Merge "Add VVM carrier config to public API." into mnc-dev
diff --git a/api/current.txt b/api/current.txt
index 80798bc..dea5255 100644
--- a/api/current.txt
+++ b/api/current.txt
@@ -215,6 +215,8 @@
 
   public static final class R.attr {
     ctor public R.attr();
+    field public static final int __removeBeforeMRelease_leftIndents = 16844016; // 0x10104f0
+    field public static final int __removeBeforeMRelease_rightIndents = 16844017; // 0x10104f1
     field public static final int __reserved0 = 16844020; // 0x10104f4
     field public static final int __reserved1 = 16844019; // 0x10104f3
     field public static final int __reserved2 = 16843999; // 0x10104df
@@ -801,7 +803,6 @@
     field public static final int layout_x = 16843135; // 0x101017f
     field public static final int layout_y = 16843136; // 0x1010180
     field public static final int left = 16843181; // 0x10101ad
-    field public static final int leftIndents = 16844016; // 0x10104f0
     field public static final int letterSpacing = 16843958; // 0x10104b6
     field public static final int lineSpacingExtra = 16843287; // 0x1010217
     field public static final int lineSpacingMultiplier = 16843288; // 0x1010218
@@ -826,6 +827,7 @@
     field public static final int listViewWhiteStyle = 16842869; // 0x1010075
     field public static final int lockTaskMode = 16844015; // 0x10104ef
     field public static final int logo = 16843454; // 0x10102be
+    field public static final int logoDescription = 16844026; // 0x10104fa
     field public static final int longClickable = 16842982; // 0x10100e6
     field public static final int loopViews = 16843527; // 0x1010307
     field public static final int manageSpaceActivity = 16842756; // 0x1010004
@@ -1026,7 +1028,6 @@
     field public static final int reversible = 16843851; // 0x101044b
     field public static final int revisionCode = 16843989; // 0x10104d5
     field public static final int right = 16843183; // 0x10101af
-    field public static final int rightIndents = 16844017; // 0x10104f1
     field public static final int ringtonePreferenceStyle = 16842899; // 0x1010093
     field public static final int ringtoneType = 16843257; // 0x10101f9
     field public static final int rotation = 16843558; // 0x1010326
@@ -1178,6 +1179,7 @@
     field public static final int submitBackground = 16843912; // 0x1010488
     field public static final int subtitle = 16843473; // 0x10102d1
     field public static final int subtitleTextAppearance = 16843823; // 0x101042f
+    field public static final int subtitleTextColor = 16844028; // 0x10104fc
     field public static final int subtitleTextStyle = 16843513; // 0x10102f9
     field public static final int subtypeExtraValue = 16843674; // 0x101039a
     field public static final int subtypeId = 16843713; // 0x10103c1
@@ -1308,6 +1310,7 @@
     field public static final int title = 16843233; // 0x10101e1
     field public static final int titleCondensed = 16843234; // 0x10101e2
     field public static final int titleTextAppearance = 16843822; // 0x101042e
+    field public static final int titleTextColor = 16844027; // 0x10104fb
     field public static final int titleTextStyle = 16843512; // 0x10102f8
     field public static final int toAlpha = 16843211; // 0x10101cb
     field public static final int toDegrees = 16843188; // 0x10101b4
@@ -2109,22 +2112,6 @@
     field public static final int Theme_Light_Panel = 16973914; // 0x103005a
     field public static final int Theme_Light_WallpaperSettings = 16973922; // 0x1030062
     field public static final int Theme_Material = 16974372; // 0x1030224
-    field public static final int Theme_Material_DayNight = 16974548; // 0x10302d4
-    field public static final int Theme_Material_DayNight_DarkActionBar = 16974549; // 0x10302d5
-    field public static final int Theme_Material_DayNight_Dialog = 16974550; // 0x10302d6
-    field public static final int Theme_Material_DayNight_DialogWhenLarge = 16974556; // 0x10302dc
-    field public static final int Theme_Material_DayNight_DialogWhenLarge_DarkActionBar = 16974568; // 0x10302e8
-    field public static final int Theme_Material_DayNight_DialogWhenLarge_NoActionBar = 16974557; // 0x10302dd
-    field public static final int Theme_Material_DayNight_Dialog_Alert = 16974551; // 0x10302d7
-    field public static final int Theme_Material_DayNight_Dialog_MinWidth = 16974552; // 0x10302d8
-    field public static final int Theme_Material_DayNight_Dialog_NoActionBar = 16974553; // 0x10302d9
-    field public static final int Theme_Material_DayNight_Dialog_NoActionBar_MinWidth = 16974554; // 0x10302da
-    field public static final int Theme_Material_DayNight_Dialog_Presentation = 16974555; // 0x10302db
-    field public static final int Theme_Material_DayNight_NoActionBar = 16974558; // 0x10302de
-    field public static final int Theme_Material_DayNight_NoActionBar_Fullscreen = 16974559; // 0x10302df
-    field public static final int Theme_Material_DayNight_NoActionBar_Overscan = 16974560; // 0x10302e0
-    field public static final int Theme_Material_DayNight_NoActionBar_TranslucentDecor = 16974561; // 0x10302e1
-    field public static final int Theme_Material_DayNight_Panel = 16974562; // 0x10302e2
     field public static final int Theme_Material_Dialog = 16974373; // 0x1030225
     field public static final int Theme_Material_DialogWhenLarge = 16974379; // 0x103022b
     field public static final int Theme_Material_DialogWhenLarge_NoActionBar = 16974380; // 0x103022c
@@ -2138,7 +2125,6 @@
     field public static final int Theme_Material_Light_DarkActionBar = 16974392; // 0x1030238
     field public static final int Theme_Material_Light_Dialog = 16974393; // 0x1030239
     field public static final int Theme_Material_Light_DialogWhenLarge = 16974399; // 0x103023f
-    field public static final int Theme_Material_Light_DialogWhenLarge_DarkActionBar = 16974567; // 0x10302e7
     field public static final int Theme_Material_Light_DialogWhenLarge_NoActionBar = 16974400; // 0x1030240
     field public static final int Theme_Material_Light_Dialog_Alert = 16974394; // 0x103023a
     field public static final int Theme_Material_Light_Dialog_MinWidth = 16974395; // 0x103023b
@@ -2594,6 +2580,21 @@
     field public static final int Widget_Toolbar = 16974311; // 0x10301e7
     field public static final int Widget_Toolbar_Button_Navigation = 16974312; // 0x10301e8
     field public static final int Widget_WebView = 16973875; // 0x1030033
+    field public static final int __reserved10 = 16974550; // 0x10302d6
+    field public static final int __reserved11 = 16974551; // 0x10302d7
+    field public static final int __reserved12 = 16974552; // 0x10302d8
+    field public static final int __reserved13 = 16974553; // 0x10302d9
+    field public static final int __reserved14 = 16974554; // 0x10302da
+    field public static final int __reserved15 = 16974555; // 0x10302db
+    field public static final int __reserved16 = 16974556; // 0x10302dc
+    field public static final int __reserved17 = 16974557; // 0x10302dd
+    field public static final int __reserved18 = 16974558; // 0x10302de
+    field public static final int __reserved19 = 16974559; // 0x10302df
+    field public static final int __reserved20 = 16974560; // 0x10302e0
+    field public static final int __reserved21 = 16974561; // 0x10302e1
+    field public static final int __reserved22 = 16974562; // 0x10302e2
+    field public static final int __reserved8 = 16974548; // 0x10302d4
+    field public static final int __reserved9 = 16974549; // 0x10302d5
   }
 
   public static final class R.transition {
@@ -3758,7 +3759,7 @@
     method public void requestUsageTimeReport(android.app.PendingIntent);
     method public android.os.Bundle toBundle();
     method public void update(android.app.ActivityOptions);
-    field public static final java.lang.String EXTRA_USAGE_TIME_REPORT = "android.usage_time";
+    field public static final java.lang.String EXTRA_USAGE_TIME_REPORT = "android.activity.usage_time";
     field public static final java.lang.String EXTRA_USAGE_TIME_REPORT_PACKAGES = "android.usage_time_packages";
   }
 
@@ -5194,6 +5195,7 @@
     method public void send(int, android.app.PendingIntent.OnFinished, android.os.Handler) throws android.app.PendingIntent.CanceledException;
     method public void send(android.content.Context, int, android.content.Intent, android.app.PendingIntent.OnFinished, android.os.Handler) throws android.app.PendingIntent.CanceledException;
     method public void send(android.content.Context, int, android.content.Intent, android.app.PendingIntent.OnFinished, android.os.Handler, java.lang.String) throws android.app.PendingIntent.CanceledException;
+    method public void send(android.content.Context, int, android.content.Intent, android.app.PendingIntent.OnFinished, android.os.Handler, java.lang.String, android.os.Bundle) throws android.app.PendingIntent.CanceledException;
     method public static void writePendingIntentOrNullToParcel(android.app.PendingIntent, android.os.Parcel);
     method public void writeToParcel(android.os.Parcel, int);
     field public static final android.os.Parcelable.Creator<android.app.PendingIntent> CREATOR;
@@ -5848,7 +5850,6 @@
     field public static final java.lang.String EXTRA_PROVISIONING_LEAVE_ALL_SYSTEM_APPS_ENABLED = "android.app.extra.PROVISIONING_LEAVE_ALL_SYSTEM_APPS_ENABLED";
     field public static final java.lang.String EXTRA_PROVISIONING_LOCALE = "android.app.extra.PROVISIONING_LOCALE";
     field public static final java.lang.String EXTRA_PROVISIONING_LOCAL_TIME = "android.app.extra.PROVISIONING_LOCAL_TIME";
-    field public static final java.lang.String EXTRA_PROVISIONING_RESET_PROTECTION_PARAMETERS = "android.app.extra.PROVISIONING_RESET_PROTECTION_PARAMETERS";
     field public static final java.lang.String EXTRA_PROVISIONING_SKIP_ENCRYPTION = "android.app.extra.PROVISIONING_SKIP_ENCRYPTION";
     field public static final java.lang.String EXTRA_PROVISIONING_TIME_ZONE = "android.app.extra.PROVISIONING_TIME_ZONE";
     field public static final java.lang.String EXTRA_PROVISIONING_WIFI_HIDDEN = "android.app.extra.PROVISIONING_WIFI_HIDDEN";
@@ -12302,7 +12303,6 @@
     method public android.graphics.drawable.Drawable.ConstantState getConstantState();
     method public android.graphics.drawable.Drawable getCurrent();
     method public android.graphics.Rect getDirtyBounds();
-    method public boolean getDither();
     method public void getHotspotBounds(android.graphics.Rect);
     method public int getIntrinsicHeight();
     method public int getIntrinsicWidth();
@@ -12319,6 +12319,7 @@
     method public void inflate(android.content.res.Resources, org.xmlpull.v1.XmlPullParser, android.util.AttributeSet, android.content.res.Resources.Theme) throws java.io.IOException, org.xmlpull.v1.XmlPullParserException;
     method public void invalidateSelf();
     method public boolean isAutoMirrored();
+    method public boolean isDither();
     method public boolean isFilterBitmap();
     method public boolean isStateful();
     method public final boolean isVisible();
@@ -26057,6 +26058,7 @@
     field public static final java.lang.String EXTRA_EXCLUDE_SELF = "android.provider.extra.EXCLUDE_SELF";
     field public static final java.lang.String EXTRA_INFO = "info";
     field public static final java.lang.String EXTRA_LOADING = "loading";
+    field public static final java.lang.String EXTRA_PROMPT = "android.provider.extra.PROMPT";
     field public static final java.lang.String PROVIDER_INTERFACE = "android.content.action.DOCUMENTS_PROVIDER";
   }
 
@@ -27918,8 +27920,6 @@
 
   public static final class ScriptGroup.Binding {
     ctor public ScriptGroup.Binding(android.renderscript.Script.FieldID, java.lang.Object);
-    method public android.renderscript.Script.FieldID getField();
-    method public java.lang.Object getValue();
   }
 
   public static final deprecated class ScriptGroup.Builder {
@@ -28909,6 +28909,7 @@
     method public void onDestroy();
     method public boolean[] onGetSupportedCommands(java.lang.String[]);
     method public void onHandleAssist(android.os.Bundle, android.app.assist.AssistStructure, android.app.assist.AssistContent);
+    method public void onHandleScreenshot(android.graphics.Bitmap);
     method public void onHide();
     method public boolean onKeyDown(int, android.view.KeyEvent);
     method public boolean onKeyLongPress(int, android.view.KeyEvent);
@@ -28931,6 +28932,7 @@
     method public void startVoiceActivity(android.content.Intent);
     field public static final int SHOW_SOURCE_ASSIST_GESTURE = 4; // 0x4
     field public static final int SHOW_WITH_ASSIST = 1; // 0x1
+    field public static final int SHOW_WITH_SCREENSHOT = 2; // 0x2
   }
 
   public static final class VoiceInteractionSession.AbortVoiceRequest extends android.service.voice.VoiceInteractionSession.Request {
@@ -30620,12 +30622,17 @@
     field public static final java.lang.String KEY_CARRIER_VOLTE_TTY_SUPPORTED_BOOL = "carrier_volte_tty_supported_bool";
     field public static final java.lang.String KEY_CARRIER_VVM_PACKAGE_NAME_STRING = "carrier_vvm_package_name_string";
     field public static final java.lang.String KEY_CARRIER_WFC_IMS_AVAILABLE_BOOL = "carrier_wfc_ims_available_bool";
+    field public static final java.lang.String KEY_CDMA_NONROAMING_NETWORKS_STRING_ARRAY = "cdma_nonroaming_networks_string_array";
+    field public static final java.lang.String KEY_CDMA_ROAMING_NETWORKS_STRING_ARRAY = "cdma_roaming_networks_string_array";
     field public static final java.lang.String KEY_DEFAULT_SIM_CALL_MANAGER_STRING = "default_sim_call_manager_string";
     field public static final java.lang.String KEY_DISABLE_CDMA_ACTIVATION_CODE_BOOL = "disable_cdma_activation_code_bool";
     field public static final java.lang.String KEY_DTMF_TYPE_ENABLED_BOOL = "dtmf_type_enabled_bool";
     field public static final java.lang.String KEY_ENABLE_DIALER_KEY_VIBRATION_BOOL = "enable_dialer_vibration_bool";
+    field public static final java.lang.String KEY_GSM_NONROAMING_NETWORKS_STRING_ARRAY = "gsm_nonroaming_networks_string_array";
+    field public static final java.lang.String KEY_GSM_ROAMING_NETWORKS_STRING_ARRAY = "gsm_roaming_networks_string_array";
     field public static final java.lang.String KEY_HAS_IN_CALL_NOISE_SUPPRESSION_BOOL = "has_in_call_noise_suppression_bool";
     field public static final java.lang.String KEY_HIDE_CARRIER_NETWORK_SETTINGS_BOOL = "hide_carrier_network_settings_bool";
+    field public static final java.lang.String KEY_HIDE_SIM_LOCK_SETTINGS_BOOL = "hide_sim_lock_settings_bool";
     field public static final java.lang.String KEY_IGNORE_SIM_NETWORK_LOCKED_EVENTS_BOOL = "ignore_sim_network_locked_events_bool";
     field public static final java.lang.String KEY_MMS_ALIAS_ENABLED_BOOL = "aliasEnabled";
     field public static final java.lang.String KEY_MMS_ALIAS_MAX_CHARS_INT = "aliasMaxChars";
@@ -36812,6 +36819,8 @@
     method public boolean onRequestSendAccessibilityEvent(android.view.View, android.view.accessibility.AccessibilityEvent);
     method public boolean onStartNestedScroll(android.view.View, android.view.View, int);
     method public void onStopNestedScroll(android.view.View);
+    method public void onViewAdded(android.view.View);
+    method public void onViewRemoved(android.view.View);
     method public void recomputeViewAttributes(android.view.View);
     method public void removeAllViews();
     method public void removeAllViewsInLayout();
@@ -41564,7 +41573,6 @@
     method public int getInputType();
     method public final android.text.method.KeyListener getKeyListener();
     method public final android.text.Layout getLayout();
-    method public int[] getLeftIndents();
     method public float getLetterSpacing();
     method public int getLineBounds(int, android.graphics.Rect);
     method public int getLineCount();
@@ -41587,7 +41595,6 @@
     method public android.text.TextPaint getPaint();
     method public int getPaintFlags();
     method public java.lang.String getPrivateImeOptions();
-    method public int[] getRightIndents();
     method public int getSelectionEnd();
     method public int getSelectionStart();
     method public int getShadowColor();
@@ -41667,7 +41674,6 @@
     method public void setImeActionLabel(java.lang.CharSequence, int);
     method public void setImeOptions(int);
     method public void setIncludeFontPadding(boolean);
-    method public void setIndents(int[], int[]);
     method public void setInputExtras(int) throws java.io.IOException, org.xmlpull.v1.XmlPullParserException;
     method public void setInputType(int);
     method public void setKeyListener(android.text.method.KeyListener);
diff --git a/api/system-current.txt b/api/system-current.txt
index 0dff6d9..d0225e1 100644
--- a/api/system-current.txt
+++ b/api/system-current.txt
@@ -96,6 +96,7 @@
     field public static final java.lang.String FORCE_STOP_PACKAGES = "android.permission.FORCE_STOP_PACKAGES";
     field public static final java.lang.String GET_ACCOUNTS = "android.permission.GET_ACCOUNTS";
     field public static final java.lang.String GET_APP_OPS_STATS = "android.permission.GET_APP_OPS_STATS";
+    field public static final java.lang.String GET_PACKAGE_IMPORTANCE = "android.permission.GET_PACKAGE_IMPORTANCE";
     field public static final java.lang.String GET_PACKAGE_SIZE = "android.permission.GET_PACKAGE_SIZE";
     field public static final deprecated java.lang.String GET_TASKS = "android.permission.GET_TASKS";
     field public static final java.lang.String GET_TOP_ACTIVITY_INFO = "android.permission.GET_TOP_ACTIVITY_INFO";
@@ -290,6 +291,8 @@
 
   public static final class R.attr {
     ctor public R.attr();
+    field public static final int __removeBeforeMRelease_leftIndents = 16844016; // 0x10104f0
+    field public static final int __removeBeforeMRelease_rightIndents = 16844017; // 0x10104f1
     field public static final int __reserved0 = 16844020; // 0x10104f4
     field public static final int __reserved1 = 16844019; // 0x10104f3
     field public static final int __reserved2 = 16843999; // 0x10104df
@@ -876,7 +879,6 @@
     field public static final int layout_x = 16843135; // 0x101017f
     field public static final int layout_y = 16843136; // 0x1010180
     field public static final int left = 16843181; // 0x10101ad
-    field public static final int leftIndents = 16844016; // 0x10104f0
     field public static final int letterSpacing = 16843958; // 0x10104b6
     field public static final int lineSpacingExtra = 16843287; // 0x1010217
     field public static final int lineSpacingMultiplier = 16843288; // 0x1010218
@@ -901,6 +903,7 @@
     field public static final int listViewWhiteStyle = 16842869; // 0x1010075
     field public static final int lockTaskMode = 16844015; // 0x10104ef
     field public static final int logo = 16843454; // 0x10102be
+    field public static final int logoDescription = 16844026; // 0x10104fa
     field public static final int longClickable = 16842982; // 0x10100e6
     field public static final int loopViews = 16843527; // 0x1010307
     field public static final int manageSpaceActivity = 16842756; // 0x1010004
@@ -1101,7 +1104,6 @@
     field public static final int reversible = 16843851; // 0x101044b
     field public static final int revisionCode = 16843989; // 0x10104d5
     field public static final int right = 16843183; // 0x10101af
-    field public static final int rightIndents = 16844017; // 0x10104f1
     field public static final int ringtonePreferenceStyle = 16842899; // 0x1010093
     field public static final int ringtoneType = 16843257; // 0x10101f9
     field public static final int rotation = 16843558; // 0x1010326
@@ -1257,6 +1259,7 @@
     field public static final int submitBackground = 16843912; // 0x1010488
     field public static final int subtitle = 16843473; // 0x10102d1
     field public static final int subtitleTextAppearance = 16843823; // 0x101042f
+    field public static final int subtitleTextColor = 16844028; // 0x10104fc
     field public static final int subtitleTextStyle = 16843513; // 0x10102f9
     field public static final int subtypeExtraValue = 16843674; // 0x101039a
     field public static final int subtypeId = 16843713; // 0x10103c1
@@ -1387,6 +1390,7 @@
     field public static final int title = 16843233; // 0x10101e1
     field public static final int titleCondensed = 16843234; // 0x10101e2
     field public static final int titleTextAppearance = 16843822; // 0x101042e
+    field public static final int titleTextColor = 16844027; // 0x10104fb
     field public static final int titleTextStyle = 16843512; // 0x10102f8
     field public static final int toAlpha = 16843211; // 0x10101cb
     field public static final int toDegrees = 16843188; // 0x10101b4
@@ -2191,22 +2195,6 @@
     field public static final int Theme_Light_Panel = 16973914; // 0x103005a
     field public static final int Theme_Light_WallpaperSettings = 16973922; // 0x1030062
     field public static final int Theme_Material = 16974372; // 0x1030224
-    field public static final int Theme_Material_DayNight = 16974548; // 0x10302d4
-    field public static final int Theme_Material_DayNight_DarkActionBar = 16974549; // 0x10302d5
-    field public static final int Theme_Material_DayNight_Dialog = 16974550; // 0x10302d6
-    field public static final int Theme_Material_DayNight_DialogWhenLarge = 16974556; // 0x10302dc
-    field public static final int Theme_Material_DayNight_DialogWhenLarge_DarkActionBar = 16974568; // 0x10302e8
-    field public static final int Theme_Material_DayNight_DialogWhenLarge_NoActionBar = 16974557; // 0x10302dd
-    field public static final int Theme_Material_DayNight_Dialog_Alert = 16974551; // 0x10302d7
-    field public static final int Theme_Material_DayNight_Dialog_MinWidth = 16974552; // 0x10302d8
-    field public static final int Theme_Material_DayNight_Dialog_NoActionBar = 16974553; // 0x10302d9
-    field public static final int Theme_Material_DayNight_Dialog_NoActionBar_MinWidth = 16974554; // 0x10302da
-    field public static final int Theme_Material_DayNight_Dialog_Presentation = 16974555; // 0x10302db
-    field public static final int Theme_Material_DayNight_NoActionBar = 16974558; // 0x10302de
-    field public static final int Theme_Material_DayNight_NoActionBar_Fullscreen = 16974559; // 0x10302df
-    field public static final int Theme_Material_DayNight_NoActionBar_Overscan = 16974560; // 0x10302e0
-    field public static final int Theme_Material_DayNight_NoActionBar_TranslucentDecor = 16974561; // 0x10302e1
-    field public static final int Theme_Material_DayNight_Panel = 16974562; // 0x10302e2
     field public static final int Theme_Material_Dialog = 16974373; // 0x1030225
     field public static final int Theme_Material_DialogWhenLarge = 16974379; // 0x103022b
     field public static final int Theme_Material_DialogWhenLarge_NoActionBar = 16974380; // 0x103022c
@@ -2220,7 +2208,6 @@
     field public static final int Theme_Material_Light_DarkActionBar = 16974392; // 0x1030238
     field public static final int Theme_Material_Light_Dialog = 16974393; // 0x1030239
     field public static final int Theme_Material_Light_DialogWhenLarge = 16974399; // 0x103023f
-    field public static final int Theme_Material_Light_DialogWhenLarge_DarkActionBar = 16974567; // 0x10302e7
     field public static final int Theme_Material_Light_DialogWhenLarge_NoActionBar = 16974400; // 0x1030240
     field public static final int Theme_Material_Light_Dialog_Alert = 16974394; // 0x103023a
     field public static final int Theme_Material_Light_Dialog_MinWidth = 16974395; // 0x103023b
@@ -2676,6 +2663,21 @@
     field public static final int Widget_Toolbar = 16974311; // 0x10301e7
     field public static final int Widget_Toolbar_Button_Navigation = 16974312; // 0x10301e8
     field public static final int Widget_WebView = 16973875; // 0x1030033
+    field public static final int __reserved10 = 16974550; // 0x10302d6
+    field public static final int __reserved11 = 16974551; // 0x10302d7
+    field public static final int __reserved12 = 16974552; // 0x10302d8
+    field public static final int __reserved13 = 16974553; // 0x10302d9
+    field public static final int __reserved14 = 16974554; // 0x10302da
+    field public static final int __reserved15 = 16974555; // 0x10302db
+    field public static final int __reserved16 = 16974556; // 0x10302dc
+    field public static final int __reserved17 = 16974557; // 0x10302dd
+    field public static final int __reserved18 = 16974558; // 0x10302de
+    field public static final int __reserved19 = 16974559; // 0x10302df
+    field public static final int __reserved20 = 16974560; // 0x10302e0
+    field public static final int __reserved21 = 16974561; // 0x10302e1
+    field public static final int __reserved22 = 16974562; // 0x10302e2
+    field public static final int __reserved8 = 16974548; // 0x10302d4
+    field public static final int __reserved9 = 16974549; // 0x10302d5
   }
 
   public static final class R.transition {
@@ -3851,7 +3853,7 @@
     method public void requestUsageTimeReport(android.app.PendingIntent);
     method public android.os.Bundle toBundle();
     method public void update(android.app.ActivityOptions);
-    field public static final java.lang.String EXTRA_USAGE_TIME_REPORT = "android.usage_time";
+    field public static final java.lang.String EXTRA_USAGE_TIME_REPORT = "android.activity.usage_time";
     field public static final java.lang.String EXTRA_USAGE_TIME_REPORT_PACKAGES = "android.usage_time_packages";
   }
 
@@ -4183,6 +4185,12 @@
     method public int getWidth();
   }
 
+  public class BroadcastOptions {
+    method public static android.app.BroadcastOptions makeBasic();
+    method public void setTemporaryAppWhitelistDuration(long);
+    method public android.os.Bundle toBundle();
+  }
+
   public class DatePickerDialog extends android.app.AlertDialog implements android.widget.DatePicker.OnDateChangedListener android.content.DialogInterface.OnClickListener {
     ctor public DatePickerDialog(android.content.Context, android.app.DatePickerDialog.OnDateSetListener, int, int, int);
     ctor public DatePickerDialog(android.content.Context, int, android.app.DatePickerDialog.OnDateSetListener, int, int, int);
@@ -5289,6 +5297,7 @@
     method public void send(int, android.app.PendingIntent.OnFinished, android.os.Handler) throws android.app.PendingIntent.CanceledException;
     method public void send(android.content.Context, int, android.content.Intent, android.app.PendingIntent.OnFinished, android.os.Handler) throws android.app.PendingIntent.CanceledException;
     method public void send(android.content.Context, int, android.content.Intent, android.app.PendingIntent.OnFinished, android.os.Handler, java.lang.String) throws android.app.PendingIntent.CanceledException;
+    method public void send(android.content.Context, int, android.content.Intent, android.app.PendingIntent.OnFinished, android.os.Handler, java.lang.String, android.os.Bundle) throws android.app.PendingIntent.CanceledException;
     method public static void writePendingIntentOrNullToParcel(android.app.PendingIntent, android.os.Parcel);
     method public void writeToParcel(android.os.Parcel, int);
     field public static final android.os.Parcelable.Creator<android.app.PendingIntent> CREATOR;
@@ -5959,7 +5968,6 @@
     field public static final java.lang.String EXTRA_PROVISIONING_LEAVE_ALL_SYSTEM_APPS_ENABLED = "android.app.extra.PROVISIONING_LEAVE_ALL_SYSTEM_APPS_ENABLED";
     field public static final java.lang.String EXTRA_PROVISIONING_LOCALE = "android.app.extra.PROVISIONING_LOCALE";
     field public static final java.lang.String EXTRA_PROVISIONING_LOCAL_TIME = "android.app.extra.PROVISIONING_LOCAL_TIME";
-    field public static final java.lang.String EXTRA_PROVISIONING_RESET_PROTECTION_PARAMETERS = "android.app.extra.PROVISIONING_RESET_PROTECTION_PARAMETERS";
     field public static final java.lang.String EXTRA_PROVISIONING_SKIP_ENCRYPTION = "android.app.extra.PROVISIONING_SKIP_ENCRYPTION";
     field public static final java.lang.String EXTRA_PROVISIONING_TIME_ZONE = "android.app.extra.PROVISIONING_TIME_ZONE";
     field public static final java.lang.String EXTRA_PROVISIONING_WIFI_HIDDEN = "android.app.extra.PROVISIONING_WIFI_HIDDEN";
@@ -7963,10 +7971,12 @@
     method public abstract void revokeUriPermission(android.net.Uri, int);
     method public abstract void sendBroadcast(android.content.Intent);
     method public abstract void sendBroadcast(android.content.Intent, java.lang.String);
+    method public abstract void sendBroadcast(android.content.Intent, java.lang.String, android.os.Bundle);
     method public abstract void sendBroadcastAsUser(android.content.Intent, android.os.UserHandle);
     method public abstract void sendBroadcastAsUser(android.content.Intent, android.os.UserHandle, java.lang.String);
     method public abstract void sendOrderedBroadcast(android.content.Intent, java.lang.String);
     method public abstract void sendOrderedBroadcast(android.content.Intent, java.lang.String, android.content.BroadcastReceiver, android.os.Handler, int, java.lang.String, android.os.Bundle);
+    method public abstract void sendOrderedBroadcast(android.content.Intent, java.lang.String, android.os.Bundle, android.content.BroadcastReceiver, android.os.Handler, int, java.lang.String, android.os.Bundle);
     method public abstract void sendOrderedBroadcastAsUser(android.content.Intent, android.os.UserHandle, java.lang.String, android.content.BroadcastReceiver, android.os.Handler, int, java.lang.String, android.os.Bundle);
     method public abstract deprecated void sendStickyBroadcast(android.content.Intent);
     method public abstract deprecated void sendStickyBroadcastAsUser(android.content.Intent, android.os.UserHandle);
@@ -8140,10 +8150,12 @@
     method public void revokeUriPermission(android.net.Uri, int);
     method public void sendBroadcast(android.content.Intent);
     method public void sendBroadcast(android.content.Intent, java.lang.String);
+    method public void sendBroadcast(android.content.Intent, java.lang.String, android.os.Bundle);
     method public void sendBroadcastAsUser(android.content.Intent, android.os.UserHandle);
     method public void sendBroadcastAsUser(android.content.Intent, android.os.UserHandle, java.lang.String);
     method public void sendOrderedBroadcast(android.content.Intent, java.lang.String);
     method public void sendOrderedBroadcast(android.content.Intent, java.lang.String, android.content.BroadcastReceiver, android.os.Handler, int, java.lang.String, android.os.Bundle);
+    method public void sendOrderedBroadcast(android.content.Intent, java.lang.String, android.os.Bundle, android.content.BroadcastReceiver, android.os.Handler, int, java.lang.String, android.os.Bundle);
     method public void sendOrderedBroadcastAsUser(android.content.Intent, android.os.UserHandle, java.lang.String, android.content.BroadcastReceiver, android.os.Handler, int, java.lang.String, android.os.Bundle);
     method public deprecated void sendStickyBroadcast(android.content.Intent);
     method public deprecated void sendStickyBroadcastAsUser(android.content.Intent, android.os.UserHandle);
@@ -12617,7 +12629,6 @@
     method public android.graphics.drawable.Drawable.ConstantState getConstantState();
     method public android.graphics.drawable.Drawable getCurrent();
     method public android.graphics.Rect getDirtyBounds();
-    method public boolean getDither();
     method public void getHotspotBounds(android.graphics.Rect);
     method public int getIntrinsicHeight();
     method public int getIntrinsicWidth();
@@ -12634,6 +12645,7 @@
     method public void inflate(android.content.res.Resources, org.xmlpull.v1.XmlPullParser, android.util.AttributeSet, android.content.res.Resources.Theme) throws java.io.IOException, org.xmlpull.v1.XmlPullParserException;
     method public void invalidateSelf();
     method public boolean isAutoMirrored();
+    method public boolean isDither();
     method public boolean isFilterBitmap();
     method public boolean isStateful();
     method public final boolean isVisible();
@@ -27991,6 +28003,7 @@
     field public static final java.lang.String EXTRA_EXCLUDE_SELF = "android.provider.extra.EXCLUDE_SELF";
     field public static final java.lang.String EXTRA_INFO = "info";
     field public static final java.lang.String EXTRA_LOADING = "loading";
+    field public static final java.lang.String EXTRA_PROMPT = "android.provider.extra.PROMPT";
     field public static final java.lang.String PROVIDER_INTERFACE = "android.content.action.DOCUMENTS_PROVIDER";
   }
 
@@ -29955,8 +29968,6 @@
 
   public static final class ScriptGroup.Binding {
     ctor public ScriptGroup.Binding(android.renderscript.Script.FieldID, java.lang.Object);
-    method public android.renderscript.Script.FieldID getField();
-    method public java.lang.Object getValue();
   }
 
   public static final deprecated class ScriptGroup.Builder {
@@ -30903,7 +30914,6 @@
     method public abstract byte[] read() throws android.os.RemoteException;
     method public abstract void setOemUnlockEnabled(boolean) throws android.os.RemoteException;
     method public abstract void wipe() throws android.os.RemoteException;
-    method public abstract void wipeIfAllowed(android.os.Bundle, android.app.PendingIntent) throws android.os.RemoteException;
     method public abstract int write(byte[]) throws android.os.RemoteException;
   }
 
@@ -30915,14 +30925,7 @@
     method public byte[] read();
     method public void setOemUnlockEnabled(boolean);
     method public void wipe();
-    method public void wipeIfAllowed(android.os.Bundle, android.app.PendingIntent);
     method public int write(byte[]);
-    field public static final java.lang.String ACTION_WIPE_IF_ALLOWED = "android.service.persistentdata.action.WIPE_IF_ALLOWED";
-    field public static final java.lang.String EXTRA_WIPE_IF_ALLOWED_CALLBACK = "android.service.persistentdata.extra.WIPE_IF_ALLOWED_CALLBACK";
-    field public static final int STATUS_ERROR_NETWORK_ERROR = 2; // 0x2
-    field public static final int STATUS_ERROR_NOT_COMPLIANT = 3; // 0x3
-    field public static final int STATUS_ERROR_REMOTE_EXCEPTION = 1; // 0x1
-    field public static final int STATUS_SUCCESS = 0; // 0x0
   }
 
 }
@@ -31046,6 +31049,7 @@
     method public void onDestroy();
     method public boolean[] onGetSupportedCommands(java.lang.String[]);
     method public void onHandleAssist(android.os.Bundle, android.app.assist.AssistStructure, android.app.assist.AssistContent);
+    method public void onHandleScreenshot(android.graphics.Bitmap);
     method public void onHide();
     method public boolean onKeyDown(int, android.view.KeyEvent);
     method public boolean onKeyLongPress(int, android.view.KeyEvent);
@@ -31068,6 +31072,7 @@
     method public void startVoiceActivity(android.content.Intent);
     field public static final int SHOW_SOURCE_ASSIST_GESTURE = 4; // 0x4
     field public static final int SHOW_WITH_ASSIST = 1; // 0x1
+    field public static final int SHOW_WITH_SCREENSHOT = 2; // 0x2
   }
 
   public static final class VoiceInteractionSession.AbortVoiceRequest extends android.service.voice.VoiceInteractionSession.Request {
@@ -32840,12 +32845,17 @@
     field public static final java.lang.String KEY_CARRIER_VOLTE_TTY_SUPPORTED_BOOL = "carrier_volte_tty_supported_bool";
     field public static final java.lang.String KEY_CARRIER_VVM_PACKAGE_NAME_STRING = "carrier_vvm_package_name_string";
     field public static final java.lang.String KEY_CARRIER_WFC_IMS_AVAILABLE_BOOL = "carrier_wfc_ims_available_bool";
+    field public static final java.lang.String KEY_CDMA_NONROAMING_NETWORKS_STRING_ARRAY = "cdma_nonroaming_networks_string_array";
+    field public static final java.lang.String KEY_CDMA_ROAMING_NETWORKS_STRING_ARRAY = "cdma_roaming_networks_string_array";
     field public static final java.lang.String KEY_DEFAULT_SIM_CALL_MANAGER_STRING = "default_sim_call_manager_string";
     field public static final java.lang.String KEY_DISABLE_CDMA_ACTIVATION_CODE_BOOL = "disable_cdma_activation_code_bool";
     field public static final java.lang.String KEY_DTMF_TYPE_ENABLED_BOOL = "dtmf_type_enabled_bool";
     field public static final java.lang.String KEY_ENABLE_DIALER_KEY_VIBRATION_BOOL = "enable_dialer_vibration_bool";
+    field public static final java.lang.String KEY_GSM_NONROAMING_NETWORKS_STRING_ARRAY = "gsm_nonroaming_networks_string_array";
+    field public static final java.lang.String KEY_GSM_ROAMING_NETWORKS_STRING_ARRAY = "gsm_roaming_networks_string_array";
     field public static final java.lang.String KEY_HAS_IN_CALL_NOISE_SUPPRESSION_BOOL = "has_in_call_noise_suppression_bool";
     field public static final java.lang.String KEY_HIDE_CARRIER_NETWORK_SETTINGS_BOOL = "hide_carrier_network_settings_bool";
+    field public static final java.lang.String KEY_HIDE_SIM_LOCK_SETTINGS_BOOL = "hide_sim_lock_settings_bool";
     field public static final java.lang.String KEY_IGNORE_SIM_NETWORK_LOCKED_EVENTS_BOOL = "ignore_sim_network_locked_events_bool";
     field public static final java.lang.String KEY_MMS_ALIAS_ENABLED_BOOL = "aliasEnabled";
     field public static final java.lang.String KEY_MMS_ALIAS_MAX_CHARS_INT = "aliasMaxChars";
@@ -34022,10 +34032,12 @@
     method public void revokeUriPermission(android.net.Uri, int);
     method public void sendBroadcast(android.content.Intent);
     method public void sendBroadcast(android.content.Intent, java.lang.String);
+    method public void sendBroadcast(android.content.Intent, java.lang.String, android.os.Bundle);
     method public void sendBroadcastAsUser(android.content.Intent, android.os.UserHandle);
     method public void sendBroadcastAsUser(android.content.Intent, android.os.UserHandle, java.lang.String);
     method public void sendOrderedBroadcast(android.content.Intent, java.lang.String);
     method public void sendOrderedBroadcast(android.content.Intent, java.lang.String, android.content.BroadcastReceiver, android.os.Handler, int, java.lang.String, android.os.Bundle);
+    method public void sendOrderedBroadcast(android.content.Intent, java.lang.String, android.os.Bundle, android.content.BroadcastReceiver, android.os.Handler, int, java.lang.String, android.os.Bundle);
     method public void sendOrderedBroadcastAsUser(android.content.Intent, android.os.UserHandle, java.lang.String, android.content.BroadcastReceiver, android.os.Handler, int, java.lang.String, android.os.Bundle);
     method public void sendStickyBroadcast(android.content.Intent);
     method public void sendStickyBroadcastAsUser(android.content.Intent, android.os.UserHandle);
@@ -39088,6 +39100,8 @@
     method public boolean onRequestSendAccessibilityEvent(android.view.View, android.view.accessibility.AccessibilityEvent);
     method public boolean onStartNestedScroll(android.view.View, android.view.View, int);
     method public void onStopNestedScroll(android.view.View);
+    method public void onViewAdded(android.view.View);
+    method public void onViewRemoved(android.view.View);
     method public void recomputeViewAttributes(android.view.View);
     method public void removeAllViews();
     method public void removeAllViewsInLayout();
@@ -44154,7 +44168,6 @@
     method public int getInputType();
     method public final android.text.method.KeyListener getKeyListener();
     method public final android.text.Layout getLayout();
-    method public int[] getLeftIndents();
     method public float getLetterSpacing();
     method public int getLineBounds(int, android.graphics.Rect);
     method public int getLineCount();
@@ -44177,7 +44190,6 @@
     method public android.text.TextPaint getPaint();
     method public int getPaintFlags();
     method public java.lang.String getPrivateImeOptions();
-    method public int[] getRightIndents();
     method public int getSelectionEnd();
     method public int getSelectionStart();
     method public int getShadowColor();
@@ -44257,7 +44269,6 @@
     method public void setImeActionLabel(java.lang.CharSequence, int);
     method public void setImeOptions(int);
     method public void setIncludeFontPadding(boolean);
-    method public void setIndents(int[], int[]);
     method public void setInputExtras(int) throws java.io.IOException, org.xmlpull.v1.XmlPullParserException;
     method public void setInputType(int);
     method public void setKeyListener(android.text.method.KeyListener);
diff --git a/cmds/am/src/com/android/commands/am/Am.java b/cmds/am/src/com/android/commands/am/Am.java
index bf3b455..69ba27c 100644
--- a/cmds/am/src/com/android/commands/am/Am.java
+++ b/cmds/am/src/com/android/commands/am/Am.java
@@ -1002,7 +1002,7 @@
         IntentReceiver receiver = new IntentReceiver();
         System.out.println("Broadcasting: " + intent);
         mAm.broadcastIntent(null, intent, null, receiver, 0, null, null, mReceiverPermission,
-                android.app.AppOpsManager.OP_NONE, true, false, mUserId);
+                android.app.AppOpsManager.OP_NONE, null, true, false, mUserId);
         receiver.waitForFinish();
     }
 
@@ -1658,7 +1658,7 @@
         Intent intent = new Intent(
                 "com.android.server.task.controllers.IdleController.ACTION_TRIGGER_IDLE");
         mAm.broadcastIntent(null, intent, null, null, 0, null, null, null,
-                android.app.AppOpsManager.OP_NONE, true, false, UserHandle.USER_ALL);
+                android.app.AppOpsManager.OP_NONE, null, true, false, UserHandle.USER_ALL);
     }
 
     private void runScreenCompat() throws Exception {
diff --git a/cmds/pm/src/com/android/commands/pm/Pm.java b/cmds/pm/src/com/android/commands/pm/Pm.java
index 1faf41b..2be44bc 100644
--- a/cmds/pm/src/com/android/commands/pm/Pm.java
+++ b/cmds/pm/src/com/android/commands/pm/Pm.java
@@ -1812,7 +1812,7 @@
         private IIntentSender.Stub mLocalSender = new IIntentSender.Stub() {
             @Override
             public int send(int code, Intent intent, String resolvedType,
-                    IIntentReceiver finishedReceiver, String requiredPermission) {
+                    IIntentReceiver finishedReceiver, String requiredPermission, Bundle options) {
                 try {
                     mResult.offer(intent, 5, TimeUnit.SECONDS);
                 } catch (InterruptedException e) {
diff --git a/core/java/android/app/ActivityManagerNative.java b/core/java/android/app/ActivityManagerNative.java
index 6ae21eb..680feae 100644
--- a/core/java/android/app/ActivityManagerNative.java
+++ b/core/java/android/app/ActivityManagerNative.java
@@ -108,7 +108,7 @@
         try {
             getDefault().broadcastIntent(
                 null, intent, null, null, Activity.RESULT_OK, null, null,
-                null /*permission*/, appOp, false, true, userId);
+                null /*permission*/, appOp, null, false, true, userId);
         } catch (RemoteException ex) {
         }
     }
@@ -458,12 +458,13 @@
             Bundle resultExtras = data.readBundle();
             String perm = data.readString();
             int appOp = data.readInt();
+            Bundle options = data.readBundle();
             boolean serialized = data.readInt() != 0;
             boolean sticky = data.readInt() != 0;
             int userId = data.readInt();
             int res = broadcastIntent(app, intent, resolvedType, resultTo,
                     resultCode, resultData, resultExtras, perm, appOp,
-                    serialized, sticky, userId);
+                    options, serialized, sticky, userId);
             reply.writeNoException();
             reply.writeInt(res);
             return true;
@@ -2991,9 +2992,9 @@
         reply.recycle();
     }
     public int broadcastIntent(IApplicationThread caller,
-            Intent intent, String resolvedType,  IIntentReceiver resultTo,
+            Intent intent, String resolvedType, IIntentReceiver resultTo,
             int resultCode, String resultData, Bundle map,
-            String requiredPermission, int appOp, boolean serialized,
+            String requiredPermission, int appOp, Bundle options, boolean serialized,
             boolean sticky, int userId) throws RemoteException
     {
         Parcel data = Parcel.obtain();
@@ -3008,6 +3009,7 @@
         data.writeBundle(map);
         data.writeString(requiredPermission);
         data.writeInt(appOp);
+        data.writeBundle(options);
         data.writeInt(serialized ? 1 : 0);
         data.writeInt(sticky ? 1 : 0);
         data.writeInt(userId);
diff --git a/core/java/android/app/ActivityOptions.java b/core/java/android/app/ActivityOptions.java
index 6fb997e..2406985 100644
--- a/core/java/android/app/ActivityOptions.java
+++ b/core/java/android/app/ActivityOptions.java
@@ -43,7 +43,7 @@
      * A long in the extras delivered by {@link #requestUsageTimeReport} that contains
      * the total time (in ms) the user spent in the app flow.
      */
-    public static final String EXTRA_USAGE_TIME_REPORT = "android.usage_time";
+    public static final String EXTRA_USAGE_TIME_REPORT = "android.activity.usage_time";
 
     /**
      * A Bundle in the extras delivered by {@link #requestUsageTimeReport} that contains
@@ -56,67 +56,67 @@
      * The package name that created the options.
      * @hide
      */
-    public static final String KEY_PACKAGE_NAME = "android:packageName";
+    public static final String KEY_PACKAGE_NAME = "android:activity.packageName";
 
     /**
      * Type of animation that arguments specify.
      * @hide
      */
-    public static final String KEY_ANIM_TYPE = "android:animType";
+    public static final String KEY_ANIM_TYPE = "android:activity.animType";
 
     /**
      * Custom enter animation resource ID.
      * @hide
      */
-    public static final String KEY_ANIM_ENTER_RES_ID = "android:animEnterRes";
+    public static final String KEY_ANIM_ENTER_RES_ID = "android:activity.animEnterRes";
 
     /**
      * Custom exit animation resource ID.
      * @hide
      */
-    public static final String KEY_ANIM_EXIT_RES_ID = "android:animExitRes";
+    public static final String KEY_ANIM_EXIT_RES_ID = "android:activity.animExitRes";
 
     /**
      * Custom in-place animation resource ID.
      * @hide
      */
-    public static final String KEY_ANIM_IN_PLACE_RES_ID = "android:animInPlaceRes";
+    public static final String KEY_ANIM_IN_PLACE_RES_ID = "android:activity.animInPlaceRes";
 
     /**
      * Bitmap for thumbnail animation.
      * @hide
      */
-    public static final String KEY_ANIM_THUMBNAIL = "android:animThumbnail";
+    public static final String KEY_ANIM_THUMBNAIL = "android:activity.animThumbnail";
 
     /**
      * Start X position of thumbnail animation.
      * @hide
      */
-    public static final String KEY_ANIM_START_X = "android:animStartX";
+    public static final String KEY_ANIM_START_X = "android:activity.animStartX";
 
     /**
      * Start Y position of thumbnail animation.
      * @hide
      */
-    public static final String KEY_ANIM_START_Y = "android:animStartY";
+    public static final String KEY_ANIM_START_Y = "android:activity.animStartY";
 
     /**
      * Initial width of the animation.
      * @hide
      */
-    public static final String KEY_ANIM_WIDTH = "android:animWidth";
+    public static final String KEY_ANIM_WIDTH = "android:activity.animWidth";
 
     /**
      * Initial height of the animation.
      * @hide
      */
-    public static final String KEY_ANIM_HEIGHT = "android:animHeight";
+    public static final String KEY_ANIM_HEIGHT = "android:activity.animHeight";
 
     /**
      * Callback for when animation is started.
      * @hide
      */
-    public static final String KEY_ANIM_START_LISTENER = "android:animStartListener";
+    public static final String KEY_ANIM_START_LISTENER = "android:activity.animStartListener";
 
     /**
      * For Activity transitions, the calling Activity's TransitionListener used to
@@ -124,15 +124,18 @@
      * complete.
      */
     private static final String KEY_TRANSITION_COMPLETE_LISTENER
-            = "android:transitionCompleteListener";
+            = "android:activity.transitionCompleteListener";
 
-    private static final String KEY_TRANSITION_IS_RETURNING = "android:transitionIsReturning";
-    private static final String KEY_TRANSITION_SHARED_ELEMENTS = "android:sharedElementNames";
-    private static final String KEY_RESULT_DATA = "android:resultData";
-    private static final String KEY_RESULT_CODE = "android:resultCode";
-    private static final String KEY_EXIT_COORDINATOR_INDEX = "android:exitCoordinatorIndex";
+    private static final String KEY_TRANSITION_IS_RETURNING
+            = "android:activity.transitionIsReturning";
+    private static final String KEY_TRANSITION_SHARED_ELEMENTS
+            = "android:activity.sharedElementNames";
+    private static final String KEY_RESULT_DATA = "android:activity.resultData";
+    private static final String KEY_RESULT_CODE = "android:activity.resultCode";
+    private static final String KEY_EXIT_COORDINATOR_INDEX
+            = "android:activity.exitCoordinatorIndex";
 
-    private static final String KEY_USAGE_TIME_REPORT = "android:usageTimeReport";
+    private static final String KEY_USAGE_TIME_REPORT = "android:activity.usageTimeReport";
 
     /** @hide */
     public static final int ANIM_NONE = 0;
diff --git a/core/java/android/app/BroadcastOptions.java b/core/java/android/app/BroadcastOptions.java
new file mode 100644
index 0000000..1f378da
--- /dev/null
+++ b/core/java/android/app/BroadcastOptions.java
@@ -0,0 +1,85 @@
+/*
+ * Copyright (C) 2015 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.app;
+
+import android.annotation.SystemApi;
+import android.os.Bundle;
+
+/**
+ * Helper class for building an options Bundle that can be used with
+ * {@link android.content.Context#sendBroadcast(android.content.Intent)
+ * Context.sendBroadcast(Intent)} and related methods.
+ * {@hide}
+ */
+@SystemApi
+public class BroadcastOptions {
+    private long mTemporaryAppWhitelistDuration;
+
+    /**
+     * How long to temporarily put an app on the power whitelist when executing this broadcast
+     * to it.
+     * @hide
+     */
+    public static final String KEY_TEMPORARY_APP_WHITELIST_DURATION
+            = "android:broadcast.temporaryAppWhitelistDuration";
+
+    public static BroadcastOptions makeBasic() {
+        BroadcastOptions opts = new BroadcastOptions();
+        return opts;
+    }
+
+    private BroadcastOptions() {
+    }
+
+    /** @hide */
+    public BroadcastOptions(Bundle opts) {
+        mTemporaryAppWhitelistDuration = opts.getLong(KEY_TEMPORARY_APP_WHITELIST_DURATION);
+    }
+
+    /**
+     * Set a duration for which the system should temporary place an application on the
+     * power whitelist when this broadcast is being delivered to it.
+     * @param duration The duration in milliseconds; 0 means to not place on whitelist.
+     */
+    public void setTemporaryAppWhitelistDuration(long duration) {
+        mTemporaryAppWhitelistDuration = duration;
+    }
+
+    /**
+     * Return {@link #setTemporaryAppWhitelistDuration}.
+     * @hide
+     */
+    public long getTemporaryAppWhitelistDuration() {
+        return mTemporaryAppWhitelistDuration;
+    }
+
+    /**
+     * Returns the created options as a Bundle, which can be passed to
+     * {@link android.content.Context#sendBroadcast(android.content.Intent)
+     * Context.sendBroadcast(Intent)} and related methods.
+     * Note that the returned Bundle is still owned by the ActivityOptions
+     * object; you must not modify it, but can supply it to the sendBroadcast
+     * methods that take an options Bundle.
+     */
+    public Bundle toBundle() {
+        Bundle b = new Bundle();
+        if (mTemporaryAppWhitelistDuration > 0) {
+            b.putLong(KEY_TEMPORARY_APP_WHITELIST_DURATION, mTemporaryAppWhitelistDuration);
+        }
+        return b.isEmpty() ? null : b;
+    }
+}
diff --git a/core/java/android/app/ContextImpl.java b/core/java/android/app/ContextImpl.java
index be36af7..0420fb6 100644
--- a/core/java/android/app/ContextImpl.java
+++ b/core/java/android/app/ContextImpl.java
@@ -46,7 +46,6 @@
 import android.database.sqlite.SQLiteDatabase.CursorFactory;
 import android.graphics.Bitmap;
 import android.graphics.drawable.Drawable;
-import android.hardware.display.DisplayManager;
 import android.net.Uri;
 import android.os.Binder;
 import android.os.Build;
@@ -676,8 +675,8 @@
                     + " Is this really what you want?");
         }
         mMainThread.getInstrumentation().execStartActivity(
-            getOuterContext(), mMainThread.getApplicationThread(), null,
-            (Activity)null, intent, -1, options);
+                getOuterContext(), mMainThread.getApplicationThread(), null,
+                (Activity) null, intent, -1, options);
     }
 
     /** @hide */
@@ -710,8 +709,8 @@
                     + " Is this really what you want?");
         }
         mMainThread.getInstrumentation().execStartActivitiesAsUser(
-            getOuterContext(), mMainThread.getApplicationThread(), null,
-            (Activity)null, intents, options, userHandle.getIdentifier());
+                getOuterContext(), mMainThread.getApplicationThread(), null,
+                (Activity) null, intents, options, userHandle.getIdentifier());
     }
 
     @Override
@@ -724,8 +723,8 @@
                     + " Is this really what you want?");
         }
         mMainThread.getInstrumentation().execStartActivities(
-            getOuterContext(), mMainThread.getApplicationThread(), null,
-            (Activity)null, intents, options);
+                getOuterContext(), mMainThread.getApplicationThread(), null,
+                (Activity) null, intents, options);
     }
 
     @Override
@@ -766,9 +765,9 @@
         try {
             intent.prepareToLeaveProcess();
             ActivityManagerNative.getDefault().broadcastIntent(
-                mMainThread.getApplicationThread(), intent, resolvedType, null,
-                Activity.RESULT_OK, null, null, null, AppOpsManager.OP_NONE, false, false,
-                getUserId());
+                    mMainThread.getApplicationThread(), intent, resolvedType, null,
+                    Activity.RESULT_OK, null, null, null, AppOpsManager.OP_NONE, null, false, false,
+                    getUserId());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
@@ -781,9 +780,24 @@
         try {
             intent.prepareToLeaveProcess();
             ActivityManagerNative.getDefault().broadcastIntent(
-                mMainThread.getApplicationThread(), intent, resolvedType, null,
-                Activity.RESULT_OK, null, null, receiverPermission, AppOpsManager.OP_NONE,
-                false, false, getUserId());
+                    mMainThread.getApplicationThread(), intent, resolvedType, null,
+                    Activity.RESULT_OK, null, null, receiverPermission, AppOpsManager.OP_NONE,
+                    null, false, false, getUserId());
+        } catch (RemoteException e) {
+            throw new RuntimeException("Failure from system", e);
+        }
+    }
+
+    @Override
+    public void sendBroadcast(Intent intent, String receiverPermission, Bundle options) {
+        warnIfCallingFromSystemProcess();
+        String resolvedType = intent.resolveTypeIfNeeded(getContentResolver());
+        try {
+            intent.prepareToLeaveProcess();
+            ActivityManagerNative.getDefault().broadcastIntent(
+                    mMainThread.getApplicationThread(), intent, resolvedType, null,
+                    Activity.RESULT_OK, null, null, receiverPermission, AppOpsManager.OP_NONE,
+                    options, false, false, getUserId());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
@@ -796,25 +810,24 @@
         try {
             intent.prepareToLeaveProcess();
             ActivityManagerNative.getDefault().broadcastIntent(
-                mMainThread.getApplicationThread(), intent, resolvedType, null,
-                Activity.RESULT_OK, null, null, receiverPermission, appOp, false, false,
-                getUserId());
+                    mMainThread.getApplicationThread(), intent, resolvedType, null,
+                    Activity.RESULT_OK, null, null, receiverPermission, appOp, null, false, false,
+                    getUserId());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
     }
 
     @Override
-    public void sendOrderedBroadcast(Intent intent,
-            String receiverPermission) {
+    public void sendOrderedBroadcast(Intent intent, String receiverPermission) {
         warnIfCallingFromSystemProcess();
         String resolvedType = intent.resolveTypeIfNeeded(getContentResolver());
         try {
             intent.prepareToLeaveProcess();
             ActivityManagerNative.getDefault().broadcastIntent(
-                mMainThread.getApplicationThread(), intent, resolvedType, null,
-                Activity.RESULT_OK, null, null, receiverPermission, AppOpsManager.OP_NONE, true, false,
-                getUserId());
+                    mMainThread.getApplicationThread(), intent, resolvedType, null,
+                    Activity.RESULT_OK, null, null, receiverPermission, AppOpsManager.OP_NONE,
+                    null, true, false, getUserId());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
@@ -826,7 +839,16 @@
             Handler scheduler, int initialCode, String initialData,
             Bundle initialExtras) {
         sendOrderedBroadcast(intent, receiverPermission, AppOpsManager.OP_NONE,
-                resultReceiver, scheduler, initialCode, initialData, initialExtras);
+                resultReceiver, scheduler, initialCode, initialData, initialExtras, null);
+    }
+
+    @Override
+    public void sendOrderedBroadcast(Intent intent,
+            String receiverPermission, Bundle options, BroadcastReceiver resultReceiver,
+            Handler scheduler, int initialCode, String initialData,
+            Bundle initialExtras) {
+        sendOrderedBroadcast(intent, receiverPermission, AppOpsManager.OP_NONE,
+                resultReceiver, scheduler, initialCode, initialData, initialExtras, options);
     }
 
