
+        Properties::overrideRenderPipelineType(oldType); \
+    };
+
+/**
+ * Like gtests' TEST, but only runs with the OpenGL RenderPipelineType
+ */
+#define OPENGL_PIPELINE_TEST(test_case_name, test_name) \
+    class test_case_name##_##test_name##_HwuiTest { \
+    public: \
+        static void doTheThing(); \
+    }; \
+    INNER_PIPELINE_TEST(test_case_name, test_name, OpenGL, \
+            test_case_name##_##test_name##_HwuiTest::doTheThing()) \
+    void test_case_name##_##test_name##_HwuiTest::doTheThing()
+
+#define INNER_PIPELINE_RENDERTHREAD_TEST(test_case_name, test_name, pipeline) \
+    INNER_PIPELINE_TEST(test_case_name, test_name, pipeline, \
+            TestUtils::runOnRenderThread(test_case_name##_##test_name##_RenderThreadTest::doTheThing))
+
 /**
  * Like gtest's TEST, but runs on the RenderThread, and 'renderThread' is passed, in top level scope
  * (for e.g. accessing its RenderState)
@@ -60,9 +86,32 @@
     public: \
         static void doTheThing(renderthread::RenderThread& renderThread); \
     }; \
-    TEST(test_case_name, test_name) { \
-        TestUtils::runOnRenderThread(test_case_name##_##test_name##_RenderThreadTest::doTheThing); \
+    INNER_PIPELINE_RENDERTHREAD_TEST(test_case_name, test_name, OpenGL); \
+    INNER_PIPELINE_RENDERTHREAD_TEST(test_case_name, test_name, SkiaGL); \
+    INNER_PIPELINE_RENDERTHREAD_TEST(test_case_name, test_name, SkiaVulkan); \
+    void test_case_name##_##test_name##_RenderThreadTest::doTheThing(renderthread::RenderThread& renderThread)
+
+/**
+ * Like RENDERTHREAD_TEST, but only runs with the OpenGL RenderPipelineType
+ */
+#define RENDERTHREAD_OPENGL_PIPELINE_TEST(test_case_name, test_name) \
+    class test_case_name##_##test_name##_RenderThreadTest { \
+    public: \
+        static void doTheThing(renderthread::RenderThread& renderThread); \
     }; \
+    INNER_PIPELINE_RENDERTHREAD_TEST(test_case_name, test_name, OpenGL); \
+    void test_case_name##_##test_name##_RenderThreadTest::doTheThing(renderthread::RenderThread& renderThread)
+
+/**
+ * Like RENDERTHREAD_TEST, but only runs with the Skia RenderPipelineTypes
+ */
+#define RENDERTHREAD_SKIA_PIPELINE_TEST(test_case_name, test_name) \
+    class test_case_name##_##test_name##_RenderThreadTest { \
+    public: \
+        static void doTheThing(renderthread::RenderThread& renderThread); \
+    }; \
+    INNER_PIPELINE_RENDERTHREAD_TEST(test_case_name, test_name, SkiaGL); \
+    INNER_PIPELINE_RENDERTHREAD_TEST(test_case_name, test_name, SkiaVulkan); \
     void test_case_name##_##test_name##_RenderThreadTest::doTheThing(renderthread::RenderThread& renderThread)
 
 /**
@@ -137,6 +186,9 @@
     }
 
     static sp<DeferredLayerUpdater> createTextureLayerUpdater(
+            renderthread::RenderThread& renderThread);
+
+    static sp<DeferredLayerUpdater> createTextureLayerUpdater(
             renderthread::RenderThread& renderThread, uint32_t width, uint32_t height,
             const SkMatrix& transform);
 
diff --git a/libs/hwui/tests/unit/BakedOpDispatcherTests.cpp b/libs/hwui/tests/unit/BakedOpDispatcherTests.cpp
index d44be7d..9a3b81c 100644
--- a/libs/hwui/tests/unit/BakedOpDispatcherTests.cpp
+++ b/libs/hwui/tests/unit/BakedOpDispatcherTests.cpp
@@ -80,7 +80,7 @@
             << "Glop(s) expected";
 }
 
-RENDERTHREAD_TEST(BakedOpDispatcher, pathTexture_positionOvalArc) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(BakedOpDispatcher, pathTexture_positionOvalArc) {
     SkPaint strokePaint;
     strokePaint.setStyle(SkPaint::kStroke_Style);
     strokePaint.setStrokeWidth(4);
@@ -113,7 +113,7 @@
     testUnmergedGlopDispatch(renderThread, &ovalOp, textureGlopVerifier);
 }
 
-RENDERTHREAD_TEST(BakedOpDispatcher, onLayerOp_bufferless) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(BakedOpDispatcher, onLayerOp_bufferless) {
     SkPaint layerPaint;
     layerPaint.setAlpha(128);
     OffscreenBuffer* buffer = nullptr; // no providing a buffer, should hit rect fallback case
@@ -131,7 +131,7 @@
     return result;
 }
 
-RENDERTHREAD_TEST(BakedOpDispatcher, offsetFlags) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(BakedOpDispatcher, offsetFlags) {
     Rect bounds(10, 15, 20, 25);
     SkPaint paint;
     SkPaint aaPaint;
@@ -157,7 +157,7 @@
             << "Expect an offset for non-AA lines.";
 }
 
-RENDERTHREAD_TEST(BakedOpDispatcher, renderTextWithShadow) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(BakedOpDispatcher, renderTextWithShadow) {
     auto node = TestUtils::createNode<RecordingCanvas>(0, 0, 100, 100,
             [](RenderProperties& props, RecordingCanvas& canvas) {
 
@@ -232,7 +232,7 @@
     return c;
 }
 
-RENDERTHREAD_TEST(BakedOpDispatcher, layerUpdateProperties) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(BakedOpDispatcher, layerUpdateProperties) {
     for (bool debugOverdraw : { false, true }) {
         for (bool debugLayersUpdates : { false, true }) {
             ScopedProperty<bool> ovdProp(Properties::debugOverdraw, debugOverdraw);
@@ -273,7 +273,7 @@
     }
 }
 
-RENDERTHREAD_TEST(BakedOpDispatcher, pathTextureSnapping) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(BakedOpDispatcher, pathTextureSnapping) {
     Rect bounds(10, 15, 20, 25);
     SkPaint paint;
     SkPath path;
diff --git a/libs/hwui/tests/unit/BakedOpRendererTests.cpp b/libs/hwui/tests/unit/BakedOpRendererTests.cpp
index 59bd75e..380062a 100644
--- a/libs/hwui/tests/unit/BakedOpRendererTests.cpp
+++ b/libs/hwui/tests/unit/BakedOpRendererTests.cpp
@@ -23,7 +23,7 @@
 
 const BakedOpRenderer::LightInfo sLightInfo = { 128, 128 };
 
-RENDERTHREAD_TEST(BakedOpRenderer, startRepaintLayer_clear) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(BakedOpRenderer, startRepaintLayer_clear) {
     BakedOpRenderer renderer(Caches::getInstance(), renderThread.renderState(), true, sLightInfo);
     OffscreenBuffer layer(renderThread.renderState(), Caches::getInstance(), 200u, 200u);
 
diff --git a/libs/hwui/tests/unit/CanvasContextTests.cpp b/libs/hwui/tests/unit/CanvasContextTests.cpp
index d3d80a9..42ba3db 100644
--- a/libs/hwui/tests/unit/CanvasContextTests.cpp
+++ b/libs/hwui/tests/unit/CanvasContextTests.cpp
@@ -46,5 +46,10 @@
 RENDERTHREAD_TEST(CanvasContext, invokeFunctor) {
     TestUtils::MockFunctor functor;
     CanvasContext::invokeFunctor(renderThread, &functor);
-    ASSERT_EQ(functor.getLastMode(), DrawGlInfo::kModeProcess);
+    if (Properties::getRenderPipelineType() == RenderPipelineType::SkiaVulkan) {
+        // we currently don't support OpenGL WebViews on the Vulkan backend
+        ASSERT_EQ(functor.getLastMode(), DrawGlInfo::kModeProcessNoContext);
+    } else {
+        ASSERT_EQ(functor.getLastMode(), DrawGlInfo::kModeProcess);
+    }
 }
diff --git a/libs/hwui/tests/unit/DeferredLayerUpdaterTests.cpp b/libs/hwui/tests/unit/DeferredLayerUpdaterTests.cpp
index f1b8882..1ef9dba 100644
--- a/libs/hwui/tests/unit/DeferredLayerUpdaterTests.cpp
+++ b/libs/hwui/tests/unit/DeferredLayerUpdaterTests.cpp
@@ -16,8 +16,8 @@
 
 #include "DeferredLayerUpdater.h"
 #include "GlLayer.h"
+#include "Properties.h"
 
-#include "renderthread/OpenGLPipeline.h"
 #include "tests/common/TestUtils.h"
 
 #include <gtest/gtest.h>
@@ -26,12 +26,10 @@
 using namespace android::uirenderer;
 
 RENDERTHREAD_TEST(DeferredLayerUpdater, updateLayer) {
-    renderthread::OpenGLPipeline pipeline(renderThread);
-    sp<DeferredLayerUpdater> layerUpdater = pipeline.createTextureLayer();
+    sp<DeferredLayerUpdater> layerUpdater = TestUtils::createTextureLayerUpdater(renderThread);
     layerUpdater->setSize(100, 100);
     layerUpdater->setBlend(true);
 
-
     // updates are deferred so the backing layer should still be in its default state
     if (layerUpdater->backingLayer()->getApi() == Layer::Api::OpenGL) {
         GlLayer* glLayer = static_cast<GlLayer*>(layerUpdater->backingLayer());
diff --git a/libs/hwui/tests/unit/DeviceInfoTests.cpp b/libs/hwui/tests/unit/DeviceInfoTests.cpp
index 17236bd..af37938 100644
--- a/libs/hwui/tests/unit/DeviceInfoTests.cpp
+++ b/libs/hwui/tests/unit/DeviceInfoTests.cpp
@@ -17,11 +17,12 @@
 #include <DeviceInfo.h>
 
 #include <gtest/gtest.h>
+#include "tests/common/TestUtils.h"
 
 using namespace android;
 using namespace android::uirenderer;
 
-TEST(DeviceInfo, basic) {
+OPENGL_PIPELINE_TEST(DeviceInfo, basic) {
     // can't assert state before init - another test may have initialized the singleton
     DeviceInfo::initialize();
     const DeviceInfo* di = DeviceInfo::get();
diff --git a/libs/hwui/tests/unit/FontRendererTests.cpp b/libs/hwui/tests/unit/FontRendererTests.cpp
index 99080ac..ee20236 100644
--- a/libs/hwui/tests/unit/FontRendererTests.cpp
+++ b/libs/hwui/tests/unit/FontRendererTests.cpp
@@ -28,7 +28,7 @@
     return true;
 }
 
-RENDERTHREAD_TEST(FontRenderer, renderDropShadow) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FontRenderer, renderDropShadow) {
     SkPaint paint;
     paint.setTextSize(10);
     paint.setTextEncoding(SkPaint::kGlyphID_TextEncoding);
diff --git a/libs/hwui/tests/unit/FrameBuilderTests.cpp b/libs/hwui/tests/unit/FrameBuilderTests.cpp
index 71c7516..6f3ed9c 100644
--- a/libs/hwui/tests/unit/FrameBuilderTests.cpp
+++ b/libs/hwui/tests/unit/FrameBuilderTests.cpp
@@ -109,7 +109,7 @@
 
 class FailRenderer : public TestRendererBase {};
 
-RENDERTHREAD_TEST(FrameBuilder, simple) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, simple) {
     class SimpleTestRenderer : public TestRendererBase {
     public:
         void startFrame(uint32_t width, uint32_t height, const Rect& repaintRect) override {
@@ -143,7 +143,7 @@
     EXPECT_EQ(4, renderer.getIndex()); // 2 ops + start + end
 }
 
-RENDERTHREAD_TEST(FrameBuilder, simpleStroke) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, simpleStroke) {
     class SimpleStrokeTestRenderer : public TestRendererBase {
     public:
         void onPointsOp(const PointsOp& op, const BakedOpState& state) override {
@@ -171,7 +171,7 @@
     EXPECT_EQ(1, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, simpleRejection) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, simpleRejection) {
     auto node = TestUtils::createNode<RecordingCanvas>(0, 0, 200, 200,
             [](RenderProperties& props, RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
@@ -187,7 +187,7 @@
     frameBuilder.replayBakedOps<TestDispatcher>(renderer);
 }
 
-RENDERTHREAD_TEST(FrameBuilder, simpleBatching) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, simpleBatching) {
     const int LOOPS = 5;
     class SimpleBatchingTestRenderer : public TestRendererBase {
     public:
@@ -225,7 +225,7 @@
             << "Expect number of ops = 2 * loop count";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, deferRenderNode_translateClip) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, deferRenderNode_translateClip) {
     class DeferRenderNodeTranslateClipTestRenderer : public TestRendererBase {
     public:
         void onRectOp(const RectOp& op, const BakedOpState& state) override {
@@ -251,7 +251,7 @@
     EXPECT_EQ(1, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, deferRenderNodeScene) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, deferRenderNodeScene) {
     class DeferRenderNodeSceneTestRenderer : public TestRendererBase {
     public:
         void onRectOp(const RectOp& op, const BakedOpState& state) override {
@@ -320,7 +320,7 @@
     EXPECT_EQ(4, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, empty_noFbo0) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, empty_noFbo0) {
     class EmptyNoFbo0TestRenderer : public TestRendererBase {
     public:
         void startFrame(uint32_t width, uint32_t height, const Rect& repaintRect) override {
@@ -338,7 +338,7 @@
     frameBuilder.replayBakedOps<TestDispatcher>(renderer);
 }
 
-RENDERTHREAD_TEST(FrameBuilder, empty_withFbo0) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, empty_withFbo0) {
     class EmptyWithFbo0TestRenderer : public TestRendererBase {
     public:
         void startFrame(uint32_t width, uint32_t height, const Rect& repaintRect) override {
@@ -364,7 +364,7 @@
             " but fbo0 update lifecycle should still be observed";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, avoidOverdraw_rects) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, avoidOverdraw_rects) {
     class AvoidOverdrawRectsTestRenderer : public TestRendererBase {
     public:
         void onRectOp(const RectOp& op, const BakedOpState& state) override {
@@ -394,7 +394,7 @@
     EXPECT_EQ(1, renderer.getIndex()) << "Expect exactly one op";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, avoidOverdraw_bitmaps) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, avoidOverdraw_bitmaps) {
     static sk_sp<Bitmap> opaqueBitmap(TestUtils::createBitmap(50, 50,
             SkColorType::kRGB_565_SkColorType));
     static sk_sp<Bitmap> transpBitmap(TestUtils::createBitmap(50, 50,
@@ -437,7 +437,7 @@
     EXPECT_EQ(2, renderer.getIndex()) << "Expect exactly two ops";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, clippedMerging) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, clippedMerging) {
     class ClippedMergingTestRenderer : public TestRendererBase {
     public:
         void onMergedBitmapOps(const MergedBakedOpList& opList) override {
@@ -479,7 +479,7 @@
     EXPECT_EQ(4, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, regionClipStopsMerge) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, regionClipStopsMerge) {
     class RegionClipStopsMergeTestRenderer : public TestRendererBase {
     public:
         void onTextOp(const TextOp& op, const BakedOpState& state) override { mIndex++; }
@@ -508,7 +508,7 @@
     EXPECT_EQ(2, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, textMerging) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, textMerging) {
     class TextMergingTestRenderer : public TestRendererBase {
     public:
         void onMergedTextOps(const MergedBakedOpList& opList) override {
@@ -538,7 +538,7 @@
     EXPECT_EQ(2, renderer.getIndex()) << "Expect 2 ops";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, textStrikethrough) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, textStrikethrough) {
     const int LOOPS = 5;
     class TextStrikethroughTestRenderer : public TestRendererBase {
     public:
@@ -576,7 +576,7 @@
 static auto styles = {
         SkPaint::kFill_Style, SkPaint::kStroke_Style, SkPaint::kStrokeAndFill_Style };
 
-RENDERTHREAD_TEST(FrameBuilder, textStyle) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, textStyle) {
     class TextStyleTestRenderer : public TestRendererBase {
     public:
         void onMergedTextOps(const MergedBakedOpList& opList) override {
@@ -630,7 +630,7 @@
     EXPECT_EQ(3, renderer.getIndex()) << "Expect 3 ops";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, textureLayer_clipLocalMatrix) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, textureLayer_clipLocalMatrix) {
     class TextureLayerClipLocalMatrixTestRenderer : public TestRendererBase {
     public:
         void onTextureLayerOp(const TextureLayerOp& op, const BakedOpState& state) override {
@@ -664,7 +664,7 @@
     EXPECT_EQ(1, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, textureLayer_combineMatrices) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, textureLayer_combineMatrices) {
     class TextureLayerCombineMatricesTestRenderer : public TestRendererBase {
     public:
         void onTextureLayerOp(const TextureLayerOp& op, const BakedOpState& state) override {
@@ -696,10 +696,10 @@
     EXPECT_EQ(1, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, textureLayer_reject) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, textureLayer_reject) {
     auto layerUpdater = TestUtils::createTextureLayerUpdater(renderThread, 100, 100,
             SkMatrix::MakeTrans(5, 5));
-    if (layerUpdater->backingLayer()->getApi() != Layer::Api::OpenGL) return;
+    EXPECT_EQ(Layer::Api::OpenGL, layerUpdater->backingLayer()->getApi());
 
     GlLayer* glLayer = static_cast<GlLayer*>(layerUpdater->backingLayer());
     glLayer->setRenderTarget(GL_NONE); // Should be rejected
@@ -717,7 +717,7 @@
     frameBuilder.replayBakedOps<TestDispatcher>(renderer);
 }
 
-RENDERTHREAD_TEST(FrameBuilder, functor_reject) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, functor_reject) {
     class FunctorTestRenderer : public TestRendererBase {
     public:
         void onFunctorOp(const FunctorOp& op, const BakedOpState& state) override {
@@ -742,7 +742,7 @@
     EXPECT_EQ(1, renderer.getIndex()) << "Functor should not be rejected";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, deferColorOp_unbounded) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, deferColorOp_unbounded) {
     class ColorTestRenderer : public TestRendererBase {
     public:
         void onColorOp(const ColorOp& op, const BakedOpState& state) override {
@@ -767,7 +767,7 @@
     EXPECT_EQ(1, renderer.getIndex()) << "ColorOp should not be rejected";
 }
 
-TEST(FrameBuilder, renderNode) {
+OPENGL_PIPELINE_TEST(FrameBuilder, renderNode) {
     class RenderNodeTestRenderer : public TestRendererBase {
     public:
         void onRectOp(const RectOp& op, const BakedOpState& state) override {
@@ -814,7 +814,7 @@
     EXPECT_EQ(2, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, clipped) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, clipped) {
     class ClippedTestRenderer : public TestRendererBase {
     public:
         void onBitmapOp(const BitmapOp& op, const BakedOpState& state) override {
@@ -840,7 +840,7 @@
     frameBuilder.replayBakedOps<TestDispatcher>(renderer);
 }
 
-RENDERTHREAD_TEST(FrameBuilder, saveLayer_simple) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, saveLayer_simple) {
     class SaveLayerSimpleTestRenderer : public TestRendererBase {
     public:
         OffscreenBuffer* startTemporaryLayer(uint32_t width, uint32_t height) override {
@@ -890,7 +890,7 @@
     EXPECT_EQ(5, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, saveLayer_nested) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, saveLayer_nested) {
     /* saveLayer1 { rect1, saveLayer2 { rect2 } } will play back as:
      * - startTemporaryLayer2, rect2 endLayer2
      * - startTemporaryLayer1, rect1, drawLayer2, endLayer1
@@ -973,7 +973,7 @@
     EXPECT_EQ(12, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, saveLayer_contentRejection) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, saveLayer_contentRejection) {
         auto node = TestUtils::createNode<RecordingCanvas>(0, 0, 200, 200,
                 [](RenderProperties& props, RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
@@ -996,7 +996,7 @@
     frameBuilder.replayBakedOps<TestDispatcher>(renderer);
 }
 
-RENDERTHREAD_TEST(FrameBuilder, saveLayerUnclipped_simple) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, saveLayerUnclipped_simple) {
     class SaveLayerUnclippedSimpleTestRenderer : public TestRendererBase {
     public:
         void onCopyToLayerOp(const CopyToLayerOp& op, const BakedOpState& state) override {
@@ -1041,7 +1041,7 @@
     EXPECT_EQ(4, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, saveLayerUnclipped_round) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, saveLayerUnclipped_round) {
     class SaveLayerUnclippedRoundTestRenderer : public TestRendererBase {
     public:
         void onCopyToLayerOp(const CopyToLayerOp& op, const BakedOpState& state) override {
@@ -1075,7 +1075,7 @@
     EXPECT_EQ(2, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, saveLayerUnclipped_mergedClears) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, saveLayerUnclipped_mergedClears) {
     class SaveLayerUnclippedMergedClearsTestRenderer : public TestRendererBase {
     public:
         void onCopyToLayerOp(const CopyToLayerOp& op, const BakedOpState& state) override {
@@ -1133,7 +1133,7 @@
             << "Expect 4 copyTos, 4 copyFroms, 1 clear SimpleRects, and 1 rect.";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, saveLayerUnclipped_clearClip) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, saveLayerUnclipped_clearClip) {
     class SaveLayerUnclippedClearClipTestRenderer : public TestRendererBase {
     public:
         void onCopyToLayerOp(const CopyToLayerOp& op, const BakedOpState& state) override {
@@ -1175,7 +1175,7 @@
     EXPECT_EQ(4, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, saveLayerUnclipped_reject) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, saveLayerUnclipped_reject) {
     auto node = TestUtils::createNode<RecordingCanvas>(0, 0, 200, 200,
             [](RenderProperties& props, RecordingCanvas& canvas) {
         // unclipped savelayer + rect both in area that won't intersect with dirty
@@ -1197,7 +1197,7 @@
  * - startTemporaryLayer, onCopyToLayer, onSimpleRects, onRect, onCopyFromLayer, endLayer
  * - startFrame, onCopyToLayer, onSimpleRects, drawLayer, onCopyFromLayer, endframe
  */
-RENDERTHREAD_TEST(FrameBuilder, saveLayerUnclipped_complex) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, saveLayerUnclipped_complex) {
     class SaveLayerUnclippedComplexTestRenderer : public TestRendererBase {
     public:
         OffscreenBuffer* startTemporaryLayer(uint32_t width, uint32_t height) {
@@ -1262,7 +1262,7 @@
     EXPECT_EQ(13, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, hwLayer_simple) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, hwLayer_simple) {
     class HwLayerSimpleTestRenderer : public TestRendererBase {
     public:
         void startRepaintLayer(OffscreenBuffer* offscreenBuffer, const Rect& repaintRect) override {
@@ -1326,7 +1326,7 @@
     *layerHandle = nullptr;
 }
 
-RENDERTHREAD_TEST(FrameBuilder, hwLayer_complex) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, hwLayer_complex) {
     /* parentLayer { greyRect, saveLayer { childLayer { whiteRect } } } will play back as:
      * - startRepaintLayer(child), rect(grey), endLayer
      * - startTemporaryLayer, drawLayer(child), endLayer
@@ -1435,7 +1435,7 @@
 }
 
 
-RENDERTHREAD_TEST(FrameBuilder, buildLayer) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, buildLayer) {
     class BuildLayerTestRenderer : public TestRendererBase {
     public:
         void startRepaintLayer(OffscreenBuffer* offscreenBuffer, const Rect& repaintRect) override {
@@ -1531,7 +1531,7 @@
 
 } // end anonymous namespace
 
-RENDERTHREAD_TEST(FrameBuilder, zReorder) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, zReorder) {
     auto parent = TestUtils::createNode<RecordingCanvas>(0, 0, 100, 100,
             [](RenderProperties& props, RecordingCanvas& canvas) {
         canvas.insertReorderBarrier(true);
@@ -1566,7 +1566,7 @@
     EXPECT_EQ(13, renderer.getIndex());
 };
 
-RENDERTHREAD_TEST(FrameBuilder, projectionReorder) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorder) {
     static const int scrollX = 5;
     static const int scrollY = 10;
     class ProjectionReorderTestRenderer : public TestRendererBase {
@@ -1659,7 +1659,7 @@
     EXPECT_EQ(3, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, projectionHwLayer) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, projectionHwLayer) {
     static const int scrollX = 5;
     static const int scrollY = 10;
     class ProjectionHwLayerTestRenderer : public TestRendererBase {
@@ -1750,7 +1750,7 @@
     *layerHandle = nullptr;
 }
 
-RENDERTHREAD_TEST(FrameBuilder, projectionChildScroll) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, projectionChildScroll) {
     static const int scrollX = 500000;
     static const int scrollY = 0;
     class ProjectionChildScrollTestRenderer : public TestRendererBase {
@@ -1817,7 +1817,7 @@
     });
 }
 
-RENDERTHREAD_TEST(FrameBuilder, shadow) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, shadow) {
     class ShadowTestRenderer : public TestRendererBase {
     public:
         void onShadowOp(const ShadowOp& op, const BakedOpState& state) override {
@@ -1850,7 +1850,7 @@
     EXPECT_EQ(2, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, shadowSaveLayer) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, shadowSaveLayer) {
     class ShadowSaveLayerTestRenderer : public TestRendererBase {
     public:
         OffscreenBuffer* startTemporaryLayer(uint32_t width, uint32_t height) override {
@@ -1896,7 +1896,7 @@
     EXPECT_EQ(6, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, shadowHwLayer) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, shadowHwLayer) {
     class ShadowHwLayerTestRenderer : public TestRendererBase {
     public:
         void startRepaintLayer(OffscreenBuffer* offscreenBuffer, const Rect& repaintRect) override {
@@ -1954,7 +1954,7 @@
     *layerHandle = nullptr;
 }
 
-RENDERTHREAD_TEST(FrameBuilder, shadowLayering) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, shadowLayering) {
     class ShadowLayeringTestRenderer : public TestRendererBase {
     public:
         void onShadowOp(const ShadowOp& op, const BakedOpState& state) override {
@@ -1981,7 +1981,7 @@
     EXPECT_EQ(4, renderer.getIndex());
 }
 
-RENDERTHREAD_TEST(FrameBuilder, shadowClipping) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, shadowClipping) {
     class ShadowClippingTestRenderer : public TestRendererBase {
     public:
         void onShadowOp(const ShadowOp& op, const BakedOpState& state) override {
@@ -2041,7 +2041,7 @@
     EXPECT_EQ(1, renderer.getIndex()) << "Should have seen one op";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, renderPropOverlappingRenderingAlpha) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, renderPropOverlappingRenderingAlpha) {
     testProperty([](RenderProperties& properties) {
         properties.setAlpha(0.5f);
         properties.setHasOverlappingRendering(false);
@@ -2050,7 +2050,7 @@
     });
 }
 
-RENDERTHREAD_TEST(FrameBuilder, renderPropClipping) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, renderPropClipping) {
     testProperty([](RenderProperties& properties) {
         properties.setClipToBounds(true);
         properties.setClipBounds(Rect(10, 20, 300, 400));
@@ -2060,7 +2060,7 @@
     });
 }
 
-RENDERTHREAD_TEST(FrameBuilder, renderPropRevealClip) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, renderPropRevealClip) {
     testProperty([](RenderProperties& properties) {
         properties.mutableRevealClip().set(true, 50, 50, 25);
     }, [](const RectOp& op, const BakedOpState& state) {
@@ -2071,7 +2071,7 @@
     });
 }
 
-RENDERTHREAD_TEST(FrameBuilder, renderPropOutlineClip) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, renderPropOutlineClip) {
     testProperty([](RenderProperties& properties) {
         properties.mutableOutline().setShouldClip(true);
         properties.mutableOutline().setRoundRect(10, 20, 30, 40, 5.0f, 0.5f);
@@ -2083,7 +2083,7 @@
     });
 }
 
-RENDERTHREAD_TEST(FrameBuilder, renderPropTransform) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, renderPropTransform) {
     testProperty([](RenderProperties& properties) {
         properties.setLeftTopRightBottom(10, 10, 110, 110);
 
@@ -2192,7 +2192,7 @@
     ASSERT_EQ(5, renderer.getIndex()) << "Test must trigger saveLayer alpha behavior.";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, renderPropSaveLayerAlphaClipBig) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, renderPropSaveLayerAlphaClipBig) {
     SaveLayerAlphaData observedData;
     testSaveLayerAlphaClip(&observedData, [](RenderProperties& properties) {
         properties.setTranslationX(10); // offset rendering content
@@ -2211,7 +2211,7 @@
                 << "expect drawLayer to be translated as part of being clipped";
 }
 
-RENDERTHREAD_TEST(FrameBuilder, renderPropSaveLayerAlphaRotate) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, renderPropSaveLayerAlphaRotate) {
     SaveLayerAlphaData observedData;
     testSaveLayerAlphaClip(&observedData, [](RenderProperties& properties) {
         // Translate and rotate the view so that the only visible part is the top left corner of
@@ -2230,7 +2230,7 @@
     EXPECT_MATRIX_APPROX_EQ(Matrix4::identity(), observedData.rectMatrix);
 }
 
-RENDERTHREAD_TEST(FrameBuilder, renderPropSaveLayerAlphaScale) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, renderPropSaveLayerAlphaScale) {
     SaveLayerAlphaData observedData;
     testSaveLayerAlphaClip(&observedData, [](RenderProperties& properties) {
         properties.setPivotX(0);
@@ -2244,7 +2244,7 @@
     EXPECT_MATRIX_APPROX_EQ(Matrix4::identity(), observedData.rectMatrix);
 }
 
-RENDERTHREAD_TEST(FrameBuilder, clip_replace) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(FrameBuilder, clip_replace) {
     class ClipReplaceTestRenderer : public TestRendererBase {
     public:
         void onColorOp(const ColorOp& op, const BakedOpState& state) override {
@@ -2269,7 +2269,7 @@
     EXPECT_EQ(1, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderProjectedInMiddle) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderProjectedInMiddle) {
     /* R is backward projected on B
                 A
                / \
@@ -2299,7 +2299,7 @@
     EXPECT_EQ(3, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderProjectLast) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderProjectLast) {
     /* R is backward projected on E
                   A
                 / | \
@@ -2331,7 +2331,7 @@
     EXPECT_EQ(4, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderNoReceivable) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderNoReceivable) {
     /* R is backward projected without receiver
                 A
                / \
@@ -2360,7 +2360,7 @@
     EXPECT_EQ(2, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderParentReceivable) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderParentReceivable) {
     /* R is backward projected on C
                 A
                / \
@@ -2389,7 +2389,7 @@
     EXPECT_EQ(3, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderSameNodeReceivable) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderSameNodeReceivable) {
      auto nodeA = TestUtils::createNode<RecordingCanvas>(0, 0, 100, 100,
             [](RenderProperties& props, RecordingCanvas& canvas) {
         drawOrderedNode(&canvas, 0, nullptr); //nodeB
@@ -2412,7 +2412,7 @@
     EXPECT_EQ(2, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderProjectedSibling) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderProjectedSibling) {
     //TODO: this test together with the next "projectionReorderProjectedSibling2" likely expose a
     //bug in HWUI. First test draws R, while the second test does not draw R for a nearly identical
     //tree setup. The correct behaviour is to not draw R, because the receiver cannot be a sibling
@@ -2445,7 +2445,7 @@
     EXPECT_EQ(3, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderProjectedSibling2) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderProjectedSibling2) {
     /* R is set to project on B, but R is not drawn because projecting on a sibling is not allowed.
                 A
                 |
@@ -2478,7 +2478,7 @@
     EXPECT_EQ(3, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderGrandparentReceivable) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderGrandparentReceivable) {
     /* R is backward projected on B
                 A
                 |
@@ -2510,7 +2510,7 @@
     EXPECT_EQ(3, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderTwoReceivables) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderTwoReceivables) {
     /* B and G are receivables, R is backward projected
                 A
                / \
@@ -2543,7 +2543,7 @@
     EXPECT_EQ(4, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderTwoReceivablesLikelyScenario) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderTwoReceivablesLikelyScenario) {
     /* B and G are receivables, G is backward projected
                 A
                / \
@@ -2576,7 +2576,7 @@
     EXPECT_EQ(4, renderer.getIndex());
 }
 
-TEST(FrameBuilder, projectionReorderTwoReceivablesDeeper) {
+OPENGL_PIPELINE_TEST(FrameBuilder, projectionReorderTwoReceivablesDeeper) {
     /* B and G are receivables, R is backward projected
                 A
                / \
diff --git a/libs/hwui/tests/unit/GlopBuilderTests.cpp b/libs/hwui/tests/unit/GlopBuilderTests.cpp
index ce1db05..caeb6bf 100644
--- a/libs/hwui/tests/unit/GlopBuilderTests.cpp
+++ b/libs/hwui/tests/unit/GlopBuilderTests.cpp
@@ -116,7 +116,7 @@
     return glop;
 }
 
-RENDERTHREAD_TEST(GlopBuilder, rectSnapTest) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(GlopBuilder, rectSnapTest) {
     RenderState& renderState = renderThread.renderState();
     Caches& caches = Caches::getInstance();
     SkPaint paint;
diff --git a/libs/hwui/tests/unit/GradientCacheTests.cpp b/libs/hwui/tests/unit/GradientCacheTests.cpp
index 0ee9647..a3b346f 100644
--- a/libs/hwui/tests/unit/GradientCacheTests.cpp
+++ b/libs/hwui/tests/unit/GradientCacheTests.cpp
@@ -23,7 +23,7 @@
 using namespace android;
 using namespace android::uirenderer;
 
-RENDERTHREAD_TEST(GradientCache, addRemove) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(GradientCache, addRemove) {
     Extensions extensions;
     GradientCache cache(extensions);
     ASSERT_LT(1000u, cache.getMaxSize()) << "Expect non-trivial size";
diff --git a/libs/hwui/tests/unit/LeakCheckTests.cpp b/libs/hwui/tests/unit/LeakCheckTests.cpp
index 06599dd..6c42ca1 100644
--- a/libs/hwui/tests/unit/LeakCheckTests.cpp
+++ b/libs/hwui/tests/unit/LeakCheckTests.cpp
@@ -29,7 +29,7 @@
 const FrameBuilder::LightGeometry sLightGeometery = { {100, 100, 100}, 50};
 const BakedOpRenderer::LightInfo sLightInfo = { 128, 128 };
 
-RENDERTHREAD_TEST(LeakCheck, saveLayer_overdrawRejection) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(LeakCheck, saveLayer_overdrawRejection) {
     auto node = TestUtils::createNode(0, 0, 100, 100,
             [](RenderProperties& props, Canvas& canvas) {
         canvas.saveLayerAlpha(0, 0, 100, 100, 128, SaveFlags::ClipToLayer);
@@ -49,7 +49,7 @@
     frameBuilder.replayBakedOps<BakedOpDispatcher>(renderer);
 }
 
-RENDERTHREAD_TEST(LeakCheck, saveLayerUnclipped_simple) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(LeakCheck, saveLayerUnclipped_simple) {
     auto node = TestUtils::createNode(0, 0, 200, 200,
             [](RenderProperties& props, Canvas& canvas) {
         canvas.saveLayerAlpha(10, 10, 190, 190, 128, (SaveFlags::Flags)(0));
diff --git a/libs/hwui/tests/unit/MeshStateTests.cpp b/libs/hwui/tests/unit/MeshStateTests.cpp
index 0881fa2..511d6d2 100644
--- a/libs/hwui/tests/unit/MeshStateTests.cpp
+++ b/libs/hwui/tests/unit/MeshStateTests.cpp
@@ -24,7 +24,7 @@
 using namespace android::uirenderer;
 using namespace testing;
 
-RENDERTHREAD_TEST(MeshState, genOrUpdate) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(MeshState, genOrUpdate) {
     debug::ScopedReplaceDriver<debug::MockGlesDriver> driverRef;
     auto& mockGlDriver = driverRef.get();
     EXPECT_CALL(mockGlDriver, glGenBuffers_(_, _)).WillOnce(SetArgPointee<1>(35));
@@ -33,4 +33,4 @@
 
     GLuint buffer = 0;
     renderThread.renderState().meshState().genOrUpdateMeshBuffer(&buffer, 10, nullptr, GL_DYNAMIC_DRAW);
-}
\ No newline at end of file
+}
diff --git a/libs/hwui/tests/unit/OffscreenBufferPoolTests.cpp b/libs/hwui/tests/unit/OffscreenBufferPoolTests.cpp
index b7950aa..6cd595a 100644
--- a/libs/hwui/tests/unit/OffscreenBufferPoolTests.cpp
+++ b/libs/hwui/tests/unit/OffscreenBufferPoolTests.cpp
@@ -30,7 +30,7 @@
     EXPECT_EQ(1024u, OffscreenBuffer::computeIdealDimension(1000));
 }
 
-RENDERTHREAD_TEST(OffscreenBuffer, construct) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(OffscreenBuffer, construct) {
     OffscreenBuffer layer(renderThread.renderState(), Caches::getInstance(), 49u, 149u);
     EXPECT_EQ(49u, layer.viewportWidth);
     EXPECT_EQ(149u, layer.viewportHeight);
@@ -41,7 +41,7 @@
     EXPECT_EQ(64u * 192u * 4u, layer.getSizeInBytes());
 }
 
-RENDERTHREAD_TEST(OffscreenBuffer, getTextureCoordinates) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(OffscreenBuffer, getTextureCoordinates) {
     OffscreenBuffer layerAligned(renderThread.renderState(), Caches::getInstance(), 256u, 256u);
     EXPECT_EQ(Rect(0, 1, 1, 0),
             layerAligned.getTextureCoordinates());
@@ -51,7 +51,7 @@
             layerUnaligned.getTextureCoordinates());
 }
 
-RENDERTHREAD_TEST(OffscreenBuffer, dirty) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(OffscreenBuffer, dirty) {
     OffscreenBuffer buffer(renderThread.renderState(), Caches::getInstance(), 256u, 256u);
     buffer.dirty(Rect(-100, -100, 100, 100));
     EXPECT_EQ(android::Rect(100, 100), buffer.region.getBounds());
@@ -65,7 +65,7 @@
             << "pool must read size from Properties";
 }
 
-RENDERTHREAD_TEST(OffscreenBufferPool, getPutClear) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(OffscreenBufferPool, getPutClear) {
     OffscreenBufferPool pool;
 
     auto layer = pool.get(renderThread.renderState(), 100u, 200u);
@@ -88,7 +88,7 @@
     EXPECT_EQ(0u, pool.getCount());
 }
 
-RENDERTHREAD_TEST(OffscreenBufferPool, resize) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(OffscreenBufferPool, resize) {
     OffscreenBufferPool pool;
 
     auto layer = pool.get(renderThread.renderState(), 64u, 64u);
@@ -123,7 +123,7 @@
     pool.putOrDelete(layer2);
 }
 
-RENDERTHREAD_TEST(OffscreenBufferPool, putAndDestroy) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(OffscreenBufferPool, putAndDestroy) {
     OffscreenBufferPool pool;
     // layer too big to return to the pool
     // Note: this relies on the fact that the pool won't reject based on max texture size
@@ -133,7 +133,7 @@
     EXPECT_EQ(0u, pool.getCount()); // failed to put (so was destroyed instead)
 }
 
-RENDERTHREAD_TEST(OffscreenBufferPool, clear) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(OffscreenBufferPool, clear) {
     EXPECT_EQ(0, GpuMemoryTracker::getInstanceCount(GpuObjectType::OffscreenBuffer));
     OffscreenBufferPool pool;
 
diff --git a/libs/hwui/tests/unit/RecordingCanvasTests.cpp b/libs/hwui/tests/unit/RecordingCanvasTests.cpp
index 4a73383..124f5fa 100644
--- a/libs/hwui/tests/unit/RecordingCanvasTests.cpp
+++ b/libs/hwui/tests/unit/RecordingCanvasTests.cpp
@@ -47,7 +47,13 @@
     opValidator(*(dl->getOps()[0]));
 }
 
-TEST(RecordingCanvas, emptyPlayback) {
+// The RecordingCanvas is only ever used by the OpenGL RenderPipeline and never when Skia is in use.
+// Thus, even though many of these test are not directly dependent on the current RenderPipeline, we
+// set them all to be OPENGL_PIPELINE_TESTs in case the underlying code in RecordingCanvas ever
+// changes to require the use of the OPENGL_PIPELINE. Currently the textureLayer test is the only
+// test that requires being an OPENGL_PIPELINE_TEST.
+
+OPENGL_PIPELINE_TEST(RecordingCanvas, emptyPlayback) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 200, [](RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
         canvas.restore();
@@ -55,7 +61,7 @@
     playbackOps(*dl, [](const RecordedOp& op) { ADD_FAILURE(); });
 }
 
-TEST(RecordingCanvas, clipRect) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, clipRect) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 100, [](RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
         canvas.clipRect(0, 0, 100, 100, SkClipOp::kIntersect);
@@ -71,7 +77,7 @@
             << "Clip should be serialized once";
 }
 
-TEST(RecordingCanvas, emptyClipRect) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, emptyClipRect) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
         canvas.clipRect(0, 0, 100, 100, SkClipOp::kIntersect);
@@ -82,7 +88,7 @@
     ASSERT_EQ(0u, dl->getOps().size()) << "Must be zero ops. Rect should be rejected.";
 }
 
-TEST(RecordingCanvas, emptyPaintRejection) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, emptyPaintRejection) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         SkPaint emptyPaint;
         emptyPaint.setColor(Color::Transparent);
@@ -103,7 +109,7 @@
     EXPECT_EQ(0u, dl->getOps().size()) << "Op should be rejected";
 }
 
-TEST(RecordingCanvas, drawArc) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawArc) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.drawArc(0, 0, 200, 200, 0, 180, true, SkPaint());
         canvas.drawArc(0, 0, 100, 100, 0, 360, true, SkPaint());
@@ -119,7 +125,7 @@
     EXPECT_EQ(Rect(100, 100), ops[1]->unmappedBounds);
 }
 
-TEST(RecordingCanvas, drawLines) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawLines) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 200, [](RecordingCanvas& canvas) {
         SkPaint paint;
         paint.setStrokeWidth(20); // doesn't affect recorded bounds - would be resolved at bake time
@@ -136,7 +142,7 @@
             << "unmapped bounds must be size of line, and not outset for stroke width";
 }
 
-TEST(RecordingCanvas, drawRect) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawRect) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 200, [](RecordingCanvas& canvas) {
         canvas.drawRect(10, 20, 90, 180, SkPaint());
     });
@@ -148,7 +154,7 @@
     EXPECT_EQ(Rect(10, 20, 90, 180), op.unmappedBounds);
 }
 
-TEST(RecordingCanvas, drawRoundRect) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawRoundRect) {
     // Round case - stays rounded
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 200, [](RecordingCanvas& canvas) {
         canvas.drawRoundRect(0, 0, 100, 100, 10, 10, SkPaint());
@@ -165,7 +171,7 @@
         << "Non-rounded rects should be converted";
 }
 
-TEST(RecordingCanvas, drawGlyphs) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawGlyphs) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         SkPaint paint;
         paint.setAntiAlias(true);
@@ -186,7 +192,7 @@
     ASSERT_EQ(1, count);
 }
 
-TEST(RecordingCanvas, drawGlyphs_strikeThruAndUnderline) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawGlyphs_strikeThruAndUnderline) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         SkPaint paint;
         paint.setAntiAlias(true);
@@ -218,7 +224,7 @@
     EXPECT_EQ(RecordedOpId::RectOp, ops[index++]->opId); // strikethrough
 }
 
-TEST(RecordingCanvas, drawGlyphs_forceAlignLeft) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawGlyphs_forceAlignLeft) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         SkPaint paint;
         paint.setAntiAlias(true);
@@ -248,7 +254,7 @@
     ASSERT_EQ(3, count);
 }
 
-TEST(RecordingCanvas, drawColor) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawColor) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.drawColor(Color::Black, SkBlendMode::kSrcOver);
     });
@@ -260,7 +266,7 @@
     EXPECT_TRUE(op.unmappedBounds.isEmpty()) << "Expect undefined recorded bounds";
 }
 
-TEST(RecordingCanvas, backgroundAndImage) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, backgroundAndImage) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 200, [](RecordingCanvas& canvas) {
         sk_sp<Bitmap> bitmap(TestUtils::createBitmap(25, 25));
         SkPaint paint;
@@ -312,7 +318,7 @@
     ASSERT_EQ(2, count);
 }
 
-RENDERTHREAD_TEST(RecordingCanvas, textureLayer) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(RecordingCanvas, textureLayer) {
     auto layerUpdater = TestUtils::createTextureLayerUpdater(renderThread, 100, 100,
             SkMatrix::MakeTrans(5, 5));
 
@@ -327,7 +333,7 @@
     });
 }
 
-TEST(RecordingCanvas, saveLayer_simple) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, saveLayer_simple) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.saveLayerAlpha(10, 20, 190, 180, 128, SaveFlags::ClipToLayer);
         canvas.drawRect(10, 20, 190, 180, SkPaint());
@@ -361,7 +367,7 @@
     EXPECT_EQ(3, count);
 }
 
-TEST(RecordingCanvas, saveLayer_rounding) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, saveLayer_rounding) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 100, [](RecordingCanvas& canvas) {
             canvas.saveLayerAlpha(10.25f, 10.75f, 89.25f, 89.75f, 128, SaveFlags::ClipToLayer);
             canvas.drawRect(20, 20, 80, 80, SkPaint());
@@ -391,7 +397,7 @@
         EXPECT_EQ(3, count);
 }
 
-TEST(RecordingCanvas, saveLayer_missingRestore) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, saveLayer_missingRestore) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.saveLayerAlpha(0, 0, 200, 200, 128, SaveFlags::ClipToLayer);
         canvas.drawRect(0, 0, 200, 200, SkPaint());
@@ -406,7 +412,7 @@
     EXPECT_EQ(3, count) << "Missing a restore shouldn't result in an unmatched saveLayer";
 }
 
-TEST(RecordingCanvas, saveLayer_simpleUnclipped) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, saveLayer_simpleUnclipped) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.saveLayerAlpha(10, 20, 190, 180, 128, (SaveFlags::Flags)0); // unclipped
         canvas.drawRect(10, 20, 190, 180, SkPaint());
@@ -438,7 +444,7 @@
     EXPECT_EQ(3, count);
 }
 
-TEST(RecordingCanvas, saveLayer_addClipFlag) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, saveLayer_addClipFlag) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
         canvas.clipRect(10, 20, 190, 180, SkClipOp::kIntersect);
@@ -457,7 +463,7 @@
     EXPECT_EQ(3, count);
 }
 
-TEST(RecordingCanvas, saveLayer_viewportCrop) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, saveLayer_viewportCrop) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         // shouldn't matter, since saveLayer will clip to its bounds
         canvas.clipRect(-1000, -1000, 1000, 1000, SkClipOp::kReplace);
@@ -481,7 +487,7 @@
     EXPECT_EQ(3, count);
 }
 
-TEST(RecordingCanvas, saveLayer_rotateUnclipped) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, saveLayer_rotateUnclipped) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
         canvas.translate(100, 100);
@@ -507,7 +513,7 @@
     EXPECT_EQ(3, count);
 }
 
-TEST(RecordingCanvas, saveLayer_rotateClipped) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, saveLayer_rotateClipped) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
         canvas.translate(100, 100);
@@ -545,7 +551,7 @@
     EXPECT_EQ(3, count);
 }
 
-TEST(RecordingCanvas, saveLayer_rejectBegin) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, saveLayer_rejectBegin) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
         canvas.translate(0, -20); // avoid identity case
@@ -560,7 +566,7 @@
     ASSERT_EQ(0u, dl->getOps().size()) << "Begin/Rect/End should all be rejected.";
 }
 
-TEST(RecordingCanvas, drawRenderNode_rejection) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawRenderNode_rejection) {
     auto child = TestUtils::createNode(50, 50, 150, 150,
             [](RenderProperties& props, Canvas& canvas) {
         SkPaint paint;
@@ -575,7 +581,7 @@
     ASSERT_TRUE(dl->isEmpty());
 }
 
-TEST(RecordingCanvas, drawRenderNode_projection) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawRenderNode_projection) {
     sp<RenderNode> background = TestUtils::createNode(50, 50, 150, 150,
             [](RenderProperties& props, Canvas& canvas) {
         SkPaint paint;
@@ -618,7 +624,7 @@
     }
 }
 
-TEST(RecordingCanvas, firstClipWillReplace) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, firstClipWillReplace) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
         // since no explicit clip set on canvas, this should be the one observed on op:
@@ -635,7 +641,7 @@
     EXPECT_CLIP_RECT(Rect(-100, -100, 300, 300), dl->getOps()[0]->localClip);
 }
 
-TEST(RecordingCanvas, replaceClipIntersectWithRoot) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, replaceClipIntersectWithRoot) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 100, [](RecordingCanvas& canvas) {
         canvas.save(SaveFlags::MatrixClip);
         canvas.clipRect(-10, -10, 110, 110, SkClipOp::kReplace);
@@ -648,7 +654,7 @@
     EXPECT_TRUE(dl->getOps()[0]->localClip->intersectWithRoot);
 }
 
-TEST(RecordingCanvas, insertReorderBarrier) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, insertReorderBarrier) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.drawRect(0, 0, 400, 400, SkPaint());
         canvas.insertReorderBarrier(true);
@@ -669,7 +675,7 @@
     EXPECT_TRUE(chunks[1].reorderChildren);
 }
 
-TEST(RecordingCanvas, insertReorderBarrier_clip) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, insertReorderBarrier_clip) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         // first chunk: no recorded clip
         canvas.insertReorderBarrier(true);
@@ -699,7 +705,7 @@
     EXPECT_EQ(Rect(200, 200), chunks[2].reorderClip->rect);
 }
 
-TEST(RecordingCanvas, refPaint) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, refPaint) {
     SkPaint paint;
 
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [&paint](RecordingCanvas& canvas) {
@@ -727,7 +733,7 @@
     EXPECT_NE(&paint, ops[2]->paint);
 }
 
-TEST(RecordingCanvas, refBitmap) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, refBitmap) {
     sk_sp<Bitmap> bitmap(TestUtils::createBitmap(100, 100));
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 100, [&bitmap](RecordingCanvas& canvas) {
         canvas.drawBitmap(*bitmap, 0, 0, nullptr);
@@ -736,7 +742,7 @@
     EXPECT_EQ(1u, bitmaps.size());
 }
 
-TEST(RecordingCanvas, refBitmapInShader_bitmapShader) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, refBitmapInShader_bitmapShader) {
     sk_sp<Bitmap> bitmap = TestUtils::createBitmap(100, 100);
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 100, [&bitmap](RecordingCanvas& canvas) {
         SkPaint paint;
@@ -755,7 +761,7 @@
     EXPECT_EQ(1u, bitmaps.size());
 }
 
-TEST(RecordingCanvas, refBitmapInShader_composeShader) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, refBitmapInShader_composeShader) {
     sk_sp<Bitmap> bitmap = TestUtils::createBitmap(100, 100);
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(100, 100, [&bitmap](RecordingCanvas& canvas) {
         SkPaint paint;
@@ -785,7 +791,7 @@
     EXPECT_EQ(1u, bitmaps.size());
 }
 
-TEST(RecordingCanvas, drawText) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawText) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         Paint paint;
         paint.setAntiAlias(true);
@@ -807,7 +813,7 @@
     ASSERT_EQ(1, count);
 }
 
-TEST(RecordingCanvas, drawTextInHighContrast) {
+OPENGL_PIPELINE_TEST(RecordingCanvas, drawTextInHighContrast) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         canvas.setHighContrastText(true);
         Paint paint;
diff --git a/libs/hwui/tests/unit/RenderNodeTests.cpp b/libs/hwui/tests/unit/RenderNodeTests.cpp
index 331a6ac..ab8e4e1 100644
--- a/libs/hwui/tests/unit/RenderNodeTests.cpp
+++ b/libs/hwui/tests/unit/RenderNodeTests.cpp
@@ -137,10 +137,11 @@
 RENDERTHREAD_TEST(RenderNode, prepareTree_HwLayer_AVD_enqueueDamage) {
 
     VectorDrawable::Group* group = new VectorDrawable::Group();
-    VectorDrawableRoot* vectorDrawable = new VectorDrawableRoot(group);
+    sp<VectorDrawableRoot> vectorDrawable(new VectorDrawableRoot(group));
+
     auto rootNode = TestUtils::createNode(0, 0, 200, 400,
             [&](RenderProperties& props, Canvas& canvas) {
-        canvas.drawVectorDrawable(vectorDrawable);
+        canvas.drawVectorDrawable(vectorDrawable.get());
     });
     ContextFactory contextFactory;
     std::unique_ptr<CanvasContext> canvasContext(CanvasContext::create(
@@ -164,7 +165,5 @@
     EXPECT_FALSE(info.layerUpdateQueue->entries().empty());
     EXPECT_EQ(rootNode.get(), info.layerUpdateQueue->entries().at(0).renderNode);
     EXPECT_EQ(uirenderer::Rect(0, 0, 200, 400), info.layerUpdateQueue->entries().at(0).damage);
-
-    delete vectorDrawable;
     canvasContext->destroy(nullptr);
 }
diff --git a/libs/hwui/tests/unit/SkiaCanvasTests.cpp b/libs/hwui/tests/unit/SkiaCanvasTests.cpp
index 95f9974..0ac09ac 100644
--- a/libs/hwui/tests/unit/SkiaCanvasTests.cpp
+++ b/libs/hwui/tests/unit/SkiaCanvasTests.cpp
@@ -28,7 +28,7 @@
  * Verify that we get the same culling bounds for text for (1) drawing glyphs
  * directly to a Canvas or (2) going through a SkPicture as an intermediate step.
  */
-TEST(SkiaCanvasProxy, drawGlyphsViaPicture) {
+OPENGL_PIPELINE_TEST(SkiaCanvasProxy, drawGlyphsViaPicture) {
     auto dl = TestUtils::createDisplayList<RecordingCanvas>(200, 200, [](RecordingCanvas& canvas) {
         // setup test variables
         SkPaint paint;
diff --git a/libs/hwui/tests/unit/SkiaDisplayListTests.cpp b/libs/hwui/tests/unit/SkiaDisplayListTests.cpp
index 899758a..8f6fc8b 100644
--- a/libs/hwui/tests/unit/SkiaDisplayListTests.cpp
+++ b/libs/hwui/tests/unit/SkiaDisplayListTests.cpp
@@ -118,7 +118,7 @@
     }
 };
 
-RENDERTHREAD_TEST(SkiaDisplayList, prepareListAndChildren) {
+RENDERTHREAD_SKIA_PIPELINE_TEST(SkiaDisplayList, prepareListAndChildren) {
     auto rootNode = TestUtils::createNode(0, 0, 200, 400, nullptr);
     ContextFactory contextFactory;
     std::unique_ptr<CanvasContext> canvasContext(CanvasContext::create(
diff --git a/libs/hwui/tests/unit/SkiaPipelineTests.cpp b/libs/hwui/tests/unit/SkiaPipelineTests.cpp
index 494585a..0b8c2a9 100644
--- a/libs/hwui/tests/unit/SkiaPipelineTests.cpp
+++ b/libs/hwui/tests/unit/SkiaPipelineTests.cpp
@@ -36,7 +36,7 @@
 using namespace android::uirenderer::renderthread;
 using namespace android::uirenderer::skiapipeline;
 
-RENDERTHREAD_TEST(SkiaPipeline, renderFrame) {
+RENDERTHREAD_SKIA_PIPELINE_TEST(SkiaPipeline, renderFrame) {
     auto redNode = TestUtils::createSkiaNode(0, 0, 1, 1,
         [](RenderProperties& props, SkiaRecordingCanvas& redCanvas) {
             redCanvas.drawColor(SK_ColorRED, SkBlendMode::kSrcOver);
@@ -55,7 +55,7 @@
     ASSERT_EQ(TestUtils::getColor(surface, 0, 0), SK_ColorRED);
 }
 
-RENDERTHREAD_TEST(SkiaPipeline, renderFrameCheckOpaque) {
+RENDERTHREAD_SKIA_PIPELINE_TEST(SkiaPipeline, renderFrameCheckOpaque) {
     auto halfGreenNode = TestUtils::createSkiaNode(0, 0, 2, 2,
         [](RenderProperties& props, SkiaRecordingCanvas& bottomHalfGreenCanvas) {
             SkPaint greenPaint;
@@ -80,7 +80,7 @@
     ASSERT_EQ(TestUtils::getColor(surface, 0, 1), SK_ColorGREEN);
 }
 
-RENDERTHREAD_TEST(SkiaPipeline, renderFrameCheckDirtyRect) {
+RENDERTHREAD_SKIA_PIPELINE_TEST(SkiaPipeline, renderFrameCheckDirtyRect) {
     auto redNode = TestUtils::createSkiaNode(0, 0, 2, 2,
         [](RenderProperties& props, SkiaRecordingCanvas& redCanvas) {
             redCanvas.drawColor(SK_ColorRED, SkBlendMode::kSrcOver);
@@ -101,7 +101,7 @@
     ASSERT_EQ(TestUtils::getColor(surface, 1, 1), SK_ColorRED);
 }
 
-RENDERTHREAD_TEST(SkiaPipeline, renderLayer) {
+RENDERTHREAD_SKIA_PIPELINE_TEST(SkiaPipeline, renderLayer) {
     auto redNode = TestUtils::createSkiaNode(0, 0, 1, 1,
         [](RenderProperties& props, SkiaRecordingCanvas& redCanvas) {
             redCanvas.drawColor(SK_ColorRED, SkBlendMode::kSrcOver);
@@ -144,7 +144,7 @@
     blueNode->setLayerSurface(sk_sp<SkSurface>());
 }
 
-RENDERTHREAD_TEST(SkiaPipeline, renderOverdraw) {
+RENDERTHREAD_SKIA_PIPELINE_TEST(SkiaPipeline, renderOverdraw) {
     ScopedProperty<bool> prop(Properties::debugOverdraw, true);
 
     auto whiteNode = TestUtils::createSkiaNode(0, 0, 1, 1,
@@ -218,7 +218,7 @@
 };
 }
 
-RENDERTHREAD_TEST(SkiaPipeline, deferRenderNodeScene) {
+RENDERTHREAD_SKIA_PIPELINE_TEST(SkiaPipeline, deferRenderNodeScene) {
     class DeferTestCanvas : public SkCanvas {
     public:
         DeferTestCanvas() : SkCanvas(800, 600) {}
@@ -284,7 +284,7 @@
     EXPECT_EQ(4, surface->canvas()->mDrawCounter);
 }
 
