Merge "Also inform activity manager that lock task packages changed"
diff --git a/Android.bp b/Android.bp
index e5d4b8b..2685ac3 100644
--- a/Android.bp
+++ b/Android.bp
@@ -471,8 +471,6 @@
"telephony/java/android/telephony/ims/internal/aidl/IImsMmTelFeature.aidl",
"telephony/java/android/telephony/ims/internal/aidl/IImsMmTelListener.aidl",
"telephony/java/android/telephony/ims/internal/aidl/IImsRcsFeature.aidl",
- "telephony/java/android/telephony/ims/internal/aidl/IImsRegistration.aidl",
- "telephony/java/android/telephony/ims/internal/aidl/IImsRegistrationCallback.aidl",
"telephony/java/android/telephony/ims/internal/aidl/IImsServiceController.aidl",
"telephony/java/android/telephony/ims/internal/aidl/IImsServiceControllerListener.aidl",
"telephony/java/android/telephony/ims/internal/aidl/IImsSmsListener.aidl",
@@ -492,6 +490,8 @@
"telephony/java/com/android/ims/internal/IImsFeatureStatusCallback.aidl",
"telephony/java/com/android/ims/internal/IImsMMTelFeature.aidl",
"telephony/java/com/android/ims/internal/IImsMultiEndpoint.aidl",
+ "telephony/java/com/android/ims/internal/IImsRegistration.aidl",
+ "telephony/java/com/android/ims/internal/IImsRegistrationCallback.aidl",
"telephony/java/com/android/ims/internal/IImsRcsFeature.aidl",
"telephony/java/com/android/ims/internal/IImsService.aidl",
"telephony/java/com/android/ims/internal/IImsServiceController.aidl",
diff --git a/apct-tests/perftests/core/src/android/text/StaticLayoutPerfTest.java b/apct-tests/perftests/core/src/android/text/StaticLayoutPerfTest.java
index 5653a03..93a0fc3 100644
--- a/apct-tests/perftests/core/src/android/text/StaticLayoutPerfTest.java
+++ b/apct-tests/perftests/core/src/android/text/StaticLayoutPerfTest.java
@@ -190,7 +190,7 @@
final BenchmarkState state = mPerfStatusReporter.getBenchmarkState();
while (state.keepRunning()) {
state.pauseTiming();
- final PremeasuredText text = PremeasuredText.build(
+ final MeasuredText text = MeasuredText.build(
generateRandomParagraph(WORD_LENGTH, NO_STYLE_TEXT), PAINT, LTR);
state.resumeTiming();
@@ -206,7 +206,7 @@
final BenchmarkState state = mPerfStatusReporter.getBenchmarkState();
while (state.keepRunning()) {
state.pauseTiming();
- final PremeasuredText text = PremeasuredText.build(
+ final MeasuredText text = MeasuredText.build(
generateRandomParagraph(WORD_LENGTH, NO_STYLE_TEXT), PAINT, LTR);
state.resumeTiming();
@@ -222,7 +222,7 @@
final BenchmarkState state = mPerfStatusReporter.getBenchmarkState();
while (state.keepRunning()) {
state.pauseTiming();
- final PremeasuredText text = PremeasuredText.build(
+ final MeasuredText text = MeasuredText.build(
generateRandomParagraph(WORD_LENGTH, NO_STYLE_TEXT), PAINT, LTR);
state.resumeTiming();
@@ -238,7 +238,7 @@
final BenchmarkState state = mPerfStatusReporter.getBenchmarkState();
while (state.keepRunning()) {
state.pauseTiming();
- final PremeasuredText text = PremeasuredText.build(
+ final MeasuredText text = MeasuredText.build(
generateRandomParagraph(WORD_LENGTH, NO_STYLE_TEXT), PAINT, LTR);
state.resumeTiming();
@@ -254,7 +254,7 @@
final BenchmarkState state = mPerfStatusReporter.getBenchmarkState();
while (state.keepRunning()) {
state.pauseTiming();
- final PremeasuredText text = PremeasuredText.build(
+ final MeasuredText text = MeasuredText.build(
generateRandomParagraph(WORD_LENGTH, STYLE_TEXT), PAINT, LTR);
state.resumeTiming();
diff --git a/api/current.txt b/api/current.txt
index a560e96..ad78307 100644
--- a/api/current.txt
+++ b/api/current.txt
@@ -6403,6 +6403,7 @@
method public int getLockTaskFeatures(android.content.ComponentName);
method public java.lang.String[] getLockTaskPackages(android.content.ComponentName);
method public java.lang.CharSequence getLongSupportMessage(android.content.ComponentName);
+ method public android.content.ComponentName getMandatoryBackupTransport();
method public int getMaximumFailedPasswordsForWipe(android.content.ComponentName);
method public long getMaximumTimeToLock(android.content.ComponentName);
method public int getOrganizationColor(android.content.ComponentName);
@@ -6502,6 +6503,7 @@
method public void setLockTaskPackages(android.content.ComponentName, java.lang.String[]) throws java.lang.SecurityException;
method public void setLogoutEnabled(android.content.ComponentName, boolean);
method public void setLongSupportMessage(android.content.ComponentName, java.lang.CharSequence);
+ method public void setMandatoryBackupTransport(android.content.ComponentName, android.content.ComponentName);
method public void setMasterVolumeMuted(android.content.ComponentName, boolean);
method public void setMaximumFailedPasswordsForWipe(android.content.ComponentName, int);
method public void setMaximumTimeToLock(android.content.ComponentName, long);
@@ -20882,7 +20884,6 @@
method public int getMaxWidth();
method public java.lang.CharSequence getTextForImeAction(int);
method public android.app.Dialog getWindow();
- method public void hideSoftInputFromInputMethod(int);
method public void hideStatusIcon();
method public void hideWindow();
method public boolean isExtractViewShown();
@@ -20930,6 +20931,7 @@
method public void onWindowHidden();
method public void onWindowShown();
method public void requestHideSelf(int);
+ method public void requestShowSelf(int);
method public boolean sendDefaultEditorAction(boolean);
method public void sendDownUpKeyEvents(int);
method public void sendKeyChar(char);
@@ -20942,7 +20944,6 @@
method public void setInputMethodAndSubtype(java.lang.String, android.view.inputmethod.InputMethodSubtype);
method public void setInputView(android.view.View);
method public boolean shouldOfferSwitchingToNextInputMethod();
- method public void showSoftInputFromInputMethod(int);
method public void showStatusIcon(int);
method public void showWindow(boolean);
method public void switchInputMethod(java.lang.String);
@@ -26218,12 +26219,18 @@
}
public final class IpSecManager {
- method public android.net.IpSecManager.SecurityParameterIndex allocateSecurityParameterIndex(int, java.net.InetAddress) throws android.net.IpSecManager.ResourceUnavailableException;
- method public android.net.IpSecManager.SecurityParameterIndex allocateSecurityParameterIndex(int, java.net.InetAddress, int) throws android.net.IpSecManager.ResourceUnavailableException, android.net.IpSecManager.SpiUnavailableException;
- method public void applyTransportModeTransform(java.io.FileDescriptor, android.net.IpSecTransform) throws java.io.IOException;
+ method public android.net.IpSecManager.SecurityParameterIndex allocateSecurityParameterIndex(java.net.InetAddress) throws android.net.IpSecManager.ResourceUnavailableException;
+ method public android.net.IpSecManager.SecurityParameterIndex allocateSecurityParameterIndex(java.net.InetAddress, int) throws android.net.IpSecManager.ResourceUnavailableException, android.net.IpSecManager.SpiUnavailableException;
+ method public void applyTransportModeTransform(java.net.Socket, int, android.net.IpSecTransform) throws java.io.IOException;
+ method public void applyTransportModeTransform(java.net.DatagramSocket, int, android.net.IpSecTransform) throws java.io.IOException;
+ method public void applyTransportModeTransform(java.io.FileDescriptor, int, android.net.IpSecTransform) throws java.io.IOException;
method public android.net.IpSecManager.UdpEncapsulationSocket openUdpEncapsulationSocket(int) throws java.io.IOException, android.net.IpSecManager.ResourceUnavailableException;
method public android.net.IpSecManager.UdpEncapsulationSocket openUdpEncapsulationSocket() throws java.io.IOException, android.net.IpSecManager.ResourceUnavailableException;
- method public void removeTransportModeTransform(java.io.FileDescriptor, android.net.IpSecTransform) throws java.io.IOException;
+ method public void removeTransportModeTransforms(java.net.Socket, android.net.IpSecTransform) throws java.io.IOException;
+ method public void removeTransportModeTransforms(java.net.DatagramSocket, android.net.IpSecTransform) throws java.io.IOException;
+ method public void removeTransportModeTransforms(java.io.FileDescriptor, android.net.IpSecTransform) throws java.io.IOException;
+ field public static final int DIRECTION_IN = 0; // 0x0
+ field public static final int DIRECTION_OUT = 1; // 0x1
}
public static final class IpSecManager.ResourceUnavailableException extends android.util.AndroidException {
@@ -26246,18 +26253,15 @@
public final class IpSecTransform implements java.lang.AutoCloseable {
method public void close();
- field public static final int DIRECTION_IN = 0; // 0x0
- field public static final int DIRECTION_OUT = 1; // 0x1
}
public static class IpSecTransform.Builder {
ctor public IpSecTransform.Builder(android.content.Context);
- method public android.net.IpSecTransform buildTransportModeTransform(java.net.InetAddress) throws java.io.IOException, android.net.IpSecManager.ResourceUnavailableException, android.net.IpSecManager.SpiUnavailableException;
- method public android.net.IpSecTransform.Builder setAuthenticatedEncryption(int, android.net.IpSecAlgorithm);
- method public android.net.IpSecTransform.Builder setAuthentication(int, android.net.IpSecAlgorithm);
- method public android.net.IpSecTransform.Builder setEncryption(int, android.net.IpSecAlgorithm);
+ method public android.net.IpSecTransform buildTransportModeTransform(java.net.InetAddress, android.net.IpSecManager.SecurityParameterIndex) throws java.io.IOException, android.net.IpSecManager.ResourceUnavailableException, android.net.IpSecManager.SpiUnavailableException;
+ method public android.net.IpSecTransform.Builder setAuthenticatedEncryption(android.net.IpSecAlgorithm);
+ method public android.net.IpSecTransform.Builder setAuthentication(android.net.IpSecAlgorithm);
+ method public android.net.IpSecTransform.Builder setEncryption(android.net.IpSecAlgorithm);
method public android.net.IpSecTransform.Builder setIpv4Encapsulation(android.net.IpSecManager.UdpEncapsulationSocket, int);
- method public android.net.IpSecTransform.Builder setSpi(int, android.net.IpSecManager.SecurityParameterIndex);
}
public class LinkAddress implements android.os.Parcelable {
@@ -26340,10 +26344,10 @@
}
public final class MacAddress implements android.os.Parcelable {
- method public int addressType();
method public int describeContents();
method public static android.net.MacAddress fromBytes(byte[]);
method public static android.net.MacAddress fromString(java.lang.String);
+ method public int getAddressType();
method public boolean isLocallyAssigned();
method public byte[] toByteArray();
method public java.lang.String toOuiString();
@@ -26353,7 +26357,6 @@
field public static final int TYPE_BROADCAST = 3; // 0x3
field public static final int TYPE_MULTICAST = 2; // 0x2
field public static final int TYPE_UNICAST = 1; // 0x1
- field public static final int TYPE_UNKNOWN = 0; // 0x0
}
public class MailTo {
@@ -32462,6 +32465,7 @@
field public static final java.lang.String DISALLOW_CONFIG_LOCALE = "no_config_locale";
field public static final java.lang.String DISALLOW_CONFIG_LOCATION_MODE = "no_config_location_mode";
field public static final java.lang.String DISALLOW_CONFIG_MOBILE_NETWORKS = "no_config_mobile_networks";
+ field public static final java.lang.String DISALLOW_CONFIG_SCREEN_TIMEOUT = "no_config_screen_timeout";
field public static final java.lang.String DISALLOW_CONFIG_TETHERING = "no_config_tethering";
field public static final java.lang.String DISALLOW_CONFIG_VPN = "no_config_vpn";
field public static final java.lang.String DISALLOW_CONFIG_WIFI = "no_config_wifi";
@@ -42296,20 +42300,9 @@
method public boolean isAllowed(char);
}
- public abstract interface NoCopySpan {
- }
-
- public static class NoCopySpan.Concrete implements android.text.NoCopySpan {
- ctor public NoCopySpan.Concrete();
- }
-
- public abstract interface ParcelableSpan implements android.os.Parcelable {
- method public abstract int getSpanTypeId();
- }
-
- public class PremeasuredText implements android.text.Spanned {
- method public static android.text.PremeasuredText build(java.lang.CharSequence, android.text.TextPaint, android.text.TextDirectionHeuristic);
- method public static android.text.PremeasuredText build(java.lang.CharSequence, android.text.TextPaint, android.text.TextDirectionHeuristic, int, int);
+ public class MeasuredText implements android.text.Spanned {
+ method public static android.text.MeasuredText build(java.lang.CharSequence, android.text.TextPaint, android.text.TextDirectionHeuristic);
+ method public static android.text.MeasuredText build(java.lang.CharSequence, android.text.TextPaint, android.text.TextDirectionHeuristic, int, int);
method public char charAt(int);
method public int getEnd();
method public android.text.TextPaint getPaint();
@@ -42328,6 +42321,17 @@
method public java.lang.CharSequence subSequence(int, int);
}
+ public abstract interface NoCopySpan {
+ }
+
+ public static class NoCopySpan.Concrete implements android.text.NoCopySpan {
+ ctor public NoCopySpan.Concrete();
+ }
+
+ public abstract interface ParcelableSpan implements android.os.Parcelable {
+ method public abstract int getSpanTypeId();
+ }
+
public class Selection {
method public static boolean extendDown(android.text.Spannable, android.text.Layout);
method public static boolean extendLeft(android.text.Spannable, android.text.Layout);
@@ -47889,7 +47893,6 @@
field public static final int FIRST_APPLICATION_WINDOW = 1; // 0x1
field public static final int FIRST_SUB_WINDOW = 1000; // 0x3e8
field public static final int FIRST_SYSTEM_WINDOW = 2000; // 0x7d0
- field public static final long FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA = 1L; // 0x1L
field public static final int FLAGS_CHANGED = 4; // 0x4
field public static final int FLAG_ALLOW_LOCK_WHILE_SCREEN_ON = 1; // 0x1
field public static final int FLAG_ALT_FOCUSABLE_IM = 131072; // 0x20000
@@ -47927,6 +47930,9 @@
field public static final int LAST_SUB_WINDOW = 1999; // 0x7cf
field public static final int LAST_SYSTEM_WINDOW = 2999; // 0xbb7
field public static final int LAYOUT_CHANGED = 1; // 0x1
+ field public static final int LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS = 1; // 0x1
+ field public static final int LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT = 0; // 0x0
+ field public static final int LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER = 2; // 0x2
field public static final int MEMORY_TYPE_CHANGED = 256; // 0x100
field public static final deprecated int MEMORY_TYPE_GPU = 2; // 0x2
field public static final deprecated int MEMORY_TYPE_HARDWARE = 1; // 0x1
@@ -47989,6 +47995,7 @@
field public int gravity;
field public float horizontalMargin;
field public float horizontalWeight;
+ field public int layoutInDisplayCutoutMode;
field public deprecated int memoryType;
field public java.lang.String packageName;
field public int preferredDisplayModeId;
@@ -48036,6 +48043,8 @@
method public void setPackageName(java.lang.CharSequence);
method public void writeToParcel(android.os.Parcel, int);
field public static final int CONTENT_CHANGE_TYPE_CONTENT_DESCRIPTION = 4; // 0x4
+ field public static final int CONTENT_CHANGE_TYPE_PANE_APPEARED = 16; // 0x10
+ field public static final int CONTENT_CHANGE_TYPE_PANE_DISAPPEARED = 32; // 0x20
field public static final int CONTENT_CHANGE_TYPE_PANE_TITLE = 8; // 0x8
field public static final int CONTENT_CHANGE_TYPE_SUBTREE = 1; // 0x1
field public static final int CONTENT_CHANGE_TYPE_TEXT = 2; // 0x2
diff --git a/api/system-current.txt b/api/system-current.txt
index b47304a..762b6e8 100644
--- a/api/system-current.txt
+++ b/api/system-current.txt
@@ -33,6 +33,7 @@
field public static final java.lang.String BIND_TV_REMOTE_SERVICE = "android.permission.BIND_TV_REMOTE_SERVICE";
field public static final java.lang.String BLUETOOTH_PRIVILEGED = "android.permission.BLUETOOTH_PRIVILEGED";
field public static final java.lang.String BRICK = "android.permission.BRICK";
+ field public static final java.lang.String BRIGHTNESS_SLIDER_USAGE = "android.permission.BRIGHTNESS_SLIDER_USAGE";
field public static final deprecated java.lang.String BROADCAST_NETWORK_PRIVILEGED = "android.permission.BROADCAST_NETWORK_PRIVILEGED";
field public static final java.lang.String CALL_PRIVILEGED = "android.permission.CALL_PRIVILEGED";
field public static final java.lang.String CAMERA_DISABLE_TRANSMIT_LED = "android.permission.CAMERA_DISABLE_TRANSMIT_LED";
@@ -46,6 +47,7 @@
field public static final java.lang.String CHANGE_CONFIGURATION = "android.permission.CHANGE_CONFIGURATION";
field public static final java.lang.String CHANGE_DEVICE_IDLE_TEMP_WHITELIST = "android.permission.CHANGE_DEVICE_IDLE_TEMP_WHITELIST";
field public static final java.lang.String CLEAR_APP_USER_DATA = "android.permission.CLEAR_APP_USER_DATA";
+ field public static final java.lang.String CONFIGURE_DISPLAY_BRIGHTNESS = "android.permission.CONFIGURE_DISPLAY_BRIGHTNESS";
field public static final java.lang.String CONNECTIVITY_INTERNAL = "android.permission.CONNECTIVITY_INTERNAL";
field public static final java.lang.String CONNECTIVITY_USE_RESTRICTED_NETWORKS = "android.permission.CONNECTIVITY_USE_RESTRICTED_NETWORKS";
field public static final java.lang.String CONTROL_INCALL_EXPERIENCE = "android.permission.CONTROL_INCALL_EXPERIENCE";
@@ -1092,8 +1094,38 @@
package android.hardware.display {
+ public final class BrightnessChangeEvent implements android.os.Parcelable {
+ method public int describeContents();
+ method public void writeToParcel(android.os.Parcel, int);
+ field public static final android.os.Parcelable.Creator<android.hardware.display.BrightnessChangeEvent> CREATOR;
+ field public final float batteryLevel;
+ field public final float brightness;
+ field public final int colorTemperature;
+ field public final float lastBrightness;
+ field public final long[] luxTimestamps;
+ field public final float[] luxValues;
+ field public final boolean nightMode;
+ field public final java.lang.String packageName;
+ field public final long timeStamp;
+ }
+
+ public final class BrightnessConfiguration implements android.os.Parcelable {
+ method public int describeContents();
+ method public android.util.Pair<float[], float[]> getCurve();
+ method public void writeToParcel(android.os.Parcel, int);
+ field public static final android.os.Parcelable.Creator<android.hardware.display.BrightnessConfiguration> CREATOR;
+ }
+
+ public static class BrightnessConfiguration.Builder {
+ ctor public BrightnessConfiguration.Builder();
+ method public android.hardware.display.BrightnessConfiguration build();
+ method public android.hardware.display.BrightnessConfiguration.Builder setCurve(float[], float[]);
+ }
+
public final class DisplayManager {
+ method public java.util.List<android.hardware.display.BrightnessChangeEvent> getBrightnessEvents();
method public android.graphics.Point getStableDisplaySize();
+ method public void setBrightnessConfiguration(android.hardware.display.BrightnessConfiguration);
}
}
@@ -1701,6 +1733,39 @@
package android.hardware.radio {
+ public final class ProgramList implements java.lang.AutoCloseable {
+ method public void addOnCompleteListener(java.util.concurrent.Executor, android.hardware.radio.ProgramList.OnCompleteListener);
+ method public void addOnCompleteListener(android.hardware.radio.ProgramList.OnCompleteListener);
+ method public void close();
+ method public android.hardware.radio.RadioManager.ProgramInfo get(android.hardware.radio.ProgramSelector.Identifier);
+ method public void registerListCallback(java.util.concurrent.Executor, android.hardware.radio.ProgramList.ListCallback);
+ method public void registerListCallback(android.hardware.radio.ProgramList.ListCallback);
+ method public void removeOnCompleteListener(android.hardware.radio.ProgramList.OnCompleteListener);
+ method public java.util.List<android.hardware.radio.RadioManager.ProgramInfo> toList();
+ method public void unregisterListCallback(android.hardware.radio.ProgramList.ListCallback);
+ }
+
+ public static final class ProgramList.Filter implements android.os.Parcelable {
+ ctor public ProgramList.Filter(java.util.Set<java.lang.Integer>, java.util.Set<android.hardware.radio.ProgramSelector.Identifier>, boolean, boolean);
+ method public boolean areCategoriesIncluded();
+ method public boolean areModificationsExcluded();
+ method public int describeContents();
+ method public java.util.Set<java.lang.Integer> getIdentifierTypes();
+ method public java.util.Set<android.hardware.radio.ProgramSelector.Identifier> getIdentifiers();
+ method public void writeToParcel(android.os.Parcel, int);
+ field public static final android.os.Parcelable.Creator<android.hardware.radio.ProgramList.Filter> CREATOR;
+ }
+
+ public static abstract class ProgramList.ListCallback {
+ ctor public ProgramList.ListCallback();
+ method public void onItemChanged(android.hardware.radio.ProgramSelector.Identifier);
+ method public void onItemRemoved(android.hardware.radio.ProgramSelector.Identifier);
+ }
+
+ public static abstract interface ProgramList.OnCompleteListener {
+ method public abstract void onComplete();
+ }
+
public final class ProgramSelector implements android.os.Parcelable {
ctor public ProgramSelector(int, android.hardware.radio.ProgramSelector.Identifier, android.hardware.radio.ProgramSelector.Identifier[], long[]);
method public static android.hardware.radio.ProgramSelector createAmFmSelector(int, int);
@@ -1724,6 +1789,7 @@
field public static final int IDENTIFIER_TYPE_DRMO_SERVICE_ID = 9; // 0x9
field public static final int IDENTIFIER_TYPE_HD_STATION_ID_EXT = 3; // 0x3
field public static final int IDENTIFIER_TYPE_HD_SUBCHANNEL = 4; // 0x4
+ field public static final int IDENTIFIER_TYPE_INVALID = 0; // 0x0
field public static final int IDENTIFIER_TYPE_RDS_PI = 2; // 0x2
field public static final int IDENTIFIER_TYPE_SXM_CHANNEL = 13; // 0xd
field public static final int IDENTIFIER_TYPE_SXM_SERVICE_ID = 12; // 0xc
@@ -1735,6 +1801,7 @@
field public static final int PROGRAM_TYPE_DRMO = 6; // 0x6
field public static final int PROGRAM_TYPE_FM = 2; // 0x2
field public static final int PROGRAM_TYPE_FM_HD = 4; // 0x4
+ field public static final int PROGRAM_TYPE_INVALID = 0; // 0x0
field public static final int PROGRAM_TYPE_SXM = 7; // 0x7
field public static final int PROGRAM_TYPE_VENDOR_END = 1999; // 0x7cf
field public static final int PROGRAM_TYPE_VENDOR_START = 1000; // 0x3e8
@@ -1953,10 +2020,11 @@
method public abstract void cancelAnnouncement();
method public abstract void close();
method public abstract int getConfiguration(android.hardware.radio.RadioManager.BandConfig[]);
+ method public android.hardware.radio.ProgramList getDynamicProgramList(android.hardware.radio.ProgramList.Filter);
method public abstract boolean getMute();
method public java.util.Map<java.lang.String, java.lang.String> getParameters(java.util.List<java.lang.String>);
method public abstract int getProgramInformation(android.hardware.radio.RadioManager.ProgramInfo[]);
- method public abstract java.util.List<android.hardware.radio.RadioManager.ProgramInfo> getProgramList(java.util.Map<java.lang.String, java.lang.String>);
+ method public abstract deprecated java.util.List<android.hardware.radio.RadioManager.ProgramInfo> getProgramList(java.util.Map<java.lang.String, java.lang.String>);
method public abstract boolean hasControl();
method public abstract deprecated boolean isAnalogForced();
method public abstract boolean isAntennaConnected();
@@ -4386,6 +4454,8 @@
method public deprecated void setDataEnabled(int, boolean);
method public boolean setRadio(boolean);
method public boolean setRadioPower(boolean);
+ method public void setSimPowerState(int);
+ method public void setSimPowerStateForSlot(int, int);
method public deprecated void setVisualVoicemailEnabled(android.telecom.PhoneAccountHandle, boolean);
method public void setVoiceActivationState(int);
method public deprecated void silenceRinger();
@@ -4395,8 +4465,6 @@
method public int[] supplyPukReportResult(java.lang.String, java.lang.String);
method public void toggleRadioOnOff();
method public void updateServiceLocation();
- method public void setSimPowerState(int);
- method public void setSimPowerStateForSlot(int, int);
field public static final int CARRIER_PRIVILEGE_STATUS_ERROR_LOADING_RULES = -2; // 0xfffffffe
field public static final int CARRIER_PRIVILEGE_STATUS_HAS_ACCESS = 1; // 0x1
field public static final int CARRIER_PRIVILEGE_STATUS_NO_ACCESS = 0; // 0x0
@@ -4579,9 +4647,12 @@
}
public final class StatsManager {
+ method public boolean addConfiguration(java.lang.String, byte[], java.lang.String, java.lang.String);
method public boolean addConfiguration(long, byte[], java.lang.String, java.lang.String);
+ method public byte[] getData(java.lang.String);
method public byte[] getData(long);
method public byte[] getMetadata();
+ method public boolean removeConfiguration(java.lang.String);
method public boolean removeConfiguration(long);
}
diff --git a/api/test-current.txt b/api/test-current.txt
index 6ad4f5a..6941731 100644
--- a/api/test-current.txt
+++ b/api/test-current.txt
@@ -295,6 +295,43 @@
}
+package android.hardware.display {
+
+ public final class BrightnessChangeEvent implements android.os.Parcelable {
+ method public int describeContents();
+ method public void writeToParcel(android.os.Parcel, int);
+ field public static final android.os.Parcelable.Creator<android.hardware.display.BrightnessChangeEvent> CREATOR;
+ field public final float batteryLevel;
+ field public final float brightness;
+ field public final int colorTemperature;
+ field public final float lastBrightness;
+ field public final long[] luxTimestamps;
+ field public final float[] luxValues;
+ field public final boolean nightMode;
+ field public final java.lang.String packageName;
+ field public final long timeStamp;
+ }
+
+ public final class BrightnessConfiguration implements android.os.Parcelable {
+ method public int describeContents();
+ method public android.util.Pair<float[], float[]> getCurve();
+ method public void writeToParcel(android.os.Parcel, int);
+ field public static final android.os.Parcelable.Creator<android.hardware.display.BrightnessConfiguration> CREATOR;
+ }
+
+ public static class BrightnessConfiguration.Builder {
+ ctor public BrightnessConfiguration.Builder();
+ method public android.hardware.display.BrightnessConfiguration build();
+ method public android.hardware.display.BrightnessConfiguration.Builder setCurve(float[], float[]);
+ }
+
+ public final class DisplayManager {
+ method public java.util.List<android.hardware.display.BrightnessChangeEvent> getBrightnessEvents();
+ method public void setBrightnessConfiguration(android.hardware.display.BrightnessConfiguration);
+ }
+
+}
+
package android.location {
public final class GnssClock implements android.os.Parcelable {
diff --git a/cmds/statsd/Android.mk b/cmds/statsd/Android.mk
index ffe652f..2c35d41 100644
--- a/cmds/statsd/Android.mk
+++ b/cmds/statsd/Android.mk
@@ -186,7 +186,8 @@
tests/statsd_test_util.cpp \
tests/e2e/WakelockDuration_e2e_test.cpp \
tests/e2e/MetricConditionLink_e2e_test.cpp \
- tests/e2e/Attribution_e2e_test.cpp
+ tests/e2e/Attribution_e2e_test.cpp \
+ tests/e2e/GaugeMetric_e2e_test.cpp
LOCAL_STATIC_LIBRARIES := \
$(statsd_common_static_libraries) \
@@ -198,6 +199,24 @@
include $(BUILD_NATIVE_TEST)
+##############################
+# stats proto static java lib
+##############################
+
+include $(CLEAR_VARS)
+LOCAL_MODULE := statsdprotolite
+
+LOCAL_SRC_FILES := \
+ src/stats_log.proto \
+ src/statsd_config.proto \
+ src/atoms.proto
+
+LOCAL_PROTOC_OPTIMIZE_TYPE := lite
+
+LOCAL_STATIC_JAVA_LIBRARIES := \
+ platformprotoslite
+
+include $(BUILD_STATIC_JAVA_LIBRARY)
statsd_common_src:=
statsd_common_aidl_includes:=
@@ -208,4 +227,4 @@
##############################
-include $(call all-makefiles-under,$(LOCAL_PATH))
\ No newline at end of file
+include $(call all-makefiles-under,$(LOCAL_PATH))
diff --git a/cmds/statsd/src/StatsLogProcessor.h b/cmds/statsd/src/StatsLogProcessor.h
index 09e10a1..301e3a5 100644
--- a/cmds/statsd/src/StatsLogProcessor.h
+++ b/cmds/statsd/src/StatsLogProcessor.h
@@ -99,6 +99,7 @@
FRIEND_TEST(WakelockDurationE2eTest, TestAggregatedPredicateDimensions);
FRIEND_TEST(MetricConditionLinkE2eTest, TestMultiplePredicatesAndLinks);
FRIEND_TEST(AttributionE2eTest, TestAttributionMatchAndSlice);
+ FRIEND_TEST(GaugeMetricE2eTest, TestMultipleFieldsForPushedEvent);
};
diff --git a/cmds/statsd/src/dimension.h b/cmds/statsd/src/dimension.h
index 845c138..d0f96a2 100644
--- a/cmds/statsd/src/dimension.h
+++ b/cmds/statsd/src/dimension.h
@@ -32,6 +32,10 @@
const DimensionsValue* getSingleLeafValue(const DimensionsValue* value);
DimensionsValue getSingleLeafValue(const DimensionsValue& value);
+// Appends the leaf node to the parent tree.
+void appendLeafNodeToParent(const Field& field, const DimensionsValue& value,
+ DimensionsValue* parentValue);
+
// Constructs the DimensionsValue protos from the FieldMatcher. Each DimensionsValue proto
// represents a tree. When the input proto has repeated fields and the input "dimensions" wants
// "ANY" locations, it will return multiple trees.
diff --git a/cmds/statsd/src/metrics/GaugeMetricProducer.cpp b/cmds/statsd/src/metrics/GaugeMetricProducer.cpp
index 1a4888c..ae47bd8 100644
--- a/cmds/statsd/src/metrics/GaugeMetricProducer.cpp
+++ b/cmds/statsd/src/metrics/GaugeMetricProducer.cpp
@@ -114,6 +114,9 @@
void GaugeMetricProducer::onDumpReportLocked(const uint64_t dumpTimeNs, StatsLogReport* report) {
flushIfNeededLocked(dumpTimeNs);
+ ProtoOutputStream pbOutput;
+ onDumpReportLocked(dumpTimeNs, &pbOutput);
+ parseProtoOutputStream(pbOutput, report);
}
void GaugeMetricProducer::onDumpReportLocked(const uint64_t dumpTimeNs,
diff --git a/cmds/statsd/src/metrics/MetricsManager.h b/cmds/statsd/src/metrics/MetricsManager.h
index 08b0981..a0239fc 100644
--- a/cmds/statsd/src/metrics/MetricsManager.h
+++ b/cmds/statsd/src/metrics/MetricsManager.h
@@ -141,6 +141,7 @@
FRIEND_TEST(WakelockDurationE2eTest, TestAggregatedPredicateDimensions);
FRIEND_TEST(MetricConditionLinkE2eTest, TestMultiplePredicatesAndLinks);
FRIEND_TEST(AttributionE2eTest, TestAttributionMatchAndSlice);
+ FRIEND_TEST(GaugeMetricE2eTest, TestMultipleFieldsForPushedEvent);
};
} // namespace statsd
diff --git a/cmds/statsd/src/stats_log_util.h b/cmds/statsd/src/stats_log_util.h
index 09a43f5..cee9200 100644
--- a/cmds/statsd/src/stats_log_util.h
+++ b/cmds/statsd/src/stats_log_util.h
@@ -43,6 +43,19 @@
// Helper function to write PulledAtomStats to ProtoOutputStream
void writePullerStatsToStream(const std::pair<int, StatsdStats::PulledAtomStats>& pair,
util::ProtoOutputStream* protoOutput);
+
+template<class T>
+bool parseProtoOutputStream(util::ProtoOutputStream& protoOutput, T* message) {
+ std::string pbBytes;
+ auto iter = protoOutput.data();
+ while (iter.readBuffer() != NULL) {
+ size_t toRead = iter.currentToRead();
+ pbBytes.append(reinterpret_cast<const char*>(iter.readBuffer()), toRead);
+ iter.rp()->move(toRead);
+ }
+ return message->ParseFromArray(pbBytes.c_str(), pbBytes.size());
+}
+
} // namespace statsd
} // namespace os
} // namespace android
\ No newline at end of file
diff --git a/cmds/statsd/tests/e2e/GaugeMetric_e2e_test.cpp b/cmds/statsd/tests/e2e/GaugeMetric_e2e_test.cpp
new file mode 100644
index 0000000..10a6c36
--- /dev/null
+++ b/cmds/statsd/tests/e2e/GaugeMetric_e2e_test.cpp
@@ -0,0 +1,193 @@
+// Copyright (C) 2017 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <gtest/gtest.h>
+
+#include "src/StatsLogProcessor.h"
+#include "src/stats_log_util.h"
+#include "tests/statsd_test_util.h"
+
+#include <vector>
+
+namespace android {
+namespace os {
+namespace statsd {
+
+#ifdef __ANDROID__
+
+namespace {
+
+StatsdConfig CreateStatsdConfigForPushedEvent() {
+ StatsdConfig config;
+ *config.add_atom_matcher() = CreateMoveToBackgroundAtomMatcher();
+ *config.add_atom_matcher() = CreateMoveToForegroundAtomMatcher();
+
+ auto atomMatcher = CreateSimpleAtomMatcher("", android::util::APP_START_CHANGED);
+ *config.add_atom_matcher() = atomMatcher;
+
+ auto isInBackgroundPredicate = CreateIsInBackgroundPredicate();
+ *isInBackgroundPredicate.mutable_simple_predicate()->mutable_dimensions() =
+ CreateDimensions(android::util::ACTIVITY_FOREGROUND_STATE_CHANGED, {1 /* uid field */ });
+ *config.add_predicate() = isInBackgroundPredicate;
+
+ auto gaugeMetric = config.add_gauge_metric();
+ gaugeMetric->set_id(123456);
+ gaugeMetric->set_what(atomMatcher.id());
+ gaugeMetric->set_condition(isInBackgroundPredicate.id());
+ gaugeMetric->mutable_gauge_fields_filter()->set_include_all(false);
+ auto fieldMatcher = gaugeMetric->mutable_gauge_fields_filter()->mutable_fields();
+ fieldMatcher->set_field(android::util::APP_START_CHANGED);
+ fieldMatcher->add_child()->set_field(3); // type (enum)
+ fieldMatcher->add_child()->set_field(4); // activity_name(str)
+ fieldMatcher->add_child()->set_field(7); // activity_start_msec(int64)
+ *gaugeMetric->mutable_dimensions() =
+ CreateDimensions(android::util::APP_START_CHANGED, {1 /* uid field */ });
+ gaugeMetric->set_bucket(ONE_MINUTE);
+
+ auto links = gaugeMetric->add_links();
+ links->set_condition(isInBackgroundPredicate.id());
+ auto dimensionWhat = links->mutable_dimensions_in_what();
+ dimensionWhat->set_field(android::util::APP_START_CHANGED);
+ dimensionWhat->add_child()->set_field(1); // uid field.
+ auto dimensionCondition = links->mutable_dimensions_in_condition();
+ dimensionCondition->set_field(android::util::ACTIVITY_FOREGROUND_STATE_CHANGED);
+ dimensionCondition->add_child()->set_field(1); // uid field.
+ return config;
+}
+
+std::unique_ptr<LogEvent> CreateAppStartChangedEvent(
+ const int uid, const string& pkg_name, AppStartChanged::TransitionType type,
+ const string& activity_name, const string& calling_pkg_name, const bool is_instant_app,
+ int64_t activity_start_msec, uint64_t timestampNs) {
+ auto logEvent = std::make_unique<LogEvent>(
+ android::util::APP_START_CHANGED, timestampNs);
+ logEvent->write(uid);
+ logEvent->write(pkg_name);
+ logEvent->write(type);
+ logEvent->write(activity_name);
+ logEvent->write(calling_pkg_name);
+ logEvent->write(is_instant_app);
+ logEvent->write(activity_start_msec);
+ logEvent->init();
+ return logEvent;
+}
+
+} // namespace
+
+TEST(GaugeMetricE2eTest, TestMultipleFieldsForPushedEvent) {
+ auto config = CreateStatsdConfigForPushedEvent();
+ int64_t bucketStartTimeNs = 10000000000;
+ int64_t bucketSizeNs =
+ TimeUnitToBucketSizeInMillis(config.gauge_metric(0).bucket()) * 1000000;
+
+ ConfigKey cfgKey;
+ auto processor = CreateStatsLogProcessor(bucketStartTimeNs / NS_PER_SEC, config, cfgKey);
+ EXPECT_EQ(processor->mMetricsManagers.size(), 1u);
+ EXPECT_TRUE(processor->mMetricsManagers.begin()->second->isConfigValid());
+
+ int appUid1 = 123;
+ int appUid2 = 456;
+ std::vector<std::unique_ptr<LogEvent>> events;
+ events.push_back(CreateMoveToBackgroundEvent(appUid1, bucketStartTimeNs + 15));
+ events.push_back(CreateMoveToForegroundEvent(appUid1, bucketStartTimeNs + bucketSizeNs + 250));
+ events.push_back(CreateMoveToBackgroundEvent(appUid1, bucketStartTimeNs + bucketSizeNs + 350));
+ events.push_back(CreateMoveToForegroundEvent(
+ appUid1, bucketStartTimeNs + 2 * bucketSizeNs + 100));
+
+
+ events.push_back(CreateAppStartChangedEvent(
+ appUid1, "app1", AppStartChanged::WARM, "activity_name1", "calling_pkg_name1",
+ true /*is_instant_app*/, 101 /*activity_start_msec*/, bucketStartTimeNs + 10));
+ events.push_back(CreateAppStartChangedEvent(
+ appUid1, "app1", AppStartChanged::HOT, "activity_name2", "calling_pkg_name2",
+ true /*is_instant_app*/, 102 /*activity_start_msec*/, bucketStartTimeNs + 20));
+ events.push_back(CreateAppStartChangedEvent(
+ appUid1, "app1", AppStartChanged::COLD, "activity_name3", "calling_pkg_name3",
+ true /*is_instant_app*/, 103 /*activity_start_msec*/, bucketStartTimeNs + 30));
+ events.push_back(CreateAppStartChangedEvent(
+ appUid1, "app1", AppStartChanged::WARM, "activity_name4", "calling_pkg_name4",
+ true /*is_instant_app*/, 104 /*activity_start_msec*/,
+ bucketStartTimeNs + bucketSizeNs + 30));
+ events.push_back(CreateAppStartChangedEvent(
+ appUid1, "app1", AppStartChanged::COLD, "activity_name5", "calling_pkg_name5",
+ true /*is_instant_app*/, 105 /*activity_start_msec*/,
+ bucketStartTimeNs + 2 * bucketSizeNs));
+ events.push_back(CreateAppStartChangedEvent(
+ appUid1, "app1", AppStartChanged::HOT, "activity_name6", "calling_pkg_name6",
+ false /*is_instant_app*/, 106 /*activity_start_msec*/,
+ bucketStartTimeNs + 2 * bucketSizeNs + 10));
+
+ events.push_back(CreateMoveToBackgroundEvent(appUid2, bucketStartTimeNs + bucketSizeNs + 10));
+ events.push_back(CreateAppStartChangedEvent(
+ appUid2, "app2", AppStartChanged::COLD, "activity_name7", "calling_pkg_name7",
+ true /*is_instant_app*/, 201 /*activity_start_msec*/,
+ bucketStartTimeNs + 2 * bucketSizeNs + 10));
+
+ sortLogEventsByTimestamp(&events);
+
+ for (const auto& event : events) {
+ processor->OnLogEvent(event.get());
+ }
+ ConfigMetricsReportList reports;
+ processor->onDumpReport(cfgKey, bucketStartTimeNs + 3 * bucketSizeNs, &reports);
+ EXPECT_EQ(reports.reports_size(), 1);
+ EXPECT_EQ(reports.reports(0).metrics_size(), 1);
+ StatsLogReport::GaugeMetricDataWrapper gaugeMetrics;
+ sortMetricDataByDimensionsValue(reports.reports(0).metrics(0).gauge_metrics(), &gaugeMetrics);
+ EXPECT_EQ(gaugeMetrics.data_size(), 2);
+
+ auto data = gaugeMetrics.data(0);
+ EXPECT_EQ(data.dimension().field(), android::util::APP_START_CHANGED);
+ EXPECT_EQ(data.dimension().value_tuple().dimensions_value_size(), 1);
+ EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0).field(), 1 /* uid field */);
+ EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0).value_int(), appUid1);
+ EXPECT_EQ(data.bucket_info_size(), 3);
+ EXPECT_EQ(data.bucket_info(0).start_bucket_nanos(), bucketStartTimeNs);
+ EXPECT_EQ(data.bucket_info(0).end_bucket_nanos(), bucketStartTimeNs + bucketSizeNs);
+ EXPECT_EQ(data.bucket_info(0).atom().app_start_changed().type(), AppStartChanged::HOT);
+ EXPECT_EQ(data.bucket_info(0).atom().app_start_changed().activity_name(), "activity_name2");
+ EXPECT_EQ(data.bucket_info(0).atom().app_start_changed().activity_start_msec(), 102L);
+
+ EXPECT_EQ(data.bucket_info(1).start_bucket_nanos(), bucketStartTimeNs + bucketSizeNs);
+ EXPECT_EQ(data.bucket_info(1).end_bucket_nanos(), bucketStartTimeNs + 2 * bucketSizeNs);
+ EXPECT_EQ(data.bucket_info(1).atom().app_start_changed().type(), AppStartChanged::WARM);
+ EXPECT_EQ(data.bucket_info(1).atom().app_start_changed().activity_name(), "activity_name4");
+ EXPECT_EQ(data.bucket_info(1).atom().app_start_changed().activity_start_msec(), 104L);
+
+ EXPECT_EQ(data.bucket_info(2).start_bucket_nanos(), bucketStartTimeNs + 2 * bucketSizeNs);
+ EXPECT_EQ(data.bucket_info(2).end_bucket_nanos(), bucketStartTimeNs + 3 * bucketSizeNs);
+ EXPECT_EQ(data.bucket_info(2).atom().app_start_changed().type(), AppStartChanged::COLD);
+ EXPECT_EQ(data.bucket_info(2).atom().app_start_changed().activity_name(), "activity_name5");
+ EXPECT_EQ(data.bucket_info(2).atom().app_start_changed().activity_start_msec(), 105L);
+
+ data = gaugeMetrics.data(1);
+ EXPECT_EQ(data.dimension().field(), android::util::APP_START_CHANGED);
+ EXPECT_EQ(data.dimension().value_tuple().dimensions_value_size(), 1);
+ EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0).field(), 1 /* uid field */);
+ EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0).value_int(), appUid2);
+ EXPECT_EQ(data.bucket_info_size(), 1);
+ EXPECT_EQ(data.bucket_info(0).start_bucket_nanos(), bucketStartTimeNs + 2 * bucketSizeNs);
+ EXPECT_EQ(data.bucket_info(0).end_bucket_nanos(), bucketStartTimeNs + 3 * bucketSizeNs);
+ EXPECT_EQ(data.bucket_info(0).atom().app_start_changed().type(), AppStartChanged::COLD);
+ EXPECT_EQ(data.bucket_info(0).atom().app_start_changed().activity_name(), "activity_name7");
+ EXPECT_EQ(data.bucket_info(0).atom().app_start_changed().activity_start_msec(), 201L);
+}
+
+#else
+GTEST_LOG_(INFO) << "This test does nothing.\n";
+#endif
+
+} // namespace statsd
+} // namespace os
+} // namespace android
\ No newline at end of file
diff --git a/cmds/statsd/tests/e2e/WakelockDuration_e2e_test.cpp b/cmds/statsd/tests/e2e/WakelockDuration_e2e_test.cpp
index 2783356..fcdaafc 100644
--- a/cmds/statsd/tests/e2e/WakelockDuration_e2e_test.cpp
+++ b/cmds/statsd/tests/e2e/WakelockDuration_e2e_test.cpp
@@ -26,6 +26,8 @@
#ifdef __ANDROID__
+namespace {
+
StatsdConfig CreateStatsdConfig(DurationMetric::AggregationType aggregationType) {
StatsdConfig config;
*config.add_atom_matcher() = CreateScreenTurnedOnAtomMatcher();
@@ -56,6 +58,8 @@
return config;
}
+} // namespace
+
TEST(WakelockDurationE2eTest, TestAggregatedPredicateDimensions) {
ConfigKey cfgKey;
for (auto aggregationType : { DurationMetric::SUM, DurationMetric::MAX_SPARSE }) {
@@ -94,6 +98,7 @@
auto releaseEvent2 = CreateReleaseWakelockEvent(
attributions2, "wl2", bucketStartTimeNs + 2 * bucketSizeNs - 15);
+
std::vector<std::unique_ptr<LogEvent>> events;
events.push_back(std::move(screenTurnedOnEvent));
@@ -119,18 +124,8 @@
auto data = reports.reports(0).metrics(0).duration_metrics().data(0);
// Validate dimension value.
- EXPECT_EQ(data.dimension().field(),
- android::util::WAKELOCK_STATE_CHANGED);
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value_size(), 1);
- // Attribution field.
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0).field(), 1);
- // Uid only.
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0)
- .value_tuple().dimensions_value_size(), 1);
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0)
- .value_tuple().dimensions_value(0).field(), 1);
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0)
- .value_tuple().dimensions_value(0).value_int(), 111);
+ ValidateAttributionUidDimension(
+ data.dimension(), android::util::WAKELOCK_STATE_CHANGED, 111);
// Validate bucket info.
EXPECT_EQ(reports.reports(0).metrics(0).duration_metrics().data(0).bucket_info_size(), 1);
data = reports.reports(0).metrics(0).duration_metrics().data(0);
@@ -147,18 +142,8 @@
EXPECT_EQ(reports.reports(0).metrics(0).duration_metrics().data(0).bucket_info_size(), 2);
data = reports.reports(0).metrics(0).duration_metrics().data(0);
// Validate dimension value.
- EXPECT_EQ(data.dimension().field(),
- android::util::WAKELOCK_STATE_CHANGED);
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value_size(), 1);
- // Attribution field.
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0).field(), 1);
- // Uid only.
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0)
- .value_tuple().dimensions_value_size(), 1);
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0)
- .value_tuple().dimensions_value(0).field(), 1);
- EXPECT_EQ(data.dimension().value_tuple().dimensions_value(0)
- .value_tuple().dimensions_value(0).value_int(), 111);
+ ValidateAttributionUidDimension(
+ data.dimension(), android::util::WAKELOCK_STATE_CHANGED, 111);
// Two output buckets.
// The wakelock holding interval in the 1st bucket starts from the screen off event and to
// the end of the 1st bucket.
@@ -167,6 +152,32 @@
// The wakelock holding interval in the 2nd bucket starts at the beginning of the bucket and
// ends at the second screen on event.
EXPECT_EQ((unsigned long long)data.bucket_info(1).duration_nanos(), 500UL);
+
+ events.clear();
+ events.push_back(CreateScreenStateChangedEvent(
+ ScreenStateChanged::STATE_OFF, bucketStartTimeNs + 2 * bucketSizeNs + 90));
+ events.push_back(CreateAcquireWakelockEvent(
+ attributions1, "wl3", bucketStartTimeNs + 2 * bucketSizeNs + 100));
+ events.push_back(CreateReleaseWakelockEvent(
+ attributions1, "wl3", bucketStartTimeNs + 5 * bucketSizeNs + 100));
+ sortLogEventsByTimestamp(&events);
+ for (const auto& event : events) {
+ processor->OnLogEvent(event.get());
+ }
+ reports.Clear();
+ processor->onDumpReport(cfgKey, bucketStartTimeNs + 6 * bucketSizeNs + 1, &reports);
+ EXPECT_EQ(reports.reports_size(), 1);
+ EXPECT_EQ(reports.reports(0).metrics_size(), 1);
+ EXPECT_EQ(reports.reports(0).metrics(0).duration_metrics().data_size(), 1);
+ EXPECT_EQ(reports.reports(0).metrics(0).duration_metrics().data(0).bucket_info_size(), 6);
+ data = reports.reports(0).metrics(0).duration_metrics().data(0);
+ ValidateAttributionUidDimension(
+ data.dimension(), android::util::WAKELOCK_STATE_CHANGED, 111);
+ // The last wakelock holding spans 4 buckets.
+ EXPECT_EQ((unsigned long long)data.bucket_info(2).duration_nanos(), bucketSizeNs - 100);
+ EXPECT_EQ((unsigned long long)data.bucket_info(3).duration_nanos(), bucketSizeNs);
+ EXPECT_EQ((unsigned long long)data.bucket_info(4).duration_nanos(), bucketSizeNs);
+ EXPECT_EQ((unsigned long long)data.bucket_info(5).duration_nanos(), 100UL);
}
}
diff --git a/cmds/statsd/tests/statsd_test_util.cpp b/cmds/statsd/tests/statsd_test_util.cpp
index e788235..718b2e1 100644
--- a/cmds/statsd/tests/statsd_test_util.cpp
+++ b/cmds/statsd/tests/statsd_test_util.cpp
@@ -19,6 +19,14 @@
namespace os {
namespace statsd {
+AtomMatcher CreateSimpleAtomMatcher(const string& name, int atomId) {
+ AtomMatcher atom_matcher;
+ atom_matcher.set_id(StringToId(name));
+ auto simple_atom_matcher = atom_matcher.mutable_simple_atom_matcher();
+ simple_atom_matcher->set_atom_id(atomId);
+ return atom_matcher;
+}
+
AtomMatcher CreateWakelockStateChangedAtomMatcher(const string& name,
WakelockStateChanged::State state) {
AtomMatcher atom_matcher;
diff --git a/cmds/statsd/tests/statsd_test_util.h b/cmds/statsd/tests/statsd_test_util.h
index 1bbbd9a..7eb93b9 100644
--- a/cmds/statsd/tests/statsd_test_util.h
+++ b/cmds/statsd/tests/statsd_test_util.h
@@ -23,6 +23,9 @@
namespace os {
namespace statsd {
+// Create AtomMatcher proto to simply match a specific atom type.
+AtomMatcher CreateSimpleAtomMatcher(const string& name, int atomId);
+
// Create AtomMatcher proto for acquiring wakelock.
AtomMatcher CreateAcquireWakelockAtomMatcher();
diff --git a/core/java/android/app/ActivityThread.java b/core/java/android/app/ActivityThread.java
index e610ac4..70c383b 100644
--- a/core/java/android/app/ActivityThread.java
+++ b/core/java/android/app/ActivityThread.java
@@ -1752,9 +1752,11 @@
handleLocalVoiceInteractionStarted((IBinder) ((SomeArgs) msg.obj).arg1,
(IVoiceInteractor) ((SomeArgs) msg.obj).arg2);
break;
- case ATTACH_AGENT:
- handleAttachAgent((String) msg.obj);
+ case ATTACH_AGENT: {
+ Application app = getApplication();
+ handleAttachAgent((String) msg.obj, app != null ? app.mLoadedApk : null);
break;
+ }
case APPLICATION_INFO_CHANGED:
mUpdatingSystemConfig = true;
try {
@@ -3246,11 +3248,23 @@
}
}
- static final void handleAttachAgent(String agent) {
+ private static boolean attemptAttachAgent(String agent, ClassLoader classLoader) {
try {
- VMDebug.attachAgent(agent);
+ VMDebug.attachAgent(agent, classLoader);
+ return true;
} catch (IOException e) {
- Slog.e(TAG, "Attaching agent failed: " + agent);
+ Slog.e(TAG, "Attaching agent with " + classLoader + " failed: " + agent);
+ return false;
+ }
+ }
+
+ static void handleAttachAgent(String agent, LoadedApk loadedApk) {
+ ClassLoader classLoader = loadedApk != null ? loadedApk.getClassLoader() : null;
+ if (attemptAttachAgent(agent, classLoader)) {
+ return;
+ }
+ if (classLoader != null) {
+ attemptAttachAgent(agent, null);
}
}
@@ -5542,12 +5556,16 @@
mCompatConfiguration = new Configuration(data.config);
mProfiler = new Profiler();
+ String agent = null;
if (data.initProfilerInfo != null) {
mProfiler.profileFile = data.initProfilerInfo.profileFile;
mProfiler.profileFd = data.initProfilerInfo.profileFd;
mProfiler.samplingInterval = data.initProfilerInfo.samplingInterval;
mProfiler.autoStopProfiler = data.initProfilerInfo.autoStopProfiler;
mProfiler.streamingOutput = data.initProfilerInfo.streamingOutput;
+ if (data.initProfilerInfo.attachAgentDuringBind) {
+ agent = data.initProfilerInfo.agent;
+ }
}
// send up app name; do this *before* waiting for debugger
@@ -5597,6 +5615,10 @@
data.loadedApk = getLoadedApkNoCheck(data.appInfo, data.compatInfo);
+ if (agent != null) {
+ handleAttachAgent(agent, data.loadedApk);
+ }
+
/**
* Switch this process to density compatibility mode if needed.
*/
diff --git a/core/java/android/app/ProfilerInfo.java b/core/java/android/app/ProfilerInfo.java
index d523427..a295c4c 100644
--- a/core/java/android/app/ProfilerInfo.java
+++ b/core/java/android/app/ProfilerInfo.java
@@ -55,14 +55,24 @@
*/
public final String agent;
+ /**
+ * Whether the {@link agent} should be attached early (before bind-application) or during
+ * bind-application. Agents attached prior to binding cannot be loaded from the app's APK
+ * directly and must be given as an absolute path (or available in the default LD_LIBRARY_PATH).
+ * Agents attached during bind-application will miss early setup (e.g., resource initialization
+ * and classloader generation), but are searched in the app's library search path.
+ */
+ public final boolean attachAgentDuringBind;
+
public ProfilerInfo(String filename, ParcelFileDescriptor fd, int interval, boolean autoStop,
- boolean streaming, String agent) {
+ boolean streaming, String agent, boolean attachAgentDuringBind) {
profileFile = filename;
profileFd = fd;
samplingInterval = interval;
autoStopProfiler = autoStop;
streamingOutput = streaming;
this.agent = agent;
+ this.attachAgentDuringBind = attachAgentDuringBind;
}
public ProfilerInfo(ProfilerInfo in) {
@@ -72,6 +82,7 @@
autoStopProfiler = in.autoStopProfiler;
streamingOutput = in.streamingOutput;
agent = in.agent;
+ attachAgentDuringBind = in.attachAgentDuringBind;
}
/**
@@ -110,6 +121,7 @@
out.writeInt(autoStopProfiler ? 1 : 0);
out.writeInt(streamingOutput ? 1 : 0);
out.writeString(agent);
+ out.writeBoolean(attachAgentDuringBind);
}
public static final Parcelable.Creator<ProfilerInfo> CREATOR =
@@ -132,6 +144,7 @@
autoStopProfiler = in.readInt() != 0;
streamingOutput = in.readInt() != 0;
agent = in.readString();
+ attachAgentDuringBind = in.readBoolean();
}
@Override
diff --git a/core/java/android/app/admin/ConnectEvent.java b/core/java/android/app/admin/ConnectEvent.java
index f06a925..d511c57 100644
--- a/core/java/android/app/admin/ConnectEvent.java
+++ b/core/java/android/app/admin/ConnectEvent.java
@@ -68,7 +68,7 @@
@Override
public String toString() {
- return String.format("ConnectEvent(%s, %d, %d, %s)", mIpAddress, mPort, mTimestamp,
+ return String.format("ConnectEvent(%d, %s, %d, %d, %s)", mId, mIpAddress, mPort, mTimestamp,
mPackageName);
}
diff --git a/core/java/android/app/admin/DevicePolicyManager.java b/core/java/android/app/admin/DevicePolicyManager.java
index e334aab..67b59f6 100644
--- a/core/java/android/app/admin/DevicePolicyManager.java
+++ b/core/java/android/app/admin/DevicePolicyManager.java
@@ -8633,6 +8633,13 @@
*
* <p> Backup service is off by default when device owner is present.
*
+ * <p> If backups are made mandatory by specifying a non-null mandatory backup transport using
+ * the {@link DevicePolicyManager#setMandatoryBackupTransport} method, the backup service is
+ * automatically enabled.
+ *
+ * <p> If the backup service is disabled using this method after the mandatory backup transport
+ * has been set, the mandatory backup transport is cleared.
+ *
* @param admin Which {@link DeviceAdminReceiver} this request is associated with.
* @param enabled {@code true} to enable the backup service, {@code false} to disable it.
* @throws SecurityException if {@code admin} is not a device owner.
@@ -8664,6 +8671,43 @@
}
/**
+ * Makes backups mandatory and enforces the usage of the specified backup transport.
+ *
+ * <p>When a {@code null} backup transport is specified, backups are made optional again.
+ * <p>Only device owner can call this method.
+ * <p>If backups were disabled and a non-null backup transport {@link ComponentName} is
+ * specified, backups will be enabled.
+ *
+ * @param admin admin Which {@link DeviceAdminReceiver} this request is associated with.
+ * @param backupTransportComponent The backup transport layer to be used for mandatory backups.
+ * @throws SecurityException if {@code admin} is not a device owner.
+ */
+ public void setMandatoryBackupTransport(
+ @NonNull ComponentName admin, @Nullable ComponentName backupTransportComponent) {
+ try {
+ mService.setMandatoryBackupTransport(admin, backupTransportComponent);
+ } catch (RemoteException re) {
+ throw re.rethrowFromSystemServer();
+ }
+ }
+
+ /**
+ * Returns the backup transport which has to be used for backups if backups are mandatory or
+ * {@code null} if backups are not mandatory.
+ *
+ * @return a {@link ComponentName} of the backup transport layer to be used if backups are
+ * mandatory or {@code null} if backups are not mandatory.
+ */
+ public ComponentName getMandatoryBackupTransport() {
+ try {
+ return mService.getMandatoryBackupTransport();
+ } catch (RemoteException re) {
+ throw re.rethrowFromSystemServer();
+ }
+ }
+
+
+ /**
* Called by a device owner to control the network logging feature.
*
* <p> Network logs contain DNS lookup and connect() library call events. The following library
diff --git a/core/java/android/app/admin/DnsEvent.java b/core/java/android/app/admin/DnsEvent.java
index 4ddf13e..a2d704b 100644
--- a/core/java/android/app/admin/DnsEvent.java
+++ b/core/java/android/app/admin/DnsEvent.java
@@ -96,7 +96,7 @@
@Override
public String toString() {
- return String.format("DnsEvent(%s, %s, %d, %d, %s)", mHostname,
+ return String.format("DnsEvent(%d, %s, %s, %d, %d, %s)", mId, mHostname,
(mIpAddresses == null) ? "NONE" : String.join(" ", mIpAddresses),
mIpAddressesCount, mTimestamp, mPackageName);
}
diff --git a/core/java/android/app/admin/IDevicePolicyManager.aidl b/core/java/android/app/admin/IDevicePolicyManager.aidl
index 7154053..9cdd1f8 100644
--- a/core/java/android/app/admin/IDevicePolicyManager.aidl
+++ b/core/java/android/app/admin/IDevicePolicyManager.aidl
@@ -359,6 +359,8 @@
void setBackupServiceEnabled(in ComponentName admin, boolean enabled);
boolean isBackupServiceEnabled(in ComponentName admin);
+ void setMandatoryBackupTransport(in ComponentName admin, in ComponentName backupTransportComponent);
+ ComponentName getMandatoryBackupTransport();
void setNetworkLoggingEnabled(in ComponentName admin, boolean enabled);
boolean isNetworkLoggingEnabled(in ComponentName admin);
diff --git a/core/java/android/app/backup/BackupTransport.java b/core/java/android/app/backup/BackupTransport.java
index da81d19..3558e34 100644
--- a/core/java/android/app/backup/BackupTransport.java
+++ b/core/java/android/app/backup/BackupTransport.java
@@ -55,6 +55,22 @@
// Transport should ignore its own moratoriums for call with this flag set.
public static final int FLAG_USER_INITIATED = 1;
+ /**
+ * For key value backup, indicates that the backup data is a diff from a previous backup. The
+ * transport must apply this diff to an existing backup to build the new backup set.
+ *
+ * @hide
+ */
+ public static final int FLAG_INCREMENTAL = 1 << 1;
+
+ /**
+ * For key value backup, indicates that the backup data is a complete set, not a diff from a
+ * previous backup. The transport should clear any previous backup when storing this backup.
+ *
+ * @hide
+ */
+ public static final int FLAG_NON_INCREMENTAL = 1 << 2;
+
IBackupTransport mBinderImpl = new TransportImpl();
public IBinder getBinder() {
@@ -231,12 +247,18 @@
* {@link #TRANSPORT_OK}, {@link #finishBackup} will then be called to ensure the data
* is sent and recorded successfully.
*
+ * If the backup data is a diff against the previous backup then the flag {@link
+ * BackupTransport#FLAG_INCREMENTAL} will be set. Otherwise, if the data is a complete backup
+ * set then {@link BackupTransport#FLAG_NON_INCREMENTAL} will be set. Before P neither flag will
+ * be set regardless of whether the backup is incremental or not.
+ *
* @param packageInfo The identity of the application whose data is being backed up.
* This specifically includes the signature list for the package.
* @param inFd Descriptor of file with data that resulted from invoking the application's
* BackupService.doBackup() method. This may be a pipe rather than a file on
* persistent media, so it may not be seekable.
- * @param flags {@link BackupTransport#FLAG_USER_INITIATED} or 0.
+ * @param flags a combination of {@link BackupTransport#FLAG_USER_INITIATED}, {@link
+ * BackupTransport#FLAG_NON_INCREMENTAL}, {@link BackupTransport#FLAG_INCREMENTAL}, or 0.
* @return one of {@link BackupTransport#TRANSPORT_OK} (OK so far),
* {@link BackupTransport#TRANSPORT_PACKAGE_REJECTED} (to suppress backup of this
* specific package, but allow others to proceed),
diff --git a/core/java/android/app/backup/IBackupManager.aidl b/core/java/android/app/backup/IBackupManager.aidl
index 792cb5f..f3ca746 100644
--- a/core/java/android/app/backup/IBackupManager.aidl
+++ b/core/java/android/app/backup/IBackupManager.aidl
@@ -294,7 +294,8 @@
*
* @param transport ComponentName of the service hosting the transport. This is different from
* the transport's name that is returned by {@link BackupTransport#name()}.
- * @param listener A listener object to get a callback on the transport being selected.
+ * @param listener A listener object to get a callback on the transport being selected. It may
+ * be {@code null}.
*
* @hide
*/
diff --git a/core/java/android/app/job/JobParameters.java b/core/java/android/app/job/JobParameters.java
index 5053dc6..c71bf2e 100644
--- a/core/java/android/app/job/JobParameters.java
+++ b/core/java/android/app/job/JobParameters.java
@@ -70,6 +70,7 @@
private final Network network;
private int stopReason; // Default value of stopReason is REASON_CANCELED
+ private String debugStopReason; // Human readable stop reason for debugging.
/** @hide */
public JobParameters(IBinder callback, int jobId, PersistableBundle extras,
@@ -104,6 +105,14 @@
}
/**
+ * Reason onStopJob() was called on this job.
+ * @hide
+ */
+ public String getDebugStopReason() {
+ return debugStopReason;
+ }
+
+ /**
* @return The extras you passed in when constructing this job with
* {@link android.app.job.JobInfo.Builder#setExtras(android.os.PersistableBundle)}. This will
* never be null. If you did not set any extras this will be an empty bundle.
@@ -288,11 +297,13 @@
network = null;
}
stopReason = in.readInt();
+ debugStopReason = in.readString();
}
/** @hide */
- public void setStopReason(int reason) {
+ public void setStopReason(int reason, String debugStopReason) {
stopReason = reason;
+ this.debugStopReason = debugStopReason;
}
@Override
@@ -323,6 +334,7 @@
dest.writeInt(0);
}
dest.writeInt(stopReason);
+ dest.writeString(debugStopReason);
}
public static final Creator<JobParameters> CREATOR = new Creator<JobParameters>() {
diff --git a/core/java/android/content/pm/PackageParser.java b/core/java/android/content/pm/PackageParser.java
index a18f22e..6d6c02a 100644
--- a/core/java/android/content/pm/PackageParser.java
+++ b/core/java/android/content/pm/PackageParser.java
@@ -6285,6 +6285,31 @@
+ " " + packageName + "}";
}
+ public String dumpState_temp() {
+ String flags = "";
+ flags += ((applicationInfo.flags & ApplicationInfo.FLAG_UPDATED_SYSTEM_APP) != 0 ? "U" : "");
+ flags += ((applicationInfo.flags & ApplicationInfo.FLAG_SYSTEM) != 0 ? "S" : "");
+ if ("".equals(flags)) {
+ flags = "-";
+ }
+ String privFlags = "";
+ privFlags += ((applicationInfo.privateFlags & ApplicationInfo.PRIVATE_FLAG_PRIVILEGED) != 0 ? "P" : "");
+ privFlags += ((applicationInfo.privateFlags & ApplicationInfo.PRIVATE_FLAG_OEM) != 0 ? "O" : "");
+ privFlags += ((applicationInfo.privateFlags & ApplicationInfo.PRIVATE_FLAG_VENDOR) != 0 ? "V" : "");
+ if ("".equals(privFlags)) {
+ privFlags = "-";
+ }
+ return "Package{"
+ + Integer.toHexString(System.identityHashCode(this))
+ + " " + packageName
+ + ", ver:" + getLongVersionCode()
+ + ", path: " + codePath
+ + ", flags: " + flags
+ + ", privFlags: " + privFlags
+ + ", extra: " + (mExtras == null ? "<<NULL>>" : Integer.toHexString(System.identityHashCode(mExtras)) + "}")
+ + "}";
+ }
+
@Override
public int describeContents() {
return 0;
diff --git a/core/java/android/hardware/display/BrightnessChangeEvent.java b/core/java/android/hardware/display/BrightnessChangeEvent.java
index 0a08353..2301824 100644
--- a/core/java/android/hardware/display/BrightnessChangeEvent.java
+++ b/core/java/android/hardware/display/BrightnessChangeEvent.java
@@ -16,6 +16,8 @@
package android.hardware.display;
+import android.annotation.SystemApi;
+import android.annotation.TestApi;
import android.os.Parcel;
import android.os.Parcelable;
@@ -23,51 +25,65 @@
* Data about a brightness settings change.
*
* {@see DisplayManager.getBrightnessEvents()}
- * TODO make this SystemAPI
* @hide
*/
+@SystemApi
+@TestApi
public final class BrightnessChangeEvent implements Parcelable {
/** Brightness in nits */
- public float brightness;
+ public final float brightness;
/** Timestamp of the change {@see System.currentTimeMillis()} */
- public long timeStamp;
+ public final long timeStamp;
/** Package name of focused activity when brightness was changed.
* This will be null if the caller of {@see DisplayManager.getBrightnessEvents()}
* does not have access to usage stats {@see UsageStatsManager} */
- public String packageName;
+ public final String packageName;
/** User id of of the user running when brightness was changed.
* @hide */
- public int userId;
+ public final int userId;
/** Lux values of recent sensor data */
- public float[] luxValues;
+ public final float[] luxValues;
/** Timestamps of the lux sensor readings {@see System.currentTimeMillis()} */
- public long[] luxTimestamps;
+ public final long[] luxTimestamps;
/** Most recent battery level when brightness was changed or Float.NaN */
- public float batteryLevel;
+ public final float batteryLevel;
/** Color filter active to provide night mode */
- public boolean nightMode;
+ public final boolean nightMode;
/** If night mode color filter is active this will be the temperature in kelvin */
- public int colorTemperature;
+ public final int colorTemperature;
- /** Brightness level before slider adjustment */
- public float lastBrightness;
+ /** Brightness le vel before slider adjustment */
+ public final float lastBrightness;
- public BrightnessChangeEvent() {
+ /** @hide */
+ private BrightnessChangeEvent(float brightness, long timeStamp, String packageName,
+ int userId, float[] luxValues, long[] luxTimestamps, float batteryLevel,
+ boolean nightMode, int colorTemperature, float lastBrightness) {
+ this.brightness = brightness;
+ this.timeStamp = timeStamp;
+ this.packageName = packageName;
+ this.userId = userId;
+ this.luxValues = luxValues;
+ this.luxTimestamps = luxTimestamps;
+ this.batteryLevel = batteryLevel;
+ this.nightMode = nightMode;
+ this.colorTemperature = colorTemperature;
+ this.lastBrightness = lastBrightness;
}
/** @hide */
- public BrightnessChangeEvent(BrightnessChangeEvent other) {
+ public BrightnessChangeEvent(BrightnessChangeEvent other, boolean redactPackage) {
this.brightness = other.brightness;
this.timeStamp = other.timeStamp;
- this.packageName = other.packageName;
+ this.packageName = redactPackage ? null : other.packageName;
this.userId = other.userId;
this.luxValues = other.luxValues;
this.luxTimestamps = other.luxTimestamps;
@@ -118,4 +134,85 @@
dest.writeInt(colorTemperature);
dest.writeFloat(lastBrightness);
}
+
+ /** @hide */
+ public static class Builder {
+ private float mBrightness;
+ private long mTimeStamp;
+ private String mPackageName;
+ private int mUserId;
+ private float[] mLuxValues;
+ private long[] mLuxTimestamps;
+ private float mBatteryLevel;
+ private boolean mNightMode;
+ private int mColorTemperature;
+ private float mLastBrightness;
+
+ /** {@see BrightnessChangeEvent#brightness} */
+ public Builder setBrightness(float brightness) {
+ mBrightness = brightness;
+ return this;
+ }
+
+ /** {@see BrightnessChangeEvent#timeStamp} */
+ public Builder setTimeStamp(long timeStamp) {
+ mTimeStamp = timeStamp;
+ return this;
+ }
+
+ /** {@see BrightnessChangeEvent#packageName} */
+ public Builder setPackageName(String packageName) {
+ mPackageName = packageName;
+ return this;
+ }
+
+ /** {@see BrightnessChangeEvent#userId} */
+ public Builder setUserId(int userId) {
+ mUserId = userId;
+ return this;
+ }
+
+ /** {@see BrightnessChangeEvent#luxValues} */
+ public Builder setLuxValues(float[] luxValues) {
+ mLuxValues = luxValues;
+ return this;
+ }
+
+ /** {@see BrightnessChangeEvent#luxTimestamps} */
+ public Builder setLuxTimestamps(long[] luxTimestamps) {
+ mLuxTimestamps = luxTimestamps;
+ return this;
+ }
+
+ /** {@see BrightnessChangeEvent#batteryLevel} */
+ public Builder setBatteryLevel(float batteryLevel) {
+ mBatteryLevel = batteryLevel;
+ return this;
+ }
+
+ /** {@see BrightnessChangeEvent#nightMode} */
+ public Builder setNightMode(boolean nightMode) {
+ mNightMode = nightMode;
+ return this;
+ }
+
+ /** {@see BrightnessChangeEvent#colorTemperature} */
+ public Builder setColorTemperature(int colorTemperature) {
+ mColorTemperature = colorTemperature;
+ return this;
+ }
+
+ /** {@see BrightnessChangeEvent#lastBrightness} */
+ public Builder setLastBrightness(float lastBrightness) {
+ mLastBrightness = lastBrightness;
+ return this;
+ }
+
+ /** Builds a BrightnessChangeEvent */
+ public BrightnessChangeEvent build() {
+ return new BrightnessChangeEvent(mBrightness, mTimeStamp,
+ mPackageName, mUserId, mLuxValues, mLuxTimestamps, mBatteryLevel,
+ mNightMode, mColorTemperature, mLastBrightness);
+ }
+ }
}
diff --git a/core/java/android/hardware/display/BrightnessConfiguration.java b/core/java/android/hardware/display/BrightnessConfiguration.java
index 6c3be81..2156491 100644
--- a/core/java/android/hardware/display/BrightnessConfiguration.java
+++ b/core/java/android/hardware/display/BrightnessConfiguration.java
@@ -16,6 +16,8 @@
package android.hardware.display;
+import android.annotation.SystemApi;
+import android.annotation.TestApi;
import android.os.Parcel;
import android.os.Parcelable;
import android.util.Pair;
@@ -25,6 +27,8 @@
import java.util.Arrays;
/** @hide */
+@SystemApi
+@TestApi
public final class BrightnessConfiguration implements Parcelable {
private final float[] mLux;
private final float[] mNits;
diff --git a/core/java/android/hardware/display/DisplayManager.java b/core/java/android/hardware/display/DisplayManager.java
index 97e9b9c..76ab35d 100644
--- a/core/java/android/hardware/display/DisplayManager.java
+++ b/core/java/android/hardware/display/DisplayManager.java
@@ -22,6 +22,7 @@
import android.annotation.RequiresPermission;
import android.annotation.SystemApi;
import android.annotation.SystemService;
+import android.annotation.TestApi;
import android.app.KeyguardManager;
import android.content.Context;
import android.graphics.Point;
@@ -622,6 +623,8 @@
* Fetch {@link BrightnessChangeEvent}s.
* @hide until we make it a system api.
*/
+ @SystemApi
+ @TestApi
@RequiresPermission(Manifest.permission.BRIGHTNESS_SLIDER_USAGE)
public List<BrightnessChangeEvent> getBrightnessEvents() {
return mGlobal.getBrightnessEvents(mContext.getOpPackageName());
@@ -632,6 +635,9 @@
*
* @hide
*/
+ @SystemApi
+ @TestApi
+ @RequiresPermission(Manifest.permission.CONFIGURE_DISPLAY_BRIGHTNESS)
public void setBrightnessConfiguration(BrightnessConfiguration c) {
setBrightnessConfigurationForUser(c, UserHandle.myUserId());
}
diff --git a/core/java/android/hardware/radio/ITuner.aidl b/core/java/android/hardware/radio/ITuner.aidl
index ca38076..bf5e391 100644
--- a/core/java/android/hardware/radio/ITuner.aidl
+++ b/core/java/android/hardware/radio/ITuner.aidl
@@ -17,6 +17,7 @@
package android.hardware.radio;
import android.graphics.Bitmap;
+import android.hardware.radio.ProgramList;
import android.hardware.radio.ProgramSelector;
import android.hardware.radio.RadioManager;
@@ -73,14 +74,8 @@
*/
boolean startBackgroundScan();
- /**
- * @param vendorFilter Vendor-specific filter, must be Map<String, String>
- * @return the list, or null if scan is in progress
- * @throws IllegalArgumentException if invalid arguments are passed
- * @throws IllegalStateException if the scan has not been started, client may
- * call startBackgroundScan to fix this.
- */
- List<RadioManager.ProgramInfo> getProgramList(in Map vendorFilter);
+ void startProgramListUpdates(in ProgramList.Filter filter);
+ void stopProgramListUpdates();
boolean isConfigFlagSupported(int flag);
boolean isConfigFlagSet(int flag);
diff --git a/core/java/android/hardware/radio/ITunerCallback.aidl b/core/java/android/hardware/radio/ITunerCallback.aidl
index 775e25c..54af30f 100644
--- a/core/java/android/hardware/radio/ITunerCallback.aidl
+++ b/core/java/android/hardware/radio/ITunerCallback.aidl
@@ -16,6 +16,7 @@
package android.hardware.radio;
+import android.hardware.radio.ProgramList;
import android.hardware.radio.RadioManager;
import android.hardware.radio.RadioMetadata;
@@ -30,6 +31,7 @@
void onBackgroundScanAvailabilityChange(boolean isAvailable);
void onBackgroundScanComplete();
void onProgramListChanged();
+ void onProgramListUpdated(in ProgramList.Chunk chunk);
/**
* @param parameters Vendor-specific key-value pairs, must be Map<String, String>
diff --git a/core/java/android/hardware/radio/ProgramList.aidl b/core/java/android/hardware/radio/ProgramList.aidl
new file mode 100644
index 0000000..34b7f97
--- /dev/null
+++ b/core/java/android/hardware/radio/ProgramList.aidl
@@ -0,0 +1,23 @@
+/**
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.radio;
+
+/** @hide */
+parcelable ProgramList.Filter;
+
+/** @hide */
+parcelable ProgramList.Chunk;
diff --git a/core/java/android/hardware/radio/ProgramList.java b/core/java/android/hardware/radio/ProgramList.java
new file mode 100644
index 0000000..b2aa9ba
--- /dev/null
+++ b/core/java/android/hardware/radio/ProgramList.java
@@ -0,0 +1,427 @@
+/**
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.radio;
+
+import android.annotation.CallbackExecutor;
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.annotation.SystemApi;
+import android.os.Parcel;
+import android.os.Parcelable;
+
+import java.util.ArrayList;
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.List;
+import java.util.Map;
+import java.util.Objects;
+import java.util.Set;
+import java.util.concurrent.Executor;
+import java.util.stream.Collectors;
+
+/**
+ * @hide
+ */
+@SystemApi
+public final class ProgramList implements AutoCloseable {
+
+ private final Object mLock = new Object();
+ private final Map<ProgramSelector.Identifier, RadioManager.ProgramInfo> mPrograms =
+ new HashMap<>();
+
+ private final List<ListCallback> mListCallbacks = new ArrayList<>();
+ private final List<OnCompleteListener> mOnCompleteListeners = new ArrayList<>();
+ private OnCloseListener mOnCloseListener;
+ private boolean mIsClosed = false;
+ private boolean mIsComplete = false;
+
+ ProgramList() {}
+
+ /**
+ * Callback for list change operations.
+ */
+ public abstract static class ListCallback {
+ /**
+ * Called when item was modified or added to the list.
+ */
+ public void onItemChanged(@NonNull ProgramSelector.Identifier id) { }
+
+ /**
+ * Called when item was removed from the list.
+ */
+ public void onItemRemoved(@NonNull ProgramSelector.Identifier id) { }
+ }
+
+ /**
+ * Listener of list complete event.
+ */
+ public interface OnCompleteListener {
+ /**
+ * Called when the list turned complete (i.e. when the scan process
+ * came to an end).
+ */
+ void onComplete();
+ }
+
+ interface OnCloseListener {
+ void onClose();
+ }
+
+ /**
+ * Registers list change callback with executor.
+ */
+ public void registerListCallback(@NonNull @CallbackExecutor Executor executor,
+ @NonNull ListCallback callback) {
+ registerListCallback(new ListCallback() {
+ public void onItemChanged(@NonNull ProgramSelector.Identifier id) {
+ executor.execute(() -> callback.onItemChanged(id));
+ }
+
+ public void onItemRemoved(@NonNull ProgramSelector.Identifier id) {
+ executor.execute(() -> callback.onItemRemoved(id));
+ }
+ });
+ }
+
+ /**
+ * Registers list change callback.
+ */
+ public void registerListCallback(@NonNull ListCallback callback) {
+ synchronized (mLock) {
+ if (mIsClosed) return;
+ mListCallbacks.add(Objects.requireNonNull(callback));
+ }
+ }
+
+ /**
+ * Unregisters list change callback.
+ */
+ public void unregisterListCallback(@NonNull ListCallback callback) {
+ synchronized (mLock) {
+ if (mIsClosed) return;
+ mListCallbacks.remove(Objects.requireNonNull(callback));
+ }
+ }
+
+ /**
+ * Adds list complete event listener with executor.
+ */
+ public void addOnCompleteListener(@NonNull @CallbackExecutor Executor executor,
+ @NonNull OnCompleteListener listener) {
+ addOnCompleteListener(() -> executor.execute(listener::onComplete));
+ }
+
+ /**
+ * Adds list complete event listener.
+ */
+ public void addOnCompleteListener(@NonNull OnCompleteListener listener) {
+ synchronized (mLock) {
+ if (mIsClosed) return;
+ mOnCompleteListeners.add(Objects.requireNonNull(listener));
+ if (mIsComplete) listener.onComplete();
+ }
+ }
+
+ /**
+ * Removes list complete event listener.
+ */
+ public void removeOnCompleteListener(@NonNull OnCompleteListener listener) {
+ synchronized (mLock) {
+ if (mIsClosed) return;
+ mOnCompleteListeners.remove(Objects.requireNonNull(listener));
+ }
+ }
+
+ void setOnCloseListener(@Nullable OnCloseListener listener) {
+ synchronized (mLock) {
+ if (mOnCloseListener != null) {
+ throw new IllegalStateException("Close callback is already set");
+ }
+ mOnCloseListener = listener;
+ }
+ }
+
+ /**
+ * Disables list updates and releases all resources.
+ */
+ public void close() {
+ synchronized (mLock) {
+ if (mIsClosed) return;
+ mIsClosed = true;
+ mPrograms.clear();
+ mListCallbacks.clear();
+ mOnCompleteListeners.clear();
+ if (mOnCloseListener != null) {
+ mOnCloseListener.onClose();
+ mOnCloseListener = null;
+ }
+ }
+ }
+
+ void apply(@NonNull Chunk chunk) {
+ synchronized (mLock) {
+ if (mIsClosed) return;
+
+ mIsComplete = false;
+
+ if (chunk.isPurge()) {
+ new HashSet<>(mPrograms.keySet()).stream().forEach(id -> removeLocked(id));
+ }
+
+ chunk.getRemoved().stream().forEach(id -> removeLocked(id));
+ chunk.getModified().stream().forEach(info -> putLocked(info));
+
+ if (chunk.isComplete()) {
+ mIsComplete = true;
+ mOnCompleteListeners.forEach(cb -> cb.onComplete());
+ }
+ }
+ }
+
+ private void putLocked(@NonNull RadioManager.ProgramInfo value) {
+ ProgramSelector.Identifier key = value.getSelector().getPrimaryId();
+ mPrograms.put(Objects.requireNonNull(key), value);
+ ProgramSelector.Identifier sel = value.getSelector().getPrimaryId();
+ mListCallbacks.forEach(cb -> cb.onItemChanged(sel));
+ }
+
+ private void removeLocked(@NonNull ProgramSelector.Identifier key) {
+ RadioManager.ProgramInfo removed = mPrograms.remove(Objects.requireNonNull(key));
+ if (removed == null) return;
+ ProgramSelector.Identifier sel = removed.getSelector().getPrimaryId();
+ mListCallbacks.forEach(cb -> cb.onItemRemoved(sel));
+ }
+
+ /**
+ * Converts the program list in its current shape to the static List<>.
+ *
+ * @return the new List<> object; it won't receive any further updates
+ */
+ public @NonNull List<RadioManager.ProgramInfo> toList() {
+ synchronized (mLock) {
+ return mPrograms.values().stream().collect(Collectors.toList());
+ }
+ }
+
+ /**
+ * Returns the program with a specified primary identifier.
+ *
+ * @param id primary identifier of a program to fetch
+ * @return the program info, or null if there is no such program on the list
+ */
+ public @Nullable RadioManager.ProgramInfo get(@NonNull ProgramSelector.Identifier id) {
+ synchronized (mLock) {
+ return mPrograms.get(Objects.requireNonNull(id));
+ }
+ }
+
+ /**
+ * Filter for the program list.
+ */
+ public static final class Filter implements Parcelable {
+ private final @NonNull Set<Integer> mIdentifierTypes;
+ private final @NonNull Set<ProgramSelector.Identifier> mIdentifiers;
+ private final boolean mIncludeCategories;
+ private final boolean mExcludeModifications;
+ private final @Nullable Map<String, String> mVendorFilter;
+
+ /**
+ * Constructor of program list filter.
+ *
+ * Arrays passed to this constructor become owned by this object, do not modify them later.
+ *
+ * @param identifierTypes see getIdentifierTypes()
+ * @param identifiers see getIdentifiers()
+ * @param includeCategories see areCategoriesIncluded()
+ * @param excludeModifications see areModificationsExcluded()
+ */
+ public Filter(@NonNull Set<Integer> identifierTypes,
+ @NonNull Set<ProgramSelector.Identifier> identifiers,
+ boolean includeCategories, boolean excludeModifications) {
+ mIdentifierTypes = Objects.requireNonNull(identifierTypes);
+ mIdentifiers = Objects.requireNonNull(identifiers);
+ mIncludeCategories = includeCategories;
+ mExcludeModifications = excludeModifications;
+ mVendorFilter = null;
+ }
+
+ /**
+ * @hide for framework use only
+ */
+ public Filter(@Nullable Map<String, String> vendorFilter) {
+ mIdentifierTypes = Collections.emptySet();
+ mIdentifiers = Collections.emptySet();
+ mIncludeCategories = false;
+ mExcludeModifications = false;
+ mVendorFilter = vendorFilter;
+ }
+
+ private Filter(@NonNull Parcel in) {
+ mIdentifierTypes = Utils.createIntSet(in);
+ mIdentifiers = Utils.createSet(in, ProgramSelector.Identifier.CREATOR);
+ mIncludeCategories = in.readByte() != 0;
+ mExcludeModifications = in.readByte() != 0;
+ mVendorFilter = Utils.readStringMap(in);
+ }
+
+ @Override
+ public void writeToParcel(Parcel dest, int flags) {
+ Utils.writeIntSet(dest, mIdentifierTypes);
+ Utils.writeSet(dest, mIdentifiers);
+ dest.writeByte((byte) (mIncludeCategories ? 1 : 0));
+ dest.writeByte((byte) (mExcludeModifications ? 1 : 0));
+ Utils.writeStringMap(dest, mVendorFilter);
+ }
+
+ @Override
+ public int describeContents() {
+ return 0;
+ }
+
+ public static final Parcelable.Creator<Filter> CREATOR = new Parcelable.Creator<Filter>() {
+ public Filter createFromParcel(Parcel in) {
+ return new Filter(in);
+ }
+
+ public Filter[] newArray(int size) {
+ return new Filter[size];
+ }
+ };
+
+ /**
+ * @hide for framework use only
+ */
+ public Map<String, String> getVendorFilter() {
+ return mVendorFilter;
+ }
+
+ /**
+ * Returns the list of identifier types that satisfy the filter.
+ *
+ * If the program list entry contains at least one identifier of the type
+ * listed, it satisfies this condition.
+ *
+ * Empty list means no filtering on identifier type.
+ *
+ * @return the list of accepted identifier types, must not be modified
+ */
+ public @NonNull Set<Integer> getIdentifierTypes() {
+ return mIdentifierTypes;
+ }
+
+ /**
+ * Returns the list of identifiers that satisfy the filter.
+ *
+ * If the program list entry contains at least one listed identifier,
+ * it satisfies this condition.
+ *
+ * Empty list means no filtering on identifier.
+ *
+ * @return the list of accepted identifiers, must not be modified
+ */
+ public @NonNull Set<ProgramSelector.Identifier> getIdentifiers() {
+ return mIdentifiers;
+ }
+
+ /**
+ * Checks, if non-tunable entries that define tree structure on the
+ * program list (i.e. DAB ensembles) should be included.
+ */
+ public boolean areCategoriesIncluded() {
+ return mIncludeCategories;
+ }
+
+ /**
+ * Checks, if updates on entry modifications should be disabled.
+ *
+ * If true, 'modified' vector of ProgramListChunk must contain list
+ * additions only. Once the program is added to the list, it's not
+ * updated anymore.
+ */
+ public boolean areModificationsExcluded() {
+ return mExcludeModifications;
+ }
+ }
+
+ /**
+ * @hide This is a transport class used for internal communication between
+ * Broadcast Radio Service and RadioManager.
+ * Do not use it directly.
+ */
+ public static final class Chunk implements Parcelable {
+ private final boolean mPurge;
+ private final boolean mComplete;
+ private final @NonNull Set<RadioManager.ProgramInfo> mModified;
+ private final @NonNull Set<ProgramSelector.Identifier> mRemoved;
+
+ public Chunk(boolean purge, boolean complete,
+ @Nullable Set<RadioManager.ProgramInfo> modified,
+ @Nullable Set<ProgramSelector.Identifier> removed) {
+ mPurge = purge;
+ mComplete = complete;
+ mModified = (modified != null) ? modified : Collections.emptySet();
+ mRemoved = (removed != null) ? removed : Collections.emptySet();
+ }
+
+ private Chunk(@NonNull Parcel in) {
+ mPurge = in.readByte() != 0;
+ mComplete = in.readByte() != 0;
+ mModified = Utils.createSet(in, RadioManager.ProgramInfo.CREATOR);
+ mRemoved = Utils.createSet(in, ProgramSelector.Identifier.CREATOR);
+ }
+
+ @Override
+ public void writeToParcel(Parcel dest, int flags) {
+ dest.writeByte((byte) (mPurge ? 1 : 0));
+ dest.writeByte((byte) (mComplete ? 1 : 0));
+ Utils.writeSet(dest, mModified);
+ Utils.writeSet(dest, mRemoved);
+ }
+
+ @Override
+ public int describeContents() {
+ return 0;
+ }
+
+ public static final Parcelable.Creator<Chunk> CREATOR = new Parcelable.Creator<Chunk>() {
+ public Chunk createFromParcel(Parcel in) {
+ return new Chunk(in);
+ }
+
+ public Chunk[] newArray(int size) {
+ return new Chunk[size];
+ }
+ };
+
+ public boolean isPurge() {
+ return mPurge;
+ }
+
+ public boolean isComplete() {
+ return mComplete;
+ }
+
+ public @NonNull Set<RadioManager.ProgramInfo> getModified() {
+ return mModified;
+ }
+
+ public @NonNull Set<ProgramSelector.Identifier> getRemoved() {
+ return mRemoved;
+ }
+ }
+}
diff --git a/core/java/android/hardware/radio/ProgramSelector.java b/core/java/android/hardware/radio/ProgramSelector.java
index 2211cee..3556751 100644
--- a/core/java/android/hardware/radio/ProgramSelector.java
+++ b/core/java/android/hardware/radio/ProgramSelector.java
@@ -59,6 +59,7 @@
*/
@SystemApi
public final class ProgramSelector implements Parcelable {
+ public static final int PROGRAM_TYPE_INVALID = 0;
/** Analogue AM radio (with or without RDS). */
public static final int PROGRAM_TYPE_AM = 1;
/** analogue FM radio (with or without RDS). */
@@ -77,6 +78,7 @@
public static final int PROGRAM_TYPE_VENDOR_START = 1000;
public static final int PROGRAM_TYPE_VENDOR_END = 1999;
@IntDef(prefix = { "PROGRAM_TYPE_" }, value = {
+ PROGRAM_TYPE_INVALID,
PROGRAM_TYPE_AM,
PROGRAM_TYPE_FM,
PROGRAM_TYPE_AM_HD,
@@ -89,6 +91,7 @@
@Retention(RetentionPolicy.SOURCE)
public @interface ProgramType {}
+ public static final int IDENTIFIER_TYPE_INVALID = 0;
/** kHz */
public static final int IDENTIFIER_TYPE_AMFM_FREQUENCY = 1;
/** 16bit */
@@ -148,6 +151,7 @@
public static final int IDENTIFIER_TYPE_VENDOR_PRIMARY_START = PROGRAM_TYPE_VENDOR_START;
public static final int IDENTIFIER_TYPE_VENDOR_PRIMARY_END = PROGRAM_TYPE_VENDOR_END;
@IntDef(prefix = { "IDENTIFIER_TYPE_" }, value = {
+ IDENTIFIER_TYPE_INVALID,
IDENTIFIER_TYPE_AMFM_FREQUENCY,
IDENTIFIER_TYPE_RDS_PI,
IDENTIFIER_TYPE_HD_STATION_ID_EXT,
@@ -268,7 +272,7 @@
* Vendor identifiers are passed as-is to the HAL implementation,
* preserving elements order.
*
- * @return a array of vendor identifiers, must not be modified.
+ * @return an array of vendor identifiers, must not be modified.
*/
public @NonNull long[] getVendorIds() {
return mVendorIds;
diff --git a/core/java/android/hardware/radio/RadioManager.java b/core/java/android/hardware/radio/RadioManager.java
index b740f14..56668ac 100644
--- a/core/java/android/hardware/radio/RadioManager.java
+++ b/core/java/android/hardware/radio/RadioManager.java
@@ -185,25 +185,6 @@
@Retention(RetentionPolicy.SOURCE)
public @interface ConfigFlag {}
- private static void writeStringMap(@NonNull Parcel dest, @NonNull Map<String, String> map) {
- dest.writeInt(map.size());
- for (Map.Entry<String, String> entry : map.entrySet()) {
- dest.writeString(entry.getKey());
- dest.writeString(entry.getValue());
- }
- }
-
- private static @NonNull Map<String, String> readStringMap(@NonNull Parcel in) {
- int size = in.readInt();
- Map<String, String> map = new HashMap<>();
- while (size-- > 0) {
- String key = in.readString();
- String value = in.readString();
- map.put(key, value);
- }
- return map;
- }
-
/*****************************************************************************
* Lists properties, options and radio bands supported by a given broadcast radio module.
* Each module has a unique ID used to address it when calling RadioManager APIs.
@@ -415,7 +396,7 @@
mIsBgScanSupported = in.readInt() == 1;
mSupportedProgramTypes = arrayToSet(in.createIntArray());
mSupportedIdentifierTypes = arrayToSet(in.createIntArray());
- mVendorInfo = readStringMap(in);
+ mVendorInfo = Utils.readStringMap(in);
}
public static final Parcelable.Creator<ModuleProperties> CREATOR
@@ -445,7 +426,7 @@
dest.writeInt(mIsBgScanSupported ? 1 : 0);
dest.writeIntArray(setToArray(mSupportedProgramTypes));
dest.writeIntArray(setToArray(mSupportedIdentifierTypes));
- writeStringMap(dest, mVendorInfo);
+ Utils.writeStringMap(dest, mVendorInfo);
}
@Override
@@ -1410,7 +1391,7 @@
private static final int FLAG_TRAFFIC_ANNOUNCEMENT = 1 << 3;
@NonNull private final ProgramSelector mSelector;
- private final boolean mTuned;
+ private final boolean mTuned; // TODO(b/69958777): replace with mFlags
private final boolean mStereo;
private final boolean mDigital;
private final int mFlags;
@@ -1418,7 +1399,8 @@
private final RadioMetadata mMetadata;
@NonNull private final Map<String, String> mVendorInfo;
- ProgramInfo(@NonNull ProgramSelector selector, boolean tuned, boolean stereo,
+ /** @hide */
+ public ProgramInfo(@NonNull ProgramSelector selector, boolean tuned, boolean stereo,
boolean digital, int signalStrength, RadioMetadata metadata, int flags,
Map<String, String> vendorInfo) {
mSelector = selector;
@@ -1564,7 +1546,7 @@
mMetadata = null;
}
mFlags = in.readInt();
- mVendorInfo = readStringMap(in);
+ mVendorInfo = Utils.readStringMap(in);
}
public static final Parcelable.Creator<ProgramInfo> CREATOR
@@ -1592,7 +1574,7 @@
mMetadata.writeToParcel(dest, flags);
}
dest.writeInt(mFlags);
- writeStringMap(dest, mVendorInfo);
+ Utils.writeStringMap(dest, mVendorInfo);
}
@Override
@@ -1727,7 +1709,8 @@
Log.e(TAG, "Failed to open tuner");
return null;
}
- return new TunerAdapter(tuner, config != null ? config.getType() : BAND_INVALID);
+ return new TunerAdapter(tuner, halCallback,
+ config != null ? config.getType() : BAND_INVALID);
}
@NonNull private final Context mContext;
diff --git a/core/java/android/hardware/radio/RadioTuner.java b/core/java/android/hardware/radio/RadioTuner.java
index 0d367e7..ed20c4a 100644
--- a/core/java/android/hardware/radio/RadioTuner.java
+++ b/core/java/android/hardware/radio/RadioTuner.java
@@ -280,11 +280,29 @@
* @throws IllegalStateException if the scan is in progress or has not been started,
* startBackgroundScan() call may fix it.
* @throws IllegalArgumentException if the vendorFilter argument is not valid.
+ * @deprecated Use {@link getDynamicProgramList} instead.
*/
+ @Deprecated
public abstract @NonNull List<RadioManager.ProgramInfo>
getProgramList(@Nullable Map<String, String> vendorFilter);
/**
+ * Get the dynamic list of discovered radio stations.
+ *
+ * The list object is updated asynchronously; to get the updates register
+ * with {@link ProgramList#addListCallback}.
+ *
+ * When the returned object is no longer used, it must be closed.
+ *
+ * @param filter filter for the list, or null to get the full list.
+ * @return the dynamic program list object, close it after use
+ * or {@code null} if program list is not supported by the tuner
+ */
+ public @Nullable ProgramList getDynamicProgramList(@Nullable ProgramList.Filter filter) {
+ return null;
+ }
+
+ /**
* Checks, if the analog playback is forced, see setAnalogForced.
*
* @throws IllegalStateException if the switch is not supported at current
diff --git a/core/java/android/hardware/radio/TunerAdapter.java b/core/java/android/hardware/radio/TunerAdapter.java
index 8ad609d..91944bf 100644
--- a/core/java/android/hardware/radio/TunerAdapter.java
+++ b/core/java/android/hardware/radio/TunerAdapter.java
@@ -33,15 +33,18 @@
private static final String TAG = "BroadcastRadio.TunerAdapter";
@NonNull private final ITuner mTuner;
+ @NonNull private final TunerCallbackAdapter mCallback;
private boolean mIsClosed = false;
private @RadioManager.Band int mBand;
- TunerAdapter(ITuner tuner, @RadioManager.Band int band) {
- if (tuner == null) {
- throw new NullPointerException();
- }
- mTuner = tuner;
+ private ProgramList mLegacyListProxy;
+ private Map<String, String> mLegacyListFilter;
+
+ TunerAdapter(@NonNull ITuner tuner, @NonNull TunerCallbackAdapter callback,
+ @RadioManager.Band int band) {
+ mTuner = Objects.requireNonNull(tuner);
+ mCallback = Objects.requireNonNull(callback);
mBand = band;
}
@@ -53,6 +56,10 @@
return;
}
mIsClosed = true;
+ if (mLegacyListProxy != null) {
+ mLegacyListProxy.close();
+ mLegacyListProxy = null;
+ }
}
try {
mTuner.close();
@@ -227,10 +234,55 @@
@Override
public @NonNull List<RadioManager.ProgramInfo>
getProgramList(@Nullable Map<String, String> vendorFilter) {
- try {
- return mTuner.getProgramList(vendorFilter);
- } catch (RemoteException e) {
- throw new RuntimeException("service died", e);
+ synchronized (mTuner) {
+ if (mLegacyListProxy == null || !Objects.equals(mLegacyListFilter, vendorFilter)) {
+ Log.i(TAG, "Program list filter has changed, requesting new list");
+ mLegacyListProxy = new ProgramList();
+ mLegacyListFilter = vendorFilter;
+
+ mCallback.clearLastCompleteList();
+ mCallback.setProgramListObserver(mLegacyListProxy, () -> { });
+ try {
+ mTuner.startProgramListUpdates(new ProgramList.Filter(vendorFilter));
+ } catch (RemoteException ex) {
+ throw new RuntimeException("service died", ex);
+ }
+ }
+
+ List<RadioManager.ProgramInfo> list = mCallback.getLastCompleteList();
+ if (list == null) throw new IllegalStateException("Program list is not ready yet");
+ return list;
+ }
+ }
+
+ @Override
+ public @Nullable ProgramList getDynamicProgramList(@Nullable ProgramList.Filter filter) {
+ synchronized (mTuner) {
+ if (mLegacyListProxy != null) {
+ mLegacyListProxy.close();
+ mLegacyListProxy = null;
+ }
+ mLegacyListFilter = null;
+
+ ProgramList list = new ProgramList();
+ mCallback.setProgramListObserver(list, () -> {
+ try {
+ mTuner.stopProgramListUpdates();
+ } catch (RemoteException ex) {
+ Log.e(TAG, "Couldn't stop program list updates", ex);
+ }
+ });
+
+ try {
+ mTuner.startProgramListUpdates(filter);
+ } catch (UnsupportedOperationException ex) {
+ return null;
+ } catch (RemoteException ex) {
+ mCallback.setProgramListObserver(null, () -> { });
+ throw new RuntimeException("service died", ex);
+ }
+
+ return list;
}
}
diff --git a/core/java/android/hardware/radio/TunerCallbackAdapter.java b/core/java/android/hardware/radio/TunerCallbackAdapter.java
index a01f658..b299ffe 100644
--- a/core/java/android/hardware/radio/TunerCallbackAdapter.java
+++ b/core/java/android/hardware/radio/TunerCallbackAdapter.java
@@ -22,7 +22,9 @@
import android.os.Looper;
import android.util.Log;
+import java.util.List;
import java.util.Map;
+import java.util.Objects;
/**
* Implements the ITunerCallback interface by forwarding calls to RadioTuner.Callback.
@@ -30,9 +32,14 @@
class TunerCallbackAdapter extends ITunerCallback.Stub {
private static final String TAG = "BroadcastRadio.TunerCallbackAdapter";
+ private final Object mLock = new Object();
@NonNull private final RadioTuner.Callback mCallback;
@NonNull private final Handler mHandler;
+ @Nullable ProgramList mProgramList;
+ @Nullable List<RadioManager.ProgramInfo> mLastCompleteList; // for legacy getProgramList call
+ private boolean mDelayedCompleteCallback = false;
+
TunerCallbackAdapter(@NonNull RadioTuner.Callback callback, @Nullable Handler handler) {
mCallback = callback;
if (handler == null) {
@@ -42,6 +49,49 @@
}
}
+ void setProgramListObserver(@Nullable ProgramList programList,
+ @NonNull ProgramList.OnCloseListener closeListener) {
+ Objects.requireNonNull(closeListener);
+ synchronized (mLock) {
+ if (mProgramList != null) {
+ Log.w(TAG, "Previous program list observer wasn't properly closed, closing it...");
+ mProgramList.close();
+ }
+ mProgramList = programList;
+ if (programList == null) return;
+ programList.setOnCloseListener(() -> {
+ synchronized (mLock) {
+ if (mProgramList != programList) return;
+ mProgramList = null;
+ mLastCompleteList = null;
+ closeListener.onClose();
+ }
+ });
+ programList.addOnCompleteListener(() -> {
+ synchronized (mLock) {
+ if (mProgramList != programList) return;
+ mLastCompleteList = programList.toList();
+ if (mDelayedCompleteCallback) {
+ Log.d(TAG, "Sending delayed onBackgroundScanComplete callback");
+ sendBackgroundScanCompleteLocked();
+ }
+ }
+ });
+ }
+ }
+
+ @Nullable List<RadioManager.ProgramInfo> getLastCompleteList() {
+ synchronized (mLock) {
+ return mLastCompleteList;
+ }
+ }
+
+ void clearLastCompleteList() {
+ synchronized (mLock) {
+ mLastCompleteList = null;
+ }
+ }
+
@Override
public void onError(int status) {
mHandler.post(() -> mCallback.onError(status));
@@ -87,9 +137,22 @@
mHandler.post(() -> mCallback.onBackgroundScanAvailabilityChange(isAvailable));
}
+ private void sendBackgroundScanCompleteLocked() {
+ mDelayedCompleteCallback = false;
+ mHandler.post(() -> mCallback.onBackgroundScanComplete());
+ }
+
@Override
public void onBackgroundScanComplete() {
- mHandler.post(() -> mCallback.onBackgroundScanComplete());
+ synchronized (mLock) {
+ if (mLastCompleteList == null) {
+ Log.i(TAG, "Got onBackgroundScanComplete callback, but the "
+ + "program list didn't get through yet. Delaying it...");
+ mDelayedCompleteCallback = true;
+ return;
+ }
+ sendBackgroundScanCompleteLocked();
+ }
}
@Override
@@ -98,6 +161,14 @@
}
@Override
+ public void onProgramListUpdated(ProgramList.Chunk chunk) {
+ synchronized (mLock) {
+ if (mProgramList == null) return;
+ mProgramList.apply(Objects.requireNonNull(chunk));
+ }
+ }
+
+ @Override
public void onParametersUpdated(Map parameters) {
mHandler.post(() -> mCallback.onParametersUpdated(parameters));
}
diff --git a/core/java/android/hardware/radio/Utils.java b/core/java/android/hardware/radio/Utils.java
new file mode 100644
index 0000000..09bf8fe
--- /dev/null
+++ b/core/java/android/hardware/radio/Utils.java
@@ -0,0 +1,92 @@
+/**
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.hardware.radio;
+
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.os.Parcel;
+import android.os.Parcelable;
+
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.Map;
+import java.util.Objects;
+import java.util.Set;
+
+final class Utils {
+ static void writeStringMap(@NonNull Parcel dest, @Nullable Map<String, String> map) {
+ if (map == null) {
+ dest.writeInt(0);
+ return;
+ }
+ dest.writeInt(map.size());
+ for (Map.Entry<String, String> entry : map.entrySet()) {
+ dest.writeString(entry.getKey());
+ dest.writeString(entry.getValue());
+ }
+ }
+
+ static @NonNull Map<String, String> readStringMap(@NonNull Parcel in) {
+ int size = in.readInt();
+ Map<String, String> map = new HashMap<>();
+ while (size-- > 0) {
+ String key = in.readString();
+ String value = in.readString();
+ map.put(key, value);
+ }
+ return map;
+ }
+
+ static <T extends Parcelable> void writeSet(@NonNull Parcel dest, @Nullable Set<T> set) {
+ if (set == null) {
+ dest.writeInt(0);
+ return;
+ }
+ dest.writeInt(set.size());
+ set.stream().forEach(elem -> dest.writeTypedObject(elem, 0));
+ }
+
+ static <T> Set<T> createSet(@NonNull Parcel in, Parcelable.Creator<T> c) {
+ int size = in.readInt();
+ Set<T> set = new HashSet<>();
+ while (size-- > 0) {
+ set.add(in.readTypedObject(c));
+ }
+ return set;
+ }
+
+ static void writeIntSet(@NonNull Parcel dest, @Nullable Set<Integer> set) {
+ if (set == null) {
+ dest.writeInt(0);
+ return;
+ }
+ dest.writeInt(set.size());
+ set.stream().forEach(elem -> dest.writeInt(Objects.requireNonNull(elem)));
+ }
+
+ static Set<Integer> createIntSet(@NonNull Parcel in) {
+ return createSet(in, new Parcelable.Creator<Integer>() {
+ public Integer createFromParcel(Parcel in) {
+ return in.readInt();
+ }
+
+ public Integer[] newArray(int size) {
+ return new Integer[size];
+ }
+ });
+ }
+}
diff --git a/core/java/android/inputmethodservice/InputMethodService.java b/core/java/android/inputmethodservice/InputMethodService.java
index e941279..7528bc3 100644
--- a/core/java/android/inputmethodservice/InputMethodService.java
+++ b/core/java/android/inputmethodservice/InputMethodService.java
@@ -1082,33 +1082,6 @@
}
/**
- * Close/hide the input method's soft input area, so the user no longer
- * sees it or can interact with it. This can only be called
- * from the currently active input method, as validated by the given token.