     @Override
@@ -834,6 +856,14 @@
             String receiverPermission, int appOp, BroadcastReceiver resultReceiver,
             Handler scheduler, int initialCode, String initialData,
             Bundle initialExtras) {
+        sendOrderedBroadcast(intent, receiverPermission, appOp,
+                resultReceiver, scheduler, initialCode, initialData, initialExtras, null);
+    }
+
+    void sendOrderedBroadcast(Intent intent,
+            String receiverPermission, int appOp, BroadcastReceiver resultReceiver,
+            Handler scheduler, int initialCode, String initialData,
+            Bundle initialExtras, Bundle options) {
         warnIfCallingFromSystemProcess();
         IIntentReceiver rd = null;
         if (resultReceiver != null) {
@@ -858,7 +888,7 @@
             ActivityManagerNative.getDefault().broadcastIntent(
                 mMainThread.getApplicationThread(), intent, resolvedType, rd,
                 initialCode, initialData, initialExtras, receiverPermission, appOp,
-                    true, false, getUserId());
+                    options, true, false, getUserId());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
@@ -871,7 +901,7 @@
             intent.prepareToLeaveProcess();
             ActivityManagerNative.getDefault().broadcastIntent(mMainThread.getApplicationThread(),
                     intent, resolvedType, null, Activity.RESULT_OK, null, null, null,
-                    AppOpsManager.OP_NONE, false, false, user.getIdentifier());
+                    AppOpsManager.OP_NONE, null, false, false, user.getIdentifier());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
@@ -891,7 +921,7 @@
             intent.prepareToLeaveProcess();
             ActivityManagerNative.getDefault().broadcastIntent(
                     mMainThread.getApplicationThread(), intent, resolvedType, null,
-                    Activity.RESULT_OK, null, null, receiverPermission, appOp, false, false,
+                    Activity.RESULT_OK, null, null, receiverPermission, appOp, null, false, false,
                     user.getIdentifier());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
@@ -934,7 +964,7 @@
             ActivityManagerNative.getDefault().broadcastIntent(
                 mMainThread.getApplicationThread(), intent, resolvedType, rd,
                 initialCode, initialData, initialExtras, receiverPermission,
-                    appOp, true, false, user.getIdentifier());
+                    appOp, null, true, false, user.getIdentifier());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
@@ -949,7 +979,7 @@
             intent.prepareToLeaveProcess();
             ActivityManagerNative.getDefault().broadcastIntent(
                 mMainThread.getApplicationThread(), intent, resolvedType, null,
-                Activity.RESULT_OK, null, null, null, AppOpsManager.OP_NONE, false, true,
+                Activity.RESULT_OK, null, null, null, AppOpsManager.OP_NONE, null, false, true,
                 getUserId());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
@@ -986,7 +1016,7 @@
             ActivityManagerNative.getDefault().broadcastIntent(
                 mMainThread.getApplicationThread(), intent, resolvedType, rd,
                 initialCode, initialData, initialExtras, null,
-                    AppOpsManager.OP_NONE, true, true, getUserId());
+                    AppOpsManager.OP_NONE, null, true, true, getUserId());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
@@ -1017,7 +1047,7 @@
             intent.prepareToLeaveProcess();
             ActivityManagerNative.getDefault().broadcastIntent(
                 mMainThread.getApplicationThread(), intent, resolvedType, null,
-                Activity.RESULT_OK, null, null, null, AppOpsManager.OP_NONE, false, true, user.getIdentifier());
+                Activity.RESULT_OK, null, null, null, AppOpsManager.OP_NONE, null, false, true, user.getIdentifier());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
@@ -1052,7 +1082,7 @@
             ActivityManagerNative.getDefault().broadcastIntent(
                 mMainThread.getApplicationThread(), intent, resolvedType, rd,
                 initialCode, initialData, initialExtras, null,
-                    AppOpsManager.OP_NONE, true, true, user.getIdentifier());
+                    AppOpsManager.OP_NONE, null, true, true, user.getIdentifier());
         } catch (RemoteException e) {
             throw new RuntimeException("Failure from system", e);
         }
diff --git a/core/java/android/app/IActivityManager.java b/core/java/android/app/IActivityManager.java
index 9311e5e..e7f7e13 100644
--- a/core/java/android/app/IActivityManager.java
+++ b/core/java/android/app/IActivityManager.java
@@ -107,7 +107,7 @@
     public int broadcastIntent(IApplicationThread caller, Intent intent,
             String resolvedType, IIntentReceiver resultTo, int resultCode,
             String resultData, Bundle map, String requiredPermission,
-            int appOp, boolean serialized, boolean sticky, int userId) throws RemoteException;
+            int appOp, Bundle options, boolean serialized, boolean sticky, int userId) throws RemoteException;
     public void unbroadcastIntent(IApplicationThread caller, Intent intent, int userId) throws RemoteException;
     public void finishReceiver(IBinder who, int resultCode, String resultData, Bundle map,
             boolean abortBroadcast, int flags) throws RemoteException;
diff --git a/core/java/android/app/Notification.java b/core/java/android/app/Notification.java
index 33a47b24..5a0d246 100644
--- a/core/java/android/app/Notification.java
+++ b/core/java/android/app/Notification.java
@@ -1371,6 +1371,9 @@
         when = parcel.readLong();
         if (parcel.readInt() != 0) {
             mSmallIcon = Icon.CREATOR.createFromParcel(parcel);
+            if (mSmallIcon.getType() == Icon.TYPE_RESOURCE) {
+                icon = mSmallIcon.getResId();
+            }
         }
         number = parcel.readInt();
         if (parcel.readInt() != 0) {
@@ -1588,13 +1591,17 @@
     }
 
     /**
-     * Flatten this notification from a parcel.
+     * Flatten this notification into a parcel.
      */
     public void writeToParcel(Parcel parcel, int flags)
     {
         parcel.writeInt(1);
 
         parcel.writeLong(when);
+        if (mSmallIcon == null && icon != 0) {
+            // you snuck an icon in here without using the builder; let's try to keep it
+            mSmallIcon = Icon.createWithResource("", icon);
+        }
         if (mSmallIcon != null) {
             parcel.writeInt(1);
             mSmallIcon.writeToParcel(parcel, 0);
@@ -2791,7 +2798,10 @@
             return this;
         }
 
-        private void setFlag(int mask, boolean value) {
+        /**
+         * @hide
+         */
+        public void setFlag(int mask, boolean value) {
             if (value) {
                 mFlags |= mask;
             } else {
diff --git a/core/java/android/app/NotificationManager.java b/core/java/android/app/NotificationManager.java
index 0904e21..605c006 100644
--- a/core/java/android/app/NotificationManager.java
+++ b/core/java/android/app/NotificationManager.java
@@ -25,6 +25,7 @@
 import android.content.pm.ParceledListSlice;
 import android.graphics.drawable.Icon;
 import android.net.Uri;
+import android.os.Build;
 import android.os.Bundle;
 import android.os.Handler;
 import android.os.IBinder;
@@ -216,6 +217,12 @@
             }
         }
         fixLegacySmallIcon(notification, pkg);
+        if (mContext.getApplicationInfo().targetSdkVersion > Build.VERSION_CODES.LOLLIPOP_MR1) {
+            if (notification.getSmallIcon() == null) {
+                throw new IllegalArgumentException("Invalid notification (no valid small icon): "
+                    + notification);
+            }
+        }
         if (localLOGV) Log.v(TAG, pkg + ": notify(" + id + ", " + notification + ")");
         Notification stripped = notification.clone();
         Builder.stripForDelivery(stripped);
diff --git a/core/java/android/app/PendingIntent.java b/core/java/android/app/PendingIntent.java
index 031854a..c42ba65 100644
--- a/core/java/android/app/PendingIntent.java
+++ b/core/java/android/app/PendingIntent.java
@@ -613,7 +613,7 @@
      * is no longer allowing more intents to be sent through it.
      */
     public void send() throws CanceledException {
-        send(null, 0, null, null, null, null);
+        send(null, 0, null, null, null, null, null);
     }
 
     /**
@@ -627,7 +627,7 @@
      * is no longer allowing more intents to be sent through it.
      */
     public void send(int code) throws CanceledException {
-        send(null, code, null, null, null, null);
+        send(null, code, null, null, null, null, null);
     }
 
     /**
@@ -646,9 +646,9 @@
      * @throws CanceledException Throws CanceledException if the PendingIntent
      * is no longer allowing more intents to be sent through it.
      */
-    public void send(Context context, int code, Intent intent)
+    public void send(Context context, int code, @Nullable Intent intent)
             throws CanceledException {
-        send(context, code, intent, null, null, null);
+        send(context, code, intent, null, null, null, null);
     }
 
     /**
@@ -667,9 +667,9 @@
      * @throws CanceledException Throws CanceledException if the PendingIntent
      * is no longer allowing more intents to be sent through it.
      */
-    public void send(int code, OnFinished onFinished, Handler handler)
+    public void send(int code, @Nullable OnFinished onFinished, @Nullable Handler handler)
             throws CanceledException {
-        send(null, code, null, onFinished, handler, null);
+        send(null, code, null, onFinished, handler, null, null);
     }
 
     /**
@@ -705,9 +705,9 @@
      * @throws CanceledException Throws CanceledException if the PendingIntent
      * is no longer allowing more intents to be sent through it.
      */
-    public void send(Context context, int code, Intent intent,
-            OnFinished onFinished, Handler handler) throws CanceledException {
-        send(context, code, intent, onFinished, handler, null);
+    public void send(Context context, int code, @Nullable Intent intent,
+            @Nullable OnFinished onFinished, @Nullable Handler handler) throws CanceledException {
+        send(context, code, intent, onFinished, handler, null, null);
     }
 
     /**
@@ -748,8 +748,56 @@
      * @throws CanceledException Throws CanceledException if the PendingIntent
      * is no longer allowing more intents to be sent through it.
      */
-    public void send(Context context, int code, Intent intent,
-            OnFinished onFinished, Handler handler, String requiredPermission)
+    public void send(Context context, int code, @Nullable Intent intent,
+            @Nullable OnFinished onFinished, @Nullable Handler handler,
+            @Nullable String requiredPermission)
+            throws CanceledException {
+        send(context, code, intent, onFinished, handler, requiredPermission, null);
+    }
+
+    /**
+     * Perform the operation associated with this PendingIntent, allowing the
+     * caller to specify information about the Intent to use and be notified
+     * when the send has completed.
+     *
+     * <p>For the intent parameter, a PendingIntent
+     * often has restrictions on which fields can be supplied here, based on
+     * how the PendingIntent was retrieved in {@link #getActivity},
+     * {@link #getBroadcast}, or {@link #getService}.
+     *
+     * @param context The Context of the caller.  This may be null if
+     * <var>intent</var> is also null.
+     * @param code Result code to supply back to the PendingIntent's target.
+     * @param intent Additional Intent data.  See {@link Intent#fillIn
+     * Intent.fillIn()} for information on how this is applied to the
+     * original Intent.  Use null to not modify the original Intent.
+     * If flag {@link #FLAG_IMMUTABLE} was set when this pending intent was
+     * created, this argument will be ignored.
+     * @param onFinished The object to call back on when the send has
+     * completed, or null for no callback.
+     * @param handler Handler identifying the thread on which the callback
+     * should happen.  If null, the callback will happen from the thread
+     * pool of the process.
+     * @param requiredPermission Name of permission that a recipient of the PendingIntent
+     * is required to hold.  This is only valid for broadcast intents, and
+     * corresponds to the permission argument in
+     * {@link Context#sendBroadcast(Intent, String) Context.sendOrderedBroadcast(Intent, String)}.
+     * If null, no permission is required.
+     * @param options Additional options the caller would like to provide to modify the sending
+     * behavior.  May be built from an {@link ActivityOptions} to apply to an activity start.
+     *
+     * @see #send()
+     * @see #send(int)
+     * @see #send(Context, int, Intent)
+     * @see #send(int, android.app.PendingIntent.OnFinished, Handler)
+     * @see #send(Context, int, Intent, OnFinished, Handler)
+     *
+     * @throws CanceledException Throws CanceledException if the PendingIntent
+     * is no longer allowing more intents to be sent through it.
+     */
+    public void send(Context context, int code, @Nullable Intent intent,
+            @Nullable OnFinished onFinished, @Nullable Handler handler,
+            @Nullable String requiredPermission, @Nullable Bundle options)
             throws CanceledException {
         try {
             String resolvedType = intent != null ?
@@ -759,7 +807,7 @@
                     onFinished != null
                             ? new FinishedDispatcher(this, onFinished, handler)
                             : null,
-                    requiredPermission);
+                    requiredPermission, options);
             if (res < 0) {
                 throw new CanceledException();
             }
diff --git a/core/java/android/app/admin/DevicePolicyManager.java b/core/java/android/app/admin/DevicePolicyManager.java
index ed20086..b9862ca 100644
--- a/core/java/android/app/admin/DevicePolicyManager.java
+++ b/core/java/android/app/admin/DevicePolicyManager.java
@@ -552,19 +552,6 @@
         = "android.app.extra.PROVISIONING_DEVICE_INITIALIZER_SIGNATURE_CHECKSUM";
 
     /**
-     * A {@link android.os.Parcelable} extra of type {@link android.os.PersistableBundle} that
-     * holds data needed by the system to wipe factory reset protection. The data needed to wipe
-     * the device depend on the installed factory reset protection implementation. For example,
-     * if an account is needed to unlock a device, this extra may contain data used to
-     * authenticate that account.
-     *
-     * <p>Use in an NFC record with {@link #MIME_TYPE_PROVISIONING_NFC_V2} that starts device owner
-     * provisioning via an NFC bump.
-     */
-    public static final String EXTRA_PROVISIONING_RESET_PROTECTION_PARAMETERS
-            = "android.app.extra.PROVISIONING_RESET_PROTECTION_PARAMETERS";
-
-    /**
      * This MIME type is used for starting the Device Owner provisioning that does not require
      * provisioning features introduced in Android API level
      * {@link android.os.Build.VERSION_CODES#MNC} or later levels.
diff --git a/core/java/android/appwidget/AppWidgetManager.java b/core/java/android/appwidget/AppWidgetManager.java
index 1205708..278c9d6 100644
--- a/core/java/android/appwidget/AppWidgetManager.java
+++ b/core/java/android/appwidget/AppWidgetManager.java
@@ -20,6 +20,7 @@
 import android.content.ComponentName;
 import android.content.Context;
 import android.content.Intent;
+import android.content.pm.ParceledListSlice;
 import android.os.Bundle;
 import android.os.IBinder;
 import android.os.Process;
@@ -753,16 +754,16 @@
         }
 
         try {
-            List<AppWidgetProviderInfo> providers = mService.getInstalledProvidersForProfile(
+            ParceledListSlice<AppWidgetProviderInfo> providers = mService.getInstalledProvidersForProfile(
                     categoryFilter, profile.getIdentifier());
             if (providers == null) {
                 return Collections.emptyList();
             }
-            for (AppWidgetProviderInfo info : providers) {
+            for (AppWidgetProviderInfo info : providers.getList()) {
                 // Converting complex to dp.
                 convertSizesToPixels(info);
             }
-            return providers;
+            return providers.getList();
         }
         catch (RemoteException e) {
             throw new RuntimeException("system server dead?", e);
diff --git a/core/java/android/content/Context.java b/core/java/android/content/Context.java
index 83ce087..675515b 100644
--- a/core/java/android/content/Context.java
+++ b/core/java/android/content/Context.java
@@ -1517,6 +1517,38 @@
             @Nullable String receiverPermission);
 
     /**
+     * Broadcast the given intent to all interested BroadcastReceivers, allowing
+     * an optional required permission to be enforced.  This
+     * call is asynchronous; it returns immediately, and you will continue
+     * executing while the receivers are run.  No results are propagated from
+     * receivers and receivers can not abort the broadcast. If you want
+     * to allow receivers to propagate results or abort the broadcast, you must
+     * send an ordered broadcast using
+     * {@link #sendOrderedBroadcast(Intent, String)}.
+     *
+     * <p>See {@link BroadcastReceiver} for more information on Intent broadcasts.
+     *
+     * @param intent The Intent to broadcast; all receivers matching this
+     *               Intent will receive the broadcast.
+     * @param receiverPermission (optional) String naming a permission that
+     *               a receiver must hold in order to receive your broadcast.
+     *               If null, no permission is required.
+     * @param options (optional) Additional sending options, generated from a
+     * {@link android.app.BroadcastOptions}.
+     *
+     * @see android.content.BroadcastReceiver
+     * @see #registerReceiver
+     * @see #sendBroadcast(Intent)
+     * @see #sendOrderedBroadcast(Intent, String)
+     * @see #sendOrderedBroadcast(Intent, String, BroadcastReceiver, Handler, int, String, Bundle)
+     * @hide
+     */
+    @SystemApi
+    public abstract void sendBroadcast(Intent intent,
+            @Nullable String receiverPermission,
+            @Nullable Bundle options);
+
+    /**
      * Like {@link #sendBroadcast(Intent, String)}, but also allows specification
      * of an associated app op as per {@link android.app.AppOpsManager}.
      * @hide
@@ -1588,11 +1620,60 @@
      * @see android.app.Activity#RESULT_OK
      */
     public abstract void sendOrderedBroadcast(@NonNull Intent intent,
-            @Nullable String receiverPermission, BroadcastReceiver resultReceiver,
+            @Nullable String receiverPermission, @Nullable BroadcastReceiver resultReceiver,
             @Nullable Handler scheduler, int initialCode, @Nullable String initialData,
             @Nullable Bundle initialExtras);
 
     /**
+     * Version of {@link #sendBroadcast(Intent)} that allows you to
+     * receive data back from the broadcast.  This is accomplished by
+     * supplying your own BroadcastReceiver when calling, which will be
+     * treated as a final receiver at the end of the broadcast -- its
+     * {@link BroadcastReceiver#onReceive} method will be called with
+     * the result values collected from the other receivers.  The broadcast will
+     * be serialized in the same way as calling
+     * {@link #sendOrderedBroadcast(Intent, String)}.
+     *
+     * <p>Like {@link #sendBroadcast(Intent)}, this method is
+     * asynchronous; it will return before
+     * resultReceiver.onReceive() is called.
+     *
+     * <p>See {@link BroadcastReceiver} for more information on Intent broadcasts.
+     *
+     *
+     * @param intent The Intent to broadcast; all receivers matching this
+     *               Intent will receive the broadcast.
+     * @param receiverPermission String naming a permissions that
+     *               a receiver must hold in order to receive your broadcast.
+     *               If null, no permission is required.
+     * @param options (optional) Additional sending options, generated from a
+     * {@link android.app.BroadcastOptions}.
+     * @param resultReceiver Your own BroadcastReceiver to treat as the final
+     *                       receiver of the broadcast.
+     * @param scheduler A custom Handler with which to schedule the
+     *                  resultReceiver callback; if null it will be
+     *                  scheduled in the Context's main thread.
+     * @param initialCode An initial value for the result code.  Often
+     *                    Activity.RESULT_OK.
+     * @param initialData An initial value for the result data.  Often
+     *                    null.
+     * @param initialExtras An initial value for the result extras.  Often
+     *                      null.
+     * @see #sendBroadcast(Intent)
+     * @see #sendBroadcast(Intent, String)
+     * @see #sendOrderedBroadcast(Intent, String)
+     * @see android.content.BroadcastReceiver
+     * @see #registerReceiver
+     * @see android.app.Activity#RESULT_OK
+     * @hide
+     */
+    @SystemApi
+    public abstract void sendOrderedBroadcast(@NonNull Intent intent,
+            @Nullable String receiverPermission, @Nullable Bundle options,
+            @Nullable BroadcastReceiver resultReceiver, @Nullable Handler scheduler,
+            int initialCode, @Nullable String initialData, @Nullable Bundle initialExtras);
+
+    /**
      * Like {@link #sendOrderedBroadcast(Intent, String, BroadcastReceiver, android.os.Handler,
      * int, String, android.os.Bundle)}, but also allows specification
      * of an associated app op as per {@link android.app.AppOpsManager}.
diff --git a/core/java/android/content/ContextWrapper.java b/core/java/android/content/ContextWrapper.java
index fb9e194..4e7c832 100644
--- a/core/java/android/content/ContextWrapper.java
+++ b/core/java/android/content/ContextWrapper.java
@@ -16,6 +16,7 @@
 
 package android.content;
 
+import android.annotation.SystemApi;
 import android.content.pm.ApplicationInfo;
 import android.content.pm.PackageManager;
 import android.content.res.AssetManager;
@@ -401,6 +402,13 @@
     }
 
     /** @hide */
+    @SystemApi
+    @Override
+    public void sendBroadcast(Intent intent, String receiverPermission, Bundle options) {
+        mBase.sendBroadcast(intent, receiverPermission, options);
+    }
+
+    /** @hide */
     @Override
     public void sendBroadcast(Intent intent, String receiverPermission, int appOp) {
         mBase.sendBroadcast(intent, receiverPermission, appOp);
@@ -423,6 +431,18 @@
     }
 
     /** @hide */
+    @SystemApi
+    @Override
+    public void sendOrderedBroadcast(
+            Intent intent, String receiverPermission, Bundle options, BroadcastReceiver resultReceiver,
+            Handler scheduler, int initialCode, String initialData,
+            Bundle initialExtras) {
+        mBase.sendOrderedBroadcast(intent, receiverPermission,
+                options, resultReceiver, scheduler, initialCode,
+                initialData, initialExtras);
+    }
+
+    /** @hide */
     @Override
     public void sendOrderedBroadcast(
         Intent intent, String receiverPermission, int appOp, BroadcastReceiver resultReceiver,
diff --git a/core/java/android/content/IIntentSender.aidl b/core/java/android/content/IIntentSender.aidl
index 7dbd6f2..f3affa7 100644
--- a/core/java/android/content/IIntentSender.aidl
+++ b/core/java/android/content/IIntentSender.aidl
@@ -18,9 +18,10 @@
 
 import android.content.IIntentReceiver;
 import android.content.Intent;
+import android.os.Bundle;
 
 /** @hide */
 interface IIntentSender {
     int send(int code, in Intent intent, String resolvedType,
-            IIntentReceiver finishedReceiver, String requiredPermission);
+            IIntentReceiver finishedReceiver, String requiredPermission, in Bundle options);
 }
diff --git a/core/java/android/content/IntentSender.java b/core/java/android/content/IntentSender.java
index 166495b..13a767e 100644
--- a/core/java/android/content/IntentSender.java
+++ b/core/java/android/content/IntentSender.java
@@ -195,7 +195,7 @@
                     onFinished != null
                             ? new FinishedDispatcher(this, onFinished, handler)
                             : null,
-                    requiredPermission);
+                    requiredPermission, null);
             if (res < 0) {
                 throw new SendIntentException();
             }
diff --git a/core/java/android/content/pm/PackageManager.java b/core/java/android/content/pm/PackageManager.java
index bd50ca0..dd1c5c2 100644
--- a/core/java/android/content/pm/PackageManager.java
+++ b/core/java/android/content/pm/PackageManager.java
@@ -2900,7 +2900,7 @@
      *
      * @return A List&lt;ResolveInfo&gt; containing one entry for each matching
      *         Receiver. These are ordered from first to last in priority.  If
-     *         there are no matching receivers, an empty list is returned.
+     *         there are no matching receivers, an empty list or {@code null} is returned.
      *
      * @see #MATCH_DEFAULT_ONLY
      * @see #GET_INTENT_FILTERS
@@ -2936,7 +2936,7 @@
      *         ServiceInfo. These are ordered from best to worst match -- that
      *         is, the first item in the list is what is returned by
      *         resolveService().  If there are no matching services, an empty
-     *         list is returned.
+     *         list or {@code null} is returned.
      *
      * @see #GET_INTENT_FILTERS
      * @see #GET_RESOLVED_FILTER
@@ -2955,7 +2955,7 @@
      *         ServiceInfo. These are ordered from best to worst match -- that
      *         is, the first item in the list is what is returned by
      *         resolveService().  If there are no matching services, an empty
-     *         list is returned.
+     *         list or {@code null} is returned.
      *
      * @see #GET_INTENT_FILTERS
      * @see #GET_RESOLVED_FILTER
@@ -2977,7 +2977,7 @@
      * @param flags Additional option flags.
      * @return A List&lt;ResolveInfo&gt; containing one entry for each matching
      *         ProviderInfo. These are ordered from best to worst match. If
-     *         there are no matching providers, an empty list is returned.
+     *         there are no matching providers, an empty list or {@code null} is returned.
      * @see #GET_INTENT_FILTERS
      * @see #GET_RESOLVED_FILTER
      */
diff --git a/core/java/android/hardware/camera2/impl/CameraDeviceImpl.java b/core/java/android/hardware/camera2/impl/CameraDeviceImpl.java
index a1ebe6a..83128c3 100644
--- a/core/java/android/hardware/camera2/impl/CameraDeviceImpl.java
+++ b/core/java/android/hardware/camera2/impl/CameraDeviceImpl.java
@@ -537,12 +537,16 @@
             CameraAccessException pendingException = null;
             Surface input = null;
             try {
-                 // configure streams and then block until IDLE
+                // configure streams and then block until IDLE
                 configureSuccess = configureStreamsChecked(inputConfig, outputConfigurations,
                         isConstrainedHighSpeed);
-                if (inputConfig != null) {
+                if (configureSuccess == true && inputConfig != null) {
                     input = new Surface();
-                    mRemoteDevice.getInputSurface(/*out*/input);
+                    try {
+                        mRemoteDevice.getInputSurface(/*out*/input);
+                    } catch (CameraRuntimeException e) {
+                        e.asChecked();
+                    }
                 }
             } catch (CameraAccessException e) {
                 configureSuccess = false;
@@ -2049,6 +2053,8 @@
         // Prepare the Request builders: need carry over the request controls.
         // First, create a request builder that will only include preview or recording target.
         CameraMetadataNative requestMetadata = new CameraMetadataNative(request.getNativeCopy());
+        // Note that after this step, the requestMetadata is mutated (swapped) and can not be used
+        // for next request builder creation.
         CaptureRequest.Builder singleTargetRequestBuilder = new CaptureRequest.Builder(
                 requestMetadata, /*reprocess*/false, CameraCaptureSession.SESSION_ID_NONE);
 
@@ -2069,6 +2075,9 @@
         // Second, Create a request builder that will include both preview and recording targets.
         CaptureRequest.Builder doubleTargetRequestBuilder = null;
         if (outputSurfaces.size() == 2) {
+            // Have to create a new copy, the original one was mutated after a new
+            // CaptureRequest.Builder creation.
+            requestMetadata = new CameraMetadataNative(request.getNativeCopy());
             doubleTargetRequestBuilder = new CaptureRequest.Builder(
                     requestMetadata, /*reprocess*/false, CameraCaptureSession.SESSION_ID_NONE);
             doubleTargetRequestBuilder.set(CaptureRequest.CONTROL_CAPTURE_INTENT,
diff --git a/core/java/android/hardware/camera2/utils/CameraBinderDecorator.java b/core/java/android/hardware/camera2/utils/CameraBinderDecorator.java
index d461bca..1aee794 100644
--- a/core/java/android/hardware/camera2/utils/CameraBinderDecorator.java
+++ b/core/java/android/hardware/camera2/utils/CameraBinderDecorator.java
@@ -138,8 +138,8 @@
          * errors, then add them to the top switch statement
          */
         if (errorFlag < 0) {
-            throw new UnsupportedOperationException(String.format("Unknown error %d",
-                    errorFlag));
+            throw new CameraRuntimeException(CAMERA_ERROR,
+                    String.format("Unknown camera device error %d", errorFlag));
         }
     }
 
diff --git a/core/java/android/net/NetworkPolicyManager.java b/core/java/android/net/NetworkPolicyManager.java
index ecc3fb4..3f40484 100644
--- a/core/java/android/net/NetworkPolicyManager.java
+++ b/core/java/android/net/NetworkPolicyManager.java
@@ -61,6 +61,17 @@
     public static final int FIREWALL_RULE_ALLOW = 1;
     public static final int FIREWALL_RULE_DENY = 2;
 
+    public static final int FIREWALL_TYPE_WHITELIST = 0;
+    public static final int FIREWALL_TYPE_BLACKLIST = 1;
+
+    public static final int FIREWALL_CHAIN_NONE = 0;
+    public static final int FIREWALL_CHAIN_DOZABLE = 1;
+    public static final int FIREWALL_CHAIN_STANDBY = 2;
+
+    public static final String FIREWALL_CHAIN_NAME_NONE = "none";
+    public static final String FIREWALL_CHAIN_NAME_DOZABLE = "dozable";
+    public static final String FIREWALL_CHAIN_NAME_STANDBY = "standby";
+
     private static final boolean ALLOW_PLATFORM_APP_POLICY = true;
 
     /**
diff --git a/core/java/android/os/BatteryStats.java b/core/java/android/os/BatteryStats.java
index d165240..eb6e1c2 100644
--- a/core/java/android/os/BatteryStats.java
+++ b/core/java/android/os/BatteryStats.java
@@ -1165,25 +1165,23 @@
         public static final int EVENT_USER_FOREGROUND = 0x0008;
         // Event for connectivity changed.
         public static final int EVENT_CONNECTIVITY_CHANGED = 0x0009;
-        // Event for significant motion taking us out of idle mode.
-        public static final int EVENT_SIGNIFICANT_MOTION = 0x000a;
         // Event for becoming active taking us out of idle mode.
-        public static final int EVENT_ACTIVE = 0x000b;
+        public static final int EVENT_ACTIVE = 0x000a;
         // Event for a package being installed.
-        public static final int EVENT_PACKAGE_INSTALLED = 0x000c;
+        public static final int EVENT_PACKAGE_INSTALLED = 0x000b;
         // Event for a package being uninstalled.
-        public static final int EVENT_PACKAGE_UNINSTALLED = 0x000d;
+        public static final int EVENT_PACKAGE_UNINSTALLED = 0x000c;
         // Event for a package being uninstalled.
-        public static final int EVENT_ALARM = 0x000e;
+        public static final int EVENT_ALARM = 0x000d;
         // Record that we have decided we need to collect new stats data.
-        public static final int EVENT_COLLECT_EXTERNAL_STATS = 0x000f;
+        public static final int EVENT_COLLECT_EXTERNAL_STATS = 0x000e;
         // Event for a package becoming inactive due to being unused for a period of time.
-        public static final int EVENT_PACKAGE_INACTIVE = 0x0010;
+        public static final int EVENT_PACKAGE_INACTIVE = 0x000f;
         // Event for a package becoming active due to an interaction.
-        public static final int EVENT_PACKAGE_ACTIVE = 0x0011;
+        public static final int EVENT_PACKAGE_ACTIVE = 0x0010;
 
         // Number of event types.
-        public static final int EVENT_COUNT = 0x0012;
+        public static final int EVENT_COUNT = 0x0011;
         // Mask to extract out only the type part of the event.
         public static final int EVENT_TYPE_MASK = ~(EVENT_FLAG_START|EVENT_FLAG_FINISH);
 
@@ -1840,12 +1838,12 @@
 
     public static final String[] HISTORY_EVENT_NAMES = new String[] {
             "null", "proc", "fg", "top", "sync", "wake_lock_in", "job", "user", "userfg", "conn",
-            "motion", "active", "pkginst", "pkgunin", "alarm", "stats", "inactive", "active"
+            "active", "pkginst", "pkgunin", "alarm", "stats", "inactive", "active"
     };
 
     public static final String[] HISTORY_EVENT_CHECKIN_NAMES = new String[] {
             "Enl", "Epr", "Efg", "Etp", "Esy", "Ewl", "Ejb", "Eur", "Euf", "Ecn",
-            "Esm", "Eac", "Epi", "Epu", "Eal", "Est", "Eai", "Eaa"
+            "Eac", "Epi", "Epu", "Eal", "Est", "Eai", "Eaa"
     };
 
     /**
@@ -4017,8 +4015,10 @@
             if (userCpuTimeUs > 0 || systemCpuTimeUs > 0) {
                 sb.setLength(0);
                 sb.append(prefix);
-                sb.append("    Total cpu time: ");
-                formatTimeMs(sb, (userCpuTimeUs + systemCpuTimeUs) / 1000);
+                sb.append("    Total cpu time: u=");
+                formatTimeMs(sb, userCpuTimeUs / 1000);
+                sb.append("s=");
+                formatTimeMs(sb, systemCpuTimeUs / 1000);
                 pw.println(sb.toString());
             }
 
diff --git a/core/java/android/os/IDeviceIdleController.aidl b/core/java/android/os/IDeviceIdleController.aidl
index 268295d..fe4aa13 100644
--- a/core/java/android/os/IDeviceIdleController.aidl
+++ b/core/java/android/os/IDeviceIdleController.aidl
@@ -28,4 +28,5 @@
     int[] getAppIdTempWhitelist();
     boolean isPowerSaveWhitelistApp(String name);
     void addPowerSaveTempWhitelistApp(String name, long duration, int userId);
+    void exitIdle(String reason);
 }
diff --git a/core/java/android/os/INetworkManagementService.aidl b/core/java/android/os/INetworkManagementService.aidl
index b29e8d0..8114155 100644
--- a/core/java/android/os/INetworkManagementService.aidl
+++ b/core/java/android/os/INetworkManagementService.aidl
@@ -342,7 +342,9 @@
     void setFirewallInterfaceRule(String iface, boolean allow);
     void setFirewallEgressSourceRule(String addr, boolean allow);
     void setFirewallEgressDestRule(String addr, int port, boolean allow);
-    void setFirewallUidRule(int uid, int rule);
+    void setFirewallUidRule(int chain, int uid, int rule);
+    void setFirewallUidRules(int chain, in int[] uids, in int[] rules);
+    void setFirewallChainEnabled(int chain, boolean enable);
 
     /**
      * Set all packets from users in ranges to go through VPN specified by netId.
diff --git a/core/java/android/provider/DocumentsContract.java b/core/java/android/provider/DocumentsContract.java
index 30535ff..c7ba607 100644
--- a/core/java/android/provider/DocumentsContract.java
+++ b/core/java/android/provider/DocumentsContract.java
@@ -107,6 +107,11 @@
      */
     public static final String EXTRA_ORIENTATION = "android.content.extra.ORIENTATION";
 
+    /**
+     * Overrides the default prompt text in DocumentsUI when set in an intent.
+     */
+    public static final String EXTRA_PROMPT = "android.provider.extra.PROMPT";
+
     /** {@hide} */
     public static final String ACTION_MANAGE_ROOT = "android.provider.action.MANAGE_ROOT";
     /** {@hide} */
diff --git a/core/java/android/provider/Settings.java b/core/java/android/provider/Settings.java
index 3e9c9de..56cd1a7 100644
--- a/core/java/android/provider/Settings.java
+++ b/core/java/android/provider/Settings.java
@@ -7133,6 +7133,29 @@
         public static final String APP_IDLE_CONSTANTS = "app_idle_constants";
 
         /**
+         * Alarm manager specific settings.
+         * This is encoded as a key=value list, separated by commas. Ex:
+         *
+         * "min_futurity=5000,allow_while_idle_short_time=4500"
+         *
+         * The following keys are supported:
+         *
+         * <pre>
+         * min_futurity                         (long)
+         * min_interval                         (long)
+         * allow_while_idle_short_time          (long)
+         * allow_while_idle_long_time           (long)
+         * allow_while_idle_whitelist_duration  (long)
+         * </pre>
+         *
+         * <p>
+         * Type: string
+         * @hide
+         * @see com.android.server.AlarmManagerService.Constants
+         */
+        public static final String ALARM_MANAGER_CONSTANTS = "alarm_manager_constants";
+
+        /**
          * Get the key that retrieves a bluetooth headset's priority.
          * @hide
          */
diff --git a/core/java/android/security/keymaster/KeymasterDefs.java b/core/java/android/security/keymaster/KeymasterDefs.java
index 6e40c6c..e4fab12 100644
--- a/core/java/android/security/keymaster/KeymasterDefs.java
+++ b/core/java/android/security/keymaster/KeymasterDefs.java
@@ -81,9 +81,8 @@
 
     public static final int KM_TAG_ASSOCIATED_DATA = KM_BYTES | 1000;
     public static final int KM_TAG_NONCE = KM_BYTES | 1001;
-    public static final int KM_TAG_AEAD_TAG = KM_BYTES | 1002;
-    public static final int KM_TAG_AUTH_TOKEN = KM_BYTES | 1003;
-    public static final int KM_TAG_MAC_LENGTH = KM_INT | 1004;
+    public static final int KM_TAG_AUTH_TOKEN = KM_BYTES | 1002;
+    public static final int KM_TAG_MAC_LENGTH = KM_INT | 1003;
 
     // Algorithm values.
     public static final int KM_ALGORITHM_RSA = 1;
diff --git a/core/java/android/security/keymaster/OperationResult.java b/core/java/android/security/keymaster/OperationResult.java
index 911a05a..30659662 100644
--- a/core/java/android/security/keymaster/OperationResult.java
+++ b/core/java/android/security/keymaster/OperationResult.java
@@ -35,15 +35,28 @@
 
     public static final Parcelable.Creator<OperationResult> CREATOR = new
             Parcelable.Creator<OperationResult>() {
+                @Override
                 public OperationResult createFromParcel(Parcel in) {
                     return new OperationResult(in);
                 }
 
+                @Override
                 public OperationResult[] newArray(int length) {
                     return new OperationResult[length];
                 }
             };
 
+    public OperationResult(
+            int resultCode, IBinder token, long operationHandle, int inputConsumed, byte[] output,
+            KeymasterArguments outParams) {
+        this.resultCode = resultCode;
+        this.token = token;
+        this.operationHandle = operationHandle;
+        this.inputConsumed = inputConsumed;
+        this.output = output;
+        this.outParams = outParams;
+    }
+
     protected OperationResult(Parcel in) {
         resultCode = in.readInt();
         token = in.readStrongBinder();
diff --git a/core/java/android/service/persistentdata/IPersistentDataBlockService.aidl b/core/java/android/service/persistentdata/IPersistentDataBlockService.aidl
index 0071a33..52db223 100644
--- a/core/java/android/service/persistentdata/IPersistentDataBlockService.aidl
+++ b/core/java/android/service/persistentdata/IPersistentDataBlockService.aidl
@@ -16,8 +16,6 @@
 
 package android.service.persistentdata;
 
-import android.app.PendingIntent;
-import android.os.Bundle;
 import android.os.ParcelFileDescriptor;
 
 /**
@@ -32,7 +30,6 @@
     int write(in byte[] data);
     byte[] read();
     void wipe();
-    void wipeIfAllowed(in Bundle bundle, in PendingIntent pi);
     int getDataBlockSize();
     long getMaximumDataBlockSize();
 
diff --git a/core/java/android/service/persistentdata/PersistentDataBlockManager.java b/core/java/android/service/persistentdata/PersistentDataBlockManager.java
index 31570c6..0ffdf68 100644
--- a/core/java/android/service/persistentdata/PersistentDataBlockManager.java
+++ b/core/java/android/service/persistentdata/PersistentDataBlockManager.java
@@ -17,8 +17,6 @@
 package android.service.persistentdata;
 
 import android.annotation.SystemApi;
-import android.app.PendingIntent;
-import android.os.Bundle;
 import android.os.RemoteException;
 import android.util.Slog;
 
@@ -43,56 +41,6 @@
 @SystemApi
 public class PersistentDataBlockManager {
     private static final String TAG = PersistentDataBlockManager.class.getSimpleName();
-
-    /**
-     * Broadcast action that will be called when the {@link #wipeIfAllowed(Bundle,PendingIntent)}
-     * method is called.  A broadcast with this action will be sent to the package allowed to write
-     * to the persistent data block. Packages receiving this broadcasts should respond by using the
-     * {@link android.app.PendingIntent} sent in the {@link #EXTRA_WIPE_IF_ALLOWED_CALLBACK} extra.
-     */
-    public static final String ACTION_WIPE_IF_ALLOWED
-            = "android.service.persistentdata.action.WIPE_IF_ALLOWED";
-
-    /**
-     * A {@link android.os.Parcelable} extra of type {@link android.app.PendingIntent} used to
-     * response to {@link #wipeIfAllowed(Bundle,PendingIntent)}. This extra will set in broadcasts
-     * with an action of {@link #ACTION_WIPE_IF_ALLOWED}.
-     */
-    public static final String EXTRA_WIPE_IF_ALLOWED_CALLBACK
-            = "android.service.persistentdata.extra.WIPE_IF_ALLOWED_CALLBACK";
-
-    /**
-     * Result code indicating that the data block was wiped.
-     *
-     * <p>This value is set as result code of the {@link android.app.PendingIntent} argument to
-     * {@link #wipeIfAllowed(Bundle,PendingIntent)}
-     */
-    public static final int STATUS_SUCCESS = 0;
-
-    /**
-     * Result code indicating that a remote exception was received while processing the request.
-     *
-     * <p>This value is set as result code of the {@link android.app.PendingIntent} argument to
-     * {@link #wipeIfAllowed(Bundle,PendingIntent)}
-     */
-    public static final int STATUS_ERROR_REMOTE_EXCEPTION = 1;
-
-    /**
-     * Result code indicating that a network error occurred while processing the request.
-     *
-     * <p>This value is set as result code of the {@link android.app.PendingIntent} argument to
-     * {@link #wipeIfAllowed(Bundle,PendingIntent)}
-     */
-    public static final int STATUS_ERROR_NETWORK_ERROR = 2;
-
-    /**
-     * Result code indicating that the data block could not be cleared with the provided data.
-     *
-     * <p>This value is set as result code of the {@link android.app.PendingIntent} argument to
-     * {@link #wipeIfAllowed(Bundle,PendingIntent)}
-     */
-    public static final int STATUS_ERROR_NOT_COMPLIANT = 3;
-
     private IPersistentDataBlockService sService;
 
     public PersistentDataBlockManager(IPersistentDataBlockService service) {
@@ -170,28 +118,6 @@
     }
 
     /**
-     * Attempt to wipe the data block by sending a broadcast to the package allowed to modify the
-     * datablock. The allowed package can refuse to wipe the data block based on the contents of
-     * the specified bundle. This bundle may contain data used by the allowed package to wipe the
-     * partition such as account credentials or an authorization token.
-     * @param bundle data used to wipe the data block. The contents of this bundle depend on the
-     *    allowed package receiving the data.
-     * @param pi intent called when attempt finished. The result code of this intent will be set
-     *    to one of {@link #STATUS_SUCCESS}, {@link #STATUS_ERROR_REMOTE_EXCEPTION},
-     *    {@link #STATUS_ERROR_NETWORK_ERROR}, or {@link #STATUS_ERROR_NOT_COMPLIANT}.
-     */
-    public void wipeIfAllowed(Bundle bundle, PendingIntent pi) {
-        if (pi == null) {
-            throw new NullPointerException();
-        }
-        try {
-            sService.wipeIfAllowed(bundle, pi);
-        } catch (RemoteException e) {
-            onError("wiping persistent partition");
-        }
-    }
-
-    /**
      * Writes a byte enabling or disabling the ability to "OEM unlock" the device.
      */
     public void setOemUnlockEnabled(boolean enabled) {
diff --git a/core/java/android/service/voice/VoiceInteractionSession.java b/core/java/android/service/voice/VoiceInteractionSession.java
index d5ee7e7..39dd29b 100644
--- a/core/java/android/service/voice/VoiceInteractionSession.java
+++ b/core/java/android/service/voice/VoiceInteractionSession.java
@@ -80,7 +80,6 @@
     public static final int SHOW_WITH_ASSIST = 1<<0;
 
     /**
-     * @hide
      * Flag received in {@link #onShow}: originator requested that the session be started with
      * a screen shot of the currently focused activity.
      */
@@ -1098,7 +1097,8 @@
                 WindowManager.LayoutParams.TYPE_VOICE_INTERACTION, Gravity.BOTTOM, true);
         mWindow.getWindow().addFlags(
                 WindowManager.LayoutParams.FLAG_HARDWARE_ACCELERATED |
-                WindowManager.LayoutParams.FLAG_LAYOUT_IN_SCREEN);
+                WindowManager.LayoutParams.FLAG_LAYOUT_IN_SCREEN |
+                WindowManager.LayoutParams.FLAG_LAYOUT_INSET_DECOR);
         initViews();
         mWindow.getWindow().setLayout(MATCH_PARENT, MATCH_PARENT);
         mWindow.setToken(mToken);
@@ -1143,7 +1143,7 @@
         mContentFrame.addView(view, new FrameLayout.LayoutParams(
                 ViewGroup.LayoutParams.MATCH_PARENT,
                 ViewGroup.LayoutParams.MATCH_PARENT));
-
+        mContentFrame.requestApplyInsets();
     }
 
     /** @hide */
@@ -1162,7 +1162,6 @@
         onHandleAssist(data);
     }
 
-    /** @hide */
     public void onHandleScreenshot(Bitmap screenshot) {
     }
 
diff --git a/core/java/android/view/ViewGroup.java b/core/java/android/view/ViewGroup.java
index 73cfd8c..2e2ba88 100644
--- a/core/java/android/view/ViewGroup.java
+++ b/core/java/android/view/ViewGroup.java
@@ -4148,24 +4148,38 @@
         mOnHierarchyChangeListener = listener;
     }
 
-    /**
-     * @hide
-     */
-    protected void onViewAdded(View child) {
+    void dispatchViewAdded(View child) {
+        onViewAdded(child);
         if (mOnHierarchyChangeListener != null) {
             mOnHierarchyChangeListener.onChildViewAdded(this, child);
         }
     }
 
     /**
-     * @hide
+     * Called when a new child is added to this ViewGroup. Overrides should always
+     * call super.onViewAdded.
+     *
+     * @param child the added child view
      */
-    protected void onViewRemoved(View child) {
+    public void onViewAdded(View child) {
+    }
+
+    void dispatchViewRemoved(View child) {
+        onViewRemoved(child);
         if (mOnHierarchyChangeListener != null) {
             mOnHierarchyChangeListener.onChildViewRemoved(this, child);
         }
     }
 
+    /**
+     * Called when a child view is removed from this ViewGroup. Overrides should always
+     * call super.onViewRemoved.
+     *
+     * @param child the removed child view
+     */
+    public void onViewRemoved(View child) {
+    }
+
     private void clearCachedLayoutMode() {
         if (!hasBooleanFlag(FLAG_LAYOUT_MODE_WAS_EXPLICITLY_SET)) {
            mLayoutMode = LAYOUT_MODE_UNDEFINED;
@@ -4292,7 +4306,7 @@
             child.resetRtlProperties();
         }
 
-        onViewAdded(child);
+        dispatchViewAdded(child);
 
         if ((child.mViewFlags & DUPLICATE_PARENT_STATE) == DUPLICATE_PARENT_STATE) {
             mGroupFlags |= FLAG_NOTIFY_CHILDREN_ON_DRAWABLE_STATE_CHANGE;
@@ -4554,7 +4568,7 @@
             }
         }
 
-        onViewRemoved(view);
+        dispatchViewRemoved(view);
 
         if (view.getVisibility() != View.GONE) {
             notifySubtreeAccessibilityStateChangedIfNeeded();
@@ -4646,7 +4660,7 @@
 
             needGlobalAttributesUpdate(false);
 
-            onViewRemoved(view);
+            dispatchViewRemoved(view);
         }
 
         removeFromArray(start, count);
@@ -4729,7 +4743,7 @@
                 childHasTransientStateChanged(view, false);
             }
 
-            onViewRemoved(view);
+            dispatchViewRemoved(view);
 
             view.mParent = null;
             children[i] = null;
@@ -4788,7 +4802,7 @@
             childHasTransientStateChanged(child, false);
         }
 
-        onViewRemoved(child);
+        dispatchViewRemoved(child);
     }
 
     /**
diff --git a/core/java/android/view/accessibility/AccessibilityInteractionClient.java b/core/java/android/view/accessibility/AccessibilityInteractionClient.java
index db78ec5..b49cbc6 100644
--- a/core/java/android/view/accessibility/AccessibilityInteractionClient.java
+++ b/core/java/android/view/accessibility/AccessibilityInteractionClient.java
@@ -186,7 +186,9 @@
                 if (DEBUG) {
                     Log.i(LOG_TAG, "Window cache miss");
                 }
+                final long identityToken = Binder.clearCallingIdentity();
                 window = connection.getWindow(accessibilityWindowId);
+                Binder.restoreCallingIdentity(identityToken);
                 if (window != null) {
                     sAccessibilityCache.addWindow(window);
                     return window;
@@ -222,7 +224,9 @@
                 if (DEBUG) {
                     Log.i(LOG_TAG, "Windows cache miss");
                 }
+                final long identityToken = Binder.clearCallingIdentity();
                 windows = connection.getWindows();
+                Binder.restoreCallingIdentity(identityToken);
                 if (windows != null) {
                     final int windowCount = windows.size();
                     for (int i = 0; i < windowCount; i++) {
@@ -282,9 +286,11 @@
                     }
                 }
                 final int interactionId = mInteractionIdCounter.getAndIncrement();
+                final long identityToken = Binder.clearCallingIdentity();
                 final boolean success = connection.findAccessibilityNodeInfoByAccessibilityId(
                         accessibilityWindowId, accessibilityNodeId, interactionId, this,
                         prefetchFlags, Thread.currentThread().getId());
+                Binder.restoreCallingIdentity(identityToken);
                 // If the scale is zero the call has failed.
                 if (success) {
                     List<AccessibilityNodeInfo> infos = getFindAccessibilityNodeInfosResultAndClear(
@@ -328,9 +334,11 @@
             IAccessibilityServiceConnection connection = getConnection(connectionId);
             if (connection != null) {
                 final int interactionId = mInteractionIdCounter.getAndIncrement();
+                final long identityToken = Binder.clearCallingIdentity();
                 final boolean success = connection.findAccessibilityNodeInfosByViewId(
                         accessibilityWindowId, accessibilityNodeId, viewId, interactionId, this,
                         Thread.currentThread().getId());
+                Binder.restoreCallingIdentity(identityToken);
                 if (success) {
                     List<AccessibilityNodeInfo> infos = getFindAccessibilityNodeInfosResultAndClear(
                             interactionId);
@@ -374,9 +382,11 @@
             IAccessibilityServiceConnection connection = getConnection(connectionId);
             if (connection != null) {
                 final int interactionId = mInteractionIdCounter.getAndIncrement();
+                final long identityToken = Binder.clearCallingIdentity();
                 final boolean success = connection.findAccessibilityNodeInfosByText(
                         accessibilityWindowId, accessibilityNodeId, text, interactionId, this,
                         Thread.currentThread().getId());
+                Binder.restoreCallingIdentity(identityToken);
                 if (success) {
                     List<AccessibilityNodeInfo> infos = getFindAccessibilityNodeInfosResultAndClear(
                             interactionId);
@@ -419,9 +429,11 @@
             IAccessibilityServiceConnection connection = getConnection(connectionId);
             if (connection != null) {
                 final int interactionId = mInteractionIdCounter.getAndIncrement();
+                final long identityToken = Binder.clearCallingIdentity();
                 final boolean success = connection.findFocus(accessibilityWindowId,
                         accessibilityNodeId, focusType, interactionId, this,
                         Thread.currentThread().getId());
+                Binder.restoreCallingIdentity(identityToken);
                 if (success) {
                     AccessibilityNodeInfo info = getFindAccessibilityNodeInfoResultAndClear(
                             interactionId);
@@ -461,9 +473,11 @@
             IAccessibilityServiceConnection connection = getConnection(connectionId);
             if (connection != null) {
                 final int interactionId = mInteractionIdCounter.getAndIncrement();
+                final long identityToken = Binder.clearCallingIdentity();
                 final boolean success = connection.focusSearch(accessibilityWindowId,
                         accessibilityNodeId, direction, interactionId, this,
                         Thread.currentThread().getId());
+                Binder.restoreCallingIdentity(identityToken);
                 if (success) {
                     AccessibilityNodeInfo info = getFindAccessibilityNodeInfoResultAndClear(
                             interactionId);
@@ -502,9 +516,11 @@
             IAccessibilityServiceConnection connection = getConnection(connectionId);
             if (connection != null) {
                 final int interactionId = mInteractionIdCounter.getAndIncrement();
+                final long identityToken = Binder.clearCallingIdentity();
                 final boolean success = connection.performAccessibilityAction(
                         accessibilityWindowId, accessibilityNodeId, action, arguments,
                         interactionId, this, Thread.currentThread().getId());
+                Binder.restoreCallingIdentity(identityToken);
                 if (success) {
                     return getPerformAccessibilityActionResultAndClear(interactionId);
                 }
diff --git a/core/java/android/widget/AbsListView.java b/core/java/android/widget/AbsListView.java
index 0001860..a96bf71 100644
--- a/core/java/android/widget/AbsListView.java
+++ b/core/java/android/widget/AbsListView.java
@@ -3113,9 +3113,7 @@
     }
 
     private boolean performStylusButtonPressAction(MotionEvent ev) {
-        if (ev.getToolType(0) == MotionEvent.TOOL_TYPE_STYLUS
-                && ev.isButtonPressed(MotionEvent.BUTTON_SECONDARY)
-                && mChoiceMode == CHOICE_MODE_MULTIPLE_MODAL && mChoiceActionMode == null) {
+        if (mChoiceMode == CHOICE_MODE_MULTIPLE_MODAL && mChoiceActionMode == null) {
             final View child = getChildAt(mMotionPosition - mFirstPosition);
             if (child != null) {
                 final int longPressPosition = mMotionPosition;
@@ -3785,7 +3783,7 @@
         }
 
         if (mTouchMode == TOUCH_MODE_DOWN && mMotionPosition != INVALID_POSITION
-                && (performButtonActionOnTouchDown(ev) || performStylusButtonPressAction(ev))) {
+                && performButtonActionOnTouchDown(ev)) {
                 removeCallbacks(mPendingCheckForTap);
         }
     }
@@ -3828,11 +3826,6 @@
                     mTouchMode = TOUCH_MODE_DONE_WAITING;
                     updateSelectorState();
                 } else if (motionView != null) {
-                    if (performStylusButtonPressAction(ev)) {
-                        removeCallbacks(mPendingCheckForTap);
-                        removeCallbacks(mPendingCheckForLongPress);
-                    }
-
                     // Still within bounds, update the hotspot.
                     final float[] point = mTmpPoint;
                     point[0] = x;
@@ -4072,7 +4065,7 @@
     public boolean onGenericMotionEvent(MotionEvent event) {
         if ((event.getSource() & InputDevice.SOURCE_CLASS_POINTER) != 0) {
             switch (event.getAction()) {
-                case MotionEvent.ACTION_SCROLL: {
+                case MotionEvent.ACTION_SCROLL:
                     if (mTouchMode == TOUCH_MODE_REST) {
                         final float vscroll = event.getAxisValue(MotionEvent.AXIS_VSCROLL);
                         if (vscroll != 0) {
@@ -4082,9 +4075,22 @@
                             }
                         }
                     }
-                }
+                    break;
+
+                case MotionEvent.ACTION_BUTTON_PRESS:
+                    int actionButton = event.getActionButton();
+                    if ((actionButton == MotionEvent.BUTTON_STYLUS_PRIMARY
+                            || actionButton == MotionEvent.BUTTON_SECONDARY)
+                            && (mTouchMode == TOUCH_MODE_DOWN || mTouchMode == TOUCH_MODE_TAP)) {
+                        if (performStylusButtonPressAction(event)) {
+                            removeCallbacks(mPendingCheckForLongPress);
+                            removeCallbacks(mPendingCheckForTap);
+                        }
+                    }
+                    break;
             }
         }
+
         return super.onGenericMotionEvent(event);
     }
 
@@ -6575,13 +6581,14 @@
          * @return A view from the ScrapViews collection. These are unordered.
          */
         View getScrapView(int position) {
+            final int whichScrap = mAdapter.getItemViewType(position);
+            if (whichScrap < 0) {
+                return null;
+            }
             if (mViewTypeCount == 1) {
                 return retrieveFromScrap(mCurrentScrap, position);
-            } else {
-                final int whichScrap = mAdapter.getItemViewType(position);
-                if (whichScrap >= 0 && whichScrap < mScrapViews.length) {
-                    return retrieveFromScrap(mScrapViews[whichScrap], position);
-                }
+            } else if (whichScrap < mScrapViews.length) {
+                return retrieveFromScrap(mScrapViews[whichScrap], position);
             }
             return null;
         }
diff --git a/core/java/android/widget/Chronometer.java b/core/java/android/widget/Chronometer.java
index a15080e..ebb54ff 100644
--- a/core/java/android/widget/Chronometer.java
+++ b/core/java/android/widget/Chronometer.java
@@ -17,6 +17,7 @@
 package android.widget;
 
 import android.content.Context;
+import android.content.res.Resources;
 import android.content.res.TypedArray;
 import android.os.Handler;
 import android.os.Message;
@@ -24,6 +25,7 @@
 import android.text.format.DateUtils;
 import android.util.AttributeSet;
 import android.util.Log;
+import android.view.accessibility.AccessibilityEvent;
 import android.widget.RemoteViews.RemoteView;
 
 import java.util.Formatter;
@@ -58,6 +60,7 @@
     }
 
     private long mBase;
+    private long mNow; // the currently displayed time
     private boolean mVisible;
     private boolean mStarted;
     private boolean mRunning;
@@ -224,6 +227,7 @@
     }
 
     private synchronized void updateText(long now) {
+        mNow = now;
         long seconds = now - mBase;
         seconds /= 1000;
         String text = DateUtils.formatElapsedTime(mRecycle, seconds);
@@ -279,6 +283,60 @@
         }
     }
 