-RENDERTHREAD_TEST(SkiaPipeline, clipped) {
+RENDERTHREAD_SKIA_PIPELINE_TEST(SkiaPipeline, clipped) {
     static const int CANVAS_WIDTH = 200;
     static const int CANVAS_HEIGHT = 200;
     class ClippedTestCanvas : public SkCanvas {
@@ -315,7 +315,7 @@
     EXPECT_EQ(1, surface->canvas()->mDrawCounter);
 }
 
-RENDERTHREAD_TEST(SkiaPipeline, clip_replace) {
+RENDERTHREAD_SKIA_PIPELINE_TEST(SkiaPipeline, clip_replace) {
     static const int CANVAS_WIDTH = 50;
     static const int CANVAS_HEIGHT = 50;
     class ClipReplaceTestCanvas : public SkCanvas {
diff --git a/libs/hwui/tests/unit/SkiaRenderPropertiesTests.cpp b/libs/hwui/tests/unit/SkiaRenderPropertiesTests.cpp
index e7171c8..92d9d3d 100644
--- a/libs/hwui/tests/unit/SkiaRenderPropertiesTests.cpp
+++ b/libs/hwui/tests/unit/SkiaRenderPropertiesTests.cpp
@@ -73,7 +73,7 @@
 
 }
 
-RENDERTHREAD_TEST(RenderNodeDrawable, renderPropClipping) {
+TEST(RenderNodeDrawable, renderPropClipping) {
     testProperty([](RenderProperties& properties) {
         properties.setClipToBounds(true);
         properties.setClipBounds(android::uirenderer::Rect(10, 20, 300, 400));
@@ -83,7 +83,7 @@
     });
 }
 
-RENDERTHREAD_TEST(RenderNodeDrawable, renderPropRevealClip) {
+TEST(RenderNodeDrawable, renderPropRevealClip) {
     testProperty([](RenderProperties& properties) {
         properties.mutableRevealClip().set(true, 50, 50, 25);
     }, [](const SkCanvas& canvas) {
@@ -98,7 +98,7 @@
     });
 }
 
-RENDERTHREAD_TEST(RenderNodeDrawable, renderPropOutlineClip) {
+TEST(RenderNodeDrawable, renderPropOutlineClip) {
     testProperty([](RenderProperties& properties) {
         properties.mutableOutline().setShouldClip(true);
         properties.mutableOutline().setRoundRect(10, 20, 30, 40, 5.0f, 0.5f);
@@ -114,7 +114,7 @@
     });
 }
 
-RENDERTHREAD_TEST(RenderNodeDrawable, renderPropTransform) {
+TEST(RenderNodeDrawable, renderPropTransform) {
     testProperty([](RenderProperties& properties) {
         properties.setLeftTopRightBottom(10, 10, 110, 110);
 
diff --git a/libs/hwui/tests/unit/TextDropShadowCacheTests.cpp b/libs/hwui/tests/unit/TextDropShadowCacheTests.cpp
index 0d26df2..8312bda 100644
--- a/libs/hwui/tests/unit/TextDropShadowCacheTests.cpp
+++ b/libs/hwui/tests/unit/TextDropShadowCacheTests.cpp
@@ -26,7 +26,7 @@
 using namespace android;
 using namespace android::uirenderer;
 
-RENDERTHREAD_TEST(TextDropShadowCache, addRemove) {
+RENDERTHREAD_OPENGL_PIPELINE_TEST(TextDropShadowCache, addRemove) {
     SkPaint paint;
     paint.setTextSize(20);
 
diff --git a/media/java/android/service/media/MediaBrowserService.java b/media/java/android/service/media/MediaBrowserService.java
index 16847c1..eaec493 100644
--- a/media/java/android/service/media/MediaBrowserService.java
+++ b/media/java/android/service/media/MediaBrowserService.java
@@ -387,7 +387,6 @@
      * @see BrowserRoot#EXTRA_RECENT
      * @see BrowserRoot#EXTRA_OFFLINE
      * @see BrowserRoot#EXTRA_SUGGESTED
-     * @see BrowserRoot#EXTRA_SUGGESTION_KEYWORDS
      */
     public abstract @Nullable BrowserRoot onGetRoot(@NonNull String clientPackageName,
             int clientUid, @Nullable Bundle rootHints);
@@ -550,7 +549,6 @@
      * @see MediaBrowserService.BrowserRoot#EXTRA_RECENT
      * @see MediaBrowserService.BrowserRoot#EXTRA_OFFLINE
      * @see MediaBrowserService.BrowserRoot#EXTRA_SUGGESTED
-     * @see MediaBrowserService.BrowserRoot#EXTRA_SUGGESTION_KEYWORDS
      */
     public final Bundle getBrowserRootHints() {
         if (mCurConnection == null) {
@@ -818,7 +816,6 @@
          *
          * @see #EXTRA_OFFLINE
          * @see #EXTRA_SUGGESTED
-         * @see #EXTRA_SUGGESTION_KEYWORDS
          */
         public static final String EXTRA_RECENT = "android.service.media.extra.RECENT";
 
@@ -836,7 +833,6 @@
          *
          * @see #EXTRA_RECENT
          * @see #EXTRA_SUGGESTED
-         * @see #EXTRA_SUGGESTION_KEYWORDS
          */
         public static final String EXTRA_OFFLINE = "android.service.media.extra.OFFLINE";
 
@@ -855,31 +851,9 @@
          *
          * @see #EXTRA_RECENT
          * @see #EXTRA_OFFLINE
-         * @see #EXTRA_SUGGESTION_KEYWORDS
          */
         public static final String EXTRA_SUGGESTED = "android.service.media.extra.SUGGESTED";
 
-        /**
-         * The lookup key for a string that indicates specific keywords which will be considered
-         * when the browser service suggests media items.
-         *
-         * <p>When creating a media browser for a given media browser service, this key can be
-         * supplied as a root hint together with {@link #EXTRA_SUGGESTED} for retrieving suggested
-         * media items related with the keywords. The list of media items passed in
-         * {@link android.media.browse.MediaBrowser.SubscriptionCallback#onChildrenLoaded(String, List)}
-         * is considered ordered by relevance, first being the top suggestion.
-         * If the media browser service can provide such media items, the implementation must return
-         * the key in the root hint when {@link #onGetRoot(String, int, Bundle)} is called back.
-         *
-         * <p>The root hint may contain multiple keys.
-         *
-         * @see #EXTRA_RECENT
-         * @see #EXTRA_OFFLINE
-         * @see #EXTRA_SUGGESTED
-         */
-        public static final String EXTRA_SUGGESTION_KEYWORDS
-                = "android.service.media.extra.SUGGESTION_KEYWORDS";
-
         final private String mRootId;
         final private Bundle mExtras;
 
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardStatusView.java b/packages/Keyguard/src/com/android/keyguard/KeyguardStatusView.java
index e1657c7..f8f4f2a 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardStatusView.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardStatusView.java
@@ -29,6 +29,7 @@
 import android.util.Slog;
 import android.util.TypedValue;
 import android.view.View;
+import android.view.ViewGroup;
 import android.widget.GridLayout;
 import android.widget.TextClock;
 import android.widget.TextView;
@@ -48,6 +49,7 @@
     private TextClock mDateView;
     private TextClock mClockView;
     private TextView mOwnerInfo;
+    private ViewGroup mClockContainer;
 
     private KeyguardUpdateMonitorCallback mInfoCallback = new KeyguardUpdateMonitorCallback() {
 
@@ -105,6 +107,7 @@
     @Override
     protected void onFinishInflate() {
         super.onFinishInflate();
+        mClockContainer = (ViewGroup) findViewById(R.id.keyguard_clock_container);
         mAlarmStatusView = (TextView) findViewById(R.id.alarm_status);
         mDateView = (TextClock) findViewById(R.id.date_view);
         mClockView = (TextClock) findViewById(R.id.clock_view);
@@ -167,6 +170,11 @@
         }
     }
 
+    public int getClockBottom() {
+        return mClockView.getBottom() +
+                ((MarginLayoutParams) mClockView.getLayoutParams()).bottomMargin;
+    }
+
     public static String formatNextAlarm(Context context, AlarmManager.AlarmClockInfo info) {
         if (info == null) {
             return "";
@@ -260,4 +268,15 @@
             cacheKey = key;
         }
     }
+
+    public void setDark(boolean dark) {
+        final int N = mClockContainer.getChildCount();
+        for (int i = 0; i < N; i++) {
+            View child = mClockContainer.getChildAt(i);
+            if (child == mClockView) {
+                continue;
+            }
+            child.setAlpha(dark ? 0 : 1);
+        }
+    }
 }
diff --git a/packages/SettingsLib/res/values/arrays.xml b/packages/SettingsLib/res/values/arrays.xml
index 5c00985..cfb990e 100644
--- a/packages/SettingsLib/res/values/arrays.xml
+++ b/packages/SettingsLib/res/values/arrays.xml
@@ -105,10 +105,10 @@
 
     <!-- Titles for Bluetooth Audio Codec selection preference. [CHAR LIMIT=40] -->
     <string-array name="bluetooth_a2dp_codec_titles">
-        <item>Default</item>
+        <item>Use System Selection (Default)</item>
         <item>SBC</item>
         <item>aptX</item>
-        <item>aptX-HD</item>
+        <item>aptX HD</item>
         <item>LDAC</item>
     </string-array>
 
@@ -123,16 +123,16 @@
 
     <!-- Summaries for Bluetooth Audio Codec selection preference. [CHAR LIMIT=40]-->
     <string-array name="bluetooth_a2dp_codec_summaries" >
-        <item>Default</item>
+        <item>Use System Selection (Default)</item>
         <item>SBC</item>
         <item>aptX</item>
-        <item>aptX-HD</item>
+        <item>aptX HD</item>
         <item>LDAC</item>
     </string-array>
 
     <!-- Titles for Bluetooth Audio Codec Sample Rate selection preference. [CHAR LIMIT=40] -->
     <string-array name="bluetooth_a2dp_codec_sample_rate_titles">
-        <item>Default</item>
+        <item>Use System Selection (Default)</item>
         <item>44.1 kHz</item>
         <item>48.0 kHz</item>
         <item>88.2 kHz</item>
@@ -150,7 +150,7 @@
 
     <!-- Summaries for Bluetooth Audio Codec Sample Rate selection preference. [CHAR LIMIT=40]-->
     <string-array name="bluetooth_a2dp_codec_sample_rate_summaries" >
-        <item>Default</item>
+        <item>Use System Selection (Default)</item>
         <item>44.1 kHz</item>
         <item>48.0 kHz</item>
         <item>88.2 kHz</item>
@@ -159,7 +159,7 @@
 
     <!-- Titles for Bluetooth Audio Codec Bits Per Sample selection preference. [CHAR LIMIT=40] -->
     <string-array name="bluetooth_a2dp_codec_bits_per_sample_titles">
-        <item>Default</item>
+        <item>Use System Selection (Default)</item>
         <item>16 bits/sample</item>
         <item>24 bits/sample</item>
         <item>32 bits/sample</item>
@@ -175,7 +175,7 @@
 
     <!-- Summaries for Bluetooth Audio Codec Bits Per Sample selection preference. [CHAR LIMIT=40]-->
     <string-array name="bluetooth_a2dp_codec_bits_per_sample_summaries" >
-        <item>Default</item>
+        <item>Use System Selection (Default)</item>
         <item>16 bits/sample</item>
         <item>24 bits/sample</item>
         <item>32 bits/sample</item>
@@ -183,7 +183,7 @@
 
     <!-- Titles for Bluetooth Audio Codec Channel Mode selection preference. [CHAR LIMIT=40] -->
     <string-array name="bluetooth_a2dp_codec_channel_mode_titles">
-        <item>Default</item>
+        <item>Use System Selection (Default)</item>
         <item>Mono</item>
         <item>Stereo</item>
     </string-array>
@@ -197,16 +197,16 @@
 
     <!-- Summaries for Bluetooth Audio Codec Channel Mode selection preference. [CHAR LIMIT=40]-->
     <string-array name="bluetooth_a2dp_codec_channel_mode_summaries" >
-        <item>Default</item>
+        <item>Use System Selection (Default)</item>
         <item>Mono</item>
         <item>Stereo</item>
     </string-array>
 
-    <!-- Titles for Bluetooth Audio Codec LDAC Playback Quality selection preference. [CHAR LIMIT=40] -->
+    <!-- Titles for Bluetooth Audio Codec LDAC Playback Quality selection preference. [CHAR LIMIT=70] -->
     <string-array name="bluetooth_a2dp_codec_ldac_playback_quality_titles">
-        <item>Sound quality preferred (990kbps/909kbps)</item>
-        <item>Standard (660kbps/606kbps)</item>
-        <item>Connection preferred (330kbps/303kbps)</item>
+        <item>Optimize for Audio Quality (990kbps/909kbps)</item>
+        <item>Balanced Audio And Connection Quality (660kbps/606kbps)</item>
+        <item>Optimize for Connection Quality (330kbps/303kbps)</item>
     </string-array>
 
     <!-- Values for Bluetooth Audio Codec LDAC Playback Quaility selection preference. -->
@@ -216,11 +216,11 @@
         <item>1002</item>
     </string-array>
 
-    <!-- Summaries for Bluetooth Audio Codec LDAC Playback Quality selection preference. [CHAR LIMIT=40]-->
+    <!-- Summaries for Bluetooth Audio Codec LDAC Playback Quality selection preference. [CHAR LIMIT=70]-->
     <string-array name="bluetooth_a2dp_codec_ldac_playback_quality_summaries" >
-        <item>Sound quality preferred (990kbps/909kbps)</item>
-        <item>Standard (660kbps/606kbps)</item>
-        <item>Connection preferred (330kbps/303kbps)</item>
+        <item>Optimize for Audio Quality</item>
+        <item>Balanced Audio And Connection Quality</item>
+        <item>Optimize for Connection Quality</item>
     </string-array>
 
     <!-- Titles for logd limit size selection preference. [CHAR LIMIT=14] -->
diff --git a/packages/SettingsLib/res/values/strings.xml b/packages/SettingsLib/res/values/strings.xml
index 93bd5dc..a1b2bdf 100644
--- a/packages/SettingsLib/res/values/strings.xml
+++ b/packages/SettingsLib/res/values/strings.xml
@@ -430,28 +430,31 @@
 
     <!-- UI debug setting: Select Bluetooth Audio Codec -->
     <string name="bluetooth_select_a2dp_codec_type">Bluetooth Audio Codec</string>
-    <!-- UI debug setting: Select Preferred Bluetooth A2DP Codec -->
-    <string name="bluetooth_select_a2dp_codec_type_dialog_title">Select Preferred Bluetooth A2DP Codec</string>
+    <!-- UI debug setting: Select Bluetooth Audio Codec -->
+    <string name="bluetooth_select_a2dp_codec_type_dialog_title">Select Bluetooth Audio Codec</string>
 
     <!-- UI debug setting: Select Bluetooth Audio Sample Rate -->
     <string name="bluetooth_select_a2dp_codec_sample_rate">Bluetooth Audio Sample Rate</string>
-    <!-- UI debug setting: Select Preferred Bluetooth A2DP Codec Sample Rate -->
-    <string name="bluetooth_select_a2dp_codec_sample_rate_dialog_title">Select Preferred Bluetooth A2DP Codec Sample Rate</string>
+    <!-- UI debug setting: Select Bluetooth Audio Codec: Sample Rate -->
+    <string name="bluetooth_select_a2dp_codec_sample_rate_dialog_title">Select Bluetooth Audio Codec:\u000ASample Rate</string>
 
     <!-- UI debug setting: Select Bluetooth Audio Bits Per Sample -->
     <string name="bluetooth_select_a2dp_codec_bits_per_sample">Bluetooth Audio Bits Per Sample</string>
-    <!-- UI debug setting: Select Preferred Bluetooth A2DP Codec Bits Per Sample -->
-    <string name="bluetooth_select_a2dp_codec_bits_per_sample_dialog_title">Select Preferred Bluetooth A2DP Codec Bits Per Sample</string>
+    <!-- UI debug setting: Select Bluetooth Audio Codec: Bits Per Sample -->
+    <string name="bluetooth_select_a2dp_codec_bits_per_sample_dialog_title">Select Bluetooth Audio Codec:\u000ABits Per Sample</string>
 
     <!-- UI debug setting: Select Bluetooth Audio Channel Mode -->
     <string name="bluetooth_select_a2dp_codec_channel_mode">Bluetooth Audio Channel Mode</string>
-    <!-- UI debug setting: Select Preferred Bluetooth A2DP Codec Channel Mode -->
-    <string name="bluetooth_select_a2dp_codec_channel_mode_dialog_title">Select Preferred Bluetooth A2DP Codec Channel Mode</string>
+    <!-- UI debug setting: Select Bluetooth Audio Codec: Channel Mode -->
+    <string name="bluetooth_select_a2dp_codec_channel_mode_dialog_title">Select Bluetooth Audio Codec:\u000AChannel Mode</string>
 
     <!-- UI debug setting: Select Bluetooth Audio LDAC Playback Quality -->
-    <string name="bluetooth_select_a2dp_codec_ldac_playback_quality">Bluetooth Audio LDAC Playback Quality</string>
-    <!-- UI debug setting: Select Preferred Bluetooth A2DP Codec LDAC Playback Quality -->
-    <string name="bluetooth_select_a2dp_codec_ldac_playback_quality_dialog_title">Select Preferred Bluetooth A2DP Codec LDAC Playback Quality</string>
+    <string name="bluetooth_select_a2dp_codec_ldac_playback_quality">Bluetooth Audio LDAC Codec: Playback Quality</string>
+    <!-- UI debug setting: Select Bluetooth Audio LDAC Codec: LDAC Playback Quality -->
+    <string name="bluetooth_select_a2dp_codec_ldac_playback_quality_dialog_title">Select Bluetooth Audio LDAC Codec:\u000APlayback Quality</string>
+
+    <!-- [CHAR LIMIT=NONE] Label for displaying Bluetooth Audio Codec Parameters while streaming -->
+    <string name="bluetooth_select_a2dp_codec_streaming_label">Streaming: <xliff:g id="streaming_parameter">%1$s</xliff:g></string>
 
     <!-- setting Checkbox summary whether to show options for wireless display certification  -->
     <string name="wifi_display_certification_summary">Show options for wireless display certification</string>
diff --git a/packages/SettingsLib/src/com/android/settingslib/accessibility/AccessibilityUtils.java b/packages/SettingsLib/src/com/android/settingslib/accessibility/AccessibilityUtils.java
index fcff305..9bb3c36 100644
--- a/packages/SettingsLib/src/com/android/settingslib/accessibility/AccessibilityUtils.java
+++ b/packages/SettingsLib/src/com/android/settingslib/accessibility/AccessibilityUtils.java
@@ -28,6 +28,8 @@
 import android.util.ArraySet;
 import android.view.accessibility.AccessibilityManager;
 
+import com.android.internal.R;
+
 import java.util.Collections;
 import java.util.HashSet;
 import java.util.List;
@@ -147,6 +149,26 @@
                 enabledServicesBuilder.toString(), userId);
     }
 
+    /**
+     * Get the name of the service that should be toggled by the accessibility shortcut. Use
+     * an OEM-configurable default if the setting has never been set.
+     *
+     * @param context A valid context
+     * @param userId The user whose settings should be checked
+     *
+     * @return The component name, flattened to a string, of the target service.
+     */
+    public static String getShortcutTargetServiceComponentNameString(
+            Context context, int userId) {
+        final String currentShortcutServiceId = Settings.Secure.getStringForUser(
+                context.getContentResolver(), Settings.Secure.ACCESSIBILITY_SHORTCUT_TARGET_SERVICE,
+                userId);
+        if (currentShortcutServiceId != null) {
+            return currentShortcutServiceId;
+        }
+        return context.getString(R.string.config_defaultAccessibilityService);
+    }
+
     private static Set<ComponentName> getInstalledServices(Context context) {
         final Set<ComponentName> installedServices = new HashSet<>();
         installedServices.clear();
diff --git a/packages/SystemUI/res/drawable/ic_qs_nfc_disabled.xml b/packages/SystemUI/res/drawable/ic_qs_nfc_disabled.xml
new file mode 100644
index 0000000..558f3d0
--- /dev/null
+++ b/packages/SystemUI/res/drawable/ic_qs_nfc_disabled.xml
@@ -0,0 +1,31 @@
+<!--
+     Copyright (C) 2016 The Android Open Source Project
+
+     Licensed under the Apache License, Version 2.0 (the "License");
+     you may not use this file except in compliance with the License.
+     You may obtain a copy of the License at
+
+          http://www.apache.org/licenses/LICENSE-2.0
+
+     Unless required by applicable law or agreed to in writing, software
+     distributed under the License is distributed on an "AS IS" BASIS,
+     WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+     See the License for the specific language governing permissions and
+     limitations under the License.
+-->
+<vector xmlns:android="http://schemas.android.com/apk/res/android"
+    android:width="24dp"
+    android:height="24dp"
+    android:viewportWidth="24"
+    android:viewportHeight="24">
+
+    <path
+        android:pathData="M4 20h16V4H4v16z" />
+    <path
+        android:fillColor="#4DFFFFFF"
+        android:pathData="M20 2H4c-1.1 0-2 .9-2 2v16c0 1.1 .9 2 2 2h16c1.1 0 2-.9 2-2V4c0-1.1-.9-2-2-2zm0
+18H4V4h16v16zM18 6h-5c-1.1 0-2 .9-2 2v2.28c-.6 .35 -1 .98-1 1.72 0 1.1 .9 2 2
+2s2-.9 2-2c0-.74-.4-1.38-1-1.72V8h3v8H8V8h2V6H6v12h12V6z" />
+    <path
+        android:pathData="M0 0h24v24H0z" />
+</vector>
diff --git a/packages/SystemUI/res/drawable/ic_qs_nfc_enabled.xml b/packages/SystemUI/res/drawable/ic_qs_nfc_enabled.xml
new file mode 100644
index 0000000..becb18a
--- /dev/null
+++ b/packages/SystemUI/res/drawable/ic_qs_nfc_enabled.xml
@@ -0,0 +1,31 @@
+<!--
+     Copyright (C) 2016 The Android Open Source Project
+
+     Licensed under the Apache License, Version 2.0 (the "License");
+     you may not use this file except in compliance with the License.
+     You may obtain a copy of the License at
+
+          http://www.apache.org/licenses/LICENSE-2.0
+
+     Unless required by applicable law or agreed to in writing, software
+     distributed under the License is distributed on an "AS IS" BASIS,
+     WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+     See the License for the specific language governing permissions and
+     limitations under the License.
+-->
+<vector xmlns:android="http://schemas.android.com/apk/res/android"
+    android:width="24dp"
+    android:height="24dp"
+    android:viewportWidth="24"
+    android:viewportHeight="24">
+
+    <path
+        android:pathData="M4 20h16V4H4v16z" />
+    <path
+        android:fillColor="#FFFFFFFF"
+        android:pathData="M20 2H4c-1.1 0-2 .9-2 2v16c0 1.1 .9 2 2 2h16c1.1 0 2-.9 2-2V4c0-1.1-.9-2-2-2zm0
+18H4V4h16v16zM18 6h-5c-1.1 0-2 .9-2 2v2.28c-.6 .35 -1 .98-1 1.72 0 1.1 .9 2 2
+2s2-.9 2-2c0-.74-.4-1.38-1-1.72V8h3v8H8V8h2V6H6v12h12V6z" />
+    <path
+        android:pathData="M0 0h24v24H0z" />
+</vector>
diff --git a/packages/SystemUI/res/drawable/recents_grid_task_view_focus_frame_background.xml b/packages/SystemUI/res/drawable/recents_grid_task_view_focus_frame_background.xml
new file mode 100644
index 0000000..a85beb8
--- /dev/null
+++ b/packages/SystemUI/res/drawable/recents_grid_task_view_focus_frame_background.xml
@@ -0,0 +1,19 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!-- Copyright (C) 2017 The Android Open Source Project
+
+     Licensed under the Apache License, Version 2.0 (the "License");
+     you may not use this file except in compliance with the License.
+     You may obtain a copy of the License at
+
+          http://www.apache.org/licenses/LICENSE-2.0
+
+     Unless required by applicable law or agreed to in writing, software
+     distributed under the License is distributed on an "AS IS" BASIS,
+     WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+     See the License for the specific language governing permissions and
+     limitations under the License.
+-->
+<shape xmlns:android="http://schemas.android.com/apk/res/android">
+  <solid android:color="#61FFFFFF" />
+  <corners android:radius="8dp"/>
+</shape>
\ No newline at end of file
diff --git a/packages/SystemUI/res/values/dimens.xml b/packages/SystemUI/res/values/dimens.xml
index 78d211f..6ffdbcb 100644
--- a/packages/SystemUI/res/values/dimens.xml
+++ b/packages/SystemUI/res/values/dimens.xml
@@ -75,6 +75,9 @@
     <!-- Height of a large notification in the status bar -->
     <dimen name="notification_max_height">284dp</dimen>
 
+    <!-- Height of an ambient notification on ambient display -->
+    <dimen name="notification_ambient_height">400dp</dimen>
+
     <!-- Height of a heads up notification in the status bar for legacy custom views -->
     <dimen name="notification_max_heads_up_height_legacy">128dp</dimen>
 
diff --git a/packages/SystemUI/res/values/dimens_grid.xml b/packages/SystemUI/res/values/dimens_grid.xml
index 94ffdb1..0b9836ff 100644
--- a/packages/SystemUI/res/values/dimens_grid.xml
+++ b/packages/SystemUI/res/values/dimens_grid.xml
@@ -21,5 +21,6 @@
   <dimen name="recents_grid_padding_task_view">20dp</dimen>
   <dimen name="recents_grid_task_view_header_height">44dp</dimen>
   <dimen name="recents_grid_task_view_header_button_padding">8dp</dimen>
+  <dimen name="recents_grid_task_view_focused_frame_thickness">8dp</dimen>
 </resources>
 
diff --git a/packages/SystemUI/res/values/strings.xml b/packages/SystemUI/res/values/strings.xml
index 69515fa..a17430a 100644
--- a/packages/SystemUI/res/values/strings.xml
+++ b/packages/SystemUI/res/values/strings.xml
@@ -760,6 +760,12 @@
     <string name="quick_settings_work_mode_label">Work mode</string>
     <!-- QuickSettings: Label for the toggle to activate Night display (renamed "Night Light" with title caps). [CHAR LIMIT=20] -->
     <string name="quick_settings_night_display_label">Night Light</string>
+    <!-- QuickSettings: NFC tile [CHAR LIMIT=NONE] -->
+    <string name="quick_settings_nfc_label">NFC</string>
+    <!-- QuickSettings: NFC (off) [CHAR LIMIT=NONE] -->
+    <string name="quick_settings_nfc_off">NFC is disabled</string>
+    <!-- QuickSettings: NFC (on) [CHAR LIMIT=NONE] -->
+    <string name="quick_settings_nfc_on">NFC is enabled</string>
 
     <!-- Recents: The empty recents string. [CHAR LIMIT=NONE] -->
     <string name="recents_empty_message">No recent items</string>
diff --git a/packages/SystemUI/src/com/android/systemui/ExpandHelper.java b/packages/SystemUI/src/com/android/systemui/ExpandHelper.java
index d98bb23..8141b28 100644
--- a/packages/SystemUI/src/com/android/systemui/ExpandHelper.java
+++ b/packages/SystemUI/src/com/android/systemui/ExpandHelper.java
@@ -326,7 +326,7 @@
             case MotionEvent.ACTION_CANCEL:
             case MotionEvent.ACTION_UP:
                 if (DEBUG) Log.d(TAG, "up/cancel");
-                finishExpanding(ev.getActionMasked() == MotionEvent.ACTION_CANCEL,
+                finishExpanding(ev.getActionMasked() == MotionEvent.ACTION_CANCEL /* forceAbort */,
                         getCurrentVelocity());
                 clearView();
                 break;
@@ -587,6 +587,9 @@
             mFlingAnimationUtils.apply(mScaleAnimation, currentHeight, targetHeight, velocity);
             mScaleAnimation.start();
         } else {
+            if (targetHeight != currentHeight) {
+                mScaler.setHeight(targetHeight);
+            }
             mCallback.setUserExpandedChild(mResizedView, nowExpanded);
             mCallback.setUserLockedChild(mResizedView, false);
         }
diff --git a/packages/SystemUI/src/com/android/systemui/doze/DozeHost.java b/packages/SystemUI/src/com/android/systemui/doze/DozeHost.java
index e081b53..00d2298 100644
--- a/packages/SystemUI/src/com/android/systemui/doze/DozeHost.java
+++ b/packages/SystemUI/src/com/android/systemui/doze/DozeHost.java
@@ -37,7 +37,7 @@
 
     interface Callback {
         default void onNewNotifications() {}
-        default void onBuzzBeepBlinked() {}
+        default void onNotificationHeadsUp() {}
         default void onNotificationLight(boolean on) {}
         default void onPowerSaveChanged(boolean active) {}
     }
diff --git a/packages/SystemUI/src/com/android/systemui/doze/DozeTriggers.java b/packages/SystemUI/src/com/android/systemui/doze/DozeTriggers.java
index 84b22ea..db5a392 100644
--- a/packages/SystemUI/src/com/android/systemui/doze/DozeTriggers.java
+++ b/packages/SystemUI/src/com/android/systemui/doze/DozeTriggers.java
@@ -309,7 +309,7 @@
 
     private DozeHost.Callback mHostCallback = new DozeHost.Callback() {
         @Override
-        public void onBuzzBeepBlinked() {
+        public void onNotificationHeadsUp() {
             onNotification();
         }
 
diff --git a/packages/SystemUI/src/com/android/systemui/qs/tiles/NfcTile.java b/packages/SystemUI/src/com/android/systemui/qs/tiles/NfcTile.java
new file mode 100644
index 0000000..967c922
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/qs/tiles/NfcTile.java
@@ -0,0 +1,136 @@
+/*
+ * Copyright (c) 2016, The Android Open Source Project
+ * Contributed by the Paranoid Android Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.qs.tiles;
+
+import android.content.BroadcastReceiver;
+import android.content.Context;
+import android.content.Intent;
+import android.content.IntentFilter;
+import android.content.pm.PackageManager;
+import android.graphics.drawable.Drawable;
+import android.nfc.NfcAdapter;
+import android.provider.Settings;
+import android.widget.Switch;
+
+import com.android.internal.logging.MetricsLogger;
+import com.android.internal.logging.nano.MetricsProto.MetricsEvent;
+import com.android.systemui.R;
+import com.android.systemui.qs.QSTile;
+
+/** Quick settings tile: Enable/Disable NFC **/
+public class NfcTile extends QSTile<QSTile.BooleanState> {
+
+    private NfcAdapter mAdapter;
+
+    private boolean mListening;
+
+    public NfcTile(Host host) {
+        super(host);
+    }
+
+    @Override
+    public BooleanState newTileState() {
+        return new BooleanState();
+    }
+
+    @Override
+    public void setListening(boolean listening) {
+        mListening = listening;
+        if (mListening) {
+            mContext.registerReceiver(mNfcReceiver,
+                    new IntentFilter(NfcAdapter.ACTION_ADAPTER_STATE_CHANGED));
+            if (mAdapter == null) {
+                try {
+                    mAdapter = NfcAdapter.getNfcAdapter(mContext);
+                } catch (UnsupportedOperationException e) {
+                    mAdapter = null;
+                }
+            }
+        } else {
+            mContext.unregisterReceiver(mNfcReceiver);
+        }
+    }
+
+    @Override
+    public boolean isAvailable() {
+        return mContext.getPackageManager().hasSystemFeature(PackageManager.FEATURE_NFC);
+    }
+
+    @Override
+    protected void handleUserSwitch(int newUserId) {
+    }
+
+    @Override
+    public Intent getLongClickIntent() {
+        return new Intent(Settings.ACTION_NFC_SETTINGS);
+    }
+
+    @Override
+    protected void handleClick() {
+        if (mAdapter == null) return;
+        MetricsLogger.action(mContext, getMetricsCategory(), !mState.value);
+        if (!mAdapter.isEnabled()) {
+            mAdapter.enable();
+        } else {
+            mAdapter.disable();
+        }
+    }
+
+    @Override
+    protected void handleSecondaryClick() {
+        handleClick();
+    }
+
+    @Override
+    public CharSequence getTileLabel() {
+        return mContext.getString(R.string.quick_settings_nfc_label);
+    }
+
+    @Override
+    protected void handleUpdateState(BooleanState state, Object arg) {
+        final Drawable mEnable = mContext.getDrawable(R.drawable.ic_qs_nfc_enabled);
+        final Drawable mDisable = mContext.getDrawable(R.drawable.ic_qs_nfc_disabled);
+        state.value = mAdapter == null ? false : mAdapter.isEnabled();
+        state.label = mContext.getString(R.string.quick_settings_nfc_label);
+        state.icon = new DrawableIcon(state.value ? mEnable : mDisable);
+        state.minimalAccessibilityClassName = state.expandedAccessibilityClassName
+                = Switch.class.getName();
+        state.contentDescription = state.label;
+    }
+
+    @Override
+    public int getMetricsCategory() {
+        return MetricsEvent.QS_NFC;
+    }
+
+    @Override
+    protected String composeChangeAnnouncement() {
+        if (mState.value) {
+            return mContext.getString(R.string.quick_settings_nfc_on);
+        } else {
+            return mContext.getString(R.string.quick_settings_nfc_off);
+        }
+    }
+
+    private BroadcastReceiver mNfcReceiver = new BroadcastReceiver() {
+        @Override
+        public void onReceive(Context context, Intent intent) {
+            refreshState();
+        }
+    };
+}
diff --git a/packages/SystemUI/src/com/android/systemui/recents/RecentsActivityLaunchState.java b/packages/SystemUI/src/com/android/systemui/recents/RecentsActivityLaunchState.java
index 914035b..a7f6b70 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/RecentsActivityLaunchState.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/RecentsActivityLaunchState.java
@@ -50,7 +50,7 @@
     /**
      * Returns the task to focus given the current launch state.
      */
-    public int getInitialFocusTaskIndex(int numTasks) {
+    public int getInitialFocusTaskIndex(int numTasks, boolean useGridLayout) {
         RecentsDebugFlags debugFlags = Recents.getDebugFlags();
         RecentsActivityLaunchState launchState = Recents.getConfiguration().getLaunchState();
         if (launchedFromApp) {
@@ -66,6 +66,11 @@
                 return numTasks - 1;
             }
 
+            if (useGridLayout) {
+                // If coming from another app to the grid layout, focus the front most task
+                return numTasks - 1;
+            }
+
             // If coming from another app, focus the next task
             return Math.max(0, numTasks - 2);
         } else {
diff --git a/packages/SystemUI/src/com/android/systemui/recents/RecentsImpl.java b/packages/SystemUI/src/com/android/systemui/recents/RecentsImpl.java
index 0a56eac..cf6357b 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/RecentsImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/RecentsImpl.java
@@ -23,6 +23,7 @@
 import static android.view.View.MeasureSpec;
 
 import android.app.ActivityManager;
+import android.app.ActivityManager.TaskSnapshot;
 import android.app.ActivityOptions;
 import android.content.ActivityNotFoundException;
 import android.content.Context;
@@ -60,6 +61,7 @@
 import com.android.systemui.recents.events.component.ScreenPinningRequestEvent;
 import com.android.systemui.recents.events.ui.DraggingInRecentsEndedEvent;
 import com.android.systemui.recents.events.ui.DraggingInRecentsEvent;
+import com.android.systemui.recents.events.ui.TaskSnapshotChangedEvent;
 import com.android.systemui.recents.misc.DozeTrigger;
 import com.android.systemui.recents.misc.ForegroundThread;
 import com.android.systemui.recents.misc.SystemServicesProxy;
@@ -131,6 +133,11 @@
                 loader.loadTasks(mContext, plan, launchOpts);
             }
         }
+
+        @Override
+        public void onTaskSnapshotChanged(int taskId, TaskSnapshot snapshot) {
+            EventBus.getDefault().send(new TaskSnapshotChangedEvent(taskId, snapshot));
+        }
     }
 
     protected static RecentsTaskLoadPlan sInstanceLoadPlan;
@@ -738,8 +745,12 @@
             Task toTask = new Task();
             TaskViewTransform toTransform = getThumbnailTransitionTransform(stackView, toTask,
                     windowOverrideRect);
-            Bitmap thumbnail = drawThumbnailTransitionBitmap(toTask, toTransform,
-                    mThumbTransitionBitmapCache);
+            // When using a grid layout, the header is already visible on screen at the target
+            // location, making it unnecessary to draw it in the transition thumbnail.
+            Bitmap thumbnail = stackView.useGridLayout()
+                    ? mThumbTransitionBitmapCache.createAshmemBitmap()
+                    : drawThumbnailTransitionBitmap(toTask, toTransform,
+                            mThumbTransitionBitmapCache);
             if (thumbnail != null) {
                 RectF toTaskRect = toTransform.rect;
                 return ActivityOptions.makeThumbnailAspectScaleDownAnimation(mDummyStackView,
@@ -770,7 +781,6 @@
         // Get the transform for the running task
         stackView.updateLayoutAlgorithm(true /* boundScroll */);
         stackView.updateToInitialState();
-        boolean isInSplitScreen = Recents.getSystemServices().hasDockedTask();
         stackView.getStackAlgorithm().getStackTransformScreenCoordinates(launchTask,
                 stackView.getScroller().getStackScroll(), mTmpTransform, null, windowOverrideRect);
         return mTmpTransform;
diff --git a/packages/SystemUI/src/com/android/systemui/recents/events/ui/TaskSnapshotChangedEvent.java b/packages/SystemUI/src/com/android/systemui/recents/events/ui/TaskSnapshotChangedEvent.java
new file mode 100644
index 0000000..07c3b3d
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/recents/events/ui/TaskSnapshotChangedEvent.java
@@ -0,0 +1,35 @@
+/*
+ * Copyright (C) 2017 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.systemui.recents.events.ui;
+
+import android.app.ActivityManager.TaskSnapshot;
+
+import com.android.systemui.recents.events.EventBus;
+
+/**
+ * Sent when a task snapshot has changed.
+ */
+public class TaskSnapshotChangedEvent extends EventBus.Event {
+
+    public final int taskId;
+    public final TaskSnapshot taskSnapshot;
+
+    public TaskSnapshotChangedEvent(int taskId, TaskSnapshot taskSnapshot) {
+        this.taskId = taskId;
+        this.taskSnapshot = taskSnapshot;
+    }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/recents/misc/SystemServicesProxy.java b/packages/SystemUI/src/com/android/systemui/recents/misc/SystemServicesProxy.java
index 3587b89..a2b86d1 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/misc/SystemServicesProxy.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/misc/SystemServicesProxy.java
@@ -24,7 +24,9 @@
 import static android.app.ActivityManager.StackId.PINNED_STACK_ID;
 import static android.provider.Settings.Global.DEVELOPMENT_ENABLE_FREEFORM_WINDOWS_SUPPORT;
 
+import android.annotation.NonNull;
 import android.app.ActivityManager;
+import android.app.ActivityManager.TaskSnapshot;
 import android.app.ActivityOptions;
 import android.app.AppGlobals;
 import android.app.IActivityManager;
@@ -148,6 +150,7 @@
      */
     public abstract static class TaskStackListener {
         public void onTaskStackChanged() { }
+        public void onTaskSnapshotChanged(int taskId, TaskSnapshot snapshot) { }
         public void onActivityPinned() { }
         public void onPinnedActivityRestartAttempt() { }
         public void onPinnedStackAnimationEnded() { }
@@ -202,6 +205,12 @@
         public void onTaskProfileLocked(int taskId, int userId) {
             mHandler.obtainMessage(H.ON_TASK_PROFILE_LOCKED, taskId, userId).sendToTarget();
         }
+
+        @Override
+        public void onTaskSnapshotChanged(int taskId, TaskSnapshot snapshot)
+                throws RemoteException {
+            mHandler.obtainMessage(H.ON_TASK_SNAPSHOT_CHANGED, taskId, 0, snapshot).sendToTarget();
+        }
     };
 
     /**
@@ -591,17 +600,17 @@
     /** Returns the top task thumbnail for the given task id */
     public ThumbnailData getTaskThumbnail(int taskId) {
         if (mAm == null) return null;
-        ThumbnailData thumbnailData = new ThumbnailData();
 
         // If we are mocking, then just return a dummy thumbnail
         if (RecentsDebugFlags.Static.EnableMockTasks) {
+            ThumbnailData thumbnailData = new ThumbnailData();
             thumbnailData.thumbnail = Bitmap.createBitmap(mDummyThumbnailWidth,
                     mDummyThumbnailHeight, Bitmap.Config.ARGB_8888);
             thumbnailData.thumbnail.eraseColor(0xff333333);
             return thumbnailData;
         }
 
-        getThumbnail(taskId, thumbnailData);
+        ThumbnailData thumbnailData = getThumbnail(taskId);
         if (thumbnailData.thumbnail != null && !ActivityManager.ENABLE_TASK_SNAPSHOTS) {
             thumbnailData.thumbnail.setHasAlpha(false);
             // We use a dumb heuristic for now, if the thumbnail is purely transparent in the top
@@ -621,11 +630,12 @@
     /**
      * Returns a task thumbnail from the activity manager
      */
-    public void getThumbnail(int taskId, ThumbnailData thumbnailDataOut) {
+    public @NonNull ThumbnailData getThumbnail(int taskId) {
         if (mAm == null) {
-            return;
+            return new ThumbnailData();
         }
 
+        final ThumbnailData thumbnailData;
         if (ActivityManager.ENABLE_TASK_SNAPSHOTS) {
             ActivityManager.TaskSnapshot snapshot = null;
             try {
@@ -634,16 +644,14 @@
                 Log.w(TAG, "Failed to retrieve snapshot", e);
             }
             if (snapshot != null) {
-                thumbnailDataOut.thumbnail = Bitmap.createHardwareBitmap(snapshot.getSnapshot());
-                thumbnailDataOut.orientation = snapshot.getOrientation();
-                thumbnailDataOut.insets.set(snapshot.getContentInsets());
+                thumbnailData = ThumbnailData.createFromTaskSnapshot(snapshot);
             } else {
-                thumbnailDataOut.thumbnail = null;
+                return new ThumbnailData();
             }
         } else {
             ActivityManager.TaskThumbnail taskThumbnail = mAm.getTaskThumbnail(taskId);
             if (taskThumbnail == null) {
-                return;
+                return new ThumbnailData();
             }
 
             Bitmap thumbnail = taskThumbnail.mainThumbnail;
@@ -658,10 +666,12 @@
                 } catch (IOException e) {
                 }
             }
-            thumbnailDataOut.thumbnail = thumbnail;
-            thumbnailDataOut.orientation = taskThumbnail.thumbnailInfo.screenOrientation;
-            thumbnailDataOut.insets.setEmpty();
+            thumbnailData = new ThumbnailData();
+            thumbnailData.thumbnail = thumbnail;
+            thumbnailData.orientation = taskThumbnail.thumbnailInfo.screenOrientation;
+            thumbnailData.insets.setEmpty();
         }
+        return thumbnailData;
     }
 
     /**
@@ -1172,12 +1182,13 @@
 
     private final class H extends Handler {
         private static final int ON_TASK_STACK_CHANGED = 1;
-        private static final int ON_ACTIVITY_PINNED = 2;
-        private static final int ON_PINNED_ACTIVITY_RESTART_ATTEMPT = 3;
-        private static final int ON_PINNED_STACK_ANIMATION_ENDED = 4;
-        private static final int ON_ACTIVITY_FORCED_RESIZABLE = 5;
-        private static final int ON_ACTIVITY_DISMISSING_DOCKED_STACK = 6;
-        private static final int ON_TASK_PROFILE_LOCKED = 7;
+        private static final int ON_TASK_SNAPSHOT_CHANGED = 2;
+        private static final int ON_ACTIVITY_PINNED = 3;
+        private static final int ON_PINNED_ACTIVITY_RESTART_ATTEMPT = 4;
+        private static final int ON_PINNED_STACK_ANIMATION_ENDED = 5;
+        private static final int ON_ACTIVITY_FORCED_RESIZABLE = 6;
+        private static final int ON_ACTIVITY_DISMISSING_DOCKED_STACK = 7;
+        private static final int ON_TASK_PROFILE_LOCKED = 8;
 
         @Override
         public void handleMessage(Message msg) {
@@ -1188,6 +1199,13 @@
                     }
                     break;
                 }
+                case ON_TASK_SNAPSHOT_CHANGED: {
+                    for (int i = mTaskStackListeners.size() - 1; i >= 0; i--) {
+                        mTaskStackListeners.get(i).onTaskSnapshotChanged(msg.arg1,
+                                (TaskSnapshot) msg.obj);
+                    }
+                    break;
+                }
                 case ON_ACTIVITY_PINNED: {
                     for (int i = mTaskStackListeners.size() - 1; i >= 0; i--) {
                         mTaskStackListeners.get(i).onActivityPinned();
diff --git a/packages/SystemUI/src/com/android/systemui/recents/model/TaskStack.java b/packages/SystemUI/src/com/android/systemui/recents/model/TaskStack.java
index 178cb9f..9b25ef8 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/model/TaskStack.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/model/TaskStack.java
@@ -247,6 +247,9 @@
      */
     public static class DockState implements DropTarget {
 
+        public static final int DOCK_AREA_BG_COLOR = 0xFFffffff;
+        public static final int DOCK_AREA_GRID_BG_COLOR = 0xFF000000;
+
         // The rotation to apply to the hint text
         @Retention(RetentionPolicy.SOURCE)
         @IntDef({HORIZONTAL, VERTICAL})
@@ -319,7 +322,8 @@
             private ViewState(int areaAlpha, int hintAlpha, @TextOrientation int hintOrientation,
                     int hintTextResId) {
                 dockAreaAlpha = areaAlpha;
-                dockAreaOverlay = new ColorDrawable(0xFFffffff);
+                dockAreaOverlay = new ColorDrawable(Recents.getConfiguration().isGridEnabled
+                        ? DOCK_AREA_GRID_BG_COLOR : DOCK_AREA_BG_COLOR);
                 dockAreaOverlay.setAlpha(0);
                 hintTextAlpha = hintAlpha;
                 hintTextOrientation = hintOrientation;
@@ -435,7 +439,7 @@
          * @param createMode used to pass to ActivityManager to dock the task
          * @param touchArea the area in which touch will initiate this dock state
          * @param dockArea the visible dock area
-         * @param expandedTouchDockArea the areain which touch will continue to dock after entering
+         * @param expandedTouchDockArea the area in which touch will continue to dock after entering
          *                              the initial touch area.  This is also the new dock area to
          *                              draw.
          */
diff --git a/packages/SystemUI/src/com/android/systemui/recents/model/ThumbnailData.java b/packages/SystemUI/src/com/android/systemui/recents/model/ThumbnailData.java
index 18735ac..09a3712 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/model/ThumbnailData.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/model/ThumbnailData.java
@@ -16,6 +16,7 @@
 
 package com.android.systemui.recents.model;
 
+import android.app.ActivityManager.TaskSnapshot;
 import android.graphics.Bitmap;
 import android.graphics.Rect;
 
@@ -23,7 +24,17 @@
  * Data for a single thumbnail.
  */
 public class ThumbnailData {
+
+    // TODO: Make these final once the non-snapshot path is removed.
     public Bitmap thumbnail;
     public int orientation;
     public final Rect insets = new Rect();
+
+    public static ThumbnailData createFromTaskSnapshot(TaskSnapshot snapshot) {
+        ThumbnailData out = new ThumbnailData();
+        out.thumbnail = Bitmap.createHardwareBitmap(snapshot.getSnapshot());
+        out.insets.set(snapshot.getContentInsets());
+        out.orientation = snapshot.getOrientation();
+        return out;
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackAnimationHelper.java b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackAnimationHelper.java
index ed86d4c..a2ee4c5 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackAnimationHelper.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackAnimationHelper.java
@@ -105,6 +105,7 @@
     private static final Interpolator ENTER_WHILE_DOCKING_INTERPOLATOR =
             Interpolators.LINEAR_OUT_SLOW_IN;
 
+    private final int mEnterAndExitFromHomeTranslationOffset;
     private TaskStackView mStackView;
 
     private TaskViewTransform mTmpTransform = new TaskViewTransform();
@@ -113,6 +114,8 @@
 
     public TaskStackAnimationHelper(Context context, TaskStackView stackView) {
         mStackView = stackView;
+        mEnterAndExitFromHomeTranslationOffset = Recents.getConfiguration().isGridEnabled
+                ? 0 : DOUBLE_FRAME_OFFSET_MS;
     }
 
     /**
@@ -260,7 +263,7 @@
                 AnimationProps taskAnimation = new AnimationProps()
                         .setInitialPlayTime(AnimationProps.BOUNDS,
                                 Math.min(ENTER_EXIT_NUM_ANIMATING_TASKS, taskIndexFromFront) *
-                                        DOUBLE_FRAME_OFFSET_MS)
+                                        mEnterAndExitFromHomeTranslationOffset)
                         .setStartDelay(AnimationProps.ALPHA,
                                 Math.min(ENTER_EXIT_NUM_ANIMATING_TASKS, taskIndexFromFront) *
                                         FRAME_OFFSET_MS)
@@ -321,7 +324,7 @@
             AnimationProps taskAnimation;
             if (animated) {
                 int delay = Math.min(ENTER_EXIT_NUM_ANIMATING_TASKS , taskIndexFromFront) *
-                        DOUBLE_FRAME_OFFSET_MS;
+                        mEnterAndExitFromHomeTranslationOffset;
                 taskAnimation = new AnimationProps()
                         .setStartDelay(AnimationProps.BOUNDS, delay)
                         .setDuration(AnimationProps.BOUNDS, EXIT_TO_HOME_TRANSLATION_DURATION)
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackLayoutAlgorithm.java b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackLayoutAlgorithm.java
index a58896a..4fa7ecb5 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackLayoutAlgorithm.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackLayoutAlgorithm.java
@@ -291,6 +291,9 @@
     @ViewDebug.ExportedProperty(category="recents")
     private int mStackBottomOffset;
 
+    /** The height, in pixels, of each task view's title bar. */
+    private int mTitleBarHeight;
+
     // The paths defining the motion of the tasks when the stack is focused and unfocused
     private Path mUnfocusedCurve;
     private Path mFocusedCurve;
@@ -403,6 +406,14 @@
         mBaseBottomMargin = res.getDimensionPixelSize(R.dimen.recents_layout_bottom_margin);
         mFreeformStackGap =
                 res.getDimensionPixelSize(R.dimen.recents_freeform_layout_bottom_margin);
+        mTitleBarHeight = getDimensionForDevice(mContext,
+                R.dimen.recents_task_view_header_height,
+                R.dimen.recents_task_view_header_height,
+                R.dimen.recents_task_view_header_height,
+                R.dimen.recents_task_view_header_height_tablet_land,
+                R.dimen.recents_task_view_header_height,
+                R.dimen.recents_task_view_header_height_tablet_land,
+                R.dimen.recents_grid_task_view_header_height);
     }
 
     /**
@@ -903,12 +914,17 @@
      * Transforms the given {@param transformOut} to the screen coordinates, overriding the current
      * window rectangle with {@param windowOverrideRect} if non-null.
      */
-    public TaskViewTransform transformToScreenCoordinates(TaskViewTransform transformOut,
+    TaskViewTransform transformToScreenCoordinates(TaskViewTransform transformOut,
             Rect windowOverrideRect) {
         Rect windowRect = windowOverrideRect != null
                 ? windowOverrideRect
                 : Recents.getSystemServices().getWindowRect();
         transformOut.rect.offset(windowRect.left, windowRect.top);
+        if (useGridLayout()) {
+            // Draw the thumbnail a little lower to perfectly coincide with the view we are
+            // transitioning to, where the header bar has already been drawn.
+            transformOut.rect.offset(0, mTitleBarHeight);
+        }
         return transformOut;
     }
 
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackView.java b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackView.java
index b7686ce..fc2550a 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackView.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackView.java
@@ -70,6 +70,7 @@
 import com.android.systemui.recents.events.activity.MultiWindowStateChangedEvent;
 import com.android.systemui.recents.events.activity.PackagesChangedEvent;
 import com.android.systemui.recents.events.activity.ShowStackActionButtonEvent;
+import com.android.systemui.recents.events.component.RecentsVisibilityChangedEvent;
 import com.android.systemui.recents.events.ui.AllTaskViewsDismissedEvent;
 import com.android.systemui.recents.events.ui.DeleteTaskDataEvent;
 import com.android.systemui.recents.events.ui.DismissAllTaskViewsEvent;
@@ -93,6 +94,7 @@
 import com.android.systemui.recents.model.TaskStack;
 
 import com.android.systemui.recents.views.grid.GridTaskView;
+import com.android.systemui.recents.views.grid.TaskViewFocusFrame;
 import java.io.PrintWriter;
 import java.lang.annotation.Retention;
 import java.lang.annotation.RetentionPolicy;
@@ -206,6 +208,10 @@
     private int mLastWidth;
     private int mLastHeight;
 
+    // We keep track of the task view focused by user interaction and draw a frame around it in the
+    // grid layout.
+    private TaskViewFocusFrame mTaskViewFocusFrame;
+
     // A convenience update listener to request updating clipping of tasks
     private ValueAnimator.AnimatorUpdateListener mRequestUpdateClippingListener =
             new ValueAnimator.AnimatorUpdateListener() {
@@ -265,6 +271,14 @@
         mDisplayOrientation = Utilities.getAppConfiguration(mContext).orientation;
         mDisplayRect = ssp.getDisplayRect();
 
+        // Create a frame to draw around the focused task view
+        if (Recents.getConfiguration().isGridEnabled) {
+            mTaskViewFocusFrame = new TaskViewFocusFrame(mContext, this,
+                mLayoutAlgorithm.mTaskGridLayoutAlgorithm);
+            addView(mTaskViewFocusFrame);
+            getViewTreeObserver().addOnGlobalFocusChangeListener(mTaskViewFocusFrame);
+        }
+
         int taskBarDismissDozeDelaySeconds = getResources().getInteger(
                 R.integer.recents_task_bar_dismiss_delay_seconds);
         mUIDozeTrigger = new DozeTrigger(taskBarDismissDozeDelaySeconds, new Runnable() {
@@ -878,7 +892,7 @@
      *
      * @return whether or not the stack will scroll as a part of this focus change
      */
-    private boolean setFocusedTask(int taskIndex, boolean scrollToTask,
+    public boolean setFocusedTask(int taskIndex, boolean scrollToTask,
             final boolean requestViewFocus) {
         return setFocusedTask(taskIndex, scrollToTask, requestViewFocus, 0);
     }
@@ -888,7 +902,7 @@
      *
      * @return whether or not the stack will scroll as a part of this focus change
      */
-    private boolean setFocusedTask(int focusTaskIndex, boolean scrollToTask,
+    public boolean setFocusedTask(int focusTaskIndex, boolean scrollToTask,
             boolean requestViewFocus, int timerIndicatorDuration) {
         // Find the next task to focus
         int newFocusedTaskIndex = mStack.getTaskCount() > 0 ?
@@ -940,6 +954,10 @@
                     newFocusedTaskView.setFocusedState(true, requestViewFocus);
                 }
             }
+            // Any time a task view gets the focus, we move the focus frame around it.
+            if (mTaskViewFocusFrame != null) {
+                mTaskViewFocusFrame.moveGridTaskViewFocus(getChildViewForTask(newFocusedTask));
+            }
         }
         return willScroll;
     }
@@ -1005,20 +1023,28 @@
             float stackScroll = mStackScroller.getStackScroll();
             ArrayList<Task> tasks = mStack.getStackTasks();
             int taskCount = tasks.size();
-            if (forward) {
-                // Walk backwards and focus the next task smaller than the current stack scroll
-                for (newIndex = taskCount - 1; newIndex >= 0; newIndex--) {
-                    float taskP = mLayoutAlgorithm.getStackScrollForTask(tasks.get(newIndex));
-                    if (Float.compare(taskP, stackScroll) <= 0) {
-                        break;
-                    }
-                }
+            if (useGridLayout()) {
+                // For the grid layout, we directly set focus to the most recently used task
+                // no matter we're moving forwards or backwards.
+                newIndex = taskCount - 1;
             } else {
-                // Walk forwards and focus the next task larger than the current stack scroll
-                for (newIndex = 0; newIndex < taskCount; newIndex++) {
-                    float taskP = mLayoutAlgorithm.getStackScrollForTask(tasks.get(newIndex));
-                    if (Float.compare(taskP, stackScroll) >= 0) {
-                        break;
+                // For the grid layout we pick a proper task to focus, according to the current
+                // stack scroll.
+                if (forward) {
+                    // Walk backwards and focus the next task smaller than the current stack scroll
+                    for (newIndex = taskCount - 1; newIndex >= 0; newIndex--) {
+                        float taskP = mLayoutAlgorithm.getStackScrollForTask(tasks.get(newIndex));
+                        if (Float.compare(taskP, stackScroll) <= 0) {
+                            break;
+                        }
+                    }
+                } else {
+                    // Walk forwards and focus the next task larger than the current stack scroll
+                    for (newIndex = 0; newIndex < taskCount; newIndex++) {
+                        float taskP = mLayoutAlgorithm.getStackScrollForTask(tasks.get(newIndex));
+                        if (Float.compare(taskP, stackScroll) >= 0) {
+                            break;
+                        }
                     }
                 }
             }
@@ -1037,20 +1063,23 @@
     /**
      * Resets the focused task.
      */
-    void resetFocusedTask(Task task) {
+    public void resetFocusedTask(Task task) {
         if (task != null) {
             TaskView tv = getChildViewForTask(task);
             if (tv != null) {
                 tv.setFocusedState(false, false /* requestViewFocus */);
             }
         }
+        if (mTaskViewFocusFrame != null) {
+            mTaskViewFocusFrame.moveGridTaskViewFocus(null);
+        }
         mFocusedTask = null;
     }
 
     /**
      * Returns the focused task.
      */
-    Task getFocusedTask() {
+    public Task getFocusedTask() {
         return mFocusedTask;
     }
 