- *
- * @param flags Provides additional operating flags. Currently may be
- * 0 or have the {@link InputMethodManager#HIDE_IMPLICIT_ONLY},
- * {@link InputMethodManager#HIDE_NOT_ALWAYS} bit set.
- */
- public void hideSoftInputFromInputMethod(int flags) {
- mImm.hideSoftInputFromInputMethodInternal(mToken, flags);
- }
-
- /**
- * Show the input method's soft input area, so the user
- * sees the input method window and can interact with it.
- * This can only be called from the currently active input method,
- * as validated by the given token.
- *
- * @param flags Provides additional operating flags. Currently may be
- * 0 or have the {@link InputMethodManager#SHOW_IMPLICIT} or
- * {@link InputMethodManager#SHOW_FORCED} bit set.
- */
- public void showSoftInputFromInputMethod(int flags) {
- mImm.showSoftInputFromInputMethodInternal(mToken, flags);
- }
-
- /**
* Force switch to the last used input method and subtype. If the last input method didn't have
* any subtypes, the framework will simply switch to the last input method with no subtype
* specified.
@@ -1738,7 +1711,7 @@
// Rethrow the exception to preserve the existing behavior. Some IMEs may have directly
// called this method and relied on this exception for some clean-up tasks.
// TODO: Give developers a clear guideline of whether it's OK to call this method or
- // InputMethodManager#showSoftInputFromInputMethod() should always be used instead.
+ // InputMethodService#requestShowSelf(int) should always be used instead.
throw e;
} finally {
// TODO: Is it OK to set true when we get BadTokenException?
@@ -2060,27 +2033,30 @@
/**
* Close this input method's soft input area, removing it from the display.
- * The input method will continue running, but the user can no longer use
- * it to generate input by touching the screen.
- * @param flags Provides additional operating flags. Currently may be
- * 0 or have the {@link InputMethodManager#HIDE_IMPLICIT_ONLY
- * InputMethodManager.HIDE_IMPLICIT_ONLY} bit set.
+ *
+ * The input method will continue running, but the user can no longer use it to generate input
+ * by touching the screen.
+ *
+ * @see InputMethodManager#HIDE_IMPLICIT_ONLY
+ * @see InputMethodManager#HIDE_NOT_ALWAYS
+ * @param flags Provides additional operating flags.
*/
public void requestHideSelf(int flags) {
- mImm.hideSoftInputFromInputMethod(mToken, flags);
+ mImm.hideSoftInputFromInputMethodInternal(mToken, flags);
}
-
+
/**
- * Show the input method. This is a call back to the
- * IMF to handle showing the input method.
- * @param flags Provides additional operating flags. Currently may be
- * 0 or have the {@link InputMethodManager#SHOW_FORCED
- * InputMethodManager.} bit set.
+ * Show the input method's soft input area, so the user sees the input method window and can
+ * interact with it.
+ *
+ * @see InputMethodManager#SHOW_IMPLICIT
+ * @see InputMethodManager#SHOW_FORCED
+ * @param flags Provides additional operating flags.
*/
- private void requestShowSelf(int flags) {
- mImm.showSoftInputFromInputMethod(mToken, flags);
+ public void requestShowSelf(int flags) {
+ mImm.showSoftInputFromInputMethodInternal(mToken, flags);
}
-
+
private boolean handleBack(boolean doIt) {
if (mShowInputRequested) {
// If the soft input area is shown, back closes it and we
diff --git a/core/java/android/net/IIpSecService.aidl b/core/java/android/net/IIpSecService.aidl
index d9b57db..3fe531f 100644
--- a/core/java/android/net/IIpSecService.aidl
+++ b/core/java/android/net/IIpSecService.aidl
@@ -31,7 +31,7 @@
interface IIpSecService
{
IpSecSpiResponse allocateSecurityParameterIndex(
- int direction, in String remoteAddress, int requestedSpi, in IBinder binder);
+ in String destinationAddress, int requestedSpi, in IBinder binder);
void releaseSecurityParameterIndex(int resourceId);
@@ -43,7 +43,7 @@
void deleteTransportModeTransform(int transformId);
- void applyTransportModeTransform(in ParcelFileDescriptor socket, int transformId);
+ void applyTransportModeTransform(in ParcelFileDescriptor socket, int direction, int transformId);
- void removeTransportModeTransform(in ParcelFileDescriptor socket, int transformId);
+ void removeTransportModeTransforms(in ParcelFileDescriptor socket, int transformId);
}
diff --git a/core/java/android/net/IpSecAlgorithm.java b/core/java/android/net/IpSecAlgorithm.java
index 7d752e8..c69a4d4 100644
--- a/core/java/android/net/IpSecAlgorithm.java
+++ b/core/java/android/net/IpSecAlgorithm.java
@@ -256,13 +256,19 @@
return getName().equals(AUTH_CRYPT_AES_GCM);
}
+ // Because encryption keys are sensitive and userdebug builds are used by large user pools
+ // such as beta testers, we only allow sensitive info such as keys on eng builds.
+ private static boolean isUnsafeBuild() {
+ return Build.IS_DEBUGGABLE && Build.IS_ENG;
+ }
+
@Override
public String toString() {
return new StringBuilder()
.append("{mName=")
.append(mName)
.append(", mKey=")
- .append(Build.IS_DEBUGGABLE ? HexDump.toHexString(mKey) : "<hidden>")
+ .append(isUnsafeBuild() ? HexDump.toHexString(mKey) : "<hidden>")
.append(", mTruncLenBits=")
.append(mTruncLenBits)
.append("}")
diff --git a/core/java/android/net/IpSecConfig.java b/core/java/android/net/IpSecConfig.java
index f54ceb5..80b0af3 100644
--- a/core/java/android/net/IpSecConfig.java
+++ b/core/java/android/net/IpSecConfig.java
@@ -32,59 +32,29 @@
// MODE_TRANSPORT or MODE_TUNNEL
private int mMode = IpSecTransform.MODE_TRANSPORT;
- // Needs to be valid only for tunnel mode
// Preventing this from being null simplifies Java->Native binder
- private String mLocalAddress = "";
+ private String mSourceAddress = "";
// Preventing this from being null simplifies Java->Native binder
- private String mRemoteAddress = "";
+ private String mDestinationAddress = "";
// The underlying Network that represents the "gateway" Network
// for outbound packets. It may also be used to select packets.
private Network mNetwork;
- /**
- * This class captures the parameters that specifically apply to inbound or outbound traffic.
- */
- public static class Flow {
- // Minimum requirements for identifying a transform
- // SPI identifying the IPsec flow in packet processing
- // and a remote IP address
- private int mSpiResourceId = IpSecManager.INVALID_RESOURCE_ID;
+ // Minimum requirements for identifying a transform
+ // SPI identifying the IPsec SA in packet processing
+ // and a destination IP address
+ private int mSpiResourceId = IpSecManager.INVALID_RESOURCE_ID;
- // Encryption Algorithm
- private IpSecAlgorithm mEncryption;
+ // Encryption Algorithm
+ private IpSecAlgorithm mEncryption;
- // Authentication Algorithm
- private IpSecAlgorithm mAuthentication;
+ // Authentication Algorithm
+ private IpSecAlgorithm mAuthentication;
- // Authenticated Encryption Algorithm
- private IpSecAlgorithm mAuthenticatedEncryption;
-
- @Override
- public String toString() {
- return new StringBuilder()
- .append("{mSpiResourceId=")
- .append(mSpiResourceId)
- .append(", mEncryption=")
- .append(mEncryption)
- .append(", mAuthentication=")
- .append(mAuthentication)
- .append(", mAuthenticatedEncryption=")
- .append(mAuthenticatedEncryption)
- .append("}")
- .toString();
- }
-
- static boolean equals(IpSecConfig.Flow lhs, IpSecConfig.Flow rhs) {
- if (lhs == null || rhs == null) return (lhs == rhs);
- return (lhs.mSpiResourceId == rhs.mSpiResourceId
- && IpSecAlgorithm.equals(lhs.mEncryption, rhs.mEncryption)
- && IpSecAlgorithm.equals(lhs.mAuthentication, rhs.mAuthentication));
- }
- }
-
- private final Flow[] mFlow = new Flow[] {new Flow(), new Flow()};
+ // Authenticated Encryption Algorithm
+ private IpSecAlgorithm mAuthenticatedEncryption;
// For tunnel mode IPv4 UDP Encapsulation
// IpSecTransform#ENCAP_ESP_*, such as ENCAP_ESP_OVER_UDP_IKE
@@ -100,36 +70,37 @@
mMode = mode;
}
- /** Set the local IP address for Tunnel mode */
- public void setLocalAddress(String localAddress) {
- mLocalAddress = localAddress;
+ /** Set the source IP addres for this IPsec transform */
+ public void setSourceAddress(String sourceAddress) {
+ mSourceAddress = sourceAddress;
}
- /** Set the remote IP address for this IPsec transform */
- public void setRemoteAddress(String remoteAddress) {
- mRemoteAddress = remoteAddress;
+ /** Set the destination IP address for this IPsec transform */
+ public void setDestinationAddress(String destinationAddress) {
+ mDestinationAddress = destinationAddress;
}
- /** Set the SPI for a given direction by resource ID */
- public void setSpiResourceId(int direction, int resourceId) {
- mFlow[direction].mSpiResourceId = resourceId;
+ /** Set the SPI by resource ID */
+ public void setSpiResourceId(int resourceId) {
+ mSpiResourceId = resourceId;
}
- /** Set the encryption algorithm for a given direction */
- public void setEncryption(int direction, IpSecAlgorithm encryption) {
- mFlow[direction].mEncryption = encryption;
+ /** Set the encryption algorithm */
+ public void setEncryption(IpSecAlgorithm encryption) {
+ mEncryption = encryption;
}
- /** Set the authentication algorithm for a given direction */
- public void setAuthentication(int direction, IpSecAlgorithm authentication) {
- mFlow[direction].mAuthentication = authentication;
+ /** Set the authentication algorithm */
+ public void setAuthentication(IpSecAlgorithm authentication) {
+ mAuthentication = authentication;
}
- /** Set the authenticated encryption algorithm for a given direction */
- public void setAuthenticatedEncryption(int direction, IpSecAlgorithm authenticatedEncryption) {
- mFlow[direction].mAuthenticatedEncryption = authenticatedEncryption;
+ /** Set the authenticated encryption algorithm */
+ public void setAuthenticatedEncryption(IpSecAlgorithm authenticatedEncryption) {
+ mAuthenticatedEncryption = authenticatedEncryption;
}
+ /** Set the underlying network that will carry traffic for this transform */
public void setNetwork(Network network) {
mNetwork = network;
}
@@ -155,28 +126,28 @@
return mMode;
}
- public String getLocalAddress() {
- return mLocalAddress;
+ public String getSourceAddress() {
+ return mSourceAddress;
}
- public int getSpiResourceId(int direction) {
- return mFlow[direction].mSpiResourceId;
+ public int getSpiResourceId() {
+ return mSpiResourceId;
}
- public String getRemoteAddress() {
- return mRemoteAddress;
+ public String getDestinationAddress() {
+ return mDestinationAddress;
}
- public IpSecAlgorithm getEncryption(int direction) {
- return mFlow[direction].mEncryption;
+ public IpSecAlgorithm getEncryption() {
+ return mEncryption;
}
- public IpSecAlgorithm getAuthentication(int direction) {
- return mFlow[direction].mAuthentication;
+ public IpSecAlgorithm getAuthentication() {
+ return mAuthentication;
}
- public IpSecAlgorithm getAuthenticatedEncryption(int direction) {
- return mFlow[direction].mAuthenticatedEncryption;
+ public IpSecAlgorithm getAuthenticatedEncryption() {
+ return mAuthenticatedEncryption;
}
public Network getNetwork() {
@@ -209,17 +180,13 @@
@Override
public void writeToParcel(Parcel out, int flags) {
out.writeInt(mMode);
- out.writeString(mLocalAddress);
- out.writeString(mRemoteAddress);
+ out.writeString(mSourceAddress);
+ out.writeString(mDestinationAddress);
out.writeParcelable(mNetwork, flags);
- out.writeInt(mFlow[IpSecTransform.DIRECTION_IN].mSpiResourceId);
- out.writeParcelable(mFlow[IpSecTransform.DIRECTION_IN].mEncryption, flags);
- out.writeParcelable(mFlow[IpSecTransform.DIRECTION_IN].mAuthentication, flags);
- out.writeParcelable(mFlow[IpSecTransform.DIRECTION_IN].mAuthenticatedEncryption, flags);
- out.writeInt(mFlow[IpSecTransform.DIRECTION_OUT].mSpiResourceId);
- out.writeParcelable(mFlow[IpSecTransform.DIRECTION_OUT].mEncryption, flags);
- out.writeParcelable(mFlow[IpSecTransform.DIRECTION_OUT].mAuthentication, flags);
- out.writeParcelable(mFlow[IpSecTransform.DIRECTION_OUT].mAuthenticatedEncryption, flags);
+ out.writeInt(mSpiResourceId);
+ out.writeParcelable(mEncryption, flags);
+ out.writeParcelable(mAuthentication, flags);
+ out.writeParcelable(mAuthenticatedEncryption, flags);
out.writeInt(mEncapType);
out.writeInt(mEncapSocketResourceId);
out.writeInt(mEncapRemotePort);
@@ -231,22 +198,15 @@
private IpSecConfig(Parcel in) {
mMode = in.readInt();
- mLocalAddress = in.readString();
- mRemoteAddress = in.readString();
+ mSourceAddress = in.readString();
+ mDestinationAddress = in.readString();
mNetwork = (Network) in.readParcelable(Network.class.getClassLoader());
- mFlow[IpSecTransform.DIRECTION_IN].mSpiResourceId = in.readInt();
- mFlow[IpSecTransform.DIRECTION_IN].mEncryption =
+ mSpiResourceId = in.readInt();
+ mEncryption =
(IpSecAlgorithm) in.readParcelable(IpSecAlgorithm.class.getClassLoader());
- mFlow[IpSecTransform.DIRECTION_IN].mAuthentication =
+ mAuthentication =
(IpSecAlgorithm) in.readParcelable(IpSecAlgorithm.class.getClassLoader());
- mFlow[IpSecTransform.DIRECTION_IN].mAuthenticatedEncryption =
- (IpSecAlgorithm) in.readParcelable(IpSecAlgorithm.class.getClassLoader());
- mFlow[IpSecTransform.DIRECTION_OUT].mSpiResourceId = in.readInt();
- mFlow[IpSecTransform.DIRECTION_OUT].mEncryption =
- (IpSecAlgorithm) in.readParcelable(IpSecAlgorithm.class.getClassLoader());
- mFlow[IpSecTransform.DIRECTION_OUT].mAuthentication =
- (IpSecAlgorithm) in.readParcelable(IpSecAlgorithm.class.getClassLoader());
- mFlow[IpSecTransform.DIRECTION_OUT].mAuthenticatedEncryption =
+ mAuthenticatedEncryption =
(IpSecAlgorithm) in.readParcelable(IpSecAlgorithm.class.getClassLoader());
mEncapType = in.readInt();
mEncapSocketResourceId = in.readInt();
@@ -260,10 +220,10 @@
strBuilder
.append("{mMode=")
.append(mMode == IpSecTransform.MODE_TUNNEL ? "TUNNEL" : "TRANSPORT")
- .append(", mLocalAddress=")
- .append(mLocalAddress)
- .append(", mRemoteAddress=")
- .append(mRemoteAddress)
+ .append(", mSourceAddress=")
+ .append(mSourceAddress)
+ .append(", mDestinationAddress=")
+ .append(mDestinationAddress)
.append(", mNetwork=")
.append(mNetwork)
.append(", mEncapType=")
@@ -274,10 +234,14 @@
.append(mEncapRemotePort)
.append(", mNattKeepaliveInterval=")
.append(mNattKeepaliveInterval)
- .append(", mFlow[OUT]=")
- .append(mFlow[IpSecTransform.DIRECTION_OUT])
- .append(", mFlow[IN]=")
- .append(mFlow[IpSecTransform.DIRECTION_IN])
+ .append("{mSpiResourceId=")
+ .append(mSpiResourceId)
+ .append(", mEncryption=")
+ .append(mEncryption)
+ .append(", mAuthentication=")
+ .append(mAuthentication)
+ .append(", mAuthenticatedEncryption=")
+ .append(mAuthenticatedEncryption)
.append("}");
return strBuilder.toString();
@@ -299,17 +263,18 @@
public static boolean equals(IpSecConfig lhs, IpSecConfig rhs) {
if (lhs == null || rhs == null) return (lhs == rhs);
return (lhs.mMode == rhs.mMode
- && lhs.mLocalAddress.equals(rhs.mLocalAddress)
- && lhs.mRemoteAddress.equals(rhs.mRemoteAddress)
+ && lhs.mSourceAddress.equals(rhs.mSourceAddress)
+ && lhs.mDestinationAddress.equals(rhs.mDestinationAddress)
&& ((lhs.mNetwork != null && lhs.mNetwork.equals(rhs.mNetwork))
|| (lhs.mNetwork == rhs.mNetwork))
&& lhs.mEncapType == rhs.mEncapType
&& lhs.mEncapSocketResourceId == rhs.mEncapSocketResourceId
&& lhs.mEncapRemotePort == rhs.mEncapRemotePort
&& lhs.mNattKeepaliveInterval == rhs.mNattKeepaliveInterval
- && IpSecConfig.Flow.equals(lhs.mFlow[IpSecTransform.DIRECTION_OUT],
- rhs.mFlow[IpSecTransform.DIRECTION_OUT])
- && IpSecConfig.Flow.equals(lhs.mFlow[IpSecTransform.DIRECTION_IN],
- rhs.mFlow[IpSecTransform.DIRECTION_IN]));
+ && lhs.mSpiResourceId == rhs.mSpiResourceId
+ && IpSecAlgorithm.equals(lhs.mEncryption, rhs.mEncryption)
+ && IpSecAlgorithm.equals(
+ lhs.mAuthenticatedEncryption, rhs.mAuthenticatedEncryption)
+ && IpSecAlgorithm.equals(lhs.mAuthentication, rhs.mAuthentication));
}
}
diff --git a/core/java/android/net/IpSecManager.java b/core/java/android/net/IpSecManager.java
index 34cfa9b..2202df3 100644
--- a/core/java/android/net/IpSecManager.java
+++ b/core/java/android/net/IpSecManager.java
@@ -17,6 +17,7 @@
import static com.android.internal.util.Preconditions.checkNotNull;
+import android.annotation.IntDef;
import android.annotation.NonNull;
import android.annotation.SystemService;
import android.annotation.TestApi;
@@ -33,6 +34,8 @@
import java.io.FileDescriptor;
import java.io.IOException;
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
import java.net.DatagramSocket;
import java.net.InetAddress;
import java.net.Socket;
@@ -53,6 +56,23 @@
private static final String TAG = "IpSecManager";
/**
+ * For direction-specific attributes of an {@link IpSecTransform}, indicates that an attribute
+ * applies to traffic towards the host.
+ */
+ public static final int DIRECTION_IN = 0;
+
+ /**
+ * For direction-specific attributes of an {@link IpSecTransform}, indicates that an attribute
+ * applies to traffic from the host.
+ */
+ public static final int DIRECTION_OUT = 1;
+
+ /** @hide */
+ @IntDef(value = {DIRECTION_IN, DIRECTION_OUT})
+ @Retention(RetentionPolicy.SOURCE)
+ public @interface PolicyDirection {}
+
+ /**
* The Security Parameter Index (SPI) 0 indicates an unknown or invalid index.
*
* <p>No IPsec packet may contain an SPI of 0.
@@ -125,7 +145,7 @@
*/
public static final class SecurityParameterIndex implements AutoCloseable {
private final IIpSecService mService;
- private final InetAddress mRemoteAddress;
+ private final InetAddress mDestinationAddress;
private final CloseGuard mCloseGuard = CloseGuard.get();
private int mSpi = INVALID_SECURITY_PARAMETER_INDEX;
private int mResourceId = INVALID_RESOURCE_ID;
@@ -164,14 +184,14 @@
}
private SecurityParameterIndex(
- @NonNull IIpSecService service, int direction, InetAddress remoteAddress, int spi)
+ @NonNull IIpSecService service, InetAddress destinationAddress, int spi)
throws ResourceUnavailableException, SpiUnavailableException {
mService = service;
- mRemoteAddress = remoteAddress;
+ mDestinationAddress = destinationAddress;
try {
IpSecSpiResponse result =
mService.allocateSecurityParameterIndex(
- direction, remoteAddress.getHostAddress(), spi, new Binder());
+ destinationAddress.getHostAddress(), spi, new Binder());
if (result == null) {
throw new NullPointerException("Received null response from IpSecService");
@@ -216,25 +236,23 @@
}
/**
- * Reserve a random SPI for traffic bound to or from the specified remote address.
+ * Reserve a random SPI for traffic bound to or from the specified destination address.
*
* <p>If successful, this SPI is guaranteed available until released by a call to {@link
* SecurityParameterIndex#close()}.
*
- * @param direction {@link IpSecTransform#DIRECTION_IN} or {@link IpSecTransform#DIRECTION_OUT}
- * @param remoteAddress address of the remote. SPIs must be unique for each remoteAddress
+ * @param destinationAddress the destination address for traffic bearing the requested SPI.
+ * For inbound traffic, the destination should be an address currently assigned on-device.
* @return the reserved SecurityParameterIndex
- * @throws ResourceUnavailableException indicating that too many SPIs are currently allocated
- * for this user
- * @throws SpiUnavailableException indicating that a particular SPI cannot be reserved
+ * @throws {@link #ResourceUnavailableException} indicating that too many SPIs are
+ * currently allocated for this user
*/
- public SecurityParameterIndex allocateSecurityParameterIndex(
- int direction, InetAddress remoteAddress) throws ResourceUnavailableException {
+ public SecurityParameterIndex allocateSecurityParameterIndex(InetAddress destinationAddress)
+ throws ResourceUnavailableException {
try {
return new SecurityParameterIndex(
mService,
- direction,
- remoteAddress,
+ destinationAddress,
IpSecManager.INVALID_SECURITY_PARAMETER_INDEX);
} catch (SpiUnavailableException unlikely) {
throw new ResourceUnavailableException("No SPIs available");
@@ -242,26 +260,27 @@
}
/**
- * Reserve the requested SPI for traffic bound to or from the specified remote address.
+ * Reserve the requested SPI for traffic bound to or from the specified destination address.
*
* <p>If successful, this SPI is guaranteed available until released by a call to {@link
* SecurityParameterIndex#close()}.
*
- * @param direction {@link IpSecTransform#DIRECTION_IN} or {@link IpSecTransform#DIRECTION_OUT}
- * @param remoteAddress address of the remote. SPIs must be unique for each remoteAddress
+ * @param destinationAddress the destination address for traffic bearing the requested SPI.
+ * For inbound traffic, the destination should be an address currently assigned on-device.
* @param requestedSpi the requested SPI, or '0' to allocate a random SPI
* @return the reserved SecurityParameterIndex
- * @throws ResourceUnavailableException indicating that too many SPIs are currently allocated
- * for this user
- * @throws SpiUnavailableException indicating that the requested SPI could not be reserved
+ * @throws {@link #ResourceUnavailableException} indicating that too many SPIs are
+ * currently allocated for this user
+ * @throws {@link #SpiUnavailableException} indicating that the requested SPI could not be
+ * reserved
*/
public SecurityParameterIndex allocateSecurityParameterIndex(
- int direction, InetAddress remoteAddress, int requestedSpi)
+ InetAddress destinationAddress, int requestedSpi)
throws SpiUnavailableException, ResourceUnavailableException {
if (requestedSpi == IpSecManager.INVALID_SECURITY_PARAMETER_INDEX) {
throw new IllegalArgumentException("Requested SPI must be a valid (non-zero) SPI");
}
- return new SecurityParameterIndex(mService, direction, remoteAddress, requestedSpi);
+ return new SecurityParameterIndex(mService, destinationAddress, requestedSpi);
}
/**
@@ -269,14 +288,14 @@
*
* <p>This applies transport mode encapsulation to the given socket. Once applied, I/O on the
* socket will be encapsulated according to the parameters of the {@code IpSecTransform}. When
- * the transform is removed from the socket by calling {@link #removeTransportModeTransform},
+ * the transform is removed from the socket by calling {@link #removeTransportModeTransforms},
* unprotected traffic can resume on that socket.
*
* <p>For security reasons, the destination address of any traffic on the socket must match the
* remote {@code InetAddress} of the {@code IpSecTransform}. Attempts to send traffic to any
* other IP address will result in an IOException. In addition, reads and writes on the socket
* will throw IOException if the user deactivates the transform (by calling {@link
- * IpSecTransform#close()}) without calling {@link #removeTransportModeTransform}.
+ * IpSecTransform#close()}) without calling {@link #removeTransportModeTransforms}.
*
* <h4>Rekey Procedure</h4>
*
@@ -287,15 +306,14 @@
* in-flight packets have been received.
*
* @param socket a stream socket
+ * @param direction the policy direction either {@link #DIRECTION_IN} or {@link #DIRECTION_OUT}
* @param transform a transport mode {@code IpSecTransform}
* @throws IOException indicating that the transform could not be applied
- * @hide
*/
- public void applyTransportModeTransform(Socket socket, IpSecTransform transform)
+ public void applyTransportModeTransform(
+ Socket socket, int direction, IpSecTransform transform)
throws IOException {
- try (ParcelFileDescriptor pfd = ParcelFileDescriptor.fromSocket(socket)) {
- applyTransportModeTransform(pfd, transform);
- }
+ applyTransportModeTransform(socket.getFileDescriptor$(), direction, transform);
}
/**
@@ -303,14 +321,14 @@
*
* <p>This applies transport mode encapsulation to the given socket. Once applied, I/O on the
* socket will be encapsulated according to the parameters of the {@code IpSecTransform}. When
- * the transform is removed from the socket by calling {@link #removeTransportModeTransform},
+ * the transform is removed from the socket by calling {@link #removeTransportModeTransforms},
* unprotected traffic can resume on that socket.
*
* <p>For security reasons, the destination address of any traffic on the socket must match the
* remote {@code InetAddress} of the {@code IpSecTransform}. Attempts to send traffic to any
* other IP address will result in an IOException. In addition, reads and writes on the socket
* will throw IOException if the user deactivates the transform (by calling {@link
- * IpSecTransform#close()}) without calling {@link #removeTransportModeTransform}.
+ * IpSecTransform#close()}) without calling {@link #removeTransportModeTransforms}.
*
* <h4>Rekey Procedure</h4>
*
@@ -321,15 +339,13 @@
* in-flight packets have been received.
*
* @param socket a datagram socket
+ * @param direction the policy direction either DIRECTION_IN or DIRECTION_OUT
* @param transform a transport mode {@code IpSecTransform}
* @throws IOException indicating that the transform could not be applied
- * @hide
*/
- public void applyTransportModeTransform(DatagramSocket socket, IpSecTransform transform)
- throws IOException {
- try (ParcelFileDescriptor pfd = ParcelFileDescriptor.fromDatagramSocket(socket)) {
- applyTransportModeTransform(pfd, transform);
- }
+ public void applyTransportModeTransform(
+ DatagramSocket socket, int direction, IpSecTransform transform) throws IOException {
+ applyTransportModeTransform(socket.getFileDescriptor$(), direction, transform);
}
/**
@@ -337,14 +353,14 @@
*
* <p>This applies transport mode encapsulation to the given socket. Once applied, I/O on the
* socket will be encapsulated according to the parameters of the {@code IpSecTransform}. When
- * the transform is removed from the socket by calling {@link #removeTransportModeTransform},
+ * the transform is removed from the socket by calling {@link #removeTransportModeTransforms},
* unprotected traffic can resume on that socket.
*
* <p>For security reasons, the destination address of any traffic on the socket must match the
* remote {@code InetAddress} of the {@code IpSecTransform}. Attempts to send traffic to any
* other IP address will result in an IOException. In addition, reads and writes on the socket
* will throw IOException if the user deactivates the transform (by calling {@link
- * IpSecTransform#close()}) without calling {@link #removeTransportModeTransform}.
+ * IpSecTransform#close()}) without calling {@link #removeTransportModeTransforms}.
*
* <h4>Rekey Procedure</h4>
*
@@ -355,24 +371,17 @@
* in-flight packets have been received.
*
* @param socket a socket file descriptor
+ * @param direction the policy direction either DIRECTION_IN or DIRECTION_OUT
* @param transform a transport mode {@code IpSecTransform}
* @throws IOException indicating that the transform could not be applied
*/
- public void applyTransportModeTransform(FileDescriptor socket, IpSecTransform transform)
+ public void applyTransportModeTransform(
+ FileDescriptor socket, int direction, IpSecTransform transform)
throws IOException {
// We dup() the FileDescriptor here because if we don't, then the ParcelFileDescriptor()
- // constructor takes control and closes the user's FD when we exit the method
- // This is behaviorally the same as the other versions, but the PFD constructor does not
- // dup() automatically, whereas PFD.fromSocket() and PDF.fromDatagramSocket() do dup().
+ // constructor takes control and closes the user's FD when we exit the method.
try (ParcelFileDescriptor pfd = ParcelFileDescriptor.dup(socket)) {
- applyTransportModeTransform(pfd, transform);
- }
- }
-
- /* Call down to activate a transform */
- private void applyTransportModeTransform(ParcelFileDescriptor pfd, IpSecTransform transform) {
- try {
- mService.applyTransportModeTransform(pfd, transform.getResourceId());
+ mService.applyTransportModeTransform(pfd, direction, transform.getResourceId());
} catch (RemoteException e) {
throw e.rethrowFromSystemServer();
}
@@ -407,13 +416,10 @@
* @param socket a socket that previously had a transform applied to it
* @param transform the IPsec Transform that was previously applied to the given socket
* @throws IOException indicating that the transform could not be removed from the socket
- * @hide
*/
- public void removeTransportModeTransform(Socket socket, IpSecTransform transform)
+ public void removeTransportModeTransforms(Socket socket, IpSecTransform transform)
throws IOException {
- try (ParcelFileDescriptor pfd = ParcelFileDescriptor.fromSocket(socket)) {
- removeTransportModeTransform(pfd, transform);
- }
+ removeTransportModeTransforms(socket.getFileDescriptor$(), transform);
}
/**
@@ -430,13 +436,10 @@
* @param socket a socket that previously had a transform applied to it
* @param transform the IPsec Transform that was previously applied to the given socket
* @throws IOException indicating that the transform could not be removed from the socket
- * @hide
*/
- public void removeTransportModeTransform(DatagramSocket socket, IpSecTransform transform)
+ public void removeTransportModeTransforms(DatagramSocket socket, IpSecTransform transform)
throws IOException {
- try (ParcelFileDescriptor pfd = ParcelFileDescriptor.fromDatagramSocket(socket)) {
- removeTransportModeTransform(pfd, transform);
- }
+ removeTransportModeTransforms(socket.getFileDescriptor$(), transform);
}
/**
@@ -454,17 +457,10 @@
* @param transform the IPsec Transform that was previously applied to the given socket
* @throws IOException indicating that the transform could not be removed from the socket
*/
- public void removeTransportModeTransform(FileDescriptor socket, IpSecTransform transform)
+ public void removeTransportModeTransforms(FileDescriptor socket, IpSecTransform transform)
throws IOException {
try (ParcelFileDescriptor pfd = ParcelFileDescriptor.dup(socket)) {
- removeTransportModeTransform(pfd, transform);
- }
- }
-
- /* Call down to remove a transform */
- private void removeTransportModeTransform(ParcelFileDescriptor pfd, IpSecTransform transform) {
- try {
- mService.removeTransportModeTransform(pfd, transform.getResourceId());
+ mService.removeTransportModeTransforms(pfd, transform.getResourceId());
} catch (RemoteException e) {
throw e.rethrowFromSystemServer();
}
diff --git a/core/java/android/net/IpSecTransform.java b/core/java/android/net/IpSecTransform.java
index 102ba6d..7b9b483 100644
--- a/core/java/android/net/IpSecTransform.java
+++ b/core/java/android/net/IpSecTransform.java
@@ -38,13 +38,11 @@
import java.net.InetAddress;
/**
- * This class represents an IPsec transform, which comprises security associations in one or both
- * directions.
+ * This class represents a transform, which roughly corresponds to an IPsec Security Association.
*
* <p>Transforms are created using {@link IpSecTransform.Builder}. Each {@code IpSecTransform}
- * object encapsulates the properties and state of an inbound and outbound IPsec security
- * association. That includes, but is not limited to, algorithm choice, key material, and allocated
- * system resources.
+ * object encapsulates the properties and state of an IPsec security association. That includes,
+ * but is not limited to, algorithm choice, key material, and allocated system resources.
*
* @see <a href="https://tools.ietf.org/html/rfc4301">RFC 4301, Security Architecture for the
* Internet Protocol</a>
@@ -52,23 +50,6 @@
public final class IpSecTransform implements AutoCloseable {
private static final String TAG = "IpSecTransform";
- /**
- * For direction-specific attributes of an {@link IpSecTransform}, indicates that an attribute
- * applies to traffic towards the host.
- */
- public static final int DIRECTION_IN = 0;
-
- /**
- * For direction-specific attributes of an {@link IpSecTransform}, indicates that an attribute
- * applies to traffic from the host.
- */
- public static final int DIRECTION_OUT = 1;
-
- /** @hide */
- @IntDef(value = {DIRECTION_IN, DIRECTION_OUT})
- @Retention(RetentionPolicy.SOURCE)
- public @interface TransformDirection {}
-
/** @hide */
public static final int MODE_TRANSPORT = 0;
@@ -170,7 +151,7 @@
*
* <p>Deactivating a transform while it is still applied to a socket will result in errors on
* that socket. Make sure to remove transforms by calling {@link
- * IpSecManager#removeTransportModeTransform}. Note, removing an {@code IpSecTransform} from a
+ * IpSecManager#removeTransportModeTransforms}. Note, removing an {@code IpSecTransform} from a
* socket will not deactivate it (because one transform may be applied to multiple sockets).
*
* <p>It is safe to call this method on a transform that has already been deactivated.
@@ -272,85 +253,49 @@
private IpSecConfig mConfig;
/**
- * Set the encryption algorithm for the given direction.
- *
- * <p>If encryption is set for a direction without also providing an SPI for that direction,
- * creation of an {@code IpSecTransform} will fail when attempting to build the transform.
+ * Set the encryption algorithm.
*
* <p>Encryption is mutually exclusive with authenticated encryption.
*
- * @param direction either {@link #DIRECTION_IN} or {@link #DIRECTION_OUT}
* @param algo {@link IpSecAlgorithm} specifying the encryption to be applied.
*/
- public IpSecTransform.Builder setEncryption(
- @TransformDirection int direction, IpSecAlgorithm algo) {
+ public IpSecTransform.Builder setEncryption(@NonNull IpSecAlgorithm algo) {
// TODO: throw IllegalArgumentException if algo is not an encryption algorithm.
- mConfig.setEncryption(direction, algo);
+ Preconditions.checkNotNull(algo);
+ mConfig.setEncryption(algo);
return this;
}
/**
- * Set the authentication (integrity) algorithm for the given direction.
- *
- * <p>If authentication is set for a direction without also providing an SPI for that
- * direction, creation of an {@code IpSecTransform} will fail when attempting to build the
- * transform.
+ * Set the authentication (integrity) algorithm.
*
* <p>Authentication is mutually exclusive with authenticated encryption.
*
- * @param direction either {@link #DIRECTION_IN} or {@link #DIRECTION_OUT}
* @param algo {@link IpSecAlgorithm} specifying the authentication to be applied.
*/
- public IpSecTransform.Builder setAuthentication(
- @TransformDirection int direction, IpSecAlgorithm algo) {
+ public IpSecTransform.Builder setAuthentication(@NonNull IpSecAlgorithm algo) {
// TODO: throw IllegalArgumentException if algo is not an authentication algorithm.
- mConfig.setAuthentication(direction, algo);
+ Preconditions.checkNotNull(algo);
+ mConfig.setAuthentication(algo);
return this;
}
/**
- * Set the authenticated encryption algorithm for the given direction.
+ * Set the authenticated encryption algorithm.
*
- * <p>If an authenticated encryption algorithm is set for a given direction without also
- * providing an SPI for that direction, creation of an {@code IpSecTransform} will fail when
- * attempting to build the transform.
- *
- * <p>The Authenticated Encryption (AE) class of algorithms are also known as Authenticated
- * Encryption with Associated Data (AEAD) algorithms, or Combined mode algorithms (as
- * referred to in <a href="https://tools.ietf.org/html/rfc4301">RFC 4301</a>).
+ * <p>The Authenticated Encryption (AE) class of algorithms are also known as
+ * Authenticated Encryption with Associated Data (AEAD) algorithms, or Combined mode
+ * algorithms (as referred to in
+ * <a href="https://tools.ietf.org/html/rfc4301">RFC 4301</a>).
*
* <p>Authenticated encryption is mutually exclusive with encryption and authentication.
*
- * @param direction either {@link #DIRECTION_IN} or {@link #DIRECTION_OUT}
* @param algo {@link IpSecAlgorithm} specifying the authenticated encryption algorithm to
* be applied.
*/
- public IpSecTransform.Builder setAuthenticatedEncryption(
- @TransformDirection int direction, IpSecAlgorithm algo) {
- mConfig.setAuthenticatedEncryption(direction, algo);
- return this;
- }
-
- /**
- * Set the SPI for the given direction.
- *
- * <p>Because IPsec operates at the IP layer, this 32-bit identifier uniquely identifies
- * packets to a given destination address. To prevent SPI collisions, values should be
- * reserved by calling {@link IpSecManager#allocateSecurityParameterIndex}.
- *
- * <p>If the SPI and algorithms are omitted for one direction, traffic in that direction
- * will not be encrypted or authenticated.
- *
- * @param direction either {@link #DIRECTION_IN} or {@link #DIRECTION_OUT}
- * @param spi a unique {@link IpSecManager.SecurityParameterIndex} to identify transformed
- * traffic
- */
- public IpSecTransform.Builder setSpi(
- @TransformDirection int direction, IpSecManager.SecurityParameterIndex spi) {
- if (spi.getResourceId() == INVALID_RESOURCE_ID) {
- throw new IllegalArgumentException("Invalid SecurityParameterIndex");
- }
- mConfig.setSpiResourceId(direction, spi.getResourceId());
+ public IpSecTransform.Builder setAuthenticatedEncryption(@NonNull IpSecAlgorithm algo) {
+ Preconditions.checkNotNull(algo);
+ mConfig.setAuthenticatedEncryption(algo);
return this;
}
@@ -363,7 +308,8 @@
* @hide
*/
@SystemApi
- public IpSecTransform.Builder setUnderlyingNetwork(Network net) {
+ public IpSecTransform.Builder setUnderlyingNetwork(@NonNull Network net) {
+ Preconditions.checkNotNull(net);
mConfig.setNetwork(net);
return this;
}
@@ -382,7 +328,8 @@
* encapsulated traffic. In the case of IKEv2, this should be port 4500.
*/
public IpSecTransform.Builder setIpv4Encapsulation(
- IpSecManager.UdpEncapsulationSocket localSocket, int remotePort) {
+ @NonNull IpSecManager.UdpEncapsulationSocket localSocket, int remotePort) {
+ Preconditions.checkNotNull(localSocket);
mConfig.setEncapType(ENCAP_ESPINUDP);
if (localSocket.getResourceId() == INVALID_RESOURCE_ID) {
throw new IllegalArgumentException("Invalid UdpEncapsulationSocket");
@@ -419,24 +366,33 @@
* will not affect any network traffic until it has been applied to one or more sockets.
*
* @see IpSecManager#applyTransportModeTransform
- * @param remoteAddress the remote {@code InetAddress} of traffic on sockets that will use
- * this transform
+ * @param sourceAddress the source {@code InetAddress} of traffic on sockets that will use
+ * this transform; this address must belong to the Network used by all sockets that
+ * utilize this transform; if provided, then only traffic originating from the
+ * specified source address will be processed.
+ * @param spi a unique {@link IpSecManager.SecurityParameterIndex} to identify transformed
+ * traffic
* @throws IllegalArgumentException indicating that a particular combination of transform
* properties is invalid
- * @throws IpSecManager.ResourceUnavailableException indicating that too many transforms are
- * active
+ * @throws IpSecManager.ResourceUnavailableException indicating that too many transforms
+ * are active
* @throws IpSecManager.SpiUnavailableException indicating the rare case where an SPI
* collides with an existing transform
* @throws IOException indicating other errors
*/
- public IpSecTransform buildTransportModeTransform(InetAddress remoteAddress)
+ public IpSecTransform buildTransportModeTransform(
+ @NonNull InetAddress sourceAddress,
+ @NonNull IpSecManager.SecurityParameterIndex spi)
throws IpSecManager.ResourceUnavailableException,
IpSecManager.SpiUnavailableException, IOException {
- if (remoteAddress == null) {
- throw new IllegalArgumentException("Remote address may not be null or empty!");
+ Preconditions.checkNotNull(sourceAddress);
+ Preconditions.checkNotNull(spi);
+ if (spi.getResourceId() == INVALID_RESOURCE_ID) {
+ throw new IllegalArgumentException("Invalid SecurityParameterIndex");
}
mConfig.setMode(MODE_TRANSPORT);
- mConfig.setRemoteAddress(remoteAddress.getHostAddress());
+ mConfig.setSourceAddress(sourceAddress.getHostAddress());
+ mConfig.setSpiResourceId(spi.getResourceId());
// FIXME: modifying a builder after calling build can change the built transform.
return new IpSecTransform(mContext, mConfig).activate();
}
@@ -445,26 +401,33 @@
* Build and return an {@link IpSecTransform} object as a Tunnel Mode Transform. Some
* parameters have interdependencies that are checked at build time.
*
- * @param localAddress the {@link InetAddress} that provides the local endpoint for this
+ * @param sourceAddress the {@link InetAddress} that provides the source address for this
* IPsec tunnel. This is almost certainly an address belonging to the {@link Network}
* that will originate the traffic, which is set as the {@link #setUnderlyingNetwork}.
- * @param remoteAddress the {@link InetAddress} representing the remote endpoint of this
- * IPsec tunnel.
+ * @param spi a unique {@link IpSecManager.SecurityParameterIndex} to identify transformed
+ * traffic
* @throws IllegalArgumentException indicating that a particular combination of transform
* properties is invalid.
+ * @throws IpSecManager.ResourceUnavailableException indicating that too many transforms
+ * are active
+ * @throws IpSecManager.SpiUnavailableException indicating the rare case where an SPI
+ * collides with an existing transform
+ * @throws IOException indicating other errors
* @hide
*/
public IpSecTransform buildTunnelModeTransform(
- InetAddress localAddress, InetAddress remoteAddress) {
- if (localAddress == null) {
- throw new IllegalArgumentException("Local address may not be null or empty!");
+ @NonNull InetAddress sourceAddress,
+ @NonNull IpSecManager.SecurityParameterIndex spi)
+ throws IpSecManager.ResourceUnavailableException,
+ IpSecManager.SpiUnavailableException, IOException {
+ Preconditions.checkNotNull(sourceAddress);
+ Preconditions.checkNotNull(spi);
+ if (spi.getResourceId() == INVALID_RESOURCE_ID) {
+ throw new IllegalArgumentException("Invalid SecurityParameterIndex");
}
- if (remoteAddress == null) {
- throw new IllegalArgumentException("Remote address may not be null or empty!");
- }
- mConfig.setLocalAddress(localAddress.getHostAddress());
- mConfig.setRemoteAddress(remoteAddress.getHostAddress());
mConfig.setMode(MODE_TUNNEL);
+ mConfig.setSourceAddress(sourceAddress.getHostAddress());
+ mConfig.setSpiResourceId(spi.getResourceId());
return new IpSecTransform(mContext, mConfig);
}
diff --git a/core/java/android/net/MacAddress.java b/core/java/android/net/MacAddress.java
index d6992aa..287bdc8 100644
--- a/core/java/android/net/MacAddress.java
+++ b/core/java/android/net/MacAddress.java
@@ -17,6 +17,7 @@
package android.net;
import android.annotation.IntDef;
+import android.annotation.NonNull;
import android.os.Parcel;
import android.os.Parcelable;
@@ -60,7 +61,7 @@
})
public @interface MacAddressType { }
- /** Indicates a MAC address of unknown type. */
+ /** @hide Indicates a MAC address of unknown type. */
public static final int TYPE_UNKNOWN = 0;
/** Indicates a MAC address is a unicast address. */
public static final int TYPE_UNICAST = 1;
@@ -92,7 +93,7 @@
*
* @return the int constant representing the MAC address type of this MacAddress.
*/
- public @MacAddressType int addressType() {
+ public @MacAddressType int getAddressType() {
if (equals(BROADCAST_ADDRESS)) {
return TYPE_BROADCAST;
}
@@ -120,12 +121,12 @@
/**
* @return a byte array representation of this MacAddress.
*/
- public byte[] toByteArray() {
+ public @NonNull byte[] toByteArray() {
return byteAddrFromLongAddr(mAddr);
}
@Override
- public String toString() {
+ public @NonNull String toString() {
return stringAddrFromLongAddr(mAddr);
}
@@ -133,7 +134,7 @@
* @return a String representation of the OUI part of this MacAddress made of 3 hexadecimal
* numbers in [0,ff] joined by ':' characters.
*/
- public String toOuiString() {
+ public @NonNull String toOuiString() {
return String.format(
"%02x:%02x:%02x", (mAddr >> 40) & 0xff, (mAddr >> 32) & 0xff, (mAddr >> 24) & 0xff);
}
@@ -197,7 +198,7 @@
if (!isMacAddress(addr)) {
return TYPE_UNKNOWN;
}
- return MacAddress.fromBytes(addr).addressType();
+ return MacAddress.fromBytes(addr).getAddressType();
}
/**
@@ -211,7 +212,7 @@
*
* @hide
*/
- public static byte[] byteAddrFromStringAddr(String addr) {
+ public static @NonNull byte[] byteAddrFromStringAddr(String addr) {
Preconditions.checkNotNull(addr);
String[] parts = addr.split(":");
if (parts.length != ETHER_ADDR_LEN) {
@@ -239,7 +240,7 @@
*
* @hide
*/
- public static String stringAddrFromByteAddr(byte[] addr) {
+ public static @NonNull String stringAddrFromByteAddr(byte[] addr) {
if (!isMacAddress(addr)) {
return null;
}
@@ -291,7 +292,7 @@
// Internal conversion function equivalent to stringAddrFromByteAddr(byteAddrFromLongAddr(addr))
// that avoids the allocation of an intermediary byte[].
- private static String stringAddrFromLongAddr(long addr) {
+ private static @NonNull String stringAddrFromLongAddr(long addr) {
return String.format("%02x:%02x:%02x:%02x:%02x:%02x",
(addr >> 40) & 0xff,
(addr >> 32) & 0xff,
@@ -310,7 +311,7 @@
* @return the MacAddress corresponding to the given String representation.
* @throws IllegalArgumentException if the given String is not a valid representation.
*/
- public static MacAddress fromString(String addr) {
+ public static @NonNull MacAddress fromString(@NonNull String addr) {
return new MacAddress(longAddrFromStringAddr(addr));
}
@@ -322,7 +323,7 @@
* @return the MacAddress corresponding to the given byte array representation.
* @throws IllegalArgumentException if the given byte array is not a valid representation.
*/
- public static MacAddress fromBytes(byte[] addr) {
+ public static @NonNull MacAddress fromBytes(@NonNull byte[] addr) {
return new MacAddress(longAddrFromByteAddr(addr));
}
@@ -336,7 +337,7 @@
*
* @hide
*/
- public static MacAddress createRandomUnicastAddress() {
+ public static @NonNull MacAddress createRandomUnicastAddress() {
return createRandomUnicastAddress(BASE_GOOGLE_MAC, new Random());
}
@@ -352,7 +353,7 @@
*
* @hide
*/
- public static MacAddress createRandomUnicastAddress(MacAddress base, Random r) {
+ public static @NonNull MacAddress createRandomUnicastAddress(MacAddress base, Random r) {
long addr = (base.mAddr & OUI_MASK) | (NIC_MASK & r.nextLong());
addr = addr | LOCALLY_ASSIGNED_MASK;
addr = addr & ~MULTICAST_MASK;
diff --git a/core/java/android/net/Network.java b/core/java/android/net/Network.java
index 1a3ce91..5df168d 100644
--- a/core/java/android/net/Network.java
+++ b/core/java/android/net/Network.java
@@ -357,13 +357,13 @@
// Multiple Provisioning Domains API recommendations, as made by the
// IETF mif working group.
//
- // The HANDLE_MAGIC value MUST be kept in sync with the corresponding
+ // The handleMagic value MUST be kept in sync with the corresponding
// value in the native/android/net.c NDK implementation.
if (netId == 0) {
return 0L; // make this zero condition obvious for debugging
}
- final long HANDLE_MAGIC = 0xfacade;
- return (((long) netId) << 32) | HANDLE_MAGIC;
+ final long handleMagic = 0xcafed00dL;
+ return (((long) netId) << 32) | handleMagic;
}
// implement the Parcelable interface
diff --git a/core/java/android/net/NetworkPolicyManager.java b/core/java/android/net/NetworkPolicyManager.java
index 81c49a3..9ef26a9 100644
--- a/core/java/android/net/NetworkPolicyManager.java
+++ b/core/java/android/net/NetworkPolicyManager.java
@@ -29,7 +29,6 @@
import android.net.wifi.WifiInfo;
import android.os.RemoteException;
import android.os.UserHandle;
-import android.telephony.SubscriptionPlan;
import android.util.DebugUtils;
import android.util.Pair;
@@ -329,7 +328,7 @@
* to access network when the device is idle or in battery saver mode. Otherwise, false.
*/
public static boolean isProcStateAllowedWhileIdleOrPowerSaveMode(int procState) {
- return procState <= ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE;
+ return procState <= ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE;
}
/**
@@ -337,7 +336,7 @@
* to access network when the device is in data saver mode. Otherwise, false.
*/
public static boolean isProcStateAllowedWhileOnRestrictBackground(int procState) {
- return procState <= ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE;
+ return procState <= ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE;
}
public static String resolveNetworkId(WifiConfiguration config) {
diff --git a/core/java/android/net/metrics/WakeupStats.java b/core/java/android/net/metrics/WakeupStats.java
index 7277ba3..bb36536 100644
--- a/core/java/android/net/metrics/WakeupStats.java
+++ b/core/java/android/net/metrics/WakeupStats.java
@@ -80,7 +80,7 @@
break;
}
- switch (ev.dstHwAddr.addressType()) {
+ switch (ev.dstHwAddr.getAddressType()) {
case MacAddress.TYPE_UNICAST:
l2UnicastCount++;
break;
diff --git a/core/java/android/os/UserManager.java b/core/java/android/os/UserManager.java
index 2197484..7b0c153 100644
--- a/core/java/android/os/UserManager.java
+++ b/core/java/android/os/UserManager.java
@@ -238,6 +238,20 @@
public static final String DISALLOW_AMBIENT_DISPLAY = "no_ambient_display";
/**
+ * Specifies if a user is disallowed from changing screen off timeout.
+ *
+ * <p>The default value is <code>false</code>.
+ *
+ * <p>This user restriction has no effect on managed profiles.
+ * <p>Key for user restrictions.
+ * <p>Type: Boolean
+ * @see DevicePolicyManager#addUserRestriction(ComponentName, String)
+ * @see DevicePolicyManager#clearUserRestriction(ComponentName, String)
+ * @see #getUserRestrictions()
+ */
+ public static final String DISALLOW_CONFIG_SCREEN_TIMEOUT = "no_config_screen_timeout";
+
+ /**
* Specifies if a user is disallowed from enabling the
* "Unknown Sources" setting, that allows installation of apps from unknown sources.
* The default value is <code>false</code>.
diff --git a/core/java/android/os/storage/StorageVolume.java b/core/java/android/os/storage/StorageVolume.java
index 070b8c1..839a8bf 100644
--- a/core/java/android/os/storage/StorageVolume.java
+++ b/core/java/android/os/storage/StorageVolume.java
@@ -394,4 +394,32 @@
parcel.writeString(mFsUuid);
parcel.writeString(mState);
}
+
+ /** {@hide} */
+ public static final class ScopedAccessProviderContract {
+
+ private ScopedAccessProviderContract() {
+ throw new UnsupportedOperationException("contains constants only");
+ }
+
+ public static final String AUTHORITY = "com.android.documentsui.scopedAccess";
+
+ public static final String TABLE_PACKAGES = "packages";
+ public static final String TABLE_PERMISSIONS = "permissions";
+
+ public static final String COL_PACKAGE = "package_name";
+ public static final String COL_VOLUME_UUID = "volume_uuid";
+ public static final String COL_DIRECTORY = "directory";
+ public static final String COL_GRANTED = "granted";
+
+ public static final String[] TABLE_PACKAGES_COLUMNS = new String[] { COL_PACKAGE };
+ public static final String[] TABLE_PERMISSIONS_COLUMNS =
+ new String[] { COL_PACKAGE, COL_VOLUME_UUID, COL_DIRECTORY, COL_GRANTED };
+
+ public static final int TABLE_PACKAGES_COL_PACKAGE = 0;
+ public static final int TABLE_PERMISSIONS_COL_PACKAGE = 0;
+ public static final int TABLE_PERMISSIONS_COL_VOLUME_UUID = 1;
+ public static final int TABLE_PERMISSIONS_COL_DIRECTORY = 2;
+ public static final int TABLE_PERMISSIONS_COL_GRANTED = 3;
+ }
}
diff --git a/core/java/android/provider/Settings.java b/core/java/android/provider/Settings.java
index 850aedd..6d91f59 100644
--- a/core/java/android/provider/Settings.java
+++ b/core/java/android/provider/Settings.java
@@ -6830,7 +6830,7 @@
* @hide
*/
public static final int SHOW_ROTATION_SUGGESTIONS_DEFAULT =
- SHOW_ROTATION_SUGGESTIONS_DISABLED;
+ SHOW_ROTATION_SUGGESTIONS_ENABLED;
/**
* Read only list of the service components that the current user has explicitly allowed to
diff --git a/core/java/android/text/Layout.java b/core/java/android/text/Layout.java
index bf4b6ac..aa97b2a 100644
--- a/core/java/android/text/Layout.java
+++ b/core/java/android/text/Layout.java
@@ -1917,10 +1917,10 @@
private static float measurePara(TextPaint paint, CharSequence text, int start, int end,
TextDirectionHeuristic textDir) {
- MeasuredText mt = null;
+ MeasuredParagraph mt = null;
TextLine tl = TextLine.obtain();
try {
- mt = MeasuredText.buildForBidi(text, start, end, textDir, mt);
+ mt = MeasuredParagraph.buildForBidi(text, start, end, textDir, mt);
final char[] chars = mt.getChars();
final int len = chars.length;
final Directions directions = mt.getDirections(0, len);
diff --git a/core/java/android/text/MeasuredParagraph.java b/core/java/android/text/MeasuredParagraph.java
new file mode 100644
index 0000000..c93e036
--- /dev/null
+++ b/core/java/android/text/MeasuredParagraph.java
@@ -0,0 +1,677 @@
+/*
+ * Copyright (C) 2010 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.text;
+
+import android.annotation.FloatRange;
+import android.annotation.IntRange;
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.graphics.Paint;
+import android.text.AutoGrowArray.ByteArray;
+import android.text.AutoGrowArray.FloatArray;
+import android.text.AutoGrowArray.IntArray;
+import android.text.Layout.Directions;
+import android.text.style.MetricAffectingSpan;
+import android.text.style.ReplacementSpan;
+import android.util.Pools.SynchronizedPool;
+
+import dalvik.annotation.optimization.CriticalNative;
+
+import libcore.util.NativeAllocationRegistry;
+
+import java.util.Arrays;
+
+/**
+ * MeasuredParagraph provides text information for rendering purpose.
+ *
+ * The first motivation of this class is identify the text directions and retrieving individual
+ * character widths. However retrieving character widths is slower than identifying text directions.
+ * Thus, this class provides several builder methods for specific purposes.
+ *
+ * - buildForBidi:
+ * Compute only text directions.
+ * - buildForMeasurement:
+ * Compute text direction and all character widths.
+ * - buildForStaticLayout:
+ * This is bit special. StaticLayout also needs to know text direction and character widths for
+ * line breaking, but all things are done in native code. Similarly, text measurement is done
+ * in native code. So instead of storing result to Java array, this keeps the result in native
+ * code since there is no good reason to move the results to Java layer.
+ *
+ * In addition to the character widths, some additional information is computed for each purposes,
+ * e.g. whole text length for measurement or font metrics for static layout.
+ *
+ * MeasuredParagraph is NOT a thread safe object.
+ * @hide
+ */
+public class MeasuredParagraph {
+ private static final char OBJECT_REPLACEMENT_CHARACTER = '\uFFFC';
+
+ private static final NativeAllocationRegistry sRegistry = new NativeAllocationRegistry(
+ MeasuredParagraph.class.getClassLoader(), nGetReleaseFunc(), 1024);
+
+ private MeasuredParagraph() {} // Use build static functions instead.
+
+ private static final SynchronizedPool<MeasuredParagraph> sPool = new SynchronizedPool<>(1);
+
+ private static @NonNull MeasuredParagraph obtain() { // Use build static functions instead.
+ final MeasuredParagraph mt = sPool.acquire();
+ return mt != null ? mt : new MeasuredParagraph();
+ }
+
+ /**
+ * Recycle the MeasuredParagraph.
+ *
+ * Do not call any methods after you call this method.
+ */
+ public void recycle() {
+ release();
+ sPool.release(this);
+ }
+
+ // The casted original text.
+ //
+ // This may be null if the passed text is not a Spanned.
+ private @Nullable Spanned mSpanned;
+
+ // The start offset of the target range in the original text (mSpanned);
+ private @IntRange(from = 0) int mTextStart;
+
+ // The length of the target range in the original text.
+ private @IntRange(from = 0) int mTextLength;
+
+ // The copied character buffer for measuring text.
+ //
+ // The length of this array is mTextLength.
+ private @Nullable char[] mCopiedBuffer;
+
+ // The whole paragraph direction.
+ private @Layout.Direction int mParaDir;
+
+ // True if the text is LTR direction and doesn't contain any bidi characters.
+ private boolean mLtrWithoutBidi;
+
+ // The bidi level for individual characters.
+ //
+ // This is empty if mLtrWithoutBidi is true.
+ private @NonNull ByteArray mLevels = new ByteArray();
+
+ // The whole width of the text.
+ // See getWholeWidth comments.
+ private @FloatRange(from = 0.0f) float mWholeWidth;
+
+ // Individual characters' widths.
+ // See getWidths comments.
+ private @Nullable FloatArray mWidths = new FloatArray();
+
+ // The span end positions.
+ // See getSpanEndCache comments.
+ private @Nullable IntArray mSpanEndCache = new IntArray(4);
+
+ // The font metrics.
+ // See getFontMetrics comments.
+ private @Nullable IntArray mFontMetrics = new IntArray(4 * 4);
+
+ // The native MeasuredParagraph.
+ // See getNativePtr comments.
+ // Do not modify these members directly. Use bindNativeObject/unbindNativeObject instead.
+ private /* Maybe Zero */ long mNativePtr = 0;
+ private @Nullable Runnable mNativeObjectCleaner;
+
+ // Associate the native object to this Java object.
+ private void bindNativeObject(/* Non Zero*/ long nativePtr) {
+ mNativePtr = nativePtr;
+ mNativeObjectCleaner = sRegistry.registerNativeAllocation(this, nativePtr);
+ }
+
+ // Decouple the native object from this Java object and release the native object.
+ private void unbindNativeObject() {
+ if (mNativePtr != 0) {
+ mNativeObjectCleaner.run();
+ mNativePtr = 0;
+ }
+ }
+
+ // Following two objects are for avoiding object allocation.
+ private @NonNull TextPaint mCachedPaint = new TextPaint();
+ private @Nullable Paint.FontMetricsInt mCachedFm;
+
+ /**
+ * Releases internal buffers.
+ */
+ public void release() {
+ reset();
+ mLevels.clearWithReleasingLargeArray();
+ mWidths.clearWithReleasingLargeArray();
+ mFontMetrics.clearWithReleasingLargeArray();
+ mSpanEndCache.clearWithReleasingLargeArray();
+ }
+
+ /**
+ * Resets the internal state for starting new text.
+ */
+ private void reset() {
+ mSpanned = null;
+ mCopiedBuffer = null;
+ mWholeWidth = 0;
+ mLevels.clear();
+ mWidths.clear();
+ mFontMetrics.clear();
+ mSpanEndCache.clear();
+ unbindNativeObject();
+ }
+
+ /**
+ * Returns the characters to be measured.
+ *
+ * This is always available.
+ */
+ public @NonNull char[] getChars() {
+ return mCopiedBuffer;
+ }
+
+ /**
+ * Returns the paragraph direction.
+ *
+ * This is always available.
+ */
+ public @Layout.Direction int getParagraphDir() {
+ return mParaDir;
+ }
+
+ /**
+ * Returns the directions.
+ *
+ * This is always available.
+ */
+ public Directions getDirections(@IntRange(from = 0) int start, // inclusive
+ @IntRange(from = 0) int end) { // exclusive
+ if (mLtrWithoutBidi) {
+ return Layout.DIRS_ALL_LEFT_TO_RIGHT;
+ }
+
+ final int length = end - start;
+ return AndroidBidi.directions(mParaDir, mLevels.getRawArray(), start, mCopiedBuffer, start,
+ length);
+ }
+
+ /**
+ * Returns the whole text width.
+ *
+ * This is available only if the MeasureText is computed with computeForMeasurement.
+ * Returns 0 in other cases.
+ */
+ public @FloatRange(from = 0.0f) float getWholeWidth() {
+ return mWholeWidth;
+ }
+
+ /**
+ * Returns the individual character's width.
+ *
+ * This is available only if the MeasureText is computed with computeForMeasurement.
+ * Returns empty array in other cases.
+ */
+ public @NonNull FloatArray getWidths() {
+ return mWidths;
+ }
+
+ /**
+ * Returns the MetricsAffectingSpan end indices.
+ *
+ * If the input text is not a spanned string, this has one value that is the length of the text.
+ *
+ * This is available only if the MeasureText is computed with computeForStaticLayout.
+ * Returns empty array in other cases.
+ */
+ public @NonNull IntArray getSpanEndCache() {
+ return mSpanEndCache;
+ }
+
+ /**
+ * Returns the int array which holds FontMetrics.
+ *
+ * This array holds the repeat of top, bottom, ascent, descent of font metrics value.
+ *
+ * This is available only if the MeasureText is computed with computeForStaticLayout.
+ * Returns empty array in other cases.
+ */
+ public @NonNull IntArray getFontMetrics() {
+ return mFontMetrics;
+ }
+
+ /**
+ * Returns the native ptr of the MeasuredParagraph.
+ *
+ * This is available only if the MeasureText is computed with computeForStaticLayout.
+ * Returns 0 in other cases.
+ */
+ public /* Maybe Zero */ long getNativePtr() {
+ return mNativePtr;
+ }
+
+ /**
+ * Generates new MeasuredParagraph for Bidi computation.
+ *
+ * If recycle is null, this returns new instance. If recycle is not null, this fills computed
+ * result to recycle and returns recycle.
+ *
+ * @param text the character sequence to be measured
+ * @param start the inclusive start offset of the target region in the text
+ * @param end the exclusive end offset of the target region in the text
+ * @param textDir the text direction
+ * @param recycle pass existing MeasuredParagraph if you want to recycle it.
+ *
+ * @return measured text
+ */
+ public static @NonNull MeasuredParagraph buildForBidi(@NonNull CharSequence text,
+ @IntRange(from = 0) int start,
+ @IntRange(from = 0) int end,
+ @NonNull TextDirectionHeuristic textDir,
+ @Nullable MeasuredParagraph recycle) {
+ final MeasuredParagraph mt = recycle == null ? obtain() : recycle;
+ mt.resetAndAnalyzeBidi(text, start, end, textDir);
+ return mt;
+ }
+
+ /**
+ * Generates new MeasuredParagraph for measuring texts.
+ *
+ * If recycle is null, this returns new instance. If recycle is not null, this fills computed
+ * result to recycle and returns recycle.
+ *
+ * @param paint the paint to be used for rendering the text.
+ * @param text the character sequence to be measured
+ * @param start the inclusive start offset of the target region in the text
+ * @param end the exclusive end offset of the target region in the text
+ * @param textDir the text direction
+ * @param recycle pass existing MeasuredParagraph if you want to recycle it.
+ *
+ * @return measured text
+ */
+ public static @NonNull MeasuredParagraph buildForMeasurement(@NonNull TextPaint paint,
+ @NonNull CharSequence text,
+ @IntRange(from = 0) int start,
+ @IntRange(from = 0) int end,
+ @NonNull TextDirectionHeuristic textDir,
+ @Nullable MeasuredParagraph recycle) {
+ final MeasuredParagraph mt = recycle == null ? obtain() : recycle;
+ mt.resetAndAnalyzeBidi(text, start, end, textDir);
+
+ mt.mWidths.resize(mt.mTextLength);
+ if (mt.mTextLength == 0) {
+ return mt;
+ }
+
+ if (mt.mSpanned == null) {
+ // No style change by MetricsAffectingSpan. Just measure all text.
+ mt.applyMetricsAffectingSpan(
+ paint, null /* spans */, start, end, 0 /* native static layout ptr */);
+ } else {
+ // There may be a MetricsAffectingSpan. Split into span transitions and apply styles.
+ int spanEnd;
+ for (int spanStart = start; spanStart < end; spanStart = spanEnd) {
+ spanEnd = mt.mSpanned.nextSpanTransition(spanStart, end, MetricAffectingSpan.class);
+ MetricAffectingSpan[] spans = mt.mSpanned.getSpans(spanStart, spanEnd,
+ MetricAffectingSpan.class);
+ spans = TextUtils.removeEmptySpans(spans, mt.mSpanned, MetricAffectingSpan.class);
+ mt.applyMetricsAffectingSpan(
+ paint, spans, spanStart, spanEnd, 0 /* native static layout ptr */);
+ }
+ }
+ return mt;
+ }
+
+ /**
+ * Generates new MeasuredParagraph for StaticLayout.
+ *
+ * If recycle is null, this returns new instance. If recycle is not null, this fills computed
+ * result to recycle and returns recycle.
+ *
+ * @param paint the paint to be used for rendering the text.
+ * @param text the character sequence to be measured
+ * @param start the inclusive start offset of the target region in the text
+ * @param end the exclusive end offset of the target region in the text
+ * @param textDir the text direction
+ * @param recycle pass existing MeasuredParagraph if you want to recycle it.
+ *
+ * @return measured text
+ */
+ public static @NonNull MeasuredParagraph buildForStaticLayout(
+ @NonNull TextPaint paint,
+ @NonNull CharSequence text,
+ @IntRange(from = 0) int start,
+ @IntRange(from = 0) int end,
+ @NonNull TextDirectionHeuristic textDir,
+ @Nullable MeasuredParagraph recycle) {
+ final MeasuredParagraph mt = recycle == null ? obtain() : recycle;
+ mt.resetAndAnalyzeBidi(text, start, end, textDir);
+ if (mt.mTextLength == 0) {
+ // Need to build empty native measured text for StaticLayout.
+ // TODO: Stop creating empty measured text for empty lines.
+ long nativeBuilderPtr = nInitBuilder();
+ try {
+ mt.bindNativeObject(
+ nBuildNativeMeasuredParagraph(nativeBuilderPtr, mt.mCopiedBuffer));
+ } finally {
+ nFreeBuilder(nativeBuilderPtr);
+ }
+ return mt;
+ }
+
+ long nativeBuilderPtr = nInitBuilder();
+ try {
+ if (mt.mSpanned == null) {
+ // No style change by MetricsAffectingSpan. Just measure all text.
+ mt.applyMetricsAffectingSpan(paint, null /* spans */, start, end, nativeBuilderPtr);
+ mt.mSpanEndCache.append(end);
+ } else {
+ // There may be a MetricsAffectingSpan. Split into span transitions and apply
+ // styles.
+ int spanEnd;
+ for (int spanStart = start; spanStart < end; spanStart = spanEnd) {
+ spanEnd = mt.mSpanned.nextSpanTransition(spanStart, end,
+ MetricAffectingSpan.class);
+ MetricAffectingSpan[] spans = mt.mSpanned.getSpans(spanStart, spanEnd,
+ MetricAffectingSpan.class);
+ spans = TextUtils.removeEmptySpans(spans, mt.mSpanned,
+ MetricAffectingSpan.class);
+ mt.applyMetricsAffectingSpan(paint, spans, spanStart, spanEnd,
+ nativeBuilderPtr);
+ mt.mSpanEndCache.append(spanEnd);
+ }
+ }
+ mt.bindNativeObject(nBuildNativeMeasuredParagraph(nativeBuilderPtr, mt.mCopiedBuffer));
+ } finally {
+ nFreeBuilder(nativeBuilderPtr);
+ }
+
+ return mt;
+ }
+
+ /**
+ * Reset internal state and analyzes text for bidirectional runs.
+ *
+ * @param text the character sequence to be measured
+ * @param start the inclusive start offset of the target region in the text
+ * @param end the exclusive end offset of the target region in the text
+ * @param textDir the text direction
+ */
+ private void resetAndAnalyzeBidi(@NonNull CharSequence text,
+ @IntRange(from = 0) int start, // inclusive
+ @IntRange(from = 0) int end, // exclusive
+ @NonNull TextDirectionHeuristic textDir) {
+ reset();
+ mSpanned = text instanceof Spanned ? (Spanned) text : null;
+ mTextStart = start;
+ mTextLength = end - start;
+
+ if (mCopiedBuffer == null || mCopiedBuffer.length != mTextLength) {
+ mCopiedBuffer = new char[mTextLength];
+ }
+ TextUtils.getChars(text, start, end, mCopiedBuffer, 0);
+
+ // Replace characters associated with ReplacementSpan to U+FFFC.
+ if (mSpanned != null) {
+ ReplacementSpan[] spans = mSpanned.getSpans(start, end, ReplacementSpan.class);
+
+ for (int i = 0; i < spans.length; i++) {
+ int startInPara = mSpanned.getSpanStart(spans[i]) - start;
+ int endInPara = mSpanned.getSpanEnd(spans[i]) - start;
+ // The span interval may be larger and must be restricted to [start, end)
+ if (startInPara < 0) startInPara = 0;
+ if (endInPara > mTextLength) endInPara = mTextLength;
+ Arrays.fill(mCopiedBuffer, startInPara, endInPara, OBJECT_REPLACEMENT_CHARACTER);
+ }
+ }
+
+ if ((textDir == TextDirectionHeuristics.LTR
+ || textDir == TextDirectionHeuristics.FIRSTSTRONG_LTR
+ || textDir == TextDirectionHeuristics.ANYRTL_LTR)
+ && TextUtils.doesNotNeedBidi(mCopiedBuffer, 0, mTextLength)) {
+ mLevels.clear();
+ mParaDir = Layout.DIR_LEFT_TO_RIGHT;
+ mLtrWithoutBidi = true;
+ } else {
+ final int bidiRequest;
+ if (textDir == TextDirectionHeuristics.LTR) {
+ bidiRequest = Layout.DIR_REQUEST_LTR;
+ } else if (textDir == TextDirectionHeuristics.RTL) {
+ bidiRequest = Layout.DIR_REQUEST_RTL;
+ } else if (textDir == TextDirectionHeuristics.FIRSTSTRONG_LTR) {
+ bidiRequest = Layout.DIR_REQUEST_DEFAULT_LTR;
+ } else if (textDir == TextDirectionHeuristics.FIRSTSTRONG_RTL) {
+ bidiRequest = Layout.DIR_REQUEST_DEFAULT_RTL;
+ } else {
+ final boolean isRtl = textDir.isRtl(mCopiedBuffer, 0, mTextLength);
+ bidiRequest = isRtl ? Layout.DIR_REQUEST_RTL : Layout.DIR_REQUEST_LTR;
+ }
+ mLevels.resize(mTextLength);
+ mParaDir = AndroidBidi.bidi(bidiRequest, mCopiedBuffer, mLevels.getRawArray());
+ mLtrWithoutBidi = false;
+ }
+ }
+
+ private void applyReplacementRun(@NonNull ReplacementSpan replacement,
+ @IntRange(from = 0) int start, // inclusive, in copied buffer
+ @IntRange(from = 0) int end, // exclusive, in copied buffer
+ /* Maybe Zero */ long nativeBuilderPtr) {
+ // Use original text. Shouldn't matter.
+ // TODO: passing uninitizlied FontMetrics to developers. Do we need to keep this for
+ // backward compatibility? or Should we initialize them for getFontMetricsInt?
+ final float width = replacement.getSize(
+ mCachedPaint, mSpanned, start + mTextStart, end + mTextStart, mCachedFm);
+ if (nativeBuilderPtr == 0) {
+ // Assigns all width to the first character. This is the same behavior as minikin.
+ mWidths.set(start, width);
+ if (end > start + 1) {
+ Arrays.fill(mWidths.getRawArray(), start + 1, end, 0.0f);
+ }
+ mWholeWidth += width;
+ } else {
+ nAddReplacementRun(nativeBuilderPtr, mCachedPaint.getNativeInstance(), start, end,
+ width);
+ }
+ }
+
+ private void applyStyleRun(@IntRange(from = 0) int start, // inclusive, in copied buffer
+ @IntRange(from = 0) int end, // exclusive, in copied buffer
+ /* Maybe Zero */ long nativeBuilderPtr) {
+ if (nativeBuilderPtr != 0) {
+ mCachedPaint.getFontMetricsInt(mCachedFm);
+ }
+
+ if (mLtrWithoutBidi) {
+ // If the whole text is LTR direction, just apply whole region.
+ if (nativeBuilderPtr == 0) {
+ mWholeWidth += mCachedPaint.getTextRunAdvances(
+ mCopiedBuffer, start, end - start, start, end - start, false /* isRtl */,
+ mWidths.getRawArray(), start);
+ } else {
+ nAddStyleRun(nativeBuilderPtr, mCachedPaint.getNativeInstance(), start, end,
+ false /* isRtl */);
+ }
+ } else {
+ // If there is multiple bidi levels, split into individual bidi level and apply style.
+ byte level = mLevels.get(start);
+ // Note that the empty text or empty range won't reach this method.
+ // Safe to search from start + 1.
+ for (int levelStart = start, levelEnd = start + 1;; ++levelEnd) {
+ if (levelEnd == end || mLevels.get(levelEnd) != level) { // transition point
+ final boolean isRtl = (level & 0x1) != 0;
+ if (nativeBuilderPtr == 0) {
+ final int levelLength = levelEnd - levelStart;
+ mWholeWidth += mCachedPaint.getTextRunAdvances(
+ mCopiedBuffer, levelStart, levelLength, levelStart, levelLength,
+ isRtl, mWidths.getRawArray(), levelStart);
+ } else {
+ nAddStyleRun(nativeBuilderPtr, mCachedPaint.getNativeInstance(), levelStart,
+ levelEnd, isRtl);
+ }
+ if (levelEnd == end) {
+ break;
+ }
+ levelStart = levelEnd;
+ level = mLevels.get(levelEnd);
+ }
+ }
+ }
+ }
+
+ private void applyMetricsAffectingSpan(
+ @NonNull TextPaint paint,
+ @Nullable MetricAffectingSpan[] spans,
+ @IntRange(from = 0) int start, // inclusive, in original text buffer
+ @IntRange(from = 0) int end, // exclusive, in original text buffer
+ /* Maybe Zero */ long nativeBuilderPtr) {
+ mCachedPaint.set(paint);
+ // XXX paint should not have a baseline shift, but...
+ mCachedPaint.baselineShift = 0;
+
+ final boolean needFontMetrics = nativeBuilderPtr != 0;
+
+ if (needFontMetrics && mCachedFm == null) {
+ mCachedFm = new Paint.FontMetricsInt();
+ }
+
+ ReplacementSpan replacement = null;
+ if (spans != null) {
+ for (int i = 0; i < spans.length; i++) {
+ MetricAffectingSpan span = spans[i];
+ if (span instanceof ReplacementSpan) {
+ // The last ReplacementSpan is effective for backward compatibility reasons.
+ replacement = (ReplacementSpan) span;
+ } else {
+ // TODO: No need to call updateMeasureState for ReplacementSpan as well?
+ span.updateMeasureState(mCachedPaint);
+ }
+ }
+ }
+
+ final int startInCopiedBuffer = start - mTextStart;
+ final int endInCopiedBuffer = end - mTextStart;
+
+ if (replacement != null) {
+ applyReplacementRun(replacement, startInCopiedBuffer, endInCopiedBuffer,
+ nativeBuilderPtr);
+ } else {
+ applyStyleRun(startInCopiedBuffer, endInCopiedBuffer, nativeBuilderPtr);
+ }
+
+ if (needFontMetrics) {
+ if (mCachedPaint.baselineShift < 0) {
+ mCachedFm.ascent += mCachedPaint.baselineShift;
+ mCachedFm.top += mCachedPaint.baselineShift;
+ } else {
+ mCachedFm.descent += mCachedPaint.baselineShift;
+ mCachedFm.bottom += mCachedPaint.baselineShift;
+ }
+
+ mFontMetrics.append(mCachedFm.top);
+ mFontMetrics.append(mCachedFm.bottom);
+ mFontMetrics.append(mCachedFm.ascent);
+ mFontMetrics.append(mCachedFm.descent);
+ }
+ }
+
+ /**
+ * Returns the maximum index that the accumulated width not exceeds the width.
+ *
+ * If forward=false is passed, returns the minimum index from the end instead.
+ *
+ * This only works if the MeasuredParagraph is computed with computeForMeasurement.
+ * Undefined behavior in other case.
+ */
+ @IntRange(from = 0) int breakText(int limit, boolean forwards, float width) {
+ float[] w = mWidths.getRawArray();
+ if (forwards) {
+ int i = 0;
+ while (i < limit) {
+ width -= w[i];
+ if (width < 0.0f) break;
+ i++;
+ }
+ while (i > 0 && mCopiedBuffer[i - 1] == ' ') i--;
+ return i;
+ } else {
+ int i = limit - 1;
+ while (i >= 0) {
+ width -= w[i];
+ if (width < 0.0f) break;
+ i--;
+ }
+ while (i < limit - 1 && (mCopiedBuffer[i + 1] == ' ' || w[i + 1] == 0.0f)) {
+ i++;
+ }
+ return limit - i - 1;
+ }
+ }
+
+ /**
+ * Returns the length of the substring.
+ *
+ * This only works if the MeasuredParagraph is computed with computeForMeasurement.
+ * Undefined behavior in other case.
+ */
+ @FloatRange(from = 0.0f) float measure(int start, int limit) {
+ float width = 0;
+ float[] w = mWidths.getRawArray();
+ for (int i = start; i < limit; ++i) {
+ width += w[i];
+ }
+ return width;
+ }
+
+ private static native /* Non Zero */ long nInitBuilder();
+
+ /**
+ * Apply style to make native measured text.
+ *
+ * @param nativeBuilderPtr The native MeasuredParagraph builder pointer.
+ * @param paintPtr The native paint pointer to be applied.
+ * @param start The start offset in the copied buffer.
+ * @param end The end offset in the copied buffer.
+ * @param isRtl True if the text is RTL.
+ */
+ private static native void nAddStyleRun(/* Non Zero */ long nativeBuilderPtr,
+ /* Non Zero */ long paintPtr,
+ @IntRange(from = 0) int start,
+ @IntRange(from = 0) int end,
+ boolean isRtl);
+
+ /**
+ * Apply ReplacementRun to make native measured text.
+ *
+ * @param nativeBuilderPtr The native MeasuredParagraph builder pointer.
+ * @param paintPtr The native paint pointer to be applied.
+ * @param start The start offset in the copied buffer.
+ * @param end The end offset in the copied buffer.
+ * @param width The width of the replacement.
+ */
+ private static native void nAddReplacementRun(/* Non Zero */ long nativeBuilderPtr,
+ /* Non Zero */ long paintPtr,
+ @IntRange(from = 0) int start,
+ @IntRange(from = 0) int end,
+ @FloatRange(from = 0) float width);
+
+ private static native long nBuildNativeMeasuredParagraph(/* Non Zero */ long nativeBuilderPtr,
+ @NonNull char[] text);
+
+ private static native void nFreeBuilder(/* Non Zero */ long nativeBuilderPtr);
+
+ @CriticalNative
+ private static native /* Non Zero */ long nGetReleaseFunc();
+}
diff --git a/core/java/android/text/MeasuredText.java b/core/java/android/text/MeasuredText.java
index 14d6f9e..2c30360 100644
--- a/core/java/android/text/MeasuredText.java
+++ b/core/java/android/text/MeasuredText.java
@@ -1,5 +1,5 @@
/*
- * Copyright (C) 2010 The Android Open Source Project
+ * Copyright (C) 2017 The Android Open Source Project
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
@@ -16,661 +16,255 @@
package android.text;
-import android.annotation.FloatRange;
import android.annotation.IntRange;
import android.annotation.NonNull;
-import android.annotation.Nullable;
-import android.graphics.Paint;
-import android.text.AutoGrowArray.ByteArray;
-import android.text.AutoGrowArray.FloatArray;
-import android.text.AutoGrowArray.IntArray;
-import android.text.Layout.Directions;
-import android.text.style.MetricAffectingSpan;
-import android.text.style.ReplacementSpan;
-import android.util.Pools.SynchronizedPool;
+import android.util.IntArray;
-import dalvik.annotation.optimization.CriticalNative;
+import com.android.internal.util.ArrayUtils;
+import com.android.internal.util.Preconditions;
-import libcore.util.NativeAllocationRegistry;
-
-import java.util.Arrays;
+import java.util.ArrayList;
/**
- * MeasuredText provides text information for rendering purpose.
- *
- * The first motivation of this class is identify the text directions and retrieving individual
- * character widths. However retrieving character widths is slower than identifying text directions.
- * Thus, this class provides several builder methods for specific purposes.
- *
- * - buildForBidi:
- * Compute only text directions.
- * - buildForMeasurement:
- * Compute text direction and all character widths.
- * - buildForStaticLayout:
- * This is bit special. StaticLayout also needs to know text direction and character widths for
- * line breaking, but all things are done in native code. Similarly, text measurement is done
- * in native code. So instead of storing result to Java array, this keeps the result in native
- * code since there is no good reason to move the results to Java layer.
- *
- * In addition to the character widths, some additional information is computed for each purposes,
- * e.g. whole text length for measurement or font metrics for static layout.
- *
- * MeasuredText is NOT a thread safe object.
- * @hide
+ * A text which has already been measured.
*/
-public class MeasuredText {
- private static final char OBJECT_REPLACEMENT_CHARACTER = '\uFFFC';
+public class MeasuredText implements Spanned {
+ private static final char LINE_FEED = '\n';
- private static final NativeAllocationRegistry sRegistry = new NativeAllocationRegistry(
- MeasuredText.class.getClassLoader(), nGetReleaseFunc(), 1024);
+ // The original text.
+ private final @NonNull CharSequence mText;
- private MeasuredText() {} // Use build static functions instead.
+ // The inclusive start offset of the measuring target.
+ private final @IntRange(from = 0) int mStart;
- private static final SynchronizedPool<MeasuredText> sPool = new SynchronizedPool<>(1);
+ // The exclusive end offset of the measuring target.
+ private final @IntRange(from = 0) int mEnd;
- private static @NonNull MeasuredText obtain() { // Use build static functions instead.
- final MeasuredText mt = sPool.acquire();
- return mt != null ? mt : new MeasuredText();
+ // The TextPaint used for measurement.
+ private final @NonNull TextPaint mPaint;
+
+ // The requested text direction.
+ private final @NonNull TextDirectionHeuristic mTextDir;
+
+ // The measured paragraph texts.
+ private final @NonNull MeasuredParagraph[] mMeasuredParagraphs;
+
+ // The sorted paragraph end offsets.
+ private final @NonNull int[] mParagraphBreakPoints;
+
+ /**
+ * Build MeasuredText from the text.
+ *
+ * @param text The text to be measured.
+ * @param paint The paint to be used for drawing.
+ * @param textDir The text direction.
+ * @return The measured text.
+ */
+ public static @NonNull MeasuredText build(@NonNull CharSequence text,
+ @NonNull TextPaint paint,
+ @NonNull TextDirectionHeuristic textDir) {
+ return MeasuredText.build(text, paint, textDir, 0, text.length());
}
/**
- * Recycle the MeasuredText.
+ * Build MeasuredText from the specific range of the text..
*
- * Do not call any methods after you call this method.
+ * @param text The text to be measured.
+ * @param paint The paint to be used for drawing.
+ * @param textDir The text direction.
+ * @param start The inclusive start offset of the text.
+ * @param end The exclusive start offset of the text.
+ * @return The measured text.
*/
- public void recycle() {
- release();
- sPool.release(this);
+ public static @NonNull MeasuredText build(@NonNull CharSequence text,
+ @NonNull TextPaint paint,
+ @NonNull TextDirectionHeuristic textDir,
+ @IntRange(from = 0) int start,
+ @IntRange(from = 0) int end) {
+ Preconditions.checkNotNull(text);
+ Preconditions.checkNotNull(paint);
+ Preconditions.checkNotNull(textDir);
+ Preconditions.checkArgumentInRange(start, 0, text.length(), "start");
+ Preconditions.checkArgumentInRange(end, 0, text.length(), "end");
+
+ final IntArray paragraphEnds = new IntArray();
+ final ArrayList<MeasuredParagraph> measuredTexts = new ArrayList<>();
+
+ int paraEnd = 0;
+ for (int paraStart = start; paraStart < end; paraStart = paraEnd) {
+ paraEnd = TextUtils.indexOf(text, LINE_FEED, paraStart, end);
+ if (paraEnd < 0) {
+ // No LINE_FEED(U+000A) character found. Use end of the text as the paragraph end.
+ paraEnd = end;
+ } else {
+ paraEnd++; // Includes LINE_FEED(U+000A) to the prev paragraph.
+ }
+
+ paragraphEnds.add(paraEnd);
+ measuredTexts.add(MeasuredParagraph.buildForStaticLayout(
+ paint, text, paraStart, paraEnd, textDir, null /* no recycle */));
+ }
+
+ return new MeasuredText(text, start, end, paint, textDir,
+ measuredTexts.toArray(new MeasuredParagraph[measuredTexts.size()]),
+ paragraphEnds.toArray());
}
- // The casted original text.
+ // Use MeasuredText.build instead.
+ private MeasuredText(@NonNull CharSequence text,
+ @IntRange(from = 0) int start,
+ @IntRange(from = 0) int end,
+ @NonNull TextPaint paint,
+ @NonNull TextDirectionHeuristic textDir,
+ @NonNull MeasuredParagraph[] measuredTexts,
+ @NonNull int[] paragraphBreakPoints) {
+ mText = text;
+ mStart = start;
+ mEnd = end;
+ mPaint = paint;
+ mMeasuredParagraphs = measuredTexts;
+ mParagraphBreakPoints = paragraphBreakPoints;
+ mTextDir = textDir;
+ }
+
+ /**
+ * Return the underlying text.
+ */
+ public @NonNull CharSequence getText() {
+ return mText;
+ }
+
+ /**
+ * Returns the inclusive start offset of measured region.
+ */
+ public @IntRange(from = 0) int getStart() {
+ return mStart;
+ }
+
+ /**
+ * Returns the exclusive end offset of measured region.
+ */
+ public @IntRange(from = 0) int getEnd() {
+ return mEnd;
+ }
+
+ /**
+ * Returns the text direction associated with char sequence.
+ */
+ public @NonNull TextDirectionHeuristic getTextDir() {
+ return mTextDir;
+ }
+
+ /**
+ * Returns the paint used to measure this text.
+ */
+ public @NonNull TextPaint getPaint() {
+ return mPaint;
+ }
+
+ /**
+ * Returns the length of the paragraph of this text.
+ */
+ public @IntRange(from = 0) int getParagraphCount() {
+ return mParagraphBreakPoints.length;
+ }
+
+ /**
+ * Returns the paragraph start offset of the text.
+ */
+ public @IntRange(from = 0) int getParagraphStart(@IntRange(from = 0) int paraIndex) {
+ Preconditions.checkArgumentInRange(paraIndex, 0, getParagraphCount(), "paraIndex");
+ return paraIndex == 0 ? mStart : mParagraphBreakPoints[paraIndex - 1];
+ }
+
+ /**
+ * Returns the paragraph end offset of the text.
+ */
+ public @IntRange(from = 0) int getParagraphEnd(@IntRange(from = 0) int paraIndex) {
+ Preconditions.checkArgumentInRange(paraIndex, 0, getParagraphCount(), "paraIndex");
+ return mParagraphBreakPoints[paraIndex];
+ }
+
+ /** @hide */
+ public @NonNull MeasuredParagraph getMeasuredParagraph(@IntRange(from = 0) int paraIndex) {
+ return mMeasuredParagraphs[paraIndex];
+ }
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////
+ // Spanned overrides
//
- // This may be null if the passed text is not a Spanned.
- private @Nullable Spanned mSpanned;
+ // Just proxy for underlying mText if appropriate.
- // The start offset of the target range in the original text (mSpanned);
- private @IntRange(from = 0) int mTextStart;
+ @Override
+ public <T> T[] getSpans(int start, int end, Class<T> type) {
+ if (mText instanceof Spanned) {
+ return ((Spanned) mText).getSpans(start, end, type);
+ } else {
+ return ArrayUtils.emptyArray(type);
+ }
+ }
- // The length of the target range in the original text.
- private @IntRange(from = 0) int mTextLength;
+ @Override
+ public int getSpanStart(Object tag) {
+ if (mText instanceof Spanned) {
+ return ((Spanned) mText).getSpanStart(tag);
+ } else {
+ return -1;
+ }
+ }
- // The copied character buffer for measuring text.
+ @Override
+ public int getSpanEnd(Object tag) {
+ if (mText instanceof Spanned) {
+ return ((Spanned) mText).getSpanEnd(tag);
+ } else {
+ return -1;
+ }
+ }
+
+ @Override
+ public int getSpanFlags(Object tag) {
+ if (mText instanceof Spanned) {
+ return ((Spanned) mText).getSpanFlags(tag);
+ } else {
+ return 0;
+ }
+ }
+
+ @Override
+ public int nextSpanTransition(int start, int limit, Class type) {
+ if (mText instanceof Spanned) {
+ return ((Spanned) mText).nextSpanTransition(start, limit, type);
+ } else {
+ return mText.length();
+ }
+ }
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////
+ // CharSequence overrides.
//
- // The length of this array is mTextLength.
- private @Nullable char[] mCopiedBuffer;
+ // Just proxy for underlying mText.
- // The whole paragraph direction.
- private @Layout.Direction int mParaDir;
-
- // True if the text is LTR direction and doesn't contain any bidi characters.
- private boolean mLtrWithoutBidi;
-
- // The bidi level for individual characters.
- //
- // This is empty if mLtrWithoutBidi is true.
- private @NonNull ByteArray mLevels = new ByteArray();
-
- // The whole width of the text.
- // See getWholeWidth comments.
- private @FloatRange(from = 0.0f) float mWholeWidth;
-
- // Individual characters' widths.
- // See getWidths comments.
- private @Nullable FloatArray mWidths = new FloatArray();
-
- // The span end positions.
- // See getSpanEndCache comments.
- private @Nullable IntArray mSpanEndCache = new IntArray(4);
-
- // The font metrics.
- // See getFontMetrics comments.
- private @Nullable IntArray mFontMetrics = new IntArray(4 * 4);
-
- // The native MeasuredText.
- // See getNativePtr comments.
- // Do not modify these members directly. Use bindNativeObject/unbindNativeObject instead.
- private /* Maybe Zero */ long mNativePtr = 0;
- private @Nullable Runnable mNativeObjectCleaner;
-
- // Associate the native object to this Java object.
- private void bindNativeObject(/* Non Zero*/ long nativePtr) {
- mNativePtr = nativePtr;
- mNativeObjectCleaner = sRegistry.registerNativeAllocation(this, nativePtr);
+ @Override
+ public int length() {
+ return mText.length();
}
- // Decouple the native object from this Java object and release the native object.
- private void unbindNativeObject() {
- if (mNativePtr != 0) {
- mNativeObjectCleaner.run();
- mNativePtr = 0;
- }
+ @Override
+ public char charAt(int index) {
+ // TODO: Should this be index + mStart ?
+ return mText.charAt(index);
}
- // Following two objects are for avoiding object allocation.
- private @NonNull TextPaint mCachedPaint = new TextPaint();
- private @Nullable Paint.FontMetricsInt mCachedFm;
-
- /**
- * Releases internal buffers.
- */
- public void release() {
- reset();
- mLevels.clearWithReleasingLargeArray();
- mWidths.clearWithReleasingLargeArray();
- mFontMetrics.clearWithReleasingLargeArray();
- mSpanEndCache.clearWithReleasingLargeArray();
+ @Override
+ public CharSequence subSequence(int start, int end) {
+ // TODO: return MeasuredText.
+ // TODO: Should this be index + mStart, end + mStart ?
+ return mText.subSequence(start, end);
}
- /**
- * Resets the internal state for starting new text.
- */
- private void reset() {
- mSpanned = null;
- mCopiedBuffer = null;
- mWholeWidth = 0;
- mLevels.clear();
- mWidths.clear();
- mFontMetrics.clear();
- mSpanEndCache.clear();
- unbindNativeObject();
+ @Override
+ public String toString() {
+ return mText.toString();
}
-
- /**
- * Returns the characters to be measured.
- *
- * This is always available.
- */
- public @NonNull char[] getChars() {
- return mCopiedBuffer;
- }
-
- /**
- * Returns the paragraph direction.
- *
- * This is always available.
- */
- public @Layout.Direction int getParagraphDir() {
- return mParaDir;
- }
-
- /**
- * Returns the directions.
- *
- * This is always available.
- */
- public Directions getDirections(@IntRange(from = 0) int start, // inclusive
- @IntRange(from = 0) int end) { // exclusive
- if (mLtrWithoutBidi) {
- return Layout.DIRS_ALL_LEFT_TO_RIGHT;
- }
-
- final int length = end - start;
- return AndroidBidi.directions(mParaDir, mLevels.getRawArray(), start, mCopiedBuffer, start,
- length);
- }
-
- /**
- * Returns the whole text width.
- *
- * This is available only if the MeasureText is computed with computeForMeasurement.
- * Returns 0 in other cases.
- */
- public @FloatRange(from = 0.0f) float getWholeWidth() {
- return mWholeWidth;
- }
-
- /**
- * Returns the individual character's width.
- *
- * This is available only if the MeasureText is computed with computeForMeasurement.
- * Returns empty array in other cases.
- */
- public @NonNull FloatArray getWidths() {
- return mWidths;
- }
-
- /**
- * Returns the MetricsAffectingSpan end indices.
- *
- * If the input text is not a spanned string, this has one value that is the length of the text.
- *
- * This is available only if the MeasureText is computed with computeForStaticLayout.
- * Returns empty array in other cases.
- */
- public @NonNull IntArray getSpanEndCache() {
- return mSpanEndCache;
- }
-
- /**
- * Returns the int array which holds FontMetrics.
- *
- * This array holds the repeat of top, bottom, ascent, descent of font metrics value.
- *
- * This is available only if the MeasureText is computed with computeForStaticLayout.
- * Returns empty array in other cases.
- */
- public @NonNull IntArray getFontMetrics() {
- return mFontMetrics;
- }
-
- /**
- * Returns the native ptr of the MeasuredText.
- *
- * This is available only if the MeasureText is computed with computeForStaticLayout.
- * Returns 0 in other cases.
- */
- public /* Maybe Zero */ long getNativePtr() {
- return mNativePtr;
- }
-
- /**
- * Generates new MeasuredText for Bidi computation.
- *
- * If recycle is null, this returns new instance. If recycle is not null, this fills computed
- * result to recycle and returns recycle.
- *
- * @param text the character sequence to be measured
- * @param start the inclusive start offset of the target region in the text
- * @param end the exclusive end offset of the target region in the text
- * @param textDir the text direction
- * @param recycle pass existing MeasuredText if you want to recycle it.
- *
- * @return measured text
- */
- public static @NonNull MeasuredText buildForBidi(@NonNull CharSequence text,
- @IntRange(from = 0) int start,
- @IntRange(from = 0) int end,
- @NonNull TextDirectionHeuristic textDir,
- @Nullable MeasuredText recycle) {
- final MeasuredText mt = recycle == null ? obtain() : recycle;
- mt.resetAndAnalyzeBidi(text, start, end, textDir);
- return mt;
- }
-
- /**
- * Generates new MeasuredText for measuring texts.
- *
- * If recycle is null, this returns new instance. If recycle is not null, this fills computed
- * result to recycle and returns recycle.
- *
- * @param paint the paint to be used for rendering the text.
- * @param text the character sequence to be measured
- * @param start the inclusive start offset of the target region in the text
- * @param end the exclusive end offset of the target region in the text
- * @param textDir the text direction
- * @param recycle pass existing MeasuredText if you want to recycle it.
- *
- * @return measured text
- */
- public static @NonNull MeasuredText buildForMeasurement(@NonNull TextPaint paint,
- @NonNull CharSequence text,
- @IntRange(from = 0) int start,
- @IntRange(from = 0) int end,
- @NonNull TextDirectionHeuristic textDir,
- @Nullable MeasuredText recycle) {
- final MeasuredText mt = recycle == null ? obtain() : recycle;
- mt.resetAndAnalyzeBidi(text, start, end, textDir);
-
- mt.mWidths.resize(mt.mTextLength);
- if (mt.mTextLength == 0) {
- return mt;
- }
-
- if (mt.mSpanned == null) {
- // No style change by MetricsAffectingSpan. Just measure all text.
- mt.applyMetricsAffectingSpan(
- paint, null /* spans */, start, end, 0 /* native static layout ptr */);
- } else {
- // There may be a MetricsAffectingSpan. Split into span transitions and apply styles.
- int spanEnd;
- for (int spanStart = start; spanStart < end; spanStart = spanEnd) {
- spanEnd = mt.mSpanned.nextSpanTransition(spanStart, end, MetricAffectingSpan.class);
- MetricAffectingSpan[] spans = mt.mSpanned.getSpans(spanStart, spanEnd,
- MetricAffectingSpan.class);
- spans = TextUtils.removeEmptySpans(spans, mt.mSpanned, MetricAffectingSpan.class);
- mt.applyMetricsAffectingSpan(
- paint, spans, spanStart, spanEnd, 0 /* native static layout ptr */);
- }
- }
- return mt;
- }
-
- /**
- * Generates new MeasuredText for StaticLayout.
- *
- * If recycle is null, this returns new instance. If recycle is not null, this fills computed
- * result to recycle and returns recycle.
- *
- * @param paint the paint to be used for rendering the text.
- * @param text the character sequence to be measured
- * @param start the inclusive start offset of the target region in the text
- * @param end the exclusive end offset of the target region in the text
- * @param textDir the text direction
- * @param recycle pass existing MeasuredText if you want to recycle it.
- *
- * @return measured text
- */
- public static @NonNull MeasuredText buildForStaticLayout(
- @NonNull TextPaint paint,
- @NonNull CharSequence text,
- @IntRange(from = 0) int start,
- @IntRange(from = 0) int end,
- @NonNull TextDirectionHeuristic textDir,
- @Nullable MeasuredText recycle) {
- final MeasuredText mt = recycle == null ? obtain() : recycle;
- mt.resetAndAnalyzeBidi(text, start, end, textDir);
- if (mt.mTextLength == 0) {
- // Need to build empty native measured text for StaticLayout.
- // TODO: Stop creating empty measured text for empty lines.
- long nativeBuilderPtr = nInitBuilder();
- try {
- mt.bindNativeObject(nBuildNativeMeasuredText(nativeBuilderPtr, mt.mCopiedBuffer));
- } finally {
- nFreeBuilder(nativeBuilderPtr);
- }
- return mt;
- }
-
- long nativeBuilderPtr = nInitBuilder();
- try {
- if (mt.mSpanned == null) {
- // No style change by MetricsAffectingSpan. Just measure all text.
- mt.applyMetricsAffectingSpan(paint, null /* spans */, start, end, nativeBuilderPtr);
- mt.mSpanEndCache.append(end);
- } else {
- // There may be a MetricsAffectingSpan. Split into span transitions and apply
- // styles.
- int spanEnd;
- for (int spanStart = start; spanStart < end; spanStart = spanEnd) {
- spanEnd = mt.mSpanned.nextSpanTransition(spanStart, end,
- MetricAffectingSpan.class);
- MetricAffectingSpan[] spans = mt.mSpanned.getSpans(spanStart, spanEnd,
- MetricAffectingSpan.class);
- spans = TextUtils.removeEmptySpans(spans, mt.mSpanned,
- MetricAffectingSpan.class);
- mt.applyMetricsAffectingSpan(paint, spans, spanStart, spanEnd,
- nativeBuilderPtr);
- mt.mSpanEndCache.append(spanEnd);
- }
- }
- mt.bindNativeObject(nBuildNativeMeasuredText(nativeBuilderPtr, mt.mCopiedBuffer));
- } finally {
- nFreeBuilder(nativeBuilderPtr);
- }
-
- return mt;
- }
-
- /**
- * Reset internal state and analyzes text for bidirectional runs.
- *
- * @param text the character sequence to be measured
- * @param start the inclusive start offset of the target region in the text
- * @param end the exclusive end offset of the target region in the text
- * @param textDir the text direction
- */
- private void resetAndAnalyzeBidi(@NonNull CharSequence text,
- @IntRange(from = 0) int start, // inclusive
- @IntRange(from = 0) int end, // exclusive
- @NonNull TextDirectionHeuristic textDir) {
- reset();
- mSpanned = text instanceof Spanned ? (Spanned) text : null;
- mTextStart = start;
- mTextLength = end - start;
-
- if (mCopiedBuffer == null || mCopiedBuffer.length != mTextLength) {
- mCopiedBuffer = new char[mTextLength];
- }
- TextUtils.getChars(text, start, end, mCopiedBuffer, 0);
-
- // Replace characters associated with ReplacementSpan to U+FFFC.
- if (mSpanned != null) {
- ReplacementSpan[] spans = mSpanned.getSpans(start, end, ReplacementSpan.class);
-
- for (int i = 0; i < spans.length; i++) {
- int startInPara = mSpanned.getSpanStart(spans[i]) - start;
- int endInPara = mSpanned.getSpanEnd(spans[i]) - start;
- // The span interval may be larger and must be restricted to [start, end)
- if (startInPara < 0) startInPara = 0;
- if (endInPara > mTextLength) endInPara = mTextLength;
- Arrays.fill(mCopiedBuffer, startInPara, endInPara, OBJECT_REPLACEMENT_CHARACTER);
- }
- }
-
- if ((textDir == TextDirectionHeuristics.LTR ||
- textDir == TextDirectionHeuristics.FIRSTSTRONG_LTR ||
- textDir == TextDirectionHeuristics.ANYRTL_LTR) &&
- TextUtils.doesNotNeedBidi(mCopiedBuffer, 0, mTextLength)) {
- mLevels.clear();
- mParaDir = Layout.DIR_LEFT_TO_RIGHT;
- mLtrWithoutBidi = true;
- } else {
- final int bidiRequest;
- if (textDir == TextDirectionHeuristics.LTR) {
- bidiRequest = Layout.DIR_REQUEST_LTR;
- } else if (textDir == TextDirectionHeuristics.RTL) {
- bidiRequest = Layout.DIR_REQUEST_RTL;
- } else if (textDir == TextDirectionHeuristics.FIRSTSTRONG_LTR) {
- bidiRequest = Layout.DIR_REQUEST_DEFAULT_LTR;
- } else if (textDir == TextDirectionHeuristics.FIRSTSTRONG_RTL) {
- bidiRequest = Layout.DIR_REQUEST_DEFAULT_RTL;
- } else {
- final boolean isRtl = textDir.isRtl(mCopiedBuffer, 0, mTextLength);
- bidiRequest = isRtl ? Layout.DIR_REQUEST_RTL : Layout.DIR_REQUEST_LTR;
- }
- mLevels.resize(mTextLength);
- mParaDir = AndroidBidi.bidi(bidiRequest, mCopiedBuffer, mLevels.getRawArray());
- mLtrWithoutBidi = false;
- }
- }
-
- private void applyReplacementRun(@NonNull ReplacementSpan replacement,
- @IntRange(from = 0) int start, // inclusive, in copied buffer
- @IntRange(from = 0) int end, // exclusive, in copied buffer
- /* Maybe Zero */ long nativeBuilderPtr) {
- // Use original text. Shouldn't matter.