+    private static final int MIN_IN_SEC = 60;
+    private static final int HOUR_IN_SEC = MIN_IN_SEC*60;
+    private static String formatDuration(long ms) {
+        final Resources res = Resources.getSystem();
+        final StringBuilder text = new StringBuilder();
+
+        int duration = (int) (ms / DateUtils.SECOND_IN_MILLIS);
+        if (duration < 0) {
+            duration = -duration;
+        }
+
+        int h = 0;
+        int m = 0;
+
+        if (duration >= HOUR_IN_SEC) {
+            h = duration / HOUR_IN_SEC;
+            duration -= h * HOUR_IN_SEC;
+        }
+        if (duration >= MIN_IN_SEC) {
+            m = duration / MIN_IN_SEC;
+            duration -= m * MIN_IN_SEC;
+        }
+        int s = duration;
+
+        try {
+            if (h > 0) {
+                text.append(res.getQuantityString(
+                        com.android.internal.R.plurals.duration_hours, h, h));
+            }
+            if (m > 0) {
+                if (text.length() > 0) {
+                    text.append(' ');
+                }
+                text.append(res.getQuantityString(
+                        com.android.internal.R.plurals.duration_minutes, m, m));
+            }
+
+            if (text.length() > 0) {
+                text.append(' ');
+            }
+            text.append(res.getQuantityString(
+                    com.android.internal.R.plurals.duration_seconds, s, s));
+        } catch (Resources.NotFoundException e) {
+            // Ignore; plurals throws an exception for an untranslated quantity for a given locale.
+            return null;
+        }
+        return text.toString();
+    }
+
+    @Override
+    public CharSequence getContentDescription() {
+        return formatDuration(mNow - mBase);
+    }
+
     @Override
     public CharSequence getAccessibilityClassName() {
         return Chronometer.class.getName();
diff --git a/core/java/android/widget/Editor.java b/core/java/android/widget/Editor.java
index d0b6160..9ca59f1 100644
--- a/core/java/android/widget/Editor.java
+++ b/core/java/android/widget/Editor.java
@@ -3568,13 +3568,24 @@
         }
 
         protected void updateDrawable() {
+            if (mIsDragging) {
+                // Don't update drawable during dragging.
+                return;
+            }
             final int offset = getCurrentCursorOffset();
             final boolean isRtlCharAtOffset = mTextView.getLayout().isRtlCharAt(offset);
             final Drawable oldDrawable = mDrawable;
             mDrawable = isRtlCharAtOffset ? mDrawableRtl : mDrawableLtr;
             mHotspotX = getHotspotX(mDrawable, isRtlCharAtOffset);
             mHorizontalGravity = getHorizontalGravity(isRtlCharAtOffset);
-            if (oldDrawable != mDrawable) {
+            final Layout layout = mTextView.getLayout();
+            if (layout != null && oldDrawable != mDrawable && isShowing()) {
+                // Update popup window position.
+                mPositionX = (int) (layout.getPrimaryHorizontal(offset) - 0.5f - mHotspotX -
+                        getHorizontalOffset() + getCursorOffset());
+                mPositionX += mTextView.viewportToContentHorizontalOffset();
+                mPositionHasChanged = true;
+                updatePosition(mLastParentX, mLastParentY, false, false);
                 postInvalidate();
             }
         }
@@ -3848,10 +3859,12 @@
                 case MotionEvent.ACTION_UP:
                     filterOnTouchUp();
                     mIsDragging = false;
+                    updateDrawable();
                     break;
 
                 case MotionEvent.ACTION_CANCEL:
                     mIsDragging = false;
+                    updateDrawable();
                     break;
             }
             return true;
@@ -4144,6 +4157,11 @@
                         offset = adjustedOffset;
                     }
                     positionCursor = true;
+                } else if (adjustedOffset < mPreviousOffset) {
+                    // Handle has jumped to the start of the word, and the user is moving
+                    // their finger towards the handle, the delta should be updated.
+                    mTouchWordDelta = mTextView.convertToLocalHorizontalCoordinate(x)
+                            - layout.getPrimaryHorizontal(mPreviousOffset);
                 }
             }
 
@@ -4278,6 +4296,11 @@
                         offset = adjustedOffset;
                     }
                     positionCursor = true;
+                } else if (adjustedOffset > mPreviousOffset) {
+                    // Handle has jumped to the end of the word, and the user is moving
+                    // their finger towards the handle, the delta should be updated.
+                    mTouchWordDelta = layout.getPrimaryHorizontal(mPreviousOffset)
+                            - mTextView.convertToLocalHorizontalCoordinate(x);
                 }
             }
 
@@ -4421,6 +4444,10 @@
         // Indicates whether the user is selecting text and using the drag accelerator.
         private boolean mDragAcceleratorActive;
         private boolean mHaventMovedEnoughToStartDrag;
+        // The line that a selection happened most recently with the drag accelerator.
+        private int mLineSelectionIsOn = -1;
+        // Whether the drag accelerator has selected past the initial line.
+        private boolean mSwitchedLines = false;
 
         SelectionModifierCursorController() {
             resetTouchOffsets();
@@ -4473,6 +4500,7 @@
             // Start location of selection.
             mStartOffset = mTextView.getOffsetForPosition(mLastDownPositionX,
                     mLastDownPositionY);
+            mLineSelectionIsOn = mTextView.getLineAtCoordinate(mLastDownPositionY);
             // Don't show the handles until user has lifted finger.
             hide();
 
@@ -4556,17 +4584,35 @@
                         break;
                     }
 
-                    if (mStartOffset != -1) {
+                    if (mStartOffset != -1 && mTextView.getLayout() != null) {
                         if (!mHaventMovedEnoughToStartDrag) {
-                            // Offset the finger by the same vertical offset as the handles. This
-                            // improves visibility of the content being selected by shifting
-                            // the finger below the content.
-                            final float fingerOffset = (mStartHandle != null)
-                                    ? mStartHandle.getIdealVerticalOffset()
-                                    : touchSlop;
-                            int offset =
-                                    mTextView.getOffsetForPosition(eventX, eventY - fingerOffset);
+
+                            float y = eventY;
+                            if (mSwitchedLines) {
+                                // Offset the finger by the same vertical offset as the handles.
+                                // This improves visibility of the content being selected by
+                                // shifting the finger below the content, this is applied once
+                                // the user has switched lines.
+                                final float fingerOffset = (mStartHandle != null)
+                                        ? mStartHandle.getIdealVerticalOffset()
+                                        : touchSlop;
+                                y = eventY - fingerOffset;
+                            }
+
+                            final int currLine = getCurrentLineAdjustedForSlop(
+                                    mTextView.getLayout(),
+                                    mLineSelectionIsOn, y);
+                            if (!mSwitchedLines && currLine != mLineSelectionIsOn) {
+                                // Break early here, we want to offset the finger position from
+                                // the selection highlight, once the user moved their finger
+                                // to a different line we should apply the offset and *not* switch
+                                // lines until recomputing the position with the finger offset.
+                                mSwitchedLines = true;
+                                break;
+                            }
+
                             int startOffset;
+                            int offset = mTextView.getOffsetAtCoordinate(currLine, eventX);
                             // Snap to word boundaries.
                             if (mStartOffset < offset) {
                                 // Expanding with end handle.
@@ -4577,6 +4623,7 @@
                                 offset = getWordStart(offset);
                                 startOffset = getWordEnd(mStartOffset);
                             }
+                            mLineSelectionIsOn = currLine;
                             Selection.setSelection((Spannable) mTextView.getText(),
                                     startOffset, offset);
                         }
@@ -4613,6 +4660,7 @@
                         startSelectionActionMode();
                         mDragAcceleratorActive = false;
                         mStartOffset = -1;
+                        mSwitchedLines = false;
                     }
                     break;
             }
@@ -4642,6 +4690,7 @@
             mMinTouchOffset = mMaxTouchOffset = -1;
             mStartOffset = -1;
             mDragAcceleratorActive = false;
+            mSwitchedLines = false;
         }
 
         /**
diff --git a/core/java/android/widget/GridLayout.java b/core/java/android/widget/GridLayout.java
index 6cc4bda..258424a 100644
--- a/core/java/android/widget/GridLayout.java
+++ b/core/java/android/widget/GridLayout.java
@@ -935,22 +935,14 @@
         super.onDebugDraw(canvas);
     }
 
-    // Add/remove
-
-    /**
-     * @hide
-     */
     @Override
-    protected void onViewAdded(View child) {
+    public void onViewAdded(View child) {
         super.onViewAdded(child);
         invalidateStructure();
     }
 
-    /**
-     * @hide
-     */
     @Override
-    protected void onViewRemoved(View child) {
+    public void onViewRemoved(View child) {
         super.onViewRemoved(child);
         invalidateStructure();
     }
diff --git a/core/java/android/widget/ImageView.java b/core/java/android/widget/ImageView.java
index 6b28f89..e0b2395 100644
--- a/core/java/android/widget/ImageView.java
+++ b/core/java/android/widget/ImageView.java
@@ -216,7 +216,7 @@
     protected boolean verifyDrawable(Drawable dr) {
         return mDrawable == dr || super.verifyDrawable(dr);
     }
-    
+
     @Override
     public void jumpDrawablesToCurrentState() {
         super.jumpDrawablesToCurrentState();
@@ -226,6 +226,15 @@
     @Override
     public void invalidateDrawable(Drawable dr) {
         if (dr == mDrawable) {
+            if (dr != null) {
+                // update cached drawable dimensions if they've changed
+                final int w = dr.getIntrinsicWidth();
+                final int h = dr.getIntrinsicHeight();
+                if (w != mDrawableWidth || h != mDrawableHeight) {
+                    mDrawableWidth = w;
+                    mDrawableHeight = h;
+                }
+            }
             /* we invalidate the whole view in this case because it's very
              * hard to know where the drawable actually is. This is made
              * complicated because of the offsets and transformations that
diff --git a/core/java/android/widget/RelativeLayout.java b/core/java/android/widget/RelativeLayout.java
index affc5da..339038e 100644
--- a/core/java/android/widget/RelativeLayout.java
+++ b/core/java/android/widget/RelativeLayout.java
@@ -522,7 +522,7 @@
         View baselineView = null;
         LayoutParams baselineParams = null;
         for (int i = 0; i < count; i++) {
-            final View child = getChildAt(i);
+            final View child = views[i];
             if (child.getVisibility() != GONE) {
                 final LayoutParams childParams = (LayoutParams) child.getLayoutParams();
                 if (baselineView == null || baselineParams == null
@@ -548,9 +548,9 @@
 
             if (offsetHorizontalAxis) {
                 for (int i = 0; i < count; i++) {
-                    View child = getChildAt(i);
+                    final View child = views[i];
                     if (child.getVisibility() != GONE) {
-                        LayoutParams params = (LayoutParams) child.getLayoutParams();
+                        final LayoutParams params = (LayoutParams) child.getLayoutParams();
                         final int[] rules = params.getRules(layoutDirection);
                         if (rules[CENTER_IN_PARENT] != 0 || rules[CENTER_HORIZONTAL] != 0) {
                             centerHorizontal(child, params, width);
@@ -578,9 +578,9 @@
 
             if (offsetVerticalAxis) {
                 for (int i = 0; i < count; i++) {
-                    View child = getChildAt(i);
+                    final View child = views[i];
                     if (child.getVisibility() != GONE) {
-                        LayoutParams params = (LayoutParams) child.getLayoutParams();
+                        final LayoutParams params = (LayoutParams) child.getLayoutParams();
                         final int[] rules = params.getRules(layoutDirection);
                         if (rules[CENTER_IN_PARENT] != 0 || rules[CENTER_VERTICAL] != 0) {
                             centerVertical(child, params, height);
@@ -607,9 +607,9 @@
             final int verticalOffset = contentBounds.top - top;
             if (horizontalOffset != 0 || verticalOffset != 0) {
                 for (int i = 0; i < count; i++) {
-                    View child = getChildAt(i);
+                    final View child = views[i];
                     if (child.getVisibility() != GONE && child != ignore) {
-                        LayoutParams params = (LayoutParams) child.getLayoutParams();
+                        final LayoutParams params = (LayoutParams) child.getLayoutParams();
                         if (horizontalGravity) {
                             params.mLeft += horizontalOffset;
                             params.mRight += horizontalOffset;
@@ -626,9 +626,9 @@
         if (isLayoutRtl()) {
             final int offsetWidth = myWidth - width;
             for (int i = 0; i < count; i++) {
-                View child = getChildAt(i);
+                final View child = views[i];
                 if (child.getVisibility() != GONE) {
-                    LayoutParams params = (LayoutParams) child.getLayoutParams();
+                    final LayoutParams params = (LayoutParams) child.getLayoutParams();
                     params.mLeft -= offsetWidth;
                     params.mRight -= offsetWidth;
                 }
diff --git a/core/java/android/widget/TextView.java b/core/java/android/widget/TextView.java
index 78b5d5d..c538dc2 100644
--- a/core/java/android/widget/TextView.java
+++ b/core/java/android/widget/TextView.java
@@ -241,8 +241,6 @@
  * @attr ref android.R.styleable#TextView_fontFeatureSettings
  * @attr ref android.R.styleable#TextView_breakStrategy
  * @attr ref android.R.styleable#TextView_hyphenationFrequency
- * @attr ref android.R.styleable#TextView_leftIndents
- * @attr ref android.R.styleable#TextView_rightIndents
  */
 @RemoteView
 public class TextView extends View implements ViewTreeObserver.OnPreDrawListener {
@@ -559,8 +557,6 @@
 
     private int mBreakStrategy;
     private int mHyphenationFrequency;
-    private int[] mLeftIndents;
-    private int[] mRightIndents;
 
     private int mMaximum = Integer.MAX_VALUE;
     private int mMaxMode = LINES;
@@ -1165,16 +1161,6 @@
             case com.android.internal.R.styleable.TextView_hyphenationFrequency:
                 mHyphenationFrequency = a.getInt(attr, Layout.HYPHENATION_FREQUENCY_NONE);
                 break;
-
-            case com.android.internal.R.styleable.TextView_leftIndents:
-                TypedArray margins = res.obtainTypedArray(a.getResourceId(attr, View.NO_ID));
-                mLeftIndents = parseDimensionArray(margins);
-                break;
-
-            case com.android.internal.R.styleable.TextView_rightIndents:
-                margins = res.obtainTypedArray(a.getResourceId(attr, View.NO_ID));
-                mRightIndents = parseDimensionArray(margins);
-                break;
             }
         }
         a.recycle();
@@ -3095,51 +3081,6 @@
     }
 
     /**
-     * Set indents. Arguments are arrays holding an indent amount, one per line, measured in
-     * pixels. For lines past the last element in the array, the last element repeats.
-     *
-     * @param leftIndents array of indent values for left margin, in pixels
-     * @param rightIndents array of indent values for right margin, in pixels
-     *
-     * @see #getLeftIndents()
-     * @see #getRightIndents()
-     *
-     * @attr ref android.R.styleable#TextView_leftIndents
-     * @attr ref android.R.styleable#TextView_rightIndents
-     */
-    public void setIndents(@Nullable int[] leftIndents, @Nullable int[] rightIndents) {
-        mLeftIndents = leftIndents;
-        mRightIndents = rightIndents;
-        if (mLayout != null) {
-            nullLayouts();
-            requestLayout();
-            invalidate();
-        }
-    }
-
-    /**
-     * Get left indents. See {#link setMargins} for more details.
-     *
-     * @return left indents
-     * @see #setIndents(int[], int[])
-     * @attr ref android.R.styleable#TextView_leftIndents
-     */
-    public int[] getLeftIndents() {
-        return mLeftIndents;
-    }
-
-    /**
-     * Get right indents. See {#link setMargins} for more details.
-     *
-     * @return right indents
-     * @see #setIndents(int[], int[])
-     * @attr ref android.R.styleable#TextView_rightIndents
-     */
-    public int[] getRightIndents() {
-        return mRightIndents;
-    }
-
-    /**
      * Sets font feature settings.  The format is the same as the CSS
      * font-feature-settings attribute:
      * http://dev.w3.org/csswg/css-fonts/#propdef-font-feature-settings
@@ -6685,9 +6626,6 @@
                         .setIncludePad(mIncludePad)
                         .setBreakStrategy(mBreakStrategy)
                         .setHyphenationFrequency(mHyphenationFrequency);
-                if (mLeftIndents != null || mRightIndents != null) {
-                    builder.setIndents(mLeftIndents, mRightIndents);
-                }
                 if (shouldEllipsize) {
                     builder.setEllipsize(mEllipsize)
                             .setEllipsizedWidth(ellipsisWidth)
@@ -6776,9 +6714,6 @@
                     .setIncludePad(mIncludePad)
                     .setBreakStrategy(mBreakStrategy)
                     .setHyphenationFrequency(mHyphenationFrequency);
-            if (mLeftIndents != null || mRightIndents != null) {
-                builder.setIndents(mLeftIndents, mRightIndents);
-            }
             if (shouldEllipsize) {
                 builder.setEllipsize(effectiveEllipsize)
                         .setEllipsizedWidth(ellipsisWidth)
diff --git a/core/java/android/widget/Toolbar.java b/core/java/android/widget/Toolbar.java
index 2ea2667..471ea9b 100644
--- a/core/java/android/widget/Toolbar.java
+++ b/core/java/android/widget/Toolbar.java
@@ -273,6 +273,24 @@
         if (!TextUtils.isEmpty(navDesc)) {
             setNavigationContentDescription(navDesc);
         }
+
+        final Drawable logo = a.getDrawable(R.styleable.Toolbar_logo);
+        if (logo != null) {
+            setLogo(logo);
+        }
+
+        final CharSequence logoDesc = a.getText(R.styleable.Toolbar_logoDescription);
+        if (!TextUtils.isEmpty(logoDesc)) {
+            setLogoDescription(logoDesc);
+        }
+
+        if (a.hasValue(R.styleable.Toolbar_titleTextColor)) {
+            setTitleTextColor(a.getColor(R.styleable.Toolbar_titleTextColor, 0xffffffff));
+        }
+
+        if (a.hasValue(R.styleable.Toolbar_subtitleTextColor)) {
+            setSubtitleTextColor(a.getColor(R.styleable.Toolbar_subtitleTextColor, 0xffffffff));
+        }
         a.recycle();
     }
 
diff --git a/core/java/com/android/internal/app/IBatteryStats.aidl b/core/java/com/android/internal/app/IBatteryStats.aidl
index 929cacd..6f0cec6 100644
--- a/core/java/com/android/internal/app/IBatteryStats.aidl
+++ b/core/java/com/android/internal/app/IBatteryStats.aidl
@@ -116,7 +116,7 @@
     void noteWifiRadioPowerState(int powerState, long timestampNs);
     void noteNetworkInterfaceType(String iface, int type);
     void noteNetworkStatsEnabled();
-    void noteDeviceIdleMode(boolean enabled, boolean fromActive, boolean fromMotion);
+    void noteDeviceIdleMode(boolean enabled, String activeReason, int activeUid);
     void setBatteryState(int status, int health, int plugType, int level, int temp, int volt);
     long getAwakeTimeBattery();
     long getAwakeTimePlugged();
diff --git a/core/java/com/android/internal/appwidget/IAppWidgetService.aidl b/core/java/com/android/internal/appwidget/IAppWidgetService.aidl
index 7d3db02..5a195cb 100644
--- a/core/java/com/android/internal/appwidget/IAppWidgetService.aidl
+++ b/core/java/com/android/internal/appwidget/IAppWidgetService.aidl
@@ -20,6 +20,7 @@
 import android.content.Intent;
 import android.content.IntentSender;
 import android.content.pm.ApplicationInfo;
+import android.content.pm.ParceledListSlice;
 import android.appwidget.AppWidgetProviderInfo;
 import com.android.internal.appwidget.IAppWidgetHost;
 import android.os.Bundle;
@@ -54,7 +55,7 @@
             in RemoteViews views);
     void updateAppWidgetProvider(in ComponentName provider, in RemoteViews views);
     void notifyAppWidgetViewDataChanged(String packageName, in int[] appWidgetIds, int viewId);
-    List<AppWidgetProviderInfo> getInstalledProvidersForProfile(int categoryFilter,
+    ParceledListSlice getInstalledProvidersForProfile(int categoryFilter,
             int profileId);
     AppWidgetProviderInfo getAppWidgetInfo(String callingPackage, int appWidgetId);
     boolean hasBindAppWidgetPermission(in String packageName, int userId);
diff --git a/core/java/com/android/internal/logging/MetricsLogger.java b/core/java/com/android/internal/logging/MetricsLogger.java
index 230d96d..03f2e3a 100644
--- a/core/java/com/android/internal/logging/MetricsLogger.java
+++ b/core/java/com/android/internal/logging/MetricsLogger.java
@@ -26,6 +26,13 @@
  * @hide
  */
 public class MetricsLogger implements MetricsConstants {
+    public static final int VOLUME_DIALOG = 207;
+    public static final int VOLUME_DIALOG_DETAILS = 208;
+    public static final int ACTION_VOLUME_SLIDER = 209;
+    public static final int ACTION_VOLUME_STREAM = 210;
+    public static final int ACTION_VOLUME_KEY = 211;
+    public static final int ACTION_VOLUME_ICON = 212;
+    public static final int ACTION_RINGER_MODE = 213;
     // Temporary constants go here, to await migration to MetricsConstants.
 
     public static void visible(Context context, int category) throws IllegalArgumentException {
diff --git a/core/java/com/android/internal/os/BatteryStatsImpl.java b/core/java/com/android/internal/os/BatteryStatsImpl.java
index 07d1fc8..229079f 100644
--- a/core/java/com/android/internal/os/BatteryStatsImpl.java
+++ b/core/java/com/android/internal/os/BatteryStatsImpl.java
@@ -95,7 +95,8 @@
 public final class BatteryStatsImpl extends BatteryStats {
     private static final String TAG = "BatteryStatsImpl";
     private static final boolean DEBUG = false;
-    private static final boolean DEBUG_ENERGY = false;
+    public static final boolean DEBUG_ENERGY = false;
+    private static final boolean DEBUG_ENERGY_CPU = DEBUG_ENERGY || false;
     private static final boolean DEBUG_HISTORY = false;
     private static final boolean USE_OLD_HISTORY = false;   // for debugging.
 
@@ -105,7 +106,7 @@
     private static final int MAGIC = 0xBA757475; // 'BATSTATS'
 
     // Current on-disk Parcel version
-    private static final int VERSION = 127 + (USE_OLD_HISTORY ? 1000 : 0);
+    private static final int VERSION = 128 + (USE_OLD_HISTORY ? 1000 : 0);
 
     // Maximum number of items we will record in the history.
     private static final int MAX_HISTORY_ITEMS = 2000;
@@ -151,6 +152,9 @@
             BatteryCallback cb = mCallback;
             switch (msg.what) {
                 case MSG_UPDATE_WAKELOCKS:
+                    synchronized (BatteryStatsImpl.this) {
+                        updateCpuTimeLocked();
+                    }
                     if (cb != null) {
                         cb.batteryNeedsCpuUpdate();
                     }
@@ -178,6 +182,7 @@
 
     public interface ExternalStatsSync {
         void scheduleSync(String reason);
+        void scheduleWifiSync(String reason);
     }
 
     public final MyHandler mHandler;
@@ -2503,12 +2508,11 @@
         boolean unpluggedScreenOff = unplugged && screenOff;
         if (unpluggedScreenOff != mOnBatteryScreenOffTimeBase.isRunning()) {
             updateKernelWakelocksLocked();
-            requestWakelockCpuUpdate();
-            if (!unpluggedScreenOff) {
-                // We are switching to no longer tracking wake locks, but we want
-                // the next CPU update we receive to take them in to account.
-                mDistributeWakelockCpu = true;
+            if (DEBUG_ENERGY_CPU) {
+                Slog.d(TAG, "Updating cpu time because screen is now " +
+                        (unpluggedScreenOff ? "off" : "on"));
             }
+            updateCpuTimeLocked();
             mOnBatteryScreenOffTimeBase.setRunning(unpluggedScreenOff, uptime, realtime);
         }
     }
@@ -2772,10 +2776,14 @@
             mWakeLockNesting++;
         }
         if (uid >= 0) {
-            //if (uid == 0) {
-            //    Slog.wtf(TAG, "Acquiring wake lock from root: " + name);
-            //}
-            requestWakelockCpuUpdate();
+            if (mOnBatteryScreenOffTimeBase.isRunning()) {
+                // We only update the cpu time when a wake lock is acquired if the screen is off.
+                // If the screen is on, we don't distribute the power amongst partial wakelocks.
+                if (DEBUG_ENERGY_CPU) {
+                    Slog.d(TAG, "Updating cpu time because of +wake_lock");
+                }
+                requestWakelockCpuUpdate();
+            }
             getUidStatsLocked(uid).noteStartWakeLocked(pid, name, type, elapsedRealtime);
         }
     }
@@ -2805,7 +2813,12 @@
             }
         }
         if (uid >= 0) {
-            requestWakelockCpuUpdate();
+            if (mOnBatteryScreenOffTimeBase.isRunning()) {
+                if (DEBUG_ENERGY_CPU) {
+                    Slog.d(TAG, "Updating cpu time because of -wake_lock");
+                }
+                requestWakelockCpuUpdate();
+            }
             getUidStatsLocked(uid).noteStopWakeLocked(pid, name, type, elapsedRealtime);
         }
     }
@@ -2874,46 +2887,14 @@
         addHistoryRecordLocked(elapsedRealtime, uptime);
     }
 
-    public int startAddingCpuLocked() {
+    public boolean startAddingCpuLocked() {
         mHandler.removeMessages(MSG_UPDATE_WAKELOCKS);
-
-        if (!mOnBatteryInternal) {
-            return -1;
-        }
-
-        final int N = mPartialTimers.size();
-        if (N == 0) {
-            mLastPartialTimers.clear();
-            mDistributeWakelockCpu = false;
-            return 0;
-        }
-
-        if (!mOnBatteryScreenOffTimeBase.isRunning() && !mDistributeWakelockCpu) {
-            return 0;
-        }
-
-        mDistributeWakelockCpu = false;
-
-        // How many timers should consume CPU?  Only want to include ones
-        // that have already been in the list.
-        for (int i=0; i<N; i++) {
-            StopwatchTimer st = mPartialTimers.get(i);
-            if (st.mInList) {
-                Uid uid = st.mUid;
-                // We don't include the system UID, because it so often
-                // holds wake locks at one request or another of an app.
-                if (uid != null && uid.mUid != Process.SYSTEM_UID) {
-                    return 50;
-                }
-            }
-        }
-
-        return 0;
+        return mOnBatteryInternal;
     }
 
-    public void finishAddingCpuLocked(int perc, int remainUTime, int remainSTtime,
-            int totalUTime, int totalSTime, int statUserTime, int statSystemTime,
-            int statIOWaitTime, int statIrqTime, int statSoftIrqTime, int statIdleTime) {
+    public void finishAddingCpuLocked(int totalUTime, int totalSTime, int statUserTime,
+                                      int statSystemTime, int statIOWaitTime, int statIrqTime,
+                                      int statSoftIrqTime, int statIdleTime) {
         if (DEBUG) Slog.d(TAG, "Adding cpu: tuser=" + totalUTime + " tsys=" + totalSTime
                 + " user=" + statUserTime + " sys=" + statSystemTime
                 + " io=" + statIOWaitTime + " irq=" + statIrqTime
@@ -2926,70 +2907,6 @@
         mCurStepStatIrqTime += statIrqTime;
         mCurStepStatSoftIrqTime += statSoftIrqTime;
         mCurStepStatIdleTime += statIdleTime;
-
-        final int N = mPartialTimers.size();
-        if (perc != 0) {
-            int num = 0;
-            for (int i=0; i<N; i++) {
-                StopwatchTimer st = mPartialTimers.get(i);
-                if (st.mInList) {
-                    Uid uid = st.mUid;
-                    // We don't include the system UID, because it so often
-                    // holds wake locks at one request or another of an app.
-                    if (uid != null && uid.mUid != Process.SYSTEM_UID) {
-                        num++;
-                    }
-                }
-            }
-            if (num != 0) {
-                for (int i=0; i<N; i++) {
-                    StopwatchTimer st = mPartialTimers.get(i);
-                    if (st.mInList) {
-                        Uid uid = st.mUid;
-                        if (uid != null && uid.mUid != Process.SYSTEM_UID) {
-                            int myUTime = remainUTime/num;
-                            int mySTime = remainSTtime/num;
-                            remainUTime -= myUTime;
-                            remainSTtime -= mySTime;
-                            num--;
-                            Uid.Proc proc = uid.getProcessStatsLocked("*wakelock*");
-                            proc.addCpuTimeLocked(myUTime, mySTime);
-                        }
-                    }
-                }
-            }
-
-            // Just in case, collect any lost CPU time.
-            if (remainUTime != 0 || remainSTtime != 0) {
-                Uid uid = getUidStatsLocked(Process.SYSTEM_UID);
-                if (uid != null) {
-                    Uid.Proc proc = uid.getProcessStatsLocked("*lost*");
-                    proc.addCpuTimeLocked(remainUTime, remainSTtime);
-                }
-            }
-        }
-
-        final int NL = mLastPartialTimers.size();
-        boolean diff = N != NL;
-        for (int i=0; i<NL && !diff; i++) {
-            diff |= mPartialTimers.get(i) != mLastPartialTimers.get(i);
-        }
-        if (!diff) {
-            for (int i=0; i<NL; i++) {
-                mPartialTimers.get(i).mInList = true;
-            }
-            return;
-        }
-
-        for (int i=0; i<NL; i++) {
-            mLastPartialTimers.get(i).mInList = false;
-        }
-        mLastPartialTimers.clear();
-        for (int i=0; i<N; i++) {
-            StopwatchTimer st = mPartialTimers.get(i);
-            st.mInList = true;
-            mLastPartialTimers.add(st);
-        }
     }
 
     public void noteProcessDiedLocked(int uid, int pid) {
@@ -3271,11 +3188,11 @@
         }
     }
 
-    public void noteDeviceIdleModeLocked(boolean enabled, boolean fromActive, boolean fromMotion) {
+    public void noteDeviceIdleModeLocked(boolean enabled, String activeReason, int activeUid) {
         final long elapsedRealtime = SystemClock.elapsedRealtime();
         final long uptime = SystemClock.uptimeMillis();
         boolean nowIdling = enabled;
-        if (mDeviceIdling && !enabled && !fromActive && !fromMotion) {
+        if (mDeviceIdling && !enabled && activeReason == null) {
             // We don't go out of general idling mode until explicitly taken out of
             // device idle through going active or significant motion.
             nowIdling = true;
@@ -3293,14 +3210,8 @@
         }
         if (mDeviceIdleModeEnabled != enabled) {
             mDeviceIdleModeEnabled = enabled;
-            if (fromMotion) {
-                addHistoryEventLocked(elapsedRealtime, uptime, HistoryItem.EVENT_SIGNIFICANT_MOTION,
-                        "", 0);
-            }
-            if (fromActive) {
-                addHistoryEventLocked(elapsedRealtime, uptime, HistoryItem.EVENT_ACTIVE,
-                        "", 0);
-            }
+            addHistoryEventLocked(elapsedRealtime, uptime, HistoryItem.EVENT_ACTIVE,
+                    activeReason != null ? activeReason : "", activeUid);
             if (enabled) {
                 mHistoryCur.states2 |= HistoryItem.STATE2_DEVICE_IDLE_FLAG;
                 if (DEBUG_HISTORY) Slog.v(TAG, "Device idle mode enabled to: "
@@ -3580,7 +3491,7 @@
             addHistoryRecordLocked(elapsedRealtime, uptime);
             mWifiOn = true;
             mWifiOnTimer.startRunningLocked(elapsedRealtime);
-            scheduleSyncExternalStatsLocked("wifi-off");
+            scheduleSyncExternalWifiStatsLocked("wifi-off");
         }
     }
 
@@ -3594,7 +3505,7 @@
             addHistoryRecordLocked(elapsedRealtime, uptime);
             mWifiOn = false;
             mWifiOnTimer.stopRunningLocked(elapsedRealtime);
-            scheduleSyncExternalStatsLocked("wifi-on");
+            scheduleSyncExternalWifiStatsLocked("wifi-on");
         }
     }
 
@@ -3846,7 +3757,7 @@
                 int uid = mapUid(ws.get(i));
                 getUidStatsLocked(uid).noteWifiRunningLocked(elapsedRealtime);
             }
-            scheduleSyncExternalStatsLocked("wifi-running");
+            scheduleSyncExternalWifiStatsLocked("wifi-running");
         } else {
             Log.w(TAG, "noteWifiRunningLocked -- called while WIFI running");
         }
@@ -3885,7 +3796,7 @@
                 int uid = mapUid(ws.get(i));
                 getUidStatsLocked(uid).noteWifiStoppedLocked(elapsedRealtime);
             }
-            scheduleSyncExternalStatsLocked("wifi-stopped");
+            scheduleSyncExternalWifiStatsLocked("wifi-stopped");
         } else {
             Log.w(TAG, "noteWifiStoppedLocked -- called while WIFI not running");
         }
@@ -3900,7 +3811,7 @@
             }
             mWifiState = wifiState;
             mWifiStateTimer[wifiState].startRunningLocked(elapsedRealtime);
-            scheduleSyncExternalStatsLocked("wifi-state");
+            scheduleSyncExternalWifiStatsLocked("wifi-state");
         }
     }
 
@@ -7632,6 +7543,10 @@
      * @param info The energy information from the WiFi controller.
      */
     public void updateWifiStateLocked(@Nullable final WifiActivityEnergyInfo info) {
+        if (DEBUG_ENERGY) {
+            Slog.d(TAG, "Updating wifi stats");
+        }
+
         final long elapsedRealtimeMs = SystemClock.elapsedRealtime();
         NetworkStats delta = null;
         try {
@@ -7829,6 +7744,10 @@
      * Distribute Cell radio energy info and network traffic to apps.
      */
     public void updateMobileRadioStateLocked(final long elapsedRealtimeMs) {
+        if (DEBUG_ENERGY) {
+            Slog.d(TAG, "Updating mobile radio stats");
+        }
+
         NetworkStats delta = null;
         try {
             if (!ArrayUtils.isEmpty(mMobileIfaces)) {
@@ -7901,6 +7820,10 @@
      * @param info The energy information from the bluetooth controller.
      */
     public void updateBluetoothStateLocked(@Nullable final BluetoothActivityEnergyInfo info) {
+        if (DEBUG_ENERGY) {
+            Slog.d(TAG, "Updating bluetooth stats");
+        }
+
         if (info != null && mOnBatteryInternal) {
             mHasBluetoothEnergyReporting = true;
             mBluetoothActivityCounters[CONTROLLER_RX_TIME].addCountLocked(
@@ -7959,30 +7882,196 @@
         }
     }
 
+    // We use an anonymous class to access these variables,
+    // so they can't live on the stack or they'd have to be
+    // final MutableLong objects (more allocations).
+    // Used in updateCpuTimeLocked().
+    long mTempTotalCpuUserTimeUs;
+    long mTempTotalCpuSystemTimeUs;
+
     /**
-     * Read and distribute CPU usage across apps.
+     * Read and distribute CPU usage across apps. If their are partial wakelocks being held
+     * and we are on battery with screen off, we give more of the cpu time to those apps holding
+     * wakelocks. If the screen is on, we just assign the actual cpu time an app used.
      */
-    public void updateCpuTimeLocked(boolean firstTime) {
+    public void updateCpuTimeLocked() {
+        if (DEBUG_ENERGY_CPU) {
+            Slog.d(TAG, "!Cpu updating!");
+        }
+
+        // Holding a wakelock costs more than just using the cpu.
+        // Currently, we assign only half the cpu time to an app that is running but
+        // not holding a wakelock. The apps holding wakelocks get the rest of the blame.
+        // If no app is holding a wakelock, then the distribution is normal.
+        final int wakelockWeight = 50;
+
+        // Read the time spent at various cpu frequencies.
         final int cpuSpeedSteps = getCpuSpeedSteps();
         final long[] cpuSpeeds = mKernelCpuSpeedReader.readDelta();
-        KernelUidCpuTimeReader.Callback callback = null;
-        if (mOnBatteryInternal && !firstTime) {
-            callback = new KernelUidCpuTimeReader.Callback() {
-                @Override
-                public void onUidCpuTime(int uid, long userTimeUs, long systemTimeUs) {
-                    final Uid u = getUidStatsLocked(mapUid(uid));
-                    u.mUserCpuTime.addCountLocked(userTimeUs);
-                    u.mSystemCpuTime.addCountLocked(systemTimeUs);
-                    for (int i = 0; i < cpuSpeedSteps; i++) {
-                        if (u.mSpeedBins[i] == null) {
-                            u.mSpeedBins[i] = new LongSamplingCounter(mOnBatteryTimeBase);
-                        }
-                        u.mSpeedBins[i].addCountLocked(cpuSpeeds[i]);
-                    }
+
+        int numWakelocks = 0;
+
+        // Calculate how many wakelocks we have to distribute amongst. The system is excluded.
+        // Only distribute cpu power to wakelocks if the screen is off and we're on battery.
+        final int numPartialTimers = mPartialTimers.size();
+        if (mOnBatteryScreenOffTimeBase.isRunning()) {
+            for (int i = 0; i < numPartialTimers; i++) {
+                final StopwatchTimer timer = mPartialTimers.get(i);
+                if (timer.mInList && timer.mUid != null && timer.mUid.mUid != Process.SYSTEM_UID) {
+                    // Since the collection and blaming of wakelocks can be scheduled to run after
+                    // some delay, the mPartialTimers list may have new entries. We can't blame
+                    // the newly added timer for past cpu time, so we only consider timers that
+                    // were present for one round of collection. Once a timer has gone through
+                    // a round of collection, its mInList field is set to true.
+                    numWakelocks++;
                 }
-            };
+            }
         }
-        mKernelUidCpuTimeReader.readDelta(callback);
+
+        final int numWakelocksF = numWakelocks;
+        mTempTotalCpuUserTimeUs = 0;
+        mTempTotalCpuSystemTimeUs = 0;
+
+        // Read the CPU data for each UID. This will internally generate a snapshot so next time
+        // we read, we get a delta. If we are to distribute the cpu time, then do so. Otherwise
+        // we just ignore the data.
+        final long startTimeMs = SystemClock.elapsedRealtime();
+        mKernelUidCpuTimeReader.readDelta(!mOnBatteryInternal ? null :
+                new KernelUidCpuTimeReader.Callback() {
+                    @Override
+                    public void onUidCpuTime(int uid, long userTimeUs, long systemTimeUs) {
+                        final Uid u = getUidStatsLocked(mapUid(uid));
+
+                        // Accumulate the total system and user time.
+                        mTempTotalCpuUserTimeUs += userTimeUs;
+                        mTempTotalCpuSystemTimeUs += systemTimeUs;
+
+                        StringBuilder sb = null;
+                        if (DEBUG_ENERGY_CPU) {
+                            sb = new StringBuilder();
+                            sb.append("  got time for uid=").append(u.mUid).append(": u=");
+                            TimeUtils.formatDuration(userTimeUs / 1000, sb);
+                            sb.append(" s=");
+                            TimeUtils.formatDuration(systemTimeUs / 1000, sb);
+                            sb.append("\n");
+                        }
+
+                        if (numWakelocksF > 0) {
+                            // We have wakelocks being held, so only give a portion of the
+                            // time to the process. The rest will be distributed among wakelock
+                            // holders.
+                            userTimeUs = (userTimeUs * wakelockWeight) / 100;
+                            systemTimeUs = (systemTimeUs * wakelockWeight) / 100;
+                        }
+
+                        if (sb != null) {
+                            sb.append("  adding to uid=").append(u.mUid).append(": u=");
+                            TimeUtils.formatDuration(userTimeUs / 1000, sb);
+                            sb.append(" s=");
+                            TimeUtils.formatDuration(systemTimeUs / 1000, sb);
+                            Slog.d(TAG, sb.toString());
+                        }
+
+                        u.mUserCpuTime.addCountLocked(userTimeUs);
+                        u.mSystemCpuTime.addCountLocked(systemTimeUs);
+
+                        // Add the cpu speeds to this UID. These are used as a ratio
+                        // for computing the power this UID used.
+                        for (int i = 0; i < cpuSpeedSteps; i++) {
+                            if (u.mSpeedBins[i] == null) {
+                                u.mSpeedBins[i] = new LongSamplingCounter(mOnBatteryTimeBase);
+                            }
+                            u.mSpeedBins[i].addCountLocked(cpuSpeeds[i]);
+                        }
+                    }
+                });
+
+        if (DEBUG_ENERGY_CPU) {
+            Slog.d(TAG, "Reading cpu stats took " + (SystemClock.elapsedRealtime() - startTimeMs) +
+                    " ms");
+        }
+
+        if (mOnBatteryInternal && numWakelocks > 0) {
+            // Distribute a portion of the total cpu time to wakelock holders.
+            mTempTotalCpuUserTimeUs = (mTempTotalCpuUserTimeUs * (100 - wakelockWeight)) / 100;
+            mTempTotalCpuSystemTimeUs =
+                    (mTempTotalCpuSystemTimeUs * (100 - wakelockWeight)) / 100;
+
+            for (int i = 0; i < numPartialTimers; i++) {
+                final StopwatchTimer timer = mPartialTimers.get(i);
+
+                // The system does not share any blame, as it is usually holding the wakelock
+                // on behalf of an app.
+                if (timer.mInList && timer.mUid != null && timer.mUid.mUid != Process.SYSTEM_UID) {
+                    int userTimeUs = (int) (mTempTotalCpuUserTimeUs / numWakelocks);
+                    int systemTimeUs = (int) (mTempTotalCpuSystemTimeUs / numWakelocks);
+
+                    if (DEBUG_ENERGY_CPU) {
+                        StringBuilder sb = new StringBuilder();
+                        sb.append("  Distributing wakelock uid=").append(timer.mUid.mUid)
+                                .append(": u=");
+                        TimeUtils.formatDuration(userTimeUs / 1000, sb);
+                        sb.append(" s=");
+                        TimeUtils.formatDuration(systemTimeUs / 1000, sb);
+                        Slog.d(TAG, sb.toString());
+                    }
+
+                    timer.mUid.mUserCpuTime.addCountLocked(userTimeUs);
+                    timer.mUid.mSystemCpuTime.addCountLocked(systemTimeUs);
+
+                    final Uid.Proc proc = timer.mUid.getProcessStatsLocked("*wakelock*");
+                    proc.addCpuTimeLocked(userTimeUs, systemTimeUs);
+
+                    mTempTotalCpuUserTimeUs -= userTimeUs;
+                    mTempTotalCpuSystemTimeUs -= systemTimeUs;
+                    numWakelocks--;
+                }
+            }
+
+            if (mTempTotalCpuUserTimeUs > 0 || mTempTotalCpuSystemTimeUs > 0) {
+                // Anything left over is given to the system.
+                if (DEBUG_ENERGY_CPU) {
+                    StringBuilder sb = new StringBuilder();
+                    sb.append("  Distributing lost time to system: u=");
+                    TimeUtils.formatDuration(mTempTotalCpuUserTimeUs / 1000, sb);
+                    sb.append(" s=");
+                    TimeUtils.formatDuration(mTempTotalCpuSystemTimeUs / 1000, sb);
+                    Slog.d(TAG, sb.toString());
+                }
+
+                final Uid u = getUidStatsLocked(Process.SYSTEM_UID);
+                u.mUserCpuTime.addCountLocked(mTempTotalCpuUserTimeUs);
+                u.mSystemCpuTime.addCountLocked(mTempTotalCpuSystemTimeUs);
+
+                final Uid.Proc proc = u.getProcessStatsLocked("*lost*");
+                proc.addCpuTimeLocked((int) mTempTotalCpuUserTimeUs,
+                        (int) mTempTotalCpuSystemTimeUs);
+            }
+        }
+
+        // See if there is a difference in wakelocks between this collection and the last
+        // collection.
+        if (ArrayUtils.referenceEquals(mPartialTimers, mLastPartialTimers)) {
+            // No difference, so each timer is now considered for the next collection.
+            for (int i = 0; i < numPartialTimers; i++) {
+                mPartialTimers.get(i).mInList = true;
+            }
+        } else {
+            // The lists are different, meaning we added (or removed a timer) since the last
+            // collection.
+            final int numLastPartialTimers = mLastPartialTimers.size();
+            for (int i = 0; i < numLastPartialTimers; i++) {
+                mLastPartialTimers.get(i).mInList = false;
+            }
+            mLastPartialTimers.clear();
+
+            // Mark the current timers as gone through a collection.
+            for (int i = 0; i < numPartialTimers; i++) {
+                final StopwatchTimer timer = mPartialTimers.get(i);
+                timer.mInList = true;
+                mLastPartialTimers.add(timer);
+            }
+        }
     }
 
     boolean setChargingLocked(boolean charging) {
@@ -8157,6 +8246,12 @@
         }
     }
 
+    private void scheduleSyncExternalWifiStatsLocked(String reason) {
+        if (mExternalSync != null) {
+            mExternalSync.scheduleWifiSync(reason);
+        }
+    }
+
     // This should probably be exposed in the API, though it's not critical
     public static final int BATTERY_PLUGGED_NONE = 0;
 
diff --git a/core/java/com/android/internal/os/KernelUidCpuTimeReader.java b/core/java/com/android/internal/os/KernelUidCpuTimeReader.java
index b236378..62926d1 100644
--- a/core/java/com/android/internal/os/KernelUidCpuTimeReader.java
+++ b/core/java/com/android/internal/os/KernelUidCpuTimeReader.java
@@ -16,9 +16,11 @@
 package com.android.internal.os;
 
 import android.annotation.Nullable;
+import android.os.SystemClock;
 import android.text.TextUtils;
 import android.util.Slog;
 import android.util.SparseLongArray;
+import android.util.TimeUtils;
 
 import java.io.BufferedReader;
 import java.io.FileReader;
@@ -49,6 +51,7 @@
 
     private SparseLongArray mLastUserTimeUs = new SparseLongArray();
     private SparseLongArray mLastSystemTimeUs = new SparseLongArray();
+    private long mLastTimeRead = 0;
 
     /**
      * Reads the proc file, calling into the callback with a delta of time for each UID.
@@ -57,6 +60,7 @@
      *                 a fresh delta.
      */
     public void readDelta(@Nullable Callback callback) {
+        long now = SystemClock.elapsedRealtime();
         try (BufferedReader reader = new BufferedReader(new FileReader(sProcFile))) {
             TextUtils.SimpleStringSplitter splitter = new TextUtils.SimpleStringSplitter(' ');
             String line;
@@ -75,10 +79,32 @@
                         userTimeDeltaUs -= mLastUserTimeUs.valueAt(index);
                         systemTimeDeltaUs -= mLastSystemTimeUs.valueAt(index);
 
-                        if (userTimeDeltaUs < 0 || systemTimeDeltaUs < 0) {
-                            // The UID must have been removed from accounting, then added back.
-                            userTimeDeltaUs = userTimeUs;
-                            systemTimeDeltaUs = systemTimeUs;
+                        final long timeDiffMs = (now - mLastTimeRead) * 1000;
+                        if (userTimeDeltaUs < 0 || systemTimeDeltaUs < 0 ||
+                                userTimeDeltaUs > timeDiffMs || systemTimeDeltaUs > timeDiffMs ) {
+                            StringBuilder sb = new StringBuilder("Malformed cpu data!\n");
+                            sb.append("Time between reads: ");
+                            TimeUtils.formatDuration(timeDiffMs, sb);
+                            sb.append("ms\n");
+                            sb.append("Previous times: u=");
+                            TimeUtils.formatDuration(mLastUserTimeUs.valueAt(index) / 1000, sb);
+                            sb.append("ms s=");
+                            TimeUtils.formatDuration(mLastSystemTimeUs.valueAt(index) / 1000, sb);
+                            sb.append("ms\n");
+                            sb.append("Current times: u=");
+                            TimeUtils.formatDuration(userTimeUs / 1000, sb);
+                            sb.append("ms s=");
+                            TimeUtils.formatDuration(systemTimeUs / 1000, sb);
+                            sb.append("ms\n");
+                            sb.append("Delta for UID=").append(uid).append(": u=");
+                            TimeUtils.formatDuration(userTimeDeltaUs / 1000, sb);
+                            sb.append("ms s=");
+                            TimeUtils.formatDuration(systemTimeDeltaUs / 1000, sb);
+                            sb.append("ms");
+                            Slog.wtf(TAG, sb.toString());
+
+                            userTimeDeltaUs = 0;
+                            systemTimeDeltaUs = 0;
                         }
                     }
 
@@ -92,6 +118,7 @@
         } catch (IOException e) {
             Slog.e(TAG, "Failed to read uid_cputime", e);
         }
+        mLastTimeRead = now;
     }
 
     /**
diff --git a/core/java/com/android/internal/policy/PhoneWindow.java b/core/java/com/android/internal/policy/PhoneWindow.java
index 294e4ba..66f6079 100644
--- a/core/java/com/android/internal/policy/PhoneWindow.java
+++ b/core/java/com/android/internal/policy/PhoneWindow.java
@@ -390,6 +390,7 @@
         } else {
             mLayoutInflater.inflate(layoutResID, mContentParent);
         }
+        mContentParent.requestApplyInsets();
         final Callback cb = getCallback();
         if (cb != null && !isDestroyed()) {
             cb.onContentChanged();
@@ -419,6 +420,7 @@
         } else {
             mContentParent.addView(view, params);
         }
+        mContentParent.requestApplyInsets();
         final Callback cb = getCallback();
         if (cb != null && !isDestroyed()) {
             cb.onContentChanged();
@@ -435,6 +437,7 @@
             Log.v(TAG, "addContentView does not support content transitions");
         }
         mContentParent.addView(view, params);
+        mContentParent.requestApplyInsets();
         final Callback cb = getCallback();
         if (cb != null && !isDestroyed()) {
             cb.onContentChanged();
diff --git a/core/java/com/android/internal/statusbar/StatusBarIcon.java b/core/java/com/android/internal/statusbar/StatusBarIcon.java
index 4693d4b..1d62623 100644
--- a/core/java/com/android/internal/statusbar/StatusBarIcon.java
+++ b/core/java/com/android/internal/statusbar/StatusBarIcon.java
@@ -20,17 +20,27 @@
 import android.os.Parcel;
 import android.os.Parcelable;
 import android.os.UserHandle;
+import android.text.TextUtils;
 
 public class StatusBarIcon implements Parcelable {
     public UserHandle user;
+    public String pkg;
     public Icon icon;
     public int iconLevel;
     public boolean visible = true;
     public int number;
     public CharSequence contentDescription;
 
-    public StatusBarIcon(UserHandle user, Icon icon, int iconLevel, int number,
+    public StatusBarIcon(UserHandle user, String resPackage, Icon icon, int iconLevel, int number,
             CharSequence contentDescription) {
+        if (icon.getType() == Icon.TYPE_RESOURCE
+                && TextUtils.isEmpty(icon.getResPackage())) {
+            // This is an odd situation where someone's managed to hand us an icon without a
+            // package inside, probably by mashing an int res into a Notification object.
+            // Now that we have the correct package name handy, let's fix it.
+            icon = Icon.createWithResource(resPackage, icon.getResId());
+        }
+        this.pkg = resPackage;
         this.user = user;
         this.icon = icon;
         this.iconLevel = iconLevel;
@@ -41,21 +51,23 @@
     public StatusBarIcon(String iconPackage, UserHandle user,
             int iconId, int iconLevel, int number,
             CharSequence contentDescription) {
-        this(user, Icon.createWithResource(iconPackage, iconId),
+        this(user, iconPackage, Icon.createWithResource(iconPackage, iconId),
                 iconLevel, number, contentDescription);
     }
 
     @Override
     public String toString() {
-        return "StatusBarIcon(icon=" + this.icon
+        return "StatusBarIcon(icon=" + icon
+                + ((iconLevel != 0)?(" level=" + iconLevel):"")
+                + (visible?" visible":"")
                 + " user=" + user.getIdentifier()
-                + " level=" + this.iconLevel + " visible=" + visible
-                + " num=" + this.number + " )";
+                + ((number != 0)?(" num=" + number):"")
+                + " )";
     }
 
     @Override
     public StatusBarIcon clone() {
-        StatusBarIcon that = new StatusBarIcon(this.user, this.icon,
+        StatusBarIcon that = new StatusBarIcon(this.user, this.pkg, this.icon,
                 this.iconLevel, this.number, this.contentDescription);
         that.visible = this.visible;
         return that;
@@ -70,6 +82,7 @@
 
     public void readFromParcel(Parcel in) {
         this.icon = (Icon) in.readParcelable(null);
+        this.pkg = in.readString();
         this.user = (UserHandle) in.readParcelable(null);
         this.iconLevel = in.readInt();
         this.visible = in.readInt() != 0;
@@ -79,6 +92,7 @@
 
     public void writeToParcel(Parcel out, int flags) {
         out.writeParcelable(this.icon, 0);
+        out.writeString(this.pkg);
         out.writeParcelable(this.user, 0);
         out.writeInt(this.iconLevel);
         out.writeInt(this.visible ? 1 : 0);
diff --git a/core/java/com/android/internal/util/ArrayUtils.java b/core/java/com/android/internal/util/ArrayUtils.java
index 62e724a..9d0636a 100644
--- a/core/java/com/android/internal/util/ArrayUtils.java
+++ b/core/java/com/android/internal/util/ArrayUtils.java
@@ -387,4 +387,26 @@
     public static <T> boolean contains(ArrayList<T> cur, T val) {
         return (cur != null) ? cur.contains(val) : false;
     }
+
+    /**
+     * Returns true if the two ArrayLists are equal with respect to the objects they contain.
+     * The objects must be in the same order and be reference equal (== not .equals()).
+     */
+    public static <T> boolean referenceEquals(ArrayList<T> a, ArrayList<T> b) {
+        if (a == b) {
+            return true;
+        }
+
+        final int sizeA = a.size();
+        final int sizeB = b.size();
+        if (a == null || b == null || sizeA != sizeB) {
+            return false;
+        }
+
+        boolean diff = false;
+        for (int i = 0; i < sizeA && !diff; i++) {
+            diff |= a.get(i) != b.get(i);
+        }
+        return !diff;
+    }
 }
diff --git a/core/java/com/android/internal/view/FloatingActionMode.java b/core/java/com/android/internal/view/FloatingActionMode.java
index 99c12776..784b256 100644
--- a/core/java/com/android/internal/view/FloatingActionMode.java
+++ b/core/java/com/android/internal/view/FloatingActionMode.java
@@ -25,6 +25,7 @@
 import android.view.View;
 import android.view.ViewConfiguration;
 
+import com.android.internal.R;
 import com.android.internal.util.Preconditions;
 import com.android.internal.view.menu.MenuBuilder;
 import com.android.internal.widget.FloatingToolbar;
@@ -44,6 +45,7 @@
     private final Rect mViewRect;
     private final Rect mScreenRect;
     private final View mOriginatingView;
+    private final int mBottomAllowance;
 
     private final Runnable mMovingOff = new Runnable() {
         public void run() {
@@ -77,6 +79,10 @@
         mScreenRect = new Rect();
         mOriginatingView = Preconditions.checkNotNull(originatingView);
         mOriginatingView.getLocationInWindow(mViewPosition);
+        // Allow the content rect to overshoot a little bit beyond the
+        // bottom view bound if necessary.
+        mBottomAllowance = context.getResources()
+                .getDimensionPixelSize(R.dimen.content_rect_bottom_clip_allowance);
     }
 
     public void setFloatingToolbar(FloatingToolbar floatingToolbar) {
@@ -141,7 +147,7 @@
                     Math.max(mContentRectOnWindow.left, mViewRect.left),
                     Math.max(mContentRectOnWindow.top, mViewRect.top),
                     Math.min(mContentRectOnWindow.right, mViewRect.right),
-                    Math.min(mContentRectOnWindow.bottom, mViewRect.bottom));
+                    Math.min(mContentRectOnWindow.bottom, mViewRect.bottom + mBottomAllowance));
 
             if (!mContentRectOnWindow.equals(mPreviousContentRectOnWindow)) {
                 // Content rect is moving.
diff --git a/core/java/com/android/internal/widget/FloatingToolbar.java b/core/java/com/android/internal/widget/FloatingToolbar.java
index 53ebc23..65f2f53f 100644
--- a/core/java/com/android/internal/widget/FloatingToolbar.java
+++ b/core/java/com/android/internal/widget/FloatingToolbar.java
@@ -20,7 +20,9 @@
 import android.animation.AnimatorListenerAdapter;
 import android.animation.AnimatorSet;
 import android.animation.ObjectAnimator;
+import android.content.ComponentCallbacks;
 import android.content.Context;
+import android.content.res.Configuration;
 import android.graphics.Color;
 import android.graphics.Point;
 import android.graphics.Rect;
@@ -89,6 +91,19 @@
     private int mSuggestedWidth;
     private boolean mWidthChanged = true;
 
+    private final ComponentCallbacks mOrientationChangeHandler = new ComponentCallbacks() {
+        @Override
+        public void onConfigurationChanged(Configuration newConfig) {
+            if (mPopup.isShowing() && mPopup.viewPortHasChanged()) {
+                mWidthChanged = true;
+                updateLayout();
+            }
+        }
+
+        @Override
+        public void onLowMemory() {}
+    };
+
     /**
      * Initializes a floating toolbar.
      */
@@ -151,6 +166,8 @@
      * Shows this floating toolbar.
      */
     public FloatingToolbar show() {
+        mContext.unregisterComponentCallbacks(mOrientationChangeHandler);
+        mContext.registerComponentCallbacks(mOrientationChangeHandler);
         List<MenuItem> menuItems = getVisibleAndEnabledMenuItems(mMenu);
         if (!isCurrentlyShowing(menuItems) || mWidthChanged) {
             mPopup.dismiss();
@@ -181,6 +198,7 @@
      * Dismisses this floating toolbar.
      */
     public void dismiss() {
+        mContext.unregisterComponentCallbacks(mOrientationChangeHandler);
         mPopup.dismiss();
     }
 