@@ -1253,6 +1282,9 @@
         for (int i = 0; i < taskViewCount; i++) {
             measureTaskView(mTmpTaskViews.get(i));
         }
+        if (mTaskViewFocusFrame != null) {
+            mTaskViewFocusFrame.measure();
+        }
 
         setMeasuredDimension(width, height);
         mLastWidth = width;
@@ -1287,6 +1319,9 @@
         for (int i = 0; i < taskViewCount; i++) {
             layoutTaskView(changed, mTmpTaskViews.get(i));
         }
+        if (mTaskViewFocusFrame != null) {
+            mTaskViewFocusFrame.layout();
+        }
 
         if (changed) {
             if (mStackScroller.isScrollOutOfBounds()) {
@@ -1339,10 +1374,19 @@
         // until after the enter-animation
         RecentsConfiguration config = Recents.getConfiguration();
         RecentsActivityLaunchState launchState = config.getLaunchState();
-        int focusedTaskIndex = launchState.getInitialFocusTaskIndex(mStack.getTaskCount());
-        if (focusedTaskIndex != -1) {
-            setFocusedTask(focusedTaskIndex, false /* scrollToTask */,
-                    false /* requestViewFocus */);
+
+        // We set the initial focused task view iff the following conditions are satisfied:
+        // 1. Recents is showing task views in stack layout.
+        // 2. Recents is launched with ALT + TAB.
+        boolean setFocusOnFirstLayout = !useGridLayout() ||
+            Recents.getConfiguration().getLaunchState().launchedWithAltTab;
+        if (setFocusOnFirstLayout) {
+            int focusedTaskIndex = launchState.getInitialFocusTaskIndex(mStack.getTaskCount(),
+                useGridLayout());
+            if (focusedTaskIndex != -1) {
+                setFocusedTask(focusedTaskIndex, false /* scrollToTask */,
+                        false /* requestViewFocus */);
+            }
         }
         updateStackActionButtonVisibility();
     }
@@ -1443,6 +1487,11 @@
         // Remove the task from the ignored set
         removeIgnoreTask(removedTask);
 
+        // Resize the grid layout task view focus frame
+        if (mTaskViewFocusFrame != null) {
+            mTaskViewFocusFrame.resize();
+        }
+
         // If requested, relayout with the given animation
         if (animation != null) {
             updateLayoutAlgorithm(true /* boundScroll */);
@@ -1740,10 +1789,18 @@
         int taskViewExitToHomeDuration = TaskStackAnimationHelper.EXIT_TO_HOME_TRANSLATION_DURATION;
         animateFreeformWorkspaceBackgroundAlpha(0, new AnimationProps(taskViewExitToHomeDuration,
                 Interpolators.FAST_OUT_SLOW_IN));
+
+        // Dismiss the grid task view focus frame
+        if (mTaskViewFocusFrame != null) {
+            mTaskViewFocusFrame.moveGridTaskViewFocus(null);
+        }
     }
 
     public final void onBusEvent(DismissFocusedTaskViewEvent event) {
         if (mFocusedTask != null) {
+            if (mTaskViewFocusFrame != null) {
+                mTaskViewFocusFrame.moveGridTaskViewFocus(null);
+            }
             TaskView tv = getChildViewForTask(mFocusedTask);
             if (tv != null) {
                 tv.dismissTask();
@@ -2073,6 +2130,12 @@
         mResetToInitialStateWhenResized = true;
     }
 
+    public final void onBusEvent(RecentsVisibilityChangedEvent event) {
+        if (!event.visible && mTaskViewFocusFrame != null) {
+            mTaskViewFocusFrame.moveGridTaskViewFocus(null);
+        }
+    }
+
     public void reloadOnConfigurationChange() {
         mStableLayoutAlgorithm.reloadOnConfigurationChange(getContext());
         mLayoutAlgorithm.reloadOnConfigurationChange(getContext());
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackViewTouchHandler.java b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackViewTouchHandler.java
index 33fa3b0..5817e92 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackViewTouchHandler.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackViewTouchHandler.java
@@ -342,8 +342,9 @@
                         mSv.invalidate();
                     }
 
-                    // Reset the focused task after the user has scrolled
-                    if (!mSv.mTouchExplorationEnabled) {
+                    // Reset the focused task after the user has scrolled, but we have no scrolling
+                    // in grid layout and therefore we don't want to reset the focus there.
+                    if (!mSv.mTouchExplorationEnabled && !mSv.useGridLayout()) {
                         mSv.resetFocusedTask(mSv.getFocusedTask());
                     }
                 } else if (mActiveTaskView == null) {
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/TaskView.java b/packages/SystemUI/src/com/android/systemui/recents/views/TaskView.java
index 5f37349..e41a718 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/views/TaskView.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/TaskView.java
@@ -22,7 +22,6 @@
 import android.animation.AnimatorSet;
 import android.animation.ObjectAnimator;
 import android.animation.ValueAnimator;
-import android.app.ActivityManager;
 import android.content.Context;
 import android.content.res.Resources;
 import android.graphics.Outline;
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/TaskViewThumbnail.java b/packages/SystemUI/src/com/android/systemui/recents/views/TaskViewThumbnail.java
index e3bf1df..bae5daa 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/views/TaskViewThumbnail.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/TaskViewThumbnail.java
@@ -35,6 +35,9 @@
 import android.view.ViewDebug;
 
 import com.android.systemui.R;
+import com.android.systemui.recents.events.EventBus;
+import com.android.systemui.recents.events.EventBus.Event;
+import com.android.systemui.recents.events.ui.TaskSnapshotChangedEvent;
 import com.android.systemui.recents.misc.Utilities;
 import com.android.systemui.recents.model.Task;
 import com.android.systemui.recents.model.ThumbnailData;
@@ -347,6 +350,7 @@
             mBgFillPaint.setColor(t.colorBackground);
         }
         mLockedPaint.setColor(t.colorPrimary);
+        EventBus.getDefault().register(this);
     }
 
     /**
@@ -361,6 +365,14 @@
     void unbindFromTask() {
         mTask = null;
         setThumbnail(null);
+        EventBus.getDefault().unregister(this);
+    }
+
+    public final void onBusEvent(TaskSnapshotChangedEvent event) {
+        if (mTask == null || event.taskId != mTask.key.id || event.taskSnapshot == null) {
+            return;
+        }
+        setThumbnail(ThumbnailData.createFromTaskSnapshot(event.taskSnapshot));
     }
 
     public void dump(String prefix, PrintWriter writer) {
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/grid/TaskGridLayoutAlgorithm.java b/packages/SystemUI/src/com/android/systemui/recents/views/grid/TaskGridLayoutAlgorithm.java
index 6fc4ad7..70536b1 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/views/grid/TaskGridLayoutAlgorithm.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/grid/TaskGridLayoutAlgorithm.java
@@ -51,6 +51,9 @@
     private float mAppAspectRatio;
     private Rect mSystemInsets = new Rect();
 
+    /** The thickness of the focused task view frame. */
+    private int mFocusedFrameThickness;
+
     /**
      * When the amount of tasks is determined, the size and position of every task view can be
      * decided. Each instance of TaskGridRectInfo store the task view information for a certain
@@ -137,6 +140,9 @@
     public void reloadOnConfigurationChange(Context context) {
         Resources res = context.getResources();
         mPaddingTaskView = res.getDimensionPixelSize(R.dimen.recents_grid_padding_task_view);
+        mFocusedFrameThickness = res.getDimensionPixelSize(
+            R.dimen.recents_grid_task_view_focused_frame_thickness);
+
         mTaskGridRect = new Rect();
         mTitleBarHeight = res.getDimensionPixelSize(R.dimen.recents_grid_task_view_header_height);
 
@@ -159,6 +165,10 @@
      */
     public TaskViewTransform getTransform(int taskIndex, int taskCount,
         TaskViewTransform transformOut, TaskStackLayoutAlgorithm stackLayout) {
+        if (taskCount == 0) {
+            transformOut.reset();
+            return transformOut;
+        }
 
         TaskGridRectInfo gridInfo = mTaskGridRectInfoList[taskCount - 1];
         mTaskGridRect.set(gridInfo.size);
@@ -174,7 +184,7 @@
 
         // We also need to invert the index in order to display the most recent tasks first.
         int taskLayoutIndex = taskCount - taskIndex - 1;
-        boolean isTaskViewVisible = (taskLayoutIndex < MAX_LAYOUT_TASK_COUNT);
+        boolean isTaskViewVisible = taskLayoutIndex < MAX_LAYOUT_TASK_COUNT;
 
         // Fill out the transform
         transformOut.scale = 1f;
@@ -223,7 +233,18 @@
         return buttonRect;
     }
 
+    public void updateTaskGridRect(int taskCount) {
+        if (taskCount > 0) {
+            TaskGridRectInfo gridInfo = mTaskGridRectInfoList[taskCount - 1];
+            mTaskGridRect.set(gridInfo.size);
+        }
+    }
+
     public Rect getTaskGridRect() {
         return mTaskGridRect;
     }
+
+    public int getFocusFrameThickness() {
+        return mFocusedFrameThickness;
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/grid/TaskViewFocusFrame.java b/packages/SystemUI/src/com/android/systemui/recents/views/grid/TaskViewFocusFrame.java
new file mode 100644
index 0000000..86ed583
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/grid/TaskViewFocusFrame.java
@@ -0,0 +1,141 @@
+/*
+ * Copyright (C) 2017 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.systemui.recents.views.grid;
+
+import android.content.Context;
+import android.graphics.Rect;
+import android.util.AttributeSet;
+import android.view.View;
+
+import android.view.ViewTreeObserver.OnGlobalFocusChangeListener;
+import com.android.systemui.R;
+import com.android.systemui.recents.model.TaskStack;
+import com.android.systemui.recents.views.TaskStackView;
+
+public class TaskViewFocusFrame extends View implements OnGlobalFocusChangeListener {
+
+    private TaskStackView mSv;
+    private TaskGridLayoutAlgorithm mTaskGridLayoutAlgorithm;
+    public TaskViewFocusFrame(Context context) {
+        this(context, null);
+    }
+
+    public TaskViewFocusFrame(Context context, AttributeSet attrs) {
+        this(context, attrs, 0);
+    }
+
+    public TaskViewFocusFrame(Context context, AttributeSet attrs, int defStyleAttr) {
+        this(context, attrs, defStyleAttr, 0);
+    }
+
+    public TaskViewFocusFrame(Context context, AttributeSet attrs, int defStyleAttr,
+        int defStyleRes) {
+        super(context, attrs, defStyleAttr, defStyleRes);
+        setBackground(mContext.getDrawable(
+            R.drawable.recents_grid_task_view_focus_frame_background));
+        setFocusable(false);
+        hide();
+    }
+
+    public TaskViewFocusFrame(Context context, TaskStackView stackView,
+        TaskGridLayoutAlgorithm taskGridLayoutAlgorithm) {
+        this(context);
+        mSv = stackView;
+        mTaskGridLayoutAlgorithm = taskGridLayoutAlgorithm;
+    }
+
+    /**
+     * Measure the width and height of the focus frame according to the current grid task view size.
+     */
+    public void measure() {
+        int thickness = mTaskGridLayoutAlgorithm.getFocusFrameThickness();
+        Rect rect = mTaskGridLayoutAlgorithm.getTaskGridRect();
+        measure(
+            MeasureSpec.makeMeasureSpec(rect.width() + thickness * 2, MeasureSpec.EXACTLY),
+            MeasureSpec.makeMeasureSpec(rect.height() + thickness * 2, MeasureSpec.EXACTLY));
+    }
+
+    /**
+     * Layout the focus frame with its size.
+     */
+    public void layout() {
+        layout(0, 0, getMeasuredWidth(), getMeasuredHeight());
+    }
+
+    /**
+     * Update the current size of grid task view and the focus frame.
+     */
+    public void resize() {
+        if (mSv.useGridLayout()) {
+            mTaskGridLayoutAlgorithm.updateTaskGridRect(mSv.getStack().getTaskCount());
+            measure();
+            requestLayout();
+        }
+    }
+
+    /**
+     * Move the task view focus frame to surround the newly focused view. If it's {@code null} or
+     * it's not an instance of GridTaskView, we hide the focus frame.
+     * @param newFocus The newly focused view.
+     */
+    public void moveGridTaskViewFocus(View newFocus) {
+        if (mSv.useGridLayout()) {
+            // The frame only shows up in the grid layout. It shouldn't show up in the stack
+            // layout including when we're in the split screen.
+            if (newFocus instanceof GridTaskView) {
+                // If the focus goes to a GridTaskView, we show the frame and layout it.
+                int[] location = new int[2];
+                newFocus.getLocationInWindow(location);
+                int thickness = mTaskGridLayoutAlgorithm.getFocusFrameThickness();
+                setTranslationX(location[0] - thickness);
+                setTranslationY(location[1] - thickness);
+                show();
+            } else {
+                // If focus goes to other views, we hide the frame.
+                hide();
+            }
+        }
+    }
+
+    @Override
+    public void onGlobalFocusChanged(View oldFocus, View newFocus) {
+        if (!mSv.useGridLayout()) {
+            return;
+        }
+        if (newFocus == null) {
+            // We're going to touch mode, unset the focus.
+            moveGridTaskViewFocus(null);
+            return;
+        }
+        if (oldFocus == null) {
+            // We're returning from touch mode, set the focus to the previously focused task.
+            final TaskStack stack = mSv.getStack();
+            final int taskCount = stack.getTaskCount();
+            final int k = stack.indexOfStackTask(mSv.getFocusedTask());
+            final int taskIndexToFocus = k == -1 ? (taskCount - 1) : (k % taskCount);
+            mSv.setFocusedTask(taskIndexToFocus, false, true);
+        }
+    }
+
+    private void show() {
+        setAlpha(1f);
+    }
+
+    private void hide() {
+        setAlpha(0f);
+    }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/ActivatableNotificationView.java b/packages/SystemUI/src/com/android/systemui/statusbar/ActivatableNotificationView.java
index d1ab96d..b5358bf 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/ActivatableNotificationView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/ActivatableNotificationView.java
@@ -182,6 +182,7 @@
     private int mStartTint;
     private int mOverrideTint;
     private float mOverrideAmount;
+    private boolean mShadowHidden;
 
     public ActivatableNotificationView(Context context, AttributeSet attrs) {
         super(context, attrs);
@@ -210,6 +211,7 @@
         super.onFinishInflate();
         mBackgroundNormal = (NotificationBackgroundView) findViewById(R.id.backgroundNormal);
         mFakeShadow = (FakeShadowView) findViewById(R.id.fake_shadow);
+        mShadowHidden = mFakeShadow.getVisibility() != VISIBLE;
         mBackgroundDimmed = (NotificationBackgroundView) findViewById(R.id.backgroundDimmed);
         mBackgroundNormal.setCustomBackground(R.drawable.notification_material_bg);
         mBackgroundDimmed.setCustomBackground(R.drawable.notification_material_bg_dim);
@@ -249,7 +251,7 @@
     @Override
     public boolean onTouchEvent(MotionEvent event) {
         boolean result;
-        if (mDimmed && !isTouchExplorationEnabled()) {
+        if (mDimmed && !isTouchExplorationEnabled() && isInteractive()) {
             boolean wasActivated = mActivated;
             result = handleTouchEventDimmed(event);
             if (wasActivated && result && event.getAction() == MotionEvent.ACTION_UP) {
@@ -261,6 +263,13 @@
         return result;
     }
 
+    /**
+     * @return whether this view is interactive and can be double tapped
+     */
+    protected boolean isInteractive() {
+        return true;
+    }
+
     @Override
     public void drawableHotspotChanged(float x, float y) {
         if (!mDimmed){
@@ -1020,9 +1029,13 @@
     @Override
     public void setFakeShadowIntensity(float shadowIntensity, float outlineAlpha, int shadowYEnd,
             int outlineTranslation) {
-        mFakeShadow.setFakeShadowTranslationZ(shadowIntensity * (getTranslationZ()
-                + FakeShadowView.SHADOW_SIBLING_TRESHOLD), outlineAlpha, shadowYEnd,
-                outlineTranslation);
+        boolean hiddenBefore = mShadowHidden;
+        mShadowHidden = shadowIntensity == 0.0f;
+        if (!mShadowHidden || !hiddenBefore) {
+            mFakeShadow.setFakeShadowTranslationZ(shadowIntensity * (getTranslationZ()
+                            + FakeShadowView.SHADOW_SIBLING_TRESHOLD), outlineAlpha, shadowYEnd,
+                    outlineTranslation);
+        }
     }
 
     public int getBackgroundColorWithoutTint() {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/BaseStatusBar.java b/packages/SystemUI/src/com/android/systemui/statusbar/BaseStatusBar.java
index 561b469..faf143e 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/BaseStatusBar.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/BaseStatusBar.java
@@ -122,7 +122,7 @@
 public abstract class BaseStatusBar extends SystemUI implements
         CommandQueue.Callbacks, ActivatableNotificationView.OnActivatedListener,
         ExpandableNotificationRow.ExpansionLogger, NotificationData.Environment,
-        ExpandableNotificationRow.OnExpandClickListener, OnGutsClosedListener {
+        ExpandableNotificationRow.OnExpandClickListener {
     public static final String TAG = "StatusBar";
     public static final boolean DEBUG = false;
     public static final boolean MULTIUSER_DEBUG = false;
@@ -1041,7 +1041,12 @@
         PackageManager pmUser = getPackageManagerForUser(mContext, sbn.getUser().getIdentifier());
         row.setTag(sbn.getPackageName());
         final NotificationGuts guts = row.getGuts();
-        guts.setClosedListener(this);
+        guts.setClosedListener((NotificationGuts g) -> {
+            if (!row.isRemoved()) {
+                mStackScroller.onHeightChanged(row, !isPanelFullyCollapsed() /* needsAnimation */);
+            }
+            mNotificationGutsExposed = null;
+        });
 
         final INotificationManager iNotificationManager = INotificationManager.Stub.asInterface(
                 ServiceManager.getService(Context.NOTIFICATION_SERVICE));
@@ -1127,6 +1132,11 @@
                 // Post to ensure the the guts are properly laid out.
                 guts.post(new Runnable() {
                     public void run() {
+                        if (row.getWindowToken() == null) {
+                            Log.e(TAG, "Trying to show notification guts, but not attached to "
+                                    + "window");
+                            return;
+                        }
                         dismissPopups(-1 /* x */, -1 /* y */, false /* resetGear */,
                                 false /* animate */);
                         guts.setVisibility(View.VISIBLE);
@@ -1149,7 +1159,7 @@
                         guts.setExposed(true /* exposed */,
                                 mState == StatusBarState.KEYGUARD /* needsFalsingProtection */);
                         row.closeRemoteInput();
-                        mStackScroller.onHeightChanged(null, true /* needsAnimation */);
+                        mStackScroller.onHeightChanged(row, true /* needsAnimation */);
                         mNotificationGutsExposed = guts;
                     }
                 });
@@ -1183,12 +1193,6 @@
     }
 
     @Override
-    public void onGutsClosed(NotificationGuts guts) {
-        mStackScroller.onHeightChanged(null, true /* needsAnimation */);
-        mNotificationGutsExposed = null;
-    }
-
-    @Override
     public void showRecentApps(boolean triggeredFromAltTab, boolean fromHome) {
         int msg = MSG_SHOW_RECENT_APPS;
         mHandler.removeMessages(msg);
@@ -1520,6 +1524,7 @@
         final RemoteViews bigContentView = entry.cachedBigContentView;
         final RemoteViews headsUpContentView = entry.cachedHeadsUpContentView;
         final RemoteViews publicContentView = entry.cachedPublicContentView;
+        final RemoteViews ambientContentView = entry.cachedAmbientContentView;
 
         if (contentView == null) {
             Log.v(TAG, "no contentView for: " + sbn.getNotification());
@@ -1600,6 +1605,7 @@
         View bigContentViewLocal = null;
         View headsUpContentViewLocal = null;
         View publicViewLocal = null;
+        View ambientViewLocal = null;
         try {
             contentViewLocal = contentView.apply(
                     sbn.getPackageContext(mContext),
@@ -1622,6 +1628,11 @@
                         sbn.getPackageContext(mContext),
                         contentContainerPublic, mOnClickHandler);
             }
+            if (ambientContentView != null) {
+                ambientViewLocal = ambientContentView.apply(
+                        sbn.getPackageContext(mContext),
+                        contentContainer, mOnClickHandler);
+            }
 
             if (contentViewLocal != null) {
                 contentViewLocal.setIsRootNamespace(true);
@@ -1639,6 +1650,11 @@
                 publicViewLocal.setIsRootNamespace(true);
                 contentContainerPublic.setContractedChild(publicViewLocal);
             }
+
+            if (ambientViewLocal != null) {
+                ambientViewLocal.setIsRootNamespace(true);
+                contentContainer.setAmbientChild(ambientViewLocal);
+            }
         }
         catch (RuntimeException e) {
             final String ident = sbn.getPackageName() + "/0x" + Integer.toHexString(sbn.getId());
@@ -2135,6 +2151,7 @@
                 row.setOnKeyguard(false);
                 row.setSystemExpanded(visibleNotifications == 0 && !childNotification);
             }
+            entry.row.setShowAmbient(isDozing());
             int userId = entry.notification.getUserId();
             boolean suppressedSummary = mGroupManager.isSummaryOfSuppressedGroup(
                     entry.notification) && !entry.row.isRemoved();
@@ -2172,6 +2189,10 @@
         mStackScroller.changeViewPosition(mNotificationShelf, mStackScroller.getChildCount() - 3);
     }
 
+    public boolean isDozing() {
+        return false;
+    }
+
     public boolean shouldShowOnKeyguard(StatusBarNotification sbn) {
         return mShowLockscreenNotifications && !mNotificationData.isAmbient(sbn.getKey());
     }
@@ -2384,7 +2405,7 @@
             Log.d(TAG, "failed to query dream manager", e);
         }
 
-        if (!inUse) {
+        if (!inUse && !isDozing()) {
             if (DEBUG) {
                 Log.d(TAG, "No peeking: not in use: " + sbn.getKey());
             }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/ExpandableNotificationRow.java b/packages/SystemUI/src/com/android/systemui/statusbar/ExpandableNotificationRow.java
index 173a110..93c48f8 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/ExpandableNotificationRow.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/ExpandableNotificationRow.java
@@ -74,6 +74,7 @@
     private int mMaxHeadsUpHeight;
     private int mNotificationMinHeight;
     private int mNotificationMaxHeight;
+    private int mNotificationAmbientHeight;
     private int mIncreasedPaddingBetweenElements;
 
     /** Does this row contain layouts that can adapt to row expansion */
@@ -197,6 +198,7 @@
     private float mContentTransformationAmount;
     private boolean mIconsVisible = true;
     private boolean mAboveShelf;
+    private boolean mShowAmbient;
     private boolean mIsLastChild;
     private Runnable mOnDismissRunnable;
 
@@ -326,7 +328,8 @@
                         != com.android.internal.R.id.status_bar_latest_event_content;
         int headsUpheight = headsUpCustom && beforeN ? mMaxHeadsUpHeightLegacy
                 : mMaxHeadsUpHeight;
-        layout.setHeights(minHeight, headsUpheight, mNotificationMaxHeight);
+        layout.setHeights(minHeight, headsUpheight, mNotificationMaxHeight,
+                mNotificationAmbientHeight);
     }
 
     public StatusBarNotification getStatusBarNotification() {
@@ -954,6 +957,7 @@
         mNotificationMinHeightLegacy = getFontScaledHeight(R.dimen.notification_min_height_legacy);
         mNotificationMinHeight = getFontScaledHeight(R.dimen.notification_min_height);
         mNotificationMaxHeight = getFontScaledHeight(R.dimen.notification_max_height);
+        mNotificationAmbientHeight = getFontScaledHeight(R.dimen.notification_ambient_height);
         mMaxHeadsUpHeightLegacy = getFontScaledHeight(
                 R.dimen.notification_max_heads_up_height_legacy);
         mMaxHeadsUpHeight = getFontScaledHeight(R.dimen.notification_max_heads_up_height);
@@ -1353,6 +1357,8 @@
             return mGuts.getHeight();
         } else if ((isChildInGroup() && !isGroupExpanded())) {
             return mPrivateLayout.getMinHeight();
+        } else if (mShowAmbient) {
+            return getAmbientHeight();
         } else if (mSensitive && mHideSensitiveForIntrinsicHeight) {
             return getMinHeight();
         } else if (mIsSummaryWithChildren && !mOnKeyguard) {
@@ -1683,6 +1689,13 @@
         return showingLayout.getMinHeight();
     }
 
+    private int getAmbientHeight() {
+        NotificationContentView showingLayout = getShowingLayout();
+        return showingLayout.getAmbientChild() != null
+                ? showingLayout.getAmbientChild().getHeight()
+                : getCollapsedHeight();
+    }
+
     @Override
     public int getCollapsedHeight() {
         if (mIsSummaryWithChildren && !mShowingPublic) {
@@ -1879,6 +1892,13 @@
         return mIsPinned || mHeadsupDisappearRunning || (mIsHeadsUp && mAboveShelf);
     }
 
+    public void setShowAmbient(boolean showAmbient) {
+        if (showAmbient != mShowAmbient) {
+            mShowAmbient = showAmbient;
+            notifyHeightChanged(false /* needsAnimation */);
+        }
+    }
+
     public void setAboveShelf(boolean aboveShelf) {
         mAboveShelf = aboveShelf;
     }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationContentView.java b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationContentView.java
index ad6a5db..b45cde8 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationContentView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationContentView.java
@@ -31,6 +31,7 @@
 import android.widget.FrameLayout;
 import android.widget.ImageView;
 
+import com.android.internal.annotations.VisibleForTesting;
 import com.android.internal.util.NotificationColorUtil;
 import com.android.systemui.R;
 import com.android.systemui.statusbar.notification.HybridNotificationView;
@@ -52,6 +53,7 @@
     private static final int VISIBLE_TYPE_EXPANDED = 1;
     private static final int VISIBLE_TYPE_HEADSUP = 2;
     private static final int VISIBLE_TYPE_SINGLELINE = 3;
+    private static final int VISIBLE_TYPE_AMBIENT = 4;
     public static final int UNDEFINED = -1;
 
     private final Rect mClipBounds = new Rect();
@@ -62,6 +64,7 @@
     private View mExpandedChild;
     private View mHeadsUpChild;
     private HybridNotificationView mSingleLineView;
+    private View mAmbientChild;
 
     private RemoteInputView mExpandedRemoteInput;
     private RemoteInputView mHeadsUpRemoteInput;
@@ -69,6 +72,7 @@
     private NotificationViewWrapper mContractedWrapper;
     private NotificationViewWrapper mExpandedWrapper;
     private NotificationViewWrapper mHeadsUpWrapper;
+    private NotificationViewWrapper mAmbientWrapper;
     private HybridGroupManager mHybridGroupManager;
     private int mClipTopAmount;
     private int mContentHeight;
@@ -81,6 +85,7 @@
     private int mSmallHeight;
     private int mHeadsUpHeight;
     private int mNotificationMaxHeight;
+    private int mNotificationAmbientHeight;
     private StatusBarNotification mStatusBarNotification;
     private NotificationGroupManager mGroupManager;
     private RemoteInputController mRemoteInputController;
@@ -136,10 +141,12 @@
         reset();
     }
 
-    public void setHeights(int smallHeight, int headsUpMaxHeight, int maxHeight) {
+    public void setHeights(int smallHeight, int headsUpMaxHeight, int maxHeight,
+            int ambientHeight) {
         mSmallHeight = smallHeight;
         mHeadsUpHeight = headsUpMaxHeight;
         mNotificationMaxHeight = maxHeight;
+        mNotificationAmbientHeight = ambientHeight;
     }
 
     @Override
@@ -215,6 +222,17 @@
                     MeasureSpec.makeMeasureSpec(maxSize, MeasureSpec.AT_MOST));
             maxChildHeight = Math.max(maxChildHeight, mSingleLineView.getMeasuredHeight());
         }
+        if (mAmbientChild != null) {
+            int size = Math.min(maxSize, mNotificationAmbientHeight);
+            ViewGroup.LayoutParams layoutParams = mAmbientChild.getLayoutParams();
+            if (layoutParams.height >= 0) {
+                // An actual height is set
+                size = Math.min(size, layoutParams.height);
+            }
+            mAmbientChild.measure(widthMeasureSpec,
+                    MeasureSpec.makeMeasureSpec(size, MeasureSpec.AT_MOST));
+            maxChildHeight = Math.max(maxChildHeight, mAmbientChild.getMeasuredHeight());
+        }
         int ownHeight = Math.min(maxChildHeight, maxSize);
         setMeasuredDimension(width, ownHeight);
     }
@@ -293,10 +311,6 @@
     }
 
     public void reset() {
-        if (mContractedChild != null) {
-            mContractedChild.animate().cancel();
-            removeView(mContractedChild);
-        }
         mPreviousExpandedRemoteInputIntent = null;
         if (mExpandedRemoteInput != null) {
             mExpandedRemoteInput.onNotificationUpdateOrReset();
@@ -327,7 +341,6 @@
             removeView(mHeadsUpChild);
             mHeadsUpRemoteInput = null;
         }
-        mContractedChild = null;
         mExpandedChild = null;
         mHeadsUpChild = null;
     }
@@ -344,6 +357,10 @@
         return mHeadsUpChild;
     }
 
+    public View getAmbientChild() {
+        return mAmbientChild;
+    }
+
     public void setContractedChild(View child) {
         if (mContractedChild != null) {
             mContractedChild.animate().cancel();
@@ -378,6 +395,17 @@
                 mContainingNotification);
     }
 
+    public void setAmbientChild(View child) {
+        if (mAmbientChild != null) {
+            mAmbientChild.animate().cancel();
+            removeView(mAmbientChild);
+        }
+        addView(child);
+        mAmbientChild = child;
+        mAmbientWrapper = NotificationViewWrapper.wrap(getContext(), child,
+                mContainingNotification);
+    }
+
     @Override
     protected void onVisibilityChanged(View changedView, int visibility) {
         super.onVisibilityChanged(changedView, visibility);
@@ -452,6 +480,11 @@
                         com.android.internal.R.dimen.notification_action_list_height);
         }
 
+        if (isVisibleOrTransitioning(VISIBLE_TYPE_AMBIENT)) {
+            return mContractedChild.getHeight() + mContext.getResources().getDimensionPixelSize(
+                    com.android.internal.R.dimen.notification_action_list_height);
+        }
+
         // Transition between heads-up & expanded, or pinned.
         if (mHeadsUpChild != null && mExpandedChild != null) {
             boolean transitioningBetweenHunAndExpanded =
@@ -656,39 +689,26 @@
     }
 
     private void forceUpdateVisibilities() {
-        boolean contractedVisible = mVisibleType == VISIBLE_TYPE_CONTRACTED
-                || mTransformationStartVisibleType == VISIBLE_TYPE_CONTRACTED;
-        boolean expandedVisible = mVisibleType == VISIBLE_TYPE_EXPANDED
-                || mTransformationStartVisibleType == VISIBLE_TYPE_EXPANDED;
-        boolean headsUpVisible = mVisibleType == VISIBLE_TYPE_HEADSUP
-                || mTransformationStartVisibleType == VISIBLE_TYPE_HEADSUP;
-        boolean singleLineVisible = mVisibleType == VISIBLE_TYPE_SINGLELINE
-                || mTransformationStartVisibleType == VISIBLE_TYPE_SINGLELINE;
-        if (!contractedVisible) {
-            mContractedChild.setVisibility(View.INVISIBLE);
+        forceUpdateVisibility(VISIBLE_TYPE_CONTRACTED, mContractedChild, mContractedWrapper);
+        forceUpdateVisibility(VISIBLE_TYPE_EXPANDED, mExpandedChild, mExpandedWrapper);
+        forceUpdateVisibility(VISIBLE_TYPE_HEADSUP, mHeadsUpChild, mHeadsUpWrapper);
+        forceUpdateVisibility(VISIBLE_TYPE_SINGLELINE, mSingleLineView, mSingleLineView);
+        forceUpdateVisibility(VISIBLE_TYPE_AMBIENT, mAmbientChild, mAmbientWrapper);
+        // forceUpdateVisibilities cancels outstanding animations without updating the
+        // mAnimationStartVisibleType. Do so here instead.
+        mAnimationStartVisibleType = UNDEFINED;
+    }
+
+    private void forceUpdateVisibility(int type, View view, TransformableView wrapper) {
+        if (view == null) {
+            return;
+        }
+        boolean visible = mVisibleType == type
+                || mTransformationStartVisibleType == type;
+        if (!visible) {
+            view.setVisibility(INVISIBLE);
         } else {
-            mContractedWrapper.setVisible(true);
-        }
-        if (mExpandedChild != null) {
-            if (!expandedVisible) {
-                mExpandedChild.setVisibility(View.INVISIBLE);
-            } else {
-                mExpandedWrapper.setVisible(true);
-            }
-        }
-        if (mHeadsUpChild != null) {
-            if (!headsUpVisible) {
-                mHeadsUpChild.setVisibility(View.INVISIBLE);
-            } else {
-                mHeadsUpWrapper.setVisible(true);
-            }
-        }
-        if (mSingleLineView != null) {
-            if (!singleLineVisible) {
-                mSingleLineView.setVisibility(View.INVISIBLE);
-            } else {
-                mSingleLineView.setVisible(true);
-            }
+            wrapper.setVisible(true);
         }
     }
 
@@ -722,19 +742,25 @@
     }
 
     private void updateViewVisibilities(int visibleType) {
-        boolean contractedVisible = visibleType == VISIBLE_TYPE_CONTRACTED;
-        mContractedWrapper.setVisible(contractedVisible);
-        if (mExpandedChild != null) {
-            boolean expandedVisible = visibleType == VISIBLE_TYPE_EXPANDED;
-            mExpandedWrapper.setVisible(expandedVisible);
-        }
-        if (mHeadsUpChild != null) {
-            boolean headsUpVisible = visibleType == VISIBLE_TYPE_HEADSUP;
-            mHeadsUpWrapper.setVisible(headsUpVisible);
-        }
-        if (mSingleLineView != null) {
-            boolean singleLineVisible = visibleType == VISIBLE_TYPE_SINGLELINE;
-            mSingleLineView.setVisible(singleLineVisible);
+        updateViewVisibility(visibleType, VISIBLE_TYPE_CONTRACTED,
+                mContractedChild, mContractedWrapper);
+        updateViewVisibility(visibleType, VISIBLE_TYPE_EXPANDED,
+                mExpandedChild, mExpandedWrapper);
+        updateViewVisibility(visibleType, VISIBLE_TYPE_HEADSUP,
+                mHeadsUpChild, mHeadsUpWrapper);
+        updateViewVisibility(visibleType, VISIBLE_TYPE_SINGLELINE,
+                mSingleLineView, mSingleLineView);
+        updateViewVisibility(visibleType, VISIBLE_TYPE_AMBIENT,
+                mAmbientChild, mAmbientWrapper);
+        // updateViewVisibilities cancels outstanding animations without updating the
+        // mAnimationStartVisibleType. Do so here instead.
+        mAnimationStartVisibleType = UNDEFINED;
+    }
+
+    private void updateViewVisibility(int visibleType, int type, View view,
+            TransformableView wrapper) {
+        if (view != null) {
+            wrapper.setVisible(visibleType == type);
         }
     }
 
@@ -784,6 +810,8 @@
                 return mHeadsUpWrapper;
             case VISIBLE_TYPE_SINGLELINE:
                 return mSingleLineView;
+            case VISIBLE_TYPE_AMBIENT:
+                return mAmbientWrapper;
             default:
                 return mContractedWrapper;
         }
@@ -801,6 +829,8 @@
                 return mHeadsUpChild;
             case VISIBLE_TYPE_SINGLELINE:
                 return mSingleLineView;
+            case VISIBLE_TYPE_AMBIENT:
+                return mAmbientChild;
             default:
                 return mContractedChild;
         }
@@ -814,6 +844,8 @@
                 return mHeadsUpWrapper;
             case VISIBLE_TYPE_CONTRACTED:
                 return mContractedWrapper;
+            case VISIBLE_TYPE_AMBIENT:
+                return mAmbientWrapper;
             default:
                 return null;
         }
@@ -823,6 +855,10 @@
      * @return one of the static enum types in this view, calculated form the current state
      */
     public int calculateVisibleType() {
+        if (mDark && !mIsChildInGroup) {
+            // TODO: Handle notification groups
+            return VISIBLE_TYPE_AMBIENT;
+        }
         if (mUserExpanding) {
             int height = !mIsChildInGroup || isGroupExpanded()
                     || mContainingNotification.isExpanded(true /* allowOnKeyguard */)
@@ -895,6 +931,7 @@
         if (mSingleLineView != null && (mVisibleType == VISIBLE_TYPE_SINGLELINE || !dark)) {
             mSingleLineView.setDark(dark, fade, delay);
         }
+        selectLayout(!dark && fade /* animate */, false /* force */);
     }
 
     public void setHeadsUp(boolean headsUp) {
@@ -947,6 +984,9 @@
         if (mHeadsUpChild != null) {
             mHeadsUpWrapper.notifyContentUpdated(entry.notification);
         }
+        if (mAmbientChild != null) {
+            mAmbientWrapper.notifyContentUpdated(entry.notification);
+        }
         updateShowingLegacyBackground();
         mForceSelectNextLayout = true;
         setDark(mDark, false /* animate */, 0 /* delay */);
@@ -1133,6 +1173,9 @@
         if (header == null && mHeadsUpChild != null) {
             header = mHeadsUpWrapper.getNotificationHeader();
         }
+        if (header == null && mAmbientChild != null) {
+            header = mAmbientWrapper.getNotificationHeader();
+        }
         return header;
     }
 
@@ -1200,6 +1243,11 @@
         }
     }
 
+    @VisibleForTesting
+    boolean isAnimatingVisibleType() {
+        return mAnimationStartVisibleType != UNDEFINED;
+    }
+
     public void setHeadsUpAnimatingAway(boolean headsUpAnimatingAway) {
         mHeadsUpAnimatingAway = headsUpAnimatingAway;
         selectLayout(false /* animate */, true /* force */);
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationData.java b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationData.java
index a6e730d..458daf1 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationData.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationData.java
@@ -67,6 +67,7 @@
         public RemoteViews cachedBigContentView;
         public RemoteViews cachedHeadsUpContentView;
         public RemoteViews cachedPublicContentView;
+        public RemoteViews cachedAmbientContentView;
         public CharSequence remoteInputText;
         private int mCachedContrastColor = COLOR_INVALID;
         private int mCachedContrastColorIsFor = COLOR_INVALID;
@@ -126,6 +127,8 @@
                         updatedNotificationBuilder.createHeadsUpContentView();
                 final RemoteViews newPublicNotification
                         = updatedNotificationBuilder.makePublicContentView();
+                final RemoteViews newAmbientNotification
+                        = updatedNotificationBuilder.makeAmbientNotification();
 
                 boolean sameCustomView = Objects.equals(
                         notification.getNotification().extras.getBoolean(
@@ -136,11 +139,13 @@
                         && compareRemoteViews(cachedBigContentView, newBigContentView)
                         && compareRemoteViews(cachedHeadsUpContentView, newHeadsUpContentView)
                         && compareRemoteViews(cachedPublicContentView, newPublicNotification)
+                        && compareRemoteViews(cachedAmbientContentView, newAmbientNotification)
                         && sameCustomView;
                 cachedPublicContentView = newPublicNotification;
                 cachedHeadsUpContentView = newHeadsUpContentView;
                 cachedBigContentView = newBigContentView;
                 cachedContentView = newContentView;
+                cachedAmbientContentView = newAmbientNotification;
             } else {
                 final Notification.Builder builder
                         = Notification.Builder.recoverBuilder(ctx, notification.getNotification());
@@ -149,6 +154,7 @@
                 cachedBigContentView = builder.createBigContentView();
                 cachedHeadsUpContentView = builder.createHeadsUpContentView();
                 cachedPublicContentView = builder.makePublicContentView();
+                cachedAmbientContentView = builder.makeAmbientNotification();
 
                 applyInPlace = false;
             }
@@ -488,20 +494,6 @@
         return false;
     }
 
-    /**
-     * Return whether there are any clearable notifications (that aren't errors).
-     */
-    public boolean hasActiveClearableNotifications() {
-        for (Entry e : mSortedAndFiltered) {
-            if (e.getContentView() != null) { // the view successfully inflated
-                if (e.notification.isClearable()) {
-                    return true;
-                }
-            }
-        }
-        return false;
-    }
-
     // Q: What kinds of notifications should show during setup?
     // A: Almost none! Only things coming from the system (package is "android") that also
     // have special "kind" tags marking them as relevant for setup (see below).
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationShelf.java b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationShelf.java
index bc1b9fb..e8e9d4e 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationShelf.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationShelf.java
@@ -67,6 +67,7 @@
     private int mStatusBarState;
     private float mMaxShelfEnd;
     private int mRelativeOffset;
+    private boolean mInteractive;
 
     public NotificationShelf(Context context, AttributeSet attrs) {
         super(context, attrs);
@@ -128,6 +129,7 @@
         } else {
             mViewInvertHelper.update(dark);
         }
+        mShelfIcons.setAmbient(dark);
     }
 
     @Override
@@ -555,13 +557,18 @@
     }
 
     private void updateInteractiveness() {
-        boolean interactive = mStatusBarState == StatusBarState.KEYGUARD && mHasItemsInStableShelf;
-        setClickable(interactive);
-        setFocusable(interactive);
-        setImportantForAccessibility(interactive ? View.IMPORTANT_FOR_ACCESSIBILITY_YES
+        mInteractive = mStatusBarState == StatusBarState.KEYGUARD && mHasItemsInStableShelf;
+        setClickable(mInteractive);
+        setFocusable(mInteractive);
+        setImportantForAccessibility(mInteractive ? View.IMPORTANT_FOR_ACCESSIBILITY_YES
                 : View.IMPORTANT_FOR_ACCESSIBILITY_NO);
     }
 
+    @Override
+    protected boolean isInteractive() {
+        return mInteractive;
+    }
+
     public void setMaxShelfEnd(float maxShelfEnd) {
         mMaxShelfEnd = maxShelfEnd;
     }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/StatusBarIconView.java b/packages/SystemUI/src/com/android/systemui/statusbar/StatusBarIconView.java
index a2c2fd7..399b0d2 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/StatusBarIconView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/StatusBarIconView.java
@@ -221,6 +221,8 @@
         setContentDescription(icon.contentDescription);
         if (!iconEquals) {
             if (!updateDrawable(false /* no clear */)) return false;
+            // we have to clear the grayscale tag since it may have changed
+            setTag(R.id.icon_is_grayscale, null);
         }
         if (!levelEquals) {
             setImageLevel(icon.iconLevel);
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/NotificationTemplateViewWrapper.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/NotificationTemplateViewWrapper.java
index 7ca2df9..b984c0b 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/NotificationTemplateViewWrapper.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/NotificationTemplateViewWrapper.java
@@ -116,8 +116,10 @@
 
     private void resolveTemplateViews(StatusBarNotification notification) {
         mPicture = (ImageView) mView.findViewById(com.android.internal.R.id.right_icon);
-        mPicture.setTag(ImageTransformState.ICON_TAG,
-                notification.getNotification().getLargeIcon());
+        if (mPicture != null) {
+            mPicture.setTag(ImageTransformState.ICON_TAG,
+                    notification.getNotification().getLargeIcon());
+        }
         mTitle = (TextView) mView.findViewById(com.android.internal.R.id.title);
         mText = (TextView) mView.findViewById(com.android.internal.R.id.text);
         final View progress = mView.findViewById(com.android.internal.R.id.progress);
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/VisualStabilityManager.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/VisualStabilityManager.java
index 5047041..a4e5916 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/VisualStabilityManager.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/VisualStabilityManager.java
@@ -39,6 +39,7 @@
     private VisibilityLocationProvider mVisibilityLocationProvider;
     private ArraySet<View> mAllowedReorderViews = new ArraySet<>();
     private ArraySet<View> mAddedChildren = new ArraySet<>();
+    private boolean mPulsing;
 
     /**
      * Add a callback to invoke when reordering is allowed again.
@@ -67,8 +68,16 @@
         updateReorderingAllowed();
     }
 
+    /**
+     * @param pulsing whether we are currently pulsing for ambient display.
+     */
+    public void setPulsing(boolean pulsing) {
+        mPulsing = pulsing;
+        updateReorderingAllowed();
+    }
+
     private void updateReorderingAllowed() {
-        boolean reorderingAllowed = !mScreenOn || !mPanelExpanded;
+        boolean reorderingAllowed = (!mScreenOn || !mPanelExpanded) && !mPulsing;
         boolean changed = reorderingAllowed && !mReorderingAllowed;
         mReorderingAllowed = reorderingAllowed;
         if (changed) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/DozeScrimController.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/DozeScrimController.java
index 01ffe01..b78f748 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/DozeScrimController.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/DozeScrimController.java
@@ -26,6 +26,7 @@
 import android.view.View;
 import android.view.animation.Interpolator;
 
+import com.android.keyguard.KeyguardStatusView;
 import com.android.systemui.Interpolators;
 import com.android.systemui.doze.DozeHost;
 import com.android.systemui.doze.DozeLog;
@@ -41,7 +42,9 @@
     private final Handler mHandler = new Handler();
     private final ScrimController mScrimController;
 
+    private final Context mContext;
     private final View mStackScroller;
+    private final NotificationPanelView mNotificationPanelView;
 
     private boolean mDozing;
     private DozeHost.PulseCallback mPulseCallback;
@@ -52,10 +55,12 @@
     private float mBehindTarget;
 
     public DozeScrimController(ScrimController scrimController, Context context,
-            View stackScroller) {
+            View stackScroller, NotificationPanelView notificationPanelView) {
+        mContext = context;
         mStackScroller = stackScroller;
         mScrimController = scrimController;
         mDozeParameters = new DozeParameters(context);
+        mNotificationPanelView = notificationPanelView;
     }
 
     public void setDozing(boolean dozing, boolean animate) {
@@ -65,10 +70,7 @@
             abortAnimations();
             mScrimController.setDozeBehindAlpha(1f);
             mScrimController.setDozeInFrontAlpha(mDozeParameters.getAlwaysOn() ? 0f : 1f);
-            if (mDozeParameters.getAlwaysOn()) {
-                mStackScroller.setAlpha(0f);
-                mHandler.postDelayed(() -> mStackScroller.setAlpha(0f), 30);
-            }
+            mNotificationPanelView.setDark(true);
         } else {
             cancelPulsing();
             if (animate) {
@@ -83,9 +85,8 @@
                 mScrimController.setDozeBehindAlpha(0f);
                 mScrimController.setDozeInFrontAlpha(0f);
             }
-            if (mDozeParameters.getAlwaysOn()) {
-                mStackScroller.setAlpha(1f);
-            }
+            // TODO: animate
+            mNotificationPanelView.setDark(false);
         }
     }
 
@@ -123,9 +124,6 @@
         if (isPulsing()) {
             final boolean pickupOrDoubleTap = mPulseReason == DozeLog.PULSE_REASON_SENSOR_PICKUP
                     || mPulseReason == DozeLog.PULSE_REASON_SENSOR_DOUBLE_TAP;
-            if (mDozeParameters.getAlwaysOn()) {
-                mStackScroller.setAlpha(1f);
-            }
             startScrimAnimation(true /* inFront */, 0f,
                     mDozeParameters.getPulseInDuration(pickupOrDoubleTap),
                     pickupOrDoubleTap ? Interpolators.LINEAR_OUT_SLOW_IN : Interpolators.ALPHA_OUT,
@@ -291,9 +289,6 @@
         @Override
         public void run() {
             if (DEBUG) Log.d(TAG, "Pulse out finished");
-            if (mDozeParameters.getAlwaysOn()) {
-                mStackScroller.setAlpha(0f);
-            }
             DozeLog.tracePulseFinish();
 
             // Signal that the pulse is all finished so we can turn the screen off now.
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardClockPositionAlgorithm.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardClockPositionAlgorithm.java
index 70beac8ea..c78ec83 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardClockPositionAlgorithm.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardClockPositionAlgorithm.java
@@ -68,6 +68,8 @@
     }
 
     private AccelerateInterpolator mAccelerateInterpolator = new AccelerateInterpolator();
+    private int mClockBottom;
+    private boolean mDark;
 
     /**
      * Refreshes the dimension values.
@@ -86,7 +88,8 @@
     }
 
     public void setup(int maxKeyguardNotifications, int maxPanelHeight, float expandedHeight,
-            int notificationCount, int height, int keyguardStatusHeight, float emptyDragAmount) {
+            int notificationCount, int height, int keyguardStatusHeight, float emptyDragAmount,
+            int clockBottom, boolean dark) {
         mMaxKeyguardNotifications = maxKeyguardNotifications;
         mMaxPanelHeight = maxPanelHeight;
         mExpandedHeight = expandedHeight;
@@ -94,6 +97,8 @@
         mHeight = height;
         mKeyguardStatusHeight = keyguardStatusHeight;
         mEmptyDragAmount = emptyDragAmount;
+        mClockBottom = clockBottom;
+        mDark = dark;
     }
 
     public float getMinStackScrollerPadding(int height, int keyguardStatusHeight) {
@@ -115,6 +120,9 @@
                 result.clockY,
                 y + getClockNotificationsPadding() + mKeyguardStatusHeight);
         result.clockAlpha = getClockAlpha(result.clockScale);
+        if (mDark) {
+            result.stackScrollerPadding = mClockBottom + y;
+        }
     }
 
     private float getClockScale(int notificationPadding, int clockY, int startPadding) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/LightBarController.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/LightBarController.java
index 6dddf18..26b0d53 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/LightBarController.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/LightBarController.java
@@ -43,7 +43,18 @@
     private boolean mDockedLight;
     private int mLastStatusBarMode;
     private int mLastNavigationBarMode;
+
+    /**
+     * Whether the navigation bar should be light factoring in already how much alpha the scrim has
+     */
     private boolean mNavigationLight;
+
+    /**
+     * Whether the flags indicate that a light status bar is requested. This doesn't factor in the
+     * scrim alpha yet.
+     */
+    private boolean mHasLightNavigationBar;
+    private boolean mScrimAlphaBelowThreshold;
     private float mScrimAlpha;
 
     private final Rect mLastFullscreenBounds = new Rect();
@@ -101,7 +112,9 @@
         if ((diffVis & View.SYSTEM_UI_FLAG_LIGHT_NAVIGATION_BAR) != 0
                 || nbModeChanged) {
             boolean last = mNavigationLight;
-            mNavigationLight = isNavigationLight(newVis, navigationBarMode);
+            mHasLightNavigationBar = isLight(vis, navigationBarMode,
+                    View.SYSTEM_UI_FLAG_LIGHT_NAVIGATION_BAR);
+            mNavigationLight = mHasLightNavigationBar && mScrimAlphaBelowThreshold;
             if (mNavigationLight != last) {
                 updateNavigation();
             }
@@ -120,12 +133,11 @@
 
     public void setScrimAlpha(float alpha) {
         mScrimAlpha = alpha;
-        reevaluate();
-    }
-
-    private boolean isNavigationLight(int vis, int barMode) {
-        return isLight(vis, barMode, View.SYSTEM_UI_FLAG_LIGHT_NAVIGATION_BAR)
-                && mScrimAlpha < NAV_BAR_INVERSION_SCRIM_ALPHA_THRESHOLD;
+        boolean belowThresholdBefore = mScrimAlphaBelowThreshold;
+        mScrimAlphaBelowThreshold = mScrimAlpha < NAV_BAR_INVERSION_SCRIM_ALPHA_THRESHOLD;
+        if (mHasLightNavigationBar && belowThresholdBefore != mScrimAlphaBelowThreshold) {
+            reevaluate();
+        }
     }
 
     private boolean isLight(int vis, int barMode, int flag) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationIconContainer.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationIconContainer.java
index 9fb5980..c25a45c 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationIconContainer.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationIconContainer.java
@@ -22,9 +22,7 @@
 import android.graphics.Color;
 import android.graphics.Paint;
 import android.util.AttributeSet;
-import android.util.Property;
 import android.view.View;
-import android.view.animation.Interpolator;
 
 import com.android.systemui.Interpolators;
 import com.android.systemui.R;
@@ -32,7 +30,6 @@
 import com.android.systemui.statusbar.StatusBarIconView;
 import com.android.systemui.statusbar.stack.AnimationFilter;
 import com.android.systemui.statusbar.stack.AnimationProperties;
-import com.android.systemui.statusbar.stack.HeadsUpAppearInterpolator;
 import com.android.systemui.statusbar.stack.ViewState;
 
 import java.util.HashMap;
@@ -98,6 +95,7 @@
     private int mActualLayoutWidth = NO_VALUE;
     private float mActualPaddingEnd = NO_VALUE;
     private float mActualPaddingStart = NO_VALUE;
+    private boolean mCentered;
     private boolean mChangingViewPositions;
     private int mAddAnimationStartIndex = -1;
     private int mCannedAnimationStartIndex = -1;
@@ -105,6 +103,7 @@
     private int mIconSize;
     private float mOpenedAmount = 0.0f;
     private float mVisualOverflowAdaption;
+    private boolean mDisallowNextAnimation;
 
     public NotificationIconContainer(Context context, AttributeSet attrs) {
         super(context, attrs);
@@ -165,6 +164,7 @@
         }
         mAddAnimationStartIndex = -1;
         mCannedAnimationStartIndex = -1;
+        mDisallowNextAnimation = false;
     }
 
     @Override
@@ -310,6 +310,15 @@
                 numDots++;
             }
         }
+        if (mCentered && translationX < getLayoutEnd()) {
+            float delta = (getLayoutEnd() - translationX) / 2;
+            for (int i = 0; i < childCount; i++) {
+                View view = getChildAt(i);
+                IconState iconState = mIconStates.get(view);
+                iconState.xTranslation += delta;
+            }
+        }
+
         if (isLayoutRtl()) {
             for (int i = 0; i < childCount; i++) {
                 View view = getChildAt(i);
@@ -379,6 +388,11 @@
         mChangingViewPositions = changingViewPositions;
     }
 
+    public void setAmbient(boolean ambient) {
+        mCentered = ambient;
+        mDisallowNextAnimation = true;
+    }
+
     public IconState getIconState(StatusBarIconView icon) {
         return mIconStates.get(icon);
     }
@@ -469,7 +483,7 @@
                     animate = true;
                 }
                 icon.setVisibleState(visibleState);
-                if (animate) {
+                if (animate && !mDisallowNextAnimation) {
                     animateTo(icon, animationProperties);
                 } else {
                     super.applyToView(view);
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
index d48819a..3bdd5e5 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
@@ -211,6 +211,7 @@
     private boolean mOpening;
     private int mIndicationBottomPadding;
     private boolean mIsFullWidth;
+    private boolean mDark;
 
     public NotificationPanelView(Context context, AttributeSet attrs) {
         super(context, attrs);
@@ -391,7 +392,9 @@
                     mNotificationStackScroller.getNotGoneChildCount(),
                     getHeight(),
                     mKeyguardStatusView.getHeight(),
-                    mEmptyDragAmount);
+                    mEmptyDragAmount,
+                    mKeyguardStatusView.getClockBottom(),
+                    mDark);
             mClockPositionAlgorithm.run(mClockPositionResult);
             if (animate || mClockAnimator != null) {
                 startClockAnimation(mClockPositionResult.clockY);
@@ -2453,4 +2456,10 @@
             }
         }
     };
+
+    public void setDark(boolean dark) {
+        mDark = dark;
+        mKeyguardStatusView.setDark(dark);
+        positionClockAndNotifications();
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBar.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBar.java
index b338420..191718e 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBar.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBar.java
@@ -74,7 +74,6 @@
 import android.os.Handler;
 import android.os.HandlerThread;
 import android.os.IBinder;
-import android.os.Looper;
 import android.os.Message;
 import android.os.PowerManager;
 import android.os.Process;
@@ -879,7 +878,8 @@
         mHeadsUpManager.addListener(mScrimController);
         mStackScroller.setScrimController(mScrimController);
         mStatusBarView.setScrimController(mScrimController);
-        mDozeScrimController = new DozeScrimController(mScrimController, context, mStackScroller);
+        mDozeScrimController = new DozeScrimController(mScrimController, context, mStackScroller,
+                mNotificationPanel);
 
         // Other icons
         mLocationController = new LocationControllerImpl(mContext,
@@ -1195,8 +1195,10 @@
                 List<ExpandableNotificationRow> children = row.getNotificationChildren();
                 if (row.areChildrenExpanded() && children != null) {
                     for (ExpandableNotificationRow childRow : children) {
-                        if (childRow.getVisibility() == View.VISIBLE) {
-                            viewsToHide.add(childRow);
+                        if (mStackScroller.canChildBeDismissed(childRow)) {
+                            if (childRow.getVisibility() == View.VISIBLE) {
+                                viewsToHide.add(childRow);
+                            }
                         }
                     }
                 }
@@ -1544,8 +1546,15 @@
             }
             List<ExpandableNotificationRow> notificationChildren =
                     entry.row.getNotificationChildren();
-            ArrayList<ExpandableNotificationRow> toRemove = new ArrayList<>(notificationChildren);
-            for (int i = 0; i < toRemove.size(); i++) {
+            ArrayList<ExpandableNotificationRow> toRemove = new ArrayList<>();
+            for (int i = 0; i < notificationChildren.size(); i++) {
+                ExpandableNotificationRow row = notificationChildren.get(i);
+                if ((row.getStatusBarNotification().getNotification().flags
+                        & Notification.FLAG_FOREGROUND_SERVICE) != 0) {
+                    // the child is a forground service notification which we can't remove!
+                    continue;
+                }
+                toRemove.add(row);
                 toRemove.get(i).setKeepInParent(true);
                 // we need to set this state earlier as otherwise we might generate some weird
                 // animations
@@ -1817,10 +1826,27 @@
     private void updateClearAll() {
         boolean showDismissView =
                 mState != StatusBarState.KEYGUARD &&
-                mNotificationData.hasActiveClearableNotifications();
+               hasActiveClearableNotifications();
         mStackScroller.updateDismissView(showDismissView);
     }
 
+    /**
+     * Return whether there are any clearable notifications
+     */
+    private boolean hasActiveClearableNotifications() {
+        int childCount = mStackScroller.getChildCount();
+        for (int i = 0; i < childCount; i++) {
+            View child = mStackScroller.getChildAt(i);
+            if (!(child instanceof ExpandableNotificationRow)) {
+                continue;
+            }
+            if (((ExpandableNotificationRow) child).canViewBeDismissed()) {
+                    return true;
+            }
+        }
+        return false;
+    }
+
     private void updateEmptyShadeView() {
         boolean showEmptyShade =
                 mState != StatusBarState.KEYGUARD &&
@@ -1867,7 +1893,7 @@
 
         if (SPEW) {
             final boolean clearable = hasActiveNotifications() &&
-                    mNotificationData.hasActiveClearableNotifications();
+                    hasActiveClearableNotifications();
             Log.d(TAG, "setAreThereNotifications: N=" +
                     mNotificationData.getActiveNotifications().size() + " any=" +
                     hasActiveNotifications() + " clearable=" + clearable);
@@ -2375,6 +2401,7 @@
         return getBarState() == StatusBarState.KEYGUARD;
     }
 
+    @Override
     public boolean isDozing() {
         return mDozing;
     }
@@ -2461,6 +2488,9 @@
             }
         } else {
             updateNotificationRanking(null);
+            if (isHeadsUp) {
+                mDozeServiceHost.fireNotificationHeadsUp();
+            }
         }
 