- // TODO: passing uninitizlied FontMetrics to developers. Do we need to keep this for
- // backward compatibility? or Should we initialize them for getFontMetricsInt?
- final float width = replacement.getSize(
- mCachedPaint, mSpanned, start + mTextStart, end + mTextStart, mCachedFm);
- if (nativeBuilderPtr == 0) {
- // Assigns all width to the first character. This is the same behavior as minikin.
- mWidths.set(start, width);
- if (end > start + 1) {
- Arrays.fill(mWidths.getRawArray(), start + 1, end, 0.0f);
- }
- mWholeWidth += width;
- } else {
- nAddReplacementRun(nativeBuilderPtr, mCachedPaint.getNativeInstance(), start, end,
- width);
- }
- }
-
- private void applyStyleRun(@IntRange(from = 0) int start, // inclusive, in copied buffer
- @IntRange(from = 0) int end, // exclusive, in copied buffer
- /* Maybe Zero */ long nativeBuilderPtr) {
- if (nativeBuilderPtr != 0) {
- mCachedPaint.getFontMetricsInt(mCachedFm);
- }
-
- if (mLtrWithoutBidi) {
- // If the whole text is LTR direction, just apply whole region.
- if (nativeBuilderPtr == 0) {
- mWholeWidth += mCachedPaint.getTextRunAdvances(
- mCopiedBuffer, start, end - start, start, end - start, false /* isRtl */,
- mWidths.getRawArray(), start);
- } else {
- nAddStyleRun(nativeBuilderPtr, mCachedPaint.getNativeInstance(), start, end,
- false /* isRtl */);
- }
- } else {
- // If there is multiple bidi levels, split into individual bidi level and apply style.
- byte level = mLevels.get(start);
- // Note that the empty text or empty range won't reach this method.
- // Safe to search from start + 1.
- for (int levelStart = start, levelEnd = start + 1;; ++levelEnd) {
- if (levelEnd == end || mLevels.get(levelEnd) != level) { // transition point
- final boolean isRtl = (level & 0x1) != 0;
- if (nativeBuilderPtr == 0) {
- final int levelLength = levelEnd - levelStart;
- mWholeWidth += mCachedPaint.getTextRunAdvances(
- mCopiedBuffer, levelStart, levelLength, levelStart, levelLength,
- isRtl, mWidths.getRawArray(), levelStart);
- } else {
- nAddStyleRun(nativeBuilderPtr, mCachedPaint.getNativeInstance(), levelStart,
- levelEnd, isRtl);
- }
- if (levelEnd == end) {
- break;
- }
- levelStart = levelEnd;
- level = mLevels.get(levelEnd);
- }
- }
- }
- }
-
- private void applyMetricsAffectingSpan(
- @NonNull TextPaint paint,
- @Nullable MetricAffectingSpan[] spans,
- @IntRange(from = 0) int start, // inclusive, in original text buffer
- @IntRange(from = 0) int end, // exclusive, in original text buffer
- /* Maybe Zero */ long nativeBuilderPtr) {
- mCachedPaint.set(paint);
- // XXX paint should not have a baseline shift, but...
- mCachedPaint.baselineShift = 0;
-
- final boolean needFontMetrics = nativeBuilderPtr != 0;
-
- if (needFontMetrics && mCachedFm == null) {
- mCachedFm = new Paint.FontMetricsInt();
- }
-
- ReplacementSpan replacement = null;
- if (spans != null) {
- for (int i = 0; i < spans.length; i++) {
- MetricAffectingSpan span = spans[i];
- if (span instanceof ReplacementSpan) {
- // The last ReplacementSpan is effective for backward compatibility reasons.
- replacement = (ReplacementSpan) span;
- } else {
- // TODO: No need to call updateMeasureState for ReplacementSpan as well?
- span.updateMeasureState(mCachedPaint);
- }
- }
- }
-
- final int startInCopiedBuffer = start - mTextStart;
- final int endInCopiedBuffer = end - mTextStart;
-
- if (replacement != null) {
- applyReplacementRun(replacement, startInCopiedBuffer, endInCopiedBuffer,
- nativeBuilderPtr);
- } else {
- applyStyleRun(startInCopiedBuffer, endInCopiedBuffer, nativeBuilderPtr);
- }
-
- if (needFontMetrics) {
- if (mCachedPaint.baselineShift < 0) {
- mCachedFm.ascent += mCachedPaint.baselineShift;
- mCachedFm.top += mCachedPaint.baselineShift;
- } else {
- mCachedFm.descent += mCachedPaint.baselineShift;
- mCachedFm.bottom += mCachedPaint.baselineShift;
- }
-
- mFontMetrics.append(mCachedFm.top);
- mFontMetrics.append(mCachedFm.bottom);
- mFontMetrics.append(mCachedFm.ascent);
- mFontMetrics.append(mCachedFm.descent);
- }
- }
-
- /**
- * Returns the maximum index that the accumulated width not exceeds the width.
- *
- * If forward=false is passed, returns the minimum index from the end instead.
- *
- * This only works if the MeasuredText is computed with computeForMeasurement.
- * Undefined behavior in other case.
- */
- @IntRange(from = 0) int breakText(int limit, boolean forwards, float width) {
- float[] w = mWidths.getRawArray();
- if (forwards) {
- int i = 0;
- while (i < limit) {
- width -= w[i];
- if (width < 0.0f) break;
- i++;
- }
- while (i > 0 && mCopiedBuffer[i - 1] == ' ') i--;
- return i;
- } else {
- int i = limit - 1;
- while (i >= 0) {
- width -= w[i];
- if (width < 0.0f) break;
- i--;
- }
- while (i < limit - 1 && (mCopiedBuffer[i + 1] == ' ' || w[i + 1] == 0.0f)) {
- i++;
- }
- return limit - i - 1;
- }
- }
-
- /**
- * Returns the length of the substring.
- *
- * This only works if the MeasuredText is computed with computeForMeasurement.
- * Undefined behavior in other case.
- */
- @FloatRange(from = 0.0f) float measure(int start, int limit) {
- float width = 0;
- float[] w = mWidths.getRawArray();
- for (int i = start; i < limit; ++i) {
- width += w[i];
- }
- return width;
- }
-
- private static native /* Non Zero */ long nInitBuilder();
-
- /**
- * Apply style to make native measured text.
- *
- * @param nativeBuilderPtr The native MeasuredText builder pointer.
- * @param paintPtr The native paint pointer to be applied.
- * @param start The start offset in the copied buffer.
- * @param end The end offset in the copied buffer.
- * @param isRtl True if the text is RTL.
- */
- private static native void nAddStyleRun(/* Non Zero */ long nativeBuilderPtr,
- /* Non Zero */ long paintPtr,
- @IntRange(from = 0) int start,
- @IntRange(from = 0) int end,
- boolean isRtl);
-
- /**
- * Apply ReplacementRun to make native measured text.
- *
- * @param nativeBuilderPtr The native MeasuredText builder pointer.
- * @param paintPtr The native paint pointer to be applied.
- * @param start The start offset in the copied buffer.
- * @param end The end offset in the copied buffer.
- * @param width The width of the replacement.
- */
- private static native void nAddReplacementRun(/* Non Zero */ long nativeBuilderPtr,
- /* Non Zero */ long paintPtr,
- @IntRange(from = 0) int start,
- @IntRange(from = 0) int end,
- @FloatRange(from = 0) float width);
-
- private static native long nBuildNativeMeasuredText(/* Non Zero */ long nativeBuilderPtr,
- @NonNull char[] text);
-
- private static native void nFreeBuilder(/* Non Zero */ long nativeBuilderPtr);
-
- @CriticalNative
- private static native /* Non Zero */ long nGetReleaseFunc();
}
diff --git a/core/java/android/text/PremeasuredText.java b/core/java/android/text/PremeasuredText.java
deleted file mode 100644
index 465314d..0000000
--- a/core/java/android/text/PremeasuredText.java
+++ /dev/null
@@ -1,272 +0,0 @@
-/*
- * Copyright (C) 2017 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-package android.text;
-
-import android.annotation.IntRange;
-import android.annotation.NonNull;
-import android.util.IntArray;
-
-import com.android.internal.util.ArrayUtils;
-import com.android.internal.util.Preconditions;
-
-import java.util.ArrayList;
-
-/**
- * A text which has already been measured.
- *
- * TODO: Rename to better name? e.g. MeasuredText, FrozenText etc.
- */
-public class PremeasuredText implements Spanned {
- private static final char LINE_FEED = '\n';
-
- // The original text.
- private final @NonNull CharSequence mText;
-
- // The inclusive start offset of the measuring target.
- private final @IntRange(from = 0) int mStart;
-
- // The exclusive end offset of the measuring target.
- private final @IntRange(from = 0) int mEnd;
-
- // The TextPaint used for measurement.
- private final @NonNull TextPaint mPaint;
-
- // The requested text direction.
- private final @NonNull TextDirectionHeuristic mTextDir;
-
- // The measured paragraph texts.
- private final @NonNull MeasuredText[] mMeasuredTexts;
-
- // The sorted paragraph end offsets.
- private final @NonNull int[] mParagraphBreakPoints;
-
- /**
- * Build PremeasuredText from the text.
- *
- * @param text The text to be measured.
- * @param paint The paint to be used for drawing.
- * @param textDir The text direction.
- * @return The measured text.
- */
- public static @NonNull PremeasuredText build(@NonNull CharSequence text,
- @NonNull TextPaint paint,
- @NonNull TextDirectionHeuristic textDir) {
- return PremeasuredText.build(text, paint, textDir, 0, text.length());
- }
-
- /**
- * Build PremeasuredText from the specific range of the text..
- *
- * @param text The text to be measured.
- * @param paint The paint to be used for drawing.
- * @param textDir The text direction.
- * @param start The inclusive start offset of the text.
- * @param end The exclusive start offset of the text.
- * @return The measured text.
- */
- public static @NonNull PremeasuredText build(@NonNull CharSequence text,
- @NonNull TextPaint paint,
- @NonNull TextDirectionHeuristic textDir,
- @IntRange(from = 0) int start,
- @IntRange(from = 0) int end) {
- Preconditions.checkNotNull(text);
- Preconditions.checkNotNull(paint);
- Preconditions.checkNotNull(textDir);
- Preconditions.checkArgumentInRange(start, 0, text.length(), "start");
- Preconditions.checkArgumentInRange(end, 0, text.length(), "end");
-
- final IntArray paragraphEnds = new IntArray();
- final ArrayList<MeasuredText> measuredTexts = new ArrayList<>();
-
- int paraEnd = 0;
- for (int paraStart = start; paraStart < end; paraStart = paraEnd) {
- paraEnd = TextUtils.indexOf(text, LINE_FEED, paraStart, end);
- if (paraEnd < 0) {
- // No LINE_FEED(U+000A) character found. Use end of the text as the paragraph end.
- paraEnd = end;
- } else {
- paraEnd++; // Includes LINE_FEED(U+000A) to the prev paragraph.
- }
-
- paragraphEnds.add(paraEnd);
- measuredTexts.add(MeasuredText.buildForStaticLayout(
- paint, text, paraStart, paraEnd, textDir, null /* no recycle */));
- }
-
- return new PremeasuredText(text, start, end, paint, textDir,
- measuredTexts.toArray(new MeasuredText[measuredTexts.size()]),
- paragraphEnds.toArray());
- }
-
- // Use PremeasuredText.build instead.
- private PremeasuredText(@NonNull CharSequence text,
- @IntRange(from = 0) int start,
- @IntRange(from = 0) int end,
- @NonNull TextPaint paint,
- @NonNull TextDirectionHeuristic textDir,
- @NonNull MeasuredText[] measuredTexts,
- @NonNull int[] paragraphBreakPoints) {
- mText = text;
- mStart = start;
- mEnd = end;
- mPaint = paint;
- mMeasuredTexts = measuredTexts;
- mParagraphBreakPoints = paragraphBreakPoints;
- mTextDir = textDir;
- }
-
- /**
- * Return the underlying text.
- */
- public @NonNull CharSequence getText() {
- return mText;
- }
-
- /**
- * Returns the inclusive start offset of measured region.
- */
- public @IntRange(from = 0) int getStart() {
- return mStart;
- }
-
- /**
- * Returns the exclusive end offset of measured region.
- */
- public @IntRange(from = 0) int getEnd() {
- return mEnd;
- }
-
- /**
- * Returns the text direction associated with char sequence.
- */
- public @NonNull TextDirectionHeuristic getTextDir() {
- return mTextDir;
- }
-
- /**
- * Returns the paint used to measure this text.
- */
- public @NonNull TextPaint getPaint() {
- return mPaint;
- }
-
- /**
- * Returns the length of the paragraph of this text.
- */
- public @IntRange(from = 0) int getParagraphCount() {
- return mParagraphBreakPoints.length;
- }
-
- /**
- * Returns the paragraph start offset of the text.
- */
- public @IntRange(from = 0) int getParagraphStart(@IntRange(from = 0) int paraIndex) {
- Preconditions.checkArgumentInRange(paraIndex, 0, getParagraphCount(), "paraIndex");
- return paraIndex == 0 ? mStart : mParagraphBreakPoints[paraIndex - 1];
- }
-
- /**
- * Returns the paragraph end offset of the text.
- */
- public @IntRange(from = 0) int getParagraphEnd(@IntRange(from = 0) int paraIndex) {
- Preconditions.checkArgumentInRange(paraIndex, 0, getParagraphCount(), "paraIndex");
- return mParagraphBreakPoints[paraIndex];
- }
-
- /** @hide */
- public @NonNull MeasuredText getMeasuredText(@IntRange(from = 0) int paraIndex) {
- return mMeasuredTexts[paraIndex];
- }
-
- ///////////////////////////////////////////////////////////////////////////////////////////////
- // Spanned overrides
- //
- // Just proxy for underlying mText if appropriate.
-
- @Override
- public <T> T[] getSpans(int start, int end, Class<T> type) {
- if (mText instanceof Spanned) {
- return ((Spanned) mText).getSpans(start, end, type);
- } else {
- return ArrayUtils.emptyArray(type);
- }
- }
-
- @Override
- public int getSpanStart(Object tag) {
- if (mText instanceof Spanned) {
- return ((Spanned) mText).getSpanStart(tag);
- } else {
- return -1;
- }
- }
-
- @Override
- public int getSpanEnd(Object tag) {
- if (mText instanceof Spanned) {
- return ((Spanned) mText).getSpanEnd(tag);
- } else {
- return -1;
- }
- }
-
- @Override
- public int getSpanFlags(Object tag) {
- if (mText instanceof Spanned) {
- return ((Spanned) mText).getSpanFlags(tag);
- } else {
- return 0;
- }
- }
-
- @Override
- public int nextSpanTransition(int start, int limit, Class type) {
- if (mText instanceof Spanned) {
- return ((Spanned) mText).nextSpanTransition(start, limit, type);
- } else {
- return mText.length();
- }
- }
-
- ///////////////////////////////////////////////////////////////////////////////////////////////
- // CharSequence overrides.
- //
- // Just proxy for underlying mText.
-
- @Override
- public int length() {
- return mText.length();
- }
-
- @Override
- public char charAt(int index) {
- // TODO: Should this be index + mStart ?
- return mText.charAt(index);
- }
-
- @Override
- public CharSequence subSequence(int start, int end) {
- // TODO: return PremeasuredText.
- // TODO: Should this be index + mStart, end + mStart ?
- return mText.subSequence(start, end);
- }
-
- @Override
- public String toString() {
- return mText.toString();
- }
-}
diff --git a/core/java/android/text/StaticLayout.java b/core/java/android/text/StaticLayout.java
index d69b119..36bec86 100644
--- a/core/java/android/text/StaticLayout.java
+++ b/core/java/android/text/StaticLayout.java
@@ -55,7 +55,8 @@
* First, call nInit to setup native line breaker object. Then, for each paragraph, do the
* following:
*
- * - Create MeasuredText by MeasuredText.buildForStaticLayout which measures in native.
+ * - Create MeasuredParagraph by MeasuredParagraph.buildForStaticLayout which measures in
+ * native.
* - Run nComputeLineBreaks() to obtain line breaks for the paragraph.
*
* After all paragraphs, call finish() to release expensive buffers.
@@ -650,34 +651,34 @@
b.mJustificationMode != Layout.JUSTIFICATION_MODE_NONE,
indents, mLeftPaddings, mRightPaddings);
- PremeasuredText premeasured = null;
+ MeasuredText measured = null;
final Spanned spanned;
- if (source instanceof PremeasuredText) {
- premeasured = (PremeasuredText) source;
+ if (source instanceof MeasuredText) {
+ measured = (MeasuredText) source;
- final CharSequence original = premeasured.getText();
+ final CharSequence original = measured.getText();
spanned = (original instanceof Spanned) ? (Spanned) original : null;
- if (bufStart != premeasured.getStart() || bufEnd != premeasured.getEnd()) {
+ if (bufStart != measured.getStart() || bufEnd != measured.getEnd()) {
// The buffer position has changed. Re-measure here.
- premeasured = PremeasuredText.build(original, paint, textDir, bufStart, bufEnd);
+ measured = MeasuredText.build(original, paint, textDir, bufStart, bufEnd);
} else {
- // We can use premeasured information.
+ // We can use measured information.
- // Overwrite with the one when premeasured.
+ // Overwrite with the one when emeasured.
// TODO: Give an option for developer not to overwrite and measure again here?
- textDir = premeasured.getTextDir();
- paint = premeasured.getPaint();
+ textDir = measured.getTextDir();
+ paint = measured.getPaint();
}
} else {
- premeasured = PremeasuredText.build(source, paint, textDir, bufStart, bufEnd);
+ measured = MeasuredText.build(source, paint, textDir, bufStart, bufEnd);
spanned = (source instanceof Spanned) ? (Spanned) source : null;
}
try {
- for (int paraIndex = 0; paraIndex < premeasured.getParagraphCount(); paraIndex++) {
- final int paraStart = premeasured.getParagraphStart(paraIndex);
- final int paraEnd = premeasured.getParagraphEnd(paraIndex);
+ for (int paraIndex = 0; paraIndex < measured.getParagraphCount(); paraIndex++) {
+ final int paraStart = measured.getParagraphStart(paraIndex);
+ final int paraEnd = measured.getParagraphEnd(paraIndex);
int firstWidthLineCount = 1;
int firstWidth = outerWidth;
@@ -743,10 +744,10 @@
}
}
- final MeasuredText measured = premeasured.getMeasuredText(paraIndex);
- final char[] chs = measured.getChars();
- final int[] spanEndCache = measured.getSpanEndCache().getRawArray();
- final int[] fmCache = measured.getFontMetrics().getRawArray();
+ final MeasuredParagraph measuredPara = measured.getMeasuredParagraph(paraIndex);
+ final char[] chs = measuredPara.getChars();
+ final int[] spanEndCache = measuredPara.getSpanEndCache().getRawArray();
+ final int[] fmCache = measuredPara.getFontMetrics().getRawArray();
// TODO: Stop keeping duplicated width copy in native and Java.
widths.resize(chs.length);
@@ -759,7 +760,7 @@
// Inputs
chs,
- measured.getNativePtr(),
+ measuredPara.getNativePtr(),
paraEnd - paraStart,
firstWidth,
firstWidthLineCount,
@@ -863,7 +864,7 @@
v = out(source, here, endPos,
ascent, descent, fmTop, fmBottom,
v, spacingmult, spacingadd, chooseHt, chooseHtv, fm,
- flags[breakIndex], needMultiply, measured, bufEnd,
+ flags[breakIndex], needMultiply, measuredPara, bufEnd,
includepad, trackpad, addLastLineSpacing, chs, widths.getRawArray(),
paraStart, ellipsize, ellipsizedWidth, lineWidths[breakIndex],
paint, moreChars);
@@ -894,8 +895,8 @@
if ((bufEnd == bufStart || source.charAt(bufEnd - 1) == CHAR_NEW_LINE)
&& mLineCount < mMaximumVisibleLineCount) {
- final MeasuredText measured =
- MeasuredText.buildForBidi(source, bufEnd, bufEnd, textDir, null);
+ final MeasuredParagraph measuredPara =
+ MeasuredParagraph.buildForBidi(source, bufEnd, bufEnd, textDir, null);
paint.getFontMetricsInt(fm);
v = out(source,
bufEnd, bufEnd, fm.ascent, fm.descent,
@@ -903,7 +904,7 @@
v,
spacingmult, spacingadd, null,
null, fm, 0,
- needMultiply, measured, bufEnd,
+ needMultiply, measuredPara, bufEnd,
includepad, trackpad, addLastLineSpacing, null,
null, bufStart, ellipsize,
ellipsizedWidth, 0, paint, false);
@@ -918,7 +919,7 @@
private int out(final CharSequence text, final int start, final int end, int above, int below,
int top, int bottom, int v, final float spacingmult, final float spacingadd,
final LineHeightSpan[] chooseHt, final int[] chooseHtv, final Paint.FontMetricsInt fm,
- final int flags, final boolean needMultiply, @NonNull final MeasuredText measured,
+ final int flags, final boolean needMultiply, @NonNull final MeasuredParagraph measured,
final int bufEnd, final boolean includePad, final boolean trackPad,
final boolean addLastLineLineSpacing, final char[] chs, final float[] widths,
final int widthStart, final TextUtils.TruncateAt ellipsize, final float ellipsisWidth,
diff --git a/core/java/android/text/TextUtils.java b/core/java/android/text/TextUtils.java
index 9c9fbf2..409e514 100644
--- a/core/java/android/text/TextUtils.java
+++ b/core/java/android/text/TextUtils.java
@@ -1250,10 +1250,10 @@
@NonNull String ellipsis) {
final int len = text.length();
- MeasuredText mt = null;
- MeasuredText resultMt = null;
+ MeasuredParagraph mt = null;
+ MeasuredParagraph resultMt = null;
try {
- mt = MeasuredText.buildForMeasurement(paint, text, 0, text.length(), textDir, mt);
+ mt = MeasuredParagraph.buildForMeasurement(paint, text, 0, text.length(), textDir, mt);
float width = mt.getWholeWidth();
if (width <= avail) {
@@ -1332,7 +1332,7 @@
if (remaining == 0) { // All text is gone.
textFits = true;
} else {
- resultMt = MeasuredText.buildForMeasurement(
+ resultMt = MeasuredParagraph.buildForMeasurement(
paint, result, 0, result.length(), textDir, resultMt);
width = resultMt.getWholeWidth();
if (width <= avail) {
@@ -1479,11 +1479,11 @@
public static CharSequence commaEllipsize(CharSequence text, TextPaint p,
float avail, String oneMore, String more, TextDirectionHeuristic textDir) {
- MeasuredText mt = null;
- MeasuredText tempMt = null;
+ MeasuredParagraph mt = null;
+ MeasuredParagraph tempMt = null;
try {
int len = text.length();
- mt = MeasuredText.buildForMeasurement(p, text, 0, len, textDir, mt);
+ mt = MeasuredParagraph.buildForMeasurement(p, text, 0, len, textDir, mt);
final float width = mt.getWholeWidth();
if (width <= avail) {
return text;
@@ -1523,7 +1523,7 @@
}
// XXX this is probably ok, but need to look at it more
- tempMt = MeasuredText.buildForMeasurement(
+ tempMt = MeasuredParagraph.buildForMeasurement(
p, format, 0, format.length(), textDir, tempMt);
float moreWid = tempMt.getWholeWidth();
diff --git a/core/java/android/util/FeatureFlagUtils.java b/core/java/android/util/FeatureFlagUtils.java
index 62f9717..8242156 100644
--- a/core/java/android/util/FeatureFlagUtils.java
+++ b/core/java/android/util/FeatureFlagUtils.java
@@ -38,7 +38,6 @@
static {
DEFAULT_FLAGS = new HashMap<>();
DEFAULT_FLAGS.put("device_info_v2", "true");
- DEFAULT_FLAGS.put("settings_search_v2", "true");
DEFAULT_FLAGS.put("settings_app_info_v2", "true");
DEFAULT_FLAGS.put("settings_connected_device_v2", "true");
DEFAULT_FLAGS.put("settings_battery_v2", "false");
diff --git a/core/java/android/util/StatsManager.java b/core/java/android/util/StatsManager.java
index c25b272..e0d085c 100644
--- a/core/java/android/util/StatsManager.java
+++ b/core/java/android/util/StatsManager.java
@@ -42,6 +42,16 @@
}
/**
+ * Temporary to prevent build failures. Will be deleted.
+ */
+ @RequiresPermission(Manifest.permission.DUMP)
+ public boolean addConfiguration(String configKey, byte[] config, String pkg, String cls) {
+ // To prevent breakages of dependencies on old API.
+
+ return false;
+ }
+
+ /**
* Clients can send a configuration and simultaneously registers the name of a broadcast
* receiver that listens for when it should request data.
*
@@ -70,6 +80,15 @@
}
/**
+ * Temporary to prevent build failures. Will be deleted.
+ */
+ @RequiresPermission(Manifest.permission.DUMP)
+ public boolean removeConfiguration(String configKey) {
+ // To prevent breakages of old dependencies.
+ return false;
+ }
+
+ /**
* Remove a configuration from logging.
*
* @param configKey Configuration key to remove.
@@ -93,6 +112,16 @@
}
/**
+ * Temporary to prevent build failures. Will be deleted.
+ */
+ @RequiresPermission(Manifest.permission.DUMP)
+ public byte[] getData(String configKey) {
+ // TODO: remove this and all other methods with String-based config keys.
+ // To prevent build breakages of dependencies.
+ return null;
+ }
+
+ /**
* Clients can request data with a binder call. This getter is destructive and also clears
* the retrieved metrics from statsd memory.
*
diff --git a/core/java/android/util/TimeUtils.java b/core/java/android/util/TimeUtils.java
index cc4a0b6..84ae20b 100644
--- a/core/java/android/util/TimeUtils.java
+++ b/core/java/android/util/TimeUtils.java
@@ -18,30 +18,18 @@
import android.os.SystemClock;
-import java.io.PrintWriter;
-import java.text.SimpleDateFormat;
-import java.util.ArrayList;
-import java.util.Calendar;
-import java.util.Collection;
-import java.util.Collections;
-import java.util.Date;
-import java.util.List;
import libcore.util.TimeZoneFinder;
import libcore.util.ZoneInfoDB;
+import java.io.PrintWriter;
+import java.text.SimpleDateFormat;
+import java.util.Calendar;
+import java.util.Date;
/**
* A class containing utility methods related to time zones.
*/
public class TimeUtils {
/** @hide */ public TimeUtils() {}
- private static final boolean DBG = false;
- private static final String TAG = "TimeUtils";
-
- /** Cached results of getTimeZonesWithUniqueOffsets */
- private static final Object sLastUniqueLockObj = new Object();
- private static List<String> sLastUniqueZoneOffsets = null;
- private static String sLastUniqueCountry = null;
-
/** {@hide} */
private static SimpleDateFormat sLoggingFormat = new SimpleDateFormat("yyyy-MM-dd HH:mm:ss");
@@ -76,86 +64,6 @@
}
/**
- * Returns an immutable list of unique time zone IDs for the country.
- *
- * @param country to find
- * @return unmodifiable list of unique time zones, maybe empty but never null.
- * @hide
- */
- public static List<String> getTimeZoneIdsWithUniqueOffsets(String country) {
- synchronized(sLastUniqueLockObj) {
- if ((country != null) && country.equals(sLastUniqueCountry)) {
- if (DBG) {
- Log.d(TAG, "getTimeZonesWithUniqueOffsets(" +
- country + "): return cached version");
- }
- return sLastUniqueZoneOffsets;
- }
- }
-
- Collection<android.icu.util.TimeZone> zones = getIcuTimeZones(country);
- ArrayList<android.icu.util.TimeZone> uniqueTimeZones = new ArrayList<>();
- for (android.icu.util.TimeZone zone : zones) {
- // See if we already have this offset,
- // Using slow but space efficient and these are small.
- boolean found = false;
- for (int i = 0; i < uniqueTimeZones.size(); i++) {
- if (uniqueTimeZones.get(i).getRawOffset() == zone.getRawOffset()) {
- found = true;
- break;
- }
- }
- if (!found) {
- if (DBG) {
- Log.d(TAG, "getTimeZonesWithUniqueOffsets: add unique offset=" +
- zone.getRawOffset() + " zone.getID=" + zone.getID());
- }
- uniqueTimeZones.add(zone);
- }
- }
-
- synchronized(sLastUniqueLockObj) {
- // Cache the last result
- sLastUniqueZoneOffsets = extractZoneIds(uniqueTimeZones);
- sLastUniqueCountry = country;
-
- return sLastUniqueZoneOffsets;
- }
- }
-
- private static List<String> extractZoneIds(List<android.icu.util.TimeZone> timeZones) {
- List<String> ids = new ArrayList<>(timeZones.size());
- for (android.icu.util.TimeZone timeZone : timeZones) {
- ids.add(timeZone.getID());
- }
- return Collections.unmodifiableList(ids);
- }
-
- /**
- * Returns an immutable list of frozen ICU time zones for the country.
- *
- * @param countryIso is a two character country code.
- * @return TimeZone list, maybe empty but never null.
- * @hide
- */
- private static List<android.icu.util.TimeZone> getIcuTimeZones(String countryIso) {
- if (countryIso == null) {
- if (DBG) Log.d(TAG, "getIcuTimeZones(null): return empty list");
- return Collections.emptyList();
- }
- List<android.icu.util.TimeZone> timeZones =
- TimeZoneFinder.getInstance().lookupTimeZonesByCountry(countryIso);
- if (timeZones == null) {
- if (DBG) {
- Log.d(TAG, "getIcuTimeZones(" + countryIso
- + "): returned null, converting to empty list");
- }
- return Collections.emptyList();
- }
- return timeZones;
- }
-
- /**
* Returns a String indicating the version of the time zone database currently
* in use. The format of the string is dependent on the underlying time zone
* database implementation, but will typically contain the year in which the database
diff --git a/core/java/android/view/IWindowManager.aidl b/core/java/android/view/IWindowManager.aidl
index 8c70322..bfcf285 100644
--- a/core/java/android/view/IWindowManager.aidl
+++ b/core/java/android/view/IWindowManager.aidl
@@ -294,6 +294,11 @@
boolean hasNavigationBar();
/**
+ * Get the position of the nav bar
+ */
+ int getNavBarPosition();
+
+ /**
* Lock the device immediately with the specified options (can be null).
*/
void lockNow(in Bundle options);
diff --git a/core/java/android/view/View.java b/core/java/android/view/View.java
index ad71b58..bd3be1b 100644
--- a/core/java/android/view/View.java
+++ b/core/java/android/view/View.java
@@ -3226,6 +3226,11 @@
*/
private static final int PFLAG3_SCREEN_READER_FOCUSABLE = 0x10000000;
+ /**
+ * The last aggregated visibility. Used to detect when it truly changes.
+ */
+ private static final int PFLAG3_AGGREGATED_VISIBLE = 0x20000000;
+
/* End of masks for mPrivateFlags3 */
/**
@@ -3387,6 +3392,18 @@
* decorations when they are shown. You can perform layout of your inner
* UI elements to account for non-fullscreen system UI through the
* {@link #fitSystemWindows(Rect)} method.
+ *
+ * <p>Note: on displays that have a {@link DisplayCutout}, the window may still be placed
+ * differently than if {@link #SYSTEM_UI_FLAG_FULLSCREEN} was set, if the
+ * window's {@link WindowManager.LayoutParams#layoutInDisplayCutoutMode
+ * layoutInDisplayCutoutMode} is
+ * {@link WindowManager.LayoutParams#LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT
+ * LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT}. To avoid this, use either of the other modes.
+ *
+ * @see WindowManager.LayoutParams#layoutInDisplayCutoutMode
+ * @see WindowManager.LayoutParams#LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT
+ * @see WindowManager.LayoutParams#LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS
+ * @see WindowManager.LayoutParams#LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER
*/
public static final int SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN = 0x00000400;
@@ -7354,7 +7371,12 @@
* @hide
*/
public void sendAccessibilityEventUncheckedInternal(AccessibilityEvent event) {
- if (!isShown()) {
+ // Panes disappearing are relevant even if though the view is no longer visible.
+ boolean isWindowStateChanged =
+ (event.getEventType() == AccessibilityEvent.TYPE_WINDOW_STATE_CHANGED);
+ boolean isWindowDisappearedEvent = isWindowStateChanged && ((event.getContentChangeTypes()
+ & AccessibilityEvent.CONTENT_CHANGE_TYPE_PANE_DISAPPEARED) != 0);
+ if (!isShown() && !isWindowDisappearedEvent) {
return;
}
onInitializeAccessibilityEvent(event);
@@ -7462,6 +7484,10 @@
* @hide
*/
public void onPopulateAccessibilityEventInternal(AccessibilityEvent event) {
+ if ((event.getEventType() == AccessibilityEvent.TYPE_WINDOW_STATE_CHANGED)
+ && !TextUtils.isEmpty(getAccessibilityPaneTitle())) {
+ event.getText().add(getAccessibilityPaneTitle());
+ }
}
/**
@@ -11587,6 +11613,23 @@
if (!AccessibilityManager.getInstance(mContext).isEnabled() || mAttachInfo == null) {
return;
}
+ // Changes to views with a pane title count as window state changes, as the pane title
+ // marks them as significant parts of the UI.
+ if (!TextUtils.isEmpty(getAccessibilityPaneTitle())) {
+ final AccessibilityEvent event = AccessibilityEvent.obtain();
+ event.setEventType(AccessibilityEvent.TYPE_WINDOW_STATE_CHANGED);
+ event.setContentChangeTypes(changeType);
+ onPopulateAccessibilityEvent(event);
+ if (mParent != null) {
+ try {
+ mParent.requestSendAccessibilityEvent(this, event);
+ } catch (AbstractMethodError e) {
+ Log.e(VIEW_LOG_TAG, mParent.getClass().getSimpleName()
+ + " does not fully implement ViewParent", e);
+ }
+ }
+ }
+
if (mParent != null) {
try {
mParent.notifySubtreeAccessibilityStateChanged(this, source, changeType);
@@ -12520,6 +12563,10 @@
*/
@CallSuper
public void onVisibilityAggregated(boolean isVisible) {
+ // Update our internal visibility tracking so we can detect changes
+ boolean oldVisible = (mPrivateFlags3 & PFLAG3_AGGREGATED_VISIBLE) != 0;
+ mPrivateFlags3 = isVisible ? (mPrivateFlags3 | PFLAG3_AGGREGATED_VISIBLE)
+ : (mPrivateFlags3 & ~PFLAG3_AGGREGATED_VISIBLE);
if (isVisible && mAttachInfo != null) {
initialAwakenScrollBars();
}
@@ -12560,6 +12607,13 @@
}
}
}
+ if (!TextUtils.isEmpty(getAccessibilityPaneTitle())) {
+ if (isVisible != oldVisible) {
+ notifyAccessibilityStateChanged(isVisible
+ ? AccessibilityEvent.CONTENT_CHANGE_TYPE_PANE_APPEARED
+ : AccessibilityEvent.CONTENT_CHANGE_TYPE_PANE_DISAPPEARED);
+ }
+ }
}
/**
diff --git a/core/java/android/view/ViewRootImpl.java b/core/java/android/view/ViewRootImpl.java
index f81a4c3..fe3b696 100644
--- a/core/java/android/view/ViewRootImpl.java
+++ b/core/java/android/view/ViewRootImpl.java
@@ -20,7 +20,7 @@
import static android.view.View.PFLAG_DRAW_ANIMATION;
import static android.view.WindowCallbacks.RESIZE_MODE_DOCKED_DIVIDER;
import static android.view.WindowCallbacks.RESIZE_MODE_FREEFORM;
-import static android.view.WindowManager.LayoutParams.FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_FORCE_DECOR_VIEW_VISIBILITY;
import static android.view.WindowManager.LayoutParams.TYPE_INPUT_METHOD;
import static android.view.WindowManager.LayoutParams.TYPE_STATUS_BAR_PANEL;
@@ -1596,9 +1596,9 @@
void dispatchApplyInsets(View host) {
WindowInsets insets = getWindowInsets(true /* forceConstruct */);
- final boolean layoutInCutout =
- (mWindowAttributes.flags2 & FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA) != 0;
- if (!layoutInCutout) {
+ final boolean dispatchCutout = (mWindowAttributes.layoutInDisplayCutoutMode
+ == LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS);
+ if (!dispatchCutout) {
// Window is either not laid out in cutout or the status bar inset takes care of
// clearing the cutout, so we don't need to dispatch the cutout to the hierarchy.
insets = insets.consumeDisplayCutout();
diff --git a/core/java/android/view/WindowManager.java b/core/java/android/view/WindowManager.java
index a65aba1..ae3c4f09 100644
--- a/core/java/android/view/WindowManager.java
+++ b/core/java/android/view/WindowManager.java
@@ -889,7 +889,12 @@
* decorations around the border (such as the status bar). The
* window must correctly position its contents to take the screen
* decoration into account. This flag is normally set for you
- * by Window as described in {@link Window#setFlags}. */
+ * by Window as described in {@link Window#setFlags}.
+ *
+ * <p>Note: on displays that have a {@link DisplayCutout}, the window may be placed
+ * such that it avoids the {@link DisplayCutout} area if necessary according to the
+ * {@link #layoutInDisplayCutoutMode}.
+ */
public static final int FLAG_LAYOUT_IN_SCREEN = 0x00000100;
/** Window flag: allow window to extend outside of the screen. */
@@ -1299,26 +1304,11 @@
@Retention(RetentionPolicy.SOURCE)
@LongDef(
flag = true,
- value = {
- LayoutParams.FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA,
- })
+ value = {})
@interface Flags2 {}
/**
- * Window flag: allow placing the window within the area that overlaps with the
- * display cutout.
- *
- * <p>
- * The window must correctly position its contents to take the display cutout into account.
- *
- * @see DisplayCutout
- */
- public static final long FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA = 0x00000001;
-
- /**
* Various behavioral options/flags. Default is none.
- *
- * @see #FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA
*/
@Flags2 public long flags2;
@@ -2050,6 +2040,77 @@
*/
public boolean hasSystemUiListeners;
+
+ /** @hide */
+ @Retention(RetentionPolicy.SOURCE)
+ @IntDef(
+ flag = true,
+ value = {LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT,
+ LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS,
+ LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER})
+ @interface LayoutInDisplayCutoutMode {}
+
+ /**
+ * Controls how the window is laid out if there is a {@link DisplayCutout}.
+ *
+ * <p>
+ * Defaults to {@link #LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT}.
+ *
+ * @see #LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT
+ * @see #LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS
+ * @see #LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER
+ * @see DisplayCutout
+ */
+ @LayoutInDisplayCutoutMode
+ public int layoutInDisplayCutoutMode = LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT;
+
+ /**
+ * The window is allowed to extend into the {@link DisplayCutout} area, only if the
+ * {@link DisplayCutout} is fully contained within the status bar. Otherwise, the window is
+ * laid out such that it does not overlap with the {@link DisplayCutout} area.
+ *
+ * <p>
+ * In practice, this means that if the window did not set FLAG_FULLSCREEN or
+ * SYSTEM_UI_FLAG_FULLSCREEN, it can extend into the cutout area in portrait.
+ * Otherwise (i.e. fullscreen or landscape) it is laid out such that it does overlap the
+ * cutout area.
+ *
+ * <p>
+ * The usual precautions for not overlapping with the status bar are sufficient for ensuring
+ * that no important content overlaps with the DisplayCutout.
+ *
+ * @see DisplayCutout
+ * @see WindowInsets
+ */
+ public static final int LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT = 0;
+
+ /**
+ * The window is always allowed to extend into the {@link DisplayCutout} area,
+ * even if fullscreen or in landscape.
+ *
+ * <p>
+ * The window must make sure that no important content overlaps with the
+ * {@link DisplayCutout}.
+ *
+ * @see DisplayCutout
+ * @see WindowInsets#getDisplayCutout()
+ */
+ public static final int LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS = 1;
+
+ /**
+ * The window is never allowed to overlap with the DisplayCutout area.
+ *
+ * <p>
+ * This should be used with windows that transiently set SYSTEM_UI_FLAG_FULLSCREEN to
+ * avoid a relayout of the window when the flag is set or cleared.
+ *
+ * @see DisplayCutout
+ * @see View#SYSTEM_UI_FLAG_FULLSCREEN SYSTEM_UI_FLAG_FULLSCREEN
+ * @see View#SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN
+ */
+ public static final int LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER = 2;
+
+
/**
* When this window has focus, disable touch pad pointer gesture processing.
* The window will receive raw position updates from the touch pad instead
@@ -2276,6 +2337,7 @@
out.writeLong(flags2);
out.writeInt(privateFlags);
out.writeInt(softInputMode);
+ out.writeInt(layoutInDisplayCutoutMode);
out.writeInt(gravity);
out.writeFloat(horizontalMargin);
out.writeFloat(verticalMargin);
@@ -2332,6 +2394,7 @@
flags2 = in.readLong();
privateFlags = in.readInt();
softInputMode = in.readInt();
+ layoutInDisplayCutoutMode = in.readInt();
gravity = in.readInt();
horizontalMargin = in.readFloat();
verticalMargin = in.readFloat();
@@ -2474,6 +2537,10 @@
softInputMode = o.softInputMode;
changes |= SOFT_INPUT_MODE_CHANGED;
}
+ if (layoutInDisplayCutoutMode != o.layoutInDisplayCutoutMode) {
+ layoutInDisplayCutoutMode = o.layoutInDisplayCutoutMode;
+ changes |= LAYOUT_CHANGED;
+ }
if (gravity != o.gravity) {
gravity = o.gravity;
changes |= LAYOUT_CHANGED;
@@ -2651,6 +2718,10 @@
sb.append(softInputModeToString(softInputMode));
sb.append('}');
}
+ if (layoutInDisplayCutoutMode != 0) {
+ sb.append(" layoutInDisplayCutoutMode=");
+ sb.append(layoutInDisplayCutoutModeToString(layoutInDisplayCutoutMode));
+ }
sb.append(" ty=");
sb.append(ViewDebug.intToString(LayoutParams.class, "type", type));
if (format != PixelFormat.OPAQUE) {
@@ -2849,6 +2920,20 @@
&& height == WindowManager.LayoutParams.MATCH_PARENT;
}
+ private static String layoutInDisplayCutoutModeToString(
+ @LayoutInDisplayCutoutMode int mode) {
+ switch (mode) {
+ case LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT:
+ return "default";
+ case LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS:
+ return "always";
+ case LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER:
+ return "never";
+ default:
+ return "unknown(" + mode + ")";
+ }
+ }
+
private static String softInputModeToString(@SoftInputModeFlags int softInputMode) {
final StringBuilder result = new StringBuilder();
final int state = softInputMode & SOFT_INPUT_MASK_STATE;
diff --git a/core/java/android/view/WindowManagerPolicyConstants.java b/core/java/android/view/WindowManagerPolicyConstants.java
index 9c1c9e3..a6f36bb 100644
--- a/core/java/android/view/WindowManagerPolicyConstants.java
+++ b/core/java/android/view/WindowManagerPolicyConstants.java
@@ -45,6 +45,11 @@
int PRESENCE_INTERNAL = 1 << 0;
int PRESENCE_EXTERNAL = 1 << 1;
+ // Navigation bar position values
+ int NAV_BAR_LEFT = 1 << 0;
+ int NAV_BAR_RIGHT = 1 << 1;
+ int NAV_BAR_BOTTOM = 1 << 2;
+
/**
* Sticky broadcast of the current HDMI plugged state.
*/
diff --git a/core/java/android/view/accessibility/AccessibilityEvent.java b/core/java/android/view/accessibility/AccessibilityEvent.java
index aa61926..e0f74a7 100644
--- a/core/java/android/view/accessibility/AccessibilityEvent.java
+++ b/core/java/android/view/accessibility/AccessibilityEvent.java
@@ -192,9 +192,11 @@
* <b>TRANSITION TYPES</b></br>
* </p>
* <p>
- * <b>Window state changed</b> - represents the event of opening a
- * {@link android.widget.PopupWindow}, {@link android.view.Menu},
- * {@link android.app.Dialog}, etc.</br>
+ * <b>Window state changed</b> - represents the event of a change to a section of
+ * the user interface that is visually distinct. Should be sent from either the
+ * root view of a window or from a view that is marked as a pane
+ * {@link android.view.View#setAccessibilityPaneTitle(CharSequence)}. Not that changes
+ * to true windows are represented by {@link #TYPE_WINDOWS_CHANGED}.</br>
* <em>Type:</em> {@link #TYPE_WINDOW_STATE_CHANGED}</br>
* <em>Properties:</em></br>
* <ul>
@@ -203,7 +205,7 @@
* <li>{@link #getClassName()} - The class name of the source.</li>
* <li>{@link #getPackageName()} - The package name of the source.</li>
* <li>{@link #getEventTime()} - The event time.</li>
- * <li>{@link #getText()} - The text of the source's sub-tree.</li>
+ * <li>{@link #getText()} - The text of the source's sub-tree, including the pane titles.</li>
* </ul>
* </p>
* <p>
@@ -436,8 +438,10 @@
public static final int TYPE_VIEW_TEXT_CHANGED = 0x00000010;
/**
- * Represents the event of opening a {@link android.widget.PopupWindow},
- * {@link android.view.Menu}, {@link android.app.Dialog}, etc.
+ * Represents the event of a change to a visually distinct section of the user interface.
+ * These events should only be dispatched from {@link android.view.View}s that have
+ * accessibility pane titles, and replaces {@link #TYPE_WINDOW_CONTENT_CHANGED} for those
+ * sources. Details about the change are available from {@link #getContentChangeTypes()}.
*/
public static final int TYPE_WINDOW_STATE_CHANGED = 0x00000020;
@@ -565,12 +569,30 @@
public static final int CONTENT_CHANGE_TYPE_CONTENT_DESCRIPTION = 0x00000004;
/**
- * Change type for {@link #TYPE_WINDOW_CONTENT_CHANGED} event:
+ * Change type for {@link #TYPE_WINDOW_STATE_CHANGED} event:
* The node's pane title changed.
*/
public static final int CONTENT_CHANGE_TYPE_PANE_TITLE = 0x00000008;
/**
+ * Change type for {@link #TYPE_WINDOW_STATE_CHANGED} event:
+ * The node has a pane title, and either just appeared or just was assigned a title when it
+ * had none before.
+ */
+ public static final int CONTENT_CHANGE_TYPE_PANE_APPEARED = 0x00000010;
+
+ /**
+ * Change type for {@link #TYPE_WINDOW_STATE_CHANGED} event:
+ * Can mean one of two slightly different things. The primary meaning is that the node has
+ * a pane title, and was removed from the node hierarchy. It will also be sent if the pane
+ * title is set to {@code null} after it contained a title.
+ * No source will be returned if the node is no longer on the screen. To make the change more
+ * clear for the user, the first entry in {@link #getText()} will return the value that would
+ * have been returned by {@code getSource().getPaneTitle()}.
+ */
+ public static final int CONTENT_CHANGE_TYPE_PANE_DISAPPEARED = 0x00000020;
+
+ /**
* Change type for {@link #TYPE_WINDOWS_CHANGED} event:
* The window was added.
*/
diff --git a/core/java/android/view/inputmethod/InputConnection.java b/core/java/android/view/inputmethod/InputConnection.java
index 57f9895..e554540 100644
--- a/core/java/android/view/inputmethod/InputConnection.java
+++ b/core/java/android/view/inputmethod/InputConnection.java
@@ -1,17 +1,17 @@
/*
- * Copyright (C) 2007-2008 The Android Open Source Project
+ * Copyright (C) 2007 The Android Open Source Project
*
- * Licensed under the Apache License, Version 2.0 (the "License"); you may not
- * use this file except in compliance with the License. You may obtain a copy of
- * the License at
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
*
- * http://www.apache.org/licenses/LICENSE-2.0
+ * http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
- * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
- * License for the specific language governing permissions and limitations under
- * the License.
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
*/
package android.view.inputmethod;
@@ -131,13 +131,13 @@
* spans. <strong>Editor authors</strong>: you should strive to
* send text with styles if possible, but it is not required.
*/
- static final int GET_TEXT_WITH_STYLES = 0x0001;
+ int GET_TEXT_WITH_STYLES = 0x0001;
/**
* Flag for use with {@link #getExtractedText} to indicate you
* would like to receive updates when the extracted text changes.
*/
- public static final int GET_EXTRACTED_TEXT_MONITOR = 0x0001;
+ int GET_EXTRACTED_TEXT_MONITOR = 0x0001;
/**
* Get <var>n</var> characters of text before the current cursor
@@ -176,7 +176,7 @@
* @return the text before the cursor position; the length of the
* returned text might be less than <var>n</var>.
*/
- public CharSequence getTextBeforeCursor(int n, int flags);
+ CharSequence getTextBeforeCursor(int n, int flags);
/**
* Get <var>n</var> characters of text after the current cursor
@@ -215,7 +215,7 @@
* @return the text after the cursor position; the length of the
* returned text might be less than <var>n</var>.
*/
- public CharSequence getTextAfterCursor(int n, int flags);
+ CharSequence getTextAfterCursor(int n, int flags);
/**
* Gets the selected text, if any.
@@ -249,7 +249,7 @@
* later, returns false when the target application does not implement
* this method.
*/
- public CharSequence getSelectedText(int flags);
+ CharSequence getSelectedText(int flags);
/**
* Retrieve the current capitalization mode in effect at the
@@ -279,7 +279,7 @@
* @return the caps mode flags that are in effect at the current
* cursor position. See TYPE_TEXT_FLAG_CAPS_* in {@link android.text.InputType}.
*/
- public int getCursorCapsMode(int reqModes);
+ int getCursorCapsMode(int reqModes);
/**
* Retrieve the current text in the input connection's editor, and
@@ -314,8 +314,7 @@
* longer valid of the editor can't comply with the request for
* some reason.
*/
- public ExtractedText getExtractedText(ExtractedTextRequest request,
- int flags);
+ ExtractedText getExtractedText(ExtractedTextRequest request, int flags);
/**
* Delete <var>beforeLength</var> characters of text before the
@@ -342,8 +341,8 @@
* delete more characters than are in the editor, as that may have
* ill effects on the application. Calling this method will cause
* the editor to call
- * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int, int, int)}
- * on your service after the batch input is over.</p>
+ * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int,
+ * int, int)} on your service after the batch input is over.</p>
*
* <p><strong>Editor authors:</strong> please be careful of race
* conditions in implementing this call. An IME can make a change
@@ -369,7 +368,7 @@
* that range.
* @return true on success, false if the input connection is no longer valid.
*/
- public boolean deleteSurroundingText(int beforeLength, int afterLength);
+ boolean deleteSurroundingText(int beforeLength, int afterLength);
/**
* A variant of {@link #deleteSurroundingText(int, int)}. Major differences are:
@@ -397,7 +396,7 @@
* @return true on success, false if the input connection is no longer valid. Returns
* {@code false} when the target application does not implement this method.
*/
- public boolean deleteSurroundingTextInCodePoints(int beforeLength, int afterLength);
+ boolean deleteSurroundingTextInCodePoints(int beforeLength, int afterLength);
/**
* Replace the currently composing text with the given text, and
@@ -416,8 +415,8 @@
* <p>This is usually called by IMEs to add or remove or change
* characters in the composing span. Calling this method will
* cause the editor to call
- * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int, int, int)}
- * on the current IME after the batch input is over.</p>
+ * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int,
+ * int, int)} on the current IME after the batch input is over.</p>
*
* <p><strong>Editor authors:</strong> please keep in mind the
* text may be very similar or completely different than what was
@@ -455,7 +454,7 @@
* @return true on success, false if the input connection is no longer
* valid.
*/
- public boolean setComposingText(CharSequence text, int newCursorPosition);
+ boolean setComposingText(CharSequence text, int newCursorPosition);
/**
* Mark a certain region of text as composing text. If there was a
@@ -474,8 +473,8 @@
* <p>Since this does not change the contents of the text, editors should not call
* {@link InputMethodManager#updateSelection(View, int, int, int, int)} and
* IMEs should not receive
- * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int, int, int)}.
- * </p>
+ * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int,
+ * int, int)}.</p>
*
* <p>This has no impact on the cursor/selection position. It may
* result in the cursor being anywhere inside or outside the
@@ -488,7 +487,7 @@
* valid. In {@link android.os.Build.VERSION_CODES#N} and later, false is returned when the
* target application does not implement this method.
*/
- public boolean setComposingRegion(int start, int end);
+ boolean setComposingRegion(int start, int end);
/**
* Have the text editor finish whatever composing text is
@@ -507,7 +506,7 @@
* @return true on success, false if the input connection
* is no longer valid.
*/
- public boolean finishComposingText();
+ boolean finishComposingText();
/**
* Commit text to the text box and set the new cursor position.
@@ -522,8 +521,8 @@
* then {@link #finishComposingText()}.</p>
*
* <p>Calling this method will cause the editor to call
- * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int, int, int)}
- * on the current IME after the batch input is over.
+ * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int,
+ * int, int)} on the current IME after the batch input is over.
* <strong>Editor authors</strong>, for this to happen you need to
* make the changes known to the input method by calling
* {@link InputMethodManager#updateSelection(View, int, int, int, int)},
@@ -543,7 +542,7 @@
* @return true on success, false if the input connection is no longer
* valid.
*/
- public boolean commitText(CharSequence text, int newCursorPosition);
+ boolean commitText(CharSequence text, int newCursorPosition);
/**
* Commit a completion the user has selected from the possible ones
@@ -569,8 +568,8 @@
*
* <p>Calling this method (with a valid {@link CompletionInfo} object)
* will cause the editor to call
- * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int, int, int)}
- * on the current IME after the batch input is over.
+ * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int,
+ * int, int)} on the current IME after the batch input is over.
* <strong>Editor authors</strong>, for this to happen you need to
* make the changes known to the input method by calling
* {@link InputMethodManager#updateSelection(View, int, int, int, int)},
@@ -581,15 +580,15 @@
* @return true on success, false if the input connection is no longer
* valid.
*/
- public boolean commitCompletion(CompletionInfo text);
+ boolean commitCompletion(CompletionInfo text);
/**
* Commit a correction automatically performed on the raw user's input. A
* typical example would be to correct typos using a dictionary.
*
* <p>Calling this method will cause the editor to call
- * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int, int, int)}
- * on the current IME after the batch input is over.
+ * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int,
+ * int, int)} on the current IME after the batch input is over.
* <strong>Editor authors</strong>, for this to happen you need to
* make the changes known to the input method by calling
* {@link InputMethodManager#updateSelection(View, int, int, int, int)},
@@ -601,7 +600,7 @@
* In {@link android.os.Build.VERSION_CODES#N} and later, returns false
* when the target application does not implement this method.
*/
- public boolean commitCorrection(CorrectionInfo correctionInfo);
+ boolean commitCorrection(CorrectionInfo correctionInfo);
/**
* Set the selection of the text editor. To set the cursor
@@ -609,8 +608,8 @@
*
* <p>Since this moves the cursor, calling this method will cause
* the editor to call
- * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int, int, int)}
- * on the current IME after the batch input is over.
+ * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int,
+ * int, int)} on the current IME after the batch input is over.
* <strong>Editor authors</strong>, for this to happen you need to
* make the changes known to the input method by calling
* {@link InputMethodManager#updateSelection(View, int, int, int, int)},
@@ -628,7 +627,7 @@
* @return true on success, false if the input connection is no longer
* valid.
*/
- public boolean setSelection(int start, int end);
+ boolean setSelection(int start, int end);
/**
* Have the editor perform an action it has said it can do.
@@ -642,7 +641,7 @@
* @return true on success, false if the input connection is no longer
* valid.
*/
- public boolean performEditorAction(int editorAction);
+ boolean performEditorAction(int editorAction);
/**
* Perform a context menu action on the field. The given id may be one of:
@@ -652,7 +651,7 @@
* {@link android.R.id#paste}, {@link android.R.id#copyUrl},
* or {@link android.R.id#switchInputMethod}
*/
- public boolean performContextMenuAction(int id);
+ boolean performContextMenuAction(int id);
/**
* Tell the editor that you are starting a batch of editor
@@ -662,8 +661,8 @@
*
* <p><strong>IME authors:</strong> use this to avoid getting
* calls to
- * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int, int, int)}
- * corresponding to intermediate state. Also, use this to avoid
+ * {@link android.inputmethodservice.InputMethodService#onUpdateSelection(int, int, int, int,
+ * int, int)} corresponding to intermediate state. Also, use this to avoid
* flickers that may arise from displaying intermediate state. Be
* sure to call {@link #endBatchEdit} for each call to this, or
* you may block updates in the editor.</p>
@@ -678,7 +677,7 @@
* this method starts a batch edit, that means it will always return true
* unless the input connection is no longer valid.
*/
- public boolean beginBatchEdit();
+ boolean beginBatchEdit();
/**
* Tell the editor that you are done with a batch edit previously
@@ -696,7 +695,7 @@
* the latest one (in other words, if the nesting count is > 0), false
* otherwise or if the input connection is no longer valid.
*/
- public boolean endBatchEdit();
+ boolean endBatchEdit();
/**
* Send a key event to the process that is currently attached
@@ -734,7 +733,7 @@
* @see KeyCharacterMap#PREDICTIVE
* @see KeyCharacterMap#ALPHA
*/
- public boolean sendKeyEvent(KeyEvent event);
+ boolean sendKeyEvent(KeyEvent event);
/**
* Clear the given meta key pressed states in the given input
@@ -749,7 +748,7 @@
* @return true on success, false if the input connection is no longer
* valid.
*/
- public boolean clearMetaKeyStates(int states);
+ boolean clearMetaKeyStates(int states);
/**
* Called back when the connected IME switches between fullscreen and normal modes.
@@ -766,7 +765,7 @@
* devices.
* @see InputMethodManager#isFullscreenMode()
*/
- public boolean reportFullscreenMode(boolean enabled);
+ boolean reportFullscreenMode(boolean enabled);
/**
* API to send private commands from an input method to its
@@ -786,7 +785,7 @@
* associated editor understood it), false if the input connection is no longer
* valid.
*/
- public boolean performPrivateCommand(String action, Bundle data);
+ boolean performPrivateCommand(String action, Bundle data);
/**
* The editor is requested to call
@@ -794,7 +793,7 @@
* once, as soon as possible, regardless of cursor/anchor position changes. This flag can be
* used together with {@link #CURSOR_UPDATE_MONITOR}.
*/
- public static final int CURSOR_UPDATE_IMMEDIATE = 1 << 0;
+ int CURSOR_UPDATE_IMMEDIATE = 1 << 0;
/**
* The editor is requested to call
@@ -805,7 +804,7 @@
* This flag can be used together with {@link #CURSOR_UPDATE_IMMEDIATE}.
* </p>
*/
- public static final int CURSOR_UPDATE_MONITOR = 1 << 1;
+ int CURSOR_UPDATE_MONITOR = 1 << 1;
/**
* Called by the input method to ask the editor for calling back
@@ -821,7 +820,7 @@
* In {@link android.os.Build.VERSION_CODES#N} and later, returns {@code false} also when the
* target application does not implement this method.
*/
- public boolean requestCursorUpdates(int cursorUpdateMode);
+ boolean requestCursorUpdates(int cursorUpdateMode);
/**
* Called by the {@link InputMethodManager} to enable application developers to specify a
@@ -832,7 +831,7 @@
*
* @return {@code null} to use the default {@link Handler}.
*/
- public Handler getHandler();
+ Handler getHandler();
/**
* Called by the system up to only once to notify that the system is about to invalidate
@@ -846,7 +845,7 @@
*
* <p>Note: This does nothing when called from input methods.</p>
*/
- public void closeConnection();
+ void closeConnection();
/**
* When this flag is used, the editor will be able to request read access to the content URI
@@ -863,7 +862,7 @@
* client is able to request a temporary read-only access even after the current IME is switched
* to any other IME as long as the client keeps {@link InputContentInfo} object.</p>
**/
- public static int INPUT_CONTENT_GRANT_READ_URI_PERMISSION =
+ int INPUT_CONTENT_GRANT_READ_URI_PERMISSION =
android.content.Intent.FLAG_GRANT_READ_URI_PERMISSION; // 0x00000001
/**
@@ -897,6 +896,6 @@
* @return {@code true} if this request is accepted by the application, whether the request
* is already handled or still being handled in background, {@code false} otherwise.
*/
- public boolean commitContent(@NonNull InputContentInfo inputContentInfo, int flags,
+ boolean commitContent(@NonNull InputContentInfo inputContentInfo, int flags,
@Nullable Bundle opts);
}
diff --git a/core/java/android/view/inputmethod/InputConnectionWrapper.java b/core/java/android/view/inputmethod/InputConnectionWrapper.java
index 317730c..f671e22 100644
--- a/core/java/android/view/inputmethod/InputConnectionWrapper.java
+++ b/core/java/android/view/inputmethod/InputConnectionWrapper.java
@@ -1,17 +1,17 @@
/*
- * Copyright (C) 2007-2008 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License"); you may not
- * use this file except in compliance with the License. You may obtain a copy of
- * the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
+ * Copyright (C) 2007 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
* Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
- * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
- * License for the specific language governing permissions and limitations under
- * the License.
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
*/
package android.view.inputmethod;
@@ -74,6 +74,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public CharSequence getTextBeforeCursor(int n, int flags) {
return mTarget.getTextBeforeCursor(n, flags);
}
@@ -82,6 +83,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public CharSequence getTextAfterCursor(int n, int flags) {
return mTarget.getTextAfterCursor(n, flags);
}
@@ -90,6 +92,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public CharSequence getSelectedText(int flags) {
return mTarget.getSelectedText(flags);
}
@@ -98,6 +101,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public int getCursorCapsMode(int reqModes) {
return mTarget.getCursorCapsMode(reqModes);
}
@@ -106,6 +110,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public ExtractedText getExtractedText(ExtractedTextRequest request, int flags) {
return mTarget.getExtractedText(request, flags);
}
@@ -114,6 +119,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean deleteSurroundingTextInCodePoints(int beforeLength, int afterLength) {
return mTarget.deleteSurroundingTextInCodePoints(beforeLength, afterLength);
}
@@ -122,6 +128,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean deleteSurroundingText(int beforeLength, int afterLength) {
return mTarget.deleteSurroundingText(beforeLength, afterLength);
}
@@ -130,6 +137,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean setComposingText(CharSequence text, int newCursorPosition) {
return mTarget.setComposingText(text, newCursorPosition);
}
@@ -138,6 +146,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean setComposingRegion(int start, int end) {
return mTarget.setComposingRegion(start, end);
}
@@ -146,6 +155,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean finishComposingText() {
return mTarget.finishComposingText();
}
@@ -154,6 +164,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean commitText(CharSequence text, int newCursorPosition) {
return mTarget.commitText(text, newCursorPosition);
}
@@ -162,6 +173,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean commitCompletion(CompletionInfo text) {
return mTarget.commitCompletion(text);
}
@@ -170,6 +182,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean commitCorrection(CorrectionInfo correctionInfo) {
return mTarget.commitCorrection(correctionInfo);
}
@@ -178,6 +191,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean setSelection(int start, int end) {
return mTarget.setSelection(start, end);
}
@@ -186,6 +200,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean performEditorAction(int editorAction) {
return mTarget.performEditorAction(editorAction);
}
@@ -194,6 +209,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean performContextMenuAction(int id) {
return mTarget.performContextMenuAction(id);
}
@@ -202,6 +218,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean beginBatchEdit() {
return mTarget.beginBatchEdit();
}
@@ -210,6 +227,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean endBatchEdit() {
return mTarget.endBatchEdit();
}
@@ -218,6 +236,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean sendKeyEvent(KeyEvent event) {
return mTarget.sendKeyEvent(event);
}
@@ -226,6 +245,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean clearMetaKeyStates(int states) {
return mTarget.clearMetaKeyStates(states);
}
@@ -234,6 +254,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean reportFullscreenMode(boolean enabled) {
return mTarget.reportFullscreenMode(enabled);
}
@@ -242,6 +263,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean performPrivateCommand(String action, Bundle data) {
return mTarget.performPrivateCommand(action, data);
}
@@ -250,6 +272,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean requestCursorUpdates(int cursorUpdateMode) {
return mTarget.requestCursorUpdates(cursorUpdateMode);
}
@@ -258,6 +281,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public Handler getHandler() {
return mTarget.getHandler();
}
@@ -266,6 +290,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public void closeConnection() {
mTarget.closeConnection();
}
@@ -274,6 +299,7 @@
* {@inheritDoc}
* @throws NullPointerException if the target is {@code null}.
*/
+ @Override
public boolean commitContent(InputContentInfo inputContentInfo, int flags, Bundle opts) {
return mTarget.commitContent(inputContentInfo, flags, opts);
}
diff --git a/core/java/android/view/inputmethod/InputMethodManager.java b/core/java/android/view/inputmethod/InputMethodManager.java
index 1e29120..7db5c32 100644
--- a/core/java/android/view/inputmethod/InputMethodManager.java
+++ b/core/java/android/view/inputmethod/InputMethodManager.java
@@ -1082,15 +1082,15 @@
}
/**
- * Flag for {@link #hideSoftInputFromWindow} to indicate that the soft
- * input window should only be hidden if it was not explicitly shown
+ * Flag for {@link #hideSoftInputFromWindow} and {@link InputMethodService#requestHideSelf(int)}
+ * to indicate that the soft input window should only be hidden if it was not explicitly shown
* by the user.
*/
public static final int HIDE_IMPLICIT_ONLY = 0x0001;
/**
- * Flag for {@link #hideSoftInputFromWindow} to indicate that the soft
- * input window should normally be hidden, unless it was originally
+ * Flag for {@link #hideSoftInputFromWindow} and {@link InputMethodService#requestShowSelf(int)}
+ * to indicate that the soft input window should normally be hidden, unless it was originally
* shown with {@link #SHOW_FORCED}.
*/
public static final int HIDE_NOT_ALWAYS = 0x0002;
@@ -1869,9 +1869,9 @@
* @param flags Provides additional operating flags. Currently may be
* 0 or have the {@link #HIDE_IMPLICIT_ONLY},
* {@link #HIDE_NOT_ALWAYS} bit set.
- * @deprecated Use {@link InputMethodService#hideSoftInputFromInputMethod(int)}
- * instead. This method was intended for IME developers who should be accessing APIs through
- * the service. APIs in this class are intended for app developers interacting with the IME.
+ * @deprecated Use {@link InputMethodService#requestHideSelf(int)} instead. This method was
+ * intended for IME developers who should be accessing APIs through the service. APIs in this
+ * class are intended for app developers interacting with the IME.
*/
@Deprecated
public void hideSoftInputFromInputMethod(IBinder token, int flags) {
@@ -1901,9 +1901,9 @@
* @param flags Provides additional operating flags. Currently may be
* 0 or have the {@link #SHOW_IMPLICIT} or
* {@link #SHOW_FORCED} bit set.
- * @deprecated Use {@link InputMethodService#showSoftInputFromInputMethod(int)}
- * instead. This method was intended for IME developers who should be accessing APIs through
- * the service. APIs in this class are intended for app developers interacting with the IME.
+ * @deprecated Use {@link InputMethodService#requestShowSelf(int)} instead. This method was
+ * intended for IME developers who should be accessing APIs through the service. APIs in this
+ * class are intended for app developers interacting with the IME.
*/
@Deprecated
public void showSoftInputFromInputMethod(IBinder token, int flags) {
diff --git a/core/java/android/view/textclassifier/TextClassifierConstants.java b/core/java/android/view/textclassifier/TextClassifierConstants.java
index 51e6168..00695b7 100644
--- a/core/java/android/view/textclassifier/TextClassifierConstants.java
+++ b/core/java/android/view/textclassifier/TextClassifierConstants.java
@@ -45,19 +45,24 @@
"smart_selection_dark_launch";
private static final String SMART_SELECTION_ENABLED_FOR_EDIT_TEXT =
"smart_selection_enabled_for_edit_text";
+ private static final String SMART_LINKIFY_ENABLED =
+ "smart_linkify_enabled";
private static final boolean SMART_SELECTION_DARK_LAUNCH_DEFAULT = false;
private static final boolean SMART_SELECTION_ENABLED_FOR_EDIT_TEXT_DEFAULT = true;
+ private static final boolean SMART_LINKIFY_ENABLED_DEFAULT = true;
/** Default settings. */
static final TextClassifierConstants DEFAULT = new TextClassifierConstants();
private final boolean mDarkLaunch;
private final boolean mSuggestSelectionEnabledForEditableText;
+ private final boolean mSmartLinkifyEnabled;
private TextClassifierConstants() {
mDarkLaunch = SMART_SELECTION_DARK_LAUNCH_DEFAULT;
mSuggestSelectionEnabledForEditableText = SMART_SELECTION_ENABLED_FOR_EDIT_TEXT_DEFAULT;
+ mSmartLinkifyEnabled = SMART_LINKIFY_ENABLED_DEFAULT;
}
private TextClassifierConstants(@Nullable String settings) {
@@ -74,6 +79,9 @@
mSuggestSelectionEnabledForEditableText = parser.getBoolean(
SMART_SELECTION_ENABLED_FOR_EDIT_TEXT,
SMART_SELECTION_ENABLED_FOR_EDIT_TEXT_DEFAULT);
+ mSmartLinkifyEnabled = parser.getBoolean(
+ SMART_LINKIFY_ENABLED,
+ SMART_LINKIFY_ENABLED_DEFAULT);
}
static TextClassifierConstants loadFromString(String settings) {
@@ -87,4 +95,8 @@
public boolean isSuggestSelectionEnabledForEditableText() {
return mSuggestSelectionEnabledForEditableText;
}
+
+ public boolean isSmartLinkifyEnabled() {
+ return mSmartLinkifyEnabled;
+ }
}
diff --git a/core/java/android/view/textclassifier/TextClassifierImpl.java b/core/java/android/view/textclassifier/TextClassifierImpl.java
index 9c7be1e..7db0e76 100644
--- a/core/java/android/view/textclassifier/TextClassifierImpl.java
+++ b/core/java/android/view/textclassifier/TextClassifierImpl.java
@@ -186,6 +186,11 @@
Utils.validateInput(text);
final String textString = text.toString();
final TextLinks.Builder builder = new TextLinks.Builder(textString);
+
+ if (!getSettings().isSmartLinkifyEnabled()) {
+ return builder.build();
+ }
+
try {
final LocaleList defaultLocales = options != null ? options.getDefaultLocales() : null;
final Collection<String> entitiesToIdentify =
diff --git a/core/java/android/webkit/WebViewFactory.java b/core/java/android/webkit/WebViewFactory.java
index b3522ec..e9fe481 100644
--- a/core/java/android/webkit/WebViewFactory.java
+++ b/core/java/android/webkit/WebViewFactory.java
@@ -27,7 +27,6 @@
import android.content.pm.Signature;
import android.os.RemoteException;
import android.os.ServiceManager;
-import android.os.StrictMode;
import android.os.Trace;
import android.util.AndroidRuntimeException;
import android.util.ArraySet;
@@ -251,7 +250,6 @@
"WebView.disableWebView() was called: WebView is disabled");
}
- StrictMode.ThreadPolicy oldPolicy = StrictMode.allowThreadDiskReads();
Trace.traceBegin(Trace.TRACE_TAG_WEBVIEW, "WebViewFactory.getProvider()");
try {
Class<WebViewFactoryProvider> providerClass = getProviderClass();
@@ -279,7 +277,6 @@
}
} finally {
Trace.traceEnd(Trace.TRACE_TAG_WEBVIEW);
- StrictMode.setThreadPolicy(oldPolicy);
}
}
}
diff --git a/core/java/android/widget/Editor.java b/core/java/android/widget/Editor.java
index b5ac330..247c806 100644
--- a/core/java/android/widget/Editor.java
+++ b/core/java/android/widget/Editor.java
@@ -4627,7 +4627,7 @@
return 0;
}
- protected final void showMagnifier() {
+ protected final void showMagnifier(@NonNull final MotionEvent event) {
if (mMagnifier == null) {
return;
}
@@ -4653,9 +4653,10 @@
final Layout layout = mTextView.getLayout();
final int lineNumber = layout.getLineForOffset(offset);
- // Horizontally snap to character offset.
- final float xPosInView = getHorizontal(mTextView.getLayout(), offset)
- + mTextView.getTotalPaddingLeft() - mTextView.getScrollX();
+ // Horizontally move the magnifier smoothly.
+ final int[] textViewLocationOnScreen = new int[2];
+ mTextView.getLocationOnScreen(textViewLocationOnScreen);
+ final float xPosInView = event.getRawX() - textViewLocationOnScreen[0];
// Vertically snap to middle of current line.
final float yPosInView = (mTextView.getLayout().getLineTop(lineNumber)
+ mTextView.getLayout().getLineBottom(lineNumber)) / 2.0f
@@ -4850,11 +4851,11 @@
case MotionEvent.ACTION_DOWN:
mDownPositionX = ev.getRawX();
mDownPositionY = ev.getRawY();
- showMagnifier();
+ showMagnifier(ev);
break;
case MotionEvent.ACTION_MOVE:
- showMagnifier();
+ showMagnifier(ev);
break;
case MotionEvent.ACTION_UP:
@@ -5208,11 +5209,11 @@
// re-engages the handle.
mTouchWordDelta = 0.0f;
mPrevX = UNSET_X_VALUE;
- showMagnifier();
+ showMagnifier(event);
break;
case MotionEvent.ACTION_MOVE:
- showMagnifier();
+ showMagnifier(event);
break;
case MotionEvent.ACTION_UP:
diff --git a/core/java/android/widget/Magnifier.java b/core/java/android/widget/Magnifier.java
index 26dfcc2..310b170 100644
--- a/core/java/android/widget/Magnifier.java
+++ b/core/java/android/widget/Magnifier.java
@@ -32,6 +32,7 @@
import android.view.Surface;
import android.view.SurfaceView;
import android.view.View;
+import android.view.ViewParent;
import com.android.internal.util.Preconditions;
@@ -44,6 +45,8 @@
private static final int NONEXISTENT_PREVIOUS_CONFIG_VALUE = -1;
// The view to which this magnifier is attached.
private final View mView;
+ // The coordinates of the view in the surface.
+ private final int[] mViewCoordinatesInSurface;
// The window containing the magnifier.
private final PopupWindow mWindow;
// The center coordinates of the window containing the magnifier.
@@ -87,6 +90,8 @@
com.android.internal.R.dimen.magnifier_height);
mZoomScale = context.getResources().getFloat(
com.android.internal.R.dimen.magnifier_zoom_scale);
+ // The view's surface coordinates will not be updated until the magnifier is first shown.
+ mViewCoordinatesInSurface = new int[2];
mWindow = new PopupWindow(context);
mWindow.setContentView(content);
@@ -120,9 +125,34 @@
configureCoordinates(xPosInView, yPosInView);
// Clamp startX value to avoid distorting the rendering of the magnifier content.
- final int startX = Math.max(0, Math.min(
+ // For this, we compute:
+ // - zeroScrollXInSurface: this is the start x of mView, where this is not masked by a
+ // potential scrolling container. For example, if mView is a
+ // TextView contained in a HorizontalScrollView,
+ // mViewCoordinatesInSurface will reflect the surface position of
+ // the first text character, rather than the position of the first
+ // visible one. Therefore, we need to add back the amount of
+ // scrolling from the parent containers.
+ // - actualWidth: similarly, the width of a View will be larger than its actually visible
+ // width when it is contained in a scrolling container. We need to use
+ // the minimum width of a scrolling container which contains this view.
+ int zeroScrollXInSurface = mViewCoordinatesInSurface[0];
+ int actualWidth = mView.getWidth();
+ ViewParent viewParent = mView.getParent();
+ while (viewParent instanceof View) {
+ final View container = (View) viewParent;
+ if (container.canScrollHorizontally(-1 /* left scroll */)
+ || container.canScrollHorizontally(1 /* right scroll */)) {
+ zeroScrollXInSurface += container.getScrollX();
+ actualWidth = Math.min(actualWidth, container.getWidth()
+ - container.getPaddingLeft() - container.getPaddingRight());
+ }
+ viewParent = viewParent.getParent();
+ }
+
+ final int startX = Math.max(zeroScrollXInSurface, Math.min(
mCenterZoomCoords.x - mBitmap.getWidth() / 2,
- mView.getWidth() - mBitmap.getWidth()));
+ zeroScrollXInSurface + actualWidth - mBitmap.getWidth()));
final int startY = mCenterZoomCoords.y - mBitmap.getHeight() / 2;
if (xPosInView != mPrevPosInView.x || yPosInView != mPrevPosInView.y) {
@@ -169,10 +199,9 @@
posX = xPosInView;
posY = yPosInView;
} else {
- final int[] coordinatesInSurface = new int[2];
- mView.getLocationInSurface(coordinatesInSurface);
- posX = xPosInView + coordinatesInSurface[0];
- posY = yPosInView + coordinatesInSurface[1];
+ mView.getLocationInSurface(mViewCoordinatesInSurface);
+ posX = xPosInView + mViewCoordinatesInSurface[0];
+ posY = yPosInView + mViewCoordinatesInSurface[1];
}
mCenterZoomCoords.x = Math.round(posX);
diff --git a/core/java/android/widget/TextView.java b/core/java/android/widget/TextView.java
index 716b205..8c4e422 100644
--- a/core/java/android/widget/TextView.java
+++ b/core/java/android/widget/TextView.java
@@ -77,8 +77,8 @@
import android.text.InputFilter;
import android.text.InputType;
import android.text.Layout;
+import android.text.MeasuredText;
import android.text.ParcelableSpan;
-import android.text.PremeasuredText;
import android.text.Selection;
import android.text.SpanWatcher;
import android.text.Spannable;
@@ -5393,7 +5393,7 @@
if (imm != null) imm.restartInput(this);
} else if (type == BufferType.SPANNABLE || mMovement != null) {
text = mSpannableFactory.newSpannable(text);
- } else if (!(text instanceof PremeasuredText || text instanceof CharWrapper)) {
+ } else if (!(text instanceof MeasuredText || text instanceof CharWrapper)) {
text = TextUtils.stringOrSpannedString(text);
}
diff --git a/core/java/android/widget/VideoView2.java b/core/java/android/widget/VideoView2.java
new file mode 100644
index 0000000..310a7bb
--- /dev/null
+++ b/core/java/android/widget/VideoView2.java
@@ -0,0 +1,363 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.widget;
+
+import android.annotation.IntDef;
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.content.Context;
+import android.graphics.Canvas;
+import android.media.AudioAttributes;
+import android.media.MediaPlayer;
+import android.media.update.ApiLoader;
+import android.media.update.VideoView2Provider;
+import android.media.update.ViewProvider;
+import android.net.Uri;
+import android.util.AttributeSet;
+import android.view.KeyEvent;
+import android.view.MotionEvent;
+
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
+import java.util.Map;
+
+/**
+ * TODO PUBLIC API
+ * @hide
+ */
+public class VideoView2 extends FrameLayout {
+ @IntDef({
+ VIEW_TYPE_TEXTUREVIEW,
+ VIEW_TYPE_SURFACEVIEW
+ })
+ @Retention(RetentionPolicy.SOURCE)
+ public @interface ViewType {}
+ public static final int VIEW_TYPE_SURFACEVIEW = 1;
+ public static final int VIEW_TYPE_TEXTUREVIEW = 2;
+
+ private final VideoView2Provider mProvider;
+
+ /**
+ * @hide
+ */
+ public VideoView2(@NonNull Context context) {
+ this(context, null);
+ }
+
+ /**
+ * @hide
+ */
+ public VideoView2(@NonNull Context context, @Nullable AttributeSet attrs) {
+ this(context, attrs, 0);
+ }
+
+ /**
+ * @hide
+ */
+ public VideoView2(@NonNull Context context, @Nullable AttributeSet attrs, int defStyleAttr) {
+ this(context, attrs, defStyleAttr, 0);
+ }
+
+ /**
+ * @hide
+ */
+ public VideoView2(
+ @NonNull Context context, @Nullable AttributeSet attrs,
+ int defStyleAttr, int defStyleRes) {
+ super(context, attrs, defStyleAttr, defStyleRes);
+
+ mProvider = ApiLoader.getProvider(context).createVideoView2(this, new SuperProvider());
+ }
+
+ /**
+ * @hide
+ */
+ public VideoView2Provider getProvider() {
+ return mProvider;
+ }
+
+ /**
+ * @hide
+ */
+ public void start() {
+ mProvider.start_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public void pause() {
+ mProvider.pause_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public int getDuration() {
+ return mProvider.getDuration_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public int getCurrentPosition() {
+ return mProvider.getCurrentPosition_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public void seekTo(int msec) {
+ mProvider.seekTo_impl(msec);
+ }
+
+ /**
+ * @hide
+ */
+ public boolean isPlaying() {
+ return mProvider.isPlaying_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public int getBufferPercentage() {
+ return mProvider.getBufferPercentage_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public int getAudioSessionId() {
+ return mProvider.getAudioSessionId_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public void showSubtitle() {
+ mProvider.showSubtitle_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public void hideSubtitle() {
+ mProvider.hideSubtitle_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public void setAudioFocusRequest(int focusGain) {
+ mProvider.setAudioFocusRequest_impl(focusGain);
+ }
+
+ /**
+ * @hide
+ */
+ public void setAudioAttributes(@NonNull AudioAttributes attributes) {
+ mProvider.setAudioAttributes_impl(attributes);
+ }
+
+ /**
+ * @hide
+ */
+ public void setVideoPath(String path) {
+ mProvider.setVideoPath_impl(path);
+ }
+
+ /**
+ * @hide
+ */
+ public void setVideoURI(Uri uri) {
+ mProvider.setVideoURI_impl(uri);
+ }
+
+ /**
+ * @hide
+ */
+ public void setVideoURI(Uri uri, Map<String, String> headers) {
+ mProvider.setVideoURI_impl(uri, headers);
+ }
+
+ /**
+ * @hide
+ */
+ public void setMediaController2(MediaController2 controllerView) {
+ mProvider.setMediaController2_impl(controllerView);
+ }
+
+ /**
+ * @hide
+ */
+ public void setViewType(@ViewType int viewType) {
+ mProvider.setViewType_impl(viewType);
+ }
+
+ /**
+ * @hide
+ */
+ @ViewType
+ public int getViewType() {
+ return mProvider.getViewType_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public void stopPlayback() {
+ mProvider.stopPlayback_impl();
+ }
+
+ /**
+ * @hide
+ */
+ public void setOnPreparedListener(MediaPlayer.OnPreparedListener l) {
+ mProvider.setOnPreparedListener_impl(l);
+ }
+
+ /**
+ * @hide
+ */
+ public void setOnCompletionListener(MediaPlayer.OnCompletionListener l) {
+ mProvider.setOnCompletionListener_impl(l);
+ }
+
+ /**
+ * @hide
+ */
+ public void setOnErrorListener(MediaPlayer.OnErrorListener l) {
+ mProvider.setOnErrorListener_impl(l);
+ }
+
+ /**
+ * @hide
+ */
+ public void setOnInfoListener(MediaPlayer.OnInfoListener l) {
+ mProvider.setOnInfoListener_impl(l);
+ }
+
+ /**
+ * @hide
+ */
+ public void setOnViewTypeChangedListener(OnViewTypeChangedListener l) {
+ mProvider.setOnViewTypeChangedListener_impl(l);
+ }
+
+ /**
+ * @hide
+ */
+ public interface OnViewTypeChangedListener {
+ /**
+ * @hide
+ */
+ void onViewTypeChanged(@ViewType int viewType);
+ }
+
+ @Override
+ public CharSequence getAccessibilityClassName() {
+ return mProvider.getAccessibilityClassName_impl();
+ }
+
+ @Override
+ public boolean onTouchEvent(MotionEvent ev) {
+ return mProvider.onTouchEvent_impl(ev);
+ }
+
+ @Override
+ public boolean onTrackballEvent(MotionEvent ev) {
+ return mProvider.onTrackballEvent_impl(ev);
+ }
+
+ @Override
+ public boolean onKeyDown(int keyCode, KeyEvent event) {
+ return mProvider.onKeyDown_impl(keyCode, event);
+ }
+
+ @Override
+ public void onFinishInflate() {
+ mProvider.onFinishInflate_impl();
+ }
+
+ @Override
+ public boolean dispatchKeyEvent(KeyEvent event) {
+ return mProvider.dispatchKeyEvent_impl(event);
+ }
+
+ @Override
+ public void setEnabled(boolean enabled) {
+ mProvider.setEnabled_impl(enabled);
+ }
+
+ private class SuperProvider implements ViewProvider {
+ @Override
+ public void onAttachedToWindow_impl() {
+ VideoView2.super.onAttachedToWindow();
+ }
+
+ @Override
+ public void onDetachedFromWindow_impl() {
+ VideoView2.super.onDetachedFromWindow();
+ }
+
+ @Override
+ public void onLayout_impl(boolean changed, int left, int top, int right, int bottom) {
+ VideoView2.super.onLayout(changed, left, top, right, bottom);
+ }
+
+ @Override
+ public void draw_impl(Canvas canvas) {
+ VideoView2.super.draw(canvas);
+ }
+
+ @Override
+ public CharSequence getAccessibilityClassName_impl() {
+ return VideoView2.super.getAccessibilityClassName();
+ }
+
+ @Override
+ public boolean onTouchEvent_impl(MotionEvent ev) {
+ return VideoView2.super.onTouchEvent(ev);
+ }
+
+ @Override
+ public boolean onTrackballEvent_impl(MotionEvent ev) {
+ return VideoView2.super.onTrackballEvent(ev);
+ }
+
+ @Override
+ public boolean onKeyDown_impl(int keyCode, KeyEvent event) {
+ return VideoView2.super.onKeyDown(keyCode, event);
+ }
+
+ @Override
+ public void onFinishInflate_impl() {
+ VideoView2.super.onFinishInflate();
+ }
+
+ @Override
+ public boolean dispatchKeyEvent_impl(KeyEvent event) {
+ return VideoView2.super.dispatchKeyEvent(event);
+ }
+
+ @Override
+ public void setEnabled_impl(boolean enabled) {
+ VideoView2.super.setEnabled(enabled);
+ }
+ }
+}
diff --git a/core/java/com/android/internal/policy/KeyguardDismissCallback.java b/core/java/com/android/internal/policy/KeyguardDismissCallback.java
new file mode 100644
index 0000000..38337ec
--- /dev/null
+++ b/core/java/com/android/internal/policy/KeyguardDismissCallback.java
@@ -0,0 +1,41 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.internal.policy;
+
+import android.os.RemoteException;
+import com.android.internal.policy.IKeyguardDismissCallback;
+
+/**
+ * @hide
+ */
+public class KeyguardDismissCallback extends IKeyguardDismissCallback.Stub {
+
+ @Override
+ public void onDismissError() throws RemoteException {
+ // To be overidden
+ }
+
+ @Override
+ public void onDismissSucceeded() throws RemoteException {
+ // To be overidden
+ }
+
+ @Override
+ public void onDismissCancelled() throws RemoteException {
+ // To be overidden
+ }
+}
diff --git a/core/jni/Android.bp b/core/jni/Android.bp
index b3f66e9..96f3308 100644
--- a/core/jni/Android.bp
+++ b/core/jni/Android.bp
@@ -84,7 +84,7 @@
"android_view_VelocityTracker.cpp",
"android_text_AndroidCharacter.cpp",
"android_text_Hyphenator.cpp",
- "android_text_MeasuredText.cpp",
+ "android_text_MeasuredParagraph.cpp",
"android_text_StaticLayout.cpp",
"android_os_Debug.cpp",
"android_os_GraphicsEnvironment.cpp",
diff --git a/core/jni/AndroidRuntime.cpp b/core/jni/AndroidRuntime.cpp
index 6d7fe05..6569b47 100644
--- a/core/jni/AndroidRuntime.cpp
+++ b/core/jni/AndroidRuntime.cpp
@@ -178,7 +178,7 @@
extern int register_android_net_NetworkUtils(JNIEnv* env);
extern int register_android_text_AndroidCharacter(JNIEnv *env);
extern int register_android_text_Hyphenator(JNIEnv *env);
-extern int register_android_text_MeasuredText(JNIEnv* env);
+extern int register_android_text_MeasuredParagraph(JNIEnv* env);
extern int register_android_text_StaticLayout(JNIEnv *env);
extern int register_android_opengl_classes(JNIEnv *env);
extern int register_android_ddm_DdmHandleNativeHeap(JNIEnv *env);
@@ -1342,7 +1342,7 @@
REG_JNI(register_android_content_XmlBlock),
REG_JNI(register_android_text_AndroidCharacter),
REG_JNI(register_android_text_Hyphenator),
- REG_JNI(register_android_text_MeasuredText),
+ REG_JNI(register_android_text_MeasuredParagraph),
REG_JNI(register_android_text_StaticLayout),
REG_JNI(register_android_view_InputDevice),
REG_JNI(register_android_view_KeyCharacterMap),
diff --git a/core/jni/android_text_MeasuredText.cpp b/core/jni/android_text_MeasuredParagraph.cpp
similarity index 83%
rename from core/jni/android_text_MeasuredText.cpp
rename to core/jni/android_text_MeasuredParagraph.cpp
index af9d131..bdae0b2 100644
--- a/core/jni/android_text_MeasuredText.cpp
+++ b/core/jni/android_text_MeasuredParagraph.cpp
@@ -14,7 +14,7 @@
* limitations under the License.
*/
-#define LOG_TAG "MeasuredText"
+#define LOG_TAG "MeasuredParagraph"
#include "ScopedIcuLocale.h"
#include "unicode/locid.h"
@@ -49,7 +49,7 @@
return reinterpret_cast<Paint*>(ptr);
}
-static inline minikin::MeasuredText* toMeasuredText(jlong ptr) {
+static inline minikin::MeasuredText* toMeasuredParagraph(jlong ptr) {
return reinterpret_cast<minikin::MeasuredText*>(ptr);
}
@@ -57,8 +57,8 @@
return reinterpret_cast<jlong>(ptr);
}
-static void releaseMeasuredText(jlong measuredTextPtr) {
- delete toMeasuredText(measuredTextPtr);
+static void releaseMeasuredParagraph(jlong measuredTextPtr) {
+ delete toMeasuredParagraph(measuredTextPtr);
}
// Regular JNI
@@ -84,7 +84,7 @@
}
// Regular JNI
-static jlong nBuildNativeMeasuredText(JNIEnv* env, jclass /* unused */, jlong builderPtr,
+static jlong nBuildNativeMeasuredParagraph(JNIEnv* env, jclass /* unused */, jlong builderPtr,
jcharArray javaText) {
ScopedCharArrayRO text(env, javaText);
const minikin::U16StringPiece textBuffer(text.get(), text.size());
@@ -100,23 +100,23 @@
// CriticalNative
static jlong nGetReleaseFunc() {
- return toJLong(&releaseMeasuredText);
+ return toJLong(&releaseMeasuredParagraph);
}
static const JNINativeMethod gMethods[] = {
- // MeasuredTextBuilder native functions.
+ // MeasuredParagraphBuilder native functions.
{"nInitBuilder", "()J", (void*) nInitBuilder},
{"nAddStyleRun", "(JJIIZ)V", (void*) nAddStyleRun},
{"nAddReplacementRun", "(JJIIF)V", (void*) nAddReplacementRun},
- {"nBuildNativeMeasuredText", "(J[C)J", (void*) nBuildNativeMeasuredText},
+ {"nBuildNativeMeasuredParagraph", "(J[C)J", (void*) nBuildNativeMeasuredParagraph},
{"nFreeBuilder", "(J)V", (void*) nFreeBuilder},
- // MeasuredText native functions.
+ // MeasuredParagraph native functions.
{"nGetReleaseFunc", "()J", (void*) nGetReleaseFunc}, // Critical Natives
};
-int register_android_text_MeasuredText(JNIEnv* env) {
- return RegisterMethodsOrDie(env, "android/text/MeasuredText", gMethods, NELEM(gMethods));
+int register_android_text_MeasuredParagraph(JNIEnv* env) {
+ return RegisterMethodsOrDie(env, "android/text/MeasuredParagraph", gMethods, NELEM(gMethods));
}
}
diff --git a/core/jni/android_text_StaticLayout.cpp b/core/jni/android_text_StaticLayout.cpp
index b5c23df..682dc873 100644
--- a/core/jni/android_text_StaticLayout.cpp
+++ b/core/jni/android_text_StaticLayout.cpp
@@ -174,7 +174,7 @@
// Inputs
"[C" // text
- "J" // MeasuredText ptr.
+ "J" // MeasuredParagraph ptr.
"I" // length
"F" // firstWidth
"I" // firstWidthLineCount
diff --git a/core/res/AndroidManifest.xml b/core/res/AndroidManifest.xml
index f0cf5b8..a3e8f1e 100644
--- a/core/res/AndroidManifest.xml
+++ b/core/res/AndroidManifest.xml
@@ -2953,13 +2953,14 @@
<!-- Allows an application to collect usage infomation about brightness slider changes.
<p>Not for use by third-party applications.</p>
- TODO: make a System API
- @hide -->
+ @hide
+ @SystemApi -->
<permission android:name="android.permission.BRIGHTNESS_SLIDER_USAGE"
- android:protectionLevel="signature|privileged" />
+ android:protectionLevel="signature|privileged|development" />
<!-- Allows an application to modify the display brightness configuration
- @hide -->
+ @hide
+ @SystemApi -->
<permission android:name="android.permission.CONFIGURE_DISPLAY_BRIGHTNESS"
android:protectionLevel="signature|privileged|development" />
diff --git a/core/res/res/raw/color_fade_frag.frag b/core/res/res/raw/color_fade_frag.frag
index a66a5a7..29975d5 100644
--- a/core/res/res/raw/color_fade_frag.frag
+++ b/core/res/res/raw/color_fade_frag.frag
@@ -3,40 +3,12 @@
precision mediump float;
uniform samplerExternalOES texUnit;
uniform float opacity;
-uniform float saturation;
uniform float gamma;
varying vec2 UV;
-vec3 rgb2hsl(vec3 rgb)
-{
- float e = 1.0e-7;
-
- vec4 p = rgb.g < rgb.b ? vec4(rgb.bg, -1.0, 2.0 / 3.0) : vec4(rgb.gb, 0.0, -1.0 / 3.0);
- vec4 q = rgb.r < p.x ? vec4(p.xyw, rgb.r) : vec4(rgb.r, p.yzx);
-
- float v = q.x;
- float c = v - min(q.w, q.y);
- float h = abs((q.w - q.y) / (6.0 * c + e) + q.z);
- float l = v - c * 0.5;
- float s = c / (1.0 - abs(2.0 * l - 1.0) + e);
- return clamp(vec3(h, s, l), 0.0, 1.0);
-}
-
-vec3 hsl2rgb(vec3 hsl)
-{
- vec3 h = vec3(hsl.x * 6.0);
- vec3 p = abs(h - vec3(3.0, 2.0, 4.0));
- vec3 q = 2.0 - p;
-
- vec3 rgb = clamp(vec3(p.x - 1.0, q.yz), 0.0, 1.0);
- float c = (1.0 - abs(2.0 * hsl.z - 1.0)) * hsl.y;
- return (rgb - vec3(0.5)) * c + hsl.z;
-}
-
void main()
{
vec4 color = texture2D(texUnit, UV);
- vec3 hsl = rgb2hsl(color.xyz);
- vec3 rgb = pow(hsl2rgb(vec3(hsl.x, hsl.y * saturation, hsl.z * opacity)), vec3(gamma));
+ vec3 rgb = pow(color.rgb * opacity, vec3(gamma));
gl_FragColor = vec4(rgb, 1.0);
}
diff --git a/core/res/res/values/attrs_manifest.xml b/core/res/res/values/attrs_manifest.xml
index efbe9c2..287f296 100644
--- a/core/res/res/values/attrs_manifest.xml
+++ b/core/res/res/values/attrs_manifest.xml
@@ -2568,9 +2568,9 @@
e.g. name=ro.oem.sku value=MKT210.
Overlay will be ignored unless system property exists and is
set to specified value -->
- <!-- @hide @SystemApi This shouldn't be public. -->
+ <!-- @hide This shouldn't be public. -->
<attr name="requiredSystemPropertyName" format="string" />
- <!-- @hide @SystemApi This shouldn't be public. -->
+ <!-- @hide This shouldn't be public. -->
<attr name="requiredSystemPropertyValue" format="string" />
</declare-styleable>
diff --git a/core/res/res/values/colors_material.xml b/core/res/res/values/colors_material.xml
index 0413100..f8a77f8 100644
--- a/core/res/res/values/colors_material.xml
+++ b/core/res/res/values/colors_material.xml
@@ -77,9 +77,9 @@
<item name="secondary_content_alpha_material_dark" format="float" type="dimen">.7</item>
<item name="secondary_content_alpha_material_light" format="float" type="dimen">0.54</item>
- <item name="highlight_alpha_material_light" format="float" type="dimen">0.12</item>
- <item name="highlight_alpha_material_dark" format="float" type="dimen">0.20</item>
- <item name="highlight_alpha_material_colored" format="float" type="dimen">0.26</item>
+ <item name="highlight_alpha_material_light" format="float" type="dimen">0.16</item>
+ <item name="highlight_alpha_material_dark" format="float" type="dimen">0.32</item>
+ <item name="highlight_alpha_material_colored" format="float" type="dimen">0.48</item>
<!-- Primary & accent colors -->
<eat-comment />
diff --git a/core/tests/coretests/src/android/text/MeasuredTextTest.java b/core/tests/coretests/src/android/text/MeasuredParagraphTest.java
similarity index 87%
rename from core/tests/coretests/src/android/text/MeasuredTextTest.java
rename to core/tests/coretests/src/android/text/MeasuredParagraphTest.java
index ddef0c6..5d33397 100644
--- a/core/tests/coretests/src/android/text/MeasuredTextTest.java
+++ b/core/tests/coretests/src/android/text/MeasuredParagraphTest.java
@@ -31,7 +31,7 @@
@SmallTest
@RunWith(AndroidJUnit4.class)
-public class MeasuredTextTest {
+public class MeasuredParagraphTest {
private static final TextDirectionHeuristic LTR = TextDirectionHeuristics.LTR;
private static final TextDirectionHeuristic RTL = TextDirectionHeuristics.RTL;
@@ -60,9 +60,9 @@
@Test
public void buildForBidi() {
- MeasuredText mt = null;
+ MeasuredParagraph mt = null;
- mt = MeasuredText.buildForBidi("XXX", 0, 3, LTR, null);
+ mt = MeasuredParagraph.buildForBidi("XXX", 0, 3, LTR, null);
assertNotNull(mt);
assertNotNull(mt.getChars());
assertEquals("XXX", charsToString(mt.getChars()));
@@ -75,7 +75,7 @@
assertEquals(0, mt.getNativePtr());
// Recycle it
- MeasuredText mt2 = MeasuredText.buildForBidi("_VVV_", 1, 4, RTL, mt);
+ MeasuredParagraph mt2 = MeasuredParagraph.buildForBidi("_VVV_", 1, 4, RTL, mt);
assertEquals(mt2, mt);
assertNotNull(mt2.getChars());
assertEquals("VVV", charsToString(mt.getChars()));
@@ -91,9 +91,9 @@
@Test
public void buildForMeasurement() {
- MeasuredText mt = null;
+ MeasuredParagraph mt = null;
- mt = MeasuredText.buildForMeasurement(PAINT, "XXX", 0, 3, LTR, null);
+ mt = MeasuredParagraph.buildForMeasurement(PAINT, "XXX", 0, 3, LTR, null);
assertNotNull(mt);
assertNotNull(mt.getChars());
assertEquals("XXX", charsToString(mt.getChars()));
@@ -109,7 +109,8 @@
assertEquals(0, mt.getNativePtr());
// Recycle it
- MeasuredText mt2 = MeasuredText.buildForMeasurement(PAINT, "_VVV_", 1, 4, RTL, mt);
+ MeasuredParagraph mt2 =
+ MeasuredParagraph.buildForMeasurement(PAINT, "_VVV_", 1, 4, RTL, mt);
assertEquals(mt2, mt);
assertNotNull(mt2.getChars());
assertEquals("VVV", charsToString(mt.getChars()));
@@ -129,9 +130,9 @@
@Test
public void buildForStaticLayout() {
- MeasuredText mt = null;
+ MeasuredParagraph mt = null;
- mt = MeasuredText.buildForStaticLayout(PAINT, "XXX", 0, 3, LTR, null);
+ mt = MeasuredParagraph.buildForStaticLayout(PAINT, "XXX", 0, 3, LTR, null);
assertNotNull(mt);
assertNotNull(mt.getChars());
assertEquals("XXX", charsToString(mt.getChars()));
@@ -145,7 +146,8 @@
assertNotEquals(0, mt.getNativePtr());
// Recycle it
- MeasuredText mt2 = MeasuredText.buildForStaticLayout(PAINT, "_VVV_", 1, 4, RTL, mt);
+ MeasuredParagraph mt2 =
+ MeasuredParagraph.buildForStaticLayout(PAINT, "_VVV_", 1, 4, RTL, mt);
assertEquals(mt2, mt);
assertNotNull(mt2.getChars());
assertEquals("VVV", charsToString(mt.getChars()));
@@ -163,6 +165,6 @@
@Test
public void testFor70146381() {
- MeasuredText.buildForMeasurement(PAINT, "X…", 0, 2, RTL, null);
+ MeasuredParagraph.buildForMeasurement(PAINT, "X…", 0, 2, RTL, null);
}
}
diff --git a/graphics/java/android/graphics/drawable/RippleBackground.java b/graphics/java/android/graphics/drawable/RippleBackground.java
index dea194e..4571553 100644
--- a/graphics/java/android/graphics/drawable/RippleBackground.java
+++ b/graphics/java/android/graphics/drawable/RippleBackground.java
@@ -16,17 +16,12 @@
package android.graphics.drawable;
-import android.animation.Animator;
-import android.animation.AnimatorSet;
import android.animation.ObjectAnimator;
import android.animation.TimeInterpolator;
import android.graphics.Canvas;
-import android.graphics.CanvasProperty;
import android.graphics.Paint;
import android.graphics.Rect;
import android.util.FloatProperty;
-import android.view.DisplayListCanvas;
-import android.view.RenderNodeAnimator;
import android.view.animation.LinearInterpolator;
/**
@@ -78,8 +73,8 @@
private void onStateChanged(boolean animateChanged) {
float newOpacity = 0.0f;
- if (mHovered) newOpacity += 1.0f;
- if (mFocused) newOpacity += 1.0f;
+ if (mHovered) newOpacity += .25f;
+ if (mFocused) newOpacity += .75f;
if (mAnimator != null) {
mAnimator.cancel();
mAnimator = null;
diff --git a/graphics/java/android/graphics/drawable/RippleDrawable.java b/graphics/java/android/graphics/drawable/RippleDrawable.java
index 734cff5..b883656 100644
--- a/graphics/java/android/graphics/drawable/RippleDrawable.java
+++ b/graphics/java/android/graphics/drawable/RippleDrawable.java
@@ -264,8 +264,8 @@
}
setRippleActive(enabled && pressed);
-
setBackgroundActive(hovered, focused);
+
return changed;
}
@@ -879,22 +879,18 @@
// Grab the color for the current state and cut the alpha channel in
// half so that the ripple and background together yield full alpha.
final int color = mState.mColor.getColorForState(getState(), Color.BLACK);
- final int halfAlpha = (Color.alpha(color) / 2) << 24;
final Paint p = mRipplePaint;
if (mMaskColorFilter != null) {
// The ripple timing depends on the paint's alpha value, so we need
// to push just the alpha channel into the paint and let the filter
// handle the full-alpha color.
- final int fullAlphaColor = color | (0xFF << 24);
- mMaskColorFilter.setColor(fullAlphaColor);
-
- p.setColor(halfAlpha);
+ mMaskColorFilter.setColor(color | 0xFF000000);
+ p.setColor(color & 0xFF000000);
p.setColorFilter(mMaskColorFilter);
p.setShader(mMaskShader);
} else {
- final int halfAlphaColor = (color & 0xFFFFFF) | halfAlpha;
- p.setColor(halfAlphaColor);
+ p.setColor(color);
p.setColorFilter(null);
p.setShader(null);
}
diff --git a/media/java/android/media/update/ApiLoader.java b/media/java/android/media/update/ApiLoader.java
index b57e02d..07483f6 100644
--- a/media/java/android/media/update/ApiLoader.java
+++ b/media/java/android/media/update/ApiLoader.java
@@ -49,8 +49,8 @@
Context.CONTEXT_INCLUDE_CODE | Context.CONTEXT_IGNORE_SECURITY);
sMediaLibrary = libContext.getClassLoader()
.loadClass(UPDATE_CLASS)
- .getMethod(UPDATE_METHOD, Context.class)
- .invoke(null, appContext);
+ .getMethod(UPDATE_METHOD, Context.class, Context.class)
+ .invoke(null, appContext, libContext);
return sMediaLibrary;
}
}
diff --git a/media/java/android/media/update/StaticProvider.java b/media/java/android/media/update/StaticProvider.java
index 19f01c2..a1e2404 100644
--- a/media/java/android/media/update/StaticProvider.java
+++ b/media/java/android/media/update/StaticProvider.java
@@ -18,6 +18,7 @@
import android.annotation.SystemApi;
import android.widget.MediaController2;
+import android.widget.VideoView2;
/**
* Interface for connecting the public API to an updatable implementation.