@@ -329,6 +347,7 @@
 
         private final Rect mViewPort = new Rect();
         private final Point mCoords = new Point();
+        private final Rect mTmpRect = new Rect();
 
         private final Region mTouchableRegion = new Region();
         private final ViewTreeObserver.OnComputeInternalInsetsListener mInsetsComputer =
@@ -873,6 +892,11 @@
             mParent.getWindowVisibleDisplayFrame(mViewPort);
         }
 
+        private boolean viewPortHasChanged() {
+            mParent.getWindowVisibleDisplayFrame(mTmpRect);
+            return !mTmpRect.equals(mViewPort);
+        }
+
         private int getToolbarWidth(int suggestedWidth) {
             int width = suggestedWidth;
             refreshViewPort();
diff --git a/core/java/com/android/internal/widget/ResolverDrawerLayout.java b/core/java/com/android/internal/widget/ResolverDrawerLayout.java
index be727f1..585cbc9 100644
--- a/core/java/com/android/internal/widget/ResolverDrawerLayout.java
+++ b/core/java/com/android/internal/widget/ResolverDrawerLayout.java
@@ -127,6 +127,8 @@
         final ViewConfiguration vc = ViewConfiguration.get(context);
         mTouchSlop = vc.getScaledTouchSlop();
         mMinFlingVelocity = vc.getScaledMinimumFlingVelocity();
+
+        setImportantForAccessibility(View.IMPORTANT_FOR_ACCESSIBILITY_YES);
     }
 
     public void setSmallCollapsed(boolean smallCollapsed) {
@@ -593,11 +595,6 @@
     }
 
     @Override
-    public CharSequence getAccessibilityClassName() {
-        return ResolverDrawerLayout.class.getName();
-    }
-
-    @Override
     public void onInitializeAccessibilityNodeInfo(AccessibilityNodeInfo info) {
         super.onInitializeAccessibilityNodeInfo(info);
         if (isEnabled()) {
diff --git a/core/jni/android/graphics/Region.cpp b/core/jni/android/graphics/Region.cpp
index 3bab2df..e99bdfc 100644
--- a/core/jni/android/graphics/Region.cpp
+++ b/core/jni/android/graphics/Region.cpp
@@ -231,15 +231,24 @@
 static jboolean Region_writeToParcel(JNIEnv* env, jobject clazz, jlong regionHandle, jobject parcel)
 {
     const SkRegion* region = reinterpret_cast<SkRegion*>(regionHandle);
-    if (parcel == NULL) {
+    if (parcel == nullptr) {
         return JNI_FALSE;
     }
 
     android::Parcel* p = android::parcelForJavaObject(env, parcel);
 
-    size_t size = region->writeToMemory(NULL);
+    const size_t size = region->writeToMemory(nullptr);
     p->writeInt32(size);
-    region->writeToMemory(p->writeInplace(size));
+    void* dst = p->writeInplace(size);
+    if (dst == nullptr) {
+        ALOGE("Region.writeToParcel could not write %zi bytes", size);
+        return JNI_FALSE;
+    }
+    const size_t sizeWritten = region->writeToMemory(dst);
+    if (sizeWritten != size) {
+        ALOGE("SkRegion::writeToMemory should have written %zi bytes but wrote %zi",
+                size, sizeWritten);
+    }
 
     return JNI_TRUE;
 }
diff --git a/core/jni/android_media_AudioFormat.h b/core/jni/android_media_AudioFormat.h
index 5144457..bb13c35 100644
--- a/core/jni/android_media_AudioFormat.h
+++ b/core/jni/android_media_AudioFormat.h
@@ -80,6 +80,13 @@
         return ENCODING_PCM_8BIT;
     case AUDIO_FORMAT_PCM_FLOAT:
         return ENCODING_PCM_FLOAT;
+
+    // map these to ENCODING_PCM_FLOAT
+    case AUDIO_FORMAT_PCM_8_24_BIT:
+    case AUDIO_FORMAT_PCM_24_BIT_PACKED:
+    case AUDIO_FORMAT_PCM_32_BIT:
+        return ENCODING_PCM_FLOAT;
+
     case AUDIO_FORMAT_AC3:
         return ENCODING_AC3;
     case AUDIO_FORMAT_E_AC3:
diff --git a/core/jni/android_media_AudioSystem.cpp b/core/jni/android_media_AudioSystem.cpp
index ac00532..91b3278 100644
--- a/core/jni/android_media_AudioSystem.cpp
+++ b/core/jni/android_media_AudioSystem.cpp
@@ -832,6 +832,15 @@
     return jStatus;
 }
 
+static bool hasFormat(int* formats, size_t size, int format) {
+    for (size_t index = 0; index < size; index++) {
+        if (formats[index] == format) {
+            return true; // found
+        }
+    }
+    return false; // not found
+}
+
 static jint convertAudioPortFromNative(JNIEnv *env,
                                            jobject *jAudioPort, const struct audio_port *nAudioPort)
 {
@@ -839,6 +848,7 @@
     jintArray jSamplingRates = NULL;
     jintArray jChannelMasks = NULL;
     jintArray jChannelIndexMasks = NULL;
+    int* cFormats = NULL;
     jintArray jFormats = NULL;
     jobjectArray jGains = NULL;
     jobject jHandle = NULL;
@@ -846,6 +856,7 @@
     bool useInMask;
     size_t numPositionMasks = 0;
     size_t numIndexMasks = 0;
+    size_t numUniqueFormats = 0;
 
     ALOGV("convertAudioPortFromNative id %d role %d type %d name %s",
         nAudioPort->id, nAudioPort->role, nAudioPort->type, nAudioPort->name);
@@ -897,14 +908,22 @@
     }
 
     // formats
-    jFormats = env->NewIntArray(nAudioPort->num_formats);
+    if (nAudioPort->num_formats != 0) {
+        cFormats = new int[nAudioPort->num_formats];
+        for (size_t index = 0; index < nAudioPort->num_formats; index++) {
+            int format = audioFormatFromNative(nAudioPort->formats[index]);
+            if (!hasFormat(cFormats, numUniqueFormats, format)) {
+                cFormats[numUniqueFormats++] = format;
+            }
+        }
+    }
+    jFormats = env->NewIntArray(numUniqueFormats);
     if (jFormats == NULL) {
         jStatus = (jint)AUDIO_JAVA_ERROR;
         goto exit;
     }
-    for (size_t j = 0; j < nAudioPort->num_formats; j++) {
-        jint jFormat = audioFormatFromNative(nAudioPort->formats[j]);
-        env->SetIntArrayRegion(jFormats, j, 1, &jFormat);
+    if (numUniqueFormats != 0) {
+        env->SetIntArrayRegion(jFormats, 0, numUniqueFormats, cFormats);
     }
 
     // gains
@@ -1000,6 +1019,12 @@
     if (jChannelMasks != NULL) {
         env->DeleteLocalRef(jChannelMasks);
     }
+    if (jChannelIndexMasks != NULL) {
+        env->DeleteLocalRef(jChannelIndexMasks);
+    }
+    if (cFormats != NULL) {
+        delete[] cFormats;
+    }
     if (jFormats != NULL) {
         env->DeleteLocalRef(jFormats);
     }
diff --git a/core/res/AndroidManifest.xml b/core/res/AndroidManifest.xml
index 65c064b..c2e8c8b 100644
--- a/core/res/AndroidManifest.xml
+++ b/core/res/AndroidManifest.xml
@@ -242,6 +242,7 @@
     <protected-broadcast android:name="android.intent.action.DATA_CONNECTION_CONNECTED_TO_PROVISIONING_APN" />
 
     <protected-broadcast android:name="com.android.server.WifiManager.action.START_SCAN" />
+    <protected-broadcast android:name="com.android.server.WifiManager.action.START_PNO" />
     <protected-broadcast android:name="com.android.server.WifiManager.action.DELAYED_DRIVER_STOP" />
     <protected-broadcast android:name="android.net.wifi.WIFI_STATE_CHANGED" />
     <protected-broadcast android:name="android.net.wifi.WIFI_AP_STATE_CHANGED" />
@@ -316,8 +317,6 @@
     <protected-broadcast android:name="android.intent.action.ACTION_SET_RADIO_CAPABILITY_FAILED" />
 
     <protected-broadcast android:name="android.internal.policy.action.BURN_IN_PROTECTION" />
-    <protected-broadcast android:name="android.service.persistentdata.action.WIPE_IF_ALLOWED" />
-
     <protected-broadcast android:name="android.app.action.SYSTEM_UPDATE_POLICY_CHANGED" />
     <!-- ====================================================================== -->
     <!--                          RUNTIME PERMISSIONS                           -->
@@ -1342,6 +1341,11 @@
         android:description="@string/permdesc_killBackgroundProcesses"
         android:protectionLevel="normal" />
 
+    <!-- @SystemApi @hide Allows an application to retrieve a package's importance.
+         This permission is not available to third party applications. -->
+    <permission android:name="android.permission.GET_PACKAGE_IMPORTANCE"
+        android:protectionLevel="signature|system" />
+
     <!-- ================================== -->
     <!-- Permissions affecting the display of other applications  -->
     <!-- ================================== -->
@@ -2435,8 +2439,7 @@
                  android:backupAgent="com.android.server.backup.SystemBackupAgent"
                  android:killAfterRestore="false"
                  android:icon="@drawable/ic_launcher_android"
-                 android:supportsRtl="true"
-                 android:theme="@style/Theme.Material.DayNight.DarkActionBar">
+                 android:supportsRtl="true">
         <activity android:name="com.android.internal.app.ChooserActivity"
                 android:theme="@style/Theme.DeviceDefault.Resolver"
                 android:finishOnCloseSystemDialogs="true"
@@ -2469,7 +2472,7 @@
                 android:label="@string/managed_profile_label">
         </activity-alias>
         <activity android:name="com.android.internal.app.HeavyWeightSwitcherActivity"
-                android:theme="@style/Theme.Material.DayNight.Dialog"
+                android:theme="@style/Theme.Material.Light.Dialog"
                 android:label="@string/heavy_weight_switcher_title"
                 android:finishOnCloseSystemDialogs="true"
                 android:excludeFromRecents="true"
@@ -2502,7 +2505,7 @@
         <activity android:name="android.accounts.ChooseAccountActivity"
                 android:excludeFromRecents="true"
                 android:exported="true"
-                android:theme="@style/Theme.Material.DayNight.Dialog"
+                android:theme="@style/Theme.Material.Light.Dialog"
                 android:label="@string/choose_account_label"
                 android:process=":ui">
         </activity>
@@ -2510,14 +2513,14 @@
         <activity android:name="android.accounts.ChooseTypeAndAccountActivity"
                 android:excludeFromRecents="true"
                 android:exported="true"
-                android:theme="@style/Theme.Material.DayNight.Dialog"
+                android:theme="@style/Theme.Material.Light.Dialog"
                 android:label="@string/choose_account_label"
                 android:process=":ui">
         </activity>
 
         <activity android:name="android.accounts.ChooseAccountTypeActivity"
                 android:excludeFromRecents="true"
-                android:theme="@style/Theme.Material.DayNight.Dialog"
+                android:theme="@style/Theme.Material.Light.Dialog"
                 android:label="@string/choose_account_label"
                 android:process=":ui">
         </activity>
@@ -2525,19 +2528,19 @@
         <activity android:name="android.accounts.CantAddAccountActivity"
                 android:excludeFromRecents="true"
                 android:exported="true"
-                android:theme="@style/Theme.Material.DayNight.Dialog.NoActionBar"
+                android:theme="@style/Theme.Material.Light.Dialog.NoActionBar"
                 android:process=":ui">
         </activity>
 
         <activity android:name="android.accounts.GrantCredentialsPermissionActivity"
                 android:excludeFromRecents="true"
                 android:exported="true"
-                android:theme="@style/Theme.Material.DayNight.DialogWhenLarge"
+                android:theme="@style/Theme.Material.Light.DialogWhenLarge"
                 android:process=":ui">
         </activity>
 
         <activity android:name="android.content.SyncActivityTooManyDeletes"
-               android:theme="@style/Theme.Material.DayNight.Dialog"
+               android:theme="@style/Theme.Material.Light.Dialog"
                android:label="@string/sync_too_many_deletes"
                android:process=":ui">
         </activity>
@@ -2557,7 +2560,7 @@
         </activity>
 
         <activity android:name="com.android.internal.app.NetInitiatedActivity"
-                android:theme="@style/Theme.Material.DayNight.Dialog.Alert"
+                android:theme="@style/Theme.Material.Light.Dialog.Alert"
                 android:excludeFromRecents="true"
                 android:process=":ui">
         </activity>
diff --git a/core/res/res/drawable/seekbar_track_material.xml b/core/res/res/drawable/seekbar_track_material.xml
index 6e40c48..01eb243 100644
--- a/core/res/res/drawable/seekbar_track_material.xml
+++ b/core/res/res/drawable/seekbar_track_material.xml
@@ -20,7 +20,7 @@
         <shape android:shape="rectangle"
                android:tint="?attr/colorControlNormal">
             <size android:height="@dimen/seekbar_track_background_height_material" />
-            <solid android:color="#ff000000" />
+            <solid android:color="@color/white_disabled_material" />
         </shape>
     </item>
     <item android:id="@id/secondaryProgress"
diff --git a/core/res/res/drawable/spinner_background_material.xml b/core/res/res/drawable/spinner_background_material.xml
index 892dbc5..d37f5b7 100644
--- a/core/res/res/drawable/spinner_background_material.xml
+++ b/core/res/res/drawable/spinner_background_material.xml
@@ -17,22 +17,18 @@
 <layer-list xmlns:android="http://schemas.android.com/apk/res/android"
             android:paddingMode="stack"
             android:paddingStart="0dp"
-            android:paddingEnd="48dp"
+            android:paddingEnd="24dp"
             android:paddingLeft="0dp"
             android:paddingRight="0dp">
     <item
         android:gravity="end|center_vertical"
-        android:width="48dp"
-        android:height="48dp">
-        <ripple
-            android:color="?attr/colorControlHighlight"
-            android:radius="24dp" />
-    </item>
+        android:width="24dp"
+        android:height="24dp"
+        android:drawable="@drawable/control_background_40dp_material" />
 
     <item
         android:drawable="@drawable/ic_spinner_caret"
         android:gravity="end|center_vertical"
         android:width="24dp"
-        android:height="24dp"
-        android:end="12dp" />
+        android:height="24dp" />
 </layer-list>
diff --git a/core/res/res/values-mcc302-mnc220/config.xml b/core/res/res/values-mcc302-mnc220/config.xml
index 9147cbf..09a63aa 100644
--- a/core/res/res/values-mcc302-mnc220/config.xml
+++ b/core/res/res/values-mcc302-mnc220/config.xml
@@ -38,7 +38,8 @@
          note that empty fields can be ommitted: "name,apn,,,,,,,,,310,260,,DUN" -->
     <string-array translatable="false" name="config_tether_apndata">
         <item>[ApnSettingV3]TELUS ISP,isp.telus.com,,,,,,,,,302,220,,DUN,,,true,0,,,,,,,gid,54</item>
-        <item>[ApnSettingV3]Tethered PC Mobile,isp.mb.com,,,,,,,,,302,220,,DUN,,,true,0,,,,,,,gid,50</item>
+        <item>[ApnSettingV3]Tethered Mobile Internet,isp.mb.com,,,,,,,,,302,220,,DUN,,,true,0,,,,,,,gid,50</item>
+        <item>[ApnSettingV3]Tethered Public Mobile,isp.mb.com,,,,,,,,,302,220,,DUN,,,true,0,,,,,,,gid,4D4F</item>
     </string-array>
 
 </resources>
diff --git a/core/res/res/values-mcc302-mnc720/config.xml b/core/res/res/values-mcc302-mnc720/config.xml
index a83107a..dcfa5c5 100644
--- a/core/res/res/values-mcc302-mnc720/config.xml
+++ b/core/res/res/values-mcc302-mnc720/config.xml
@@ -29,6 +29,8 @@
     <string-array translatable="false" name="config_tether_apndata">
         <item>Rogers LTE Tethering,ltedata.apn,,,,,,,,,302,720,,DUN</item>
         <item>[ApnSettingV3]chatr Tethering,chatrisp.apn,,,,,,,,,302,720,,DUN,,,true,0,,,,,,,imsi,302720x94</item>
+        <item>[ApnSettingV3]Tbaytel Tethering,ltedata.apn,,,,,,,,,302,720,,DUN,IPV4V6,IP,true,0,,,,,,,gid,BA</item>
+        <item>[ApnSettingV3]Cityfone Tethering,ltedata.apn,,,,,,,,,302,720,,DUN,IPV4V6,IP,true,0,,,,,,,spn,CITYFONE</item>
     </string-array>
 
     <!-- Configure mobile network MTU. Carrier specific value is set here.
diff --git a/core/res/res/values-night/themes_material_daynight.xml b/core/res/res/values-night/themes_material_daynight.xml
deleted file mode 100644
index b344582..0000000
--- a/core/res/res/values-night/themes_material_daynight.xml
+++ /dev/null
@@ -1,117 +0,0 @@
-<?xml version="1.0" encoding="utf-8"?>
-<!-- Copyright (C) 2015 The Android Open Source Project
-
-     Licensed under the Apache License, Version 2.0 (the "License");
-     you may not use this file except in compliance with the License.
-     You may obtain a copy of the License at
-
-          http://www.apache.org/licenses/LICENSE-2.0
-
-     Unless required by applicable law or agreed to in writing, software
-     distributed under the License is distributed on an "AS IS" BASIS,
-     WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-     See the License for the specific language governing permissions and
-     limitations under the License.
--->
-
-<!--
-===============================================================
-                        PLEASE READ
-===============================================================
-
-The Material themes must not be modified in order to pass CTS.
-Many related themes and styles depend on other values defined in this file.
-If you would like to provide custom themes and styles for your device,
-please see themes_device_defaults.xml.
-
-===============================================================
-                        PLEASE READ
-===============================================================
- -->
-<resources>
-
-    <!-- Material theme (day/night version) for activities. -->
-    <style name="Theme.Material.DayNight" parent="Theme.Material" />
-
-    <!-- Variant of Material.DayNight that has a solid (opaque) action bar
-         with an inverse color profile. The dark action bar sharply stands out against
-         the light content (when applicable).  -->
-    <style name="Theme.Material.DayNight.DarkActionBar" parent="Theme.Material" />
-
-    <!-- Variant of Material.DayNight with no action bar.  -->
-    <style name="Theme.Material.DayNight.NoActionBar" parent="Theme.Material.NoActionBar" />
-
-    <!-- Variant of Material.DayNight that has no title bar and fills
-         the entire screen. This theme
-         sets {@link android.R.attr#windowFullscreen} to true.  -->
-    <style name="Theme.Material.DayNight.NoActionBar.Fullscreen" parent="Theme.Material.NoActionBar.Fullscreen" />
-
-    <!-- Variant of Material.DayNight that has no title bar and fills
-         the entire screen and extends into the display overscan region. This theme
-         sets {@link android.R.attr#windowFullscreen} and {@link android.R.attr#windowOverscan}
-         to true. -->
-    <style name="Theme.Material.DayNight.NoActionBar.Overscan" parent="Theme.Material.NoActionBar.Overscan" />
-
-    <!-- Variant of Material.DayNight that has no title bar and translucent
-         system decor. This theme sets {@link android.R.attr#windowTranslucentStatus} and
-         {@link android.R.attr#windowTranslucentNavigation} to true. -->
-    <style name="Theme.Material.DayNight.NoActionBar.TranslucentDecor" parent="Theme.Material.NoActionBar.TranslucentDecor" />
-
-    <!-- Default Material.DayNight theme for panel windows. This removes all extraneous
-         window decorations, so you basically have an empty rectangle in which
-         to place your content. It makes the window floating, with a transparent
-         background, and turns off dimming behind the window. -->
-    <style name="Theme.Material.DayNight.Panel" parent="Theme.Material.Panel" />
-
-    <!-- Material theme (day/night version) for dialog windows and activities,
-         which is used by the {@link android.app.Dialog} class. This changes
-         the window to be floating (not fill the entire screen), and puts a
-         frame around its contents. You can set this theme on an activity if
-         you would like to make an activity that looks like a Dialog. -->
-    <style name="Theme.Material.DayNight.Dialog" parent="Theme.Material.DayNight.BaseDialog" />
-    <style name="Theme.Material.DayNight.BaseDialog" parent="Theme.Material.BaseDialog" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog that has a nice minimum width for
-         a regular dialog. -->
-    <style name="Theme.Material.DayNight.Dialog.MinWidth" parent="Theme.Material.Dialog.MinWidth" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog that does not include a title bar. -->
-    <style name="Theme.Material.DayNight.Dialog.NoActionBar" parent="Theme.Material.Dialog.NoActionBar" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog.NoActionBar that has a nice minimum width for
-         a regular dialog. -->
-    <style name="Theme.Material.DayNight.Dialog.NoActionBar.MinWidth" parent="Theme.Material.Dialog.NoActionBar.MinWidth" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog that has a fixed size. -->
-    <style name="Theme.Material.DayNight.Dialog.FixedSize" parent="Theme.Material.Dialog.FixedSize" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog.NoActionBar that has a fixed size. -->
-    <style name="Theme.Material.DayNight.Dialog.NoActionBar.FixedSize" parent="Theme.Material.Dialog.NoActionBar.FixedSize" />
-
-    <!-- Theme for a window that will be displayed either full-screen on
-         smaller screens (small, normal) or as a dialog on larger screens
-         (large, xlarge). -->
-    <style name="Theme.Material.DayNight.DialogWhenLarge" parent="Theme.Material.DialogWhenLarge" />
-
-    <!-- Theme for a window with a dark action bar that will be displayed
-         either full-screen on smaller screens (small, normal) or as a dialog
-         on larger screens (large, xlarge). -->
-    <style name="Theme.Material.DayNight.DialogWhenLarge.DarkActionBar" parent="Theme.Material.DialogWhenLarge" />
-
-    <!-- Theme for a window without an action bar that will be displayed either full-screen
-         on smaller screens (small, normal) or as a dialog on larger screens
-         (large, xlarge). -->
-    <style name="Theme.Material.DayNight.DialogWhenLarge.NoActionBar" parent="Theme.Material.DialogWhenLarge.NoActionBar" />
-
-    <!-- Theme for a presentation window on a secondary display. -->
-    <style name="Theme.Material.DayNight.Dialog.Presentation" parent="Theme.Material.Dialog.Presentation" />
-
-    <!-- Material user theme for alert dialog windows, which is used by the
-         {@link android.app.AlertDialog} class. -->
-    <style name="Theme.Material.DayNight.Dialog.Alert" parent="Theme.Material.DayNight.Dialog.BaseAlert" />
-    <style name="Theme.Material.DayNight.Dialog.BaseAlert" parent="Theme.Material.Dialog.BaseAlert" />
-
-    <style name="Theme.Material.DayNight.SearchBar" parent="Theme.Material.SearchBar" />
-    <style name="Theme.Material.DayNight.CompactMenu" parent="Theme.Material.CompactMenu" />
-
-</resources>
diff --git a/core/res/res/values/attrs.xml b/core/res/res/values/attrs.xml
index c08d511..33c9c60b 100644
--- a/core/res/res/values/attrs.xml
+++ b/core/res/res/values/attrs.xml
@@ -4384,7 +4384,7 @@
             <enum name="simple" value="0" />
             <!-- Line breaking uses high-quality strategy, including hyphenation. -->
             <enum name="high_quality" value="1" />
-            <!-- Line breaking stratgegy balances line lengths. -->
+            <!-- Line breaking strategy balances line lengths. -->
             <enum name="balanced" value="2" />
         </attr>
         <!-- Frequency of automatic hyphenation. -->
@@ -4398,10 +4398,10 @@
             screens with limited space for text. -->
             <enum name="full" value="2" />
         </attr>
-        <!-- Array of indents, one dimension value per line, left side. -->
-        <attr name="leftIndents" format="reference" />
-        <!-- Array of indents, one dimension value per line, right side. -->
-        <attr name="rightIndents" format="reference" />
+        <!-- Placeholder for a deleted attribute. This should be removed before M release. -->
+        <attr name="__removeBeforeMRelease_leftIndents" format="reference" />
+        <!-- Placeholder for a deleted attribute. This should be removed before M release. -->
+        <attr name="__removeBeforeMRelease_rightIndents" format="reference" />
     </declare-styleable>
     <declare-styleable name="TextViewAppearance">
         <!-- Base text color, typeface, size, and style. -->
@@ -7775,6 +7775,16 @@
         <!-- Text to set as the content description for the navigation button
              located at the start of the toolbar. -->
         <attr name="navigationContentDescription" format="string" />
+        <!-- Drawable to set as the logo that appears at the starting side of
+             the Toolbar, just after the navigation button. -->
+        <attr name="logo" />
+        <!-- A content description string to describe the appearance of the
+             associated logo image. -->
+        <attr name="logoDescription" format="string" />
+        <!-- A color to apply to the title string. -->
+        <attr name="titleTextColor" format="color" />
+        <!-- A color to apply to the subtitle string. -->
+        <attr name="subtitleTextColor" format="color" />
     </declare-styleable>
 
     <declare-styleable name="Toolbar_LayoutParams">
diff --git a/core/res/res/values/dimens.xml b/core/res/res/values/dimens.xml
index e60a48d..7e74680 100644
--- a/core/res/res/values/dimens.xml
+++ b/core/res/res/values/dimens.xml
@@ -399,6 +399,7 @@
      <dimen name="floating_toolbar_maximum_overflow_height">192dp</dimen>
      <dimen name="floating_toolbar_horizontal_margin">16dp</dimen>
      <dimen name="floating_toolbar_vertical_margin">8dp</dimen>
+     <dimen name="content_rect_bottom_clip_allowance">20dp</dimen>
 
      <dimen name="chooser_grid_padding">0dp</dimen>
 </resources>
diff --git a/core/res/res/values/public.xml b/core/res/res/values/public.xml
index bbe27a4..ab798bb 100644
--- a/core/res/res/values/public.xml
+++ b/core/res/res/values/public.xml
@@ -2631,27 +2631,41 @@
   <public type="attr" name="fullBackupContent" />
 
   <public type="style" name="Widget.Material.Button.Colored" />
-  <public type="style" name="Theme.Material.DayNight" />
-  <public type="style" name="Theme.Material.DayNight.DarkActionBar" />
-  <public type="style" name="Theme.Material.DayNight.Dialog" />
-  <public type="style" name="Theme.Material.DayNight.Dialog.Alert" />
-  <public type="style" name="Theme.Material.DayNight.Dialog.MinWidth" />
-  <public type="style" name="Theme.Material.DayNight.Dialog.NoActionBar" />
-  <public type="style" name="Theme.Material.DayNight.Dialog.NoActionBar.MinWidth" />
-  <public type="style" name="Theme.Material.DayNight.Dialog.Presentation" />
-  <public type="style" name="Theme.Material.DayNight.DialogWhenLarge" />
-  <public type="style" name="Theme.Material.DayNight.DialogWhenLarge.NoActionBar" />
-  <public type="style" name="Theme.Material.DayNight.NoActionBar" />
-  <public type="style" name="Theme.Material.DayNight.NoActionBar.Fullscreen" />
-  <public type="style" name="Theme.Material.DayNight.NoActionBar.Overscan" />
-  <public type="style" name="Theme.Material.DayNight.NoActionBar.TranslucentDecor" />
-  <public type="style" name="Theme.Material.DayNight.Panel" />
+
+  <style name="__reserved8" />
+  <public type="style" name="__reserved8" />
+  <style name="__reserved9" />
+  <public type="style" name="__reserved9" />
+  <style name="__reserved10" />
+  <public type="style" name="__reserved10" />
+  <style name="__reserved11" />
+  <public type="style" name="__reserved11" />
+  <style name="__reserved12" />
+  <public type="style" name="__reserved12" />
+  <style name="__reserved13" />
+  <public type="style" name="__reserved13" />
+  <style name="__reserved14" />
+  <public type="style" name="__reserved14" />
+  <style name="__reserved15" />
+  <public type="style" name="__reserved15" />
+  <style name="__reserved16" />
+  <public type="style" name="__reserved16" />
+  <style name="__reserved17" />
+  <public type="style" name="__reserved17" />
+  <style name="__reserved18" />
+  <public type="style" name="__reserved18" />
+  <style name="__reserved19" />
+  <public type="style" name="__reserved19" />
+  <style name="__reserved20" />
+  <public type="style" name="__reserved20" />
+  <style name="__reserved21" />
+  <public type="style" name="__reserved21" />
+  <style name="__reserved22" />
+  <public type="style" name="__reserved22" />
   <public type="style" name="Theme.Material.Light.LightStatusBar" />
   <public type="style" name="ThemeOverlay.Material.Dialog" />
   <public type="style" name="TextAppearance.Material.Widget.Button.Inverse" />
   <public type="style" name="ThemeOverlay.Material.Dialog.Alert" />
-  <public type="style" name="Theme.Material.Light.DialogWhenLarge.DarkActionBar" />
-  <public type="style" name="Theme.Material.DayNight.DialogWhenLarge.DarkActionBar" />
 
   <public type="id" name="pasteAsPlainText" />
   <public type="id" name="undo" />
@@ -2683,8 +2697,9 @@
 
   <public type="attr" name="lockTaskMode" />
 
-  <public type="attr" name="leftIndents" />
-  <public type="attr" name="rightIndents" />
+  <!-- Placeholder for a removed attribute. Remove this before M release. -->
+  <public type="attr" name="__removeBeforeMRelease_leftIndents" />
+  <public type="attr" name="__removeBeforeMRelease_rightIndents" />
 
   <public type="attr" name="showForAllUsers" />
 
@@ -2699,4 +2714,7 @@
   <public type="attr" name="scrollIndicators" />
   <public type="attr" name="hyphenationFrequency" />
   <public type="attr" name="fingerprintAuthDrawable" />
+  <public type="attr" name="logoDescription" />
+  <public type="attr" name="titleTextColor" />
+  <public type="attr" name="subtitleTextColor" />
 </resources>
diff --git a/core/res/res/values/strings.xml b/core/res/res/values/strings.xml
index 510f6a5..ea0d349 100644
--- a/core/res/res/values/strings.xml
+++ b/core/res/res/values/strings.xml
@@ -537,10 +537,10 @@
     <!-- Label for the Android system components when they are shown to the user. -->
     <string name="android_system_label">Android System</string>
 
-    <!-- Label for the user owner in the intent forwarding app. -->
-    <string name="user_owner_label">Personal apps</string>
+    <!-- Label for the user owner in the intent forwarding app. [CHAR LIMIT=15] -->
+    <string name="user_owner_label">Personal</string>
 
-    <!-- Label for a corporate profile in the intent forwarding app. -->
+    <!-- Label for a corporate profile in the intent forwarding app. [CHAR LIMIT=15] -->
     <string name="managed_profile_label">Work</string>
 
     <!-- Title of a category of application permissions, listed so the user can choose whether they want to allow the application to do this. -->
diff --git a/core/res/res/values/symbols.xml b/core/res/res/values/symbols.xml
index 5ba57c4..4160e0e 100755
--- a/core/res/res/values/symbols.xml
+++ b/core/res/res/values/symbols.xml
@@ -2274,6 +2274,7 @@
   <java-symbol type="dimen" name="floating_toolbar_maximum_overflow_height" />
   <java-symbol type="dimen" name="floating_toolbar_horizontal_margin" />
   <java-symbol type="dimen" name="floating_toolbar_vertical_margin" />
+  <java-symbol type="dimen" name="content_rect_bottom_clip_allowance" />
 
   <java-symbol type="string" name="date_picker_prev_month_button" />
   <java-symbol type="string" name="date_picker_next_month_button" />
diff --git a/core/res/res/values/themes_material.xml b/core/res/res/values/themes_material.xml
index 295b453..9d3a7ef 100644
--- a/core/res/res/values/themes_material.xml
+++ b/core/res/res/values/themes_material.xml
@@ -1281,7 +1281,7 @@
     </style>
 
     <!-- Default theme for Settings and activities launched from Settings. -->
-    <style name="Theme.Material.Settings" parent="Theme.Material.DayNight.DarkActionBar">
+    <style name="Theme.Material.Settings" parent="Theme.Material.Light.DarkActionBar">
         <item name="colorPrimary">@color/material_blue_grey_900</item>
         <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
 
@@ -1291,7 +1291,7 @@
     </style>
 
     <!-- Default theme for Settings and activities launched from Settings. -->
-    <style name="Theme.Material.Settings.NoActionBar" parent="Theme.Material.DayNight.NoActionBar">
+    <style name="Theme.Material.Settings.NoActionBar" parent="Theme.Material.Light.NoActionBar">
         <item name="colorPrimary">@color/material_blue_grey_900</item>
         <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
 
@@ -1299,42 +1299,40 @@
         <item name="searchDialogTheme">@style/Theme.Material.Settings.SearchBar</item>
         <item name="panelMenuListTheme">@style/Theme.Material.Settings.CompactMenu</item>
     </style>
-
-    <style name="Theme.Material.Settings.BaseDialog" parent="Theme.Material.DayNight.BaseDialog">
+    <style name="Theme.Material.Settings.BaseDialog" parent="Theme.Material.Light.BaseDialog">
         <item name="colorPrimary">@color/material_blue_grey_900</item>
         <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
     </style>
 
     <style name="Theme.Material.Settings.Dialog" parent="Theme.Material.Settings.BaseDialog" />
 
-    <style name="Theme.Material.Settings.Dialog.BaseAlert" parent="Theme.Material.DayNight.Dialog.BaseAlert">
+    <style name="Theme.Material.Settings.Dialog.BaseAlert" parent="Theme.Material.Light.Dialog.BaseAlert">
         <item name="colorPrimary">@color/material_blue_grey_900</item>
         <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
     </style>
 
     <style name="Theme.Material.Settings.Dialog.Alert" parent="Theme.Material.Settings.Dialog.BaseAlert" />
 
-    <style name="Theme.Material.Settings.DialogWhenLarge" parent="Theme.Material.DayNight.DialogWhenLarge.DarkActionBar">
+    <style name="Theme.Material.Settings.DialogWhenLarge" parent="Theme.Material.Light.DialogWhenLarge.DarkActionBar">
         <item name="colorPrimary">@color/material_blue_grey_900</item>
         <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
     </style>
 
-    <style name="Theme.Material.Settings.DialogWhenLarge.NoActionBar" parent="Theme.Material.DayNight.DialogWhenLarge.NoActionBar">
+    <style name="Theme.Material.Settings.DialogWhenLarge.NoActionBar" parent="Theme.Material.Light.DialogWhenLarge.NoActionBar">
+        <item name="colorPrimary">@color/material_blue_grey_900</item>
+        <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
+    </style>
+    <style name="Theme.Material.Settings.Dialog.Presentation" parent="Theme.Material.Light.Dialog.Presentation">
         <item name="colorPrimary">@color/material_blue_grey_900</item>
         <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
     </style>
 
-    <style name="Theme.Material.Settings.Dialog.Presentation" parent="Theme.Material.DayNight.Dialog.Presentation">
+    <style name="Theme.Material.Settings.SearchBar" parent="Theme.Material.Light.SearchBar">
         <item name="colorPrimary">@color/material_blue_grey_900</item>
         <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
     </style>
 
-    <style name="Theme.Material.Settings.SearchBar" parent="Theme.Material.DayNight.SearchBar">
-        <item name="colorPrimary">@color/material_blue_grey_900</item>
-        <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
-    </style>
-
-    <style name="Theme.Material.Settings.CompactMenu" parent="Theme.Material.DayNight.CompactMenu">
+    <style name="Theme.Material.Settings.CompactMenu" parent="Theme.Material.Light.CompactMenu">
         <item name="colorPrimary">@color/material_blue_grey_900</item>
         <item name="colorPrimaryDark">@color/material_blue_grey_950</item>
     </style>
diff --git a/core/res/res/values/themes_material_daynight.xml b/core/res/res/values/themes_material_daynight.xml
deleted file mode 100644
index 4ecca6b..0000000
--- a/core/res/res/values/themes_material_daynight.xml
+++ /dev/null
@@ -1,117 +0,0 @@
-<?xml version="1.0" encoding="utf-8"?>
-<!-- Copyright (C) 2015 The Android Open Source Project
-
-     Licensed under the Apache License, Version 2.0 (the "License");
-     you may not use this file except in compliance with the License.
-     You may obtain a copy of the License at
-
-          http://www.apache.org/licenses/LICENSE-2.0
-
-     Unless required by applicable law or agreed to in writing, software
-     distributed under the License is distributed on an "AS IS" BASIS,
-     WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-     See the License for the specific language governing permissions and
-     limitations under the License.
--->
-
-<!--
-===============================================================
-                        PLEASE READ
-===============================================================
-
-The Material themes must not be modified in order to pass CTS.
-Many related themes and styles depend on other values defined in this file.
-If you would like to provide custom themes and styles for your device,
-please see themes_device_defaults.xml.
-
-===============================================================
-                        PLEASE READ
-===============================================================
- -->
-<resources>
-
-    <!-- Material theme (day/night vesion) for activities. -->
-    <style name="Theme.Material.DayNight" parent="Theme.Material.Light" />
-
-    <!-- Variant of Material.DayNight that has a solid (opaque) action bar
-         with an inverse color profile. The dark action bar sharply stands out against
-         the light content (when applicable).  -->
-    <style name="Theme.Material.DayNight.DarkActionBar" parent="Theme.Material.Light.DarkActionBar" />
-
-    <!-- Variant of Material.DayNight with no action bar.  -->
-    <style name="Theme.Material.DayNight.NoActionBar" parent="Theme.Material.Light.NoActionBar" />
-
-    <!-- Variant of Material.DayNight that has no title bar and fills
-         the entire screen. This theme
-         sets {@link android.R.attr#windowFullscreen} to true.  -->
-    <style name="Theme.Material.DayNight.NoActionBar.Fullscreen" parent="Theme.Material.Light.NoActionBar.Fullscreen" />
-
-    <!-- Variant of Material.DayNight that has no title bar and fills
-         the entire screen and extends into the display overscan region. This theme
-         sets {@link android.R.attr#windowFullscreen} and {@link android.R.attr#windowOverscan}
-         to true. -->
-    <style name="Theme.Material.DayNight.NoActionBar.Overscan" parent="Theme.Material.Light.NoActionBar.Overscan" />
-
-    <!-- Variant of Material.DayNight that has no title bar and translucent
-         system decor. This theme sets {@link android.R.attr#windowTranslucentStatus} and
-         {@link android.R.attr#windowTranslucentNavigation} to true. -->
-    <style name="Theme.Material.DayNight.NoActionBar.TranslucentDecor" parent="Theme.Material.Light.NoActionBar.TranslucentDecor" />
-
-    <!-- Default Material.DayNight theme for panel windows. This removes all extraneous
-         window decorations, so you basically have an empty rectangle in which
-         to place your content. It makes the window floating, with a transparent
-         background, and turns off dimming behind the window. -->
-    <style name="Theme.Material.DayNight.Panel" parent="Theme.Material.Light.Panel" />
-
-    <!-- Material theme (day/night vesion) for dialog windows and activities,
-         which is used by the {@link android.app.Dialog} class. This changes
-         the window to be floating (not fill the entire screen), and puts a
-         frame around its contents. You can set this theme on an activity if
-         you would like to make an activity that looks like a Dialog. -->
-    <style name="Theme.Material.DayNight.Dialog" parent="Theme.Material.DayNight.BaseDialog" />
-    <style name="Theme.Material.DayNight.BaseDialog" parent="Theme.Material.Light.BaseDialog" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog that has a nice minimum width for
-         a regular dialog. -->
-    <style name="Theme.Material.DayNight.Dialog.MinWidth" parent="Theme.Material.Light.Dialog.MinWidth" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog that does not include a title bar. -->
-    <style name="Theme.Material.DayNight.Dialog.NoActionBar" parent="Theme.Material.Light.Dialog.NoActionBar" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog.NoActionBar that has a nice minimum width for
-         a regular dialog. -->
-    <style name="Theme.Material.DayNight.Dialog.NoActionBar.MinWidth" parent="Theme.Material.Light.Dialog.NoActionBar.MinWidth" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog that has a fixed size. -->
-    <style name="Theme.Material.DayNight.Dialog.FixedSize" parent="Theme.Material.Light.Dialog.FixedSize" />
-
-    <!-- Variant of Theme.Material.DayNight.Dialog.NoActionBar that has a fixed size. -->
-    <style name="Theme.Material.DayNight.Dialog.NoActionBar.FixedSize" parent="Theme.Material.Light.Dialog.NoActionBar.FixedSize" />
-
-    <!-- Theme for a window that will be displayed either full-screen on
-         smaller screens (small, normal) or as a dialog on larger screens
-         (large, xlarge). -->
-    <style name="Theme.Material.DayNight.DialogWhenLarge" parent="Theme.Material.Light.DialogWhenLarge" />
-
-    <!-- Theme for a window with a dark action bar that will be displayed
-         either full-screen on smaller screens (small, normal) or as a dialog
-         on larger screens (large, xlarge). -->
-    <style name="Theme.Material.DayNight.DialogWhenLarge.DarkActionBar" parent="Theme.Material.Light.DialogWhenLarge.DarkActionBar" />
-
-    <!-- Theme for a window without an action bar that will be displayed either full-screen
-         on smaller screens (small, normal) or as a dialog on larger screens
-         (large, xlarge). -->
-    <style name="Theme.Material.DayNight.DialogWhenLarge.NoActionBar" parent="Theme.Material.Light.DialogWhenLarge.NoActionBar" />
-
-    <!-- Theme for a presentation window on a secondary display. -->
-    <style name="Theme.Material.DayNight.Dialog.Presentation" parent="Theme.Material.Light.Dialog.Presentation" />
-
-    <!-- Material user theme for alert dialog windows, which is used by the
-         {@link android.app.AlertDialog} class. -->
-    <style name="Theme.Material.DayNight.Dialog.Alert" parent="Theme.Material.DayNight.Dialog.BaseAlert" />
-    <style name="Theme.Material.DayNight.Dialog.BaseAlert" parent="Theme.Material.Light.Dialog.BaseAlert" />
-
-    <style name="Theme.Material.DayNight.SearchBar" parent="Theme.Material.Light.SearchBar" />
-    <style name="Theme.Material.DayNight.CompactMenu" parent="Theme.Material.Light.CompactMenu" />
-
-</resources>
diff --git a/docs/html/sdk/index.jd b/docs/html/sdk/index.jd
index 9a834506..7b1169f 100644
--- a/docs/html/sdk/index.jd
+++ b/docs/html/sdk/index.jd
@@ -30,21 +30,22 @@
 
 
 
-sdk.linux_download=android-sdk_r24.3.2-linux.tgz
-sdk.linux_bytes=309138263
-sdk.linux_checksum=4a10e62c5d88fd6c2a69db12348cbe168228b98f
+sdk.linux_download=android-sdk_r24.3.3-linux.tgz
+sdk.linux_bytes=309109716
+sdk.linux_checksum=cd4cab76c2e3d926b3495c26ec56c831ba77d0d0
 
-sdk.mac_download=android-sdk_r24.3.2-macosx.zip
-sdk.mac_bytes=98329772
-sdk.mac_checksum=8609b92e26e9bd5796f771138c6b222b6c0cb474
+sdk.mac_download=android-sdk_r24.3.3-macosx.zip
+sdk.mac_bytes=98330824
+sdk.mac_checksum=41f0f3e76d6868018740e654aefb04fd765c357d
 
-sdk.win_download=android-sdk_r24.3.2-windows.zip
-sdk.win_bytes=187488291
-sdk.win_checksum=bcfe3c41ea7e33a29ad6f358adbdf977008be80a
+sdk.win_download=android-sdk_r24.3.3-windows.zip
+sdk.win_bytes=187480692
+sdk.win_checksum=b6a4899efbf20fc593042f1515446c6630ba502e
 
-sdk.win_installer=installer_r24.3.2-windows.exe
-sdk.win_installer_bytes=139471724
-sdk.win_installer_checksum=8f9d0ae9fdb37973ed62d6e93975ff375beb5542
+
+sdk.win_installer=installer_r24.3.3-windows.exe
+sdk.win_installer_bytes=139463749
+sdk.win_installer_checksum=bbdae40a7665e55b3cdb1fbae865986e6cd3df14
 
 
 
diff --git a/docs/html/tools/sdk/tools-notes.jd b/docs/html/tools/sdk/tools-notes.jd
index 326fbe2..934b262 100644
--- a/docs/html/tools/sdk/tools-notes.jd
+++ b/docs/html/tools/sdk/tools-notes.jd
@@ -25,6 +25,36 @@
 <div class="toggle-content opened">
   <p><a href="#" onclick="return toggleContent(this)">
     <img src="{@docRoot}assets/images/triangle-opened.png" class="toggle-content-img"
+      alt=""/>SDK Tools, Revision 24.3.3</a> <em>(June 2015)</em>
+  </p>
+
+  <div class="toggle-content-toggleme">
+
+    <dl>
+    <dt>Dependencies:</dt>
+
+    <dd>
+      <ul>
+        <li>Android SDK Platform-tools revision 19 or later.</li>
+      </ul>
+    </dd>
+
+    <dt>General Notes:</dt>
+    <dd>
+      <ul>
+        <li>Fixed issues with using Ant build tasks with the Eclipse ADT build structure. </li>
+        <li>Fixed the emulator boot problem on Mac OS X 10.8.5.</li>
+      </ul>
+    </dd>
+  </div>
+</div>
+
+
+
+
+<div class="toggle-content closed">
+  <p><a href="#" onclick="return toggleContent(this)">
+    <img src="{@docRoot}assets/images/triangle-closed.png" class="toggle-content-img"
       alt=""/>SDK Tools, Revision 24.3.2</a> <em>(June 2015)</em>
   </p>
 
diff --git a/docs/html/training/articles/keystore.jd b/docs/html/training/articles/keystore.jd
index fca958e..52cb13e 100644
--- a/docs/html/training/articles/keystore.jd
+++ b/docs/html/training/articles/keystore.jd
@@ -32,7 +32,7 @@
   keystore, they can be used for cryptographic operations with the key material
   remaining non-exportable. Moreover, it offers facilities to restrict when and
   how keys can be used, such as requiring user authentication for key use or
-  restricting encryption keys to be used only in certain block modes. See
+  restricting keys to be used only in certain cryptographic modes. See
   <a href="#SecurityFeatures">Security Features</a> section for more information.</p>
 
 <p>The Keystore system is used by the {@link
@@ -48,7 +48,8 @@
 mitigates unauthorized use of key material outside of the Android device by preventing extraction of
 the key material from application processes and from the Android device as a whole. Secondly,
 Android KeyStore mitigates unauthorized use of key material on the Android device by making apps
-specify authorized uses of their keys and then enforcing these restrictions.
+specify authorized uses of their keys and then enforcing these restrictions outside of the apps'
+processes.
 
 <h3 id="ExtractionPrevention">Extraction Prevention</h3>
 
@@ -78,14 +79,16 @@
 To mitigate unauthorized use of keys on the Android device, Android Keystore lets apps specify
 authorized uses of their keys when generating or importing the keys. Once a key is generated or
 imported, its authorizations can not be changed. Authorizations are then enforced by the Android
-Keystore whenever the key is used.
+Keystore whenever the key is used. This is an advanced security feature which is generally useful
+only if your requirements are that a compromise of your application process after key
+generation/import (but not before or during) cannot lead to unauthorized uses of the key.
 
 <p>Supported key use authorizations fall into the following categories:
 <ul>
 <li><em>cryptography</em>: authorized key algorithm, operations or purposes (encrypt, decrypt, sign,
-  verify), padding schemes, block modes, digests with which the key can be used</li>
+  verify), padding schemes, block modes, digests with which the key can be used;</li>
 <li><em>temporal validity interval</em>: interval of time during which the key is authorized for
-  use</li>
+  use;</li>
 <li><em>user authentication</em>: the key can only be used if the user has been authenticated
   recently enough. See <a href="#UserAuthentication">Requiring User Authentication For Key Use</a>.
   </li>
@@ -181,23 +184,33 @@
 <h3 id="UserAuthentication">Requiring User Authentication For Key Use</h3>
 
 <p>When generating or importing a key into the {@code AndroidKeyStore} you can specify that the key
-can only be used if user has been authenticated. The user is authenticated using a subset of their
-secure lock screen credentials. This is a security measure which makes it possible to generate
-cryptographic assertions about the user having been authenticated.
+is only authorized to be used if the user has been authenticated. The user is authenticated using a
+subset of their secure lock screen credentials (pattern/PIN/password, fingerprint).
 
-<p>When a key is configured to require user authentication, it is also configured to operate in one
-of the two modes:
+<p>This is an advanced security feature which is generally useful only if your requirements are that
+a compromise of your application process after key generation/import (but not before or during)
+cannot bypass the requirement for the user to be authenticated to use the key.
+
+<p>When a key is authorized to be used only if the user has been authenticated, it is configured to
+operate in one of the two modes:
 <ul>
-<li>User authentication is valid for a duration of time. All keys in this mode are authorized
-  for use as soon as the user unlocks the secure lock screen or confirms their secure lock screen
-  credentials using the {@link android.app.KeyguardManager#createConfirmDeviceCredentialIntent(CharSequence, CharSequence) KeyguardManager.createConfirmDeviceCredentialIntent}
-  flow. Each key specifies for how long the authorization remains valid for that key. Such keys
-  can only be generated or imported if the secure lock screen is enabled (see {@link android.app.KeyguardManager#isDeviceSecure() KeyguardManager.isDeviceSecure()}).
-  These keys become permanently invalidated once the secure lock screen is disabled or forcibly
-  reset (e.g. by a Device Admin).</li>
-<li>User authentication is required for every use of the key. In this mode, a specific operation
-  involving a specific key is authorized by the user. Currently, the only means of such
-  authorization is fingerprint authentication: {@link android.hardware.fingerprint.FingerprintManager#authenticate(CryptoObject, CancellationSignal, int, AuthenticationCallback, Handler) FingerprintManager.authenticate}.
-  Such keys can only be generated or imported if at least one fingerprint is enrolled (see {@link android.hardware.fingerprint.FingerprintManager#hasEnrolledFingerprints() FingerprintManager.hasEnrolledFingerprints}).
-  These keys become permanently invalidated once all fingerprints are unenrolled.</li>
-</ul>
+<li>User authentication authorizes the use of keys for a duration of time. All keys in this mode are
+  authorized for use as soon as the user unlocks the secure lock screen or confirms their secure
+  lock screen credential using the
+  {@link android.app.KeyguardManager#createConfirmDeviceCredentialIntent(CharSequence, CharSequence) KeyguardManager.createConfirmDeviceCredentialIntent}
+  flow. The duration for which the authorization remains valid is specific to each key, as specified
+  using {@code setUserAuthenticationValidityDurationSeconds} during key generation or import. Such
+  keys can only be generated or imported if the secure lock screen is enabled (see
+  {@link android.app.KeyguardManager#isDeviceSecure() KeyguardManager.isDeviceSecure()}). These keys
+  become permanently invalidated once the secure lock screen is disabled (reconfigured to None,
+  Swipe or other mode which does not authenticate the user) or forcibly reset (e.g. by a Device
+  Administrator).</li>
+<li>User authentication authorizes a specific cryptographic operation associated with one key. In
+  this mode, each operation involving such a key must be individually authorized by the user.
+  Currently, the only means of such authorization is fingerprint authentication:
+  {@link android.hardware.fingerprint.FingerprintManager#authenticate(CryptoObject, CancellationSignal, int, AuthenticationCallback, Handler) FingerprintManager.authenticate}.
+  Such keys can only be generated or imported if at least one fingerprint is enrolled (see
+  {@link android.hardware.fingerprint.FingerprintManager#hasEnrolledFingerprints() FingerprintManager.hasEnrolledFingerprints}).
+  These keys become permanently invalidated once a new fingerprint is enrolled or all fingerprints
+  are unenrolled.</li>
+</ul>
\ No newline at end of file
diff --git a/graphics/java/android/graphics/drawable/BitmapDrawable.java b/graphics/java/android/graphics/drawable/BitmapDrawable.java
index a0c407f..f059727 100644
--- a/graphics/java/android/graphics/drawable/BitmapDrawable.java
+++ b/graphics/java/android/graphics/drawable/BitmapDrawable.java
@@ -363,7 +363,7 @@
     }
 
     @Override
-    public boolean getDither() {
+    public boolean isDither() {
         return mBitmapState.mPaint.isDither();
     }
 
diff --git a/graphics/java/android/graphics/drawable/Drawable.java b/graphics/java/android/graphics/drawable/Drawable.java
index 415af0d..5e62aea 100644
--- a/graphics/java/android/graphics/drawable/Drawable.java
+++ b/graphics/java/android/graphics/drawable/Drawable.java
@@ -279,7 +279,7 @@
      * @return whether this drawable dithers its colors
      * @see #setDither(boolean)
      */
-    public boolean getDither() {
+    public boolean isDither() {
         return false;
     }
 
@@ -433,7 +433,7 @@
 
     /**
      * Set the layout direction for this drawable. Should be a resolved
-     * layout direction, as the Drawable as no capacity to do the resolution on
+     * layout direction, as the Drawable has no capacity to do the resolution on
      * its own.
      *
      * @param layoutDirection the resolved layout direction for the drawable,
diff --git a/graphics/java/android/graphics/drawable/DrawableContainer.java b/graphics/java/android/graphics/drawable/DrawableContainer.java
index 8b801c3..1759f53 100644
--- a/graphics/java/android/graphics/drawable/DrawableContainer.java
+++ b/graphics/java/android/graphics/drawable/DrawableContainer.java
@@ -167,7 +167,7 @@
     }
 
     @Override
-    public boolean getDither() {
+    public boolean isDither() {
         return mDrawableContainerState.mDither;
     }
 
diff --git a/graphics/java/android/graphics/drawable/GradientDrawable.java b/graphics/java/android/graphics/drawable/GradientDrawable.java
index ed47eed..626991d 100644
--- a/graphics/java/android/graphics/drawable/GradientDrawable.java
+++ b/graphics/java/android/graphics/drawable/GradientDrawable.java
@@ -826,7 +826,7 @@
     }
 
     @Override
-    public boolean getDither() {
+    public boolean isDither() {
         return mGradientState.mDither;
     }
 
diff --git a/graphics/java/android/graphics/drawable/Icon.java b/graphics/java/android/graphics/drawable/Icon.java
index 7b4329a..85db6a1 100644
--- a/graphics/java/android/graphics/drawable/Icon.java
+++ b/graphics/java/android/graphics/drawable/Icon.java
@@ -29,6 +29,7 @@
 import android.os.Message;
 import android.os.Parcel;
 import android.os.Parcelable;
+import android.text.TextUtils;
 import android.util.Log;
 
 import java.io.DataInputStream;
@@ -258,16 +259,21 @@
                 return new BitmapDrawable(context.getResources(), getBitmap());
             case TYPE_RESOURCE:
                 if (getResources() == null) {
-                    if (getResPackage() == null || "android".equals(getResPackage())) {
+                    // figure out where to load resources from
+                    String resPackage = getResPackage();
+                    if (TextUtils.isEmpty(resPackage)) {
+                        // if none is specified, try the given context
+                        resPackage = context.getPackageName();
+                    }
+                    if ("android".equals(resPackage)) {
                         mObj1 = Resources.getSystem();
                     } else {
                         final PackageManager pm = context.getPackageManager();
                         try {
-                            mObj1 = pm.getResourcesForApplication(getResPackage());
+                            mObj1 = pm.getResourcesForApplication(resPackage);
                         } catch (PackageManager.NameNotFoundException e) {
-                            Log.e(TAG, String.format("Unable to find pkg=%s",
-                                            getResPackage()),
-                                    e);
+                            Log.e(TAG, String.format("Unable to find pkg=%s for icon %s",
+                                    resPackage, this), e);
                             break;
                         }
                     }
@@ -320,12 +326,15 @@
      */
     public Drawable loadDrawableAsUser(Context context, int userId) {
         if (mType == TYPE_RESOURCE) {
-            if (getResources() == null
-                    && getResPackage() != null
-                    && !(getResPackage().equals("android"))) {
+            String resPackage = getResPackage();
+            if (TextUtils.isEmpty(resPackage)) {
+                resPackage = context.getPackageName();
+            }
+            if (getResources() == null && !(getResPackage().equals("android"))) {
                 final PackageManager pm = context.getPackageManager();
                 try {
-                    mObj1 = pm.getResourcesForApplicationAsUser(getResPackage(), userId);
+                    // assign getResources() as the correct user
+                    mObj1 = pm.getResourcesForApplicationAsUser(resPackage, userId);
                 } catch (PackageManager.NameNotFoundException e) {
                     Log.e(TAG, String.format("Unable to find pkg=%s user=%d",
                                     getResPackage(),
@@ -410,6 +419,9 @@
      * @param resId ID of the drawable resource
      */
     public static Icon createWithResource(Context context, @DrawableRes int resId) {
+        if (context == null) {
+            throw new IllegalArgumentException("Context must not be null.");
+        }
         final Icon rep = new Icon(TYPE_RESOURCE);
         rep.mInt1 = resId;
         rep.mString1 = context.getPackageName();
diff --git a/graphics/java/android/graphics/drawable/LayerDrawable.java b/graphics/java/android/graphics/drawable/LayerDrawable.java
index 5c00a23..90891f6 100644
--- a/graphics/java/android/graphics/drawable/LayerDrawable.java
+++ b/graphics/java/android/graphics/drawable/LayerDrawable.java
@@ -1248,12 +1248,12 @@
     }
 