     }
@@ -2860,9 +2890,6 @@
 
     @Override // CommandQueue
     public void buzzBeepBlinked() {
-        if (mDozeServiceHost != null) {
-            mDozeServiceHost.fireBuzzBeepBlinked();
-        }
     }
 
     @Override
@@ -3492,6 +3519,9 @@
         if (mSecurityController != null) {
             mSecurityController.onUserSwitched(mCurrentUserId);
         }
+        if (mNetworkController != null) {
+            mNetworkController.onUserSwitched(mCurrentUserId);
+        }
     }
 
     private void resetUserSetupObserver() {
@@ -4208,6 +4238,7 @@
         mDozeScrimController.setDozing(mDozing &&
                 mFingerprintUnlockController.getMode()
                         != FingerprintUnlockController.MODE_WAKE_AND_UNLOCK_PULSING, animate);
+        updateRowStates();
         Trace.endSection();
     }
 
@@ -4878,9 +4909,9 @@
             }
         }
 
-        public void fireBuzzBeepBlinked() {
+        public void fireNotificationHeadsUp() {
             for (Callback callback : mCallbacks) {
-                callback.onBuzzBeepBlinked();
+                callback.onNotificationHeadsUp();
             }
         }
 
@@ -4924,12 +4955,14 @@
                 public void onPulseStarted() {
                     callback.onPulseStarted();
                     mStackScroller.setPulsing(true);
+                    mVisualStabilityManager.setPulsing(true);
                 }
 
                 @Override
                 public void onPulseFinished() {
                     callback.onPulseFinished();
                     mStackScroller.setPulsing(false);
+                    mVisualStabilityManager.setPulsing(false);
                 }
             }, reason);
         }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/QSTileHost.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/QSTileHost.java
index 227ebdf..d4cf533 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/QSTileHost.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/QSTileHost.java
@@ -52,6 +52,7 @@
 import com.android.systemui.qs.tiles.HotspotTile;
 import com.android.systemui.qs.tiles.IntentTile;
 import com.android.systemui.qs.tiles.LocationTile;
+import com.android.systemui.qs.tiles.NfcTile;
 import com.android.systemui.qs.tiles.NightDisplayTile;
 import com.android.systemui.qs.tiles.RotationLockTile;
 import com.android.systemui.qs.tiles.UserTile;
@@ -440,6 +441,7 @@
         else if (tileSpec.equals("battery")) return new BatteryTile(this);
         else if (tileSpec.equals("saver")) return new DataSaverTile(this);
         else if (tileSpec.equals("night")) return new NightDisplayTile(this);
+        else if (tileSpec.equals("nfc")) return new NfcTile(this);
         // Intent tiles.
         else if (tileSpec.startsWith(IntentTile.PREFIX)) return IntentTile.create(this,tileSpec);
         else if (tileSpec.startsWith(CustomTile.PREFIX)) return CustomTile.create(this,tileSpec);
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/ScrimController.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/ScrimController.java
index 517551d..8fcbf38 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/ScrimController.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/ScrimController.java
@@ -338,13 +338,13 @@
     private void setCurrentScrimAlpha(View scrim, float alpha) {
         if (scrim == mScrimBehind) {
             mCurrentBehindAlpha = alpha;
+            mLightBarController.setScrimAlpha(mCurrentBehindAlpha);
         } else if (scrim == mScrimInFront) {
             mCurrentInFrontAlpha = alpha;
         } else {
             alpha = Math.max(0.0f, Math.min(1.0f, alpha));
             mCurrentHeadsUpAlpha = alpha;
         }
-        mLightBarController.setScrimAlpha(mCurrentBehindAlpha);
     }
 
     protected void updateScrimColor(View scrim) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/stack/NotificationStackScrollLayout.java b/packages/SystemUI/src/com/android/systemui/statusbar/stack/NotificationStackScrollLayout.java
index 06cd769..395e8f2 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/stack/NotificationStackScrollLayout.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/stack/NotificationStackScrollLayout.java
@@ -359,6 +359,7 @@
     private boolean mInHeadsUpPinnedMode;
     private boolean mHeadsUpAnimatingAway;
     private int mStatusBarState;
+    private int mCachedBackgroundColor;
 
     public NotificationStackScrollLayout(Context context) {
         this(context, null);
@@ -445,8 +446,11 @@
                         + alphaInv * Color.green(scrimColor)),
                 (int) (mBackgroundFadeAmount * Color.blue(mBgColor)
                         + alphaInv * Color.blue(scrimColor)));
-        mBackgroundPaint.setColor(color);
-        invalidate();
+        if (mCachedBackgroundColor != color) {
+            mCachedBackgroundColor = color;
+            mBackgroundPaint.setColor(color);
+            invalidate();
+        }
     }
 
     private void initView(Context context) {
@@ -1879,12 +1883,16 @@
         float previousIncreasedAmount = 0.0f;
         int numShownItems = 0;
         boolean finish = false;
+        int maxDisplayedNotifications = mAmbientState.isDark()
+                ? (mPulsing ? 1 : 0)
+                : mMaxDisplayedNotifications;
+
         for (int i = 0; i < getChildCount(); i++) {
             ExpandableView expandableView = (ExpandableView) getChildAt(i);
             if (expandableView.getVisibility() != View.GONE
                     && !expandableView.hasNoContentHeight()) {
-                if (mMaxDisplayedNotifications != -1
-                        && numShownItems >= mMaxDisplayedNotifications) {
+                if (maxDisplayedNotifications != -1
+                        && numShownItems >= maxDisplayedNotifications) {
                     expandableView = mShelf;
                     finish = true;
                 }
@@ -2092,9 +2100,14 @@
      * Update the background bounds to the new desired bounds
      */
     private void updateBackgroundBounds() {
-        getLocationInWindow(mTempInt2);
-        mBackgroundBounds.left = mTempInt2[0];
-        mBackgroundBounds.right = mTempInt2[0] + getWidth();
+        if (mAmbientState.isPanelFullWidth()) {
+            mBackgroundBounds.left = 0;
+            mBackgroundBounds.right = getWidth();
+        } else {
+            getLocationInWindow(mTempInt2);
+            mBackgroundBounds.left = mTempInt2[0];
+            mBackgroundBounds.right = mTempInt2[0] + getWidth();
+        }
         if (!mIsExpanded) {
             mBackgroundBounds.top = 0;
             mBackgroundBounds.bottom = 0;
@@ -3477,6 +3490,8 @@
             updateBackground();
             setWillNotDraw(false);
         }
+        updateContentHeight();
+        notifyHeightChangeListener(mShelf);
     }
 
     private void setBackgroundFadeAmount(float fadeAmount) {
@@ -3912,6 +3927,8 @@
     public void setPulsing(boolean pulsing) {
         mPulsing = pulsing;
         updateNotificationAnimationStates();
+        updateContentHeight();
+        notifyHeightChangeListener(mShelf);
     }
 
     public void setFadingOut(boolean fadingOut) {
diff --git a/packages/SystemUI/tests/src/com/android/systemui/notification/VisualStabilityManagerTest.java b/packages/SystemUI/tests/src/com/android/systemui/notification/VisualStabilityManagerTest.java
index be6290b..76bb6c0 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/notification/VisualStabilityManagerTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/notification/VisualStabilityManagerTest.java
@@ -150,4 +150,28 @@
         mVisualStabilityManager.onReorderingFinished();
         assertEquals(mVisualStabilityManager.canReorderNotification(mRow), false);
     }
+
+    @Test
+    public void testPulsing() {
+        mVisualStabilityManager.setPulsing(true);
+        assertEquals(mVisualStabilityManager.canReorderNotification(mRow), false);
+        mVisualStabilityManager.setPulsing(false);
+        assertEquals(mVisualStabilityManager.canReorderNotification(mRow), true);
+    }
+
+    @Test
+    public void testReorderingAllowedChanges_Pulsing() {
+        mVisualStabilityManager.setPulsing(true);
+        assertEquals(mVisualStabilityManager.isReorderingAllowed(), false);
+        mVisualStabilityManager.setPulsing(false);
+        assertEquals(mVisualStabilityManager.isReorderingAllowed(), true);
+    }
+
+    @Test
+    public void testCallBackCalled_Pulsing() {
+        mVisualStabilityManager.setPulsing(true);
+        mVisualStabilityManager.addReorderingAllowedCallback(mCallback);
+        mVisualStabilityManager.setPulsing(false);
+        verify(mCallback).onReorderingAllowed();
+    }
 }
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/NotificationContentViewTest.java b/packages/SystemUI/tests/src/com/android/systemui/statusbar/NotificationContentViewTest.java
new file mode 100644
index 0000000..3bb9f5f
--- /dev/null
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/NotificationContentViewTest.java
@@ -0,0 +1,75 @@
+/*
+ * Copyright (C) 2014 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.systemui.statusbar;
+
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.when;
+
+import android.content.Context;
+import android.support.test.InstrumentationRegistry;
+import android.support.test.annotation.UiThreadTest;
+import android.support.test.filters.SmallTest;
+import android.support.test.runner.AndroidJUnit4;
+import android.view.View;
+
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+
+@SmallTest
+@RunWith(AndroidJUnit4.class)
+public class NotificationContentViewTest {
+
+    NotificationContentView mView;
+    Context mContext;
+
+    @Before
+    public void setup() {
+        ExpandableNotificationRow rowMock = mock(ExpandableNotificationRow.class);
+        when(rowMock.getIntrinsicHeight()).thenReturn(10);
+
+        mContext = InstrumentationRegistry.getTargetContext();
+        mView = new NotificationContentView(mContext, null);
+        mView.setContainingNotification(rowMock);
+        mView.setHeights(10, 20, 30, 40);
+
+        mView.setContractedChild(createViewWithHeight(10));
+        mView.setExpandedChild(createViewWithHeight(20));
+        mView.setHeadsUpChild(createViewWithHeight(30));
+        mView.setAmbientChild(createViewWithHeight(40));
+
+        mView.measure(View.MeasureSpec.UNSPECIFIED, View.MeasureSpec.UNSPECIFIED);
+        mView.layout(0, 0, mView.getMeasuredWidth(), mView.getMeasuredHeight());
+    }
+
+    private View createViewWithHeight(int height) {
+        View view = new View(mContext, null);
+        view.setMinimumHeight(height);
+        return view;
+    }
+
+    @Test
+    @UiThreadTest
+    public void animationStartType_getsClearedAfterUpdatingVisibilitiesWithoutAnimation() {
+        mView.setHeadsUp(true);
+        mView.setDark(true, false, 0);
+        mView.setDark(false, true, 0);
+        mView.setHeadsUpAnimatingAway(true);
+        Assert.assertFalse(mView.isAnimatingVisibleType());
+    }
+}
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/StatusBarIconViewTest.java b/packages/SystemUI/tests/src/com/android/systemui/statusbar/StatusBarIconViewTest.java
new file mode 100644
index 0000000..7d9e073
--- /dev/null
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/StatusBarIconViewTest.java
@@ -0,0 +1,58 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.systemui.statusbar;
+
+import android.graphics.drawable.Icon;
+import android.os.Debug;
+import android.os.UserHandle;
+import android.support.test.runner.AndroidJUnit4;
+import android.test.suitebuilder.annotation.SmallTest;
+
+import com.android.internal.statusbar.StatusBarIcon;
+import com.android.systemui.R;
+import com.android.systemui.SysuiTestCase;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+
+import static junit.framework.Assert.assertNull;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.when;
+
+@SmallTest
+@RunWith(AndroidJUnit4.class)
+public class StatusBarIconViewTest extends SysuiTestCase {
+
+    private StatusBarIconView mIconView;
+    private StatusBarIcon mStatusBarIcon = mock(StatusBarIcon.class);
+
+    @Before
+    public void setUp() {
+        mIconView = new StatusBarIconView(getContext(), "slot", null);
+        mStatusBarIcon = new StatusBarIcon(UserHandle.ALL, getContext().getPackageName(),
+                Icon.createWithResource(getContext(), R.drawable.ic_android), 0, 0, "");
+    }
+
+    @Test
+    public void testSetClearsGrayscale() {
+        mIconView.setTag(R.id.icon_is_grayscale, true);
+        mIconView.set(mStatusBarIcon);
+        assertNull(mIconView.getTag(R.id.icon_is_grayscale));
+    }
+
+}
\ No newline at end of file
diff --git a/proto/src/metrics_constants.proto b/proto/src/metrics_constants.proto
index dc92f56..5004940 100644
--- a/proto/src/metrics_constants.proto
+++ b/proto/src/metrics_constants.proto
@@ -3191,8 +3191,97 @@
     // ACTION: Clicking on any search result in Settings.
     ACTION_CLICK_SETTINGS_SEARCH_RESULT = 763;
 
+    // ACTION: Allow Battery optimization for an app
+    APP_SPECIAL_PERMISSION_BATTERY_ALLOW = 764;
+
+    // ACTION: Deny Battery optimization for an app
+    APP_SPECIAL_PERMISSION_BATTERY_DENY = 765;
+
+    // ACTION: Enable Device Admin app
+    APP_SPECIAL_PERMISSION_ADMIN_ALLOW = 766;
+
+    // ACTION: Disable Device Admin app
+    APP_SPECIAL_PERMISSION_ADMIN_DENY = 767;
+
+    // ACTION: Allow "Do Not Disturb access" for an app
+    APP_SPECIAL_PERMISSION_DND_ALLOW = 768;
+
+    // ACTION: Deny "Do Not Disturb access" for an app
+    APP_SPECIAL_PERMISSION_DND_DENY = 769;
+
+    // ACTION: Allow "Draw over other apps" for an app
+    APP_SPECIAL_PERMISSION_APPDRAW_ALLOW = 770;
+
+    // ACTION: Deny "Draw over other apps" for an app
+    APP_SPECIAL_PERMISSION_APPDRAW_DENY = 771;
+
+    // ACTION: Allow "VR helper services" for an app
+    APP_SPECIAL_PERMISSION_VRHELPER_ALLOW = 772;
+
+    // ACTION: Deny "VR helper services" for an app
+    APP_SPECIAL_PERMISSION_VRHELPER_DENY = 773;
+
+    // ACTION: Allow "Modify system settings" for an app
+    APP_SPECIAL_PERMISSION_SETTINGS_CHANGE_ALLOW = 774;
+
+    // ACTION: Deny "Modify system settings" for an app
+    APP_SPECIAL_PERMISSION_SETTINGS_CHANGE_DENY = 775;
+
+    // ACTION: Allow "Notification access" for an app
+    APP_SPECIAL_PERMISSION_NOTIVIEW_ALLOW = 776;
+
+    // ACTION: Deny "Notification access" for an app
+    APP_SPECIAL_PERMISSION_NOTIVIEW_DENY = 777;
+
+    // ACTION: "Premium SMS access" for an app - "ask user" option
+    APP_SPECIAL_PERMISSION_PREMIUM_SMS_ASK = 778;
+
+    // ACTION: "Premium SMS access" for an app - "never allow" option
+    APP_SPECIAL_PERMISSION_PREMIUM_SMS_DENY = 779;
+
+    // ACTION: "Premium SMS access" for an app - "always allow" option
+    APP_SPECIAL_PERMISSION_PREMIUM_SMS_ALWAYS_ALLOW = 780;
+
+    // ACTION: Allow "Unrestricted data access" for an app
+    APP_SPECIAL_PERMISSION_UNL_DATA_ALLOW = 781;
+
+    // ACTION: Deny "Unrestricted data access" for an app
+    APP_SPECIAL_PERMISSION_UNL_DATA_DENY = 782;
+
+    // ACTION: Allow "Usage access" for an app
+    APP_SPECIAL_PERMISSION_USAGE_VIEW_ALLOW = 783;
+
+    // ACTION: Deny "Usage access" for an app
+    APP_SPECIAL_PERMISSION_USAGE_VIEW_DENY = 784;
+
+    // OPEN: Settings > Apps > Default Apps > Default browser
+    DEFAULT_BROWSER_PICKER = 785;
+
+    // OPEN: Settings > Apps > Default Apps > Default emergency app
+    DEFAULT_EMERGENCY_APP_PICKER = 786;
+
+    // OPEN: Settings > Apps > Default Apps > Default home
+    DEFAULT_HOME_PICKER = 787;
+
+    // OPEN: Settings > Apps > Default Apps > Default phone
+    DEFAULT_PHONE_PICKER = 788;
+
+    // OPEN: Settings > Apps > Default Apps > Default sms
+    DEFAULT_SMS_PICKER = 789;
+
+    // OPEN: Settings > Apps > Default Apps > Default notification assistant
+    DEFAULT_NOTIFICATION_ASSISTANT = 790;
+
+    // OPEN: Settings > Apps > Default Apps > Warning dialog to confirm selection
+    DEFAULT_APP_PICKER_CONFIRMATION_DIALOG = 791;
+
     // ---- End O Constants, all O constants go above this line ----
 
+    // OPEN: QS NFC tile shown
+    // ACTION: QS NFC tile tapped
+    // CATEGORY: QUICK_SETTINGS
+    QS_NFC = 800;
+
     // Add new aosp constants above this line.
     // END OF AOSP CONSTANTS
   }
diff --git a/services/Android.mk b/services/Android.mk
index abd1459..e760fe2 100644
--- a/services/Android.mk
+++ b/services/Android.mk
@@ -37,8 +37,8 @@
 
 # The convention is to name each service module 'services.$(module_name)'
 LOCAL_STATIC_JAVA_LIBRARIES := $(addprefix services.,$(services)) \
-    android.hidl.base@1.0-java \
-    android.hardware.biometrics.fingerprint@2.1-java
+    android.hidl.base@1.0-java-static \
+    android.hardware.biometrics.fingerprint@2.1-java-static
 
 ifeq ($(EMMA_INSTRUMENT_FRAMEWORK),true)
 LOCAL_EMMA_INSTRUMENT := true
diff --git a/services/accessibility/java/com/android/server/accessibility/AccessibilityManagerService.java b/services/accessibility/java/com/android/server/accessibility/AccessibilityManagerService.java
index b34e4e4..ece5149 100644
--- a/services/accessibility/java/com/android/server/accessibility/AccessibilityManagerService.java
+++ b/services/accessibility/java/com/android/server/accessibility/AccessibilityManagerService.java
@@ -97,6 +97,7 @@
 import com.android.internal.os.SomeArgs;
 import com.android.server.LocalServices;
 
+import com.android.server.policy.AccessibilityShortcutController;
 import com.android.server.statusbar.StatusBarManagerInternal;
 import org.xmlpull.v1.XmlPullParserException;
 
@@ -1489,6 +1490,7 @@
         mInitialized = true;
         updateLegacyCapabilitiesLocked(userState);
         updateServicesLocked(userState);
+        updateAccessibilityShortcutLocked(userState);
         updateWindowsForAccessibilityCallbackLocked(userState);
         updateAccessibilityFocusBehaviorLocked(userState);
         updateFilterKeyEventsLocked(userState);
@@ -1613,7 +1615,7 @@
         somethingChanged |= readEnhancedWebAccessibilityEnabledChangedLocked(userState);
         somethingChanged |= readDisplayMagnificationEnabledSettingLocked(userState);
         somethingChanged |= readAutoclickEnabledSettingLocked(userState);
-
+        somethingChanged |= readAccessibilityShortcutSettingLocked(userState);
         return somethingChanged;
     }
 
@@ -1722,6 +1724,50 @@
         }
     }
 
+    private boolean readAccessibilityShortcutSettingLocked(UserState userState) {
+        String componentNameToEnableString = AccessibilityShortcutController
+                .getTargetServiceComponentNameString(mContext, userState.mUserId);
+        if ((componentNameToEnableString == null) || componentNameToEnableString.isEmpty()) {
+            if (userState.mServiceToEnableWithShortcut == null) {
+                return false;
+            }
+            userState.mServiceToEnableWithShortcut = null;
+            return true;
+        }
+        ComponentName componentNameToEnable =
+            ComponentName.unflattenFromString(componentNameToEnableString);
+        if (componentNameToEnable.equals(userState.mServiceToEnableWithShortcut)) {
+            return false;
+        }
+        userState.mServiceToEnableWithShortcut = componentNameToEnable;
+        return true;
+    }
+
+    /**
+     * Check if the service that will be enabled by the shortcut is installed. If it isn't,
+     * clear the value and the associated setting so a sideloaded service can't spoof the
+     * package name of the default service.
+     *
+     * @param userState
+     */
+    private void updateAccessibilityShortcutLocked(UserState userState) {
+        if (userState.mServiceToEnableWithShortcut == null) {
+            return;
+        }
+        boolean shortcutServiceIsInstalled = false;
+        for (int i = 0; i < userState.mInstalledServices.size(); i++) {
+            if (userState.mInstalledServices.get(i).getComponentName()
+                    .equals(userState.mServiceToEnableWithShortcut)) {
+                shortcutServiceIsInstalled = true;
+            }
+        }
+        if (!shortcutServiceIsInstalled) {
+            userState.mServiceToEnableWithShortcut = null;
+            Settings.Secure.putStringForUser(mContext.getContentResolver(),
+                    Settings.Secure.ACCESSIBILITY_SHORTCUT_TARGET_SERVICE, "", userState.mUserId);
+        }
+    }
+
     private boolean canRequestAndRequestsTouchExplorationLocked(Service service) {
         // Service not ready or cannot request the feature - well nothing to do.
         if (!service.canReceiveEventsLocked() || !service.mRequestTouchExplorationMode) {
@@ -1895,44 +1941,63 @@
     }
 
     /**
+     * AIDL-exposed method to be called when the accessibility shortcut is enabled. Requires
+     * permission to write secure settings, since someone with that permission can enable
+     * accessibility services themselves.
+     */
+    public void performAccessibilityShortcut() {
+        if ((UserHandle.getAppId(Binder.getCallingUid()) != Process.SYSTEM_UID)
+                && (mContext.checkCallingPermission(Manifest.permission.WRITE_SECURE_SETTINGS)
+                != PackageManager.PERMISSION_GRANTED)) {
+            throw new SecurityException(
+                    "performAccessibilityShortcut requires the WRITE_SECURE_SETTINGS permission");
+        }
+        synchronized(mLock) {
+            UserState userState = getUserStateLocked(mCurrentUserId);
+            ComponentName serviceName = userState.mServiceToEnableWithShortcut;
+            if (serviceName == null) {
+                return;
+            }
+            final long identity = Binder.clearCallingIdentity();
+            try {
+                if (userState.mComponentNameToServiceMap.get(serviceName) == null) {
+                    enableAccessibilityServiceLocked(serviceName, mCurrentUserId);
+                } else {
+                    disableAccessibilityServiceLocked(serviceName, mCurrentUserId);
+                }
+            } finally {
+                Binder.restoreCallingIdentity(identity);
+            }
+        }
+    };
+
+    /**
      * Enables accessibility service specified by {@param componentName} for the {@param userId}.
      */
-    public void enableAccessibilityService(ComponentName componentName, int userId) {
-        synchronized(mLock) {
-            if (Binder.getCallingUid() != Process.SYSTEM_UID) {
-                throw new SecurityException("only SYSTEM can call enableAccessibilityService.");
-            }
+    private void enableAccessibilityServiceLocked(ComponentName componentName, int userId) {
+        SettingsStringHelper settingsHelper = new SettingsStringHelper(
+                Settings.Secure.ENABLED_ACCESSIBILITY_SERVICES, userId);
+        settingsHelper.addService(componentName);
+        settingsHelper.writeToSettings();
 
-            SettingsStringHelper settingsHelper = new SettingsStringHelper(
-                    Settings.Secure.ENABLED_ACCESSIBILITY_SERVICES, userId);
-            settingsHelper.addService(componentName);
-            settingsHelper.writeToSettings();
-
-            UserState userState = getUserStateLocked(userId);
-            if (userState.mEnabledServices.add(componentName)) {
-                onUserStateChangedLocked(userState);
-            }
+        UserState userState = getUserStateLocked(userId);
+        if (userState.mEnabledServices.add(componentName)) {
+            onUserStateChangedLocked(userState);
         }
     }
 
     /**
      * Disables accessibility service specified by {@param componentName} for the {@param userId}.
      */
-    public void disableAccessibilityService(ComponentName componentName, int userId) {
-        synchronized(mLock) {
-            if (Binder.getCallingUid() != Process.SYSTEM_UID) {
-                throw new SecurityException("only SYSTEM can call disableAccessibility");
-            }
+    private void disableAccessibilityServiceLocked(ComponentName componentName, int userId) {
+        SettingsStringHelper settingsHelper = new SettingsStringHelper(
+                Settings.Secure.ENABLED_ACCESSIBILITY_SERVICES, userId);
+        settingsHelper.deleteService(componentName);
+        settingsHelper.writeToSettings();
 
-            SettingsStringHelper settingsHelper = new SettingsStringHelper(
-                    Settings.Secure.ENABLED_ACCESSIBILITY_SERVICES, userId);
-            settingsHelper.deleteService(componentName);
-            settingsHelper.writeToSettings();
-
-            UserState userState = getUserStateLocked(userId);
-            if (userState.mEnabledServices.remove(componentName)) {
-                onUserStateChangedLocked(userState);
-            }
+        UserState userState = getUserStateLocked(userId);
+        if (userState.mEnabledServices.remove(componentName)) {
+            onUserStateChangedLocked(userState);
         }
     }
 
@@ -4307,6 +4372,8 @@
 
         public ComponentName mServiceChangingSoftKeyboardMode;
 
+        public ComponentName mServiceToEnableWithShortcut;
+
         public int mLastSentClientState = -1;
 
         public int mSoftKeyboardShowMode = 0;
@@ -4439,6 +4506,9 @@
         private final Uri mAccessibilitySoftKeyboardModeUri = Settings.Secure.getUriFor(
                 Settings.Secure.ACCESSIBILITY_SOFT_KEYBOARD_MODE);
 
+        private final Uri mAccessibilityShortcutServiceIdUri = Settings.Secure.getUriFor(
+                Settings.Secure.ACCESSIBILITY_SHORTCUT_TARGET_SERVICE);
+
         public AccessibilityContentObserver(Handler handler) {
             super(handler);
         }
@@ -4467,6 +4537,8 @@
                     mHighTextContrastUri, false, this, UserHandle.USER_ALL);
             contentResolver.registerContentObserver(
                     mAccessibilitySoftKeyboardModeUri, false, this, UserHandle.USER_ALL);
+            contentResolver.registerContentObserver(
+                    mAccessibilityShortcutServiceIdUri, false, this, UserHandle.USER_ALL);
         }
 
         @Override
@@ -4519,6 +4591,10 @@
                         notifySoftKeyboardShowModeChangedLocked(userState.mSoftKeyboardShowMode);
                         onUserStateChangedLocked(userState);
                     }
+                } else if (mAccessibilityShortcutServiceIdUri.equals(uri)) {
+                    if (readAccessibilityShortcutSettingLocked(userState)) {
+                        onUserStateChangedLocked(userState);
+                    }
                 }
             }
         }
diff --git a/services/appwidget/java/com/android/server/appwidget/AppWidgetServiceImpl.java b/services/appwidget/java/com/android/server/appwidget/AppWidgetServiceImpl.java
index 87eb380..3523706 100644
--- a/services/appwidget/java/com/android/server/appwidget/AppWidgetServiceImpl.java
+++ b/services/appwidget/java/com/android/server/appwidget/AppWidgetServiceImpl.java
@@ -126,6 +126,7 @@
 import java.util.Locale;
 import java.util.Map;
 import java.util.Set;
+import java.util.concurrent.atomic.AtomicLong;
 
 class AppWidgetServiceImpl extends IAppWidgetService.Stub implements WidgetBackupProvider,
         OnCrossProfileWidgetProvidersChangeListener {
@@ -152,6 +153,8 @@
     // Bump if the stored widgets need to be upgraded.
     private static final int CURRENT_VERSION = 1;
 
+    private static final AtomicLong REQUEST_COUNTER = new AtomicLong();
+
     private final BroadcastReceiver mBroadcastReceiver = new BroadcastReceiver() {
         @Override
         public void onReceive(Context context, Intent intent) {
@@ -771,7 +774,8 @@
             LongSparseArray<PendingHostUpdate> updatesMap = new LongSparseArray<>();
             for (int i = 0; i < N; i++) {
                 if (host.getPendingUpdatesForId(appWidgetIds[i], updatesMap)) {
-                    // We key the updates based on time, so that the values are sorted by time.
+                    // We key the updates based on request id, so that the values are sorted in the
+                    // order they were received.
                     int M = updatesMap.size();
                     for (int j = 0; j < M; j++) {
                         outUpdates.add(updatesMap.valueAt(j));
@@ -1854,9 +1858,9 @@
             // method with a wrong id. In that case, ignore the call.
             return;
         }
-        long requestTime = SystemClock.uptimeMillis();
+        long requestId = REQUEST_COUNTER.incrementAndGet();
         if (widget != null) {
-            widget.updateTimes.put(viewId, requestTime);
+            widget.updateRequestIds.put(viewId, requestId);
         }
         if (widget == null || widget.host == null || widget.host.zombie
                 || widget.host.callbacks == null || widget.provider == null
@@ -1867,7 +1871,7 @@
         SomeArgs args = SomeArgs.obtain();
         args.arg1 = widget.host;
         args.arg2 = widget.host.callbacks;
-        args.arg3 = requestTime;
+        args.arg3 = requestId;
         args.argi1 = widget.appWidgetId;
         args.argi2 = viewId;
 
@@ -1878,10 +1882,10 @@
 
 
     private void handleNotifyAppWidgetViewDataChanged(Host host, IAppWidgetHost callbacks,
-            int appWidgetId, int viewId, long requestTime) {
+            int appWidgetId, int viewId, long requestId) {
         try {
             callbacks.viewDataChanged(appWidgetId, viewId);
-            host.lastWidgetUpdateTime = requestTime;
+            host.lastWidgetUpdateRequestId = requestId;
         } catch (RemoteException re) {
             // It failed; remove the callback. No need to prune because
             // we know that this host is still referenced by this instance.
@@ -1928,9 +1932,9 @@
     }
 
     private void scheduleNotifyUpdateAppWidgetLocked(Widget widget, RemoteViews updateViews) {
-        long requestTime = SystemClock.uptimeMillis();
+        long requestId = REQUEST_COUNTER.incrementAndGet();
         if (widget != null) {
-            widget.updateTimes.put(ID_VIEWS_UPDATE, requestTime);
+            widget.updateRequestIds.put(ID_VIEWS_UPDATE, requestId);
         }
         if (widget == null || widget.provider == null || widget.provider.zombie
                 || widget.host.callbacks == null || widget.host.zombie) {
@@ -1941,7 +1945,7 @@
         args.arg1 = widget.host;
         args.arg2 = widget.host.callbacks;
         args.arg3 = (updateViews != null) ? updateViews.clone() : null;
-        args.arg4 = requestTime;
+        args.arg4 = requestId;
         args.argi1 = widget.appWidgetId;
 
         mCallbackHandler.obtainMessage(
@@ -1950,10 +1954,10 @@
     }
 
     private void handleNotifyUpdateAppWidget(Host host, IAppWidgetHost callbacks,
-            int appWidgetId, RemoteViews views, long requestTime) {
+            int appWidgetId, RemoteViews views, long requestId) {
         try {
             callbacks.updateAppWidget(appWidgetId, views);
-            host.lastWidgetUpdateTime = requestTime;
+            host.lastWidgetUpdateRequestId = requestId;
         } catch (RemoteException re) {
             synchronized (mLock) {
                 Slog.e(TAG, "Widget host dead: " + host.id, re);
@@ -1963,11 +1967,11 @@
     }
 
     private void scheduleNotifyProviderChangedLocked(Widget widget) {
-        long requestTime = SystemClock.uptimeMillis();
+        long requestId = REQUEST_COUNTER.incrementAndGet();
         if (widget != null) {
             // When the provider changes, reset everything else.
-            widget.updateTimes.clear();
-            widget.updateTimes.append(ID_PROVIDER_CHANGED, requestTime);
+            widget.updateRequestIds.clear();
+            widget.updateRequestIds.append(ID_PROVIDER_CHANGED, requestId);
         }
         if (widget == null || widget.provider == null || widget.provider.zombie
                 || widget.host.callbacks == null || widget.host.zombie) {
@@ -1978,7 +1982,7 @@
         args.arg1 = widget.host;
         args.arg2 = widget.host.callbacks;
         args.arg3 = widget.provider.info;
-        args.arg4 = requestTime;
+        args.arg4 = requestId;
         args.argi1 = widget.appWidgetId;
 
         mCallbackHandler.obtainMessage(
@@ -1987,10 +1991,10 @@
     }
 
     private void handleNotifyProviderChanged(Host host, IAppWidgetHost callbacks,
-            int appWidgetId, AppWidgetProviderInfo info, long requestTime) {
+            int appWidgetId, AppWidgetProviderInfo info, long requestId) {
         try {
             callbacks.providerChanged(appWidgetId, info);
-            host.lastWidgetUpdateTime = requestTime;
+            host.lastWidgetUpdateRequestId = requestId;
         } catch (RemoteException re) {
             synchronized (mLock){
                 Slog.e(TAG, "Widget host dead: " + host.id, re);
@@ -3463,11 +3467,11 @@
                     Host host = (Host) args.arg1;
                     IAppWidgetHost callbacks = (IAppWidgetHost) args.arg2;
                     RemoteViews views = (RemoteViews) args.arg3;
-                    long requestTime = (Long) args.arg4;
+                    long requestId = (Long) args.arg4;
                     final int appWidgetId = args.argi1;
                     args.recycle();
 
-                    handleNotifyUpdateAppWidget(host, callbacks, appWidgetId, views, requestTime);
+                    handleNotifyUpdateAppWidget(host, callbacks, appWidgetId, views, requestId);
                 } break;
 
                 case MSG_NOTIFY_PROVIDER_CHANGED: {
@@ -3475,11 +3479,11 @@
                     Host host = (Host) args.arg1;
                     IAppWidgetHost callbacks = (IAppWidgetHost) args.arg2;
                     AppWidgetProviderInfo info = (AppWidgetProviderInfo)args.arg3;
-                    long requestTime = (Long) args.arg4;
+                    long requestId = (Long) args.arg4;
                     final int appWidgetId = args.argi1;
                     args.recycle();
 
-                    handleNotifyProviderChanged(host, callbacks, appWidgetId, info, requestTime);
+                    handleNotifyProviderChanged(host, callbacks, appWidgetId, info, requestId);
                 } break;
 
                 case MSG_NOTIFY_PROVIDERS_CHANGED: {
@@ -3495,13 +3499,13 @@
                     SomeArgs args = (SomeArgs) message.obj;
                     Host host = (Host) args.arg1;
                     IAppWidgetHost callbacks = (IAppWidgetHost) args.arg2;
-                    long requestTime = (Long) args.arg3;
+                    long requestId = (Long) args.arg3;
                     final int appWidgetId = args.argi1;
                     final int viewId = args.argi2;
                     args.recycle();
 
                     handleNotifyAppWidgetViewDataChanged(host, callbacks, appWidgetId, viewId,
-                            requestTime);
+                            requestId);
                 } break;
             }
         }
@@ -3817,7 +3821,7 @@
         boolean zombie; // if we're in safe mode, don't prune this just because nobody references it
 
         int tag = TAG_UNDEFINED; // for use while saving state (the index)
-        long lastWidgetUpdateTime; // last time we were successfully able to send an update.
+        long lastWidgetUpdateRequestId; // request id for the last update successfully sent
 
         public int getUserId() {
             return UserHandle.getUserId(id.uid);
@@ -3844,18 +3848,18 @@
          */
         public boolean getPendingUpdatesForId(int appWidgetId,
                 LongSparseArray<PendingHostUpdate> outUpdates) {
-            long updateTime = lastWidgetUpdateTime;
+            long updateRequestId = lastWidgetUpdateRequestId;
             int N = widgets.size();
             for (int i = 0; i < N; i++) {
                 Widget widget = widgets.get(i);
                 if (widget.appWidgetId == appWidgetId) {
                     outUpdates.clear();
-                    for (int j = widget.updateTimes.size() - 1; j >= 0; j--) {
-                        long time = widget.updateTimes.valueAt(j);
-                        if (time <= updateTime) {
+                    for (int j = widget.updateRequestIds.size() - 1; j >= 0; j--) {
+                        long requestId = widget.updateRequestIds.valueAt(j);
+                        if (requestId <= updateRequestId) {
                             continue;
                         }
-                        int id = widget.updateTimes.keyAt(j);
+                        int id = widget.updateRequestIds.keyAt(j);
                         final PendingHostUpdate update;
                         switch (id) {
                             case ID_PROVIDER_CHANGED:
@@ -3869,7 +3873,7 @@
                             default:
                                 update = PendingHostUpdate.viewDataChanged(appWidgetId, id);
                         }
-                        outUpdates.put(time, update);
+                        outUpdates.put(requestId, update);
                     }
                     return true;
                 }
@@ -3951,8 +3955,8 @@
         RemoteViews maskedViews;
         Bundle options;
         Host host;
-        // timestamps for various operations
-        SparseLongArray updateTimes = new SparseLongArray(2);
+        // Request ids for various operations
+        SparseLongArray updateRequestIds = new SparseLongArray(2);
 
         @Override
         public String toString() {
diff --git a/services/core/Android.mk b/services/core/Android.mk
index 07f14d4..cd88b85 100644
--- a/services/core/Android.mk
+++ b/services/core/Android.mk
@@ -25,8 +25,8 @@
     android.hardware.tv.cec@1.0-java
 
 LOCAL_STATIC_JAVA_LIBRARIES := tzdata_update2 \
-    android.hidl.base@1.0-java \
-    android.hardware.biometrics.fingerprint@2.1-java \
+    android.hidl.base@1.0-java-static \
+    android.hardware.biometrics.fingerprint@2.1-java-static \
 
 ifneq ($(INCREMENTAL_BUILDS),)
     LOCAL_PROGUARD_ENABLED := disabled
diff --git a/services/core/java/com/android/server/DiskStatsService.java b/services/core/java/com/android/server/DiskStatsService.java
index dd95f67..962ac6f 100644
--- a/services/core/java/com/android/server/DiskStatsService.java
+++ b/services/core/java/com/android/server/DiskStatsService.java
@@ -95,9 +95,7 @@
             pw.println("File-based Encryption: true");
         }
 
-        if (isCheckin(args)) {
-            reportCachedValues(pw);
-        }
+        reportCachedValues(pw);
 
         // TODO: Read /proc/yaffs and report interesting values;
         // add configurable (through args) performance test parameters.
@@ -130,15 +128,6 @@
         }
     }
 
-    private boolean isCheckin(String[] args) {
-        for (String opt : args) {
-            if ("--checkin".equals(opt)) {
-                return true;
-            }
-        }
-        return false;
-    }
-
     private void reportCachedValues(PrintWriter pw) {
         try {
             String jsonString = IoUtils.readFileAsString(DISKSTATS_DUMP_FILE);
diff --git a/services/core/java/com/android/server/NetworkScoreService.java b/services/core/java/com/android/server/NetworkScoreService.java
index bd9f684..6f49702 100644
--- a/services/core/java/com/android/server/NetworkScoreService.java
+++ b/services/core/java/com/android/server/NetworkScoreService.java
@@ -75,6 +75,7 @@
 import java.util.Map;
 import java.util.concurrent.TimeoutException;
 import java.util.concurrent.atomic.AtomicBoolean;
+import java.util.concurrent.atomic.AtomicReference;
 import java.util.function.Consumer;
 
 /**
@@ -87,7 +88,7 @@
 
     private final Context mContext;
     private final NetworkScorerAppManager mNetworkScorerAppManager;
-    private final RequestRecommendationCaller mRequestRecommendationCaller;
+    private final AtomicReference<RequestRecommendationCaller> mReqRecommendationCallerRef;
     @GuardedBy("mScoreCaches")
     private final Map<Integer, RemoteCallbackList<INetworkScoreCache>> mScoreCaches;
     /** Lock used to update mPackageMonitor when scorer package changes occur. */
@@ -249,8 +250,8 @@
         mContext.registerReceiverAsUser(
                 mUserIntentReceiver, UserHandle.SYSTEM, filter, null /* broadcastPermission*/,
                 null /* scheduler */);
-        mRequestRecommendationCaller =
-            new RequestRecommendationCaller(TimedRemoteCaller.DEFAULT_CALL_TIMEOUT_MILLIS);
+        mReqRecommendationCallerRef = new AtomicReference<>(
+                new RequestRecommendationCaller(TimedRemoteCaller.DEFAULT_CALL_TIMEOUT_MILLIS));
         mRecommendationRequestTimeoutMs = TimedRemoteCaller.DEFAULT_CALL_TIMEOUT_MILLIS;
         mHandler = new ServiceHandler(looper);
         mContentObserver = new DispatchingContentObserver(context, mHandler);
@@ -569,7 +570,8 @@
             final INetworkRecommendationProvider provider = getRecommendationProvider();
             if (provider != null) {
                 try {
-                    return mRequestRecommendationCaller.getRecommendationResult(provider, request);
+                    final RequestRecommendationCaller caller = mReqRecommendationCallerRef.get();
+                    return caller.getRecommendationResult(provider, request);
                 } catch (RemoteException | TimeoutException e) {
                     Log.w(TAG, "Failed to request a recommendation.", e);
                     // TODO(jjoslin): 12/15/16 - Keep track of failures.
@@ -748,6 +750,7 @@
         }
         if (DBG) Log.d(TAG, "Updating the recommendation request timeout to " + timeoutMs + " ms");
         mRecommendationRequestTimeoutMs = timeoutMs;
+        mReqRecommendationCallerRef.set(new RequestRecommendationCaller(timeoutMs));
     }
 
     private static class ScoringServiceConnection implements ServiceConnection {
diff --git a/services/core/java/com/android/server/RecoverySystemService.java b/services/core/java/com/android/server/RecoverySystemService.java
index 2010e64..3c8c699 100644
--- a/services/core/java/com/android/server/RecoverySystemService.java
+++ b/services/core/java/com/android/server/RecoverySystemService.java
@@ -181,7 +181,7 @@
         }
 
         @Override // Binder call
-        public void rebootRecoveryWithCommand(String command, boolean update) {
+        public void rebootRecoveryWithCommand(String command) {
             if (DEBUG) Slog.d(TAG, "rebootRecoveryWithCommand: [" + command + "]");
             synchronized (sRequestLock) {
                 if (!setupOrClearBcb(true, command)) {
@@ -190,10 +190,7 @@
 
                 // Having set up the BCB, go ahead and reboot.
                 PowerManager pm = (PowerManager) mContext.getSystemService(Context.POWER_SERVICE);
-                // PowerManagerService may additionally request uncrypting the package when it's
-                // to install an update (REBOOT_RECOVERY_UPDATE).
-                pm.reboot(update ? PowerManager.REBOOT_RECOVERY_UPDATE :
-                        PowerManager.REBOOT_RECOVERY);
+                pm.reboot(PowerManager.REBOOT_RECOVERY);
             }
         }
 
diff --git a/services/core/java/com/android/server/StorageManagerService.java b/services/core/java/com/android/server/StorageManagerService.java
index 55d31c3..f9b9d6f 100644
--- a/services/core/java/com/android/server/StorageManagerService.java
+++ b/services/core/java/com/android/server/StorageManagerService.java
@@ -88,11 +88,13 @@
 import android.util.Log;
 import android.util.Pair;
 import android.util.Slog;
+import android.util.SparseArray;
 import android.util.TimeUtils;
 import android.util.Xml;
 
 import com.android.internal.annotations.GuardedBy;
 import com.android.internal.app.IMediaContainerService;
+import com.android.internal.os.AppFuseMount;
 import com.android.internal.os.SomeArgs;
 import com.android.internal.os.Zygote;
 import com.android.internal.util.ArrayUtils;
@@ -104,7 +106,7 @@
 import com.android.server.NativeDaemonConnector.Command;
 import com.android.server.NativeDaemonConnector.SensitiveArg;
 import com.android.server.pm.PackageManagerService;
-
+import com.android.server.storage.AppFuseBridge;
 import libcore.io.IoUtils;
 import libcore.util.EmptyArray;
 
@@ -135,6 +137,7 @@
 import java.util.Map;
 import java.util.Map.Entry;
 import java.util.Objects;
+import java.util.concurrent.ArrayBlockingQueue;
 import java.util.concurrent.CopyOnWriteArrayList;
 import java.util.concurrent.CountDownLatch;
 import java.util.concurrent.TimeUnit;
@@ -337,6 +340,15 @@
 
     private volatile int mCurrentUserId = UserHandle.USER_SYSTEM;
 
+    /** Holding lock for AppFuse business */
+    private final Object mAppFuseLock = new Object();
+
+    @GuardedBy("mAppFuseLock")
+    private int mNextAppFuseName = 0;
+
+    @GuardedBy("mAppFuseLock")
+    private final SparseArray<Integer> mAppFusePids = new SparseArray<>();
+
     private VolumeInfo findVolumeByIdOrThrow(String id) {
         synchronized (mLock) {
             final VolumeInfo vol = mVolumes.get(id);
@@ -3010,6 +3022,128 @@
         }
     }
 
+
+    class CloseableHolder<T extends AutoCloseable> implements AutoCloseable {
+        @Nullable T mCloseable;
+
+        CloseableHolder(T closeable) {
+            mCloseable = closeable;
+        }
+
+        @Nullable T get() {
+            return mCloseable;
+        }
+
+        @Nullable T release() {
+            final T result = mCloseable;
+            mCloseable = null;
+            return result;
+        }
+
+        @Override
+        public void close() {
+            if (mCloseable != null) {
+                IoUtils.closeQuietly(mCloseable);
+            }
+        }
+    }
+
+    class AppFuseMountScope implements AppFuseBridge.IMountScope {
+        final int mUid;
+        final int mName;
+        final ParcelFileDescriptor mDeviceFd;
+
+        AppFuseMountScope(int uid, int pid, int name) throws NativeDaemonConnectorException {
+            final NativeDaemonEvent event = mConnector.execute(
+                    "appfuse", "mount", uid, Process.myPid(), name);
+            mUid = uid;
+            mName = name;
+            synchronized (mLock) {
+                mAppFusePids.put(name, pid);
+            }
+            if (event.getFileDescriptors() != null &&
+                    event.getFileDescriptors().length > 0) {
+                mDeviceFd = new ParcelFileDescriptor(event.getFileDescriptors()[0]);
+            } else {
+                mDeviceFd = null;
+            }
+        }
+
+        @Override
+        public void close() throws NativeDaemonConnectorException {
+            try {
+                IoUtils.closeQuietly(mDeviceFd);
+                mConnector.execute(
+                        "appfuse", "unmount", mUid, Process.myPid(), mName);
+            } finally {
+                synchronized (mLock) {
+                    mAppFusePids.delete(mName);
+                }
+            }
+        }
+
+        @Override
+        public ParcelFileDescriptor getDeviceFileDescriptor() {
+            return mDeviceFd;
+        }
+    }
+
+    @Override
+    public AppFuseMount mountProxyFileDescriptorBridge() throws RemoteException {
+        final int uid = Binder.getCallingUid();
+        final int pid = Binder.getCallingPid();
+        final int name;
+        synchronized (mAppFuseLock) {
+            name = mNextAppFuseName++;
+        }
+        try (CloseableHolder<AppFuseMountScope> mountScope =
+                new CloseableHolder<>(new AppFuseMountScope(uid, pid, name))) {
+            if (mountScope.get().getDeviceFileDescriptor() == null) {
+                throw new RemoteException("Failed to obtain device FD");
+            }
+
+            // Create communication channel.
+            final ArrayBlockingQueue<Boolean> channel = new ArrayBlockingQueue<>(1);
+            final ParcelFileDescriptor[] fds = ParcelFileDescriptor.createSocketPair();
+            try (CloseableHolder<ParcelFileDescriptor> remote = new CloseableHolder<>(fds[0])) {
+                new Thread(
+                        new AppFuseBridge(mountScope.release(), fds[1], channel),
+                        AppFuseBridge.TAG).start();
+                if (!channel.take()) {
+                    throw new RemoteException("Failed to init AppFuse mount point");
+                }
+
+                return new AppFuseMount(name, remote.release());
+            }
+        } catch (NativeDaemonConnectorException e){
+            throw e.rethrowAsParcelableException();
+        } catch (IOException | InterruptedException error) {
+            throw new RemoteException(error.getMessage());
+        }
+    }
+
+    @Override
+    public ParcelFileDescriptor openProxyFileDescriptor(int mountId, int fileId, int mode) {
+        final int uid = Binder.getCallingUid();
+        final int pid = Binder.getCallingPid();
+        try {
+            synchronized (mAppFuseLock) {
+                final int expectedPid = mAppFusePids.get(mountId, -1);
+                if (expectedPid == -1) {
+                    Slog.i(TAG, "The mount point has already been unmounted");
+                    return null;
+                }
+                if (expectedPid != pid) {
+                    throw new SecurityException("Mount point was not created by this process.");
+                }
+            }
+            return AppFuseBridge.openFile(uid, mountId, fileId, mode);
+        } catch (FileNotFoundException error) {
+            Slog.e(TAG, "Failed to openProxyFileDescriptor", error);
+            return null;
+        }
+    }
+
     @Override
     public int mkdirs(String callingPkg, String appPath) {
         final int userId = UserHandle.getUserId(Binder.getCallingUid());
diff --git a/services/core/java/com/android/server/am/ActivityRecord.java b/services/core/java/com/android/server/am/ActivityRecord.java
index 47c3e6f..a2fb9f9 100644
--- a/services/core/java/com/android/server/am/ActivityRecord.java
+++ b/services/core/java/com/android/server/am/ActivityRecord.java
@@ -1802,6 +1802,9 @@
     }
 
     void showStartingWindow(ActivityRecord prev, boolean newTask, boolean taskSwitch) {
+        if (mWindowContainerController == null) {
+            return;
+        }
         final CompatibilityInfo compatInfo =
                 service.compatibilityInfoForPackageLocked(info.applicationInfo);
         final boolean shown = mWindowContainerController.addStartingWindow(packageName, theme,
diff --git a/services/core/java/com/android/server/am/NativeCrashListener.java b/services/core/java/com/android/server/am/NativeCrashListener.java
index e2870d8..9348023 100644
--- a/services/core/java/com/android/server/am/NativeCrashListener.java
+++ b/services/core/java/com/android/server/am/NativeCrashListener.java
@@ -20,7 +20,6 @@
 import android.system.ErrnoException;
 import android.system.Os;
 import android.system.StructTimeval;
-import android.system.StructUcred;
 import android.system.UnixSocketAddress;
 import android.util.Slog;
 
@@ -105,9 +104,9 @@
 
         if (DEBUG) Slog.i(TAG, "Starting up");
 
-        // The file system entity for this socket is created with 0700 perms, owned
-        // by system:system.  debuggerd runs as root, so is capable of connecting to
-        // it, but 3rd party apps cannot.
+        // The file system entity for this socket is created with 0777 perms, owned
+        // by system:system. selinux restricts things so that only crash_dump can
+        // access it.
         {
             File socketFile = new File(DEBUGGERD_SOCKET_PATH);
             if (socketFile.exists()) {
@@ -121,6 +120,7 @@
                     DEBUGGERD_SOCKET_PATH);
             Os.bind(serverFd, sockAddr);
             Os.listen(serverFd, 1);
+            Os.chmod(DEBUGGERD_SOCKET_PATH, 0777);
 
             while (true) {
                 FileDescriptor peerFd = null;
@@ -129,19 +129,14 @@
                     peerFd = Os.accept(serverFd, null /* peerAddress */);
                     if (MORE_DEBUG) Slog.v(TAG, "Got debuggerd socket " + peerFd);
                     if (peerFd != null) {
-                        // Only the superuser is allowed to talk to us over this socket
-                        StructUcred credentials =
-                                Os.getsockoptUcred(peerFd, SOL_SOCKET, SO_PEERCRED);
-                        if (credentials.uid == 0) {
-                            // the reporting thread may take responsibility for
-                            // acking the debugger; make sure we play along.
-                            consumeNativeCrashData(peerFd);
-                        }
+                        // the reporting thread may take responsibility for
+                        // acking the debugger; make sure we play along.
+                        consumeNativeCrashData(peerFd);
                     }
                 } catch (Exception e) {
                     Slog.w(TAG, "Error handling connection", e);
                 } finally {
-                    // Always ack debuggerd's connection to us.  The actual
+                    // Always ack crash_dump's connection to us.  The actual
                     // byte written is irrelevant.
                     if (peerFd != null) {
                         try {
@@ -194,7 +189,7 @@
         return totalRead;
     }
 
-    // Read the crash report from the debuggerd connection
+    // Read a crash report from the connection
     void consumeNativeCrashData(FileDescriptor fd) {
         if (MORE_DEBUG) Slog.i(TAG, "debuggerd connected");
         final byte[] buf = new byte[4096];
@@ -205,6 +200,10 @@
             Os.setsockoptTimeval(fd, SOL_SOCKET, SO_RCVTIMEO, timeout);
             Os.setsockoptTimeval(fd, SOL_SOCKET, SO_SNDTIMEO, timeout);
 
+            // The socket is guarded by an selinux neverallow rule that only
+            // permits crash_dump to connect to it. This allows us to trust the
+            // received values.
+
             // first, the pid and signal number
             int headerBytes = readExactly(fd, buf, 0, 8);
             if (headerBytes != 8) {
diff --git a/services/core/java/com/android/server/am/TaskChangeNotificationController.java b/services/core/java/com/android/server/am/TaskChangeNotificationController.java
index cb20eac..d035fa9 100644
--- a/services/core/java/com/android/server/am/TaskChangeNotificationController.java
+++ b/services/core/java/com/android/server/am/TaskChangeNotificationController.java
@@ -16,6 +16,8 @@
 
 package com.android.server.am;
 
+import android.app.ActivityManager;
+import android.app.ActivityManager.TaskSnapshot;
 import android.app.ITaskStackListener;
 import android.app.ActivityManager.TaskDescription;
 import android.content.ComponentName;
@@ -43,6 +45,7 @@
     static final int NOTIFY_ACTIVITY_REQUESTED_ORIENTATION_CHANGED_LISTENERS = 12;
     static final int NOTIFY_TASK_REMOVAL_STARTED_LISTENERS = 13;
     static final int NOTIFY_TASK_PROFILE_LOCKED_LISTENERS_MSG = 14;
+    static final int NOTIFY_TASK_SNAPSHOT_CHANGED_LISTENERS_MSG = 15;
 
     // Delay in notifying task stack change listeners (in millis)
     static final int NOTIFY_TASK_STACK_CHANGE_LISTENERS_DELAY = 100;
@@ -113,6 +116,10 @@
         l.onTaskProfileLocked(m.arg1, m.arg2);
     };
 
+    private final TaskStackConsumer mNotifyTaskSnapshotChanged = (l, m) -> {
+        l.onTaskSnapshotChanged(m.arg1, (TaskSnapshot) m.obj);
+    };
+
     @FunctionalInterface
     public interface TaskStackConsumer {
         void accept(ITaskStackListener t, Message m) throws RemoteException;
@@ -170,7 +177,9 @@
                     break;
                 case NOTIFY_TASK_PROFILE_LOCKED_LISTENERS_MSG:
                     forAllRemoteListeners(mNotifyTaskProfileLocked, msg);
-
+                    break;
+                case NOTIFY_TASK_SNAPSHOT_CHANGED_LISTENERS_MSG:
+                    forAllRemoteListeners(mNotifyTaskSnapshotChanged, msg);
                     break;
             }
         }
@@ -348,4 +357,14 @@
         forAllLocalListeners(mNotifyTaskProfileLocked, msg);
         msg.sendToTarget();
     }
+
+    /**
+     * Notify listeners that the snapshot of a task has changed.
+     */
+    void notifyTaskSnapshotChanged(int taskId, TaskSnapshot snapshot) {
+        final Message msg = mHandler.obtainMessage(NOTIFY_TASK_SNAPSHOT_CHANGED_LISTENERS_MSG,
+                taskId, 0, snapshot);
+        forAllLocalListeners(mNotifyTaskSnapshotChanged, msg);
+        msg.sendToTarget();
+    }
 }
diff --git a/services/core/java/com/android/server/am/TaskRecord.java b/services/core/java/com/android/server/am/TaskRecord.java
index 4c4c444..a72a958 100644
--- a/services/core/java/com/android/server/am/TaskRecord.java
+++ b/services/core/java/com/android/server/am/TaskRecord.java
@@ -52,6 +52,8 @@
 import com.android.internal.util.XmlUtils;
 
 import com.android.server.wm.TaskWindowContainerController;
+import com.android.server.wm.TaskWindowContainerListener;
+
 import org.xmlpull.v1.XmlPullParser;
 import org.xmlpull.v1.XmlPullParserException;
 import org.xmlpull.v1.XmlSerializer;
@@ -105,7 +107,7 @@
 import static com.android.server.am.ActivityStackSupervisor.CREATE_IF_NEEDED;
 import static com.android.server.am.ActivityStackSupervisor.PRESERVE_WINDOWS;
 
-final class TaskRecord extends ConfigurationContainer {
+final class TaskRecord extends ConfigurationContainer implements TaskWindowContainerListener {
     private static final String TAG = TAG_WITH_CLASS_NAME ? "TaskRecord" : TAG_AM;
     private static final String TAG_ADD_REMOVE = TAG + POSTFIX_ADD_REMOVE;
     private static final String TAG_RECENTS = TAG + POSTFIX_RECENTS;
@@ -412,8 +414,8 @@
 
         final Rect bounds = updateOverrideConfigurationFromLaunchBounds();
         final Configuration overrideConfig = getOverrideConfiguration();
-        mWindowContainerController = new TaskWindowContainerController(taskId, getStackId(), userId,
-                bounds, overrideConfig, mResizeMode, isHomeTask(), isOnTopLauncher(), onTop,
+        mWindowContainerController = new TaskWindowContainerController(taskId, this, getStackId(),
+                userId, bounds, overrideConfig, mResizeMode, isHomeTask(), isOnTopLauncher(), onTop,
                 showForAllUsers);
     }
 