@@ -31,4 +32,5 @@
public interface StaticProvider {
MediaController2Provider createMediaController2(
MediaController2 instance, ViewProvider superProvider);
+ VideoView2Provider createVideoView2(VideoView2 instance, ViewProvider superProvider);
}
diff --git a/media/java/android/media/update/VideoView2Provider.java b/media/java/android/media/update/VideoView2Provider.java
new file mode 100644
index 0000000..6fc9bdc
--- /dev/null
+++ b/media/java/android/media/update/VideoView2Provider.java
@@ -0,0 +1,66 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.media.update;
+
+import android.media.AudioAttributes;
+import android.media.MediaPlayer;
+import android.net.Uri;
+import android.widget.MediaController2;
+import android.widget.VideoView2;
+
+import java.util.Map;
+
+/**
+ * Interface for connecting the public API to an updatable implementation.
+ *
+ * Each instance object is connected to one corresponding updatable object which implements the
+ * runtime behavior of that class. There should a corresponding provider method for all public
+ * methods.
+ *
+ * All methods behave as per their namesake in the public API.
+ *
+ * @see android.widget.VideoView2
+ *
+ * @hide
+ */
+// TODO @SystemApi
+public interface VideoView2Provider extends ViewProvider {
+ void start_impl();
+ void pause_impl();
+ int getDuration_impl();
+ int getCurrentPosition_impl();
+ void seekTo_impl(int msec);
+ boolean isPlaying_impl();
+ int getBufferPercentage_impl();
+ int getAudioSessionId_impl();
+ void showSubtitle_impl();
+ void hideSubtitle_impl();
+ void setAudioFocusRequest_impl(int focusGain);
+ void setAudioAttributes_impl(AudioAttributes attributes);
+ void setVideoPath_impl(String path);
+ void setVideoURI_impl(Uri uri);
+ void setVideoURI_impl(Uri uri, Map<String, String> headers);
+ void setMediaController2_impl(MediaController2 controllerView);
+ void setViewType_impl(int viewType);
+ int getViewType_impl();
+ void stopPlayback_impl();
+ void setOnPreparedListener_impl(MediaPlayer.OnPreparedListener l);
+ void setOnCompletionListener_impl(MediaPlayer.OnCompletionListener l);
+ void setOnErrorListener_impl(MediaPlayer.OnErrorListener l);
+ void setOnInfoListener_impl(MediaPlayer.OnInfoListener l);
+ void setOnViewTypeChangedListener_impl(VideoView2.OnViewTypeChangedListener l);
+}
diff --git a/native/android/net.c b/native/android/net.c
index de4b90c..60296a7 100644
--- a/native/android/net.c
+++ b/native/android/net.c
@@ -27,7 +27,7 @@
static const uint32_t k32BitMask = 0xffffffff;
// This value MUST be kept in sync with the corresponding value in
// the android.net.Network#getNetworkHandle() implementation.
- static const uint32_t kHandleMagic = 0xfacade;
+ static const uint32_t kHandleMagic = 0xcafed00d;
// Check for minimum acceptable version of the API in the low bits.
if (handle != NETWORK_UNSPECIFIED &&
diff --git a/packages/SettingsLib/tests/robotests/src/com/android/settingslib/core/lifecycle/LifecycleTest.java b/packages/SettingsLib/tests/robotests/src/com/android/settingslib/core/lifecycle/LifecycleTest.java
index adb4832..ae24c07 100644
--- a/packages/SettingsLib/tests/robotests/src/com/android/settingslib/core/lifecycle/LifecycleTest.java
+++ b/packages/SettingsLib/tests/robotests/src/com/android/settingslib/core/lifecycle/LifecycleTest.java
@@ -16,9 +16,9 @@
package com.android.settingslib.core.lifecycle;
import static android.arch.lifecycle.Lifecycle.Event.ON_START;
-
import static com.google.common.truth.Truth.assertThat;
+import android.arch.lifecycle.LifecycleOwner;
import android.content.Context;
import android.view.Menu;
import android.view.MenuInflater;
@@ -48,6 +48,7 @@
@Config(manifest = TestConfig.MANIFEST_PATH, sdk = TestConfig.SDK_VERSION)
public class LifecycleTest {
+ private LifecycleOwner mLifecycleOwner;
private Lifecycle mLifecycle;
public static class TestDialogFragment extends ObservableDialogFragment {
@@ -146,7 +147,8 @@
@Before
public void setUp() {
- mLifecycle = new Lifecycle(() -> mLifecycle);
+ mLifecycleOwner = () -> mLifecycle;
+ mLifecycle = new Lifecycle(mLifecycleOwner);
}
@Test
diff --git a/packages/SettingsLib/tests/robotests/src/com/android/settingslib/development/LogpersistPreferenceControllerTest.java b/packages/SettingsLib/tests/robotests/src/com/android/settingslib/development/LogpersistPreferenceControllerTest.java
index 5d5733e4..050877d 100644
--- a/packages/SettingsLib/tests/robotests/src/com/android/settingslib/development/LogpersistPreferenceControllerTest.java
+++ b/packages/SettingsLib/tests/robotests/src/com/android/settingslib/development/LogpersistPreferenceControllerTest.java
@@ -17,11 +17,11 @@
package com.android.settingslib.development;
import static com.google.common.truth.Truth.assertThat;
-
import static org.mockito.Mockito.atLeastOnce;
import static org.mockito.Mockito.doReturn;
import static org.mockito.Mockito.verify;
+import android.arch.lifecycle.LifecycleOwner;
import android.os.SystemProperties;
import android.support.v7.preference.ListPreference;
import android.support.v7.preference.Preference;
@@ -44,6 +44,7 @@
shadows = SystemPropertiesTestImpl.class)
public class LogpersistPreferenceControllerTest {
+ private LifecycleOwner mLifecycleOwner;
private Lifecycle mLifecycle;
@Mock
@@ -57,7 +58,8 @@
public void setUp() {
MockitoAnnotations.initMocks(this);
SystemProperties.set("ro.debuggable", "1");
- mLifecycle = new Lifecycle(() -> mLifecycle);
+ mLifecycleOwner = () -> mLifecycle;
+ mLifecycle = new Lifecycle(mLifecycleOwner);
mController = new AbstractLogpersistPreferenceController(RuntimeEnvironment.application,
mLifecycle) {
@Override
diff --git a/packages/SettingsLib/tests/robotests/src/com/android/settingslib/widget/FooterPreferenceMixinTest.java b/packages/SettingsLib/tests/robotests/src/com/android/settingslib/widget/FooterPreferenceMixinTest.java
index 75b6c5f..88c57b5 100644
--- a/packages/SettingsLib/tests/robotests/src/com/android/settingslib/widget/FooterPreferenceMixinTest.java
+++ b/packages/SettingsLib/tests/robotests/src/com/android/settingslib/widget/FooterPreferenceMixinTest.java
@@ -17,13 +17,13 @@
package com.android.settingslib.widget;
import static com.google.common.truth.Truth.assertThat;
-
import static org.mockito.Matchers.any;
import static org.mockito.Mockito.mock;
import static org.mockito.Mockito.times;
import static org.mockito.Mockito.verify;
import static org.mockito.Mockito.when;
+import android.arch.lifecycle.LifecycleOwner;
import android.support.v14.preference.PreferenceFragment;
import android.support.v7.preference.PreferenceManager;
import android.support.v7.preference.PreferenceScreen;
@@ -49,13 +49,15 @@
@Mock
private PreferenceScreen mScreen;
+ private LifecycleOwner mLifecycleOwner;
private Lifecycle mLifecycle;
private FooterPreferenceMixin mMixin;
@Before
public void setUp() {
MockitoAnnotations.initMocks(this);
- mLifecycle = new Lifecycle(() -> mLifecycle);
+ mLifecycleOwner = () -> mLifecycle;
+ mLifecycle = new Lifecycle(mLifecycleOwner);
when(mFragment.getPreferenceManager()).thenReturn(mock(PreferenceManager.class));
when(mFragment.getPreferenceManager().getContext())
.thenReturn(ShadowApplication.getInstance().getApplicationContext());
diff --git a/packages/SettingsProvider/res/values/defaults.xml b/packages/SettingsProvider/res/values/defaults.xml
index 1be0645..48a3a30 100644
--- a/packages/SettingsProvider/res/values/defaults.xml
+++ b/packages/SettingsProvider/res/values/defaults.xml
@@ -28,7 +28,7 @@
<string name="def_bluetooth_disabled_profiles" translatable="false">0</string>
<bool name="def_auto_time">true</bool>
<bool name="def_auto_time_zone">true</bool>
- <bool name="def_accelerometer_rotation">true</bool>
+ <bool name="def_accelerometer_rotation">false</bool>
<!-- Default screen brightness, from 0 to 255. 102 is 40%. -->
<integer name="def_screen_brightness">102</integer>
<bool name="def_screen_brightness_automatic_mode">false</bool>
diff --git a/packages/SettingsProvider/src/com/android/providers/settings/SettingsProvider.java b/packages/SettingsProvider/src/com/android/providers/settings/SettingsProvider.java
index 1167d69..175cff6 100644
--- a/packages/SettingsProvider/src/com/android/providers/settings/SettingsProvider.java
+++ b/packages/SettingsProvider/src/com/android/providers/settings/SettingsProvider.java
@@ -1584,6 +1584,11 @@
restriction = UserManager.DISALLOW_SAFE_BOOT;
break;
+ case Settings.Global.AIRPLANE_MODE_ON:
+ if ("0".equals(value)) return false;
+ restriction = UserManager.DISALLOW_AIRPLANE_MODE;
+ break;
+
default:
if (setting != null && setting.startsWith(Settings.Global.DATA_ROAMING)) {
if ("0".equals(value)) return false;
@@ -2940,7 +2945,7 @@
}
private final class UpgradeController {
- private static final int SETTINGS_VERSION = 150;
+ private static final int SETTINGS_VERSION = 151;
private final int mUserId;
@@ -3533,6 +3538,18 @@
currentVersion = 150;
}
+ if (currentVersion == 150) {
+ // Version 151: Reset rotate locked setting for upgrading users
+ final SettingsState systemSettings = getSystemSettingsLocked(userId);
+ systemSettings.insertSettingLocked(
+ Settings.System.ACCELEROMETER_ROTATION,
+ getContext().getResources().getBoolean(
+ R.bool.def_accelerometer_rotation) ? "1" : "0",
+ null, true, SettingsState.SYSTEM_PACKAGE_NAME);
+
+ currentVersion = 151;
+ }
+
// vXXX: Add new settings above this point.
if (currentVersion != newVersion) {
diff --git a/packages/SystemUI/plugin/src/com/android/systemui/plugins/statusbar/phone/NavBarButtonProvider.java b/packages/SystemUI/plugin/src/com/android/systemui/plugins/statusbar/phone/NavBarButtonProvider.java
index 56a3ee3..e25930c 100644
--- a/packages/SystemUI/plugin/src/com/android/systemui/plugins/statusbar/phone/NavBarButtonProvider.java
+++ b/packages/SystemUI/plugin/src/com/android/systemui/plugins/statusbar/phone/NavBarButtonProvider.java
@@ -50,5 +50,7 @@
}
void setDarkIntensity(float intensity);
+
+ void setDelayTouchFeedback(boolean shouldDelay);
}
}
diff --git a/packages/SystemUI/plugin/src/com/android/systemui/plugins/statusbar/phone/NavGesture.java b/packages/SystemUI/plugin/src/com/android/systemui/plugins/statusbar/phone/NavGesture.java
index 674ed5a..6131acc 100644
--- a/packages/SystemUI/plugin/src/com/android/systemui/plugins/statusbar/phone/NavGesture.java
+++ b/packages/SystemUI/plugin/src/com/android/systemui/plugins/statusbar/phone/NavGesture.java
@@ -14,6 +14,7 @@
package com.android.systemui.plugins.statusbar.phone;
+import android.graphics.Canvas;
import android.view.MotionEvent;
import com.android.systemui.plugins.Plugin;
@@ -35,6 +36,12 @@
public void setBarState(boolean vertical, boolean isRtl);
+ public void onDraw(Canvas canvas);
+
+ public void onDarkIntensityChange(float intensity);
+
+ public void onLayout(boolean changed, int left, int top, int right, int bottom);
+
public default void destroy() { }
}
diff --git a/packages/SystemUI/res-keyguard/layout/keyguard_status_view.xml b/packages/SystemUI/res-keyguard/layout/keyguard_status_view.xml
index c97cfc4..9adb550 100644
--- a/packages/SystemUI/res-keyguard/layout/keyguard_status_view.xml
+++ b/packages/SystemUI/res-keyguard/layout/keyguard_status_view.xml
@@ -34,7 +34,6 @@
android:orientation="vertical">
<RelativeLayout
android:id="@+id/keyguard_clock_container"
- android:animateLayoutChanges="true"
android:layout_width="match_parent"
android:layout_height="wrap_content"
android:layout_gravity="center_horizontal|top">
@@ -51,16 +50,6 @@
android:format12Hour="@string/keyguard_widget_12_hours_format"
android:format24Hour="@string/keyguard_widget_24_hours_format"
android:layout_marginBottom="@dimen/bottom_text_spacing_digital" />
- <com.android.systemui.ChargingView
- android:id="@+id/battery_doze"
- android:layout_width="wrap_content"
- android:layout_height="wrap_content"
- android:layout_alignTop="@id/clock_view"
- android:layout_alignBottom="@id/clock_view"
- android:layout_toEndOf="@id/clock_view"
- android:visibility="invisible"
- android:src="@drawable/ic_aod_charging_24dp"
- android:contentDescription="@string/accessibility_ambient_display_charging" />
<View
android:id="@+id/clock_separator"
android:layout_width="16dp"
diff --git a/packages/SystemUI/res/drawable/ic_face_unlock.xml b/packages/SystemUI/res/drawable/ic_face_unlock.xml
new file mode 100644
index 0000000..29c2275
--- /dev/null
+++ b/packages/SystemUI/res/drawable/ic_face_unlock.xml
@@ -0,0 +1,27 @@
+<!--
+ ~ Copyright (C) 2018 The Android Open Source Project
+ ~
+ ~ Licensed under the Apache License, Version 2.0 (the "License");
+ ~ you may not use this file except in compliance with the License.
+ ~ You may obtain a copy of the License at
+ ~
+ ~ http://www.apache.org/licenses/LICENSE-2.0
+ ~
+ ~ Unless required by applicable law or agreed to in writing, software
+ ~ distributed under the License is distributed on an "AS IS" BASIS,
+ ~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ ~ See the License for the specific language governing permissions and
+ ~ limitations under the License
+ -->
+
+<vector xmlns:android="http://schemas.android.com/apk/res/android"
+ android:width="48dp"
+ android:height="48dp"
+ android:viewportHeight="24.0"
+ android:viewportWidth="24.0">
+ <path android:fillColor="?attr/wallpaperTextColor"
+ android:strokeColor="?attr/wallpaperTextColor"
+ android:strokeWidth="1"
+ android:pathData="M9,11.75C8.31,11.75 7.75,12.31 7.75,13C7.75,13.69 8.31,14.25 9,14.25C9.69,14.25 10.25,13.69 10.25,13C10.25,12.31 9.69,11.75 9,11.75ZM15,11.75C14.31,11.75 13.75,12.31 13.75,13C13.75,13.69 14.31,14.25 15,14.25C15.69,14.25 16.25,13.69 16.25,13C16.25,12.31 15.69,11.75 15,11.75ZM12,2C6.48,2 2,6.48 2,12C2,17.52 6.48,22 12,22C17.52,22 22,17.52 22,12C22,6.48 17.52,2 12,2ZM12,20C7.59,20 4,16.41 4,12C4,11.71 4.02,11.42 4.05,11.14C6.41,10.09 8.28,8.16 9.26,5.77C11.07,8.33 14.05,10 17.42,10C18.2,10 18.95,9.91 19.67,9.74C19.88,10.45 20,11.21 20,12C20,16.41 16.41,20 12,20Z"
+ />
+</vector>
diff --git a/packages/SystemUI/res/drawable/qs_background_primary.xml b/packages/SystemUI/res/drawable/qs_background_primary.xml
index 03bba53..dd74cadd 100644
--- a/packages/SystemUI/res/drawable/qs_background_primary.xml
+++ b/packages/SystemUI/res/drawable/qs_background_primary.xml
@@ -16,5 +16,6 @@
<inset xmlns:android="http://schemas.android.com/apk/res/android">
<shape>
<solid android:color="@color/qs_background_dark"/>
+ <corners android:radius="?android:attr/dialogCornerRadius" />
</shape>
</inset>
diff --git a/packages/SystemUI/res/layout/keyguard_bottom_area.xml b/packages/SystemUI/res/layout/keyguard_bottom_area.xml
index 2fd4df4..d0d379c 100644
--- a/packages/SystemUI/res/layout/keyguard_bottom_area.xml
+++ b/packages/SystemUI/res/layout/keyguard_bottom_area.xml
@@ -40,6 +40,7 @@
android:gravity="center_horizontal"
android:textStyle="italic"
android:textColor="?attr/wallpaperTextColorSecondary"
+ android:textSize="16sp"
android:textAppearance="?android:attr/textAppearanceSmall"
android:visibility="gone" />
@@ -50,6 +51,7 @@
android:gravity="center_horizontal"
android:textStyle="italic"
android:textColor="?attr/wallpaperTextColorSecondary"
+ android:textSize="16sp"
android:textAppearance="?android:attr/textAppearanceSmall"
android:accessibilityLiveRegion="polite" />
diff --git a/packages/SystemUI/res/layout/status_bar_expanded.xml b/packages/SystemUI/res/layout/status_bar_expanded.xml
index bef0830..c5e5ee1 100644
--- a/packages/SystemUI/res/layout/status_bar_expanded.xml
+++ b/packages/SystemUI/res/layout/status_bar_expanded.xml
@@ -43,6 +43,8 @@
android:layout_width="@dimen/qs_panel_width"
android:layout_height="match_parent"
android:layout_gravity="@integer/notification_panel_layout_gravity"
+ android:layout_marginStart="@dimen/notification_side_paddings"
+ android:layout_marginEnd="@dimen/notification_side_paddings"
android:clipToPadding="false"
android:clipChildren="false"
systemui:viewType="com.android.systemui.plugins.qs.QS" />
diff --git a/packages/SystemUI/res/values/colors.xml b/packages/SystemUI/res/values/colors.xml
index f244d88..f5be337 100644
--- a/packages/SystemUI/res/values/colors.xml
+++ b/packages/SystemUI/res/values/colors.xml
@@ -143,6 +143,9 @@
<color name="remote_input_accent">#eeeeee</color>
+ <color name="quick_step_track_background_dark">#61000000</color>
+ <color name="quick_step_track_background_light">#4DFFFFFF</color>
+
<!-- Keyboard shortcuts colors -->
<color name="ksh_application_group_color">#fff44336</color>
<color name="ksh_keyword_color">#d9000000</color>
diff --git a/packages/SystemUI/res/values/dimens.xml b/packages/SystemUI/res/values/dimens.xml
index a510c4a..39ed08e 100644
--- a/packages/SystemUI/res/values/dimens.xml
+++ b/packages/SystemUI/res/values/dimens.xml
@@ -579,6 +579,7 @@
<dimen name="keyguard_affordance_icon_width">24dp</dimen>
<dimen name="keyguard_indication_margin_bottom">65dp</dimen>
+ <dimen name="keyguard_indication_margin_bottom_ambient">30dp</dimen>
<!-- The text size for battery level -->
<dimen name="battery_level_text_size">12sp</dimen>
@@ -870,6 +871,8 @@
<dimen name="rounded_corner_radius">0dp</dimen>
<dimen name="rounded_corner_content_padding">0dp</dimen>
<dimen name="nav_content_padding">0dp</dimen>
+ <dimen name="nav_quick_scrub_track_edge_padding">32dp</dimen>
+ <dimen name="nav_quick_scrub_track_thickness">2dp</dimen>
<!-- Intended corner radius when drawing the mobile signal -->
<dimen name="stat_sys_mobile_signal_corner_radius">0.75dp</dimen>
diff --git a/packages/SystemUI/res/values/strings.xml b/packages/SystemUI/res/values/strings.xml
index 6ff239e..dde4dcf 100644
--- a/packages/SystemUI/res/values/strings.xml
+++ b/packages/SystemUI/res/values/strings.xml
@@ -61,11 +61,26 @@
<!-- When the battery is low, this is displayed to the user in a dialog. The title of the low battery alert. [CHAR LIMIT=NONE]-->
<string name="battery_low_title">Battery is low</string>
+ <!-- When the battery is low and hybrid notifications are enabled, this is displayed to the user in a dialog.
+ The title of the low battery alert. [CHAR LIMIT=NONE]-->
+ <string name="battery_low_title_hybrid">Battery is low. Turn on Battery Saver</string>
+
<!-- A message that appears when the battery level is getting low in a dialog. This is
- appened to the subtitle of the low battery alert. "percentage" is the percentage of battery
+ appended to the subtitle of the low battery alert. "percentage" is the percentage of battery
remaining [CHAR LIMIT=none]-->
<string name="battery_low_percent_format"><xliff:g id="percentage">%s</xliff:g> remaining</string>
+ <!-- A message that appears when the battery remaining estimate is low in a dialog. This is
+ appended to the subtitle of the low battery alert. "percentage" is the percentage of battery
+ remaining. "time" is the amount of time remaining before the phone runs out of battery [CHAR LIMIT=none]-->
+ <string name="battery_low_percent_format_hybrid"><xliff:g id="percentage">%s</xliff:g> remaining, about <xliff:g id="time">%s</xliff:g> left based on your usage</string>
+
+ <!-- A message that appears when the battery remaining estimate is low in a dialog and insufficient
+ data was present to say it is customized to the user. This is appended to the subtitle of the
+ low battery alert. "percentage" is the percentage of battery remaining. "time" is the amount
+ of time remaining before the phone runs out of battery [CHAR LIMIT=none]-->
+ <string name="battery_low_percent_format_hybrid_short"><xliff:g id="percentage">%s</xliff:g> remaining, about <xliff:g id="time">%s</xliff:g> left</string>
+
<!-- Same as battery_low_percent_format, with a notice about battery saver if on. [CHAR LIMIT=none]-->
<string name="battery_low_percent_format_saver_started"><xliff:g id="percentage">%s</xliff:g> remaining. Battery Saver is on.</string>
diff --git a/packages/SystemUI/shared/src/com/android/systemui/shared/recents/IOverviewProxy.aidl b/packages/SystemUI/shared/src/com/android/systemui/shared/recents/IOverviewProxy.aidl
index 173a90a..64fa9c6 100644
--- a/packages/SystemUI/shared/src/com/android/systemui/shared/recents/IOverviewProxy.aidl
+++ b/packages/SystemUI/shared/src/com/android/systemui/shared/recents/IOverviewProxy.aidl
@@ -22,4 +22,8 @@
oneway interface IOverviewProxy {
void onBind(in ISystemUiProxy sysUiProxy);
void onMotionEvent(in MotionEvent event);
+ void onQuickSwitch();
+ void onQuickScrubStart();
+ void onQuickScrubEnd();
+ void onQuickScrubProgress(float progress);
}
diff --git a/packages/SystemUI/src/com/android/keyguard/KeyguardSliceView.java b/packages/SystemUI/src/com/android/keyguard/KeyguardSliceView.java
index 8135c61..d80a336 100644
--- a/packages/SystemUI/src/com/android/keyguard/KeyguardSliceView.java
+++ b/packages/SystemUI/src/com/android/keyguard/KeyguardSliceView.java
@@ -151,6 +151,7 @@
mClickActions.clear();
final int subItemsCount = subItems.size();
+ final int blendedColor = getTextColor();
for (int i = 0; i < subItemsCount; i++) {
SliceItem item = subItems.get(i);
@@ -159,7 +160,7 @@
KeyguardSliceButton button = mRow.findViewWithTag(itemTag);
if (button == null) {
button = new KeyguardSliceButton(mContext);
- button.setTextColor(mTextColor);
+ button.setTextColor(blendedColor);
button.setTag(itemTag);
} else {
mRow.removeView(button);
@@ -258,7 +259,7 @@
}
private void updateTextColors() {
- final int blendedColor = ColorUtils.blendARGB(mTextColor, Color.WHITE, mDarkAmount);
+ final int blendedColor = getTextColor();
mTitle.setTextColor(blendedColor);
int childCount = mRow.getChildCount();
for (int i = 0; i < childCount; i++) {
@@ -322,6 +323,10 @@
}
}
+ public int getTextColor() {
+ return ColorUtils.blendARGB(mTextColor, Color.WHITE, mDarkAmount);
+ }
+
/**
* Representation of an item that appears under the clock on main keyguard message.
* Shows optional separator.
diff --git a/packages/SystemUI/src/com/android/keyguard/KeyguardStatusView.java b/packages/SystemUI/src/com/android/keyguard/KeyguardStatusView.java
index 4b9a874..2873afb 100644
--- a/packages/SystemUI/src/com/android/keyguard/KeyguardStatusView.java
+++ b/packages/SystemUI/src/com/android/keyguard/KeyguardStatusView.java
@@ -16,7 +16,6 @@
package com.android.keyguard;
-import android.app.ActivityManager;
import android.app.AlarmManager;
import android.content.Context;
import android.content.res.Configuration;
@@ -40,7 +39,6 @@
import android.widget.TextView;
import com.android.internal.widget.LockPatternUtils;
-import com.android.systemui.ChargingView;
import com.google.android.collect.Sets;
@@ -60,7 +58,6 @@
private View mClockSeparator;
private TextView mOwnerInfo;
private ViewGroup mClockContainer;
- private ChargingView mBatteryDoze;
private KeyguardSliceView mKeyguardSlice;
private Runnable mPendingMarqueeStart;
private Handler mHandler;
@@ -155,11 +152,9 @@
mClockView.setAccessibilityDelegate(new KeyguardClockAccessibilityDelegate(mContext));
}
mOwnerInfo = findViewById(R.id.owner_info);
- mBatteryDoze = findViewById(R.id.battery_doze);
mKeyguardSlice = findViewById(R.id.keyguard_status_area);
mClockSeparator = findViewById(R.id.clock_separator);
- mVisibleInDoze = Sets.newArraySet(mBatteryDoze, mClockView, mKeyguardSlice,
- mClockSeparator);
+ mVisibleInDoze = Sets.newArraySet(mClockView, mKeyguardSlice, mClockSeparator);
mTextColor = mClockView.getCurrentTextColor();
mKeyguardSlice.setListener(this::onSliceContentChanged);
@@ -184,10 +179,6 @@
mClockView.setTranslationY(translation);
mClockView.setScaleX(clockScale);
mClockView.setScaleY(clockScale);
- final float batteryTranslation =
- -(mClockView.getWidth() - (mClockView.getWidth() * clockScale)) / 2;
- mBatteryDoze.setTranslationX(batteryTranslation);
- mBatteryDoze.setTranslationY(translation);
mClockSeparator.setVisibility(hasHeader ? VISIBLE : GONE);
}
@@ -310,7 +301,7 @@
}
}
- public void setDark(float darkAmount) {
+ public void setDarkAmount(float darkAmount) {
if (mDarkAmount == darkAmount) {
return;
}
@@ -331,7 +322,6 @@
final int blendedTextColor = ColorUtils.blendARGB(mTextColor, Color.WHITE, darkAmount);
updateDozeVisibleViews();
- mBatteryDoze.setDark(dark);
mKeyguardSlice.setDark(darkAmount);
mClockView.setTextColor(blendedTextColor);
mClockSeparator.setBackgroundColor(blendedTextColor);
diff --git a/packages/SystemUI/src/com/android/keyguard/KeyguardUpdateMonitor.java b/packages/SystemUI/src/com/android/keyguard/KeyguardUpdateMonitor.java
index ab2bce8..e58ad05 100644
--- a/packages/SystemUI/src/com/android/keyguard/KeyguardUpdateMonitor.java
+++ b/packages/SystemUI/src/com/android/keyguard/KeyguardUpdateMonitor.java
@@ -1613,11 +1613,10 @@
}
}
- private static boolean isBatteryUpdateInteresting(BatteryStatus old, BatteryStatus current) {
+ private boolean isBatteryUpdateInteresting(BatteryStatus old, BatteryStatus current) {
final boolean nowPluggedIn = current.isPluggedIn();
final boolean wasPluggedIn = old.isPluggedIn();
- final boolean stateChangedWhilePluggedIn =
- wasPluggedIn == true && nowPluggedIn == true
+ final boolean stateChangedWhilePluggedIn = wasPluggedIn && nowPluggedIn
&& (old.status != current.status);
// change in plug state is always interesting
@@ -1630,6 +1629,11 @@
return true;
}
+ // change in battery level while keyguard visible
+ if (mKeyguardIsVisible && old.level != current.level) {
+ return true;
+ }
+
// change where battery needs charging
if (!nowPluggedIn && current.isBatteryLow() && current.level != old.level) {
return true;
diff --git a/packages/SystemUI/src/com/android/systemui/ChargingView.java b/packages/SystemUI/src/com/android/systemui/ChargingView.java
deleted file mode 100644
index 33f8b06..0000000
--- a/packages/SystemUI/src/com/android/systemui/ChargingView.java
+++ /dev/null
@@ -1,126 +0,0 @@
-/*
- * Copyright (C) 2017 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License
- */
-
-package com.android.systemui;
-
-import android.annotation.Nullable;
-import android.content.Context;
-import android.content.res.TypedArray;
-import android.os.UserHandle;
-import android.util.AttributeSet;
-import android.widget.ImageView;
-
-import com.android.internal.hardware.AmbientDisplayConfiguration;
-import com.android.systemui.statusbar.policy.BatteryController;
-import com.android.systemui.statusbar.policy.ConfigurationController;
-
-/**
- * A view that only shows its drawable while the phone is charging.
- *
- * Also reloads its drawable upon density changes.
- */
-public class ChargingView extends ImageView implements
- BatteryController.BatteryStateChangeCallback,
- ConfigurationController.ConfigurationListener {
-
- private static final long CHARGING_INDICATION_DELAY_MS = 1000;
-
- private final AmbientDisplayConfiguration mConfig;
- private final Runnable mClearSuppressCharging = this::clearSuppressCharging;
- private BatteryController mBatteryController;
- private int mImageResource;
- private boolean mCharging;
- private boolean mDark;
- private boolean mSuppressCharging;
-
-
- private void clearSuppressCharging() {
- mSuppressCharging = false;
- removeCallbacks(mClearSuppressCharging);
- updateVisibility();
- }
-
- public ChargingView(Context context, @Nullable AttributeSet attrs) {
- super(context, attrs);
-
- mConfig = new AmbientDisplayConfiguration(context);
-
- TypedArray a = context.obtainStyledAttributes(attrs, new int[]{android.R.attr.src});
- int srcResId = a.getResourceId(0, 0);
-
- if (srcResId != 0) {
- mImageResource = srcResId;
- }
-
- a.recycle();
-
- updateVisibility();
- }
-
- @Override
- public void onAttachedToWindow() {
- super.onAttachedToWindow();
- mBatteryController = Dependency.get(BatteryController.class);
- mBatteryController.addCallback(this);
- Dependency.get(ConfigurationController.class).addCallback(this);
- }
-
- @Override
- public void onDetachedFromWindow() {
- super.onDetachedFromWindow();
- mBatteryController.removeCallback(this);
- Dependency.get(ConfigurationController.class).removeCallback(this);
- removeCallbacks(mClearSuppressCharging);
- }
-
- @Override
- public void onBatteryLevelChanged(int level, boolean pluggedIn, boolean charging) {
- boolean startCharging = charging && !mCharging;
- if (startCharging && deviceWillWakeUpWhenPluggedIn() && mDark) {
- // We're about to wake up, and thus don't want to show the indicator just for it to be
- // hidden again.
- clearSuppressCharging();
- mSuppressCharging = true;
- postDelayed(mClearSuppressCharging, CHARGING_INDICATION_DELAY_MS);
- }
- mCharging = charging;
- updateVisibility();
- }
-
- private boolean deviceWillWakeUpWhenPluggedIn() {
- boolean plugTurnsOnScreen = getResources().getBoolean(
- com.android.internal.R.bool.config_unplugTurnsOnScreen);
- boolean aod = mConfig.alwaysOnEnabled(UserHandle.USER_CURRENT);
- return !aod && plugTurnsOnScreen;
- }
-
- @Override
- public void onDensityOrFontScaleChanged() {
- setImageResource(mImageResource);
- }
-
- public void setDark(boolean dark) {
- mDark = dark;
- if (!dark) {
- clearSuppressCharging();
- }
- updateVisibility();
- }
-
- private void updateVisibility() {
- setVisibility(mCharging && !mSuppressCharging && mDark ? VISIBLE : INVISIBLE);
- }
-}
diff --git a/packages/SystemUI/src/com/android/systemui/Dependency.java b/packages/SystemUI/src/com/android/systemui/Dependency.java
index e7e70af..7403ddc 100644
--- a/packages/SystemUI/src/com/android/systemui/Dependency.java
+++ b/packages/SystemUI/src/com/android/systemui/Dependency.java
@@ -40,6 +40,8 @@
import com.android.systemui.plugins.PluginManager;
import com.android.systemui.plugins.PluginManagerImpl;
import com.android.systemui.plugins.VolumeDialogController;
+import com.android.systemui.power.EnhancedEstimates;
+import com.android.systemui.power.EnhancedEstimatesImpl;
import com.android.systemui.power.PowerNotificationWarnings;
import com.android.systemui.power.PowerUI;
import com.android.systemui.statusbar.phone.ConfigurationControllerImpl;
@@ -310,6 +312,8 @@
mProviders.put(OverviewProxyService.class, () -> new OverviewProxyService(mContext));
+ mProviders.put(EnhancedEstimates.class, () -> new EnhancedEstimatesImpl());
+
// Put all dependencies above here so the factory can override them if it wants.
SystemUIFactory.getInstance().injectDependencies(mProviders, mContext);
}
diff --git a/packages/SystemUI/src/com/android/systemui/EmulatedDisplayCutout.java b/packages/SystemUI/src/com/android/systemui/EmulatedDisplayCutout.java
index f41425a..5d2e4d0 100644
--- a/packages/SystemUI/src/com/android/systemui/EmulatedDisplayCutout.java
+++ b/packages/SystemUI/src/com/android/systemui/EmulatedDisplayCutout.java
@@ -16,20 +16,14 @@
package com.android.systemui;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
+
import android.content.Context;
-import android.database.ContentObserver;
import android.graphics.Canvas;
import android.graphics.Color;
import android.graphics.Paint;
import android.graphics.Path;
import android.graphics.PixelFormat;
-import android.graphics.Point;
-import android.graphics.PorterDuff;
-import android.graphics.Region;
-import android.os.Handler;
-import android.os.Looper;
-import android.os.UserHandle;
-import android.provider.Settings;
import android.view.DisplayCutout;
import android.view.Gravity;
import android.view.View;
@@ -41,9 +35,6 @@
import com.android.systemui.statusbar.policy.ConfigurationController;
import com.android.systemui.statusbar.policy.ConfigurationController.ConfigurationListener;
-import java.util.Collections;
-import java.util.List;
-
/**
* Emulates a display cutout by drawing its shape in an overlay as supplied by
* {@link DisplayCutout}.
@@ -101,7 +92,7 @@
PixelFormat.TRANSLUCENT);
lp.privateFlags |= WindowManager.LayoutParams.PRIVATE_FLAG_SHOW_FOR_ALL_USERS
| WindowManager.LayoutParams.PRIVATE_FLAG_IS_ROUNDED_CORNERS_OVERLAY;
- lp.flags2 |= WindowManager.LayoutParams.FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA;
+ lp.layoutInDisplayCutoutMode = LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
lp.setTitle("EmulatedDisplayCutout");
lp.gravity = Gravity.TOP;
return lp;
diff --git a/packages/SystemUI/src/com/android/systemui/RoundedCorners.java b/packages/SystemUI/src/com/android/systemui/RoundedCorners.java
index 6f7a270..c960fa1 100644
--- a/packages/SystemUI/src/com/android/systemui/RoundedCorners.java
+++ b/packages/SystemUI/src/com/android/systemui/RoundedCorners.java
@@ -14,6 +14,8 @@
package com.android.systemui;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
+
import static com.android.systemui.tuner.TunablePadding.FLAG_START;
import static com.android.systemui.tuner.TunablePadding.FLAG_END;
@@ -163,7 +165,7 @@
| WindowManager.LayoutParams.PRIVATE_FLAG_IS_ROUNDED_CORNERS_OVERLAY;
lp.setTitle("RoundedOverlay");
lp.gravity = Gravity.TOP;
- lp.flags2 |= WindowManager.LayoutParams.FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA;
+ lp.layoutInDisplayCutoutMode = LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
return lp;
}
diff --git a/packages/SystemUI/src/com/android/systemui/pip/phone/PipMenuActivity.java b/packages/SystemUI/src/com/android/systemui/pip/phone/PipMenuActivity.java
index bfe07a9..0486a9d 100644
--- a/packages/SystemUI/src/com/android/systemui/pip/phone/PipMenuActivity.java
+++ b/packages/SystemUI/src/com/android/systemui/pip/phone/PipMenuActivity.java
@@ -373,7 +373,7 @@
if (menuState == MENU_STATE_FULL) {
mMenuContainerAnimator.playTogether(menuAnim, settingsAnim, dismissAnim);
} else {
- mMenuContainerAnimator.playTogether(settingsAnim, dismissAnim);
+ mMenuContainerAnimator.playTogether(dismissAnim);
}
mMenuContainerAnimator.setInterpolator(Interpolators.ALPHA_IN);
mMenuContainerAnimator.setDuration(MENU_FADE_DURATION);
diff --git a/packages/SystemUI/src/com/android/systemui/power/EnhancedEstimates.java b/packages/SystemUI/src/com/android/systemui/power/EnhancedEstimates.java
new file mode 100644
index 0000000..8f41a60
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/power/EnhancedEstimates.java
@@ -0,0 +1,8 @@
+package com.android.systemui.power;
+
+public interface EnhancedEstimates {
+
+ boolean isHybridNotificationEnabled();
+
+ Estimate getEstimate();
+}
diff --git a/packages/SystemUI/src/com/android/systemui/power/EnhancedEstimatesImpl.java b/packages/SystemUI/src/com/android/systemui/power/EnhancedEstimatesImpl.java
new file mode 100644
index 0000000..d447542
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/power/EnhancedEstimatesImpl.java
@@ -0,0 +1,16 @@
+package com.android.systemui.power;
+
+import android.util.Log;
+
+public class EnhancedEstimatesImpl implements EnhancedEstimates {
+
+ @Override
+ public boolean isHybridNotificationEnabled() {
+ return false;
+ }
+
+ @Override
+ public Estimate getEstimate() {
+ return null;
+ }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/power/Estimate.java b/packages/SystemUI/src/com/android/systemui/power/Estimate.java
new file mode 100644
index 0000000..12a8f0a
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/power/Estimate.java
@@ -0,0 +1,11 @@
+package com.android.systemui.power;
+
+public class Estimate {
+ public final long estimateMillis;
+ public final boolean isBasedOnUsage;
+
+ public Estimate(long estimateMillis, boolean isBasedOnUsage) {
+ this.estimateMillis = estimateMillis;
+ this.isBasedOnUsage = isBasedOnUsage;
+ }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/power/PowerNotificationWarnings.java b/packages/SystemUI/src/com/android/systemui/power/PowerNotificationWarnings.java
index c29b362..736286f 100644
--- a/packages/SystemUI/src/com/android/systemui/power/PowerNotificationWarnings.java
+++ b/packages/SystemUI/src/com/android/systemui/power/PowerNotificationWarnings.java
@@ -17,40 +17,40 @@
package com.android.systemui.power;
import android.app.Notification;
-import android.app.NotificationChannel;
import android.app.NotificationManager;
import android.app.PendingIntent;
import android.content.BroadcastReceiver;
-import android.content.ContentResolver;
import android.content.Context;
import android.content.DialogInterface;
import android.content.DialogInterface.OnClickListener;
import android.content.DialogInterface.OnDismissListener;
import android.content.Intent;
import android.content.IntentFilter;
+import android.icu.text.MeasureFormat;
+import android.icu.text.MeasureFormat.FormatWidth;
+import android.icu.util.Measure;
+import android.icu.util.MeasureUnit;
import android.media.AudioAttributes;
-import android.net.Uri;
import android.os.AsyncTask;
import android.os.Handler;
import android.os.Looper;
import android.os.PowerManager;
-import android.os.SystemClock;
import android.os.UserHandle;
-import android.provider.Settings;
import android.support.annotation.VisibleForTesting;
+import android.text.format.DateUtils;
import android.util.Slog;
import com.android.internal.messages.nano.SystemMessageProto.SystemMessage;
-import com.android.internal.notification.SystemNotificationChannels;
import com.android.settingslib.Utils;
import com.android.systemui.R;
import com.android.systemui.SystemUI;
-import com.android.systemui.statusbar.phone.StatusBar;
import com.android.systemui.statusbar.phone.SystemUIDialog;
import com.android.systemui.util.NotificationChannels;
import java.io.PrintWriter;
import java.text.NumberFormat;
+import java.util.Locale;
+import java.util.concurrent.TimeUnit;
public class PowerNotificationWarnings implements PowerUI.WarningsUI {
private static final String TAG = PowerUI.TAG + ".Notification";
@@ -96,8 +96,9 @@
private long mScreenOffTime;
private int mShowing;
- private long mBucketDroppedNegativeTimeMs;
+ private long mWarningTriggerTimeMs;
+ private Estimate mEstimate;
private boolean mWarning;
private boolean mPlaySound;
private boolean mInvalidCharger;
@@ -130,14 +131,22 @@
public void update(int batteryLevel, int bucket, long screenOffTime) {
mBatteryLevel = batteryLevel;
if (bucket >= 0) {
- mBucketDroppedNegativeTimeMs = 0;
+ mWarningTriggerTimeMs = 0;
} else if (bucket < mBucket) {
- mBucketDroppedNegativeTimeMs = System.currentTimeMillis();
+ mWarningTriggerTimeMs = System.currentTimeMillis();
}
mBucket = bucket;
mScreenOffTime = screenOffTime;
}
+ @Override
+ public void updateEstimate(Estimate estimate) {
+ mEstimate = estimate;
+ if (estimate.estimateMillis <= PowerUI.THREE_HOURS_IN_MILLIS) {
+ mWarningTriggerTimeMs = System.currentTimeMillis();
+ }
+ }
+
private void updateNotification() {
if (DEBUG) Slog.d(TAG, "updateNotification mWarning=" + mWarning + " mPlaySound="
+ mPlaySound + " mInvalidCharger=" + mInvalidCharger);
@@ -171,25 +180,43 @@
mNoMan.notifyAsUser(TAG_BATTERY, SystemMessage.NOTE_BAD_CHARGER, n, UserHandle.ALL);
}
- private void showWarningNotification() {
- final int textRes = R.string.battery_low_percent_format;
+ protected void showWarningNotification() {
final String percentage = NumberFormat.getPercentInstance().format((double) mBatteryLevel / 100.0);
+ // get standard notification copy
+ String title = mContext.getString(R.string.battery_low_title);
+ String contentText = mContext.getString(R.string.battery_low_percent_format, percentage);
+
+ // override notification copy if hybrid notification enabled
+ if (mEstimate != null) {
+ title = mContext.getString(R.string.battery_low_title_hybrid);
+ contentText = mContext.getString(
+ mEstimate.isBasedOnUsage
+ ? R.string.battery_low_percent_format_hybrid
+ : R.string.battery_low_percent_format_hybrid_short,
+ percentage,
+ getTimeRemainingFormatted());
+ }
+
final Notification.Builder nb =
new Notification.Builder(mContext, NotificationChannels.BATTERY)
.setSmallIcon(R.drawable.ic_power_low)
// Bump the notification when the bucket dropped.
- .setWhen(mBucketDroppedNegativeTimeMs)
+ .setWhen(mWarningTriggerTimeMs)
.setShowWhen(false)
- .setContentTitle(mContext.getString(R.string.battery_low_title))
- .setContentText(mContext.getString(textRes, percentage))
+ .setContentTitle(title)
+ .setContentText(contentText)
.setOnlyAlertOnce(true)
.setDeleteIntent(pendingBroadcast(ACTION_DISMISSED_WARNING))
- .setVisibility(Notification.VISIBILITY_PUBLIC)
- .setColor(Utils.getColorAttr(mContext, android.R.attr.colorError));
+ .setVisibility(Notification.VISIBILITY_PUBLIC);
if (hasBatterySettings()) {
nb.setContentIntent(pendingBroadcast(ACTION_SHOW_BATTERY_SETTINGS));
}
+ // Make the notification red if the percentage goes below a certain amount or the time
+ // remaining estimate is disabled
+ if (mEstimate == null || mBucket < 0) {
+ nb.setColor(Utils.getColorAttr(mContext, android.R.attr.colorError));
+ }
nb.addAction(0,
mContext.getString(R.string.battery_saver_start_action),
pendingBroadcast(ACTION_START_SAVER));
@@ -201,6 +228,23 @@
mNoMan.notifyAsUser(TAG_BATTERY, SystemMessage.NOTE_POWER_LOW, n, UserHandle.ALL);
}
+ @VisibleForTesting
+ String getTimeRemainingFormatted() {
+ final Locale currentLocale = mContext.getResources().getConfiguration().getLocales().get(0);
+ MeasureFormat frmt = MeasureFormat.getInstance(currentLocale, FormatWidth.NARROW);
+
+ final long remainder = mEstimate.estimateMillis % DateUtils.HOUR_IN_MILLIS;
+ final long hours = TimeUnit.MILLISECONDS.toHours(
+ mEstimate.estimateMillis - remainder);
+ // round down to the nearest 15 min for now to not appear overly precise
+ final long minutes = TimeUnit.MILLISECONDS.toMinutes(
+ remainder - (remainder % TimeUnit.MINUTES.toMillis(15)));
+ final Measure hoursMeasure = new Measure(hours, MeasureUnit.HOUR);
+ final Measure minutesMeasure = new Measure(minutes, MeasureUnit.MINUTE);
+
+ return frmt.formatMeasures(hoursMeasure, minutesMeasure);
+ }
+
private PendingIntent pendingBroadcast(String action) {
return PendingIntent.getBroadcastAsUser(mContext,
0, new Intent(action), 0, UserHandle.CURRENT);
diff --git a/packages/SystemUI/src/com/android/systemui/power/PowerUI.java b/packages/SystemUI/src/com/android/systemui/power/PowerUI.java
index a351c09..c5aab60 100644
--- a/packages/SystemUI/src/com/android/systemui/power/PowerUI.java
+++ b/packages/SystemUI/src/com/android/systemui/power/PowerUI.java
@@ -52,6 +52,7 @@
import java.io.FileDescriptor;
import java.io.PrintWriter;
import java.util.Arrays;
+import java.util.concurrent.TimeUnit;
public class PowerUI extends SystemUI {
static final String TAG = "PowerUI";
@@ -59,6 +60,7 @@
private static final long TEMPERATURE_INTERVAL = 30 * DateUtils.SECOND_IN_MILLIS;
private static final long TEMPERATURE_LOGGING_INTERVAL = DateUtils.HOUR_IN_MILLIS;
private static final int MAX_RECENT_TEMPS = 125; // TEMPERATURE_LOGGING_INTERVAL plus a buffer
+ static final long THREE_HOURS_IN_MILLIS = DateUtils.HOUR_IN_MILLIS * 3;
private final Handler mHandler = new Handler();
private final Receiver mReceiver = new Receiver();
@@ -68,9 +70,11 @@
private WarningsUI mWarnings;
private final Configuration mLastConfiguration = new Configuration();
private int mBatteryLevel = 100;
+ private long mTimeRemaining = Long.MAX_VALUE;
private int mBatteryStatus = BatteryManager.BATTERY_STATUS_UNKNOWN;
private int mPlugType = 0;
private int mInvalidCharger = 0;
+ private EnhancedEstimates mEnhancedEstimates;
private int mLowBatteryAlertCloseLevel;
private final int[] mLowBatteryReminderLevels = new int[2];
@@ -83,8 +87,8 @@
private long mNextLogTime;
private IThermalService mThermalService;
- // We create a method reference here so that we are guaranteed that we can remove a callback
// by using the same instance (method references are not guaranteed to be the same object
+ // We create a method reference here so that we are guaranteed that we can remove a callback
// each time they are created).
private final Runnable mUpdateTempCallback = this::updateTemperatureWarning;
@@ -94,6 +98,7 @@
mContext.getSystemService(Context.HARDWARE_PROPERTIES_SERVICE);
mScreenOffTime = mPowerManager.isScreenOn() ? -1 : SystemClock.elapsedRealtime();
mWarnings = Dependency.get(WarningsUI.class);
+ mEnhancedEstimates = Dependency.get(EnhancedEstimates.class);
mLastConfiguration.setTo(mContext.getResources().getConfiguration());
ContentObserver obs = new ContentObserver(mHandler) {
@@ -236,21 +241,9 @@
return;
}
- boolean isPowerSaver = mPowerManager.isPowerSaveMode();
- if (!plugged
- && !isPowerSaver
- && (bucket < oldBucket || oldPlugged)
- && mBatteryStatus != BatteryManager.BATTERY_STATUS_UNKNOWN
- && bucket < 0) {
+ // Show the correct version of low battery warning if needed
+ maybeShowBatteryWarning(plugged, oldPlugged, oldBucket, bucket);
- // only play SFX when the dialog comes up or the bucket changes
- final boolean playSound = bucket != oldBucket || oldPlugged;
- mWarnings.showLowBatteryWarning(playSound);
- } else if (isPowerSaver || plugged || (bucket > oldBucket && bucket > 0)) {
- mWarnings.dismissLowBatteryWarning();
- } else {
- mWarnings.updateLowBatteryWarning();
- }
} else if (Intent.ACTION_SCREEN_OFF.equals(action)) {
mScreenOffTime = SystemClock.elapsedRealtime();
} else if (Intent.ACTION_SCREEN_ON.equals(action)) {
@@ -261,7 +254,65 @@
Slog.w(TAG, "unknown intent: " + intent);
}
}
- };
+ }
+
+ protected void maybeShowBatteryWarning(boolean plugged, boolean oldPlugged, int oldBucket,
+ int bucket) {
+ boolean isPowerSaver = mPowerManager.isPowerSaveMode();
+ // only play SFX when the dialog comes up or the bucket changes
+ final boolean playSound = bucket != oldBucket || oldPlugged;
+ long oldTimeRemaining = mTimeRemaining;
+ if (mEnhancedEstimates.isHybridNotificationEnabled()) {
+ final Estimate estimate = mEnhancedEstimates.getEstimate();
+ // Turbo is not always booted once SysUI is running so we have ot make sure we actually
+ // get data back
+ if (estimate != null) {
+ mTimeRemaining = estimate.estimateMillis;
+ mWarnings.updateEstimate(estimate);
+ }
+ }
+
+ if (shouldShowLowBatteryWarning(plugged, oldPlugged, oldBucket, bucket, oldTimeRemaining,
+ mTimeRemaining,
+ isPowerSaver, mBatteryStatus)) {
+ mWarnings.showLowBatteryWarning(playSound);
+ } else if (shouldDismissLowBatteryWarning(plugged, oldBucket, bucket, mTimeRemaining,
+ isPowerSaver)) {
+ mWarnings.dismissLowBatteryWarning();
+ } else {
+ mWarnings.updateLowBatteryWarning();
+ }
+ }
+
+ @VisibleForTesting
+ boolean shouldShowLowBatteryWarning(boolean plugged, boolean oldPlugged, int oldBucket,
+ int bucket, long oldTimeRemaining, long timeRemaining,
+ boolean isPowerSaver, int mBatteryStatus) {
+ return !plugged
+ && !isPowerSaver
+ && (((bucket < oldBucket || oldPlugged) && bucket < 0)
+ || (mEnhancedEstimates.isHybridNotificationEnabled()
+ && timeRemaining < THREE_HOURS_IN_MILLIS
+ && isHourLess(oldTimeRemaining, timeRemaining)))
+ && mBatteryStatus != BatteryManager.BATTERY_STATUS_UNKNOWN;
+ }
+
+ private boolean isHourLess(long oldTimeRemaining, long timeRemaining) {
+ final long dif = oldTimeRemaining - timeRemaining;
+ return dif >= TimeUnit.HOURS.toMillis(1);
+ }
+
+ @VisibleForTesting
+ boolean shouldDismissLowBatteryWarning(boolean plugged, int oldBucket, int bucket,
+ long timeRemaining, boolean isPowerSaver) {
+ final boolean hybridWouldDismiss = mEnhancedEstimates.isHybridNotificationEnabled()
+ && timeRemaining > THREE_HOURS_IN_MILLIS;
+ final boolean standardWouldDismiss = (bucket > oldBucket && bucket > 0);
+ return isPowerSaver
+ || plugged
+ || (standardWouldDismiss && (!mEnhancedEstimates.isHybridNotificationEnabled()
+ || hybridWouldDismiss));
+ }
private void initTemperatureWarning() {
ContentResolver resolver = mContext.getContentResolver();
@@ -433,6 +484,7 @@
public interface WarningsUI {
void update(int batteryLevel, int bucket, long screenOffTime);
+ void updateEstimate(Estimate estimate);
void dismissLowBatteryWarning();
void showLowBatteryWarning(boolean playSound);
void dismissInvalidChargerWarning();
diff --git a/packages/SystemUI/src/com/android/systemui/qs/QSContainerImpl.java b/packages/SystemUI/src/com/android/systemui/qs/QSContainerImpl.java
index 33b5268..7f0acc2 100644
--- a/packages/SystemUI/src/com/android/systemui/qs/QSContainerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/qs/QSContainerImpl.java
@@ -17,13 +17,18 @@
package com.android.systemui.qs;
import android.content.Context;
+import android.graphics.Canvas;
+import android.graphics.Path;
import android.graphics.Point;
import android.util.AttributeSet;
+import android.util.Log;
import android.view.View;
import android.widget.FrameLayout;
+import com.android.settingslib.Utils;
import com.android.systemui.R;
import com.android.systemui.qs.customize.QSCustomizer;
+import com.android.systemui.statusbar.ExpandableOutlineView;
/**
* Wrapper view with background which contains {@link QSPanel} and {@link BaseStatusBarHeader}
@@ -31,6 +36,7 @@
public class QSContainerImpl extends FrameLayout {
private final Point mSizePoint = new Point();
+ private final Path mClipPath = new Path();
private int mHeightOverride = -1;
protected View mQSPanel;
@@ -40,6 +46,7 @@
private QSCustomizer mQSCustomizer;
private View mQSFooter;
private float mFullElevation;
+ private float mRadius;
public QSContainerImpl(Context context, AttributeSet attrs) {
super(context, attrs);
@@ -54,6 +61,8 @@
mQSCustomizer = findViewById(R.id.qs_customize);
mQSFooter = findViewById(R.id.qs_footer);
mFullElevation = mQSPanel.getElevation();
+ mRadius = getResources().getDimensionPixelSize(
+ Utils.getThemeAttr(mContext, android.R.attr.dialogCornerRadius));
setClickable(true);
setImportantForAccessibility(IMPORTANT_FOR_ACCESSIBILITY_NO);
@@ -93,6 +102,18 @@
updateExpansion();
}
+ @Override
+ protected boolean drawChild(Canvas canvas, View child, long drawingTime) {
+ boolean ret;
+ canvas.save();
+ if (child != mQSCustomizer) {
+ canvas.clipPath(mClipPath);
+ }
+ ret = super.drawChild(canvas, child, drawingTime);
+ canvas.restore();
+ return ret;
+ }
+
/**
* Overrides the height of this view (post-layout), so that the content is clipped to that
* height and the background is set to that height.
@@ -110,6 +131,10 @@
mQSDetail.setBottom(getTop() + height);
// Pin QS Footer to the bottom of the panel.
mQSFooter.setTranslationY(height - mQSFooter.getHeight());
+
+ ExpandableOutlineView.getRoundedRectPath(0, 0, getWidth(), height, mRadius,
+ mRadius,
+ mClipPath);
}
protected int calculateContainerHeight() {
diff --git a/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSIconViewImpl.java b/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSIconViewImpl.java
index c249e37..0f83078 100644
--- a/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSIconViewImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSIconViewImpl.java
@@ -103,7 +103,7 @@
if (iv instanceof SlashImageView) {
((SlashImageView) iv).setAnimationEnabled(shouldAnimate);
- ((SlashImageView) iv).setState(state.slash, d);
+ ((SlashImageView) iv).setState(null, d);
} else {
iv.setImageDrawable(d);
}
diff --git a/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSTileBaseView.java b/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSTileBaseView.java
index 4d0e60d..acd327b 100644
--- a/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSTileBaseView.java
+++ b/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSTileBaseView.java
@@ -13,7 +13,12 @@
*/
package com.android.systemui.qs.tileimpl;
+import static com.android.systemui.qs.tileimpl.QSIconViewImpl.QS_ANIM_LENGTH;
+
+import android.animation.ObjectAnimator;
+import android.animation.ValueAnimator;
import android.content.Context;
+import android.content.res.ColorStateList;
import android.content.res.TypedArray;
import android.graphics.drawable.Drawable;
import android.graphics.drawable.RippleDrawable;
@@ -22,16 +27,21 @@
import android.os.Message;
import android.service.quicksettings.Tile;
import android.text.TextUtils;
+import android.util.Log;
import android.view.Gravity;
import android.view.View;
import android.view.ViewGroup;
import android.view.accessibility.AccessibilityEvent;
import android.view.accessibility.AccessibilityNodeInfo;
import android.widget.FrameLayout;
+import android.widget.ImageView;
+import android.widget.ImageView.ScaleType;
import android.widget.Switch;
+import com.android.settingslib.Utils;
import com.android.systemui.R;
-import com.android.systemui.plugins.qs.*;
+import com.android.systemui.plugins.qs.QSIconView;
+import com.android.systemui.plugins.qs.QSTile;
import com.android.systemui.plugins.qs.QSTile.BooleanState;
public class QSTileBaseView extends com.android.systemui.plugins.qs.QSTileView {
@@ -47,6 +57,12 @@
private boolean mCollapsedView;
private boolean mClicked;
+ private final ImageView mBg;
+ private final int mColorActive;
+ private final int mColorInactive;
+ private final int mColorDisabled;
+ private int mCircleColor;
+
public QSTileBaseView(Context context, QSIconView icon) {
this(context, icon, false);
}
@@ -60,6 +76,10 @@
mIconFrame.setForegroundGravity(Gravity.CENTER);
int size = context.getResources().getDimensionPixelSize(R.dimen.qs_quick_tile_size);
addView(mIconFrame, new LayoutParams(size, size));
+ mBg = new ImageView(getContext());
+ mBg.setScaleType(ScaleType.FIT_CENTER);
+ mBg.setImageResource(R.drawable.ic_qs_circle);
+ mIconFrame.addView(mBg);
mIcon = icon;
FrameLayout.LayoutParams params = new FrameLayout.LayoutParams(
ViewGroup.LayoutParams.WRAP_CONTENT, ViewGroup.LayoutParams.WRAP_CONTENT);
@@ -73,6 +93,11 @@
setImportantForAccessibility(View.IMPORTANT_FOR_ACCESSIBILITY_YES);
setBackground(mTileBackground);
+ mColorActive = Utils.getColorAttr(context, android.R.attr.colorAccent);
+ mColorDisabled = Utils.getDisabled(context,
+ Utils.getColorAttr(context, android.R.attr.textColorTertiary));
+ mColorInactive = Utils.getColorAttr(context, android.R.attr.textColorSecondary);
+
setPadding(0, 0, 0, 0);
setClipChildren(false);
setClipToPadding(false);
@@ -80,6 +105,10 @@
setFocusable(true);
}
+ public View getBgCicle() {
+ return mBg;
+ }
+
protected Drawable newTileBackground() {
final int[] attrs = new int[]{android.R.attr.selectableItemBackgroundBorderless};
final TypedArray ta = getContext().obtainStyledAttributes(attrs);
@@ -150,6 +179,20 @@
}
protected void handleStateChanged(QSTile.State state) {
+ int circleColor = getCircleColor(state.state);
+ if (circleColor != mCircleColor) {
+ if (mBg.isShown()) {
+ ValueAnimator animator = ValueAnimator.ofArgb(mCircleColor, circleColor)
+ .setDuration(QS_ANIM_LENGTH);
+ animator.addUpdateListener(animation -> mBg.setImageTintList(ColorStateList.valueOf(
+ (Integer) animation.getAnimatedValue())));
+ animator.start();
+ } else {
+ QSIconViewImpl.setTint(mBg, circleColor);
+ }
+ mCircleColor = circleColor;
+ }
+
setClickable(state.state != Tile.STATE_UNAVAILABLE);
mIcon.setIcon(state);
setContentDescription(state.contentDescription);
@@ -163,6 +206,19 @@
}
}
+ private int getCircleColor(int state) {
+ switch (state) {
+ case Tile.STATE_ACTIVE:
+ return mColorActive;
+ case Tile.STATE_INACTIVE:
+ case Tile.STATE_UNAVAILABLE:
+ return mColorDisabled;
+ default:
+ Log.e(TAG, "Invalid state " + state);
+ return 0;
+ }
+ }
+
@Override
public void setClickable(boolean clickable) {
super.setClickable(clickable);
diff --git a/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSTileImpl.java b/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSTileImpl.java
index 576a447..72592829 100644
--- a/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSTileImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/qs/tileimpl/QSTileImpl.java
@@ -373,11 +373,11 @@
switch (state) {
case Tile.STATE_UNAVAILABLE:
return Utils.getDisabled(context,
- Utils.getColorAttr(context, android.R.attr.colorForeground));
+ Utils.getColorAttr(context, android.R.attr.textColorSecondary));
case Tile.STATE_INACTIVE:
- return Utils.getColorAttr(context, android.R.attr.textColorHint);
+ return Utils.getColorAttr(context, android.R.attr.textColorSecondary);
case Tile.STATE_ACTIVE:
- return Utils.getColorAttr(context, android.R.attr.textColorPrimary);
+ return Utils.getColorAttr(context, android.R.attr.colorPrimary);
default:
Log.e("QSTile", "Invalid state " + state);
return 0;
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/KeyguardIndicationController.java b/packages/SystemUI/src/com/android/systemui/statusbar/KeyguardIndicationController.java
index 85400a1..43047ed6 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/KeyguardIndicationController.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/KeyguardIndicationController.java
@@ -52,6 +52,8 @@
import com.android.systemui.util.wakelock.SettableWakeLock;
import com.android.systemui.util.wakelock.WakeLock;
+import java.text.NumberFormat;
+
/**
* Controls the indications and error messages shown on the Keyguard
*/
@@ -87,6 +89,7 @@
private boolean mPowerCharged;
private int mChargingSpeed;
private int mChargingWattage;
+ private int mBatteryLevel;
private String mMessageToShowOnScreenOn;
private KeyguardUpdateMonitorCallback mUpdateMonitorCallback;
@@ -285,14 +288,18 @@
// Walk down a precedence-ordered list of what indication
// should be shown based on user or device state
if (mDozing) {
- // If we're dozing, never show a persistent indication.
+ mTextView.setTextColor(Color.WHITE);
if (!TextUtils.isEmpty(mTransientIndication)) {
// When dozing we ignore any text color and use white instead, because
// colors can be hard to read in low brightness.
- mTextView.setTextColor(Color.WHITE);
mTextView.switchIndication(mTransientIndication);
+ } else if (mPowerPluggedIn) {
+ String indication = computePowerIndication();
+ mTextView.switchIndication(indication);
} else {
- mTextView.switchIndication(null);
+ String percentage = NumberFormat.getPercentInstance()
+ .format(mBatteryLevel / 100f);
+ mTextView.switchIndication(percentage);
}
return;
}
@@ -422,6 +429,7 @@
mPowerCharged = status.isCharged();
mChargingWattage = status.maxChargingWattage;
mChargingSpeed = status.getChargingSpeed(mSlowThreshold, mFastThreshold);
+ mBatteryLevel = status.level;
updateIndication();
if (mDozing) {
if (!wasPluggedIn && mPowerPluggedIn) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/ButtonDispatcher.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/ButtonDispatcher.java
index 78ee040..9b123cb 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/ButtonDispatcher.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/ButtonDispatcher.java
@@ -14,7 +14,6 @@
package com.android.systemui.statusbar.phone;
-import android.graphics.drawable.Drawable;
import android.view.View;
import com.android.systemui.plugins.statusbar.phone.NavBarButtonProvider.ButtonInterface;
@@ -39,6 +38,7 @@
private Integer mAlpha;
private Float mDarkIntensity;
private Integer mVisibility = -1;
+ private Boolean mDelayTouchFeedback;
private KeyButtonDrawable mImageDrawable;
private View mCurrentView;
private boolean mVertical;
@@ -71,10 +71,10 @@
if (mImageDrawable != null) {
((ButtonInterface) view).setImageDrawable(mImageDrawable);
}
-
- if (view instanceof ButtonInterface) {
- ((ButtonInterface) view).setVertical(mVertical);
+ if (mDelayTouchFeedback != null) {
+ ((ButtonInterface) view).setDelayTouchFeedback(mDelayTouchFeedback);
}
+ ((ButtonInterface) view).setVertical(mVertical);
}
public int getId() {
@@ -134,6 +134,14 @@
}
}
+ public void setDelayTouchFeedback(boolean delay) {
+ mDelayTouchFeedback = delay;
+ final int N = mViews.size();
+ for (int i = 0; i < N; i++) {
+ ((ButtonInterface) mViews.get(i)).setDelayTouchFeedback(delay);
+ }
+ }
+
public void setOnClickListener(View.OnClickListener clickListener) {
mClickListener = clickListener;
final int N = mViews.size();
@@ -166,6 +174,14 @@
}
}
+ public void setClickable(boolean clickable) {
+ abortCurrentGesture();
+ final int N = mViews.size();
+ for (int i = 0; i < N; i++) {
+ mViews.get(i).setClickable(clickable);
+ }
+ }
+
public ArrayList<View> getViews() {
return mViews;
}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardBottomAreaView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardBottomAreaView.java
index 01b3b44..ca66e98 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardBottomAreaView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardBottomAreaView.java
@@ -51,6 +51,7 @@
import android.text.TextUtils;
import android.util.AttributeSet;
import android.util.Log;
+import android.util.MathUtils;
import android.util.TypedValue;
import android.view.View;
import android.view.ViewGroup;
@@ -166,6 +167,10 @@
private String mLeftButtonStr;
private LockscreenGestureLogger mLockscreenGestureLogger = new LockscreenGestureLogger();
private boolean mDozing;
+ private int mIndicationBottomMargin;
+ private int mIndicationBottomMarginAmbient;
+ private float mDarkAmount;
+ private int mBurnInXOffset;
public KeyguardBottomAreaView(Context context) {
this(context, null);
@@ -235,6 +240,10 @@
mEnterpriseDisclosure = findViewById(
R.id.keyguard_indication_enterprise_disclosure);
mIndicationText = findViewById(R.id.keyguard_indication_text);
+ mIndicationBottomMargin = getResources().getDimensionPixelSize(
+ R.dimen.keyguard_indication_margin_bottom);
+ mIndicationBottomMarginAmbient = getResources().getDimensionPixelSize(
+ R.dimen.keyguard_indication_margin_bottom_ambient);
updateCameraVisibility();
mUnlockMethodCache = UnlockMethodCache.getInstance(getContext());
mUnlockMethodCache.addListener(this);
@@ -303,11 +312,13 @@
@Override
protected void onConfigurationChanged(Configuration newConfig) {
super.onConfigurationChanged(newConfig);
- int indicationBottomMargin = getResources().getDimensionPixelSize(
+ mIndicationBottomMargin = getResources().getDimensionPixelSize(
R.dimen.keyguard_indication_margin_bottom);
+ mIndicationBottomMarginAmbient = getResources().getDimensionPixelSize(
+ R.dimen.keyguard_indication_margin_bottom_ambient);
MarginLayoutParams mlp = (MarginLayoutParams) mIndicationArea.getLayoutParams();
- if (mlp.bottomMargin != indicationBottomMargin) {
- mlp.bottomMargin = indicationBottomMargin;
+ if (mlp.bottomMargin != mIndicationBottomMargin) {
+ mlp.bottomMargin = mIndicationBottomMargin;
mIndicationArea.setLayoutParams(mlp);
}
@@ -543,6 +554,22 @@
}
}
+ public void setDarkAmount(float darkAmount) {
+ if (darkAmount == mDarkAmount) {
+ return;
+ }
+ mDarkAmount = darkAmount;
+ // Let's randomize the bottom margin every time we wake up to avoid burn-in.
+ if (darkAmount == 0) {
+ mIndicationBottomMarginAmbient = getResources().getDimensionPixelSize(
+ R.dimen.keyguard_indication_margin_bottom_ambient)
+ + (int) (Math.random() * mIndicationText.getTextSize());
+ }
+ mIndicationArea.setAlpha(MathUtils.lerp(1f, 0.7f, darkAmount));
+ mIndicationArea.setTranslationY(MathUtils.lerp(0,
+ mIndicationBottomMargin - mIndicationBottomMarginAmbient, darkAmount));
+ }
+
private static boolean isSuccessfulLaunch(int result) {
return result == ActivityManager.START_SUCCESS
|| result == ActivityManager.START_DELIVERED_TO_TOP
@@ -687,11 +714,6 @@
if (mRightAffordanceView.getVisibility() == View.VISIBLE) {
startFinishDozeAnimationElement(mRightAffordanceView, delay);
}
- mIndicationArea.setAlpha(0f);
- mIndicationArea.animate()
- .alpha(1f)
- .setInterpolator(Interpolators.LINEAR_OUT_SLOW_IN)
- .setDuration(NotificationPanelView.DOZE_ANIMATION_DURATION);
}
private void startFinishDozeAnimationElement(View element, long delay) {
@@ -815,6 +837,22 @@
}
}
+ public void dozeTimeTick() {
+ if (mDarkAmount == 1) {
+ // Move indication every minute to avoid burn-in
+ final int dozeTranslation = mIndicationBottomMargin - mIndicationBottomMarginAmbient;
+ mIndicationArea.setTranslationY(dozeTranslation + (float) Math.random() * 5);
+ }
+ }
+
+ public void setBurnInXOffset(int burnInXOffset) {
+ if (mBurnInXOffset == burnInXOffset) {
+ return;
+ }
+ mBurnInXOffset = burnInXOffset;
+ mIndicationArea.setTranslationX(burnInXOffset);
+ }
+
private class DefaultLeftButton implements IntentButton {
private IconState mIconState = new IconState();
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/LockIcon.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/LockIcon.java
index 34486db..264f574 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/LockIcon.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/LockIcon.java
@@ -250,7 +250,7 @@
}
break;
case STATE_FACE_UNLOCK:
- iconRes = R.drawable.ic_account_circle;
+ iconRes = R.drawable.ic_face_unlock;
break;
case STATE_FINGERPRINT:
// If screen is off and device asleep, use the draw on animation so the first frame
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarGestureHelper.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarGestureHelper.java
index 6f636aa..4faa84a 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarGestureHelper.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarGestureHelper.java
@@ -19,15 +19,14 @@
import android.app.ActivityManager;
import android.content.Context;
import android.content.res.Resources;
+import android.graphics.Canvas;
import android.graphics.Matrix;
import android.graphics.Rect;
import android.os.RemoteException;
import android.util.Log;
-import android.view.GestureDetector;
import android.view.MotionEvent;
import android.view.VelocityTracker;
import android.view.View;
-import android.view.ViewConfiguration;
import com.android.internal.logging.nano.MetricsProto.MetricsEvent;
import com.android.internal.policy.DividerSnapAlgorithm.SnapTarget;
@@ -37,6 +36,7 @@
import com.android.systemui.RecentsComponent;
import com.android.systemui.plugins.statusbar.phone.NavGesture.GestureHelper;
import com.android.systemui.shared.recents.IOverviewProxy;
+import com.android.systemui.shared.recents.utilities.Utilities;
import com.android.systemui.stackdivider.Divider;
import com.android.systemui.tuner.TunerService;
@@ -72,6 +72,7 @@
private NavigationBarView mNavigationBarView;
private boolean mIsVertical;
+ private final QuickScrubController mQuickScrubController;
private final int mScrollTouchSlop;
private final Matrix mTransformGlobalMatrix = new Matrix();
private final Matrix mTransformLocalMatrix = new Matrix();
@@ -89,6 +90,7 @@
mContext = context;
Resources r = context.getResources();
mScrollTouchSlop = r.getDimensionPixelSize(R.dimen.navigation_bar_min_swipe_distance);
+ mQuickScrubController = new QuickScrubController(context);
Dependency.get(TunerService.class).addTunable(this, KEY_DOCK_WINDOW_GESTURE);
}
@@ -101,10 +103,12 @@
mRecentsComponent = recentsComponent;
mDivider = divider;
mNavigationBarView = navigationBarView;
+ mQuickScrubController.setComponents(mNavigationBarView);
}
public void setBarState(boolean isVertical, boolean isRTL) {
mIsVertical = isVertical;
+ mQuickScrubController.setBarState(isVertical, isRTL);
}
private boolean proxyMotionEvents(MotionEvent event) {
@@ -126,7 +130,6 @@
public boolean onInterceptTouchEvent(MotionEvent event) {
int action = event.getAction();
- boolean result = false;
switch (action & MotionEvent.ACTION_MASK) {
case MotionEvent.ACTION_DOWN: {
mTouchDownX = (int) event.getX();
@@ -137,24 +140,26 @@
mNavigationBarView.transformMatrixToLocal(mTransformLocalMatrix);
break;
}
- case MotionEvent.ACTION_MOVE: {
- int x = (int) event.getX();
- int y = (int) event.getY();
- int xDiff = Math.abs(x - mTouchDownX);
- int yDiff = Math.abs(y - mTouchDownY);
- boolean exceededTouchSlop = xDiff > mScrollTouchSlop && xDiff > yDiff
- || yDiff > mScrollTouchSlop && yDiff > xDiff;
- if (exceededTouchSlop) {
- result = true;
- }
- break;
- }
- case MotionEvent.ACTION_CANCEL:
- case MotionEvent.ACTION_UP:
- break;
}
- proxyMotionEvents(event);
- return result || (mDockWindowEnabled && interceptDockWindowEvent(event));
+ if (!mQuickScrubController.onInterceptTouchEvent(event)) {
+ proxyMotionEvents(event);
+ return false;
+ }
+ return (mDockWindowEnabled && interceptDockWindowEvent(event));
+ }
+
+ public void onDraw(Canvas canvas) {
+ if (mOverviewEventSender.getProxy() != null) {
+ mQuickScrubController.onDraw(canvas);
+ }
+ }
+
+ public void onLayout(boolean changed, int left, int top, int right, int bottom) {
+ mQuickScrubController.onLayout(changed, left, top, right, bottom);
+ }
+
+ public void onDarkIntensityChange(float intensity) {
+ mQuickScrubController.onDarkIntensityChange(intensity);
}
private boolean interceptDockWindowEvent(MotionEvent event) {
@@ -294,7 +299,7 @@
}
public boolean onTouchEvent(MotionEvent event) {
- boolean result = proxyMotionEvents(event);
+ boolean result = mQuickScrubController.onTouchEvent(event) || proxyMotionEvents(event);
if (mDockWindowEnabled) {
result |= handleDockWindowEvent(event);
}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarTransitions.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarTransitions.java
index bd6421c..b113675 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarTransitions.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarTransitions.java
@@ -138,6 +138,7 @@
if (mAutoDim) {
applyLightsOut(false, true);
}
+ mView.onDarkIntensityChange(darkIntensity);
}
private final View.OnTouchListener mLightsOutListener = new View.OnTouchListener() {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarView.java
index 006a85b..059ce92 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarView.java
@@ -26,6 +26,7 @@
import android.app.StatusBarManager;
import android.content.Context;
import android.content.res.Configuration;
+import android.graphics.Canvas;
import android.graphics.Point;
import android.graphics.Rect;
import android.os.Handler;
@@ -625,6 +626,24 @@
updateRotatedViews();
}
+ public void onDarkIntensityChange(float intensity) {
+ if (mGestureHelper != null) {
+ mGestureHelper.onDarkIntensityChange(intensity);
+ }
+ }
+
+ @Override
+ protected void onDraw(Canvas canvas) {
+ mGestureHelper.onDraw(canvas);
+ super.onDraw(canvas);
+ }
+
+ @Override
+ protected void onLayout(boolean changed, int left, int top, int right, int bottom) {
+ super.onLayout(changed, left, top, right, bottom);
+ mGestureHelper.onLayout(changed, left, top, right, bottom);
+ }
+
private void updateRotatedViews() {
mRotatedViews[Surface.ROTATION_0] =
mRotatedViews[Surface.ROTATION_180] = findViewById(R.id.rot0);
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
index 32675d3..0cc7f5d 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
@@ -478,6 +478,7 @@
}
mNotificationStackScroller.setIntrinsicPadding(stackScrollerPadding);
mNotificationStackScroller.setDarkShelfOffsetX(mClockPositionResult.clockX);
+ mKeyguardBottomArea.setBurnInXOffset(mClockPositionResult.clockX);
requestScrollerTopPaddingUpdate(animate);
}
@@ -2608,7 +2609,8 @@
private void setDarkAmount(float amount) {
mDarkAmount = amount;
- mKeyguardStatusView.setDark(mDarkAmount);
+ mKeyguardStatusView.setDarkAmount(mDarkAmount);
+ mKeyguardBottomArea.setDarkAmount(mDarkAmount);
positionClockAndNotifications();
}
@@ -2630,8 +2632,9 @@
}
}
- public void refreshTime() {
+ public void dozeTimeTick() {
mKeyguardStatusView.refreshTime();
+ mKeyguardBottomArea.dozeTimeTick();
if (mDarkAmount > 0) {
positionClockAndNotifications();
}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/QuickScrubController.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/QuickScrubController.java
new file mode 100644
index 0000000..9f8a7ef
--- /dev/null
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/QuickScrubController.java
@@ -0,0 +1,370 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.systemui.statusbar.phone;
+
+import android.animation.Animator;
+import android.animation.AnimatorListenerAdapter;
+import android.animation.AnimatorSet;
+import android.animation.ObjectAnimator;
+import android.animation.ValueAnimator;
+import android.animation.ValueAnimator.AnimatorUpdateListener;
+import android.content.Context;
+import android.graphics.Canvas;
+import android.graphics.Paint;
+import android.graphics.Rect;
+import android.os.Handler;
+import android.os.RemoteException;
+import android.util.Log;
+import android.util.Slog;
+import android.view.Display;
+import android.view.GestureDetector;
+import android.view.MotionEvent;
+import android.view.View;
+import android.view.ViewConfiguration;
+import android.view.WindowManager;
+import android.view.WindowManagerGlobal;
+import android.view.animation.DecelerateInterpolator;
+import android.view.animation.Interpolator;
+import android.support.annotation.DimenRes;
+import com.android.systemui.Dependency;
+import com.android.systemui.OverviewProxyService;
+import com.android.systemui.R;
+import com.android.systemui.plugins.statusbar.phone.NavGesture.GestureHelper;
+import com.android.systemui.shared.recents.IOverviewProxy;
+import com.android.systemui.shared.recents.utilities.Utilities;
+
+import static android.view.WindowManagerPolicyConstants.NAV_BAR_LEFT;
+import static android.view.WindowManagerPolicyConstants.NAV_BAR_BOTTOM;
+
+/**
+ * Class to detect gestures on the navigation bar and implement quick scrub and switch.
+ */
+public class QuickScrubController extends GestureDetector.SimpleOnGestureListener implements
+ GestureHelper {
+
+ private static final String TAG = "QuickScrubController";
+ private static final int QUICK_SWITCH_FLING_VELOCITY = 0;
+ private static final int ANIM_DURATION_MS = 200;
+ private static final long LONG_PRESS_DELAY_MS = 150;
+
+ /**
+ * For quick step, set a damping value to allow the button to stick closer its origin position
+ * when dragging before quick scrub is active.
+ */
+ private static final int SWITCH_STICKINESS = 4;
+
+ private NavigationBarView mNavigationBarView;
+ private GestureDetector mGestureDetector;
+
+ private boolean mDraggingActive;
+ private boolean mQuickScrubActive;
+ private float mDownOffset;
+ private float mTranslation;
+ private int mTouchDownX;
+ private int mTouchDownY;
+ private boolean mDragPositive;
+ private boolean mIsVertical;
+ private boolean mIsRTL;
+ private float mMaxTrackPaintAlpha;
+
+ private final Handler mHandler = new Handler();
+ private final Interpolator mQuickScrubEndInterpolator = new DecelerateInterpolator();
+ private final Rect mTrackRect = new Rect();
+ private final Rect mHomeButtonRect = new Rect();
+ private final Paint mTrackPaint = new Paint();
+ private final int mScrollTouchSlop;
+ private final OverviewProxyService mOverviewEventSender;
+ private final Display mDisplay;
+ private final int mTrackThickness;
+ private final int mTrackPadding;
+ private final ValueAnimator mTrackAnimator;
+ private final ValueAnimator mButtonAnimator;
+ private final AnimatorSet mQuickScrubEndAnimator;
+ private final Context mContext;
+
+ private final AnimatorUpdateListener mTrackAnimatorListener = valueAnimator -> {
+ mTrackPaint.setAlpha(Math.round((float) valueAnimator.getAnimatedValue() * 255));
+ mNavigationBarView.invalidate();
+ };
+
+ private final AnimatorUpdateListener mButtonTranslationListener = animator -> {
+ int pos = (int) animator.getAnimatedValue();
+ if (!mQuickScrubActive) {
+ pos = mDragPositive ? Math.min((int) mTranslation, pos) : Math.max((int) mTranslation, pos);
+ }
+ final View homeView = mNavigationBarView.getHomeButton().getCurrentView();
+ if (mIsVertical) {
+ homeView.setTranslationY(pos);
+ } else {
+ homeView.setTranslationX(pos);
+ }
+ };
+
+ private AnimatorListenerAdapter mQuickScrubEndListener = new AnimatorListenerAdapter() {
+ @Override
+ public void onAnimationEnd(Animator animation) {
+ mNavigationBarView.getHomeButton().setClickable(true);
+ mQuickScrubActive = false;
+ mTranslation = 0;
+ }
+ };
+
+ private Runnable mLongPressRunnable = this::startQuickScrub;
+
+ private final GestureDetector.SimpleOnGestureListener mGestureListener =
+ new GestureDetector.SimpleOnGestureListener() {
+ @Override
+ public boolean onFling(MotionEvent e1, MotionEvent e2, float velX, float velY) {
+ if (mQuickScrubActive) {
+ return false;
+ }
+ float velocityX = mIsRTL ? -velX : velX;
+ float absVelY = Math.abs(velY);
+ final boolean isValidFling = velocityX > QUICK_SWITCH_FLING_VELOCITY &&
+ mIsVertical ? (absVelY > velocityX) : (velocityX > absVelY);
+ if (isValidFling) {
+ mDraggingActive = false;
+ mButtonAnimator.setIntValues((int) mTranslation, 0);
+ mButtonAnimator.start();
+ mHandler.removeCallbacks(mLongPressRunnable);
+ try {
+ final IOverviewProxy overviewProxy = mOverviewEventSender.getProxy();
+ overviewProxy.onQuickSwitch();
+ } catch (RemoteException e) {
+ Log.e(TAG, "Failed to send start of quick switch.", e);
+ }
+ }
+ return true;
+ }
+ };
+
+ public QuickScrubController(Context context) {
+ mContext = context;
+ mScrollTouchSlop = ViewConfiguration.get(context).getScaledTouchSlop();
+ mDisplay = ((WindowManager) context.getSystemService(
+ Context.WINDOW_SERVICE)).getDefaultDisplay();
+ mOverviewEventSender = Dependency.get(OverviewProxyService.class);
+ mGestureDetector = new GestureDetector(mContext, mGestureListener);
+ mTrackThickness = getDimensionPixelSize(mContext, R.dimen.nav_quick_scrub_track_thickness);
+ mTrackPadding = getDimensionPixelSize(mContext, R.dimen.nav_quick_scrub_track_edge_padding);
+
+ mTrackAnimator = ObjectAnimator.ofFloat();
+ mTrackAnimator.addUpdateListener(mTrackAnimatorListener);
+ mButtonAnimator = ObjectAnimator.ofInt();
+ mButtonAnimator.addUpdateListener(mButtonTranslationListener);
+ mQuickScrubEndAnimator = new AnimatorSet();
+ mQuickScrubEndAnimator.playTogether(mTrackAnimator, mButtonAnimator);
+ mQuickScrubEndAnimator.setDuration(ANIM_DURATION_MS);
+ mQuickScrubEndAnimator.addListener(mQuickScrubEndListener);
+ mQuickScrubEndAnimator.setInterpolator(mQuickScrubEndInterpolator);
+ }
+
+ public void setComponents(NavigationBarView navigationBarView) {
+ mNavigationBarView = navigationBarView;
+ }
+
+ @Override
+ public boolean onInterceptTouchEvent(MotionEvent event) {
+ final IOverviewProxy overviewProxy = mOverviewEventSender.getProxy();
+ final ButtonDispatcher homeButton = mNavigationBarView.getHomeButton();
+ if (overviewProxy == null) {
+ homeButton.setDelayTouchFeedback(false);
+ return false;
+ }
+ mGestureDetector.onTouchEvent(event);
+ int action = event.getAction();
+ switch (action & MotionEvent.ACTION_MASK) {
+ case MotionEvent.ACTION_DOWN: {
+ int x = (int) event.getX();
+ int y = (int) event.getY();
+ if (mHomeButtonRect.contains(x, y)) {
+ mTouchDownX = x;
+ mTouchDownY = y;
+ homeButton.setDelayTouchFeedback(true);
+ mHandler.postDelayed(mLongPressRunnable, LONG_PRESS_DELAY_MS);
+ } else {
+ mTouchDownX = mTouchDownY = -1;
+ }
+ break;
+ }
+ case MotionEvent.ACTION_MOVE: {
+ if (mTouchDownX != -1) {
+ int x = (int) event.getX();
+ int y = (int) event.getY();
+ int xDiff = Math.abs(x - mTouchDownX);
+ int yDiff = Math.abs(y - mTouchDownY);
+ boolean exceededTouchSlop;
+ int pos, touchDown, offset, trackSize;
+ if (mIsVertical) {
+ exceededTouchSlop = yDiff > mScrollTouchSlop && yDiff > xDiff;
+ pos = y;
+ touchDown = mTouchDownY;
+ offset = pos - mTrackRect.top;
+ trackSize = mTrackRect.height();
+ } else {
+ exceededTouchSlop = xDiff > mScrollTouchSlop && xDiff > yDiff;
+ pos = x;
+ touchDown = mTouchDownX;
+ offset = pos - mTrackRect.left;
+ trackSize = mTrackRect.width();
+ }
+ if (!mDragPositive) {
+ offset -= mIsVertical ? mTrackRect.height() : mTrackRect.width();
+ }
+
+ // Control the button movement
+ if (!mDraggingActive && exceededTouchSlop) {
+ boolean allowDrag = !mDragPositive
+ ? offset < 0 && pos < touchDown : offset >= 0 && pos > touchDown;
+ if (allowDrag) {
+ mDownOffset = offset;
+ homeButton.setClickable(false);
+ mDraggingActive = true;
+ }
+ }
+ if (mDraggingActive && (mDragPositive && offset >= 0
+ || !mDragPositive && offset <= 0)) {
+ float scrubFraction =
+ Utilities.clamp(Math.abs(offset) * 1f / trackSize, 0, 1);
+ mTranslation = !mDragPositive
+ ? Utilities.clamp(offset - mDownOffset, -trackSize, 0)
+ : Utilities.clamp(offset - mDownOffset, 0, trackSize);
+ if (mQuickScrubActive) {
+ try {
+ overviewProxy.onQuickScrubProgress(scrubFraction);
+ } catch (RemoteException e) {
+ Log.e(TAG, "Failed to send progress of quick scrub.", e);
+ }
+ } else {
+ mTranslation /= SWITCH_STICKINESS;
+ }
+ if (mIsVertical) {
+ homeButton.getCurrentView().setTranslationY(mTranslation);
+ } else {
+ homeButton.getCurrentView().setTranslationX(mTranslation);
+ }
+ }
+ }
+ break;
+ }
+ case MotionEvent.ACTION_CANCEL:
+ case MotionEvent.ACTION_UP:
+ endQuickScrub();
+ break;
+ }
+ return mDraggingActive || mQuickScrubActive;
+ }
+
+ @Override
+ public void onDraw(Canvas canvas) {
+ canvas.drawRect(mTrackRect, mTrackPaint);
+ }
+
+ @Override
+ public void onLayout(boolean changed, int left, int top, int right, int bottom) {
+ final int width = right - left;
+ final int height = bottom - top;
+ final int x1, x2, y1, y2;
+ if (mIsVertical) {
+ x1 = (width - mTrackThickness) / 2;
+ x2 = x1 + mTrackThickness;
+ y1 = mDragPositive ? height / 2 : mTrackPadding;
+ y2 = y1 + height / 2 - mTrackPadding;
+ } else {
+ y1 = (height - mTrackThickness) / 2;
+ y2 = y1 + mTrackThickness;
+ x1 = mDragPositive ? width / 2 : mTrackPadding;
+ x2 = x1 + width / 2 - mTrackPadding;
+ }
+ mTrackRect.set(x1, y1, x2, y2);
+
+ // Get the touch rect of the home button location
+ View homeView = mNavigationBarView.getHomeButton().getCurrentView();
+ int[] globalHomePos = homeView.getLocationOnScreen();
+ int[] globalNavBarPos = mNavigationBarView.getLocationOnScreen();
+ int homeX = globalHomePos[0] - globalNavBarPos[0];
+ int homeY = globalHomePos[1] - globalNavBarPos[1];
+ mHomeButtonRect.set(homeX, homeY, homeX + homeView.getMeasuredWidth(),
+ homeY + homeView.getMeasuredHeight());
+ }
+
+ @Override
+ public void onDarkIntensityChange(float intensity) {
+ if (intensity == 0) {
+ mTrackPaint.setColor(mContext.getColor(R.color.quick_step_track_background_light));
+ } else if (intensity == 1) {
+ mTrackPaint.setColor(mContext.getColor(R.color.quick_step_track_background_dark));
+ }
+ mMaxTrackPaintAlpha = mTrackPaint.getAlpha() * 1f / 255;
+ mTrackPaint.setAlpha(0);
+ }
+
+ @Override
+ public boolean onTouchEvent(MotionEvent event) {
+ if (event.getAction() == MotionEvent.ACTION_UP) {
+ endQuickScrub();
+ }
+ return false;
+ }
+
+ @Override
+ public void setBarState(boolean isVertical, boolean isRTL) {
+ mIsVertical = isVertical;
+ mIsRTL = isRTL;
+ try {
+ int navbarPos = WindowManagerGlobal.getWindowManagerService().getNavBarPosition();
+ mDragPositive = navbarPos == NAV_BAR_LEFT || navbarPos == NAV_BAR_BOTTOM;
+ if (isRTL) {
+ mDragPositive = !mDragPositive;
+ }
+ } catch (RemoteException e) {
+ Slog.e(TAG, "Failed to get nav bar position.", e);
+ }
+ }
+
+ private void startQuickScrub() {
+ if (!mQuickScrubActive) {
+ mQuickScrubActive = true;
+ mTrackAnimator.setFloatValues(0, mMaxTrackPaintAlpha);
+ mTrackAnimator.start();
+ try {
+ mOverviewEventSender.getProxy().onQuickScrubStart();
+ } catch (RemoteException e) {
+ Log.e(TAG, "Failed to send start of quick scrub.", e);
+ }
+ }
+ }
+
+ private void endQuickScrub() {
+ mHandler.removeCallbacks(mLongPressRunnable);
+ if (mDraggingActive || mQuickScrubActive) {
+ mButtonAnimator.setIntValues((int) mTranslation, 0);
+ mTrackAnimator.setFloatValues(mTrackPaint.getAlpha() * 1f / 255, 0);
+ mQuickScrubEndAnimator.start();
+ try {
+ mOverviewEventSender.getProxy().onQuickScrubEnd();
+ } catch (RemoteException e) {
+ Log.e(TAG, "Failed to send end of quick scrub.", e);
+ }
+ }
+ mDraggingActive = false;
+ }
+
+ private int getDimensionPixelSize(Context context, @DimenRes int resId) {
+ return context.getResources().getDimensionPixelSize(resId);
+ }
+}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBar.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBar.java
index 2da1e4d..af65a86 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBar.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBar.java
@@ -1596,7 +1596,7 @@
final boolean hasArtwork = artworkDrawable != null;
- if ((hasArtwork || DEBUG_MEDIA_FAKE_ARTWORK)
+ if ((hasArtwork || DEBUG_MEDIA_FAKE_ARTWORK) && !mDozing
&& (mState != StatusBarState.SHADE || allowWhenShade)
&& mFingerprintUnlockController.getMode()
!= FingerprintUnlockController.MODE_WAKE_AND_UNLOCK_PULSING
@@ -1657,15 +1657,16 @@
}
}
} else {
- // need to hide the album art, either because we are unlocked or because
- // the metadata isn't there to support it
+ // need to hide the album art, either because we are unlocked, on AOD
+ // or because the metadata isn't there to support it
if (mBackdrop.getVisibility() != View.GONE) {
if (DEBUG_MEDIA) {
Log.v(TAG, "DEBUG_MEDIA: Fading out album artwork");
}
+ boolean cannotAnimateDoze = mDozing && !ScrimState.AOD.getAnimateChange();
if (mFingerprintUnlockController.getMode()
== FingerprintUnlockController.MODE_WAKE_AND_UNLOCK_PULSING
- || hideBecauseOccluded) {
+ || hideBecauseOccluded || cannotAnimateDoze) {
// We are unlocking directly - no animation!
mBackdrop.setVisibility(View.GONE);
@@ -4644,7 +4645,7 @@
@Override
public void dozeTimeTick() {
- mNotificationPanel.refreshTime();
+ mNotificationPanel.dozeTimeTick();
}
@Override
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/KeyButtonRipple.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/KeyButtonRipple.java
index cc7943b..a2bec98 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/KeyButtonRipple.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/KeyButtonRipple.java
@@ -26,9 +26,11 @@
import android.graphics.Paint;
import android.graphics.PixelFormat;
import android.graphics.drawable.Drawable;
+import android.os.Handler;
import android.view.DisplayListCanvas;
import android.view.RenderNodeAnimator;
import android.view.View;
+import android.view.ViewConfiguration;
import android.view.animation.Interpolator;
import com.android.systemui.Interpolators;
@@ -56,14 +58,17 @@
private float mGlowAlpha = 0f;
private float mGlowScale = 1f;
private boolean mPressed;
+ private boolean mVisible;
private boolean mDrawingHardwareGlow;
private int mMaxWidth;
private boolean mLastDark;
private boolean mDark;
+ private boolean mDelayTouchFeedback;
private final Interpolator mInterpolator = new LogInterpolator();
private boolean mSupportHardware;
private final View mTargetView;
+ private final Handler mHandler = new Handler();
private final HashSet<Animator> mRunningAnimations = new HashSet<>();
private final ArrayList<Animator> mTmpArray = new ArrayList<>();
@@ -77,6 +82,10 @@
mDark = darkIntensity >= 0.5f;
}
+ public void setDelayTouchFeedback(boolean delay) {
+ mDelayTouchFeedback = delay;
+ }
+
private Paint getRipplePaint() {
if (mRipplePaint == null) {
mRipplePaint = new Paint();
@@ -211,7 +220,16 @@
}
}
+ /**
+ * Abort the ripple while it is delayed and before shown used only when setShouldDelayStartTouch
+ * is enabled.
+ */
+ public void abortDelayedRipple() {
+ mHandler.removeCallbacksAndMessages(null);
+ }
+
private void cancelAnimations() {
+ mVisible = false;
mTmpArray.addAll(mRunningAnimations);
int size = mTmpArray.size();
for (int i = 0; i < size; i++) {
@@ -220,11 +238,21 @@
}
mTmpArray.clear();
mRunningAnimations.clear();
+ mHandler.removeCallbacksAndMessages(null);
}
private void setPressedSoftware(boolean pressed) {
if (pressed) {
- enterSoftware();
+ if (mDelayTouchFeedback) {
+ if (mRunningAnimations.isEmpty()) {
+ mHandler.removeCallbacksAndMessages(null);
+ mHandler.postDelayed(this::enterSoftware, ViewConfiguration.getTapTimeout());
+ } else if (mVisible) {
+ enterSoftware();
+ }
+ } else {
+ enterSoftware();
+ }
} else {
exitSoftware();
}
@@ -232,6 +260,7 @@
private void enterSoftware() {
cancelAnimations();
+ mVisible = true;
mGlowAlpha = getMaxGlowAlpha();
ObjectAnimator scaleAnimator = ObjectAnimator.ofFloat(this, "glowScale",
0f, GLOW_MAX_SCALE_FACTOR);
@@ -240,6 +269,12 @@
scaleAnimator.addListener(mAnimatorListener);
scaleAnimator.start();
mRunningAnimations.add(scaleAnimator);
+
+ // With the delay, it could eventually animate the enter animation with no pressed state,
+ // then immediately show the exit animation. If this is skipped there will be no ripple.
+ if (mDelayTouchFeedback && !mPressed) {
+ exitSoftware();
+ }
}
private void exitSoftware() {
@@ -253,7 +288,16 @@
private void setPressedHardware(boolean pressed) {
if (pressed) {
- enterHardware();
+ if (mDelayTouchFeedback) {
+ if (mRunningAnimations.isEmpty()) {
+ mHandler.removeCallbacksAndMessages(null);
+ mHandler.postDelayed(this::enterHardware, ViewConfiguration.getTapTimeout());
+ } else if (mVisible) {
+ enterHardware();
+ }
+ } else {
+ enterHardware();
+ }
} else {
exitHardware();
}
@@ -302,6 +346,7 @@
private void enterHardware() {
cancelAnimations();
+ mVisible = true;
mDrawingHardwareGlow = true;
setExtendStart(CanvasProperty.createFloat(getExtendSize() / 2));
final RenderNodeAnimator startAnim = new RenderNodeAnimator(getExtendStart(),
@@ -343,6 +388,12 @@
mRunningAnimations.add(endAnim);
invalidateSelf();
+
+ // With the delay, it could eventually animate the enter animation with no pressed state,
+ // then immediately show the exit animation. If this is skipped there will be no ripple.