     @Override
-    public boolean getDither() {
+    public boolean isDither() {
         final Drawable dr = getFirstNonNullDrawable();
         if (dr != null) {
-            return dr.getDither();
+            return dr.isDither();
         } else {
-            return super.getDither();
+            return super.isDither();
         }
     }
 
@@ -1537,8 +1537,23 @@
                 continue;
             }
 
+            // Take the resolved layout direction into account. If start / end
+            // padding are defined, they will be resolved (hence overriding) to
+            // left / right or right / left depending on the resolved layout
+            // direction. If start / end padding are not defined, use the
+            // left / right ones.
+            final int insetL, insetR;
+            final int layoutDirection = getLayoutDirection();
+            if (layoutDirection == LayoutDirection.RTL) {
+                insetL = r.mInsetE == UNDEFINED_INSET ? r.mInsetL : r.mInsetE;
+                insetR = r.mInsetS == UNDEFINED_INSET ? r.mInsetR : r.mInsetS;
+            } else {
+                insetL = r.mInsetS == UNDEFINED_INSET ? r.mInsetL : r.mInsetS;
+                insetR = r.mInsetE == UNDEFINED_INSET ? r.mInsetR : r.mInsetE;
+            }
+
             final int minWidth = r.mWidth < 0 ? r.mDrawable.getIntrinsicWidth() : r.mWidth;
-            final int w = minWidth + r.mInsetL + r.mInsetR + padL + padR;
+            final int w = minWidth + insetL + insetR + padL + padR;
             if (w > width) {
                 width = w;
             }
diff --git a/graphics/java/android/graphics/drawable/NinePatchDrawable.java b/graphics/java/android/graphics/drawable/NinePatchDrawable.java
index 0b7869b..adf53e3 100644
--- a/graphics/java/android/graphics/drawable/NinePatchDrawable.java
+++ b/graphics/java/android/graphics/drawable/NinePatchDrawable.java
@@ -374,7 +374,7 @@
     }
 
     @Override
-    public boolean getDither() {
+    public boolean isDither() {
         return mPaint == null ? DEFAULT_DITHER : mPaint.isDither();
     }
 
diff --git a/graphics/java/android/graphics/drawable/ShapeDrawable.java b/graphics/java/android/graphics/drawable/ShapeDrawable.java
index 334b3bd..a669d3c 100644
--- a/graphics/java/android/graphics/drawable/ShapeDrawable.java
+++ b/graphics/java/android/graphics/drawable/ShapeDrawable.java
@@ -328,7 +328,7 @@
     }
 
     @Override
-    public boolean getDither() {
+    public boolean isDither() {
         return mShapeState.mPaint.isDither();
     }
 
diff --git a/keystore/java/android/security/keystore/AndroidKeyStoreAuthenticatedAESCipherSpi.java b/keystore/java/android/security/keystore/AndroidKeyStoreAuthenticatedAESCipherSpi.java
new file mode 100644
index 0000000..f412743
--- /dev/null
+++ b/keystore/java/android/security/keystore/AndroidKeyStoreAuthenticatedAESCipherSpi.java
@@ -0,0 +1,442 @@
+/*
+ * Copyright (C) 2015 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.security.keystore;
+
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.os.IBinder;
+import android.security.KeyStore;
+import android.security.KeyStoreException;
+import android.security.keymaster.KeymasterArguments;
+import android.security.keymaster.KeymasterDefs;
+import android.security.keymaster.OperationResult;
+import android.security.keystore.KeyStoreCryptoOperationChunkedStreamer.Stream;
+
+import libcore.util.EmptyArray;
+
+import java.io.ByteArrayOutputStream;
+import java.io.IOException;
+import java.security.AlgorithmParameters;
+import java.security.InvalidAlgorithmParameterException;
+import java.security.InvalidKeyException;
+import java.security.Key;
+import java.security.NoSuchAlgorithmException;
+import java.security.ProviderException;
+import java.security.spec.AlgorithmParameterSpec;
+import java.security.spec.InvalidParameterSpecException;
+import java.util.Arrays;
+
+import javax.crypto.CipherSpi;
+import javax.crypto.spec.GCMParameterSpec;
+
+/**
+ * Base class for Android Keystore authenticated AES {@link CipherSpi} implementations.
+ *
+ * @hide
+ */
+abstract class AndroidKeyStoreAuthenticatedAESCipherSpi extends AndroidKeyStoreCipherSpiBase {
+
+    abstract static class GCM extends AndroidKeyStoreAuthenticatedAESCipherSpi {
+        private static final int MIN_SUPPORTED_TAG_LENGTH_BITS = 96;
+        private static final int MAX_SUPPORTED_TAG_LENGTH_BITS = 128;
+        private static final int DEFAULT_TAG_LENGTH_BITS = 128;
+        private static final int IV_LENGTH_BYTES = 12;
+
+        private int mTagLengthBits = DEFAULT_TAG_LENGTH_BITS;
+
+        GCM(int keymasterPadding) {
+            super(KeymasterDefs.KM_MODE_GCM, keymasterPadding);
+        }
+
+        @Override
+        protected final void resetAll() {
+            mTagLengthBits = DEFAULT_TAG_LENGTH_BITS;
+            super.resetAll();
+        }
+
+        @Override
+        protected final void resetWhilePreservingInitState() {
+            super.resetWhilePreservingInitState();
+        }
+
+        @Override
+        protected final void initAlgorithmSpecificParameters() throws InvalidKeyException {
+            if (!isEncrypting()) {
+                throw new InvalidKeyException("IV required when decrypting"
+                        + ". Use IvParameterSpec or AlgorithmParameters to provide it.");
+            }
+        }
+
+        @Override
+        protected final void initAlgorithmSpecificParameters(AlgorithmParameterSpec params)
+                throws InvalidAlgorithmParameterException {
+            // IV is used
+            if (params == null) {
+                if (!isEncrypting()) {
+                    // IV must be provided by the caller
+                    throw new InvalidAlgorithmParameterException(
+                            "GCMParameterSpec must be provided when decrypting");
+                }
+                return;
+            }
+            if (!(params instanceof GCMParameterSpec)) {
+                throw new InvalidAlgorithmParameterException("Only GCMParameterSpec supported");
+            }
+            GCMParameterSpec spec = (GCMParameterSpec) params;
+            byte[] iv = spec.getIV();
+            if (iv == null) {
+                throw new InvalidAlgorithmParameterException("Null IV in GCMParameterSpec");
+            } else if (iv.length != IV_LENGTH_BYTES) {
+                throw new InvalidAlgorithmParameterException("Unsupported IV length: "
+                        + iv.length + " bytes. Only " + IV_LENGTH_BYTES
+                        + " bytes long IV supported");
+            }
+            int tagLengthBits = spec.getTLen();
+            if ((tagLengthBits < MIN_SUPPORTED_TAG_LENGTH_BITS)
+                    || (tagLengthBits > MAX_SUPPORTED_TAG_LENGTH_BITS)
+                    || ((tagLengthBits % 8) != 0)) {
+                throw new InvalidAlgorithmParameterException(
+                        "Unsupported tag length: " + tagLengthBits + " bits"
+                        + ". Supported lengths: 96, 104, 112, 120, 128");
+            }
+            setIv(iv);
+            mTagLengthBits = tagLengthBits;
+        }
+
+        @Override
+        protected final void initAlgorithmSpecificParameters(AlgorithmParameters params)
+                throws InvalidAlgorithmParameterException {
+            if (params == null) {
+                if (!isEncrypting()) {
+                    // IV must be provided by the caller
+                    throw new InvalidAlgorithmParameterException("IV required when decrypting"
+                            + ". Use GCMParameterSpec or GCM AlgorithmParameters to provide it.");
+                }
+                return;
+            }
+
+            GCMParameterSpec spec;
+            try {
+                spec = params.getParameterSpec(GCMParameterSpec.class);
+            } catch (InvalidParameterSpecException e) {
+                if (!isEncrypting()) {
+                    // IV must be provided by the caller
+                    throw new InvalidAlgorithmParameterException("IV and tag length required when"
+                            + " decrypting, but not found in parameters: " + params, e);
+                }
+                setIv(null);
+                return;
+            }
+            initAlgorithmSpecificParameters(spec);
+        }
+
+        @Nullable
+        @Override
+        protected final AlgorithmParameters engineGetParameters() {
+            byte[] iv = getIv();
+            if ((iv != null) && (iv.length > 0)) {
+                try {
+                    AlgorithmParameters params = AlgorithmParameters.getInstance("GCM");
+                    params.init(new GCMParameterSpec(mTagLengthBits, iv));
+                    return params;
+                } catch (NoSuchAlgorithmException e) {
+                    throw new ProviderException(
+                            "Failed to obtain GCM AlgorithmParameters", e);
+                } catch (InvalidParameterSpecException e) {
+                    throw new ProviderException(
+                            "Failed to initialize GCM AlgorithmParameters", e);
+                }
+            }
+            return null;
+        }
+
+        @NonNull
+        @Override
+        protected KeyStoreCryptoOperationStreamer createMainDataStreamer(
+                KeyStore keyStore, IBinder operationToken) {
+            KeyStoreCryptoOperationStreamer streamer = new KeyStoreCryptoOperationChunkedStreamer(
+                    new KeyStoreCryptoOperationChunkedStreamer.MainDataStream(
+                            keyStore, operationToken));
+            if (isEncrypting()) {
+                return streamer;
+            } else {
+                // When decrypting, to avoid leaking unauthenticated plaintext, do not return any
+                // plaintext before ciphertext is authenticated by KeyStore.finish.
+                return new BufferAllOutputUntilDoFinalStreamer(streamer);
+            }
+        }
+
+        @NonNull
+        @Override
+        protected final KeyStoreCryptoOperationStreamer createAdditionalAuthenticationDataStreamer(
+                KeyStore keyStore, IBinder operationToken) {
+            return new KeyStoreCryptoOperationChunkedStreamer(
+                    new AdditionalAuthenticationDataStream(keyStore, operationToken));
+        }
+
+        @Override
+        protected final int getAdditionalEntropyAmountForBegin() {
+            if ((getIv() == null) && (isEncrypting())) {
+                // IV will need to be generated
+                return IV_LENGTH_BYTES;
+            }
+
+            return 0;
+        }
+
+        @Override
+        protected final int getAdditionalEntropyAmountForFinish() {
+            return 0;
+        }
+
+        @Override
+        protected final void addAlgorithmSpecificParametersToBegin(
+                @NonNull KeymasterArguments keymasterArgs) {
+            super.addAlgorithmSpecificParametersToBegin(keymasterArgs);
+            keymasterArgs.addInt(KeymasterDefs.KM_TAG_MAC_LENGTH, mTagLengthBits);
+        }
+
+        protected final int getTagLengthBits() {
+            return mTagLengthBits;
+        }
+
+        public static final class NoPadding extends GCM {
+            public NoPadding() {
+                super(KeymasterDefs.KM_PAD_NONE);
+            }
+
+            @Override
+            protected final int engineGetOutputSize(int inputLen) {
+                int tagLengthBytes = (getTagLengthBits() + 7) / 8;
+                long result;
+                if (isEncrypting()) {
+                    result = getConsumedInputSizeBytes() - getProducedOutputSizeBytes() + inputLen
+                            + tagLengthBytes;
+                } else {
+                    result = getConsumedInputSizeBytes() - getProducedOutputSizeBytes() + inputLen
+                            - tagLengthBytes;
+                }
+                if (result < 0) {
+                    return 0;
+                } else if (result > Integer.MAX_VALUE) {
+                    return Integer.MAX_VALUE;
+                }
+                return (int) result;
+            }
+        }
+    }
+
+    private static final int BLOCK_SIZE_BYTES = 16;
+
+    private final int mKeymasterBlockMode;
+    private final int mKeymasterPadding;
+
+    private byte[] mIv;
+
+    /** Whether the current {@code #mIv} has been used by the underlying crypto operation. */
+    private boolean mIvHasBeenUsed;
+
+    AndroidKeyStoreAuthenticatedAESCipherSpi(
+            int keymasterBlockMode,
+            int keymasterPadding) {
+        mKeymasterBlockMode = keymasterBlockMode;
+        mKeymasterPadding = keymasterPadding;
+    }
+
+    @Override
+    protected void resetAll() {
+        mIv = null;
+        mIvHasBeenUsed = false;
+        super.resetAll();
+    }
+
+    @Override
+    protected final void initKey(int opmode, Key key) throws InvalidKeyException {
+        if (!(key instanceof AndroidKeyStoreSecretKey)) {
+            throw new InvalidKeyException(
+                    "Unsupported key: " + ((key != null) ? key.getClass().getName() : "null"));
+        }
+        if (!KeyProperties.KEY_ALGORITHM_AES.equalsIgnoreCase(key.getAlgorithm())) {
+            throw new InvalidKeyException(
+                    "Unsupported key algorithm: " + key.getAlgorithm() + ". Only " +
+                    KeyProperties.KEY_ALGORITHM_AES + " supported");
+        }
+        setKey((AndroidKeyStoreSecretKey) key);
+    }
+
+    @Override
+    protected void addAlgorithmSpecificParametersToBegin(
+            @NonNull KeymasterArguments keymasterArgs) {
+        if ((isEncrypting()) && (mIvHasBeenUsed)) {
+            // IV is being reused for encryption: this violates security best practices.
+            throw new IllegalStateException(
+                    "IV has already been used. Reusing IV in encryption mode violates security best"
+                    + " practices.");
+        }
+
+        keymasterArgs.addInt(KeymasterDefs.KM_TAG_ALGORITHM, KeymasterDefs.KM_ALGORITHM_AES);
+        keymasterArgs.addInt(KeymasterDefs.KM_TAG_BLOCK_MODE, mKeymasterBlockMode);
+        keymasterArgs.addInt(KeymasterDefs.KM_TAG_PADDING, mKeymasterPadding);
+        if (mIv != null) {
+            keymasterArgs.addBlob(KeymasterDefs.KM_TAG_NONCE, mIv);
+        }
+    }
+
+    @Override
+    protected final void loadAlgorithmSpecificParametersFromBeginResult(
+            @NonNull KeymasterArguments keymasterArgs) {
+        mIvHasBeenUsed = true;
+
+        // NOTE: Keymaster doesn't always return an IV, even if it's used.
+        byte[] returnedIv = keymasterArgs.getBlob(KeymasterDefs.KM_TAG_NONCE, null);
+        if ((returnedIv != null) && (returnedIv.length == 0)) {
+            returnedIv = null;
+        }
+
+        if (mIv == null) {
+            mIv = returnedIv;
+        } else if ((returnedIv != null) && (!Arrays.equals(returnedIv, mIv))) {
+            throw new ProviderException("IV in use differs from provided IV");
+        }
+    }
+
+    @Override
+    protected final int engineGetBlockSize() {
+        return BLOCK_SIZE_BYTES;
+    }
+
+    @Override
+    protected final byte[] engineGetIV() {
+        return ArrayUtils.cloneIfNotEmpty(mIv);
+    }
+
+    protected void setIv(byte[] iv) {
+        mIv = iv;
+    }
+
+    protected byte[] getIv() {
+        return mIv;
+    }
+
+    /**
+     * {@link KeyStoreCryptoOperationStreamer} which buffers all output until {@code doFinal} from
+     * which it returns all output in one go, provided {@code doFinal} succeeds.
+     */
+    private static class BufferAllOutputUntilDoFinalStreamer
+        implements KeyStoreCryptoOperationStreamer {
+
+        private final KeyStoreCryptoOperationStreamer mDelegate;
+        private ByteArrayOutputStream mBufferedOutput = new ByteArrayOutputStream();
+        private long mProducedOutputSizeBytes;
+
+        private BufferAllOutputUntilDoFinalStreamer(KeyStoreCryptoOperationStreamer delegate) {
+            mDelegate = delegate;
+        }
+
+        @Override
+        public byte[] update(byte[] input, int inputOffset, int inputLength)
+                throws KeyStoreException {
+            byte[] output = mDelegate.update(input, inputOffset, inputLength);
+            if (output != null) {
+                try {
+                    mBufferedOutput.write(output);
+                } catch (IOException e) {
+                    throw new ProviderException("Failed to buffer output", e);
+                }
+            }
+            return EmptyArray.BYTE;
+        }
+
+        @Override
+        public byte[] doFinal(byte[] input, int inputOffset, int inputLength,
+                byte[] additionalEntropy) throws KeyStoreException {
+            byte[] output = mDelegate.doFinal(input, inputOffset, inputLength, additionalEntropy);
+            if (output != null) {
+                try {
+                    mBufferedOutput.write(output);
+                } catch (IOException e) {
+                    throw new ProviderException("Failed to buffer output", e);
+                }
+            }
+            byte[] result = mBufferedOutput.toByteArray();
+            mBufferedOutput.reset();
+            mProducedOutputSizeBytes += result.length;
+            return result;
+        }
+
+        @Override
+        public long getConsumedInputSizeBytes() {
+            return mDelegate.getConsumedInputSizeBytes();
+        }
+
+        @Override
+        public long getProducedOutputSizeBytes() {
+            return mProducedOutputSizeBytes;
+        }
+    }
+
+    /**
+     * Additional Authentication Data (AAD) stream via a KeyStore streaming operation. This stream
+     * sends AAD into the KeyStore.
+     */
+    private static class AdditionalAuthenticationDataStream implements Stream {
+
+        private final KeyStore mKeyStore;
+        private final IBinder mOperationToken;
+
+        private AdditionalAuthenticationDataStream(KeyStore keyStore, IBinder operationToken) {
+            mKeyStore = keyStore;
+            mOperationToken = operationToken;
+        }
+
+        @Override
+        public OperationResult update(byte[] input) {
+            KeymasterArguments keymasterArgs = new KeymasterArguments();
+            keymasterArgs.addBlob(KeymasterDefs.KM_TAG_ASSOCIATED_DATA, input);
+
+            // KeyStore does not reflect AAD in inputConsumed, but users of Stream rely on this
+            // field. We fix this discrepancy here. KeyStore.update contract is that all of AAD
+            // has been consumed if the method succeeds.
+            OperationResult result = mKeyStore.update(mOperationToken, keymasterArgs, null);
+            if (result.resultCode == KeyStore.NO_ERROR) {
+                result = new OperationResult(
+                        result.resultCode,
+                        result.token,
+                        result.operationHandle,
+                        input.length, // inputConsumed
+                        result.output,
+                        result.outParams);
+            }
+            return result;
+        }
+
+        @Override
+        public OperationResult finish(byte[] additionalEntropy) {
+            if ((additionalEntropy != null) && (additionalEntropy.length > 0)) {
+                throw new ProviderException("AAD stream does not support additional entropy");
+            }
+            return new OperationResult(
+                    KeyStore.NO_ERROR,
+                    mOperationToken,
+                    0, // operation handle -- nobody cares about this being returned from finish
+                    0, // inputConsumed
+                    EmptyArray.BYTE, // output
+                    new KeymasterArguments() // additional params returned by finish
+                    );
+        }
+    }
+}
\ No newline at end of file
diff --git a/keystore/java/android/security/keystore/AndroidKeyStoreBCWorkaroundProvider.java b/keystore/java/android/security/keystore/AndroidKeyStoreBCWorkaroundProvider.java
index f37cf07..156f45f6 100644
--- a/keystore/java/android/security/keystore/AndroidKeyStoreBCWorkaroundProvider.java
+++ b/keystore/java/android/security/keystore/AndroidKeyStoreBCWorkaroundProvider.java
@@ -93,6 +93,9 @@
         putSymmetricCipherImpl("AES/CTR/NoPadding",
                 PACKAGE_NAME + ".AndroidKeyStoreUnauthenticatedAESCipherSpi$CTR$NoPadding");
 
+        putSymmetricCipherImpl("AES/GCM/NoPadding",
+                PACKAGE_NAME + ".AndroidKeyStoreAuthenticatedAESCipherSpi$GCM$NoPadding");
+
         putAsymmetricCipherImpl("RSA/ECB/NoPadding",
                 PACKAGE_NAME + ".AndroidKeyStoreRSACipherSpi$NoPadding");
         put("Alg.Alias.Cipher.RSA/None/NoPadding", "RSA/ECB/NoPadding");
@@ -129,52 +132,52 @@
 
         putSignatureImpl("MD5withRSA",
                 PACKAGE_NAME + ".AndroidKeyStoreRSASignatureSpi$MD5WithPKCS1Padding");
-        put("Alg.Alias.Signature.MD5WithRSAEncryption", "MD5WithRSA");
-        put("Alg.Alias.Signature.MD5/RSA", "MD5WithRSA");
-        put("Alg.Alias.Signature.1.2.840.113549.1.1.4", "MD5WithRSA");
-        put("Alg.Alias.Signature.1.2.840.113549.2.5with1.2.840.113549.1.1.1", "MD5WithRSA");
+        put("Alg.Alias.Signature.MD5WithRSAEncryption", "MD5withRSA");
+        put("Alg.Alias.Signature.MD5/RSA", "MD5withRSA");
+        put("Alg.Alias.Signature.1.2.840.113549.1.1.4", "MD5withRSA");
+        put("Alg.Alias.Signature.1.2.840.113549.2.5with1.2.840.113549.1.1.1", "MD5withRSA");
 
         putSignatureImpl("SHA1withRSA",
                 PACKAGE_NAME + ".AndroidKeyStoreRSASignatureSpi$SHA1WithPKCS1Padding");
-        put("Alg.Alias.Signature.SHA1WithRSAEncryption", "SHA1WithRSA");
-        put("Alg.Alias.Signature.SHA1/RSA", "SHA1WithRSA");
-        put("Alg.Alias.Signature.SHA-1/RSA", "SHA1WithRSA");
-        put("Alg.Alias.Signature.1.2.840.113549.1.1.5", "SHA1WithRSA");
-        put("Alg.Alias.Signature.1.3.14.3.2.26with1.2.840.113549.1.1.1", "SHA1WithRSA");
-        put("Alg.Alias.Signature.1.3.14.3.2.26with1.2.840.113549.1.1.5", "SHA1WithRSA");
-        put("Alg.Alias.Signature.1.3.14.3.2.29", "SHA1WithRSA");
+        put("Alg.Alias.Signature.SHA1WithRSAEncryption", "SHA1withRSA");
+        put("Alg.Alias.Signature.SHA1/RSA", "SHA1withRSA");
+        put("Alg.Alias.Signature.SHA-1/RSA", "SHA1withRSA");
+        put("Alg.Alias.Signature.1.2.840.113549.1.1.5", "SHA1withRSA");
+        put("Alg.Alias.Signature.1.3.14.3.2.26with1.2.840.113549.1.1.1", "SHA1withRSA");
+        put("Alg.Alias.Signature.1.3.14.3.2.26with1.2.840.113549.1.1.5", "SHA1withRSA");
+        put("Alg.Alias.Signature.1.3.14.3.2.29", "SHA1withRSA");
 
         putSignatureImpl("SHA224withRSA",
                 PACKAGE_NAME + ".AndroidKeyStoreRSASignatureSpi$SHA224WithPKCS1Padding");
-        put("Alg.Alias.Signature.SHA224WithRSAEncryption", "SHA224WithRSA");
-        put("Alg.Alias.Signature.1.2.840.113549.1.1.11", "SHA224WithRSA");
+        put("Alg.Alias.Signature.SHA224WithRSAEncryption", "SHA224withRSA");
+        put("Alg.Alias.Signature.1.2.840.113549.1.1.11", "SHA224withRSA");
         put("Alg.Alias.Signature.2.16.840.1.101.3.4.2.4with1.2.840.113549.1.1.1",
-                "SHA224WithRSA");
+                "SHA224withRSA");
         put("Alg.Alias.Signature.2.16.840.1.101.3.4.2.4with1.2.840.113549.1.1.11",
-                "SHA224WithRSA");
+                "SHA224withRSA");
 
         putSignatureImpl("SHA256withRSA",
                 PACKAGE_NAME + ".AndroidKeyStoreRSASignatureSpi$SHA256WithPKCS1Padding");
-        put("Alg.Alias.Signature.SHA256WithRSAEncryption", "SHA256WithRSA");
-        put("Alg.Alias.Signature.1.2.840.113549.1.1.11", "SHA256WithRSA");
+        put("Alg.Alias.Signature.SHA256WithRSAEncryption", "SHA256withRSA");
+        put("Alg.Alias.Signature.1.2.840.113549.1.1.11", "SHA256withRSA");
         put("Alg.Alias.Signature.2.16.840.1.101.3.4.2.1with1.2.840.113549.1.1.1",
-                "SHA256WithRSA");
+                "SHA256withRSA");
         put("Alg.Alias.Signature.2.16.840.1.101.3.4.2.1with1.2.840.113549.1.1.11",
-                "SHA256WithRSA");
+                "SHA256withRSA");
 
         putSignatureImpl("SHA384withRSA",
                 PACKAGE_NAME + ".AndroidKeyStoreRSASignatureSpi$SHA384WithPKCS1Padding");
-        put("Alg.Alias.Signature.SHA384WithRSAEncryption", "SHA384WithRSA");
-        put("Alg.Alias.Signature.1.2.840.113549.1.1.12", "SHA384WithRSA");
+        put("Alg.Alias.Signature.SHA384WithRSAEncryption", "SHA384withRSA");
+        put("Alg.Alias.Signature.1.2.840.113549.1.1.12", "SHA384withRSA");
         put("Alg.Alias.Signature.2.16.840.1.101.3.4.2.2with1.2.840.113549.1.1.1",
-                "SHA384WithRSA");
+                "SHA384withRSA");
 
         putSignatureImpl("SHA512withRSA",
                 PACKAGE_NAME + ".AndroidKeyStoreRSASignatureSpi$SHA512WithPKCS1Padding");
-        put("Alg.Alias.Signature.SHA512WithRSAEncryption", "SHA512WithRSA");
-        put("Alg.Alias.Signature.1.2.840.113549.1.1.13", "SHA512WithRSA");
+        put("Alg.Alias.Signature.SHA512WithRSAEncryption", "SHA512withRSA");
+        put("Alg.Alias.Signature.1.2.840.113549.1.1.13", "SHA512withRSA");
         put("Alg.Alias.Signature.2.16.840.1.101.3.4.2.3with1.2.840.113549.1.1.1",
-                "SHA512WithRSA");
+                "SHA512withRSA");
 
         putSignatureImpl("SHA1withRSA/PSS",
                 PACKAGE_NAME + ".AndroidKeyStoreRSASignatureSpi$SHA1WithPSSPadding");
diff --git a/keystore/java/android/security/keystore/AndroidKeyStoreCipherSpiBase.java b/keystore/java/android/security/keystore/AndroidKeyStoreCipherSpiBase.java
index d2d5850..fc53451 100644
--- a/keystore/java/android/security/keystore/AndroidKeyStoreCipherSpiBase.java
+++ b/keystore/java/android/security/keystore/AndroidKeyStoreCipherSpiBase.java
@@ -26,6 +26,8 @@
 import android.security.keymaster.KeymasterDefs;
 import android.security.keymaster.OperationResult;
 
+import libcore.util.EmptyArray;
+
 import java.nio.ByteBuffer;
 import java.security.AlgorithmParameters;
 import java.security.GeneralSecurityException;
@@ -78,6 +80,8 @@
     private IBinder mOperationToken;
     private long mOperationHandle;
     private KeyStoreCryptoOperationStreamer mMainDataStreamer;
+    private KeyStoreCryptoOperationStreamer mAdditionalAuthenticationDataStreamer;
+    private boolean mAdditionalAuthenticationDataStreamerClosed;
 
     /**
      * Encountered exception which could not be immediately thrown because it was encountered inside
@@ -189,6 +193,8 @@
         mOperationToken = null;
         mOperationHandle = 0;
         mMainDataStreamer = null;
+        mAdditionalAuthenticationDataStreamer = null;
+        mAdditionalAuthenticationDataStreamerClosed = false;
         mCachedException = null;
     }
 
@@ -209,6 +215,8 @@
         mOperationToken = null;
         mOperationHandle = 0;
         mMainDataStreamer = null;
+        mAdditionalAuthenticationDataStreamer = null;
+        mAdditionalAuthenticationDataStreamerClosed = false;
         mCachedException = null;
     }
 
@@ -273,6 +281,9 @@
 
         loadAlgorithmSpecificParametersFromBeginResult(opResult.outParams);
         mMainDataStreamer = createMainDataStreamer(mKeyStore, opResult.token);
+        mAdditionalAuthenticationDataStreamer =
+                createAdditionalAuthenticationDataStreamer(mKeyStore, opResult.token);
+        mAdditionalAuthenticationDataStreamerClosed = false;
     }
 
     /**
@@ -289,6 +300,20 @@
                         keyStore, operationToken));
     }
 
+    /**
+     * Creates a streamer which sends Additional Authentication Data (AAD) into the KeyStore.
+     *
+     * <p>This implementation returns {@code null}.
+     *
+     * @returns stream or {@code null} if AAD is not supported by this cipher.
+     */
+    @Nullable
+    protected KeyStoreCryptoOperationStreamer createAdditionalAuthenticationDataStreamer(
+            @SuppressWarnings("unused") KeyStore keyStore,
+            @SuppressWarnings("unused") IBinder operationToken) {
+        return null;
+    }
+
     @Override
     protected final byte[] engineUpdate(byte[] input, int inputOffset, int inputLen) {
         if (mCachedException != null) {
@@ -307,6 +332,7 @@
 
         byte[] output;
         try {
+            flushAAD();
             output = mMainDataStreamer.update(input, inputOffset, inputLen);
         } catch (KeyStoreException e) {
             mCachedException = e;
@@ -320,6 +346,25 @@
         return output;
     }
 
+    private void flushAAD() throws KeyStoreException {
+        if ((mAdditionalAuthenticationDataStreamer != null)
+                && (!mAdditionalAuthenticationDataStreamerClosed)) {
+            byte[] output;
+            try {
+                output = mAdditionalAuthenticationDataStreamer.doFinal(
+                        EmptyArray.BYTE, 0, 0,
+                        null // no additional entropy needed flushing AAD
+                        );
+            } finally {
+                mAdditionalAuthenticationDataStreamerClosed = true;
+            }
+            if ((output != null) && (output.length > 0)) {
+                throw new ProviderException(
+                        "AAD update unexpectedly returned data: " + output.length + " bytes");
+            }
+        }
+    }
+
     @Override
     protected final int engineUpdate(byte[] input, int inputOffset, int inputLen, byte[] output,
             int outputOffset) throws ShortBufferException {
@@ -344,12 +389,64 @@
 
     @Override
     protected final void engineUpdateAAD(byte[] input, int inputOffset, int inputLen) {
-        super.engineUpdateAAD(input, inputOffset, inputLen);
+        if (mCachedException != null) {
+            return;
+        }
+
+        try {
+            ensureKeystoreOperationInitialized();
+        } catch (InvalidKeyException | InvalidAlgorithmParameterException e) {
+            mCachedException = e;
+            return;
+        }
+
+        if (mAdditionalAuthenticationDataStreamerClosed) {
+            throw new IllegalStateException(
+                    "AAD can only be provided before Cipher.update is invoked");
+        }
+
+        if (mAdditionalAuthenticationDataStreamer == null) {
+            throw new IllegalStateException("This cipher does not support AAD");
+        }
+
+        byte[] output;
+        try {
+            output = mAdditionalAuthenticationDataStreamer.update(input, inputOffset, inputLen);
+        } catch (KeyStoreException e) {
+            mCachedException = e;
+            return;
+        }
+
+        if ((output != null) && (output.length > 0)) {
+            throw new ProviderException("AAD update unexpectedly produced output: "
+                    + output.length + " bytes");
+        }
     }
 
     @Override
     protected final void engineUpdateAAD(ByteBuffer src) {
-        super.engineUpdateAAD(src);
+        if (src == null) {
+            throw new IllegalArgumentException("src == null");
+        }
+        if (!src.hasRemaining()) {
+            return;
+        }
+
+        byte[] input;
+        int inputOffset;
+        int inputLen;
+        if (src.hasArray()) {
+            input = src.array();
+            inputOffset = src.arrayOffset() + src.position();
+            inputLen = src.remaining();
+            src.position(src.limit());
+        } else {
+            input = new byte[src.remaining()];
+            inputOffset = 0;
+            inputLen = input.length;
+            src.get(input);
+        }
+        super.engineUpdateAAD(input, inputOffset, inputLen);
     }
 
     @Override
@@ -368,6 +465,7 @@
 
         byte[] output;
         try {
+            flushAAD();
             byte[] additionalEntropy =
                     KeyStoreCryptoOperationUtils.getRandomBytesToMixIntoKeystoreRng(
                             mRng, getAdditionalEntropyAmountForFinish());
@@ -615,6 +713,20 @@
         return mKeyStore;
     }
 
+    protected final long getConsumedInputSizeBytes() {
+        if (mMainDataStreamer == null) {
+            throw new IllegalStateException("Not initialized");
+        }
+        return mMainDataStreamer.getConsumedInputSizeBytes();
+    }
+
+    protected final long getProducedOutputSizeBytes() {
+        if (mMainDataStreamer == null) {
+            throw new IllegalStateException("Not initialized");
+        }
+        return mMainDataStreamer.getProducedOutputSizeBytes();
+    }
+
     // The methods below need to be implemented by subclasses.
 
     /**
diff --git a/keystore/java/android/security/keystore/AndroidKeyStoreKeyPairGeneratorSpi.java b/keystore/java/android/security/keystore/AndroidKeyStoreKeyPairGeneratorSpi.java
index 2de60fd..2055cdb 100644
--- a/keystore/java/android/security/keystore/AndroidKeyStoreKeyPairGeneratorSpi.java
+++ b/keystore/java/android/security/keystore/AndroidKeyStoreKeyPairGeneratorSpi.java
@@ -104,8 +104,6 @@
 
     /* EC */
     private static final int EC_DEFAULT_KEY_SIZE = 256;
-    private static final int EC_MIN_KEY_SIZE = 192;
-    private static final int EC_MAX_KEY_SIZE = 521;
 
     /* RSA */
     private static final int RSA_DEFAULT_KEY_SIZE = 2048;
@@ -115,16 +113,13 @@
     private static final Map<String, Integer> SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE =
             new HashMap<String, Integer>();
     private static final List<String> SUPPORTED_EC_NIST_CURVE_NAMES = new ArrayList<String>();
+    private static final List<Integer> SUPPORTED_EC_NIST_CURVE_SIZES = new ArrayList<Integer>();
     static {
-        // Aliases for NIST P-192
-        SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE.put("p-192", 192);
-        SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE.put("secp192r1", 192);
-        SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE.put("prime192v1", 192);
-
         // Aliases for NIST P-224
         SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE.put("p-224", 224);
         SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE.put("secp224r1", 224);
 
+
         // Aliases for NIST P-256
         SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE.put("p-256", 256);
         SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE.put("secp256r1", 256);
@@ -140,6 +135,10 @@
 
         SUPPORTED_EC_NIST_CURVE_NAMES.addAll(SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE.keySet());
         Collections.sort(SUPPORTED_EC_NIST_CURVE_NAMES);
+
+        SUPPORTED_EC_NIST_CURVE_SIZES.addAll(
+                new HashSet<Integer>(SUPPORTED_EC_NIST_CURVE_NAME_TO_SIZE.values()));
+        Collections.sort(SUPPORTED_EC_NIST_CURVE_SIZES);
     }
 
     private final int mOriginalKeymasterAlgorithm;
@@ -227,9 +226,8 @@
                                     | KeyProperties.PURPOSE_VERIFY);
                             // Authorized to be used with any digest (including no digest).
                             specBuilder.setDigests(KeyProperties.DIGEST_NONE);
-                            specBuilder.setSignaturePaddings(
-                                    KeyProperties.SIGNATURE_PADDING_RSA_PKCS1);
-                            // Authorized to be used with any padding (including no padding).
+                            // Authorized to be used with any encryption and signature padding
+                            // scheme (including no padding).
                             specBuilder.setEncryptionPaddings(
                                     KeyProperties.ENCRYPTION_PADDING_NONE);
                             // Disable randomized encryption requirement to support encryption
@@ -598,9 +596,9 @@
             throws InvalidAlgorithmParameterException {
         switch (keymasterAlgorithm) {
             case KeymasterDefs.KM_ALGORITHM_EC:
-                if (keySize < EC_MIN_KEY_SIZE || keySize > EC_MAX_KEY_SIZE) {
-                    throw new InvalidAlgorithmParameterException("EC key size must be >= "
-                            + EC_MIN_KEY_SIZE + " and <= " + EC_MAX_KEY_SIZE);
+                if (!SUPPORTED_EC_NIST_CURVE_SIZES.contains(keySize)) {
+                    throw new InvalidAlgorithmParameterException("Unsupported EC key size: "
+                            + keySize + " bits. Supported: " + SUPPORTED_EC_NIST_CURVE_SIZES);
                 }
                 break;
             case KeymasterDefs.KM_ALGORITHM_RSA:
diff --git a/keystore/java/android/security/keystore/AndroidKeyStoreRSACipherSpi.java b/keystore/java/android/security/keystore/AndroidKeyStoreRSACipherSpi.java
index 6abdf19..38e216d 100644
--- a/keystore/java/android/security/keystore/AndroidKeyStoreRSACipherSpi.java
+++ b/keystore/java/android/security/keystore/AndroidKeyStoreRSACipherSpi.java
@@ -129,6 +129,7 @@
             private final KeyStoreCryptoOperationStreamer mDelegate;
             private final int mModulusSizeBytes;
             private final ByteArrayOutputStream mInputBuffer = new ByteArrayOutputStream();
+            private long mConsumedInputSizeBytes;
 
             private ZeroPaddingEncryptionStreamer(
                     KeyStoreCryptoOperationStreamer delegate,
@@ -142,6 +143,7 @@
                     throws KeyStoreException {
                 if (inputLength > 0) {
                     mInputBuffer.write(input, inputOffset, inputLength);
+                    mConsumedInputSizeBytes += inputLength;
                 }
                 return EmptyArray.BYTE;
             }
@@ -151,6 +153,7 @@
                     byte[] additionalEntropy)
                     throws KeyStoreException {
                 if (inputLength > 0) {
+                    mConsumedInputSizeBytes += inputLength;
                     mInputBuffer.write(input, inputOffset, inputLength);
                 }
                 byte[] bufferedInput = mInputBuffer.toByteArray();
@@ -173,6 +176,16 @@
                 }
                 return mDelegate.doFinal(paddedInput, 0, paddedInput.length, additionalEntropy);
             }
+
+            @Override
+            public long getConsumedInputSizeBytes() {
+                return mConsumedInputSizeBytes;
+            }
+
+            @Override
+            public long getProducedOutputSizeBytes() {
+                return mDelegate.getProducedOutputSizeBytes();
+            }
         }
     }
 
diff --git a/keystore/java/android/security/keystore/AndroidKeyStoreSpi.java b/keystore/java/android/security/keystore/AndroidKeyStoreSpi.java
index 3bd9d1d..5fb589e 100644
--- a/keystore/java/android/security/keystore/AndroidKeyStoreSpi.java
+++ b/keystore/java/android/security/keystore/AndroidKeyStoreSpi.java
@@ -258,9 +258,8 @@
                             | KeyProperties.PURPOSE_VERIFY);
             // Authorized to be used with any digest (including no digest).
             specBuilder.setDigests(KeyProperties.DIGEST_NONE);
-            specBuilder.setSignaturePaddings(
-                    KeyProperties.SIGNATURE_PADDING_RSA_PKCS1);
-            // Authorized to be used with any padding (including no padding).
+            // Authorized to be used with any encryption and signature padding scheme (including no
+            // padding).
             specBuilder.setEncryptionPaddings(
                     KeyProperties.ENCRYPTION_PADDING_NONE);
             // Disable randomized encryption requirement to support encryption padding NONE
diff --git a/keystore/java/android/security/keystore/AndroidKeyStoreUnauthenticatedAESCipherSpi.java b/keystore/java/android/security/keystore/AndroidKeyStoreUnauthenticatedAESCipherSpi.java
index 76804a9..6c53c6a 100644
--- a/keystore/java/android/security/keystore/AndroidKeyStoreUnauthenticatedAESCipherSpi.java
+++ b/keystore/java/android/security/keystore/AndroidKeyStoreUnauthenticatedAESCipherSpi.java
@@ -1,3 +1,19 @@
+/*
+ * Copyright (C) 2015 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
 package android.security.keystore;
 
 import android.annotation.NonNull;
diff --git a/keystore/java/android/security/keystore/KeyGenParameterSpec.java b/keystore/java/android/security/keystore/KeyGenParameterSpec.java
index 8d4bfcd..1732db9 100644
--- a/keystore/java/android/security/keystore/KeyGenParameterSpec.java
+++ b/keystore/java/android/security/keystore/KeyGenParameterSpec.java
@@ -19,16 +19,20 @@
 import android.annotation.IntRange;
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.app.KeyguardManager;
+import android.hardware.fingerprint.FingerprintManager;
 import android.text.TextUtils;
 
 import java.math.BigInteger;
 import java.security.KeyPairGenerator;
+import java.security.Signature;
 import java.security.cert.Certificate;
 import java.security.spec.AlgorithmParameterSpec;
 import java.util.Date;
 
 import javax.crypto.Cipher;
 import javax.crypto.KeyGenerator;
+import javax.crypto.Mac;
 import javax.security.auth.x500.X500Principal;
 
 /**
@@ -62,10 +66,15 @@
  * <p>NOTE: If a private key is not authorized to sign the self-signed certificate, then the
  * certificate will be created with an invalid signature which will not verify. Such a certificate
  * is still useful because it provides access to the public key. To generate a valid
- * signature for the certificate the key needs to be authorized for
- * {@link KeyProperties#PURPOSE_SIGN}, a suitable digest or {@link KeyProperties#DIGEST_NONE}, and
- * {@link KeyProperties#SIGNATURE_PADDING_RSA_PKCS1} or
- * {@link KeyProperties#ENCRYPTION_PADDING_NONE}.
+ * signature for the certificate the key needs to be authorized for all of the following:
+ * <ul>
+ * <li>{@link KeyProperties#PURPOSE_SIGN},</li>
+ * <li>operation without requiring the user to be authenticated (see
+ * {@link Builder#setUserAuthenticationRequired(boolean)}),</li>
+ * <li>suitable digest or {@link KeyProperties#DIGEST_NONE},</li>
+ * <li>(RSA keys only) padding scheme {@link KeyProperties#SIGNATURE_PADDING_RSA_PKCS1} or
+ * {@link KeyProperties#ENCRYPTION_PADDING_NONE}.</li>
+ * </ul>
  *
  * <p>NOTE: The key material of the generated symmetric and private keys is not accessible. The key
  * material of the public keys is accessible.
@@ -103,7 +112,7 @@
  *
  * <p><h3>Example: Symmetric key</h3>
  * The following example illustrates how to generate an AES key in the Android KeyStore system under
- * alias {@code key2} authorized to be used only for encryption/decryption in CBC mode with PKCS#7
+ * alias {@code key2} authorized to be used only for encryption/decryption in GCM mode with no
  * padding.
  * <pre> {@code
  * KeyGenerator keyGenerator = KeyGenerator.getInstance(
@@ -112,8 +121,8 @@
  * keyGenerator.initialize(
  *         new KeyGenParameterSpec.Builder("key2",
  *                 KeyProperties.PURPOSE_ENCRYPT | KeyProperties.PURPOSE_DECRYPT)
- *                 .setBlockModes(KeyProperties.BLOCK_MODE_CBC)
- *                 .setEncryptionPaddings(KeyProperties.ENCRYPTION_PADDING_PKCS7)
+ *                 .setBlockModes(KeyProperties.BLOCK_MODE_GCM)
+ *                 .setEncryptionPaddings(KeyProperties.ENCRYPTION_PADDING_NONE)
  *                 .build());
  * SecretKey key = keyGenerator.generateKey();
  *
@@ -368,7 +377,7 @@
     }
 
     /**
-     * Gets the set of block modes (e.g., {@code CBC}, {@code CTR}) with which the key can be used
+     * Gets the set of block modes (e.g., {@code GCM}, {@code CBC}) with which the key can be used
      * when encrypting/decrypting. Attempts to use the key with any other block modes will be
      * rejected.
      *
@@ -393,28 +402,32 @@
     }
 
     /**
-     * Returns {@code true} if user authentication is required for this key to be used.
+     * Returns {@code true} if the key is authorized to be used only if the user has been
+     * authenticated.
      *
-     * <p>This restriction applies only to private key operations. Public key operations are not
-     * restricted.
+     * <p>This authorization applies only to secret key and private key operations. Public key
+     * operations are not restricted.
      *
      * @see #getUserAuthenticationValidityDurationSeconds()
+     * @see Builder#setUserAuthenticationRequired(boolean)
      */
     public boolean isUserAuthenticationRequired() {
         return mUserAuthenticationRequired;
     }
 
     /**
-     * Gets the duration of time (seconds) for which this key can be used after the user is
-     * successfully authenticated. This has effect only if user authentication is required.
+     * Gets the duration of time (seconds) for which this key is authorized to be used after the
+     * user is successfully authenticated. This has effect only if user authentication is required
+     * (see {@link #isUserAuthenticationRequired()}).
      *
-     * <p>This restriction applies only to private key operations. Public key operations are not
-     * restricted.
+     * <p>This authorization applies only to secret key and private key operations. Public key
+     * operations are not restricted.
      *
      * @return duration in seconds or {@code -1} if authentication is required for every use of the
-     * key.
+     *         key.
      *
      * @see #isUserAuthenticationRequired()
+     * @see Builder#setUserAuthenticationValidityDurationSeconds(int)
      */
     public int getUserAuthenticationValidityDurationSeconds() {
         return mUserAuthenticationValidityDurationSeconds;
@@ -681,11 +694,11 @@
         }
 
         /**
-         * Sets the set of block modes (e.g., {@code CBC}, {@code CTR}, {@code ECB}) with which the
-         * key can be used when encrypting/decrypting. Attempts to use the key with any other block
-         * modes will be rejected.
+         * Sets the set of block modes (e.g., {@code GCM}, {@code CBC}) with which the key can be
+         * used when encrypting/decrypting. Attempts to use the key with any other block modes will
+         * be rejected.
          *
-         * <p>This must be specified for encryption/decryption keys.
+         * <p>This must be specified for symmetric encryption/decryption keys.
          *
          * <p>See {@link KeyProperties}.{@code BLOCK_MODE} constants.
          */
@@ -711,7 +724,7 @@
          * <li>encryption/decryption transformation which do not offer {@code IND-CPA}, such as
          * {@code ECB} with a symmetric encryption algorithm, or RSA encryption/decryption without
          * padding, are prohibited;</li>
-         * <li>in block modes which use an IV, such as {@code CBC}, {@code CTR}, and {@code GCM},
+         * <li>in block modes which use an IV, such as {@code GCM}, {@code CBC}, and {@code CTR},
          * caller-provided IVs are rejected when encrypting, to ensure that only random IVs are
          * used.</li>
          * </ul>
@@ -738,22 +751,38 @@
         }
 
         /**
-         * Sets whether user authentication is required to use this key.
+         * Sets whether this key is authorized to be used only if the user has been authenticated.
          *
-         * <p>By default, the key can be used without user authentication.
+         * <p>By default, the key is authorized to be used regardless of whether the user has been
+         * authenticated.
          *
-         * <p>When user authentication is required, the user authorizes the use of the key by
-         * authenticating to this Android device using a subset of their secure lock screen
-         * credentials. Different authentication methods are used depending on whether the every
-         * use of the key must be authenticated (as specified by
-         * {@link #setUserAuthenticationValidityDurationSeconds(int)}).
+         * <p>When user authentication is required:
+         * <ul>
+         * <li>The key can only be generated if secure lock screen is set up (see
+         * {@link KeyguardManager#isDeviceSecure()}). Additionally, if the key requires that user
+         * authentication takes place for every use of the key (see
+         * {@link #setUserAuthenticationValidityDurationSeconds(int)}), at least one fingerprint
+         * must be enrolled (see {@link FingerprintManager#hasEnrolledFingerprints()}).</li>
+         * <li>The use of the key must be authorized by the user by authenticating to this Android
+         * device using a subset of their secure lock screen credentials such as
+         * password/PIN/pattern or fingerprint.
          * <a href="{@docRoot}training/articles/keystore.html#UserAuthentication">More
          * information</a>.
+         * <li>The key will become <em>irreversibly invalidated</em> once the secure lock screen is
+         * disabled (reconfigured to None, Swipe or other mode which does not authenticate the user)
+         * or when the secure lock screen is forcibly reset (e.g., by a Device Administrator).
+         * Additionally, if the key requires that user authentication takes place for every use of
+         * the key, it is also irreversibly invalidated once a new fingerprint is enrolled or once\
+         * no more fingerprints are enrolled. Attempts to initialize cryptographic operations using
+         * such keys will throw {@link KeyPermanentlyInvalidatedException}.</li>
+         * </ul>
          *
-         * <p>This restriction applies only to private key operations. Public key operations are not
-         * restricted.
+         * <p>This authorization applies only to secret key and private key operations. Public key
+         * operations are not restricted.
          *
          * @see #setUserAuthenticationValidityDurationSeconds(int)
+         * @see KeyguardManager#isDeviceSecure()
+         * @see FingerprintManager#hasEnrolledFingerprints()
          */
         @NonNull
         public Builder setUserAuthenticationRequired(boolean required) {
@@ -762,15 +791,39 @@
         }
 
         /**
-         * Sets the duration of time (seconds) for which this key can be used after the user is
-         * successfully authenticated. This has effect only if user authentication is required.
+         * Sets the duration of time (seconds) for which this key is authorized to be used after the
+         * user is successfully authenticated. This has effect if the key requires user
+         * authentication for its use (see {@link #setUserAuthenticationRequired(boolean)}).
          *
-         * <p>By default, the user needs to authenticate for every use of the key.
+         * <p>By default, if user authentication is required, it must take place for every use of
+         * the key.
          *
-         * @param seconds duration in seconds or {@code -1} if the user needs to authenticate for
-         *        every use of the key.
+         * <p>Cryptographic operations involving keys which require user authentication to take
+         * place for every operation can only use fingerprint authentication. This is achieved by
+         * initializing a cryptographic operation ({@link Signature}, {@link Cipher}, {@link Mac})
+         * with the key, wrapping it into a {@link FingerprintManager.CryptoObject}, invoking
+         * {@code FingerprintManager.authenticate} with {@code CryptoObject}, and proceeding with
+         * the cryptographic operation only if the authentication flow succeeds.
+         *
+         * <p>Cryptographic operations involving keys which are authorized to be used for a duration
+         * of time after a successful user authentication event can only use secure lock screen
+         * authentication. These cryptographic operations will throw
+         * {@link UserNotAuthenticatedException} during initialization if the user needs to be
+         * authenticated to proceed. This situation can be resolved by the user unlocking the secure
+         * lock screen of the Android or by going through the confirm credential flow initiated by
+         * {@link KeyguardManager#createConfirmDeviceCredentialIntent(CharSequence, CharSequence)}.
+         * Once resolved, initializing a new cryptographic operation using this key (or any other
+         * key which is authorized to be used for a fixed duration of time after user
+         * authentication) should succeed provided the user authentication flow completed
+         * successfully.
+         *
+         * @param seconds duration in seconds or {@code -1} if user authentication must take place
+         *        for every use of the key.
          *
          * @see #setUserAuthenticationRequired(boolean)
+         * @see FingerprintManager
+         * @see FingerprintManager.CryptoObject
+         * @see KeyguardManager
          */
         @NonNull
         public Builder setUserAuthenticationValidityDurationSeconds(
diff --git a/keystore/java/android/security/keystore/KeyInfo.java b/keystore/java/android/security/keystore/KeyInfo.java
index 03b4100..785ec15 100644
--- a/keystore/java/android/security/keystore/KeyInfo.java
+++ b/keystore/java/android/security/keystore/KeyInfo.java
@@ -30,7 +30,7 @@
  * Keystore system</a>. This class describes whether the key material is available in
  * plaintext outside of secure hardware, whether user authentication is required for using the key
  * and whether this requirement is enforced by secure hardware, the key's origin, what uses the key
- * is authorized for (e.g., only in {@code CBC} mode, or signing only), whether the key should be
+ * is authorized for (e.g., only in {@code GCM} mode, or signing only), whether the key should be
  * encrypted at rest, the key's and validity start and end dates.
  *
  * <p>Instances of this class are immutable.
@@ -191,7 +191,7 @@
     }
 
     /**
-     * Gets the set of block modes (e.g., {@code CBC}, {@code CTR}) with which the key can be used
+     * Gets the set of block modes (e.g., {@code GCM}, {@code CBC}) with which the key can be used
      * when encrypting/decrypting. Attempts to use the key with any other block modes will be
      * rejected.
      *
@@ -238,17 +238,27 @@
     }
 
     /**
-     * Returns {@code true} if user authentication is required for this key to be used.
+     * Returns {@code true} if the key is authorized to be used only if the user has been
+     * authenticated.
+     *
+     * <p>This authorization applies only to secret key and private key operations. Public key
+     * operations are not restricted.
      *
      * @see #getUserAuthenticationValidityDurationSeconds()
+     * @see KeyGenParameterSpec.Builder#setUserAuthenticationRequired(boolean)
+     * @see KeyProtection.Builder#setUserAuthenticationRequired(boolean)
      */
     public boolean isUserAuthenticationRequired() {
         return mUserAuthenticationRequired;
     }
 
     /**
-     * Gets the duration of time (seconds) for which this key can be used after the user is
-     * successfully authenticated. This has effect only if user authentication is required.
+     * Gets the duration of time (seconds) for which this key is authorized to be used after the
+     * user is successfully authenticated. This has effect only if user authentication is required
+     * (see {@link #isUserAuthenticationRequired()}).
+     *
+     * <p>This authorization applies only to secret key and private key operations. Public key
+     * operations are not restricted.
      *
      * @return duration in seconds or {@code -1} if authentication is required for every use of the
      *         key.
diff --git a/keystore/java/android/security/keystore/KeyPermanentlyInvalidatedException.java b/keystore/java/android/security/keystore/KeyPermanentlyInvalidatedException.java
index e320c9c..9e82fc0 100644
--- a/keystore/java/android/security/keystore/KeyPermanentlyInvalidatedException.java
+++ b/keystore/java/android/security/keystore/KeyPermanentlyInvalidatedException.java
@@ -21,12 +21,13 @@
 /**
  * Indicates that the key can no longer be used because it has been permanently invalidated.
  *
- * <p>This can currently occur only for keys that require user authentication. Such keys are
- * permanently invalidated once the secure lock screen is disabled (i.e., reconfigured to None,
- * Swipe or other mode which does not authenticate the user) or when the secure lock screen is
- * forcibly reset (e.g., by Device Admin). Additionally, keys configured to require user
- * authentication for every use of the key are also permanently invalidated once a new fingerprint
- * is enrolled or once no more fingerprints are enrolled.
+ * <p>This only occurs for keys which are authorized to be used only if the user has been
+ * authenticated. Such keys are permanently and irreversibly invalidated once the secure lock screen
+ * is disabled (i.e., reconfigured to None, Swipe or other mode which does not authenticate the
+ * user) or when the secure lock screen is forcibly reset (e.g., by Device Admin). Additionally,
+ * keys configured to require user authentication to take place for every of the keys, are also
+ * permanently invalidated once a new fingerprint is enrolled or once no more fingerprints are
+ * enrolled.
  */
 public class KeyPermanentlyInvalidatedException extends InvalidKeyException {
 
diff --git a/keystore/java/android/security/keystore/KeyProtection.java b/keystore/java/android/security/keystore/KeyProtection.java
index 1e0611c..b7a2a0b 100644
--- a/keystore/java/android/security/keystore/KeyProtection.java
+++ b/keystore/java/android/security/keystore/KeyProtection.java
@@ -19,19 +19,23 @@
 import android.annotation.IntRange;
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.app.KeyguardManager;
+import android.hardware.fingerprint.FingerprintManager;
 
 import java.security.Key;
+import java.security.Signature;
 import java.security.KeyStore.ProtectionParameter;
 import java.security.cert.Certificate;
 import java.util.Date;
 
 import javax.crypto.Cipher;
+import javax.crypto.Mac;
 
 /**
  * Specification of how a key or key pair is secured when imported into the
  * <a href="{@docRoot}training/articles/keystore.html">Android KeyStore facility</a>. This class
  * specifies parameters such as whether user authentication is required for using the key, what uses
- * the key is authorized for (e.g., only in {@code CTR} mode, or only for signing -- decryption not
+ * the key is authorized for (e.g., only in {@code GCM} mode, or only for signing -- decryption not
  * permitted), the key's and validity start and end dates.
  *
  * <p>To import a key or key pair into the Android KeyStore, create an instance of this class using
@@ -51,8 +55,8 @@
  *
  * <p><h3>Example: Symmetric Key</h3>
  * The following example illustrates how to import an AES key into the Android KeyStore under alias
- * {@code key1} authorized to be used only for encryption/decryption in CBC mode with PKCS#7
- * padding. The key must export its key material via {@link Key#getEncoded()} in {@code RAW} format.
+ * {@code key1} authorized to be used only for encryption/decryption in GCM mode with no padding.
+ * The key must export its key material via {@link Key#getEncoded()} in {@code RAW} format.
  * <pre> {@code
  * SecretKey key = ...; // AES key
  *
@@ -62,8 +66,8 @@
  *         "key1",
  *         new KeyStore.SecretKeyEntry(key),
  *         new KeyProtection.Builder(KeyProperties.PURPOSE_ENCRYPT | KeyProperties.PURPOSE_DECRYPT)
- *                 .setBlockMode(KeyProperties.BLOCK_MODE_CBC)
- *                 .setEncryptionPaddings(KeyProperties.ENCRYPTION_PADDING_PKCS7)
+ *                 .setBlockMode(KeyProperties.BLOCK_MODE_GCM)
+ *                 .setEncryptionPaddings(KeyProperties.ENCRYPTION_PADDING_NONE)
  *                 .build());
  * // Key imported, obtain a reference to it.
  * SecretKey keyStoreKey = (SecretKey) keyStore.getKey("key1", null);
@@ -232,7 +236,7 @@
     }
 