@@ -429,6 +431,11 @@
         mWindowContainerController = null;
     }
 
+    @Override
+    public void onSnapshotChanged(TaskSnapshot snapshot) {
+        mService.mTaskChangeNotificationController.notifyTaskSnapshotChanged(taskId, snapshot);
+    }
+
     void setResizeMode(int resizeMode) {
         if (mResizeMode == resizeMode) {
             return;
diff --git a/services/core/java/com/android/server/am/UserController.java b/services/core/java/com/android/server/am/UserController.java
index 71ebad9..f516e99 100644
--- a/services/core/java/com/android/server/am/UserController.java
+++ b/services/core/java/com/android/server/am/UserController.java
@@ -259,6 +259,11 @@
                     int uptimeSeconds = (int)(SystemClock.elapsedRealtime() / 1000);
                     MetricsLogger.histogram(mInjector.getContext(),
                             "framework_locked_boot_completed", uptimeSeconds);
+                    final int MAX_UPTIME_SECONDS = 120;
+                    if (uptimeSeconds > MAX_UPTIME_SECONDS) {
+                        Slog.wtf("SystemServerTiming",
+                                "finishUserBoot took too long. uptimeSeconds=" + uptimeSeconds);
+                    }
                 }
 
                 mHandler.sendMessage(mHandler.obtainMessage(REPORT_LOCKED_BOOT_COMPLETE_MSG,
diff --git a/services/core/java/com/android/server/connectivity/tethering/UpstreamNetworkMonitor.java b/services/core/java/com/android/server/connectivity/tethering/UpstreamNetworkMonitor.java
index 927dfd5..4c950de 100644
--- a/services/core/java/com/android/server/connectivity/tethering/UpstreamNetworkMonitor.java
+++ b/services/core/java/com/android/server/connectivity/tethering/UpstreamNetworkMonitor.java
@@ -16,6 +16,9 @@
 
 package com.android.server.connectivity.tethering;
 
+import static android.net.ConnectivityManager.TYPE_MOBILE_DUN;
+import static android.net.ConnectivityManager.TYPE_MOBILE_HIPRI;
+
 import android.content.Context;
 import android.net.ConnectivityManager;
 import android.net.ConnectivityManager.NetworkCallback;
@@ -142,7 +145,11 @@
         // message to aid in any subsequent debugging
         if (DBG) Log.d(TAG, "requesting mobile upstream network: " + mobileUpstreamRequest);
 
-        cm().requestNetwork(mobileUpstreamRequest, mMobileNetworkCallback);
+        // The following use of the legacy type system cannot be removed until
+        // after upstream selection no longer finds networks by legacy type.
+        // See also b/34364553.
+        final int apnType = mDunRequired ? TYPE_MOBILE_DUN : TYPE_MOBILE_HIPRI;
+        cm().requestNetwork(mobileUpstreamRequest, mMobileNetworkCallback, 0, apnType);
     }
 
     public void releaseMobileNetworkRequest() {
diff --git a/services/core/java/com/android/server/input/InputManagerService.java b/services/core/java/com/android/server/input/InputManagerService.java
index 87f4030..fbb39384 100644
--- a/services/core/java/com/android/server/input/InputManagerService.java
+++ b/services/core/java/com/android/server/input/InputManagerService.java
@@ -25,6 +25,7 @@
 import com.android.internal.inputmethod.InputMethodSubtypeHandle;
 import com.android.internal.os.SomeArgs;
 import com.android.internal.R;
+import com.android.internal.util.Preconditions;
 import com.android.internal.util.XmlUtils;
 import com.android.server.DisplayThread;
 import com.android.server.LocalServices;
@@ -1700,6 +1701,7 @@
     // Binder call
     @Override
     public void setCustomPointerIcon(PointerIcon icon) {
+        Preconditions.checkNotNull(icon);
         nativeSetCustomPointerIcon(mPtr, icon);
     }
 
diff --git a/services/core/java/com/android/server/net/NetworkIdentitySet.java b/services/core/java/com/android/server/net/NetworkIdentitySet.java
index c48f430..ee00fdc 100644
--- a/services/core/java/com/android/server/net/NetworkIdentitySet.java
+++ b/services/core/java/com/android/server/net/NetworkIdentitySet.java
@@ -17,6 +17,8 @@
 package com.android.server.net;
 
 import android.net.NetworkIdentity;
+import android.service.NetworkIdentitySetProto;
+import android.util.proto.ProtoOutputStream;
 
 import java.io.DataInputStream;
 import java.io.DataOutputStream;
@@ -143,4 +145,14 @@
         final NetworkIdentity anotherIdent = another.iterator().next();
         return ident.compareTo(anotherIdent);
     }
+
+    public void writeToProto(ProtoOutputStream proto, long tag) {
+        final long start = proto.start(tag);
+
+        for (NetworkIdentity ident : this) {
+            ident.writeToProto(proto, NetworkIdentitySetProto.IDENTITIES);
+        }
+
+        proto.end(start);
+    }
 }
diff --git a/services/core/java/com/android/server/net/NetworkStatsCollection.java b/services/core/java/com/android/server/net/NetworkStatsCollection.java
index c45b416..0354300 100644
--- a/services/core/java/com/android/server/net/NetworkStatsCollection.java
+++ b/services/core/java/com/android/server/net/NetworkStatsCollection.java
@@ -34,9 +34,13 @@
 import android.net.NetworkTemplate;
 import android.net.TrafficStats;
 import android.os.Binder;
+import android.service.NetworkStatsCollectionKeyProto;
+import android.service.NetworkStatsCollectionProto;
+import android.service.NetworkStatsCollectionStatsProto;
 import android.util.ArrayMap;
 import android.util.AtomicFile;
 import android.util.IntArray;
+import android.util.proto.ProtoOutputStream;
 
 import com.android.internal.util.ArrayUtils;
 import com.android.internal.util.FileRotator;
@@ -532,12 +536,15 @@
                 / mBucketDuration);
     }
 
-    public void dump(IndentingPrintWriter pw) {
+    private ArrayList<Key> getSortedKeys() {
         final ArrayList<Key> keys = Lists.newArrayList();
         keys.addAll(mStats.keySet());
         Collections.sort(keys);
+        return keys;
+    }
 
-        for (Key key : keys) {
+    public void dump(IndentingPrintWriter pw) {
+        for (Key key : getSortedKeys()) {
             pw.print("ident="); pw.print(key.ident.toString());
             pw.print(" uid="); pw.print(key.uid);
             pw.print(" set="); pw.print(NetworkStats.setToString(key.set));
@@ -550,6 +557,29 @@
         }
     }
 
+    public void writeToProto(ProtoOutputStream proto, long tag) {
+        final long start = proto.start(tag);
+
+        for (Key key : getSortedKeys()) {
+            final long startStats = proto.start(NetworkStatsCollectionProto.STATS);
+
+            // Key
+            final long startKey = proto.start(NetworkStatsCollectionStatsProto.KEY);
+            key.ident.writeToProto(proto, NetworkStatsCollectionKeyProto.IDENTITY);
+            proto.write(NetworkStatsCollectionKeyProto.UID, key.uid);
+            proto.write(NetworkStatsCollectionKeyProto.SET, key.set);
+            proto.write(NetworkStatsCollectionKeyProto.TAG, key.tag);
+            proto.end(startKey);
+
+            // Value
+            final NetworkStatsHistory history = mStats.get(key);
+            history.writeToProto(proto, NetworkStatsCollectionStatsProto.HISTORY);
+            proto.end(startStats);
+        }
+
+        proto.end(start);
+    }
+
     public void dumpCheckin(PrintWriter pw, long start, long end) {
         dumpCheckin(pw, start, end, NetworkTemplate.buildTemplateMobileWildcard(), "cell");
         dumpCheckin(pw, start, end, NetworkTemplate.buildTemplateWifiWildcard(), "wifi");
diff --git a/services/core/java/com/android/server/net/NetworkStatsRecorder.java b/services/core/java/com/android/server/net/NetworkStatsRecorder.java
index 090a076..80309e1 100644
--- a/services/core/java/com/android/server/net/NetworkStatsRecorder.java
+++ b/services/core/java/com/android/server/net/NetworkStatsRecorder.java
@@ -29,9 +29,11 @@
 import android.net.NetworkTemplate;
 import android.net.TrafficStats;
 import android.os.DropBoxManager;
+import android.service.NetworkStatsRecorderProto;
 import android.util.Log;
 import android.util.MathUtils;
 import android.util.Slog;
+import android.util.proto.ProtoOutputStream;
 
 import com.android.internal.net.VpnInfo;
 import com.android.internal.util.FileRotator;
@@ -465,6 +467,15 @@
         }
     }
 
+    public void writeToProtoLocked(ProtoOutputStream proto, long tag) {
+        final long start = proto.start(tag);
+        if (mPending != null) {
+            proto.write(NetworkStatsRecorderProto.PENDING_TOTAL_BYTES, mPending.getTotalBytes());
+        }
+        getOrLoadCompleteLocked().writeToProto(proto, NetworkStatsRecorderProto.COMPLETE_HISTORY);
+        proto.end(start);
+    }
+
     public void dumpCheckin(PrintWriter pw, long start, long end) {
         // Only load and dump stats from the requested window
         getOrLoadPartialLocked(start, end).dumpCheckin(pw, start, end);
diff --git a/services/core/java/com/android/server/net/NetworkStatsService.java b/services/core/java/com/android/server/net/NetworkStatsService.java
index 386e78b..104c296 100644
--- a/services/core/java/com/android/server/net/NetworkStatsService.java
+++ b/services/core/java/com/android/server/net/NetworkStatsService.java
@@ -104,6 +104,8 @@
 import android.os.UserHandle;
 import android.provider.Settings;
 import android.provider.Settings.Global;
+import android.service.NetworkInterfaceProto;
+import android.service.NetworkStatsServiceDumpProto;
 import android.telephony.TelephonyManager;
 import android.text.format.DateUtils;
 import android.util.ArrayMap;
@@ -115,6 +117,7 @@
 import android.util.Slog;
 import android.util.SparseIntArray;
 import android.util.TrustedTime;
+import android.util.proto.ProtoOutputStream;
 
 import com.android.internal.annotations.VisibleForTesting;
 import com.android.internal.net.VpnInfo;
@@ -1255,6 +1258,12 @@
         final IndentingPrintWriter pw = new IndentingPrintWriter(rawWriter, "  ");
 
         synchronized (mStatsLock) {
+            if (args.length > 0 && "--proto".equals(args[0])) {
+                // In this case ignore all other arguments.
+                dumpProto(fd);
+                return;
+            }
+
             if (poll) {
                 performPollLocked(FLAG_PERSIST_ALL | FLAG_PERSIST_FORCE);
                 pw.println("Forced poll");
@@ -1327,6 +1336,33 @@
         }
     }
 
+    private void dumpProto(FileDescriptor fd) {
+        final ProtoOutputStream proto = new ProtoOutputStream(fd);
+
+        // TODO Right now it writes all history.  Should it limit to the "since-boot" log?
+
+        dumpInterfaces(proto, NetworkStatsServiceDumpProto.ACTIVE_INTERFACES, mActiveIfaces);
+        dumpInterfaces(proto, NetworkStatsServiceDumpProto.ACTIVE_UID_INTERFACES, mActiveUidIfaces);
+        mDevRecorder.writeToProtoLocked(proto, NetworkStatsServiceDumpProto.DEV_STATS);
+        mXtRecorder.writeToProtoLocked(proto, NetworkStatsServiceDumpProto.XT_STATS);
+        mUidRecorder.writeToProtoLocked(proto, NetworkStatsServiceDumpProto.UID_STATS);
+        mUidTagRecorder.writeToProtoLocked(proto, NetworkStatsServiceDumpProto.UID_TAG_STATS);
+
+        proto.flush();
+    }
+
+    private static void dumpInterfaces(ProtoOutputStream proto, long tag,
+            ArrayMap<String, NetworkIdentitySet> ifaces) {
+        for (int i = 0; i < ifaces.size(); i++) {
+            final long start = proto.start(tag);
+
+            proto.write(NetworkInterfaceProto.INTERFACE, ifaces.keyAt(i));
+            ifaces.valueAt(i).writeToProto(proto, NetworkInterfaceProto.IDENTITIES);
+
+            proto.end(start);
+        }
+    }
+
     /**
      * Return snapshot of current UID statistics, including any
      * {@link TrafficStats#UID_TETHERING} and {@link #mUidOperations} values.
diff --git a/services/core/java/com/android/server/notification/NotificationManagerService.java b/services/core/java/com/android/server/notification/NotificationManagerService.java
index 0cac406..9018302 100644
--- a/services/core/java/com/android/server/notification/NotificationManagerService.java
+++ b/services/core/java/com/android/server/notification/NotificationManagerService.java
@@ -3289,7 +3289,9 @@
     private boolean playSound(final NotificationRecord record, Uri soundUri) {
         boolean looping = (record.getNotification().flags & Notification.FLAG_INSISTENT) != 0;
         // do not play notifications if there is a user of exclusive audio focus
-        if (!mAudioManager.isAudioFocusExclusive()) {
+        // or the device is in vibrate mode
+        if (!mAudioManager.isAudioFocusExclusive() && mAudioManager.getRingerModeInternal()
+                != AudioManager.RINGER_MODE_VIBRATE) {
             final long identity = Binder.clearCallingIdentity();
             try {
                 final IRingtonePlayer player = mAudioManager.getRingtonePlayer();
@@ -3995,7 +3997,8 @@
             NotificationRecord childR = mNotificationList.get(i);
             StatusBarNotification childSbn = childR.sbn;
             if ((childSbn.isGroup() && !childSbn.getNotification().isGroupSummary()) &&
-                    childR.getGroupKey().equals(r.getGroupKey())) {
+                    childR.getGroupKey().equals(r.getGroupKey())
+                    && (childR.getFlags() & Notification.FLAG_FOREGROUND_SERVICE) == 0) {
                 EventLogTags.writeNotificationCancel(callingUid, callingPid, pkg, childSbn.getId(),
                         childSbn.getTag(), userId, 0, 0, reason, listenerName);
                 mNotificationList.remove(i);
diff --git a/services/core/java/com/android/server/pm/Installer.java b/services/core/java/com/android/server/pm/Installer.java
index 98249dd1..de0d2a3 100644
--- a/services/core/java/com/android/server/pm/Installer.java
+++ b/services/core/java/com/android/server/pm/Installer.java
@@ -415,6 +415,15 @@
         }
     }
 
+    public void invalidateMounts() throws InstallerException {
+        if (!checkBeforeRemote()) return;
+        try {
+            mInstalld.invalidateMounts();
+        } catch (Exception e) {
+            throw InstallerException.from(e);
+        }
+    }
+
     private static void assertValidInstructionSet(String instructionSet)
             throws InstallerException {
         for (String abi : Build.SUPPORTED_ABIS) {
diff --git a/services/core/java/com/android/server/pm/LauncherAppsService.java b/services/core/java/com/android/server/pm/LauncherAppsService.java
index 48e000d8..2ddf6db 100644
--- a/services/core/java/com/android/server/pm/LauncherAppsService.java
+++ b/services/core/java/com/android/server/pm/LauncherAppsService.java
@@ -21,9 +21,11 @@
 import android.app.ActivityManager;
 import android.app.ActivityManagerInternal;
 import android.app.AppGlobals;
+import android.app.PendingIntent;
 import android.content.ComponentName;
 import android.content.Context;
 import android.content.Intent;
+import android.content.IntentSender;
 import android.content.pm.ActivityInfo;
 import android.content.pm.ApplicationInfo;
 import android.content.pm.ILauncherApps;
@@ -277,24 +279,11 @@
         @Override
         public ParceledListSlice<ResolveInfo> getLauncherActivities(String packageName, UserHandle user)
                 throws RemoteException {
-            ensureInUserProfiles(user, "Cannot retrieve activities for unrelated profile " + user);
-            if (!isUserEnabled(user)) {
-                return null;
-            }
-
-            final Intent mainIntent = new Intent(Intent.ACTION_MAIN, null);
-            mainIntent.addCategory(Intent.CATEGORY_LAUNCHER);
-            mainIntent.setPackage(packageName);
-            long ident = Binder.clearCallingIdentity();
-            try {
-                List<ResolveInfo> apps = mPm.queryIntentActivitiesAsUser(mainIntent,
-                        PackageManager.MATCH_DIRECT_BOOT_AWARE
-                                | PackageManager.MATCH_DIRECT_BOOT_UNAWARE,
-                        user.getIdentifier());
-                return new ParceledListSlice<>(apps);
-            } finally {
-                Binder.restoreCallingIdentity(ident);
-            }
+            return queryActivitiesForUser(
+                    new Intent(Intent.ACTION_MAIN)
+                            .addCategory(Intent.CATEGORY_LAUNCHER)
+                            .setPackage(packageName),
+                    user);
         }
 
         @Override
@@ -318,6 +307,53 @@
         }
 
         @Override
+        public ParceledListSlice getShortcutConfigActivities(String packageName, UserHandle user)
+                throws RemoteException {
+            return queryActivitiesForUser(
+                    new Intent(Intent.ACTION_CREATE_SHORTCUT).setPackage(packageName), user);
+        }
+
+        private ParceledListSlice<ResolveInfo> queryActivitiesForUser(Intent intent,
+                UserHandle user) {
+            ensureInUserProfiles(user, "Cannot retrieve activities for unrelated profile " + user);
+            if (!isUserEnabled(user)) {
+                return null;
+            }
+
+            long ident = injectClearCallingIdentity();
+            try {
+                List<ResolveInfo> apps = mPm.queryIntentActivitiesAsUser(intent,
+                        PackageManager.MATCH_DIRECT_BOOT_AWARE
+                                | PackageManager.MATCH_DIRECT_BOOT_UNAWARE,
+                        user.getIdentifier());
+                return new ParceledListSlice<>(apps);
+            } finally {
+                injectRestoreCallingIdentity(ident);
+            }
+        }
+
+        @Override
+        public IntentSender getShortcutConfigActivityIntent(String callingPackage,
+                ComponentName component, UserHandle user) throws RemoteException {
+            ensureShortcutPermission(callingPackage, user);
+            Preconditions.checkNotNull(component);
+            Preconditions.checkArgument(isUserEnabled(user), "User not enabled");
+
+            // All right, create the sender.
+            Intent intent = new Intent(Intent.ACTION_CREATE_SHORTCUT).setComponent(component);
+            final long identity = Binder.clearCallingIdentity();
+            try {
+                return PendingIntent.getActivityAsUser(
+                        mContext, 0, intent, PendingIntent.FLAG_ONE_SHOT
+                                | PendingIntent.FLAG_IMMUTABLE | PendingIntent.FLAG_CANCEL_CURRENT,
+                        null, user)
+                        .getIntentSender();
+            } finally {
+                Binder.restoreCallingIdentity(identity);
+            }
+        }
+
+        @Override
         public boolean isPackageEnabled(String packageName, UserHandle user)
                 throws RemoteException {
             ensureInUserProfiles(user, "Cannot check package for unrelated profile " + user);
diff --git a/services/core/java/com/android/server/pm/PackageInstallerService.java b/services/core/java/com/android/server/pm/PackageInstallerService.java
index d25abbf..d516acf 100644
--- a/services/core/java/com/android/server/pm/PackageInstallerService.java
+++ b/services/core/java/com/android/server/pm/PackageInstallerService.java
@@ -145,6 +145,7 @@
     private static final String ATTR_ABI_OVERRIDE = "abiOverride";
     private static final String ATTR_VOLUME_UUID = "volumeUuid";
     private static final String ATTR_NAME = "name";
+    private static final String ATTR_INSTALL_REASON = "installRason";
 
     /** Automatically destroy sessions older than this */
     private static final long MAX_AGE_MILLIS = 3 * DateUtils.DAY_IN_MILLIS;
@@ -412,6 +413,7 @@
         params.abiOverride = readStringAttribute(in, ATTR_ABI_OVERRIDE);
         params.volumeUuid = readStringAttribute(in, ATTR_VOLUME_UUID);
         params.grantedRuntimePermissions = readGrantedRuntimePermissions(in);
+        params.installReason = readIntAttribute(in, ATTR_INSTALL_REASON);
 
         final File appIconFile = buildAppIconFile(sessionId);
         if (appIconFile.exists()) {
@@ -484,6 +486,7 @@
         writeUriAttribute(out, ATTR_REFERRER_URI, params.referrerUri);
         writeStringAttribute(out, ATTR_ABI_OVERRIDE, params.abiOverride);
         writeStringAttribute(out, ATTR_VOLUME_UUID, params.volumeUuid);
+        writeIntAttribute(out, ATTR_INSTALL_REASON, params.installReason);
 
         // Persist app icon if changed since last written
         final File appIconFile = buildAppIconFile(session.sessionId);
diff --git a/services/core/java/com/android/server/pm/PackageManagerService.java b/services/core/java/com/android/server/pm/PackageManagerService.java
index 7362a51..af1e007 100644
--- a/services/core/java/com/android/server/pm/PackageManagerService.java
+++ b/services/core/java/com/android/server/pm/PackageManagerService.java
@@ -1713,9 +1713,11 @@
             }
 
             // Now that we successfully installed the package, grant runtime
-            // permissions if requested before broadcasting the install.
-            if (grantPermissions && res.pkg.applicationInfo.targetSdkVersion
-                    >= Build.VERSION_CODES.M) {
+            // permissions if requested before broadcasting the install. Also
+            // for legacy apps in permission review mode we clear the permission
+            // review flag which is used to emulate runtime permissions for
+            // legacy apps.
+            if (grantPermissions) {
                 grantRequestedRuntimePermissions(res.pkg, res.newUsers, grantedPermissions);
             }
 
@@ -1958,11 +1960,6 @@
         for (int userId : userIds) {
             grantRequestedRuntimePermissionsForUser(pkg, userId, grantedPermissions);
         }
-
-        // We could have touched GID membership, so flush out packages.list
-        synchronized (mPackages) {
-            mSettings.writePackageListLPr();
-        }
     }
 
     private void grantRequestedRuntimePermissionsForUser(PackageParser.Package pkg, int userId,
@@ -1977,6 +1974,9 @@
         final int immutableFlags = PackageManager.FLAG_PERMISSION_SYSTEM_FIXED
                 | PackageManager.FLAG_PERMISSION_POLICY_FIXED;
 
+        final boolean supportsRuntimePermissions = pkg.applicationInfo.targetSdkVersion
+                >= Build.VERSION_CODES.M;
+
         for (String permission : pkg.requestedPermissions) {
             final BasePermission bp;
             synchronized (mPackages) {
@@ -1986,9 +1986,18 @@
                     && (grantedPermissions == null
                            || ArrayUtils.contains(grantedPermissions, permission))) {
                 final int flags = permissionsState.getPermissionFlags(permission, userId);
-                // Installer cannot change immutable permissions.
-                if ((flags & immutableFlags) == 0) {
-                    grantRuntimePermission(pkg.packageName, permission, userId);
+                if (supportsRuntimePermissions) {
+                    // Installer cannot change immutable permissions.
+                    if ((flags & immutableFlags) == 0) {
+                        grantRuntimePermission(pkg.packageName, permission, userId);
+                    }
+                } else if (mPermissionReviewRequired) {
+                    // In permission review mode we clear the review flag when we
+                    // are asked to install the app with all permissions granted.
+                    if ((flags & PackageManager.FLAG_PERMISSION_REVIEW_REQUIRED) != 0) {
+                        updatePermissionFlags(permission, pkg.packageName,
+                                PackageManager.FLAG_PERMISSION_REVIEW_REQUIRED, 0, userId);
+                    }
                 }
             }
         }
@@ -12208,6 +12217,67 @@
         mHandler.sendMessage(msg);
     }
 
+
+    /**
+     * Ensure that the install reason matches what we know about the package installer (e.g. whether
+     * it is acting on behalf on an enterprise or the user).
+     *
+     * Note that the ordering of the conditionals in this method is important. The checks we perform
+     * are as follows, in this order:
+     *
+     * 1) If the install is being performed by a system app, we can trust the app to have set the
+     *    install reason correctly. Thus, we pass through the install reason unchanged, no matter
+     *    what it is.
+     * 2) If the install is being performed by a device or profile owner app, the install reason
+     *    should be enterprise policy. However, we cannot be sure that the device or profile owner
+     *    set the install reason correctly. If the app targets an older SDK version where install
+     *    reasons did not exist yet, or if the app author simply forgot, the install reason may be
+     *    unset or wrong. Thus, we force the install reason to be enterprise policy.
+     * 3) In all other cases, the install is being performed by a regular app that is neither part
+     *    of the system nor a device or profile owner. We have no reason to believe that this app is
+     *    acting on behalf of the enterprise admin. Thus, we check whether the install reason was
+     *    set to enterprise policy and if so, change it to unknown instead.
+     */
+    private int fixUpInstallReason(String installerPackageName, int installerUid,
+            int installReason) {
+        if (checkUidPermission(android.Manifest.permission.INSTALL_PACKAGES, installerUid)
+                == PERMISSION_GRANTED) {
+            // If the install is being performed by a system app, we trust that app to have set the
+            // install reason correctly.
+            return installReason;
+        }
+
+        final IDevicePolicyManager dpm = IDevicePolicyManager.Stub.asInterface(
+            ServiceManager.getService(Context.DEVICE_POLICY_SERVICE));
+        if (dpm != null) {
+            ComponentName owner = null;
+            try {
+                owner = dpm.getDeviceOwnerComponent(true /* callingUserOnly */);
+                if (owner == null) {
+                    owner = dpm.getProfileOwner(UserHandle.getUserId(installerUid));
+                }
+            } catch (RemoteException e) {
+            }
+            if (owner != null && owner.getPackageName().equals(installerPackageName)) {
+                // If the install is being performed by a device or profile owner, the install
+                // reason should be enterprise policy.
+                return PackageManager.INSTALL_REASON_POLICY;
+            }
+        }
+
+        if (installReason == PackageManager.INSTALL_REASON_POLICY) {
+            // If the install is being performed by a regular app (i.e. neither system app nor
+            // device or profile owner), we have no reason to believe that the app is acting on
+            // behalf of an enterprise. If the app set the install reason to enterprise policy,
+            // change it to unknown instead.
+            return PackageManager.INSTALL_REASON_UNKNOWN;
+        }
+
+        // If the install is being performed by a regular app and the install reason was set to any
+        // value but enterprise policy, leave the install reason unchanged.
+        return installReason;
+    }
+
     void installStage(String packageName, File stagedDir, String stagedCid,
             IPackageInstallObserver2 observer, PackageInstaller.SessionParams sessionParams,
             String installerPackageName, int installerUid, UserHandle user,
@@ -12229,10 +12299,12 @@
         }
 
         final Message msg = mHandler.obtainMessage(INIT_COPY);
+        final int installReason = fixUpInstallReason(installerPackageName, installerUid,
+                sessionParams.installReason);
         final InstallParams params = new InstallParams(origin, null, observer,
                 sessionParams.installFlags, installerPackageName, sessionParams.volumeUuid,
                 verificationInfo, user, sessionParams.abiOverride,
-                sessionParams.grantedRuntimePermissions, certificates, sessionParams.installReason);
+                sessionParams.grantedRuntimePermissions, certificates, installReason);
         params.setTraceMethod("installStage").setTraceCookie(System.identityHashCode(params));
         msg.obj = params;
 
diff --git a/services/core/java/com/android/server/pm/ShortcutRequestPinProcessor.java b/services/core/java/com/android/server/pm/ShortcutRequestPinProcessor.java
index c8ddf0a..a156356 100644
--- a/services/core/java/com/android/server/pm/ShortcutRequestPinProcessor.java
+++ b/services/core/java/com/android/server/pm/ShortcutRequestPinProcessor.java
@@ -15,6 +15,7 @@
  */
 package com.android.server.pm;
 
+import android.annotation.NonNull;
 import android.annotation.Nullable;
 import android.appwidget.AppWidgetProviderInfo;
 import android.content.ComponentName;
@@ -24,6 +25,7 @@
 import android.content.pm.LauncherApps;
 import android.content.pm.LauncherApps.PinItemRequest;
 import android.content.pm.ShortcutInfo;
+import android.os.Binder;
 import android.os.Bundle;
 import android.os.UserHandle;
 import android.util.Log;
@@ -50,18 +52,31 @@
     private static class PinItemRequestInner extends IPinItemRequest.Stub {
         protected final ShortcutRequestPinProcessor mProcessor;
         private final IntentSender mResultIntent;
+        private final int mLauncherUid;
 
         @GuardedBy("this")
         private boolean mAccepted;
 
         private PinItemRequestInner(ShortcutRequestPinProcessor processor,
-                IntentSender resultIntent) {
+                IntentSender resultIntent, int launcherUid) {
             mProcessor = processor;
             mResultIntent = resultIntent;
+            mLauncherUid = launcherUid;
+        }
+
+        /**
+         * Returns true if the caller is same as the default launcher app when this request
+         * object was created.
+         */
+        private boolean isCallerValid() {
+            return mProcessor.isCallerUid(mLauncherUid);
         }
 
         @Override
         public boolean isValid() {
+            if (!isCallerValid()) {
+                return false;
+            }
             // TODO When an app calls requestPinShortcut(), all pending requests should be
             // invalidated.
             synchronized (this) {
@@ -76,6 +91,9 @@
         public boolean accept(Bundle options) {
             // Make sure the options are unparcellable by the FW. (e.g. not containing unknown
             // classes.)
+            if (!isCallerValid()) {
+                throw new SecurityException("Calling uid mismatch");
+            }
             Intent extras = null;
             if (options != null) {
                 try {
@@ -126,8 +144,8 @@
         private PinShortcutRequestInner(ShortcutRequestPinProcessor processor,
                 ShortcutInfo shortcutOriginal, ShortcutInfo shortcutForLauncher,
                 IntentSender resultIntent,
-                String launcherPackage, int launcherUserId, boolean preExisting) {
-            super(processor, resultIntent);
+                String launcherPackage, int launcherUserId, int launcherUid, boolean preExisting) {
+            super(processor, resultIntent, launcherUid);
             this.shortcutOriginal = shortcutOriginal;
             this.shortcutForLauncher = shortcutForLauncher;
             this.launcherPackage = launcherPackage;
@@ -157,6 +175,7 @@
     /**
      * Handle {@link android.content.pm.ShortcutManager#requestPinShortcut)} and
      * {@link android.appwidget.AppWidgetManager#requestPinAppWidget}.
+     * In this flow the PinItemRequest is delivered directly to the default launcher app.
      * One of {@param inShortcut} and {@param inAppWidget} is always non-null and the other is
      * always null.
      */
@@ -184,9 +203,13 @@
         // Next, validate the incoming shortcut, etc.
         final PinItemRequest request;
         if (inShortcut != null) {
-            request = requestPinShortcutLocked(inShortcut, resultIntent, confirmActivity);
+            request = requestPinShortcutLocked(inShortcut, resultIntent, confirmActivity,
+                    true /* ignoreIfAlreadyPinned */);
         } else {
-            request = new PinItemRequest(inAppWidget, new PinItemRequestInner(this, resultIntent));
+            int launcherUid = mService.injectGetPackageUid(
+                    confirmActivity.first.getPackageName(), launcherUserId);
+            request = new PinItemRequest(inAppWidget,
+                    new PinItemRequestInner(this, resultIntent, launcherUid));
         }
 
         if (request == null) {
@@ -197,10 +220,41 @@
     }
 
     /**
+     * Handle {@link android.content.pm.ShortcutManager#createShortcutResultIntent(ShortcutInfo)}.
+     * In this flow the PinItemRequest is delivered to the caller app. Its the app's responsibility
+     * to send it to the Launcher app (via {@link android.app.Activity#setResult(int, Intent)}).
+     */
+    public Intent createShortcutResultIntent(@NonNull ShortcutInfo inShortcut, int userId) {
+        // Find the default launcher activity
+        final int launcherUserId = mService.getParentOrSelfUserId(userId);
+        final ComponentName defaultLauncher = mService.getDefaultLauncher(launcherUserId);
+        if (defaultLauncher == null) {
+            Log.e(TAG, "Default launcher not found.");
+            return null;
+        }
+
+        // Make sure the launcher user is unlocked. (it's always the parent profile, so should
+        // really be unlocked here though.)
+        mService.throwIfUserLockedL(launcherUserId);
+
+        // Next, validate the incoming shortcut, etc.
+        PinItemRequest request = requestPinShortcutLocked(inShortcut, null,
+                Pair.create(defaultLauncher, launcherUserId), false /* ignoreIfAlreadyPinned */);
+        if (request == null) {
+            return null;
+        }
+        return new Intent().putExtra(LauncherApps.EXTRA_PIN_ITEM_REQUEST, request);
+    }
+
+    /**
      * Handle {@link android.content.pm.ShortcutManager#requestPinShortcut)}.
+     *
+     * @param ignoreIfAlreadyPinned if true and the {@param inShortcut} is already pinned for
+     *                              {@param confirmActivity}, null is returned instead.
      */
     private PinItemRequest requestPinShortcutLocked(ShortcutInfo inShortcut,
-            IntentSender resultIntent, Pair<ComponentName, Integer> confirmActivity) {
+            IntentSender resultIntent, Pair<ComponentName, Integer> confirmActivity,
+            boolean ignoreIfAlreadyPinned) {
         final ShortcutPackage ps = mService.getPackageShortcutsForPublisherLocked(
                 inShortcut.getPackage(), inShortcut.getUserId());
 
@@ -221,9 +275,10 @@
         if (existsAlready) {
             validateExistingShortcut(existing);
 
+            final boolean isAlreadyPinned = mService.getLauncherShortcutsLocked(
+                    launcherPackage, existing.getUserId(), launcherUserId).hasPinned(existing);
             // See if it's already pinned.
-            if (mService.getLauncherShortcutsLocked(
-                    launcherPackage, existing.getUserId(), launcherUserId).hasPinned(existing)) {
+            if (ignoreIfAlreadyPinned && isAlreadyPinned) {
                 Log.i(TAG, "Launcher's already pinning shortcut " + existing.getId()
                         + " for package " + existing.getPackage());
                 return null;
@@ -233,8 +288,10 @@
             // Note this will remove the intent and icons.
             shortcutForLauncher = existing.clone(ShortcutInfo.CLONE_REMOVE_FOR_LAUNCHER);
 
-            // FLAG_PINNED is still set, if it's pinned by other launchers.
-            shortcutForLauncher.clearFlags(ShortcutInfo.FLAG_PINNED);
+            if (!isAlreadyPinned) {
+                // FLAG_PINNED is still set, if it's pinned by other launchers.
+                shortcutForLauncher.clearFlags(ShortcutInfo.FLAG_PINNED);
+            }
         } else {
             // If the shortcut has no default activity, try to set the main activity.
             // But in the request-pin case, it's optional, so it's okay even if the caller
@@ -264,7 +321,9 @@
         // Create a request object.
         final PinShortcutRequestInner inner =
                 new PinShortcutRequestInner(this, inShortcut, shortcutForLauncher, resultIntent,
-                        launcherPackage, launcherUserId, existsAlready);
+                        launcherPackage, launcherUserId,
+                        mService.injectGetPackageUid(launcherPackage, launcherUserId),
+                        existsAlready);
 
         return new PinItemRequest(shortcutForLauncher, inner);
     }
@@ -327,6 +386,10 @@
         mService.injectSendIntentSender(intent, extras);
     }
 
+    public boolean isCallerUid(int uid) {
+        return uid == mService.injectBinderCallingUid();
+    }
+
     /**
      * The last step of the "request pin shortcut" flow.  Called when the launcher accepted a
      * request.
diff --git a/services/core/java/com/android/server/pm/ShortcutService.java b/services/core/java/com/android/server/pm/ShortcutService.java
index a890526..ae709fe 100644
--- a/services/core/java/com/android/server/pm/ShortcutService.java
+++ b/services/core/java/com/android/server/pm/ShortcutService.java
@@ -1529,7 +1529,7 @@
         if (UserHandle.getUserId(callingUid) != userId) {
             throw new SecurityException("Invalid user-ID");
         }
-        if (injectGetPackageUid(packageName, userId) == injectBinderCallingUid()) {
+        if (injectGetPackageUid(packageName, userId) == callingUid) {
             return; // Caller is valid.
         }
         throw new SecurityException("Calling package name mismatch");
@@ -1854,6 +1854,25 @@
         return requestPinItem(packageName, userId, shortcut, null, resultIntent);
     }
 
+    @Override
+    public Intent createShortcutResultIntent(String packageName, ShortcutInfo shortcut, int userId)
+            throws RemoteException {
+        Preconditions.checkNotNull(shortcut);
+        Preconditions.checkArgument(shortcut.isEnabled(), "Shortcut must be enabled");
+        verifyCaller(packageName, userId);
+
+        final Intent ret;
+        synchronized (mLock) {
+            throwIfUserLockedL(userId);
+
+            // Send request to the launcher, if supported.
+            ret = mShortcutRequestPinProcessor.createShortcutResultIntent(shortcut, userId);
+        }
+
+        verifyStates();
+        return ret;
+    }
+
     /**
      * Handles {@link #requestPinShortcut} and {@link ShortcutServiceInternal#requestPinAppWidget}.
      * After validating the caller, it passes the request to {@link #mShortcutRequestPinProcessor}.
diff --git a/services/core/java/com/android/server/pm/UserManagerService.java b/services/core/java/com/android/server/pm/UserManagerService.java
index 9fc70d6..e646ffc 100644
--- a/services/core/java/com/android/server/pm/UserManagerService.java
+++ b/services/core/java/com/android/server/pm/UserManagerService.java
@@ -67,6 +67,7 @@
 import android.os.SystemProperties;
 import android.os.UserHandle;
 import android.os.UserManager;
+import android.os.UserManager.EnforcingUser;
 import android.os.UserManagerInternal;
 import android.os.UserManagerInternal.UserRestrictionsListener;
 import android.os.storage.StorageManager;
@@ -118,6 +119,7 @@
 import java.io.PrintWriter;
 import java.nio.charset.StandardCharsets;
 import java.util.ArrayList;
+import java.util.Collections;
 import java.util.LinkedList;
 import java.util.List;
 
@@ -162,7 +164,11 @@
     private static final String TAG_USER = "user";
     private static final String TAG_RESTRICTIONS = "restrictions";
     private static final String TAG_DEVICE_POLICY_RESTRICTIONS = "device_policy_restrictions";
+    private static final String TAG_DEVICE_POLICY_GLOBAL_RESTRICTIONS =
+            "device_policy_global_restrictions";
+    /** Legacy name for device owner id tag. */
     private static final String TAG_GLOBAL_RESTRICTION_OWNER_ID = "globalRestrictionOwnerUserId";
+    private static final String TAG_DEVICE_OWNER_USER_ID = "deviceOwnerUserId";
     private static final String TAG_ENTRY = "entry";
     private static final String TAG_VALUE = "value";
     private static final String TAG_SEED_ACCOUNT_OPTIONS = "seedAccountOptions";
@@ -202,7 +208,7 @@
     @VisibleForTesting
     static final int MAX_RECENTLY_REMOVED_IDS_SIZE = 100;
 
-    private static final int USER_VERSION = 6;
+    private static final int USER_VERSION = 7;
 
     private static final long EPOCH_PLUS_30_YEARS = 30L * 365 * 24 * 60 * 60 * 1000L; // ms
 
@@ -267,7 +273,7 @@
 
     /**
      * User restrictions set via UserManager.  This doesn't include restrictions set by
-     * device owner / profile owners.
+     * device owner / profile owners. Only non-empty restriction bundles are stored.
      *
      * DO NOT Change existing {@link Bundle} in it.  When changing a restriction for a user,
      * a new {@link Bundle} should always be created and set.  This is because a {@link Bundle}
@@ -305,20 +311,21 @@
 
     /**
      * User restrictions set by {@link com.android.server.devicepolicy.DevicePolicyManagerService}
-     * that should be applied to all users, including guests.
+     * that should be applied to all users, including guests. Only non-empty restriction bundles are
+     * stored.
      */
     @GuardedBy("mRestrictionsLock")
-    private Bundle mDevicePolicyGlobalUserRestrictions;
+    private final SparseArray<Bundle> mDevicePolicyGlobalUserRestrictions = new SparseArray<>();
 
     /**
      * Id of the user that set global restrictions.
      */
     @GuardedBy("mRestrictionsLock")
-    private int mGlobalRestrictionOwnerUserId = UserHandle.USER_NULL;
+    private int mDeviceOwnerUserId = UserHandle.USER_NULL;
 
     /**
      * User restrictions set by {@link com.android.server.devicepolicy.DevicePolicyManagerService}
-     * for each user.
+     * for each user. Only non-empty restriction bundles are stored.
      */
     @GuardedBy("mRestrictionsLock")
     private final SparseArray<Bundle> mDevicePolicyLocalUserRestrictions = new SparseArray<>();
@@ -1176,39 +1183,36 @@
     }
 
     /**
-     * See {@link UserManagerInternal#setDevicePolicyUserRestrictions(int, Bundle, Bundle)}
+     * See {@link UserManagerInternal#setDevicePolicyUserRestrictions}
      */
-    void setDevicePolicyUserRestrictionsInner(int userId, @NonNull Bundle local,
-            @Nullable Bundle global) {
-        Preconditions.checkNotNull(local);
-        boolean globalChanged = false;
-        boolean localChanged;
+    private void setDevicePolicyUserRestrictionsInner(int userId, @Nullable Bundle restrictions,
+            boolean isDeviceOwner, int cameraRestrictionScope) {
+        final Bundle global = new Bundle();
+        final Bundle local = new Bundle();
+
+        // Sort restrictions into local and global ensuring they don't overlap.
+        UserRestrictionsUtils.sortToGlobalAndLocal(restrictions, isDeviceOwner,
+                cameraRestrictionScope, global, local);
+
+        boolean globalChanged, localChanged;
         synchronized (mRestrictionsLock) {
-            if (global != null) {
-                // Update global.
-                globalChanged = !UserRestrictionsUtils.areEqual(
-                        mDevicePolicyGlobalUserRestrictions, global);
-                if (globalChanged) {
-                    mDevicePolicyGlobalUserRestrictions = global;
-                }
+            // Update global and local restrictions if they were changed.
+            globalChanged = updateRestrictionsIfNeededLR(
+                    userId, global, mDevicePolicyGlobalUserRestrictions);
+            localChanged = updateRestrictionsIfNeededLR(
+                    userId, local, mDevicePolicyLocalUserRestrictions);
+
+            if (isDeviceOwner) {
                 // Remember the global restriction owner userId to be able to make a distinction
                 // in getUserRestrictionSource on who set local policies.
-                mGlobalRestrictionOwnerUserId = userId;
+                mDeviceOwnerUserId = userId;
             } else {
-                if (mGlobalRestrictionOwnerUserId == userId) {
+                if (mDeviceOwnerUserId == userId) {
                     // When profile owner sets restrictions it passes null global bundle and we
                     // reset global restriction owner userId.
                     // This means this user used to have DO, but now the DO is gone and the user
                     // instead has PO.
-                    mGlobalRestrictionOwnerUserId = UserHandle.USER_NULL;
-                }
-            }
-            {
-                // Update local.
-                final Bundle prev = mDevicePolicyLocalUserRestrictions.get(userId);
-                localChanged = !UserRestrictionsUtils.areEqual(prev, local);
-                if (localChanged) {
-                    mDevicePolicyLocalUserRestrictions.put(userId, local);
+                    mDeviceOwnerUserId = UserHandle.USER_NULL;
                 }
             }
         }
@@ -1220,12 +1224,9 @@
         }
         // Don't call them within the mRestrictionsLock.
         synchronized (mPackagesLock) {
-            if (localChanged) {
+            if (localChanged || globalChanged) {
                 writeUserLP(getUserDataNoChecks(userId));
             }
-            if (globalChanged) {
-                writeUserListLP();
-            }
         }
 
         synchronized (mRestrictionsLock) {
@@ -1237,11 +1238,30 @@
         }
     }
 
+    /**
+     * Updates restriction bundle for a given user in a given restriction array. If new bundle is
+     * empty, record is removed from the array.
+     * @return whether restrictions bundle is different from the old one.
+     */
+    private boolean updateRestrictionsIfNeededLR(int userId, @Nullable Bundle restrictions,
+            SparseArray<Bundle> restrictionsArray) {
+        final boolean changed =
+                !UserRestrictionsUtils.areEqual(restrictionsArray.get(userId), restrictions);
+        if (changed) {
+            if (!UserRestrictionsUtils.isEmpty(restrictions)) {
+                restrictionsArray.put(userId, restrictions);
+            } else {
+                restrictionsArray.delete(userId);
+            }
+        }
+        return changed;
+    }
+
     @GuardedBy("mRestrictionsLock")
     private Bundle computeEffectiveUserRestrictionsLR(int userId) {
         final Bundle baseRestrictions =
                 UserRestrictionsUtils.nonNull(mBaseUserRestrictions.get(userId));
-        final Bundle global = mDevicePolicyGlobalUserRestrictions;
+        final Bundle global = UserRestrictionsUtils.mergeAll(mDevicePolicyGlobalUserRestrictions);
         final Bundle local = mDevicePolicyLocalUserRestrictions.get(userId);
 
         if (UserRestrictionsUtils.isEmpty(global) && UserRestrictionsUtils.isEmpty(local)) {
@@ -1299,39 +1319,58 @@
      */
     @Override
     public int getUserRestrictionSource(String restrictionKey, int userId) {
-        checkManageUsersPermission("getUserRestrictionSource");
+        List<EnforcingUser> enforcingUsers = getUserRestrictionSources(restrictionKey,  userId);
+        // Get "bitwise or" of restriction sources for all enforcing users.
         int result = UserManager.RESTRICTION_NOT_SET;
+        for (int i = enforcingUsers.size() - 1; i >= 0; i--) {
+            result |= enforcingUsers.get(i).getUserRestrictionSource();
+        }
+        return result;
+    }
+
+    @Override
+    public List<EnforcingUser> getUserRestrictionSources(
+            String restrictionKey, @UserIdInt int userId) {
+        checkManageUsersPermission("getUserRestrictionSource");
 
         // Shortcut for the most common case
         if (!hasUserRestriction(restrictionKey, userId)) {
-            return result;
+            return Collections.emptyList();
         }
 
+        final List<EnforcingUser> result = new ArrayList<>();
+
+        // Check if it is base restriction.
         if (hasBaseUserRestriction(restrictionKey, userId)) {
-            result |= UserManager.RESTRICTION_SOURCE_SYSTEM;
+            result.add(new EnforcingUser(
+                    UserHandle.USER_NULL, UserManager.RESTRICTION_SOURCE_SYSTEM));
         }
 
-        synchronized(mRestrictionsLock) {
-            Bundle localRestrictions = mDevicePolicyLocalUserRestrictions.get(userId);
-            if (!UserRestrictionsUtils.isEmpty(localRestrictions)
-                    && localRestrictions.getBoolean(restrictionKey)) {
-                // Local restrictions may have been set by device owner the userId of which is
-                // stored in mGlobalRestrictionOwnerUserId.
-                if (mGlobalRestrictionOwnerUserId == userId) {
-                    result |= UserManager.RESTRICTION_SOURCE_DEVICE_OWNER;
-                } else {
-                    result |= UserManager.RESTRICTION_SOURCE_PROFILE_OWNER;
+        synchronized (mRestrictionsLock) {
+            // Check if it is set by profile owner.
+            Bundle profileOwnerRestrictions = mDevicePolicyLocalUserRestrictions.get(userId);
+            if (UserRestrictionsUtils.contains(profileOwnerRestrictions, restrictionKey)) {
+                result.add(getEnforcingUserLocked(userId));
+            }
+
+            // Iterate over all users who enforce global restrictions.
+            for (int i = mDevicePolicyGlobalUserRestrictions.size() - 1; i >= 0; i--) {
+                Bundle globalRestrictions = mDevicePolicyGlobalUserRestrictions.valueAt(i);
+                int profileUserId = mDevicePolicyGlobalUserRestrictions.keyAt(i);
+                if (UserRestrictionsUtils.contains(globalRestrictions, restrictionKey)) {
+                    result.add(getEnforcingUserLocked(profileUserId));
                 }
             }
-            if (!UserRestrictionsUtils.isEmpty(mDevicePolicyGlobalUserRestrictions)
-                    && mDevicePolicyGlobalUserRestrictions.getBoolean(restrictionKey)) {
-                result |= UserManager.RESTRICTION_SOURCE_DEVICE_OWNER;
-            }
         }
-
         return result;
     }
 
+    private EnforcingUser getEnforcingUserLocked(@UserIdInt int userId) {
+        int source = mDeviceOwnerUserId == userId ? UserManager.RESTRICTION_SOURCE_DEVICE_OWNER
+                : UserManager.RESTRICTION_SOURCE_PROFILE_OWNER;
+        return new EnforcingUser(userId, source);
+    }
+
     /**
      * @return UserRestrictions that are in effect currently.  This always returns a new
      * {@link Bundle}.
@@ -1374,28 +1413,26 @@
      * Optionally updating user restrictions, calculate the effective user restrictions and also
      * propagate to other services and system settings.
      *
-     * @param newRestrictions User restrictions to set.
+     * @param newBaseRestrictions User restrictions to set.
      *      If null, will not update user restrictions and only does the propagation.
      * @param userId target user ID.
      */
     @GuardedBy("mRestrictionsLock")
     private void updateUserRestrictionsInternalLR(
-            @Nullable Bundle newRestrictions, int userId) {
-
+            @Nullable Bundle newBaseRestrictions, int userId) {
         final Bundle prevAppliedRestrictions = UserRestrictionsUtils.nonNull(
                 mAppliedUserRestrictions.get(userId));
 
         // Update base restrictions.
-        if (newRestrictions != null) {
-            // If newRestrictions == the current one, it's probably a bug.
+        if (newBaseRestrictions != null) {
+            // If newBaseRestrictions == the current one, it's probably a bug.
             final Bundle prevBaseRestrictions = mBaseUserRestrictions.get(userId);
 
-            Preconditions.checkState(prevBaseRestrictions != newRestrictions);
+            Preconditions.checkState(prevBaseRestrictions != newBaseRestrictions);
             Preconditions.checkState(mCachedEffectiveUserRestrictions.get(userId)
-                    != newRestrictions);
+                    != newBaseRestrictions);
 
-            if (!UserRestrictionsUtils.areEqual(prevBaseRestrictions, newRestrictions)) {
-                mBaseUserRestrictions.put(userId, newRestrictions);
+            if (updateRestrictionsIfNeededLR(userId, newBaseRestrictions, mBaseUserRestrictions)) {
                 scheduleWriteUser(getUserDataNoChecks(userId));
             }
         }
@@ -1746,7 +1783,9 @@
                 }
             }
 
-            final Bundle newDevicePolicyGlobalUserRestrictions = new Bundle();
+            // Pre-O global user restriction were stored as a single bundle (as opposed to per-user
+            // currently), take care of it in case of upgrade.
+            Bundle oldDevicePolicyGlobalUserRestrictions = null;
 
             while ((type = parser.next()) != XmlPullParser.END_DOCUMENT) {
                 if (type == XmlPullParser.START_TAG) {
@@ -1771,29 +1810,30 @@
                             if (type == XmlPullParser.START_TAG) {
                                 if (parser.getName().equals(TAG_RESTRICTIONS)) {
                                     synchronized (mGuestRestrictions) {
-                                        UserRestrictionsUtils
-                                                .readRestrictions(parser, mGuestRestrictions);
+                                        mGuestRestrictions.putAll(
+                                                UserRestrictionsUtils.readRestrictions(parser));
                                     }
                                 }
                                 break;
                             }
                         }
-                    } else if (name.equals(TAG_DEVICE_POLICY_RESTRICTIONS)) {
-                        UserRestrictionsUtils.readRestrictions(parser,
-                                newDevicePolicyGlobalUserRestrictions);
-                    } else if (name.equals(TAG_GLOBAL_RESTRICTION_OWNER_ID)) {
+                    } else if (name.equals(TAG_DEVICE_OWNER_USER_ID)
+                            // Legacy name, should only be encountered when upgrading from pre-O.
+                            || name.equals(TAG_GLOBAL_RESTRICTION_OWNER_ID)) {
                         String ownerUserId = parser.getAttributeValue(null, ATTR_ID);
                         if (ownerUserId != null) {
-                            mGlobalRestrictionOwnerUserId = Integer.parseInt(ownerUserId);
+                            mDeviceOwnerUserId = Integer.parseInt(ownerUserId);
                         }
+                    } else if (name.equals(TAG_DEVICE_POLICY_RESTRICTIONS)) {
+                        // Should only happen when upgrading from pre-O (version < 7).
+                        oldDevicePolicyGlobalUserRestrictions =
+                                UserRestrictionsUtils.readRestrictions(parser);
                     }
                 }
             }
-            synchronized (mRestrictionsLock) {
-                mDevicePolicyGlobalUserRestrictions = newDevicePolicyGlobalUserRestrictions;
-            }
+
             updateUserIds();
-            upgradeIfNecessaryLP();
+            upgradeIfNecessaryLP(oldDevicePolicyGlobalUserRestrictions);
         } catch (IOException | XmlPullParserException e) {
             fallbackToSingleUserLP();
         } finally {
@@ -1803,8 +1843,9 @@
 
     /**
      * Upgrade steps between versions, either for fixing bugs or changing the data format.
+     * @param oldGlobalUserRestrictions Pre-O global device policy restrictions.
      */
-    private void upgradeIfNecessaryLP() {
+    private void upgradeIfNecessaryLP(Bundle oldGlobalUserRestrictions) {
         final int originalVersion = mUserVersion;
         int userVersion = mUserVersion;
         if (userVersion < 1) {
@@ -1855,6 +1896,23 @@
             userVersion = 6;
         }
 
+        if (userVersion < 7) {
+            // Previously only one user could enforce global restrictions, now it is per-user.
+            synchronized (mRestrictionsLock) {
+                if (!UserRestrictionsUtils.isEmpty(oldGlobalUserRestrictions)
+                        && mDeviceOwnerUserId != UserHandle.USER_NULL) {
+                    mDevicePolicyGlobalUserRestrictions.put(
+                            mDeviceOwnerUserId, oldGlobalUserRestrictions);
+                }
+                // ENSURE_VERIFY_APPS is now enforced globally even if put by profile owner, so move
+                // it from local to global bundle for all users who set it.
+                UserRestrictionsUtils.moveRestriction(UserManager.ENSURE_VERIFY_APPS,
+                        mDevicePolicyLocalUserRestrictions, mDevicePolicyGlobalUserRestrictions
+                );
+            }
+            userVersion = 7;
+        }
+
         if (userVersion < USER_VERSION) {
             Slog.w(LOG_TAG, "User version " + mUserVersion + " didn't upgrade as expected to "
                     + USER_VERSION);
@@ -1893,8 +1951,10 @@
             Log.e(LOG_TAG, "Couldn't find resource: config_defaultFirstUserRestrictions", e);
         }
 
-        synchronized (mRestrictionsLock) {
-            mBaseUserRestrictions.append(UserHandle.USER_SYSTEM, restrictions);
+        if (!restrictions.isEmpty()) {
+            synchronized (mRestrictionsLock) {
+                mBaseUserRestrictions.append(UserHandle.USER_SYSTEM, restrictions);
+            }
         }
 
         updateUserIds();
@@ -2004,6 +2064,9 @@
             UserRestrictionsUtils.writeRestrictions(serializer,
                     mDevicePolicyLocalUserRestrictions.get(userInfo.id),
                     TAG_DEVICE_POLICY_RESTRICTIONS);
+            UserRestrictionsUtils.writeRestrictions(serializer,
+                    mDevicePolicyGlobalUserRestrictions.get(userInfo.id),
+                    TAG_DEVICE_POLICY_GLOBAL_RESTRICTIONS);
         }
 
         if (userData.account != null) {
@@ -2057,13 +2120,9 @@
                         .writeRestrictions(serializer, mGuestRestrictions, TAG_RESTRICTIONS);
             }
             serializer.endTag(null, TAG_GUEST_RESTRICTIONS);
-            synchronized (mRestrictionsLock) {
-                UserRestrictionsUtils.writeRestrictions(serializer,
-                        mDevicePolicyGlobalUserRestrictions, TAG_DEVICE_POLICY_RESTRICTIONS);
-            }
-            serializer.startTag(null, TAG_GLOBAL_RESTRICTION_OWNER_ID);
-            serializer.attribute(null, ATTR_ID, Integer.toString(mGlobalRestrictionOwnerUserId));
-            serializer.endTag(null, TAG_GLOBAL_RESTRICTION_OWNER_ID);
+            serializer.startTag(null, TAG_DEVICE_OWNER_USER_ID);
+            serializer.attribute(null, ATTR_ID, Integer.toString(mDeviceOwnerUserId));
+            serializer.endTag(null, TAG_DEVICE_OWNER_USER_ID);
             int[] userIdsToWrite;
             synchronized (mUsersLock) {
                 userIdsToWrite = new int[mUsers.size()];
@@ -2125,8 +2184,9 @@
         String seedAccountName = null;
         String seedAccountType = null;
         PersistableBundle seedAccountOptions = null;
-        Bundle baseRestrictions = new Bundle();
-        Bundle localRestrictions = new Bundle();
+        Bundle baseRestrictions = null;
+        Bundle localRestrictions = null;
+        Bundle globalRestrictions = null;
 
         XmlPullParser parser = Xml.newPullParser();
         parser.setInput(is, StandardCharsets.UTF_8.name());
@@ -2187,9 +2247,11 @@
                         name = parser.getText();
                     }
                 } else if (TAG_RESTRICTIONS.equals(tag)) {
-                    UserRestrictionsUtils.readRestrictions(parser, baseRestrictions);
+                    baseRestrictions = UserRestrictionsUtils.readRestrictions(parser);
                 } else if (TAG_DEVICE_POLICY_RESTRICTIONS.equals(tag)) {
-                    UserRestrictionsUtils.readRestrictions(parser, localRestrictions);
+                    localRestrictions = UserRestrictionsUtils.readRestrictions(parser);
+                } else if (TAG_DEVICE_POLICY_GLOBAL_RESTRICTIONS.equals(tag)) {
+                    globalRestrictions = UserRestrictionsUtils.readRestrictions(parser);
                 } else if (TAG_ACCOUNT.equals(tag)) {
                     type = parser.next();
                     if (type == XmlPullParser.TEXT) {
@@ -2224,8 +2286,15 @@
         userData.seedAccountOptions = seedAccountOptions;
 
         synchronized (mRestrictionsLock) {
-            mBaseUserRestrictions.put(id, baseRestrictions);
-            mDevicePolicyLocalUserRestrictions.put(id, localRestrictions);
+            if (baseRestrictions != null) {
+                mBaseUserRestrictions.put(id, baseRestrictions);
+            }
+            if (localRestrictions != null) {
+                mDevicePolicyLocalUserRestrictions.put(id, localRestrictions);
+            }
+            if (globalRestrictions != null) {
+                mDevicePolicyGlobalUserRestrictions.put(id, globalRestrictions);
+            }
         }
         return userData;
     }
@@ -2731,6 +2800,10 @@
             mAppliedUserRestrictions.remove(userHandle);
             mCachedEffectiveUserRestrictions.remove(userHandle);
             mDevicePolicyLocalUserRestrictions.remove(userHandle);
+            if (mDevicePolicyGlobalUserRestrictions.get(userHandle) != null) {
+                mDevicePolicyGlobalUserRestrictions.remove(userHandle);
+                applyUserRestrictionsForAllUsersLR();
+            }
         }
         // Update the user list
         synchronized (mPackagesLock) {
@@ -3420,6 +3493,9 @@
                     synchronized (mRestrictionsLock) {
                         UserRestrictionsUtils.dumpRestrictions(
                                 pw, "      ", mBaseUserRestrictions.get(userInfo.id));
+                        pw.println("    Device policy global restrictions:");
+                        UserRestrictionsUtils.dumpRestrictions(
+                                pw, "      ", mDevicePolicyGlobalUserRestrictions.get(userInfo.id));
                         pw.println("    Device policy local restrictions:");
                         UserRestrictionsUtils.dumpRestrictions(
                                 pw, "      ", mDevicePolicyLocalUserRestrictions.get(userInfo.id));
@@ -3448,13 +3524,7 @@
                 }
             }
             pw.println();
-            pw.println("  Device policy global restrictions:");
-            synchronized (mRestrictionsLock) {
-                UserRestrictionsUtils
-                        .dumpRestrictions(pw, "    ", mDevicePolicyGlobalUserRestrictions);
-            }
-            pw.println();
-            pw.println("  Global restrictions owner id:" + mGlobalRestrictionOwnerUserId);
+            pw.println("  Device owner id:" + mDeviceOwnerUserId);
             pw.println();
             pw.println("  Guest restrictions:");
             synchronized (mGuestRestrictions) {
@@ -3508,10 +3578,10 @@
 
     private class LocalService extends UserManagerInternal {
         @Override
-        public void setDevicePolicyUserRestrictions(int userId, @NonNull Bundle localRestrictions,
-                @Nullable Bundle globalRestrictions) {
-            UserManagerService.this.setDevicePolicyUserRestrictionsInner(userId, localRestrictions,
-                    globalRestrictions);
+        public void setDevicePolicyUserRestrictions(int userId, @Nullable Bundle restrictions,
+                boolean isDeviceOwner, int cameraRestrictionScope) {
+            UserManagerService.this.setDevicePolicyUserRestrictionsInner(userId, restrictions,
+                isDeviceOwner, cameraRestrictionScope);
         }
 