+ if (mDelayTouchFeedback && !mPressed) {
+ exitHardware();
+ }
}
private void exitHardware() {
@@ -366,6 +417,7 @@
public void onAnimationEnd(Animator animation) {
mRunningAnimations.remove(animation);
if (mRunningAnimations.isEmpty() && !mPressed) {
+ mVisible = false;
mDrawingHardwareGlow = false;
invalidateSelf();
}
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/KeyButtonView.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/KeyButtonView.java
index 0501771..077c6c3 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/KeyButtonView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/KeyButtonView.java
@@ -284,6 +284,7 @@
@Override
public void abortCurrentGesture() {
setPressed(false);
+ mRipple.abortDelayedRipple();
mGestureAborted = true;
}
@@ -301,6 +302,11 @@
}
@Override
+ public void setDelayTouchFeedback(boolean shouldDelay) {
+ mRipple.setDelayTouchFeedback(shouldDelay);
+ }
+
+ @Override
public void setVertical(boolean vertical) {
//no op
}
diff --git a/packages/SystemUI/tests/src/com/android/systemui/power/PowerNotificationWarningsTest.java b/packages/SystemUI/tests/src/com/android/systemui/power/PowerNotificationWarningsTest.java
index 7f07e0c..3e37cfe 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/power/PowerNotificationWarningsTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/power/PowerNotificationWarningsTest.java
@@ -38,6 +38,7 @@
import com.android.systemui.SysuiTestCase;
import com.android.systemui.util.NotificationChannels;
+import java.util.concurrent.TimeUnit;
import org.junit.Before;
import org.junit.Test;
import org.junit.runner.RunWith;
@@ -46,6 +47,9 @@
@SmallTest
@RunWith(AndroidJUnit4.class)
public class PowerNotificationWarningsTest extends SysuiTestCase {
+
+ public static final String FORMATTED_45M = "0h 45m";
+ public static final String FORMATTED_HOUR = "1h 0m";
private final NotificationManager mMockNotificationManager = mock(NotificationManager.class);
private PowerNotificationWarnings mPowerNotificationWarnings;
@@ -147,4 +151,22 @@
verify(mMockNotificationManager, times(1)).cancelAsUser(anyString(),
eq(SystemMessage.NOTE_THERMAL_SHUTDOWN), any());
}
+
+ @Test
+ public void testGetTimeRemainingFormatted_roundsDownTo15() {
+ mPowerNotificationWarnings.updateEstimate(
+ new Estimate(TimeUnit.MINUTES.toMillis(57), true));
+ String time = mPowerNotificationWarnings.getTimeRemainingFormatted();
+
+ assertTrue("time:" + time + ", expected: " + FORMATTED_45M, time.equals(FORMATTED_45M));
+ }
+
+ @Test
+ public void testGetTimeRemainingFormatted_keepsMinutesWhenZero() {
+ mPowerNotificationWarnings.updateEstimate(
+ new Estimate(TimeUnit.MINUTES.toMillis(65), true));
+ String time = mPowerNotificationWarnings.getTimeRemainingFormatted();
+
+ assertTrue("time:" + time + ", expected: " + FORMATTED_HOUR, time.equals(FORMATTED_HOUR));
+ }
}
diff --git a/packages/SystemUI/tests/src/com/android/systemui/power/PowerUITest.java b/packages/SystemUI/tests/src/com/android/systemui/power/PowerUITest.java
index e4734a4..fdb7f8d 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/power/PowerUITest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/power/PowerUITest.java
@@ -19,12 +19,15 @@
import static android.os.HardwarePropertiesManager.TEMPERATURE_SHUTDOWN;
import static android.provider.Settings.Global.SHOW_TEMPERATURE_WARNING;
+import static junit.framework.Assert.assertFalse;
+import static junit.framework.Assert.assertTrue;
import static org.mockito.Mockito.mock;
import static org.mockito.Mockito.never;
import static org.mockito.Mockito.verify;
import static org.mockito.Mockito.when;
import android.content.Context;
+import android.os.BatteryManager;
import android.os.HardwarePropertiesManager;
import android.provider.Settings;
import android.testing.AndroidTestingRunner;
@@ -37,6 +40,7 @@
import com.android.systemui.power.PowerUI.WarningsUI;
import com.android.systemui.statusbar.phone.StatusBar;
+import java.util.concurrent.TimeUnit;
import org.junit.Before;
import org.junit.Test;
import org.junit.runner.RunWith;
@@ -46,14 +50,23 @@
@SmallTest
public class PowerUITest extends SysuiTestCase {
+ private static final boolean UNPLUGGED = false;
+ private static final boolean POWER_SAVER_OFF = false;
+ private static final int ABOVE_WARNING_BUCKET = 1;
+ public static final int BELOW_WARNING_BUCKET = -1;
+ public static final long BELOW_HYBRID_THRESHOLD = TimeUnit.HOURS.toMillis(2);
+ public static final long ABOVE_HYBRID_THRESHOLD = TimeUnit.HOURS.toMillis(4);
private HardwarePropertiesManager mHardProps;
private WarningsUI mMockWarnings;
private PowerUI mPowerUI;
+ private EnhancedEstimates mEnhacedEstimates;
@Before
public void setup() {
mMockWarnings = mDependency.injectMockDependency(WarningsUI.class);
+ mEnhacedEstimates = mDependency.injectMockDependency(EnhancedEstimates.class);
mHardProps = mock(HardwarePropertiesManager.class);
+
mContext.putComponent(StatusBar.class, mock(StatusBar.class));
mContext.addMockSystemService(Context.HARDWARE_PROPERTIES_SERVICE, mHardProps);
@@ -128,6 +141,180 @@
verify(mMockWarnings).showHighTemperatureWarning();
}
+ @Test
+ public void testShouldShowLowBatteryWarning_showHybridOnly_returnsShow() {
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+ mPowerUI.start();
+
+ // unplugged device that would not show the non-hybrid notification but would show the
+ // hybrid
+ boolean shouldShow =
+ mPowerUI.shouldShowLowBatteryWarning(UNPLUGGED, UNPLUGGED, ABOVE_WARNING_BUCKET,
+ ABOVE_WARNING_BUCKET, Long.MAX_VALUE, BELOW_HYBRID_THRESHOLD,
+ POWER_SAVER_OFF, BatteryManager.BATTERY_HEALTH_GOOD);
+ assertTrue(shouldShow);
+ }
+
+ @Test
+ public void testShouldShowLowBatteryWarning_showHybrid_showStandard_returnsShow() {
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+ mPowerUI.start();
+
+ // unplugged device that would show the non-hybrid notification and the hybrid
+ boolean shouldShow =
+ mPowerUI.shouldShowLowBatteryWarning(UNPLUGGED, UNPLUGGED, ABOVE_WARNING_BUCKET,
+ BELOW_WARNING_BUCKET, Long.MAX_VALUE, BELOW_HYBRID_THRESHOLD,
+ POWER_SAVER_OFF, BatteryManager.BATTERY_HEALTH_GOOD);
+ assertTrue(shouldShow);
+ }
+
+ @Test
+ public void testShouldShowLowBatteryWarning_showStandardOnly_returnsShow() {
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+ mPowerUI.start();
+
+ // unplugged device that would show the non-hybrid but not the hybrid
+ boolean shouldShow =
+ mPowerUI.shouldShowLowBatteryWarning(UNPLUGGED, UNPLUGGED, ABOVE_WARNING_BUCKET,
+ BELOW_WARNING_BUCKET, Long.MAX_VALUE, ABOVE_HYBRID_THRESHOLD,
+ POWER_SAVER_OFF, BatteryManager.BATTERY_HEALTH_GOOD);
+ assertTrue(shouldShow);
+ }
+
+ @Test
+ public void testShouldShowLowBatteryWarning_deviceHighBattery_returnsNoShow() {
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+ mPowerUI.start();
+
+ // unplugged device that would show the neither due to battery level being good
+ boolean shouldShow =
+ mPowerUI.shouldShowLowBatteryWarning(UNPLUGGED, UNPLUGGED, ABOVE_WARNING_BUCKET,
+ ABOVE_WARNING_BUCKET, ABOVE_HYBRID_THRESHOLD, ABOVE_HYBRID_THRESHOLD,
+ POWER_SAVER_OFF, BatteryManager.BATTERY_HEALTH_GOOD);
+ assertFalse(shouldShow);
+ }
+
+ @Test
+ public void testShouldShowLowBatteryWarning_devicePlugged_returnsNoShow() {
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+ mPowerUI.start();
+
+ // plugged device that would show the neither due to being plugged
+ boolean shouldShow =
+ mPowerUI.shouldShowLowBatteryWarning(!UNPLUGGED, UNPLUGGED, ABOVE_WARNING_BUCKET,
+ BELOW_WARNING_BUCKET, ABOVE_HYBRID_THRESHOLD, BELOW_HYBRID_THRESHOLD,
+ POWER_SAVER_OFF, BatteryManager.BATTERY_HEALTH_GOOD);
+ assertFalse(shouldShow);
+ }
+
+ @Test
+ public void testShouldShowLowBatteryWarning_deviceBatteryStatusUnkown_returnsNoShow() {
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+ mPowerUI.start();
+
+ // Unknown battery status device that would show the neither due
+ boolean shouldShow =
+ mPowerUI.shouldShowLowBatteryWarning(UNPLUGGED, UNPLUGGED, ABOVE_WARNING_BUCKET,
+ BELOW_WARNING_BUCKET, ABOVE_HYBRID_THRESHOLD, BELOW_HYBRID_THRESHOLD,
+ !POWER_SAVER_OFF, BatteryManager.BATTERY_STATUS_UNKNOWN);
+ assertFalse(shouldShow);
+ }
+
+ @Test
+ public void testShouldShowLowBatteryWarning_batterySaverEnabled_returnsNoShow() {
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+ mPowerUI.start();
+
+ // BatterySaverEnabled device that would show the neither due to battery saver
+ boolean shouldShow =
+ mPowerUI.shouldShowLowBatteryWarning(UNPLUGGED, UNPLUGGED, ABOVE_WARNING_BUCKET,
+ BELOW_WARNING_BUCKET, ABOVE_HYBRID_THRESHOLD, BELOW_HYBRID_THRESHOLD,
+ !POWER_SAVER_OFF, BatteryManager.BATTERY_HEALTH_GOOD);
+ assertFalse(shouldShow);
+ }
+
+ @Test
+ public void testShouldDismissLowBatteryWarning_dismissWhenPowerSaverEnabled() {
+ mPowerUI.start();
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+ // device that gets power saver turned on should dismiss
+ boolean shouldDismiss =
+ mPowerUI.shouldDismissLowBatteryWarning(UNPLUGGED, BELOW_WARNING_BUCKET,
+ BELOW_WARNING_BUCKET, ABOVE_HYBRID_THRESHOLD, !POWER_SAVER_OFF);
+ assertTrue(shouldDismiss);
+ }
+
+ @Test
+ public void testShouldDismissLowBatteryWarning_dismissWhenPlugged() {
+ mPowerUI.start();
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+
+ // device that gets plugged in should dismiss
+ boolean shouldDismiss =
+ mPowerUI.shouldDismissLowBatteryWarning(!UNPLUGGED, BELOW_WARNING_BUCKET,
+ BELOW_WARNING_BUCKET, ABOVE_HYBRID_THRESHOLD, POWER_SAVER_OFF);
+ assertTrue(shouldDismiss);
+ }
+
+ @Test
+ public void testShouldDismissLowBatteryWarning_dismissHybridSignal_showStandardSignal_shouldShow() {
+ mPowerUI.start();
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+ // would dismiss hybrid but not non-hybrid should not dismiss
+ boolean shouldDismiss =
+ mPowerUI.shouldDismissLowBatteryWarning(UNPLUGGED, BELOW_WARNING_BUCKET,
+ BELOW_WARNING_BUCKET, ABOVE_HYBRID_THRESHOLD, POWER_SAVER_OFF);
+ assertFalse(shouldDismiss);
+ }
+
+ @Test
+ public void testShouldDismissLowBatteryWarning_showHybridSignal_dismissStandardSignal_shouldShow() {
+ mPowerUI.start();
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+
+ // would dismiss non-hybrid but not hybrid should not dismiss
+ boolean shouldDismiss =
+ mPowerUI.shouldDismissLowBatteryWarning(UNPLUGGED, BELOW_WARNING_BUCKET,
+ ABOVE_WARNING_BUCKET, BELOW_HYBRID_THRESHOLD, POWER_SAVER_OFF);
+ assertFalse(shouldDismiss);
+ }
+
+ @Test
+ public void testShouldDismissLowBatteryWarning_showBothSignal_shouldShow() {
+ mPowerUI.start();
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+
+ // should not dismiss when both would not dismiss
+ boolean shouldDismiss =
+ mPowerUI.shouldDismissLowBatteryWarning(UNPLUGGED, BELOW_WARNING_BUCKET,
+ BELOW_WARNING_BUCKET, BELOW_HYBRID_THRESHOLD, POWER_SAVER_OFF);
+ assertFalse(shouldDismiss);
+ }
+
+ @Test
+ public void testShouldDismissLowBatteryWarning_dismissBothSignal_shouldDismiss() {
+ mPowerUI.start();
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(true);
+
+ //should dismiss if both would dismiss
+ boolean shouldDismiss =
+ mPowerUI.shouldDismissLowBatteryWarning(UNPLUGGED, BELOW_WARNING_BUCKET,
+ ABOVE_WARNING_BUCKET, ABOVE_HYBRID_THRESHOLD, POWER_SAVER_OFF);
+ assertTrue(shouldDismiss);
+ }
+
+ @Test
+ public void testShouldDismissLowBatteryWarning_dismissStandardSignal_hybridDisabled_shouldDismiss() {
+ mPowerUI.start();
+ when(mEnhacedEstimates.isHybridNotificationEnabled()).thenReturn(false);
+
+ // would dismiss non-hybrid with hybrid disabled should dismiss
+ boolean shouldDismiss =
+ mPowerUI.shouldDismissLowBatteryWarning(UNPLUGGED, BELOW_WARNING_BUCKET,
+ ABOVE_WARNING_BUCKET, ABOVE_HYBRID_THRESHOLD, POWER_SAVER_OFF);
+ assertTrue(shouldDismiss);
+ }
+
private void setCurrentTemp(float temp) {
when(mHardProps.getDeviceTemperatures(DEVICE_TEMPERATURE_SKIN, TEMPERATURE_CURRENT))
.thenReturn(new float[] { temp });
diff --git a/proto/src/metrics_constants.proto b/proto/src/metrics_constants.proto
index 10a809a..04cee67 100644
--- a/proto/src/metrics_constants.proto
+++ b/proto/src/metrics_constants.proto
@@ -5134,6 +5134,15 @@
// OS: P
ACTION_SCREENSHOT_POWER_MENU = 1282;
+ // OPEN: Settings > Apps & Notifications -> Special app access -> Storage Access
+ // CATEGORY: SETTINGS
+ // OS: P
+ STORAGE_ACCESS = 1283;
+
+ // OPEN: Settings > Apps & Notifications -> Special app access -> Storage Access -> Package
+ // CATEGORY: SETTINGS
+ // OS: P
+ APPLICATIONS_STORAGE_DETAIL = 1284;
// ---- End P Constants, all P constants go above this line ----
// Add new aosp constants above this line.
diff --git a/services/backup/java/com/android/server/backup/BackupPolicyEnforcer.java b/services/backup/java/com/android/server/backup/BackupPolicyEnforcer.java
new file mode 100644
index 0000000..158084a
--- /dev/null
+++ b/services/backup/java/com/android/server/backup/BackupPolicyEnforcer.java
@@ -0,0 +1,25 @@
+package com.android.server.backup;
+
+import android.app.admin.DevicePolicyManager;
+import android.content.ComponentName;
+import android.content.Context;
+
+import com.android.internal.annotations.VisibleForTesting;
+
+/**
+ * A helper class to decouple this service from {@link DevicePolicyManager} in order to improve
+ * testability.
+ */
+@VisibleForTesting
+public class BackupPolicyEnforcer {
+ private DevicePolicyManager mDevicePolicyManager;
+
+ public BackupPolicyEnforcer(Context context) {
+ mDevicePolicyManager =
+ (DevicePolicyManager) context.getSystemService(Context.DEVICE_POLICY_SERVICE);
+ }
+
+ public ComponentName getMandatoryBackupTransport() {
+ return mDevicePolicyManager.getMandatoryBackupTransport();
+ }
+}
diff --git a/services/backup/java/com/android/server/backup/RefactoredBackupManagerService.java b/services/backup/java/com/android/server/backup/RefactoredBackupManagerService.java
index 03591a8..f33ec55 100644
--- a/services/backup/java/com/android/server/backup/RefactoredBackupManagerService.java
+++ b/services/backup/java/com/android/server/backup/RefactoredBackupManagerService.java
@@ -38,6 +38,7 @@
import android.app.IActivityManager;
import android.app.IBackupAgent;
import android.app.PendingIntent;
+import android.app.admin.DevicePolicyManager;
import android.app.backup.BackupManager;
import android.app.backup.BackupManagerMonitor;
import android.app.backup.FullBackup;
@@ -207,6 +208,10 @@
public static final String BACKUP_FINISHED_ACTION = "android.intent.action.BACKUP_FINISHED";
public static final String BACKUP_FINISHED_PACKAGE_EXTRA = "packageName";
+ // Time delay for initialization operations that can be delayed so as not to consume too much CPU
+ // on bring-up and increase time-to-UI.
+ private static final long INITIALIZATION_DELAY_MILLIS = 3000;
+
// Timeout interval for deciding that a bind or clear-data has taken too long
private static final long TIMEOUT_INTERVAL = 10 * 1000;
@@ -282,6 +287,9 @@
private final BackupPasswordManager mBackupPasswordManager;
+ // Time when we post the transport registration operation
+ private final long mRegisterTransportsRequestedTime;
+
@GuardedBy("mPendingRestores")
private boolean mIsRestoreInProgress;
@GuardedBy("mPendingRestores")
@@ -674,6 +682,8 @@
@GuardedBy("mQueueLock")
private ArrayList<FullBackupEntry> mFullBackupQueue;
+ private BackupPolicyEnforcer mBackupPolicyEnforcer;
+
// Utility: build a new random integer token. The low bits are the ordinal of the
// operation for near-time uniqueness, and the upper bits are random for app-
// side unpredictability.
@@ -735,6 +745,9 @@
// Set up our transport options and initialize the default transport
SystemConfig systemConfig = SystemConfig.getInstance();
Set<ComponentName> transportWhitelist = systemConfig.getBackupTransportWhitelist();
+ if (transportWhitelist == null) {
+ transportWhitelist = Collections.emptySet();
+ }
String transport =
Settings.Secure.getString(
@@ -749,8 +762,7 @@
new TransportManager(
context,
transportWhitelist,
- transport,
- backupThread.getLooper());
+ transport);
// If encrypted file systems is enabled or disabled, this call will return the
// correct directory.
@@ -852,15 +864,19 @@
}
mTransportManager = transportManager;
- mTransportManager.setTransportBoundListener(mTransportBoundListener);
- mTransportManager.registerAllTransports();
+ mTransportManager.setOnTransportRegisteredListener(this::onTransportRegistered);
+ mRegisterTransportsRequestedTime = SystemClock.elapsedRealtime();
+ mBackupHandler.postDelayed(
+ mTransportManager::registerTransports, INITIALIZATION_DELAY_MILLIS);
- // Now that we know about valid backup participants, parse any
- // leftover journal files into the pending backup set
- mBackupHandler.post(this::parseLeftoverJournals);
+ // Now that we know about valid backup participants, parse any leftover journal files into
+ // the pending backup set
+ mBackupHandler.postDelayed(this::parseLeftoverJournals, INITIALIZATION_DELAY_MILLIS);
// Power management
mWakelock = mPowerManager.newWakeLock(PowerManager.PARTIAL_WAKE_LOCK, "*backup*");
+
+ mBackupPolicyEnforcer = new BackupPolicyEnforcer(context);
}
private void initPackageTracking() {
@@ -1151,39 +1167,28 @@
}
}
- private TransportManager.TransportBoundListener mTransportBoundListener =
- new TransportManager.TransportBoundListener() {
- @Override
- public boolean onTransportBound(IBackupTransport transport) {
- // If the init sentinel file exists, we need to be sure to perform the init
- // as soon as practical. We also create the state directory at registration
- // time to ensure it's present from the outset.
- String name = null;
- try {
- name = transport.name();
- String transportDirName = transport.transportDirName();
- File stateDir = new File(mBaseStateDir, transportDirName);
- stateDir.mkdirs();
+ private void onTransportRegistered(String transportName, String transportDirName) {
+ if (DEBUG) {
+ long timeMs = SystemClock.elapsedRealtime() - mRegisterTransportsRequestedTime;
+ Slog.d(TAG, "Transport " + transportName + " registered " + timeMs
+ + "ms after first request (delay = " + INITIALIZATION_DELAY_MILLIS + "ms)");
+ }
- File initSentinel = new File(stateDir, INIT_SENTINEL_FILE_NAME);
- if (initSentinel.exists()) {
- synchronized (mQueueLock) {
- mPendingInits.add(name);
+ File stateDir = new File(mBaseStateDir, transportDirName);
+ stateDir.mkdirs();
- // TODO: pick a better starting time than now + 1 minute
- long delay = 1000 * 60; // one minute, in milliseconds
- mAlarmManager.set(AlarmManager.RTC_WAKEUP,
- System.currentTimeMillis() + delay, mRunInitIntent);
- }
- }
- return true;
- } catch (Exception e) {
- // the transport threw when asked its file naming prefs; declare it invalid
- Slog.w(TAG, "Failed to regiser transport: " + name);
- return false;
- }
- }
- };
+ File initSentinel = new File(stateDir, INIT_SENTINEL_FILE_NAME);
+ if (initSentinel.exists()) {
+ synchronized (mQueueLock) {
+ mPendingInits.add(transportName);
+
+ // TODO: pick a better starting time than now + 1 minute
+ long delay = 1000 * 60; // one minute, in milliseconds
+ mAlarmManager.set(AlarmManager.RTC_WAKEUP,
+ System.currentTimeMillis() + delay, mRunInitIntent);
+ }
+ }
+ }
// ----- Track installation/removal of packages -----
private BroadcastReceiver mBroadcastReceiver = new BroadcastReceiver() {
@@ -2774,6 +2779,10 @@
public void setBackupEnabled(boolean enable) {
mContext.enforceCallingOrSelfPermission(android.Manifest.permission.BACKUP,
"setBackupEnabled");
+ if (!enable && mBackupPolicyEnforcer.getMandatoryBackupTransport() != null) {
+ Slog.w(TAG, "Cannot disable backups when the mandatory backups policy is active.");
+ return;
+ }
Slog.i(TAG, "Backup enabled => " + enable);
@@ -2891,14 +2900,14 @@
mContext.enforceCallingOrSelfPermission(android.Manifest.permission.BACKUP,
"listAllTransports");
- return mTransportManager.getBoundTransportNames();
+ return mTransportManager.getRegisteredTransportNames();
}
@Override
public ComponentName[] listAllTransportComponents() {
mContext.enforceCallingOrSelfPermission(android.Manifest.permission.BACKUP,
"listAllTransportComponents");
- return mTransportManager.getAllTransportComponents();
+ return mTransportManager.getRegisteredTransportComponents();
}
@Override
@@ -3003,10 +3012,18 @@
/** Selects transport {@code transportName} and returns previous selected transport. */
@Override
+ @Deprecated
+ @Nullable
public String selectBackupTransport(String transportName) {
mContext.enforceCallingOrSelfPermission(
android.Manifest.permission.BACKUP, "selectBackupTransport");
+ if (!isAllowedByMandatoryBackupTransportPolicy(transportName)) {
+ // Don't change the transport if it is not allowed.
+ Slog.w(TAG, "Failed to select transport - disallowed by device owner policy.");
+ return mTransportManager.getCurrentTransportName();
+ }
+
final long oldId = Binder.clearCallingIdentity();
try {
String previousTransportName = mTransportManager.selectTransport(transportName);
@@ -3021,10 +3038,20 @@
@Override
public void selectBackupTransportAsync(
- ComponentName transportComponent, ISelectBackupTransportCallback listener) {
+ ComponentName transportComponent, @Nullable ISelectBackupTransportCallback listener) {
mContext.enforceCallingOrSelfPermission(
android.Manifest.permission.BACKUP, "selectBackupTransportAsync");
-
+ if (!isAllowedByMandatoryBackupTransportPolicy(transportComponent)) {
+ try {
+ if (listener != null) {
+ Slog.w(TAG, "Failed to select transport - disallowed by device owner policy.");
+ listener.onFailure(BackupManager.ERROR_BACKUP_NOT_ALLOWED);
+ }
+ } catch (RemoteException e) {
+ Slog.e(TAG, "ISelectBackupTransportCallback listener not available");
+ }
+ return;
+ }
final long oldId = Binder.clearCallingIdentity();
try {
String transportString = transportComponent.flattenToShortString();
@@ -3046,10 +3073,12 @@
}
try {
- if (transportName != null) {
- listener.onSuccess(transportName);
- } else {
- listener.onFailure(result);
+ if (listener != null) {
+ if (transportName != null) {
+ listener.onSuccess(transportName);
+ } else {
+ listener.onFailure(result);
+ }
}
} catch (RemoteException e) {
Slog.e(TAG, "ISelectBackupTransportCallback listener not available");
@@ -3060,6 +3089,38 @@
}
}
+ /**
+ * Returns if the specified transport can be set as the current transport without violating the
+ * mandatory backup transport policy.
+ */
+ private boolean isAllowedByMandatoryBackupTransportPolicy(String transportName) {
+ ComponentName mandatoryBackupTransport = mBackupPolicyEnforcer.getMandatoryBackupTransport();
+ if (mandatoryBackupTransport == null) {
+ return true;
+ }
+ final String mandatoryBackupTransportName;
+ try {
+ mandatoryBackupTransportName =
+ mTransportManager.getTransportName(mandatoryBackupTransport);
+ } catch (TransportNotRegisteredException e) {
+ Slog.e(TAG, "mandatory backup transport not registered!");
+ return false;
+ }
+ return TextUtils.equals(mandatoryBackupTransportName, transportName);
+ }
+
+ /**
+ * Returns if the specified transport can be set as the current transport without violating the
+ * mandatory backup transport policy.
+ */
+ private boolean isAllowedByMandatoryBackupTransportPolicy(ComponentName transport) {
+ ComponentName mandatoryBackupTransport = mBackupPolicyEnforcer.getMandatoryBackupTransport();
+ if (mandatoryBackupTransport == null) {
+ return true;
+ }
+ return mandatoryBackupTransport.equals(transport);
+ }
+
private void updateStateForTransport(String newTransportName) {
// Publish the name change
Settings.Secure.putString(mContext.getContentResolver(),
diff --git a/services/backup/java/com/android/server/backup/TransportManager.java b/services/backup/java/com/android/server/backup/TransportManager.java
index 34b8935..09456b68 100644
--- a/services/backup/java/com/android/server/backup/TransportManager.java
+++ b/services/backup/java/com/android/server/backup/TransportManager.java
@@ -16,93 +16,56 @@
package com.android.server.backup;
-import static com.android.internal.annotations.VisibleForTesting.Visibility.PACKAGE;
-
import android.annotation.Nullable;
+import android.annotation.WorkerThread;
import android.app.backup.BackupManager;
import android.content.ComponentName;
import android.content.Context;
import android.content.Intent;
-import android.content.ServiceConnection;
import android.content.pm.ApplicationInfo;
import android.content.pm.PackageInfo;
import android.content.pm.PackageManager;
import android.content.pm.ResolveInfo;
-import android.content.pm.ServiceInfo;
-import android.os.Handler;
-import android.os.IBinder;
-import android.os.Looper;
-import android.os.Message;
import android.os.RemoteException;
import android.os.UserHandle;
-import android.provider.Settings;
import android.util.ArrayMap;
-import android.util.ArraySet;
import android.util.EventLog;
-import android.util.Log;
import android.util.Slog;
import com.android.internal.annotations.GuardedBy;
import com.android.internal.annotations.VisibleForTesting;
import com.android.internal.backup.IBackupTransport;
+import com.android.internal.util.Preconditions;
import com.android.server.EventLogTags;
+import com.android.server.backup.transport.OnTransportRegisteredListener;
import com.android.server.backup.transport.TransportClient;
import com.android.server.backup.transport.TransportClientManager;
import com.android.server.backup.transport.TransportConnectionListener;
import com.android.server.backup.transport.TransportNotAvailableException;
import com.android.server.backup.transport.TransportNotRegisteredException;
-import java.util.ArrayList;
-import java.util.Iterator;
import java.util.List;
import java.util.Map;
import java.util.Set;
import java.util.function.Consumer;
import java.util.function.Predicate;
+import java.util.stream.Collectors;
+import java.util.stream.Stream;
-/**
- * Handles in-memory bookkeeping of all BackupTransport objects.
- */
+/** Handles in-memory bookkeeping of all BackupTransport objects. */
public class TransportManager {
-
private static final String TAG = "BackupTransportManager";
@VisibleForTesting
public static final String SERVICE_ACTION_TRANSPORT_HOST = "android.backup.TRANSPORT_HOST";
- private static final long REBINDING_TIMEOUT_UNPROVISIONED_MS = 30 * 1000; // 30 sec
- private static final long REBINDING_TIMEOUT_PROVISIONED_MS = 5 * 60 * 1000; // 5 mins
- private static final int REBINDING_TIMEOUT_MSG = 1;
-
private final Intent mTransportServiceIntent = new Intent(SERVICE_ACTION_TRANSPORT_HOST);
private final Context mContext;
private final PackageManager mPackageManager;
private final Set<ComponentName> mTransportWhitelist;
- private final Handler mHandler;
private final TransportClientManager mTransportClientManager;
-
- /**
- * This listener is called after we bind to any transport. If it returns true, this is a valid
- * transport.
- */
- private TransportBoundListener mTransportBoundListener;
-
private final Object mTransportLock = new Object();
-
- /**
- * We have detected these transports on the device. Unless in exceptional cases, we are also
- * bound to all of these.
- */
- @GuardedBy("mTransportLock")
- private final Map<ComponentName, TransportConnection> mValidTransports = new ArrayMap<>();
-
- /** We are currently bound to these transports. */
- @GuardedBy("mTransportLock")
- private final Map<String, ComponentName> mBoundTransports = new ArrayMap<>();
-
- /** @see #getEligibleTransportComponents() */
- @GuardedBy("mTransportLock")
- private final Set<ComponentName> mEligibleTransports = new ArraySet<>();
+ private OnTransportRegisteredListener mOnTransportRegisteredListener = (c, n) -> {};
/** @see #getRegisteredTransportNames() */
@GuardedBy("mTransportLock")
@@ -110,120 +73,98 @@
new ArrayMap<>();
@GuardedBy("mTransportLock")
+ @Nullable
private volatile String mCurrentTransportName;
- TransportManager(
- Context context,
- Set<ComponentName> whitelist,
- String defaultTransport,
- TransportBoundListener listener,
- Looper looper) {
- this(context, whitelist, defaultTransport, looper);
- mTransportBoundListener = listener;
+ TransportManager(Context context, Set<ComponentName> whitelist, String selectedTransport) {
+ this(context, whitelist, selectedTransport, new TransportClientManager(context));
}
+ @VisibleForTesting
TransportManager(
Context context,
Set<ComponentName> whitelist,
- String defaultTransport,
- Looper looper) {
+ String selectedTransport,
+ TransportClientManager transportClientManager) {
mContext = context;
mPackageManager = context.getPackageManager();
- if (whitelist != null) {
- mTransportWhitelist = whitelist;
- } else {
- mTransportWhitelist = new ArraySet<>();
- }
- mCurrentTransportName = defaultTransport;
- mHandler = new RebindOnTimeoutHandler(looper);
- mTransportClientManager = new TransportClientManager(context);
+ mTransportWhitelist = Preconditions.checkNotNull(whitelist);
+ mCurrentTransportName = selectedTransport;
+ mTransportClientManager = transportClientManager;
}
- public void setTransportBoundListener(TransportBoundListener transportBoundListener) {
- mTransportBoundListener = transportBoundListener;
+ /* Sets a listener to be called whenever a transport is registered. */
+ public void setOnTransportRegisteredListener(OnTransportRegisteredListener listener) {
+ mOnTransportRegisteredListener = listener;
}
+ @WorkerThread
void onPackageAdded(String packageName) {
- // New package added. Bind to all transports it contains.
- synchronized (mTransportLock) {
- log_verbose("Package added. Binding to all transports. " + packageName);
- bindToAllInternal(packageName, null /* all components */);
- }
+ registerTransportsFromPackage(packageName, transportComponent -> true);
}
void onPackageRemoved(String packageName) {
- // Package removed. Remove all its transports from our list. These transports have already
- // been removed from mBoundTransports because onServiceDisconnected would already been
- // called on TransportConnection objects.
synchronized (mTransportLock) {
- Iterator<Map.Entry<ComponentName, TransportConnection>> iter =
- mValidTransports.entrySet().iterator();
- while (iter.hasNext()) {
- Map.Entry<ComponentName, TransportConnection> validTransport = iter.next();
- ComponentName componentName = validTransport.getKey();
- if (componentName.getPackageName().equals(packageName)) {
- TransportConnection transportConnection = validTransport.getValue();
- iter.remove();
- if (transportConnection != null) {
- mContext.unbindService(transportConnection);
- log_verbose("Package removed, removing transport: "
- + componentName.flattenToShortString());
- }
- }
- }
- removeTransportsIfLocked(
- componentName -> packageName.equals(componentName.getPackageName()));
+ mRegisteredTransportsDescriptionMap.keySet().removeIf(fromPackageFilter(packageName));
}
}
- void onPackageChanged(String packageName, String[] components) {
+ @WorkerThread
+ void onPackageChanged(String packageName, String... components) {
synchronized (mTransportLock) {
- // Remove all changed components from mValidTransports. We'll bind to them again
- // and re-add them if still valid.
- Set<ComponentName> transportsToBeRemoved = new ArraySet<>();
- for (String component : components) {
- ComponentName componentName = new ComponentName(packageName, component);
- transportsToBeRemoved.add(componentName);
- TransportConnection removed = mValidTransports.remove(componentName);
- if (removed != null) {
- mContext.unbindService(removed);
- log_verbose("Package changed. Removing transport: " +
- componentName.flattenToShortString());
- }
- }
- removeTransportsIfLocked(transportsToBeRemoved::contains);
- bindToAllInternal(packageName, components);
+ Set<ComponentName> transportComponents =
+ Stream.of(components)
+ .map(component -> new ComponentName(packageName, component))
+ .collect(Collectors.toSet());
+
+ mRegisteredTransportsDescriptionMap.keySet().removeIf(transportComponents::contains);
+ registerTransportsFromPackage(packageName, transportComponents::contains);
}
}
- @GuardedBy("mTransportLock")
- private void removeTransportsIfLocked(Predicate<ComponentName> filter) {
- mEligibleTransports.removeIf(filter);
- mRegisteredTransportsDescriptionMap.keySet().removeIf(filter);
- }
-
- public IBackupTransport getTransportBinder(String transportName) {
+ /**
+ * Returns the {@link ComponentName}s of the registered transports.
+ *
+ * <p>A *registered* transport is a transport that satisfies intent with action
+ * android.backup.TRANSPORT_HOST, returns true for {@link #isTransportTrusted(ComponentName)}
+ * and that we have successfully connected to once.
+ */
+ ComponentName[] getRegisteredTransportComponents() {
synchronized (mTransportLock) {
- ComponentName component = mBoundTransports.get(transportName);
- if (component == null) {
- Slog.w(TAG, "Transport " + transportName + " not bound.");
- return null;
- }
- TransportConnection conn = mValidTransports.get(component);
- if (conn == null) {
- Slog.w(TAG, "Transport " + transportName + " not valid.");
- return null;
- }
- return conn.getBinder();
+ return mRegisteredTransportsDescriptionMap
+ .keySet()
+ .toArray(new ComponentName[mRegisteredTransportsDescriptionMap.size()]);
}
}
- public IBackupTransport getCurrentTransportBinder() {
- return getTransportBinder(mCurrentTransportName);
+ /**
+ * Returns the names of the registered transports.
+ *
+ * @see #getRegisteredTransportComponents()
+ */
+ String[] getRegisteredTransportNames() {
+ synchronized (mTransportLock) {
+ return mRegisteredTransportsDescriptionMap
+ .values()
+ .stream()
+ .map(transportDescription -> transportDescription.name)
+ .toArray(String[]::new);
+ }
+ }
+
+ /** Returns a set with the whitelisted transports. */
+ Set<ComponentName> getTransportWhitelist() {
+ return mTransportWhitelist;
+ }
+
+ @Nullable
+ String getCurrentTransportName() {
+ return mCurrentTransportName;
}
/**
* Returns the transport name associated with {@code transportComponent}.
+ *
* @throws TransportNotRegisteredException if the transport is not registered.
*/
public String getTransportName(ComponentName transportComponent)
@@ -234,7 +175,32 @@
}
/**
- * Retrieve the configuration intent of {@code transportName}.
+ * Retrieves the transport dir name of {@code transportComponent}.
+ *
+ * @throws TransportNotRegisteredException if the transport is not registered.
+ */
+ public String getTransportDirName(ComponentName transportComponent)
+ throws TransportNotRegisteredException {
+ synchronized (mTransportLock) {
+ return getRegisteredTransportDescriptionOrThrowLocked(transportComponent)
+ .transportDirName;
+ }
+ }
+
+ /**
+ * Retrieves the transport dir name of {@code transportName}.
+ *
+ * @throws TransportNotRegisteredException if the transport is not registered.
+ */
+ public String getTransportDirName(String transportName) throws TransportNotRegisteredException {
+ synchronized (mTransportLock) {
+ return getRegisteredTransportDescriptionOrThrowLocked(transportName).transportDirName;
+ }
+ }
+
+ /**
+ * Retrieves the configuration intent of {@code transportName}.
+ *
* @throws TransportNotRegisteredException if the transport is not registered.
*/
@Nullable
@@ -247,7 +213,21 @@
}
/**
- * Retrieve the data management intent of {@code transportName}.
+ * Retrieves the current destination string of {@code transportName}.
+ *
+ * @throws TransportNotRegisteredException if the transport is not registered.
+ */
+ public String getTransportCurrentDestinationString(String transportName)
+ throws TransportNotRegisteredException {
+ synchronized (mTransportLock) {
+ return getRegisteredTransportDescriptionOrThrowLocked(transportName)
+ .currentDestinationString;
+ }
+ }
+
+ /**
+ * Retrieves the data management intent of {@code transportName}.
+ *
* @throws TransportNotRegisteredException if the transport is not registered.
*/
@Nullable
@@ -260,19 +240,8 @@
}
/**
- * Retrieve the current destination string of {@code transportName}.
- * @throws TransportNotRegisteredException if the transport is not registered.
- */
- public String getTransportCurrentDestinationString(String transportName)
- throws TransportNotRegisteredException {
- synchronized (mTransportLock) {
- return getRegisteredTransportDescriptionOrThrowLocked(transportName)
- .currentDestinationString;
- }
- }
-
- /**
- * Retrieve the data management label of {@code transportName}.
+ * Retrieves the data management label of {@code transportName}.
+ *
* @throws TransportNotRegisteredException if the transport is not registered.
*/
@Nullable
@@ -284,54 +253,74 @@
}
}
- /**
- * Retrieve the transport dir name of {@code transportName}.
- * @throws TransportNotRegisteredException if the transport is not registered.
- */
- public String getTransportDirName(String transportName)
- throws TransportNotRegisteredException {
+ /* Returns true if the transport identified by {@code transportName} is registered. */
+ public boolean isTransportRegistered(String transportName) {
synchronized (mTransportLock) {
- return getRegisteredTransportDescriptionOrThrowLocked(transportName)
- .transportDirName;
- }
- }
-
- /**
- * Retrieve the transport dir name of {@code transportComponent}.
- * @throws TransportNotRegisteredException if the transport is not registered.
- */
- public String getTransportDirName(ComponentName transportComponent)
- throws TransportNotRegisteredException {
- synchronized (mTransportLock) {
- return getRegisteredTransportDescriptionOrThrowLocked(transportComponent)
- .transportDirName;
+ return getRegisteredTransportEntryLocked(transportName) != null;
}
}
/**
* Execute {@code transportConsumer} for each registered transport passing the transport name.
* This is called with an internal lock held, ensuring that the transport will remain registered
- * while {@code transportConsumer} is being executed. Don't do heavy operations in
- * {@code transportConsumer}.
+ * while {@code transportConsumer} is being executed. Don't do heavy operations in {@code
+ * transportConsumer}.
*/
public void forEachRegisteredTransport(Consumer<String> transportConsumer) {
synchronized (mTransportLock) {
- for (TransportDescription transportDescription
- : mRegisteredTransportsDescriptionMap.values()) {
+ for (TransportDescription transportDescription :
+ mRegisteredTransportsDescriptionMap.values()) {
transportConsumer.accept(transportDescription.name);
}
}
}
- public String getTransportName(IBackupTransport binder) {
+ /**
+ * Updates given values for the transport already registered and identified with {@param
+ * transportComponent}. If the transport is not registered it will log and return.
+ */
+ public void updateTransportAttributes(
+ ComponentName transportComponent,
+ String name,
+ @Nullable Intent configurationIntent,
+ String currentDestinationString,
+ @Nullable Intent dataManagementIntent,
+ @Nullable String dataManagementLabel) {
synchronized (mTransportLock) {
- for (TransportConnection conn : mValidTransports.values()) {
- if (conn.getBinder() == binder) {
- return conn.getName();
- }
+ TransportDescription description =
+ mRegisteredTransportsDescriptionMap.get(transportComponent);
+ if (description == null) {
+ Slog.e(TAG, "Transport " + name + " not registered tried to change description");
+ return;
}
+ description.name = name;
+ description.configurationIntent = configurationIntent;
+ description.currentDestinationString = currentDestinationString;
+ description.dataManagementIntent = dataManagementIntent;
+ description.dataManagementLabel = dataManagementLabel;
+ Slog.d(TAG, "Transport " + name + " updated its attributes");
}
- return null;
+ }
+
+ @GuardedBy("mTransportLock")
+ private TransportDescription getRegisteredTransportDescriptionOrThrowLocked(
+ ComponentName transportComponent) throws TransportNotRegisteredException {
+ TransportDescription description =
+ mRegisteredTransportsDescriptionMap.get(transportComponent);
+ if (description == null) {
+ throw new TransportNotRegisteredException(transportComponent);
+ }
+ return description;
+ }
+
+ @GuardedBy("mTransportLock")
+ private TransportDescription getRegisteredTransportDescriptionOrThrowLocked(
+ String transportName) throws TransportNotRegisteredException {
+ TransportDescription description = getRegisteredTransportDescriptionLocked(transportName);
+ if (description == null) {
+ throw new TransportNotRegisteredException(transportName);
+ }
+ return description;
}
@GuardedBy("mTransportLock")
@@ -351,21 +340,11 @@
}
@GuardedBy("mTransportLock")
- private TransportDescription getRegisteredTransportDescriptionOrThrowLocked(
- String transportName) throws TransportNotRegisteredException {
- TransportDescription description = getRegisteredTransportDescriptionLocked(transportName);
- if (description == null) {
- throw new TransportNotRegisteredException(transportName);
- }
- return description;
- }
-
- @GuardedBy("mTransportLock")
@Nullable
private Map.Entry<ComponentName, TransportDescription> getRegisteredTransportEntryLocked(
String transportName) {
- for (Map.Entry<ComponentName, TransportDescription> entry
- : mRegisteredTransportsDescriptionMap.entrySet()) {
+ for (Map.Entry<ComponentName, TransportDescription> entry :
+ mRegisteredTransportsDescriptionMap.entrySet()) {
TransportDescription description = entry.getValue();
if (transportName.equals(description.name)) {
return entry;
@@ -374,17 +353,16 @@
return null;
}
- @GuardedBy("mTransportLock")
- private TransportDescription getRegisteredTransportDescriptionOrThrowLocked(
- ComponentName transportComponent) throws TransportNotRegisteredException {
- TransportDescription description =
- mRegisteredTransportsDescriptionMap.get(transportComponent);
- if (description == null) {
- throw new TransportNotRegisteredException(transportComponent);
- }
- return description;
- }
-
+ /**
+ * Returns a {@link TransportClient} for {@code transportName} or {@code null} if not
+ * registered.
+ *
+ * @param transportName The name of the transport.
+ * @param caller A {@link String} identifying the caller for logging/debugging purposes. Check
+ * {@link TransportClient#connectAsync(TransportConnectionListener, String)} for more
+ * details.
+ * @return A {@link TransportClient} or null if not registered.
+ */
@Nullable
public TransportClient getTransportClient(String transportName, String caller) {
try {
@@ -395,6 +373,16 @@
}
}
+ /**
+ * Returns a {@link TransportClient} for {@code transportName} or throws if not registered.
+ *
+ * @param transportName The name of the transport.
+ * @param caller A {@link String} identifying the caller for logging/debugging purposes. Check
+ * {@link TransportClient#connectAsync(TransportConnectionListener, String)} for more
+ * details.
+ * @return A {@link TransportClient}.
+ * @throws TransportNotRegisteredException if the transport is not registered.
+ */
public TransportClient getTransportClientOrThrow(String transportName, String caller)
throws TransportNotRegisteredException {
synchronized (mTransportLock) {
@@ -406,19 +394,14 @@
}
}
- public boolean isTransportRegistered(String transportName) {
- synchronized (mTransportLock) {
- return getRegisteredTransportEntryLocked(transportName) != null;
- }
- }
-
/**
- * Returns a {@link TransportClient} for the current transport or null if not found.
+ * Returns a {@link TransportClient} for the current transport or {@code null} if not
+ * registered.
*
* @param caller A {@link String} identifying the caller for logging/debugging purposes. Check
* {@link TransportClient#connectAsync(TransportConnectionListener, String)} for more
* details.
- * @return A {@link TransportClient} or null if not found.
+ * @return A {@link TransportClient} or null if not registered.
*/
@Nullable
public TransportClient getCurrentTransportClient(String caller) {
@@ -455,130 +438,88 @@
mTransportClientManager.disposeOfTransportClient(transportClient, caller);
}
- String[] getBoundTransportNames() {
- synchronized (mTransportLock) {
- return mBoundTransports.keySet().toArray(new String[mBoundTransports.size()]);
- }
- }
-
- ComponentName[] getAllTransportComponents() {
- synchronized (mTransportLock) {
- return mValidTransports.keySet().toArray(new ComponentName[mValidTransports.size()]);
- }
- }
-
/**
- * An *eligible* transport is a service component that satisfies intent with action
- * android.backup.TRANSPORT_HOST and returns true for
- * {@link #isTransportTrusted(ComponentName)}. It may be registered or not registered.
- * This method returns the {@link ComponentName}s of those transports.
- */
- ComponentName[] getEligibleTransportComponents() {
- synchronized (mTransportLock) {
- return mEligibleTransports.toArray(new ComponentName[mEligibleTransports.size()]);
- }
- }
-
- Set<ComponentName> getTransportWhitelist() {
- return mTransportWhitelist;
- }
-
- /**
- * A *registered* transport is an eligible transport that has been successfully connected and
- * that returned true for method
- * {@link TransportBoundListener#onTransportBound(IBackupTransport)} of TransportBoundListener
- * provided in the constructor. This method returns the names of the registered transports.
- */
- String[] getRegisteredTransportNames() {
- synchronized (mTransportLock) {
- return mRegisteredTransportsDescriptionMap.values().stream()
- .map(transportDescription -> transportDescription.name)
- .toArray(String[]::new);
- }
- }
-
- /**
- * Updates given values for the transport already registered and identified with
- * {@param transportComponent}. If the transport is not registered it will log and return.
- */
- public void updateTransportAttributes(
- ComponentName transportComponent,
- String name,
- @Nullable Intent configurationIntent,
- String currentDestinationString,
- @Nullable Intent dataManagementIntent,
- @Nullable String dataManagementLabel) {
- synchronized (mTransportLock) {
- TransportDescription description =
- mRegisteredTransportsDescriptionMap.get(transportComponent);
- if (description == null) {
- Slog.e(TAG, "Transport " + name + " not registered tried to change description");
- return;
- }
- description.name = name;
- description.configurationIntent = configurationIntent;
- description.currentDestinationString = currentDestinationString;
- description.dataManagementIntent = dataManagementIntent;
- description.dataManagementLabel = dataManagementLabel;
- Slog.d(TAG, "Transport " + name + " updated its attributes");
- }
- }
-
- @Nullable
- String getCurrentTransportName() {
- return mCurrentTransportName;
- }
-
- // This is for mocking, Mockito can't mock if package-protected and in the same package but
- // different class loaders. Checked with the debugger and class loaders are different
- // See https://github.com/mockito/mockito/issues/796
- @VisibleForTesting(visibility = PACKAGE)
- public void registerAllTransports() {
- bindToAllInternal(null /* all packages */, null /* all components */);
- }
-
- /**
- * Bind to all transports belonging to the given package and the given component list.
- * null acts a wildcard.
+ * Sets {@code transportName} as selected transport and returns previously selected transport
+ * name. If there was no previous transport it returns null.
*
- * If packageName is null, bind to all transports in all packages.
- * If components is null, bind to all transports in the given package.
+ * <p>You should NOT call this method in new code. This won't make any checks against {@code
+ * transportName}, putting any operation at risk of a {@link TransportNotRegisteredException} or
+ * another error at the time it's being executed.
+ *
+ * <p>{@link Deprecated} as public, this method can be used as private.
*/
- private void bindToAllInternal(String packageName, String[] components) {
- PackageInfo pkgInfo = null;
- if (packageName != null) {
+ @Deprecated
+ @Nullable
+ String selectTransport(String transportName) {
+ synchronized (mTransportLock) {
+ String prevTransport = mCurrentTransportName;
+ mCurrentTransportName = transportName;
+ return prevTransport;
+ }
+ }
+
+ /**
+ * Tries to register the transport if not registered. If successful also selects the transport.
+ *
+ * @param transportComponent Host of the transport.
+ * @return One of {@link BackupManager#SUCCESS}, {@link BackupManager#ERROR_TRANSPORT_INVALID}
+ * or {@link BackupManager#ERROR_TRANSPORT_UNAVAILABLE}.
+ */
+ @WorkerThread
+ public int registerAndSelectTransport(ComponentName transportComponent) {
+ synchronized (mTransportLock) {
+ if (!mRegisteredTransportsDescriptionMap.containsKey(transportComponent)) {
+ int result = registerTransport(transportComponent);
+ if (result != BackupManager.SUCCESS) {
+ return result;
+ }
+ }
+
try {
- pkgInfo = mPackageManager.getPackageInfo(packageName, 0);
- } catch (PackageManager.NameNotFoundException e) {
- Slog.w(TAG, "Package not found: " + packageName);
- return;
+ selectTransport(getTransportName(transportComponent));
+ return BackupManager.SUCCESS;
+ } catch (TransportNotRegisteredException e) {
+ // Shouldn't happen because we are holding the lock
+ Slog.wtf(TAG, "Transport unexpectedly not registered");
+ return BackupManager.ERROR_TRANSPORT_UNAVAILABLE;
}
}
+ }
- Intent intent = new Intent(mTransportServiceIntent);
- if (packageName != null) {
- intent.setPackage(packageName);
+ @WorkerThread
+ public void registerTransports() {
+ registerTransportsForIntent(mTransportServiceIntent, transportComponent -> true);
+ }
+
+ @WorkerThread
+ private void registerTransportsFromPackage(
+ String packageName, Predicate<ComponentName> transportComponentFilter) {
+ try {
+ mPackageManager.getPackageInfo(packageName, 0);
+ } catch (PackageManager.NameNotFoundException e) {
+ Slog.e(TAG, "Trying to register transports from package not found " + packageName);
+ return;
}
- List<ResolveInfo> hosts = mPackageManager.queryIntentServicesAsUser(
- intent, 0, UserHandle.USER_SYSTEM);
- if (hosts != null) {
+ registerTransportsForIntent(
+ new Intent(mTransportServiceIntent).setPackage(packageName),
+ transportComponentFilter.and(fromPackageFilter(packageName)));
+ }
+
+ @WorkerThread
+ private void registerTransportsForIntent(
+ Intent intent, Predicate<ComponentName> transportComponentFilter) {
+ List<ResolveInfo> hosts =
+ mPackageManager.queryIntentServicesAsUser(intent, 0, UserHandle.USER_SYSTEM);
+ if (hosts == null) {
+ return;
+ }
+ synchronized (mTransportLock) {
for (ResolveInfo host : hosts) {
- final ComponentName infoComponentName = getComponentName(host.serviceInfo);
- boolean shouldBind = false;
- if (components != null && packageName != null) {
- for (String component : components) {
- ComponentName cn = new ComponentName(pkgInfo.packageName, component);
- if (infoComponentName.equals(cn)) {
- shouldBind = true;
- break;
- }
- }
- } else {
- shouldBind = true;
- }
- if (shouldBind && isTransportTrusted(infoComponentName)) {
- tryBindTransport(infoComponentName);
+ ComponentName transportComponent = host.serviceInfo.getComponentName();
+ if (transportComponentFilter.test(transportComponent)
+ && isTransportTrusted(transportComponent)) {
+ registerTransport(transportComponent);
}
}
}
@@ -605,64 +546,6 @@
return true;
}
- private void tryBindTransport(ComponentName transportComponentName) {
- Slog.d(TAG, "Binding to transport: " + transportComponentName.flattenToShortString());
- // TODO: b/22388012 (Multi user backup and restore)
- TransportConnection connection = new TransportConnection(transportComponentName);
- synchronized (mTransportLock) {
- mEligibleTransports.add(transportComponentName);
- }
- if (bindToTransport(transportComponentName, connection)) {
- synchronized (mTransportLock) {
- mValidTransports.put(transportComponentName, connection);
- }
- } else {
- Slog.w(TAG, "Couldn't bind to transport " + transportComponentName);
- }
- }
-
- private boolean bindToTransport(ComponentName componentName, ServiceConnection connection) {
- Intent intent = new Intent(mTransportServiceIntent)
- .setComponent(componentName);
- return mContext.bindServiceAsUser(intent, connection, Context.BIND_AUTO_CREATE,
- createSystemUserHandle());
- }
-
- String selectTransport(String transportName) {
- synchronized (mTransportLock) {
- String prevTransport = mCurrentTransportName;
- mCurrentTransportName = transportName;
- return prevTransport;
- }
- }
-
- /**
- * Tries to register the transport if not registered. If successful also selects the transport.
- *
- * @param transportComponent Host of the transport.
- * @return One of {@link BackupManager#SUCCESS}, {@link BackupManager#ERROR_TRANSPORT_INVALID}
- * or {@link BackupManager#ERROR_TRANSPORT_UNAVAILABLE}.
- */
- public int registerAndSelectTransport(ComponentName transportComponent) {
- synchronized (mTransportLock) {
- if (!mRegisteredTransportsDescriptionMap.containsKey(transportComponent)) {
- int result = registerTransport(transportComponent);
- if (result != BackupManager.SUCCESS) {
- return result;
- }
- }
-
- try {
- selectTransport(getTransportName(transportComponent));
- return BackupManager.SUCCESS;
- } catch (TransportNotRegisteredException e) {
- // Shouldn't happen because we are holding the lock
- Slog.wtf(TAG, "Transport unexpectedly not registered");
- return BackupManager.ERROR_TRANSPORT_UNAVAILABLE;
- }
- }
- }
-
/**
* Tries to register transport represented by {@code transportComponent}.
*
@@ -670,7 +553,12 @@
* @return One of {@link BackupManager#SUCCESS}, {@link BackupManager#ERROR_TRANSPORT_INVALID}
* or {@link BackupManager#ERROR_TRANSPORT_UNAVAILABLE}.
*/
+ @WorkerThread
private int registerTransport(ComponentName transportComponent) {
+ if (!isTransportTrusted(transportComponent)) {
+ return BackupManager.ERROR_TRANSPORT_INVALID;
+ }
+
String transportString = transportComponent.flattenToShortString();
String callerLogString = "TransportManager.registerTransport()";
@@ -689,26 +577,21 @@
EventLog.writeEvent(EventLogTags.BACKUP_TRANSPORT_LIFECYCLE, transportString, 1);
int result;
- if (isTransportValid(transport)) {
- try {
- registerTransport(transportComponent, transport);
- // If registerTransport() hasn't thrown...
- result = BackupManager.SUCCESS;
- } catch (RemoteException e) {
- Slog.e(TAG, "Transport " + transportString + " died while registering");
- result = BackupManager.ERROR_TRANSPORT_UNAVAILABLE;
- }
- } else {
- Slog.w(TAG, "Can't register invalid transport " + transportString);
- result = BackupManager.ERROR_TRANSPORT_INVALID;
+ try {
+ String transportName = transport.name();
+ String transportDirName = transport.transportDirName();
+ registerTransport(transportComponent, transport);
+ // If registerTransport() hasn't thrown...
+ Slog.d(TAG, "Transport " + transportString + " registered");
+ mOnTransportRegisteredListener.onTransportRegistered(transportName, transportDirName);
+ result = BackupManager.SUCCESS;
+ } catch (RemoteException e) {
+ Slog.e(TAG, "Transport " + transportString + " died while registering");
+ EventLog.writeEvent(EventLogTags.BACKUP_TRANSPORT_LIFECYCLE, transportString, 0);
+ result = BackupManager.ERROR_TRANSPORT_UNAVAILABLE;
}
mTransportClientManager.disposeOfTransportClient(transportClient, callerLogString);
- if (result == BackupManager.SUCCESS) {
- Slog.d(TAG, "Transport " + transportString + " registered");
- } else {
- EventLog.writeEvent(EventLogTags.BACKUP_TRANSPORT_LIFECYCLE, transportString, 0);
- }
return result;
}
@@ -717,204 +600,20 @@
throws RemoteException {
synchronized (mTransportLock) {
String name = transport.name();
- TransportDescription description = new TransportDescription(
- name,
- transport.transportDirName(),
- transport.configurationIntent(),
- transport.currentDestinationString(),
- transport.dataManagementIntent(),
- transport.dataManagementLabel());
+ TransportDescription description =
+ new TransportDescription(
+ name,
+ transport.transportDirName(),
+ transport.configurationIntent(),
+ transport.currentDestinationString(),
+ transport.dataManagementIntent(),
+ transport.dataManagementLabel());
mRegisteredTransportsDescriptionMap.put(transportComponent, description);
}
}
- private boolean isTransportValid(IBackupTransport transport) {
- if (mTransportBoundListener == null) {
- Slog.w(TAG, "setTransportBoundListener() not called, assuming transport invalid");
- return false;
- }
- return mTransportBoundListener.onTransportBound(transport);
- }
-
- private class TransportConnection implements ServiceConnection {
-
- // Hold mTransportLock to access these fields so as to provide a consistent view of them.
- private volatile IBackupTransport mBinder;
- private volatile String mTransportName;
-
- private final ComponentName mTransportComponent;
-
- private TransportConnection(ComponentName transportComponent) {
- mTransportComponent = transportComponent;
- }
-
- @Override
- public void onServiceConnected(ComponentName component, IBinder binder) {
- synchronized (mTransportLock) {
- mBinder = IBackupTransport.Stub.asInterface(binder);
- boolean success = false;
-
- EventLog.writeEvent(EventLogTags.BACKUP_TRANSPORT_LIFECYCLE,
- component.flattenToShortString(), 1);
-
- try {
- mTransportName = mBinder.name();
- // BackupManager requests some fields from the transport. If they are
- // invalid, throw away this transport.
- if (isTransportValid(mBinder)) {
- // We're now using the always-bound connection to do the registration but
- // when we remove the always-bound code this will be in the first binding
- // TODO: Move registration to first binding
- registerTransport(component, mBinder);
- // If registerTransport() hasn't thrown...
- success = true;
- }
- } catch (RemoteException e) {
- success = false;
- Slog.e(TAG, "Couldn't get transport name.", e);
- } finally {
- // we need to intern() the String of the component, so that we can use it with
- // Handler's removeMessages(), which uses == operator to compare the tokens
- String componentShortString = component.flattenToShortString().intern();
- if (success) {
- Slog.d(TAG, "Bound to transport: " + componentShortString);
- mBoundTransports.put(mTransportName, component);
- // cancel rebinding on timeout for this component as we've already connected
- mHandler.removeMessages(REBINDING_TIMEOUT_MSG, componentShortString);
- } else {
- Slog.w(TAG, "Bound to transport " + componentShortString +
- " but it is invalid");
- EventLog.writeEvent(EventLogTags.BACKUP_TRANSPORT_LIFECYCLE,
- componentShortString, 0);
- mContext.unbindService(this);
- mValidTransports.remove(component);
- mEligibleTransports.remove(component);
- mBinder = null;
- }
- }
- }
- }
-
- @Override
- public void onServiceDisconnected(ComponentName component) {
- synchronized (mTransportLock) {
- mBinder = null;
- mBoundTransports.remove(mTransportName);
- }
- String componentShortString = component.flattenToShortString();
- EventLog.writeEvent(EventLogTags.BACKUP_TRANSPORT_LIFECYCLE, componentShortString, 0);
- Slog.w(TAG, "Disconnected from transport " + componentShortString);
- scheduleRebindTimeout(component);
- }
-
- /**
- * We'll attempt to explicitly rebind to a transport if it hasn't happened automatically
- * for a few minutes after the binding went away.
- */
- private void scheduleRebindTimeout(ComponentName component) {
- // we need to intern() the String of the component, so that we can use it with Handler's
- // removeMessages(), which uses == operator to compare the tokens
- final String componentShortString = component.flattenToShortString().intern();
- final long rebindTimeout = getRebindTimeout();
- mHandler.removeMessages(REBINDING_TIMEOUT_MSG, componentShortString);
- Message msg = mHandler.obtainMessage(REBINDING_TIMEOUT_MSG);
- msg.obj = componentShortString;
- mHandler.sendMessageDelayed(msg, rebindTimeout);
- Slog.d(TAG, "Scheduled explicit rebinding for " + componentShortString + " in "
- + rebindTimeout + "ms");
- }
-
- // Intentionally not synchronized -- the variable is volatile and changes to its value
- // are inside synchronized blocks, providing a memory sync barrier; and this method
- // does not touch any other state protected by that lock.
- private IBackupTransport getBinder() {
- return mBinder;
- }
-
- // Intentionally not synchronized; same as getBinder()
- private String getName() {
- return mTransportName;
- }
-
- // Intentionally not synchronized; same as getBinder()
- private void bindIfUnbound() {
- if (mBinder == null) {
- Slog.d(TAG,
- "Rebinding to transport " + mTransportComponent.flattenToShortString());
- bindToTransport(mTransportComponent, this);
- }
- }
-
- private long getRebindTimeout() {
- final boolean isDeviceProvisioned = Settings.Global.getInt(
- mContext.getContentResolver(),
- Settings.Global.DEVICE_PROVISIONED, 0) != 0;
- return isDeviceProvisioned
- ? REBINDING_TIMEOUT_PROVISIONED_MS
- : REBINDING_TIMEOUT_UNPROVISIONED_MS;
- }
- }
-
- public interface TransportBoundListener {
- /** Should return true if this is a valid transport. */
- boolean onTransportBound(IBackupTransport binder);
- }
-
- private class RebindOnTimeoutHandler extends Handler {
-
- RebindOnTimeoutHandler(Looper looper) {
- super(looper);
- }
-
- @Override
- public void handleMessage(Message msg) {
- if (msg.what == REBINDING_TIMEOUT_MSG) {
- String componentShortString = (String) msg.obj;
- ComponentName transportComponent =
- ComponentName.unflattenFromString(componentShortString);
- synchronized (mTransportLock) {
- if (mBoundTransports.containsValue(transportComponent)) {
- Slog.d(TAG, "Explicit rebinding timeout passed, but already bound to "
- + componentShortString + " so not attempting to rebind");
- return;
- }
- Slog.d(TAG, "Explicit rebinding timeout passed, attempting rebinding to: "
- + componentShortString);
- // unbind the existing (broken) connection
- TransportConnection conn = mValidTransports.get(transportComponent);
- if (conn != null) {
- mContext.unbindService(conn);
- Slog.d(TAG, "Unbinding the existing (broken) connection to transport: "
- + componentShortString);
- }
- }
- // rebind to transport
- tryBindTransport(transportComponent);
- } else {
- Slog.e(TAG, "Unknown message sent to RebindOnTimeoutHandler, msg.what: "
- + msg.what);
- }
- }
- }
-
- private static void log_verbose(String message) {
- if (Log.isLoggable(TAG, Log.VERBOSE)) {
- Slog.v(TAG, message);
- }
- }
-
- // These only exists to make it testable with Robolectric, which is not updated to API level 24
- // yet.
- // TODO: Get rid of this once Robolectric is updated.
- private static ComponentName getComponentName(ServiceInfo serviceInfo) {
- return new ComponentName(serviceInfo.packageName, serviceInfo.name);
- }
-
- // These only exists to make it testable with Robolectric, which is not updated to API level 24
- // yet.
- // TODO: Get rid of this once Robolectric is updated.
- public static UserHandle createSystemUserHandle() {
- return new UserHandle(UserHandle.USER_SYSTEM);
+ private static Predicate<ComponentName> fromPackageFilter(String packageName) {
+ return transportComponent -> packageName.equals(transportComponent.getPackageName());
}
private static class TransportDescription {
diff --git a/services/backup/java/com/android/server/backup/internal/PerformBackupTask.java b/services/backup/java/com/android/server/backup/internal/PerformBackupTask.java
index c232241..cc3af8c 100644
--- a/services/backup/java/com/android/server/backup/internal/PerformBackupTask.java
+++ b/services/backup/java/com/android/server/backup/internal/PerformBackupTask.java
@@ -907,7 +907,15 @@
backupData = ParcelFileDescriptor.open(mBackupDataName,
ParcelFileDescriptor.MODE_READ_ONLY);
backupManagerService.addBackupTrace("sending data to transport");
- int flags = mUserInitiated ? BackupTransport.FLAG_USER_INITIATED : 0;
+
+ int userInitiatedFlag =
+ mUserInitiated ? BackupTransport.FLAG_USER_INITIATED : 0;
+ int incrementalFlag =
+ mSavedStateName.length() == 0
+ ? BackupTransport.FLAG_NON_INCREMENTAL
+ : BackupTransport.FLAG_INCREMENTAL;
+ int flags = userInitiatedFlag | incrementalFlag;
+
mStatus = transport.performBackup(mCurrentPackage, backupData, flags);
}
diff --git a/services/backup/java/com/android/server/backup/transport/OnTransportRegisteredListener.java b/services/backup/java/com/android/server/backup/transport/OnTransportRegisteredListener.java
new file mode 100644
index 0000000..391ec2d
--- /dev/null
+++ b/services/backup/java/com/android/server/backup/transport/OnTransportRegisteredListener.java
@@ -0,0 +1,33 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.server.backup.transport;
+
+import com.android.server.backup.TransportManager;
+
+/**
+ * Listener called when a transport is registered with the {@link TransportManager}. Can be set
+ * using {@link TransportManager#setOnTransportRegisteredListener(OnTransportRegisteredListener)}.
+ */
+@FunctionalInterface
+public interface OnTransportRegisteredListener {
+ /**
+ * Called when a transport is successfully registered.
+ * @param transportName The name of the transport.
+ * @param transportDirName The dir name of the transport.
+ */
+ public void onTransportRegistered(String transportName, String transportDirName);
+}
diff --git a/services/backup/java/com/android/server/backup/transport/TransportClient.java b/services/backup/java/com/android/server/backup/transport/TransportClient.java
index 7bd9111..bd4a0bb 100644
--- a/services/backup/java/com/android/server/backup/transport/TransportClient.java
+++ b/services/backup/java/com/android/server/backup/transport/TransportClient.java
@@ -236,7 +236,7 @@
mBindIntent,
mConnection,
Context.BIND_AUTO_CREATE,
- TransportManager.createSystemUserHandle());
+ UserHandle.SYSTEM);
if (hasBound) {
// We don't need to set a time-out because we are guaranteed to get a call
// back in ServiceConnection, either an onServiceConnected() or
diff --git a/services/core/Android.bp b/services/core/Android.bp
index 9fb2681..3369458 100644
--- a/services/core/Android.bp
+++ b/services/core/Android.bp
@@ -16,6 +16,7 @@
":installd_aidl",
":storaged_aidl",
":vold_aidl",
+ ":mediaupdateservice_aidl",
"java/com/android/server/EventLogTags.logtags",
"java/com/android/server/am/EventLogTags.logtags",
],
diff --git a/services/core/java/com/android/server/BatteryService.java b/services/core/java/com/android/server/BatteryService.java
index af0b66d..04d292f 100644
--- a/services/core/java/com/android/server/BatteryService.java
+++ b/services/core/java/com/android/server/BatteryService.java
@@ -293,15 +293,10 @@
private void updateBatteryWarningLevelLocked() {
final ContentResolver resolver = mContext.getContentResolver();
- final int defWarnLevel = mContext.getResources().getInteger(
+ int defWarnLevel = mContext.getResources().getInteger(
com.android.internal.R.integer.config_lowBatteryWarningLevel);
- final int lowPowerModeTriggerLevel = Settings.Global.getInt(resolver,
+ mLowBatteryWarningLevel = Settings.Global.getInt(resolver,
Settings.Global.LOW_POWER_MODE_TRIGGER_LEVEL, defWarnLevel);
-
- // NOTE: Keep the logic in sync with PowerUI.java in systemUI.
- // TODO: Propagate this value from BatteryService to system UI, really.
- mLowBatteryWarningLevel = Math.min(defWarnLevel, lowPowerModeTriggerLevel);
-
if (mLowBatteryWarningLevel == 0) {
mLowBatteryWarningLevel = defWarnLevel;
}
diff --git a/services/core/java/com/android/server/ConnectivityService.java b/services/core/java/com/android/server/ConnectivityService.java
index bbba878..77521df 100644
--- a/services/core/java/com/android/server/ConnectivityService.java
+++ b/services/core/java/com/android/server/ConnectivityService.java
@@ -226,7 +226,11 @@
@GuardedBy("mVpns")
private final SparseArray<Vpn> mVpns = new SparseArray<Vpn>();
+ // TODO: investigate if mLockdownEnabled can be removed and replaced everywhere by
+ // a direct call to LockdownVpnTracker.isEnabled().
+ @GuardedBy("mVpns")
private boolean mLockdownEnabled;
+ @GuardedBy("mVpns")
private LockdownVpnTracker mLockdownTracker;
final private Context mContext;
@@ -997,9 +1001,9 @@
}
private Network[] getVpnUnderlyingNetworks(int uid) {
- if (!mLockdownEnabled) {
- int user = UserHandle.getUserId(uid);
- synchronized (mVpns) {
+ synchronized (mVpns) {
+ if (!mLockdownEnabled) {
+ int user = UserHandle.getUserId(uid);
Vpn vpn = mVpns.get(user);
if (vpn != null && vpn.appliesToUid(uid)) {
return vpn.getUnderlyingNetworks();
@@ -1087,8 +1091,10 @@
if (isNetworkWithLinkPropertiesBlocked(state.linkProperties, uid, ignoreBlocked)) {
state.networkInfo.setDetailedState(DetailedState.BLOCKED, null, null);
}
- if (mLockdownTracker != null) {
- mLockdownTracker.augmentNetworkInfo(state.networkInfo);
+ synchronized (mVpns) {
+ if (mLockdownTracker != null) {
+ mLockdownTracker.augmentNetworkInfo(state.networkInfo);
+ }
}
}
@@ -1253,8 +1259,8 @@
result.put(nai.network, nc);
}
- if (!mLockdownEnabled) {
- synchronized (mVpns) {
+ synchronized (mVpns) {
+ if (!mLockdownEnabled) {
Vpn vpn = mVpns.get(userId);
if (vpn != null) {
Network[] networks = vpn.getUnderlyingNetworks();
@@ -1580,9 +1586,11 @@
}
private Intent makeGeneralIntent(NetworkInfo info, String bcastType) {
- if (mLockdownTracker != null) {
- info = new NetworkInfo(info);
- mLockdownTracker.augmentNetworkInfo(info);
+ synchronized (mVpns) {
+ if (mLockdownTracker != null) {
+ info = new NetworkInfo(info);
+ mLockdownTracker.augmentNetworkInfo(info);
+ }
}
Intent intent = new Intent(bcastType);
@@ -3436,9 +3444,9 @@
public boolean prepareVpn(@Nullable String oldPackage, @Nullable String newPackage,
int userId) {
enforceCrossUserPermission(userId);
- throwIfLockdownEnabled();
synchronized (mVpns) {
+ throwIfLockdownEnabled();
Vpn vpn = mVpns.get(userId);
if (vpn != null) {
return vpn.prepare(oldPackage, newPackage);
@@ -3482,9 +3490,9 @@
*/
@Override
public ParcelFileDescriptor establishVpn(VpnConfig config) {
- throwIfLockdownEnabled();
int user = UserHandle.getUserId(Binder.getCallingUid());
synchronized (mVpns) {
+ throwIfLockdownEnabled();
return mVpns.get(user).establish(config);
}
}
@@ -3495,13 +3503,13 @@
*/
@Override
public void startLegacyVpn(VpnProfile profile) {
- throwIfLockdownEnabled();
+ int user = UserHandle.getUserId(Binder.getCallingUid());
final LinkProperties egress = getActiveLinkProperties();
if (egress == null) {
throw new IllegalStateException("Missing active network connection");
}
- int user = UserHandle.getUserId(Binder.getCallingUid());
synchronized (mVpns) {
+ throwIfLockdownEnabled();
mVpns.get(user).startLegacyVpn(profile, mKeyStore, egress);
}
}
@@ -3527,11 +3535,11 @@
@Override
public VpnInfo[] getAllVpnInfo() {
enforceConnectivityInternalPermission();
- if (mLockdownEnabled) {
- return new VpnInfo[0];
- }
-
synchronized (mVpns) {
+ if (mLockdownEnabled) {
+ return new VpnInfo[0];
+ }
+
List<VpnInfo> infoList = new ArrayList<>();
for (int i = 0; i < mVpns.size(); i++) {
VpnInfo info = createVpnInfo(mVpns.valueAt(i));
@@ -3596,33 +3604,33 @@
return false;
}
- // Tear down existing lockdown if profile was removed
- mLockdownEnabled = LockdownVpnTracker.isEnabled();
- if (mLockdownEnabled) {
- byte[] profileTag = mKeyStore.get(Credentials.LOCKDOWN_VPN);
- if (profileTag == null) {
- Slog.e(TAG, "Lockdown VPN configured but cannot be read from keystore");
- return false;
- }
- String profileName = new String(profileTag);
- final VpnProfile profile = VpnProfile.decode(
- profileName, mKeyStore.get(Credentials.VPN + profileName));
- if (profile == null) {
- Slog.e(TAG, "Lockdown VPN configured invalid profile " + profileName);
- setLockdownTracker(null);
- return true;
- }
- int user = UserHandle.getUserId(Binder.getCallingUid());
- synchronized (mVpns) {
+ synchronized (mVpns) {
+ // Tear down existing lockdown if profile was removed
+ mLockdownEnabled = LockdownVpnTracker.isEnabled();
+ if (mLockdownEnabled) {
+ byte[] profileTag = mKeyStore.get(Credentials.LOCKDOWN_VPN);
+ if (profileTag == null) {
+ Slog.e(TAG, "Lockdown VPN configured but cannot be read from keystore");
+ return false;
+ }
+ String profileName = new String(profileTag);
+ final VpnProfile profile = VpnProfile.decode(
+ profileName, mKeyStore.get(Credentials.VPN + profileName));
+ if (profile == null) {
+ Slog.e(TAG, "Lockdown VPN configured invalid profile " + profileName);
+ setLockdownTracker(null);
+ return true;
+ }
+ int user = UserHandle.getUserId(Binder.getCallingUid());
Vpn vpn = mVpns.get(user);
if (vpn == null) {
Slog.w(TAG, "VPN for user " + user + " not ready yet. Skipping lockdown");
return false;
}
setLockdownTracker(new LockdownVpnTracker(mContext, mNetd, this, vpn, profile));
+ } else {
+ setLockdownTracker(null);
}
- } else {
- setLockdownTracker(null);
}
return true;
@@ -3632,6 +3640,7 @@
* Internally set new {@link LockdownVpnTracker}, shutting down any existing
* {@link LockdownVpnTracker}. Can be {@code null} to disable lockdown.
*/
+ @GuardedBy("mVpns")
private void setLockdownTracker(LockdownVpnTracker tracker) {
// Shutdown any existing tracker
final LockdownVpnTracker existing = mLockdownTracker;
@@ -3646,6 +3655,7 @@
}
}
+ @GuardedBy("mVpns")
private void throwIfLockdownEnabled() {
if (mLockdownEnabled) {
throw new IllegalStateException("Unavailable in lockdown mode");
@@ -3693,12 +3703,12 @@
enforceConnectivityInternalPermission();
enforceCrossUserPermission(userId);
- // Can't set always-on VPN if legacy VPN is already in lockdown mode.
- if (LockdownVpnTracker.isEnabled()) {
- return false;
- }
-
synchronized (mVpns) {
+ // Can't set always-on VPN if legacy VPN is already in lockdown mode.
+ if (LockdownVpnTracker.isEnabled()) {
+ return false;
+ }
+
Vpn vpn = mVpns.get(userId);
if (vpn == null) {
Slog.w(TAG, "User " + userId + " has no Vpn configuration");
@@ -3874,9 +3884,9 @@
}
userVpn = new Vpn(mHandler.getLooper(), mContext, mNetd, userId);
mVpns.put(userId, userVpn);
- }
- if (mUserManager.getUserInfo(userId).isPrimary() && LockdownVpnTracker.isEnabled()) {
- updateLockdownVpn();
+ if (mUserManager.getUserInfo(userId).isPrimary() && LockdownVpnTracker.isEnabled()) {
+ updateLockdownVpn();
+ }
}
}
@@ -3913,11 +3923,13 @@
}
private void onUserUnlocked(int userId) {
- // User present may be sent because of an unlock, which might mean an unlocked keystore.
- if (mUserManager.getUserInfo(userId).isPrimary() && LockdownVpnTracker.isEnabled()) {
- updateLockdownVpn();
- } else {
- startAlwaysOnVpn(userId);
+ synchronized (mVpns) {
+ // User present may be sent because of an unlock, which might mean an unlocked keystore.
+ if (mUserManager.getUserInfo(userId).isPrimary() && LockdownVpnTracker.isEnabled()) {
+ updateLockdownVpn();
+ } else {
+ startAlwaysOnVpn(userId);
+ }
}
}
@@ -4597,51 +4609,67 @@
}
/**
- * Update the NetworkCapabilities for {@code networkAgent} to {@code networkCapabilities}
- * augmented with any stateful capabilities implied from {@code networkAgent}
- * (e.g., validated status and captive portal status).
- *
- * @param oldScore score of the network before any of the changes that prompted us
- * to call this function.
- * @param nai the network having its capabilities updated.
- * @param networkCapabilities the new network capabilities.
+ * Augments the NetworkCapabilities passed in by a NetworkAgent with capabilities that are
+ * maintained here that the NetworkAgent is not aware of (e.g., validated, captive portal,
+ * and foreground status).
*/
- private void updateCapabilities(
- int oldScore, NetworkAgentInfo nai, NetworkCapabilities networkCapabilities) {
+ private NetworkCapabilities mixInCapabilities(NetworkAgentInfo nai, NetworkCapabilities nc) {
// Once a NetworkAgent is connected, complain if some immutable capabilities are removed.
- if (nai.everConnected && !nai.networkCapabilities.satisfiedByImmutableNetworkCapabilities(
- networkCapabilities)) {
- // TODO: consider not complaining when a network agent degrade its capabilities if this
+ if (nai.everConnected &&
+ !nai.networkCapabilities.satisfiedByImmutableNetworkCapabilities(nc)) {
+ // TODO: consider not complaining when a network agent degrades its capabilities if this
// does not cause any request (that is not a listen) currently matching that agent to
// stop being matched by the updated agent.
- String diff = nai.networkCapabilities.describeImmutableDifferences(networkCapabilities);
+ String diff = nai.networkCapabilities.describeImmutableDifferences(nc);
if (!TextUtils.isEmpty(diff)) {
Slog.wtf(TAG, "BUG: " + nai + " lost immutable capabilities:" + diff);
}
}
// Don't modify caller's NetworkCapabilities.
- networkCapabilities = new NetworkCapabilities(networkCapabilities);
+ NetworkCapabilities newNc = new NetworkCapabilities(nc);
if (nai.lastValidated) {
- networkCapabilities.addCapability(NET_CAPABILITY_VALIDATED);
+ newNc.addCapability(NET_CAPABILITY_VALIDATED);
} else {
- networkCapabilities.removeCapability(NET_CAPABILITY_VALIDATED);
+ newNc.removeCapability(NET_CAPABILITY_VALIDATED);
}
if (nai.lastCaptivePortalDetected) {
- networkCapabilities.addCapability(NET_CAPABILITY_CAPTIVE_PORTAL);
+ newNc.addCapability(NET_CAPABILITY_CAPTIVE_PORTAL);
} else {
- networkCapabilities.removeCapability(NET_CAPABILITY_CAPTIVE_PORTAL);
+ newNc.removeCapability(NET_CAPABILITY_CAPTIVE_PORTAL);
}
if (nai.isBackgroundNetwork()) {
- networkCapabilities.removeCapability(NET_CAPABILITY_FOREGROUND);
+ newNc.removeCapability(NET_CAPABILITY_FOREGROUND);
} else {
- networkCapabilities.addCapability(NET_CAPABILITY_FOREGROUND);
+ newNc.addCapability(NET_CAPABILITY_FOREGROUND);
}
- if (Objects.equals(nai.networkCapabilities, networkCapabilities)) return;
+ return newNc;
+ }
+
+ /**
+ * Update the NetworkCapabilities for {@code nai} to {@code nc}. Specifically:
+ *
+ * 1. Calls mixInCapabilities to merge the passed-in NetworkCapabilities {@code nc} with the
+ * capabilities we manage and store in {@code nai}, such as validated status and captive
+ * portal status)
+ * 2. Takes action on the result: changes network permissions, sends CAP_CHANGED callbacks, and
+ * potentially triggers rematches.
+ * 3. Directly informs other network stack components (NetworkStatsService, VPNs, etc. of the
+ * change.)
+ *
+ * @param oldScore score of the network before any of the changes that prompted us
+ * to call this function.
+ * @param nai the network having its capabilities updated.
+ * @param nc the new network capabilities.
+ */
+ private void updateCapabilities(int oldScore, NetworkAgentInfo nai, NetworkCapabilities nc) {
+ NetworkCapabilities newNc = mixInCapabilities(nai, nc);
+
+ if (Objects.equals(nai.networkCapabilities, newNc)) return;
final String oldPermission = getNetworkPermission(nai.networkCapabilities);
- final String newPermission = getNetworkPermission(networkCapabilities);
+ final String newPermission = getNetworkPermission(newNc);
if (!Objects.equals(oldPermission, newPermission) && nai.created && !nai.isVPN()) {
try {
mNetd.setNetworkPermission(nai.network.netId, newPermission);
@@ -4653,11 +4681,10 @@
final NetworkCapabilities prevNc;
synchronized (nai) {
prevNc = nai.networkCapabilities;
- nai.networkCapabilities = networkCapabilities;
+ nai.networkCapabilities = newNc;
}
- if (nai.getCurrentScore() == oldScore &&
- networkCapabilities.equalRequestableCapabilities(prevNc)) {
+ if (nai.getCurrentScore() == oldScore && newNc.equalRequestableCapabilities(prevNc)) {
// If the requestable capabilities haven't changed, and the score hasn't changed, then
// the change we're processing can't affect any requests, it can only affect the listens
// on this network. We might have been called by rematchNetworkAndRequests when a
@@ -4673,15 +4700,15 @@
// Report changes that are interesting for network statistics tracking.
if (prevNc != null) {
final boolean meteredChanged = prevNc.hasCapability(NET_CAPABILITY_NOT_METERED) !=
- networkCapabilities.hasCapability(NET_CAPABILITY_NOT_METERED);
+ newNc.hasCapability(NET_CAPABILITY_NOT_METERED);
final boolean roamingChanged = prevNc.hasCapability(NET_CAPABILITY_NOT_ROAMING) !=
- networkCapabilities.hasCapability(NET_CAPABILITY_NOT_ROAMING);
+ newNc.hasCapability(NET_CAPABILITY_NOT_ROAMING);
if (meteredChanged || roamingChanged) {
notifyIfacesChangedForNetworkStats();
}
}
- if (!networkCapabilities.hasTransport(TRANSPORT_VPN)) {
+ if (!newNc.hasTransport(TRANSPORT_VPN)) {
// Tell VPNs about updated capabilities, since they may need to
// bubble those changes through.
synchronized (mVpns) {
@@ -5205,11 +5232,13 @@
}
private void notifyLockdownVpn(NetworkAgentInfo nai) {
- if (mLockdownTracker != null) {
- if (nai != null && nai.isVPN()) {
- mLockdownTracker.onVpnStateChanged(nai.networkInfo);
- } else {
- mLockdownTracker.onNetworkInfoChanged();
+ synchronized (mVpns) {
+ if (mLockdownTracker != null) {
+ if (nai != null && nai.isVPN()) {
+ mLockdownTracker.onVpnStateChanged(nai.networkInfo);
+ } else {
+ mLockdownTracker.onNetworkInfoChanged();
+ }
}
}
}
@@ -5439,28 +5468,28 @@
@Override
public boolean addVpnAddress(String address, int prefixLength) {
- throwIfLockdownEnabled();
int user = UserHandle.getUserId(Binder.getCallingUid());
synchronized (mVpns) {
+ throwIfLockdownEnabled();
return mVpns.get(user).addAddress(address, prefixLength);
}
}
@Override
public boolean removeVpnAddress(String address, int prefixLength) {
- throwIfLockdownEnabled();
int user = UserHandle.getUserId(Binder.getCallingUid());
synchronized (mVpns) {
+ throwIfLockdownEnabled();
return mVpns.get(user).removeAddress(address, prefixLength);
}
}
@Override
public boolean setUnderlyingNetworksForVpn(Network[] networks) {
- throwIfLockdownEnabled();
int user = UserHandle.getUserId(Binder.getCallingUid());
- boolean success;
+ final boolean success;
synchronized (mVpns) {
+ throwIfLockdownEnabled();
success = mVpns.get(user).setUnderlyingNetworks(networks);
}
if (success) {
@@ -5520,31 +5549,31 @@
setAlwaysOnVpnPackage(userId, null, false);
setVpnPackageAuthorization(alwaysOnPackage, userId, false);
}
- }
- // Turn Always-on VPN off
- if (mLockdownEnabled && userId == UserHandle.USER_SYSTEM) {
- final long ident = Binder.clearCallingIdentity();
- try {
- mKeyStore.delete(Credentials.LOCKDOWN_VPN);
- mLockdownEnabled = false;
- setLockdownTracker(null);
- } finally {
- Binder.restoreCallingIdentity(ident);
+ // Turn Always-on VPN off
+ if (mLockdownEnabled && userId == UserHandle.USER_SYSTEM) {
+ final long ident = Binder.clearCallingIdentity();
+ try {
+ mKeyStore.delete(Credentials.LOCKDOWN_VPN);
+ mLockdownEnabled = false;
+ setLockdownTracker(null);
+ } finally {
+ Binder.restoreCallingIdentity(ident);
+ }
}
- }
- // Turn VPN off
- VpnConfig vpnConfig = getVpnConfig(userId);
- if (vpnConfig != null) {
- if (vpnConfig.legacy) {
- prepareVpn(VpnConfig.LEGACY_VPN, VpnConfig.LEGACY_VPN, userId);
- } else {
- // Prevent this app (packagename = vpnConfig.user) from initiating VPN connections
- // in the future without user intervention.
- setVpnPackageAuthorization(vpnConfig.user, userId, false);
+ // Turn VPN off
+ VpnConfig vpnConfig = getVpnConfig(userId);
+ if (vpnConfig != null) {
+ if (vpnConfig.legacy) {
+ prepareVpn(VpnConfig.LEGACY_VPN, VpnConfig.LEGACY_VPN, userId);
+ } else {
+ // Prevent this app (packagename = vpnConfig.user) from initiating
+ // VPN connections in the future without user intervention.
+ setVpnPackageAuthorization(vpnConfig.user, userId, false);
- prepareVpn(null, VpnConfig.LEGACY_VPN, userId);
+ prepareVpn(null, VpnConfig.LEGACY_VPN, userId);
+ }
}
}
}
diff --git a/services/core/java/com/android/server/IpSecService.java b/services/core/java/com/android/server/IpSecService.java
index 02cfe3d..9d228c3 100644
--- a/services/core/java/com/android/server/IpSecService.java
+++ b/services/core/java/com/android/server/IpSecService.java
@@ -25,6 +25,7 @@
import static com.android.internal.util.Preconditions.checkNotNull;
import android.content.Context;
+import android.net.ConnectivityManager;
import android.net.IIpSecService;
import android.net.INetd;
import android.net.IpSecAlgorithm;
@@ -62,7 +63,6 @@
import java.net.UnknownHostException;
import java.util.ArrayList;
import java.util.List;
-import java.util.concurrent.atomic.AtomicInteger;
import libcore.io.IoUtils;
@@ -83,7 +83,7 @@
private static final String NETD_SERVICE_NAME = "netd";
private static final int[] DIRECTIONS =
- new int[] {IpSecTransform.DIRECTION_OUT, IpSecTransform.DIRECTION_IN};
+ new int[] {IpSecManager.DIRECTION_OUT, IpSecManager.DIRECTION_IN};
private static final int NETD_FETCH_TIMEOUT_MS = 5000; // ms
private static final int MAX_PORT_BIND_ATTEMPTS = 10;
@@ -104,10 +104,10 @@
private final Context mContext;
/**
- * The next non-repeating global ID for tracking resources between users, this service,
- * and kernel data structures. Accessing this variable is not thread safe, so it is
- * only read or modified within blocks synchronized on IpSecService.this. We want to
- * avoid -1 (INVALID_RESOURCE_ID) and 0 (we probably forgot to initialize it).
+ * The next non-repeating global ID for tracking resources between users, this service, and
+ * kernel data structures. Accessing this variable is not thread safe, so it is only read or
+ * modified within blocks synchronized on IpSecService.this. We want to avoid -1
+ * (INVALID_RESOURCE_ID) and 0 (we probably forgot to initialize it).
*/
@GuardedBy("IpSecService.this")
private int mNextResourceId = 1;
@@ -536,14 +536,14 @@
private final class TransformRecord extends KernelResourceRecord {
private final IpSecConfig mConfig;
- private final SpiRecord[] mSpis;
+ private final SpiRecord mSpi;
private final EncapSocketRecord mSocket;
TransformRecord(
- int resourceId, IpSecConfig config, SpiRecord[] spis, EncapSocketRecord socket) {
+ int resourceId, IpSecConfig config, SpiRecord spi, EncapSocketRecord socket) {
super(resourceId);
mConfig = config;
- mSpis = spis;
+ mSpi = spi;
mSocket = socket;
}
@@ -551,29 +551,26 @@
return mConfig;
}
- public SpiRecord getSpiRecord(int direction) {
- return mSpis[direction];
+ public SpiRecord getSpiRecord() {
+ return mSpi;
}
/** always guarded by IpSecService#this */
@Override
public void freeUnderlyingResources() {
- for (int direction : DIRECTIONS) {
- int spi = mSpis[direction].getSpi();
- try {
- mSrvConfig
- .getNetdInstance()
- .ipSecDeleteSecurityAssociation(
- mResourceId,
- direction,
- mConfig.getLocalAddress(),
- mConfig.getRemoteAddress(),
- spi);
- } catch (ServiceSpecificException e) {
- // FIXME: get the error code and throw is at an IOException from Errno Exception
- } catch (RemoteException e) {
- Log.e(TAG, "Failed to delete SA with ID: " + mResourceId);
- }
+ int spi = mSpi.getSpi();
+ try {
+ mSrvConfig
+ .getNetdInstance()
+ .ipSecDeleteSecurityAssociation(
+ mResourceId,
+ mConfig.getSourceAddress(),
+ mConfig.getDestinationAddress(),
+ spi);
+ } catch (ServiceSpecificException e) {
+ // FIXME: get the error code and throw is at an IOException from Errno Exception
+ } catch (RemoteException e) {
+ Log.e(TAG, "Failed to delete SA with ID: " + mResourceId);
}
getResourceTracker().give();
@@ -597,10 +594,8 @@
.append(super.toString())
.append(", mSocket=")
.append(mSocket)
- .append(", mSpis[OUT].mResourceId=")
- .append(mSpis[IpSecTransform.DIRECTION_OUT].mResourceId)
- .append(", mSpis[IN].mResourceId=")
- .append(mSpis[IpSecTransform.DIRECTION_IN].mResourceId)
+ .append(", mSpi.mResourceId=")
+ .append(mSpi.mResourceId)
.append(", mConfig=")
.append(mConfig)
.append("}");
@@ -609,23 +604,16 @@
}
private final class SpiRecord extends KernelResourceRecord {
- private final int mDirection;
- private final String mLocalAddress;
- private final String mRemoteAddress;
+ private final String mSourceAddress;
+ private final String mDestinationAddress;
private int mSpi;
private boolean mOwnedByTransform = false;
- SpiRecord(
- int resourceId,
- int direction,
- String localAddress,
- String remoteAddress,
- int spi) {
+ SpiRecord(int resourceId, String sourceAddress, String destinationAddress, int spi) {
super(resourceId);
- mDirection = direction;
- mLocalAddress = localAddress;
- mRemoteAddress = remoteAddress;
+ mSourceAddress = sourceAddress;
+ mDestinationAddress = destinationAddress;
mSpi = spi;
}
@@ -646,7 +634,7 @@
mSrvConfig
.getNetdInstance()
.ipSecDeleteSecurityAssociation(
- mResourceId, mDirection, mLocalAddress, mRemoteAddress, mSpi);
+ mResourceId, mSourceAddress, mDestinationAddress, mSpi);
} catch (ServiceSpecificException e) {
// FIXME: get the error code and throw is at an IOException from Errno Exception
} catch (RemoteException e) {
@@ -662,6 +650,10 @@
return mSpi;
}
+ public String getDestinationAddress() {
+ return mDestinationAddress;
+ }
+
public void setOwnedByTransform() {
if (mOwnedByTransform) {
// Programming error
@@ -689,12 +681,10 @@
.append(super.toString())
.append(", mSpi=")
.append(mSpi)
- .append(", mDirection=")
- .append(mDirection)
- .append(", mLocalAddress=")
- .append(mLocalAddress)
- .append(", mRemoteAddress=")
- .append(mRemoteAddress)
+ .append(", mSourceAddress=")
+ .append(mSourceAddress)
+ .append(", mDestinationAddress=")
+ .append(mDestinationAddress)
.append(", mOwnedByTransform=")
.append(mOwnedByTransform)
.append("}");
@@ -772,14 +762,17 @@
/** @hide */
@VisibleForTesting
public IpSecService(Context context, IpSecServiceConfiguration config) {
- this(context, config, (fd, uid) -> {
- try{
- TrafficStats.setThreadStatsUid(uid);
- TrafficStats.tagFileDescriptor(fd);
- } finally {
- TrafficStats.clearThreadStatsUid();
- }
- });
+ this(
+ context,
+ config,
+ (fd, uid) -> {
+ try {
+ TrafficStats.setThreadStatsUid(uid);
+ TrafficStats.tagFileDescriptor(fd);
+ } finally {
+ TrafficStats.clearThreadStatsUid();
+ }
+ });
}
/** @hide */
@@ -845,8 +838,8 @@
*/
private static void checkDirection(int direction) {
switch (direction) {
- case IpSecTransform.DIRECTION_OUT:
- case IpSecTransform.DIRECTION_IN:
+ case IpSecManager.DIRECTION_OUT:
+ case IpSecManager.DIRECTION_IN:
return;
}
throw new IllegalArgumentException("Invalid Direction: " + direction);
@@ -855,10 +848,8 @@
/** Get a new SPI and maintain the reservation in the system server */
@Override
public synchronized IpSecSpiResponse allocateSecurityParameterIndex(
- int direction, String remoteAddress, int requestedSpi, IBinder binder)
- throws RemoteException {
- checkDirection(direction);
- checkInetAddress(remoteAddress);
+ String destinationAddress, int requestedSpi, IBinder binder) throws RemoteException {
+ checkInetAddress(destinationAddress);
/* requestedSpi can be anything in the int range, so no check is needed. */
checkNotNull(binder, "Null Binder passed to allocateSecurityParameterIndex");
@@ -866,28 +857,21 @@
final int resourceId = mNextResourceId++;
int spi = IpSecManager.INVALID_SECURITY_PARAMETER_INDEX;
- String localAddress = "";
-
try {
if (!userRecord.mSpiQuotaTracker.isAvailable()) {
return new IpSecSpiResponse(
IpSecManager.Status.RESOURCE_UNAVAILABLE, INVALID_RESOURCE_ID, spi);
}
+
spi =
mSrvConfig
.getNetdInstance()
- .ipSecAllocateSpi(
- resourceId,
- direction,
- localAddress,
- remoteAddress,
- requestedSpi);
+ .ipSecAllocateSpi(resourceId, "", destinationAddress, requestedSpi);
Log.d(TAG, "Allocated SPI " + spi);
userRecord.mSpiRecords.put(
resourceId,
new RefcountedResource<SpiRecord>(
- new SpiRecord(resourceId, direction, localAddress, remoteAddress, spi),
- binder));
+ new SpiRecord(resourceId, "", destinationAddress, spi), binder));
} catch (ServiceSpecificException e) {
// TODO: Add appropriate checks when other ServiceSpecificException types are supported
return new IpSecSpiResponse(
@@ -1032,27 +1016,27 @@
}
@VisibleForTesting
- void validateAlgorithms(IpSecConfig config, int direction) throws IllegalArgumentException {
- IpSecAlgorithm auth = config.getAuthentication(direction);
- IpSecAlgorithm crypt = config.getEncryption(direction);
- IpSecAlgorithm aead = config.getAuthenticatedEncryption(direction);
+ void validateAlgorithms(IpSecConfig config) throws IllegalArgumentException {
+ IpSecAlgorithm auth = config.getAuthentication();
+ IpSecAlgorithm crypt = config.getEncryption();
+ IpSecAlgorithm aead = config.getAuthenticatedEncryption();
- // Validate the algorithm set
- Preconditions.checkArgument(
- aead != null || crypt != null || auth != null,
- "No Encryption or Authentication algorithms specified");
- Preconditions.checkArgument(
- auth == null || auth.isAuthentication(),
- "Unsupported algorithm for Authentication");
- Preconditions.checkArgument(
+ // Validate the algorithm set
+ Preconditions.checkArgument(
+ aead != null || crypt != null || auth != null,
+ "No Encryption or Authentication algorithms specified");
+ Preconditions.checkArgument(
+ auth == null || auth.isAuthentication(),
+ "Unsupported algorithm for Authentication");
+ Preconditions.checkArgument(
crypt == null || crypt.isEncryption(), "Unsupported algorithm for Encryption");
- Preconditions.checkArgument(
- aead == null || aead.isAead(),
- "Unsupported algorithm for Authenticated Encryption");
- Preconditions.checkArgument(
- aead == null || (auth == null && crypt == null),
- "Authenticated Encryption is mutually exclusive with other Authentication "
- + "or Encryption algorithms");
+ Preconditions.checkArgument(
+ aead == null || aead.isAead(),
+ "Unsupported algorithm for Authenticated Encryption");
+ Preconditions.checkArgument(
+ aead == null || (auth == null && crypt == null),
+ "Authenticated Encryption is mutually exclusive with other Authentication "
+ + "or Encryption algorithms");
}
/**
@@ -1062,29 +1046,6 @@
private void checkIpSecConfig(IpSecConfig config) {
UserRecord userRecord = mUserResourceTracker.getUserRecord(Binder.getCallingUid());
- if (config.getLocalAddress() == null) {
- throw new IllegalArgumentException("Invalid null Local InetAddress");
- }
-
- if (config.getRemoteAddress() == null) {
- throw new IllegalArgumentException("Invalid null Remote InetAddress");
- }
-
- switch (config.getMode()) {
- case IpSecTransform.MODE_TRANSPORT:
- if (!config.getLocalAddress().isEmpty()) {
- throw new IllegalArgumentException("Non-empty Local Address");
- }
- // Must be valid, and not a wildcard
- checkInetAddress(config.getRemoteAddress());
- break;
- case IpSecTransform.MODE_TUNNEL:
- break;
- default:
- throw new IllegalArgumentException(
- "Invalid IpSecTransform.mode: " + config.getMode());
- }
-
switch (config.getEncapType()) {
case IpSecTransform.ENCAP_NONE:
break;
@@ -1103,11 +1064,36 @@
throw new IllegalArgumentException("Invalid Encap Type: " + config.getEncapType());
}
- for (int direction : DIRECTIONS) {
- validateAlgorithms(config, direction);
+ validateAlgorithms(config);
- // Retrieve SPI record; will throw IllegalArgumentException if not found
- userRecord.mSpiRecords.getResourceOrThrow(config.getSpiResourceId(direction));
+ // Retrieve SPI record; will throw IllegalArgumentException if not found
+ SpiRecord s = userRecord.mSpiRecords.getResourceOrThrow(config.getSpiResourceId());
+
+ // If no remote address is supplied, then use one from the SPI.
+ if (TextUtils.isEmpty(config.getDestinationAddress())) {
+ config.setDestinationAddress(s.getDestinationAddress());
+ }
+
+ // All remote addresses must match
+ if (!config.getDestinationAddress().equals(s.getDestinationAddress())) {
+ throw new IllegalArgumentException("Mismatched remote addresseses.");
+ }
+
+ // This check is technically redundant due to the chain of custody between the SPI and
+ // the IpSecConfig, but in the future if the dest is allowed to be set explicitly in
+ // the transform, this will prevent us from messing up.
+ checkInetAddress(config.getDestinationAddress());
+
+ // Require a valid source address for all transforms.
+ checkInetAddress(config.getSourceAddress());
+
+ switch (config.getMode()) {
+ case IpSecTransform.MODE_TRANSPORT:
+ case IpSecTransform.MODE_TUNNEL:
+ break;
+ default:
+ throw new IllegalArgumentException(
+ "Invalid IpSecTransform.mode: " + config.getMode());
}
}
@@ -1127,13 +1113,12 @@
UserRecord userRecord = mUserResourceTracker.getUserRecord(Binder.getCallingUid());
- // Avoid resizing by creating a dependency array of min-size 3 (1 UDP encap + 2 SPIs)
- List<RefcountedResource> dependencies = new ArrayList<>(3);
+ // Avoid resizing by creating a dependency array of min-size 2 (1 UDP encap + 1 SPI)
+ List<RefcountedResource> dependencies = new ArrayList<>(2);
if (!userRecord.mTransformQuotaTracker.isAvailable()) {
return new IpSecTransformResponse(IpSecManager.Status.RESOURCE_UNAVAILABLE);
}
- SpiRecord[] spis = new SpiRecord[DIRECTIONS.length];
int encapType, encapLocalPort = 0, encapRemotePort = 0;
EncapSocketRecord socketRecord = null;
@@ -1149,51 +1134,46 @@
encapRemotePort = c.getEncapRemotePort();
}
- for (int direction : DIRECTIONS) {
- IpSecAlgorithm auth = c.getAuthentication(direction);
- IpSecAlgorithm crypt = c.getEncryption(direction);
- IpSecAlgorithm authCrypt = c.getAuthenticatedEncryption(direction);
+ IpSecAlgorithm auth = c.getAuthentication();
+ IpSecAlgorithm crypt = c.getEncryption();
+ IpSecAlgorithm authCrypt = c.getAuthenticatedEncryption();
- RefcountedResource<SpiRecord> refcountedSpiRecord =
- userRecord.mSpiRecords.getRefcountedResourceOrThrow(
- c.getSpiResourceId(direction));
- dependencies.add(refcountedSpiRecord);
+ RefcountedResource<SpiRecord> refcountedSpiRecord =
+ userRecord.mSpiRecords.getRefcountedResourceOrThrow(c.getSpiResourceId());
+ dependencies.add(refcountedSpiRecord);
+ SpiRecord spiRecord = refcountedSpiRecord.getResource();
- spis[direction] = refcountedSpiRecord.getResource();
- int spi = spis[direction].getSpi();
- try {
- mSrvConfig
- .getNetdInstance()
- .ipSecAddSecurityAssociation(
- resourceId,
- c.getMode(),
- direction,
- c.getLocalAddress(),
- c.getRemoteAddress(),
- (c.getNetwork() != null) ? c.getNetwork().getNetworkHandle() : 0,
- spi,
- (auth != null) ? auth.getName() : "",
- (auth != null) ? auth.getKey() : new byte[] {},
- (auth != null) ? auth.getTruncationLengthBits() : 0,
- (crypt != null) ? crypt.getName() : "",
- (crypt != null) ? crypt.getKey() : new byte[] {},
- (crypt != null) ? crypt.getTruncationLengthBits() : 0,
- (authCrypt != null) ? authCrypt.getName() : "",
- (authCrypt != null) ? authCrypt.getKey() : new byte[] {},
- (authCrypt != null) ? authCrypt.getTruncationLengthBits() : 0,
- encapType,
- encapLocalPort,
- encapRemotePort);
- } catch (ServiceSpecificException e) {
- // FIXME: get the error code and throw is at an IOException from Errno Exception
- return new IpSecTransformResponse(IpSecManager.Status.RESOURCE_UNAVAILABLE);
- }
+ try {
+ mSrvConfig
+ .getNetdInstance()
+ .ipSecAddSecurityAssociation(
+ resourceId,
+ c.getMode(),
+ c.getSourceAddress(),
+ c.getDestinationAddress(),
+ (c.getNetwork() != null) ? c.getNetwork().netId : 0,
+ spiRecord.getSpi(),
+ (auth != null) ? auth.getName() : "",
+ (auth != null) ? auth.getKey() : new byte[] {},
+ (auth != null) ? auth.getTruncationLengthBits() : 0,
+ (crypt != null) ? crypt.getName() : "",
+ (crypt != null) ? crypt.getKey() : new byte[] {},
+ (crypt != null) ? crypt.getTruncationLengthBits() : 0,
+ (authCrypt != null) ? authCrypt.getName() : "",
+ (authCrypt != null) ? authCrypt.getKey() : new byte[] {},
+ (authCrypt != null) ? authCrypt.getTruncationLengthBits() : 0,
+ encapType,
+ encapLocalPort,
+ encapRemotePort);
+ } catch (ServiceSpecificException e) {
+ // FIXME: get the error code and throw is at an IOException from Errno Exception
+ return new IpSecTransformResponse(IpSecManager.Status.RESOURCE_UNAVAILABLE);
}
// Both SAs were created successfully, time to construct a record and lock it away
userRecord.mTransformRecords.put(
resourceId,
new RefcountedResource<TransformRecord>(
- new TransformRecord(resourceId, c, spis, socketRecord),
+ new TransformRecord(resourceId, c, spiRecord, socketRecord),
binder,
dependencies.toArray(new RefcountedResource[dependencies.size()])));
return new IpSecTransformResponse(IpSecManager.Status.OK, resourceId);
@@ -1217,9 +1197,9 @@
*/
@Override
public synchronized void applyTransportModeTransform(
- ParcelFileDescriptor socket, int resourceId) throws RemoteException {
+ ParcelFileDescriptor socket, int direction, int resourceId) throws RemoteException {
UserRecord userRecord = mUserResourceTracker.getUserRecord(Binder.getCallingUid());
-
+ checkDirection(direction);
// Get transform record; if no transform is found, will throw IllegalArgumentException
TransformRecord info = userRecord.mTransformRecords.getResourceOrThrow(resourceId);
@@ -1230,17 +1210,15 @@
IpSecConfig c = info.getConfig();
try {
- for (int direction : DIRECTIONS) {
- mSrvConfig
- .getNetdInstance()
- .ipSecApplyTransportModeTransform(
- socket.getFileDescriptor(),
- resourceId,
- direction,
- c.getLocalAddress(),
- c.getRemoteAddress(),
- info.getSpiRecord(direction).getSpi());
- }
+ mSrvConfig
+ .getNetdInstance()
+ .ipSecApplyTransportModeTransform(
+ socket.getFileDescriptor(),
+ resourceId,
+ direction,
+ c.getSourceAddress(),
+ c.getDestinationAddress(),
+ info.getSpiRecord().getSpi());
} catch (ServiceSpecificException e) {
if (e.errorCode == EINVAL) {
throw new IllegalArgumentException(e.toString());
@@ -1251,14 +1229,14 @@
}
/**
- * Remove a transport mode transform from a socket, applying the default (empty) policy. This
- * will ensure that NO IPsec policy is applied to the socket (would be the equivalent of
- * applying a policy that performs no IPsec). Today the resourceId parameter is passed but not
- * used: reserved for future improved input validation.
+ * Remove transport mode transforms from a socket, applying the default (empty) policy. This
+ * ensures that NO IPsec policy is applied to the socket (would be the equivalent of applying a
+ * policy that performs no IPsec). Today the resourceId parameter is passed but not used:
+ * reserved for future improved input validation.
*/
@Override
- public synchronized void removeTransportModeTransform(ParcelFileDescriptor socket, int resourceId)
- throws RemoteException {
+ public synchronized void removeTransportModeTransforms(
+ ParcelFileDescriptor socket, int resourceId) throws RemoteException {
try {
mSrvConfig
.getNetdInstance()
diff --git a/services/core/java/com/android/server/am/ActivityManagerService.java b/services/core/java/com/android/server/am/ActivityManagerService.java
index 3dc237d..dfe89e0 100644
--- a/services/core/java/com/android/server/am/ActivityManagerService.java
+++ b/services/core/java/com/android/server/am/ActivityManagerService.java
@@ -397,6 +397,7 @@
import com.android.internal.os.TransferPipe;
import com.android.internal.os.Zygote;
import com.android.internal.policy.IKeyguardDismissCallback;
+import com.android.internal.policy.KeyguardDismissCallback;
import com.android.internal.telephony.TelephonyIntents;
import com.android.internal.util.ArrayUtils;
import com.android.internal.util.DumpUtils;
@@ -6242,7 +6243,7 @@
// Clear its pending alarms
AlarmManagerInternal ami = LocalServices.getService(AlarmManagerInternal.class);
- ami.removeAlarmsForUid(uid);
+ ami.removeAlarmsForUid(appInfo.uid);
}
} catch (RemoteException e) {
}
@@ -7260,15 +7261,22 @@
}
ProfilerInfo profilerInfo = null;
- String agent = null;
+ String preBindAgent = null;
if (mProfileApp != null && mProfileApp.equals(processName)) {
mProfileProc = app;
- profilerInfo = (mProfilerInfo != null && mProfilerInfo.profileFile != null) ?
- new ProfilerInfo(mProfilerInfo) : null;
- agent = mProfilerInfo != null ? mProfilerInfo.agent : null;
+ if (mProfilerInfo != null) {
+ // Send a profiler info object to the app if either a file is given, or
+ // an agent should be loaded at bind-time.
+ boolean needsInfo = mProfilerInfo.profileFile != null
+ || mProfilerInfo.attachAgentDuringBind;
+ profilerInfo = needsInfo ? new ProfilerInfo(mProfilerInfo) : null;
+ if (!mProfilerInfo.attachAgentDuringBind) {
+ preBindAgent = mProfilerInfo.agent;
+ }
+ }
} else if (app.instr != null && app.instr.mProfileFile != null) {
profilerInfo = new ProfilerInfo(app.instr.mProfileFile, null, 0, false, false,
- null);
+ null, false);
}
boolean enableTrackAllocation = false;
@@ -7337,8 +7345,8 @@
// If we were asked to attach an agent on startup, do so now, before we're binding
// application code.