     /**
-     * Gets the set of block modes (e.g., {@code CBC}, {@code CTR}) with which the key can be used
+     * Gets the set of block modes (e.g., {@code GCM}, {@code CBC}) with which the key can be used
      * when encrypting/decrypting. Attempts to use the key with any other block modes will be
      * rejected.
      *
@@ -257,22 +261,32 @@
     }
 
     /**
-     * Returns {@code true} if user authentication is required for this key to be used.
+     * Returns {@code true} if the key is authorized to be used only if the user has been
+     * authenticated.
+     *
+     * <p>This authorization applies only to secret key and private key operations. Public key
+     * operations are not restricted.
      *
      * @see #getUserAuthenticationValidityDurationSeconds()
+     * @see Builder#setUserAuthenticationRequired(boolean)
      */
     public boolean isUserAuthenticationRequired() {
         return mUserAuthenticationRequired;
     }
 
     /**
-     * Gets the duration of time (seconds) for which this key can be used after the user is
-     * successfully authenticated. This has effect only if user authentication is required.
+     * Gets the duration of time (seconds) for which this key is authorized to be used after the
+     * user is successfully authenticated. This has effect only if user authentication is required
+     * (see {@link #isUserAuthenticationRequired()}).
+     *
+     * <p>This authorization applies only to secret key and private key operations. Public key
+     * operations are not restricted.
      *
      * @return duration in seconds or {@code -1} if authentication is required for every use of the
      *         key.
      *
      * @see #isUserAuthenticationRequired()
+     * @see Builder#setUserAuthenticationValidityDurationSeconds(int)
      */
     public int getUserAuthenticationValidityDurationSeconds() {
         return mUserAuthenticationValidityDurationSeconds;
@@ -424,11 +438,11 @@
         }
 
         /**
-         * Sets the set of block modes (e.g., {@code CBC}, {@code CTR}, {@code ECB}) with which the
-         * key can be used when encrypting/decrypting. Attempts to use the key with any other block
-         * modes will be rejected.
+         * Sets the set of block modes (e.g., {@code GCM}, {@code CBC}) with which the key can be
+         * used when encrypting/decrypting. Attempts to use the key with any other block modes will
+         * be rejected.
          *
-         * <p>This must be specified for encryption/decryption keys.
+         * <p>This must be specified for symmetric encryption/decryption keys.
          *
          * <p>See {@link KeyProperties}.{@code BLOCK_MODE} constants.
          */
@@ -453,8 +467,8 @@
          * <ul>
          * <li>transformation which do not offer {@code IND-CPA}, such as symmetric ciphers using
          * {@code ECB} mode or RSA encryption without padding, are prohibited;</li>
-         * <li>in transformations which use an IV, such as symmetric ciphers in {@code CBC},
-         * {@code CTR}, and {@code GCM} block modes, caller-provided IVs are rejected when
+         * <li>in transformations which use an IV, such as symmetric ciphers in {@code GCM},
+         * {@code CBC}, and {@code CTR} block modes, caller-provided IVs are rejected when
          * encrypting, to ensure that only random IVs are used.</li>
          *
          * <p>Before disabling this requirement, consider the following approaches instead:
@@ -479,19 +493,38 @@
         }
 
         /**
-         * Sets whether user authentication is required to use this key.
+         * Sets whether this key is authorized to be used only if the user has been authenticated.
          *
-         * <p>By default, the key can be used without user authentication.
+         * <p>By default, the key is authorized to be used regardless of whether the user has been
+         * authenticated.
          *
-         * <p>When user authentication is required, the user authorizes the use of the key by
-         * authenticating to this Android device using a subset of their secure lock screen
-         * credentials. Different authentication methods are used depending on whether the every
-         * use of the key must be authenticated (as specified by
-         * {@link #setUserAuthenticationValidityDurationSeconds(int)}).
+         * <p>When user authentication is required:
+         * <ul>
+         * <li>The key can only be import if secure lock screen is set up (see
+         * {@link KeyguardManager#isDeviceSecure()}). Additionally, if the key requires that user
+         * authentication takes place for every use of the key (see
+         * {@link #setUserAuthenticationValidityDurationSeconds(int)}), at least one fingerprint
+         * must be enrolled (see {@link FingerprintManager#hasEnrolledFingerprints()}).</li>
+         * <li>The use of the key must be authorized by the user by authenticating to this Android
+         * device using a subset of their secure lock screen credentials such as
+         * password/PIN/pattern or fingerprint.
          * <a href="{@docRoot}training/articles/keystore.html#UserAuthentication">More
          * information</a>.
+         * <li>The key will become <em>irreversibly invalidated</em> once the secure lock screen is
+         * disabled (reconfigured to None, Swipe or other mode which does not authenticate the user)
+         * or when the secure lock screen is forcibly reset (e.g., by a Device Administrator).
+         * Additionally, if the key requires that user authentication takes place for every use of
+         * the key, it is also irreversibly invalidated once a new fingerprint is enrolled or once\
+         * no more fingerprints are enrolled. Attempts to initialize cryptographic operations using
+         * such keys will throw {@link KeyPermanentlyInvalidatedException}.</li>
+         * </ul>
+         *
+         * <p>This authorization applies only to secret key and private key operations. Public key
+         * operations are not restricted.
          *
          * @see #setUserAuthenticationValidityDurationSeconds(int)
+         * @see KeyguardManager#isDeviceSecure()
+         * @see FingerprintManager#hasEnrolledFingerprints()
          */
         @NonNull
         public Builder setUserAuthenticationRequired(boolean required) {
@@ -500,15 +533,39 @@
         }
 
         /**
-         * Sets the duration of time (seconds) for which this key can be used after the user is
-         * successfully authenticated. This has effect only if user authentication is required.
+         * Sets the duration of time (seconds) for which this key is authorized to be used after the
+         * user is successfully authenticated. This has effect if the key requires user
+         * authentication for its use (see {@link #setUserAuthenticationRequired(boolean)}).
          *
-         * <p>By default, the user needs to authenticate for every use of the key.
+         * <p>By default, if user authentication is required, it must take place for every use of
+         * the key.
          *
-         * @param seconds duration in seconds or {@code -1} if the user needs to authenticate for
-         *        every use of the key.
+         * <p>Cryptographic operations involving keys which require user authentication to take
+         * place for every operation can only use fingerprint authentication. This is achieved by
+         * initializing a cryptographic operation ({@link Signature}, {@link Cipher}, {@link Mac})
+         * with the key, wrapping it into a {@link FingerprintManager.CryptoObject}, invoking
+         * {@code FingerprintManager.authenticate} with {@code CryptoObject}, and proceeding with
+         * the cryptographic operation only if the authentication flow succeeds.
+         *
+         * <p>Cryptographic operations involving keys which are authorized to be used for a duration
+         * of time after a successful user authentication event can only use secure lock screen
+         * authentication. These cryptographic operations will throw
+         * {@link UserNotAuthenticatedException} during initialization if the user needs to be
+         * authenticated to proceed. This situation can be resolved by the user unlocking the secure
+         * lock screen of the Android or by going through the confirm credential flow initiated by
+         * {@link KeyguardManager#createConfirmDeviceCredentialIntent(CharSequence, CharSequence)}.
+         * Once resolved, initializing a new cryptographic operation using this key (or any other
+         * key which is authorized to be used for a fixed duration of time after user
+         * authentication) should succeed provided the user authentication flow completed
+         * successfully.
+         *
+         * @param seconds duration in seconds or {@code -1} if user authentication must take place
+         *        for every use of the key.
          *
          * @see #setUserAuthenticationRequired(boolean)
+         * @see FingerprintManager
+         * @see FingerprintManager.CryptoObject
+         * @see KeyguardManager
          */
         @NonNull
         public Builder setUserAuthenticationValidityDurationSeconds(
diff --git a/keystore/java/android/security/keystore/KeyStoreCryptoOperationChunkedStreamer.java b/keystore/java/android/security/keystore/KeyStoreCryptoOperationChunkedStreamer.java
index 9957e79..894d52a 100644
--- a/keystore/java/android/security/keystore/KeyStoreCryptoOperationChunkedStreamer.java
+++ b/keystore/java/android/security/keystore/KeyStoreCryptoOperationChunkedStreamer.java
@@ -73,6 +73,8 @@
     private byte[] mBuffered = EmptyArray.BYTE;
     private int mBufferedOffset;
     private int mBufferedLength;
+    private long mConsumedInputSizeBytes;
+    private long mProducedOutputSizeBytes;
 
     public KeyStoreCryptoOperationChunkedStreamer(Stream operation) {
         this(operation, DEFAULT_MAX_CHUNK_SIZE);
@@ -119,6 +121,7 @@
             // Update input array references to reflect that some of its bytes are now in mBuffered.
             inputOffset += inputBytesInChunk;
             inputLength -= inputBytesInChunk;
+            mConsumedInputSizeBytes += inputBytesInChunk;
 
             OperationResult opResult = mKeyStoreStream.update(chunk);
             if (opResult == null) {
@@ -167,9 +170,10 @@
                     }
                 } else {
                     // No more output will be produced in this loop
+                    byte[] result;
                     if (bufferedOutput == null) {
                         // No previously buffered output
-                        return opResult.output;
+                        result = opResult.output;
                     } else {
                         // There was some previously buffered output
                         try {
@@ -177,18 +181,23 @@
                         } catch (IOException e) {
                             throw new IllegalStateException("Failed to buffer output", e);
                         }
-                        return bufferedOutput.toByteArray();
+                        result = bufferedOutput.toByteArray();
                     }
+                    mProducedOutputSizeBytes += result.length;
+                    return result;
                 }
             }
         }
 
+        byte[] result;
         if (bufferedOutput == null) {
             // No output produced
-            return EmptyArray.BYTE;
+            result = EmptyArray.BYTE;
         } else {
-            return bufferedOutput.toByteArray();
+            result = bufferedOutput.toByteArray();
         }
+        mProducedOutputSizeBytes += result.length;
+        return result;
     }
 
     @Override
@@ -210,14 +219,11 @@
         } else if (opResult.resultCode != KeyStore.NO_ERROR) {
             throw KeyStore.getKeyStoreException(opResult.resultCode);
         }
+        mProducedOutputSizeBytes += opResult.output.length;
 
         return ArrayUtils.concat(output, opResult.output);
     }
 
-    /**
-     * Passes all of buffered input into the the KeyStore operation (via the {@code update}
-     * operation) and returns output.
-     */
     public byte[] flush() throws KeyStoreException {
         if (mBufferedLength <= 0) {
             return EmptyArray.BYTE;
@@ -243,7 +249,19 @@
                     + " . Provided: " + chunk.length + ", consumed: " + opResult.inputConsumed);
         }
 
-        return (opResult.output != null) ? opResult.output : EmptyArray.BYTE;
+        byte[] result = (opResult.output != null) ? opResult.output : EmptyArray.BYTE;
+        mProducedOutputSizeBytes += result.length;
+        return result;
+    }
+
+    @Override
+    public long getConsumedInputSizeBytes() {
+        return mConsumedInputSizeBytes;
+    }
+
+    @Override
+    public long getProducedOutputSizeBytes() {
+        return mProducedOutputSizeBytes;
     }
 
     /**
diff --git a/keystore/java/android/security/keystore/KeyStoreCryptoOperationStreamer.java b/keystore/java/android/security/keystore/KeyStoreCryptoOperationStreamer.java
index 1c6de2d..897bd71 100644
--- a/keystore/java/android/security/keystore/KeyStoreCryptoOperationStreamer.java
+++ b/keystore/java/android/security/keystore/KeyStoreCryptoOperationStreamer.java
@@ -37,4 +37,6 @@
     byte[] update(byte[] input, int inputOffset, int inputLength) throws KeyStoreException;
     byte[] doFinal(byte[] input, int inputOffset, int inputLength, byte[] additionalEntropy)
             throws KeyStoreException;
+    long getConsumedInputSizeBytes();
+    long getProducedOutputSizeBytes();
 }
diff --git a/location/java/android/location/ILocationManager.aidl b/location/java/android/location/ILocationManager.aidl
index a3ea896..f3d755c 100644
--- a/location/java/android/location/ILocationManager.aidl
+++ b/location/java/android/location/ILocationManager.aidl
@@ -75,6 +75,7 @@
     String getBestProvider(in Criteria criteria, boolean enabledOnly);
     boolean providerMeetsCriteria(String provider, in Criteria criteria);
     ProviderProperties getProviderProperties(String provider);
+    String getNetworkProviderPackage();
     boolean isProviderEnabled(String provider);
 
     void addTestProvider(String name, in ProviderProperties properties, String opPackageName);
diff --git a/media/java/android/media/AudioRecord.java b/media/java/android/media/AudioRecord.java
index 3cbc405..974b62e 100644
--- a/media/java/android/media/AudioRecord.java
+++ b/media/java/android/media/AudioRecord.java
@@ -527,10 +527,11 @@
         }
 
         /**
-         * @return a new {@link AudioRecord} instance initialized with all the parameters set
-         *     on this <code>Builder</code>
+         * @return a new {@link AudioRecord} instance successfully initialized with all
+         *     the parameters set on this <code>Builder</code>.
          * @throws UnsupportedOperationException if the parameters set on the <code>Builder</code>
-         *     were incompatible, or if they are not supported by the device.
+         *     were incompatible, or if they are not supported by the device,
+         *     or if the device was not available.
          */
         public AudioRecord build() throws UnsupportedOperationException {
             if (mFormat == null) {
@@ -564,7 +565,13 @@
                     mBufferSizeInBytes = mFormat.getChannelCount()
                             * mFormat.getBytesPerSample(mFormat.getEncoding());
                 }
-                return new AudioRecord(mAttributes, mFormat, mBufferSizeInBytes, mSessionId);
+                final AudioRecord record = new AudioRecord(
+                        mAttributes, mFormat, mBufferSizeInBytes, mSessionId);
+                if (record.getState() == STATE_UNINITIALIZED) {
+                    // release is not necessary
+                    throw new UnsupportedOperationException("Cannot create AudioRecord");
+                }
+                return record;
             } catch (IllegalArgumentException e) {
                 throw new UnsupportedOperationException(e.getMessage());
             }
diff --git a/media/java/android/media/AudioTrack.java b/media/java/android/media/AudioTrack.java
index f395cb3..62810c6 100644
--- a/media/java/android/media/AudioTrack.java
+++ b/media/java/android/media/AudioTrack.java
@@ -661,9 +661,10 @@
         /**
          * Builds an {@link AudioTrack} instance initialized with all the parameters set
          * on this <code>Builder</code>.
-         * @return a new {@link AudioTrack} instance.
+         * @return a new successfully initialized {@link AudioTrack} instance.
          * @throws UnsupportedOperationException if the parameters set on the <code>Builder</code>
-         *     were incompatible, or if they are not supported by the device.
+         *     were incompatible, or if they are not supported by the device,
+         *     or if the device was not available.
          */
         public @NonNull AudioTrack build() throws UnsupportedOperationException {
             if (mAttributes == null) {
@@ -686,7 +687,13 @@
                     mBufferSizeInBytes = mFormat.getChannelCount()
                             * mFormat.getBytesPerSample(mFormat.getEncoding());
                 }
-                return new AudioTrack(mAttributes, mFormat, mBufferSizeInBytes, mMode, mSessionId);
+                final AudioTrack track = new AudioTrack(
+                        mAttributes, mFormat, mBufferSizeInBytes, mMode, mSessionId);
+                if (track.getState() == STATE_UNINITIALIZED) {
+                    // release is not necessary
+                    throw new UnsupportedOperationException("Cannot create AudioTrack");
+                }
+                return track;
             } catch (IllegalArgumentException e) {
                 throw new UnsupportedOperationException(e.getMessage());
             }
diff --git a/media/java/android/media/IAudioService.aidl b/media/java/android/media/IAudioService.aidl
index 8e962187..c75c7e5 100644
--- a/media/java/android/media/IAudioService.aidl
+++ b/media/java/android/media/IAudioService.aidl
@@ -40,7 +40,7 @@
  */
 interface IAudioService {
 
-    void adjustSuggestedStreamVolume(int direction, int suggestedStreamType, int flags,
+    oneway void adjustSuggestedStreamVolume(int direction, int suggestedStreamType, int flags,
             String callingPackage, String caller);
 
     void adjustStreamVolume(int streamType, int direction, int flags, String callingPackage);
diff --git a/media/java/android/media/midi/MidiDevice.java b/media/java/android/media/midi/MidiDevice.java
index 7998a92..93fb6d2 100644
--- a/media/java/android/media/midi/MidiDevice.java
+++ b/media/java/android/media/midi/MidiDevice.java
@@ -50,21 +50,43 @@
      * Close this object to terminate the connection.
      */
     public class MidiConnection implements Closeable {
-        private final IBinder mToken;
-        private final MidiInputPort mInputPort;
+        private final IMidiDeviceServer mInputPortDeviceServer;
+        private final IBinder mInputPortToken;
+        private final IBinder mOutputPortToken;
+        private final CloseGuard mGuard = CloseGuard.get();
+        private boolean mIsClosed;
 
-        MidiConnection(IBinder token, MidiInputPort inputPort) {
-            mToken = token;
-            mInputPort = inputPort;
+        MidiConnection(IBinder outputPortToken, MidiInputPort inputPort) {
+            mInputPortDeviceServer = inputPort.getDeviceServer();
+            mInputPortToken = inputPort.getToken();
+            mOutputPortToken = outputPortToken;
+            mGuard.open("close");
         }
 
         @Override
         public void close() throws IOException {
+            synchronized (mGuard) {
+                if (mIsClosed) return;
+                mGuard.close();
+                try {
+                    // close input port
+                    mInputPortDeviceServer.closePort(mInputPortToken);
+                    // close output port
+                    mDeviceServer.closePort(mOutputPortToken);
+                } catch (RemoteException e) {
+                    Log.e(TAG, "RemoteException in MidiConnection.close");
+                }
+                mIsClosed = true;
+            }
+        }
+
+        @Override
+        protected void finalize() throws Throwable {
             try {
-                mDeviceServer.closePort(mToken);
-                IoUtils.closeQuietly(mInputPort);
-            } catch (RemoteException e) {
-                Log.e(TAG, "RemoteException in MidiConnection.close");
+                mGuard.warnIfOpen();
+                close();
+            } finally {
+                super.finalize();
             }
         }
     }
diff --git a/media/java/android/media/midi/MidiDeviceServer.java b/media/java/android/media/midi/MidiDeviceServer.java
index 1212b64..19ff624 100644
--- a/media/java/android/media/midi/MidiDeviceServer.java
+++ b/media/java/android/media/midi/MidiDeviceServer.java
@@ -257,7 +257,14 @@
         public void connectPorts(IBinder token, ParcelFileDescriptor pfd,
                 int outputPortNumber) {
             MidiInputPort inputPort = new MidiInputPort(pfd, outputPortNumber);
-            mOutputPortDispatchers[outputPortNumber].getSender().connect(inputPort);
+            MidiDispatcher dispatcher = mOutputPortDispatchers[outputPortNumber];
+            synchronized (dispatcher) {
+                dispatcher.getSender().connect(inputPort);
+                int openCount = dispatcher.getReceiverCount();
+                mOutputPortOpenCount[outputPortNumber] = openCount;
+                updateDeviceStatus();
+            }
+
             mInputPorts.add(inputPort);
             OutputPortClient client = new OutputPortClient(token, inputPort);
             synchronized (mPortClients) {
diff --git a/media/java/android/media/midi/MidiInputPort.java b/media/java/android/media/midi/MidiInputPort.java
index af5a86c..db41b10 100644
--- a/media/java/android/media/midi/MidiInputPort.java
+++ b/media/java/android/media/midi/MidiInputPort.java
@@ -103,17 +103,33 @@
 
     // used by MidiDevice.connectInputPort() to connect our socket directly to another device
     /* package */ ParcelFileDescriptor claimFileDescriptor() {
-        synchronized (mBuffer) {
-            ParcelFileDescriptor pfd = mParcelFileDescriptor;
-            if (pfd != null) {
+        synchronized (mGuard) {
+            ParcelFileDescriptor pfd;
+            synchronized (mBuffer) {
+                pfd = mParcelFileDescriptor;
+                if (pfd == null) return null;
                 IoUtils.closeQuietly(mOutputStream);
                 mParcelFileDescriptor = null;
                 mOutputStream = null;
             }
+
+            // Set mIsClosed = true so we will not call mDeviceServer.closePort() in close().
+            // MidiDevice.MidiConnection.close() will do the cleanup instead.
+            mIsClosed = true;
             return pfd;
         }
     }
 
+    // used by MidiDevice.MidiConnection to close this port after the connection is closed
+    /* package */ IBinder getToken() {
+        return mToken;
+    }
+
+    // used by MidiDevice.MidiConnection to close this port after the connection is closed
+    /* package */ IMidiDeviceServer getDeviceServer() {
+        return mDeviceServer;
+    }
+
     @Override
     public void close() throws IOException {
         synchronized (mGuard) {
diff --git a/media/jni/android_media_ImageWriter.cpp b/media/jni/android_media_ImageWriter.cpp
index 634ba64..ba7634c 100644
--- a/media/jni/android_media_ImageWriter.cpp
+++ b/media/jni/android_media_ImageWriter.cpp
@@ -361,8 +361,7 @@
     ALOGV("%s:", __FUNCTION__);
     JNIImageWriterContext* const ctx = reinterpret_cast<JNIImageWriterContext *>(nativeCtx);
     if (ctx == NULL || thiz == NULL) {
-        jniThrowException(env, "java/lang/IllegalStateException",
-                "ImageWriterContext is not initialized");
+        // ImageWriter is already closed.
         return;
     }
 
diff --git a/packages/DocumentsUI/res/values-sw720dp/styles.xml b/packages/DocumentsUI/res/values-sw720dp/styles.xml
index 0b03a94..d7c031e 100644
--- a/packages/DocumentsUI/res/values-sw720dp/styles.xml
+++ b/packages/DocumentsUI/res/values-sw720dp/styles.xml
@@ -16,7 +16,7 @@
 
 <resources xmlns:android="http://schemas.android.com/apk/res/android">
 
-    <style name="DialogWhenReallyLarge" parent="@*android:style/Theme.Material.DayNight.Dialog">
+    <style name="DialogWhenReallyLarge" parent="@*android:style/Theme.DeviceDefault.Light.Dialog">
         <!-- We do not specify width of window here because the max size of
              floating window specified by windowFixedWidthis is limited. -->
         <item name="*android:windowFixedHeightMajor">80%</item>
diff --git a/packages/DocumentsUI/res/values/styles.xml b/packages/DocumentsUI/res/values/styles.xml
index 6d741aa..8c4b777 100644
--- a/packages/DocumentsUI/res/values/styles.xml
+++ b/packages/DocumentsUI/res/values/styles.xml
@@ -16,7 +16,7 @@
 
 <resources xmlns:android="http://schemas.android.com/apk/res/android">
 
-    <style name="DialogWhenReallyLarge" parent="@android:style/Theme.Material.DayNight.DarkActionBar" />
+    <style name="DialogWhenReallyLarge" parent="@android:style/Theme.DeviceDefault.Light.DarkActionBar" />
 
     <style name="DocumentsTheme" parent="@style/DialogWhenReallyLarge">
         <item name="android:actionBarWidgetTheme">@null</item>
diff --git a/packages/DocumentsUI/src/com/android/documentsui/DocumentsActivity.java b/packages/DocumentsUI/src/com/android/documentsui/DocumentsActivity.java
index 90ccf91..fe148da 100644
--- a/packages/DocumentsUI/src/com/android/documentsui/DocumentsActivity.java
+++ b/packages/DocumentsUI/src/com/android/documentsui/DocumentsActivity.java
@@ -393,25 +393,23 @@
     @Override
     public void updateActionBar() {
         if (mRootsToolbar != null) {
-            if (mState.action == ACTION_OPEN ||
-                mState.action == ACTION_GET_CONTENT ||
-                mState.action == ACTION_OPEN_TREE) {
-                mRootsToolbar.setTitle(R.string.title_open);
-            } else if (mState.action == ACTION_CREATE ||
-                       mState.action == ACTION_OPEN_COPY_DESTINATION) {
-                mRootsToolbar.setTitle(R.string.title_save);
+            final String prompt = getIntent().getStringExtra(DocumentsContract.EXTRA_PROMPT);
+            if (prompt != null) {
+                mRootsToolbar.setTitle(prompt);
+            } else {
+                if (mState.action == ACTION_OPEN ||
+                    mState.action == ACTION_GET_CONTENT ||
+                    mState.action == ACTION_OPEN_TREE) {
+                    mRootsToolbar.setTitle(R.string.title_open);
+                } else if (mState.action == ACTION_CREATE ||
+                           mState.action == ACTION_OPEN_COPY_DESTINATION) {
+                    mRootsToolbar.setTitle(R.string.title_save);
+                }
             }
         }
 
-        final RootInfo root = getCurrentRoot();
-        final boolean showRootIcon = mShowAsDialog
-                || (mState.action == ACTION_MANAGE || mState.action == ACTION_BROWSE);
-        if (showRootIcon) {
-            mToolbar.setNavigationIcon(
-                    root != null ? root.loadToolbarIcon(mToolbar.getContext()) : null);
-            mToolbar.setNavigationContentDescription(R.string.drawer_open);
-            mToolbar.setNavigationOnClickListener(null);
-        } else {
+        if (!mShowAsDialog && mDrawerLayout.getDrawerLockMode(mRootsDrawer) ==
+                DrawerLayout.LOCK_MODE_UNLOCKED) {
             mToolbar.setNavigationIcon(R.drawable.ic_hamburger);
             mToolbar.setNavigationContentDescription(R.string.drawer_open);
             mToolbar.setNavigationOnClickListener(new View.OnClickListener() {
@@ -420,6 +418,10 @@
                     setRootsDrawerOpen(true);
                 }
             });
+        } else {
+            mToolbar.setNavigationIcon(null);
+            mToolbar.setNavigationContentDescription(R.string.drawer_open);
+            mToolbar.setNavigationOnClickListener(null);
         }
 
         if (mSearchManager.isExpanded()) {
@@ -428,7 +430,7 @@
             mToolbarStack.setAdapter(null);
         } else {
             if (mState.stack.size() <= 1) {
-                mToolbar.setTitle(root.title);
+                mToolbar.setTitle(getCurrentRoot().title);
                 mToolbarStack.setVisibility(View.GONE);
                 mToolbarStack.setAdapter(null);
             } else {
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardAbsKeyInputView.java b/packages/Keyguard/src/com/android/keyguard/KeyguardAbsKeyInputView.java
index aa99a7b..0c6837f 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardAbsKeyInputView.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardAbsKeyInputView.java
@@ -216,6 +216,19 @@
         return mCallback;
     }
 
+    @Override
+    public void showPromptReason(int reason) {
+        if (reason != PROMPT_REASON_NONE) {
+            int promtReasonStringRes = getPromtReasonStringRes(reason);
+            if (promtReasonStringRes != 0) {
+                mSecurityMessageDisplay.setMessage(promtReasonStringRes,
+                        true /* important */);
+            }
+        }
+    }
+
+    protected abstract int getPromtReasonStringRes(int reason);
+
     // Cause a VIRTUAL_KEY vibration
     public void doHapticKeyClick() {
         if (mEnableHaptics) {
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardHostView.java b/packages/Keyguard/src/com/android/keyguard/KeyguardHostView.java
index cd4b24a..ff4e815 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardHostView.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardHostView.java
@@ -160,6 +160,17 @@
     }
 
     /**
+     * Show a string explaining why the security view needs to be solved.
+     *
+     * @param reason a flag indicating which string should be shown, see
+     *               {@link KeyguardSecurityView#PROMPT_REASON_NONE}
+     *               and {@link KeyguardSecurityView#PROMPT_REASON_RESTART}
+     */
+    public void showPromptReason(int reason) {
+        mSecurityContainer.showPromptReason(reason);
+    }
+
+    /**
      *  Dismisses the keyguard by going to the next screen or making it gone.
      *
      *  @return True if the keyguard is done.
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardPasswordView.java b/packages/Keyguard/src/com/android/keyguard/KeyguardPasswordView.java
index c9ad728..2db87b3 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardPasswordView.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardPasswordView.java
@@ -111,6 +111,16 @@
     }
 
     @Override
+    protected int getPromtReasonStringRes(int reason) {
+        switch (reason) {
+            case PROMPT_REASON_RESTART:
+                return R.string.kg_prompt_reason_restart_password;
+            default:
+                return 0;
+        }
+    }
+
+    @Override
     public void onPause() {
         super.onPause();
         mImm.hideSoftInputFromWindow(getWindowToken(), 0);
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardPatternView.java b/packages/Keyguard/src/com/android/keyguard/KeyguardPatternView.java
index 1bd0bb4..59a8ad5 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardPatternView.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardPatternView.java
@@ -85,10 +85,9 @@
         }
     };
     private Rect mTempRect = new Rect();
-    private SecurityMessageDisplay mSecurityMessageDisplay;
+    private KeyguardMessageArea mSecurityMessageDisplay;
     private View mEcaView;
     private ViewGroup mContainer;
-    private KeyguardMessageArea mHelpMessage;
     private int mDisappearYTranslation;
 
     enum FooterMode {
@@ -141,10 +140,10 @@
         // vibrate mode will be the same for the life of this screen
         mLockPatternView.setTactileFeedbackEnabled(mLockPatternUtils.isTactileFeedbackEnabled());
 
-        mSecurityMessageDisplay = KeyguardMessageArea.findSecurityMessageDisplay(this);
+        mSecurityMessageDisplay =
+                (KeyguardMessageArea) KeyguardMessageArea.findSecurityMessageDisplay(this);
         mEcaView = findViewById(R.id.keyguard_selector_fade_container);
         mContainer = (ViewGroup) findViewById(R.id.container);
-        mHelpMessage = (KeyguardMessageArea) findViewById(R.id.keyguard_message_area);
 
         EmergencyButton button = (EmergencyButton) findViewById(R.id.emergency_call_button);
         if (button != null) {
@@ -320,6 +319,17 @@
     }
 
     @Override
+    public void showPromptReason(int reason) {
+        switch (reason) {
+            case PROMPT_REASON_RESTART:
+                mSecurityMessageDisplay.setMessage(R.string.kg_prompt_reason_restart_pattern,
+                        true /* important */);
+                break;
+            default:
+        }
+    }
+
+    @Override
     public void startAppearAnimation() {
         enableClipping(false);
         setAlpha(1f);
@@ -337,8 +347,8 @@
                     }
                 },
                 this);
-        if (!TextUtils.isEmpty(mHelpMessage.getText())) {
-            mAppearAnimationUtils.createAnimation(mHelpMessage, 0,
+        if (!TextUtils.isEmpty(mSecurityMessageDisplay.getText())) {
+            mAppearAnimationUtils.createAnimation(mSecurityMessageDisplay, 0,
                     AppearAnimationUtils.DEFAULT_APPEAR_DURATION,
                     mAppearAnimationUtils.getStartTranslation(),
                     true /* appearing */,
@@ -366,8 +376,8 @@
                         }
                     }
                 }, KeyguardPatternView.this);
-        if (!TextUtils.isEmpty(mHelpMessage.getText())) {
-            mDisappearAnimationUtils.createAnimation(mHelpMessage, 0,
+        if (!TextUtils.isEmpty(mSecurityMessageDisplay.getText())) {
+            mDisappearAnimationUtils.createAnimation(mSecurityMessageDisplay, 0,
                     200,
                     - mDisappearAnimationUtils.getStartTranslation() * 3,
                     false /* appearing */,
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardPinBasedInputView.java b/packages/Keyguard/src/com/android/keyguard/KeyguardPinBasedInputView.java
index 23834a3..07947b1 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardPinBasedInputView.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardPinBasedInputView.java
@@ -93,6 +93,16 @@
         return super.onKeyDown(keyCode, event);
     }
 
+    @Override
+    protected int getPromtReasonStringRes(int reason) {
+        switch (reason) {
+            case PROMPT_REASON_RESTART:
+                return R.string.kg_prompt_reason_restart_pin;
+            default:
+                return 0;
+        }
+    }
+
     private void performClick(View view) {
         view.performClick();
     }
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityContainer.java b/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityContainer.java
index d17b25a..f529ac0 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityContainer.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityContainer.java
@@ -509,6 +509,13 @@
     }
 
     @Override
+    public void showPromptReason(int reason) {
+        if (mCurrentSecuritySelection != SecurityMode.None) {
+            getSecurityView(mCurrentSecuritySelection).showPromptReason(reason);
+        }
+    }
+
+    @Override
     public void showUsabilityHint() {
         mSecurityViewFlipper.showUsabilityHint();
     }
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityView.java b/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityView.java
index 5b50236..5658a74 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityView.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityView.java
@@ -21,6 +21,9 @@
     static public final int SCREEN_ON = 1;
     static public final int VIEW_REVEALED = 2;
 
+    int PROMPT_REASON_NONE = 0;
+    int PROMPT_REASON_RESTART = 1;
+
     /**
      * Interface back to keyguard to tell it when security
      * @param callback
@@ -66,6 +69,14 @@
     KeyguardSecurityCallback getCallback();
 
     /**
+     * Show a string explaining why the security view needs to be solved.
+     *
+     * @param reason a flag indicating which string should be shown, see {@link #PROMPT_REASON_NONE}
+     *               and {@link #PROMPT_REASON_RESTART}
+     */
+    void showPromptReason(int reason);
+
+    /**
      * Instruct the view to show usability hints, if any.
      *
      */
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityViewFlipper.java b/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityViewFlipper.java
index 54467f3..a0ff21b 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityViewFlipper.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardSecurityViewFlipper.java
@@ -131,6 +131,14 @@
     }
 
     @Override
+    public void showPromptReason(int reason) {
+        KeyguardSecurityView ksv = getSecurityView();
+        if (ksv != null) {
+            ksv.showPromptReason(reason);
+        }
+    }
+
+    @Override
     public void showUsabilityHint() {
         KeyguardSecurityView ksv = getSecurityView();
         if (ksv != null) {
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardSimPinView.java b/packages/Keyguard/src/com/android/keyguard/KeyguardSimPinView.java
index f4acff8..aeac912 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardSimPinView.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardSimPinView.java
@@ -95,6 +95,12 @@
         }
     }
 
+    @Override
+    protected int getPromtReasonStringRes(int reason) {
+        // No message on SIM Pin
+        return 0;
+    }
+
     private String getPinPasswordErrorMessage(int attemptsRemaining) {
         String displayMessage;
 
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardSimPukView.java b/packages/Keyguard/src/com/android/keyguard/KeyguardSimPukView.java
index b85d966..af88239 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardSimPukView.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardSimPukView.java
@@ -140,6 +140,12 @@
         }
     }
 
+    @Override
+    protected int getPromtReasonStringRes(int reason) {
+        // No message on SIM Puk
+        return 0;
+    }
+
     private String getPukPasswordErrorMessage(int attemptsRemaining) {
         String displayMessage;
 
diff --git a/packages/Keyguard/src/com/android/keyguard/KeyguardUpdateMonitor.java b/packages/Keyguard/src/com/android/keyguard/KeyguardUpdateMonitor.java
index 273f166..022338d 100644
--- a/packages/Keyguard/src/com/android/keyguard/KeyguardUpdateMonitor.java
+++ b/packages/Keyguard/src/com/android/keyguard/KeyguardUpdateMonitor.java
@@ -804,8 +804,7 @@
     private void startListeningForFingerprint() {
         if (DEBUG) Log.v(TAG, "startListeningForFingerprint()");
         int userId = ActivityManager.getCurrentUser();
-        if (mFpm != null && mFpm.isHardwareDetected() && !isFingerprintDisabled(userId)
-                && mFpm.getEnrolledFingerprints(userId).size() > 0) {
+        if (isUnlockWithFingerPrintPossible(userId)) {
             if (mFingerprintCancelSignal != null) {
                 mFingerprintCancelSignal.cancel();
             }
@@ -815,6 +814,11 @@
         }
     }
 
+    public boolean isUnlockWithFingerPrintPossible(int userId) {
+        return mFpm != null && mFpm.isHardwareDetected() && !isFingerprintDisabled(userId)
+                && mFpm.getEnrolledFingerprints(userId).size() > 0;
+    }
+
     private void stopListeningForFingerprint() {
         if (DEBUG) Log.v(TAG, "stopListeningForFingerprint()");
         if (isFingerprintDetectionRunning()) {
diff --git a/packages/Keyguard/src/com/android/keyguard/ViewMediatorCallback.java b/packages/Keyguard/src/com/android/keyguard/ViewMediatorCallback.java
index f5c809a..ff463c6 100644
--- a/packages/Keyguard/src/com/android/keyguard/ViewMediatorCallback.java
+++ b/packages/Keyguard/src/com/android/keyguard/ViewMediatorCallback.java
@@ -81,4 +81,12 @@
      * @return true if the screen is on
      */
     boolean isScreenOn();
+
+    /**
+     * @return one of the reasons why the bouncer needs to be shown right now and the user can't use
+     *         his normal unlock method like fingerprint or trust agents. See
+     *         {@link KeyguardSecurityView#PROMPT_REASON_NONE}
+     *         and {@link KeyguardSecurityView#PROMPT_REASON_RESTART}.
+     */
+    int getBouncerPromptReason();
 }
diff --git a/packages/PrintSpooler/res/values/themes.xml b/packages/PrintSpooler/res/values/themes.xml
index 05de5b7..11fa991 100644
--- a/packages/PrintSpooler/res/values/themes.xml
+++ b/packages/PrintSpooler/res/values/themes.xml
@@ -17,6 +17,9 @@
 <resources>
 
     <style name="PrintActivity" parent="@android:style/Theme.DeviceDefault">
+        <item name="android:colorPrimary">@*android:color/material_blue_grey_900</item>
+        <item name="android:colorPrimaryDark">@*android:color/material_blue_grey_950</item>
+        <item name="android:colorAccent">@*android:color/material_deep_teal_500</item>
         <item name="android:windowIsTranslucent">true</item>
         <item name="android:windowBackground">@android:color/transparent</item>
         <item name="android:windowContentOverlay">@null</item>
diff --git a/packages/SettingsLib/src/com/android/settingslib/bluetooth/CachedBluetoothDevice.java b/packages/SettingsLib/src/com/android/settingslib/bluetooth/CachedBluetoothDevice.java
index b0429ef..249eaa5 100644
--- a/packages/SettingsLib/src/com/android/settingslib/bluetooth/CachedBluetoothDevice.java
+++ b/packages/SettingsLib/src/com/android/settingslib/bluetooth/CachedBluetoothDevice.java
@@ -808,7 +808,7 @@
             // The pairing dialog now warns of phone-book access for paired devices.
             // No separate prompt is displayed after pairing.
             if (getPhonebookPermissionChoice() == CachedBluetoothDevice.ACCESS_UNKNOWN) {
-                setPhonebookPermissionChoice(CachedBluetoothDevice.ACCESS_ALLOWED);
+                setPhonebookPermissionChoice(CachedBluetoothDevice.ACCESS_REJECTED);
             }
         }
     }
diff --git a/packages/Shell/AndroidManifest.xml b/packages/Shell/AndroidManifest.xml
index 640fb29..9832b45 100644
--- a/packages/Shell/AndroidManifest.xml
+++ b/packages/Shell/AndroidManifest.xml
@@ -128,7 +128,7 @@
 
         <activity
             android:name=".BugreportWarningActivity"
-            android:theme="@*android:style/Theme.Material.DayNight.Dialog.Alert"
+            android:theme="@*android:style/Theme.DeviceDefault.Light.Dialog.Alert"
             android:finishOnCloseSystemDialogs="true"
             android:excludeFromRecents="true"
             android:exported="false" />
diff --git a/packages/Shell/src/com/android/shell/BugreportReceiver.java b/packages/Shell/src/com/android/shell/BugreportReceiver.java
index 13747ed..0c84fa1 100644
--- a/packages/Shell/src/com/android/shell/BugreportReceiver.java
+++ b/packages/Shell/src/com/android/shell/BugreportReceiver.java
@@ -27,6 +27,7 @@
 import android.content.BroadcastReceiver;
 import android.content.Context;
 import android.content.Intent;
+import android.content.res.Configuration;
 import android.net.Uri;
 import android.os.AsyncTask;
 import android.os.FileUtils;
@@ -77,21 +78,12 @@
 
     @Override
     public void onReceive(Context context, Intent intent) {
+        final Configuration conf = context.getResources().getConfiguration();
         final File bugreportFile = getFileExtra(intent, EXTRA_BUGREPORT);
         final File screenshotFile = getFileExtra(intent, EXTRA_SCREENSHOT);
 
-        // Files are kept on private storage, so turn into Uris that we can
-        // grant temporary permissions for.
-        final Uri bugreportUri = FileProvider.getUriForFile(context, AUTHORITY, bugreportFile);
-        final Uri screenshotUri = FileProvider.getUriForFile(context, AUTHORITY, screenshotFile);
-
-        boolean isPlainText = bugreportFile.getName().toLowerCase().endsWith(".txt");
-        if (!isPlainText) {
-            // Already zipped, send it right away.
-            sendBugreportNotification(context, bugreportFile, screenshotFile);
-        } else {
-            // Asynchronously zip the file first, then send it.
-            sendZippedBugreportNotification(context, bugreportFile, screenshotFile);
+        if ((conf.uiMode & Configuration.UI_MODE_TYPE_MASK) != Configuration.UI_MODE_TYPE_WATCH) {
+            triggerLocalNotification(context, bugreportFile, screenshotFile);
         }
 
         // Clean up older bugreports in background
@@ -107,6 +99,29 @@
         }.execute();
     }
 
+    /**
+     * Responsible for triggering a notification that allows the user to start a
+     * "share" intent with the bug report. On watches we have other methods to allow the user to
+     * start this intent (usually by triggering it on another connected device); we don't need to
+     * display the notification in this case.
+     */
+    private void triggerLocalNotification(final Context context, final File bugreportFile,
+            final File screenshotFile) {
+        // Files are kept on private storage, so turn into Uris that we can
+        // grant temporary permissions for.
+        final Uri bugreportUri = FileProvider.getUriForFile(context, AUTHORITY, bugreportFile);
+        final Uri screenshotUri = FileProvider.getUriForFile(context, AUTHORITY, screenshotFile);
+
+        boolean isPlainText = bugreportFile.getName().toLowerCase().endsWith(".txt");
+        if (!isPlainText) {
+            // Already zipped, send it right away.
+            sendBugreportNotification(context, bugreportFile, screenshotFile);
+        } else {
+            // Asynchronously zip the file first, then send it.
+            sendZippedBugreportNotification(context, bugreportFile, screenshotFile);
+        }
+    }
+
     private static Intent buildWarningIntent(Context context, Intent sendIntent) {
         final Intent intent = new Intent(context, BugreportWarningActivity.class);
         intent.putExtra(Intent.EXTRA_INTENT, sendIntent);
diff --git a/packages/SystemUI/src/com/android/systemui/keyguard/KeyguardViewMediator.java b/packages/SystemUI/src/com/android/systemui/keyguard/KeyguardViewMediator.java
index c06b34f..80761d8 100644
--- a/packages/SystemUI/src/com/android/systemui/keyguard/KeyguardViewMediator.java
+++ b/packages/SystemUI/src/com/android/systemui/keyguard/KeyguardViewMediator.java
@@ -62,6 +62,7 @@
 import com.android.internal.widget.LockPatternUtils;
 import com.android.keyguard.KeyguardConstants;
 import com.android.keyguard.KeyguardDisplayManager;
+import com.android.keyguard.KeyguardSecurityView;
 import com.android.keyguard.KeyguardUpdateMonitor;
 import com.android.keyguard.KeyguardUpdateMonitorCallback;
 import com.android.keyguard.ViewMediatorCallback;
@@ -526,6 +527,17 @@
         public boolean isScreenOn() {
             return mDeviceInteractive;
         }
+
+        @Override
+        public int getBouncerPromptReason() {
+            int currentUser = ActivityManager.getCurrentUser();
+            if ((mUpdateMonitor.getUserTrustIsManaged(currentUser)
+                    || mUpdateMonitor.isUnlockWithFingerPrintPossible(currentUser))
+                    && !mTrustManager.hasUserAuthenticatedSinceBoot(currentUser)) {
+                return KeyguardSecurityView.PROMPT_REASON_RESTART;
+            }
+            return KeyguardSecurityView.PROMPT_REASON_NONE;
+        }
     };
 
     public void userActivity() {
diff --git a/packages/SystemUI/src/com/android/systemui/recents/Recents.java b/packages/SystemUI/src/com/android/systemui/recents/Recents.java
index 442af90..89c456c 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/Recents.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/Recents.java
@@ -316,14 +316,12 @@
 
     void hideRecentsInternal(boolean triggeredFromAltTab, boolean triggeredFromHomeKey) {
         if (mBootCompleted) {
-            ActivityManager.RunningTaskInfo topTask = mSystemServicesProxy.getTopMostTask();
-            if (topTask != null && mSystemServicesProxy.isRecentsTopMost(topTask, null)) {
-                // Notify recents to hide itself
-                Intent intent = createLocalBroadcastIntent(mContext, ACTION_HIDE_RECENTS_ACTIVITY);
-                intent.putExtra(EXTRA_TRIGGERED_FROM_ALT_TAB, triggeredFromAltTab);
-                intent.putExtra(EXTRA_TRIGGERED_FROM_HOME_KEY, triggeredFromHomeKey);
-                mContext.sendBroadcastAsUser(intent, UserHandle.CURRENT);
-            }
+            // Defer to the activity to handle hiding recents, if it handles it, then it must still
+            // be visible
+            Intent intent = createLocalBroadcastIntent(mContext, ACTION_HIDE_RECENTS_ACTIVITY);
+            intent.putExtra(EXTRA_TRIGGERED_FROM_ALT_TAB, triggeredFromAltTab);
+            intent.putExtra(EXTRA_TRIGGERED_FROM_HOME_KEY, triggeredFromHomeKey);
+            mContext.sendBroadcastAsUser(intent, UserHandle.CURRENT);
         }
     }
 
diff --git a/packages/SystemUI/src/com/android/systemui/recents/RecentsActivity.java b/packages/SystemUI/src/com/android/systemui/recents/RecentsActivity.java
index 3885799..3cd769e 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/RecentsActivity.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/RecentsActivity.java
@@ -134,9 +134,9 @@
                     dismissRecentsToFocusedTaskOrHome(false);
                 } else if (intent.getBooleanExtra(Recents.EXTRA_TRIGGERED_FROM_HOME_KEY, false)) {
                     // Otherwise, dismiss Recents to Home
-                    dismissRecentsToHome(true);
+                    dismissRecentsToHomeRaw(true);
                 } else {
-                    // Do nothing, another activity is being launched on top of Recents
+                    // Do nothing
                 }
             } else if (action.equals(Recents.ACTION_TOGGLE_RECENTS_ACTIVITY)) {
                 // If we are toggling Recents, then first unfilter any filtered stacks first
diff --git a/packages/SystemUI/src/com/android/systemui/recents/RecentsAppWidgetHost.java b/packages/SystemUI/src/com/android/systemui/recents/RecentsAppWidgetHost.java
index 02a7b94..d4e50f8 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/RecentsAppWidgetHost.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/RecentsAppWidgetHost.java
@@ -70,6 +70,7 @@
     @Override
     protected void onProviderChanged(int appWidgetId, AppWidgetProviderInfo appWidgetInfo) {
         if (mCb == null) return;
+        if (mContext == null) return;
 
         SystemServicesProxy ssp = RecentsTaskLoader.getInstance().getSystemServicesProxy();
         if (appWidgetId > -1 && appWidgetId == mConfig.searchBarAppWidgetId) {
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackView.java b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackView.java
index 5711cd6..ebfc796 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackView.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackView.java
@@ -22,10 +22,12 @@
 import android.graphics.Canvas;
 import android.graphics.Matrix;
 import android.graphics.Rect;
+import android.os.Bundle;
 import android.view.LayoutInflater;
 import android.view.MotionEvent;
 import android.view.View;
 import android.view.accessibility.AccessibilityEvent;
+import android.view.accessibility.AccessibilityNodeInfo;
 import android.widget.FrameLayout;
 import com.android.systemui.R;
 import com.android.systemui.recents.Constants;
@@ -133,6 +135,7 @@
                 }
             }
         });
+        setImportantForAccessibility(View.IMPORTANT_FOR_ACCESSIBILITY_YES);
     }
 
     /** Sets the callbacks */
@@ -350,6 +353,7 @@
             mTmpTaskViewMap.clear();
             List<TaskView> taskViews = getTaskViews();
             int taskViewCount = taskViews.size();
+            boolean reaquireAccessibilityFocus = false;
             for (int i = taskViewCount - 1; i >= 0; i--) {
                 TaskView tv = taskViews.get(i);
                 Task task = tv.getTask();
@@ -358,6 +362,7 @@
                     mTmpTaskViewMap.put(task, tv);
                 } else {
                     mViewPool.returnViewToPool(tv);
+                    reaquireAccessibilityFocus |= (i == mPrevAccessibilityFocusedIndex);
 
                     // Hide the dismiss button if the front most task is invisible
                     if (task == mStack.getFrontMostTask()) {
@@ -402,14 +407,17 @@
 
                 // Request accessibility focus on the next view if we removed the task
                 // that previously held accessibility focus
-                taskViews = getTaskViews();
-                taskViewCount = taskViews.size();
-                if (taskViewCount > 0 && ssp.isTouchExplorationEnabled()) {
-                    TaskView atv = taskViews.get(taskViewCount - 1);
-                    int indexOfTask = mStack.indexOfTask(atv.getTask());
-                    if (mPrevAccessibilityFocusedIndex != indexOfTask) {
-                        tv.requestAccessibilityFocus();
-                        mPrevAccessibilityFocusedIndex = indexOfTask;
+                if (reaquireAccessibilityFocus) {
+                    taskViews = getTaskViews();
+                    taskViewCount = taskViews.size();
+                    if (taskViewCount > 0 && ssp.isTouchExplorationEnabled() &&
+                            mPrevAccessibilityFocusedIndex != -1) {
+                        TaskView atv = taskViews.get(taskViewCount - 1);
+                        int indexOfTask = mStack.indexOfTask(atv.getTask());
+                        if (mPrevAccessibilityFocusedIndex != indexOfTask) {
+                            tv.requestAccessibilityFocus();
+                            mPrevAccessibilityFocusedIndex = indexOfTask;
+                        }
                     }
                 }
             }
@@ -496,25 +504,20 @@
 
         if (0 <= taskIndex && taskIndex < mStack.getTaskCount()) {
             mFocusedTaskIndex = taskIndex;
+            mPrevAccessibilityFocusedIndex = taskIndex;
 
             // Focus the view if possible, otherwise, focus the view after we scroll into position
-            Task t = mStack.getTasks().get(taskIndex);
-            TaskView tv = getChildViewForTask(t);
-            Runnable postScrollRunnable = null;
-            if (tv != null) {
-                tv.setFocusedTask(animateFocusedState);
-            } else {
-                postScrollRunnable = new Runnable() {
-                    @Override
-                    public void run() {
-                        Task t = mStack.getTasks().get(mFocusedTaskIndex);
-                        TaskView tv = getChildViewForTask(t);
-                        if (tv != null) {
-                            tv.setFocusedTask(animateFocusedState);
-                        }
+            final Task t = mStack.getTasks().get(mFocusedTaskIndex);
+            Runnable postScrollRunnable = new Runnable() {
+                @Override
+                public void run() {
+                    TaskView tv = getChildViewForTask(t);
+                    if (tv != null) {
+                        tv.setFocusedTask(animateFocusedState);
+                        tv.requestAccessibilityFocus();
                     }
-                };
-            }
+                }
+            };
 
             // Scroll the view into position (just center it in the curve)
             if (scrollToNewPosition) {
@@ -534,25 +537,30 @@
      * Ensures that there is a task focused, if nothing is focused, then we will use the task
      * at the center of the visible stack.
      */
-    public boolean ensureFocusedTask() {
+    public boolean ensureFocusedTask(boolean findClosestToCenter) {
         if (mFocusedTaskIndex < 0) {
-            // If there is no task focused, then find the task that is closes to the center
-            // of the screen and use that as the currently focused task
-            int x = mLayoutAlgorithm.mStackVisibleRect.centerX();
-            int y = mLayoutAlgorithm.mStackVisibleRect.centerY();
             List<TaskView> taskViews = getTaskViews();
             int taskViewCount = taskViews.size();
-            for (int i = taskViewCount - 1; i >= 0; i--) {
-                TaskView tv = taskViews.get(i);
-                tv.getHitRect(mTmpRect);
-                if (mTmpRect.contains(x, y)) {
-                    mFocusedTaskIndex = mStack.indexOfTask(tv.getTask());
-                    break;
+            if (findClosestToCenter) {
+                // If there is no task focused, then find the task that is closes to the center
+                // of the screen and use that as the currently focused task
+                int x = mLayoutAlgorithm.mStackVisibleRect.centerX();
+                int y = mLayoutAlgorithm.mStackVisibleRect.centerY();
+                for (int i = taskViewCount - 1; i >= 0; i--) {
+                    TaskView tv = taskViews.get(i);
+                    tv.getHitRect(mTmpRect);
+                    if (mTmpRect.contains(x, y)) {
+                        mFocusedTaskIndex = mStack.indexOfTask(tv.getTask());
+                        mPrevAccessibilityFocusedIndex = mFocusedTaskIndex;
+                        break;
+                    }
                 }
             }
             // If we can't find the center task, then use the front most index
             if (mFocusedTaskIndex < 0 && taskViewCount > 0) {
-                mFocusedTaskIndex = taskViewCount - 1;
+                TaskView tv = taskViews.get(taskViewCount - 1);
+                mFocusedTaskIndex = mStack.indexOfTask(tv.getTask());
+                mPrevAccessibilityFocusedIndex = mFocusedTaskIndex;
             }
         }
         return mFocusedTaskIndex >= 0;
@@ -600,6 +608,7 @@
             }
         }
         mFocusedTaskIndex = -1;
+        mPrevAccessibilityFocusedIndex = -1;
     }
 
     @Override
@@ -620,6 +629,53 @@
     }
 
     @Override
+    public void onInitializeAccessibilityNodeInfo(AccessibilityNodeInfo info) {
+        super.onInitializeAccessibilityNodeInfo(info);
+        List<TaskView> taskViews = getTaskViews();
+        int taskViewCount = taskViews.size();
+        if (taskViewCount > 1 && mPrevAccessibilityFocusedIndex != -1) {
+            info.setScrollable(true);
+            if (mPrevAccessibilityFocusedIndex > 0) {
+                info.addAction(AccessibilityNodeInfo.ACTION_SCROLL_FORWARD);
+            }
+            if (mPrevAccessibilityFocusedIndex < mStack.getTaskCount() - 1) {
+                info.addAction(AccessibilityNodeInfo.ACTION_SCROLL_BACKWARD);
+            }
+        }
+    }
+
+    @Override
+    public CharSequence getAccessibilityClassName() {
+        return TaskStackView.class.getName();
+    }
+
+    @Override
+    public boolean performAccessibilityAction(int action, Bundle arguments) {
+        if (super.performAccessibilityAction(action, arguments)) {
+            return true;
+        }
+        if (ensureFocusedTask(false)) {
+            switch (action) {
+                case AccessibilityNodeInfo.ACTION_SCROLL_FORWARD: {
+                    if (mPrevAccessibilityFocusedIndex > 0) {
+                        focusNextTask(true, false);
+                        return true;
+                    }
+                }
+                break;
+                case AccessibilityNodeInfo.ACTION_SCROLL_BACKWARD: {
+                    if (mPrevAccessibilityFocusedIndex < mStack.getTaskCount() - 1) {
+                        focusNextTask(false, false);
+                        return true;
+                    }
+                }
+                break;
+            }
+        }
+        return false;
+    }
+
+    @Override
     public boolean onInterceptTouchEvent(MotionEvent ev) {
         return mTouchHandler.onInterceptTouchEvent(ev);
     }
@@ -724,8 +780,8 @@
         if (mDismissAllButton != null) {
             int taskRectWidth = mLayoutAlgorithm.mTaskRect.width();
             mDismissAllButton.measure(
-                MeasureSpec.makeMeasureSpec(taskRectWidth, MeasureSpec.EXACTLY),
-                MeasureSpec.makeMeasureSpec(mConfig.dismissAllButtonSizePx, MeasureSpec.EXACTLY));
+                    MeasureSpec.makeMeasureSpec(taskRectWidth, MeasureSpec.EXACTLY),
+                    MeasureSpec.makeMeasureSpec(mConfig.dismissAllButtonSizePx, MeasureSpec.EXACTLY));
         }
 
         setMeasuredDimension(width, height);
diff --git a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackViewTouchHandler.java b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackViewTouchHandler.java
index 509560eb..13bdbd2 100644
--- a/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackViewTouchHandler.java
+++ b/packages/SystemUI/src/com/android/systemui/recents/views/TaskStackViewTouchHandler.java
@@ -396,11 +396,11 @@
                     // Find the front most task and scroll the next task to the front
                     float vScroll = ev.getAxisValue(MotionEvent.AXIS_VSCROLL);
                     if (vScroll > 0) {
-                        if (mSv.ensureFocusedTask()) {
+                        if (mSv.ensureFocusedTask(true)) {
                             mSv.focusNextTask(true, false);
                         }
                     } else {
-                        if (mSv.ensureFocusedTask()) {
+                        if (mSv.ensureFocusedTask(true)) {
                             mSv.focusNextTask(false, false);
                         }
                     }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/BaseStatusBar.java b/packages/SystemUI/src/com/android/systemui/statusbar/BaseStatusBar.java
index 79761ec..a496548 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/BaseStatusBar.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/BaseStatusBar.java
@@ -41,6 +41,7 @@
 import android.database.ContentObserver;
 import android.graphics.PorterDuff;
 import android.graphics.drawable.Drawable;
+import android.graphics.drawable.Icon;
 import android.os.AsyncTask;
 import android.os.Build;
 import android.os.Handler;
@@ -1396,6 +1397,7 @@
 
             final StatusBarIcon ic = new StatusBarIcon(
                     entry.notification.getUser(),
+                    entry.notification.getPackageName(),
                     entry.notification.getNotification().getSmallIcon(),
                     entry.notification.getNotification().iconLevel,
                     entry.notification.getNotification().number,
@@ -1682,10 +1684,11 @@
 
         final StatusBarIcon ic = new StatusBarIcon(
                 sbn.getUser(),
-                    n.getSmallIcon(),
-                    n.iconLevel,
-                    n.number,
-                    n.tickerText);
+                sbn.getPackageName(),
+                n.getSmallIcon(),
+                n.iconLevel,
+                n.number,
+                n.tickerText);
         if (!iconView.set(ic)) {
             handleNotificationError(sbn, "Couldn't create icon: " + ic);
             return null;
@@ -1825,6 +1828,7 @@
                     // Update the icon
                     final StatusBarIcon ic = new StatusBarIcon(
                             notification.getUser(),
+                            notification.getPackageName(),
                             n.getSmallIcon(),
                             n.iconLevel,
                             n.number,
@@ -1847,6 +1851,7 @@
             if (DEBUG) Log.d(TAG, "not reusing notification for key: " + key);
             final StatusBarIcon ic = new StatusBarIcon(
                     notification.getUser(),
+                    notification.getPackageName(),
                     n.getSmallIcon(),
                     n.iconLevel,
                     n.number,
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationData.java b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationData.java
index dbabe3f..aedae52 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationData.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationData.java
@@ -125,16 +125,22 @@
 