         @Override
@@ -3525,8 +3595,10 @@
         public void setBaseUserRestrictionsByDpmsForMigration(
                 int userId, Bundle baseRestrictions) {
             synchronized (mRestrictionsLock) {
-                mBaseUserRestrictions.put(userId, new Bundle(baseRestrictions));
-                invalidateEffectiveUserRestrictionsLR(userId);
+                if (updateRestrictionsIfNeededLR(
+                        userId, new Bundle(baseRestrictions), mBaseUserRestrictions)) {
+                    invalidateEffectiveUserRestrictionsLR(userId);
+                }
             }
 
             final UserData userData = getUserDataNoChecks(userId);
diff --git a/services/core/java/com/android/server/pm/UserRestrictionsUtils.java b/services/core/java/com/android/server/pm/UserRestrictionsUtils.java
index f5b8669..d301463 100644
--- a/services/core/java/com/android/server/pm/UserRestrictionsUtils.java
+++ b/services/core/java/com/android/server/pm/UserRestrictionsUtils.java
@@ -30,11 +30,13 @@
 import android.os.RemoteException;
 import android.os.UserHandle;
 import android.os.UserManager;
+import android.os.UserManagerInternal;
 import android.service.persistentdata.PersistentDataBlockManager;
 import android.telephony.SubscriptionInfo;
 import android.telephony.SubscriptionManager;
 import android.util.Log;
 import android.util.Slog;
+import android.util.SparseArray;
 
 import org.xmlpull.v1.XmlPullParser;
 import org.xmlpull.v1.XmlSerializer;
@@ -117,9 +119,10 @@
     );
 
     /**
-     * User restrictions that can not be set by profile owners.
+     * User restrictions that cannot be set by profile owners of secondary users. When set by DO
+     * they will be applied to all users.
      */
-    private static final Set<String> DEVICE_OWNER_ONLY_RESTRICTIONS = Sets.newArraySet(
+    private static final Set<String> PRIMARY_USER_ONLY_RESTRICTIONS = Sets.newArraySet(
             UserManager.DISALLOW_BLUETOOTH,
             UserManager.DISALLOW_USB_FILE_TRANSFER,
             UserManager.DISALLOW_CONFIG_TETHERING,
@@ -163,6 +166,13 @@
             UserManager.DISALLOW_ADD_MANAGED_PROFILE
     );
 
+    /*
+     * Special user restrictions that are always applied to all users no matter who sets them.
+     */
+    private static final Set<String> PROFILE_GLOBAL_RESTRICTIONS = Sets.newArraySet(
+            UserManager.ENSURE_VERIFY_APPS
+    );
+
     /**
      * Throws {@link IllegalArgumentException} if the given restriction name is invalid.
      */
@@ -205,6 +215,12 @@
         }
     }
 
+    public static Bundle readRestrictions(XmlPullParser parser) {
+        final Bundle result = new Bundle();
+        readRestrictions(parser, result);
+        return result;
+    }
+
     /**
      * @return {@code in} itself when it's not null, or an empty bundle (which can writable).
      */
@@ -217,6 +233,14 @@
     }
 
     /**
+     * Returns {@code true} if given bundle is not null and contains {@code true} for a given
+     * restriction.
+     */
+    public static boolean contains(@Nullable Bundle in, String restriction) {
+        return in != null && in.getBoolean(restriction);
+    }
+
+    /**
      * Creates a copy of the {@code in} Bundle.  If {@code in} is null, it'll return an empty
      * bundle.
      *
@@ -241,6 +265,22 @@
     }
 
     /**
+     * Merges a sparse array of restrictions bundles into one.
+     */
+    @Nullable
+    public static Bundle mergeAll(SparseArray<Bundle> restrictions) {
+        if (restrictions.size() == 0) {
+            return null;
+        } else {
+            final Bundle result = new Bundle();
+            for (int i = 0; i < restrictions.size(); i++) {
+                merge(result, restrictions.valueAt(i));
+            }
+            return result;
+        }
+    }
+
+    /**
      * @return true if a restriction is settable by device owner.
      */
     public static boolean canDeviceOwnerChange(String restriction) {
@@ -254,7 +294,7 @@
     public static boolean canProfileOwnerChange(String restriction, int userId) {
         return !IMMUTABLE_BY_OWNERS.contains(restriction)
                 && !(userId != UserHandle.USER_SYSTEM
-                    && DEVICE_OWNER_ONLY_RESTRICTIONS.contains(restriction));
+                    && PRIMARY_USER_ONLY_RESTRICTIONS.contains(restriction));
     }
 
     /**
@@ -269,8 +309,15 @@
      * Takes restrictions that can be set by device owner, and sort them into what should be applied
      * globally and what should be applied only on the current user.
      */
-    public static void sortToGlobalAndLocal(@Nullable Bundle in, @NonNull Bundle global,
-            @NonNull Bundle local) {
+    public static void sortToGlobalAndLocal(@Nullable Bundle in, boolean isDeviceOwner,
+            int cameraRestrictionScope,
+            @NonNull Bundle global, @NonNull Bundle local) {
+        // Camera restriction (as well as all others) goes to at most one bundle.
+        if (cameraRestrictionScope == UserManagerInternal.CAMERA_DISABLED_GLOBALLY) {
+            global.putBoolean(UserManager.DISALLOW_CAMERA, true);
+        } else if (cameraRestrictionScope == UserManagerInternal.CAMERA_DISABLED_LOCALLY) {
+            local.putBoolean(UserManager.DISALLOW_CAMERA, true);
+        }
         if (in == null || in.size() == 0) {
             return;
         }
@@ -278,7 +325,7 @@
             if (!in.getBoolean(key)) {
                 continue;
             }
-            if (DEVICE_OWNER_ONLY_RESTRICTIONS.contains(key) || GLOBAL_RESTRICTIONS.contains(key)) {
+            if (isGlobal(isDeviceOwner, key)) {
                 global.putBoolean(key, true);
             } else {
                 local.putBoolean(key, true);
@@ -287,6 +334,15 @@
     }
 
     /**
+     * Whether given user restriction should be enforced globally.
+     */
+    private static boolean isGlobal(boolean isDeviceOwner, String key) {
+        return (isDeviceOwner &&
+                (PRIMARY_USER_ONLY_RESTRICTIONS.contains(key)|| GLOBAL_RESTRICTIONS.contains(key)))
+                || PROFILE_GLOBAL_RESTRICTIONS.contains(key);
+    }
+
+    /**
      * @return true if two Bundles contain the same user restriction.
      * A null bundle and an empty bundle are considered to be equal.
      */
@@ -485,4 +541,29 @@
             pw.println(prefix + "null");
         }
     }
+
+    /**
+     * Moves a particular restriction from one array of bundles to another, e.g. for all users.
+     */
+    public static void moveRestriction(String restrictionKey, SparseArray<Bundle> srcRestrictions,
+            SparseArray<Bundle> destRestrictions) {
+        for (int i = 0; i < srcRestrictions.size(); i++) {
+            int key = srcRestrictions.keyAt(i);
+            Bundle from = srcRestrictions.valueAt(i);
+            if (contains(from, restrictionKey)) {
+                from.remove(restrictionKey);
+                Bundle to = destRestrictions.get(key);
+                if (to == null) {
+                    to = new Bundle();
+                    destRestrictions.append(key, to);
+                }
+                to.putBoolean(restrictionKey, true);
+                // Don't keep empty bundles.
+                if (from.isEmpty()) {
+                    srcRestrictions.removeAt(i);
+                    i--;
+                }
+            }
+        }
+    }
 }
diff --git a/services/core/java/com/android/server/policy/AccessibilityShortcutController.java b/services/core/java/com/android/server/policy/AccessibilityShortcutController.java
new file mode 100644
index 0000000..133881a
--- /dev/null
+++ b/services/core/java/com/android/server/policy/AccessibilityShortcutController.java
@@ -0,0 +1,219 @@
+/*
+ * Copyright (C) 2012 Google Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may not
+ * use this file except in compliance with the License. You may obtain a copy of
+ * the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations under
+ * the License.
+ */
+
+package com.android.server.policy;
+
+import android.accessibilityservice.AccessibilityServiceInfo;
+import android.app.ActivityManager;
+import android.app.AlertDialog;
+import android.content.ComponentName;
+import android.content.ContentResolver;
+import android.content.Context;
+import android.content.DialogInterface;
+import android.database.ContentObserver;
+import android.media.AudioAttributes;
+import android.media.Ringtone;
+import android.media.RingtoneManager;
+import android.os.Handler;
+import android.os.UserHandle;
+import android.provider.Settings;
+import android.text.TextUtils;
+import android.util.Slog;
+import android.view.Window;
+import android.view.WindowManager;
+import android.view.accessibility.AccessibilityManager;
+
+import android.widget.Toast;
+import com.android.internal.R;
+
+import java.util.List;
+
+import static android.view.WindowManager.LayoutParams.TYPE_KEYGUARD_DIALOG;
+
+/**
+ * Class to help manage the accessibility shortcut
+ */
+public class AccessibilityShortcutController {
+    private static final String TAG = "AccessibilityShortcutController";
+
+    private final Context mContext;
+    private AlertDialog mAlertDialog;
+    private boolean mIsShortcutEnabled;
+    // Visible for testing
+    public FrameworkObjectProvider mFrameworkObjectProvider = new FrameworkObjectProvider();
+
+    public static String getTargetServiceComponentNameString(
+            Context context, int userId) {
+        final String currentShortcutServiceId = Settings.Secure.getStringForUser(
+                context.getContentResolver(), Settings.Secure.ACCESSIBILITY_SHORTCUT_TARGET_SERVICE,
+                userId);
+        if (currentShortcutServiceId != null) {
+            return currentShortcutServiceId;
+        }
+        return context.getString(R.string.config_defaultAccessibilityService);
+    }
+
+    public AccessibilityShortcutController(Context context, Handler handler) {
+        mContext = context;
+
+        // Keep track of state of shortcut
+        mContext.getContentResolver().registerContentObserver(
+                Settings.Secure.getUriFor(Settings.Secure.ACCESSIBILITY_SHORTCUT_TARGET_SERVICE),
+                false,
+                new ContentObserver(handler) {
+                    @Override
+                    public void onChange(boolean selfChange) {
+                        onSettingsChanged();
+                    }
+                },
+                UserHandle.USER_ALL);
+        updateShortcutEnabled();
+    }
+
+    public boolean isAccessibilityShortcutAvailable() {
+        return mIsShortcutEnabled;
+    }
+
+    public void onSettingsChanged() {
+        updateShortcutEnabled();
+    }
+
+    /**
+     * Called when the accessibility shortcut is activated
+     */
+    public void performAccessibilityShortcut() {
+        Slog.d(TAG, "Accessibility shortcut activated");
+        final ContentResolver cr = mContext.getContentResolver();
+        final int userId = ActivityManager.getCurrentUser();
+        final int dialogAlreadyShown = Settings.Secure.getIntForUser(
+                cr, Settings.Secure.ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 0, userId);
+        final Ringtone tone =
+                RingtoneManager.getRingtone(mContext, Settings.System.DEFAULT_NOTIFICATION_URI);
+        if (tone != null) {
+            tone.setAudioAttributes(new AudioAttributes.Builder()
+                .setUsage(AudioAttributes.USAGE_NOTIFICATION_EVENT)
+                .build());
+            tone.play();
+        }
+        if (dialogAlreadyShown == 0) {
+            // The first time, we show a warning rather than toggle the service to give the user a
+            // chance to turn off this feature before stuff gets enabled.
+            mAlertDialog = createShortcutWarningDialog(userId);
+            if (mAlertDialog == null) {
+                return;
+            }
+            Window w = mAlertDialog.getWindow();
+            WindowManager.LayoutParams attr = w.getAttributes();
+            attr.type = TYPE_KEYGUARD_DIALOG;
+            w.setAttributes(attr);
+            mAlertDialog.show();
+            Settings.Secure.putIntForUser(
+                    cr, Settings.Secure.ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 1, userId);
+        } else {
+            if (mAlertDialog != null) {
+                mAlertDialog.dismiss();
+                mAlertDialog = null;
+            }
+
+            // Show a toast alerting the user to what's happening
+            final AccessibilityServiceInfo serviceInfo = getInfoForTargetService();
+            if (serviceInfo == null) {
+                Slog.e(TAG, "Accessibility shortcut set to invalid service");
+                return;
+            }
+            String toastMessageFormatString = mContext.getString(isServiceEnabled(serviceInfo)
+                    ? R.string.accessibility_shortcut_disabling_service
+                    : R.string.accessibility_shortcut_enabling_service);
+            String toastMessage = String.format(toastMessageFormatString,
+                    serviceInfo.getResolveInfo()
+                            .loadLabel(mContext.getPackageManager()).toString());
+            mFrameworkObjectProvider.makeToastFromText(mContext, toastMessage, Toast.LENGTH_LONG)
+                    .show();
+
+            mFrameworkObjectProvider.getAccessibilityManagerInstance(mContext)
+                    .performAccessibilityShortcut();
+        }
+    }
+
+    private void updateShortcutEnabled() {
+        mIsShortcutEnabled = !TextUtils.isEmpty(getTargetServiceComponentNameString(
+                mContext, UserHandle.myUserId()));
+    }
+
+    private AlertDialog createShortcutWarningDialog(int userId) {
+        final AccessibilityServiceInfo serviceInfo = getInfoForTargetService();
+
+        if (serviceInfo == null) {
+            return null;
+        }
+
+        final String warningMessage = String.format(
+                mContext.getString(R.string.accessibility_shortcut_toogle_warning),
+                serviceInfo.getResolveInfo().loadLabel(mContext.getPackageManager()).toString());
+        final AlertDialog alertDialog = mFrameworkObjectProvider.getAlertDialogBuilder(mContext)
+                .setTitle(R.string.accessibility_shortcut_warning_dialog_title)
+                .setMessage(warningMessage)
+                .setCancelable(false)
+                .setPositiveButton(R.string.leave_accessibility_shortcut_on, null)
+                .setNegativeButton(R.string.disable_accessibility_shortcut,
+                        (DialogInterface d, int which) -> {
+                            Settings.Secure.putStringForUser(mContext.getContentResolver(),
+                                    Settings.Secure.ACCESSIBILITY_SHORTCUT_TARGET_SERVICE, "",
+                                    userId);
+                        })
+                .setOnCancelListener((DialogInterface d) -> {
+                    // If canceled, treat as if the dialog has never been shown
+                    Settings.Secure.putIntForUser(mContext.getContentResolver(),
+                        Settings.Secure.ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 0, userId);
+                })
+                .create();
+        return alertDialog;
+    }
+
+    private AccessibilityServiceInfo getInfoForTargetService() {
+        final String currentShortcutServiceString = getTargetServiceComponentNameString(
+                mContext, UserHandle.myUserId());
+        if (currentShortcutServiceString == null) {
+            return null;
+        }
+        AccessibilityManager accessibilityManager =
+                mFrameworkObjectProvider.getAccessibilityManagerInstance(mContext);
+        return accessibilityManager.getInstalledServiceInfoWithComponentName(
+                        ComponentName.unflattenFromString(currentShortcutServiceString));
+    }
+
+    private boolean isServiceEnabled(AccessibilityServiceInfo serviceInfo) {
+        AccessibilityManager accessibilityManager =
+                mFrameworkObjectProvider.getAccessibilityManagerInstance(mContext);
+        return accessibilityManager.getEnabledAccessibilityServiceList(
+                AccessibilityServiceInfo.FEEDBACK_ALL_MASK).contains(serviceInfo);
+    }
+
+    // Class to allow mocking of static framework calls
+    public static class FrameworkObjectProvider {
+        public AccessibilityManager getAccessibilityManagerInstance(Context context) {
+            return AccessibilityManager.getInstance(context);
+        }
+
+        public AlertDialog.Builder getAlertDialogBuilder(Context context) {
+            return new AlertDialog.Builder(context);
+        }
+
+        public Toast makeToastFromText(Context context, CharSequence charSequence, int duration) {
+            return Toast.makeText(context, charSequence, duration);
+        }
+    }
+}
diff --git a/services/core/java/com/android/server/policy/EnableAccessibilityController.java b/services/core/java/com/android/server/policy/EnableAccessibilityController.java
deleted file mode 100644
index 6b203a9..0000000
--- a/services/core/java/com/android/server/policy/EnableAccessibilityController.java
+++ /dev/null
@@ -1,291 +0,0 @@
-/*
- * Copyright (C) 2012 Google Inc.
- *
- * Licensed under the Apache License, Version 2.0 (the "License"); you may not
- * use this file except in compliance with the License. You may obtain a copy of
- * the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
- * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
- * License for the specific language governing permissions and limitations under
- * the License.
- */
-
-package com.android.server.policy;
-
-import android.accessibilityservice.AccessibilityService;
-import android.accessibilityservice.AccessibilityServiceInfo;
-import android.annotation.Nullable;
-import android.app.ActivityManager;
-import android.content.ComponentName;
-import android.content.ContentResolver;
-import android.content.Context;
-import android.content.pm.ServiceInfo;
-import android.media.AudioManager;
-import android.media.Ringtone;
-import android.media.RingtoneManager;
-import android.os.Handler;
-import android.os.Message;
-import android.os.RemoteException;
-import android.os.ServiceManager;
-import android.os.UserManager;
-import android.provider.Settings;
-import android.speech.tts.TextToSpeech;
-import android.util.Log;
-import android.util.MathUtils;
-import android.view.IWindowManager;
-import android.view.MotionEvent;
-import android.view.WindowManager;
-import android.view.WindowManagerGlobal;
-import android.view.WindowManagerInternal;
-import android.view.accessibility.AccessibilityManager;
-import android.view.accessibility.IAccessibilityManager;
-
-import com.android.internal.R;
-import com.android.server.LocalServices;
-
-import java.util.ArrayList;
-import java.util.Iterator;
-import java.util.List;
-
-public class EnableAccessibilityController {
-    private static final String TAG = "EnableAccessibilityController";
-
-    private static final int SPEAK_WARNING_DELAY_MILLIS = 2000;
-    private static final int ENABLE_ACCESSIBILITY_DELAY_MILLIS = 6000;
-
-    public static final int MESSAGE_SPEAK_WARNING = 1;
-    public static final int MESSAGE_SPEAK_ENABLE_CANCELED = 2;
-    public static final int MESSAGE_ENABLE_ACCESSIBILITY = 3;
-
-    private final Handler mHandler = new Handler() {
-        @Override
-        public void handleMessage(Message message) {
-            switch (message.what) {
-                case MESSAGE_SPEAK_WARNING: {
-                    String text = mContext.getString(R.string.continue_to_enable_accessibility);
-                    mTts.speak(text, TextToSpeech.QUEUE_FLUSH, null);
-                } break;
-                case MESSAGE_SPEAK_ENABLE_CANCELED: {
-                    String text = mContext.getString(R.string.enable_accessibility_canceled);
-                    mTts.speak(text, TextToSpeech.QUEUE_FLUSH, null);
-                } break;
-                case MESSAGE_ENABLE_ACCESSIBILITY: {
-                    enableAccessibility();
-                    mTone.play();
-                    mTts.speak(mContext.getString(R.string.accessibility_enabled),
-                            TextToSpeech.QUEUE_FLUSH, null);
-                } break;
-            }
-        }
-    };
-
-    private final IAccessibilityManager mAccessibilityManager = IAccessibilityManager
-            .Stub.asInterface(ServiceManager.getService("accessibility"));
-
-
-    private final Context mContext;
-    private final Runnable mOnAccessibilityEnabledCallback;
-    private final UserManager mUserManager;
-    private final TextToSpeech mTts;
-    private final Ringtone mTone;
-
-    private final float mTouchSlop;
-
-    private boolean mDestroyed;
-    private boolean mCanceled;
-
-    private float mFirstPointerDownX;
-    private float mFirstPointerDownY;
-    private float mSecondPointerDownX;
-    private float mSecondPointerDownY;
-
-    public EnableAccessibilityController(Context context, Runnable onAccessibilityEnabledCallback) {
-        mContext = context;
-        mOnAccessibilityEnabledCallback = onAccessibilityEnabledCallback;
-        mUserManager = (UserManager) mContext.getSystemService(Context.USER_SERVICE);
-        mTts = new TextToSpeech(context, new TextToSpeech.OnInitListener() {
-            @Override
-            public void onInit(int status) {
-                if (mDestroyed) {
-                    mTts.shutdown();
-                }
-            }
-        });
-        mTone = RingtoneManager.getRingtone(context, Settings.System.DEFAULT_NOTIFICATION_URI);
-        mTone.setStreamType(AudioManager.STREAM_MUSIC);
-        mTouchSlop = context.getResources().getDimensionPixelSize(
-                R.dimen.accessibility_touch_slop);
-    }
-
-    public static boolean canEnableAccessibilityViaGesture(Context context) {
-        AccessibilityManager accessibilityManager = AccessibilityManager.getInstance(context);
-        // Accessibility is enabled and there is an enabled speaking
-        // accessibility service, then we have nothing to do.
-        if (accessibilityManager.isEnabled()
-                && !accessibilityManager.getEnabledAccessibilityServiceList(
-                        AccessibilityServiceInfo.FEEDBACK_SPOKEN).isEmpty()) {
-            return false;
-        }
-        // If the global gesture is enabled and there is a speaking service
-        // installed we are good to go, otherwise there is nothing to do.
-        return Settings.Global.getInt(context.getContentResolver(),
-                Settings.Global.ENABLE_ACCESSIBILITY_GLOBAL_GESTURE_ENABLED, 0) == 1
-                && !getInstalledSpeakingAccessibilityServices(context).isEmpty();
-    }
-
-    public static List<AccessibilityServiceInfo> getInstalledSpeakingAccessibilityServices(
-            Context context) {
-        List<AccessibilityServiceInfo> services = new ArrayList<AccessibilityServiceInfo>();
-        services.addAll(AccessibilityManager.getInstance(context)
-                .getInstalledAccessibilityServiceList());
-        Iterator<AccessibilityServiceInfo> iterator = services.iterator();
-        while (iterator.hasNext()) {
-            AccessibilityServiceInfo service = iterator.next();
-            if ((service.feedbackType & AccessibilityServiceInfo.FEEDBACK_SPOKEN) == 0) {
-                iterator.remove();
-            }
-        }
-        return services;
-    }
-
-    public void onDestroy() {
-        mDestroyed = true;
-    }
-
-    public boolean onInterceptTouchEvent(MotionEvent event) {
-        if (event.getActionMasked() == MotionEvent.ACTION_POINTER_DOWN
-                && event.getPointerCount() == 2) {
-            mFirstPointerDownX = event.getX(0);
-            mFirstPointerDownY = event.getY(0);
-            mSecondPointerDownX = event.getX(1);
-            mSecondPointerDownY = event.getY(1);
-            mHandler.sendEmptyMessageDelayed(MESSAGE_SPEAK_WARNING,
-                    SPEAK_WARNING_DELAY_MILLIS);
-            mHandler.sendEmptyMessageDelayed(MESSAGE_ENABLE_ACCESSIBILITY,
-                   ENABLE_ACCESSIBILITY_DELAY_MILLIS);
-            return true;
-        }
-        return false;
-    }
-
-    public boolean onTouchEvent(MotionEvent event) {
-        final int pointerCount = event.getPointerCount();
-        final int action = event.getActionMasked();
-        if (mCanceled) {
-            if (action == MotionEvent.ACTION_UP) {
-                mCanceled = false;
-            }
-            return true;
-        }
-        switch (action) {
-            case MotionEvent.ACTION_POINTER_DOWN: {
-                if (pointerCount > 2) {
-                    cancel();
-                }
-            } break;
-            case MotionEvent.ACTION_MOVE: {
-                final float firstPointerMove = MathUtils.dist(event.getX(0),
-                        event.getY(0), mFirstPointerDownX, mFirstPointerDownY);
-                if (Math.abs(firstPointerMove) > mTouchSlop) {
-                    cancel();
-                }
-                final float secondPointerMove = MathUtils.dist(event.getX(1),
-                        event.getY(1), mSecondPointerDownX, mSecondPointerDownY);
-                if (Math.abs(secondPointerMove) > mTouchSlop) {
-                    cancel();
-                }
-            } break;
-            case MotionEvent.ACTION_POINTER_UP:
-            case MotionEvent.ACTION_CANCEL: {
-                cancel();
-            } break;
-        }
-        return true;
-    }
-
-    private void cancel() {
-        mCanceled = true;
-        if (mHandler.hasMessages(MESSAGE_SPEAK_WARNING)) {
-            mHandler.removeMessages(MESSAGE_SPEAK_WARNING);
-        } else if (mHandler.hasMessages(MESSAGE_ENABLE_ACCESSIBILITY)) {
-            mHandler.sendEmptyMessage(MESSAGE_SPEAK_ENABLE_CANCELED);
-        }
-        mHandler.removeMessages(MESSAGE_ENABLE_ACCESSIBILITY);
-    }
-
-    private void enableAccessibility() {
-        if (enableAccessibility(mContext)) {
-            mOnAccessibilityEnabledCallback.run();
-        }
-    }
-
-    public static boolean enableAccessibility(Context context) {
-        final IAccessibilityManager accessibilityManager = IAccessibilityManager
-                .Stub.asInterface(ServiceManager.getService("accessibility"));
-        final WindowManagerInternal windowManager = LocalServices.getService(
-                WindowManagerInternal.class);
-        final UserManager userManager = (UserManager) context.getSystemService(
-                Context.USER_SERVICE);
-        ComponentName componentName = getInstalledSpeakingAccessibilityServiceComponent(context);
-        if (componentName == null) {
-            return false;
-        }
-
-        boolean keyguardLocked = windowManager.isKeyguardLocked();
-        final boolean hasMoreThanOneUser = userManager.getUsers().size() > 1;
-        try {
-            if (!keyguardLocked || !hasMoreThanOneUser) {
-                final int userId = ActivityManager.getCurrentUser();
-                accessibilityManager.enableAccessibilityService(componentName, userId);
-            } else if (keyguardLocked) {
-                accessibilityManager.temporaryEnableAccessibilityStateUntilKeyguardRemoved(
-                        componentName, true /* enableTouchExploration */);
-            }
-        } catch (RemoteException e) {
-            Log.e(TAG, "cannot enable accessibilty: " + e);
-        }
-
-        return true;
-    }
-
-    public static void disableAccessibility(Context context) {
-        final IAccessibilityManager accessibilityManager = IAccessibilityManager
-                .Stub.asInterface(ServiceManager.getService("accessibility"));
-        ComponentName componentName = getInstalledSpeakingAccessibilityServiceComponent(context);
-        if (componentName == null) {
-            return;
-        }
-
-        final int userId = ActivityManager.getCurrentUser();
-        try {
-            accessibilityManager.disableAccessibilityService(componentName, userId);
-        } catch (RemoteException e) {
-            Log.e(TAG, "cannot disable accessibility " + e);
-        }
-    }
-
-    public static boolean isAccessibilityEnabled(Context context) {
-        final AccessibilityManager accessibilityManager =
-                context.getSystemService(AccessibilityManager.class);
-        List enabledServices = accessibilityManager.getEnabledAccessibilityServiceList(
-                AccessibilityServiceInfo.FEEDBACK_SPOKEN);
-        return enabledServices != null && !enabledServices.isEmpty();
-    }
-
-    @Nullable
-    public static ComponentName getInstalledSpeakingAccessibilityServiceComponent(
-            Context context) {
-        List<AccessibilityServiceInfo> services =
-                getInstalledSpeakingAccessibilityServices(context);
-        if (services.isEmpty()) {
-            return null;
-        }
-
-        ServiceInfo serviceInfo = services.get(0).getResolveInfo().serviceInfo;
-        return new ComponentName(serviceInfo.packageName, serviceInfo.name);
-    }
-}
diff --git a/services/core/java/com/android/server/policy/GlobalActions.java b/services/core/java/com/android/server/policy/GlobalActions.java
index d4adcc4..335a230 100644
--- a/services/core/java/com/android/server/policy/GlobalActions.java
+++ b/services/core/java/com/android/server/policy/GlobalActions.java
@@ -44,7 +44,6 @@
 import android.os.Message;
 import android.os.RemoteException;
 import android.os.ServiceManager;
-import android.os.SystemClock;
 import android.os.SystemProperties;
 import android.os.UserHandle;
 import android.os.UserManager;
@@ -59,12 +58,9 @@
 import android.util.ArraySet;
 import android.util.Log;
 import android.util.TypedValue;
-import android.view.InputDevice;
 import android.view.KeyEvent;
 import android.view.LayoutInflater;
-import android.view.MotionEvent;
 import android.view.View;
-import android.view.ViewConfiguration;
 import android.view.ViewGroup;
 import android.view.WindowManager;
 import android.view.WindowManagerGlobal;
@@ -1194,21 +1190,14 @@
 
     private static final class GlobalActionsDialog extends Dialog implements DialogInterface {
         private final Context mContext;
-        private final int mWindowTouchSlop;
         private final AlertController mAlert;
         private final MyAdapter mAdapter;
 
-        private EnableAccessibilityController mEnableAccessibilityController;
-
-        private boolean mIntercepted;
-        private boolean mCancelOnUp;
-
         public GlobalActionsDialog(Context context, AlertParams params) {
             super(context, getDialogTheme(context));
             mContext = getContext();
             mAlert = AlertController.create(mContext, this, getWindow());
             mAdapter = (MyAdapter) params.mAdapter;
-            mWindowTouchSlop = ViewConfiguration.get(context).getScaledWindowTouchSlop();
             params.apply(mAlert);
         }
 
@@ -1221,76 +1210,10 @@
 
         @Override
         protected void onStart() {
-            // If global accessibility gesture can be performed, we will take care
-            // of dismissing the dialog on touch outside. This is because the dialog
-            // is dismissed on the first down while the global gesture is a long press
-            // with two fingers anywhere on the screen.
-            if (EnableAccessibilityController.canEnableAccessibilityViaGesture(mContext)) {
-                mEnableAccessibilityController = new EnableAccessibilityController(mContext,
-                        new Runnable() {
-                    @Override
-                    public void run() {
-                        dismiss();
-                    }
-                });
-                super.setCanceledOnTouchOutside(false);
-            } else {
-                mEnableAccessibilityController = null;
-                super.setCanceledOnTouchOutside(true);
-            }
-
+            super.setCanceledOnTouchOutside(true);
             super.onStart();
         }
 
-        @Override
-        protected void onStop() {
-            if (mEnableAccessibilityController != null) {
-                mEnableAccessibilityController.onDestroy();
-            }
-            super.onStop();
-        }
-
-        @Override
-        public boolean dispatchTouchEvent(MotionEvent event) {
-            if (mEnableAccessibilityController != null) {
-                final int action = event.getActionMasked();
-                if (action == MotionEvent.ACTION_DOWN) {
-                    View decor = getWindow().getDecorView();
-                    final int eventX = (int) event.getX();
-                    final int eventY = (int) event.getY();
-                    if (eventX < -mWindowTouchSlop
-                            || eventY < -mWindowTouchSlop
-                            || eventX >= decor.getWidth() + mWindowTouchSlop
-                            || eventY >= decor.getHeight() + mWindowTouchSlop) {
-                        mCancelOnUp = true;
-                    }
-                }
-                try {
-                    if (!mIntercepted) {
-                        mIntercepted = mEnableAccessibilityController.onInterceptTouchEvent(event);
-                        if (mIntercepted) {
-                            final long now = SystemClock.uptimeMillis();
-                            event = MotionEvent.obtain(now, now,
-                                    MotionEvent.ACTION_CANCEL, 0.0f, 0.0f, 0);
-                            event.setSource(InputDevice.SOURCE_TOUCHSCREEN);
-                            mCancelOnUp = true;
-                        }
-                    } else {
-                        return mEnableAccessibilityController.onTouchEvent(event);
-                    }
-                } finally {
-                    if (action == MotionEvent.ACTION_UP) {
-                        if (mCancelOnUp) {
-                            cancel();
-                        }
-                        mCancelOnUp = false;
-                        mIntercepted = false;
-                    }
-                }
-            }
-            return super.dispatchTouchEvent(event);
-        }
-
         public ListView getListView() {
             return mAlert.getListView();
         }
diff --git a/services/core/java/com/android/server/policy/PhoneWindowManager.java b/services/core/java/com/android/server/policy/PhoneWindowManager.java
index 4b2b184..32b8c9b 100644
--- a/services/core/java/com/android/server/policy/PhoneWindowManager.java
+++ b/services/core/java/com/android/server/policy/PhoneWindowManager.java
@@ -149,8 +149,6 @@
 import android.media.AudioManager;
 import android.media.AudioSystem;
 import android.media.IAudioService;
-import android.media.Ringtone;
-import android.media.RingtoneManager;
 import android.media.session.MediaSessionLegacyHelper;
 import android.os.Binder;
 import android.os.Build;
@@ -441,6 +439,9 @@
     /** If true, hitting shift & menu will broadcast Intent.ACTION_BUG_REPORT */
     boolean mEnableShiftMenuBugReports = false;
 
+    /** Controller that supports enabling an AccessibilityService by holding down the volume keys */
+    private AccessibilityShortcutController mAccessibilityShortcutController;
+
     boolean mSafeMode;
     WindowState mStatusBar = null;
     int mStatusBarHeight;
@@ -748,7 +749,10 @@
     private boolean mScreenshotChordVolumeDownKeyTriggered;
     private long mScreenshotChordVolumeDownKeyTime;
     private boolean mScreenshotChordVolumeDownKeyConsumed;
-    private boolean mScreenshotChordVolumeUpKeyTriggered;
+    private boolean mA11yShortcutChordVolumeUpKeyTriggered;
+    private long mA11yShortcutChordVolumeUpKeyTime;
+    private boolean mA11yShortcutChordVolumeUpKeyConsumed;
+
     private boolean mScreenshotChordPowerKeyTriggered;
     private long mScreenshotChordPowerKeyTime;
 
@@ -794,6 +798,7 @@
     private static final int MSG_BACK_LONG_PRESS = 18;
     private static final int MSG_DISPOSE_INPUT_CONSUMER = 19;
     private static final int MSG_BACK_DELAYED_PRESS = 20;
+    private static final int MSG_ACCESSIBILITY_SHORTCUT = 21;
 
     private static final int MSG_REQUEST_TRANSIENT_BARS_ARG_STATUS = 0;
     private static final int MSG_REQUEST_TRANSIENT_BARS_ARG_NAVIGATION = 1;
@@ -869,6 +874,9 @@
                     backMultiPressAction((Long) msg.obj, msg.arg1);
                     finishBackKeyPress();
                     break;
+                case MSG_ACCESSIBILITY_SHORTCUT:
+                    accessibilityShortcutActivated();
+                    break;
             }
         }
     }
@@ -1213,7 +1221,7 @@
         // If the power key has still not yet been handled, then detect short
         // press, long press, or multi press and decide what to do.
         mPowerKeyHandled = hungUp || mScreenshotChordVolumeDownKeyTriggered
-                || mScreenshotChordVolumeUpKeyTriggered || gesturedServiceIntercepted;
+                || mA11yShortcutChordVolumeUpKeyTriggered || gesturedServiceIntercepted;
         if (!mPowerKeyHandled) {
             if (interactive) {
                 // When interactive, we're already awake.
@@ -1406,9 +1414,7 @@
             break;
         case LONG_PRESS_POWER_GLOBAL_ACTIONS:
             mPowerKeyHandled = true;
-            if (!performHapticFeedbackLw(null, HapticFeedbackConstants.LONG_PRESS, false)) {
-                performAuditoryFeedbackForAccessibilityIfNeed();
-            }
+            performHapticFeedbackLw(null, HapticFeedbackConstants.LONG_PRESS, false);
             showGlobalActionsInternal();
             break;
         case LONG_PRESS_POWER_SHUT_OFF:
@@ -1439,6 +1445,10 @@
         }
     }
 
+    private void accessibilityShortcutActivated() {
+        mAccessibilityShortcutController.performAccessibilityShortcut();
+    }
+
     private void disposeInputConsumer(InputConsumer inputConsumer) {
         if (inputConsumer != null) {
             inputConsumer.dismiss();
@@ -1484,7 +1494,7 @@
     private void interceptScreenshotChord() {
         if (mScreenshotChordEnabled
                 && mScreenshotChordVolumeDownKeyTriggered && mScreenshotChordPowerKeyTriggered
-                && !mScreenshotChordVolumeUpKeyTriggered) {
+                && !mA11yShortcutChordVolumeUpKeyTriggered) {
             final long now = SystemClock.uptimeMillis();
             if (now <= mScreenshotChordVolumeDownKeyTime + SCREENSHOT_CHORD_DEBOUNCE_DELAY_MILLIS
                     && now <= mScreenshotChordPowerKeyTime
@@ -1497,6 +1507,22 @@
         }
     }
 
+    private void interceptAccessibilityShortcutChord() {
+        if (mAccessibilityShortcutController.isAccessibilityShortcutAvailable()
+                && mScreenshotChordVolumeDownKeyTriggered && mA11yShortcutChordVolumeUpKeyTriggered
+                && !mScreenshotChordPowerKeyTriggered) {
+            final long now = SystemClock.uptimeMillis();
+            if (now <= mScreenshotChordVolumeDownKeyTime + SCREENSHOT_CHORD_DEBOUNCE_DELAY_MILLIS
+                    && now <= mA11yShortcutChordVolumeUpKeyTime
+                    + SCREENSHOT_CHORD_DEBOUNCE_DELAY_MILLIS) {
+                mScreenshotChordVolumeDownKeyConsumed = true;
+                mA11yShortcutChordVolumeUpKeyConsumed = true;
+                mHandler.sendMessageDelayed(mHandler.obtainMessage(MSG_ACCESSIBILITY_SHORTCUT),
+                        ViewConfiguration.get(mContext).getAccessibilityShortcutKeyTimeout());
+            }
+        }
+    }
+
     private long getScreenshotChordLongPressDelay() {
         if (mKeyguardDelegate.isShowing()) {
             // Double the time it takes to take a screenshot from the keyguard
@@ -1510,13 +1536,15 @@
         mHandler.removeCallbacks(mScreenshotRunnable);
     }
 
+    private void cancelPendingAccessibilityShortcutAction() {
+        mHandler.removeMessages(MSG_ACCESSIBILITY_SHORTCUT);
+    }
+
     private final Runnable mEndCallLongPress = new Runnable() {
         @Override
         public void run() {
             mEndCallKeyHandled = true;
-            if (!performHapticFeedbackLw(null, HapticFeedbackConstants.LONG_PRESS, false)) {
-                performAuditoryFeedbackForAccessibilityIfNeed();
-            }
+            performHapticFeedbackLw(null, HapticFeedbackConstants.LONG_PRESS, false);
             showGlobalActionsInternal();
         }
     };
@@ -1698,7 +1726,8 @@
         mPowerManagerInternal = LocalServices.getService(PowerManagerInternal.class);
         mAppOpsManager = (AppOpsManager) mContext.getSystemService(Context.APP_OPS_SERVICE);
         mHasFeatureWatch = mContext.getPackageManager().hasSystemFeature(FEATURE_WATCH);
-
+        mAccessibilityShortcutController =
+                new AccessibilityShortcutController(mContext, new Handler());
         // Init display burn-in protection
         boolean burnInProtectionEnabled = context.getResources().getBoolean(
                 com.android.internal.R.bool.config_enableBurnInProtection);
@@ -3251,6 +3280,33 @@
             }
         }
 
+        // If an accessibility shortcut might be partially complete, hold off dispatching until we
+        // know if it is complete or not
+        if (mAccessibilityShortcutController.isAccessibilityShortcutAvailable()
+                && (flags & KeyEvent.FLAG_FALLBACK) == 0) {
+            if (mScreenshotChordVolumeDownKeyTriggered ^ mA11yShortcutChordVolumeUpKeyTriggered) {
+                final long now = SystemClock.uptimeMillis();
+                final long timeoutTime = (mScreenshotChordVolumeDownKeyTriggered
+                        ? mScreenshotChordVolumeDownKeyTime : mA11yShortcutChordVolumeUpKeyTime)
+                        + SCREENSHOT_CHORD_DEBOUNCE_DELAY_MILLIS;
+                if (now < timeoutTime) {
+                    return timeoutTime - now;
+                }
+            }
+            if (keyCode == KeyEvent.KEYCODE_VOLUME_DOWN && mScreenshotChordVolumeDownKeyConsumed) {
+                if (!down) {
+                    mScreenshotChordVolumeDownKeyConsumed = false;
+                }
+                return -1;
+            }
+            if (keyCode == KeyEvent.KEYCODE_VOLUME_UP && mA11yShortcutChordVolumeUpKeyConsumed) {
+                if (!down) {
+                    mA11yShortcutChordVolumeUpKeyConsumed = false;
+                }
+                return -1;
+            }
+        }
+
         // Cancel any pending meta actions if we see any other keys being pressed between the down
         // of the meta key and its corresponding up.
         if (mPendingMetaAction && !KeyEvent.isMetaKey(keyCode)) {
@@ -5760,22 +5816,32 @@
                             mScreenshotChordVolumeDownKeyConsumed = false;
                             cancelPendingPowerKeyAction();
                             interceptScreenshotChord();
+                            if (!keyguardActive) {
+                                interceptAccessibilityShortcutChord();
+                            }
                         }
                     } else {
                         mScreenshotChordVolumeDownKeyTriggered = false;
                         cancelPendingScreenshotChordAction();
+                        cancelPendingAccessibilityShortcutAction();
                     }
                 } else if (keyCode == KeyEvent.KEYCODE_VOLUME_UP) {
                     if (down) {
-                        if (interactive && !mScreenshotChordVolumeUpKeyTriggered
+                        if (interactive && !mA11yShortcutChordVolumeUpKeyTriggered
                                 && (event.getFlags() & KeyEvent.FLAG_FALLBACK) == 0) {
-                            mScreenshotChordVolumeUpKeyTriggered = true;
+                            mA11yShortcutChordVolumeUpKeyTriggered = true;
+                            mA11yShortcutChordVolumeUpKeyTime = event.getDownTime();
+                            mA11yShortcutChordVolumeUpKeyConsumed = false;
                             cancelPendingPowerKeyAction();
                             cancelPendingScreenshotChordAction();
+                            if (!keyguardActive) {
+                                interceptAccessibilityShortcutChord();
+                            }
                         }
                     } else {
-                        mScreenshotChordVolumeUpKeyTriggered = false;
+                        mA11yShortcutChordVolumeUpKeyTriggered = false;
                         cancelPendingScreenshotChordAction();
+                        cancelPendingAccessibilityShortcutAction();
                     }
                 }
                 if (down) {
@@ -5863,6 +5929,8 @@
             }
 
             case KeyEvent.KEYCODE_POWER: {
+                // Any activity on the power button stops the accessibility shortcut
+                cancelPendingAccessibilityShortcutAction();
                 result &= ~ACTION_PASS_TO_USER;
                 isWakeKey = false; // wake-up will be handled separately
                 if (down) {
@@ -7416,31 +7484,11 @@
         }
     }
 
-    private void performAuditoryFeedbackForAccessibilityIfNeed() {
-        if (!isGlobalAccessibilityGestureEnabled()) {
-            return;
-        }
-        AudioManager audioManager = (AudioManager) mContext.getSystemService(
-                Context.AUDIO_SERVICE);
-        if (audioManager.isSilentMode()) {
-            return;
-        }
-        Ringtone ringTone = RingtoneManager.getRingtone(mContext,
-                Settings.System.DEFAULT_NOTIFICATION_URI);
-        ringTone.setStreamType(AudioManager.STREAM_MUSIC);
-        ringTone.play();
-    }
-
     private boolean isTheaterModeEnabled() {
         return Settings.Global.getInt(mContext.getContentResolver(),
                 Settings.Global.THEATER_MODE_ON, 0) == 1;
     }
 
-    private boolean isGlobalAccessibilityGestureEnabled() {
-        return Settings.Global.getInt(mContext.getContentResolver(),
-                Settings.Global.ENABLE_ACCESSIBILITY_GLOBAL_GESTURE_ENABLED, 0) == 1;
-    }
-
     private boolean areSystemNavigationKeysEnabled() {
         return Settings.Secure.getIntForUser(mContext.getContentResolver(),
                 Settings.Secure.SYSTEM_NAVIGATION_KEYS_ENABLED, 0, UserHandle.USER_CURRENT) == 1;
diff --git a/services/core/java/com/android/server/storage/AppFuseBridge.java b/services/core/java/com/android/server/storage/AppFuseBridge.java
index 23be9a3..5a1f473 100644
--- a/services/core/java/com/android/server/storage/AppFuseBridge.java
+++ b/services/core/java/com/android/server/storage/AppFuseBridge.java
@@ -16,79 +16,95 @@
 
 package com.android.server.storage;
 
-import android.annotation.CallSuper;
-import android.annotation.WorkerThread;
-import android.os.Handler;
 import android.os.ParcelFileDescriptor;
 import android.system.ErrnoException;
 import android.system.Os;
-import android.system.OsConstants;
-import android.util.Log;
-import com.android.internal.os.AppFuseMount;
+import com.android.internal.util.Preconditions;
 import libcore.io.IoUtils;
-
 import java.io.File;
-import java.io.FileDescriptor;
 import java.io.FileNotFoundException;
-import java.io.IOException;
-import java.util.concurrent.CountDownLatch;
+import java.util.concurrent.BlockingQueue;
 
-public class AppFuseBridge implements Runnable {
-    private static final String TAG = AppFuseBridge.class.getSimpleName();
-
-    private final FileDescriptor mDeviceFd;
-    private final FileDescriptor mProxyFd;
-    private final CountDownLatch mMountLatch = new CountDownLatch(1);
+/**
+ * Runnable that delegates FUSE command from the kernel to application.
+ * run() blocks until all opened files on the FUSE mount point are closed. So this should be run in
+ * a separated thread.
+ */
+public class AppFuseBridge implements Runnable, AutoCloseable {
+    public static final String TAG = "AppFuseBridge";
 
     /**
-     * @param deviceFd FD of /dev/fuse. Ownership of fd is taken by AppFuseBridge.
-     * @param proxyFd FD of socket pair. Ownership of fd is taken by AppFuseBridge.
+     * The path AppFuse is mounted to.
+     * The first number is UID who is mounting the FUSE.
+     * THe second number is mount ID.
+     * The path must be sync with vold.
      */
-    private AppFuseBridge(FileDescriptor deviceFd, FileDescriptor proxyFd) {
-        mDeviceFd = deviceFd;
+    private static final String APPFUSE_MOUNT_NAME_TEMPLATE = "/mnt/appfuse/%d_%d";
+
+    private final IMountScope mMountScope;
+    private final ParcelFileDescriptor mProxyFd;
+    private final BlockingQueue<Boolean> mChannel;
+
+    /**
+     * @param mountScope Listener to unmount mount point.
+     * @param proxyFd FD of socket pair. Ownership of FD is taken by AppFuseBridge.
+     * @param channel Channel that the runnable send mount result to.
+     */
+    public AppFuseBridge(
+            IMountScope mountScope, ParcelFileDescriptor proxyFd, BlockingQueue<Boolean> channel) {
+        Preconditions.checkNotNull(mountScope);
+        Preconditions.checkNotNull(proxyFd);
+        Preconditions.checkNotNull(channel);
+        mMountScope = mountScope;
         mProxyFd = proxyFd;
-    }
-
-    public static AppFuseMount startMessageLoop(
-            int uid,
-            String name,
-            FileDescriptor deviceFd,
-            Handler handler,
-            ParcelFileDescriptor.OnCloseListener listener)
-                    throws IOException, ErrnoException, InterruptedException {
-        final FileDescriptor localFd = new FileDescriptor();
-        final FileDescriptor remoteFd = new FileDescriptor();
-        // Needs to specify OsConstants.SOCK_SEQPACKET to keep message boundaries.
-        Os.socketpair(OsConstants.AF_UNIX, OsConstants.SOCK_SEQPACKET, 0, remoteFd, localFd);
-
-        // Caller must invoke #start() after instantiate AppFuseBridge.
-        // Otherwise FDs will be leaked.
-        final AppFuseBridge bridge = new AppFuseBridge(deviceFd, localFd);
-        final Thread thread = new Thread(bridge, TAG);
-        thread.start();
-        try {
-            bridge.mMountLatch.await();
-        } catch (InterruptedException error) {
-            throw error;
-        }
-        return new AppFuseMount(
-                new File("/mnt/appfuse/" + uid + "_" + name),
-                ParcelFileDescriptor.fromFd(remoteFd, handler, listener));
+        mChannel = channel;
     }
 
     @Override
     public void run() {
-        // deviceFd and proxyFd must be closed in native_start_loop.
-        final int deviceFd = mDeviceFd.getInt$();
-        final int proxyFd = mProxyFd.getInt$();
-        mDeviceFd.setInt$(-1);
-        mProxyFd.setInt$(-1);
-        native_start_loop(deviceFd, proxyFd);
+        try {
+            // deviceFd and proxyFd must be closed in native_start_loop.
+            native_start_loop(
+                    mMountScope.getDeviceFileDescriptor().detachFd(),
+                    mProxyFd.detachFd());
+        } finally {
+            close();
+        }
+    }
+
+    public static ParcelFileDescriptor openFile(int uid, int mountId, int fileId, int mode)
+            throws FileNotFoundException {
+        final File mountPoint = getMountPoint(uid, mountId);
+        try {
+            if (Os.stat(mountPoint.getPath()).st_ino != 1) {
+                throw new FileNotFoundException("Could not find bridge mount point.");
+            }
+        } catch (ErrnoException e) {
+            throw new FileNotFoundException(
+                    "Failed to stat mount point: " + mountPoint.getParent());
+        }
+        return ParcelFileDescriptor.open(new File(mountPoint, String.valueOf(fileId)), mode);
+    }
+
+    private static File getMountPoint(int uid, int mountId) {
+        return new File(String.format(APPFUSE_MOUNT_NAME_TEMPLATE,  uid, mountId));
+    }
+
+    @Override
+    public void close() {
+        IoUtils.closeQuietly(mMountScope);
+        IoUtils.closeQuietly(mProxyFd);
+        // Invoke countDown here in case where close is invoked before mount.
+        mChannel.offer(false);
     }
 
     // Used by com_android_server_storage_AppFuse.cpp.
     private void onMount() {
-        mMountLatch.countDown();
+        mChannel.offer(true);
+    }
+
+    public static interface IMountScope extends AutoCloseable {
+        ParcelFileDescriptor getDeviceFileDescriptor();
     }
 
     private native boolean native_start_loop(int deviceFd, int proxyFd);
diff --git a/services/core/java/com/android/server/webkit/SystemImpl.java b/services/core/java/com/android/server/webkit/SystemImpl.java
index 7ba95a4..02b46ec 100644
--- a/services/core/java/com/android/server/webkit/SystemImpl.java
+++ b/services/core/java/com/android/server/webkit/SystemImpl.java
@@ -271,21 +271,20 @@
     }
 
     @Override
-    public void setMultiProcessEnabledFromContext(Context context) {
-        boolean enableMultiProcess = false;
-        try {
-            enableMultiProcess = Settings.Global.getInt(context.getContentResolver(),
-                    Settings.Global.WEBVIEW_MULTIPROCESS) == 1;
-        } catch (Settings.SettingNotFoundException ex) {
-        }
-        WebViewZygote.setMultiprocessEnabled(enableMultiProcess);
+    public int getMultiProcessSetting(Context context) {
+        return Settings.Global.getInt(context.getContentResolver(),
+                                      Settings.Global.WEBVIEW_MULTIPROCESS, 0);
     }
 
     @Override
-    public void registerContentObserver(Context context, ContentObserver contentObserver) {
-        context.getContentResolver().registerContentObserver(
-                Settings.Global.getUriFor(Settings.Global.WEBVIEW_MULTIPROCESS),
-                false, contentObserver);
+    public void setMultiProcessSetting(Context context, int value) {
+        Settings.Global.putInt(context.getContentResolver(),
+                               Settings.Global.WEBVIEW_MULTIPROCESS, value);
+    }
+
+    @Override
+    public void notifyZygote(boolean enableMultiProcess) {
+        WebViewZygote.setMultiprocessEnabled(enableMultiProcess);
     }
 
     // flags declaring we want extra info from the package manager for webview providers
diff --git a/services/core/java/com/android/server/webkit/SystemInterface.java b/services/core/java/com/android/server/webkit/SystemInterface.java
index 2d7a998..fd137eb 100644
--- a/services/core/java/com/android/server/webkit/SystemInterface.java
+++ b/services/core/java/com/android/server/webkit/SystemInterface.java
@@ -50,6 +50,7 @@
     public PackageInfo getPackageInfoForProvider(WebViewProviderInfo configInfo)
             throws NameNotFoundException;
 
-    public void setMultiProcessEnabledFromContext(Context context);
-    public void registerContentObserver(Context context, ContentObserver contentObserver);
+    public int getMultiProcessSetting(Context context);
+    public void setMultiProcessSetting(Context context, int value);
+    public void notifyZygote(boolean enableMultiProcess);
 }
diff --git a/services/core/java/com/android/server/webkit/WebViewUpdateService.java b/services/core/java/com/android/server/webkit/WebViewUpdateService.java
index 0a7454f..311570e 100644
--- a/services/core/java/com/android/server/webkit/WebViewUpdateService.java
+++ b/services/core/java/com/android/server/webkit/WebViewUpdateService.java
@@ -261,6 +261,32 @@
             }
         }
 
+        @Override // Binder call
+        public boolean isMultiProcessEnabled() {
+            return WebViewUpdateService.this.mImpl.isMultiProcessEnabled();
+        }
+
+        @Override // Binder call
+        public void enableMultiProcess(boolean enable) {
+            if (getContext().checkCallingPermission(
+                        android.Manifest.permission.WRITE_SECURE_SETTINGS)
+                    != PackageManager.PERMISSION_GRANTED) {
+                String msg = "Permission Denial: enableMultiProcess() from pid="
+                        + Binder.getCallingPid()
+                        + ", uid=" + Binder.getCallingUid()
+                        + " requires " + android.Manifest.permission.WRITE_SECURE_SETTINGS;
+                Slog.w(TAG, msg);
+                throw new SecurityException(msg);
+            }
+
+            long callingId = Binder.clearCallingIdentity();
+            try {
+                WebViewUpdateService.this.mImpl.enableMultiProcess(enable);
+            } finally {
+                Binder.restoreCallingIdentity(callingId);
+            }
+        }
+
         @Override
         protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
             if (getContext().checkCallingOrSelfPermission(android.Manifest.permission.DUMP)
diff --git a/services/core/java/com/android/server/webkit/WebViewUpdateServiceImpl.java b/services/core/java/com/android/server/webkit/WebViewUpdateServiceImpl.java
index 1a77c68..edfb11c 100644
--- a/services/core/java/com/android/server/webkit/WebViewUpdateServiceImpl.java
+++ b/services/core/java/com/android/server/webkit/WebViewUpdateServiceImpl.java
@@ -20,8 +20,6 @@
 import android.content.pm.PackageInfo;
 import android.content.pm.PackageManager.NameNotFoundException;
 import android.content.pm.Signature;
-import android.database.ContentObserver;
-import android.net.Uri;
 import android.os.Handler;
 import android.os.UserHandle;
 import android.util.Base64;
@@ -77,7 +75,6 @@
 
     private SystemInterface mSystemInterface;
     private WebViewUpdater mWebViewUpdater;
-    private SettingsObserver mSettingsObserver;
     final private Context mContext;
 
     public WebViewUpdateServiceImpl(Context context, SystemInterface systemInterface) {
@@ -97,10 +94,7 @@
     void prepareWebViewInSystemServer() {
         updateFallbackStateOnBoot();
         mWebViewUpdater.prepareWebViewInSystemServer();
-
-        // Register for changes in the multiprocess developer option. This has to be done
-        // here, since the update service gets created before the ContentResolver service.
-        mSettingsObserver = new SettingsObserver();
+        mSystemInterface.notifyZygote(isMultiProcessEnabled());
     }
 
     private boolean existsValidNonFallbackProvider(WebViewProviderInfo[] providers) {
@@ -247,6 +241,19 @@
                 && packageName.equals(fallbackProvider.packageName));
     }
 
+    boolean isMultiProcessEnabled() {
+        return mSystemInterface.getMultiProcessSetting(mContext) != 0;
+    }
+
+    void enableMultiProcess(boolean enable) {
+        PackageInfo current = getCurrentWebViewPackage();
+        mSystemInterface.setMultiProcessSetting(mContext, enable ? 1 : 0);
+        mSystemInterface.notifyZygote(enable);
+        if (current != null) {
+            mSystemInterface.killPackageDependents(current.packageName);
+        }
+    }
+
     /**
      * Class that decides what WebView implementation to use and prepares that implementation for
      * use.
@@ -740,31 +747,6 @@
     }
 