- if (agent != null) {
- thread.attachAgent(agent);
+ if (preBindAgent != null) {
+ thread.attachAgent(preBindAgent);
}
checkTime(startTime, "attachApplicationLocked: immediately before bindApplication");
@@ -8386,21 +8394,11 @@
// entering picture-in-picture (this will prompt the user to authenticate if the
// device is currently locked).
try {
- dismissKeyguard(token, new IKeyguardDismissCallback.Stub() {
- @Override
- public void onDismissError() throws RemoteException {
- // Do nothing
- }
-
+ dismissKeyguard(token, new KeyguardDismissCallback() {
@Override
public void onDismissSucceeded() throws RemoteException {
mHandler.post(enterPipRunnable);
}
-
- @Override
- public void onDismissCancelled() throws RemoteException {
- // Do nothing
- }
}, null /* message */);
} catch (RemoteException e) {
// Local call
@@ -25345,6 +25343,10 @@
}
}
}
+ if (updateFrameworkRes && mWindowManager != null) {
+ ActivityThread.currentActivityThread().getExecutor().execute(
+ mWindowManager::onOverlayChanged);
+ }
}
/**
diff --git a/services/core/java/com/android/server/am/ActivityManagerShellCommand.java b/services/core/java/com/android/server/am/ActivityManagerShellCommand.java
index 4f60e17..1240f5e 100644
--- a/services/core/java/com/android/server/am/ActivityManagerShellCommand.java
+++ b/services/core/java/com/android/server/am/ActivityManagerShellCommand.java
@@ -109,6 +109,7 @@
private boolean mAutoStop;
private boolean mStreaming; // Streaming the profiling output to a file.
private String mAgent; // Agent to attach on startup.
+ private boolean mAttachAgentDuringBind; // Whether agent should be attached late.
private int mDisplayId;
private int mWindowingMode;
private int mActivityType;
@@ -296,7 +297,21 @@
} else if (opt.equals("--streaming")) {
mStreaming = true;
} else if (opt.equals("--attach-agent")) {
+ if (mAgent != null) {
+ cmd.getErrPrintWriter().println(
+ "Multiple --attach-agent(-bind) not supported");
+ return false;
+ }
mAgent = getNextArgRequired();
+ mAttachAgentDuringBind = false;
+ } else if (opt.equals("--attach-agent-bind")) {
+ if (mAgent != null) {
+ cmd.getErrPrintWriter().println(
+ "Multiple --attach-agent(-bind) not supported");
+ return false;
+ }
+ mAgent = getNextArgRequired();
+ mAttachAgentDuringBind = true;
} else if (opt.equals("-R")) {
mRepeat = Integer.parseInt(getNextArgRequired());
} else if (opt.equals("-S")) {
@@ -384,7 +399,7 @@
}
}
profilerInfo = new ProfilerInfo(mProfileFile, fd, mSamplingInterval, mAutoStop,
- mStreaming, mAgent);
+ mStreaming, mAgent, mAttachAgentDuringBind);
}
pw.println("Starting: " + intent);
@@ -766,7 +781,7 @@
return -1;
}
profilerInfo = new ProfilerInfo(profileFile, fd, mSamplingInterval, false, mStreaming,
- null);
+ null, false);
}
try {
@@ -2544,6 +2559,7 @@
pw.println(" (use with --start-profiler)");
pw.println(" -P <FILE>: like above, but profiling stops when app goes idle");
pw.println(" --attach-agent <agent>: attach the given agent before binding");
+ pw.println(" --attach-agent-bind <agent>: attach the given agent during binding");
pw.println(" -R: repeat the activity launch <COUNT> times. Prior to each repeat,");
pw.println(" the top activity will be finished.");
pw.println(" -S: force stop the target app before starting the activity");
diff --git a/services/core/java/com/android/server/am/ActivityRecord.java b/services/core/java/com/android/server/am/ActivityRecord.java
index b74c8da..b5fbee6 100644
--- a/services/core/java/com/android/server/am/ActivityRecord.java
+++ b/services/core/java/com/android/server/am/ActivityRecord.java
@@ -1609,9 +1609,8 @@
mStackSupervisor.mStoppingActivities.remove(this);
mStackSupervisor.mGoingToSleepActivities.remove(this);
- // If an activity is not in the paused state when becoming visible, cycle to the paused
- // state.
- if (state != PAUSED) {
+ // If the activity is stopped or stopping, cycle to the paused state.
+ if (state == STOPPED || state == STOPPING) {
// An activity must be in the {@link PAUSING} state for the system to validate
// the move to {@link PAUSED}.
state = PAUSING;
diff --git a/services/core/java/com/android/server/broadcastradio/BroadcastRadioService.java b/services/core/java/com/android/server/broadcastradio/BroadcastRadioService.java
index 7d3b670..10e6cad 100644
--- a/services/core/java/com/android/server/broadcastradio/BroadcastRadioService.java
+++ b/services/core/java/com/android/server/broadcastradio/BroadcastRadioService.java
@@ -25,6 +25,7 @@
import android.hardware.radio.ITunerCallback;
import android.hardware.radio.RadioManager;
import android.os.ParcelableException;
+import android.os.RemoteException;
import android.util.Slog;
import com.android.server.SystemService;
@@ -86,7 +87,7 @@
@Override
public ITuner openTuner(int moduleId, RadioManager.BandConfig bandConfig,
- boolean withAudio, ITunerCallback callback) {
+ boolean withAudio, ITunerCallback callback) throws RemoteException {
Slog.i(TAG, "openTuner(" + moduleId + ", _, " + withAudio + ", _)");
enforcePolicyAccess();
if (callback == null) {
diff --git a/services/core/java/com/android/server/broadcastradio/hal1/Tuner.java b/services/core/java/com/android/server/broadcastradio/hal1/Tuner.java
index e5090ed..f9b35f5 100644
--- a/services/core/java/com/android/server/broadcastradio/hal1/Tuner.java
+++ b/services/core/java/com/android/server/broadcastradio/hal1/Tuner.java
@@ -21,6 +21,7 @@
import android.graphics.BitmapFactory;
import android.hardware.radio.ITuner;
import android.hardware.radio.ITunerCallback;
+import android.hardware.radio.ProgramList;
import android.hardware.radio.ProgramSelector;
import android.hardware.radio.RadioManager;
import android.os.IBinder;
@@ -249,8 +250,7 @@
}
}
- @Override
- public List<RadioManager.ProgramInfo> getProgramList(Map vendorFilter) {
+ List<RadioManager.ProgramInfo> getProgramList(Map vendorFilter) {
Map<String, String> sFilter = vendorFilter;
synchronized (mLock) {
checkNotClosedLocked();
@@ -263,6 +263,16 @@
}
@Override
+ public void startProgramListUpdates(ProgramList.Filter filter) {
+ mTunerCallback.startProgramListUpdates(filter);
+ }
+
+ @Override
+ public void stopProgramListUpdates() {
+ mTunerCallback.stopProgramListUpdates();
+ }
+
+ @Override
public boolean isConfigFlagSupported(int flag) {
return flag == RadioManager.CONFIG_FORCE_ANALOG;
}
diff --git a/services/core/java/com/android/server/broadcastradio/hal1/TunerCallback.java b/services/core/java/com/android/server/broadcastradio/hal1/TunerCallback.java
index 673ff88..18f56ed 100644
--- a/services/core/java/com/android/server/broadcastradio/hal1/TunerCallback.java
+++ b/services/core/java/com/android/server/broadcastradio/hal1/TunerCallback.java
@@ -19,6 +19,7 @@
import android.annotation.NonNull;
import android.hardware.radio.ITuner;
import android.hardware.radio.ITunerCallback;
+import android.hardware.radio.ProgramList;
import android.hardware.radio.RadioManager;
import android.hardware.radio.RadioMetadata;
import android.hardware.radio.RadioTuner;
@@ -28,6 +29,10 @@
import java.util.List;
import java.util.Map;
+import java.util.Objects;
+import java.util.Set;
+import java.util.concurrent.atomic.AtomicReference;
+import java.util.stream.Collectors;
class TunerCallback implements ITunerCallback {
private static final String TAG = "BroadcastRadioService.TunerCallback";
@@ -40,6 +45,8 @@
@NonNull private final Tuner mTuner;
@NonNull private final ITunerCallback mClientCallback;
+ private final AtomicReference<ProgramList.Filter> mProgramListFilter = new AtomicReference<>();
+
TunerCallback(@NonNull Tuner tuner, @NonNull ITunerCallback clientCallback, int halRev) {
mTuner = tuner;
mClientCallback = clientCallback;
@@ -78,6 +85,15 @@
mTuner.close();
}
+ void startProgramListUpdates(@NonNull ProgramList.Filter filter) {
+ mProgramListFilter.set(Objects.requireNonNull(filter));
+ sendProgramListUpdate();
+ }
+
+ void stopProgramListUpdates() {
+ mProgramListFilter.set(null);
+ }
+
@Override
public void onError(int status) {
dispatch(() -> mClientCallback.onError(status));
@@ -121,6 +137,28 @@
@Override
public void onProgramListChanged() {
dispatch(() -> mClientCallback.onProgramListChanged());
+ sendProgramListUpdate();
+ }
+
+ private void sendProgramListUpdate() {
+ ProgramList.Filter filter = mProgramListFilter.get();
+ if (filter == null) return;
+
+ List<RadioManager.ProgramInfo> modified;
+ try {
+ modified = mTuner.getProgramList(filter.getVendorFilter());
+ } catch (IllegalStateException ex) {
+ Slog.d(TAG, "Program list not ready yet");
+ return;
+ }
+ Set<RadioManager.ProgramInfo> modifiedSet = modified.stream().collect(Collectors.toSet());
+ ProgramList.Chunk chunk = new ProgramList.Chunk(true, true, modifiedSet, null);
+ dispatch(() -> mClientCallback.onProgramListUpdated(chunk));
+ }
+
+ @Override
+ public void onProgramListUpdated(ProgramList.Chunk chunk) {
+ dispatch(() -> mClientCallback.onProgramListUpdated(chunk));
}
@Override
diff --git a/services/core/java/com/android/server/broadcastradio/hal2/BroadcastRadioService.java b/services/core/java/com/android/server/broadcastradio/hal2/BroadcastRadioService.java
index 9158ff0..fc9a5d6 100644
--- a/services/core/java/com/android/server/broadcastradio/hal2/BroadcastRadioService.java
+++ b/services/core/java/com/android/server/broadcastradio/hal2/BroadcastRadioService.java
@@ -82,7 +82,7 @@
}
public ITuner openSession(int moduleId, @Nullable RadioManager.BandConfig legacyConfig,
- boolean withAudio, @NonNull ITunerCallback callback) {
+ boolean withAudio, @NonNull ITunerCallback callback) throws RemoteException {
Objects.requireNonNull(callback);
if (!withAudio) {
diff --git a/services/core/java/com/android/server/broadcastradio/hal2/Convert.java b/services/core/java/com/android/server/broadcastradio/hal2/Convert.java
index 2c129bb..60a927c 100644
--- a/services/core/java/com/android/server/broadcastradio/hal2/Convert.java
+++ b/services/core/java/com/android/server/broadcastradio/hal2/Convert.java
@@ -20,15 +20,22 @@
import android.annotation.Nullable;
import android.hardware.broadcastradio.V2_0.AmFmBandRange;
import android.hardware.broadcastradio.V2_0.AmFmRegionConfig;
+import android.hardware.broadcastradio.V2_0.ProgramFilter;
+import android.hardware.broadcastradio.V2_0.ProgramIdentifier;
+import android.hardware.broadcastradio.V2_0.ProgramInfo;
+import android.hardware.broadcastradio.V2_0.ProgramInfoFlags;
+import android.hardware.broadcastradio.V2_0.ProgramListChunk;
import android.hardware.broadcastradio.V2_0.Properties;
import android.hardware.broadcastradio.V2_0.Result;
import android.hardware.broadcastradio.V2_0.VendorKeyValue;
+import android.hardware.radio.ProgramList;
import android.hardware.radio.ProgramSelector;
import android.hardware.radio.RadioManager;
import android.os.ParcelableException;
import android.util.Slog;
import java.util.ArrayList;
+import java.util.Arrays;
import java.util.Collections;
import java.util.HashMap;
import java.util.HashSet;
@@ -36,6 +43,7 @@
import java.util.Map;
import java.util.Objects;
import java.util.Set;
+import java.util.stream.Collectors;
class Convert {
private static final String TAG = "BcRadio2Srv.convert";
@@ -78,43 +86,52 @@
return map;
}
+ private static @ProgramSelector.ProgramType int identifierTypeToProgramType(
+ @ProgramSelector.IdentifierType int idType) {
+ switch (idType) {
+ case ProgramSelector.IDENTIFIER_TYPE_AMFM_FREQUENCY:
+ case ProgramSelector.IDENTIFIER_TYPE_RDS_PI:
+ // TODO(b/69958423): verify AM/FM with frequency range
+ return ProgramSelector.PROGRAM_TYPE_FM;
+ case ProgramSelector.IDENTIFIER_TYPE_HD_STATION_ID_EXT:
+ // TODO(b/69958423): verify AM/FM with frequency range
+ return ProgramSelector.PROGRAM_TYPE_FM_HD;
+ case ProgramSelector.IDENTIFIER_TYPE_DAB_SIDECC:
+ case ProgramSelector.IDENTIFIER_TYPE_DAB_ENSEMBLE:
+ case ProgramSelector.IDENTIFIER_TYPE_DAB_SCID:
+ case ProgramSelector.IDENTIFIER_TYPE_DAB_FREQUENCY:
+ return ProgramSelector.PROGRAM_TYPE_DAB;
+ case ProgramSelector.IDENTIFIER_TYPE_DRMO_SERVICE_ID:
+ case ProgramSelector.IDENTIFIER_TYPE_DRMO_FREQUENCY:
+ return ProgramSelector.PROGRAM_TYPE_DRMO;
+ case ProgramSelector.IDENTIFIER_TYPE_SXM_SERVICE_ID:
+ case ProgramSelector.IDENTIFIER_TYPE_SXM_CHANNEL:
+ return ProgramSelector.PROGRAM_TYPE_SXM;
+ }
+ if (idType >= ProgramSelector.IDENTIFIER_TYPE_VENDOR_PRIMARY_START
+ && idType <= ProgramSelector.IDENTIFIER_TYPE_VENDOR_PRIMARY_END) {
+ return idType;
+ }
+ return ProgramSelector.PROGRAM_TYPE_INVALID;
+ }
+
private static @NonNull int[]
identifierTypesToProgramTypes(@NonNull int[] idTypes) {
Set<Integer> pTypes = new HashSet<>();
for (int idType : idTypes) {
- switch (idType) {
- case ProgramSelector.IDENTIFIER_TYPE_AMFM_FREQUENCY:
- case ProgramSelector.IDENTIFIER_TYPE_RDS_PI:
- // TODO(b/69958423): verify AM/FM with region info
- pTypes.add(ProgramSelector.PROGRAM_TYPE_AM);
- pTypes.add(ProgramSelector.PROGRAM_TYPE_FM);
- break;
- case ProgramSelector.IDENTIFIER_TYPE_HD_STATION_ID_EXT:
- // TODO(b/69958423): verify AM/FM with region info
- pTypes.add(ProgramSelector.PROGRAM_TYPE_AM_HD);
- pTypes.add(ProgramSelector.PROGRAM_TYPE_FM_HD);
- break;
- case ProgramSelector.IDENTIFIER_TYPE_DAB_SIDECC:
- case ProgramSelector.IDENTIFIER_TYPE_DAB_ENSEMBLE:
- case ProgramSelector.IDENTIFIER_TYPE_DAB_SCID:
- case ProgramSelector.IDENTIFIER_TYPE_DAB_FREQUENCY:
- pTypes.add(ProgramSelector.PROGRAM_TYPE_DAB);
- break;
- case ProgramSelector.IDENTIFIER_TYPE_DRMO_SERVICE_ID:
- case ProgramSelector.IDENTIFIER_TYPE_DRMO_FREQUENCY:
- pTypes.add(ProgramSelector.PROGRAM_TYPE_DRMO);
- break;
- case ProgramSelector.IDENTIFIER_TYPE_SXM_SERVICE_ID:
- case ProgramSelector.IDENTIFIER_TYPE_SXM_CHANNEL:
- pTypes.add(ProgramSelector.PROGRAM_TYPE_SXM);
- break;
- default:
- break;
+ int pType = identifierTypeToProgramType(idType);
+
+ if (pType == ProgramSelector.PROGRAM_TYPE_INVALID) continue;
+
+ pTypes.add(pType);
+ if (pType == ProgramSelector.PROGRAM_TYPE_FM) {
+ // TODO(b/69958423): verify AM/FM with region info
+ pTypes.add(ProgramSelector.PROGRAM_TYPE_AM);
}
- if (idType >= ProgramSelector.IDENTIFIER_TYPE_VENDOR_PRIMARY_START
- && idType <= ProgramSelector.IDENTIFIER_TYPE_VENDOR_PRIMARY_END) {
- pTypes.add(idType);
+ if (pType == ProgramSelector.PROGRAM_TYPE_FM_HD) {
+ // TODO(b/69958423): verify AM/FM with region info
+ pTypes.add(ProgramSelector.PROGRAM_TYPE_AM_HD);
}
}
@@ -189,6 +206,64 @@
false, // isBgScanSupported is deprecated
supportedProgramTypes,
supportedIdentifierTypes,
- vendorInfoFromHal(prop.vendorInfo));
+ vendorInfoFromHal(prop.vendorInfo)
+ );
+ }
+
+ static @NonNull ProgramIdentifier programIdentifierToHal(
+ @NonNull ProgramSelector.Identifier id) {
+ ProgramIdentifier hwId = new ProgramIdentifier();
+ hwId.type = id.getType();
+ hwId.value = id.getValue();
+ return hwId;
+ }
+
+ static @NonNull ProgramSelector.Identifier programIdentifierFromHal(@NonNull ProgramIdentifier id) {
+ return new ProgramSelector.Identifier(id.type, id.value);
+ }
+
+ static @NonNull ProgramSelector programSelectorFromHal(
+ @NonNull android.hardware.broadcastradio.V2_0.ProgramSelector sel) {
+ ProgramSelector.Identifier[] secondaryIds = sel.secondaryIds.stream().map(
+ id -> programIdentifierFromHal(id)).toArray(ProgramSelector.Identifier[]::new);
+
+ return new ProgramSelector(
+ identifierTypeToProgramType(sel.primaryId.type),
+ programIdentifierFromHal(sel.primaryId),
+ secondaryIds, null);
+ }
+
+ static @NonNull RadioManager.ProgramInfo programInfoFromHal(@NonNull ProgramInfo info) {
+ return new RadioManager.ProgramInfo(
+ programSelectorFromHal(info.selector),
+ (info.infoFlags & ProgramInfoFlags.TUNED) != 0,
+ (info.infoFlags & ProgramInfoFlags.STEREO) != 0,
+ false, // TODO(b/69860743): digital
+ info.signalQuality,
+ null, // TODO(b/69860743): metadata
+ info.infoFlags,
+ vendorInfoFromHal(info.vendorInfo)
+ );
+ }
+
+ static @NonNull ProgramFilter programFilterToHal(@NonNull ProgramList.Filter filter) {
+ ProgramFilter hwFilter = new ProgramFilter();
+
+ filter.getIdentifierTypes().stream().forEachOrdered(hwFilter.identifierTypes::add);
+ filter.getIdentifiers().stream().forEachOrdered(
+ id -> hwFilter.identifiers.add(programIdentifierToHal(id)));
+ hwFilter.includeCategories = filter.areCategoriesIncluded();
+ hwFilter.excludeModifications = filter.areModificationsExcluded();
+
+ return hwFilter;
+ }
+
+ static @NonNull ProgramList.Chunk programListChunkFromHal(@NonNull ProgramListChunk chunk) {
+ Set<RadioManager.ProgramInfo> modified = chunk.modified.stream().map(
+ info -> programInfoFromHal(info)).collect(Collectors.toSet());
+ Set<ProgramSelector.Identifier> removed = chunk.removed.stream().map(
+ id -> programIdentifierFromHal(id)).collect(Collectors.toSet());
+
+ return new ProgramList.Chunk(chunk.purge, chunk.complete, modified, removed);
}
}
diff --git a/services/core/java/com/android/server/broadcastradio/hal2/RadioModule.java b/services/core/java/com/android/server/broadcastradio/hal2/RadioModule.java
index 45b2190..c8e15c1 100644
--- a/services/core/java/com/android/server/broadcastradio/hal2/RadioModule.java
+++ b/services/core/java/com/android/server/broadcastradio/hal2/RadioModule.java
@@ -63,20 +63,16 @@
}
}
- public @NonNull TunerSession openSession(@NonNull android.hardware.radio.ITunerCallback userCb) {
+ public @NonNull TunerSession openSession(@NonNull android.hardware.radio.ITunerCallback userCb)
+ throws RemoteException {
TunerCallback cb = new TunerCallback(Objects.requireNonNull(userCb));
Mutable<ITunerSession> hwSession = new Mutable<>();
MutableInt halResult = new MutableInt(Result.UNKNOWN_ERROR);
- try {
- mService.openSession(cb, (int result, ITunerSession session) -> {
- hwSession.value = session;
- halResult.value = result;
- });
- } catch (RemoteException ex) {
- Slog.e(TAG, "failed to open session", ex);
- throw new ParcelableException(ex);
- }
+ mService.openSession(cb, (int result, ITunerSession session) -> {
+ hwSession.value = session;
+ halResult.value = result;
+ });
Convert.throwOnError("openSession", halResult.value);
Objects.requireNonNull(hwSession.value);
diff --git a/services/core/java/com/android/server/broadcastradio/hal2/TunerCallback.java b/services/core/java/com/android/server/broadcastradio/hal2/TunerCallback.java
index c9084ee..ed2a1b3 100644
--- a/services/core/java/com/android/server/broadcastradio/hal2/TunerCallback.java
+++ b/services/core/java/com/android/server/broadcastradio/hal2/TunerCallback.java
@@ -56,7 +56,9 @@
public void onCurrentProgramInfoChanged(ProgramInfo info) {}
@Override
- public void onProgramListUpdated(ProgramListChunk chunk) {}
+ public void onProgramListUpdated(ProgramListChunk chunk) {
+ dispatch(() -> mClientCb.onProgramListUpdated(Convert.programListChunkFromHal(chunk)));
+ }
@Override
public void onAntennaStateChange(boolean connected) {}
diff --git a/services/core/java/com/android/server/broadcastradio/hal2/TunerSession.java b/services/core/java/com/android/server/broadcastradio/hal2/TunerSession.java
index 8ed646a..e093c9d 100644
--- a/services/core/java/com/android/server/broadcastradio/hal2/TunerSession.java
+++ b/services/core/java/com/android/server/broadcastradio/hal2/TunerSession.java
@@ -22,6 +22,7 @@
import android.hardware.broadcastradio.V2_0.ITunerSession;
import android.hardware.broadcastradio.V2_0.Result;
import android.hardware.radio.ITuner;
+import android.hardware.radio.ProgramList;
import android.hardware.radio.ProgramSelector;
import android.hardware.radio.RadioManager;
import android.media.AudioSystem;
@@ -184,10 +185,19 @@
}
@Override
- public List<RadioManager.ProgramInfo> getProgramList(Map vendorFilter) {
+ public void startProgramListUpdates(ProgramList.Filter filter) throws RemoteException {
synchronized (mLock) {
checkNotClosedLocked();
- return null;
+ int halResult = mHwSession.startProgramListUpdates(Convert.programFilterToHal(filter));
+ Convert.throwOnError("startProgramListUpdates", halResult);
+ }
+ }
+
+ @Override
+ public void stopProgramListUpdates() throws RemoteException {
+ synchronized (mLock) {
+ checkNotClosedLocked();
+ mHwSession.stopProgramListUpdates();
}
}
@@ -226,17 +236,12 @@
}
@Override
- public void setConfigFlag(int flag, boolean value) {
+ public void setConfigFlag(int flag, boolean value) throws RemoteException {
Slog.v(TAG, "setConfigFlag " + ConfigFlag.toString(flag) + " = " + value);
synchronized (mLock) {
checkNotClosedLocked();
- int halResult;
- try {
- halResult = mHwSession.setConfigFlag(flag, value);
- } catch (RemoteException ex) {
- throw new RuntimeException("Failed to set flag " + ConfigFlag.toString(flag), ex);
- }
+ int halResult = mHwSession.setConfigFlag(flag, value);
Convert.throwOnError("setConfigFlag", halResult);
}
}
diff --git a/services/core/java/com/android/server/content/SyncJobService.java b/services/core/java/com/android/server/content/SyncJobService.java
index 40a93c1..51499f7 100644
--- a/services/core/java/com/android/server/content/SyncJobService.java
+++ b/services/core/java/com/android/server/content/SyncJobService.java
@@ -122,10 +122,12 @@
final long startUptime = mJobStartUptimes.get(jobId);
final long nowUptime = SystemClock.uptimeMillis();
+ final long runtime = nowUptime - startUptime;
+
if (startUptime == 0) {
wtf("Job " + jobId + " start uptime not found: "
+ " params=" + jobParametersToString(params));
- } else if ((nowUptime - startUptime) > 60 * 1000) {
+ } else if (runtime > 60 * 1000) {
// WTF if startSyncH() hasn't happened, *unless* onStopJob() was called too soon.
// (1 minute threshold.)
if (!mStartedSyncs.get(jobId)) {
@@ -134,6 +136,12 @@
+ " nowUptime=" + nowUptime
+ " params=" + jobParametersToString(params));
}
+ } else if (runtime < 10 * 1000) {
+ // Job stopped too soon. WTF.
+ wtf("Job " + jobId + " stopped in " + runtime + " ms: "
+ + " startUptime=" + startUptime
+ + " nowUptime=" + nowUptime
+ + " params=" + jobParametersToString(params));
}
mStartedSyncs.delete(jobId);
@@ -183,6 +191,7 @@
return "job:null";
} else {
return "job:#" + params.getJobId() + ":"
+ + "sr=[" + params.getStopReason() + "/" + params.getDebugStopReason() + "]:"
+ SyncOperation.maybeCreateFromJobExtras(params.getExtras());
}
}
diff --git a/services/core/java/com/android/server/display/BrightnessTracker.java b/services/core/java/com/android/server/display/BrightnessTracker.java
index cbb1c01..1e94e00 100644
--- a/services/core/java/com/android/server/display/BrightnessTracker.java
+++ b/services/core/java/com/android/server/display/BrightnessTracker.java
@@ -149,7 +149,7 @@
/**
* Start listening for brightness slider events
*
- * @param brightness the initial screen brightness
+ * @param initialBrightness the initial screen brightness
*/
public void start(float initialBrightness) {
if (DEBUG) {
@@ -219,8 +219,8 @@
if (includePackage) {
out.add(events[i]);
} else {
- BrightnessChangeEvent event = new BrightnessChangeEvent((events[i]));
- event.packageName = null;
+ BrightnessChangeEvent event = new BrightnessChangeEvent((events[i]),
+ /* redactPackage */ true);
out.add(event);
}
}
@@ -246,7 +246,8 @@
}
private void handleBrightnessChanged(float brightness, boolean userInitiated) {
- final BrightnessChangeEvent event;
+ BrightnessChangeEvent.Builder builder;
+
synchronized (mDataCollectionLock) {
if (!mStarted) {
// Not currently gathering brightness change information
@@ -263,9 +264,9 @@
return;
}
-
- event = new BrightnessChangeEvent();
- event.timeStamp = mInjector.currentTimeMillis();
+ builder = new BrightnessChangeEvent.Builder();
+ builder.setBrightness(brightness);
+ builder.setTimeStamp(mInjector.currentTimeMillis());
final int readingCount = mLastSensorReadings.size();
if (readingCount == 0) {
@@ -273,8 +274,8 @@
return;
}
- event.luxValues = new float[readingCount];
- event.luxTimestamps = new long[readingCount];
+ float[] luxValues = new float[readingCount];
+ long[] luxTimestamps = new long[readingCount];
int pos = 0;
@@ -282,33 +283,35 @@
long currentTimeMillis = mInjector.currentTimeMillis();
long elapsedTimeNanos = mInjector.elapsedRealtimeNanos();
for (LightData reading : mLastSensorReadings) {
- event.luxValues[pos] = reading.lux;
- event.luxTimestamps[pos] = currentTimeMillis -
+ luxValues[pos] = reading.lux;
+ luxTimestamps[pos] = currentTimeMillis -
TimeUnit.NANOSECONDS.toMillis(elapsedTimeNanos - reading.timestamp);
++pos;
}
+ builder.setLuxValues(luxValues);
+ builder.setLuxTimestamps(luxTimestamps);
- event.batteryLevel = mLastBatteryLevel;
- event.lastBrightness = previousBrightness;
+ builder.setBatteryLevel(mLastBatteryLevel);
+ builder.setLastBrightness(previousBrightness);
}
- event.brightness = brightness;
-
try {
final ActivityManager.StackInfo focusedStack = mInjector.getFocusedStack();
- event.userId = focusedStack.userId;
- event.packageName = focusedStack.topActivity.getPackageName();
+ builder.setUserId(focusedStack.userId);
+ builder.setPackageName(focusedStack.topActivity.getPackageName());
} catch (RemoteException e) {
// Really shouldn't be possible.
+ return;
}
- event.nightMode = mInjector.getSecureIntForUser(mContentResolver,
+ builder.setNightMode(mInjector.getSecureIntForUser(mContentResolver,
Settings.Secure.NIGHT_DISPLAY_ACTIVATED, 0, UserHandle.USER_CURRENT)
- == 1;
- event.colorTemperature = mInjector.getSecureIntForUser(mContentResolver,
+ == 1);
+ builder.setColorTemperature(mInjector.getSecureIntForUser(mContentResolver,
Settings.Secure.NIGHT_DISPLAY_COLOR_TEMPERATURE,
- 0, UserHandle.USER_CURRENT);
+ 0, UserHandle.USER_CURRENT));
+ BrightnessChangeEvent event = builder.build();
if (DEBUG) {
Slog.d(TAG, "Event " + event.brightness + " " + event.packageName);
}
@@ -457,40 +460,43 @@
}
tag = parser.getName();
if (TAG_EVENT.equals(tag)) {
- BrightnessChangeEvent event = new BrightnessChangeEvent();
+ BrightnessChangeEvent.Builder builder = new BrightnessChangeEvent.Builder();
String brightness = parser.getAttributeValue(null, ATTR_NITS);
- event.brightness = Float.parseFloat(brightness);
+ builder.setBrightness(Float.parseFloat(brightness));
String timestamp = parser.getAttributeValue(null, ATTR_TIMESTAMP);
- event.timeStamp = Long.parseLong(timestamp);
- event.packageName = parser.getAttributeValue(null, ATTR_PACKAGE_NAME);
+ builder.setTimeStamp(Long.parseLong(timestamp));
+ builder.setPackageName(parser.getAttributeValue(null, ATTR_PACKAGE_NAME));
String user = parser.getAttributeValue(null, ATTR_USER);
- event.userId = mInjector.getUserId(mUserManager, Integer.parseInt(user));
+ builder.setUserId(mInjector.getUserId(mUserManager, Integer.parseInt(user)));
String batteryLevel = parser.getAttributeValue(null, ATTR_BATTERY_LEVEL);
- event.batteryLevel = Float.parseFloat(batteryLevel);
+ builder.setBatteryLevel(Float.parseFloat(batteryLevel));
String nightMode = parser.getAttributeValue(null, ATTR_NIGHT_MODE);
- event.nightMode = Boolean.parseBoolean(nightMode);
+ builder.setNightMode(Boolean.parseBoolean(nightMode));
String colorTemperature =
parser.getAttributeValue(null, ATTR_COLOR_TEMPERATURE);
- event.colorTemperature = Integer.parseInt(colorTemperature);
+ builder.setColorTemperature(Integer.parseInt(colorTemperature));
String lastBrightness = parser.getAttributeValue(null, ATTR_LAST_NITS);
- event.lastBrightness = Float.parseFloat(lastBrightness);
+ builder.setLastBrightness(Float.parseFloat(lastBrightness));
String luxValue = parser.getAttributeValue(null, ATTR_LUX);
String luxTimestamp = parser.getAttributeValue(null, ATTR_LUX_TIMESTAMPS);
- String[] luxValues = luxValue.split(",");
- String[] luxTimestamps = luxTimestamp.split(",");
- if (luxValues.length != luxTimestamps.length) {
+ String[] luxValuesStrings = luxValue.split(",");
+ String[] luxTimestampsStrings = luxTimestamp.split(",");
+ if (luxValuesStrings.length != luxTimestampsStrings.length) {
continue;
}
- event.luxValues = new float[luxValues.length];
- event.luxTimestamps = new long[luxValues.length];
+ float[] luxValues = new float[luxValuesStrings.length];
+ long[] luxTimestamps = new long[luxValuesStrings.length];
for (int i = 0; i < luxValues.length; ++i) {
- event.luxValues[i] = Float.parseFloat(luxValues[i]);
- event.luxTimestamps[i] = Long.parseLong(luxTimestamps[i]);
+ luxValues[i] = Float.parseFloat(luxValuesStrings[i]);
+ luxTimestamps[i] = Long.parseLong(luxTimestampsStrings[i]);
}
+ builder.setLuxValues(luxValues);
+ builder.setLuxTimestamps(luxTimestamps);
+ BrightnessChangeEvent event = builder.build();
if (DEBUG) {
Slog.i(TAG, "Read event " + event.brightness
+ " " + event.packageName);
diff --git a/services/core/java/com/android/server/display/ColorFade.java b/services/core/java/com/android/server/display/ColorFade.java
index 85686ae..4f53ed4 100644
--- a/services/core/java/com/android/server/display/ColorFade.java
+++ b/services/core/java/com/android/server/display/ColorFade.java
@@ -99,7 +99,7 @@
private final float mProjMatrix[] = new float[16];
private final int[] mGLBuffers = new int[2];
private int mTexCoordLoc, mVertexLoc, mTexUnitLoc, mProjMatrixLoc, mTexMatrixLoc;
- private int mOpacityLoc, mGammaLoc, mSaturationLoc;
+ private int mOpacityLoc, mGammaLoc;
private int mProgram;
// Vertex and corresponding texture coordinates.
@@ -245,7 +245,6 @@
mOpacityLoc = GLES20.glGetUniformLocation(mProgram, "opacity");
mGammaLoc = GLES20.glGetUniformLocation(mProgram, "gamma");
- mSaturationLoc = GLES20.glGetUniformLocation(mProgram, "saturation");
mTexUnitLoc = GLES20.glGetUniformLocation(mProgram, "texUnit");
GLES20.glUseProgram(mProgram);
@@ -393,9 +392,8 @@
double cos = Math.cos(Math.PI * one_minus_level);
double sign = cos < 0 ? -1 : 1;
float opacity = (float) -Math.pow(one_minus_level, 2) + 1;
- float saturation = (float) Math.pow(level, 4);
float gamma = (float) ((0.5d * sign * Math.pow(cos, 2) + 0.5d) * 0.9d + 0.1d);
- drawFaded(opacity, 1.f / gamma, saturation);
+ drawFaded(opacity, 1.f / gamma);
if (checkGlErrors("drawFrame")) {
return false;
}
@@ -407,10 +405,9 @@
return showSurface(1.0f);
}
- private void drawFaded(float opacity, float gamma, float saturation) {
+ private void drawFaded(float opacity, float gamma) {
if (DEBUG) {
- Slog.d(TAG, "drawFaded: opacity=" + opacity + ", gamma=" + gamma +
- ", saturation=" + saturation);
+ Slog.d(TAG, "drawFaded: opacity=" + opacity + ", gamma=" + gamma);
}
// Use shaders
GLES20.glUseProgram(mProgram);
@@ -420,7 +417,6 @@
GLES20.glUniformMatrix4fv(mTexMatrixLoc, 1, false, mTexMatrix, 0);
GLES20.glUniform1f(mOpacityLoc, opacity);
GLES20.glUniform1f(mGammaLoc, gamma);
- GLES20.glUniform1f(mSaturationLoc, saturation);
// Use textures
GLES20.glActiveTexture(GLES20.GL_TEXTURE0);
diff --git a/services/core/java/com/android/server/job/JobSchedulerService.java b/services/core/java/com/android/server/job/JobSchedulerService.java
index 733ed3d..bd1dbf9 100644
--- a/services/core/java/com/android/server/job/JobSchedulerService.java
+++ b/services/core/java/com/android/server/job/JobSchedulerService.java
@@ -934,12 +934,14 @@
* @param uid Uid of the calling client.
* @param jobId Id of the job, provided at schedule-time.
*/
- public boolean cancelJob(int uid, int jobId) {
+ public boolean cancelJob(int uid, int jobId, int callingUid) {
JobStatus toCancel;
synchronized (mLock) {
toCancel = mJobs.getJobByUidAndJobId(uid, jobId);
if (toCancel != null) {
- cancelJobImplLocked(toCancel, null, "cancel() called by app");
+ cancelJobImplLocked(toCancel, null,
+ "cancel() called by app, callingUid=" + callingUid
+ + " uid=" + uid + " jobId=" + jobId);
}
return (toCancel != null);
}
@@ -2341,7 +2343,8 @@
final int uid = Binder.getCallingUid();
long ident = Binder.clearCallingIdentity();
try {
- JobSchedulerService.this.cancelJobsForUid(uid, "cancelAll() called by app");
+ JobSchedulerService.this.cancelJobsForUid(uid,
+ "cancelAll() called by app, callingUid=" + uid);
} finally {
Binder.restoreCallingIdentity(ident);
}
@@ -2353,7 +2356,7 @@
long ident = Binder.clearCallingIdentity();
try {
- JobSchedulerService.this.cancelJob(uid, jobId);
+ JobSchedulerService.this.cancelJob(uid, jobId, uid);
} finally {
Binder.restoreCallingIdentity(ident);
}
@@ -2466,7 +2469,7 @@
for (int i=0; i<mActiveServices.size(); i++) {
final JobServiceContext jc = mActiveServices.get(i);
final JobStatus js = jc.getRunningJobLocked();
- if (jc.timeoutIfExecutingLocked(pkgName, userId, hasJobId, jobId)) {
+ if (jc.timeoutIfExecutingLocked(pkgName, userId, hasJobId, jobId, "shell")) {
foundSome = true;
pw.print("Timing out: ");
js.printUniqueId(pw);
@@ -2506,7 +2509,7 @@
}
} else {
pw.println("Canceling job " + pkgName + "/#" + jobId + " in user " + userId);
- if (!cancelJob(pkgUid, jobId)) {
+ if (!cancelJob(pkgUid, jobId, Process.SHELL_UID)) {
pw.println("No matching job found.");
}
}
diff --git a/services/core/java/com/android/server/job/JobServiceContext.java b/services/core/java/com/android/server/job/JobServiceContext.java
index 709deeb..83a3c19 100644
--- a/services/core/java/com/android/server/job/JobServiceContext.java
+++ b/services/core/java/com/android/server/job/JobServiceContext.java
@@ -312,13 +312,14 @@
return mTimeoutElapsed;
}
- boolean timeoutIfExecutingLocked(String pkgName, int userId, boolean matchJobId, int jobId) {
+ boolean timeoutIfExecutingLocked(String pkgName, int userId, boolean matchJobId, int jobId,
+ String reason) {
final JobStatus executing = getRunningJobLocked();
if (executing != null && (userId == UserHandle.USER_ALL || userId == executing.getUserId())
&& (pkgName == null || pkgName.equals(executing.getSourcePackageName()))
&& (!matchJobId || jobId == executing.getJobId())) {
if (mVerb == VERB_EXECUTING) {
- mParams.setStopReason(JobParameters.REASON_TIMEOUT);
+ mParams.setStopReason(JobParameters.REASON_TIMEOUT, reason);
sendStopMessageLocked("force timeout from shell");
return true;
}
@@ -537,7 +538,7 @@
}
return;
}
- mParams.setStopReason(arg1);
+ mParams.setStopReason(arg1, debugReason);
if (arg1 == JobParameters.REASON_PREEMPT) {
mPreferredUid = mRunningJob != null ? mRunningJob.getUid() :
NO_PREFERRED_UID;
@@ -687,7 +688,7 @@
// Not an error - client ran out of time.
Slog.i(TAG, "Client timed out while executing (no jobFinished received), " +
"sending onStop: " + getRunningJobNameLocked());
- mParams.setStopReason(JobParameters.REASON_TIMEOUT);
+ mParams.setStopReason(JobParameters.REASON_TIMEOUT, "client timed out");
sendStopMessageLocked("timeout while executing");
break;
default:
diff --git a/services/core/java/com/android/server/media/MediaUpdateService.java b/services/core/java/com/android/server/media/MediaUpdateService.java
new file mode 100644
index 0000000..016d062
--- /dev/null
+++ b/services/core/java/com/android/server/media/MediaUpdateService.java
@@ -0,0 +1,151 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.server.media;
+
+import android.content.Context;
+import android.content.Intent;
+import android.media.IMediaResourceMonitor;
+import android.os.Binder;
+import android.os.UserHandle;
+import android.os.UserManager;
+import android.util.Log;
+import android.util.Slog;
+import com.android.server.SystemService;
+
+import android.content.BroadcastReceiver;
+import android.content.Intent;
+import android.content.IntentFilter;
+import android.content.pm.ApplicationInfo;
+import android.content.pm.PackageManager;
+import android.os.IBinder;
+import android.os.PatternMatcher;
+import android.os.ServiceManager;
+import android.media.IMediaExtractorUpdateService;
+
+import java.lang.Exception;
+
+/** This class provides a system service that manages media framework updates. */
+public class MediaUpdateService extends SystemService {
+ private static final String TAG = "MediaUpdateService";
+ private static final boolean DEBUG = Log.isLoggable(TAG, Log.DEBUG);
+ private static final String MEDIA_UPDATE_PACKAGE_NAME = "com.android.media.update";
+ private static final String EXTRACTOR_UPDATE_SERVICE_NAME = "media.extractor.update";
+
+ private IMediaExtractorUpdateService mMediaExtractorUpdateService;
+
+ public MediaUpdateService(Context context) {
+ super(context);
+ }
+
+ @Override
+ public void onStart() {
+ // TODO: Uncomment below once sepolicy change is landed.
+ /*
+ if ("userdebug".equals(android.os.Build.TYPE) || "eng".equals(android.os.Build.TYPE)) {
+ connect();
+ registerBroadcastReceiver();
+ }
+ */
+ }
+
+ private void connect() {
+ IBinder binder = ServiceManager.getService(EXTRACTOR_UPDATE_SERVICE_NAME);
+ if (binder != null) {
+ try {
+ binder.linkToDeath(new IBinder.DeathRecipient() {
+ @Override
+ public void binderDied() {
+ Slog.w(TAG, "mediaextractor died; reconnecting");
+ mMediaExtractorUpdateService = null;
+ connect();
+ }
+ }, 0);
+ } catch (Exception e) {
+ binder = null;
+ }
+ }
+ if (binder != null) {
+ mMediaExtractorUpdateService = IMediaExtractorUpdateService.Stub.asInterface(binder);
+ packageStateChanged();
+ } else {
+ Slog.w(TAG, EXTRACTOR_UPDATE_SERVICE_NAME + " not found.");
+ }
+ }
+
+ private void registerBroadcastReceiver() {
+ BroadcastReceiver updateReceiver = new BroadcastReceiver() {
+ @Override
+ public void onReceive(Context context, Intent intent) {
+ if (intent.getIntExtra(Intent.EXTRA_USER_HANDLE, UserHandle.USER_SYSTEM)
+ != UserHandle.USER_SYSTEM) {
+ // Ignore broadcast for non system users. We don't want to update system
+ // service multiple times.
+ return;
+ }
+ switch (intent.getAction()) {
+ case Intent.ACTION_PACKAGE_REMOVED:
+ if (intent.getExtras().getBoolean(Intent.EXTRA_REPLACING)) {
+ // The existing package is updated. Will be handled with the
+ // following ACTION_PACKAGE_ADDED case.
+ return;
+ }
+ packageStateChanged();
+ break;
+ case Intent.ACTION_PACKAGE_CHANGED:
+ packageStateChanged();
+ break;
+ case Intent.ACTION_PACKAGE_ADDED:
+ packageStateChanged();
+ break;
+ }
+ }
+ };
+ IntentFilter filter = new IntentFilter();
+ filter.addAction(Intent.ACTION_PACKAGE_ADDED);
+ filter.addAction(Intent.ACTION_PACKAGE_REMOVED);
+ filter.addAction(Intent.ACTION_PACKAGE_CHANGED);
+ filter.addDataScheme("package");
+ filter.addDataSchemeSpecificPart(MEDIA_UPDATE_PACKAGE_NAME, PatternMatcher.PATTERN_LITERAL);
+
+ getContext().registerReceiverAsUser(updateReceiver, UserHandle.ALL, filter,
+ null /* broadcast permission */, null /* handler */);
+ }
+
+ private void packageStateChanged() {
+ ApplicationInfo packageInfo = null;
+ boolean pluginsAvailable = false;
+ try {
+ packageInfo = getContext().getPackageManager().getApplicationInfo(
+ MEDIA_UPDATE_PACKAGE_NAME, PackageManager.MATCH_SYSTEM_ONLY);
+ pluginsAvailable = packageInfo.enabled;
+ } catch (Exception e) {
+ Slog.v(TAG, "package '" + MEDIA_UPDATE_PACKAGE_NAME + "' not installed");
+ }
+ loadExtractorPlugins(
+ (packageInfo != null && pluginsAvailable) ? packageInfo.sourceDir : "");
+ }
+
+ private void loadExtractorPlugins(String apkPath) {
+ try {
+ if (mMediaExtractorUpdateService != null) {
+ mMediaExtractorUpdateService.loadPlugins(apkPath);
+ }
+ } catch (Exception e) {
+ Slog.w(TAG, "Error in loadPlugins", e);
+ }
+ }
+}
diff --git a/services/core/java/com/android/server/notification/NotificationManagerService.java b/services/core/java/com/android/server/notification/NotificationManagerService.java
index 575c44d..16b9257 100644
--- a/services/core/java/com/android/server/notification/NotificationManagerService.java
+++ b/services/core/java/com/android/server/notification/NotificationManagerService.java
@@ -2917,12 +2917,34 @@
}
}
+ /**
+ * Sets the notification policy. Apps that target API levels below
+ * {@link android.os.Build.VERSION_CODES#P} cannot make DND silence
+ * {@link Policy#PRIORITY_CATEGORY_ALARMS} or
+ * {@link Policy#PRIORITY_CATEGORY_MEDIA_SYSTEM_OTHER}
+ */
@Override
public void setNotificationPolicy(String pkg, Policy policy) {
enforcePolicyAccess(pkg, "setNotificationPolicy");
final long identity = Binder.clearCallingIdentity();
try {
+ final ApplicationInfo applicationInfo = mPackageManager.getApplicationInfo(pkg,
+ 0, UserHandle.getUserId(MY_UID));
+
+ if (applicationInfo.targetSdkVersion <= Build.VERSION_CODES.O_MR1) {
+ Policy currPolicy = mZenModeHelper.getNotificationPolicy();
+
+ int priorityCategories = policy.priorityCategories
+ | (currPolicy.priorityCategories & Policy.PRIORITY_CATEGORY_ALARMS)
+ | (currPolicy.priorityCategories &
+ Policy.PRIORITY_CATEGORY_MEDIA_SYSTEM_OTHER);
+ policy = new Policy(priorityCategories,
+ policy.priorityCallSenders, policy.priorityMessageSenders,
+ policy.suppressedVisualEffects);
+ }
+
mZenModeHelper.setNotificationPolicy(policy);
+ } catch (RemoteException e) {
} finally {
Binder.restoreCallingIdentity(identity);
}
diff --git a/services/core/java/com/android/server/pm/LauncherAppsService.java b/services/core/java/com/android/server/pm/LauncherAppsService.java
index b06b583..1717b3d 100644
--- a/services/core/java/com/android/server/pm/LauncherAppsService.java
+++ b/services/core/java/com/android/server/pm/LauncherAppsService.java
@@ -652,6 +652,7 @@
activityInfo.name.equals(component.getClassName())) {
// Found an activity with category launcher that matches
// this component so ok to launch.
+ launchIntent.setPackage(null);
launchIntent.setComponent(component);
mContext.startActivityAsUser(launchIntent, opts, user);
return;
diff --git a/services/core/java/com/android/server/pm/PackageManagerService.java b/services/core/java/com/android/server/pm/PackageManagerService.java
index 1e2f2b2..6e94523 100644
--- a/services/core/java/com/android/server/pm/PackageManagerService.java
+++ b/services/core/java/com/android/server/pm/PackageManagerService.java
@@ -2697,6 +2697,12 @@
mSettings.getDisabledSystemPkgLPr(ps.name);
if (disabledPs.codePath == null || !disabledPs.codePath.exists()
|| disabledPs.pkg == null) {
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Possibly deleted app: " + ps.dumpState_temp()
+ + "; path: " + (disabledPs.codePath == null ? "<<NULL>>":disabledPs.codePath)
+ + "; pkg: " + (disabledPs.pkg==null?"<<NULL>>":disabledPs.pkg.toString()));
+}
possiblyDeletedUpdatedSystemApps.add(ps.name);
}
}
@@ -2748,6 +2754,10 @@
for (String deletedAppName : possiblyDeletedUpdatedSystemApps) {
PackageParser.Package deletedPkg = mPackages.get(deletedAppName);
mSettings.removeDisabledSystemPackageLPw(deletedAppName);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "remove update; name: " + deletedAppName + ", exists? " + (deletedPkg != null));
+}
final String msg;
if (deletedPkg == null) {
// should have found an update, but, we didn't; remove everything
@@ -8311,6 +8321,8 @@
return scannedPkg;
}
+ // Temporary to catch potential issues with refactoring
+ private static boolean REFACTOR_DEBUG = true;
/**
* Adds a new package to the internal data structures during platform initialization.
* <p>After adding, the package is known to the system and available for querying.
@@ -8351,6 +8363,10 @@
synchronized (mPackages) {
renamedPkgName = mSettings.getRenamedPackageLPr(pkg.mRealPackage);
final String realPkgName = getRealPackageName(pkg, renamedPkgName);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Add pkg: " + pkg.packageName + (realPkgName==null?"":", realName: " + realPkgName));
+}
if (realPkgName != null) {
ensurePackageRenamed(pkg, renamedPkgName);
}
@@ -8365,6 +8381,12 @@
if (DEBUG_INSTALL && isSystemPkgUpdated) {
Slog.d(TAG, "updatedPkg = " + disabledPkgSetting);
}
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "SSP? " + scanSystemPartition
+ + ", exists? " + pkgAlreadyExists + (pkgAlreadyExists?" "+pkgSetting.toString():"")
+ + ", upgraded? " + isSystemPkgUpdated + (isSystemPkgUpdated?" "+disabledPkgSetting.toString():""));
+}
final SharedUserSetting sharedUserSetting = (pkg.mSharedUserId != null)
? mSettings.getSharedUserLPw(pkg.mSharedUserId,
@@ -8376,6 +8398,12 @@
Log.d(TAG, "Shared UserID " + pkg.mSharedUserId
+ " (uid=" + sharedUserSetting.userId + "):"
+ " packages=" + sharedUserSetting.packages);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Shared UserID " + pkg.mSharedUserId
+ + " (uid=" + sharedUserSetting.userId + "):"
+ + " packages=" + sharedUserSetting.packages);
+}
}
if (scanSystemPartition) {
@@ -8384,6 +8412,10 @@
// version on /data, cycle through all of its children packages and
// remove children that are no longer defined.
if (isSystemPkgUpdated) {
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Disable child packages");
+}
final int scannedChildCount = (pkg.childPackages != null)
? pkg.childPackages.size() : 0;
final int disabledChildCount = disabledPkgSetting.childPackageNames != null
@@ -8395,11 +8427,19 @@
for (int j = 0; j < scannedChildCount; j++) {
PackageParser.Package childPkg = pkg.childPackages.get(j);
if (childPkg.packageName.equals(disabledChildPackageName)) {
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Ignore " + disabledChildPackageName);
+}
disabledPackageAvailable = true;
break;
}
}
if (!disabledPackageAvailable) {
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Disable " + disabledChildPackageName);
+}
mSettings.removeDisabledSystemPackageLPw(disabledChildPackageName);
}
}
@@ -8408,17 +8448,44 @@
disabledPkgSetting /* pkgSetting */, null /* disabledPkgSetting */,
null /* originalPkgSetting */, null, parseFlags, scanFlags,
(pkg == mPlatformPackage), user);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Scan disabled system package");
+Slog.e("TODD",
+ "Pre: " + request.pkgSetting.dumpState_temp());
+}
+final ScanResult result =
scanPackageOnlyLI(request, mFactoryTest, -1L);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Post: " + (result.success?result.pkgSetting.dumpState_temp():"FAILED scan"));
+}
}
}
}
final boolean newPkgChangedPaths =
pkgAlreadyExists && !pkgSetting.codePathString.equals(pkg.codePath);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "paths changed? " + newPkgChangedPaths
+ + "; old: " + pkg.codePath
+ + ", new: " + (pkgSetting==null?"<<NULL>>":pkgSetting.codePathString));
+}
final boolean newPkgVersionGreater =
pkgAlreadyExists && pkg.getLongVersionCode() > pkgSetting.versionCode;
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "version greater? " + newPkgVersionGreater
+ + "; old: " + pkg.getLongVersionCode()
+ + ", new: " + (pkgSetting==null?"<<NULL>>":pkgSetting.versionCode));
+}
final boolean isSystemPkgBetter = scanSystemPartition && isSystemPkgUpdated
&& newPkgChangedPaths && newPkgVersionGreater;
+if (REFACTOR_DEBUG) {
+ Slog.e("TODD",
+ "system better? " + isSystemPkgBetter);
+}
if (isSystemPkgBetter) {
// The version of the application on /system is greater than the version on
// /data. Switch back to the application on /system.
@@ -8434,6 +8501,13 @@
+ " name: " + pkgSetting.name
+ "; " + pkgSetting.versionCode + " --> " + pkg.getLongVersionCode()
+ "; " + pkgSetting.codePathString + " --> " + pkg.codePath);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "System package changed;"
+ + " name: " + pkgSetting.name
+ + "; " + pkgSetting.versionCode + " --> " + pkg.getLongVersionCode()
+ + "; " + pkgSetting.codePathString + " --> " + pkg.codePath);
+}
final InstallArgs args = createInstallArgsForExisting(
packageFlagsToInstallFlags(pkgSetting), pkgSetting.codePathString,
@@ -8445,6 +8519,10 @@
}
if (scanSystemPartition && isSystemPkgUpdated && !isSystemPkgBetter) {
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "THROW exception; system pkg version not good enough");
+}
// The version of the application on the /system partition is less than or
// equal to the version on the /data partition. Throw an exception and use
// the application already installed on the /data partition.
@@ -8470,6 +8548,11 @@
logCriticalInfo(Log.WARN,
"System package signature mismatch;"
+ " name: " + pkgSetting.name);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "System package signature mismatch;"
+ + " name: " + pkgSetting.name);
+}
try (PackageFreezer freezer = freezePackage(pkg.packageName,
"scanPackageInternalLI")) {
deletePackageLIF(pkg.packageName, null, true, null, 0, null, false, null);
@@ -8484,6 +8567,13 @@
+ " name: " + pkgSetting.name
+ "; " + pkgSetting.versionCode + " --> " + pkg.getLongVersionCode()
+ "; " + pkgSetting.codePathString + " --> " + pkg.codePath);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "System package enabled;"
+ + " name: " + pkgSetting.name
+ + "; " + pkgSetting.versionCode + " --> " + pkg.getLongVersionCode()
+ + "; " + pkgSetting.codePathString + " --> " + pkg.codePath);
+}
InstallArgs args = createInstallArgsForExisting(
packageFlagsToInstallFlags(pkgSetting), pkgSetting.codePathString,
pkgSetting.resourcePathString, getAppDexInstructionSets(pkgSetting));
@@ -8500,13 +8590,35 @@
+ " name: " + pkgSetting.name
+ "; old: " + pkgSetting.codePathString + " @ " + pkgSetting.versionCode
+ "; new: " + pkg.codePath + " @ " + pkg.codePath);
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "System package disabled;"
+ + " name: " + pkgSetting.name
+ + "; old: " + pkgSetting.codePathString + " @ " + pkgSetting.versionCode
+ + "; new: " + pkg.codePath + " @ " + pkg.codePath);
+}
}
}
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Scan package");
+Slog.e("TODD",
+ "Pre: " + (pkgSetting==null?"<<NONE>>":pkgSetting.dumpState_temp()));
+}
final PackageParser.Package scannedPkg = scanPackageNewLI(pkg, parseFlags, scanFlags
| SCAN_UPDATE_SIGNATURE, currentTime, user);
+if (REFACTOR_DEBUG) {
+pkgSetting = mSettings.getPackageLPr(pkg.packageName);
+Slog.e("TODD",
+ "Post: " + (pkgSetting==null?"<<NONE>>":pkgSetting.dumpState_temp()));
+}
if (shouldHideSystemApp) {
+if (REFACTOR_DEBUG) {
+Slog.e("TODD",
+ "Disable package: " + pkg.packageName);
+}
synchronized (mPackages) {
mSettings.disableSystemPackageLPw(pkg.packageName, true);
}
diff --git a/services/core/java/com/android/server/pm/PackageSetting.java b/services/core/java/com/android/server/pm/PackageSetting.java
index 2b91b7d..2a2430c 100644
--- a/services/core/java/com/android/server/pm/PackageSetting.java
+++ b/services/core/java/com/android/server/pm/PackageSetting.java
@@ -97,6 +97,35 @@
+ " " + name + "/" + appId + "}";
}
+ // Temporary to catch potential issues with refactoring
+ public String dumpState_temp() {
+ String flags = "";
+ flags += ((pkgFlags & ApplicationInfo.FLAG_UPDATED_SYSTEM_APP) != 0 ? "U" : "");
+ flags += ((pkgFlags & ApplicationInfo.FLAG_SYSTEM) != 0 ? "S" : "");
+ if ("".equals(flags)) {
+ flags = "-";
+ }
+ String privFlags = "";
+ privFlags += ((pkgPrivateFlags & ApplicationInfo.PRIVATE_FLAG_PRIVILEGED) != 0 ? "P" : "");
+ privFlags += ((pkgPrivateFlags & ApplicationInfo.PRIVATE_FLAG_OEM) != 0 ? "O" : "");
+ privFlags += ((pkgPrivateFlags & ApplicationInfo.PRIVATE_FLAG_VENDOR) != 0 ? "V" : "");
+ if ("".equals(privFlags)) {
+ privFlags = "-";
+ }
+ return "PackageSetting{"
+ + Integer.toHexString(System.identityHashCode(this))
+ + " " + name + (realName == null ? "" : "("+realName+")") + "/" + appId + (sharedUser==null?"":" u:" + sharedUser.name+"("+sharedUserId+")")
+ + ", ver:" + versionCode
+ + ", path: " + codePath
+ + ", pABI: " + primaryCpuAbiString
+ + ", sABI: " + secondaryCpuAbiString
+ + ", oABI: " + cpuAbiOverrideString
+ + ", flags: " + flags
+ + ", privFlags: " + privFlags
+ + ", pkg: " + (pkg == null ? "<<NULL>>" : pkg.dumpState_temp())
+ + "}";
+ }
+
public void copyFrom(PackageSetting orig) {
super.copyFrom(orig);
doCopy(orig);
diff --git a/services/core/java/com/android/server/pm/UserRestrictionsUtils.java b/services/core/java/com/android/server/pm/UserRestrictionsUtils.java
index 50690cb..cc07d82 100644
--- a/services/core/java/com/android/server/pm/UserRestrictionsUtils.java
+++ b/services/core/java/com/android/server/pm/UserRestrictionsUtils.java
@@ -25,12 +25,14 @@
import android.app.ActivityManager;
import android.content.ContentResolver;
import android.content.Context;
+import android.content.Intent;
import android.os.Binder;
import android.os.Bundle;
import android.os.RemoteException;
import android.os.UserHandle;
import android.os.UserManager;
import android.os.UserManagerInternal;
+import android.provider.Settings;
import android.telephony.SubscriptionInfo;
import android.telephony.SubscriptionManager;
import android.util.Log;
@@ -119,7 +121,8 @@
UserManager.DISALLOW_AIRPLANE_MODE,
UserManager.DISALLOW_CONFIG_BRIGHTNESS,
UserManager.DISALLOW_SHARE_INTO_MANAGED_PROFILE,
- UserManager.DISALLOW_AMBIENT_DISPLAY
+ UserManager.DISALLOW_AMBIENT_DISPLAY,
+ UserManager.DISALLOW_CONFIG_SCREEN_TIMEOUT
});
/**
@@ -542,6 +545,22 @@
android.provider.Settings.Global.SAFE_BOOT_DISALLOWED,
newValue ? 1 : 0);
break;
+ case UserManager.DISALLOW_AIRPLANE_MODE:
+ if (newValue) {
+ final boolean airplaneMode = Settings.Global.getInt(
+ context.getContentResolver(),
+ Settings.Global.AIRPLANE_MODE_ON, 0) == 1;
+ if (airplaneMode) {
+ android.provider.Settings.Global.putInt(
+ context.getContentResolver(),
+ android.provider.Settings.Global.AIRPLANE_MODE_ON, 0);
+ // Post the intent.
+ Intent intent = new Intent(Intent.ACTION_AIRPLANE_MODE_CHANGED);
+ intent.putExtra("state", 0);
+ context.sendBroadcastAsUser(intent, UserHandle.ALL);
+ }
+ }
+ break;
}
} finally {
Binder.restoreCallingIdentity(id);
diff --git a/services/core/java/com/android/server/pm/crossprofile/CrossProfileAppsServiceImpl.java b/services/core/java/com/android/server/pm/crossprofile/CrossProfileAppsServiceImpl.java
index d6281c5..a517d6d 100644
--- a/services/core/java/com/android/server/pm/crossprofile/CrossProfileAppsServiceImpl.java
+++ b/services/core/java/com/android/server/pm/crossprofile/CrossProfileAppsServiceImpl.java
@@ -111,6 +111,7 @@
final long ident = mInjector.clearCallingIdentity();
try {
+ launchIntent.setPackage(null);
launchIntent.setComponent(component);
mContext.startActivityAsUser(launchIntent,
ActivityOptions.makeOpenCrossProfileAppsAnimation().toBundle(), user);
diff --git a/services/core/java/com/android/server/policy/PhoneWindowManager.java b/services/core/java/com/android/server/policy/PhoneWindowManager.java
index 79f20c5..a453c33 100644
--- a/services/core/java/com/android/server/policy/PhoneWindowManager.java
+++ b/services/core/java/com/android/server/policy/PhoneWindowManager.java
@@ -48,7 +48,6 @@
import static android.view.WindowManager.LayoutParams.FIRST_APPLICATION_WINDOW;
import static android.view.WindowManager.LayoutParams.FIRST_SUB_WINDOW;
import static android.view.WindowManager.LayoutParams.FIRST_SYSTEM_WINDOW;
-import static android.view.WindowManager.LayoutParams.FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA;
import static android.view.WindowManager.LayoutParams.FLAG_ALLOW_LOCK_WHILE_SCREEN_ON;
import static android.view.WindowManager.LayoutParams.FLAG_DRAWS_SYSTEM_BAR_BACKGROUNDS;
import static android.view.WindowManager.LayoutParams.FLAG_FORCE_NOT_FULLSCREEN;
@@ -65,6 +64,9 @@
import static android.view.WindowManager.LayoutParams.LAST_APPLICATION_WINDOW;
import static android.view.WindowManager.LayoutParams.LAST_SUB_WINDOW;
import static android.view.WindowManager.LayoutParams.LAST_SYSTEM_WINDOW;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER;
import static android.view.WindowManager.LayoutParams.MATCH_PARENT;
import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_ACQUIRES_SLEEP_TOKEN;
import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_FORCE_DRAW_STATUS_BAR_BACKGROUND;
@@ -161,6 +163,7 @@
import android.app.UiModeManager;
import android.content.ActivityNotFoundException;
import android.content.BroadcastReceiver;
+import android.content.ComponentCallbacks;
import android.content.ComponentName;
import android.content.ContentResolver;
import android.content.Context;
@@ -266,6 +269,7 @@
import com.android.internal.logging.MetricsLogger;
import com.android.internal.policy.IKeyguardDismissCallback;
import com.android.internal.policy.IShortcutService;
+import com.android.internal.policy.KeyguardDismissCallback;
import com.android.internal.policy.PhoneWindow;
import com.android.internal.statusbar.IStatusBarService;
import com.android.internal.util.ArrayUtils;
@@ -2741,6 +2745,11 @@
}
@Override
+ public void onOverlayChangedLw() {
+ onConfigurationChanged();
+ }
+
+ @Override
public void onConfigurationChanged() {
// TODO(multi-display): Define policy for secondary displays.
Context uiContext = getSystemUiContext();
@@ -4203,20 +4212,23 @@
if (isKeyguardShowingAndNotOccluded()) {
// don't launch home if keyguard showing
return;
- }
-
- if (!mKeyguardOccluded && mKeyguardDelegate.isInputRestricted()) {
+ } else if (mKeyguardOccluded && mKeyguardDelegate.isShowing()) {
+ mKeyguardDelegate.dismiss(new KeyguardDismissCallback() {
+ @Override
+ public void onDismissSucceeded() throws RemoteException {
+ mHandler.post(() -> {
+ startDockOrHome(true /*fromHomeKey*/, awakenFromDreams);
+ });
+ }
+ }, null /* message */);
+ return;
+ } else if (!mKeyguardOccluded && mKeyguardDelegate.isInputRestricted()) {
// when in keyguard restricted mode, must first verify unlock
// before launching home
mKeyguardDelegate.verifyUnlock(new OnKeyguardExitResult() {
@Override
public void onKeyguardExitResult(boolean success) {
if (success) {
- try {
- ActivityManager.getService().stopAppSwitches();
- } catch (RemoteException e) {
- }
- sendCloseSystemWindows(SYSTEM_DIALOG_REASON_HOME_KEY);
startDockOrHome(true /*fromHomeKey*/, awakenFromDreams);
}
}
@@ -4226,11 +4238,11 @@
}
// no keyguard stuff to worry about, just launch home!
- try {
- ActivityManager.getService().stopAppSwitches();
- } catch (RemoteException e) {
- }
if (mRecentsVisible) {
+ try {
+ ActivityManager.getService().stopAppSwitches();
+ } catch (RemoteException e) {}
+
// Hide Recents and notify it to launch Home
if (awakenFromDreams) {
awakenDreams();
@@ -4238,7 +4250,6 @@
hideRecentApps(false, true);
} else {
// Otherwise, just launch Home
- sendCloseSystemWindows(SYSTEM_DIALOG_REASON_HOME_KEY);
startDockOrHome(true /*fromHomeKey*/, awakenFromDreams);
}
}
@@ -4861,7 +4872,6 @@
final int type = attrs.type;
final int fl = PolicyControl.getWindowFlags(win, attrs);
- final long fl2 = attrs.flags2;
final int pfl = attrs.privateFlags;
final int sim = attrs.softInputMode;
final int requestedSysUiFl = PolicyControl.getSystemUiVisibility(win, null);
@@ -4883,12 +4893,10 @@
final int adjust = sim & SOFT_INPUT_MASK_ADJUST;
final boolean requestedFullscreen = (fl & FLAG_FULLSCREEN) != 0
- || (requestedSysUiFl & View.SYSTEM_UI_FLAG_FULLSCREEN) != 0
- || (requestedSysUiFl & View.SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN) != 0;
+ || (requestedSysUiFl & View.SYSTEM_UI_FLAG_FULLSCREEN) != 0;
final boolean layoutInScreen = (fl & FLAG_LAYOUT_IN_SCREEN) == FLAG_LAYOUT_IN_SCREEN;
final boolean layoutInsetDecor = (fl & FLAG_LAYOUT_INSET_DECOR) == FLAG_LAYOUT_INSET_DECOR;
- final boolean layoutInCutout = (fl2 & FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA) != 0;
sf.set(displayFrames.mStable);
@@ -5048,9 +5056,6 @@
// moving from a window that is not hiding the status bar to one that is.
cf.set(displayFrames.mRestricted);
}
- if (requestedFullscreen && !layoutInCutout) {
- pf.intersectUnchecked(displayFrames.mDisplayCutoutSafe);
- }
applyStableConstraints(sysUiFl, fl, cf, displayFrames);
if (adjust != SOFT_INPUT_ADJUST_NOTHING) {
vf.set(displayFrames.mCurrent);
@@ -5136,9 +5141,6 @@
of.set(displayFrames.mUnrestricted);
df.set(displayFrames.mUnrestricted);
pf.set(displayFrames.mUnrestricted);
- if (requestedFullscreen && !layoutInCutout) {
- pf.intersectUnchecked(displayFrames.mDisplayCutoutSafe);
- }
} else if ((sysUiFl & View.SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN) != 0) {
of.set(displayFrames.mRestricted);
df.set(displayFrames.mRestricted);
@@ -5213,15 +5215,18 @@
}
}
- // Ensure that windows that did not request to be laid out in the cutout don't get laid
- // out there.
- if (!layoutInCutout) {
+ final int cutoutMode = attrs.layoutInDisplayCutoutMode;
+ // Ensure that windows with a DEFAULT or NEVER display cutout mode are laid out in
+ // the cutout safe zone.
+ if (cutoutMode != LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS) {
final Rect displayCutoutSafeExceptMaybeTop = mTmpRect;
displayCutoutSafeExceptMaybeTop.set(displayFrames.mDisplayCutoutSafe);
- if (layoutInScreen && layoutInsetDecor) {
+ if (layoutInScreen && layoutInsetDecor && !requestedFullscreen
+ && cutoutMode == LAYOUT_IN_DISPLAY_CUTOUT_MODE_DEFAULT) {
// At the top we have the status bar, so apps that are
- // LAYOUT_IN_SCREEN | LAYOUT_INSET_DECOR already expect that there's an inset
- // there and we don't need to exclude the window from that area.
+ // LAYOUT_IN_SCREEN | LAYOUT_INSET_DECOR but not FULLSCREEN
+ // already expect that there's an inset there and we don't need to exclude
+ // the window from that area.
displayCutoutSafeExceptMaybeTop.top = Integer.MIN_VALUE;
}
pf.intersectUnchecked(displayCutoutSafeExceptMaybeTop);
@@ -7631,6 +7636,11 @@
}
void startDockOrHome(boolean fromHomeKey, boolean awakenFromDreams) {
+ try {
+ ActivityManager.getService().stopAppSwitches();
+ } catch (RemoteException e) {}
+ sendCloseSystemWindows(SYSTEM_DIALOG_REASON_HOME_KEY);
+
if (awakenFromDreams) {
awakenDreams();
}
@@ -7670,11 +7680,6 @@
}
if (false) {
// This code always brings home to the front.
- try {
- ActivityManager.getService().stopAppSwitches();
- } catch (RemoteException e) {
- }
- sendCloseSystemWindows();
startDockOrHome(false /*fromHomeKey*/, true /* awakenFromDreams */);
} else {
// This code brings home to the front or, if it is already
@@ -7898,8 +7903,11 @@
// If the top fullscreen-or-dimming window is also the top fullscreen, respect
// its light flag.
vis &= ~View.SYSTEM_UI_FLAG_LIGHT_STATUS_BAR;
- vis |= PolicyControl.getSystemUiVisibility(statusColorWin, null)
- & View.SYSTEM_UI_FLAG_LIGHT_STATUS_BAR;
+ if (!statusColorWin.isLetterboxedForDisplayCutoutLw()) {
+ // Only allow white status bar if the window was not letterboxed.
+ vis |= PolicyControl.getSystemUiVisibility(statusColorWin, null)
+ & View.SYSTEM_UI_FLAG_LIGHT_STATUS_BAR;
+ }
} else if (statusColorWin != null && statusColorWin.isDimming()) {
// Otherwise if it's dimming, clear the light flag.
vis &= ~View.SYSTEM_UI_FLAG_LIGHT_STATUS_BAR;
diff --git a/services/core/java/com/android/server/policy/WindowManagerPolicy.java b/services/core/java/com/android/server/policy/WindowManagerPolicy.java
index 686155b..60dae53 100644
--- a/services/core/java/com/android/server/policy/WindowManagerPolicy.java
+++ b/services/core/java/com/android/server/policy/WindowManagerPolicy.java
@@ -138,11 +138,6 @@
* </dl>
*/
public interface WindowManagerPolicy extends WindowManagerPolicyConstants {
- // Navigation bar position values
- int NAV_BAR_LEFT = 1 << 0;
- int NAV_BAR_RIGHT = 1 << 1;
- int NAV_BAR_BOTTOM = 1 << 2;
-
@Retention(SOURCE)
@IntDef({NAV_BAR_LEFT, NAV_BAR_RIGHT, NAV_BAR_BOTTOM})
@interface NavigationBarPosition {}
@@ -176,6 +171,11 @@
void onKeyguardOccludedChangedLw(boolean occluded);
/**
+ * Called when the resource overlays change.
+ */
+ default void onOverlayChangedLw() {}
+
+ /**
* Interface to the Window Manager state associated with a particular
* window. You can hold on to an instance of this interface from the call
* to prepareAddWindow() until removeWindow().
@@ -446,6 +446,13 @@
*/
public boolean isDimming();
+ /**
+ * Returns true if the window is letterboxed for the display cutout.
+ */
+ default boolean isLetterboxedForDisplayCutoutLw() {
+ return false;
+ }
+
/** @return the current windowing mode of this window. */
int getWindowingMode();
diff --git a/services/core/java/com/android/server/policy/WindowOrientationListener.java b/services/core/java/com/android/server/policy/WindowOrientationListener.java
index 1b5a521..48a196d 100644
--- a/services/core/java/com/android/server/policy/WindowOrientationListener.java
+++ b/services/core/java/com/android/server/policy/WindowOrientationListener.java
@@ -32,6 +32,7 @@
import android.view.Surface;
import java.io.PrintWriter;
+import java.util.List;
/**
* A special helper class used by the WindowManager
@@ -90,7 +91,28 @@
mHandler = handler;
mSensorManager = (SensorManager)context.getSystemService(Context.SENSOR_SERVICE);
mRate = rate;
- mSensor = mSensorManager.getDefaultSensor(Sensor.TYPE_DEVICE_ORIENTATION);
+ List<Sensor> l = mSensorManager.getSensorList(Sensor.TYPE_DEVICE_ORIENTATION);
+ Sensor wakeUpDeviceOrientationSensor = null;
+ Sensor nonWakeUpDeviceOrientationSensor = null;
+ /**
+ * Prefer the wakeup form of the sensor if implemented.
+ * It's OK to look for just two types of this sensor and use
+ * the last found. Typical devices will only have one sensor of
+ * this type.
+ */
+ for (Sensor s : l) {
+ if (s.isWakeUpSensor()) {
+ wakeUpDeviceOrientationSensor = s;
+ } else {
+ nonWakeUpDeviceOrientationSensor = s;
+ }
+ }
+
+ if (wakeUpDeviceOrientationSensor != null) {
+ mSensor = wakeUpDeviceOrientationSensor;
+ } else {
+ mSensor = nonWakeUpDeviceOrientationSensor;
+ }
if (mSensor != null) {
mOrientationJudge = new OrientationSensorJudge();
diff --git a/services/core/java/com/android/server/wm/AppWindowToken.java b/services/core/java/com/android/server/wm/AppWindowToken.java
index 2c84cb1..a254ba2 100644
--- a/services/core/java/com/android/server/wm/AppWindowToken.java
+++ b/services/core/java/com/android/server/wm/AppWindowToken.java
@@ -1427,13 +1427,13 @@
mLetterbox.setDimensions(mPendingTransaction, getParent().getBounds(), w.mFrame);
} else if (mLetterbox != null) {
final SurfaceControl.Transaction t = new SurfaceControl.Transaction();
+ // Make sure we have a transaction here, in case we're called outside of a transaction.
+ // This does not use mPendingTransaction, because SurfaceAnimator uses a
+ // global transaction in onAnimationEnd.
SurfaceControl.openTransaction();
try {
mLetterbox.hide(t);
} finally {
- // TODO: This should use pendingTransaction eventually, but right now things
- // happening on the animation finished callback are happening on the global
- // transaction.
SurfaceControl.mergeToGlobalTransaction(t);
SurfaceControl.closeTransaction();
}
diff --git a/services/core/java/com/android/server/wm/DragDropController.java b/services/core/java/com/android/server/wm/DragDropController.java
index 28b4c1d..0171b56 100644
--- a/services/core/java/com/android/server/wm/DragDropController.java
+++ b/services/core/java/com/android/server/wm/DragDropController.java
@@ -136,7 +136,7 @@
outSurface.copyFrom(surface);
final IBinder winBinder = window.asBinder();
IBinder token = new Binder();
- mDragState = new DragState(mService, token, surface, flags, winBinder);
+ mDragState = new DragState(mService, this, token, surface, flags, winBinder);
mDragState.mPid = callerPid;
mDragState.mUid = callerUid;
mDragState.mOriginalAlpha = alpha;
diff --git a/services/core/java/com/android/server/wm/DragState.java b/services/core/java/com/android/server/wm/DragState.java
index b9f437a..1ac9b88 100644
--- a/services/core/java/com/android/server/wm/DragState.java
+++ b/services/core/java/com/android/server/wm/DragState.java
@@ -42,6 +42,7 @@
import android.os.UserHandle;
import android.os.UserManager;
import android.os.IUserManager;
+import android.os.UserManagerInternal;
import android.util.Slog;
import android.view.Display;
import android.view.DragEvent;
@@ -55,6 +56,7 @@
import android.view.animation.Interpolator;
import com.android.internal.view.IDragAndDropPermissions;
+import com.android.server.LocalServices;
import com.android.server.input.InputApplicationHandle;
import com.android.server.input.InputWindowHandle;
@@ -116,10 +118,10 @@
private final Interpolator mCubicEaseOutInterpolator = new DecelerateInterpolator(1.5f);
private Point mDisplaySize = new Point();
- DragState(WindowManagerService service, IBinder token, SurfaceControl surface,
- int flags, IBinder localWin) {
+ DragState(WindowManagerService service, DragDropController controller, IBinder token,
+ SurfaceControl surface, int flags, IBinder localWin) {
mService = service;
- mDragDropController = service.mDragDropController;
+ mDragDropController = controller;
mToken = token;
mSurfaceControl = surface;
mFlags = flags;
@@ -318,15 +320,9 @@
mSourceUserId = UserHandle.getUserId(mUid);
- final IUserManager userManager =
- (IUserManager) ServiceManager.getService(Context.USER_SERVICE);
- try {
- mCrossProfileCopyAllowed = !userManager.getUserRestrictions(mSourceUserId).getBoolean(
- UserManager.DISALLOW_CROSS_PROFILE_COPY_PASTE);
- } catch (RemoteException e) {
- Slog.e(TAG_WM, "Remote Exception calling UserManager: " + e);
- mCrossProfileCopyAllowed = false;
- }
+ final UserManagerInternal userManager = LocalServices.getService(UserManagerInternal.class);
+ mCrossProfileCopyAllowed = !userManager.getUserRestriction(
+ mSourceUserId, UserManager.DISALLOW_CROSS_PROFILE_COPY_PASTE);
if (DEBUG_DRAG) {
Slog.d(TAG_WM, "broadcasting DRAG_STARTED at (" + touchX + ", " + touchY + ")");
@@ -534,7 +530,8 @@
final int targetUserId = UserHandle.getUserId(touchedWin.getOwningUid());
final DragAndDropPermissionsHandler dragAndDropPermissions;
- if ((mFlags & View.DRAG_FLAG_GLOBAL) != 0 && (mFlags & DRAG_FLAGS_URI_ACCESS) != 0) {
+ if ((mFlags & View.DRAG_FLAG_GLOBAL) != 0 && (mFlags & DRAG_FLAGS_URI_ACCESS) != 0
+ && mData != null) {
dragAndDropPermissions = new DragAndDropPermissionsHandler(
mData,
mUid,
@@ -546,7 +543,9 @@
dragAndDropPermissions = null;
}
if (mSourceUserId != targetUserId){
- mData.fixUris(mSourceUserId);
+ if (mData != null) {
+ mData.fixUris(mSourceUserId);
+ }
}
final int myPid = Process.myPid();
final IBinder token = touchedWin.mClient.asBinder();
diff --git a/services/core/java/com/android/server/wm/PinnedStackController.java b/services/core/java/com/android/server/wm/PinnedStackController.java
index 69cbe46..62519e1 100644
--- a/services/core/java/com/android/server/wm/PinnedStackController.java
+++ b/services/core/java/com/android/server/wm/PinnedStackController.java
@@ -360,14 +360,19 @@
* Sets the Ime state and height.
*/
void setAdjustedForIme(boolean adjustedForIme, int imeHeight) {
- // Return early if there is no state change
- if (mIsImeShowing == adjustedForIme && mImeHeight == imeHeight) {
+ // Due to the order of callbacks from the system, we may receive an ime height even when
+ // {@param adjustedForIme} is false, and also a zero height when {@param adjustedForIme}
+ // is true. Instead, ensure that the ime state changes with the height and if the ime is
+ // showing, then the height is non-zero.
+ final boolean imeShowing = adjustedForIme && imeHeight > 0;
+ imeHeight = imeShowing ? imeHeight : 0;
+ if (imeShowing == mIsImeShowing && imeHeight == mImeHeight) {
return;
}
- mIsImeShowing = adjustedForIme;
+ mIsImeShowing = imeShowing;
mImeHeight = imeHeight;
- notifyImeVisibilityChanged(adjustedForIme, imeHeight);
+ notifyImeVisibilityChanged(imeShowing, imeHeight);
notifyMovementBoundsChanged(true /* fromImeAdjustment */);
}
diff --git a/services/core/java/com/android/server/wm/WindowManagerService.java b/services/core/java/com/android/server/wm/WindowManagerService.java
index e4fe888..d2ab9df 100644
--- a/services/core/java/com/android/server/wm/WindowManagerService.java
+++ b/services/core/java/com/android/server/wm/WindowManagerService.java
@@ -5894,6 +5894,7 @@
* the screen is.
* @see WindowManagerPolicy#getNavBarPosition()
*/
+ @Override
@WindowManagerPolicy.NavigationBarPosition
public int getNavBarPosition() {
synchronized (mWindowMap) {
@@ -6596,6 +6597,13 @@
}
}
+ public void onOverlayChanged() {
+ synchronized (mWindowMap) {
+ mPolicy.onOverlayChangedLw();
+ requestTraversal();
+ }
+ }
+
public void onDisplayChanged(int displayId) {
synchronized (mWindowMap) {
final DisplayContent displayContent = mRoot.getDisplayContentOrCreate(displayId);
diff --git a/services/core/java/com/android/server/wm/WindowState.java b/services/core/java/com/android/server/wm/WindowState.java
index dbad6ad..d068c49 100644
--- a/services/core/java/com/android/server/wm/WindowState.java
+++ b/services/core/java/com/android/server/wm/WindowState.java
@@ -21,14 +21,12 @@
import static android.view.Display.DEFAULT_DISPLAY;
import static android.view.SurfaceControl.Transaction;
import static android.view.View.SYSTEM_UI_FLAG_FULLSCREEN;
-import static android.view.View.SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN;
import static android.view.ViewTreeObserver.InternalInsetsInfo.TOUCHABLE_INSETS_CONTENT;
import static android.view.ViewTreeObserver.InternalInsetsInfo.TOUCHABLE_INSETS_FRAME;
import static android.view.ViewTreeObserver.InternalInsetsInfo.TOUCHABLE_INSETS_REGION;
import static android.view.ViewTreeObserver.InternalInsetsInfo.TOUCHABLE_INSETS_VISIBLE;
import static android.view.WindowManager.LayoutParams.FIRST_SUB_WINDOW;
import static android.view.WindowManager.LayoutParams.FIRST_SYSTEM_WINDOW;
-import static android.view.WindowManager.LayoutParams.FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA;
import static android.view.WindowManager.LayoutParams.FLAG_ALLOW_LOCK_WHILE_SCREEN_ON;
import static android.view.WindowManager.LayoutParams.FLAG_ALT_FOCUSABLE_IM;
import static android.view.WindowManager.LayoutParams.FLAG_DIM_BEHIND;
@@ -43,6 +41,8 @@
import static android.view.WindowManager.LayoutParams.FLAG_TURN_SCREEN_ON;
import static android.view.WindowManager.LayoutParams.FORMAT_CHANGED;
import static android.view.WindowManager.LayoutParams.LAST_SUB_WINDOW;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER;
import static android.view.WindowManager.LayoutParams.MATCH_PARENT;
import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_COMPATIBLE_WINDOW;
import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_HIDE_NON_SYSTEM_OVERLAY_WINDOWS;
@@ -202,7 +202,6 @@
import java.lang.ref.WeakReference;
import java.util.ArrayList;
import java.util.Comparator;
-import java.util.LinkedList;
import java.util.function.Predicate;
/** A window in the window manager. */
@@ -2981,25 +2980,33 @@
/** @return true when the window is in fullscreen task, but has non-fullscreen bounds set. */
boolean isLetterboxedAppWindow() {
- return !isInMultiWindowMode() && mAppToken != null && (!mAppToken.matchParentBounds()
- || isLetterboxedForCutout());
+ return !isInMultiWindowMode() && mAppToken != null && !mAppToken.matchParentBounds()
+ || isLetterboxedForDisplayCutoutLw();
}
- private boolean isLetterboxedForCutout() {
+ @Override
+ public boolean isLetterboxedForDisplayCutoutLw() {
+ if (mAppToken == null) {
+ // Only windows with an AppWindowToken are letterboxed.
+ return false;
+ }
if (getDisplayContent().getDisplayInfo().displayCutout == null) {
// No cutout, no letterbox.
return false;
}
- if ((mAttrs.flags2 & FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA) != 0) {
+ if (mAttrs.layoutInDisplayCutoutMode == LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS) {
// Layout in cutout, no letterbox.
return false;
}
// TODO: handle dialogs and other non-filling windows
+ if (mAttrs.layoutInDisplayCutoutMode == LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER) {
+ // Never layout in cutout, always letterbox.
+ return true;
+ }
// Letterbox if any fullscreen mode is set.
final int fl = mAttrs.flags;
final int sysui = mSystemUiVisibility;
- return (fl & FLAG_FULLSCREEN) != 0
- || (sysui & (SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN | SYSTEM_UI_FLAG_FULLSCREEN)) != 0;
+ return (fl & FLAG_FULLSCREEN) != 0 || (sysui & (SYSTEM_UI_FLAG_FULLSCREEN)) != 0;
}
boolean isDragResizeChanged() {
diff --git a/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java b/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
index d4ef315..62a97f8 100644
--- a/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
+++ b/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
@@ -226,6 +226,7 @@
import java.util.List;
import java.util.Map.Entry;
import java.util.Map;
+import java.util.Objects;
import java.util.Set;
import java.util.concurrent.TimeUnit;
import java.util.concurrent.atomic.AtomicBoolean;
@@ -790,6 +791,7 @@
private static final String ATTR_LAST_NETWORK_LOGGING_NOTIFICATION = "last-notification";
private static final String ATTR_NUM_NETWORK_LOGGING_NOTIFICATIONS = "num-notifications";
private static final String TAG_IS_LOGOUT_ENABLED = "is_logout_enabled";
+ private static final String TAG_MANDATORY_BACKUP_TRANSPORT = "mandatory_backup_transport";
DeviceAdminInfo info;
@@ -906,6 +908,10 @@
// The blacklist data is stored in a file whose name is stored in the XML
String passwordBlacklistFile = null;
+ // The component name of the backup transport which has to be used if backups are mandatory
+ // or null if backups are not mandatory.
+ ComponentName mandatoryBackupTransport = null;
+
ActiveAdmin(DeviceAdminInfo _info, boolean parent) {
info = _info;
isParent = parent;
@@ -1169,6 +1175,11 @@
out.attribute(null, ATTR_VALUE, Boolean.toString(isLogoutEnabled));
out.endTag(null, TAG_IS_LOGOUT_ENABLED);
}
+ if (mandatoryBackupTransport != null) {
+ out.startTag(null, TAG_MANDATORY_BACKUP_TRANSPORT);
+ out.attribute(null, ATTR_VALUE, mandatoryBackupTransport.flattenToString());
+ out.endTag(null, TAG_MANDATORY_BACKUP_TRANSPORT);
+ }
}
void writePackageListToXml(XmlSerializer out, String outerTag,
@@ -1347,6 +1358,9 @@
} else if (TAG_IS_LOGOUT_ENABLED.equals(tag)) {
isLogoutEnabled = Boolean.parseBoolean(
parser.getAttributeValue(null, ATTR_VALUE));
+ } else if (TAG_MANDATORY_BACKUP_TRANSPORT.equals(tag)) {
+ mandatoryBackupTransport = ComponentName.unflattenFromString(
+ parser.getAttributeValue(null, ATTR_VALUE));
} else {
Slog.w(LOG_TAG, "Unknown admin tag: " + tag);
XmlUtils.skipCurrentTag(parser);
@@ -11338,7 +11352,12 @@
}
Preconditions.checkNotNull(admin);
synchronized (this) {
- getActiveAdminForCallerLocked(admin, DeviceAdminInfo.USES_POLICY_DEVICE_OWNER);
+ ActiveAdmin activeAdmin = getActiveAdminForCallerLocked(
+ admin, DeviceAdminInfo.USES_POLICY_DEVICE_OWNER);
+ if (!enabled) {
+ activeAdmin.mandatoryBackupTransport = null;
+ saveSettingsLocked(UserHandle.USER_SYSTEM);
+ }
}
final long ident = mInjector.binderClearCallingIdentity();
@@ -11373,6 +11392,50 @@
}
@Override
+ public void setMandatoryBackupTransport(
+ ComponentName admin, ComponentName backupTransportComponent) {
+ if (!mHasFeature) {
+ return;
+ }
+ Preconditions.checkNotNull(admin);
+ synchronized (this) {
+ ActiveAdmin activeAdmin =
+ getActiveAdminForCallerLocked(admin, DeviceAdminInfo.USES_POLICY_DEVICE_OWNER);
+ if (!Objects.equals(backupTransportComponent, activeAdmin.mandatoryBackupTransport)) {
+ activeAdmin.mandatoryBackupTransport = backupTransportComponent;
+ saveSettingsLocked(UserHandle.USER_SYSTEM);
+ }
+ }
+ final long identity = mInjector.binderClearCallingIdentity();
+ try {
+ IBackupManager ibm = mInjector.getIBackupManager();
+ if (ibm != null && backupTransportComponent != null) {
+ if (!ibm.isBackupServiceActive(UserHandle.USER_SYSTEM)) {
+ ibm.setBackupServiceActive(UserHandle.USER_SYSTEM, true);
+ }
+ ibm.selectBackupTransportAsync(backupTransportComponent, null);
+ ibm.setBackupEnabled(true);
+ }
+ } catch (RemoteException e) {
+ throw new IllegalStateException("Failed to set mandatory backup transport.", e);
+ } finally {
+ mInjector.binderRestoreCallingIdentity(identity);
+ }
+ }
+
+ @Override
+ public ComponentName getMandatoryBackupTransport() {
+ if (!mHasFeature) {
+ return null;
+ }
+ synchronized (this) {
+ ActiveAdmin activeAdmin = getDeviceOwnerAdminLocked();
+ return activeAdmin == null ? null : activeAdmin.mandatoryBackupTransport;
+ }
+ }
+
+
+ @Override
public boolean bindDeviceAdminServiceAsUser(
@NonNull ComponentName admin, @NonNull IApplicationThread caller,
@Nullable IBinder activtiyToken, @NonNull Intent serviceIntent,
diff --git a/services/java/com/android/server/SystemServer.java b/services/java/com/android/server/SystemServer.java
index 4310a98..3199bfa 100644
--- a/services/java/com/android/server/SystemServer.java
+++ b/services/java/com/android/server/SystemServer.java
@@ -80,6 +80,7 @@
import com.android.server.lights.LightsService;
import com.android.server.media.MediaResourceMonitorService;
import com.android.server.media.MediaRouterService;
+import com.android.server.media.MediaUpdateService;
import com.android.server.media.MediaSessionService;
import com.android.server.media.projection.MediaProjectionManagerService;
import com.android.server.net.NetworkPolicyManagerService;
@@ -1442,6 +1443,10 @@
mSystemServiceManager.startService(MediaSessionService.class);
traceEnd();
+ traceBeginAndSlog("StartMediaUpdateService");
+ mSystemServiceManager.startService(MediaUpdateService.class);
+ traceEnd();
+
if (mPackageManager.hasSystemFeature(PackageManager.FEATURE_HDMI_CEC)) {
traceBeginAndSlog("StartHdmiControlService");
mSystemServiceManager.startService(HdmiControlService.class);
diff --git a/services/robotests/src/com/android/server/backup/BackupManagerServiceRoboTest.java b/services/robotests/src/com/android/server/backup/BackupManagerServiceRoboTest.java
index f9ebd28..dc0a4e3 100644
--- a/services/robotests/src/com/android/server/backup/BackupManagerServiceRoboTest.java
+++ b/services/robotests/src/com/android/server/backup/BackupManagerServiceRoboTest.java
@@ -16,7 +16,11 @@
package com.android.server.backup;
-import static com.android.server.backup.testing.TransportTestUtils.TRANSPORT_NAMES;
+import static com.android.server.backup.testing.TransportData.backupTransport;
+import static com.android.server.backup.testing.TransportData.d2dTransport;
+import static com.android.server.backup.testing.TransportData.localTransport;
+import static com.android.server.backup.testing.TransportTestUtils.setUpCurrentTransport;
+import static com.android.server.backup.testing.TransportTestUtils.setUpTransports;
import static com.google.common.truth.Truth.assertThat;
@@ -24,6 +28,7 @@
import static org.mockito.ArgumentMatchers.anyInt;
import static org.mockito.ArgumentMatchers.eq;
import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.never;
import static org.mockito.Mockito.verify;
import static org.mockito.Mockito.when;
import static org.robolectric.Shadows.shadowOf;
@@ -39,8 +44,10 @@
import android.provider.Settings;
import com.android.server.backup.testing.ShadowAppBackupUtils;
+import com.android.server.backup.testing.ShadowBackupPolicyEnforcer;
+import com.android.server.backup.testing.TransportData;
import com.android.server.backup.testing.TransportTestUtils;
-import com.android.server.backup.testing.TransportTestUtils.TransportData;
+import com.android.server.backup.testing.TransportTestUtils.TransportMock;
import com.android.server.backup.transport.TransportNotRegisteredException;
import com.android.server.testing.FrameworkRobolectricTestRunner;
import com.android.server.testing.SystemLoaderClasses;
@@ -57,38 +64,40 @@
import org.robolectric.shadows.ShadowLog;
import org.robolectric.shadows.ShadowLooper;
import org.robolectric.shadows.ShadowSettings;
+import org.robolectric.shadows.ShadowSystemClock;
import java.io.File;
import java.util.HashMap;
-import java.util.List;
import java.util.Map;
@RunWith(FrameworkRobolectricTestRunner.class)
@Config(
manifest = Config.NONE,
sdk = 26,
- shadows = {ShadowAppBackupUtils.class}
+ shadows = {ShadowAppBackupUtils.class, ShadowBackupPolicyEnforcer.class}
)
@SystemLoaderClasses({RefactoredBackupManagerService.class, TransportManager.class})
@Presubmit
public class BackupManagerServiceRoboTest {
private static final String TAG = "BMSTest";
- private static final String TRANSPORT_NAME =
- "com.google.android.gms/.backup.BackupTransportService";
@Mock private TransportManager mTransportManager;
private HandlerThread mBackupThread;
private ShadowLooper mShadowBackupLooper;
private File mBaseStateDir;
private File mDataDir;
- private RefactoredBackupManagerService mBackupManagerService;
private ShadowContextWrapper mShadowContext;
private Context mContext;
+ private TransportData mTransport;
+ private String mTransportName;
@Before
public void setUp() throws Exception {
MockitoAnnotations.initMocks(this);
+ mTransport = backupTransport();
+ mTransportName = mTransport.transportName;
+
mBackupThread = new HandlerThread("backup-test");
mBackupThread.setUncaughtExceptionHandler(
(t, e) -> ShadowLog.e(TAG, "Uncaught exception in test thread " + t.getName(), e));
@@ -103,20 +112,14 @@
mBaseStateDir = new File(cacheDir, "base_state_dir");
mDataDir = new File(cacheDir, "data_dir");
- mBackupManagerService =
- new RefactoredBackupManagerService(
- mContext,
- new Trampoline(mContext),
- mBackupThread,
- mBaseStateDir,
- mDataDir,
- mTransportManager);
+ ShadowBackupPolicyEnforcer.setMandatoryBackupTransport(null);
}
@After
public void tearDown() throws Exception {
mBackupThread.quit();
ShadowAppBackupUtils.reset();
+ ShadowBackupPolicyEnforcer.setMandatoryBackupTransport(null);
}
/* Tests for destination string */
@@ -124,10 +127,12 @@
@Test
public void testDestinationString() throws Exception {
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
- when(mTransportManager.getTransportCurrentDestinationString(eq(TRANSPORT_NAME)))
+ when(mTransportManager.getTransportCurrentDestinationString(eq(mTransportName)))
.thenReturn("destinationString");
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
- String destination = mBackupManagerService.getDestinationString(TRANSPORT_NAME);
+ String destination = backupManagerService.getDestinationString(mTransportName);
assertThat(destination).isEqualTo("destinationString");
}
@@ -135,10 +140,12 @@
@Test
public void testDestinationString_whenTransportNotRegistered() throws Exception {
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
- when(mTransportManager.getTransportCurrentDestinationString(eq(TRANSPORT_NAME)))
+ when(mTransportManager.getTransportCurrentDestinationString(eq(mTransportName)))
.thenThrow(TransportNotRegisteredException.class);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
- String destination = mBackupManagerService.getDestinationString(TRANSPORT_NAME);
+ String destination = backupManagerService.getDestinationString(mTransportName);
assertThat(destination).isNull();
}
@@ -146,12 +153,14 @@
@Test
public void testDestinationString_withoutPermission() throws Exception {
mShadowContext.denyPermissions(android.Manifest.permission.BACKUP);
- when(mTransportManager.getTransportCurrentDestinationString(eq(TRANSPORT_NAME)))
+ when(mTransportManager.getTransportCurrentDestinationString(eq(mTransportName)))
.thenThrow(TransportNotRegisteredException.class);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
expectThrows(
SecurityException.class,
- () -> mBackupManagerService.getDestinationString(TRANSPORT_NAME));
+ () -> backupManagerService.getDestinationString(mTransportName));
}
/* Tests for app eligibility */
@@ -159,24 +168,28 @@
@Test
public void testIsAppEligibleForBackup_whenAppEligible() throws Exception {
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
- TransportData transport =
- TransportTestUtils.setUpCurrentTransport(mTransportManager, TRANSPORT_NAME);
+ TransportMock transportMock = setUpCurrentTransport(mTransportManager, backupTransport());
ShadowAppBackupUtils.sAppIsRunningAndEligibleForBackupWithTransport = p -> true;
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
- boolean result = mBackupManagerService.isAppEligibleForBackup("app.package");
+ boolean result = backupManagerService.isAppEligibleForBackup("app.package");
assertThat(result).isTrue();
+
verify(mTransportManager)
- .disposeOfTransportClient(eq(transport.transportClientMock), any());
+ .disposeOfTransportClient(eq(transportMock.transportClient), any());
}
@Test
public void testIsAppEligibleForBackup_whenAppNotEligible() throws Exception {
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
- TransportTestUtils.setUpCurrentTransport(mTransportManager, TRANSPORT_NAME);
+ setUpCurrentTransport(mTransportManager, mTransport);
ShadowAppBackupUtils.sAppIsRunningAndEligibleForBackupWithTransport = p -> false;
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
- boolean result = mBackupManagerService.isAppEligibleForBackup("app.package");
+ boolean result = backupManagerService.isAppEligibleForBackup("app.package");
assertThat(result).isFalse();
}
@@ -184,38 +197,43 @@
@Test
public void testIsAppEligibleForBackup_withoutPermission() throws Exception {
mShadowContext.denyPermissions(android.Manifest.permission.BACKUP);
- TransportTestUtils.setUpCurrentTransport(mTransportManager, TRANSPORT_NAME);
+ setUpCurrentTransport(mTransportManager, mTransport);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
expectThrows(
SecurityException.class,
- () -> mBackupManagerService.isAppEligibleForBackup("app.package"));
+ () -> backupManagerService.isAppEligibleForBackup("app.package"));
}
@Test
public void testFilterAppsEligibleForBackup() throws Exception {
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
- TransportData transport =
- TransportTestUtils.setUpCurrentTransport(mTransportManager, TRANSPORT_NAME);
+ TransportMock transportMock = setUpCurrentTransport(mTransportManager, mTransport);
Map<String, Boolean> packagesMap = new HashMap<>();
packagesMap.put("package.a", true);
packagesMap.put("package.b", false);
ShadowAppBackupUtils.sAppIsRunningAndEligibleForBackupWithTransport = packagesMap::get;
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
String[] packages = packagesMap.keySet().toArray(new String[packagesMap.size()]);
- String[] filtered = mBackupManagerService.filterAppsEligibleForBackup(packages);
+ String[] filtered = backupManagerService.filterAppsEligibleForBackup(packages);
assertThat(filtered).asList().containsExactly("package.a");
verify(mTransportManager)
- .disposeOfTransportClient(eq(transport.transportClientMock), any());
+ .disposeOfTransportClient(eq(transportMock.transportClient), any());
}
@Test
public void testFilterAppsEligibleForBackup_whenNoneIsEligible() throws Exception {
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
ShadowAppBackupUtils.sAppIsRunningAndEligibleForBackupWithTransport = p -> false;
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
String[] filtered =
- mBackupManagerService.filterAppsEligibleForBackup(
+ backupManagerService.filterAppsEligibleForBackup(
new String[] {"package.a", "package.b"});
assertThat(filtered).isEmpty();
@@ -224,12 +242,14 @@
@Test
public void testFilterAppsEligibleForBackup_withoutPermission() throws Exception {
mShadowContext.denyPermissions(android.Manifest.permission.BACKUP);
- TransportTestUtils.setUpCurrentTransport(mTransportManager, TRANSPORT_NAME);
+ setUpCurrentTransport(mTransportManager, mTransport);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
expectThrows(
SecurityException.class,
() ->
- mBackupManagerService.filterAppsEligibleForBackup(
+ backupManagerService.filterAppsEligibleForBackup(
new String[] {"package.a", "package.b"}));
}
@@ -238,14 +258,14 @@
private TransportData mNewTransport;
private TransportData mOldTransport;
private ComponentName mNewTransportComponent;
- private ISelectBackupTransportCallback mCallback;
+ private ComponentName mOldTransportComponent;
private void setUpForSelectTransport() throws Exception {
- List<TransportData> transports =
- TransportTestUtils.setUpTransports(mTransportManager, TRANSPORT_NAMES);
- mNewTransport = transports.get(0);
- mNewTransportComponent = mNewTransport.transportClientMock.getTransportComponent();
- mOldTransport = transports.get(1);
+ mNewTransport = backupTransport();
+ mNewTransportComponent = mNewTransport.getTransportComponent();
+ mOldTransport = d2dTransport();
+ mOldTransportComponent = mOldTransport.getTransportComponent();
+ setUpTransports(mTransportManager, mNewTransport, mOldTransport, localTransport());
when(mTransportManager.selectTransport(eq(mNewTransport.transportName)))
.thenReturn(mOldTransport.transportName);
}
@@ -254,9 +274,11 @@
public void testSelectBackupTransport() throws Exception {
setUpForSelectTransport();
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
String oldTransport =
- mBackupManagerService.selectBackupTransport(mNewTransport.transportName);
+ backupManagerService.selectBackupTransport(mNewTransport.transportName);
assertThat(getSettingsTransport()).isEqualTo(mNewTransport.transportName);
assertThat(oldTransport).isEqualTo(mOldTransport.transportName);
@@ -266,10 +288,12 @@
public void testSelectBackupTransport_withoutPermission() throws Exception {
setUpForSelectTransport();
mShadowContext.denyPermissions(android.Manifest.permission.BACKUP);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
expectThrows(
SecurityException.class,
- () -> mBackupManagerService.selectBackupTransport(mNewTransport.transportName));
+ () -> backupManagerService.selectBackupTransport(mNewTransport.transportName));
}
@Test
@@ -278,9 +302,11 @@
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
when(mTransportManager.registerAndSelectTransport(eq(mNewTransportComponent)))
.thenReturn(BackupManager.SUCCESS);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
ISelectBackupTransportCallback callback = mock(ISelectBackupTransportCallback.class);
- mBackupManagerService.selectBackupTransportAsync(mNewTransportComponent, callback);
+ backupManagerService.selectBackupTransportAsync(mNewTransportComponent, callback);
mShadowBackupLooper.runToEndOfTasks();
assertThat(getSettingsTransport()).isEqualTo(mNewTransport.transportName);
@@ -288,14 +314,53 @@
}
@Test
+ public void testSelectBackupTransportAsync_whenMandatoryTransport() throws Exception {
+ setUpForSelectTransport();
+ ShadowBackupPolicyEnforcer.setMandatoryBackupTransport(mNewTransportComponent);
+ mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
+ when(mTransportManager.registerAndSelectTransport(eq(mNewTransportComponent)))
+ .thenReturn(BackupManager.SUCCESS);
+ ISelectBackupTransportCallback callback = mock(ISelectBackupTransportCallback.class);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
+
+ backupManagerService.selectBackupTransportAsync(mNewTransportComponent, callback);
+
+ mShadowBackupLooper.runToEndOfTasks();
+ assertThat(getSettingsTransport()).isEqualTo(mNewTransport.transportName);
+ verify(callback).onSuccess(eq(mNewTransport.transportName));
+ }
+
+ @Test
+ public void testSelectBackupTransportAsync_whenOtherThanMandatoryTransport()
+ throws Exception {
+ setUpForSelectTransport();
+ ShadowBackupPolicyEnforcer.setMandatoryBackupTransport(mOldTransportComponent);
+ mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
+ when(mTransportManager.registerAndSelectTransport(eq(mNewTransportComponent)))
+ .thenReturn(BackupManager.SUCCESS);
+ ISelectBackupTransportCallback callback = mock(ISelectBackupTransportCallback.class);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
+
+ backupManagerService.selectBackupTransportAsync(mNewTransportComponent, callback);
+
+ mShadowBackupLooper.runToEndOfTasks();
+ assertThat(getSettingsTransport()).isNotEqualTo(mNewTransport.transportName);
+ verify(callback).onFailure(eq(BackupManager.ERROR_BACKUP_NOT_ALLOWED));
+ }
+
+ @Test
public void testSelectBackupTransportAsync_whenRegistrationFails() throws Exception {
setUpForSelectTransport();
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
when(mTransportManager.registerAndSelectTransport(eq(mNewTransportComponent)))
.thenReturn(BackupManager.ERROR_TRANSPORT_UNAVAILABLE);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
ISelectBackupTransportCallback callback = mock(ISelectBackupTransportCallback.class);
- mBackupManagerService.selectBackupTransportAsync(mNewTransportComponent, callback);
+ backupManagerService.selectBackupTransportAsync(mNewTransportComponent, callback);
mShadowBackupLooper.runToEndOfTasks();
assertThat(getSettingsTransport()).isNotEqualTo(mNewTransport.transportName);
@@ -304,19 +369,19 @@
@Test
public void testSelectBackupTransportAsync_whenTransportGetsUnregistered() throws Exception {
- TransportTestUtils.setUpTransports(
- mTransportManager, new TransportData(TRANSPORT_NAME, null, null));
- ComponentName newTransportComponent =
- TransportTestUtils.transportComponentName(TRANSPORT_NAME);
+ setUpTransports(mTransportManager, mTransport.unregistered());
+ ComponentName newTransportComponent = mTransport.getTransportComponent();
mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
when(mTransportManager.registerAndSelectTransport(eq(newTransportComponent)))
.thenReturn(BackupManager.SUCCESS);
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
ISelectBackupTransportCallback callback = mock(ISelectBackupTransportCallback.class);
- mBackupManagerService.selectBackupTransportAsync(newTransportComponent, callback);
+ backupManagerService.selectBackupTransportAsync(newTransportComponent, callback);
mShadowBackupLooper.runToEndOfTasks();
- assertThat(getSettingsTransport()).isNotEqualTo(TRANSPORT_NAME);
+ assertThat(getSettingsTransport()).isNotEqualTo(mTransportName);
verify(callback).onFailure(anyInt());
}
@@ -324,13 +389,14 @@
public void testSelectBackupTransportAsync_withoutPermission() throws Exception {
setUpForSelectTransport();
mShadowContext.denyPermissions(android.Manifest.permission.BACKUP);
- ComponentName newTransportComponent =
- mNewTransport.transportClientMock.getTransportComponent();
+ RefactoredBackupManagerService backupManagerService =
+ createInitializedBackupManagerService();
+ ComponentName newTransportComponent = mNewTransport.getTransportComponent();
expectThrows(
SecurityException.class,
() ->
- mBackupManagerService.selectBackupTransportAsync(
+ backupManagerService.selectBackupTransportAsync(
newTransportComponent, mock(ISelectBackupTransportCallback.class)));
}
@@ -338,4 +404,55 @@
return ShadowSettings.ShadowSecure.getString(
mContext.getContentResolver(), Settings.Secure.BACKUP_TRANSPORT);
}
+
+ /* Miscellaneous tests */
+
+ @Test
+ public void testConstructor_postRegisterTransports() {
+ mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
+
+ createBackupManagerService();
+
+ mShadowBackupLooper.runToEndOfTasks();
+ verify(mTransportManager).registerTransports();
+ }
+
+ @Test
+ public void testConstructor_doesNotRegisterTransportsSynchronously() {
+ mShadowContext.grantPermissions(android.Manifest.permission.BACKUP);
+
+ createBackupManagerService();
+
+ // Operations posted to mBackupThread only run with mShadowBackupLooper.runToEndOfTasks()
+ verify(mTransportManager, never()).registerTransports();
+ }
+
+ private RefactoredBackupManagerService createBackupManagerService() {
+ return new RefactoredBackupManagerService(
+ mContext,
+ new Trampoline(mContext),
+ mBackupThread,
+ mBaseStateDir,
+ mDataDir,
+ mTransportManager);
+ }
+
+ private RefactoredBackupManagerService createInitializedBackupManagerService() {
+ RefactoredBackupManagerService backupManagerService =
+ new RefactoredBackupManagerService(
+ mContext,
+ new Trampoline(mContext),
+ mBackupThread,
+ mBaseStateDir,
+ mDataDir,
+ mTransportManager);
+ mShadowBackupLooper.runToEndOfTasks();
+ // Handler instances have their own clock, so advancing looper (with runToEndOfTasks())
+ // above does NOT advance the handlers' clock, hence whenever a handler post messages with
+ // specific time to the looper the time of those messages will be before the looper's time.