         @Override
         public int compare(Entry a, Entry b) {
-            String mediaNotification = mEnvironment.getCurrentMediaNotificationKey();
-            boolean aMedia = a.key.equals(mediaNotification);
-            boolean bMedia = b.key.equals(mediaNotification);
-
             final StatusBarNotification na = a.notification;
             final StatusBarNotification nb = b.notification;
+            final int aPriority = na.getNotification().priority;
+            final int bPriority = nb.getNotification().priority;
 
-            boolean aSystemMax = na.getNotification().priority >= Notification.PRIORITY_MAX &&
+            String mediaNotification = mEnvironment.getCurrentMediaNotificationKey();
+
+            // PRIORITY_MIN media streams are allowed to drift to the bottom
+            final boolean aMedia = a.key.equals(mediaNotification)
+                    && aPriority > Notification.PRIORITY_MIN;
+            final boolean bMedia = b.key.equals(mediaNotification)
+                    && bPriority > Notification.PRIORITY_MIN;
+
+            boolean aSystemMax = aPriority >= Notification.PRIORITY_MAX &&
                     isSystemNotification(na);
-            boolean bSystemMax = nb.getNotification().priority >= Notification.PRIORITY_MAX &&
+            boolean bSystemMax = bPriority >= Notification.PRIORITY_MAX &&
                     isSystemNotification(nb);
             int d = nb.getScore() - na.getScore();
 
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/SignalClusterView.java b/packages/SystemUI/src/com/android/systemui/statusbar/SignalClusterView.java
index 9e0b08b..5a4acb4 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/SignalClusterView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/SignalClusterView.java
@@ -251,6 +251,9 @@
 
     @Override
     public void setSubs(List<SubscriptionInfo> subs) {
+        if (hasCorrectSubs(subs)) {
+            return;
+        }
         // Clear out all old subIds.
         mPhoneStates.clear();
         if (mMobileSignalGroup != null) {
@@ -265,6 +268,19 @@
         }
     }
 
+    private boolean hasCorrectSubs(List<SubscriptionInfo> subs) {
+        final int N = subs.size();
+        if (N != mPhoneStates.size()) {
+            return false;
+        }
+        for (int i = 0; i < N; i++) {
+            if (mPhoneStates.get(i).mSubId != subs.get(i).getSubscriptionId()) {
+                return false;
+            }
+        }
+        return true;
+    }
+
     private PhoneState getOrInflateState(int subId) {
         for (PhoneState state : mPhoneStates) {
             if (state.mSubId == subId) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/DemoStatusIcons.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/DemoStatusIcons.java
index 26d1c86..fcdd4b7 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/DemoStatusIcons.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/DemoStatusIcons.java
@@ -124,6 +124,9 @@
 
     private void updateSlot(String slot, String iconPkg, int iconId) {
         if (!mDemoMode) return;
+        if (iconPkg == null) {
+            iconPkg = mContext.getPackageName();
+        }
         int removeIndex = -1;
         for (int i = 0; i < getChildCount(); i++) {
             StatusBarIconView v = (StatusBarIconView) getChildAt(i);
@@ -143,10 +146,10 @@
         if (iconId == 0) {
             if (removeIndex != -1) {
                 removeViewAt(removeIndex);
-                return;
             }
+            return;
         }
-        StatusBarIcon icon = new StatusBarIcon(iconPkg, UserHandle.CURRENT, iconId, 0, 0, "Demo");
+        StatusBarIcon icon = new StatusBarIcon(iconPkg, UserHandle.OWNER, iconId, 0, 0, "Demo");
         StatusBarIconView v = new StatusBarIconView(getContext(), null, null);
         v.setTag(slot);
         v.set(icon);
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/HeadsUpTouchHelper.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/HeadsUpTouchHelper.java
index f57575d..10c35af 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/HeadsUpTouchHelper.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/HeadsUpTouchHelper.java
@@ -110,6 +110,8 @@
                     mInitialTouchX = x;
                     mInitialTouchY = y;
                     int expandedHeight = mPickedChild.getActualHeight();
+                    mPanel.setPanelScrimMinFraction((float) expandedHeight
+                            / mPanel.getMaxPanelHeight());
                     mPanel.startExpandMotion(x, y, true /* startTracking */, expandedHeight
                             + mNotificationsTopPadding);
                     mHeadsUpManager.unpinAll();
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardBouncer.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardBouncer.java
index 3737d05..a3bb129 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardBouncer.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/KeyguardBouncer.java
@@ -26,6 +26,7 @@
 
 import com.android.internal.widget.LockPatternUtils;
 import com.android.keyguard.KeyguardHostView;
+import com.android.keyguard.KeyguardSecurityView;
 import com.android.keyguard.R;
 import com.android.keyguard.ViewMediatorCallback;
 
@@ -46,6 +47,7 @@
     private ViewGroup mRoot;
     private boolean mShowingSoon;
     private Choreographer mChoreographer = Choreographer.getInstance();
+    private int mBouncerPromptReason;
 
     public KeyguardBouncer(Context context, ViewMediatorCallback callback,
             LockPatternUtils lockPatternUtils, StatusBarWindowManager windowManager,
@@ -68,6 +70,8 @@
             return;
         }
 
+        mBouncerPromptReason = mCallback.getBouncerPromptReason();
+
         // Try to dismiss the Keyguard. If no security pattern is set, this will dismiss the whole
         // Keyguard. If we need to authenticate, show the bouncer.
         if (!mKeyguardView.dismiss()) {
@@ -84,12 +88,24 @@
         public void run() {
             mRoot.setVisibility(View.VISIBLE);
             mKeyguardView.onResume();
+            showPromptReason(mBouncerPromptReason);
             mKeyguardView.startAppearAnimation();
             mShowingSoon = false;
             mKeyguardView.sendAccessibilityEvent(AccessibilityEvent.TYPE_WINDOW_STATE_CHANGED);
         }
     };
 
+    /**
+     * Show a string explaining why the security view needs to be solved.
+     *
+     * @param reason a flag indicating which string should be shown, see
+     *               {@link KeyguardSecurityView#PROMPT_REASON_NONE}
+     *               and {@link KeyguardSecurityView#PROMPT_REASON_RESTART}
+     */
+    public void showPromptReason(int reason) {
+        mKeyguardView.showPromptReason(reason);
+    }
+
     private void cancelShowRunnable() {
         mChoreographer.removeCallbacks(Choreographer.CALLBACK_ANIMATION, mShowRunnable, null);
         mShowingSoon = false;
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
index 5ac436a..c30cb34 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
@@ -491,7 +491,7 @@
     }
 
     public void closeQs() {
-        cancelAnimation();
+        cancelQsAnimation();
         setQsExpansion(mQsMinExpansionHeight);
     }
 
@@ -508,7 +508,7 @@
     }
 
     public void openQs() {
-        cancelAnimation();
+        cancelQsAnimation();
         if (mQsExpansionEnabled) {
             setQsExpansion(mQsMaxExpansionHeight);
         }
@@ -921,7 +921,7 @@
 
     @Override
     public void onOverscrollTopChanged(float amount, boolean isRubberbanded) {
-        cancelAnimation();
+        cancelQsAnimation();
         if (!mQsExpansionEnabled) {
             amount = 0f;
         }
@@ -953,7 +953,8 @@
     }
 
     private void onQsExpansionStarted(int overscrollAmount) {
-        cancelAnimation();
+        cancelQsAnimation();
+        cancelHeightAnimator();
 
         // Reset scroll position and apply that position to the expanded height.
         float height = mQsExpansionHeight - mScrollView.getScrollY() - overscrollAmount;
@@ -1391,7 +1392,7 @@
         return mVelocityTracker.getYVelocity();
     }
 
-    private void cancelAnimation() {
+    private void cancelQsAnimation() {
         if (mQsExpansionAnimator != null) {
             mQsExpansionAnimator.cancel();
         }
@@ -1767,6 +1768,7 @@
         mIsExpansionFromHeadsUp = false;
         mNotificationStackScroller.setTrackingHeadsUp(false);
         mExpandingFromHeadsUp = false;
+        setPanelScrimMinFraction(0.0f);
     }
 
     private void setListening(boolean listening) {
@@ -2317,7 +2319,7 @@
         }
         x = Math.min(rightMost, Math.max(leftMost, x));
         setVerticalPanelTranslation(x -
-                (mNotificationStackScroller.getLeft() + mNotificationStackScroller.getWidth()/2));
+                (mNotificationStackScroller.getLeft() + mNotificationStackScroller.getWidth() / 2));
      }
 
     private void resetVerticalPanelPosition() {
@@ -2334,4 +2336,8 @@
         mNotificationStackScroller.setStackHeight(stackHeight);
         updateKeyguardBottomAreaAlpha();
     }
+
+    public void setPanelScrimMinFraction(float minFraction) {
+        mBar.panelScrimMinFractionChanged(minFraction);
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PanelBar.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PanelBar.java
index 552a0b2..cf553ec 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PanelBar.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PanelBar.java
@@ -25,7 +25,7 @@
 
 import java.util.ArrayList;
 
-public class PanelBar extends FrameLayout {
+public abstract class PanelBar extends FrameLayout {
     public static final boolean DEBUG = false;
     public static final String TAG = PanelBar.class.getSimpleName();
     public static final void LOG(String fmt, Object... args) {
@@ -156,6 +156,8 @@
         }
     }
 
+    public abstract void panelScrimMinFractionChanged(float minFraction);
+
     /**
      * @param panel the panel which changed its expansion state
      * @param frac the fraction from the expansion in [0, 1]
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PanelView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PanelView.java
index 9d4997c..094d5f0 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PanelView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PanelView.java
@@ -535,7 +535,7 @@
      */
     protected abstract boolean isInContentBounds(float x, float y);
 
-    private void cancelHeightAnimator() {
+    protected void cancelHeightAnimator() {
         if (mHeightAnimator != null) {
             mHeightAnimator.cancel();
         }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBar.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBar.java
index 69198ed..cd90d27 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBar.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBar.java
@@ -3460,6 +3460,7 @@
             mKeyguardIndicationController.setVisible(true);
             mNotificationPanel.resetViews();
             mKeyguardUserSwitcher.setKeyguard(true, fromShadeLocked);
+            mStatusBarView.removePendingHideExpandedRunnables();
         } else {
             mKeyguardIndicationController.setVisible(false);
             mKeyguardUserSwitcher.setKeyguard(false,
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBarView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBarView.java
index b7e675d..6a46924 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBarView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/PhoneStatusBarView.java
@@ -40,6 +40,14 @@
     PanelView mNotificationPanel;
     private final PhoneStatusBarTransitions mBarTransitions;
     private ScrimController mScrimController;
+    private float mMinFraction;
+    private float mPanelFraction;
+    private Runnable mHideExpandedRunnable = new Runnable() {
+        @Override
+        public void run() {
+            mBar.makeExpandedInvisible();
+        }
+    };
 
     public PhoneStatusBarView(Context context, AttributeSet attrs) {
         super(context, attrs);
@@ -116,15 +124,14 @@
                     + Log.getStackTraceString(new Throwable()));
         }
         // Close the status bar in the next frame so we can show the end of the animation.
-        postOnAnimation(new Runnable() {
-            @Override
-            public void run() {
-                mBar.makeExpandedInvisible();
-            }
-        });
+        postOnAnimation(mHideExpandedRunnable);
         mLastFullyOpenedPanel = null;
     }
 
+    public void removePendingHideExpandedRunnables() {
+        removeCallbacks(mHideExpandedRunnable);
+    }
+
     @Override
     public void onPanelFullyOpened(PanelView openPanel) {
         super.onPanelFullyOpened(openPanel);
@@ -180,8 +187,22 @@
     }
 
     @Override
+    public void panelScrimMinFractionChanged(float minFraction) {
+        if (mMinFraction != minFraction) {
+            mMinFraction = minFraction;
+            updateScrimFraction();
+        }
+    }
+
+    @Override
     public void panelExpansionChanged(PanelView panel, float frac, boolean expanded) {
         super.panelExpansionChanged(panel, frac, expanded);
-        mScrimController.setPanelExpansion(frac);
+        mPanelFraction = frac;
+        updateScrimFraction();
+    }
+
+    private void updateScrimFraction() {
+        float scrimFraction = Math.max(mPanelFraction - mMinFraction / (1.0f - mMinFraction), 0);
+        mScrimController.setPanelExpansion(scrimFraction);
     }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/AccessPointControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/AccessPointControllerImpl.java
index 0eb7197..d1e4963 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/AccessPointControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/AccessPointControllerImpl.java
@@ -116,7 +116,7 @@
             // Unknown network, need to add it.
             if (ap.getSecurity() != AccessPoint.SECURITY_NONE) {
                 Intent intent = new Intent(Settings.ACTION_WIFI_SETTINGS);
-                intent.putExtra(EXTRA_START_CONNECT_SSID, ap.getSsid());
+                intent.putExtra(EXTRA_START_CONNECT_SSID, ap.getSsidStr());
                 intent.addFlags(Intent.FLAG_ACTIVITY_NEW_TASK);
                 fireSettingsIntentCallback(intent);
                 return true;
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/NetworkControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/NetworkControllerImpl.java
index 18b5820..1ba87da 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/NetworkControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/NetworkControllerImpl.java
@@ -408,7 +408,7 @@
         boolean hasNoSims = mHasMobileDataFeature && mMobileSignalControllers.size() == 0;
         if (hasNoSims != mHasNoSims) {
             mHasNoSims = hasNoSims;
-            notifyListeners();
+            mCallbackHandler.setNoSims(mHasNoSims);
         }
     }
 
@@ -660,8 +660,8 @@
             }
             String nosim = args.getString("nosim");
             if (nosim != null) {
-                boolean show = nosim.equals("show");
-                mCallbackHandler.setNoSims(show);
+                mHasNoSims = nosim.equals("show");
+                mCallbackHandler.setNoSims(mHasNoSims);
             }
             String mobile = args.getString("mobile");
             if (mobile != null) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/stack/NotificationStackScrollLayout.java b/packages/SystemUI/src/com/android/systemui/statusbar/stack/NotificationStackScrollLayout.java
index 1bf4547..5700732 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/stack/NotificationStackScrollLayout.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/stack/NotificationStackScrollLayout.java
@@ -228,6 +228,7 @@
     private ScrimController mScrimController;
     private boolean mForceNoOverlappingRendering;
     private NotificationOverflowContainer mOverflowContainer;
+    private final ArrayList<Pair<ExpandableNotificationRow, Boolean>> mTmpList = new ArrayList<>();
 
     public NotificationStackScrollLayout(Context context) {
         this(context, null);
@@ -1608,7 +1609,7 @@
     }
 
     @Override
-    protected void onViewRemoved(View child) {
+    public void onViewRemoved(View child) {
         super.onViewRemoved(child);
         // we only call our internal methods if this is actually a removal and not just a
         // notification which becomes a child notification
@@ -1651,8 +1652,7 @@
      * @return Whether an animation was generated.
      */
     private boolean generateRemoveAnimation(View child) {
-        if (mAddedHeadsUpChildren.contains(child)) {
-            removeChildFromHeadsUpChangeAnimations(child);
+        if (removeRemovedChildFromHeadsUpChangeAnimations(child)) {
             mAddedHeadsUpChildren.remove(child);
             return false;
         }
@@ -1671,15 +1671,27 @@
         return false;
     }
 
-    private void removeChildFromHeadsUpChangeAnimations(View child) {
-        ArrayList<Pair<ExpandableNotificationRow, Boolean> > toRemove = new ArrayList<>();
+    /**
+     * Remove a removed child view from the heads up animations if it was just added there
+     *
+     * @return whether any child was removed from the list to animate
+     */
+    private boolean removeRemovedChildFromHeadsUpChangeAnimations(View child) {
+        boolean hasAddEvent = false;
         for (Pair<ExpandableNotificationRow, Boolean> eventPair : mHeadsUpChangeAnimations) {
             ExpandableNotificationRow row = eventPair.first;
+            boolean isHeadsUp = eventPair.second;
             if (child == row) {
-                toRemove.add(eventPair);
+                mTmpList.add(eventPair);
+                hasAddEvent |= isHeadsUp;
             }
         }
-        mHeadsUpChangeAnimations.removeAll(toRemove);
+        if (hasAddEvent) {
+            // This child was just added lets remove all events.
+            mHeadsUpChangeAnimations.removeAll(mTmpList);
+        }
+        mTmpList.clear();
+        return hasAddEvent;
     }
 
     /**
@@ -1745,7 +1757,7 @@
     }
 
     @Override
-    protected void onViewAdded(View child) {
+    public void onViewAdded(View child) {
         super.onViewAdded(child);
         onViewAddedInternal(child);
     }
diff --git a/packages/SystemUI/src/com/android/systemui/tuner/DemoModeFragment.java b/packages/SystemUI/src/com/android/systemui/tuner/DemoModeFragment.java
index d9f0598..ca6aaeb 100644
--- a/packages/SystemUI/src/com/android/systemui/tuner/DemoModeFragment.java
+++ b/packages/SystemUI/src/com/android/systemui/tuner/DemoModeFragment.java
@@ -131,11 +131,14 @@
         intent.putExtra("mobile", "show");
         intent.putExtra("sims", "1");
         intent.putExtra("nosim", "false");
-        intent.putExtra("fully", "true");
         intent.putExtra("level", "4");
         intent.putExtra("datatypel", "");
         getContext().sendBroadcast(intent);
 
+        // Need to send this after so that the sim controller already exists.
+        intent.putExtra("fully", "true");
+        getContext().sendBroadcast(intent);
+
         intent.putExtra(DemoMode.EXTRA_COMMAND, DemoMode.COMMAND_BATTERY);
         intent.putExtra("level", "100");
         intent.putExtra("plugged", "false");
diff --git a/packages/SystemUI/src/com/android/systemui/volume/Events.java b/packages/SystemUI/src/com/android/systemui/volume/Events.java
index 12dca94..893c939 100644
--- a/packages/SystemUI/src/com/android/systemui/volume/Events.java
+++ b/packages/SystemUI/src/com/android/systemui/volume/Events.java
@@ -16,11 +16,13 @@
 
 package com.android.systemui.volume;
 
+import android.content.Context;
 import android.media.AudioManager;
 import android.media.AudioSystem;
 import android.provider.Settings.Global;
 import android.util.Log;
 
+import com.android.internal.logging.MetricsLogger;
 import com.android.systemui.volume.VolumeDialogController.State;
 
 import java.util.Arrays;
@@ -47,6 +49,7 @@
     public static final int EVENT_ZEN_MODE_CHANGED = 13; // (mode|int)
     public static final int EVENT_SUPPRESSOR_CHANGED = 14;  // (component|string) (name|string)
     public static final int EVENT_MUTE_CHANGED = 15;  // (stream|int) (muted|bool)
+    public static final int EVENT_TOUCH_LEVEL_DONE = 16;  // (stream|int) (level|bool)
 
     private static final String[] EVENT_TAGS = {
         "show_dialog",
@@ -65,6 +68,7 @@
         "zen_mode_changed",
         "suppressor_changed",
         "mute_changed",
+        "touch_level_done",
     };
 
     public static final int DISMISS_REASON_UNKNOWN = 0;
@@ -100,36 +104,59 @@
 
     public static Callback sCallback;
 
-    public static void writeEvent(int tag, Object... list) {
+    public static void writeEvent(Context context, int tag, Object... list) {
         final long time = System.currentTimeMillis();
         final StringBuilder sb = new StringBuilder("writeEvent ").append(EVENT_TAGS[tag]);
         if (list != null && list.length > 0) {
             sb.append(" ");
             switch (tag) {
                 case EVENT_SHOW_DIALOG:
+                    MetricsLogger.visible(context, MetricsLogger.VOLUME_DIALOG);
+                    MetricsLogger.histogram(context, "volume_from_keyguard",
+                            (Boolean) list[1] ? 1 : 0);
                     sb.append(SHOW_REASONS[(Integer) list[0]]).append(" keyguard=").append(list[1]);
                     break;
                 case EVENT_EXPAND:
+                    MetricsLogger.visibility(context, MetricsLogger.VOLUME_DIALOG_DETAILS,
+                            (Boolean) list[0]);
                     sb.append(list[0]);
                     break;
                 case EVENT_DISMISS_DIALOG:
+                    MetricsLogger.hidden(context, MetricsLogger.VOLUME_DIALOG);
                     sb.append(DISMISS_REASONS[(Integer) list[0]]);
                     break;
                 case EVENT_ACTIVE_STREAM_CHANGED:
+                    MetricsLogger.action(context, MetricsLogger.ACTION_VOLUME_STREAM,
+                            (Integer) list[0]);
                     sb.append(AudioSystem.streamToString((Integer) list[0]));
                     break;
                 case EVENT_ICON_CLICK:
+                    MetricsLogger.action(context, MetricsLogger.ACTION_VOLUME_ICON,
+                            (Integer) list[1]);
                     sb.append(AudioSystem.streamToString((Integer) list[0])).append(' ')
                             .append(iconStateToString((Integer) list[1]));
                     break;
+                case EVENT_TOUCH_LEVEL_DONE:
+                    MetricsLogger.action(context, MetricsLogger.ACTION_VOLUME_SLIDER,
+                            (Integer) list[1]);
+                    // fall through
                 case EVENT_TOUCH_LEVEL_CHANGED:
                 case EVENT_LEVEL_CHANGED:
                 case EVENT_MUTE_CHANGED:
                     sb.append(AudioSystem.streamToString((Integer) list[0])).append(' ')
                             .append(list[1]);
                     break;
-                case EVENT_INTERNAL_RINGER_MODE_CHANGED:
+                case EVENT_KEY:
+                    MetricsLogger.action(context, MetricsLogger.ACTION_VOLUME_KEY,
+                            (Integer) list[1]);
+                    sb.append(AudioSystem.streamToString((Integer) list[0])).append(' ')
+                            .append(list[1]);
+                    break;
                 case EVENT_EXTERNAL_RINGER_MODE_CHANGED:
+                    MetricsLogger.action(context, MetricsLogger.ACTION_RINGER_MODE,
+                            (Integer) list[0]);
+                    // fall through
+                case EVENT_INTERNAL_RINGER_MODE_CHANGED:
                     sb.append(ringerModeToString((Integer) list[0]));
                     break;
                 case EVENT_ZEN_MODE_CHANGED:
diff --git a/packages/SystemUI/src/com/android/systemui/volume/VolumeDialog.java b/packages/SystemUI/src/com/android/systemui/volume/VolumeDialog.java
index aa891b6..5b2eb84 100644
--- a/packages/SystemUI/src/com/android/systemui/volume/VolumeDialog.java
+++ b/packages/SystemUI/src/com/android/systemui/volume/VolumeDialog.java
@@ -369,7 +369,7 @@
         row.icon.setOnClickListener(new OnClickListener() {
             @Override
             public void onClick(View v) {
-                Events.writeEvent(Events.EVENT_ICON_CLICK, row.stream, row.iconState);
+                Events.writeEvent(mContext, Events.EVENT_ICON_CLICK, row.stream, row.iconState);
                 mController.setActiveStream(row.stream);
                 if (row.stream == AudioManager.STREAM_RING) {
                     final boolean hasVibrator = mController.hasVibrator();
@@ -417,7 +417,7 @@
         if (mShowing) return;
         mShowing = true;
         mDialog.show();
-        Events.writeEvent(Events.EVENT_SHOW_DIALOG, reason, mKeyguard.isKeyguardLocked());
+        Events.writeEvent(mContext, Events.EVENT_SHOW_DIALOG, reason, mKeyguard.isKeyguardLocked());
         mController.notifyVisible(true);
     }
 
@@ -444,7 +444,7 @@
         if (!mShowing) return;
         mShowing = false;
         mDialog.dismiss();
-        Events.writeEvent(Events.EVENT_DISMISS_DIALOG, reason);
+        Events.writeEvent(mContext, Events.EVENT_DISMISS_DIALOG, reason);
         setExpandedH(false);
         mController.notifyVisible(false);
         synchronized (mSafetyWarningLock) {
@@ -834,7 +834,7 @@
         public void onClick(View v) {
             if (mExpanding) return;
             final boolean newExpand = !mExpanded;
-            Events.writeEvent(Events.EVENT_EXPAND, v);
+            Events.writeEvent(mContext, Events.EVENT_EXPAND, newExpand);
             setExpandedH(newExpand);
         }
     };
@@ -845,7 +845,7 @@
             mSettingsButton.postDelayed(new Runnable() {
                 @Override
                 public void run() {
-                    Events.writeEvent(Events.EVENT_SETTINGS_CLICK);
+                    Events.writeEvent(mContext, Events.EVENT_SETTINGS_CLICK);
                     if (mCallback != null) {
                         mCallback.onSettingsClicked();
                     }
@@ -933,7 +933,8 @@
                 if (mRow.requestedLevel != userLevel) {
                     mController.setStreamVolume(mRow.stream, userLevel);
                     mRow.requestedLevel = userLevel;
-                    Events.writeEvent(Events.EVENT_TOUCH_LEVEL_CHANGED, mRow.stream, userLevel);
+                    Events.writeEvent(mContext, Events.EVENT_TOUCH_LEVEL_CHANGED, mRow.stream,
+                            userLevel);
                 }
             }
         }
@@ -951,6 +952,7 @@
             mRow.tracking = false;
             mRow.userAttempt = SystemClock.uptimeMillis();
             int userLevel = getImpliedLevel(seekBar, seekBar.getProgress());
+            Events.writeEvent(mContext, Events.EVENT_TOUCH_LEVEL_DONE, mRow.stream, userLevel);
             if (mRow.ss.level != userLevel) {
                 mHandler.sendMessageDelayed(mHandler.obtainMessage(H.RECHECK, mRow),
                         USER_ATTEMPT_GRACE_PERIOD);
diff --git a/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogController.java b/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogController.java
index c6d9e46..9a59a2a 100644
--- a/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogController.java
+++ b/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogController.java
@@ -104,7 +104,7 @@
 
     public VolumeDialogController(Context context, ComponentName component) {
         mContext = context.getApplicationContext();
-        Events.writeEvent(Events.EVENT_COLLECTION_STARTED);
+        Events.writeEvent(mContext, Events.EVENT_COLLECTION_STARTED);
         mComponent = component;
         mWorkerThread = new HandlerThread(VolumeDialogController.class.getSimpleName());
         mWorkerThread.start();
@@ -168,7 +168,7 @@
         if (D.BUG) Log.d(TAG, "destroy");
         if (mDestroyed) return;
         mDestroyed = true;
-        Events.writeEvent(Events.EVENT_COLLECTION_STOPPED);
+        Events.writeEvent(mContext, Events.EVENT_COLLECTION_STOPPED);
         mMediaSessions.destroy();
         mObserver.destroy();
         mReceiver.destroy();
@@ -293,7 +293,8 @@
         if (showUI) {
             changed |= updateActiveStreamW(stream);
         }
-        changed |= updateStreamLevelW(stream, mAudio.getLastAudibleStreamVolume(stream));
+        int lastAudibleStreamVolume = mAudio.getLastAudibleStreamVolume(stream);
+        changed |= updateStreamLevelW(stream, lastAudibleStreamVolume);
         changed |= checkRoutedToBluetoothW(showUI ? AudioManager.STREAM_MUSIC : stream);
         if (changed) {
             mCallbacks.onStateChanged(mState);
@@ -308,14 +309,14 @@
             mCallbacks.onShowSilentHint();
         }
         if (changed && fromKey) {
-            Events.writeEvent(Events.EVENT_KEY);
+            Events.writeEvent(mContext, Events.EVENT_KEY, stream, lastAudibleStreamVolume);
         }
     }
 
     private boolean updateActiveStreamW(int activeStream) {
         if (activeStream == mState.activeStream) return false;
         mState.activeStream = activeStream;
-        Events.writeEvent(Events.EVENT_ACTIVE_STREAM_CHANGED, activeStream);
+        Events.writeEvent(mContext, Events.EVENT_ACTIVE_STREAM_CHANGED, activeStream);
         if (D.BUG) Log.d(TAG, "updateActiveStreamW " + activeStream);
         final int s = activeStream < DYNAMIC_STREAM_START_INDEX ? activeStream : -1;
         if (D.BUG) Log.d(TAG, "forceVolumeControlStream " + s);
@@ -364,7 +365,7 @@
         if (ss.level == level) return false;
         ss.level = level;
         if (isLogWorthy(stream)) {
-            Events.writeEvent(Events.EVENT_LEVEL_CHANGED, stream, level);
+            Events.writeEvent(mContext, Events.EVENT_LEVEL_CHANGED, stream, level);
         }
         return true;
     }
@@ -387,7 +388,7 @@
         if (ss.muted == muted) return false;
         ss.muted = muted;
         if (isLogWorthy(stream)) {
-            Events.writeEvent(Events.EVENT_MUTE_CHANGED, stream, muted);
+            Events.writeEvent(mContext, Events.EVENT_MUTE_CHANGED, stream, muted);
         }
         if (muted && isRinger(stream)) {
             updateRingerModeInternalW(mAudio.getRingerModeInternal());
@@ -410,7 +411,7 @@
         if (Objects.equals(mState.effectsSuppressor, effectsSuppressor)) return false;
         mState.effectsSuppressor = effectsSuppressor;
         mState.effectsSuppressorName = getApplicationName(mContext, mState.effectsSuppressor);
-        Events.writeEvent(Events.EVENT_SUPPRESSOR_CHANGED, mState.effectsSuppressor,
+        Events.writeEvent(mContext, Events.EVENT_SUPPRESSOR_CHANGED, mState.effectsSuppressor,
                 mState.effectsSuppressorName);
         return true;
     }
@@ -434,21 +435,21 @@
                 Settings.Global.ZEN_MODE, Settings.Global.ZEN_MODE_OFF);
         if (mState.zenMode == zen) return false;
         mState.zenMode = zen;
-        Events.writeEvent(Events.EVENT_ZEN_MODE_CHANGED, zen);
+        Events.writeEvent(mContext, Events.EVENT_ZEN_MODE_CHANGED, zen);
         return true;
     }
 
     private boolean updateRingerModeExternalW(int rm) {
         if (rm == mState.ringerModeExternal) return false;
         mState.ringerModeExternal = rm;
-        Events.writeEvent(Events.EVENT_EXTERNAL_RINGER_MODE_CHANGED, rm);
+        Events.writeEvent(mContext, Events.EVENT_EXTERNAL_RINGER_MODE_CHANGED, rm);
         return true;
     }
 
     private boolean updateRingerModeInternalW(int rm) {
         if (rm == mState.ringerModeInternal) return false;
         mState.ringerModeInternal = rm;
-        Events.writeEvent(Events.EVENT_INTERNAL_RINGER_MODE_CHANGED, rm);
+        Events.writeEvent(mContext, Events.EVENT_INTERNAL_RINGER_MODE_CHANGED, rm);
         return true;
     }
 
diff --git a/packages/VpnDialogs/AndroidManifest.xml b/packages/VpnDialogs/AndroidManifest.xml
index 32e1e6d..375c5d8 100644
--- a/packages/VpnDialogs/AndroidManifest.xml
+++ b/packages/VpnDialogs/AndroidManifest.xml
@@ -24,7 +24,7 @@
     <application android:label="VpnDialogs"
             android:allowBackup="false" >
         <activity android:name=".ConfirmDialog"
-                android:theme="@*android:style/Theme.Material.DayNight.Dialog.Alert">
+                android:theme="@*android:style/Theme.DeviceDefault.Light.Dialog.Alert">
             <intent-filter>
                 <action android:name="android.intent.action.MAIN"/>
                 <category android:name="android.intent.category.DEFAULT"/>
@@ -32,7 +32,7 @@
         </activity>
 
         <activity android:name=".ManageDialog"
-                android:theme="@*android:style/Theme.Material.DayNight.Dialog.Alert"
+                android:theme="@*android:style/Theme.DeviceDefault.Light.Dialog.Alert"
                 android:noHistory="true">
             <intent-filter>
                 <action android:name="android.intent.action.MAIN"/>
diff --git a/packages/WallpaperCropper/res/values/styles.xml b/packages/WallpaperCropper/res/values/styles.xml
index e438c84..a34b25a 100644
--- a/packages/WallpaperCropper/res/values/styles.xml
+++ b/packages/WallpaperCropper/res/values/styles.xml
@@ -15,13 +15,13 @@
 -->
 
 <resources>
-    <style name="Theme.WallpaperCropper" parent="@android:style/Theme.Material.DayNight">
+    <style name="Theme.WallpaperCropper" parent="@android:style/Theme.DeviceDefault">
         <item name="android:actionBarStyle">@style/WallpaperCropperActionBar</item>
         <item name="android:windowFullscreen">true</item>
         <item name="android:windowActionBarOverlay">true</item>
     </style>
 
-    <style name="WallpaperCropperActionBar" parent="@android:style/Widget.Material.ActionBar">
+    <style name="WallpaperCropperActionBar" parent="android:style/Widget.DeviceDefault.ActionBar">
         <item name="android:displayOptions">showCustom</item>
         <item name="android:background">#88000000</item>
     </style>
diff --git a/rs/java/android/renderscript/ScriptGroup.java b/rs/java/android/renderscript/ScriptGroup.java
index 82d9a2f..9000d4d 100644
--- a/rs/java/android/renderscript/ScriptGroup.java
+++ b/rs/java/android/renderscript/ScriptGroup.java
@@ -851,13 +851,13 @@
          * Returns the field ID
          */
 
-        public Script.FieldID getField() { return mField; }
+        Script.FieldID getField() { return mField; }
 
         /**
          * Returns the value
          */
 
-        public Object getValue() { return mValue; }
+        Object getValue() { return mValue; }
     }
 
     /**
diff --git a/services/appwidget/java/com/android/server/appwidget/AppWidgetServiceImpl.java b/services/appwidget/java/com/android/server/appwidget/AppWidgetServiceImpl.java
index 17d7078..30680ed 100644
--- a/services/appwidget/java/com/android/server/appwidget/AppWidgetServiceImpl.java
+++ b/services/appwidget/java/com/android/server/appwidget/AppWidgetServiceImpl.java
@@ -37,6 +37,7 @@
 import android.content.pm.IPackageManager;
 import android.content.pm.PackageInfo;
 import android.content.pm.PackageManager;
+import android.content.pm.ParceledListSlice;
 import android.content.pm.ResolveInfo;
 import android.content.pm.ServiceInfo;
 import android.content.pm.UserInfo;
@@ -1281,7 +1282,7 @@
     }
 
     @Override
-    public List<AppWidgetProviderInfo> getInstalledProvidersForProfile(int categoryFilter,
+    public ParceledListSlice<AppWidgetProviderInfo> getInstalledProvidersForProfile(int categoryFilter,
             int profileId) {
         final int userId = UserHandle.getCallingUserId();
 
@@ -1297,7 +1298,7 @@
         synchronized (mLock) {
             ensureGroupStateLoadedLocked(userId);
 
-            ArrayList<AppWidgetProviderInfo> result = null;
+            ArrayList<AppWidgetProviderInfo> result = new ArrayList<AppWidgetProviderInfo>();
 
             final int providerCount = mProviders.size();
             for (int i = 0; i < providerCount; i++) {
@@ -1314,14 +1315,11 @@
                 if (providerProfileId == profileId
                         && mSecurityPolicy.isProviderInCallerOrInProfileAndWhitelListed(
                             provider.id.componentName.getPackageName(), providerProfileId)) {
-                    if (result == null) {
-                        result = new ArrayList<>();
-                    }
                     result.add(cloneIfLocalBinder(info));
                 }
             }
 
-            return result;
+            return new ParceledListSlice<AppWidgetProviderInfo>(result);
         }
     }
 
diff --git a/services/core/java/com/android/server/AlarmManagerService.java b/services/core/java/com/android/server/AlarmManagerService.java
index 26ece72..839b87a 100644
--- a/services/core/java/com/android/server/AlarmManagerService.java
+++ b/services/core/java/com/android/server/AlarmManagerService.java
@@ -20,13 +20,16 @@
 import android.app.ActivityManager;
 import android.app.ActivityManagerNative;
 import android.app.AlarmManager;
+import android.app.BroadcastOptions;
 import android.app.IAlarmManager;
 import android.app.PendingIntent;
 import android.content.BroadcastReceiver;
+import android.content.ContentResolver;
 import android.content.Context;
 import android.content.Intent;
 import android.content.IntentFilter;
 import android.content.pm.PackageManager;
+import android.database.ContentObserver;
 import android.net.Uri;
 import android.os.Binder;
 import android.os.Bundle;
@@ -43,6 +46,7 @@
 import android.text.TextUtils;
 import android.text.format.DateFormat;
 import android.util.ArrayMap;
+import android.util.KeyValueListParser;
 import android.util.Log;
 import android.util.Slog;
 import android.util.SparseArray;
@@ -75,22 +79,6 @@
 import com.android.internal.util.LocalLog;
 
 class AlarmManagerService extends SystemService {
-    // The threshold for how long an alarm can be late before we print a
-    // warning message.  The time duration is in milliseconds.
-    private static final long LATE_ALARM_THRESHOLD = 10 * 1000;
-
-    // Minimum futurity of a new alarm
-    private static final long MIN_FUTURITY = 5 * 1000;  // 5 seconds, in millis
-
-    // Minimum alarm recurrence interval
-    private static final long MIN_INTERVAL = 60 * 1000;  // one minute, in millis
-
-    // Minimum time between ALLOW_WHILE_IDLE alarms when system is not idle.
-    private static final long ALLOW_WHILE_IDLE_SHORT_TIME = 60*1000;
-
-    // Minimum time between ALLOW_WHILE_IDLE alarms when system is idling.
-    private static final long ALLOW_WHILE_IDLE_LONG_TIME = 15*60*1000;
-
     private static final int RTC_WAKEUP_MASK = 1 << RTC_WAKEUP;
     private static final int RTC_MASK = 1 << RTC;
     private static final int ELAPSED_REALTIME_WAKEUP_MASK = 1 << ELAPSED_REALTIME_WAKEUP;
@@ -102,7 +90,6 @@
     static final int TYPE_NONWAKEUP_MASK = 0x1; // low bit => non-wakeup
 
     static final String TAG = "AlarmManager";
-    static final String ClockReceiver_TAG = "ClockReceiver";
     static final boolean localLOGV = false;
     static final boolean DEBUG_BATCH = localLOGV || false;
     static final boolean DEBUG_VALIDATE = localLOGV || false;
@@ -148,7 +135,7 @@
     long mNextNonWakeupDeliveryTime;
     long mLastTimeChangeClockTime;
     long mLastTimeChangeRealtime;
-    long mAllowWhileIdleMinTime = ALLOW_WHILE_IDLE_SHORT_TIME;
+    long mAllowWhileIdleMinTime;
     int mNumTimeChanged;
 
     /**
@@ -157,6 +144,11 @@
      */
     final SparseLongArray mLastAllowWhileIdleDispatch = new SparseLongArray();
 
+    /**
+     * Broadcast options to use for FLAG_ALLOW_WHILE_IDLE.
+     */
+    Bundle mIdleOptions;
+
     private final SparseArray<AlarmManager.AlarmClockInfo> mNextAlarmClockForUser =
             new SparseArray<>();
     private final SparseArray<AlarmManager.AlarmClockInfo> mTmpSparseAlarmClockArray =
@@ -169,12 +161,137 @@
     private final SparseArray<AlarmManager.AlarmClockInfo> mHandlerSparseAlarmClockArray =
             new SparseArray<>();
 
+    /**
+     * All times are in milliseconds. These constants are kept synchronized with the system
+     * global Settings. Any access to this class or its fields should be done while
+     * holding the AlarmManagerService.mLock lock.
+     */
+    private final class Constants extends ContentObserver {
+        // Key names stored in the settings value.
+        private static final String KEY_MIN_FUTURITY = "min_futurity";
+        private static final String KEY_MIN_INTERVAL = "min_interval";
+        private static final String KEY_ALLOW_WHILE_IDLE_SHORT_TIME = "allow_while_idle_short_time";
+        private static final String KEY_ALLOW_WHILE_IDLE_LONG_TIME = "allow_while_idle_long_time";
+        private static final String KEY_ALLOW_WHILE_IDLE_WHITELIST_DURATION
+                = "allow_while_idle_whitelist_duration";
+
+        private static final long DEFAULT_MIN_FUTURITY = 5 * 1000;
+        private static final long DEFAULT_MIN_INTERVAL = 60 * 1000;
+        private static final long DEFAULT_ALLOW_WHILE_IDLE_SHORT_TIME = 60*1000;
+        private static final long DEFAULT_ALLOW_WHILE_IDLE_LONG_TIME = 15*60*1000;
+        private static final long DEFAULT_ALLOW_WHILE_IDLE_WHITELIST_DURATION = 10*1000;
+
+        // Minimum futurity of a new alarm
+        public long MIN_FUTURITY = DEFAULT_MIN_FUTURITY;
+
+        // Minimum alarm recurrence interval
+        public long MIN_INTERVAL = DEFAULT_MIN_INTERVAL;
+
+        // Minimum time between ALLOW_WHILE_IDLE alarms when system is not idle.
+        public long ALLOW_WHILE_IDLE_SHORT_TIME = DEFAULT_ALLOW_WHILE_IDLE_SHORT_TIME;
+
+        // Minimum time between ALLOW_WHILE_IDLE alarms when system is idling.
+        public long ALLOW_WHILE_IDLE_LONG_TIME = DEFAULT_ALLOW_WHILE_IDLE_LONG_TIME;
+
+        // BroadcastOptions.setTemporaryAppWhitelistDuration() to use for FLAG_ALLOW_WHILE_IDLE.
+        public long ALLOW_WHILE_IDLE_WHITELIST_DURATION
+                = DEFAULT_ALLOW_WHILE_IDLE_WHITELIST_DURATION;
+
+        private ContentResolver mResolver;
+        private final KeyValueListParser mParser = new KeyValueListParser(',');
+        private long mLastAllowWhileIdleWhitelistDuration = -1;
+
+        public Constants(Handler handler) {
+            super(handler);
+            updateAllowWhileIdleMinTimeLocked();
+            updateAllowWhileIdleWhitelistDurationLocked();
+        }
+
+        public void start(ContentResolver resolver) {
+            mResolver = resolver;
+            mResolver.registerContentObserver(Settings.Global.getUriFor(
+                    Settings.Global.ALARM_MANAGER_CONSTANTS), false, this);
+            updateConstants();
+        }
+
+        public void updateAllowWhileIdleMinTimeLocked() {
+            mAllowWhileIdleMinTime = mPendingIdleUntil != null
+                    ? ALLOW_WHILE_IDLE_LONG_TIME : ALLOW_WHILE_IDLE_SHORT_TIME;
+        }
+
+        public void updateAllowWhileIdleWhitelistDurationLocked() {
+            if (mLastAllowWhileIdleWhitelistDuration != ALLOW_WHILE_IDLE_WHITELIST_DURATION) {
+                mLastAllowWhileIdleWhitelistDuration = ALLOW_WHILE_IDLE_WHITELIST_DURATION;
+                BroadcastOptions opts = BroadcastOptions.makeBasic();
+                opts.setTemporaryAppWhitelistDuration(ALLOW_WHILE_IDLE_WHITELIST_DURATION);
+                mIdleOptions = opts.toBundle();
+            }
+        }
+
+        @Override
+        public void onChange(boolean selfChange, Uri uri) {
+            updateConstants();
+        }
+
+        private void updateConstants() {
+            synchronized (mLock) {
+                try {
+                    mParser.setString(Settings.Global.getString(mResolver,
+                            Settings.Global.ALARM_MANAGER_CONSTANTS));
+                } catch (IllegalArgumentException e) {
+                    // Failed to parse the settings string, log this and move on
+                    // with defaults.
+                    Slog.e(TAG, "Bad device idle settings", e);
+                }
+
+                MIN_FUTURITY = mParser.getLong(KEY_MIN_FUTURITY, DEFAULT_MIN_FUTURITY);
+                MIN_INTERVAL = mParser.getLong(KEY_MIN_INTERVAL, DEFAULT_MIN_INTERVAL);
+                ALLOW_WHILE_IDLE_SHORT_TIME = mParser.getLong(KEY_ALLOW_WHILE_IDLE_SHORT_TIME,
+                        DEFAULT_ALLOW_WHILE_IDLE_SHORT_TIME);
+                ALLOW_WHILE_IDLE_LONG_TIME = mParser.getLong(KEY_ALLOW_WHILE_IDLE_LONG_TIME,
+                        DEFAULT_ALLOW_WHILE_IDLE_LONG_TIME);
+                ALLOW_WHILE_IDLE_WHITELIST_DURATION = mParser.getLong(
+                        KEY_ALLOW_WHILE_IDLE_WHITELIST_DURATION,
+                        DEFAULT_ALLOW_WHILE_IDLE_WHITELIST_DURATION);
+
+                updateAllowWhileIdleMinTimeLocked();
+                updateAllowWhileIdleWhitelistDurationLocked();
+            }
+        }
+
+        void dump(PrintWriter pw) {
+            pw.println("  Settings:");
+
+            pw.print("    "); pw.print(KEY_MIN_FUTURITY); pw.print("=");
+            TimeUtils.formatDuration(MIN_FUTURITY, pw);
+            pw.println();
+
+            pw.print("    "); pw.print(KEY_MIN_INTERVAL); pw.print("=");
+            TimeUtils.formatDuration(MIN_INTERVAL, pw);
+            pw.println();
+
+            pw.print("    "); pw.print(KEY_ALLOW_WHILE_IDLE_SHORT_TIME); pw.print("=");
+            TimeUtils.formatDuration(ALLOW_WHILE_IDLE_SHORT_TIME, pw);
+            pw.println();
+
+            pw.print("    "); pw.print(KEY_ALLOW_WHILE_IDLE_LONG_TIME); pw.print("=");
+            TimeUtils.formatDuration(ALLOW_WHILE_IDLE_LONG_TIME, pw);
+            pw.println();
+
+            pw.print("    "); pw.print(KEY_ALLOW_WHILE_IDLE_WHITELIST_DURATION); pw.print("=");
+            TimeUtils.formatDuration(ALLOW_WHILE_IDLE_WHITELIST_DURATION, pw);
+            pw.println();
+        }
+    }
+
+    final Constants mConstants;
+
     // Alarm delivery ordering bookkeeping
     static final int PRIO_TICK = 0;
     static final int PRIO_WAKEUP = 1;
     static final int PRIO_NORMAL = 2;
 
-    class PriorityClass {
+    final class PriorityClass {
         int seq;
         int priority;
 
@@ -184,11 +301,10 @@
         }
     }
 
-    final HashMap<String, PriorityClass> mPriorities =
-            new HashMap<String, PriorityClass>();
+    final HashMap<String, PriorityClass> mPriorities = new HashMap<>();
     int mCurrentSeq = 0;
 
-    class WakeupEvent {
+    static final class WakeupEvent {
         public long when;
         public int uid;
         public String action;
@@ -482,6 +598,7 @@
 
     public AlarmManagerService(Context context) {
         super(context);
+        mConstants = new Constants(mHandler);
     }
 
     static long convertToElapsed(long when, int type) {
@@ -595,7 +712,7 @@
         }
 
         // Make sure we are using the correct ALLOW_WHILE_IDLE min time.
-        mAllowWhileIdleMinTime = ALLOW_WHILE_IDLE_SHORT_TIME;
+        mConstants.updateAllowWhileIdleMinTimeLocked();
 
         // Reschedule everything.
         rescheduleKernelAlarmsLocked();
@@ -714,6 +831,13 @@
     }
 
     @Override
+    public void onBootPhase(int phase) {
+        if (phase == PHASE_SYSTEM_SERVICES_READY) {
+            mConstants.start(getContext().getContentResolver());
+        }
+    }
+
+    @Override
     protected void finalize() throws Throwable {
         try {
             close(mNativeData);
@@ -784,11 +908,12 @@
 
         // Sanity check the recurrence interval.  This will catch people who supply
         // seconds when the API expects milliseconds.
-        if (interval > 0 && interval < MIN_INTERVAL) {
+        final long minInterval = mConstants.MIN_INTERVAL;
+        if (interval > 0 && interval < minInterval) {
             Slog.w(TAG, "Suspiciously short interval " + interval
-                    + " millis; expanding to " + (int)(MIN_INTERVAL/1000)
+                    + " millis; expanding to " + (minInterval/1000)
                     + " seconds");
-            interval = MIN_INTERVAL;
+            interval = minInterval;
         }
 
         if (type < RTC_WAKEUP || type > ELAPSED_REALTIME) {
@@ -805,7 +930,7 @@
         final long nowElapsed = SystemClock.elapsedRealtime();
         final long nominalTrigger = convertToElapsed(triggerAtTime, type);
         // Try to prevent spamming by making sure we aren't firing alarms in the immediate future
-        final long minTrigger = nowElapsed + MIN_FUTURITY;
+        final long minTrigger = nowElapsed + mConstants.MIN_FUTURITY;
         final long triggerElapsed = (nominalTrigger > minTrigger) ? nominalTrigger : minTrigger;
 
         final long maxElapsed;
@@ -904,7 +1029,7 @@
 
         if ((a.flags&AlarmManager.FLAG_IDLE_UNTIL) != 0) {
             mPendingIdleUntil = a;
-            mAllowWhileIdleMinTime = ALLOW_WHILE_IDLE_LONG_TIME;
+            mConstants.updateAllowWhileIdleMinTimeLocked();
             needRebatch = true;
         } else if ((a.flags&AlarmManager.FLAG_WAKE_FROM_IDLE) != 0) {
             if (mNextWakeFromIdle == null || mNextWakeFromIdle.whenElapsed > a.whenElapsed) {
@@ -1054,45 +1179,48 @@
     void dumpImpl(PrintWriter pw) {
         synchronized (mLock) {
             pw.println("Current Alarm Manager state:");
+            mConstants.dump(pw);
+            pw.println();
+
             final long nowRTC = System.currentTimeMillis();
             final long nowELAPSED = SystemClock.elapsedRealtime();
             SimpleDateFormat sdf = new SimpleDateFormat("yyyy-MM-dd HH:mm:ss");
 
-            pw.print("nowRTC="); pw.print(nowRTC);
+            pw.print("  nowRTC="); pw.print(nowRTC);
             pw.print("="); pw.print(sdf.format(new Date(nowRTC)));
             pw.print(" nowELAPSED="); TimeUtils.formatDuration(nowELAPSED, pw);
             pw.println();
-            pw.print("mLastTimeChangeClockTime="); pw.print(mLastTimeChangeClockTime);
+            pw.print("  mLastTimeChangeClockTime="); pw.print(mLastTimeChangeClockTime);
             pw.print("="); pw.println(sdf.format(new Date(mLastTimeChangeClockTime)));
-            pw.print("mLastTimeChangeRealtime=");
+            pw.print("  mLastTimeChangeRealtime=");
             TimeUtils.formatDuration(mLastTimeChangeRealtime, pw);
             pw.println();
             if (!mInteractive) {
-                pw.print("Time since non-interactive: ");
+                pw.print("  Time since non-interactive: ");
                 TimeUtils.formatDuration(nowELAPSED - mNonInteractiveStartTime, pw);
                 pw.println();
-                pw.print("Max wakeup delay: ");
+                pw.print("  Max wakeup delay: ");
                 TimeUtils.formatDuration(currentNonWakeupFuzzLocked(nowELAPSED), pw);
                 pw.println();
-                pw.print("Time since last dispatch: ");
+                pw.print("  Time since last dispatch: ");
                 TimeUtils.formatDuration(nowELAPSED - mLastAlarmDeliveryTime, pw);
                 pw.println();
-                pw.print("Next non-wakeup delivery time: ");
+                pw.print("  Next non-wakeup delivery time: ");
                 TimeUtils.formatDuration(nowELAPSED - mNextNonWakeupDeliveryTime, pw);
                 pw.println();
             }
 
             long nextWakeupRTC = mNextWakeup + (nowRTC - nowELAPSED);
             long nextNonWakeupRTC = mNextNonWakeup + (nowRTC - nowELAPSED);
-            pw.print("Next non-wakeup alarm: ");
+            pw.print("  Next non-wakeup alarm: ");
                     TimeUtils.formatDuration(mNextNonWakeup, nowELAPSED, pw);
                     pw.print(" = "); pw.println(sdf.format(new Date(nextNonWakeupRTC)));
-            pw.print("Next wakeup: "); TimeUtils.formatDuration(mNextWakeup, nowELAPSED, pw);
+            pw.print("  Next wakeup: "); TimeUtils.formatDuration(mNextWakeup, nowELAPSED, pw);
                     pw.print(" = "); pw.println(sdf.format(new Date(nextWakeupRTC)));
-            pw.print("Num time change events: "); pw.println(mNumTimeChanged);
+            pw.print("  Num time change events: "); pw.println(mNumTimeChanged);
 
             pw.println();
-            pw.println("Next alarm clock information: ");
+            pw.println("  Next alarm clock information: ");
             final TreeSet<Integer> users = new TreeSet<>();
             for (int i = 0; i < mNextAlarmClockForUser.size(); i++) {
                 users.add(mNextAlarmClockForUser.keyAt(i));
@@ -1104,7 +1232,7 @@
                 final AlarmManager.AlarmClockInfo next = mNextAlarmClockForUser.get(user);
                 final long time = next != null ? next.getTriggerTime() : 0;
                 final boolean pendingSend = mPendingSendNextAlarmClockChangedForUser.get(user);
-                pw.print("  user:"); pw.print(user);
+                pw.print("    user:"); pw.print(user);
                 pw.print(" pendingSend:"); pw.print(pendingSend);
                 pw.print(" time:"); pw.print(time);
                 if (time > 0) {
@@ -1115,25 +1243,25 @@
             }
             if (mAlarmBatches.size() > 0) {
                 pw.println();
-                pw.print("Pending alarm batches: ");
+                pw.print("  Pending alarm batches: ");
                 pw.println(mAlarmBatches.size());
                 for (Batch b : mAlarmBatches) {
                     pw.print(b); pw.println(':');
-                    dumpAlarmList(pw, b.alarms, "  ", nowELAPSED, nowRTC, sdf);
+                    dumpAlarmList(pw, b.alarms, "    ", nowELAPSED, nowRTC, sdf);
                 }
             }
             if (mPendingIdleUntil != null || mPendingWhileIdleAlarms.size() > 0) {
                 pw.println();
-                pw.println("Idle mode state:");
-                pw.print("  Idling until: ");
+                pw.println("    Idle mode state:");
+                pw.print("      Idling until: ");
                 if (mPendingIdleUntil != null) {
                     pw.println(mPendingIdleUntil);
                     mPendingIdleUntil.dump(pw, "    ", nowRTC, nowELAPSED, sdf);
                 } else {
                     pw.println("null");
                 }
-                pw.println("  Pending alarms:");
-                dumpAlarmList(pw, mPendingWhileIdleAlarms, "    ", nowELAPSED, nowRTC, sdf);
+                pw.println("      Pending alarms:");
+                dumpAlarmList(pw, mPendingWhileIdleAlarms, "      ", nowELAPSED, nowRTC, sdf);
             }
             if (mNextWakeFromIdle != null) {
                 pw.println();
@@ -1142,17 +1270,17 @@
             }
 
             pw.println();
-            pw.print("Past-due non-wakeup alarms: ");
+            pw.print("  Past-due non-wakeup alarms: ");
             if (mPendingNonWakeupAlarms.size() > 0) {
                 pw.println(mPendingNonWakeupAlarms.size());
-                dumpAlarmList(pw, mPendingNonWakeupAlarms, "  ", nowELAPSED, nowRTC, sdf);
+                dumpAlarmList(pw, mPendingNonWakeupAlarms, "    ", nowELAPSED, nowRTC, sdf);
             } else {
                 pw.println("(none)");
             }
-            pw.print("  Number of delayed alarms: "); pw.print(mNumDelayedAlarms);
+            pw.print("    Number of delayed alarms: "); pw.print(mNumDelayedAlarms);
             pw.print(", total delay time: "); TimeUtils.formatDuration(mTotalDelayTime, pw);
             pw.println();
-            pw.print("  Max delay time: "); TimeUtils.formatDuration(mMaxDelayTime, pw);
+            pw.print("    Max delay time: "); TimeUtils.formatDuration(mMaxDelayTime, pw);
             pw.print(", max non-interactive time: ");
             TimeUtils.formatDuration(mNonInteractiveTime, pw);
             pw.println();
@@ -1161,11 +1289,11 @@
             pw.print("  Broadcast ref count: "); pw.println(mBroadcastRefCount);
             pw.println();
 