     /**
-     * Watches for changes in the WEBVIEW_MULTIPROCESS setting and lets
-     * the WebViewZygote know, so it can start or stop the zygote process
-     * appropriately.
-     */
-    private class SettingsObserver extends ContentObserver {
-        SettingsObserver() {
-            super(new Handler());
-
-            mSystemInterface.registerContentObserver(mContext, this);
-
-            // Push the current value of the setting immediately.
-            notifyZygote();
-        }
-
-        @Override
-        public void onChange(boolean selfChange, Uri uri) {
-            notifyZygote();
-        }
-
-        private void notifyZygote() {
-            mSystemInterface.setMultiProcessEnabledFromContext(mContext);
-        }
-    }
-
-    /**
      * Dump the state of this Service.
      */
     void dumpState(PrintWriter pw) {
diff --git a/services/core/java/com/android/server/wm/AppWindowToken.java b/services/core/java/com/android/server/wm/AppWindowToken.java
index 10d1d8b..ac9859d 100644
--- a/services/core/java/com/android/server/wm/AppWindowToken.java
+++ b/services/core/java/com/android/server/wm/AppWindowToken.java
@@ -445,6 +445,7 @@
 
         mService.mOpeningApps.remove(this);
         mService.mUnknownAppVisibilityController.appRemoved(this);
+        mService.mTaskSnapshotController.onAppRemoved(this);
         waitingToShow = false;
         if (mService.mClosingApps.contains(this)) {
             delayed = true;
diff --git a/services/core/java/com/android/server/wm/Task.java b/services/core/java/com/android/server/wm/Task.java
index 2d50e3a..4b680e5 100644
--- a/services/core/java/com/android/server/wm/Task.java
+++ b/services/core/java/com/android/server/wm/Task.java
@@ -638,6 +638,11 @@
     }
 
     @Override
+    TaskWindowContainerController getController() {
+        return (TaskWindowContainerController) super.getController();
+    }
+
+    @Override
     public String toString() {
         return "{taskId=" + mTaskId + " appTokens=" + mChildren + " mdr=" + mDeferRemoval + "}";
     }
diff --git a/services/core/java/com/android/server/wm/TaskSnapshotCache.java b/services/core/java/com/android/server/wm/TaskSnapshotCache.java
index 994a155..c86229b 100644
--- a/services/core/java/com/android/server/wm/TaskSnapshotCache.java
+++ b/services/core/java/com/android/server/wm/TaskSnapshotCache.java
@@ -20,6 +20,8 @@
 import android.app.ActivityManager.TaskSnapshot;
 import android.util.ArrayMap;
 
+import java.io.PrintWriter;
+
 /**
  * Caches snapshots. See {@link TaskSnapshotController}.
  * <p>
@@ -27,13 +29,65 @@
  */
 class TaskSnapshotCache {
 
-    private final ArrayMap<Task, TaskSnapshot> mCache = new ArrayMap<>();
+    private final ArrayMap<AppWindowToken, Task> mAppTaskMap = new ArrayMap<>();
+    private final ArrayMap<Task, CacheEntry> mCache = new ArrayMap<>();
 
     void putSnapshot(Task task, TaskSnapshot snapshot) {
-        mCache.put(task, snapshot);
+        final CacheEntry entry = mCache.get(task);
+        if (entry != null) {
+            mAppTaskMap.remove(entry.topApp);
+        }
+        final AppWindowToken top = task.getTopChild();
+        mAppTaskMap.put(top, task);
+        mCache.put(task, new CacheEntry(snapshot, task.getTopChild()));
     }
 
     @Nullable TaskSnapshot getSnapshot(Task task) {
-        return mCache.get(task);
+        final CacheEntry entry = mCache.get(task);
+        return entry != null ? entry.snapshot : null;
+    }
+
+    /**
+     * Cleans the cache after an app window token's process died.
+     */
+    void cleanCache(AppWindowToken wtoken) {
+        final Task task = mAppTaskMap.get(wtoken);
+        if (task != null) {
+            removeEntry(task);
+        }
+    }
+
+    private void removeEntry(Task task) {
+        final CacheEntry entry = mCache.get(task);
+        if (entry != null) {
+            mAppTaskMap.remove(entry.topApp);
+            mCache.remove(task);
+        }
+    }
+
+    void dump(PrintWriter pw, String prefix) {
+        final String doublePrefix = prefix + "  ";
+        final String triplePrefix = doublePrefix + "  ";
+        pw.println(prefix + "SnapshotCache");
+        for (int i = mCache.size() - 1; i >= 0; i--) {
+            final CacheEntry entry = mCache.valueAt(i);
+            pw.println(doublePrefix + "Entry taskId=" + mCache.keyAt(i).mTaskId);
+            pw.println(triplePrefix + "topApp=" + entry.topApp);
+            pw.println(triplePrefix + "snapshot=" + entry.snapshot);
+        }
+    }
+
+    private static final class CacheEntry {
+
+        /** The snapshot. */
+        final TaskSnapshot snapshot;
+
+        /** The app token that was on top of the task when the snapshot was taken */
+        final AppWindowToken topApp;
+
+        CacheEntry(TaskSnapshot snapshot, AppWindowToken topApp) {
+            this.snapshot = snapshot;
+            this.topApp = topApp;
+        }
     }
 }
diff --git a/services/core/java/com/android/server/wm/TaskSnapshotController.java b/services/core/java/com/android/server/wm/TaskSnapshotController.java
index 68aceae..df8679d 100644
--- a/services/core/java/com/android/server/wm/TaskSnapshotController.java
+++ b/services/core/java/com/android/server/wm/TaskSnapshotController.java
@@ -17,23 +17,18 @@
 package com.android.server.wm;
 
 import static android.app.ActivityManager.ENABLE_TASK_SNAPSHOTS;
-import static android.graphics.Bitmap.Config.ARGB_8888;
-import static android.graphics.GraphicBuffer.USAGE_HW_TEXTURE;
-import static android.graphics.GraphicBuffer.USAGE_SW_READ_NEVER;
-import static android.graphics.GraphicBuffer.USAGE_SW_WRITE_NEVER;
-import static android.graphics.PixelFormat.RGBA_8888;
 
 import android.annotation.Nullable;
 import android.app.ActivityManager.StackId;
 import android.app.ActivityManager.TaskSnapshot;
-import android.graphics.Bitmap;
-import android.graphics.Canvas;
 import android.graphics.GraphicBuffer;
 import android.util.ArraySet;
 import android.view.WindowManagerPolicy.StartingSurface;
 
 import com.android.internal.annotations.VisibleForTesting;
 
+import java.io.PrintWriter;
+
 /**
  * When an app token becomes invisible, we take a snapshot (bitmap) of the corresponding task and
  * put it into our cache. Internally we use gralloc buffers to be able to draw them wherever we
@@ -74,6 +69,9 @@
             final TaskSnapshot snapshot = snapshotTask(task);
             if (snapshot != null) {
                 mCache.putSnapshot(task, snapshot);
+                if (task.getController() != null) {
+                    task.getController().reportSnapshotChanged(snapshot);
+                }
             }
         }
     }
@@ -92,7 +90,7 @@
     }
 
     private TaskSnapshot snapshotTask(Task task) {
-        final AppWindowToken top = (AppWindowToken) task.getTop();
+        final AppWindowToken top = task.getTopChild();
         if (top == null) {
             return null;
         }
@@ -125,4 +123,25 @@
     private boolean canSnapshotTask(Task task) {
         return !StackId.isHomeOrRecentsStack(task.mStack.mStackId);
     }
+
+    /**
+     * Called when an {@link AppWindowToken} has been removed.
+     */
+    void onAppRemoved(AppWindowToken wtoken) {
+        // TODO: Clean from both recents and running cache.
+        mCache.cleanCache(wtoken);
+    }
+
+    /**
+     * Called when the process of an {@link AppWindowToken} has died.
+     */
+    void onAppDied(AppWindowToken wtoken) {
+
+        // TODO: Only clean from running cache.
+        mCache.cleanCache(wtoken);
+    }
+
+    void dump(PrintWriter pw, String prefix) {
+        mCache.dump(pw, prefix);
+    }
 }
diff --git a/services/core/java/com/android/server/wm/TaskSnapshotSurface.java b/services/core/java/com/android/server/wm/TaskSnapshotSurface.java
index c3e3141..4a09423 100644
--- a/services/core/java/com/android/server/wm/TaskSnapshotSurface.java
+++ b/services/core/java/com/android/server/wm/TaskSnapshotSurface.java
@@ -35,7 +35,6 @@
 import android.os.Message;
 import android.os.RemoteException;
 import android.util.Slog;
-import android.view.Display;
 import android.view.IWindowSession;
 import android.view.Surface;
 import android.view.View;
@@ -147,6 +146,7 @@
         if (reportNextDraw) {
             reportDrawn();
         }
+        mSurface.release();
     }
 
     private void reportDrawn() {
diff --git a/services/core/java/com/android/server/wm/TaskWindowContainerController.java b/services/core/java/com/android/server/wm/TaskWindowContainerController.java
index bbc9ed2..26e36dc 100644
--- a/services/core/java/com/android/server/wm/TaskWindowContainerController.java
+++ b/services/core/java/com/android/server/wm/TaskWindowContainerController.java
@@ -19,6 +19,9 @@
 import android.app.ActivityManager.TaskSnapshot;
 import android.content.res.Configuration;
 import android.graphics.Rect;
+import android.os.Handler;
+import android.os.Looper;
+import android.os.Message;
 import android.util.EventLog;
 import android.util.Slog;
 import com.android.internal.annotations.VisibleForTesting;
@@ -37,14 +40,30 @@
  * Test class: {@link TaskWindowContainerControllerTests}
  */
 public class TaskWindowContainerController
-        extends WindowContainerController<Task, WindowContainerListener> {
+        extends WindowContainerController<Task, TaskWindowContainerListener> {
+
+    private static final int REPORT_SNAPSHOT_CHANGED = 0;
 
     private final int mTaskId;
 
-    public TaskWindowContainerController(int taskId, int stackId, int userId, Rect bounds,
-            Configuration overrideConfig, int resizeMode, boolean homeTask, boolean isOnTopLauncher,
-            boolean toTop, boolean showForAllUsers) {
-        super(null, WindowManagerService.getInstance());
+    private final Handler mHandler = new Handler(Looper.getMainLooper()) {
+
+        @Override
+        public void handleMessage(Message msg) {
+            switch (msg.what) {
+                case REPORT_SNAPSHOT_CHANGED:
+                    if (mListener != null) {
+                        mListener.onSnapshotChanged((TaskSnapshot) msg.obj);
+                    }
+                    break;
+            }
+        }
+    };
+
+    public TaskWindowContainerController(int taskId, TaskWindowContainerListener listener,
+            int stackId, int userId, Rect bounds, Configuration overrideConfig, int resizeMode,
+            boolean homeTask, boolean isOnTopLauncher, boolean toTop, boolean showForAllUsers) {
+        super(listener, WindowManagerService.getInstance());
         mTaskId = taskId;
 
         synchronized(mWindowMap) {
@@ -259,6 +278,10 @@
         }
     }
 
+    void reportSnapshotChanged(TaskSnapshot snapshot) {
+        mHandler.obtainMessage(REPORT_SNAPSHOT_CHANGED, snapshot).sendToTarget();
+    }
+
     @Override
     public String toString() {
         return "{TaskWindowContainerController taskId=" + mTaskId + "}";
diff --git a/services/core/java/com/android/server/wm/TaskWindowContainerListener.java b/services/core/java/com/android/server/wm/TaskWindowContainerListener.java
new file mode 100644
index 0000000..61b202d
--- /dev/null
+++ b/services/core/java/com/android/server/wm/TaskWindowContainerListener.java
@@ -0,0 +1,30 @@
+/*
+ * Copyright (C) 2017 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.server.wm;
+
+import android.app.ActivityManager.TaskSnapshot;
+
+/**
+ * Interface used by the creator of the controller to listen to changes with the container.
+ */
+public interface TaskWindowContainerListener extends WindowContainerListener {
+
+    /**
+     * Called when the snapshot of this task has changed.
+     */
+    void onSnapshotChanged(TaskSnapshot snapshot);
+}
diff --git a/services/core/java/com/android/server/wm/WindowContainer.java b/services/core/java/com/android/server/wm/WindowContainer.java
index e231da8..5b96263 100644
--- a/services/core/java/com/android/server/wm/WindowContainer.java
+++ b/services/core/java/com/android/server/wm/WindowContainer.java
@@ -458,9 +458,9 @@
         return false;
     }
 
-    /** Returns the top child container or this container if there are no children. */
-    WindowContainer getTop() {
-        return mChildren.isEmpty() ? this : mChildren.peekLast();
+    /** Returns the top child container. */
+    E getTopChild() {
+        return mChildren.peekLast();
     }
 
     /** Returns true if there is still a removal being deferred */
diff --git a/services/core/java/com/android/server/wm/WindowManagerService.java b/services/core/java/com/android/server/wm/WindowManagerService.java
index 0c8c10b..dcc0c6f 100644
--- a/services/core/java/com/android/server/wm/WindowManagerService.java
+++ b/services/core/java/com/android/server/wm/WindowManagerService.java
@@ -235,6 +235,8 @@
 import java.util.HashMap;
 import java.util.List;
 
+import static android.Manifest.permission.MANAGE_ACTIVITY_STACKS;
+import static android.Manifest.permission.READ_FRAME_BUFFER;
 /** {@hide} */
 public class WindowManagerService extends IWindowManager.Stub
         implements Watchdog.Monitor, WindowManagerPolicy.WindowManagerFuncs {
@@ -3859,7 +3861,7 @@
 
     @Override
     public Bitmap screenshotWallpaper() {
-        if (!checkCallingPermission(Manifest.permission.READ_FRAME_BUFFER,
+        if (!checkCallingPermission(READ_FRAME_BUFFER,
                 "screenshotWallpaper()")) {
             throw new SecurityException("Requires READ_FRAME_BUFFER permission");
         }
@@ -3880,7 +3882,7 @@
      */
     @Override
     public boolean requestAssistScreenshot(final IAssistScreenshotReceiver receiver) {
-        if (!checkCallingPermission(Manifest.permission.READ_FRAME_BUFFER,
+        if (!checkCallingPermission(READ_FRAME_BUFFER,
                 "requestAssistScreenshot()")) {
             throw new SecurityException("Requires READ_FRAME_BUFFER permission");
         }
@@ -7148,6 +7150,7 @@
 
         mInputMonitor.dump(pw, "  ");
         mUnknownAppVisibilityController.dump(pw, "  ");
+        mTaskSnapshotController.dump(pw, "  ");
 
         if (dumpAll) {
             pw.print("  mSystemDecorLayer="); pw.print(mSystemDecorLayer);
diff --git a/services/core/java/com/android/server/wm/WindowState.java b/services/core/java/com/android/server/wm/WindowState.java
index b1bf2c6..10aebe6 100644
--- a/services/core/java/com/android/server/wm/WindowState.java
+++ b/services/core/java/com/android/server/wm/WindowState.java
@@ -2304,6 +2304,9 @@
                     final WindowState win = mService.windowForClientLocked(mSession, mClient, false);
                     Slog.i(TAG, "WIN DEATH: " + win);
                     if (win != null) {
+                        if (win.mAppToken != null && win.mAppToken.findMainWindow() == win) {
+                            mService.mTaskSnapshotController.onAppDied(win.mAppToken);
+                        }
                         win.removeIfPossible(shouldKeepVisibleDeadAppWindow());
                         if (win.mAttrs.type == TYPE_DOCK_DIVIDER) {
                             // The owner of the docked divider died :( We reset the docked stack,
diff --git a/services/core/jni/com_android_server_input_InputManagerService.cpp b/services/core/jni/com_android_server_input_InputManagerService.cpp
index 27efd05..6791da9 100644
--- a/services/core/jni/com_android_server_input_InputManagerService.cpp
+++ b/services/core/jni/com_android_server_input_InputManagerService.cpp
@@ -1462,7 +1462,11 @@
     NativeInputManager* im = reinterpret_cast<NativeInputManager*>(ptr);
 
     PointerIcon pointerIcon;
-    android_view_PointerIcon_getLoadedIcon(env, iconObj, &pointerIcon);
+    status_t result = android_view_PointerIcon_getLoadedIcon(env, iconObj, &pointerIcon);
+    if (result) {
+        jniThrowRuntimeException(env, "Failed to load custom pointer icon.");
+        return;
+    }
 
     SpriteIcon spriteIcon;
     pointerIcon.bitmap.copyTo(&spriteIcon.bitmap, kN32_SkColorType);
diff --git a/services/core/jni/com_android_server_location_ContextHubService.cpp b/services/core/jni/com_android_server_location_ContextHubService.cpp
index 9106441..517fce0 100644
--- a/services/core/jni/com_android_server_location_ContextHubService.cpp
+++ b/services/core/jni/com_android_server_location_ContextHubService.cpp
@@ -14,7 +14,6 @@
  * limitations under the License.
  */
 
-
 #undef LOG_NDEBUG
 #undef LOG_TAG
 #define LOG_NDEBUG 0
@@ -26,11 +25,13 @@
 #include <stdio.h>
 #include <stdlib.h>
 #include <string.h>
+#include <sys/endian.h>
 
 #include <chrono>
 #include <mutex>
 #include <queue>
 #include <unordered_map>
+#include <utility>
 
 #include <android-base/macros.h>
 #include <android/hardware/contexthub/1.0/IContexthub.h>
@@ -39,20 +40,20 @@
 #include "core_jni_helpers.h"
 #include "JNIHelp.h"
 
-using IContexthub = android::hardware::contexthub::V1_0::IContexthub;
+using android::hardware::contexthub::V1_0::AsyncEventType;
+using android::hardware::contexthub::V1_0::ContextHub;
+using android::hardware::contexthub::V1_0::ContextHubMsg;
+using android::hardware::contexthub::V1_0::HubAppInfo;
+using android::hardware::contexthub::V1_0::IContexthub;
+using android::hardware::contexthub::V1_0::IContexthubCallback;
+using android::hardware::contexthub::V1_0::NanoAppBinary;
+using android::hardware::contexthub::V1_0::Result;
+using android::hardware::contexthub::V1_0::TransactionResult;
 
-using Result = android::hardware::contexthub::V1_0::Result;
-using ContextHubMsg = android::hardware::contexthub::V1_0::ContextHubMsg;
-using IContexthubCallback = android::hardware::contexthub::V1_0::IContexthubCallback;
-using AsyncEventType = android::hardware::contexthub::V1_0::AsyncEventType;
-using TransactionResult = android::hardware::contexthub::V1_0::TransactionResult;
-using ContextHub = android::hardware::contexthub::V1_0::ContextHub;
-using HubAppInfo = android::hardware::contexthub::V1_0::HubAppInfo;
-
-template<typename T>
-using Return = android::hardware::Return<T>;
+using android::hardware::Return;
 
 using std::chrono::steady_clock;
+
 // If a transaction takes longer than this, we'll allow it to be
 // canceled by a new transaction.  Note we do _not_ automatically
 // cancel a transaction after this much time.  We can have a
@@ -63,6 +64,22 @@
 
 namespace android {
 
+constexpr uint32_t kNanoAppBinaryHeaderVersion = 1;
+
+// Important: this header is explicitly defined as little endian byte order, and
+// therefore may not match host endianness
+struct NanoAppBinaryHeader {
+    uint32_t headerVersion;        // 0x1 for this version
+    uint32_t magic;                // "NANO" (see NANOAPP_MAGIC in context_hub.h)
+    uint64_t appId;                // App Id, contains vendor id
+    uint32_t appVersion;           // Version of the app
+    uint32_t flags;                // Signed, encrypted
+    uint64_t hwHubType;            // Which hub type is this compiled for
+    uint8_t targetChreApiMajorVersion; // Which CHRE API version this is compiled for
+    uint8_t targetChreApiMinorVersion;
+    uint8_t reserved[6];
+} __attribute__((packed));
+
 enum HubMessageType {
     CONTEXT_HUB_APPS_ENABLE  = 1, // Enables loaded nano-app(s)
     CONTEXT_HUB_APPS_DISABLE = 2, // Disables loaded nano-app(s)
@@ -361,11 +378,12 @@
 
 ContextHubServiceDb db;
 
-int getHubIdForHubHandle(int hubHandle) {
-    if (hubHandle < 0 || hubHandle >= db.hubInfo.numHubs) {
-      return -1;
+bool getHubIdForHubHandle(int hubHandle, uint32_t *hubId) {
+    if (hubHandle < 0 || hubHandle >= db.hubInfo.numHubs || hubId == nullptr) {
+        return false;
     } else {
-      return db.hubInfo.hubs[hubHandle].hubId;
+        *hubId = db.hubInfo.hubs[hubHandle].hubId;
+        return true;
     }
 }
 
@@ -380,17 +398,6 @@
     return db.appInstances[id].hubHandle;
 }
 
-int getHubIdForAppInstance(jint id) {
-    int hubHandle = getHubHandleForAppInstance(id);
-
-    if (hubHandle < 0) {
-        ALOGD("Cannot find hub instance for app instance %d", id);
-        return -1;
-    }
-
-    return db.hubInfo.hubs[hubHandle].hubId;
-}
-
 jint getAppInstanceForAppId(uint64_t app_id) {
     auto end = db.appInstances.end();
     for (auto current = db.appInstances.begin(); current != end; ++current) {
@@ -1001,6 +1008,45 @@
     return retArray;
 }
 
+Result sendLoadNanoAppRequest(uint32_t hubId,
+                              jbyte *data,
+                              size_t dataBufferLength) {
+    auto header = reinterpret_cast<const NanoAppBinaryHeader *>(data);
+    Result result;
+
+    if (dataBufferLength < sizeof(NanoAppBinaryHeader)) {
+        ALOGE("Got short NanoApp, length %zu", dataBufferLength);
+        result = Result::BAD_PARAMS;
+    } else if (header->headerVersion != htole32(kNanoAppBinaryHeaderVersion)) {
+        ALOGE("Got unexpected NanoApp header version %" PRIu32,
+              letoh32(header->headerVersion));
+        result = Result::BAD_PARAMS;
+    } else {
+        NanoAppBinary nanoapp;
+
+        // Data from the common nanoapp header goes into explicit fields
+        nanoapp.appId      = letoh64(header->appId);
+        nanoapp.appVersion = letoh32(header->appVersion);
+        nanoapp.flags      = letoh32(header->flags);
+        nanoapp.targetChreApiMajorVersion = header->targetChreApiMajorVersion;
+        nanoapp.targetChreApiMinorVersion = header->targetChreApiMinorVersion;
+
+        // Everything past the header goes in customBinary
+        auto dataBytes = reinterpret_cast<const uint8_t *>(data);
+        std::vector<uint8_t> customBinary(
+            dataBytes + sizeof(NanoAppBinaryHeader),
+            dataBytes + dataBufferLength);
+        nanoapp.customBinary = std::move(customBinary);
+
+        ALOGW("Calling Load NanoApp on hub %d", hubId);
+        result = db.hubInfo.contextHub->loadNanoApp(hubId,
+                                                    nanoapp,
+                                                    CONTEXT_HUB_LOAD_APP);
+    }
+
+    return result;
+}
+
 jint nativeSendMessage(JNIEnv *env,
                        jobject instance,
                        jintArray header_,
@@ -1012,19 +1058,18 @@
     jint retVal = -1; // Default to failure
 
     jint *header = env->GetIntArrayElements(header_, 0);
-    unsigned int numHeaderElements = env->GetArrayLength(header_);
+    size_t numHeaderElements = env->GetArrayLength(header_);
     jbyte *data = env->GetByteArrayElements(data_, 0);
-    int dataBufferLength = env->GetArrayLength(data_);
+    size_t dataBufferLength = env->GetArrayLength(data_);
 
     if (numHeaderElements < MSG_HEADER_SIZE) {
         ALOGW("Malformed header len");
         return -1;
     }
 
-    uint32_t appInstanceHandle = header[HEADER_FIELD_APP_INSTANCE];
+    jint appInstanceHandle = header[HEADER_FIELD_APP_INSTANCE];
     uint32_t msgType = header[HEADER_FIELD_MSG_TYPE];
     int hubHandle = -1;
-    int hubId;
     uint64_t appId;
 
     if (msgType == CONTEXT_HUB_UNLOAD_APP) {
@@ -1042,7 +1087,8 @@
         hubHandle = header[HEADER_FIELD_HUB_HANDLE];
     }
 
-    if (hubHandle < 0) {
+    uint32_t hubId = -1;
+    if (!getHubIdForHubHandle(hubHandle, &hubId)) {
         ALOGD("Invalid hub Handle %d", hubHandle);
         return -1;
     }
@@ -1072,46 +1118,41 @@
     Result result;
 
     if (msgType == CONTEXT_HUB_UNLOAD_APP) {
-        hubId = getHubIdForHubHandle(hubHandle);
-        ALOGW("Calling UnLoad NanoApp for app %" PRIx64 " on hub %d",
+        ALOGW("Calling UnLoad NanoApp for app %" PRIx64 " on hub %" PRIu32,
               db.appInstances[appInstanceHandle].appInfo.appId,
               hubId);
         result = db.hubInfo.contextHub->unloadNanoApp(
                 hubId, db.appInstances[appInstanceHandle].appInfo.appId, CONTEXT_HUB_UNLOAD_APP);
     } else {
-        if (header[HEADER_FIELD_APP_INSTANCE] == OS_APP_ID) {
+        if (appInstanceHandle == OS_APP_ID) {
             if (msgType == CONTEXT_HUB_LOAD_APP) {
-                std::vector<uint8_t> dataVector(reinterpret_cast<uint8_t *>(data),
-                                                reinterpret_cast<uint8_t *>(data + dataBufferLength));
-                hubId = getHubIdForHubHandle(hubHandle);
-                ALOGW("Calling Load NanoApp on hub %d", hubId);
-                result = db.hubInfo.contextHub->loadNanoApp(hubId,
-                                                            dataVector,
-                                                            CONTEXT_HUB_LOAD_APP);
+                result = sendLoadNanoAppRequest(hubId, data, dataBufferLength);
             } else {
                 ALOGD("Dropping OS addresses message of type - %" PRIu32, msgType);
                 result = Result::BAD_PARAMS;
             }
         } else {
-
-            appId = getAppIdForAppInstance(header[HEADER_FIELD_APP_INSTANCE]);
-            hubId = getHubIdForAppInstance(header[HEADER_FIELD_APP_INSTANCE]);
-
-            if (appId != static_cast<uint64_t>(INVALID_APP_ID) && hubId >= 0) {
+            appId = getAppIdForAppInstance(appInstanceHandle);
+            if (appId == static_cast<uint64_t>(INVALID_APP_ID)) {
+                ALOGD("Cannot find application instance %d", appInstanceHandle);
+                result = Result::BAD_PARAMS;
+            } else if (hubHandle != getHubHandleForAppInstance(appInstanceHandle)) {
+                ALOGE("Given hubHandle (%d) doesn't match expected for app instance (%d)",
+                      hubHandle,
+                      getHubHandleForAppInstance(appInstanceHandle));
+                result = Result::BAD_PARAMS;
+            } else {
                 ContextHubMsg msg;
                 msg.appName = appId;
                 msg.msgType = msgType;
                 msg.msg.setToExternal((unsigned char *)data, dataBufferLength);
 
-                ALOGW("Sending msg of type %" PRIu32 " len %u to app %" PRIx64 " on hub %d",
+                ALOGW("Sending msg of type %" PRIu32 " len %zu to app %" PRIx64 " on hub %" PRIu32,
                        msgType,
                        dataBufferLength,
                        appId,
                        hubId);
                 result = db.hubInfo.contextHub->sendMessageToHub(hubId, msg);
-            } else {
-                ALOGD("Cannot find application instance %u", header[HEADER_FIELD_APP_INSTANCE]);
-                result = Result::BAD_PARAMS;
             }
         }
     }
diff --git a/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java b/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
index 040188d..111f37f 100644
--- a/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
+++ b/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
@@ -191,6 +191,7 @@
 import java.util.List;
 import java.util.Map.Entry;
 import java.util.Set;
+import java.util.concurrent.TimeUnit;
 import java.util.concurrent.atomic.AtomicBoolean;
 
 /**
@@ -235,7 +236,7 @@
 
     private static final int REQUEST_EXPIRE_PASSWORD = 5571;
 
-    private static final long MS_PER_DAY = 86400 * 1000;
+    private static final long MS_PER_DAY = TimeUnit.DAYS.toMillis(1);
 
     private static final long EXPIRATION_GRACE_PERIOD_MS = 5 * MS_PER_DAY; // 5 days, in ms
 
@@ -330,7 +331,7 @@
      * Minimum timeout in milliseconds after which unlocking with weak auth times out,
      * i.e. the user has to use a strong authentication method like password, PIN or pattern.
      */
-    private static final long MINIMUM_STRONG_AUTH_TIMEOUT_MS = 1 * 60 * 60 * 1000; // 1h
+    private static final long MINIMUM_STRONG_AUTH_TIMEOUT_MS = TimeUnit.HOURS.toMillis(1);
 
     /**
      * Strings logged with {@link
@@ -1154,7 +1155,7 @@
                 } else if (TAG_KEEP_UNINSTALLED_PACKAGES.equals(tag)) {
                     keepUninstalledPackages = readPackageList(parser, tag);
                 } else if (TAG_USER_RESTRICTIONS.equals(tag)) {
-                    UserRestrictionsUtils.readRestrictions(parser, ensureUserRestrictions());
+                    userRestrictions = UserRestrictionsUtils.readRestrictions(parser);
                 } else if (TAG_DEFAULT_ENABLED_USER_RESTRICTIONS.equals(tag)) {
                     readAttributeValues(
                             parser, TAG_RESTRICTION, defaultEnabledRestrictionsAlreadySet);
@@ -2663,14 +2664,14 @@
             // Ignore
         }
 
+        // Generate a list of admins from the admin map
+        policy.mAdminList.addAll(policy.mAdminMap.values());
+
         // Might need to upgrade the file by rewriting it
         if (needsRewrite) {
             saveSettingsLocked(userHandle);
         }
 
-        // Generate a list of admins from the admin map
-        policy.mAdminList.addAll(policy.mAdminMap.values());
-
         validatePasswordOwnerLocked(policy);
         updateMaximumTimeToLockLocked(userHandle);
         updateLockTaskPackagesLocked(policy.mLockTaskPackages, userHandle);
@@ -6783,6 +6784,18 @@
         enforceManageUsers();
     }
 
+    private void enforceProfileOwnerOrSystemUser(ComponentName admin) {
+        synchronized (this) {
+            if (getActiveAdminWithPolicyForUidLocked(admin,
+                    DeviceAdminInfo.USES_POLICY_PROFILE_OWNER, mInjector.binderGetCallingUid())
+                            != null) {
+                return;
+            }
+        }
+        Preconditions.checkState(isCallerWithSystemUid(),
+                "Only profile owner, device owner and system may call this method.");
+    }
+
     private void ensureCallerPackage(@Nullable String packageName) {
         if (packageName == null) {
             Preconditions.checkState(isCallerWithSystemUid(),
@@ -7767,7 +7780,7 @@
 
         final int userHandle = mInjector.userHandleGetCallingUserId();
         synchronized (this) {
-            ActiveAdmin activeAdmin =
+            final ActiveAdmin activeAdmin =
                     getActiveAdminForCallerLocked(who,
                             DeviceAdminInfo.USES_POLICY_PROFILE_OWNER);
             final boolean isDeviceOwner = isDeviceOwner(who, userHandle);
@@ -7782,7 +7795,12 @@
             }
 
             // Save the restriction to ActiveAdmin.
-            activeAdmin.ensureUserRestrictions().putBoolean(key, enabledFromThisOwner);
+            final Bundle restrictions = activeAdmin.ensureUserRestrictions();
+            if (enabledFromThisOwner) {
+                restrictions.putBoolean(key, true);
+            } else {
+                restrictions.remove(key);
+            }
             saveUserRestrictionsLocked(userHandle);
         }
     }
@@ -7795,39 +7813,46 @@
 
     private void pushUserRestrictions(int userId) {
         synchronized (this) {
-            final Bundle global;
-            final Bundle local = new Bundle();
-            if (mOwners.isDeviceOwnerUserId(userId)) {
-                global = new Bundle();
+            final boolean isDeviceOwner = mOwners.isDeviceOwnerUserId(userId);
+            final Bundle userRestrictions;
+            // Whether device owner enforces camera restriction.
+            boolean disallowCameraGlobally = false;
 
+            if (isDeviceOwner) {
                 final ActiveAdmin deviceOwner = getDeviceOwnerAdminLocked();
                 if (deviceOwner == null) {
                     return; // Shouldn't happen.
                 }
-
-                UserRestrictionsUtils.sortToGlobalAndLocal(deviceOwner.userRestrictions,
-                        global, local);
+                userRestrictions = deviceOwner.userRestrictions;
                 // DO can disable camera globally.
-                if (deviceOwner.disableCamera) {
-                    global.putBoolean(UserManager.DISALLOW_CAMERA, true);
-                }
+                disallowCameraGlobally = deviceOwner.disableCamera;
             } else {
-                global = null;
+                final ActiveAdmin profileOwner = getProfileOwnerAdminLocked(userId);
+                userRestrictions = profileOwner != null ? profileOwner.userRestrictions : null;
+            }
 
-                ActiveAdmin profileOwner = getProfileOwnerAdminLocked(userId);
-                if (profileOwner != null) {
-                    UserRestrictionsUtils.merge(local, profileOwner.userRestrictions);
-                }
-            }
-            // Also merge in *local* camera restriction.
-            if (getCameraDisabled(/* who= */ null,
-                    userId, /* mergeDeviceOwnerRestriction= */ false)) {
-                local.putBoolean(UserManager.DISALLOW_CAMERA, true);
-            }
-            mUserManagerInternal.setDevicePolicyUserRestrictions(userId, local, global);
+            // Whether any admin enforces camera restriction.
+            final int cameraRestrictionScope =
+                    getCameraRestrictionScopeLocked(userId, disallowCameraGlobally);
+
+            mUserManagerInternal.setDevicePolicyUserRestrictions(userId, userRestrictions,
+                    isDeviceOwner, cameraRestrictionScope);
         }
     }
 
+    /**
+     * Get the scope of camera restriction for a given user if any.
+     */
+    private int getCameraRestrictionScopeLocked(int userId, boolean disallowCameraGlobally) {
+        if (disallowCameraGlobally) {
+            return UserManagerInternal.CAMERA_DISABLED_GLOBALLY;
+        } else if (getCameraDisabled(
+                /* who= */ null, userId, /* mergeDeviceOwnerRestriction= */ false)) {
+            return UserManagerInternal.CAMERA_DISABLED_LOCALLY;
+        }
+        return UserManagerInternal.CAMERA_NOT_DISABLED;
+    }
+
     @Override
     public Bundle getUserRestrictions(ComponentName who) {
         if (!mHasFeature) {
@@ -8913,8 +8938,8 @@
         PackageManager packageManager = mInjector.getPackageManager();
 
         UserHandle user = mInjector.binderGetCallingUserHandle();
+        enforceProfileOwnerOrSystemUser(admin);
         synchronized (this) {
-            getActiveAdminForCallerLocked(admin, DeviceAdminInfo.USES_POLICY_PROFILE_OWNER);
             long ident = mInjector.binderClearCallingIdentity();
             try {
                 int granted = mIPackageManager.checkPermission(permission,
diff --git a/services/java/com/android/server/SystemServer.java b/services/java/com/android/server/SystemServer.java
index 08fb591..b6c518b 100644
--- a/services/java/com/android/server/SystemServer.java
+++ b/services/java/com/android/server/SystemServer.java
@@ -282,12 +282,6 @@
             EventLog.writeEvent(EventLogTags.BOOT_PROGRESS_SYSTEM_RUN, uptimeMillis);
             if (!mRuntimeRestart && !mFirstBoot) {
                 MetricsLogger.histogram(null, "boot_system_server_init", uptimeMillis);
-                // Also report when first stage of init has started
-                long initStartNs = SystemProperties.getLong("ro.boottime.init", -1);
-                if (initStartNs >= 0) {
-                    MetricsLogger.histogram(null, "boot_android_init",
-                            (int)(initStartNs / 1000000));
-                }
             }
 
             // In case the runtime switched since last boot (such as when
@@ -383,8 +377,13 @@
             Slog.i(TAG, "Enabled StrictMode for system server main thread.");
         }
         if (!mRuntimeRestart && !mFirstBoot) {
-            MetricsLogger.histogram(null, "boot_system_server_ready",
-                    (int) SystemClock.elapsedRealtime());
+            int uptimeMillis = (int) SystemClock.elapsedRealtime();
+            MetricsLogger.histogram(null, "boot_system_server_ready", uptimeMillis);
+            final int MAX_UPTIME_MILLIS = 60 * 1000;
+            if (uptimeMillis > MAX_UPTIME_MILLIS) {
+                Slog.wtf("SystemServerTiming",
+                        "SystemServer init took too long. uptimeMillis=" + uptimeMillis);
+            }
         }
 
         // Loop forever.
@@ -955,6 +954,21 @@
                 }
                 traceEnd();
 
+                // Wifi Service must be started first for wifi-related services.
+                traceBeginAndSlog("StartWifi");
+                mSystemServiceManager.startService(WIFI_SERVICE_CLASS);
+                traceEnd();
+                traceBeginAndSlog("StartWifiScanning");
+                mSystemServiceManager.startService(
+                        "com.android.server.wifi.scanner.WifiScanningService");
+                traceEnd();
+
+                if (!disableRtt) {
+                    traceBeginAndSlog("StartWifiRtt");
+                    mSystemServiceManager.startService("com.android.server.wifi.RttService");
+                    traceEnd();
+                }
+
                 if (context.getPackageManager().hasSystemFeature(
                         PackageManager.FEATURE_WIFI_AWARE)) {
                     traceBeginAndSlog("StartWifiAware");
@@ -970,19 +984,6 @@
                     mSystemServiceManager.startService(WIFI_P2P_SERVICE_CLASS);
                     traceEnd();
                 }
-                traceBeginAndSlog("StartWifi");
-                mSystemServiceManager.startService(WIFI_SERVICE_CLASS);
-                traceEnd();
-                traceBeginAndSlog("StartWifiScanning");
-                mSystemServiceManager.startService(
-                            "com.android.server.wifi.scanner.WifiScanningService");
-                traceEnd();
-
-                if (!disableRtt) {
-                    traceBeginAndSlog("StartWifiRtt");
-                    mSystemServiceManager.startService("com.android.server.wifi.RttService");
-                    traceEnd();
-                }
 
                 if (mPackageManager.hasSystemFeature(PackageManager.FEATURE_ETHERNET) ||
                     mPackageManager.hasSystemFeature(PackageManager.FEATURE_USB_HOST)) {
diff --git a/services/tests/servicestests/AndroidManifest.xml b/services/tests/servicestests/AndroidManifest.xml
index 1393615..133bc3d 100644
--- a/services/tests/servicestests/AndroidManifest.xml
+++ b/services/tests/servicestests/AndroidManifest.xml
@@ -138,6 +138,12 @@
             android:enabled="true" android:exported="true">
             <meta-data android:name="android.app.shortcuts" android:resource="@xml/shortcut_1"/>
         </activity-alias>
+        <activity-alias android:name="a.ShortcutConfigActivity"
+                        android:targetActivity="com.android.server.pm.ShortcutTestActivity">
+            <intent-filter>
+                <action android:name="android.intent.action.CREATE_SHORTCUT" />
+            </intent-filter>
+        </activity-alias>
 
         <activity-alias android:name="a.DisabledMain"
             android:targetActivity="com.android.server.pm.ShortcutTestActivity"
diff --git a/services/tests/servicestests/src/com/android/server/appwidget/AppWidgetServiceImplTest.java b/services/tests/servicestests/src/com/android/server/appwidget/AppWidgetServiceImplTest.java
index 4886a5f..677e468 100644
--- a/services/tests/servicestests/src/com/android/server/appwidget/AppWidgetServiceImplTest.java
+++ b/services/tests/servicestests/src/com/android/server/appwidget/AppWidgetServiceImplTest.java
@@ -21,6 +21,7 @@
 import static org.mockito.Matchers.anyString;
 import static org.mockito.Matchers.eq;
 import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.reset;
 import static org.mockito.Mockito.times;
 import static org.mockito.Mockito.verify;
 import static org.mockito.Mockito.when;
@@ -28,6 +29,7 @@
 import android.app.admin.DevicePolicyManagerInternal;
 import android.appwidget.AppWidgetManager;
 import android.appwidget.AppWidgetProviderInfo;
+import android.appwidget.PendingHostUpdate;
 import android.content.BroadcastReceiver;
 import android.content.ComponentName;
 import android.content.ContextWrapper;
@@ -39,11 +41,17 @@
 import android.os.UserHandle;
 import android.test.InstrumentationTestCase;
 import android.test.suitebuilder.annotation.SmallTest;
+import android.widget.RemoteViews;
 
+import com.android.internal.appwidget.IAppWidgetHost;
 import com.android.server.LocalServices;
 
 import org.mockito.ArgumentCaptor;
 
+import java.util.List;
+import java.util.Random;
+import java.util.concurrent.CountDownLatch;
+
 
 /**
  * Tests for {@link AppWidgetManager} and {@link AppWidgetServiceImpl}.
@@ -57,11 +65,15 @@
 @SmallTest
 public class AppWidgetServiceImplTest extends InstrumentationTestCase {
 
+    private static final int HOST_ID = 42;
+
     private TestContext mTestContext;
+    private String mPkgName;
     private AppWidgetServiceImpl mService;
     private AppWidgetManager mManager;
 
     private ShortcutServiceInternal mMockShortcutService;
+    private IAppWidgetHost mMockHost;
 
     @Override
     protected void setUp() throws Exception {
@@ -70,12 +82,13 @@
         LocalServices.removeServiceForTest(ShortcutServiceInternal.class);
 
         mTestContext = new TestContext();
+        mPkgName = mTestContext.getOpPackageName();
         mService = new AppWidgetServiceImpl(mTestContext);
         mManager = new AppWidgetManager(mTestContext, mService);
 
         mMockShortcutService = mock(ShortcutServiceInternal.class);
+        mMockHost = mock(IAppWidgetHost.class);
         LocalServices.addService(ShortcutServiceInternal.class, mMockShortcutService);
-
         mService.onStart();
     }
 
@@ -108,6 +121,142 @@
         assertEquals(provider, providerCaptor.getValue().provider);
     }
 
+    public void testProviderUpdatesReceived() throws Exception {
+        int widgetId = setupHostAndWidget();
+        RemoteViews view = new RemoteViews(mPkgName, android.R.layout.simple_list_item_1);
+        mManager.updateAppWidget(widgetId, view);
+        mManager.updateAppWidget(widgetId, view);
+        mManager.updateAppWidget(widgetId, view);
+        mManager.updateAppWidget(widgetId, view);
+
+        flushMainThread();
+        verify(mMockHost, times(4)).updateAppWidget(eq(widgetId), any(RemoteViews.class));
+
+        reset(mMockHost);
+        mManager.notifyAppWidgetViewDataChanged(widgetId, 22);
+        flushMainThread();
+        verify(mMockHost, times(1)).viewDataChanged(eq(widgetId), eq(22));
+    }
+
+    public void testProviderUpdatesNotReceived() throws Exception {
+        int widgetId = setupHostAndWidget();
+        mService.stopListening(mPkgName, HOST_ID);
+        RemoteViews view = new RemoteViews(mPkgName, android.R.layout.simple_list_item_1);
+        mManager.updateAppWidget(widgetId, view);
+        mManager.notifyAppWidgetViewDataChanged(widgetId, 22);
+
+        flushMainThread();
+        verify(mMockHost, times(0)).updateAppWidget(anyInt(), any(RemoteViews.class));
+        verify(mMockHost, times(0)).viewDataChanged(anyInt(), eq(22));
+    }
+
+    public void testNoUpdatesReceived_queueEmpty() {
+        int widgetId = setupHostAndWidget();
+        RemoteViews view = new RemoteViews(mPkgName, android.R.layout.simple_list_item_1);
+        mManager.updateAppWidget(widgetId, view);
+        mManager.notifyAppWidgetViewDataChanged(widgetId, 22);
+        mService.stopListening(mPkgName, HOST_ID);
+
+        List<PendingHostUpdate> updates = mService.startListening(
+                mMockHost, mPkgName, HOST_ID, new int[0]).getList();
+        assertTrue(updates.isEmpty());
+    }
+
+    /**
+     * Sends dummy widget updates to {@link #mManager}.
+     * @param widgetId widget to update
+     * @param viewIds a list of view ids for which
+     *                {@link AppWidgetManager#notifyAppWidgetViewDataChanged} will be called
+     */
+    private void sendDummyUpdates(int widgetId, int... viewIds) {
+        Random r = new Random();
+        RemoteViews view = new RemoteViews(mPkgName, android.R.layout.simple_list_item_1);
+        for (int i = r.nextInt(10) + 2; i >= 0; i--) {
+            mManager.updateAppWidget(widgetId, view);
+        }
+
+        for (int viewId : viewIds) {
+            mManager.notifyAppWidgetViewDataChanged(widgetId, viewId);
+            for (int i = r.nextInt(3); i >= 0; i--) {
+                mManager.updateAppWidget(widgetId, view);
+            }
+        }
+    }
+
+    public void testNoUpdatesReceived_queueNonEmpty_noWidgetId() {
+        int widgetId = setupHostAndWidget();
+        mService.stopListening(mPkgName, HOST_ID);
+
+        sendDummyUpdates(widgetId, 22, 23);
+        List<PendingHostUpdate> updates = mService.startListening(
+                mMockHost, mPkgName, HOST_ID, new int[0]).getList();
+        assertTrue(updates.isEmpty());
+    }
+
+    public void testUpdatesReceived_queueNotEmpty_widgetIdProvided() {
+        int widgetId = setupHostAndWidget();
+        int widgetId2 = bindNewWidget();
+        mService.stopListening(mPkgName, HOST_ID);
+
+        sendDummyUpdates(widgetId, 22, 23);
+        sendDummyUpdates(widgetId2, 100, 101, 102);
+
+        List<PendingHostUpdate> updates = mService.startListening(
+                mMockHost, mPkgName, HOST_ID, new int[]{widgetId}).getList();
+        // 3 updates corresponding to the first widget
+        assertEquals(3, updates.size());
+    }
+
+    public void testUpdatesReceived_queueNotEmpty_widgetIdProvided2() {
+        int widgetId = setupHostAndWidget();
+        int widgetId2 = bindNewWidget();
+        mService.stopListening(mPkgName, HOST_ID);
+
+        sendDummyUpdates(widgetId, 22, 23);
+        sendDummyUpdates(widgetId2, 100, 101, 102);
+
+        List<PendingHostUpdate> updates = mService.startListening(
+                mMockHost, mPkgName, HOST_ID, new int[]{widgetId2}).getList();
+        // 4 updates corresponding to the second widget
+        assertEquals(4, updates.size());
+    }
+
+    public void testUpdatesReceived_queueNotEmpty_multipleWidgetIdProvided() {
+        int widgetId = setupHostAndWidget();
+        int widgetId2 = bindNewWidget();
+        mService.stopListening(mPkgName, HOST_ID);
+
+        sendDummyUpdates(widgetId, 22, 23);
+        sendDummyUpdates(widgetId2, 100, 101, 102);
+
+        List<PendingHostUpdate> updates = mService.startListening(
+                mMockHost, mPkgName, HOST_ID, new int[]{widgetId, widgetId2}).getList();
+        // 3 updates for first widget and 4 for second
+        assertEquals(7, updates.size());
+    }
+
+    private int setupHostAndWidget() {
+        List<PendingHostUpdate> updates = mService.startListening(
+                mMockHost, mPkgName, HOST_ID, new int[0]).getList();
+        assertTrue(updates.isEmpty());
+        return bindNewWidget();
+    }
+
+    private int bindNewWidget() {
+        ComponentName provider = new ComponentName(mTestContext, DummyAppWidget.class);
+        int widgetId = mService.allocateAppWidgetId(mPkgName, HOST_ID);
+        assertTrue(mManager.bindAppWidgetIdIfAllowed(widgetId, provider));
+        assertEquals(provider, mManager.getAppWidgetInfo(widgetId).provider);
+
+        return widgetId;
+    }
+
+    private void flushMainThread() throws Exception {
+        CountDownLatch latch = new CountDownLatch(1);
+        new Handler(mTestContext.getMainLooper()).post(latch::countDown);
+        latch.await();
+    }
+
     private class TestContext extends ContextWrapper {
 
         public TestContext() {
@@ -125,5 +274,15 @@
         public void unregisterReceiver(BroadcastReceiver receiver) {
             // ignore.
         }
+
+        @Override
+        public void enforceCallingOrSelfPermission(String permission, String message) {
+            // ignore.
+        }
+
+        @Override
+        public void sendBroadcastAsUser(Intent intent, UserHandle user) {
+            // ignore.
+        }
     }
 }
diff --git a/services/tests/servicestests/src/com/android/server/devicepolicy/DevicePolicyManagerTest.java b/services/tests/servicestests/src/com/android/server/devicepolicy/DevicePolicyManagerTest.java
index c3eb09d..8da47c8 100644
--- a/services/tests/servicestests/src/com/android/server/devicepolicy/DevicePolicyManagerTest.java
+++ b/services/tests/servicestests/src/com/android/server/devicepolicy/DevicePolicyManagerTest.java
@@ -15,6 +15,10 @@
  */
 package com.android.server.devicepolicy;
 
+import static android.os.UserManagerInternal.CAMERA_DISABLED_GLOBALLY;
+import static android.os.UserManagerInternal.CAMERA_DISABLED_LOCALLY;
+import static android.os.UserManagerInternal.CAMERA_NOT_DISABLED;
+
 import android.Manifest.permission;
 import android.app.Activity;
 import android.app.admin.DeviceAdminReceiver;
@@ -39,6 +43,7 @@
 import android.os.Process;
 import android.os.UserHandle;
 import android.os.UserManager;
+import android.os.UserManagerInternal;
 import android.provider.Settings;
 import android.telephony.TelephonyManager;
 import android.test.MoreAsserts;
@@ -61,9 +66,11 @@
 import java.util.List;
 import java.util.Map;
 import java.util.Set;
+import java.util.concurrent.TimeUnit;
 
 import static org.mockito.Matchers.any;
 import static org.mockito.Matchers.anyInt;
+import static org.mockito.Matchers.anyLong;
 import static org.mockito.Matchers.anyObject;
 import static org.mockito.Matchers.anyString;
 import static org.mockito.Matchers.eq;
@@ -928,9 +935,8 @@
 
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
-                MockUtils.checkUserRestrictions(),
-                MockUtils.checkUserRestrictions()
-        );
+                eq(null),
+                eq(true), eq(CAMERA_NOT_DISABLED));
 
         assertFalse(dpm.isAdminActiveAsUser(admin1, UserHandle.USER_SYSTEM));
 
@@ -1287,7 +1293,8 @@
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
                 MockUtils.checkUserRestrictions(defaultRestrictions),
-                MockUtils.checkUserRestrictions()
+                eq(true) /* isDeviceOwner */,
+                eq(CAMERA_NOT_DISABLED)
         );
         reset(mContext.userManagerInternal);
 
@@ -1296,21 +1303,21 @@
         }
 
         assertNoDeviceOwnerRestrictions();
+        reset(mContext.userManagerInternal);
 
         dpm.addUserRestriction(admin1, UserManager.DISALLOW_ADD_USER);
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
-                MockUtils.checkUserRestrictions(),
-                MockUtils.checkUserRestrictions(UserManager.DISALLOW_ADD_USER)
-        );
+                MockUtils.checkUserRestrictions(UserManager.DISALLOW_ADD_USER),
+                eq(true), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         dpm.addUserRestriction(admin1, UserManager.DISALLOW_OUTGOING_CALLS);
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
-                MockUtils.checkUserRestrictions(UserManager.DISALLOW_OUTGOING_CALLS),
-                MockUtils.checkUserRestrictions(UserManager.DISALLOW_ADD_USER)
-        );
+                MockUtils.checkUserRestrictions(UserManager.DISALLOW_OUTGOING_CALLS,
+                        UserManager.DISALLOW_ADD_USER),
+                eq(true), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         DpmTestUtils.assertRestrictions(
@@ -1328,8 +1335,7 @@
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
                 MockUtils.checkUserRestrictions(UserManager.DISALLOW_OUTGOING_CALLS),
-                MockUtils.checkUserRestrictions()
-        );
+                eq(true), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         DpmTestUtils.assertRestrictions(
@@ -1345,8 +1351,7 @@
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
                 MockUtils.checkUserRestrictions(),
-                MockUtils.checkUserRestrictions()
-        );
+                eq(true), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         assertNoDeviceOwnerRestrictions();
@@ -1358,42 +1363,38 @@
         dpm.addUserRestriction(admin1, UserManager.DISALLOW_UNMUTE_MICROPHONE);
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
-                MockUtils.checkUserRestrictions(),
                 MockUtils.checkUserRestrictions(UserManager.DISALLOW_ADJUST_VOLUME,
-                        UserManager.DISALLOW_UNMUTE_MICROPHONE)
-        );
+                        UserManager.DISALLOW_UNMUTE_MICROPHONE),
+                eq(true), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         dpm.clearUserRestriction(admin1, UserManager.DISALLOW_ADJUST_VOLUME);
         dpm.clearUserRestriction(admin1, UserManager.DISALLOW_UNMUTE_MICROPHONE);
-
+        reset(mContext.userManagerInternal);
 
         // More tests.
         dpm.addUserRestriction(admin1, UserManager.DISALLOW_ADD_USER);
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
-                MockUtils.checkUserRestrictions(),
-                MockUtils.checkUserRestrictions(UserManager.DISALLOW_ADD_USER)
-        );
+                MockUtils.checkUserRestrictions(UserManager.DISALLOW_ADD_USER),
+                eq(true), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         dpm.addUserRestriction(admin1, UserManager.DISALLOW_FUN);
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
-                MockUtils.checkUserRestrictions(),
                 MockUtils.checkUserRestrictions(UserManager.DISALLOW_FUN,
-                        UserManager.DISALLOW_ADD_USER)
-        );
+                        UserManager.DISALLOW_ADD_USER),
+                eq(true), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         dpm.setCameraDisabled(admin1, true);
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
                 // DISALLOW_CAMERA will be applied to both local and global.
-                MockUtils.checkUserRestrictions(UserManager.DISALLOW_CAMERA),
                 MockUtils.checkUserRestrictions(UserManager.DISALLOW_FUN,
-                        UserManager.DISALLOW_CAMERA, UserManager.DISALLOW_ADD_USER)
-        );
+                        UserManager.DISALLOW_ADD_USER),
+                eq(true), eq(CAMERA_DISABLED_GLOBALLY));
         reset(mContext.userManagerInternal);
 
         // Set up another DA and let it disable camera.  Now DISALLOW_CAMERA will only be applied
@@ -1407,11 +1408,10 @@
 
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
-                // DISALLOW_CAMERA will be applied to both local and global.
-                MockUtils.checkUserRestrictions(UserManager.DISALLOW_CAMERA),
+                // DISALLOW_CAMERA will be applied to both local and global. <- TODO: fix this
                 MockUtils.checkUserRestrictions(UserManager.DISALLOW_FUN,
-                        UserManager.DISALLOW_ADD_USER)
-        );
+                        UserManager.DISALLOW_ADD_USER),
+                eq(true), eq(CAMERA_DISABLED_LOCALLY));
         reset(mContext.userManagerInternal);
         // TODO Make sure restrictions are written to the file.
     }
@@ -1429,8 +1429,7 @@
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(DpmMockContext.CALLER_USER_HANDLE),
                 MockUtils.checkUserRestrictions(UserManager.DISALLOW_INSTALL_UNKNOWN_SOURCES),
-                isNull(Bundle.class)
-        );
+                eq(false), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         dpm.addUserRestriction(admin1, UserManager.DISALLOW_OUTGOING_CALLS);
@@ -1438,8 +1437,7 @@
                 eq(DpmMockContext.CALLER_USER_HANDLE),
                 MockUtils.checkUserRestrictions(UserManager.DISALLOW_INSTALL_UNKNOWN_SOURCES,
                         UserManager.DISALLOW_OUTGOING_CALLS),
-                isNull(Bundle.class)
-        );
+                eq(false), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         DpmTestUtils.assertRestrictions(
@@ -1462,8 +1460,7 @@
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(DpmMockContext.CALLER_USER_HANDLE),
                 MockUtils.checkUserRestrictions(UserManager.DISALLOW_OUTGOING_CALLS),
-                isNull(Bundle.class)
-        );
+                eq(false), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         DpmTestUtils.assertRestrictions(
@@ -1484,8 +1481,7 @@
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(DpmMockContext.CALLER_USER_HANDLE),
                 MockUtils.checkUserRestrictions(),
-                isNull(Bundle.class)
-        );
+                eq(false), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         DpmTestUtils.assertRestrictions(
@@ -1507,18 +1503,15 @@
                 eq(DpmMockContext.CALLER_USER_HANDLE),
                 MockUtils.checkUserRestrictions(UserManager.DISALLOW_ADJUST_VOLUME,
                         UserManager.DISALLOW_UNMUTE_MICROPHONE),
-                isNull(Bundle.class)
-        );
+                eq(false), eq(CAMERA_NOT_DISABLED));
         reset(mContext.userManagerInternal);
 
         dpm.setCameraDisabled(admin1, true);
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(DpmMockContext.CALLER_USER_HANDLE),
-                MockUtils.checkUserRestrictions(UserManager.DISALLOW_CAMERA,
-                        UserManager.DISALLOW_ADJUST_VOLUME,
+                MockUtils.checkUserRestrictions(UserManager.DISALLOW_ADJUST_VOLUME,
                         UserManager.DISALLOW_UNMUTE_MICROPHONE),
-                isNull(Bundle.class)
-        );
+                eq(false), eq(CAMERA_DISABLED_LOCALLY));
         reset(mContext.userManagerInternal);
 
         // TODO Make sure restrictions are written to the file.
@@ -1558,7 +1551,8 @@
         verify(mContext.userManagerInternal).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
                 MockUtils.checkUserRestrictions(defaultRestrictions),
-                MockUtils.checkUserRestrictions()
+                eq(true) /* isDeviceOwner */,
+                eq(CAMERA_NOT_DISABLED)
         );
         reset(mContext.userManagerInternal);
 
@@ -1600,7 +1594,8 @@
             verify(mContext.userManagerInternal, atLeast(1)).setDevicePolicyUserRestrictions(
                 eq(UserHandle.USER_SYSTEM),
                 MockUtils.checkUserRestrictions(newDefaultEnabledRestriction),
-                MockUtils.checkUserRestrictions()
+                eq(true) /* isDeviceOwner */,
+                eq(CAMERA_NOT_DISABLED)
             );
             reset(mContext.userManagerInternal);
 
@@ -2124,8 +2119,37 @@
         setupDeviceOwner();
         mContext.callerPermissions.add(permission.MANAGE_PROFILE_AND_DEVICE_OWNERS);
 