+ // To fix this we advance SystemClock as well since that is from where the handlers read
+ // time.
+ ShadowSystemClock.setCurrentTimeMillis(mShadowBackupLooper.getScheduler().getCurrentTime());
+ return backupManagerService;
+ }
}
diff --git a/services/robotests/src/com/android/server/backup/TransportManagerTest.java b/services/robotests/src/com/android/server/backup/TransportManagerTest.java
index acd670f..cf0bc23 100644
--- a/services/robotests/src/com/android/server/backup/TransportManagerTest.java
+++ b/services/robotests/src/com/android/server/backup/TransportManagerTest.java
@@ -16,108 +16,97 @@
package com.android.server.backup;
+import static com.android.server.backup.testing.TransportData.genericTransport;
+import static com.android.server.backup.testing.TransportTestUtils.mockTransport;
+import static com.android.server.backup.testing.TransportTestUtils.setUpTransportsForTransportManager;
+
import static com.google.common.truth.Truth.assertThat;
-import static org.mockito.Mockito.mock;
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.ArgumentMatchers.eq;
+import static org.mockito.Mockito.never;
+import static org.mockito.Mockito.reset;
+import static org.mockito.Mockito.verify;
import static org.mockito.Mockito.when;
import static org.robolectric.shadow.api.Shadow.extract;
import static org.testng.Assert.expectThrows;
+import static java.util.Arrays.asList;
+import static java.util.Collections.emptyList;
+import static java.util.Collections.singletonList;
+import static java.util.stream.Collectors.toList;
+import static java.util.stream.Collectors.toSet;
+import static java.util.stream.Stream.concat;
+
import android.annotation.Nullable;
import android.content.ComponentName;
+import android.content.Context;
import android.content.Intent;
import android.content.pm.ApplicationInfo;
import android.content.pm.PackageInfo;
-import android.content.pm.ResolveInfo;
-import android.content.pm.ServiceInfo;
-import android.os.IBinder;
-import android.os.RemoteException;
import android.platform.test.annotations.Presubmit;
-import com.android.internal.backup.IBackupTransport;
-import com.android.server.backup.testing.ShadowBackupTransportStub;
import com.android.server.backup.testing.ShadowContextImplForBackup;
-import com.android.server.backup.testing.ShadowPackageManagerForBackup;
-import com.android.server.backup.testing.TransportBoundListenerStub;
+import com.android.server.testing.shadows.FrameworkShadowPackageManager;
+import com.android.server.backup.testing.TransportData;
+import com.android.server.backup.testing.TransportTestUtils.TransportMock;
+import com.android.server.backup.transport.OnTransportRegisteredListener;
import com.android.server.backup.transport.TransportClient;
+import com.android.server.backup.transport.TransportClientManager;
import com.android.server.backup.transport.TransportNotRegisteredException;
import com.android.server.testing.FrameworkRobolectricTestRunner;
import com.android.server.testing.SystemLoaderClasses;
+import com.android.server.testing.shadows.FrameworkShadowContextImpl;
import org.junit.After;
import org.junit.Before;
import org.junit.Test;
import org.junit.runner.RunWith;
+import org.mockito.Mock;
import org.mockito.MockitoAnnotations;
import org.robolectric.RuntimeEnvironment;
import org.robolectric.annotation.Config;
-import org.robolectric.shadows.ShadowLog;
-import org.robolectric.shadows.ShadowLooper;
import org.robolectric.shadows.ShadowPackageManager;
import java.util.ArrayList;
-import java.util.Arrays;
-import java.util.Collections;
-import java.util.HashSet;
import java.util.List;
+import java.util.Objects;
+import java.util.Set;
+import java.util.stream.Stream;
@RunWith(FrameworkRobolectricTestRunner.class)
@Config(
- manifest = Config.NONE,
- sdk = 26,
- shadows = {
- ShadowContextImplForBackup.class,
- ShadowBackupTransportStub.class,
- ShadowPackageManagerForBackup.class
- }
+ manifest = Config.NONE,
+ sdk = 26,
+ shadows = {FrameworkShadowPackageManager.class, FrameworkShadowContextImpl.class}
)
@SystemLoaderClasses({TransportManager.class})
@Presubmit
public class TransportManagerTest {
- private static final String PACKAGE_NAME = "some.package.name";
- private static final String ANOTHER_PACKAGE_NAME = "another.package.name";
+ private static final String PACKAGE_A = "some.package.a";
+ private static final String PACKAGE_B = "some.package.b";
- private TransportInfo mTransport1;
- private TransportInfo mTransport2;
+ @Mock private OnTransportRegisteredListener mListener;
+ @Mock private TransportClientManager mTransportClientManager;
+ private TransportData mTransportA1;
+ private TransportData mTransportA2;
+ private TransportData mTransportB1;
- private ShadowPackageManager mPackageManagerShadow;
-
- private final TransportBoundListenerStub mTransportBoundListenerStub =
- new TransportBoundListenerStub(true);
+ private ShadowPackageManager mShadowPackageManager;
+ private Context mContext;
@Before
public void setUp() throws Exception {
MockitoAnnotations.initMocks(this);
- ShadowLog.stream = System.out;
-
- mPackageManagerShadow =
- (ShadowPackageManagerForBackup)
+ mShadowPackageManager =
+ (FrameworkShadowPackageManager)
extract(RuntimeEnvironment.application.getPackageManager());
+ mContext = RuntimeEnvironment.application.getApplicationContext();
- mTransport1 = new TransportInfo(
- PACKAGE_NAME,
- "transport1.name",
- new Intent(),
- "currentDestinationString",
- new Intent(),
- "dataManagementLabel");
- mTransport2 = new TransportInfo(
- PACKAGE_NAME,
- "transport2.name",
- new Intent(),
- "currentDestinationString",
- new Intent(),
- "dataManagementLabel");
-
- ShadowContextImplForBackup.sComponentBinderMap.put(mTransport1.componentName,
- mTransport1.binder);
- ShadowContextImplForBackup.sComponentBinderMap.put(mTransport2.componentName,
- mTransport2.binder);
- ShadowBackupTransportStub.sBinderTransportMap.put(
- mTransport1.binder, mTransport1.binderInterface);
- ShadowBackupTransportStub.sBinderTransportMap.put(
- mTransport2.binder, mTransport2.binderInterface);
+ mTransportA1 = genericTransport(PACKAGE_A, "TransportFoo");
+ mTransportA2 = genericTransport(PACKAGE_A, "TransportBar");
+ mTransportB1 = genericTransport(PACKAGE_B, "TransportBaz");
}
@After
@@ -126,560 +115,441 @@
}
@Test
- public void onPackageAdded_bindsToAllTransports() throws Exception {
- setUpPackageWithTransports(PACKAGE_NAME, Arrays.asList(mTransport1, mTransport2),
- ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
-
- TransportManager transportManager = new TransportManager(
- RuntimeEnvironment.application.getApplicationContext(),
- new HashSet<>(Arrays.asList(
- mTransport1.componentName, mTransport2.componentName)),
- null /* defaultTransport */,
- mTransportBoundListenerStub,
- ShadowLooper.getMainLooper());
- transportManager.onPackageAdded(PACKAGE_NAME);
-
- assertThat(transportManager.getAllTransportComponents()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.componentName, mTransport2.componentName));
- assertThat(transportManager.getBoundTransportNames()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.name, mTransport2.name));
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport1.binderInterface))
- .isTrue();
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport2.binderInterface))
- .isTrue();
- }
-
- @Test
- public void onPackageAdded_oneTransportUnavailable_bindsToOnlyOneTransport() throws Exception {
- setUpPackageWithTransports(PACKAGE_NAME, Arrays.asList(mTransport1, mTransport2),
- ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
-
- ShadowContextImplForBackup.sUnbindableComponents.add(mTransport1.componentName);
-
- TransportManager transportManager = new TransportManager(
- RuntimeEnvironment.application.getApplicationContext(),
- new HashSet<>(Arrays.asList(
- mTransport1.componentName, mTransport2.componentName)),
- null /* defaultTransport */,
- mTransportBoundListenerStub,
- ShadowLooper.getMainLooper());
- transportManager.onPackageAdded(PACKAGE_NAME);
-
- assertThat(transportManager.getAllTransportComponents()).asList().containsExactlyElementsIn(
- Collections.singleton(mTransport2.componentName));
- assertThat(transportManager.getBoundTransportNames()).asList().containsExactlyElementsIn(
- Collections.singleton(mTransport2.name));
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport1.binderInterface))
- .isFalse();
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport2.binderInterface))
- .isTrue();
- }
-
- @Test
- public void onPackageAdded_whitelistIsNull_doesNotBindToTransports() throws Exception {
- setUpPackageWithTransports(PACKAGE_NAME, Arrays.asList(mTransport1, mTransport2),
- ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
-
- TransportManager transportManager = new TransportManager(
- RuntimeEnvironment.application.getApplicationContext(),
- null /* whitelist */,
- null /* defaultTransport */,
- mTransportBoundListenerStub,
- ShadowLooper.getMainLooper());
- transportManager.onPackageAdded(PACKAGE_NAME);
-
- assertThat(transportManager.getAllTransportComponents()).isEmpty();
- assertThat(transportManager.getBoundTransportNames()).isEmpty();
- assertThat(mTransportBoundListenerStub.isCalled()).isFalse();
- }
-
- @Test
- public void onPackageAdded_onlyOneTransportWhitelisted_onlyConnectsToWhitelistedTransport()
- throws Exception {
- setUpPackageWithTransports(PACKAGE_NAME, Arrays.asList(mTransport1, mTransport2),
- ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
-
- TransportManager transportManager = new TransportManager(
- RuntimeEnvironment.application.getApplicationContext(),
- new HashSet<>(Collections.singleton(mTransport2.componentName)),
- null /* defaultTransport */,
- mTransportBoundListenerStub,
- ShadowLooper.getMainLooper());
- transportManager.onPackageAdded(PACKAGE_NAME);
-
- assertThat(transportManager.getAllTransportComponents()).asList().containsExactlyElementsIn(
- Collections.singleton(mTransport2.componentName));
- assertThat(transportManager.getBoundTransportNames()).asList().containsExactlyElementsIn(
- Collections.singleton(mTransport2.name));
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport1.binderInterface))
- .isFalse();
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport2.binderInterface))
- .isTrue();
- }
-
- @Test
- public void onPackageAdded_appIsNotPrivileged_doesNotBindToTransports() throws Exception {
- setUpPackageWithTransports(PACKAGE_NAME, Arrays.asList(mTransport1, mTransport2), 0);
-
- TransportManager transportManager = new TransportManager(
- RuntimeEnvironment.application.getApplicationContext(),
- new HashSet<>(Arrays.asList(
- mTransport1.componentName, mTransport2.componentName)),
- null /* defaultTransport */,
- mTransportBoundListenerStub,
- ShadowLooper.getMainLooper());
- transportManager.onPackageAdded(PACKAGE_NAME);
-
- assertThat(transportManager.getAllTransportComponents()).isEmpty();
- assertThat(transportManager.getBoundTransportNames()).isEmpty();
- assertThat(mTransportBoundListenerStub.isCalled()).isFalse();
- }
-
- @Test
- public void onPackageRemoved_transportsUnbound() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- transportManager.onPackageRemoved(PACKAGE_NAME);
-
- assertThat(transportManager.getAllTransportComponents()).isEmpty();
- assertThat(transportManager.getBoundTransportNames()).isEmpty();
- }
-
- @Test
- public void onPackageRemoved_incorrectPackageName_nothingHappens() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- transportManager.onPackageRemoved(ANOTHER_PACKAGE_NAME);
-
- assertThat(transportManager.getAllTransportComponents()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.componentName, mTransport2.componentName));
- assertThat(transportManager.getBoundTransportNames()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.name, mTransport2.name));
- }
-
- @Test
- public void onPackageChanged_oneComponentChanged_onlyOneTransportRebound() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- transportManager.onPackageChanged(PACKAGE_NAME, new String[]{mTransport2.name});
-
- assertThat(transportManager.getAllTransportComponents()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.componentName, mTransport2.componentName));
- assertThat(transportManager.getBoundTransportNames()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.name, mTransport2.name));
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport1.binderInterface))
- .isFalse();
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport2.binderInterface))
- .isTrue();
- }
-
- @Test
- public void onPackageChanged_nothingChanged_noTransportsRebound() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- transportManager.onPackageChanged(PACKAGE_NAME, new String[0]);
-
- assertThat(transportManager.getAllTransportComponents()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.componentName, mTransport2.componentName));
- assertThat(transportManager.getBoundTransportNames()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.name, mTransport2.name));
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport1.binderInterface))
- .isFalse();
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport2.binderInterface))
- .isFalse();
- }
-
- @Test
- public void onPackageChanged_unexpectedComponentChanged_noTransportsRebound() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- transportManager.onPackageChanged(PACKAGE_NAME, new String[]{"unexpected.component"});
-
- assertThat(transportManager.getAllTransportComponents()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.componentName, mTransport2.componentName));
- assertThat(transportManager.getBoundTransportNames()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.name, mTransport2.name));
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport1.binderInterface))
- .isFalse();
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport2.binderInterface))
- .isFalse();
- }
-
- @Test
- public void onPackageChanged_transportsRebound() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- transportManager.onPackageChanged(PACKAGE_NAME, new String[]{mTransport2.name});
-
- assertThat(transportManager.getAllTransportComponents()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.componentName, mTransport2.componentName));
- assertThat(transportManager.getBoundTransportNames()).asList().containsExactlyElementsIn(
- Arrays.asList(mTransport1.name, mTransport2.name));
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport1.binderInterface))
- .isFalse();
- assertThat(mTransportBoundListenerStub.isCalledForTransport(mTransport2.binderInterface))
- .isTrue();
- }
-
- @Test
- public void getTransportBinder_returnsCorrectBinder() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- assertThat(transportManager.getTransportBinder(mTransport1.name)).isEqualTo(
- mTransport1.binderInterface);
- assertThat(transportManager.getTransportBinder(mTransport2.name)).isEqualTo(
- mTransport2.binderInterface);
- }
-
- @Test
- public void getTransportBinder_incorrectTransportName_returnsNull() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- assertThat(transportManager.getTransportBinder("incorrect.transport")).isNull();
- }
-
- @Test
- public void getTransportBinder_oneTransportUnavailable_returnsCorrectBinder() throws Exception {
+ public void testRegisterTransports() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpPackage(PACKAGE_B, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2, mTransportB1);
TransportManager transportManager =
- createTransportManagerAndSetUpTransports(Collections.singletonList(mTransport2),
- Collections.singletonList(mTransport1), mTransport1.name);
+ createTransportManager(mTransportA1, mTransportA2, mTransportB1);
- assertThat(transportManager.getTransportBinder(mTransport1.name)).isNull();
- assertThat(transportManager.getTransportBinder(mTransport2.name)).isEqualTo(
- mTransport2.binderInterface);
+ transportManager.registerTransports();
+
+ assertRegisteredTransports(
+ transportManager, asList(mTransportA1, mTransportA2, mTransportB1));
+
+ verify(mListener)
+ .onTransportRegistered(mTransportA1.transportName, mTransportA1.transportDirName);
+ verify(mListener)
+ .onTransportRegistered(mTransportA2.transportName, mTransportA2.transportDirName);
+ verify(mListener)
+ .onTransportRegistered(mTransportB1.transportName, mTransportB1.transportDirName);
}
@Test
- public void getCurrentTransport_selectTransportNotCalled_returnsDefaultTransport()
+ public void
+ testRegisterTransports_whenOneTransportUnavailable_doesNotRegisterUnavailableTransport()
+ throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ TransportData transport1 = mTransportA1.unavailable();
+ TransportData transport2 = mTransportA2;
+ setUpTransports(transport1, transport2);
+ TransportManager transportManager = createTransportManager(transport1, transport2);
+
+ transportManager.registerTransports();
+
+ assertRegisteredTransports(transportManager, singletonList(transport2));
+ verify(mListener, never())
+ .onTransportRegistered(transport1.transportName, transport1.transportDirName);
+ verify(mListener)
+ .onTransportRegistered(transport2.transportName, transport2.transportDirName);
+ }
+
+ @Test
+ public void testRegisterTransports_whenWhitelistIsEmpty_doesNotRegisterTransports()
throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(null);
- assertThat(transportManager.getCurrentTransportName()).isEqualTo(mTransport1.name);
+ transportManager.registerTransports();
+
+ assertRegisteredTransports(transportManager, emptyList());
+ verify(mListener, never()).onTransportRegistered(any(), any());
}
@Test
- public void getCurrentTransport_selectTransportCalled_returnsCorrectTransport()
+ public void
+ testRegisterTransports_whenOnlyOneTransportWhitelisted_onlyRegistersWhitelistedTransport()
+ throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(null, mTransportA1);
+
+ transportManager.registerTransports();
+
+ assertRegisteredTransports(transportManager, singletonList(mTransportA1));
+ verify(mListener)
+ .onTransportRegistered(mTransportA1.transportName, mTransportA1.transportDirName);
+ verify(mListener, never())
+ .onTransportRegistered(mTransportA2.transportName, mTransportA2.transportDirName);
+ }
+
+ @Test
+ public void testRegisterTransports_whenAppIsNotPrivileged_doesNotRegisterTransports()
throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- assertThat(transportManager.getCurrentTransportName()).isEqualTo(mTransport1.name);
-
- transportManager.selectTransport(mTransport2.name);
-
- assertThat(transportManager.getCurrentTransportName()).isEqualTo(mTransport2.name);
- }
-
- @Test
- public void getCurrentTransportBinder_returnsCorrectBinder() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
-
- assertThat(transportManager.getCurrentTransportBinder())
- .isEqualTo(mTransport1.binderInterface);
- }
-
- @Test
- public void getCurrentTransportBinder_transportNotBound_returnsNull() throws Exception {
+ // Note ApplicationInfo.PRIVATE_FLAG_PRIVILEGED is missing from flags
+ setUpPackage(PACKAGE_A, 0);
+ setUpTransports(mTransportA1, mTransportA2);
TransportManager transportManager =
- createTransportManagerAndSetUpTransports(Collections.singletonList(mTransport2),
- Collections.singletonList(mTransport1), mTransport2.name);
+ createTransportManager(null, mTransportA1, mTransportA2);
- transportManager.selectTransport(mTransport1.name);
+ transportManager.registerTransports();
- assertThat(transportManager.getCurrentTransportBinder()).isNull();
+ assertRegisteredTransports(transportManager, emptyList());
+ verify(mListener, never()).onTransportRegistered(any(), any());
}
@Test
- public void getTransportName_returnsCorrectTransportName() throws Exception {
- TransportManager transportManager = createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
+ public void testOnPackageAdded_registerTransports() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1);
+ TransportManager transportManager = createTransportManager(mTransportA1);
- assertThat(transportManager.getTransportName(mTransport1.binderInterface))
- .isEqualTo(mTransport1.name);
- assertThat(transportManager.getTransportName(mTransport2.binderInterface))
- .isEqualTo(mTransport2.name);
+ transportManager.onPackageAdded(PACKAGE_A);
+
+ assertRegisteredTransports(transportManager, asList(mTransportA1));
+ verify(mListener)
+ .onTransportRegistered(mTransportA1.transportName, mTransportA1.transportDirName);
}
@Test
- public void getTransportName_transportNotBound_returnsNull() throws Exception {
- TransportManager transportManager =
- createTransportManagerAndSetUpTransports(Collections.singletonList(mTransport2),
- Collections.singletonList(mTransport1), mTransport1.name);
+ public void testOnPackageRemoved_unregisterTransports() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpPackage(PACKAGE_B, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportB1);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportB1);
+ transportManager.registerTransports();
- assertThat(transportManager.getTransportName(mTransport1.binderInterface)).isNull();
- assertThat(transportManager.getTransportName(mTransport2.binderInterface))
- .isEqualTo(mTransport2.name);
+ transportManager.onPackageRemoved(PACKAGE_A);
+
+ assertRegisteredTransports(transportManager, singletonList(mTransportB1));
}
@Test
- public void getTransportWhitelist_returnsCorrectWhiteList() throws Exception {
- TransportManager transportManager = new TransportManager(
- RuntimeEnvironment.application.getApplicationContext(),
- new HashSet<>(Arrays.asList(mTransport1.componentName, mTransport2.componentName)),
- mTransport1.name,
- mTransportBoundListenerStub,
- ShadowLooper.getMainLooper());
+ public void testOnPackageRemoved_whenUnknownPackage_nothingHappens() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1);
+ TransportManager transportManager = createTransportManager(mTransportA1);
+ transportManager.registerTransports();
- assertThat(transportManager.getTransportWhitelist()).containsExactlyElementsIn(
- Arrays.asList(mTransport1.componentName, mTransport2.componentName));
+ transportManager.onPackageRemoved(PACKAGE_A + "unknown");
+
+ assertRegisteredTransports(transportManager, singletonList(mTransportA1));
}
@Test
- public void getTransportWhitelist_whiteListIsNull_returnsEmptyArray() throws Exception {
- TransportManager transportManager = new TransportManager(
- RuntimeEnvironment.application.getApplicationContext(),
- null /* whitelist */,
- mTransport1.name,
- mTransportBoundListenerStub,
- ShadowLooper.getMainLooper());
-
- assertThat(transportManager.getTransportWhitelist()).isEmpty();
- }
-
- @Test
- public void selectTransport_setsTransportCorrectlyAndReturnsPreviousTransport()
+ public void testOnPackageChanged_whenOneComponentChanged_onlyOneTransportReRegistered()
throws Exception {
- TransportManager transportManager = new TransportManager(
- RuntimeEnvironment.application.getApplicationContext(),
- null /* whitelist */,
- mTransport1.name,
- mTransportBoundListenerStub,
- ShadowLooper.getMainLooper());
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+ transportManager.registerTransports();
+ // Reset listener to verify calls after registerTransports() above
+ reset(mListener);
- assertThat(transportManager.selectTransport(mTransport2.name)).isEqualTo(mTransport1.name);
- assertThat(transportManager.selectTransport(mTransport1.name)).isEqualTo(mTransport2.name);
+ transportManager.onPackageChanged(
+ PACKAGE_A, mTransportA1.getTransportComponent().getClassName());
+
+ assertRegisteredTransports(transportManager, asList(mTransportA1, mTransportA2));
+ verify(mListener)
+ .onTransportRegistered(mTransportA1.transportName, mTransportA1.transportDirName);
+ verify(mListener, never())
+ .onTransportRegistered(mTransportA2.transportName, mTransportA2.transportDirName);
}
@Test
- public void getTransportClient_forRegisteredTransport_returnCorrectly() throws Exception {
+ public void testOnPackageChanged_whenNoComponentsChanged_doesNotRegisterTransports()
+ throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1);
+ TransportManager transportManager = createTransportManager(mTransportA1);
+ transportManager.registerTransports();
+ reset(mListener);
+
+ transportManager.onPackageChanged(PACKAGE_A);
+
+ assertRegisteredTransports(transportManager, singletonList(mTransportA1));
+ verify(mListener, never()).onTransportRegistered(any(), any());
+ }
+
+ @Test
+ public void testOnPackageChanged_whenUnknownComponentChanged_noTransportsRegistered()
+ throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1);
+ TransportManager transportManager = createTransportManager(mTransportA1);
+ transportManager.registerTransports();
+ reset(mListener);
+
+ transportManager.onPackageChanged(PACKAGE_A, PACKAGE_A + ".UnknownComponent");
+
+ assertRegisteredTransports(transportManager, singletonList(mTransportA1));
+ verify(mListener, never()).onTransportRegistered(any(), any());
+ }
+
+ @Test
+ public void testOnPackageChanged_reRegisterTransports() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+ transportManager.registerTransports();
+ reset(mListener);
+
+ transportManager.onPackageChanged(
+ PACKAGE_A,
+ mTransportA1.getTransportComponent().getClassName(),
+ mTransportA2.getTransportComponent().getClassName());
+
+ assertRegisteredTransports(transportManager, asList(mTransportA1, mTransportA2));
+ verify(mListener)
+ .onTransportRegistered(mTransportA1.transportName, mTransportA1.transportDirName);
+ verify(mListener)
+ .onTransportRegistered(mTransportA2.transportName, mTransportA2.transportDirName);
+ }
+
+ @Test
+ public void testGetCurrentTransportName_whenSelectTransportNotCalled_returnsDefaultTransport()
+ throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+ transportManager.registerTransports();
+
+ String currentTransportName = transportManager.getCurrentTransportName();
+
+ assertThat(currentTransportName).isEqualTo(mTransportA1.transportName);
+ }
+
+ @Test
+ public void testGetCurrentTransport_whenSelectTransportCalled_returnsSelectedTransport()
+ throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+ transportManager.registerTransports();
+ transportManager.selectTransport(mTransportA2.transportName);
+
+ String currentTransportName = transportManager.getCurrentTransportName();
+
+ assertThat(currentTransportName).isEqualTo(mTransportA2.transportName);
+ }
+
+ @Test
+ public void testGetTransportWhitelist() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+
+ Set<ComponentName> transportWhitelist = transportManager.getTransportWhitelist();
+
+ assertThat(transportWhitelist)
+ .containsExactlyElementsIn(
+ asList(
+ mTransportA1.getTransportComponent(),
+ mTransportA2.getTransportComponent()));
+ }
+
+ @Test
+ public void testSelectTransport() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
TransportManager transportManager =
- createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
+ createTransportManager(null, mTransportA1, mTransportA2);
+
+ String transport1 = transportManager.selectTransport(mTransportA1.transportName);
+ String transport2 = transportManager.selectTransport(mTransportA2.transportName);
+
+ assertThat(transport1).isNull();
+ assertThat(transport2).isEqualTo(mTransportA1.transportName);
+ }
+
+ @Test
+ public void testGetTransportClient_forRegisteredTransport() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+ transportManager.registerTransports();
TransportClient transportClient =
- transportManager.getTransportClient(mTransport1.name, "caller");
+ transportManager.getTransportClient(mTransportA1.transportName, "caller");
- assertThat(transportClient.getTransportComponent()).isEqualTo(mTransport1.componentName);
+ assertThat(transportClient.getTransportComponent())
+ .isEqualTo(mTransportA1.getTransportComponent());
}
@Test
- public void getTransportClient_forOldNameOfTransportThatChangedName_returnsNull()
+ public void testGetTransportClient_forOldNameOfTransportThatChangedName_returnsNull()
throws Exception {
- TransportManager transportManager =
- createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+ transportManager.registerTransports();
transportManager.updateTransportAttributes(
- mTransport1.componentName, "newName", null, "destinationString", null, null);
+ mTransportA1.getTransportComponent(),
+ "newName",
+ null,
+ "destinationString",
+ null,
+ null);
TransportClient transportClient =
- transportManager.getTransportClient(mTransport1.name, "caller");
+ transportManager.getTransportClient(mTransportA1.transportName, "caller");
assertThat(transportClient).isNull();
}
@Test
- public void getTransportClient_forNewNameOfTransportThatChangedName_returnsCorrectly()
+ public void testGetTransportClient_forNewNameOfTransportThatChangedName_returnsCorrectly()
throws Exception {
- TransportManager transportManager =
- createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+ transportManager.registerTransports();
transportManager.updateTransportAttributes(
- mTransport1.componentName, "newName", null, "destinationString", null, null);
+ mTransportA1.getTransportComponent(),
+ "newName",
+ null,
+ "destinationString",
+ null,
+ null);
- TransportClient transportClient =
- transportManager.getTransportClient("newName", "caller");
+ TransportClient transportClient = transportManager.getTransportClient("newName", "caller");
- assertThat(transportClient.getTransportComponent()).isEqualTo(mTransport1.componentName);
+ assertThat(transportClient.getTransportComponent())
+ .isEqualTo(mTransportA1.getTransportComponent());
}
@Test
- public void getTransportName_forTransportThatChangedName_returnsNewName()
- throws Exception {
- TransportManager transportManager =
- createTransportManagerAndSetUpTransports(
- Arrays.asList(mTransport1, mTransport2), mTransport1.name);
+ public void testGetTransportName_forTransportThatChangedName_returnsNewName() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1, mTransportA2);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+ transportManager.registerTransports();
transportManager.updateTransportAttributes(
- mTransport1.componentName, "newName", null, "destinationString", null, null);
+ mTransportA1.getTransportComponent(),
+ "newName",
+ null,
+ "destinationString",
+ null,
+ null);
- String transportName = transportManager.getTransportName(mTransport1.componentName);
+ String transportName =
+ transportManager.getTransportName(mTransportA1.getTransportComponent());
assertThat(transportName).isEqualTo("newName");
}
@Test
- public void isTransportRegistered_returnsCorrectly() throws Exception {
- TransportManager transportManager =
- createTransportManagerAndSetUpTransports(
- Collections.singletonList(mTransport1),
- Collections.singletonList(mTransport2),
- mTransport1.name);
+ public void testIsTransportRegistered() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1);
+ TransportManager transportManager = createTransportManager(mTransportA1, mTransportA2);
+ transportManager.registerTransports();
- assertThat(transportManager.isTransportRegistered(mTransport1.name)).isTrue();
- assertThat(transportManager.isTransportRegistered(mTransport2.name)).isFalse();
+ boolean isTransportA1Registered =
+ transportManager.isTransportRegistered(mTransportA1.transportName);
+ boolean isTransportA2Registered =
+ transportManager.isTransportRegistered(mTransportA2.transportName);
+
+ assertThat(isTransportA1Registered).isTrue();
+ assertThat(isTransportA2Registered).isFalse();
}
@Test
- public void getTransportAttributes_forRegisteredTransport_returnsCorrectValues()
+ public void testGetTransportAttributes_forRegisteredTransport_returnsCorrectValues()
throws Exception {
- TransportManager transportManager =
- createTransportManagerAndSetUpTransports(
- Collections.singletonList(mTransport1),
- mTransport1.name);
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1);
+ TransportManager transportManager = createTransportManager(mTransportA1);
+ transportManager.registerTransports();
- assertThat(transportManager.getTransportConfigurationIntent(mTransport1.name))
- .isEqualTo(mTransport1.binderInterface.configurationIntent());
- assertThat(transportManager.getTransportDataManagementIntent(mTransport1.name))
- .isEqualTo(mTransport1.binderInterface.dataManagementIntent());
- assertThat(transportManager.getTransportDataManagementLabel(mTransport1.name))
- .isEqualTo(mTransport1.binderInterface.dataManagementLabel());
- assertThat(transportManager.getTransportDirName(mTransport1.name))
- .isEqualTo(mTransport1.binderInterface.transportDirName());
+ Intent configurationIntent =
+ transportManager.getTransportConfigurationIntent(mTransportA1.transportName);
+ Intent dataManagementIntent =
+ transportManager.getTransportDataManagementIntent(mTransportA1.transportName);
+ String dataManagementLabel =
+ transportManager.getTransportDataManagementLabel(mTransportA1.transportName);
+ String transportDirName = transportManager.getTransportDirName(mTransportA1.transportName);
+
+ assertThat(configurationIntent).isEqualTo(mTransportA1.configurationIntent);
+ assertThat(dataManagementIntent).isEqualTo(mTransportA1.dataManagementIntent);
+ assertThat(dataManagementLabel).isEqualTo(mTransportA1.dataManagementLabel);
+ assertThat(transportDirName).isEqualTo(mTransportA1.transportDirName);
}
@Test
- public void getTransportAttributes_forUnregisteredTransport_throws()
- throws Exception {
- TransportManager transportManager =
- createTransportManagerAndSetUpTransports(
- Collections.singletonList(mTransport1),
- Collections.singletonList(mTransport2),
- mTransport1.name);
+ public void testGetTransportAttributes_forUnregisteredTransport_throws() throws Exception {
+ setUpPackage(PACKAGE_A, ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
+ setUpTransports(mTransportA1);
+ TransportManager transportManager = createTransportManager(mTransportA1);
+ transportManager.registerTransports();
expectThrows(
TransportNotRegisteredException.class,
- () -> transportManager.getTransportConfigurationIntent(mTransport2.name));
+ () -> transportManager.getTransportConfigurationIntent(mTransportA2.transportName));
expectThrows(
TransportNotRegisteredException.class,
- () -> transportManager.getTransportDataManagementIntent(
- mTransport2.name));
+ () ->
+ transportManager.getTransportDataManagementIntent(
+ mTransportA2.transportName));
expectThrows(
TransportNotRegisteredException.class,
- () -> transportManager.getTransportDataManagementLabel(mTransport2.name));
+ () -> transportManager.getTransportDataManagementLabel(mTransportA2.transportName));
expectThrows(
TransportNotRegisteredException.class,
- () -> transportManager.getTransportDirName(mTransport2.name));
+ () -> transportManager.getTransportDirName(mTransportA2.transportName));
}
- private void setUpPackageWithTransports(String packageName, List<TransportInfo> transports,
- int flags) throws Exception {
+ private List<TransportMock> setUpTransports(TransportData... transports) throws Exception {
+ setUpTransportsForTransportManager(mShadowPackageManager, transports);
+ List<TransportMock> transportMocks = new ArrayList<>(transports.length);
+ for (TransportData transport : transports) {
+ TransportMock transportMock = mockTransport(transport);
+ when(mTransportClientManager.getTransportClient(
+ eq(transport.getTransportComponent()), any()))
+ .thenReturn(transportMock.transportClient);
+ transportMocks.add(transportMock);
+ }
+ return transportMocks;
+ }
+
+ private void setUpPackage(String packageName, int flags) {
PackageInfo packageInfo = new PackageInfo();
packageInfo.packageName = packageName;
packageInfo.applicationInfo = new ApplicationInfo();
packageInfo.applicationInfo.privateFlags = flags;
-
- mPackageManagerShadow.addPackage(packageInfo);
-
- List<ResolveInfo> transportsInfo = new ArrayList<>();
- for (TransportInfo transport : transports) {
- ResolveInfo info = new ResolveInfo();
- info.serviceInfo = new ServiceInfo();
- info.serviceInfo.packageName = packageName;
- info.serviceInfo.name = transport.name;
- transportsInfo.add(info);
- }
-
- Intent intent = new Intent(TransportManager.SERVICE_ACTION_TRANSPORT_HOST);
- intent.setPackage(packageName);
-
- mPackageManagerShadow.addResolveInfoForIntent(intent, transportsInfo);
+ mShadowPackageManager.addPackage(packageInfo);
}
- private TransportManager createTransportManagerAndSetUpTransports(
- List<TransportInfo> availableTransports, String defaultTransportName) throws Exception {
- return createTransportManagerAndSetUpTransports(availableTransports,
- Collections.<TransportInfo>emptyList(), defaultTransportName);
- }
-
- private TransportManager createTransportManagerAndSetUpTransports(
- List<TransportInfo> availableTransports, List<TransportInfo> unavailableTransports,
- String defaultTransportName)
- throws Exception {
- List<String> availableTransportsNames = new ArrayList<>();
- List<ComponentName> availableTransportsComponentNames = new ArrayList<>();
- for (TransportInfo transport : availableTransports) {
- availableTransportsNames.add(transport.name);
- availableTransportsComponentNames.add(transport.componentName);
- }
-
- List<ComponentName> allTransportsComponentNames = new ArrayList<>();
- allTransportsComponentNames.addAll(availableTransportsComponentNames);
- for (TransportInfo transport : unavailableTransports) {
- allTransportsComponentNames.add(transport.componentName);
- }
-
- for (TransportInfo transport : unavailableTransports) {
- ShadowContextImplForBackup.sUnbindableComponents.add(transport.componentName);
- }
-
- setUpPackageWithTransports(PACKAGE_NAME, Arrays.asList(mTransport1, mTransport2),
- ApplicationInfo.PRIVATE_FLAG_PRIVILEGED);
-
- TransportManager transportManager = new TransportManager(
- RuntimeEnvironment.application.getApplicationContext(),
- new HashSet<>(allTransportsComponentNames),
- defaultTransportName,
- mTransportBoundListenerStub,
- ShadowLooper.getMainLooper());
- transportManager.onPackageAdded(PACKAGE_NAME);
-
- assertThat(transportManager.getAllTransportComponents()).asList().containsExactlyElementsIn(
- availableTransportsComponentNames);
- assertThat(transportManager.getBoundTransportNames()).asList().containsExactlyElementsIn(
- availableTransportsNames);
- for (TransportInfo transport : availableTransports) {
- assertThat(mTransportBoundListenerStub.isCalledForTransport(transport.binderInterface))
- .isTrue();
- }
- for (TransportInfo transport : unavailableTransports) {
- assertThat(mTransportBoundListenerStub.isCalledForTransport(transport.binderInterface))
- .isFalse();
- }
-
- mTransportBoundListenerStub.resetState();
-
+ private TransportManager createTransportManager(
+ @Nullable TransportData selectedTransport, TransportData... transports) {
+ Set<ComponentName> whitelist =
+ concat(Stream.of(selectedTransport), Stream.of(transports))
+ .filter(Objects::nonNull)
+ .map(TransportData::getTransportComponent)
+ .collect(toSet());
+ TransportManager transportManager =
+ new TransportManager(
+ mContext,
+ whitelist,
+ selectedTransport != null ? selectedTransport.transportName : null,
+ mTransportClientManager);
+ transportManager.setOnTransportRegisteredListener(mListener);
return transportManager;
}
- private static class TransportInfo {
- public final String packageName;
- public final String name;
- public final ComponentName componentName;
- public final IBackupTransport binderInterface;
- public final IBinder binder;
-
- TransportInfo(
- String packageName,
- String name,
- @Nullable Intent configurationIntent,
- String currentDestinationString,
- @Nullable Intent dataManagementIntent,
- String dataManagementLabel) {
- this.packageName = packageName;
- this.name = name;
- this.componentName = new ComponentName(packageName, name);
- this.binder = mock(IBinder.class);
- IBackupTransport transport = mock(IBackupTransport.class);
- try {
- when(transport.name()).thenReturn(name);
- when(transport.configurationIntent()).thenReturn(configurationIntent);
- when(transport.currentDestinationString()).thenReturn(currentDestinationString);
- when(transport.dataManagementIntent()).thenReturn(dataManagementIntent);
- when(transport.dataManagementLabel()).thenReturn(dataManagementLabel);
- } catch (RemoteException e) {
- // Only here to mock methods that throw RemoteException
- }
- this.binderInterface = transport;
- }
+ private void assertRegisteredTransports(
+ TransportManager transportManager, List<TransportData> transports) {
+ assertThat(transportManager.getRegisteredTransportComponents())
+ .asList()
+ .containsExactlyElementsIn(
+ transports
+ .stream()
+ .map(TransportData::getTransportComponent)
+ .collect(toList()));
+ assertThat(transportManager.getRegisteredTransportNames())
+ .asList()
+ .containsExactlyElementsIn(
+ transports.stream().map(t -> t.transportName).collect(toList()));
}
-
}
diff --git a/services/robotests/src/com/android/server/backup/internal/PerformInitializeTaskTest.java b/services/robotests/src/com/android/server/backup/internal/PerformInitializeTaskTest.java
index dfca901..ace0441 100644
--- a/services/robotests/src/com/android/server/backup/internal/PerformInitializeTaskTest.java
+++ b/services/robotests/src/com/android/server/backup/internal/PerformInitializeTaskTest.java
@@ -19,8 +19,10 @@
import static android.app.backup.BackupTransport.TRANSPORT_ERROR;
import static android.app.backup.BackupTransport.TRANSPORT_OK;
-import static com.android.server.backup.testing.TransportTestUtils.TRANSPORT_NAME;
-import static com.android.server.backup.testing.TransportTestUtils.TRANSPORT_NAMES;
+import static com.android.server.backup.testing.TransportData.backupTransport;
+import static com.android.server.backup.testing.TransportData.d2dTransport;
+import static com.android.server.backup.testing.TransportData.localTransport;
+import static com.android.server.backup.testing.TransportTestUtils.setUpTransports;
import static com.google.common.truth.Truth.assertThat;
@@ -28,7 +30,6 @@
import static org.mockito.ArgumentMatchers.anyInt;
import static org.mockito.ArgumentMatchers.anyLong;
import static org.mockito.ArgumentMatchers.eq;
-import static org.mockito.Mockito.mock;
import static org.mockito.Mockito.never;
import static org.mockito.Mockito.verify;
import static org.mockito.Mockito.when;
@@ -44,7 +45,8 @@
import com.android.server.backup.RefactoredBackupManagerService;
import com.android.server.backup.TransportManager;
import com.android.server.backup.testing.TransportTestUtils;
-import com.android.server.backup.testing.TransportTestUtils.TransportData;
+import com.android.server.backup.testing.TransportData;
+import com.android.server.backup.testing.TransportTestUtils.TransportMock;
import com.android.server.backup.transport.TransportClient;
import com.android.server.testing.FrameworkRobolectricTestRunner;
import com.android.server.testing.SystemLoaderClasses;
@@ -58,7 +60,10 @@
import org.robolectric.annotation.Config;
import java.io.File;
+import java.util.Arrays;
+import java.util.Iterator;
import java.util.List;
+import java.util.stream.Stream;
@RunWith(FrameworkRobolectricTestRunner.class)
@Config(manifest = Config.NONE, sdk = 26)
@@ -68,16 +73,21 @@
@Mock private RefactoredBackupManagerService mBackupManagerService;
@Mock private TransportManager mTransportManager;
@Mock private OnTaskFinishedListener mListener;
- @Mock private IBackupTransport mTransport;
+ @Mock private IBackupTransport mTransportBinder;
@Mock private IBackupObserver mObserver;
@Mock private AlarmManager mAlarmManager;
@Mock private PendingIntent mRunInitIntent;
private File mBaseStateDir;
+ private TransportData mTransport;
+ private String mTransportName;
@Before
public void setUp() throws Exception {
MockitoAnnotations.initMocks(this);
+ mTransport = backupTransport();
+ mTransportName = mTransport.transportName;
+
Application context = RuntimeEnvironment.application;
mBaseStateDir = new File(context.getCacheDir(), "base_state_dir");
assertThat(mBaseStateDir.mkdir()).isTrue();
@@ -88,82 +98,76 @@
@Test
public void testRun_callsTransportCorrectly() throws Exception {
- setUpTransport(TRANSPORT_NAME);
- configureTransport(mTransport, TRANSPORT_OK, TRANSPORT_OK);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransport(mTransport);
+ configureTransport(mTransportBinder, TRANSPORT_OK, TRANSPORT_OK);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
- verify(mTransport).initializeDevice();
- verify(mTransport).finishBackup();
+ verify(mTransportBinder).initializeDevice();
+ verify(mTransportBinder).finishBackup();
}
@Test
public void testRun_callsBackupManagerCorrectly() throws Exception {
- setUpTransport(TRANSPORT_NAME);
- configureTransport(mTransport, TRANSPORT_OK, TRANSPORT_OK);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransport(mTransport);
+ configureTransport(mTransportBinder, TRANSPORT_OK, TRANSPORT_OK);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
verify(mBackupManagerService)
- .recordInitPending(
- false, TRANSPORT_NAME, TransportTestUtils.transportDirName(TRANSPORT_NAME));
+ .recordInitPending(false, mTransportName, mTransport.transportDirName);
verify(mBackupManagerService)
- .resetBackupState(
- eq(
- new File(
- mBaseStateDir,
- TransportTestUtils.transportDirName(TRANSPORT_NAME))));
+ .resetBackupState(eq(new File(mBaseStateDir, mTransport.transportDirName)));
}
@Test
public void testRun_callsObserverAndListenerCorrectly() throws Exception {
- setUpTransport(TRANSPORT_NAME);
- configureTransport(mTransport, TRANSPORT_OK, TRANSPORT_OK);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransport(mTransport);
+ configureTransport(mTransportBinder, TRANSPORT_OK, TRANSPORT_OK);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
- verify(mObserver).onResult(eq(TRANSPORT_NAME), eq(TRANSPORT_OK));
+ verify(mObserver).onResult(eq(mTransportName), eq(TRANSPORT_OK));
verify(mObserver).backupFinished(eq(TRANSPORT_OK));
verify(mListener).onFinished(any());
}
@Test
public void testRun_whenInitializeDeviceFails() throws Exception {
- setUpTransport(TRANSPORT_NAME);
- configureTransport(mTransport, TRANSPORT_ERROR, 0);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransport(mTransport);
+ configureTransport(mTransportBinder, TRANSPORT_ERROR, 0);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
- verify(mTransport).initializeDevice();
- verify(mTransport, never()).finishBackup();
+ verify(mTransportBinder).initializeDevice();
+ verify(mTransportBinder, never()).finishBackup();
verify(mBackupManagerService)
- .recordInitPending(
- true, TRANSPORT_NAME, TransportTestUtils.transportDirName(TRANSPORT_NAME));
+ .recordInitPending(true, mTransportName, mTransport.transportDirName);
}
@Test
public void testRun_whenInitializeDeviceFails_callsObserverAndListenerCorrectly()
throws Exception {
- setUpTransport(TRANSPORT_NAME);
- configureTransport(mTransport, TRANSPORT_ERROR, 0);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransport(mTransport);
+ configureTransport(mTransportBinder, TRANSPORT_ERROR, 0);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
- verify(mObserver).onResult(eq(TRANSPORT_NAME), eq(TRANSPORT_ERROR));
+ verify(mObserver).onResult(eq(mTransportName), eq(TRANSPORT_ERROR));
verify(mObserver).backupFinished(eq(TRANSPORT_ERROR));
verify(mListener).onFinished(any());
}
@Test
public void testRun_whenInitializeDeviceFails_schedulesAlarm() throws Exception {
- setUpTransport(TRANSPORT_NAME);
- configureTransport(mTransport, TRANSPORT_ERROR, 0);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransport(mTransport);
+ configureTransport(mTransportBinder, TRANSPORT_ERROR, 0);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
@@ -172,37 +176,36 @@
@Test
public void testRun_whenFinishBackupFails() throws Exception {
- setUpTransport(TRANSPORT_NAME);
- configureTransport(mTransport, TRANSPORT_OK, TRANSPORT_ERROR);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransport(mTransport);
+ configureTransport(mTransportBinder, TRANSPORT_OK, TRANSPORT_ERROR);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
- verify(mTransport).initializeDevice();
- verify(mTransport).finishBackup();
+ verify(mTransportBinder).initializeDevice();
+ verify(mTransportBinder).finishBackup();
verify(mBackupManagerService)
- .recordInitPending(
- true, TRANSPORT_NAME, TransportTestUtils.transportDirName(TRANSPORT_NAME));
+ .recordInitPending(true, mTransportName, mTransport.transportDirName);
}
@Test
public void testRun_whenFinishBackupFails_callsObserverAndListenerCorrectly() throws Exception {
- setUpTransport(TRANSPORT_NAME);
- configureTransport(mTransport, TRANSPORT_OK, TRANSPORT_ERROR);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransport(mTransport);
+ configureTransport(mTransportBinder, TRANSPORT_OK, TRANSPORT_ERROR);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
- verify(mObserver).onResult(eq(TRANSPORT_NAME), eq(TRANSPORT_ERROR));
+ verify(mObserver).onResult(eq(mTransportName), eq(TRANSPORT_ERROR));
verify(mObserver).backupFinished(eq(TRANSPORT_ERROR));
verify(mListener).onFinished(any());
}
@Test
public void testRun_whenFinishBackupFails_schedulesAlarm() throws Exception {
- setUpTransport(TRANSPORT_NAME);
- configureTransport(mTransport, TRANSPORT_OK, TRANSPORT_ERROR);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransport(mTransport);
+ configureTransport(mTransportBinder, TRANSPORT_OK, TRANSPORT_ERROR);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
@@ -211,64 +214,76 @@
@Test
public void testRun_whenOnlyOneTransportFails() throws Exception {
- List<TransportData> transports =
- TransportTestUtils.setUpTransports(
- mTransportManager, TRANSPORT_NAMES[0], TRANSPORT_NAMES[1]);
- configureTransport(transports.get(0).transportMock, TRANSPORT_ERROR, 0);
- configureTransport(transports.get(1).transportMock, TRANSPORT_OK, TRANSPORT_OK);
+ TransportData transport1 = backupTransport();
+ TransportData transport2 = d2dTransport();
+ List<TransportMock> transportMocks =
+ setUpTransports(mTransportManager, transport1, transport2);
+ configureTransport(transportMocks.get(0).transport, TRANSPORT_ERROR, 0);
+ configureTransport(transportMocks.get(1).transport, TRANSPORT_OK, TRANSPORT_OK);
PerformInitializeTask performInitializeTask =
- createPerformInitializeTask(TRANSPORT_NAMES[0], TRANSPORT_NAMES[1]);
+ createPerformInitializeTask(transport1.transportName, transport2.transportName);
performInitializeTask.run();
- verify(transports.get(1).transportMock).initializeDevice();
- verify(mObserver).onResult(eq(TRANSPORT_NAMES[0]), eq(TRANSPORT_ERROR));
- verify(mObserver).onResult(eq(TRANSPORT_NAMES[1]), eq(TRANSPORT_OK));
+ verify(transportMocks.get(1).transport).initializeDevice();
+ verify(mObserver).onResult(eq(transport1.transportName), eq(TRANSPORT_ERROR));
+ verify(mObserver).onResult(eq(transport2.transportName), eq(TRANSPORT_OK));
verify(mObserver).backupFinished(eq(TRANSPORT_ERROR));
}
@Test
public void testRun_withMultipleTransports() throws Exception {
- List<TransportData> transports =
- TransportTestUtils.setUpTransports(mTransportManager, TRANSPORT_NAMES);
- configureTransport(transports.get(0).transportMock, TRANSPORT_OK, TRANSPORT_OK);
- configureTransport(transports.get(1).transportMock, TRANSPORT_OK, TRANSPORT_OK);
- configureTransport(transports.get(2).transportMock, TRANSPORT_OK, TRANSPORT_OK);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAMES);
+ List<TransportMock> transportMocks =
+ setUpTransports(
+ mTransportManager, backupTransport(), d2dTransport(), localTransport());
+ configureTransport(transportMocks.get(0).transport, TRANSPORT_OK, TRANSPORT_OK);
+ configureTransport(transportMocks.get(1).transport, TRANSPORT_OK, TRANSPORT_OK);
+ configureTransport(transportMocks.get(2).transport, TRANSPORT_OK, TRANSPORT_OK);
+ String[] transportNames =
+ Stream.of(new TransportData[] {backupTransport(), d2dTransport(), localTransport()})
+ .map(t -> t.transportName)
+ .toArray(String[]::new);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(transportNames);
performInitializeTask.run();
- for (TransportData transport : transports) {
+ Iterator<TransportData> transportsIterator =
+ Arrays.asList(
+ new TransportData[] {
+ backupTransport(), d2dTransport(), localTransport()
+ })
+ .iterator();
+ for (TransportMock transportMock : transportMocks) {
+ TransportData transport = transportsIterator.next();
verify(mTransportManager).getTransportClient(eq(transport.transportName), any());
verify(mTransportManager)
- .disposeOfTransportClient(eq(transport.transportClientMock), any());
+ .disposeOfTransportClient(eq(transportMock.transportClient), any());
}
}
@Test
public void testRun_whenOnlyOneTransportFails_disposesAllTransports() throws Exception {
- List<TransportData> transports =
- TransportTestUtils.setUpTransports(
- mTransportManager, TRANSPORT_NAMES[0], TRANSPORT_NAMES[1]);
- configureTransport(transports.get(0).transportMock, TRANSPORT_ERROR, 0);
- configureTransport(transports.get(1).transportMock, TRANSPORT_OK, TRANSPORT_OK);
+ TransportData transport1 = backupTransport();
+ TransportData transport2 = d2dTransport();
+ List<TransportMock> transportMocks =
+ setUpTransports(mTransportManager, transport1, transport2);
+ configureTransport(transportMocks.get(0).transport, TRANSPORT_ERROR, 0);
+ configureTransport(transportMocks.get(1).transport, TRANSPORT_OK, TRANSPORT_OK);
PerformInitializeTask performInitializeTask =
- createPerformInitializeTask(TRANSPORT_NAMES[0], TRANSPORT_NAMES[1]);
+ createPerformInitializeTask(transport1.transportName, transport2.transportName);
performInitializeTask.run();
verify(mTransportManager)
- .disposeOfTransportClient(eq(transports.get(0).transportClientMock), any());
+ .disposeOfTransportClient(eq(transportMocks.get(0).transportClient), any());
verify(mTransportManager)
- .disposeOfTransportClient(eq(transports.get(1).transportClientMock), any());
+ .disposeOfTransportClient(eq(transportMocks.get(1).transportClient), any());
}
@Test
public void testRun_whenTransportNotRegistered() throws Exception {
- TransportTestUtils.setUpTransports(
- mTransportManager, new TransportData(TRANSPORT_NAME, null, null));
-
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ setUpTransports(mTransportManager, mTransport.unregistered());
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
@@ -279,16 +294,15 @@
@Test
public void testRun_whenOnlyOneTransportNotRegistered() throws Exception {
- List<TransportData> transports =
- TransportTestUtils.setUpTransports(
- mTransportManager,
- new TransportData(TRANSPORT_NAMES[0], null, null),
- new TransportData(TRANSPORT_NAMES[1]));
- String registeredTransportName = transports.get(1).transportName;
- IBackupTransport registeredTransport = transports.get(1).transportMock;
- TransportClient registeredTransportClient = transports.get(1).transportClientMock;
+ TransportData transport1 = backupTransport().unregistered();
+ TransportData transport2 = d2dTransport();
+ List<TransportMock> transportMocks =
+ setUpTransports(mTransportManager, transport1, transport2);
+ String registeredTransportName = transport2.transportName;
+ IBackupTransport registeredTransport = transportMocks.get(1).transport;
+ TransportClient registeredTransportClient = transportMocks.get(1).transportClient;
PerformInitializeTask performInitializeTask =
- createPerformInitializeTask(TRANSPORT_NAMES[0], TRANSPORT_NAMES[1]);
+ createPerformInitializeTask(transport1.transportName, transport2.transportName);
performInitializeTask.run();
@@ -299,25 +313,24 @@
@Test
public void testRun_whenTransportNotAvailable() throws Exception {
- TransportClient transportClient = mock(TransportClient.class);
- TransportTestUtils.setUpTransports(
- mTransportManager, new TransportData(TRANSPORT_NAME, null, transportClient));
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ TransportMock transportMock = setUpTransport(mTransport.unavailable());
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
- verify(mTransportManager).disposeOfTransportClient(eq(transportClient), any());
+ verify(mTransportManager)
+ .disposeOfTransportClient(eq(transportMock.transportClient), any());
verify(mObserver).backupFinished(eq(TRANSPORT_ERROR));
verify(mListener).onFinished(any());
}
@Test
public void testRun_whenTransportThrowsDeadObjectException() throws Exception {
- TransportClient transportClient = mock(TransportClient.class);
- TransportTestUtils.setUpTransports(
- mTransportManager, new TransportData(TRANSPORT_NAME, mTransport, transportClient));
- when(mTransport.initializeDevice()).thenThrow(DeadObjectException.class);
- PerformInitializeTask performInitializeTask = createPerformInitializeTask(TRANSPORT_NAME);
+ TransportMock transportMock = setUpTransport(mTransport);
+ IBackupTransport transport = transportMock.transport;
+ TransportClient transportClient = transportMock.transportClient;
+ when(transport.initializeDevice()).thenThrow(DeadObjectException.class);
+ PerformInitializeTask performInitializeTask = createPerformInitializeTask(mTransportName);
performInitializeTask.run();
@@ -343,9 +356,10 @@
when(transportMock.finishBackup()).thenReturn(finishBackupStatus);
}
- private void setUpTransport(String transportName) throws Exception {
- TransportTestUtils.setUpTransport(
- mTransportManager,
- new TransportData(transportName, mTransport, mock(TransportClient.class)));
+ private TransportMock setUpTransport(TransportData transport) throws Exception {
+ TransportMock transportMock =
+ TransportTestUtils.setUpTransport(mTransportManager, transport);
+ mTransportBinder = transportMock.transport;
+ return transportMock;
}
}
diff --git a/services/robotests/src/com/android/server/backup/testing/ShadowBackupPolicyEnforcer.java b/services/robotests/src/com/android/server/backup/testing/ShadowBackupPolicyEnforcer.java
new file mode 100644
index 0000000..88b30da
--- /dev/null
+++ b/services/robotests/src/com/android/server/backup/testing/ShadowBackupPolicyEnforcer.java
@@ -0,0 +1,24 @@
+package com.android.server.backup.testing;
+
+import android.content.ComponentName;
+
+import com.android.server.backup.BackupPolicyEnforcer;
+import com.android.server.backup.RefactoredBackupManagerService;
+
+import org.robolectric.annotation.Implementation;
+import org.robolectric.annotation.Implements;
+
+@Implements(BackupPolicyEnforcer.class)
+public class ShadowBackupPolicyEnforcer {
+
+ private static ComponentName sMandatoryBackupTransport;
+
+ public static void setMandatoryBackupTransport(ComponentName backupTransportComponent) {
+ sMandatoryBackupTransport = backupTransportComponent;
+ }
+
+ @Implementation
+ public ComponentName getMandatoryBackupTransport() {
+ return sMandatoryBackupTransport;
+ }
+}
diff --git a/services/robotests/src/com/android/server/backup/testing/TestUtils.java b/services/robotests/src/com/android/server/backup/testing/TestUtils.java
new file mode 100644
index 0000000..1be298d
--- /dev/null
+++ b/services/robotests/src/com/android/server/backup/testing/TestUtils.java
@@ -0,0 +1,68 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.server.backup.testing;
+
+import com.android.internal.util.FunctionalUtils.ThrowingRunnable;
+
+import java.util.concurrent.Callable;
+
+public class TestUtils {
+ /**
+ * Calls {@link Runnable#run()} and returns if no exception is thrown. Otherwise, if the
+ * exception is unchecked, rethrow it; if it's checked wrap in a {@link RuntimeException} and
+ * throw.
+ *
+ * <p><b>Warning:</b>DON'T use this outside tests. A wrapped checked exception is just a failure
+ * in a test.
+ */
+ public static void uncheck(ThrowingRunnable runnable) {
+ try {
+ runnable.runOrThrow();
+ } catch (Exception e) {
+ throw wrapIfChecked(e);
+ }
+ }
+
+ /**
+ * Calls {@link Callable#call()} and returns the value if no exception is thrown. Otherwise, if
+ * the exception is unchecked, rethrow it; if it's checked wrap in a {@link RuntimeException}
+ * and throw.
+ *
+ * <p><b>Warning:</b>DON'T use this outside tests. A wrapped checked exception is just a failure
+ * in a test.
+ */
+ public static <T> T uncheck(Callable<T> callable) {
+ try {
+ return callable.call();
+ } catch (Exception e) {
+ throw wrapIfChecked(e);
+ }
+ }
+
+ /**
+ * Wrap {@code e} in a {@link RuntimeException} only if it's not one already, in which case it's
+ * returned.
+ */
+ public static RuntimeException wrapIfChecked(Exception e) {
+ if (e instanceof RuntimeException) {
+ return (RuntimeException) e;
+ }
+ return new RuntimeException(e);
+ }
+
+ private TestUtils() {}
+}
diff --git a/services/robotests/src/com/android/server/backup/testing/TransportBoundListenerStub.java b/services/robotests/src/com/android/server/backup/testing/TransportBoundListenerStub.java
deleted file mode 100644
index 84ac2c2..0000000
--- a/services/robotests/src/com/android/server/backup/testing/TransportBoundListenerStub.java
+++ /dev/null
@@ -1,64 +0,0 @@
-/*
- * Copyright (C) 2017 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- * http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License
- */
-
-package com.android.server.backup.testing;
-
-import com.android.internal.backup.IBackupTransport;
-import com.android.server.backup.TransportManager;
-
-import java.util.HashSet;
-import java.util.Set;
-
-/**
- * Stub implementation of TransportBoundListener, which returns given result and can tell whether
- * it was called for given transport.
- */
-public class TransportBoundListenerStub implements
- TransportManager.TransportBoundListener {
- private boolean mAlwaysReturnSuccess;
- private Set<IBackupTransport> mTransportsCalledFor = new HashSet<>();
-
- public TransportBoundListenerStub(boolean alwaysReturnSuccess) {
- this.mAlwaysReturnSuccess = alwaysReturnSuccess;
- }
-
- @Override
- public boolean onTransportBound(IBackupTransport binder) {
- mTransportsCalledFor.add(binder);
- return mAlwaysReturnSuccess;
- }
-
- /**
- * Returns whether the listener was called for the specified transport at least once.
- */
- public boolean isCalledForTransport(IBackupTransport binder) {
- return mTransportsCalledFor.contains(binder);
- }
-
- /**
- * Returns whether the listener was called at least once.
- */
- public boolean isCalled() {
- return !mTransportsCalledFor.isEmpty();
- }
-
- /**
- * Resets listener calls.
- */
- public void resetState() {
- mTransportsCalledFor.clear();
- }
-}
diff --git a/services/robotests/src/com/android/server/backup/testing/TransportData.java b/services/robotests/src/com/android/server/backup/testing/TransportData.java
new file mode 100644
index 0000000..9feaa8e
--- /dev/null
+++ b/services/robotests/src/com/android/server/backup/testing/TransportData.java
@@ -0,0 +1,149 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.server.backup.testing;
+
+import android.annotation.Nullable;
+import android.content.ComponentName;
+import android.content.Intent;
+
+public class TransportData {
+ // No constants since new Intent() can't be called in static context because of Robolectric
+ public static TransportData backupTransport() {
+ return new TransportData(
+ "com.google.android.gms/.backup.BackupTransportService",
+ "com.google.android.gms/.backup.BackupTransportService",
+ "com.google.android.gms.backup.BackupTransportService",
+ new Intent(),
+ "user@gmail.com",
+ new Intent(),
+ "Google Account");
+ }
+
+ public static TransportData d2dTransport() {
+ return new TransportData(
+ "com.google.android.gms/.backup.migrate.service.D2dTransport",
+ "com.google.android.gms/.backup.component.D2dTransportService",
+ "d2dMigrateTransport",
+ null,
+ "Moving data to new device",
+ null,
+ "");
+ }
+
+ public static TransportData localTransport() {
+ return new TransportData(
+ "android/com.android.internal.backup.LocalTransport",
+ "android/com.android.internal.backup.LocalTransportService",
+ "com.android.internal.backup.LocalTransport",
+ null,
+ "Backing up to debug-only private cache",
+ null,
+ "");
+ }
+
+ public static TransportData genericTransport(String packageName, String className) {
+ return new TransportData(
+ packageName + "/." + className,
+ packageName + "/." + className + "Service",
+ packageName + "." + className,
+ new Intent(),
+ "currentDestinationString",
+ new Intent(),
+ "dataManagementLabel");
+ }
+
+ @TransportTestUtils.TransportStatus
+ public int transportStatus;
+ public final String transportName;
+ private final String transportComponentShort;
+ @Nullable
+ public String transportDirName;
+ @Nullable public Intent configurationIntent;
+ @Nullable public String currentDestinationString;
+ @Nullable public Intent dataManagementIntent;
+ @Nullable public String dataManagementLabel;
+
+ private TransportData(
+ @TransportTestUtils.TransportStatus int transportStatus,
+ String transportName,
+ String transportComponentShort,
+ String transportDirName,
+ Intent configurationIntent,
+ String currentDestinationString,
+ Intent dataManagementIntent,
+ String dataManagementLabel) {
+ this.transportStatus = transportStatus;
+ this.transportName = transportName;
+ this.transportComponentShort = transportComponentShort;
+ this.transportDirName = transportDirName;
+ this.configurationIntent = configurationIntent;
+ this.currentDestinationString = currentDestinationString;
+ this.dataManagementIntent = dataManagementIntent;
+ this.dataManagementLabel = dataManagementLabel;
+ }
+
+ public TransportData(
+ String transportName,
+ String transportComponentShort,
+ String transportDirName,
+ Intent configurationIntent,
+ String currentDestinationString,
+ Intent dataManagementIntent,
+ String dataManagementLabel) {
+ this(
+ TransportTestUtils.TransportStatus.REGISTERED_AVAILABLE,
+ transportName,
+ transportComponentShort,
+ transportDirName,
+ configurationIntent,
+ currentDestinationString,
+ dataManagementIntent,
+ dataManagementLabel);
+ }
+
+ /**
+ * Not field because otherwise we'd have to call ComponentName::new in static context and
+ * Robolectric does not like this.
+ */
+ public ComponentName getTransportComponent() {
+ return ComponentName.unflattenFromString(transportComponentShort);
+ }
+
+ public TransportData unavailable() {
+ return new TransportData(
+ TransportTestUtils.TransportStatus.REGISTERED_UNAVAILABLE,
+ transportName,
+ transportComponentShort,
+ transportDirName,
+ configurationIntent,
+ currentDestinationString,
+ dataManagementIntent,
+ dataManagementLabel);
+ }
+
+ public TransportData unregistered() {
+ return new TransportData(
+ TransportTestUtils.TransportStatus.UNREGISTERED,
+ transportName,
+ transportComponentShort,
+ transportDirName,
+ configurationIntent,
+ currentDestinationString,
+ dataManagementIntent,
+ dataManagementLabel);
+ }
+}
diff --git a/services/robotests/src/com/android/server/backup/testing/TransportTestUtils.java b/services/robotests/src/com/android/server/backup/testing/TransportTestUtils.java
index 9770e40..e1dc7b5 100644
--- a/services/robotests/src/com/android/server/backup/testing/TransportTestUtils.java
+++ b/services/robotests/src/com/android/server/backup/testing/TransportTestUtils.java
@@ -16,13 +16,23 @@
package com.android.server.backup.testing;
+import static com.android.server.backup.testing.TestUtils.uncheck;
+
+import static org.junit.Assert.fail;
import static org.mockito.ArgumentMatchers.any;
import static org.mockito.ArgumentMatchers.eq;
import static org.mockito.Mockito.mock;
import static org.mockito.Mockito.when;
+import static java.util.stream.Collectors.toList;
+
import android.annotation.Nullable;
import android.content.ComponentName;
+import android.content.Intent;
+import android.content.pm.ResolveInfo;
+import android.content.pm.ServiceInfo;
+import android.os.RemoteException;
+import android.support.annotation.IntDef;
import com.android.internal.backup.IBackupTransport;
import com.android.server.backup.TransportManager;
@@ -30,85 +40,82 @@
import com.android.server.backup.transport.TransportNotAvailableException;
import com.android.server.backup.transport.TransportNotRegisteredException;
-import java.util.Arrays;
+import org.robolectric.shadows.ShadowPackageManager;
+
import java.util.List;
+import java.util.stream.Stream;
public class TransportTestUtils {
- public static final String[] TRANSPORT_NAMES = {
- "android/com.android.internal.backup.LocalTransport",
- "com.google.android.gms/.backup.migrate.service.D2dTransport",
- "com.google.android.gms/.backup.BackupTransportService"
- };
+ /**
+ * Differently from {@link #setUpTransports(TransportManager, TransportData...)}, which
+ * configures {@link TransportManager}, this is meant to mock the environment for a real
+ * TransportManager.
+ */
+ public static void setUpTransportsForTransportManager(
+ ShadowPackageManager shadowPackageManager, TransportData... transports)
+ throws Exception {
+ for (TransportData transport : transports) {
+ ComponentName transportComponent = transport.getTransportComponent();
+ String packageName = transportComponent.getPackageName();
+ ResolveInfo resolveInfo = resolveInfo(transportComponent);
+ shadowPackageManager.addResolveInfoForIntent(transportIntent(), resolveInfo);
+ shadowPackageManager.addResolveInfoForIntent(
+ transportIntent().setPackage(packageName), resolveInfo);
+ }
+ }
- public static final String TRANSPORT_NAME = TRANSPORT_NAMES[0];
+ private static Intent transportIntent() {
+ return new Intent(TransportManager.SERVICE_ACTION_TRANSPORT_HOST);
+ }
- /** {@code transportName} has to be in the {@link ComponentName} format (with '/') */
- public static TransportData setUpCurrentTransport(
- TransportManager transportManager, String transportName) throws Exception {
- TransportData transport = setUpTransports(transportManager, transportName).get(0);
- when(transportManager.getCurrentTransportClient(any()))
- .thenReturn(transport.transportClientMock);
- return transport;
+ private static ResolveInfo resolveInfo(ComponentName transportComponent) {
+ ResolveInfo resolveInfo = new ResolveInfo();
+ resolveInfo.serviceInfo = new ServiceInfo();
+ resolveInfo.serviceInfo.packageName = transportComponent.getPackageName();
+ resolveInfo.serviceInfo.name = transportComponent.getClassName();
+ return resolveInfo;
}
/** {@code transportName} has to be in the {@link ComponentName} format (with '/') */
- public static List<TransportData> setUpTransports(
- TransportManager transportManager, String... transportNames) throws Exception {
- return setUpTransports(
- transportManager,
- Arrays.stream(transportNames)
- .map(TransportData::new)
- .toArray(TransportData[]::new));
+ public static TransportMock setUpCurrentTransport(
+ TransportManager transportManager, TransportData transport) throws Exception {
+ TransportMock transportMock = setUpTransports(transportManager, transport).get(0);
+ if (transportMock.transportClient != null) {
+ when(transportManager.getCurrentTransportClient(any()))
+ .thenReturn(transportMock.transportClient);
+ }
+ return transportMock;
}
/** @see #setUpTransport(TransportManager, TransportData) */
- public static List<TransportData> setUpTransports(
+ public static List<TransportMock> setUpTransports(
TransportManager transportManager, TransportData... transports) throws Exception {
- for (TransportData transport : transports) {
- setUpTransport(transportManager, transport);
- }
- return Arrays.asList(transports);
+ return Stream.of(transports)
+ .map(transport -> uncheck(() -> setUpTransport(transportManager, transport)))
+ .collect(toList());
}
- /**
- * Configures transport according to {@link TransportData}:
- *
- * <ul>
- * <li>{@link TransportData#transportMock} {@code null} means transport not available.
- * <li>{@link TransportData#transportClientMock} {@code null} means transport not registered.
- * </ul>
- */
- public static void setUpTransport(TransportManager transportManager, TransportData transport)
- throws Exception {
+ public static TransportMock setUpTransport(
+ TransportManager transportManager, TransportData transport) throws Exception {
+ int status = transport.transportStatus;
String transportName = transport.transportName;
- String transportDirName = transportDirName(transportName);
- ComponentName transportComponent = transportComponentName(transportName);
- IBackupTransport transportMock = transport.transportMock;
- TransportClient transportClientMock = transport.transportClientMock;
+ ComponentName transportComponent = transport.getTransportComponent();
+ String transportDirName = transport.transportDirName;
- if (transportClientMock != null) {
+ TransportMock transportMock = mockTransport(transport);
+ if (status == TransportStatus.REGISTERED_AVAILABLE
+ || status == TransportStatus.REGISTERED_UNAVAILABLE) {
// Transport registered
when(transportManager.getTransportClient(eq(transportName), any()))
- .thenReturn(transportClientMock);
+ .thenReturn(transportMock.transportClient);
when(transportManager.getTransportClientOrThrow(eq(transportName), any()))
- .thenReturn(transportClientMock);
+ .thenReturn(transportMock.transportClient);
when(transportManager.getTransportName(transportComponent)).thenReturn(transportName);
when(transportManager.getTransportDirName(eq(transportName)))
.thenReturn(transportDirName);
when(transportManager.getTransportDirName(eq(transportComponent)))
.thenReturn(transportDirName);
- when(transportClientMock.getTransportComponent()).thenReturn(transportComponent);
-
- if (transportMock != null) {
- // Transport registered and available
- when(transportClientMock.connectOrThrow(any())).thenReturn(transportMock);
- when(transportMock.name()).thenReturn(transportName);
- when(transportMock.transportDirName()).thenReturn(transportDirName);
- } else {
- // Transport registered but unavailable
- when(transportClientMock.connectOrThrow(any()))
- .thenThrow(TransportNotAvailableException.class);
- }
+ // TODO: Mock rest of description methods
} else {
// Transport not registered
when(transportManager.getTransportClient(eq(transportName), any())).thenReturn(null);
@@ -121,34 +128,73 @@
when(transportManager.getTransportDirName(eq(transportComponent)))
.thenThrow(TransportNotRegisteredException.class);
}
+ return transportMock;
}
- /** {@code transportName} has to be in the {@link ComponentName} format (with '/') */
- public static ComponentName transportComponentName(String transportName) {
- return ComponentName.unflattenFromString(transportName);
- }
+ public static TransportMock mockTransport(TransportData transport) throws Exception {
+ final TransportClient transportClientMock;
+ int status = transport.transportStatus;
+ ComponentName transportComponent = transport.getTransportComponent();
+ if (status == TransportStatus.REGISTERED_AVAILABLE
+ || status == TransportStatus.REGISTERED_UNAVAILABLE) {
+ // Transport registered
+ transportClientMock = mock(TransportClient.class);
+ when(transportClientMock.getTransportComponent()).thenReturn(transportComponent);
+ if (status == TransportStatus.REGISTERED_AVAILABLE) {
+ // Transport registered and available
+ IBackupTransport transportMock = mockTransportBinder(transport);
+ when(transportClientMock.connectOrThrow(any())).thenReturn(transportMock);
- public static String transportDirName(String transportName) {
- return transportName + "_dir_name";
- }
+ return new TransportMock(transportClientMock, transportMock);
+ } else {
+ // Transport registered but unavailable
+ when(transportClientMock.connectOrThrow(any()))
+ .thenThrow(TransportNotAvailableException.class);
- public static class TransportData {
- public final String transportName;
- @Nullable public final IBackupTransport transportMock;
- @Nullable public final TransportClient transportClientMock;
-
- public TransportData(
- String transportName,
- @Nullable IBackupTransport transportMock,
- @Nullable TransportClient transportClientMock) {
- this.transportName = transportName;
- this.transportMock = transportMock;
- this.transportClientMock = transportClientMock;
+ return new TransportMock(transportClientMock, null);
+ }
+ } else {
+ // Transport not registered
+ return new TransportMock(null, null);
}
+ }
- public TransportData(String transportName) {
- this(transportName, mock(IBackupTransport.class), mock(TransportClient.class));
+ private static IBackupTransport mockTransportBinder(TransportData transport) throws Exception {
+ IBackupTransport transportBinder = mock(IBackupTransport.class);
+ try {
+ when(transportBinder.name()).thenReturn(transport.transportName);
+ when(transportBinder.transportDirName()).thenReturn(transport.transportDirName);
+ when(transportBinder.configurationIntent()).thenReturn(transport.configurationIntent);
+ when(transportBinder.currentDestinationString())
+ .thenReturn(transport.currentDestinationString);
+ when(transportBinder.dataManagementIntent()).thenReturn(transport.dataManagementIntent);
+ when(transportBinder.dataManagementLabel()).thenReturn(transport.dataManagementLabel);
+ } catch (RemoteException e) {
+ fail("RemoteException?");
}
+ return transportBinder;
+ }
+
+ public static class TransportMock {
+ @Nullable public final TransportClient transportClient;
+ @Nullable public final IBackupTransport transport;
+
+ private TransportMock(
+ @Nullable TransportClient transportClient, @Nullable IBackupTransport transport) {
+ this.transportClient = transportClient;
+ this.transport = transport;
+ }
+ }
+
+ @IntDef({
+ TransportStatus.REGISTERED_AVAILABLE,
+ TransportStatus.REGISTERED_UNAVAILABLE,
+ TransportStatus.UNREGISTERED
+ })
+ public @interface TransportStatus {
+ int REGISTERED_AVAILABLE = 0;
+ int REGISTERED_UNAVAILABLE = 1;
+ int UNREGISTERED = 2;
}
private TransportTestUtils() {}
diff --git a/services/robotests/src/com/android/server/testing/shadows/FrameworkShadowContextImpl.java b/services/robotests/src/com/android/server/testing/shadows/FrameworkShadowContextImpl.java
new file mode 100644
index 0000000..6d22073
--- /dev/null
+++ b/services/robotests/src/com/android/server/testing/shadows/FrameworkShadowContextImpl.java
@@ -0,0 +1,37 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License
+ */
+
+package com.android.server.testing.shadows;
+
+import android.content.Intent;
+import android.content.ServiceConnection;
+import android.os.UserHandle;
+
+import org.robolectric.annotation.Implementation;
+import org.robolectric.annotation.Implements;
+import org.robolectric.shadows.ShadowContextImpl;
+
+@Implements(className = ShadowContextImpl.CLASS_NAME, inheritImplementationMethods = true)
+public class FrameworkShadowContextImpl extends ShadowContextImpl {
+ @Implementation
+ public boolean bindServiceAsUser(
+ Intent service,
+ ServiceConnection connection,
+ int flags,
+ UserHandle user) {
+ return bindService(service, connection, flags);
+ }
+}
diff --git a/services/robotests/src/com/android/server/backup/testing/ShadowPackageManagerForBackup.java b/services/robotests/src/com/android/server/testing/shadows/FrameworkShadowPackageManager.java
similarity index 83%
rename from services/robotests/src/com/android/server/backup/testing/ShadowPackageManagerForBackup.java
rename to services/robotests/src/com/android/server/testing/shadows/FrameworkShadowPackageManager.java
index b64b59d..5cdbe7f 100644
--- a/services/robotests/src/com/android/server/backup/testing/ShadowPackageManagerForBackup.java
+++ b/services/robotests/src/com/android/server/testing/shadows/FrameworkShadowPackageManager.java
@@ -14,22 +14,18 @@
* limitations under the License
*/
-package com.android.server.backup.testing;
+package com.android.server.testing.shadows;
import android.app.ApplicationPackageManager;
import android.content.Intent;
import android.content.pm.ResolveInfo;
-
+import java.util.List;
import org.robolectric.annotation.Implements;
import org.robolectric.shadows.ShadowApplicationPackageManager;
-import java.util.List;
-
-/**
- * Implementation of PackageManager for Robolectric which handles queryIntentServicesAsUser().
- */
+/** Extension of ShadowApplicationPackageManager */
@Implements(value = ApplicationPackageManager.class, inheritImplementationMethods = true)
-public class ShadowPackageManagerForBackup extends ShadowApplicationPackageManager {
+public class FrameworkShadowPackageManager extends ShadowApplicationPackageManager {
@Override
public List<ResolveInfo> queryIntentServicesAsUser(Intent intent, int flags, int userId) {
return queryIntentServices(intent, flags);
diff --git a/services/tests/servicestests/src/com/android/server/am/ActivityRecordTests.java b/services/tests/servicestests/src/com/android/server/am/ActivityRecordTests.java
index b38a413..9923fa8 100644
--- a/services/tests/servicestests/src/com/android/server/am/ActivityRecordTests.java
+++ b/services/tests/servicestests/src/com/android/server/am/ActivityRecordTests.java
@@ -22,6 +22,7 @@
import static android.content.pm.ActivityInfo.RESIZE_MODE_UNRESIZEABLE;
import static android.view.Display.DEFAULT_DISPLAY;
+import static com.android.server.am.ActivityStack.ActivityState.INITIALIZING;
import static com.android.server.am.ActivityStack.ActivityState.PAUSING;
import static com.android.server.am.ActivityStack.ActivityState.STOPPED;
import static com.android.server.am.ActivityStack.REMOVE_TASK_MODE_MOVING;
@@ -122,7 +123,15 @@
mActivity.makeVisibleIfNeeded(null /* starting */);
assertEquals(mActivity.state, PAUSING);
+
assertTrue(pauseFound.value);
+
+ // Make sure that the state does not change for current non-stopping states.
+ mActivity.state = INITIALIZING;
+
+ mActivity.makeVisibleIfNeeded(null /* starting */);
+
+ assertEquals(mActivity.state, INITIALIZING);
}
@Test
diff --git a/services/tests/servicestests/src/com/android/server/backup/BackupManagerServiceTest.java b/services/tests/servicestests/src/com/android/server/backup/BackupManagerServiceTest.java
index 766d30d..7b4441a 100644
--- a/services/tests/servicestests/src/com/android/server/backup/BackupManagerServiceTest.java
+++ b/services/tests/servicestests/src/com/android/server/backup/BackupManagerServiceTest.java
@@ -96,7 +96,7 @@
createBackupManagerService();
verify(mTransportManager)
- .setTransportBoundListener(any(TransportManager.TransportBoundListener.class));
+ .setOnTransportRegisteredListener(any());
}
@Test
diff --git a/services/tests/servicestests/src/com/android/server/display/BrightnessTrackerTest.java b/services/tests/servicestests/src/com/android/server/display/BrightnessTrackerTest.java
index 08edd52..edc7d74 100644
--- a/services/tests/servicestests/src/com/android/server/display/BrightnessTrackerTest.java
+++ b/services/tests/servicestests/src/com/android/server/display/BrightnessTrackerTest.java
@@ -447,21 +447,24 @@
@Test
public void testParcelUnParcel() {
Parcel parcel = Parcel.obtain();
- BrightnessChangeEvent event = new BrightnessChangeEvent();
- event.brightness = 23f;
- event.timeStamp = 345L;
- event.packageName = "com.example";
- event.userId = 12;
- event.luxValues = new float[2];
- event.luxValues[0] = 3000.0f;
- event.luxValues[1] = 4000.0f;
- event.luxTimestamps = new long[2];
- event.luxTimestamps[0] = 325L;
- event.luxTimestamps[1] = 315L;
- event.batteryLevel = 0.7f;
- event.nightMode = false;
- event.colorTemperature = 345;
- event.lastBrightness = 50f;
+ BrightnessChangeEvent.Builder builder = new BrightnessChangeEvent.Builder();
+ builder.setBrightness(23f);
+ builder.setTimeStamp(345L);
+ builder.setPackageName("com.example");
+ builder.setUserId(12);
+ float[] luxValues = new float[2];
+ luxValues[0] = 3000.0f;
+ luxValues[1] = 4000.0f;
+ builder.setLuxValues(luxValues);
+ long[] luxTimestamps = new long[2];
+ luxTimestamps[0] = 325L;
+ luxTimestamps[1] = 315L;
+ builder.setLuxTimestamps(luxTimestamps);
+ builder.setBatteryLevel(0.7f);
+ builder.setNightMode(false);
+ builder.setColorTemperature(345);
+ builder.setLastBrightness(50f);
+ BrightnessChangeEvent event = builder.build();
event.writeToParcel(parcel, 0);
byte[] parceled = parcel.marshall();
@@ -485,7 +488,8 @@
assertEquals(event.lastBrightness, event2.lastBrightness, FLOAT_DELTA);
parcel = Parcel.obtain();
- event.batteryLevel = Float.NaN;
+ builder.setBatteryLevel(Float.NaN);
+ event = builder.build();
event.writeToParcel(parcel, 0);
parceled = parcel.marshall();
parcel.recycle();
diff --git a/services/tests/servicestests/src/com/android/server/policy/PhoneWindowManagerLayoutTest.java b/services/tests/servicestests/src/com/android/server/policy/PhoneWindowManagerLayoutTest.java
index 9a6da0e..b6c370e 100644
--- a/services/tests/servicestests/src/com/android/server/policy/PhoneWindowManagerLayoutTest.java
+++ b/services/tests/servicestests/src/com/android/server/policy/PhoneWindowManagerLayoutTest.java
@@ -16,15 +16,16 @@
package com.android.server.policy;
-import static android.view.Surface.ROTATION_180;
import static android.view.Surface.ROTATION_270;
import static android.view.Surface.ROTATION_90;
+import static android.view.View.SYSTEM_UI_FLAG_FULLSCREEN;
import static android.view.View.SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN;
import static android.view.ViewGroup.LayoutParams.MATCH_PARENT;
-import static android.view.WindowManager.LayoutParams.FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA;
import static android.view.WindowManager.LayoutParams.FLAG_DRAWS_SYSTEM_BAR_BACKGROUNDS;
import static android.view.WindowManager.LayoutParams.FLAG_LAYOUT_INSET_DECOR;
import static android.view.WindowManager.LayoutParams.FLAG_LAYOUT_IN_SCREEN;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
+import static android.view.WindowManager.LayoutParams.LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER;
import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_FORCE_DRAW_STATUS_BAR_BACKGROUND;
import static android.view.WindowManager.LayoutParams.TYPE_APPLICATION;
@@ -34,7 +35,6 @@
import android.platform.test.annotations.Presubmit;
import android.support.test.filters.SmallTest;
import android.support.test.runner.AndroidJUnit4;
-import android.view.Surface;
import android.view.WindowManager;
import org.junit.Before;
@@ -128,7 +128,23 @@
}
@Test
- public void layoutWindowLw_withDisplayCutout_fullscreen() {
+ public void layoutWindowLw_withhDisplayCutout_never() {
+ addDisplayCutout();
+
+ mAppWindow.attrs.layoutInDisplayCutoutMode = LAYOUT_IN_DISPLAY_CUTOUT_MODE_NEVER;
+ mPolicy.addWindow(mAppWindow);
+
+ mPolicy.beginLayoutLw(mFrames, 0 /* UI mode */);
+ mPolicy.layoutWindowLw(mAppWindow, null, mFrames);
+
+ assertInsetByTopBottom(mAppWindow.parentFrame, STATUS_BAR_HEIGHT, 0);
+ assertInsetByTopBottom(mAppWindow.stableFrame, STATUS_BAR_HEIGHT, NAV_BAR_HEIGHT);
+ assertInsetByTopBottom(mAppWindow.contentFrame, STATUS_BAR_HEIGHT, NAV_BAR_HEIGHT);
+ assertInsetByTopBottom(mAppWindow.decorFrame, 0, 0);
+ }
+
+ @Test
+ public void layoutWindowLw_withDisplayCutout_layoutFullscreen() {
addDisplayCutout();
mAppWindow.attrs.subtreeSystemUiVisibility |= SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN;
@@ -137,6 +153,22 @@
mPolicy.beginLayoutLw(mFrames, 0 /* UI mode */);
mPolicy.layoutWindowLw(mAppWindow, null, mFrames);
+ assertInsetByTopBottom(mAppWindow.parentFrame, 0, 0);
+ assertInsetByTopBottom(mAppWindow.stableFrame, STATUS_BAR_HEIGHT, NAV_BAR_HEIGHT);
+ assertInsetByTopBottom(mAppWindow.contentFrame, STATUS_BAR_HEIGHT, NAV_BAR_HEIGHT);
+ assertInsetByTopBottom(mAppWindow.decorFrame, 0, 0);
+ }
+
+ @Test
+ public void layoutWindowLw_withDisplayCutout_fullscreen() {
+ addDisplayCutout();
+
+ mAppWindow.attrs.subtreeSystemUiVisibility |= SYSTEM_UI_FLAG_FULLSCREEN;
+ mPolicy.addWindow(mAppWindow);
+
+ mPolicy.beginLayoutLw(mFrames, 0 /* UI mode */);
+ mPolicy.layoutWindowLw(mAppWindow, null, mFrames);
+
assertInsetByTopBottom(mAppWindow.parentFrame, STATUS_BAR_HEIGHT, 0);
assertInsetByTopBottom(mAppWindow.stableFrame, STATUS_BAR_HEIGHT, NAV_BAR_HEIGHT);
assertInsetByTopBottom(mAppWindow.contentFrame, STATUS_BAR_HEIGHT, NAV_BAR_HEIGHT);
@@ -147,8 +179,8 @@
public void layoutWindowLw_withDisplayCutout_fullscreenInCutout() {
addDisplayCutout();
- mAppWindow.attrs.subtreeSystemUiVisibility |= SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN;
- mAppWindow.attrs.flags2 |= FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA;
+ mAppWindow.attrs.subtreeSystemUiVisibility |= SYSTEM_UI_FLAG_FULLSCREEN;
+ mAppWindow.attrs.layoutInDisplayCutoutMode = LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
mPolicy.addWindow(mAppWindow);
mPolicy.beginLayoutLw(mFrames, 0 /* UI mode */);
@@ -217,7 +249,7 @@
setRotation(ROTATION_90);
mAppWindow.attrs.subtreeSystemUiVisibility |= SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN;
- mAppWindow.attrs.flags2 |= FLAG2_LAYOUT_IN_DISPLAY_CUTOUT_AREA;
+ mAppWindow.attrs.layoutInDisplayCutoutMode = LAYOUT_IN_DISPLAY_CUTOUT_MODE_ALWAYS;
mPolicy.addWindow(mAppWindow);
mPolicy.beginLayoutLw(mFrames, 0 /* UI mode */);
diff --git a/services/tests/servicestests/src/com/android/server/wm/DragDropControllerTests.java b/services/tests/servicestests/src/com/android/server/wm/DragDropControllerTests.java
index ce76a22..ac29163 100644
--- a/services/tests/servicestests/src/com/android/server/wm/DragDropControllerTests.java
+++ b/services/tests/servicestests/src/com/android/server/wm/DragDropControllerTests.java
@@ -16,27 +16,38 @@
package com.android.server.wm;
+import static android.app.WindowConfiguration.ACTIVITY_TYPE_STANDARD;
+import static android.app.WindowConfiguration.WINDOWING_MODE_FULLSCREEN;
import static android.view.WindowManager.LayoutParams.TYPE_BASE_APPLICATION;
-import static org.junit.Assert.assertFalse;
import static org.junit.Assert.assertNotNull;
import static org.junit.Assert.assertNull;
import static org.junit.Assert.assertTrue;
-import static org.mockito.Matchers.anyInt;
import static org.mockito.Mockito.any;
import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.spy;
import static org.mockito.Mockito.when;
+import android.content.ClipData;
import android.os.IBinder;
+import android.os.Looper;
+import android.os.UserHandle;
+import android.os.UserManagerInternal;
import android.platform.test.annotations.Presubmit;
import android.support.test.filters.SmallTest;
import android.support.test.runner.AndroidJUnit4;
import android.view.InputChannel;
import android.view.Surface;
import android.view.SurfaceSession;
+import android.view.View;
+import com.android.internal.annotations.GuardedBy;
+import com.android.server.LocalServices;
+import java.util.concurrent.CountDownLatch;
+import java.util.concurrent.TimeUnit;
import org.junit.After;
import org.junit.Before;
import org.junit.Test;
import org.junit.runner.RunWith;
+
/**
* Tests for the {@link DragDropController} class.
*
@@ -46,36 +57,92 @@
@RunWith(AndroidJUnit4.class)
@Presubmit
public class DragDropControllerTests extends WindowTestsBase {
- private static final int TIMEOUT_MS = 1000;
- private DragDropController mTarget;
+ private static final int TIMEOUT_MS = 3000;
+ private TestDragDropController mTarget;
private WindowState mWindow;
private IBinder mToken;
+ static class TestDragDropController extends DragDropController {
+ @GuardedBy("sWm.mWindowMap")
+ private Runnable mCloseCallback;
+
+ TestDragDropController(WindowManagerService service, Looper looper) {
+ super(service, looper);
+ }
+
+ void setOnClosedCallbackLocked(Runnable runnable) {
+ assertTrue(dragDropActiveLocked());
+ mCloseCallback = runnable;
+ }
+
+ @Override
+ void onDragStateClosedLocked(DragState dragState) {
+ super.onDragStateClosedLocked(dragState);
+ if (mCloseCallback != null) {
+ mCloseCallback.run();
+ mCloseCallback = null;
+ }
+ }
+ }
+
+ /**
+ * Creates a window state which can be used as a drop target.
+ */
+ private WindowState createDropTargetWindow(String name, int ownerId) {
+ final WindowTestUtils.TestAppWindowToken token = new WindowTestUtils.TestAppWindowToken(
+ mDisplayContent);
+ final TaskStack stack = createStackControllerOnStackOnDisplay(
+ WINDOWING_MODE_FULLSCREEN, ACTIVITY_TYPE_STANDARD, mDisplayContent).mContainer;
+ final Task task = createTaskInStack(stack, ownerId);
+ task.addChild(token, 0);
+
+ final WindowState window = createWindow(
+ null, TYPE_BASE_APPLICATION, token, name, ownerId, false);
+ window.mInputChannel = new InputChannel();
+ window.mHasSurface = true;
+ return window;
+ }
+
@Before
public void setUp() throws Exception {
+ final UserManagerInternal userManager = mock(UserManagerInternal.class);
+ LocalServices.addService(UserManagerInternal.class, userManager);
+
super.setUp();
- assertNotNull(sWm.mDragDropController);
- mTarget = sWm.mDragDropController;
- mWindow = createWindow(null, TYPE_BASE_APPLICATION, "window");
+
+ mTarget = new TestDragDropController(sWm, sWm.mH.getLooper());
+ mDisplayContent = spy(mDisplayContent);
+ mWindow = createDropTargetWindow("Drag test window", 0);
+ when(mDisplayContent.getTouchableWinAtPointLocked(0, 0)).thenReturn(mWindow);
+ when(sWm.mInputManager.transferTouchFocus(any(), any())).thenReturn(true);
+
synchronized (sWm.mWindowMap) {
- // Because sWm is a static object, the previous operation may remain.
- assertFalse(mTarget.dragDropActiveLocked());
+ sWm.mWindowMap.put(mWindow.mClient.asBinder(), mWindow);
}
}
@After
- public void tearDown() {
- if (mToken != null) {
- mTarget.cancelDragAndDrop(mToken);
+ public void tearDown() throws Exception {
+ LocalServices.removeServiceForTest(UserManagerInternal.class);
+ final CountDownLatch latch;
+ synchronized (sWm.mWindowMap) {
+ if (!mTarget.dragDropActiveLocked()) {
+ return;
+ }
+ if (mToken != null) {
+ mTarget.cancelDragAndDrop(mToken);
+ }
+ latch = new CountDownLatch(1);
+ mTarget.setOnClosedCallbackLocked(() -> {
+ latch.countDown();
+ });
}
+ assertTrue(latch.await(TIMEOUT_MS, TimeUnit.MILLISECONDS));
}
@Test
- public void testPrepareDrag() throws Exception {
- final Surface surface = new Surface();
- mToken = mTarget.prepareDrag(
- new SurfaceSession(), 0, 0, mWindow.mClient, 0, 100, 100, surface);
- assertNotNull(mToken);
+ public void testDragFlow() throws Exception {
+ dragFlow(0, ClipData.newPlainText("label", "Test"), 0, 0);
}
@Test
@@ -85,4 +152,33 @@
new SurfaceSession(), 0, 0, mWindow.mClient, 0, 0, 0, surface);
assertNull(mToken);
}
+
+ @Test
+ public void testPerformDrag_NullDataWithGrantUri() throws Exception {
+ dragFlow(View.DRAG_FLAG_GLOBAL | View.DRAG_FLAG_GLOBAL_URI_READ, null, 0, 0);
+ }
+
+ @Test
+ public void testPerformDrag_NullDataToOtherUser() throws Exception {
+ final WindowState otherUsersWindow =
+ createDropTargetWindow("Other user's window", 1 * UserHandle.PER_USER_RANGE);
+ when(mDisplayContent.getTouchableWinAtPointLocked(10, 10))
+ .thenReturn(otherUsersWindow);
+
+ dragFlow(0, null, 10, 10);
+ }
+
+ private void dragFlow(int flag, ClipData data, float dropX, float dropY) {
+ final Surface surface = new Surface();
+ mToken = mTarget.prepareDrag(
+ new SurfaceSession(), 0, 0, mWindow.mClient, flag, 100, 100, surface);
+ assertNotNull(mToken);
+
+ assertTrue(sWm.mInputManager.transferTouchFocus(null, null));
+ assertTrue(mTarget.performDrag(
+ mWindow.mClient, mToken, 0, 0, 0, 0, 0, data));
+
+ mTarget.handleMotionEvent(false, dropX, dropY);
+ mToken = mWindow.mClient.asBinder();
+ }
}
diff --git a/services/tests/servicestests/src/com/android/server/wm/WindowTestsBase.java b/services/tests/servicestests/src/com/android/server/wm/WindowTestsBase.java
index c699a94..69b1378 100644
--- a/services/tests/servicestests/src/com/android/server/wm/WindowTestsBase.java
+++ b/services/tests/servicestests/src/com/android/server/wm/WindowTestsBase.java
@@ -230,20 +230,22 @@
boolean ownerCanAddInternalSystemWindow) {
final WindowToken token = createWindowToken(
dc, WINDOWING_MODE_FULLSCREEN, ACTIVITY_TYPE_STANDARD, type);
- return createWindow(parent, type, token, name, ownerCanAddInternalSystemWindow);
+ return createWindow(parent, type, token, name, 0 /* ownerId */,
+ ownerCanAddInternalSystemWindow);
}
static WindowState createWindow(WindowState parent, int type, WindowToken token, String name) {
- return createWindow(parent, type, token, name, false /* ownerCanAddInternalSystemWindow */);
+ return createWindow(parent, type, token, name, 0 /* ownerId */,
+ false /* ownerCanAddInternalSystemWindow */);
}
static WindowState createWindow(WindowState parent, int type, WindowToken token, String name,
- boolean ownerCanAddInternalSystemWindow) {
+ int ownerId, boolean ownerCanAddInternalSystemWindow) {
final WindowManager.LayoutParams attrs = new WindowManager.LayoutParams(type);
attrs.setTitle(name);
final WindowState w = new WindowState(sWm, sMockSession, sIWindow, token, parent, OP_NONE,
- 0, attrs, VISIBLE, 0, ownerCanAddInternalSystemWindow);
+ 0, attrs, VISIBLE, ownerId, ownerCanAddInternalSystemWindow);
// TODO: Probably better to make this call in the WindowState ctor to avoid errors with
// adding it to the token...
token.addWindow(w);
diff --git a/telephony/java/android/telephony/CarrierConfigManager.java b/telephony/java/android/telephony/CarrierConfigManager.java
index 5a1a3e3..ce0b551 100644
--- a/telephony/java/android/telephony/CarrierConfigManager.java
+++ b/telephony/java/android/telephony/CarrierConfigManager.java
@@ -960,8 +960,9 @@
public static final String KEY_CARRIER_NAME_OVERRIDE_BOOL = "carrier_name_override_bool";
/**
- * String to identify carrier name in CarrierConfig app. This string is used only if
- * #KEY_CARRIER_NAME_OVERRIDE_BOOL is true
+ * String to identify carrier name in CarrierConfig app. This string overrides SPN if
+ * #KEY_CARRIER_NAME_OVERRIDE_BOOL is true; otherwise, it will be used if its value is provided
+ * and SPN is unavailable
* @hide
*/
public static final String KEY_CARRIER_NAME_STRING = "carrier_name_string";
diff --git a/telephony/java/android/telephony/TelephonyManager.java b/telephony/java/android/telephony/TelephonyManager.java
index f411ef7..8edc8b1 100644
--- a/telephony/java/android/telephony/TelephonyManager.java
+++ b/telephony/java/android/telephony/TelephonyManager.java
@@ -53,6 +53,7 @@
import com.android.ims.internal.IImsMMTelFeature;
import com.android.ims.internal.IImsRcsFeature;
+import com.android.ims.internal.IImsRegistration;
import com.android.ims.internal.IImsServiceFeatureCallback;
import com.android.internal.annotations.VisibleForTesting;
import com.android.internal.telecom.ITelecomService;
@@ -2514,6 +2515,33 @@
}
}
+ /**
+ * Resets the Carrier Keys in the database. This involves 2 steps:
+ * 1. Delete the keys from the database.
+ * 2. Send an intent to download new Certificates.
+ * <p>
+ * Requires Permission:
+ * {@link android.Manifest.permission#MODIFY_PHONE_STATE MODIFY_PHONE_STATE}
+ * @hide
+ */
+ public void resetCarrierKeysForImsiEncryption() {
+ try {
+ IPhoneSubInfo info = getSubscriberInfo();
+ if (info == null) {
+ throw new RuntimeException("IMSI error: Subscriber Info is null");
+ }
+ int subId = getSubId(SubscriptionManager.getDefaultDataSubscriptionId());
+ info.resetCarrierKeysForImsiEncryption(subId, mContext.getOpPackageName());
+ } catch (RemoteException ex) {
+ Rlog.e(TAG, "getCarrierInfoForImsiEncryption RemoteException" + ex);
+ throw new RuntimeException("IMSI error: Remote Exception");
+ } catch (NullPointerException ex) {
+ // This could happen before phone restarts due to crashing
+ Rlog.e(TAG, "getCarrierInfoForImsiEncryption NullPointerException" + ex);
+ throw new RuntimeException("IMSI error: Null Pointer exception");
+ }
+ }
+
/**
* @param keyAvailability bitmask that defines the availabilty of keys for a type.
* @param keyType the key type which is being checked. (WLAN, EPDG)
@@ -2549,7 +2577,7 @@
* device keystore.
* <p>
* Requires Permission:
- * {@link android.Manifest.permission#READ_PHONE_STATE READ_PHONE_STATE}
+ * {@link android.Manifest.permission#MODIFY_PHONE_STATE MODIFY_PHONE_STATE}
* @param imsiEncryptionInfo which includes the Key Type, the Public Key
* (java.security.PublicKey) and the Key Identifier.and the Key Identifier.
* The keyIdentifier Attribute value pair that helps a server locate
@@ -4932,6 +4960,25 @@
}
/**
+ * @return the {@IImsRegistration} interface that corresponds with the slot index and feature.
+ * @param slotIndex The SIM slot corresponding to the ImsService ImsRegistration is active for.
+ * @param feature An integer indicating the feature that we wish to get the ImsRegistration for.
+ * Corresponds to features defined in ImsFeature.