-        final long MINIMUM_STRONG_AUTH_TIMEOUT_MS = 1 * 60 * 60 * 1000; // 1h
-        final long ONE_MINUTE = 60 * 1000;
+        final long MINIMUM_STRONG_AUTH_TIMEOUT_MS = TimeUnit.HOURS.toMillis(1);
+        final long ONE_MINUTE = TimeUnit.MINUTES.toMillis(1);
+        final long MIN_PLUS_ONE_MINUTE = MINIMUM_STRONG_AUTH_TIMEOUT_MS + ONE_MINUTE;
+        final long MAX_MINUS_ONE_MINUTE = DevicePolicyManager.DEFAULT_STRONG_AUTH_TIMEOUT_MS
+                - ONE_MINUTE;
+
+        // verify that the minimum timeout cannot be modified on user builds (system property is
+        // not being read)
+        mContext.buildMock.isDebuggable = false;
+
+        dpm.setRequiredStrongAuthTimeout(admin1, MAX_MINUS_ONE_MINUTE);
+        assertEquals(dpm.getRequiredStrongAuthTimeout(admin1), MAX_MINUS_ONE_MINUTE);
+        assertEquals(dpm.getRequiredStrongAuthTimeout(null), MAX_MINUS_ONE_MINUTE);
+
+        verify(mContext.systemProperties, never()).getLong(anyString(), anyLong());
+
+        // restore to the debuggable build state
+        mContext.buildMock.isDebuggable = true;
+
+        // Always return the default (second arg) when getting system property for long type
+        when(mContext.systemProperties.getLong(anyString(), anyLong())).thenAnswer(
+                new Answer<Long>() {
+                    @Override
+                    public Long answer(InvocationOnMock invocation) throws Throwable {
+                        return (Long) invocation.getArguments()[1];
+                    }
+                }
+        );
+
+        // reset to default (0 means the admin is not participating, so default should be returned)
+        dpm.setRequiredStrongAuthTimeout(admin1, 0);
 
         // aggregation should be the default if unset by any admin
         assertEquals(dpm.getRequiredStrongAuthTimeout(null),
@@ -2142,7 +2166,7 @@
         assertEquals(dpm.getRequiredStrongAuthTimeout(null),
                 DevicePolicyManager.DEFAULT_STRONG_AUTH_TIMEOUT_MS);
 
-        // 0 means default
+        // 0 means the admin is not participating, so default should be returned
         dpm.setRequiredStrongAuthTimeout(admin1, 0);
         assertEquals(dpm.getRequiredStrongAuthTimeout(admin1), 0);
         assertEquals(dpm.getRequiredStrongAuthTimeout(null),
@@ -2153,12 +2177,14 @@
         assertEquals(dpm.getRequiredStrongAuthTimeout(admin1), MINIMUM_STRONG_AUTH_TIMEOUT_MS);
         assertEquals(dpm.getRequiredStrongAuthTimeout(null), MINIMUM_STRONG_AUTH_TIMEOUT_MS);
 
-        // value within range
-        dpm.setRequiredStrongAuthTimeout(admin1, MINIMUM_STRONG_AUTH_TIMEOUT_MS + ONE_MINUTE);
-        assertEquals(dpm.getRequiredStrongAuthTimeout(admin1), MINIMUM_STRONG_AUTH_TIMEOUT_MS
-                + ONE_MINUTE);
-        assertEquals(dpm.getRequiredStrongAuthTimeout(null), MINIMUM_STRONG_AUTH_TIMEOUT_MS
-                + ONE_MINUTE);
+        // values within range
+        dpm.setRequiredStrongAuthTimeout(admin1, MIN_PLUS_ONE_MINUTE);
+        assertEquals(dpm.getRequiredStrongAuthTimeout(admin1), MIN_PLUS_ONE_MINUTE);
+        assertEquals(dpm.getRequiredStrongAuthTimeout(null), MIN_PLUS_ONE_MINUTE);
+
+        dpm.setRequiredStrongAuthTimeout(admin1, MAX_MINUS_ONE_MINUTE);
+        assertEquals(dpm.getRequiredStrongAuthTimeout(admin1), MAX_MINUS_ONE_MINUTE);
+        assertEquals(dpm.getRequiredStrongAuthTimeout(null), MAX_MINUS_ONE_MINUTE);
 
         // reset to default
         dpm.setRequiredStrongAuthTimeout(admin1, 0);
@@ -3207,6 +3233,48 @@
         }
     }
 
+    public void testGetPermissionGrantState() throws Exception {
+        final String permission = "some.permission";
+        final String app1 = "com.example.app1";
+        final String app2 = "com.example.app2";
+
+        when(mContext.ipackageManager.checkPermission(eq(permission), eq(app1), anyInt()))
+                .thenReturn(PackageManager.PERMISSION_GRANTED);
+        doReturn(PackageManager.FLAG_PERMISSION_POLICY_FIXED).when(mContext.packageManager)
+                .getPermissionFlags(permission, app1, UserHandle.SYSTEM);
+        when(mContext.packageManager.getPermissionFlags(permission, app1,
+                UserHandle.of(DpmMockContext.CALLER_USER_HANDLE)))
+                .thenReturn(PackageManager.FLAG_PERMISSION_POLICY_FIXED);
+        when(mContext.ipackageManager.checkPermission(eq(permission), eq(app2), anyInt()))
+                .thenReturn(PackageManager.PERMISSION_DENIED);
+        doReturn(0).when(mContext.packageManager).getPermissionFlags(permission, app2,
+                UserHandle.SYSTEM);
+        when(mContext.packageManager.getPermissionFlags(permission, app2,
+                UserHandle.of(DpmMockContext.CALLER_USER_HANDLE))).thenReturn(0);
+
+        // System can retrieve permission grant state.
+        mContext.binder.callingUid = DpmMockContext.SYSTEM_UID;
+        assertEquals(DevicePolicyManager.PERMISSION_GRANT_STATE_GRANTED,
+                dpm.getPermissionGrantState(null, app1, permission));
+        assertEquals(DevicePolicyManager.PERMISSION_GRANT_STATE_DEFAULT,
+                dpm.getPermissionGrantState(null, app2, permission));
+
+        // A regular app cannot retrieve permission grant state.
+        mMockContext.binder.callingUid = DpmMockContext.CALLER_UID;
+        try {
+            dpm.getPermissionGrantState(null, app1, permission);
+            fail("Didn't throw IllegalStateException");
+        } catch (IllegalStateException expected) {
+        }
+
+        // Profile owner can retrieve permission grant state.
+        setAsProfileOwner(admin1);
+        assertEquals(DevicePolicyManager.PERMISSION_GRANT_STATE_GRANTED,
+                dpm.getPermissionGrantState(admin1, app1, permission));
+        assertEquals(DevicePolicyManager.PERMISSION_GRANT_STATE_DEFAULT,
+                dpm.getPermissionGrantState(admin1, app2, permission));
+    }
+
     private void setUserSetupCompleteForUser(boolean isUserSetupComplete, int userhandle) {
         when(mContext.settings.settingsSecureGetIntForUser(Settings.Secure.USER_SETUP_COMPLETE, 0,
                 userhandle)).thenReturn(isUserSetupComplete ? 1 : 0);
diff --git a/services/tests/servicestests/src/com/android/server/pm/InstallerTest.java b/services/tests/servicestests/src/com/android/server/pm/InstallerTest.java
index 5ab9020..b5a6178 100644
--- a/services/tests/servicestests/src/com/android/server/pm/InstallerTest.java
+++ b/services/tests/servicestests/src/com/android/server/pm/InstallerTest.java
@@ -80,11 +80,19 @@
     }
 
     public void testGetAppSize() throws Exception {
+        int[] appIds = null;
+
         final PackageManager pm = getContext().getPackageManager();
         for (ApplicationInfo app : pm.getInstalledApplications(0)) {
             final int userId = UserHandle.getUserId(app.uid);
             final int appId = UserHandle.getAppId(app.uid);
 
+            if (ArrayUtils.contains(appIds, appId)) {
+                continue;
+            } else {
+                appIds = ArrayUtils.appendInt(appIds, appId);
+            }
+
             final String[] packageNames = pm.getPackagesForUid(app.uid);
             final long[] ceDataInodes = new long[packageNames.length];
             final String[] codePaths = new String[packageNames.length];
diff --git a/services/tests/servicestests/src/com/android/server/pm/ShortcutManagerTest10.java b/services/tests/servicestests/src/com/android/server/pm/ShortcutManagerTest10.java
new file mode 100644
index 0000000..ca1e6af
--- /dev/null
+++ b/services/tests/servicestests/src/com/android/server/pm/ShortcutManagerTest10.java
@@ -0,0 +1,183 @@
+/*
+ * Copyright (C) 2017 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package com.android.server.pm;
+
+import static com.android.server.pm.shortcutmanagertest.ShortcutManagerTestUtils
+        .assertExpectException;
+import static com.android.server.pm.shortcutmanagertest.ShortcutManagerTestUtils.list;
+
+import android.content.ComponentName;
+import android.content.Intent;
+import android.content.pm.LauncherActivityInfo;
+import android.content.pm.LauncherApps.PinItemRequest;
+import android.content.pm.ShortcutInfo;
+import android.content.pm.ShortcutManager;
+import android.os.Process;
+import android.test.suitebuilder.annotation.SmallTest;
+
+import static org.mockito.Mockito.*;
+
+/**
+ * Tests for {@link ShortcutManager#createShortcutResultIntent(ShortcutInfo)} and relevant APIs.
+ *
+ m FrameworksServicesTests &&
+ adb install \
+ -r -g ${ANDROID_PRODUCT_OUT}/data/app/FrameworksServicesTests/FrameworksServicesTests.apk &&
+ adb shell am instrument -e class com.android.server.pm.ShortcutManagerTest10 \
+ -w com.android.frameworks.servicestests/android.support.test.runner.AndroidJUnitRunner
+ */
+@SmallTest
+public class ShortcutManagerTest10 extends BaseShortcutManagerTest {
+
+    private PinItemRequest mRequest;
+
+    private PinItemRequest verifyAndGetCreateShortcutResult(Intent resultIntent) {
+        PinItemRequest request = mLauncherApps.getPinItemRequest(resultIntent);
+        assertNotNull(request);
+        assertEquals(PinItemRequest.REQUEST_TYPE_SHORTCUT, request.getRequestType());
+        return request;
+    }
+
+    public void testCreateShortcutResult_noDefaultLauncher() {
+        runWithCaller(CALLING_PACKAGE_1, USER_P0, () -> {
+            ShortcutInfo s1 = makeShortcut("s1");
+            assertNull(mManager.createShortcutResultIntent(s1));
+        });
+    }
+
+    public void testCreateShortcutResult_validResult() {
+        setDefaultLauncher(USER_0, mMainActivityFetcher.apply(LAUNCHER_1, USER_0));
+
+        runWithCaller(CALLING_PACKAGE_1, USER_P0, () -> {
+            ShortcutInfo s1 = makeShortcut("s1");
+            Intent intent = mManager.createShortcutResultIntent(s1);
+            mRequest = verifyAndGetCreateShortcutResult(intent);
+        });
+
+        runWithCaller(LAUNCHER_1, USER_0, () -> {
+            assertTrue(mRequest.isValid());
+            assertTrue(mRequest.accept());
+        });
+    }
+
+    public void testCreateShortcutResult_alreadyPinned() {
+        setDefaultLauncher(USER_0, mMainActivityFetcher.apply(LAUNCHER_1, USER_0));
+
+        runWithCaller(CALLING_PACKAGE_1, USER_P0, () -> {
+            assertTrue(mManager.setDynamicShortcuts(list(makeShortcut("s1"))));
+        });
+
+        runWithCaller(LAUNCHER_1, USER_0, () -> {
+            mLauncherApps.pinShortcuts(CALLING_PACKAGE_1, list("s1"), HANDLE_USER_P0);
+        });
+
+        runWithCaller(CALLING_PACKAGE_1, USER_P0, () -> {
+            ShortcutInfo s1 = makeShortcut("s1");
+            Intent intent = mManager.createShortcutResultIntent(s1);
+            mRequest = verifyAndGetCreateShortcutResult(intent);
+        });
+
+        runWithCaller(LAUNCHER_1, USER_0, () -> {
+            assertTrue(mRequest.isValid());
+            assertTrue(mRequest.getShortcutInfo().isPinned());
+            assertTrue(mRequest.accept());
+        });
+    }
+
+    public void testCreateShortcutResult_alreadyPinnedByAnother() {
+        runWithCaller(CALLING_PACKAGE_1, USER_P0, () -> {
+            assertTrue(mManager.setDynamicShortcuts(list(makeShortcut("s1"))));
+        });
+
+        // Initially all launchers have the shortcut permission, until we call setDefaultLauncher().
+        runWithCaller(LAUNCHER_2, USER_0, () -> {
+            mLauncherApps.pinShortcuts(CALLING_PACKAGE_1, list("s1"), HANDLE_USER_P0);
+        });
+
+        setDefaultLauncher(USER_0, mMainActivityFetcher.apply(LAUNCHER_1, USER_0));
+        runWithCaller(CALLING_PACKAGE_1, USER_P0, () -> {
+            ShortcutInfo s1 = makeShortcut("s1");
+            Intent intent = mManager.createShortcutResultIntent(s1);
+            mRequest = verifyAndGetCreateShortcutResult(intent);
+        });
+
+        runWithCaller(LAUNCHER_1, USER_0, () -> {
+            assertTrue(mRequest.isValid());
+            assertFalse(mRequest.getShortcutInfo().isPinned());
+            assertTrue(mRequest.accept());
+        });
+    }
+
+    public void testCreateShortcutResult_defaultLauncherChanges() {
+        setDefaultLauncher(USER_0, mMainActivityFetcher.apply(LAUNCHER_1, USER_0));
+
+        runWithCaller(CALLING_PACKAGE_1, USER_P0, () -> {
+            ShortcutInfo s1 = makeShortcut("s1");
+            Intent intent = mManager.createShortcutResultIntent(s1);
+            mRequest = verifyAndGetCreateShortcutResult(intent);
+        });
+
+        setDefaultLauncher(USER_0, mMainActivityFetcher.apply(LAUNCHER_2, USER_0));
+        // Verify that other launcher can't use this request
+        runWithCaller(LAUNCHER_2, USER_0, () -> {
+            assertFalse(mRequest.isValid());
+            assertExpectException(SecurityException.class, "Calling uid mismatch",
+                    mRequest::accept);
+        });
+
+        runWithCaller(LAUNCHER_1, USER_0, () -> {
+            // Set some random caller UID.
+            mInjectedCallingUid = 12345;
+
+            assertFalse(mRequest.isValid());
+            assertExpectException(SecurityException.class, "Calling uid mismatch",
+                    mRequest::accept);
+        });
+
+        runWithCaller(LAUNCHER_1, USER_0, () -> {
+            assertTrue(mRequest.isValid());
+            assertTrue(mRequest.accept());
+        });
+    }
+
+    private LauncherActivityInfo setupMockActivityInfo() {
+        doReturn(getTestContext().getPackageName()).when(mServiceContext).getPackageName();
+        doReturn(getTestContext().getContentResolver()).when(mServiceContext).getContentResolver();
+
+        LauncherActivityInfo info = mock(LauncherActivityInfo.class);
+        when(info.getComponentName()).thenReturn(
+                new ComponentName(getTestContext(), "a.ShortcutConfigActivity"));
+        when(info.getUser()).thenReturn(Process.myUserHandle());
+        return info;
+    }
+
+    public void testStartConfigActivity_defaultLauncher() {
+        LauncherActivityInfo info = setupMockActivityInfo();
+        setDefaultLauncher(USER_0, mMainActivityFetcher.apply(LAUNCHER_1, USER_0));
+        runWithCaller(LAUNCHER_1, USER_0, () ->
+            assertNotNull(mLauncherApps.getShortcutConfigActivityIntent(info))
+        );
+    }
+
+    public void testStartConfigActivity_nonDefaultLauncher() {
+        LauncherActivityInfo info = setupMockActivityInfo();
+        setDefaultLauncher(USER_0, mMainActivityFetcher.apply(LAUNCHER_1, USER_0));
+        runWithCaller(LAUNCHER_2, USER_0, () ->
+            assertExpectException(SecurityException.class, null, () ->
+                    mLauncherApps.getShortcutConfigActivityIntent(info))
+        );
+    }
+}
diff --git a/services/tests/servicestests/src/com/android/server/pm/ShortcutManagerTest8.java b/services/tests/servicestests/src/com/android/server/pm/ShortcutManagerTest8.java
index bcd72fc..df275d2 100644
--- a/services/tests/servicestests/src/com/android/server/pm/ShortcutManagerTest8.java
+++ b/services/tests/servicestests/src/com/android/server/pm/ShortcutManagerTest8.java
@@ -1421,6 +1421,35 @@
         });
     }
 
+    public void testRequestPinShortcut_wrongLauncherCannotAccept() {
+        setDefaultLauncher(USER_0, mMainActivityFetcher.apply(LAUNCHER_1, USER_0));
+
+        runWithCaller(CALLING_PACKAGE_1, USER_P0, () -> {
+            ShortcutInfo s1 = makeShortcut("s1");
+            assertTrue(mManager.requestPinShortcut(s1, null));
+            verify(mServiceContext, times(0)).sendIntentSender(any(IntentSender.class));
+        });
+
+        final ArgumentCaptor<Intent> intent = ArgumentCaptor.forClass(Intent.class);
+        verify(mServiceContext).startActivityAsUser(intent.capture(), eq(HANDLE_USER_0));
+        final PinItemRequest request = mLauncherApps.getPinItemRequest(intent.getValue());
+
+        // Verify that other launcher can't use this request
+        runWithCaller(LAUNCHER_1, USER_0, () -> {
+            // Set some random caller UID.
+            mInjectedCallingUid = 12345;
+
+            assertFalse(request.isValid());
+            assertExpectException(SecurityException.class, "Calling uid mismatch", request::accept);
+        });
+
+        // The default launcher can still use this request
+        runWithCaller(LAUNCHER_1, USER_0, () -> {
+            assertTrue(request.isValid());
+            assertTrue(request.accept());
+        });
+    }
+
     // TODO More tests:
 
     // Cancel previous pending request and release memory?
diff --git a/services/tests/servicestests/src/com/android/server/pm/UserRestrictionsUtilsTest.java b/services/tests/servicestests/src/com/android/server/pm/UserRestrictionsUtilsTest.java
index 11f9ebb..480be2e 100644
--- a/services/tests/servicestests/src/com/android/server/pm/UserRestrictionsUtilsTest.java
+++ b/services/tests/servicestests/src/com/android/server/pm/UserRestrictionsUtilsTest.java
@@ -16,13 +16,16 @@
 
 package com.android.server.pm;
 
+import static com.android.server.devicepolicy.DpmTestUtils.assertRestrictions;
+import static com.android.server.devicepolicy.DpmTestUtils.newRestrictions;
+
 import android.os.Bundle;
 import android.os.UserHandle;
 import android.os.UserManager;
+import android.os.UserManagerInternal;
 import android.test.AndroidTestCase;
 import android.test.suitebuilder.annotation.SmallTest;
-
-import com.android.server.devicepolicy.DpmTestUtils;
+import android.util.SparseArray;
 
 /**
  * Tests for {@link com.android.server.pm.UserRestrictionsUtils}.
@@ -49,14 +52,14 @@
     public void testIsEmpty() {
         assertTrue(UserRestrictionsUtils.isEmpty(null));
         assertTrue(UserRestrictionsUtils.isEmpty(new Bundle()));
-        assertFalse(UserRestrictionsUtils.isEmpty(DpmTestUtils.newRestrictions("a")));
+        assertFalse(UserRestrictionsUtils.isEmpty(newRestrictions("a")));
     }
 
     public void testClone() {
         Bundle in = new Bundle();
         Bundle out = UserRestrictionsUtils.clone(in);
         assertNotSame(in, out);
-        DpmTestUtils.assertRestrictions(out, new Bundle());
+        assertRestrictions(out, new Bundle());
 
         out = UserRestrictionsUtils.clone(null);
         assertNotNull(out);
@@ -64,16 +67,16 @@
     }
 
     public void testMerge() {
-        Bundle a = DpmTestUtils.newRestrictions("a", "d");
-        Bundle b = DpmTestUtils.newRestrictions("b", "d", "e");
+        Bundle a = newRestrictions("a", "d");
+        Bundle b = newRestrictions("b", "d", "e");
 
         UserRestrictionsUtils.merge(a, b);
 
-        DpmTestUtils.assertRestrictions(DpmTestUtils.newRestrictions("a", "b", "d", "e"), a);
+        assertRestrictions(newRestrictions("a", "b", "d", "e"), a);
 
         UserRestrictionsUtils.merge(a, null);
 
-        DpmTestUtils.assertRestrictions(DpmTestUtils.newRestrictions("a", "b", "d", "e"), a);
+        assertRestrictions(newRestrictions("a", "b", "d", "e"), a);
 
         try {
             UserRestrictionsUtils.merge(a, a);
@@ -114,25 +117,32 @@
         final Bundle local = new Bundle();
         final Bundle global = new Bundle();
 
-        UserRestrictionsUtils.sortToGlobalAndLocal(null, global, local);
+        UserRestrictionsUtils.sortToGlobalAndLocal(null, false /* isDeviceOwner */,
+                UserManagerInternal.CAMERA_NOT_DISABLED, global, local);
         assertEquals(0, global.size());
         assertEquals(0, local.size());
 
-        UserRestrictionsUtils.sortToGlobalAndLocal(Bundle.EMPTY, global, local);
+        UserRestrictionsUtils.sortToGlobalAndLocal(Bundle.EMPTY, false /* isDeviceOwner */,
+                UserManagerInternal.CAMERA_NOT_DISABLED, global, local);
         assertEquals(0, global.size());
         assertEquals(0, local.size());
 
-        UserRestrictionsUtils.sortToGlobalAndLocal(DpmTestUtils.newRestrictions(
+        // Restrictions set by DO.
+        UserRestrictionsUtils.sortToGlobalAndLocal(newRestrictions(
                 UserManager.DISALLOW_ADJUST_VOLUME,
                 UserManager.DISALLOW_UNMUTE_MICROPHONE,
                 UserManager.DISALLOW_USB_FILE_TRANSFER,
                 UserManager.DISALLOW_CONFIG_TETHERING,
                 UserManager.DISALLOW_OUTGOING_BEAM,
-                UserManager.DISALLOW_APPS_CONTROL
-        ), global, local);
+                UserManager.DISALLOW_APPS_CONTROL,
+                UserManager.ENSURE_VERIFY_APPS
+        ), true /* isDeviceOwner */, UserManagerInternal.CAMERA_NOT_DISABLED, global, local);
 
 
-        DpmTestUtils.assertRestrictions(DpmTestUtils.newRestrictions(
+        assertRestrictions(newRestrictions(
+                // This one is global no matter who sets it.
+                UserManager.ENSURE_VERIFY_APPS,
+
                 // These can be set by PO too, but when DO sets them, they're global.
                 UserManager.DISALLOW_ADJUST_VOLUME,
                 UserManager.DISALLOW_UNMUTE_MICROPHONE,
@@ -142,11 +152,117 @@
                 UserManager.DISALLOW_CONFIG_TETHERING
         ), global);
 
-        DpmTestUtils.assertRestrictions(DpmTestUtils.newRestrictions(
+        assertRestrictions(newRestrictions(
                 // They can be set by both DO/PO.
                 UserManager.DISALLOW_OUTGOING_BEAM,
                 UserManager.DISALLOW_APPS_CONTROL
         ), local);
+
+        local.clear();
+        global.clear();
+
+        // Restrictions set by PO.
+        UserRestrictionsUtils.sortToGlobalAndLocal(newRestrictions(
+                UserManager.DISALLOW_ADJUST_VOLUME,
+                UserManager.DISALLOW_UNMUTE_MICROPHONE,
+                UserManager.DISALLOW_USB_FILE_TRANSFER,
+                UserManager.DISALLOW_CONFIG_TETHERING,
+                UserManager.DISALLOW_OUTGOING_BEAM,
+                UserManager.DISALLOW_APPS_CONTROL,
+                UserManager.ENSURE_VERIFY_APPS
+        ), false /* isDeviceOwner */, UserManagerInternal.CAMERA_NOT_DISABLED, global, local);
+
+        assertRestrictions(newRestrictions(
+                // This one is global no matter who sets it.
+                UserManager.ENSURE_VERIFY_APPS
+        ), global);
+
+        assertRestrictions(newRestrictions(
+                // These can be set by PO too, but when PO sets them, they're local.
+                UserManager.DISALLOW_ADJUST_VOLUME,
+                UserManager.DISALLOW_UNMUTE_MICROPHONE,
+
+                // They can be set by both DO/PO.
+                UserManager.DISALLOW_OUTGOING_BEAM,
+                UserManager.DISALLOW_APPS_CONTROL,
+
+                // These can only be set by DO.
+                UserManager.DISALLOW_USB_FILE_TRANSFER,
+                UserManager.DISALLOW_CONFIG_TETHERING
+        ), local);
+
+    }
+
+    public void testSortToLocalAndGlobalWithCameraDisabled() {
+        final Bundle local = new Bundle();
+        final Bundle global = new Bundle();
+
+        UserRestrictionsUtils.sortToGlobalAndLocal(Bundle.EMPTY, false,
+                UserManagerInternal.CAMERA_DISABLED_GLOBALLY, global, local);
+        assertRestrictions(newRestrictions(UserManager.DISALLOW_CAMERA), global);
+        assertEquals(0, local.size());
+        global.clear();
+
+        UserRestrictionsUtils.sortToGlobalAndLocal(Bundle.EMPTY, false,
+                UserManagerInternal.CAMERA_DISABLED_LOCALLY, global, local);
+        assertEquals(0, global.size());
+        assertRestrictions(newRestrictions(UserManager.DISALLOW_CAMERA), local);
+    }
+
+    public void testMergeAll() {
+        SparseArray<Bundle> restrictions = new SparseArray<>();
+        assertNull(UserRestrictionsUtils.mergeAll(restrictions));
+
+        restrictions.put(0, newRestrictions(UserManager.DISALLOW_ADJUST_VOLUME));
+        restrictions.put(1, newRestrictions(UserManager.DISALLOW_USB_FILE_TRANSFER));
+        restrictions.put(2, newRestrictions(UserManager.DISALLOW_APPS_CONTROL));
+
+        Bundle result = UserRestrictionsUtils.mergeAll(restrictions);
+        assertRestrictions(
+                newRestrictions(
+                        UserManager.DISALLOW_ADJUST_VOLUME,
+                        UserManager.DISALLOW_USB_FILE_TRANSFER,
+                        UserManager.DISALLOW_APPS_CONTROL),
+                result);
+    }
+
+    public void testMoveRestriction() {
+        SparseArray<Bundle> localRestrictions = new SparseArray<>();
+        SparseArray<Bundle> globalRestrictions = new SparseArray<>();
+
+        // User 0 has only local restrictions, nothing should change.
+        localRestrictions.put(0, newRestrictions(UserManager.DISALLOW_ADJUST_VOLUME));
+        // User 1 has a local restriction to be moved to global and some global already. Local
+        // restrictions should be removed for this user.
+        localRestrictions.put(1, newRestrictions(UserManager.ENSURE_VERIFY_APPS));
+        globalRestrictions.put(1, newRestrictions(UserManager.DISALLOW_ADD_USER));
+        // User 2 has a local restriction to be moved and one to leave local.
+        localRestrictions.put(2, newRestrictions(
+                UserManager.ENSURE_VERIFY_APPS,
+                UserManager.DISALLOW_CONFIG_VPN));
+
+        UserRestrictionsUtils.moveRestriction(
+                UserManager.ENSURE_VERIFY_APPS, localRestrictions, globalRestrictions);
+
+        // Check user 0.
+        assertRestrictions(
+                newRestrictions(UserManager.DISALLOW_ADJUST_VOLUME),
+                localRestrictions.get(0));
+        assertNull(globalRestrictions.get(0));
+
+        // Check user 1.
+        assertNull(localRestrictions.get(1));
+        assertRestrictions(
+                newRestrictions(UserManager.ENSURE_VERIFY_APPS, UserManager.DISALLOW_ADD_USER),
+                globalRestrictions.get(1));
+
+        // Check user 2.
+        assertRestrictions(
+                newRestrictions(UserManager.DISALLOW_CONFIG_VPN),
+                localRestrictions.get(2));
+        assertRestrictions(
+                newRestrictions(UserManager.ENSURE_VERIFY_APPS),
+                globalRestrictions.get(2));
     }
 
     public void testAreEqual() {
@@ -172,33 +288,33 @@
 
         assertFalse(UserRestrictionsUtils.areEqual(
                 null,
-                DpmTestUtils.newRestrictions("a")));
+                newRestrictions("a")));
 
         assertFalse(UserRestrictionsUtils.areEqual(
-                DpmTestUtils.newRestrictions("a"),
+                newRestrictions("a"),
                 null));
 
         assertTrue(UserRestrictionsUtils.areEqual(
-                DpmTestUtils.newRestrictions("a"),
-                DpmTestUtils.newRestrictions("a")));
+                newRestrictions("a"),
+                newRestrictions("a")));
 
         assertFalse(UserRestrictionsUtils.areEqual(
-                DpmTestUtils.newRestrictions("a"),
-                DpmTestUtils.newRestrictions("a", "b")));
+                newRestrictions("a"),
+                newRestrictions("a", "b")));
 
         assertFalse(UserRestrictionsUtils.areEqual(
-                DpmTestUtils.newRestrictions("a", "b"),
-                DpmTestUtils.newRestrictions("a")));
+                newRestrictions("a", "b"),
+                newRestrictions("a")));
 
         assertFalse(UserRestrictionsUtils.areEqual(
-                DpmTestUtils.newRestrictions("b", "a"),
-                DpmTestUtils.newRestrictions("a", "a")));
+                newRestrictions("b", "a"),
+                newRestrictions("a", "a")));
 
         // Make sure false restrictions are handled correctly.
-        final Bundle a = DpmTestUtils.newRestrictions("a");
+        final Bundle a = newRestrictions("a");
         a.putBoolean("b", true);
 
-        final Bundle b = DpmTestUtils.newRestrictions("a");
+        final Bundle b = newRestrictions("a");
         b.putBoolean("b", false);
 
         assertFalse(UserRestrictionsUtils.areEqual(a, b));
diff --git a/services/tests/servicestests/src/com/android/server/policy/AccessibilityShortcutControllerTest.java b/services/tests/servicestests/src/com/android/server/policy/AccessibilityShortcutControllerTest.java
new file mode 100644
index 0000000..e2aff16
--- /dev/null
+++ b/services/tests/servicestests/src/com/android/server/policy/AccessibilityShortcutControllerTest.java
@@ -0,0 +1,268 @@
+/*
+ * Copyright (C) 2016 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.policy;
+
+import android.accessibilityservice.AccessibilityServiceInfo;
+import android.app.AlertDialog;
+import android.content.ComponentName;
+import android.content.Context;
+import android.content.DialogInterface;
+import android.content.pm.ResolveInfo;
+import android.content.res.Resources;
+import android.os.Handler;
+import android.provider.Settings;
+import android.support.test.runner.AndroidJUnit4;
+
+import android.test.mock.MockContentResolver;
+import android.text.TextUtils;
+import android.view.Window;
+import android.view.WindowManager;
+import android.view.accessibility.AccessibilityManager;
+import android.view.accessibility.IAccessibilityManager;
+import android.widget.Toast;
+import com.android.internal.R;
+import com.android.internal.util.test.FakeSettingsProvider;
+import com.android.server.policy.AccessibilityShortcutController.FrameworkObjectProvider;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+import org.mockito.ArgumentCaptor;
+import org.mockito.Mock;
+import org.mockito.MockitoAnnotations;
+import org.mockito.internal.util.reflection.Whitebox;
+
+import java.util.Collections;
+
+import static android.provider.Settings.Secure.ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN;
+import static android.provider.Settings.Secure.ACCESSIBILITY_SHORTCUT_TARGET_SERVICE;
+import static junit.framework.Assert.assertEquals;
+import static junit.framework.Assert.assertFalse;
+import static junit.framework.Assert.assertTrue;
+import static org.mockito.Matchers.anyBoolean;
+import static org.mockito.Matchers.anyInt;
+import static org.mockito.Matchers.anyObject;
+import static org.mockito.Matchers.eq;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.times;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.verifyZeroInteractions;
+import static org.mockito.Mockito.when;
+
+@RunWith(AndroidJUnit4.class)
+public class AccessibilityShortcutControllerTest {
+    private static final String SERVICE_NAME_STRING = "fake.package/fake.service.name";
+
+    private @Mock Context mContext;
+    private @Mock FrameworkObjectProvider mFrameworkObjectProvider;
+    private @Mock IAccessibilityManager mAccessibilityManagerService;
+    private @Mock Handler mHandler;
+    private @Mock AlertDialog.Builder mAlertDialogBuilder;
+    private @Mock AlertDialog mAlertDialog;
+    private @Mock AccessibilityServiceInfo mServiceInfo;
+    private @Mock Resources mResources;
+    private @Mock Toast mToast;
+
+    private MockContentResolver mContentResolver;
+
+    @Before
+    public void setUp() throws Exception {
+        MockitoAnnotations.initMocks(this);
+
+        mContentResolver = new MockContentResolver(mContext);
+        mContentResolver.addProvider(Settings.AUTHORITY, new FakeSettingsProvider());
+        when(mContext.getContentResolver()).thenReturn(mContentResolver);
+        when(mContext.getResources()).thenReturn(mResources);
+
+        when(mAccessibilityManagerService.getInstalledAccessibilityServiceList(anyInt()))
+                .thenReturn(Collections.singletonList(mServiceInfo));
+
+        // Use the extra level of indirection in the object to mock framework objects
+        AccessibilityManager accessibilityManager =
+                new AccessibilityManager(mHandler, mAccessibilityManagerService, 0);
+        when(mFrameworkObjectProvider.getAccessibilityManagerInstance(mContext))
+                .thenReturn(accessibilityManager);
+        when(mFrameworkObjectProvider.getAlertDialogBuilder(mContext))
+                .thenReturn(mAlertDialogBuilder);
+        when(mFrameworkObjectProvider.makeToastFromText(eq(mContext), anyObject(), anyInt()))
+                .thenReturn(mToast);
+
+        when(mResources.getString(anyInt())).thenReturn("Howdy %s");
+        ResolveInfo resolveInfo = mock(ResolveInfo.class);
+        when(resolveInfo.loadLabel(anyObject())).thenReturn("Service name");
+        when(mServiceInfo.getResolveInfo()).thenReturn(resolveInfo);
+        when(mServiceInfo.getComponentName())
+                .thenReturn(ComponentName.unflattenFromString(SERVICE_NAME_STRING));
+
+        when(mAlertDialogBuilder.setTitle(anyInt())).thenReturn(mAlertDialogBuilder);
+        when(mAlertDialogBuilder.setCancelable(anyBoolean())).thenReturn(mAlertDialogBuilder);
+        when(mAlertDialogBuilder.setMessage(anyObject())).thenReturn(mAlertDialogBuilder);
+        when(mAlertDialogBuilder.setPositiveButton(anyInt(), anyObject()))
+                .thenReturn(mAlertDialogBuilder);
+        when(mAlertDialogBuilder.setNegativeButton(anyInt(), anyObject()))
+                .thenReturn(mAlertDialogBuilder);
+        when(mAlertDialogBuilder.setOnCancelListener(anyObject())).thenReturn(mAlertDialogBuilder);
+        when(mAlertDialogBuilder.create()).thenReturn(mAlertDialog);
+
+        Window window = mock(Window.class);
+        Whitebox.setInternalState(window, "mWindowAttributes", new WindowManager.LayoutParams());
+        when(mAlertDialog.getWindow()).thenReturn(window);
+    }
+
+    @After
+    public void tearDown() {
+    }
+
+    @Test
+    public void testShortcutAvailable_withNullServiceIdWhenCreated_shouldReturnFalse() {
+        configureShortcutDisabled();
+        assertFalse(getController().isAccessibilityShortcutAvailable());
+    }
+
+    @Test
+    public void testShortcutAvailable_withNonNullServiceIdWhenCreated_shouldReturnTrue() {
+        configureShortcutEnabled();
+        assertTrue(getController().isAccessibilityShortcutAvailable());
+    }
+
+    @Test
+    public void testShortcutAvailable_whenServiceIdBecomesNull_shouldReturnFalse() {
+        configureShortcutEnabled();
+        AccessibilityShortcutController accessibilityShortcutController = getController();
+        Settings.Secure.putString(mContentResolver, ACCESSIBILITY_SHORTCUT_TARGET_SERVICE, "");
+        accessibilityShortcutController.onSettingsChanged();
+        assertFalse(accessibilityShortcutController.isAccessibilityShortcutAvailable());
+    }
+
+    @Test
+    public void testShortcutAvailable_whenServiceIdBecomesNonNull_shouldReturnTrue() {
+        configureShortcutDisabled();
+        AccessibilityShortcutController accessibilityShortcutController = getController();
+        configureShortcutEnabled();
+        accessibilityShortcutController.onSettingsChanged();
+        assertTrue(accessibilityShortcutController.isAccessibilityShortcutAvailable());
+    }
+
+    @Test
+    public void testOnAccessibilityShortcut_firstTime_showsWarningDialog()
+            throws Exception {
+        configureShortcutEnabled();
+        AccessibilityShortcutController accessibilityShortcutController = getController();
+        Settings.Secure.putInt(mContentResolver, ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 0);
+        accessibilityShortcutController.performAccessibilityShortcut();
+
+        assertEquals(1, Settings.Secure.getInt(
+                mContentResolver, ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 0));
+        verify(mResources).getString(R.string.accessibility_shortcut_toogle_warning);
+        verify(mAlertDialog).show();
+        verify(mAccessibilityManagerService).getInstalledAccessibilityServiceList(anyInt());
+        verify(mAccessibilityManagerService, times(0)).performAccessibilityShortcut();
+    }
+
+    @Test
+    public void testOnAccessibilityShortcut_withDialogShowing_callsServer()
+        throws Exception {
+        configureShortcutEnabled();
+        AccessibilityShortcutController accessibilityShortcutController = getController();
+        Settings.Secure.putInt(mContentResolver, ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 0);
+        accessibilityShortcutController.performAccessibilityShortcut();
+        accessibilityShortcutController.performAccessibilityShortcut();
+        verify(mToast).show();
+        verify(mAccessibilityManagerService, times(1)).performAccessibilityShortcut();
+    }
+
+    @Test
+    public void testOnAccessibilityShortcut_ifCanceledFirstTime_showsWarningDialog()
+        throws Exception {
+        configureShortcutEnabled();
+        AccessibilityShortcutController accessibilityShortcutController = getController();
+        Settings.Secure.putInt(mContentResolver, ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 0);
+        accessibilityShortcutController.performAccessibilityShortcut();
+        ArgumentCaptor<AlertDialog.OnCancelListener> cancelListenerCaptor =
+                ArgumentCaptor.forClass(AlertDialog.OnCancelListener.class);
+        verify(mAlertDialogBuilder).setOnCancelListener(cancelListenerCaptor.capture());
+        // Call the cancel callback
+        cancelListenerCaptor.getValue().onCancel(null);
+
+        accessibilityShortcutController.performAccessibilityShortcut();
+        verify(mAlertDialog, times(2)).show();
+    }
+
+    @Test
+    public void testClickingDisableButtonInDialog_shouldClearShortcutId() {
+        configureShortcutEnabled();
+        Settings.Secure.putInt(mContentResolver, ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 0);
+        getController().performAccessibilityShortcut();
+
+        ArgumentCaptor<DialogInterface.OnClickListener> captor =
+                ArgumentCaptor.forClass(DialogInterface.OnClickListener.class);
+        verify(mAlertDialogBuilder).setNegativeButton(eq(R.string.disable_accessibility_shortcut),
+                captor.capture());
+        // Call the button callback
+        captor.getValue().onClick(null, 0);
+        assertTrue(TextUtils.isEmpty(
+                Settings.Secure.getString(mContentResolver, ACCESSIBILITY_SHORTCUT_TARGET_SERVICE)));
+    }
+
+    @Test
+    public void testClickingLeaveOnButtonInDialog_shouldLeaveShortcutReady() throws Exception {
+        configureShortcutEnabled();
+        Settings.Secure.putInt(mContentResolver, ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 0);
+        getController().performAccessibilityShortcut();
+
+        ArgumentCaptor<DialogInterface.OnClickListener> captor =
+            ArgumentCaptor.forClass(DialogInterface.OnClickListener.class);
+        verify(mAlertDialogBuilder).setPositiveButton(eq(R.string.leave_accessibility_shortcut_on),
+            captor.capture());
+        // Call the button callback, if one exists
+        if (captor.getValue() != null) {
+            captor.getValue().onClick(null, 0);
+        }
+        assertEquals(SERVICE_NAME_STRING,
+                Settings.Secure.getString(mContentResolver, ACCESSIBILITY_SHORTCUT_TARGET_SERVICE));
+        assertEquals(1, Settings.Secure.getInt(
+            mContentResolver, ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN));
+    }
+
+    @Test
+    public void testOnAccessibilityShortcut_afterDialogShown_shouldCallServer() throws Exception {
+        configureShortcutEnabled();
+        Settings.Secure.putInt(mContentResolver, ACCESSIBILITY_SHORTCUT_DIALOG_SHOWN, 1);
+        getController().performAccessibilityShortcut();
+
+        verifyZeroInteractions(mAlertDialogBuilder, mAlertDialog);
+        verify(mToast).show();
+        verify(mAccessibilityManagerService).performAccessibilityShortcut();
+    }
+
+    private void configureShortcutDisabled() {
+        Settings.Secure.putString(mContentResolver, ACCESSIBILITY_SHORTCUT_TARGET_SERVICE, "");
+    }
+
+    private void configureShortcutEnabled() {
+        Settings.Secure.putString(
+                mContentResolver, ACCESSIBILITY_SHORTCUT_TARGET_SERVICE, SERVICE_NAME_STRING);
+    }
+
+    private AccessibilityShortcutController getController() {
+        AccessibilityShortcutController accessibilityShortcutController =
+                new AccessibilityShortcutController(mContext, mHandler);
+        accessibilityShortcutController.mFrameworkObjectProvider = mFrameworkObjectProvider;
+        return accessibilityShortcutController;
+    }
+}
diff --git a/services/tests/servicestests/src/com/android/server/webkit/TestSystemImpl.java b/services/tests/servicestests/src/com/android/server/webkit/TestSystemImpl.java
index d2512ac..83a61ca 100644
--- a/services/tests/servicestests/src/com/android/server/webkit/TestSystemImpl.java
+++ b/services/tests/servicestests/src/com/android/server/webkit/TestSystemImpl.java
@@ -19,7 +19,6 @@
 import android.content.Context;
 import android.content.pm.PackageInfo;
 import android.content.pm.PackageManager.NameNotFoundException;
-import android.database.ContentObserver;
 import android.webkit.WebViewProviderInfo;
 
 import java.util.HashMap;
@@ -31,6 +30,7 @@
     private boolean mFallbackLogicEnabled;
     private final int mNumRelros;
     private final boolean mIsDebuggable;
+    private int mMultiProcessSetting;
 
     public TestSystemImpl(WebViewProviderInfo[] packageConfigs, boolean fallbackLogicEnabled,
             int numRelros, boolean isDebuggable) {
@@ -121,8 +121,15 @@
     }
 
     @Override
-    public void setMultiProcessEnabledFromContext(Context context) {}
+    public int getMultiProcessSetting(Context context) {
+        return mMultiProcessSetting;
+    }
 
     @Override
-    public void registerContentObserver(Context context, ContentObserver contentObserver) {}
+    public void setMultiProcessSetting(Context context, int value) {
+        mMultiProcessSetting = value;
+    }
+
+    @Override
+    public void notifyZygote(boolean enableMultiProcess) {}
 }
diff --git a/services/tests/servicestests/src/com/android/server/wm/TaskSnapshotCacheTest.java b/services/tests/servicestests/src/com/android/server/wm/TaskSnapshotCacheTest.java
new file mode 100644
index 0000000..48d4770
--- /dev/null
+++ b/services/tests/servicestests/src/com/android/server/wm/TaskSnapshotCacheTest.java
@@ -0,0 +1,64 @@
+/*
+ * Copyright (C) 2017 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.server.wm;
+
+import static android.graphics.GraphicBuffer.USAGE_HW_TEXTURE;
+import static android.graphics.GraphicBuffer.USAGE_SW_READ_NEVER;
+import static android.graphics.GraphicBuffer.USAGE_SW_WRITE_NEVER;
+import static android.graphics.GraphicBuffer.create;
+import static android.view.WindowManager.LayoutParams.FIRST_APPLICATION_WINDOW;
+import static junit.framework.Assert.assertNotNull;
+import static junit.framework.Assert.assertNull;
+
+import android.app.ActivityManager.TaskSnapshot;
+import android.content.res.Configuration;
+import android.graphics.GraphicBuffer;
+import android.graphics.PixelFormat;
+import android.graphics.Rect;
+import android.platform.test.annotations.Presubmit;
+import android.support.test.filters.SmallTest;
+import android.support.test.runner.AndroidJUnit4;
+
+import org.junit.Test;
+import org.junit.runner.RunWith;
+
+/**
+ * Test class for {@link TaskSnapshotCache}.
+ *
+ * runtest frameworks-services -c com.android.server.wm.TaskSnapshotCacheTest
+ */
+@SmallTest
+@Presubmit
+@RunWith(AndroidJUnit4.class)
+public class TaskSnapshotCacheTest extends WindowTestsBase {
+
+    @Test
+    public void testCleanCache() throws Exception {
+        TaskSnapshotCache snapshotCache = new TaskSnapshotCache();
+        final WindowState window = createWindow(null, FIRST_APPLICATION_WINDOW, "window");
+        snapshotCache.putSnapshot(window.getTask(), createSnapshot());
+        assertNotNull(snapshotCache.getSnapshot(window.getTask()));
+        snapshotCache.cleanCache(window.mAppToken);
+        assertNull(snapshotCache.getSnapshot(window.getTask()));
+    }
+
+    private TaskSnapshot createSnapshot() {
+        GraphicBuffer buffer = create(1, 1, PixelFormat.RGBA_8888,
+                USAGE_HW_TEXTURE | USAGE_SW_WRITE_NEVER | USAGE_SW_READ_NEVER);
+        return new TaskSnapshot(buffer, Configuration.ORIENTATION_PORTRAIT, new Rect());
+    }
+}
diff --git a/services/tests/servicestests/src/com/android/server/wm/WindowTestsBase.java b/services/tests/servicestests/src/com/android/server/wm/WindowTestsBase.java
index 44d5055..dd5077b 100644
--- a/services/tests/servicestests/src/com/android/server/wm/WindowTestsBase.java
+++ b/services/tests/servicestests/src/com/android/server/wm/WindowTestsBase.java
@@ -23,6 +23,8 @@
 import org.junit.Assert;
 import org.junit.Before;
 
+import android.app.ActivityManager;
+import android.app.ActivityManager.TaskSnapshot;
 import android.content.Context;
 import android.os.IBinder;
 import android.support.test.InstrumentationRegistry;
@@ -238,7 +240,7 @@
         }
 
         TestTaskWindowContainerController(int stackId) {
-            super(sNextTaskId++, stackId, 0 /* userId */, null /* bounds */,
+            super(sNextTaskId++, snapshot -> {}, stackId, 0 /* userId */, null /* bounds */,
                     EMPTY /* overrideConfig*/, RESIZE_MODE_UNRESIZEABLE, false /* homeTask*/,
                     false /* isOnTopLauncher */, true /* toTop*/, true /* showForAllUsers */);
         }
diff --git a/services/usage/java/com/android/server/usage/StorageStatsService.java b/services/usage/java/com/android/server/usage/StorageStatsService.java
index 3be04d4..68765b6 100644
--- a/services/usage/java/com/android/server/usage/StorageStatsService.java
+++ b/services/usage/java/com/android/server/usage/StorageStatsService.java
@@ -31,9 +31,10 @@
 import android.os.SystemProperties;
 import android.os.UserHandle;
 import android.os.UserManager;
+import android.os.storage.StorageEventListener;
 import android.os.storage.StorageManager;
 import android.os.storage.VolumeInfo;
-import android.util.Log;
+import android.util.Slog;
 
 import com.android.internal.util.ArrayUtils;
 import com.android.server.SystemService;
@@ -66,6 +67,7 @@
     private final UserManager mUser;
     private final PackageManager mPackage;
     private final StorageManager mStorage;
+
     private final Installer mInstaller;
 
     public StorageStatsService(Context context) {
@@ -74,8 +76,28 @@
         mUser = context.getSystemService(UserManager.class);
         mPackage = context.getSystemService(PackageManager.class);
         mStorage = context.getSystemService(StorageManager.class);
+
         mInstaller = new Installer(context);
         mInstaller.onStart();
+        invalidateMounts();
+
+        mStorage.registerListener(new StorageEventListener() {
+            @Override
+            public void onVolumeStateChanged(VolumeInfo vol, int oldState, int newState) {
+                if ((vol.type == VolumeInfo.TYPE_PRIVATE)
+                        && (newState == VolumeInfo.STATE_MOUNTED)) {
+                    invalidateMounts();
+                }
+            }
+        });
+    }
+
+    private void invalidateMounts() {
+        try {
+            mInstaller.invalidateMounts();
+        } catch (InstallerException e) {
+            Slog.wtf(TAG, "Failed to invalidate mounts", e);
+        }
     }
 
     private void enforcePermission(int callingUid, String callingPackage) {
@@ -242,7 +264,7 @@
 
     private static void checkEquals(String msg, long expected, long actual) {
         if (expected != actual) {
-            Log.e(TAG, msg + " expected " + expected + " actual " + actual);
+            Slog.e(TAG, msg + " expected " + expected + " actual " + actual);
         }
     }
 
diff --git a/services/usage/java/com/android/server/usage/UsageStatsService.java b/services/usage/java/com/android/server/usage/UsageStatsService.java
index 4bfc3df..d243bf2 100644
--- a/services/usage/java/com/android/server/usage/UsageStatsService.java
+++ b/services/usage/java/com/android/server/usage/UsageStatsService.java
@@ -20,6 +20,7 @@
 import android.app.ActivityManager;
 import android.app.AppGlobals;
 import android.app.AppOpsManager;
+import android.app.IUidObserver;
 import android.app.admin.DevicePolicyManager;
 import android.app.usage.ConfigurationStats;
 import android.app.usage.IUsageStatsManager;
@@ -38,9 +39,9 @@
 import android.content.pm.ApplicationInfo;
 import android.content.pm.PackageInfo;
 import android.content.pm.PackageManager;
+import android.content.pm.PackageManager.NameNotFoundException;
 import android.content.pm.ParceledListSlice;
 import android.content.pm.UserInfo;
-import android.content.pm.PackageManager.NameNotFoundException;
 import android.content.res.Configuration;
 import android.database.ContentObserver;
 import android.hardware.display.DisplayManager;
@@ -49,6 +50,7 @@
 import android.os.BatteryStats;
 import android.os.Binder;
 import android.os.Environment;
+import android.os.FileUtils;
 import android.os.Handler;
 import android.os.IDeviceIdleController;
 import android.os.Looper;
@@ -80,6 +82,7 @@
 
 import java.io.File;
 import java.io.FileDescriptor;
+import java.io.IOException;
 import java.io.PrintWriter;
 import java.util.ArrayList;
 import java.util.Arrays;
@@ -103,6 +106,8 @@
     private static final long FLUSH_INTERVAL = COMPRESS_TIME ? TEN_SECONDS : TWENTY_MINUTES;
     private static final long TIME_CHANGE_THRESHOLD_MILLIS = 2 * 1000; // Two seconds.
 
+    private static final File KERNEL_COUNTER_FILE = new File("/proc/uid_procstat/set");
+
     long mAppIdleScreenThresholdMillis;
     long mCheckIdleIntervalMillis;
     long mAppIdleWallclockThresholdMillis;
@@ -134,6 +139,7 @@
     private IBatteryStats mBatteryStats;
 
     private final SparseArray<UserUsageStatsService> mUserState = new SparseArray<>();
+    private final SparseIntArray mUidToKernelCounter = new SparseIntArray();
     private File mUsageStatsDir;
     long mRealTimeSnapshot;
     long mSystemTimeSnapshot;
@@ -235,6 +241,19 @@
                 postOneTimeCheckIdleStates();
             }
 
+            if (KERNEL_COUNTER_FILE.exists()) {
+                try {
+                    ActivityManager.getService().registerUidObserver(mUidObserver,
+                            ActivityManager.UID_OBSERVER_PROCSTATE
+                                    | ActivityManager.UID_OBSERVER_GONE,
+                            ActivityManager.PROCESS_STATE_UNKNOWN, null);
+                } catch (RemoteException e) {
+                    throw new RuntimeException(e);
+                }
+            } else {
+                Slog.w(TAG, "Missing procfs interface: " + KERNEL_COUNTER_FILE);
+            }
+
             mSystemServicesReady = true;
         } else if (phase == PHASE_BOOT_COMPLETED) {
             setChargingState(getContext().getSystemService(BatteryManager.class).isCharging());
@@ -311,6 +330,39 @@
         }
     };
 
+    private final IUidObserver mUidObserver = new IUidObserver.Stub() {
+        @Override
+        public void onUidStateChanged(int uid, int procState) {
+            final int newCounter = (procState <= ActivityManager.PROCESS_STATE_TOP) ? 0 : 1;
+            synchronized (mUidToKernelCounter) {
+                final int oldCounter = mUidToKernelCounter.get(uid, 0);
+                if (newCounter != oldCounter) {
+                    mUidToKernelCounter.put(uid, newCounter);
+                    try {
+                        FileUtils.stringToFile(KERNEL_COUNTER_FILE, uid + " " + newCounter);
+                    } catch (IOException e) {
+                        Slog.w(TAG, "Failed to update counter set: " + e);
+                    }
+                }
+            }
+        }
+
+        @Override
+        public void onUidIdle(int uid, boolean disabled) throws RemoteException {
+            // Ignored
+        }
+
+        @Override
+        public void onUidGone(int uid, boolean disabled) throws RemoteException {
+            onUidStateChanged(uid, ActivityManager.PROCESS_STATE_NONEXISTENT);
+        }
+
+        @Override
+        public void onUidActive(int uid) throws RemoteException {
+            // Ignored
+        }
+    };
+
     @Override
     public void onStatsUpdated() {
         mHandler.sendEmptyMessageDelayed(MSG_FLUSH_TO_DISK, FLUSH_INTERVAL);
diff --git a/tests/net/java/com/android/server/connectivity/tethering/UpstreamNetworkMonitorTest.java b/tests/net/java/com/android/server/connectivity/tethering/UpstreamNetworkMonitorTest.java
index b2a9a49..00420e9 100644
--- a/tests/net/java/com/android/server/connectivity/tethering/UpstreamNetworkMonitorTest.java
+++ b/tests/net/java/com/android/server/connectivity/tethering/UpstreamNetworkMonitorTest.java
@@ -16,6 +16,8 @@
 
 package com.android.server.connectivity.tethering;
 
+import static android.net.ConnectivityManager.TYPE_MOBILE_DUN;
+import static android.net.ConnectivityManager.TYPE_MOBILE_HIPRI;
 import static android.net.NetworkCapabilities.NET_CAPABILITY_DUN;
 import static org.junit.Assert.assertEquals;
 import static org.junit.Assert.assertFalse;
@@ -114,6 +116,9 @@
         mUNM.registerMobileNetworkRequest();
         assertTrue(mUNM.mobileNetworkRequested());
         assertEquals(1, mCM.requested.size());
+        assertEquals(1, mCM.legacyTypeMap.size());
+        assertEquals(Integer.valueOf(TYPE_MOBILE_HIPRI),
+                mCM.legacyTypeMap.values().iterator().next());
         assertFalse(mCM.isDunRequested());
 
         mUNM.stop();
@@ -137,6 +142,9 @@
         mUNM.registerMobileNetworkRequest();
         assertTrue(mUNM.mobileNetworkRequested());
         assertEquals(1, mCM.requested.size());
+        assertEquals(1, mCM.legacyTypeMap.size());
+        assertEquals(Integer.valueOf(TYPE_MOBILE_DUN),
+                mCM.legacyTypeMap.values().iterator().next());
         assertTrue(mCM.isDunRequested());
 
         mUNM.stop();
@@ -148,6 +156,7 @@
         public Set<NetworkCallback> trackingDefault = new HashSet<>();
         public Map<NetworkCallback, NetworkRequest> listening = new HashMap<>();
         public Map<NetworkCallback, NetworkRequest> requested = new HashMap<>();
+        public Map<NetworkCallback, Integer> legacyTypeMap = new HashMap<>();
 
         public TestConnectivityManager(Context ctx, IConnectivityManager svc) {
             super(ctx, svc);
@@ -156,7 +165,8 @@
         boolean isEmpty() {
             return trackingDefault.isEmpty() &&
                    listening.isEmpty() &&
-                   requested.isEmpty();
+                   requested.isEmpty() &&
+                   legacyTypeMap.isEmpty();
         }
 
         boolean isListeningForDun() {
@@ -184,6 +194,17 @@
         }
 
         @Override
+        public void requestNetwork(NetworkRequest req, NetworkCallback cb,
+                int timeoutMs, int legacyType) {
+            assertFalse(requested.containsKey(cb));
+            requested.put(cb, req);
+            assertFalse(legacyTypeMap.containsKey(cb));
+            if (legacyType != ConnectivityManager.TYPE_NONE) {
+                legacyTypeMap.put(cb, legacyType);
+            }
+        }
+
+        @Override
         public void registerNetworkCallback(NetworkRequest req, NetworkCallback cb) {
             assertFalse(listening.containsKey(cb));
             listening.put(cb, req);
@@ -203,6 +224,7 @@
                 listening.remove(cb);
             } else if (requested.containsKey(cb)) {
                 requested.remove(cb);
+                legacyTypeMap.remove(cb);
             }
 
             assertFalse(trackingDefault.contains(cb));
diff --git a/tools/localedata/extract_icu_data.py b/tools/localedata/extract_icu_data.py
index b071093..9dceba2 100755
--- a/tools/localedata/extract_icu_data.py
+++ b/tools/localedata/extract_icu_data.py
@@ -48,6 +48,8 @@
             # they may be used by apps for other purposes.)
             "en_XA": "~~~A",
             "ar_XB": "~~~B",
+            # Removed data from later versions of ICU
+            "ji": "Hebr", # Old code for Yiddish, still used in Java and Android
         }
         representative_locales = {
             # Android's additions
@@ -69,7 +71,7 @@
                 _, to_scr, to_region = get_locale_parts(to_locale)
                 if from_lang == 'und':
                     continue  # not very useful for our purposes
-                if from_region is None and to_region != '001':
+                if from_region is None and to_region not in ['001', 'ZZ']:
                     representative_locales.add(to_locale)
                 if from_scr is None:
                     likely_script_dict[from_locale] = to_scr