+ * @hide
+ */
+ public @Nullable IImsRegistration getImsRegistration(int slotIndex, int feature) {
+ try {
+ ITelephony telephony = getITelephony();
+ if (telephony != null) {
+ return telephony.getImsRegistration(slotIndex, feature);
+ }
+ } catch (RemoteException e) {
+ Rlog.e(TAG, "getImsRegistration, RemoteException: " + e.getMessage());
+ }
+ return null;
+ }
+
+ /**
* Set IMS registration state
*
* @param Registration state
diff --git a/telephony/java/android/telephony/ims/ImsService.java b/telephony/java/android/telephony/ims/ImsService.java
index 8230eaf..aaa0f08 100644
--- a/telephony/java/android/telephony/ims/ImsService.java
+++ b/telephony/java/android/telephony/ims/ImsService.java
@@ -26,12 +26,14 @@
import android.telephony.ims.feature.ImsFeature;
import android.telephony.ims.feature.MMTelFeature;
import android.telephony.ims.feature.RcsFeature;
+import android.telephony.ims.stub.ImsRegistrationImplBase;
import android.util.Log;
import android.util.SparseArray;
import com.android.ims.internal.IImsFeatureStatusCallback;
import com.android.ims.internal.IImsMMTelFeature;
import com.android.ims.internal.IImsRcsFeature;
+import com.android.ims.internal.IImsRegistration;
import com.android.ims.internal.IImsServiceController;
import com.android.internal.annotations.VisibleForTesting;
@@ -113,6 +115,12 @@
throws RemoteException {
ImsService.this.removeImsFeature(slotId, featureType, c);
}
+
+ @Override
+ public IImsRegistration getRegistration(int slotId) throws RemoteException {
+ ImsRegistrationImplBase r = ImsService.this.getRegistration(slotId);
+ return r != null ? r.getBinder() : null;
+ }
};
/**
@@ -174,6 +182,8 @@
f.setSlotId(slotId);
f.addImsFeatureStatusCallback(c);
addImsFeature(slotId, featureType, f);
+ // TODO: Remove once new onFeatureReady AIDL is merged in.
+ f.onFeatureReady();
}
private void addImsFeature(int slotId, int featureType, ImsFeature f) {
@@ -236,4 +246,13 @@
public @Nullable RcsFeature onCreateRcsFeature(int slotId) {
return null;
}
+
+ /**
+ * @param slotId The slot that is associated with the IMS Registration.
+ * @return the ImsRegistration implementation associated with the slot.
+ * @hide
+ */
+ public ImsRegistrationImplBase getRegistration(int slotId) {
+ return new ImsRegistrationImplBase();
+ }
}
diff --git a/telephony/java/android/telephony/ims/feature/ImsFeature.java b/telephony/java/android/telephony/ims/feature/ImsFeature.java
index ca4a210..d47cea30 100644
--- a/telephony/java/android/telephony/ims/feature/ImsFeature.java
+++ b/telephony/java/android/telephony/ims/feature/ImsFeature.java
@@ -96,7 +96,7 @@
new WeakHashMap<IImsFeatureStatusCallback, Boolean>());
private @ImsState int mState = STATE_NOT_AVAILABLE;
private int mSlotId = SubscriptionManager.INVALID_SIM_SLOT_INDEX;
- private Context mContext;
+ protected Context mContext;
public void setContext(Context context) {
mContext = context;
diff --git a/telephony/java/android/telephony/ims/internal/ImsService.java b/telephony/java/android/telephony/ims/internal/ImsService.java
index b7c8ca0..afaf332 100644
--- a/telephony/java/android/telephony/ims/internal/ImsService.java
+++ b/telephony/java/android/telephony/ims/internal/ImsService.java
@@ -24,7 +24,6 @@
import android.telephony.ims.internal.aidl.IImsConfig;
import android.telephony.ims.internal.aidl.IImsMmTelFeature;
import android.telephony.ims.internal.aidl.IImsRcsFeature;
-import android.telephony.ims.internal.aidl.IImsRegistration;
import android.telephony.ims.internal.aidl.IImsServiceController;
import android.telephony.ims.internal.aidl.IImsServiceControllerListener;
import android.telephony.ims.internal.feature.ImsFeature;
@@ -32,11 +31,12 @@
import android.telephony.ims.internal.feature.RcsFeature;
import android.telephony.ims.internal.stub.ImsConfigImplBase;
import android.telephony.ims.internal.stub.ImsFeatureConfiguration;
-import android.telephony.ims.internal.stub.ImsRegistrationImplBase;
+import android.telephony.ims.stub.ImsRegistrationImplBase;
import android.util.Log;
import android.util.SparseArray;
import com.android.ims.internal.IImsFeatureStatusCallback;
+import com.android.ims.internal.IImsRegistration;
import com.android.internal.annotations.VisibleForTesting;
/**
diff --git a/telephony/java/android/telephony/ims/internal/aidl/IImsMmTelListener.aidl b/telephony/java/android/telephony/ims/internal/aidl/IImsMmTelListener.aidl
index 8332bc0..43f5098 100644
--- a/telephony/java/android/telephony/ims/internal/aidl/IImsMmTelListener.aidl
+++ b/telephony/java/android/telephony/ims/internal/aidl/IImsMmTelListener.aidl
@@ -24,4 +24,5 @@
*/
oneway interface IImsMmTelListener {
void onIncomingCall(IImsCallSession c);
+ void onVoiceMessageCountUpdate(int count);
}
\ No newline at end of file
diff --git a/telephony/java/android/telephony/ims/internal/aidl/IImsServiceController.aidl b/telephony/java/android/telephony/ims/internal/aidl/IImsServiceController.aidl
index 8afb955..82a8525 100644
--- a/telephony/java/android/telephony/ims/internal/aidl/IImsServiceController.aidl
+++ b/telephony/java/android/telephony/ims/internal/aidl/IImsServiceController.aidl
@@ -18,12 +18,12 @@
import android.telephony.ims.internal.aidl.IImsMmTelFeature;
import android.telephony.ims.internal.aidl.IImsRcsFeature;
-import android.telephony.ims.internal.aidl.IImsRegistration;
import android.telephony.ims.internal.aidl.IImsConfig;
import android.telephony.ims.internal.aidl.IImsServiceControllerListener;
import android.telephony.ims.internal.stub.ImsFeatureConfiguration;
import com.android.ims.internal.IImsFeatureStatusCallback;
+import com.android.ims.internal.IImsRegistration;
/**
* See ImsService and MmTelFeature for more information.
diff --git a/telephony/java/android/telephony/ims/internal/feature/CapabilityChangeRequest.java b/telephony/java/android/telephony/ims/internal/feature/CapabilityChangeRequest.java
index 4d18873..5dbf077 100644
--- a/telephony/java/android/telephony/ims/internal/feature/CapabilityChangeRequest.java
+++ b/telephony/java/android/telephony/ims/internal/feature/CapabilityChangeRequest.java
@@ -18,7 +18,7 @@
import android.os.Parcel;
import android.os.Parcelable;
-import android.telephony.ims.internal.stub.ImsRegistrationImplBase;
+import android.telephony.ims.stub.ImsRegistrationImplBase;
import android.util.ArraySet;
import java.util.ArrayList;
diff --git a/telephony/java/android/telephony/ims/internal/feature/MmTelFeature.java b/telephony/java/android/telephony/ims/internal/feature/MmTelFeature.java
index 238411e..8d888c2 100644
--- a/telephony/java/android/telephony/ims/internal/feature/MmTelFeature.java
+++ b/telephony/java/android/telephony/ims/internal/feature/MmTelFeature.java
@@ -28,8 +28,8 @@
import android.telephony.ims.internal.aidl.IImsCapabilityCallback;
import android.telephony.ims.internal.aidl.IImsMmTelFeature;
import android.telephony.ims.internal.aidl.IImsMmTelListener;
-import android.telephony.ims.internal.stub.ImsRegistrationImplBase;
import android.telephony.ims.internal.aidl.IImsSmsListener;
+import android.telephony.ims.stub.ImsRegistrationImplBase;
import android.telephony.ims.stub.ImsEcbmImplBase;
import android.telephony.ims.stub.ImsMultiEndpointImplBase;
import android.telephony.ims.stub.ImsUtImplBase;
@@ -262,6 +262,15 @@
}
/**
+ * Updates the Listener when the voice message count for IMS has changed.
+ * @param count an integer representing the new message count.
+ */
+ @Override
+ public void onVoiceMessageCountUpdate(int count) {
+
+ }
+
+ /**
* Called when the IMS provider receives an incoming call.
* @param c The {@link ImsCallSession} associated with the new call.
*/
diff --git a/telephony/java/android/telephony/ims/internal/stub/ImsRegistrationImplBase.java b/telephony/java/android/telephony/ims/stub/ImsRegistrationImplBase.java
similarity index 83%
rename from telephony/java/android/telephony/ims/internal/stub/ImsRegistrationImplBase.java
rename to telephony/java/android/telephony/ims/stub/ImsRegistrationImplBase.java
index 558b009..42af083 100644
--- a/telephony/java/android/telephony/ims/internal/stub/ImsRegistrationImplBase.java
+++ b/telephony/java/android/telephony/ims/stub/ImsRegistrationImplBase.java
@@ -14,16 +14,19 @@
* limitations under the License
*/
-package android.telephony.ims.internal.stub;
+package android.telephony.ims.stub;
import android.annotation.IntDef;
+import android.net.Uri;
+import android.os.IBinder;
import android.os.RemoteCallbackList;
import android.os.RemoteException;
-import android.telephony.ims.internal.aidl.IImsRegistration;
-import android.telephony.ims.internal.aidl.IImsRegistrationCallback;
import android.util.Log;
import com.android.ims.ImsReasonInfo;
+import com.android.ims.internal.IImsRegistration;
+import com.android.ims.internal.IImsRegistrationCallback;
+import com.android.internal.annotations.VisibleForTesting;
import java.lang.annotation.Retention;
import java.lang.annotation.RetentionPolicy;
@@ -62,23 +65,25 @@
// Registration states, used to notify new ImsRegistrationImplBase#Callbacks of the current
// state.
+ // The unknown state is set as the initialization state. This is so that we do not call back
+ // with NOT_REGISTERED in the case where the ImsService has not updated the registration state
+ // yet.
+ private static final int REGISTRATION_STATE_UNKNOWN = -1;
private static final int REGISTRATION_STATE_NOT_REGISTERED = 0;
private static final int REGISTRATION_STATE_REGISTERING = 1;
private static final int REGISTRATION_STATE_REGISTERED = 2;
-
/**
* Callback class for receiving Registration callback events.
+ * @hide
*/
- public static class Callback extends IImsRegistrationCallback.Stub {
-
+ public static class Callback {
/**
* Notifies the framework when the IMS Provider is connected to the IMS network.
*
* @param imsRadioTech the radio access technology. Valid values are defined in
* {@link ImsRegistrationTech}.
*/
- @Override
public void onRegistered(@ImsRegistrationTech int imsRadioTech) {
}
@@ -88,7 +93,6 @@
* @param imsRadioTech the radio access technology. Valid values are defined in
* {@link ImsRegistrationTech}.
*/
- @Override
public void onRegistering(@ImsRegistrationTech int imsRadioTech) {
}
@@ -97,7 +101,6 @@
*
* @param info the {@link ImsReasonInfo} associated with why registration was disconnected.
*/
- @Override
public void onDeregistered(ImsReasonInfo info) {
}
@@ -108,10 +111,19 @@
* @param imsRadioTech The {@link ImsRegistrationTech} type that has failed
* @param info A {@link ImsReasonInfo} that identifies the reason for failure.
*/
- @Override
public void onTechnologyChangeFailed(@ImsRegistrationTech int imsRadioTech,
ImsReasonInfo info) {
}
+
+ /**
+ * Returns a list of subscriber {@link Uri}s associated with this IMS subscription when
+ * it changes.
+ * @param uris new array of subscriber {@link Uri}s that are associated with this IMS
+ * subscription.
+ */
+ public void onSubscriberAssociatedUriChanged(Uri[] uris) {
+
+ }
}
private final IImsRegistration mBinder = new IImsRegistration.Stub() {
@@ -139,9 +151,9 @@
private @ImsRegistrationTech
int mConnectionType = REGISTRATION_TECH_NONE;
// Locked on mLock
- private int mRegistrationState = REGISTRATION_STATE_NOT_REGISTERED;
- // Locked on mLock
- private ImsReasonInfo mLastDisconnectCause;
+ private int mRegistrationState = REGISTRATION_STATE_UNKNOWN;
+ // Locked on mLock, create unspecified disconnect cause.
+ private ImsReasonInfo mLastDisconnectCause = new ImsReasonInfo();
public final IImsRegistration getBinder() {
return mBinder;
@@ -221,6 +233,17 @@
});
}
+ public final void onSubscriberAssociatedUriChanged(Uri[] uris) {
+ mCallbacks.broadcast((c) -> {
+ try {
+ c.onSubscriberAssociatedUriChanged(uris);
+ } catch (RemoteException e) {
+ Log.w(LOG_TAG, e + " " + "onSubscriberAssociatedUriChanged() - Skipping " +
+ "callback.");
+ }
+ });
+ }
+
private void updateToState(@ImsRegistrationTech int connType, int newState) {
synchronized (mLock) {
mConnectionType = connType;
@@ -241,7 +264,8 @@
}
}
- private @ImsRegistrationTech int getConnectionType() {
+ @VisibleForTesting
+ public final @ImsRegistrationTech int getConnectionType() {
synchronized (mLock) {
return mConnectionType;
}
@@ -271,6 +295,10 @@
c.onRegistered(getConnectionType());
break;
}
+ case REGISTRATION_STATE_UNKNOWN: {
+ // Do not callback if the state has not been updated yet by the ImsService.
+ break;
+ }
}
}
}
diff --git a/telephony/java/android/telephony/ims/internal/aidl/IImsRegistration.aidl b/telephony/java/com/android/ims/internal/IImsRegistration.aidl
similarity index 82%
rename from telephony/java/android/telephony/ims/internal/aidl/IImsRegistration.aidl
rename to telephony/java/com/android/ims/internal/IImsRegistration.aidl
index 687b7ca..6de264e 100644
--- a/telephony/java/android/telephony/ims/internal/aidl/IImsRegistration.aidl
+++ b/telephony/java/com/android/ims/internal/IImsRegistration.aidl
@@ -15,10 +15,9 @@
*/
-package android.telephony.ims.internal.aidl;
+package com.android.ims.internal;
-import android.telephony.ims.internal.aidl.IImsRegistrationCallback;
-import android.telephony.ims.internal.stub.ImsFeatureConfiguration;
+import com.android.ims.internal.IImsRegistrationCallback;
/**
* See ImsRegistration for more information.
diff --git a/telephony/java/android/telephony/ims/internal/aidl/IImsRegistrationCallback.aidl b/telephony/java/com/android/ims/internal/IImsRegistrationCallback.aidl
similarity index 89%
rename from telephony/java/android/telephony/ims/internal/aidl/IImsRegistrationCallback.aidl
rename to telephony/java/com/android/ims/internal/IImsRegistrationCallback.aidl
index a50575b..5f21167 100644
--- a/telephony/java/android/telephony/ims/internal/aidl/IImsRegistrationCallback.aidl
+++ b/telephony/java/com/android/ims/internal/IImsRegistrationCallback.aidl
@@ -15,8 +15,9 @@
*/
-package android.telephony.ims.internal.aidl;
+package com.android.ims.internal;
+import android.net.Uri;
import android.telephony.ims.internal.stub.ImsFeatureConfiguration;
import com.android.ims.ImsReasonInfo;
@@ -31,4 +32,5 @@
void onRegistering(int imsRadioTech);
void onDeregistered(in ImsReasonInfo info);
void onTechnologyChangeFailed(int imsRadioTech, in ImsReasonInfo info);
+ void onSubscriberAssociatedUriChanged(in Uri[] uris);
}
\ No newline at end of file
diff --git a/telephony/java/com/android/ims/internal/IImsServiceController.aidl b/telephony/java/com/android/ims/internal/IImsServiceController.aidl
index 857089f..7ac25ac 100644
--- a/telephony/java/com/android/ims/internal/IImsServiceController.aidl
+++ b/telephony/java/com/android/ims/internal/IImsServiceController.aidl
@@ -18,6 +18,7 @@
import com.android.ims.internal.IImsFeatureStatusCallback;
import com.android.ims.internal.IImsMMTelFeature;
+import com.android.ims.internal.IImsRegistration;
import com.android.ims.internal.IImsRcsFeature;
/**
@@ -29,4 +30,5 @@
IImsMMTelFeature createMMTelFeature(int slotId, in IImsFeatureStatusCallback c);
IImsRcsFeature createRcsFeature(int slotId, in IImsFeatureStatusCallback c);
void removeImsFeature(int slotId, int featureType, in IImsFeatureStatusCallback c);
+ IImsRegistration getRegistration(int slotId);
}
diff --git a/telephony/java/com/android/internal/telephony/IPhoneSubInfo.aidl b/telephony/java/com/android/internal/telephony/IPhoneSubInfo.aidl
index 0f31821..f8a040d 100644
--- a/telephony/java/com/android/internal/telephony/IPhoneSubInfo.aidl
+++ b/telephony/java/com/android/internal/telephony/IPhoneSubInfo.aidl
@@ -152,6 +152,13 @@
in ImsiEncryptionInfo imsiEncryptionInfo);
/**
+ * Resets the Carrier Keys in the database. This involves 2 steps:
+ * 1. Delete the keys from the database.
+ * 2. Send an intent to download new Certificates.
+ */
+ void resetCarrierKeysForImsiEncryption(int subId, String callingPackage);
+
+ /**
* Retrieves the alpha identifier associated with the voice mail number.
*/
String getVoiceMailAlphaTag(String callingPackage);
diff --git a/telephony/java/com/android/internal/telephony/ITelephony.aidl b/telephony/java/com/android/internal/telephony/ITelephony.aidl
index 416146f..fba82ee 100644
--- a/telephony/java/com/android/internal/telephony/ITelephony.aidl
+++ b/telephony/java/com/android/internal/telephony/ITelephony.aidl
@@ -40,6 +40,7 @@
import android.telephony.VisualVoicemailSmsFilterSettings;
import com.android.ims.internal.IImsMMTelFeature;
import com.android.ims.internal.IImsRcsFeature;
+import com.android.ims.internal.IImsRegistration;
import com.android.ims.internal.IImsServiceFeatureCallback;
import com.android.internal.telephony.CellNetworkScanResult;
import com.android.internal.telephony.OperatorInfo;
@@ -808,6 +809,11 @@
IImsRcsFeature getRcsFeatureAndListen(int slotId, in IImsServiceFeatureCallback callback);
/**
+ * Returns the IImsRegistration associated with the slot and feature specified.
+ */
+ IImsRegistration getImsRegistration(int slotId, int feature);
+
+ /**
* Set the network selection mode to automatic.
*
* @param subId the id of the subscription to update.
diff --git a/telephony/java/com/android/internal/telephony/TelephonyIntents.java b/telephony/java/com/android/internal/telephony/TelephonyIntents.java
index f29d993c..51369d0 100644
--- a/telephony/java/com/android/internal/telephony/TelephonyIntents.java
+++ b/telephony/java/com/android/internal/telephony/TelephonyIntents.java
@@ -486,4 +486,10 @@
*/
public static final String ACTION_REQUEST_OMADM_CONFIGURATION_UPDATE =
"com.android.omadm.service.CONFIGURATION_UPDATE";
+
+ /**
+ * Broadcast action to trigger the Carrier Certificate download.
+ */
+ public static final String ACTION_CARRIER_CERTIFICATE_DOWNLOAD =
+ "com.android.internal.telephony.ACTION_CARRIER_CERTIFICATE_DOWNLOAD";
}
diff --git a/test-base/Android.bp b/test-base/Android.bp
index d2da613..ccf57b0 100644
--- a/test-base/Android.bp
+++ b/test-base/Android.bp
@@ -49,7 +49,8 @@
// Build the repackaged.android.test.base library
// ==============================================
-// This contains repackaged versions of the classes from legacy-test.
+// This contains repackaged versions of the classes from
+// android.test.base.
java_library_static {
name: "repackaged.android.test.base",
diff --git a/test-mock/Android.bp b/test-mock/Android.bp
index 8eddec4..b1ae40e 100644
--- a/test-mock/Android.bp
+++ b/test-mock/Android.bp
@@ -24,7 +24,6 @@
no_framework_libs: true,
libs: [
"framework",
- "legacy-test",
],
}
diff --git a/test-runner/Android.bp b/test-runner/Android.bp
index 85844a0..dfaeed5 100644
--- a/test-runner/Android.bp
+++ b/test-runner/Android.bp
@@ -24,7 +24,7 @@
no_framework_libs: true,
libs: [
"framework",
- "legacy-test",
+ "android.test.base",
"android.test.mock",
],
}
@@ -40,7 +40,7 @@
no_framework_libs: true,
libs: [
"framework",
- "legacy-test",
+ "android.test.base",
"android.test.mock",
"junit",
],
diff --git a/tests/net/java/android/net/IpSecConfigTest.java b/tests/net/java/android/net/IpSecConfigTest.java
index efc01f2a..f6c5532 100644
--- a/tests/net/java/android/net/IpSecConfigTest.java
+++ b/tests/net/java/android/net/IpSecConfigTest.java
@@ -36,19 +36,16 @@
public void testDefaults() throws Exception {
IpSecConfig c = new IpSecConfig();
assertEquals(IpSecTransform.MODE_TRANSPORT, c.getMode());
- assertEquals("", c.getLocalAddress());
- assertEquals("", c.getRemoteAddress());
+ assertEquals("", c.getSourceAddress());
+ assertEquals("", c.getDestinationAddress());
assertNull(c.getNetwork());
assertEquals(IpSecTransform.ENCAP_NONE, c.getEncapType());
assertEquals(IpSecManager.INVALID_RESOURCE_ID, c.getEncapSocketResourceId());
assertEquals(0, c.getEncapRemotePort());
assertEquals(0, c.getNattKeepaliveInterval());
- for (int direction :
- new int[] {IpSecTransform.DIRECTION_OUT, IpSecTransform.DIRECTION_IN}) {
- assertNull(c.getEncryption(direction));
- assertNull(c.getAuthentication(direction));
- assertEquals(IpSecManager.INVALID_RESOURCE_ID, c.getSpiResourceId(direction));
- }
+ assertNull(c.getEncryption());
+ assertNull(c.getAuthentication());
+ assertEquals(IpSecManager.INVALID_RESOURCE_ID, c.getSpiResourceId());
}
@Test
@@ -57,34 +54,21 @@
IpSecConfig c = new IpSecConfig();
c.setMode(IpSecTransform.MODE_TUNNEL);
- c.setLocalAddress("0.0.0.0");
- c.setRemoteAddress("1.2.3.4");
+ c.setSourceAddress("0.0.0.0");
+ c.setDestinationAddress("1.2.3.4");
c.setEncapType(android.system.OsConstants.UDP_ENCAP_ESPINUDP);
c.setEncapSocketResourceId(7);
c.setEncapRemotePort(22);
c.setNattKeepaliveInterval(42);
c.setEncryption(
- IpSecTransform.DIRECTION_OUT,
new IpSecAlgorithm(
IpSecAlgorithm.CRYPT_AES_CBC,
new byte[] {0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 0xA, 0xB, 0xC, 0xD, 0xE, 0xF}));
c.setAuthentication(
- IpSecTransform.DIRECTION_OUT,
new IpSecAlgorithm(
IpSecAlgorithm.AUTH_HMAC_MD5,
new byte[] {1, 2, 3, 4, 5, 6, 7, 8, 9, 0xA, 0xB, 0xC, 0xD, 0xE, 0xF, 0}));
- c.setSpiResourceId(IpSecTransform.DIRECTION_OUT, 1984);
- c.setEncryption(
- IpSecTransform.DIRECTION_IN,
- new IpSecAlgorithm(
- IpSecAlgorithm.CRYPT_AES_CBC,
- new byte[] {2, 1, 2, 3, 4, 5, 6, 7, 8, 9, 0xA, 0xB, 0xC, 0xD, 0xE, 0xF}));
- c.setAuthentication(
- IpSecTransform.DIRECTION_IN,
- new IpSecAlgorithm(
- IpSecAlgorithm.AUTH_HMAC_MD5,
- new byte[] {1, 2, 3, 4, 5, 6, 7, 8, 9, 0xA, 0xB, 0xC, 0xD, 0xE, 0xF, 1}));
- c.setSpiResourceId(IpSecTransform.DIRECTION_IN, 99);
+ c.setSpiResourceId(1984);
assertParcelingIsLossless(c);
}
diff --git a/tests/net/java/android/net/IpSecManagerTest.java b/tests/net/java/android/net/IpSecManagerTest.java
index 0f40b45..cc3366f 100644
--- a/tests/net/java/android/net/IpSecManagerTest.java
+++ b/tests/net/java/android/net/IpSecManagerTest.java
@@ -81,15 +81,13 @@
IpSecSpiResponse spiResp =
new IpSecSpiResponse(IpSecManager.Status.OK, resourceId, DROID_SPI);
when(mMockIpSecService.allocateSecurityParameterIndex(
- eq(IpSecTransform.DIRECTION_IN),
eq(GOOGLE_DNS_4.getHostAddress()),
eq(DROID_SPI),
anyObject()))
.thenReturn(spiResp);
IpSecManager.SecurityParameterIndex droidSpi =
- mIpSecManager.allocateSecurityParameterIndex(
- IpSecTransform.DIRECTION_IN, GOOGLE_DNS_4, DROID_SPI);
+ mIpSecManager.allocateSecurityParameterIndex(GOOGLE_DNS_4, DROID_SPI);
assertEquals(DROID_SPI, droidSpi.getSpi());
droidSpi.close();
@@ -103,15 +101,13 @@
IpSecSpiResponse spiResp =
new IpSecSpiResponse(IpSecManager.Status.OK, resourceId, DROID_SPI);
when(mMockIpSecService.allocateSecurityParameterIndex(
- eq(IpSecTransform.DIRECTION_OUT),
eq(GOOGLE_DNS_4.getHostAddress()),
eq(IpSecManager.INVALID_SECURITY_PARAMETER_INDEX),
anyObject()))
.thenReturn(spiResp);
IpSecManager.SecurityParameterIndex randomSpi =
- mIpSecManager.allocateSecurityParameterIndex(
- IpSecTransform.DIRECTION_OUT, GOOGLE_DNS_4);
+ mIpSecManager.allocateSecurityParameterIndex(GOOGLE_DNS_4);
assertEquals(DROID_SPI, randomSpi.getSpi());
@@ -124,16 +120,15 @@
* Throws resource unavailable exception
*/
@Test
- public void testAllocSpiResUnavaiableExeption() throws Exception {
+ public void testAllocSpiResUnavailableException() throws Exception {
IpSecSpiResponse spiResp =
new IpSecSpiResponse(IpSecManager.Status.RESOURCE_UNAVAILABLE, 0, 0);
when(mMockIpSecService.allocateSecurityParameterIndex(
- anyInt(), anyString(), anyInt(), anyObject()))
+ anyString(), anyInt(), anyObject()))
.thenReturn(spiResp);
try {
- mIpSecManager.allocateSecurityParameterIndex(
- IpSecTransform.DIRECTION_OUT, GOOGLE_DNS_4);
+ mIpSecManager.allocateSecurityParameterIndex(GOOGLE_DNS_4);
fail("ResourceUnavailableException was not thrown");
} catch (IpSecManager.ResourceUnavailableException e) {
}
@@ -143,15 +138,14 @@
* Throws spi unavailable exception
*/
@Test
- public void testAllocSpiSpiUnavaiableExeption() throws Exception {
+ public void testAllocSpiSpiUnavailableException() throws Exception {
IpSecSpiResponse spiResp = new IpSecSpiResponse(IpSecManager.Status.SPI_UNAVAILABLE, 0, 0);
when(mMockIpSecService.allocateSecurityParameterIndex(
- anyInt(), anyString(), anyInt(), anyObject()))
+ anyString(), anyInt(), anyObject()))
.thenReturn(spiResp);
try {
- mIpSecManager.allocateSecurityParameterIndex(
- IpSecTransform.DIRECTION_OUT, GOOGLE_DNS_4);
+ mIpSecManager.allocateSecurityParameterIndex(GOOGLE_DNS_4);
fail("ResourceUnavailableException was not thrown");
} catch (IpSecManager.ResourceUnavailableException e) {
}
@@ -163,8 +157,7 @@
@Test
public void testRequestAllocInvalidSpi() throws Exception {
try {
- mIpSecManager.allocateSecurityParameterIndex(
- IpSecTransform.DIRECTION_OUT, GOOGLE_DNS_4, 0);
+ mIpSecManager.allocateSecurityParameterIndex(GOOGLE_DNS_4, 0);
fail("Able to allocate invalid spi");
} catch (IllegalArgumentException e) {
}
diff --git a/tests/net/java/android/net/MacAddressTest.java b/tests/net/java/android/net/MacAddressTest.java
index 473dc538..9aad413 100644
--- a/tests/net/java/android/net/MacAddressTest.java
+++ b/tests/net/java/android/net/MacAddressTest.java
@@ -67,7 +67,7 @@
assertEquals(msg, t.expectedType, got);
if (got != MacAddress.TYPE_UNKNOWN) {
- assertEquals(got, MacAddress.fromBytes(t.addr).addressType());
+ assertEquals(got, MacAddress.fromBytes(t.addr).getAddressType());
}
}
}
@@ -191,7 +191,7 @@
assertTrue(stringRepr + " expected to be a locally assigned address",
mac.isLocallyAssigned());
- assertEquals(MacAddress.TYPE_UNICAST, mac.addressType());
+ assertEquals(MacAddress.TYPE_UNICAST, mac.getAddressType());
assertTrue(stringRepr + " expected to begin with " + expectedLocalOui,
stringRepr.startsWith(expectedLocalOui));
}
diff --git a/tests/net/java/android/net/NetworkTest.java b/tests/net/java/android/net/NetworkTest.java
index bacf986..94d01e9 100644
--- a/tests/net/java/android/net/NetworkTest.java
+++ b/tests/net/java/android/net/NetworkTest.java
@@ -147,9 +147,9 @@
// Adjust as necessary to test an implementation's specific constants.
// When running with runtest, "adb logcat -s TestRunner" can be useful.
- assertEquals(4311403230L, one.getNetworkHandle());
- assertEquals(8606370526L, two.getNetworkHandle());
- assertEquals(12901337822L, three.getNetworkHandle());
+ assertEquals(7700664333L, one.getNetworkHandle());
+ assertEquals(11995631629L, two.getNetworkHandle());
+ assertEquals(16290598925L, three.getNetworkHandle());
}
private static <T> void assertNotEqual(T t1, T t2) {
diff --git a/tests/net/java/com/android/server/ConnectivityServiceTest.java b/tests/net/java/com/android/server/ConnectivityServiceTest.java
index 2b0349c..b8e37f3 100644
--- a/tests/net/java/com/android/server/ConnectivityServiceTest.java
+++ b/tests/net/java/com/android/server/ConnectivityServiceTest.java
@@ -1392,39 +1392,75 @@
return null;
}
- void expectAvailableCallbacks(
- MockNetworkAgent agent, boolean expectSuspended, int timeoutMs) {
+ // Expects onAvailable and the callbacks that follow it. These are:
+ // - onSuspended, iff the network was suspended when the callbacks fire.
+ // - onCapabilitiesChanged.
+ // - onLinkPropertiesChanged.
+ //
+ // @param agent the network to expect the callbacks on.
+ // @param expectSuspended whether to expect a SUSPENDED callback.
+ // @param expectValidated the expected value of the VALIDATED capability in the
+ // onCapabilitiesChanged callback.
+ // @param timeoutMs how long to wait for the callbacks.
+ void expectAvailableCallbacks(MockNetworkAgent agent, boolean expectSuspended,
+ boolean expectValidated, int timeoutMs) {
expectCallback(CallbackState.AVAILABLE, agent, timeoutMs);
if (expectSuspended) {
expectCallback(CallbackState.SUSPENDED, agent, timeoutMs);
}
- expectCallback(CallbackState.NETWORK_CAPABILITIES, agent, timeoutMs);
+ if (expectValidated) {
+ expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, agent);
+ } else {
+ expectCapabilitiesWithout(NET_CAPABILITY_VALIDATED, agent);
+ }
expectCallback(CallbackState.LINK_PROPERTIES, agent, timeoutMs);
}
- void expectAvailableCallbacks(MockNetworkAgent agent) {
- expectAvailableCallbacks(agent, false, TIMEOUT_MS);
+ // Expects the available callbacks (validated), plus onSuspended.
+ void expectAvailableAndSuspendedCallbacks(MockNetworkAgent agent, boolean expectValidated) {
+ expectAvailableCallbacks(agent, true, expectValidated, TIMEOUT_MS);
}
- void expectAvailableAndSuspendedCallbacks(MockNetworkAgent agent) {
- expectAvailableCallbacks(agent, true, TIMEOUT_MS);
+ void expectAvailableCallbacksValidated(MockNetworkAgent agent) {
+ expectAvailableCallbacks(agent, false, true, TIMEOUT_MS);
}
- void expectAvailableAndValidatedCallbacks(MockNetworkAgent agent) {
- expectAvailableCallbacks(agent, false, TIMEOUT_MS);
+ void expectAvailableCallbacksUnvalidated(MockNetworkAgent agent) {
+ expectAvailableCallbacks(agent, false, false, TIMEOUT_MS);
+ }
+
+ // Expects the available callbacks (where the onCapabilitiesChanged must contain the
+ // VALIDATED capability), plus another onCapabilitiesChanged which is identical to the
+ // one we just sent.
+ // TODO: this is likely a bug. Fix it and remove this method.
+ void expectAvailableDoubleValidatedCallbacks(MockNetworkAgent agent) {
+ expectCallback(CallbackState.AVAILABLE, agent, TIMEOUT_MS);
+ NetworkCapabilities nc1 = expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, agent);
+ expectCallback(CallbackState.LINK_PROPERTIES, agent, TIMEOUT_MS);
+ NetworkCapabilities nc2 = expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, agent);
+ assertEquals(nc1, nc2);
+ }
+
+ // Expects the available callbacks where the onCapabilitiesChanged must not have validated,
+ // then expects another onCapabilitiesChanged that has the validated bit set. This is used
+ // when a network connects and satisfies a callback, and then immediately validates.
+ void expectAvailableThenValidatedCallbacks(MockNetworkAgent agent) {
+ expectAvailableCallbacksUnvalidated(agent);
expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, agent);
}
- void expectCapabilitiesWith(int capability, MockNetworkAgent agent) {
+ NetworkCapabilities expectCapabilitiesWith(int capability, MockNetworkAgent agent) {
CallbackInfo cbi = expectCallback(CallbackState.NETWORK_CAPABILITIES, agent);
NetworkCapabilities nc = (NetworkCapabilities) cbi.arg;
assertTrue(nc.hasCapability(capability));
+ return nc;
}
- void expectCapabilitiesWithout(int capability, MockNetworkAgent agent) {
+ NetworkCapabilities expectCapabilitiesWithout(int capability, MockNetworkAgent agent) {
CallbackInfo cbi = expectCallback(CallbackState.NETWORK_CAPABILITIES, agent);
NetworkCapabilities nc = (NetworkCapabilities) cbi.arg;
assertFalse(nc.hasCapability(capability));
+ return nc;
}
void assertNoCallback() {
@@ -1461,8 +1497,8 @@
ConditionVariable cv = waitForConnectivityBroadcasts(1);
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.connect(false);
- genericNetworkCallback.expectAvailableCallbacks(mCellNetworkAgent);
- cellNetworkCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ genericNetworkCallback.expectAvailableCallbacksUnvalidated(mCellNetworkAgent);
+ cellNetworkCallback.expectAvailableCallbacksUnvalidated(mCellNetworkAgent);
assertEquals(mCellNetworkAgent.getNetwork(), mCm.getActiveNetwork());
waitFor(cv);
assertNoCallbacks(genericNetworkCallback, wifiNetworkCallback, cellNetworkCallback);
@@ -1476,8 +1512,8 @@
cv = waitForConnectivityBroadcasts(2);
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(false);
- genericNetworkCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
- wifiNetworkCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ genericNetworkCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
+ wifiNetworkCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
assertEquals(mWiFiNetworkAgent.getNetwork(), mCm.getActiveNetwork());
waitFor(cv);
assertNoCallbacks(genericNetworkCallback, wifiNetworkCallback, cellNetworkCallback);
@@ -1500,8 +1536,8 @@
// Test validated networks
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.connect(true);
- genericNetworkCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
- cellNetworkCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ genericNetworkCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
+ cellNetworkCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
assertEquals(mCellNetworkAgent.getNetwork(), mCm.getActiveNetwork());
assertNoCallbacks(genericNetworkCallback, wifiNetworkCallback, cellNetworkCallback);
@@ -1513,10 +1549,10 @@
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(true);
- genericNetworkCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ genericNetworkCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
genericNetworkCallback.expectCallback(CallbackState.LOSING, mCellNetworkAgent);
genericNetworkCallback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
- wifiNetworkCallback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
+ wifiNetworkCallback.expectAvailableThenValidatedCallbacks(mWiFiNetworkAgent);
cellNetworkCallback.expectCallback(CallbackState.LOSING, mCellNetworkAgent);
assertEquals(mWiFiNetworkAgent.getNetwork(), mCm.getActiveNetwork());
assertNoCallbacks(genericNetworkCallback, wifiNetworkCallback, cellNetworkCallback);
@@ -1552,32 +1588,32 @@
mEthernetNetworkAgent.addCapability(NET_CAPABILITY_NOT_METERED);
mCellNetworkAgent.connect(true);
- callback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
- defaultCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ callback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
assertEquals(mCellNetworkAgent.getNetwork(), mCm.getActiveNetwork());
mWiFiNetworkAgent.connect(true);
// We get AVAILABLE on wifi when wifi connects and satisfies our unmetered request.
// We then get LOSING when wifi validates and cell is outscored.
- callback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
// TODO: Investigate sending validated before losing.
callback.expectCallback(CallbackState.LOSING, mCellNetworkAgent);
callback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
- defaultCallback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
assertEquals(mWiFiNetworkAgent.getNetwork(), mCm.getActiveNetwork());
mEthernetNetworkAgent.connect(true);
- callback.expectAvailableCallbacks(mEthernetNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mEthernetNetworkAgent);
// TODO: Investigate sending validated before losing.
callback.expectCallback(CallbackState.LOSING, mWiFiNetworkAgent);
callback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mEthernetNetworkAgent);
- defaultCallback.expectAvailableAndValidatedCallbacks(mEthernetNetworkAgent);
+ defaultCallback.expectAvailableDoubleValidatedCallbacks(mEthernetNetworkAgent);
assertEquals(mEthernetNetworkAgent.getNetwork(), mCm.getActiveNetwork());
mEthernetNetworkAgent.disconnect();
callback.expectCallback(CallbackState.LOST, mEthernetNetworkAgent);
defaultCallback.expectCallback(CallbackState.LOST, mEthernetNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableCallbacksValidated(mWiFiNetworkAgent);
for (int i = 0; i < 4; i++) {
MockNetworkAgent oldNetwork, newNetwork;
@@ -1594,7 +1630,7 @@
callback.expectCallback(CallbackState.LOSING, oldNetwork);
// TODO: should we send an AVAILABLE callback to newNetwork, to indicate that it is no
// longer lingering?
- defaultCallback.expectAvailableCallbacks(newNetwork);
+ defaultCallback.expectAvailableCallbacksValidated(newNetwork);
assertEquals(newNetwork.getNetwork(), mCm.getActiveNetwork());
}
assertEquals(mWiFiNetworkAgent.getNetwork(), mCm.getActiveNetwork());
@@ -1614,7 +1650,7 @@
// Disconnect our test networks.
mWiFiNetworkAgent.disconnect();
defaultCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
mCellNetworkAgent.disconnect();
defaultCallback.expectCallback(CallbackState.LOST, mCellNetworkAgent);
@@ -1630,22 +1666,22 @@
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.connect(false); // Score: 10
- callback.expectAvailableCallbacks(mCellNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksUnvalidated(mCellNetworkAgent);
assertEquals(mCellNetworkAgent.getNetwork(), mCm.getActiveNetwork());
// Bring up wifi with a score of 20.
// Cell stays up because it would satisfy the default request if it validated.
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(false); // Score: 20
- callback.expectAvailableCallbacks(mWiFiNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
assertEquals(mWiFiNetworkAgent.getNetwork(), mCm.getActiveNetwork());
mWiFiNetworkAgent.disconnect();
callback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
defaultCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksUnvalidated(mCellNetworkAgent);
assertEquals(mCellNetworkAgent.getNetwork(), mCm.getActiveNetwork());
// Bring up wifi with a score of 70.
@@ -1653,33 +1689,33 @@
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.adjustScore(50);
mWiFiNetworkAgent.connect(false); // Score: 70
- callback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
callback.expectCallback(CallbackState.LOSING, mCellNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
assertEquals(mWiFiNetworkAgent.getNetwork(), mCm.getActiveNetwork());
// Tear down wifi.
mWiFiNetworkAgent.disconnect();
callback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
defaultCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksUnvalidated(mCellNetworkAgent);
assertEquals(mCellNetworkAgent.getNetwork(), mCm.getActiveNetwork());
// Bring up wifi, then validate it. Previous versions would immediately tear down cell, but
// it's arguably correct to linger it, since it was the default network before it validated.
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(true);
- callback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
// TODO: Investigate sending validated before losing.
callback.expectCallback(CallbackState.LOSING, mCellNetworkAgent);
callback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
- defaultCallback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableThenValidatedCallbacks(mWiFiNetworkAgent);
assertEquals(mWiFiNetworkAgent.getNetwork(), mCm.getActiveNetwork());
mWiFiNetworkAgent.disconnect();
callback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
defaultCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksUnvalidated(mCellNetworkAgent);
mCellNetworkAgent.disconnect();
callback.expectCallback(CallbackState.LOST, mCellNetworkAgent);
defaultCallback.expectCallback(CallbackState.LOST, mCellNetworkAgent);
@@ -1687,12 +1723,12 @@
// If a network is lingering, and we add and remove a request from it, resume lingering.
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.connect(true);
- callback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
- defaultCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ callback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(true);
- defaultCallback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
- callback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
// TODO: Investigate sending validated before losing.
callback.expectCallback(CallbackState.LOSING, mCellNetworkAgent);
callback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
@@ -1711,7 +1747,7 @@
mWiFiNetworkAgent.disconnect();
callback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
defaultCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
// Cell is now the default network. Pin it with a cell-specific request.
noopCallback = new NetworkCallback(); // Can't reuse NetworkCallbacks. http://b/20701525
@@ -1720,8 +1756,8 @@
// Now connect wifi, and expect it to become the default network.
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(true);
- callback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
- defaultCallback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableThenValidatedCallbacks(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
// The default request is lingering on cell, but nothing happens to cell, and we send no
// callbacks for it, because it's kept up by cellRequest.
callback.assertNoCallback();
@@ -1737,14 +1773,14 @@
// Register a TRACK_DEFAULT request and check that it does not affect lingering.
TestNetworkCallback trackDefaultCallback = new TestNetworkCallback();
mCm.registerDefaultNetworkCallback(trackDefaultCallback);
- trackDefaultCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ trackDefaultCallback.expectAvailableCallbacksValidated(mWiFiNetworkAgent);
mEthernetNetworkAgent = new MockNetworkAgent(TRANSPORT_ETHERNET);
mEthernetNetworkAgent.connect(true);
- callback.expectAvailableCallbacks(mEthernetNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mEthernetNetworkAgent);
callback.expectCallback(CallbackState.LOSING, mWiFiNetworkAgent);
callback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mEthernetNetworkAgent);
- trackDefaultCallback.expectAvailableAndValidatedCallbacks(mEthernetNetworkAgent);
- defaultCallback.expectAvailableAndValidatedCallbacks(mEthernetNetworkAgent);
+ trackDefaultCallback.expectAvailableDoubleValidatedCallbacks(mEthernetNetworkAgent);
+ defaultCallback.expectAvailableDoubleValidatedCallbacks(mEthernetNetworkAgent);
// Let linger run its course.
callback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent, lingerTimeoutMs);
@@ -1771,13 +1807,13 @@
// Bring up validated cell.
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.connect(true);
- callback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ callback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
// Bring up unvalidated wifi with explicitlySelected=true.
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.explicitlySelected(false);
mWiFiNetworkAgent.connect(false);
- callback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
// Cell Remains the default.
assertEquals(mCellNetworkAgent.getNetwork(), mCm.getActiveNetwork());
@@ -1800,7 +1836,7 @@
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.explicitlySelected(false);
mWiFiNetworkAgent.connect(false);
- callback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
// If the user chooses no on the "No Internet access, stay connected?" dialog, we ask the
// network to disconnect.
@@ -1811,7 +1847,7 @@
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.explicitlySelected(false);
mWiFiNetworkAgent.connect(true);
- callback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
callback.expectCallback(CallbackState.LOSING, mCellNetworkAgent);
callback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
assertEquals(mWiFiNetworkAgent.getNetwork(), mCm.getActiveNetwork());
@@ -1820,7 +1856,7 @@
// TODO: fix this.
mEthernetNetworkAgent = new MockNetworkAgent(TRANSPORT_ETHERNET);
mEthernetNetworkAgent.connect(true);
- callback.expectAvailableAndValidatedCallbacks(mEthernetNetworkAgent);
+ callback.expectAvailableThenValidatedCallbacks(mEthernetNetworkAgent);
assertEquals(mEthernetNetworkAgent.getNetwork(), mCm.getActiveNetwork());
callback.assertNoCallback();
@@ -1993,7 +2029,7 @@
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.addCapability(NET_CAPABILITY_MMS);
mCellNetworkAgent.connectWithoutInternet();
- networkCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ networkCallback.expectAvailableCallbacksUnvalidated(mCellNetworkAgent);
verifyActiveNetwork(TRANSPORT_WIFI);
// Test releasing NetworkRequest disconnects cellular with MMS
@@ -2022,7 +2058,7 @@
MockNetworkAgent mmsNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mmsNetworkAgent.addCapability(NET_CAPABILITY_MMS);
mmsNetworkAgent.connectWithoutInternet();
- networkCallback.expectAvailableCallbacks(mmsNetworkAgent);
+ networkCallback.expectAvailableCallbacksUnvalidated(mmsNetworkAgent);
verifyActiveNetwork(TRANSPORT_CELLULAR);
// Test releasing MMS NetworkRequest does not disconnect main cellular NetworkAgent
@@ -2049,7 +2085,7 @@
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
String firstRedirectUrl = "http://example.com/firstPath";
mWiFiNetworkAgent.connectWithCaptivePortal(firstRedirectUrl);
- captivePortalCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ captivePortalCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
assertEquals(mWiFiNetworkAgent.waitForRedirectUrl(), firstRedirectUrl);
// Take down network.
@@ -2062,7 +2098,7 @@
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
String secondRedirectUrl = "http://example.com/secondPath";
mWiFiNetworkAgent.connectWithCaptivePortal(secondRedirectUrl);
- captivePortalCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ captivePortalCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
assertEquals(mWiFiNetworkAgent.waitForRedirectUrl(), secondRedirectUrl);
// Make captive portal disappear then revalidate.
@@ -2072,9 +2108,7 @@
captivePortalCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
// Expect NET_CAPABILITY_VALIDATED onAvailable callback.
- validatedCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
- // TODO: Investigate only sending available callbacks.
- validatedCallback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
+ validatedCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
// Break network connectivity.
// Expect NET_CAPABILITY_VALIDATED onLost callback.
@@ -2098,7 +2132,7 @@
// Bring up wifi.
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(true);
- validatedCallback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
+ validatedCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
Network wifiNetwork = mWiFiNetworkAgent.getNetwork();
// Check that calling startCaptivePortalApp does nothing.
@@ -2109,7 +2143,7 @@
// Turn into a captive portal.
mWiFiNetworkAgent.getWrappedNetworkMonitor().gen204ProbeResult = 302;
mCm.reportNetworkConnectivity(wifiNetwork, false);
- captivePortalCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ captivePortalCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
validatedCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
// Check that startCaptivePortalApp sends the expected intent.
@@ -2122,7 +2156,7 @@
mWiFiNetworkAgent.getWrappedNetworkMonitor().gen204ProbeResult = 204;
CaptivePortal c = (CaptivePortal) intent.getExtra(ConnectivityManager.EXTRA_CAPTIVE_PORTAL);
c.reportCaptivePortalDismissed();
- validatedCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ validatedCallback.expectAvailableCallbacksValidated(mWiFiNetworkAgent);
captivePortalCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
mCm.unregisterNetworkCallback(validatedCallback);
@@ -2165,7 +2199,7 @@
mWiFiNetworkAgent.connectWithCaptivePortal(secondRedirectUrl);
// Expect NET_CAPABILITY_VALIDATED onAvailable callback.
- validatedCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ validatedCallback.expectAvailableCallbacksValidated(mWiFiNetworkAgent);
// But there should be no CaptivePortal callback.
captivePortalCallback.assertNoCallback();
}
@@ -2203,14 +2237,14 @@
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(false);
- cEmpty1.expectAvailableCallbacks(mWiFiNetworkAgent);
- cEmpty2.expectAvailableCallbacks(mWiFiNetworkAgent);
- cEmpty3.expectAvailableCallbacks(mWiFiNetworkAgent);
- cEmpty4.expectAvailableCallbacks(mWiFiNetworkAgent);
+ cEmpty1.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
+ cEmpty2.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
+ cEmpty3.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
+ cEmpty4.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
assertNoCallbacks(cFoo, cBar);
mWiFiNetworkAgent.setNetworkSpecifier(new StringNetworkSpecifier("foo"));
- cFoo.expectAvailableCallbacks(mWiFiNetworkAgent);
+ cFoo.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
for (TestNetworkCallback c: emptyCallbacks) {
c.expectCallback(CallbackState.NETWORK_CAPABILITIES, mWiFiNetworkAgent);
}
@@ -2219,7 +2253,7 @@
mWiFiNetworkAgent.setNetworkSpecifier(new StringNetworkSpecifier("bar"));
cFoo.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
- cBar.expectAvailableCallbacks(mWiFiNetworkAgent);
+ cBar.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
for (TestNetworkCallback c: emptyCallbacks) {
c.expectCallback(CallbackState.NETWORK_CAPABILITIES, mWiFiNetworkAgent);
}
@@ -2348,14 +2382,14 @@
// Bring up cell and expect CALLBACK_AVAILABLE.
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.connect(true);
- cellNetworkCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
- defaultNetworkCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ cellNetworkCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
+ defaultNetworkCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
// Bring up wifi and expect CALLBACK_AVAILABLE.
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(true);
cellNetworkCallback.assertNoCallback();
- defaultNetworkCallback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
+ defaultNetworkCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
// Bring down cell. Expect no default network callback, since it wasn't the default.
mCellNetworkAgent.disconnect();
@@ -2365,7 +2399,7 @@
// Bring up cell. Expect no default network callback, since it won't be the default.
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.connect(true);
- cellNetworkCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ cellNetworkCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
defaultNetworkCallback.assertNoCallback();
// Bring down wifi. Expect the default network callback to notified of LOST wifi
@@ -2373,7 +2407,7 @@
mWiFiNetworkAgent.disconnect();
cellNetworkCallback.assertNoCallback();
defaultNetworkCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
- defaultNetworkCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultNetworkCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
mCellNetworkAgent.disconnect();
cellNetworkCallback.expectCallback(CallbackState.LOST, mCellNetworkAgent);
defaultNetworkCallback.expectCallback(CallbackState.LOST, mCellNetworkAgent);
@@ -2394,7 +2428,7 @@
// We should get onAvailable(), onCapabilitiesChanged(), and
// onLinkPropertiesChanged() in rapid succession. Additionally, we
// should get onCapabilitiesChanged() when the mobile network validates.
- cellNetworkCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ cellNetworkCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
cellNetworkCallback.assertNoCallback();
// Update LinkProperties.
@@ -2415,7 +2449,7 @@
mCm.registerDefaultNetworkCallback(dfltNetworkCallback);
// We should get onAvailable(), onCapabilitiesChanged(), onLinkPropertiesChanged(),
// as well as onNetworkSuspended() in rapid succession.
- dfltNetworkCallback.expectAvailableAndSuspendedCallbacks(mCellNetworkAgent);
+ dfltNetworkCallback.expectAvailableAndSuspendedCallbacks(mCellNetworkAgent, true);
dfltNetworkCallback.assertNoCallback();
mCm.unregisterNetworkCallback(dfltNetworkCallback);
@@ -2455,18 +2489,18 @@
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.connect(true);
- callback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
- fgCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ callback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
+ fgCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
assertTrue(isForegroundNetwork(mCellNetworkAgent));
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(true);
// When wifi connects, cell lingers.
- callback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ callback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
callback.expectCallback(CallbackState.LOSING, mCellNetworkAgent);
callback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
- fgCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ fgCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
fgCallback.expectCallback(CallbackState.LOSING, mCellNetworkAgent);
fgCallback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
assertTrue(isForegroundNetwork(mCellNetworkAgent));
@@ -2490,8 +2524,8 @@
// is currently delivered before the onAvailable() callbacks.
// TODO: Fix this.
cellCallback.expectCapabilitiesWith(NET_CAPABILITY_FOREGROUND, mCellNetworkAgent);
- cellCallback.expectAvailableCallbacks(mCellNetworkAgent);
- fgCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ cellCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
+ fgCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
// Expect a network capabilities update with FOREGROUND, because the most recent
// request causes its state to change.
callback.expectCapabilitiesWith(NET_CAPABILITY_FOREGROUND, mCellNetworkAgent);
@@ -2511,7 +2545,7 @@
mWiFiNetworkAgent.disconnect();
callback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
fgCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
- fgCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ fgCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
assertTrue(isForegroundNetwork(mCellNetworkAgent));
mCm.unregisterNetworkCallback(callback);
@@ -2651,7 +2685,7 @@
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
testFactory.expectAddRequests(2); // Because the cell request changes score twice.
mCellNetworkAgent.connect(true);
- cellNetworkCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ cellNetworkCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
testFactory.waitForNetworkRequests(2);
assertFalse(testFactory.getMyStartRequested()); // Because the cell network outscores us.
@@ -2742,16 +2776,15 @@
// Bring up validated cell.
mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
mCellNetworkAgent.connect(true);
- cellNetworkCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
- defaultCallback.expectAvailableAndValidatedCallbacks(mCellNetworkAgent);
+ cellNetworkCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
Network cellNetwork = mCellNetworkAgent.getNetwork();
// Bring up validated wifi.
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(true);
- defaultCallback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
- validatedWifiCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
- validatedWifiCallback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
+ defaultCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
+ validatedWifiCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
Network wifiNetwork = mWiFiNetworkAgent.getNetwork();
// Fail validation on wifi.
@@ -2772,18 +2805,18 @@
// that we switch back to cell.
tracker.configRestrictsAvoidBadWifi = false;
tracker.reevaluate();
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
assertEquals(mCm.getActiveNetwork(), cellNetwork);
// Switch back to a restrictive carrier.
tracker.configRestrictsAvoidBadWifi = true;
tracker.reevaluate();
- defaultCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
assertEquals(mCm.getActiveNetwork(), wifiNetwork);
// Simulate the user selecting "switch" on the dialog, and check that we switch to cell.
mCm.setAvoidUnvalidated(wifiNetwork);
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
assertFalse(mCm.getNetworkCapabilities(wifiNetwork).hasCapability(
NET_CAPABILITY_VALIDATED));
assertTrue(mCm.getNetworkCapabilities(cellNetwork).hasCapability(
@@ -2794,9 +2827,8 @@
mWiFiNetworkAgent.disconnect();
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(true);
- defaultCallback.expectAvailableAndValidatedCallbacks(mWiFiNetworkAgent);
- validatedWifiCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
- validatedWifiCallback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mWiFiNetworkAgent);
+ defaultCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
+ validatedWifiCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
wifiNetwork = mWiFiNetworkAgent.getNetwork();
// Fail validation on wifi and expect the dialog to appear.
@@ -2810,7 +2842,7 @@
tracker.reevaluate();
// We now switch to cell.
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
assertFalse(mCm.getNetworkCapabilities(wifiNetwork).hasCapability(
NET_CAPABILITY_VALIDATED));
assertTrue(mCm.getNetworkCapabilities(cellNetwork).hasCapability(
@@ -2821,17 +2853,17 @@
// We switch to wifi and then to cell.
Settings.Global.putString(cr, Settings.Global.NETWORK_AVOID_BAD_WIFI, null);
tracker.reevaluate();
- defaultCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
assertEquals(mCm.getActiveNetwork(), wifiNetwork);
Settings.Global.putInt(cr, Settings.Global.NETWORK_AVOID_BAD_WIFI, 1);
tracker.reevaluate();
- defaultCallback.expectAvailableCallbacks(mCellNetworkAgent);
+ defaultCallback.expectAvailableCallbacksValidated(mCellNetworkAgent);
assertEquals(mCm.getActiveNetwork(), cellNetwork);
// If cell goes down, we switch to wifi.
mCellNetworkAgent.disconnect();
defaultCallback.expectCallback(CallbackState.LOST, mCellNetworkAgent);
- defaultCallback.expectAvailableCallbacks(mWiFiNetworkAgent);
+ defaultCallback.expectAvailableCallbacksUnvalidated(mWiFiNetworkAgent);
validatedWifiCallback.assertNoCallback();
mCm.unregisterNetworkCallback(cellNetworkCallback);
@@ -2873,7 +2905,7 @@
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(false);
- networkCallback.expectAvailableCallbacks(mWiFiNetworkAgent, false, timeoutMs);
+ networkCallback.expectAvailableCallbacks(mWiFiNetworkAgent, false, false, timeoutMs);
// pass timeout and validate that UNAVAILABLE is not called
networkCallback.assertNoCallback();
@@ -2894,7 +2926,7 @@
mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
mWiFiNetworkAgent.connect(false);
final int assertTimeoutMs = 100;
- networkCallback.expectAvailableCallbacks(mWiFiNetworkAgent, false, assertTimeoutMs);
+ networkCallback.expectAvailableCallbacks(mWiFiNetworkAgent, false, false, assertTimeoutMs);
mWiFiNetworkAgent.disconnect();
networkCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
@@ -3381,7 +3413,7 @@
// Bring up wifi aware network.
wifiAware.connect(false, false);
- callback.expectAvailableCallbacks(wifiAware);
+ callback.expectAvailableCallbacksUnvalidated(wifiAware);
assertNull(mCm.getActiveNetworkInfo());
assertNull(mCm.getActiveNetwork());
diff --git a/tests/net/java/com/android/server/IpSecServiceParameterizedTest.java b/tests/net/java/com/android/server/IpSecServiceParameterizedTest.java
index 2282c13..1ddab5b 100644
--- a/tests/net/java/com/android/server/IpSecServiceParameterizedTest.java
+++ b/tests/net/java/com/android/server/IpSecServiceParameterizedTest.java
@@ -32,7 +32,6 @@
import android.net.IpSecConfig;
import android.net.IpSecManager;
import android.net.IpSecSpiResponse;
-import android.net.IpSecTransform;
import android.net.IpSecTransformResponse;
import android.net.NetworkUtils;
import android.os.Binder;
@@ -54,14 +53,14 @@
@RunWith(Parameterized.class)
public class IpSecServiceParameterizedTest {
- private static final int TEST_SPI_OUT = 0xD1201D;
- private static final int TEST_SPI_IN = TEST_SPI_OUT + 1;
+ private static final int TEST_SPI = 0xD1201D;
- private final String mRemoteAddr;
+ private final String mDestinationAddr;
+ private final String mSourceAddr;
@Parameterized.Parameters
public static Collection ipSecConfigs() {
- return Arrays.asList(new Object[][] {{"8.8.4.4"}, {"2601::10"}});
+ return Arrays.asList(new Object[][] {{"1.2.3.4", "8.8.4.4"}, {"2601::2", "2601::10"}});
}
private static final byte[] AEAD_KEY = {
@@ -96,11 +95,9 @@
private static final IpSecAlgorithm AEAD_ALGO =
new IpSecAlgorithm(IpSecAlgorithm.AUTH_CRYPT_AES_GCM, AEAD_KEY, 128);
- private static final int[] DIRECTIONS =
- new int[] {IpSecTransform.DIRECTION_IN, IpSecTransform.DIRECTION_OUT};
-
- public IpSecServiceParameterizedTest(String remoteAddr) {
- mRemoteAddr = remoteAddr;
+ public IpSecServiceParameterizedTest(String sourceAddr, String destAddr) {
+ mSourceAddr = sourceAddr;
+ mDestinationAddr = destAddr;
}
@Before
@@ -116,44 +113,30 @@
@Test
public void testIpSecServiceReserveSpi() throws Exception {
- when(mMockNetd.ipSecAllocateSpi(
- anyInt(),
- eq(IpSecTransform.DIRECTION_OUT),
- anyString(),
- eq(mRemoteAddr),
- eq(TEST_SPI_OUT)))
- .thenReturn(TEST_SPI_OUT);
+ when(mMockNetd.ipSecAllocateSpi(anyInt(), anyString(), eq(mDestinationAddr), eq(TEST_SPI)))
+ .thenReturn(TEST_SPI);
IpSecSpiResponse spiResp =
mIpSecService.allocateSecurityParameterIndex(
- IpSecTransform.DIRECTION_OUT, mRemoteAddr, TEST_SPI_OUT, new Binder());
+ mDestinationAddr, TEST_SPI, new Binder());
assertEquals(IpSecManager.Status.OK, spiResp.status);
- assertEquals(TEST_SPI_OUT, spiResp.spi);
+ assertEquals(TEST_SPI, spiResp.spi);
}
@Test
public void testReleaseSecurityParameterIndex() throws Exception {
- when(mMockNetd.ipSecAllocateSpi(
- anyInt(),
- eq(IpSecTransform.DIRECTION_OUT),
- anyString(),
- eq(mRemoteAddr),
- eq(TEST_SPI_OUT)))
- .thenReturn(TEST_SPI_OUT);
+ when(mMockNetd.ipSecAllocateSpi(anyInt(), anyString(), eq(mDestinationAddr), eq(TEST_SPI)))
+ .thenReturn(TEST_SPI);
IpSecSpiResponse spiResp =
mIpSecService.allocateSecurityParameterIndex(
- IpSecTransform.DIRECTION_OUT, mRemoteAddr, TEST_SPI_OUT, new Binder());
+ mDestinationAddr, TEST_SPI, new Binder());
mIpSecService.releaseSecurityParameterIndex(spiResp.resourceId);
verify(mMockNetd)
.ipSecDeleteSecurityAssociation(
- eq(spiResp.resourceId),
- anyInt(),
- anyString(),
- anyString(),
- eq(TEST_SPI_OUT));
+ eq(spiResp.resourceId), anyString(), anyString(), eq(TEST_SPI));
// Verify quota and RefcountedResource objects cleaned up
IpSecService.UserRecord userRecord =
@@ -169,17 +152,12 @@
@Test
public void testSecurityParameterIndexBinderDeath() throws Exception {
- when(mMockNetd.ipSecAllocateSpi(
- anyInt(),
- eq(IpSecTransform.DIRECTION_OUT),
- anyString(),
- eq(mRemoteAddr),
- eq(TEST_SPI_OUT)))
- .thenReturn(TEST_SPI_OUT);
+ when(mMockNetd.ipSecAllocateSpi(anyInt(), anyString(), eq(mDestinationAddr), eq(TEST_SPI)))
+ .thenReturn(TEST_SPI);
IpSecSpiResponse spiResp =
mIpSecService.allocateSecurityParameterIndex(
- IpSecTransform.DIRECTION_OUT, mRemoteAddr, TEST_SPI_OUT, new Binder());
+ mDestinationAddr, TEST_SPI, new Binder());
IpSecService.UserRecord userRecord =
mIpSecService.mUserResourceTracker.getUserRecord(Os.getuid());
@@ -190,11 +168,7 @@
verify(mMockNetd)
.ipSecDeleteSecurityAssociation(
- eq(spiResp.resourceId),
- anyInt(),
- anyString(),
- anyString(),
- eq(TEST_SPI_OUT));
+ eq(spiResp.resourceId), anyString(), anyString(), eq(TEST_SPI));
// Verify quota and RefcountedResource objects cleaned up
assertEquals(0, userRecord.mSpiQuotaTracker.mCurrent);
@@ -206,14 +180,12 @@
}
}
- private int getNewSpiResourceId(int direction, String remoteAddress, int returnSpi)
- throws Exception {
- when(mMockNetd.ipSecAllocateSpi(anyInt(), anyInt(), anyString(), anyString(), anyInt()))
+ private int getNewSpiResourceId(String remoteAddress, int returnSpi) throws Exception {
+ when(mMockNetd.ipSecAllocateSpi(anyInt(), anyString(), anyString(), anyInt()))
.thenReturn(returnSpi);
IpSecSpiResponse spi =
mIpSecService.allocateSecurityParameterIndex(
- direction,
NetworkUtils.numericToInetAddress(remoteAddress).getHostAddress(),
IpSecManager.INVALID_SECURITY_PARAMETER_INDEX,
new Binder());
@@ -221,20 +193,14 @@
}
private void addDefaultSpisAndRemoteAddrToIpSecConfig(IpSecConfig config) throws Exception {
- config.setSpiResourceId(
- IpSecTransform.DIRECTION_OUT,
- getNewSpiResourceId(IpSecTransform.DIRECTION_OUT, mRemoteAddr, TEST_SPI_OUT));
- config.setSpiResourceId(
- IpSecTransform.DIRECTION_IN,
- getNewSpiResourceId(IpSecTransform.DIRECTION_IN, mRemoteAddr, TEST_SPI_IN));
- config.setRemoteAddress(mRemoteAddr);
+ config.setSpiResourceId(getNewSpiResourceId(mDestinationAddr, TEST_SPI));
+ config.setSourceAddress(mSourceAddr);
+ config.setDestinationAddress(mDestinationAddr);
}
private void addAuthAndCryptToIpSecConfig(IpSecConfig config) throws Exception {
- for (int direction : DIRECTIONS) {
- config.setEncryption(direction, CRYPT_ALGO);
- config.setAuthentication(direction, AUTH_ALGO);
- }
+ config.setEncryption(CRYPT_ALGO);
+ config.setAuthentication(AUTH_ALGO);
}
@Test
@@ -251,32 +217,10 @@
.ipSecAddSecurityAssociation(
eq(createTransformResp.resourceId),
anyInt(),
- eq(IpSecTransform.DIRECTION_OUT),
anyString(),
anyString(),
anyLong(),
- eq(TEST_SPI_OUT),
- eq(IpSecAlgorithm.AUTH_HMAC_SHA256),
- eq(AUTH_KEY),
- anyInt(),
- eq(IpSecAlgorithm.CRYPT_AES_CBC),
- eq(CRYPT_KEY),
- anyInt(),
- eq(""),
- eq(new byte[] {}),
- eq(0),
- anyInt(),
- anyInt(),
- anyInt());
- verify(mMockNetd)
- .ipSecAddSecurityAssociation(
- eq(createTransformResp.resourceId),
- anyInt(),
- eq(IpSecTransform.DIRECTION_IN),
- anyString(),
- anyString(),
- anyLong(),
- eq(TEST_SPI_IN),
+ eq(TEST_SPI),
eq(IpSecAlgorithm.AUTH_HMAC_SHA256),
eq(AUTH_KEY),
anyInt(),
@@ -296,8 +240,7 @@
IpSecConfig ipSecConfig = new IpSecConfig();
addDefaultSpisAndRemoteAddrToIpSecConfig(ipSecConfig);
- ipSecConfig.setAuthenticatedEncryption(IpSecTransform.DIRECTION_OUT, AEAD_ALGO);
- ipSecConfig.setAuthenticatedEncryption(IpSecTransform.DIRECTION_IN, AEAD_ALGO);
+ ipSecConfig.setAuthenticatedEncryption(AEAD_ALGO);
IpSecTransformResponse createTransformResp =
mIpSecService.createTransportModeTransform(ipSecConfig, new Binder());
@@ -307,32 +250,10 @@
.ipSecAddSecurityAssociation(
eq(createTransformResp.resourceId),
anyInt(),
- eq(IpSecTransform.DIRECTION_OUT),
anyString(),
anyString(),
anyLong(),
- eq(TEST_SPI_OUT),
- eq(""),
- eq(new byte[] {}),
- eq(0),
- eq(""),
- eq(new byte[] {}),
- eq(0),
- eq(IpSecAlgorithm.AUTH_CRYPT_AES_GCM),
- eq(AEAD_KEY),
- anyInt(),
- anyInt(),
- anyInt(),
- anyInt());
- verify(mMockNetd)
- .ipSecAddSecurityAssociation(
- eq(createTransformResp.resourceId),
- anyInt(),
- eq(IpSecTransform.DIRECTION_IN),
- anyString(),
- anyString(),
- anyLong(),
- eq(TEST_SPI_IN),
+ eq(TEST_SPI),
eq(""),
eq(new byte[] {}),
eq(0),
@@ -359,18 +280,7 @@
verify(mMockNetd)
.ipSecDeleteSecurityAssociation(
- eq(createTransformResp.resourceId),
- eq(IpSecTransform.DIRECTION_OUT),
- anyString(),
- anyString(),
- eq(TEST_SPI_OUT));
- verify(mMockNetd)
- .ipSecDeleteSecurityAssociation(
- eq(createTransformResp.resourceId),
- eq(IpSecTransform.DIRECTION_IN),
- anyString(),
- anyString(),
- eq(TEST_SPI_IN));
+ eq(createTransformResp.resourceId), anyString(), anyString(), eq(TEST_SPI));
// Verify quota and RefcountedResource objects cleaned up
IpSecService.UserRecord userRecord =
@@ -404,18 +314,7 @@
verify(mMockNetd)
.ipSecDeleteSecurityAssociation(
- eq(createTransformResp.resourceId),
- eq(IpSecTransform.DIRECTION_OUT),
- anyString(),
- anyString(),
- eq(TEST_SPI_OUT));
- verify(mMockNetd)
- .ipSecDeleteSecurityAssociation(
- eq(createTransformResp.resourceId),
- eq(IpSecTransform.DIRECTION_IN),
- anyString(),
- anyString(),
- eq(TEST_SPI_IN));
+ eq(createTransformResp.resourceId), anyString(), anyString(), eq(TEST_SPI));
// Verify quota and RefcountedResource objects cleaned up
assertEquals(0, userRecord.mTransformQuotaTracker.mCurrent);
@@ -439,30 +338,22 @@
ParcelFileDescriptor pfd = ParcelFileDescriptor.fromSocket(new Socket());
int resourceId = createTransformResp.resourceId;
- mIpSecService.applyTransportModeTransform(pfd, resourceId);
+ mIpSecService.applyTransportModeTransform(pfd, IpSecManager.DIRECTION_OUT, resourceId);
verify(mMockNetd)
.ipSecApplyTransportModeTransform(
eq(pfd.getFileDescriptor()),
eq(resourceId),
- eq(IpSecTransform.DIRECTION_OUT),
+ eq(IpSecManager.DIRECTION_OUT),
anyString(),
anyString(),
- eq(TEST_SPI_OUT));
- verify(mMockNetd)
- .ipSecApplyTransportModeTransform(
- eq(pfd.getFileDescriptor()),
- eq(resourceId),
- eq(IpSecTransform.DIRECTION_IN),
- anyString(),
- anyString(),
- eq(TEST_SPI_IN));
+ eq(TEST_SPI));
}
@Test
public void testRemoveTransportModeTransform() throws Exception {
ParcelFileDescriptor pfd = ParcelFileDescriptor.fromSocket(new Socket());
- mIpSecService.removeTransportModeTransform(pfd, 1);
+ mIpSecService.removeTransportModeTransforms(pfd, 1);
verify(mMockNetd).ipSecRemoveTransportModeTransform(pfd.getFileDescriptor());
}
diff --git a/tests/net/java/com/android/server/IpSecServiceTest.java b/tests/net/java/com/android/server/IpSecServiceTest.java
index 0467989..b2a27e8 100644
--- a/tests/net/java/com/android/server/IpSecServiceTest.java
+++ b/tests/net/java/com/android/server/IpSecServiceTest.java
@@ -105,9 +105,6 @@
private static final IpSecAlgorithm AEAD_ALGO =
new IpSecAlgorithm(IpSecAlgorithm.AUTH_CRYPT_AES_GCM, AEAD_KEY, 128);
- private static final int[] DIRECTIONS =
- new int[] {IpSecTransform.DIRECTION_IN, IpSecTransform.DIRECTION_OUT};
-
static {
try {
INADDR_ANY = InetAddress.getByAddress(new byte[] {0, 0, 0, 0});
@@ -303,83 +300,75 @@
@Test
public void testValidateAlgorithmsAuth() {
- for (int direction : DIRECTIONS) {
- // Validate that correct algorithm type succeeds
- IpSecConfig config = new IpSecConfig();
- config.setAuthentication(direction, AUTH_ALGO);
- mIpSecService.validateAlgorithms(config, direction);
+ // Validate that correct algorithm type succeeds
+ IpSecConfig config = new IpSecConfig();
+ config.setAuthentication(AUTH_ALGO);
+ mIpSecService.validateAlgorithms(config);
- // Validate that incorrect algorithm types fails
- for (IpSecAlgorithm algo : new IpSecAlgorithm[] {CRYPT_ALGO, AEAD_ALGO}) {
- try {
- config = new IpSecConfig();
- config.setAuthentication(direction, algo);
- mIpSecService.validateAlgorithms(config, direction);
- fail("Did not throw exception on invalid algorithm type");
- } catch (IllegalArgumentException expected) {
- }
+ // Validate that incorrect algorithm types fails
+ for (IpSecAlgorithm algo : new IpSecAlgorithm[] {CRYPT_ALGO, AEAD_ALGO}) {
+ try {
+ config = new IpSecConfig();
+ config.setAuthentication(algo);
+ mIpSecService.validateAlgorithms(config);
+ fail("Did not throw exception on invalid algorithm type");
+ } catch (IllegalArgumentException expected) {
}
}
}
@Test
public void testValidateAlgorithmsCrypt() {
- for (int direction : DIRECTIONS) {
- // Validate that correct algorithm type succeeds
- IpSecConfig config = new IpSecConfig();
- config.setEncryption(direction, CRYPT_ALGO);
- mIpSecService.validateAlgorithms(config, direction);
+ // Validate that correct algorithm type succeeds
+ IpSecConfig config = new IpSecConfig();
+ config.setEncryption(CRYPT_ALGO);
+ mIpSecService.validateAlgorithms(config);
- // Validate that incorrect algorithm types fails
- for (IpSecAlgorithm algo : new IpSecAlgorithm[] {AUTH_ALGO, AEAD_ALGO}) {
- try {
- config = new IpSecConfig();
- config.setEncryption(direction, algo);
- mIpSecService.validateAlgorithms(config, direction);
- fail("Did not throw exception on invalid algorithm type");
- } catch (IllegalArgumentException expected) {
- }
+ // Validate that incorrect algorithm types fails
+ for (IpSecAlgorithm algo : new IpSecAlgorithm[] {AUTH_ALGO, AEAD_ALGO}) {
+ try {
+ config = new IpSecConfig();
+ config.setEncryption(algo);
+ mIpSecService.validateAlgorithms(config);
+ fail("Did not throw exception on invalid algorithm type");
+ } catch (IllegalArgumentException expected) {
}
}
}
@Test
public void testValidateAlgorithmsAead() {
- for (int direction : DIRECTIONS) {
- // Validate that correct algorithm type succeeds
- IpSecConfig config = new IpSecConfig();
- config.setAuthenticatedEncryption(direction, AEAD_ALGO);
- mIpSecService.validateAlgorithms(config, direction);
+ // Validate that correct algorithm type succeeds
+ IpSecConfig config = new IpSecConfig();
+ config.setAuthenticatedEncryption(AEAD_ALGO);
+ mIpSecService.validateAlgorithms(config);
- // Validate that incorrect algorithm types fails
- for (IpSecAlgorithm algo : new IpSecAlgorithm[] {AUTH_ALGO, CRYPT_ALGO}) {
- try {
- config = new IpSecConfig();
- config.setAuthenticatedEncryption(direction, algo);
- mIpSecService.validateAlgorithms(config, direction);
- fail("Did not throw exception on invalid algorithm type");
- } catch (IllegalArgumentException expected) {
- }
+ // Validate that incorrect algorithm types fails
+ for (IpSecAlgorithm algo : new IpSecAlgorithm[] {AUTH_ALGO, CRYPT_ALGO}) {
+ try {
+ config = new IpSecConfig();
+ config.setAuthenticatedEncryption(algo);
+ mIpSecService.validateAlgorithms(config);
+ fail("Did not throw exception on invalid algorithm type");
+ } catch (IllegalArgumentException expected) {
}
}
}
@Test
public void testValidateAlgorithmsAuthCrypt() {
- for (int direction : DIRECTIONS) {
- // Validate that correct algorithm type succeeds
- IpSecConfig config = new IpSecConfig();
- config.setAuthentication(direction, AUTH_ALGO);
- config.setEncryption(direction, CRYPT_ALGO);
- mIpSecService.validateAlgorithms(config, direction);
- }
+ // Validate that correct algorithm type succeeds
+ IpSecConfig config = new IpSecConfig();
+ config.setAuthentication(AUTH_ALGO);
+ config.setEncryption(CRYPT_ALGO);
+ mIpSecService.validateAlgorithms(config);
}
@Test
public void testValidateAlgorithmsNoAlgorithms() {
IpSecConfig config = new IpSecConfig();
try {
- mIpSecService.validateAlgorithms(config, IpSecTransform.DIRECTION_IN);
+ mIpSecService.validateAlgorithms(config);
fail("Expected exception; no algorithms specified");
} catch (IllegalArgumentException expected) {
}
@@ -388,10 +377,10 @@
@Test
public void testValidateAlgorithmsAeadWithAuth() {
IpSecConfig config = new IpSecConfig();
- config.setAuthenticatedEncryption(IpSecTransform.DIRECTION_IN, AEAD_ALGO);
- config.setAuthentication(IpSecTransform.DIRECTION_IN, AUTH_ALGO);
+ config.setAuthenticatedEncryption(AEAD_ALGO);
+ config.setAuthentication(AUTH_ALGO);
try {
- mIpSecService.validateAlgorithms(config, IpSecTransform.DIRECTION_IN);
+ mIpSecService.validateAlgorithms(config);
fail("Expected exception; both AEAD and auth algorithm specified");
} catch (IllegalArgumentException expected) {
}
@@ -400,10 +389,10 @@
@Test
public void testValidateAlgorithmsAeadWithCrypt() {
IpSecConfig config = new IpSecConfig();
- config.setAuthenticatedEncryption(IpSecTransform.DIRECTION_IN, AEAD_ALGO);
- config.setEncryption(IpSecTransform.DIRECTION_IN, CRYPT_ALGO);
+ config.setAuthenticatedEncryption(AEAD_ALGO);
+ config.setEncryption(CRYPT_ALGO);
try {
- mIpSecService.validateAlgorithms(config, IpSecTransform.DIRECTION_IN);
+ mIpSecService.validateAlgorithms(config);
fail("Expected exception; both AEAD and crypt algorithm specified");
} catch (IllegalArgumentException expected) {
}
@@ -412,11 +401,11 @@
@Test
public void testValidateAlgorithmsAeadWithAuthAndCrypt() {
IpSecConfig config = new IpSecConfig();
- config.setAuthenticatedEncryption(IpSecTransform.DIRECTION_IN, AEAD_ALGO);
- config.setAuthentication(IpSecTransform.DIRECTION_IN, AUTH_ALGO);
- config.setEncryption(IpSecTransform.DIRECTION_IN, CRYPT_ALGO);
+ config.setAuthenticatedEncryption(AEAD_ALGO);
+ config.setAuthentication(AUTH_ALGO);
+ config.setEncryption(CRYPT_ALGO);
try {
- mIpSecService.validateAlgorithms(config, IpSecTransform.DIRECTION_IN);
+ mIpSecService.validateAlgorithms(config);
fail("Expected exception; AEAD, auth and crypt algorithm specified");
} catch (IllegalArgumentException expected) {
}
@@ -434,7 +423,7 @@
@Test
public void testRemoveTransportModeTransform() throws Exception {
ParcelFileDescriptor pfd = ParcelFileDescriptor.fromSocket(new Socket());
- mIpSecService.removeTransportModeTransform(pfd, 1);
+ mIpSecService.removeTransportModeTransforms(pfd, 1);
verify(mMockNetd).ipSecRemoveTransportModeTransform(pfd.getFileDescriptor());
}
@@ -447,7 +436,7 @@
try {
IpSecSpiResponse spiResp =
mIpSecService.allocateSecurityParameterIndex(
- IpSecTransform.DIRECTION_OUT, address, DROID_SPI, new Binder());
+ address, DROID_SPI, new Binder());
fail("Invalid address was passed through IpSecService validation: " + address);
} catch (IllegalArgumentException e) {
} catch (Exception e) {
@@ -519,7 +508,6 @@
// tracks the resource ID.
when(mMockNetd.ipSecAllocateSpi(
anyInt(),
- eq(IpSecTransform.DIRECTION_OUT),
anyString(),
eq(InetAddress.getLoopbackAddress().getHostAddress()),
anyInt()))
@@ -528,7 +516,6 @@
for (int i = 0; i < MAX_NUM_SPIS; i++) {
IpSecSpiResponse newSpi =
mIpSecService.allocateSecurityParameterIndex(
- 0x1,
InetAddress.getLoopbackAddress().getHostAddress(),
DROID_SPI + i,
new Binder());
@@ -544,7 +531,6 @@
// Try to reserve one more SPI, and should fail.
IpSecSpiResponse extraSpi =
mIpSecService.allocateSecurityParameterIndex(
- 0x1,
InetAddress.getLoopbackAddress().getHostAddress(),
DROID_SPI + MAX_NUM_SPIS,
new Binder());
@@ -558,7 +544,6 @@
// Should successfully reserve one more spi.
extraSpi =
mIpSecService.allocateSecurityParameterIndex(
- 0x1,
InetAddress.getLoopbackAddress().getHostAddress(),
DROID_SPI + MAX_NUM_SPIS,
new Binder());
diff --git a/tools/stats_log_api_gen/Collation.cpp b/tools/stats_log_api_gen/Collation.cpp
index 80853b1..0e57f7f 100644
--- a/tools/stats_log_api_gen/Collation.cpp
+++ b/tools/stats_log_api_gen/Collation.cpp
@@ -15,6 +15,7 @@
*/
#include "Collation.h"
+#include "frameworks/base/cmds/statsd/src/atoms.pb.h"
#include <stdio.h>
#include <map>
@@ -137,6 +138,16 @@
}
/**
+ * Gather the enums info.
+ */
+void collate_enums(const EnumDescriptor &enumDescriptor, AtomField *atomField) {
+ for (int i = 0; i < enumDescriptor.value_count(); i++) {
+ atomField->enumValues[enumDescriptor.value(i)->number()] =
+ enumDescriptor.value(i)->name().c_str();
+ }
+}
+
+/**
* Gather the info about an atom proto.
*/
int collate_atom(const Descriptor *atom, AtomDecl *atomDecl,
@@ -221,11 +232,7 @@
if (javaType == JAVA_TYPE_ENUM) {
// All enums are treated as ints when it comes to function signatures.
signature->push_back(JAVA_TYPE_INT);
- const EnumDescriptor *enumDescriptor = field->enum_type();
- for (int i = 0; i < enumDescriptor->value_count(); i++) {
- atField.enumValues[enumDescriptor->value(i)->number()] =
- enumDescriptor->value(i)->name().c_str();
- }
+ collate_enums(*field->enum_type(), &atField);
} else {
signature->push_back(javaType);
}
@@ -235,6 +242,53 @@
return errorCount;
}
+// This function flattens the fields of the AttributionNode proto in an Atom proto and generates
+// the corresponding atom decl and signature.
+bool get_non_chained_node(const Descriptor *atom, AtomDecl *atomDecl,
+ vector<java_type_t> *signature) {
+ // Build a sorted list of the fields. Descriptor has them in source file
+ // order.
+ map<int, const FieldDescriptor *> fields;
+ for (int j = 0; j < atom->field_count(); j++) {
+ const FieldDescriptor *field = atom->field(j);
+ fields[field->number()] = field;
+ }
+
+ AtomDecl attributionDecl;
+ vector<java_type_t> attributionSignature;
+ collate_atom(android::os::statsd::AttributionNode::descriptor(),
+ &attributionDecl, &attributionSignature);
+
+ // Build the type signature and the atom data.
+ bool has_attribution_node = false;
+ for (map<int, const FieldDescriptor *>::const_iterator it = fields.begin();
+ it != fields.end(); it++) {
+ const FieldDescriptor *field = it->second;
+ java_type_t javaType = java_type(field);
+ if (javaType == JAVA_TYPE_ATTRIBUTION_CHAIN) {
+ atomDecl->fields.insert(
+ atomDecl->fields.end(),
+ attributionDecl.fields.begin(), attributionDecl.fields.end());
+ signature->insert(
+ signature->end(),
+ attributionSignature.begin(), attributionSignature.end());
+ has_attribution_node = true;
+
+ } else {
+ AtomField atField(field->name(), javaType);
+ if (javaType == JAVA_TYPE_ENUM) {
+ // All enums are treated as ints when it comes to function signatures.
+ signature->push_back(JAVA_TYPE_INT);
+ collate_enums(*field->enum_type(), &atField);
+ } else {
+ signature->push_back(javaType);
+ }
+ atomDecl->fields.push_back(atField);
+ }
+ }
+ return has_attribution_node;
+}
+
/**
* Gather the info about the atoms.
*/
@@ -266,6 +320,13 @@
errorCount += collate_atom(atom, &atomDecl, &signature);
atoms->signatures.insert(signature);
atoms->decls.insert(atomDecl);
+
+ AtomDecl nonChainedAtomDecl(atomField->number(), atomField->name(), atom->name());
+ vector<java_type_t> nonChainedSignature;
+ if (get_non_chained_node(atom, &nonChainedAtomDecl, &nonChainedSignature)) {
+ atoms->non_chained_signatures.insert(nonChainedSignature);
+ atoms->non_chained_decls.insert(nonChainedAtomDecl);
+ }
}
if (dbg) {
diff --git a/tools/stats_log_api_gen/Collation.h b/tools/stats_log_api_gen/Collation.h
index cd0625c..0455eca 100644
--- a/tools/stats_log_api_gen/Collation.h
+++ b/tools/stats_log_api_gen/Collation.h
@@ -32,6 +32,7 @@
using std::string;
using std::vector;
using google::protobuf::Descriptor;
+using google::protobuf::FieldDescriptor;
/**
* The types for atom parameters.
@@ -93,14 +94,15 @@
struct Atoms {
set<vector<java_type_t>> signatures;
set<AtomDecl> decls;
+ set<AtomDecl> non_chained_decls;
+ set<vector<java_type_t>> non_chained_signatures;
};
/**
* Gather the information about the atoms. Returns the number of errors.
*/
int collate_atoms(const Descriptor* descriptor, Atoms* atoms);
-int collate_atom(const Descriptor *atom, AtomDecl *atomDecl,
- vector<java_type_t> *signature);
+int collate_atom(const Descriptor *atom, AtomDecl *atomDecl, vector<java_type_t> *signature);
} // namespace stats_log_api_gen
} // namespace android
diff --git a/tools/stats_log_api_gen/main.cpp b/tools/stats_log_api_gen/main.cpp
index bbe6d63..e0e6b58 100644
--- a/tools/stats_log_api_gen/main.cpp
+++ b/tools/stats_log_api_gen/main.cpp
@@ -195,6 +195,47 @@
fprintf(out, "\n");
}
+ for (set<vector<java_type_t>>::const_iterator signature = atoms.non_chained_signatures.begin();
+ signature != atoms.non_chained_signatures.end(); signature++) {
+ int argIndex;
+
+ fprintf(out, "void\n");
+ fprintf(out, "stats_write_non_chained(int32_t code");
+ argIndex = 1;
+ for (vector<java_type_t>::const_iterator arg = signature->begin();
+ arg != signature->end(); arg++) {
+ fprintf(out, ", %s arg%d", cpp_type_name(*arg), argIndex);
+ argIndex++;
+ }
+ fprintf(out, ")\n");
+
+ fprintf(out, "{\n");
+ argIndex = 1;
+ fprintf(out, " android_log_event_list event(kStatsEventTag);\n");
+ fprintf(out, " event << code;\n\n");
+ for (vector<java_type_t>::const_iterator arg = signature->begin();
+ arg != signature->end(); arg++) {
+ if (argIndex == 1) {
+ fprintf(out, " event.begin();\n\n");
+ fprintf(out, " event.begin();\n");
+ }
+ if (*arg == JAVA_TYPE_STRING) {
+ fprintf(out, " if (arg%d == NULL) {\n", argIndex);
+ fprintf(out, " arg%d = \"\";\n", argIndex);
+ fprintf(out, " }\n");
+ }
+ fprintf(out, " event << arg%d;\n", argIndex);
+ if (argIndex == 2) {
+ fprintf(out, " event.end();\n\n");
+ fprintf(out, " event.end();\n\n");
+ }
+ argIndex++;
+ }
+
+ fprintf(out, " event.write(LOG_ID_STATS);\n");
+ fprintf(out, "}\n");
+ fprintf(out, "\n");
+ }
// Print footer
fprintf(out, "\n");
fprintf(out, "} // namespace util\n");
@@ -203,6 +244,68 @@
return 0;
}
+void build_non_chained_decl_map(const Atoms& atoms,
+ std::map<int, set<AtomDecl>::const_iterator>* decl_map){
+ for (set<AtomDecl>::const_iterator atom = atoms.non_chained_decls.begin();
+ atom != atoms.non_chained_decls.end(); atom++) {
+ decl_map->insert(std::make_pair(atom->code, atom));
+ }
+}
+
+static void write_cpp_usage(
+ FILE* out, const string& method_name, const string& atom_code_name,
+ const AtomDecl& atom, const AtomDecl &attributionDecl) {
+ fprintf(out, " * Usage: %s(StatsLog.%s", method_name.c_str(), atom_code_name.c_str());
+ for (vector<AtomField>::const_iterator field = atom.fields.begin();
+ field != atom.fields.end(); field++) {
+ if (field->javaType == JAVA_TYPE_ATTRIBUTION_CHAIN) {
+ for (auto chainField : attributionDecl.fields) {
+ if (chainField.javaType == JAVA_TYPE_STRING) {
+ fprintf(out, ", const std::vector<%s>& %s",
+ cpp_type_name(chainField.javaType),
+ chainField.name.c_str());
+ } else {
+ fprintf(out, ", const %s* %s, size_t %s_length",
+ cpp_type_name(chainField.javaType),
+ chainField.name.c_str(), chainField.name.c_str());
+ }
+ }
+ } else {
+ fprintf(out, ", %s %s", cpp_type_name(field->javaType), field->name.c_str());
+ }
+ }
+ fprintf(out, ");\n");
+}
+
+static void write_cpp_method_header(
+ FILE* out, const string& method_name, const set<vector<java_type_t>>& signatures,
+ const AtomDecl &attributionDecl) {
+ for (set<vector<java_type_t>>::const_iterator signature = signatures.begin();
+ signature != signatures.end(); signature++) {
+ fprintf(out, "void %s(int32_t code ", method_name.c_str());
+ int argIndex = 1;
+ for (vector<java_type_t>::const_iterator arg = signature->begin();
+ arg != signature->end(); arg++) {
+ if (*arg == JAVA_TYPE_ATTRIBUTION_CHAIN) {
+ for (auto chainField : attributionDecl.fields) {
+ if (chainField.javaType == JAVA_TYPE_STRING) {
+ fprintf(out, ", const std::vector<%s>& %s",
+ cpp_type_name(chainField.javaType), chainField.name.c_str());
+ } else {
+ fprintf(out, ", const %s* %s, size_t %s_length",
+ cpp_type_name(chainField.javaType),
+ chainField.name.c_str(), chainField.name.c_str());
+ }
+ }
+ } else {
+ fprintf(out, ", %s arg%d", cpp_type_name(*arg), argIndex);
+ }
+ argIndex++;
+ }
+ fprintf(out, ");\n");
+
+ }
+}
static int
write_stats_log_header(FILE* out, const Atoms& atoms, const AtomDecl &attributionDecl)
@@ -228,6 +331,9 @@
fprintf(out, " */\n");
fprintf(out, "enum {\n");
+ std::map<int, set<AtomDecl>::const_iterator> atom_code_to_non_chained_decl_map;
+ build_non_chained_decl_map(atoms, &atom_code_to_non_chained_decl_map);
+
size_t i = 0;
// Print constants
for (set<AtomDecl>::const_iterator atom = atoms.decls.begin();
@@ -236,26 +342,13 @@
fprintf(out, "\n");
fprintf(out, " /**\n");
fprintf(out, " * %s %s\n", atom->message.c_str(), atom->name.c_str());
- fprintf(out, " * Usage: stats_write(StatsLog.%s", constant.c_str());
- for (vector<AtomField>::const_iterator field = atom->fields.begin();
- field != atom->fields.end(); field++) {
- if (field->javaType == JAVA_TYPE_ATTRIBUTION_CHAIN) {
- for (auto chainField : attributionDecl.fields) {
- if (chainField.javaType == JAVA_TYPE_STRING) {
- fprintf(out, ", const std::vector<%s>& %s",
- cpp_type_name(chainField.javaType),
- chainField.name.c_str());
- } else {
- fprintf(out, ", const %s* %s, size_t %s_length",
- cpp_type_name(chainField.javaType),
- chainField.name.c_str(), chainField.name.c_str());
- }
- }
- } else {
- fprintf(out, ", %s %s", cpp_type_name(field->javaType), field->name.c_str());
- }
+ write_cpp_usage(out, "stats_write", constant, *atom, attributionDecl);
+
+ auto non_chained_decl = atom_code_to_non_chained_decl_map.find(atom->code);
+ if (non_chained_decl != atom_code_to_non_chained_decl_map.end()) {
+ write_cpp_usage(out, "stats_write_non_chained", constant, *non_chained_decl->second,
+ attributionDecl);
}
- fprintf(out, ");\n");
fprintf(out, " */\n");
char const* const comma = (i == atoms.decls.size() - 1) ? "" : ",";
fprintf(out, " %s = %d%s\n", constant.c_str(), atom->code, comma);
@@ -274,30 +367,13 @@
fprintf(out, "//\n");
fprintf(out, "// Write methods\n");
fprintf(out, "//\n");
- for (set<vector<java_type_t>>::const_iterator signature = atoms.signatures.begin();
- signature != atoms.signatures.end(); signature++) {
- fprintf(out, "void stats_write(int32_t code ");
- int argIndex = 1;
- for (vector<java_type_t>::const_iterator arg = signature->begin();
- arg != signature->end(); arg++) {
- if (*arg == JAVA_TYPE_ATTRIBUTION_CHAIN) {
- for (auto chainField : attributionDecl.fields) {
- if (chainField.javaType == JAVA_TYPE_STRING) {
- fprintf(out, ", const std::vector<%s>& %s",
- cpp_type_name(chainField.javaType), chainField.name.c_str());
- } else {
- fprintf(out, ", const %s* %s, size_t %s_length",
- cpp_type_name(chainField.javaType),
- chainField.name.c_str(), chainField.name.c_str());
- }
- }
- } else {
- fprintf(out, ", %s arg%d", cpp_type_name(*arg), argIndex);
- }
- argIndex++;
- }
- fprintf(out, ");\n");
- }
+ write_cpp_method_header(out, "stats_write", atoms.signatures, attributionDecl);
+
+ fprintf(out, "//\n");
+ fprintf(out, "// Write flattened methods\n");
+ fprintf(out, "//\n");
+ write_cpp_method_header(out, "stats_write_non_chained", atoms.non_chained_signatures,
+ attributionDecl);
fprintf(out, "\n");
fprintf(out, "} // namespace util\n");
@@ -306,6 +382,49 @@
return 0;
}
+static void write_java_usage(
+ FILE* out, const string& method_name, const string& atom_code_name,
+ const AtomDecl& atom, const AtomDecl &attributionDecl) {
+ fprintf(out, " * Usage: StatsLog.%s(StatsLog.%s",
+ method_name.c_str(), atom_code_name.c_str());
+ for (vector<AtomField>::const_iterator field = atom.fields.begin();
+ field != atom.fields.end(); field++) {
+ if (field->javaType == JAVA_TYPE_ATTRIBUTION_CHAIN) {
+ for (auto chainField : attributionDecl.fields) {
+ fprintf(out, ", %s[] %s",
+ java_type_name(chainField.javaType), chainField.name.c_str());
+ }
+ } else {
+ fprintf(out, ", %s %s", java_type_name(field->javaType), field->name.c_str());
+ }
+ }
+ fprintf(out, ");\n");
+}
+
+static void write_java_method(
+ FILE* out, const string& method_name, const set<vector<java_type_t>>& signatures,
+ const AtomDecl &attributionDecl) {
+ for (set<vector<java_type_t>>::const_iterator signature = signatures.begin();
+ signature != signatures.end(); signature++) {
+ fprintf(out, " public static native void %s(int code", method_name.c_str());
+ int argIndex = 1;
+ for (vector<java_type_t>::const_iterator arg = signature->begin();
+ arg != signature->end(); arg++) {
+ if (*arg == JAVA_TYPE_ATTRIBUTION_CHAIN) {
+ for (auto chainField : attributionDecl.fields) {
+ fprintf(out, ", %s[] %s",
+ java_type_name(chainField.javaType), chainField.name.c_str());
+ }
+ } else {
+ fprintf(out, ", %s arg%d", java_type_name(*arg), argIndex);
+ }
+ argIndex++;
+ }
+ fprintf(out, ");\n");
+ }
+}
+
+
static int
write_stats_log_java(FILE* out, const Atoms& atoms, const AtomDecl &attributionDecl)
{
@@ -322,6 +441,9 @@
fprintf(out, "public class StatsLogInternal {\n");
fprintf(out, " // Constants for atom codes.\n");
+ std::map<int, set<AtomDecl>::const_iterator> atom_code_to_non_chained_decl_map;
+ build_non_chained_decl_map(atoms, &atom_code_to_non_chained_decl_map);
+
// Print constants for the atom codes.
for (set<AtomDecl>::const_iterator atom = atoms.decls.begin();
atom != atoms.decls.end(); atom++) {
@@ -329,19 +451,12 @@
fprintf(out, "\n");
fprintf(out, " /**\n");
fprintf(out, " * %s %s\n", atom->message.c_str(), atom->name.c_str());
- fprintf(out, " * Usage: StatsLog.write(StatsLog.%s", constant.c_str());
- for (vector<AtomField>::const_iterator field = atom->fields.begin();
- field != atom->fields.end(); field++) {
- if (field->javaType == JAVA_TYPE_ATTRIBUTION_CHAIN) {
- for (auto chainField : attributionDecl.fields) {
- fprintf(out, ", %s[] %s",
- java_type_name(chainField.javaType), chainField.name.c_str());
- }
- } else {
- fprintf(out, ", %s %s", java_type_name(field->javaType), field->name.c_str());
- }
+ write_java_usage(out, "write", constant, *atom, attributionDecl);
+ auto non_chained_decl = atom_code_to_non_chained_decl_map.find(atom->code);
+ if (non_chained_decl != atom_code_to_non_chained_decl_map.end()) {
+ write_java_usage(out, "write_non_chained", constant, *non_chained_decl->second,
+ attributionDecl);
}
- fprintf(out, ");\n");
fprintf(out, " */\n");
fprintf(out, " public static final int %s = %d;\n", constant.c_str(), atom->code);
}
@@ -371,24 +486,8 @@
// Print write methods
fprintf(out, " // Write methods\n");
- for (set<vector<java_type_t>>::const_iterator signature = atoms.signatures.begin();
- signature != atoms.signatures.end(); signature++) {
- fprintf(out, " public static native void write(int code");
- int argIndex = 1;
- for (vector<java_type_t>::const_iterator arg = signature->begin();
- arg != signature->end(); arg++) {
- if (*arg == JAVA_TYPE_ATTRIBUTION_CHAIN) {
- for (auto chainField : attributionDecl.fields) {
- fprintf(out, ", %s[] %s",
- java_type_name(chainField.javaType), chainField.name.c_str());
- }
- } else {
- fprintf(out, ", %s arg%d", java_type_name(*arg), argIndex);
- }
- argIndex++;
- }
- fprintf(out, ");\n");
- }
+ write_java_method(out, "write", atoms.signatures, attributionDecl);
+ write_java_method(out, "write_non_chained", atoms.non_chained_signatures, attributionDecl);
fprintf(out, "}\n");
@@ -431,9 +530,9 @@
}
static string
-jni_function_name(const vector<java_type_t>& signature)
+jni_function_name(const string& method_name, const vector<java_type_t>& signature)
{
- string result("StatsLog_write");
+ string result("StatsLog_" + method_name);
for (vector<java_type_t>::const_iterator arg = signature.begin();
arg != signature.end(); arg++) {
switch (*arg) {
@@ -509,34 +608,17 @@
}
static int
-write_stats_log_jni(FILE* out, const Atoms& atoms, const AtomDecl &attributionDecl)
+write_stats_log_jni(FILE* out, const string& java_method_name, const string& cpp_method_name,
+ const set<vector<java_type_t>>& signatures, const AtomDecl &attributionDecl)
{
- // Print prelude
- fprintf(out, "// This file is autogenerated\n");
- fprintf(out, "\n");
-
- fprintf(out, "#include <statslog.h>\n");
- fprintf(out, "\n");
- fprintf(out, "#include <nativehelper/JNIHelp.h>\n");
- fprintf(out, "#include <nativehelper/ScopedUtfChars.h>\n");
- fprintf(out, "#include <utils/Vector.h>\n");
- fprintf(out, "#include \"core_jni_helpers.h\"\n");
- fprintf(out, "#include \"jni.h\"\n");
- fprintf(out, "\n");
- fprintf(out, "#define UNUSED __attribute__((__unused__))\n");
- fprintf(out, "\n");
-
- fprintf(out, "namespace android {\n");
- fprintf(out, "\n");
-
// Print write methods
- for (set<vector<java_type_t>>::const_iterator signature = atoms.signatures.begin();
- signature != atoms.signatures.end(); signature++) {
+ for (set<vector<java_type_t>>::const_iterator signature = signatures.begin();
+ signature != signatures.end(); signature++) {
int argIndex;
fprintf(out, "static void\n");
fprintf(out, "%s(JNIEnv* env, jobject clazz UNUSED, jint code",
- jni_function_name(*signature).c_str());
+ jni_function_name(java_method_name, *signature).c_str());
argIndex = 1;
for (vector<java_type_t>::const_iterator arg = signature->begin();
arg != signature->end(); arg++) {
@@ -624,7 +706,7 @@
// stats_write call
argIndex = 1;
- fprintf(out, " android::util::stats_write(code");
+ fprintf(out, " android::util::%s(code", cpp_method_name.c_str());
for (vector<java_type_t>::const_iterator arg = signature->begin();
arg != signature->end(); arg++) {
if (*arg == JAVA_TYPE_ATTRIBUTION_CHAIN) {
@@ -675,17 +757,53 @@
fprintf(out, "\n");
}
+
+ return 0;
+}
+
+void write_jni_registration(FILE* out, const string& java_method_name,
+ const set<vector<java_type_t>>& signatures, const AtomDecl &attributionDecl) {
+ for (set<vector<java_type_t>>::const_iterator signature = signatures.begin();
+ signature != signatures.end(); signature++) {
+ fprintf(out, " { \"%s\", \"%s\", (void*)%s },\n",
+ java_method_name.c_str(),
+ jni_function_signature(*signature, attributionDecl).c_str(),
+ jni_function_name(java_method_name, *signature).c_str());
+ }
+}
+
+static int
+write_stats_log_jni(FILE* out, const Atoms& atoms, const AtomDecl &attributionDecl)
+{
+ // Print prelude
+ fprintf(out, "// This file is autogenerated\n");
+ fprintf(out, "\n");
+
+ fprintf(out, "#include <statslog.h>\n");
+ fprintf(out, "\n");
+ fprintf(out, "#include <nativehelper/JNIHelp.h>\n");
+ fprintf(out, "#include <nativehelper/ScopedUtfChars.h>\n");
+ fprintf(out, "#include <utils/Vector.h>\n");
+ fprintf(out, "#include \"core_jni_helpers.h\"\n");
+ fprintf(out, "#include \"jni.h\"\n");
+ fprintf(out, "\n");
+ fprintf(out, "#define UNUSED __attribute__((__unused__))\n");
+ fprintf(out, "\n");
+
+ fprintf(out, "namespace android {\n");
+ fprintf(out, "\n");
+
+ write_stats_log_jni(out, "write", "stats_write", atoms.signatures, attributionDecl);
+ write_stats_log_jni(out, "write_non_chained", "stats_write_non_chained",
+ atoms.non_chained_signatures, attributionDecl);
+
// Print registration function table
fprintf(out, "/*\n");
fprintf(out, " * JNI registration.\n");
fprintf(out, " */\n");
fprintf(out, "static const JNINativeMethod gRegisterMethods[] = {\n");
- for (set<vector<java_type_t>>::const_iterator signature = atoms.signatures.begin();
- signature != atoms.signatures.end(); signature++) {
- fprintf(out, " { \"write\", \"%s\", (void*)%s },\n",
- jni_function_signature(*signature, attributionDecl).c_str(),
- jni_function_name(*signature).c_str());
- }
+ write_jni_registration(out, "write", atoms.signatures, attributionDecl);
+ write_jni_registration(out, "write_non_chained", atoms.non_chained_signatures, attributionDecl);
fprintf(out, "};\n");
fprintf(out, "\n");
@@ -699,11 +817,9 @@
fprintf(out, "\n");
fprintf(out, "} // namespace android\n");
-
return 0;
}
-
static void
print_usage()
{