-            pw.print("mAllowWhileIdleMinTime=");
+            pw.print("  mAllowWhileIdleMinTime=");
             TimeUtils.formatDuration(mAllowWhileIdleMinTime, pw);
             pw.println();
             if (mLastAllowWhileIdleDispatch.size() > 0) {
-                pw.println("Last allow while idle dispatch times:");
+                pw.println("  Last allow while idle dispatch times:");
                 for (int i=0; i<mLastAllowWhileIdleDispatch.size(); i++) {
                     pw.print("  UID ");
                     UserHandle.formatUid(pw, mLastAllowWhileIdleDispatch.keyAt(i));
@@ -1969,6 +2097,7 @@
         mLastAlarmDeliveryTime = nowELAPSED;
         for (int i=0; i<triggerList.size(); i++) {
             Alarm alarm = triggerList.get(i);
+            final boolean allowWhileIdle = (alarm.flags&AlarmManager.FLAG_ALLOW_WHILE_IDLE) != 0;
             try {
                 if (localLOGV) {
                     Slog.v(TAG, "sending alarm " + alarm);
@@ -1987,7 +2116,7 @@
                 alarm.operation.send(getContext(), 0,
                         mBackgroundIntent.putExtra(
                                 Intent.EXTRA_ALARM_COUNT, alarm.count),
-                        mResultReceiver, mHandler);
+                        mResultReceiver, mHandler, null, allowWhileIdle ? mIdleOptions : null);
 
                 // we have an active broadcast so stay awake.
                 if (mBroadcastRefCount == 0) {
@@ -2000,7 +2129,7 @@
                 mInFlight.add(inflight);
                 mBroadcastRefCount++;
 
-                if ((alarm.flags&AlarmManager.FLAG_ALLOW_WHILE_IDLE) != 0) {
+                if (allowWhileIdle) {
                     // Record the last time this uid handled an ALLOW_WHILE_IDLE alarm.
                     mLastAllowWhileIdleDispatch.put(alarm.uid, nowELAPSED);
                 }
diff --git a/services/core/java/com/android/server/BluetoothManagerService.java b/services/core/java/com/android/server/BluetoothManagerService.java
index fbb6dc9..f9f6714 100644
--- a/services/core/java/com/android/server/BluetoothManagerService.java
+++ b/services/core/java/com/android/server/BluetoothManagerService.java
@@ -237,6 +237,12 @@
                         sendEnableMsg(mQuietEnableExternal);
                     }
                 }
+
+                if (!isNameAndAddressSet()) {
+                    // Sync the Bluetooth name and address from the Bluetooth Adapter
+                    if (DBG) Log.d(TAG,"Retrieving Bluetooth Adapter name and address...");
+                    getNameAndAddress();
+                }
             }
         }
     };
diff --git a/services/core/java/com/android/server/ConnectivityService.java b/services/core/java/com/android/server/ConnectivityService.java
index 82399da..98f0b45 100644
--- a/services/core/java/com/android/server/ConnectivityService.java
+++ b/services/core/java/com/android/server/ConnectivityService.java
@@ -136,11 +136,13 @@
 import java.io.IOException;
 import java.io.PrintWriter;
 import java.net.Inet4Address;
+import java.net.Inet6Address;
 import java.net.InetAddress;
 import java.net.UnknownHostException;
 import java.util.ArrayList;
 import java.util.Arrays;
 import java.util.Collection;
+import java.util.Collections;
 import java.util.HashMap;
 import java.util.HashSet;
 import java.util.Iterator;
@@ -3920,10 +3922,52 @@
         }
         return !routeDiff.added.isEmpty() || !routeDiff.removed.isEmpty();
     }
+
+    // TODO: investigate moving this into LinkProperties, if only to make more accurate
+    // the isProvisioned() checks.
+    private static Collection<InetAddress> getLikelyReachableDnsServers(LinkProperties lp) {
+        final ArrayList<InetAddress> dnsServers = new ArrayList<InetAddress>();
+        final List<RouteInfo> allRoutes = lp.getAllRoutes();
+        for (InetAddress nameserver : lp.getDnsServers()) {
+            // If the LinkProperties doesn't include a route to the nameserver, ignore it.
+            final RouteInfo bestRoute = RouteInfo.selectBestRoute(allRoutes, nameserver);
+            if (bestRoute == null) {
+                continue;
+            }
+
+            // TODO: better source address evaluation for destination addresses.
+            if (nameserver instanceof Inet4Address) {
+                if (!lp.hasIPv4Address()) {
+                    continue;
+                }
+            } else if (nameserver instanceof Inet6Address) {
+                if (nameserver.isLinkLocalAddress()) {
+                    if (((Inet6Address)nameserver).getScopeId() == 0) {
+                        // For now, just make sure link-local DNS servers have
+                        // scopedIds set, since DNS lookups will fail otherwise.
+                        // TODO: verify the scopeId matches that of lp's interface.
+                        continue;
+                    }
+                }  else {
+                    if (bestRoute.isIPv6Default() && !lp.hasGlobalIPv6Address()) {
+                        // TODO: reconsider all corner cases (disconnected ULA networks, ...).
+                        continue;
+                    }
+                }
+            }
+
+            dnsServers.add(nameserver);
+        }
+        return Collections.unmodifiableList(dnsServers);
+    }
+
     private void updateDnses(LinkProperties newLp, LinkProperties oldLp, int netId,
                              boolean flush, boolean useDefaultDns) {
+        // TODO: consider comparing the getLikelyReachableDnsServers() lists, in case the
+        // route to a DNS server has been removed (only really applicable in special cases
+        // where there is no default route).
         if (oldLp == null || (newLp.isIdenticalDnses(oldLp) == false)) {
-            Collection<InetAddress> dnses = newLp.getDnsServers();
+            Collection<InetAddress> dnses = getLikelyReachableDnsServers(newLp);
             if (dnses.size() == 0 && mDefaultDns != null && useDefaultDns) {
                 dnses = new ArrayList();
                 dnses.add(mDefaultDns);
diff --git a/services/core/java/com/android/server/DeviceIdleController.java b/services/core/java/com/android/server/DeviceIdleController.java
index 6eba3f6..82b334a 100644
--- a/services/core/java/com/android/server/DeviceIdleController.java
+++ b/services/core/java/com/android/server/DeviceIdleController.java
@@ -19,7 +19,6 @@
 import android.Manifest;
 import android.app.ActivityManagerNative;
 import android.app.AlarmManager;
-import android.app.AppGlobals;
 import android.app.PendingIntent;
 import android.content.BroadcastReceiver;
 import android.content.ContentResolver;
@@ -27,7 +26,6 @@
 import android.content.Intent;
 import android.content.IntentFilter;
 import android.content.pm.ApplicationInfo;
-import android.content.pm.PackageInfo;
 import android.content.pm.PackageManager;
 import android.content.pm.PackageManager.NameNotFoundException;
 import android.database.ContentObserver;
@@ -47,6 +45,7 @@
 import android.os.Message;
 import android.os.PowerManager;
 import android.os.PowerManagerInternal;
+import android.os.Process;
 import android.os.RemoteException;
 import android.os.ServiceManager;
 import android.os.SystemClock;
@@ -101,10 +100,6 @@
     private static final String ACTION_ENTER_INACTIVE_STATE =
         "com.android.server.device_idle.ENTER_INACTIVE_STATE";
 
-    // TODO: These need to be moved to system settings.
-
-
-
     private AlarmManager mAlarmManager;
     private IBatteryStats mBatteryStats;
     private PowerManagerInternal mLocalPowerManager;
@@ -180,7 +175,7 @@
      * List of end times for UIDs that are temporarily marked as being allowed to access
      * the network and acquire wakelocks. Times are in milliseconds.
      */
-    private SparseLongArray mTempWhitelistAppIdEndTimes = new SparseLongArray();
+    private final SparseLongArray mTempWhitelistAppIdEndTimes = new SparseLongArray();
 
     /**
      * Current app IDs of temporarily whitelist apps for high-priority messages.
@@ -234,7 +229,7 @@
      * global Settings. Any access to this class or its fields should be done while
      * holding the DeviceIdleController lock.
      */
-    private class Constants extends ContentObserver {
+    private final class Constants extends ContentObserver {
         // Key names stored in the settings value.
         private static final String KEY_INACTIVE_TIMEOUT = "inactive_to";
         private static final String KEY_SENSING_TIMEOUT = "sensing_to";
@@ -403,49 +398,49 @@
         void dump(PrintWriter pw) {
             pw.println("  Settings:");
 
-            pw.print("    DOZE_INACTIVE_TIMEOUT=");
+            pw.print("    "); pw.print(KEY_INACTIVE_TIMEOUT); pw.print("=");
             TimeUtils.formatDuration(INACTIVE_TIMEOUT, pw);
             pw.println();
 
-            pw.print("    DOZE_SENSING_TIMEOUT=");
+            pw.print("    "); pw.print(KEY_SENSING_TIMEOUT); pw.print("=");
             TimeUtils.formatDuration(SENSING_TIMEOUT, pw);
             pw.println();
 
-            pw.print("    DOZE_MOTION_INACTIVE_TIMEOUT=");
+            pw.print("    "); pw.print(KEY_MOTION_INACTIVE_TIMEOUT); pw.print("=");
             TimeUtils.formatDuration(MOTION_INACTIVE_TIMEOUT, pw);
             pw.println();
 
-            pw.print("    DOZE_IDLE_AFTER_INACTIVE_TIMEOUT=");
+            pw.print("    "); pw.print(KEY_IDLE_AFTER_INACTIVE_TIMEOUT); pw.print("=");
             TimeUtils.formatDuration(IDLE_AFTER_INACTIVE_TIMEOUT, pw);
             pw.println();
 
-            pw.print("    DOZE_IDLE_PENDING_TIMEOUT=");
+            pw.print("    "); pw.print(KEY_IDLE_PENDING_TIMEOUT); pw.print("=");
             TimeUtils.formatDuration(IDLE_PENDING_TIMEOUT, pw);
             pw.println();
 
-            pw.print("    DOZE_MAX_IDLE_PENDING_TIMEOUT=");
+            pw.print("    "); pw.print(KEY_MAX_IDLE_PENDING_TIMEOUT); pw.print("=");
             TimeUtils.formatDuration(MAX_IDLE_PENDING_TIMEOUT, pw);
             pw.println();
 
-            pw.print("    DOZE_IDLE_PENDING_FACTOR=");
+            pw.print("    "); pw.print(KEY_IDLE_PENDING_FACTOR); pw.print("=");
             pw.println(IDLE_PENDING_FACTOR);
 
-            pw.print("    DOZE_IDLE_TIMEOUT=");
+            pw.print("    "); pw.print(KEY_IDLE_TIMEOUT); pw.print("=");
             TimeUtils.formatDuration(IDLE_TIMEOUT, pw);
             pw.println();
 
-            pw.print("    DOZE_MAX_IDLE_TIMEOUT=");
+            pw.print("    "); pw.print(KEY_MAX_IDLE_TIMEOUT); pw.print("=");
             TimeUtils.formatDuration(MAX_IDLE_TIMEOUT, pw);
             pw.println();
 
-            pw.print("    DOZE_IDLE_FACTOR=");
+            pw.print("    "); pw.print(KEY_IDLE_FACTOR); pw.print("=");
             pw.println(IDLE_FACTOR);
 
-            pw.print("    DOZE_MIN_TIME_TO_ALARM=");
+            pw.print("    "); pw.print(KEY_MIN_TIME_TO_ALARM); pw.print("=");
             TimeUtils.formatDuration(MIN_TIME_TO_ALARM, pw);
             pw.println();
 
-            pw.print("    DOZE_MAX_TEMP_APP_WHITELIST_DURATION=");
+            pw.print("    "); pw.print(KEY_MAX_TEMP_APP_WHITELIST_DURATION); pw.print("=");
             TimeUtils.formatDuration(MAX_TEMP_APP_WHITELIST_DURATION, pw);
             pw.println();
         }
@@ -465,6 +460,7 @@
             } else if (result == AnyMotionDetector.RESULT_MOVED) {
                 if (DEBUG) Slog.d(TAG, "RESULT_MOVED received.");
                 synchronized (this) {
+                    EventLogTags.writeDeviceIdle(mState, "sense_moved");
                     enterInactiveStateLocked();
                 }
             }
@@ -492,7 +488,7 @@
                     mLocalPowerManager.setDeviceIdleMode(true);
                     try {
                         mNetworkPolicyManager.setDeviceIdleMode(true);
-                        mBatteryStats.noteDeviceIdleMode(true, false, false);
+                        mBatteryStats.noteDeviceIdleMode(true, null, Process.myUid());
                     } catch (RemoteException e) {
                     }
                     getContext().sendBroadcastAsUser(mIdleIntent, UserHandle.ALL);
@@ -501,18 +497,19 @@
                     mLocalPowerManager.setDeviceIdleMode(false);
                     try {
                         mNetworkPolicyManager.setDeviceIdleMode(false);
-                        mBatteryStats.noteDeviceIdleMode(false, false, false);
+                        mBatteryStats.noteDeviceIdleMode(false, null, Process.myUid());
                     } catch (RemoteException e) {
                     }
                     getContext().sendBroadcastAsUser(mIdleIntent, UserHandle.ALL);
                 } break;
                 case MSG_REPORT_ACTIVE: {
-                    boolean fromMotion = msg.arg1 != 0;
+                    String activeReason = (String)msg.obj;
+                    int activeUid = msg.arg1;
                     boolean needBroadcast = msg.arg2 != 0;
                     mLocalPowerManager.setDeviceIdleMode(false);
                     try {
                         mNetworkPolicyManager.setDeviceIdleMode(false);
-                        mBatteryStats.noteDeviceIdleMode(false, !fromMotion, fromMotion);
+                        mBatteryStats.noteDeviceIdleMode(false, activeReason, activeUid);
                     } catch (RemoteException e) {
                     }
                     if (needBroadcast) {
@@ -573,25 +570,33 @@
                     userId,
                     /*allowAll=*/ false,
                     /*requireFull=*/ false,
-                    "addAppBrieflyToWhitelist", null);
+                    "addPowerSaveTempWhitelistApp", null);
             final long token = Binder.clearCallingIdentity();
             try {
-                PackageInfo pi = AppGlobals.getPackageManager()
-                        .getPackageInfo(packageName, 0, userId);
-                if (pi == null) return;
                 DeviceIdleController.this.addPowerSaveTempWhitelistAppInternal(packageName,
                         duration, userId);
-            } catch (RemoteException re) {
             } finally {
                 Binder.restoreCallingIdentity(token);
             }
         }
 
+        @Override public void exitIdle(String reason) {
+            getContext().enforceCallingOrSelfPermission(android.Manifest.permission.DEVICE_POWER,
+                    null);
+            exitIdleInternal(reason);
+        }
+
         @Override protected void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
             DeviceIdleController.this.dump(fd, pw, args);
         }
     }
 
+    public final class LocalService {
+        public void addPowerSaveTempWhitelistAppDirect(int appId, long duration) {
+            DeviceIdleController.this.addPowerSaveTempWhitelistAppDirectInternal(appId, duration);
+        }
+    }
+
     public DeviceIdleController(Context context) {
         super(context);
         mConfigFile = new AtomicFile(new File(getSystemDir(), "deviceidle.xml"));
@@ -635,6 +640,7 @@
         }
 
         publishBinderService(Context.DEVICE_IDLE_CONTROLLER, new BinderService());
+        publishLocalService(LocalService.class, new LocalService());
     }
 
     @Override
@@ -765,33 +771,41 @@
         try {
             int uid = getContext().getPackageManager().getPackageUid(packageName, userId);
             int appId = UserHandle.getAppId(uid);
-            final long timeNow = System.currentTimeMillis();
-            synchronized (this) {
-                duration = Math.min(duration, mConstants.MAX_TEMP_APP_WHITELIST_DURATION);
-                long currentEndTime = mTempWhitelistAppIdEndTimes.get(appId);
-                // Set the new end time
-                mTempWhitelistAppIdEndTimes.put(appId, timeNow + duration);
-                if (DEBUG) {
-                    Slog.d(TAG, "Adding AppId " + appId + " to temp whitelist");
-                }
-                if (currentEndTime == 0) {
-                    // No pending timeout for the app id, post a delayed message
-                    postTempActiveTimeoutMessage(appId, duration);
-                    updateTempWhitelistAppIdsLocked();
-                    reportTempWhitelistChangedLocked();
-                }
-            }
+            addPowerSaveTempWhitelistAppDirectInternal(appId, duration);
         } catch (NameNotFoundException e) {
         }
     }
 
+    /**
+     * Adds an app to the temporary whitelist and resets the endTime for granting the
+     * app an exemption to access network and acquire wakelocks.
+     */
+    public void addPowerSaveTempWhitelistAppDirectInternal(int appId, long duration) {
+        final long timeNow = SystemClock.elapsedRealtime();
+        synchronized (this) {
+            duration = Math.min(duration, mConstants.MAX_TEMP_APP_WHITELIST_DURATION);
+            long currentEndTime = mTempWhitelistAppIdEndTimes.get(appId);
+            // Set the new end time
+            mTempWhitelistAppIdEndTimes.put(appId, timeNow + duration);
+            if (DEBUG) {
+                Slog.d(TAG, "Adding AppId " + appId + " to temp whitelist");
+            }
+            if (currentEndTime == 0) {
+                // No pending timeout for the app id, post a delayed message
+                postTempActiveTimeoutMessage(appId, duration);
+                updateTempWhitelistAppIdsLocked();
+                reportTempWhitelistChangedLocked();
+            }
+        }
+    }
+
     private void postTempActiveTimeoutMessage(int uid, long delay) {
         mHandler.sendMessageDelayed(mHandler.obtainMessage(MSG_TEMP_APP_WHITELIST_TIMEOUT, uid, 0),
                 delay);
     }
 
     void checkTempAppWhitelistTimeout(int uid) {
-        final long timeNow = System.currentTimeMillis();
+        final long timeNow = SystemClock.elapsedRealtime();
         synchronized (this) {
             long endTime = mTempWhitelistAppIdEndTimes.get(uid);
             if (endTime == 0) {
@@ -812,6 +826,12 @@
         }
     }
 
+    public void exitIdleInternal(String reason) {
+        synchronized (this) {
+            becomeActiveLocked(reason, Binder.getCallingUid());
+        }
+    }
+
     void updateDisplayLocked() {
         mCurDisplay = mDisplayManager.getDisplay(Display.DEFAULT_DISPLAY);
         // We consider any situation where the display is showing something to be it on,
@@ -824,7 +844,7 @@
             becomeInactiveIfAppropriateLocked();
         } else if (screenOn) {
             mScreenOn = true;
-            becomeActiveLocked("screen");
+            becomeActiveLocked("screen", Process.myUid());
         }
     }
 
@@ -835,21 +855,21 @@
             becomeInactiveIfAppropriateLocked();
         } else if (charging) {
             mCharging = charging;
-            becomeActiveLocked("charging");
+            becomeActiveLocked("charging", Process.myUid());
         }
     }
 
-    void scheduleReportActiveLocked(boolean fromMotion) {
-        Message msg = mHandler.obtainMessage(MSG_REPORT_ACTIVE, fromMotion ? 1 : 0,
-                mState == STATE_IDLE ? 1 : 0);
+    void scheduleReportActiveLocked(String activeReason, int activeUid) {
+        Message msg = mHandler.obtainMessage(MSG_REPORT_ACTIVE, activeUid,
+                mState == STATE_IDLE ? 1 : 0, activeReason);
         mHandler.sendMessage(msg);
     }
 
-    void becomeActiveLocked(String reason) {
-        if (DEBUG) Slog.i(TAG, "becomeActiveLocked, reason = " + reason);
+    void becomeActiveLocked(String activeReason, int activeUid) {
+        if (DEBUG) Slog.i(TAG, "becomeActiveLocked, reason = " + activeReason);
         if (mState != STATE_ACTIVE) {
-            EventLogTags.writeDeviceIdle(STATE_ACTIVE, reason);
-            scheduleReportActiveLocked(false);
+            EventLogTags.writeDeviceIdle(STATE_ACTIVE, activeReason);
+            scheduleReportActiveLocked(activeReason, activeUid);
             mState = STATE_ACTIVE;
             mInactiveTimeout = mConstants.INACTIVE_TIMEOUT;
             mNextIdlePendingDelay = 0;
@@ -890,7 +910,7 @@
         if ((now+mConstants.MIN_TIME_TO_ALARM) > mAlarmManager.getNextWakeFromIdleTime()) {
             // Whoops, there is an upcoming alarm.  We don't actually want to go idle.
             if (mState != STATE_ACTIVE) {
-                becomeActiveLocked("alarm");
+                becomeActiveLocked("alarm", Process.myUid());
             }
             return;
         }
@@ -948,7 +968,7 @@
         // state to wait again for no motion.  Note that we only monitor for significant
         // motion after moving out of the inactive state, so no need to worry about that.
         if (mState != STATE_ACTIVE) {
-            scheduleReportActiveLocked(true);
+            scheduleReportActiveLocked("motion", Process.myUid());
             mState = STATE_ACTIVE;
             mInactiveTimeout = mConstants.MOTION_INACTIVE_TIMEOUT;
             EventLogTags.writeDeviceIdle(mState, "motion");
@@ -1234,7 +1254,7 @@
                     synchronized (this) {
                         if (!mIdleDisabled) {
                             mIdleDisabled = true;
-                            becomeActiveLocked("disabled");
+                            becomeActiveLocked("disabled", Process.myUid());
                             pw.println("Idle mode disabled");
                         }
                     }
@@ -1295,6 +1315,8 @@
         }
 
         synchronized (this) {
+            mConstants.dump(pw);
+
             int size = mPowerSaveWhitelistApps.size();
             if (size > 0) {
                 pw.println("  Whitelist system apps:");
@@ -1313,17 +1335,34 @@
             }
             size = mPowerSaveWhitelistAppIds.size();
             if (size > 0) {
-                pw.println("  Whitelist app uids:");
+                pw.println("  Whitelist app ids:");
                 for (int i = 0; i < size; i++) {
-                    pw.print("    UID=");
+                    pw.print("    ");
                     pw.print(mPowerSaveWhitelistAppIds.keyAt(i));
-                    pw.print(": ");
-                    pw.print(mPowerSaveWhitelistAppIds.valueAt(i));
                     pw.println();
                 }
             }
-
-            mConstants.dump(pw);
+            size = mTempWhitelistAppIdEndTimes.size();
+            if (size > 0) {
+                pw.println("  Temp whitelist schedule:");
+                final long timeNow = SystemClock.elapsedRealtime();
+                for (int i = 0; i < size; i++) {
+                    pw.print("    UID=");
+                    pw.print(mTempWhitelistAppIdEndTimes.keyAt(i));
+                    pw.print(": ");
+                    TimeUtils.formatDuration(mTempWhitelistAppIdEndTimes.valueAt(i), timeNow, pw);
+                    pw.println();
+                }
+            }
+            size = mTempWhitelistAppIdArray != null ? mTempWhitelistAppIdArray.length : 0;
+            if (size > 0) {
+                pw.println("  Temp whitelist app ids:");
+                for (int i = 0; i < size; i++) {
+                    pw.print("    ");
+                    pw.print(mTempWhitelistAppIdArray[i]);
+                    pw.println();
+                }
+            }
 
             pw.print("  mSigMotionSensor="); pw.println(mSigMotionSensor);
             pw.print("  mCurDisplay="); pw.println(mCurDisplay);
diff --git a/services/core/java/com/android/server/InputMethodManagerService.java b/services/core/java/com/android/server/InputMethodManagerService.java
index a5d536e..2f153a0 100644
--- a/services/core/java/com/android/server/InputMethodManagerService.java
+++ b/services/core/java/com/android/server/InputMethodManagerService.java
@@ -2112,8 +2112,23 @@
             if (DEBUG) Slog.v(TAG, "Not hiding: forced show not cancelled by not-always hide");
             return false;
         }
+
+        // There is a chance that IMM#hideSoftInput() is called in a transient state where
+        // IMMS#InputShown is already updated to be true whereas IMMS#mImeWindowVis is still waiting
+        // to be updated with the new value sent from IME process.  Even in such a transient state
+        // historically we have accepted an incoming call of IMM#hideSoftInput() from the
+        // application process as a valid request, and have even promised such a behavior with CTS
+        // since Android Eclair.  That's why we need to accept IMM#hideSoftInput() even when only
+        // IMMS#InputShown indicates that the software keyboard is shown.
+        // TODO: Clean up, IMMS#mInputShown, IMMS#mImeWindowVis and mShowRequested.
+        final boolean shouldHideSoftInput = (mCurMethod != null) && (mInputShown ||
+                (mImeWindowVis & InputMethodService.IME_ACTIVE) != 0);
         boolean res;
-        if ((mImeWindowVis & InputMethodService.IME_ACTIVE) != 0 && mCurMethod != null) {
+        if (shouldHideSoftInput) {
+            // The IME will report its visible state again after the following message finally
+            // delivered to the IME process as an IPC.  Hence the inconsistency between
+            // IMMS#mInputShown and IMMS#mImeWindowVis should be resolved spontaneously in
+            // the final state.
             executeOrSendMessage(mCurMethod, mCaller.obtainMessageOO(
                     MSG_HIDE_SOFT_INPUT, mCurMethod, resultReceiver));
             res = true;
diff --git a/services/core/java/com/android/server/LocationManagerService.java b/services/core/java/com/android/server/LocationManagerService.java
index c76fc1c..743aafb 100644
--- a/services/core/java/com/android/server/LocationManagerService.java
+++ b/services/core/java/com/android/server/LocationManagerService.java
@@ -1958,6 +1958,27 @@
         return p.getProperties();
     }
 
+    /**
+     * @return null if the provider does not exist
+     * @throws SecurityException if the provider is not allowed to be
+     * accessed by the caller
+     */
+    @Override
+    public String getNetworkProviderPackage() {
+        LocationProviderInterface p;
+        synchronized (mLock) {
+            if (mProvidersByName.get(LocationManager.NETWORK_PROVIDER) == null) {
+                return null;
+            }
+            p = mProvidersByName.get(LocationManager.NETWORK_PROVIDER);
+        }
+
+        if (p instanceof LocationProviderProxy) {
+            return ((LocationProviderProxy) p).getConnectedPackageName();
+        }
+        return null;
+    }
+
     @Override
     public boolean isProviderEnabled(String provider) {
         // Fused provider is accessed indirectly via criteria rather than the provider-based APIs,
diff --git a/services/core/java/com/android/server/NetworkManagementService.java b/services/core/java/com/android/server/NetworkManagementService.java
index a1e2a54..baa55e7 100644
--- a/services/core/java/com/android/server/NetworkManagementService.java
+++ b/services/core/java/com/android/server/NetworkManagementService.java
@@ -19,6 +19,15 @@
 import static android.Manifest.permission.CONNECTIVITY_INTERNAL;
 import static android.Manifest.permission.DUMP;
 import static android.Manifest.permission.SHUTDOWN;
+import static android.net.NetworkPolicyManager.FIREWALL_CHAIN_DOZABLE;
+import static android.net.NetworkPolicyManager.FIREWALL_CHAIN_NAME_DOZABLE;
+import static android.net.NetworkPolicyManager.FIREWALL_CHAIN_NAME_NONE;
+import static android.net.NetworkPolicyManager.FIREWALL_CHAIN_NAME_STANDBY;
+import static android.net.NetworkPolicyManager.FIREWALL_CHAIN_NONE;
+import static android.net.NetworkPolicyManager.FIREWALL_CHAIN_STANDBY;
+import static android.net.NetworkPolicyManager.FIREWALL_RULE_DEFAULT;
+import static android.net.NetworkPolicyManager.FIREWALL_TYPE_BLACKLIST;
+import static android.net.NetworkPolicyManager.FIREWALL_TYPE_WHITELIST;
 import static android.net.NetworkStats.SET_DEFAULT;
 import static android.net.NetworkStats.TAG_ALL;
 import static android.net.NetworkStats.TAG_NONE;
@@ -35,6 +44,7 @@
 import static com.android.server.NetworkManagementService.NetdResponseCode.TtyListResult;
 import static com.android.server.NetworkManagementSocketTagger.PROP_QTAGUID_ENABLED;
 
+import android.annotation.NonNull;
 import android.app.ActivityManagerNative;
 import android.content.Context;
 import android.net.ConnectivityManager;
@@ -192,6 +202,21 @@
     /** Set of UIDs that are to be blocked/allowed by firewall controller. */
     @GuardedBy("mQuotaLock")
     private SparseIntArray mUidFirewallRules = new SparseIntArray();
+    /**
+     * Set of UIDs that are to be blocked/allowed by firewall controller.  This set of Ids matches
+     * to application idles.
+     */
+    @GuardedBy("mQuotaLock")
+    private SparseIntArray mUidFirewallStandbyRules = new SparseIntArray();
+    /**
+     * Set of UIDs that are to be blocked/allowed by firewall controller.  This set of Ids matches
+     * to device idles.
+     */
+    @GuardedBy("mQuotaLock")
+    private SparseIntArray mUidFirewallDozableRules = new SparseIntArray();
+
+    private boolean mStandbyChainEnabled = false;
+    private boolean mDozableChainEnabled = false;
 
     private Object mIdleTimerLock = new Object();
     /** Set of interfaces with active idle timers. */
@@ -282,6 +307,9 @@
     }
 
     public void systemReady() {
+        // init firewall states
+        mDozableChainEnabled = false;
+        mStandbyChainEnabled = true;
         prepareNativeDaemon();
         if (DBG) Slog.d(TAG, "Prepared");
     }
@@ -568,9 +596,38 @@
                 final SparseIntArray uidFirewallRules = mUidFirewallRules;
                 mUidFirewallRules = new SparseIntArray();
                 for (int i = 0; i < uidFirewallRules.size(); i++) {
-                    setFirewallUidRule(uidFirewallRules.keyAt(i), uidFirewallRules.valueAt(i));
+                    setFirewallUidRuleInternal(FIREWALL_CHAIN_NONE, uidFirewallRules.keyAt(i),
+                            uidFirewallRules.valueAt(i));
                 }
             }
+
+            size = mUidFirewallStandbyRules.size();
+            if (size > 0) {
+                Slog.d(TAG, "Pushing " + size + " active firewall standby UID rules");
+                final SparseIntArray uidFirewallRules = mUidFirewallStandbyRules;
+                mUidFirewallStandbyRules = new SparseIntArray();
+                for (int i = 0; i < uidFirewallRules.size(); i++) {
+                    setFirewallUidRuleInternal(FIREWALL_CHAIN_STANDBY, uidFirewallRules.keyAt(i),
+                            uidFirewallRules.valueAt(i));
+                }
+            }
+            if (mStandbyChainEnabled) {
+                setFirewallChainEnabled(FIREWALL_CHAIN_STANDBY, true);
+            }
+
+            size = mUidFirewallDozableRules.size();
+            if (size > 0) {
+                Slog.d(TAG, "Pushing " + size + " active firewall dozable UID rules");
+                final SparseIntArray uidFirewallRules = mUidFirewallDozableRules;
+                mUidFirewallDozableRules = new SparseIntArray();
+                for (int i = 0; i < uidFirewallRules.size(); i++) {
+                    setFirewallUidRuleInternal(FIREWALL_CHAIN_DOZABLE, uidFirewallRules.keyAt(i),
+                            uidFirewallRules.valueAt(i));
+                }
+            }
+            if (mDozableChainEnabled) {
+                setFirewallChainEnabled(FIREWALL_CHAIN_DOZABLE, true);
+            }
         }
     }
 
@@ -1954,13 +2011,78 @@
     }
 
     @Override
-    public void setFirewallUidRule(int uid, int rule) {
+    public void setFirewallChainEnabled(int chain, boolean enable) {
         enforceSystemUid();
-        if (rule == NetworkPolicyManager.FIREWALL_RULE_ALLOW) {
-            Preconditions.checkState(mFirewallEnabled);
+        final String operation = enable ? "enable_chain" : "disable_chain";
+        try {
+            String chainName;
+            switch(chain) {
+                case FIREWALL_CHAIN_STANDBY:
+                    chainName = FIREWALL_CHAIN_NAME_STANDBY;
+                    mStandbyChainEnabled = enable;
+                    break;
+                case FIREWALL_CHAIN_DOZABLE:
+                    chainName = FIREWALL_CHAIN_NAME_DOZABLE;
+                    mDozableChainEnabled = enable;
+                    break;
+                default:
+                    throw new IllegalArgumentException("Bad child chain: " + chain);
+            }
+            mConnector.execute("firewall", operation, chainName);
+        } catch (NativeDaemonConnectorException e) {
+            throw e.rethrowAsParcelableException();
         }
+    }
+
+    private int getFirewallType(int chain) {
+        switch (chain) {
+            case FIREWALL_CHAIN_STANDBY:
+                return FIREWALL_TYPE_BLACKLIST;
+            case FIREWALL_CHAIN_DOZABLE:
+                return FIREWALL_TYPE_WHITELIST;
+            default:
+                return isFirewallEnabled() ? FIREWALL_TYPE_WHITELIST : FIREWALL_TYPE_BLACKLIST;
+        }
+    }
+
+    @Override
+    public void setFirewallUidRules(int chain, int[] uids, int[] rules) {
+        enforceSystemUid();
+        SparseIntArray uidFirewallRules = getUidFirewallRules(chain);
+        SparseIntArray newRules = new SparseIntArray();
+        // apply new set of rules
+        for (int index = uids.length - 1; index >= 0; --index) {
+            int uid = uids[index];
+            int rule = rules[index];
+            setFirewallUidRule(chain, uid, rule);
+            newRules.put(uid, rule);
+        }
+        // collect the rules to remove.
+        SparseIntArray rulesToRemove = new SparseIntArray();
+        for (int index = uidFirewallRules.size() - 1; index >= 0; --index) {
+            int uid = uidFirewallRules.keyAt(index);
+            if (newRules.indexOfKey(uid) < 0) {
+                rulesToRemove.put(uid, FIREWALL_RULE_DEFAULT);
+            }
+        }
+        // remove dead rules
+        for (int index = rulesToRemove.size() - 1; index >= 0; --index) {
+            int uid = rulesToRemove.keyAt(index);
+            setFirewallUidRuleInternal(chain, uid, FIREWALL_RULE_DEFAULT);
+        }
+    }
+
+    @Override
+    public void setFirewallUidRule(int chain, int uid, int rule) {
+        enforceSystemUid();
+        setFirewallUidRuleInternal(chain, uid, rule);
+    }
+
+    private void setFirewallUidRuleInternal(int chain, int uid, int rule) {
         synchronized (mQuotaLock) {
-            final int oldUidFirewallRule = mUidFirewallRules.get(uid);
+            SparseIntArray uidFirewallRules = getUidFirewallRules(chain);
+
+            final int oldUidFirewallRule = uidFirewallRules.get(uid, FIREWALL_RULE_DEFAULT);
             if (DBG) {
                 Slog.d(TAG, "oldRule = " + oldUidFirewallRule
                         + ", newRule=" + rule + " for uid=" + uid);
@@ -1973,7 +2095,7 @@
 
             try {
                 String ruleName;
-                if (isFirewallEnabled()) { // Whitelist mode
+                if (getFirewallType(chain) == FIREWALL_TYPE_WHITELIST) {
                     if (rule == NetworkPolicyManager.FIREWALL_RULE_ALLOW) {
                         ruleName = "allow";
                     } else {
@@ -1988,17 +2110,44 @@
                 }
 
                 if (rule == NetworkPolicyManager.FIREWALL_RULE_DEFAULT) {
-                    mUidFirewallRules.delete(uid);
+                    uidFirewallRules.delete(uid);
                 } else {
-                    mUidFirewallRules.put(uid, rule);
+                    uidFirewallRules.put(uid, rule);
                 }
-                mConnector.execute("firewall", "set_uid_rule", uid, ruleName);
+                mConnector.execute("firewall", "set_uid_rule", getFirewallChainName(chain), uid,
+                        ruleName);
             } catch (NativeDaemonConnectorException e) {
                 throw e.rethrowAsParcelableException();
             }
         }
     }
 
+    private @NonNull SparseIntArray getUidFirewallRules(int chain) {
+        switch (chain) {
+            case FIREWALL_CHAIN_STANDBY:
+                return mUidFirewallStandbyRules;
+            case FIREWALL_CHAIN_DOZABLE:
+                return mUidFirewallDozableRules;
+            case FIREWALL_CHAIN_NONE:
+                return mUidFirewallRules;
+            default:
+                throw new IllegalArgumentException("Unknown chain:" + chain);
+        }
+    }
+
+    public @NonNull String getFirewallChainName(int chain) {
+        switch (chain) {
+            case FIREWALL_CHAIN_STANDBY:
+                return FIREWALL_CHAIN_NAME_STANDBY;
+            case FIREWALL_CHAIN_DOZABLE:
+                return FIREWALL_CHAIN_NAME_DOZABLE;
+            case FIREWALL_CHAIN_NONE:
+                return FIREWALL_CHAIN_NAME_NONE;
+            default:
+                throw new IllegalArgumentException("Unknown chain:" + chain);
+        }
+    }
+
     private static void enforceSystemUid() {
         final int uid = Binder.getCallingUid();
         if (uid != Process.SYSTEM_UID) {
@@ -2123,6 +2272,32 @@
             pw.println("]");
         }
 
+        pw.println("UID firewall standby chain enabled: " + mStandbyChainEnabled);
+        synchronized (mUidFirewallStandbyRules) {
+            pw.print("UID firewall standby rule: [");
+            final int size = mUidFirewallStandbyRules.size();
+            for (int i = 0; i < size; i++) {
+                pw.print(mUidFirewallStandbyRules.keyAt(i));
+                pw.print(":");
+                pw.print(mUidFirewallStandbyRules.valueAt(i));
+                if (i < size - 1) pw.print(",");
+            }
+            pw.println("]");
+        }
+
+        pw.println("UID firewall dozable chain enabled: " + mDozableChainEnabled);
+        synchronized (mUidFirewallDozableRules) {
+            pw.print("UID firewall dozable rule: [");
+            final int size = mUidFirewallDozableRules.size();
+            for (int i = 0; i < size; i++) {
+                pw.print(mUidFirewallDozableRules.keyAt(i));
+                pw.print(":");
+                pw.print(mUidFirewallDozableRules.valueAt(i));
+                if (i < size - 1) pw.print(",");
+            }
+            pw.println("]");
+        }
+
         synchronized (mIdleTimerLock) {
             pw.println("Idle timers:");
             for (HashMap.Entry<String, IdleTimerParams> ent : mActiveIdleTimers.entrySet()) {
diff --git a/services/core/java/com/android/server/PersistentDataBlockService.java b/services/core/java/com/android/server/PersistentDataBlockService.java
index 56f9942..94316fe 100644
--- a/services/core/java/com/android/server/PersistentDataBlockService.java
+++ b/services/core/java/com/android/server/PersistentDataBlockService.java
@@ -18,18 +18,14 @@
 
 import android.Manifest;
 import android.app.ActivityManager;
-import android.app.PendingIntent;
 import android.content.Context;
-import android.content.Intent;
 import android.content.pm.PackageManager;
 import android.os.Binder;
-import android.os.Bundle;
 import android.os.IBinder;
 import android.os.RemoteException;
 import android.os.SystemProperties;
 import android.os.UserHandle;
 import android.service.persistentdata.IPersistentDataBlockService;
-import android.service.persistentdata.PersistentDataBlockManager;
 import android.util.Slog;
 
 import com.android.internal.R;
@@ -432,29 +428,6 @@
         }
 
         @Override
-        public void wipeIfAllowed(Bundle bundle, PendingIntent pi) {
-            // Should only be called by owner
-            if (UserHandle.getCallingUserId() != UserHandle.USER_OWNER) {
-                throw new SecurityException("Only the Owner is allowed to wipe");
-            }
-            // Caller must be able to query the the state of the PersistentDataBlock
-            enforcePersistentDataBlockAccess();
-            String allowedPackage = mContext.getResources()
-                    .getString(R.string.config_persistentDataPackageName);
-            Intent intent = new Intent();
-            intent.setPackage(allowedPackage);
-            intent.setAction(PersistentDataBlockManager.ACTION_WIPE_IF_ALLOWED);
-            intent.putExtras(bundle);
-            intent.putExtra(PersistentDataBlockManager.EXTRA_WIPE_IF_ALLOWED_CALLBACK, pi);
-            long id = Binder.clearCallingIdentity();
-            try {
-                mContext.sendBroadcastAsUser(intent, UserHandle.OWNER);
-            } finally {
-                restoreCallingIdentity(id);
-            }
-        }
-
-        @Override
         public void setOemUnlockEnabled(boolean enabled) {
             // do not allow monkey to flip the flag
             if (ActivityManager.isUserAMonkey()) {
diff --git a/services/core/java/com/android/server/SystemService.java b/services/core/java/com/android/server/SystemService.java
index 6e67970..e0a9ab4 100644
--- a/services/core/java/com/android/server/SystemService.java
+++ b/services/core/java/com/android/server/SystemService.java
@@ -34,7 +34,7 @@
  * local interfaces that other services within the system server may use to access
  * privileged internal functions.
  * <li>Then {@link #onBootPhase(int)} is called as many times as there are boot phases
- * until {@link #PHASE_BOOT_COMPLETE} is sent, which is the last boot phase. Each phase
+ * until {@link #PHASE_BOOT_COMPLETED} is sent, which is the last boot phase. Each phase
  * is an opportunity to do special work, like acquiring optional service dependencies,
  * waiting to see if SafeMode is enabled, or registering with a service that gets
  * started after this one.
diff --git a/services/core/java/com/android/server/am/ActivityManagerService.java b/services/core/java/com/android/server/am/ActivityManagerService.java
index 667abb6..970deba 100644
--- a/services/core/java/com/android/server/am/ActivityManagerService.java
+++ b/services/core/java/com/android/server/am/ActivityManagerService.java
@@ -39,6 +39,7 @@
 import android.Manifest;
 import android.app.AppOpsManager;
 import android.app.ApplicationThreadNative;
+import android.app.BroadcastOptions;
 import android.app.IActivityContainer;
 import android.app.IActivityContainerCallback;
 import android.app.IAppTask;
@@ -89,6 +90,7 @@
 import com.android.internal.util.Preconditions;
 import com.android.server.AppOpsService;
 import com.android.server.AttributeCache;
+import com.android.server.DeviceIdleController;
 import com.android.server.IntentResolver;
 import com.android.server.LocalServices;
 import com.android.server.ServiceThread;
@@ -941,6 +943,11 @@
     UsageStatsManagerInternal mUsageStatsService;
 
     /**
+     * Access to DeviceIdleController service.
+     */
+    DeviceIdleController.LocalService mLocalDeviceIdleController;
+
+    /**
      * Information about and control over application operations
      */
     final AppOpsService mAppOpsService;
@@ -1438,7 +1445,7 @@
                     }
                     broadcastIntentLocked(null, null, intent,
                             null, null, 0, null, null, null, AppOpsManager.OP_NONE,
-                            false, false, MY_PID, Process.SYSTEM_UID, 0 /* TODO: Verify */);
+                            null, false, false, MY_PID, Process.SYSTEM_UID, 0 /* TODO: Verify */);
 
                     if (mShowDialogs) {
                         Dialog d = new AppNotRespondingDialog(ActivityManagerService.this,
@@ -2481,10 +2488,7 @@
             synchronized(bstats) {
                 synchronized(mPidsSelfLocked) {
                     if (haveNewCpuStats) {
-                        final int perc = bstats.startAddingCpuLocked();
-                        if (perc >= 0) {
-                            int remainUTime = 0;
-                            int remainSTime = 0;
+                        if (bstats.startAddingCpuLocked()) {
                             int totalUTime = 0;
                             int totalSTime = 0;
                             final int N = mProcessCpuTracker.countStats();
@@ -2494,10 +2498,6 @@
                                     continue;
                                 }
                                 ProcessRecord pr = mPidsSelfLocked.get(st.pid);
-                                int otherUTime = (st.rel_utime*perc)/100;
-                                int otherSTime = (st.rel_stime*perc)/100;
-                                remainUTime += otherUTime;
-                                remainSTime += otherSTime;
                                 totalUTime += st.rel_utime;
                                 totalSTime += st.rel_stime;
                                 if (pr != null) {
@@ -2506,8 +2506,7 @@
                                         pr.curProcBatteryStats = ps = bstats.getProcessStatsLocked(
                                                 pr.info.uid, pr.processName);
                                     }
-                                    ps.addCpuTimeLocked(st.rel_utime - otherUTime,
-                                            st.rel_stime - otherSTime);
+                                    ps.addCpuTimeLocked(st.rel_utime, st.rel_stime);
                                     pr.curCpuTime += st.rel_utime + st.rel_stime;
                                 } else {
                                     BatteryStatsImpl.Uid.Proc ps = st.batteryStats;
@@ -2515,8 +2514,7 @@
                                         st.batteryStats = ps = bstats.getProcessStatsLocked(
                                                 bstats.mapUid(st.uid), st.name);
                                     }
-                                    ps.addCpuTimeLocked(st.rel_utime - otherUTime,
-                                            st.rel_stime - otherSTime);
+                                    ps.addCpuTimeLocked(st.rel_utime, st.rel_stime);
                                 }
                             }
                             final int userTime = mProcessCpuTracker.getLastUserTime();
@@ -2525,9 +2523,8 @@
                             final int irqTime = mProcessCpuTracker.getLastIrqTime();
                             final int softIrqTime = mProcessCpuTracker.getLastSoftIrqTime();
                             final int idleTime = mProcessCpuTracker.getLastIdleTime();
-                            bstats.finishAddingCpuLocked(perc, remainUTime,
-                                    remainSTime, totalUTime, totalSTime, userTime, systemTime,
-                                    iowaitTime, irqTime, softIrqTime, idleTime);
+                            bstats.finishAddingCpuLocked(totalUTime, totalSTime, userTime,
+                                    systemTime, iowaitTime, irqTime, softIrqTime, idleTime);
                         }
                     }
                 }
@@ -2559,9 +2556,9 @@
 
     @Override
     public void batterySendBroadcast(Intent intent) {
-        broadcastIntentLocked(null, null, intent, null,
-                null, 0, null, null, null, AppOpsManager.OP_NONE, false, false, -1,
-                Process.SYSTEM_UID, UserHandle.USER_ALL);
+        broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
+                AppOpsManager.OP_NONE, null, false, false,
+                -1, Process.SYSTEM_UID, UserHandle.USER_ALL);
     }
 
     /**
@@ -3582,6 +3579,8 @@
 
     @Override
     public int getPackageProcessState(String packageName) {
+        enforceCallingPermission(android.Manifest.permission.GET_PACKAGE_IMPORTANCE,
+                "getPackageProcessState");
         int procState = ActivityManager.PROCESS_STATE_NONEXISTENT;
         synchronized (this) {
             for (int i=mLruProcesses.size()-1; i>=0; i--) {
@@ -5089,7 +5088,7 @@
                         Uri.fromParts("package", packageName, null));
                 intent.putExtra(Intent.EXTRA_UID, pkgUid);
                 broadcastIntentInPackage("android", Process.SYSTEM_UID, intent,
-                        null, null, 0, null, null, null, false, false, userId);
+                        null, null, 0, null, null, null, null, false, false, userId);
             } catch (RemoteException e) {
             }
         } finally {
@@ -5322,9 +5321,9 @@
 
         mStackSupervisor.closeSystemDialogsLocked();
 
-        broadcastIntentLocked(null, null, intent, null,
-                null, 0, null, null, null, AppOpsManager.OP_NONE, false, false, -1,
-                Process.SYSTEM_UID, UserHandle.USER_ALL);
+        broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
+                AppOpsManager.OP_NONE, null, false, false,
+                -1, Process.SYSTEM_UID, UserHandle.USER_ALL);
     }
 
     @Override
@@ -5423,8 +5422,7 @@
         intent.putExtra(Intent.EXTRA_USER_HANDLE, UserHandle.getUserId(uid));
         broadcastIntentLocked(null, null, intent,
                 null, null, 0, null, null, null, AppOpsManager.OP_NONE,
-                false, false,
-                MY_PID, Process.SYSTEM_UID, UserHandle.getUserId(uid));
+                null, false, false, MY_PID, Process.SYSTEM_UID, UserHandle.getUserId(uid));
     }
 
     private void forceStopUserLocked(int userId, String reason) {
@@ -5435,8 +5433,7 @@
         intent.putExtra(Intent.EXTRA_USER_HANDLE, userId);
         broadcastIntentLocked(null, null, intent,
                 null, null, 0, null, null, null, AppOpsManager.OP_NONE,
-                false, false,
-                MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
+                null, false, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
     }
 
     private final boolean killPackageProcessesLocked(String packageName, int appId,
@@ -6329,8 +6326,8 @@
                                 },
                                 0, null, null,
                                 android.Manifest.permission.RECEIVE_BOOT_COMPLETED,
-                                AppOpsManager.OP_NONE, true, false, MY_PID, Process.SYSTEM_UID,
-                                userId);
+                                AppOpsManager.OP_NONE, null, true, false,
+                                MY_PID, Process.SYSTEM_UID, userId);
                     }
                 }
                 scheduleStartProfilesLocked();
@@ -11442,8 +11439,7 @@
             EventLogTags.writeAmPreBoot(users[curUser], intent.getComponent().getPackageName());
             broadcastIntentLocked(null, null, intent, null, this,
                     0, null, null, null, AppOpsManager.OP_NONE,
-                    true, false, MY_PID, Process.SYSTEM_UID,
-                    users[curUser]);
+                    null, true, false, MY_PID, Process.SYSTEM_UID, users[curUser]);
         }
 
         public void performReceive(Intent intent, int resultCode,
@@ -11535,6 +11531,9 @@
                 return;
             }
 
+            mLocalDeviceIdleController
+                    = LocalServices.getService(DeviceIdleController.LocalService.class);
+
             // Make sure we have the current profile info, since it is needed for
             // security checks.
             updateCurrentProfileIdsLocked();
@@ -11704,7 +11703,7 @@
                 intent.putExtra(Intent.EXTRA_USER_HANDLE, mCurrentUserId);
                 broadcastIntentLocked(null, null, intent,
                         null, null, 0, null, null, null, AppOpsManager.OP_NONE,
-                        false, false, MY_PID, Process.SYSTEM_UID, mCurrentUserId);
+                        null, false, false, MY_PID, Process.SYSTEM_UID, mCurrentUserId);
                 intent = new Intent(Intent.ACTION_USER_STARTING);
                 intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
                 intent.putExtra(Intent.EXTRA_USER_HANDLE, mCurrentUserId);
@@ -11717,7 +11716,7 @@
                             }
                         }, 0, null, null,
                         INTERACT_ACROSS_USERS, AppOpsManager.OP_NONE,
-                        true, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
+                        null, true, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
             } catch (Throwable t) {
                 Slog.wtf(TAG, "Failed sending first user broadcasts", t);
             } finally {
@@ -16101,8 +16100,8 @@
                     Intent intent = allSticky.get(i);
                     BroadcastQueue queue = broadcastQueueForIntent(intent);
                     BroadcastRecord r = new BroadcastRecord(queue, intent, null,
-                            null, -1, -1, null, null, AppOpsManager.OP_NONE, receivers, null, 0,
-                            null, null, false, true, true, -1);
+                            null, -1, -1, null, null, AppOpsManager.OP_NONE, null, receivers,
+                            null, 0, null, null, false, true, true, -1);
                     queue.enqueueParallelBroadcastLocked(r);
                     queue.scheduleBroadcastsLocked();
                 }
@@ -16255,9 +16254,8 @@
     private final int broadcastIntentLocked(ProcessRecord callerApp,
             String callerPackage, Intent intent, String resolvedType,
             IIntentReceiver resultTo, int resultCode, String resultData,
-            Bundle map, String requiredPermission, int appOp,
-            boolean ordered, boolean sticky, int callingPid, int callingUid,
-            int userId) {
+            Bundle resultExtras, String requiredPermission, int appOp, Bundle options,
+            boolean ordered, boolean sticky, int callingPid, int callingUid, int userId) {
         intent = new Intent(intent);
 
         // By default broadcasts do not go to stopped apps.
@@ -16292,6 +16290,28 @@
             }
         }
 
+        BroadcastOptions brOptions = null;
+        if (options != null) {
+            brOptions = new BroadcastOptions(options);
+            if (brOptions.getTemporaryAppWhitelistDuration() > 0) {
+                // See if the caller is allowed to do this.  Note we are checking against
+                // the actual real caller (not whoever provided the operation as say a
+                // PendingIntent), because that who is actually supplied the arguments.
+                if (checkComponentPermission(
+                        android.Manifest.permission.CHANGE_DEVICE_IDLE_TEMP_WHITELIST,
+                        Binder.getCallingPid(), Binder.getCallingUid(), -1, true)
+                        != PackageManager.PERMISSION_GRANTED) {
+                    String msg = "Permission Denial: " + intent.getAction()
+                            + " broadcast from " + callerPackage + " (pid=" + callingPid
+                            + ", uid=" + callingUid + ")"
+                            + " requires "
+                            + android.Manifest.permission.CHANGE_DEVICE_IDLE_TEMP_WHITELIST;
+                    Slog.w(TAG, msg);
+                    throw new SecurityException(msg);
+                }
+            }
+        }
+
         /*
          * Prevent non-system code (defined here to be non-persistent
          * processes) from sending protected broadcasts.
@@ -16598,8 +16618,8 @@
             final BroadcastQueue queue = broadcastQueueForIntent(intent);
             BroadcastRecord r = new BroadcastRecord(queue, intent, callerApp,
                     callerPackage, callingPid, callingUid, resolvedType, requiredPermission,
-                    appOp, registeredReceivers, resultTo, resultCode, resultData, map,
-                    ordered, sticky, false, userId);
+                    appOp, brOptions, registeredReceivers, resultTo, resultCode, resultData,
+                    resultExtras, ordered, sticky, false, userId);
             if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Enqueueing parallel broadcast " + r);
             final boolean replaced = replacePending && queue.replaceParallelBroadcastLocked(r);
             if (!replaced) {
@@ -16687,8 +16707,8 @@
             BroadcastQueue queue = broadcastQueueForIntent(intent);
             BroadcastRecord r = new BroadcastRecord(queue, intent, callerApp,
                     callerPackage, callingPid, callingUid, resolvedType,
-                    requiredPermission, appOp, receivers, resultTo, resultCode,
-                    resultData, map, ordered, sticky, false, userId);
+                    requiredPermission, appOp, brOptions, receivers, resultTo, resultCode,
+                    resultData, resultExtras, ordered, sticky, false, userId);
 
             if (DEBUG_BROADCAST) Slog.v(TAG_BROADCAST, "Enqueueing ordered broadcast " + r
                     + ": prev had " + queue.mOrderedBroadcasts.size());
@@ -16735,8 +16755,9 @@
 
     public final int broadcastIntent(IApplicationThread caller,
             Intent intent, String resolvedType, IIntentReceiver resultTo,
-            int resultCode, String resultData, Bundle map,
-            String requiredPermission, int appOp, boolean serialized, boolean sticky, int userId) {
+            int resultCode, String resultData, Bundle resultExtras,
+            String requiredPermission, int appOp, Bundle options,
+            boolean serialized, boolean sticky, int userId) {
         enforceNotIsolatedCaller("broadcastIntent");
         synchronized(this) {
             intent = verifyBroadcastLocked(intent);
@@ -16747,8 +16768,8 @@
             final long origId = Binder.clearCallingIdentity();
             int res = broadcastIntentLocked(callerApp,
                     callerApp != null ? callerApp.info.packageName : null,
-                    intent, resolvedType, resultTo,
-                    resultCode, resultData, map, requiredPermission, appOp, serialized, sticky,
+                    intent, resolvedType, resultTo, resultCode, resultData, resultExtras,
+                    requiredPermission, appOp, null, serialized, sticky,
                     callingPid, callingUid, userId);
             Binder.restoreCallingIdentity(origId);
             return res;
@@ -16757,15 +16778,16 @@
 
     int broadcastIntentInPackage(String packageName, int uid,
             Intent intent, String resolvedType, IIntentReceiver resultTo,
-            int resultCode, String resultData, Bundle map,
-            String requiredPermission, boolean serialized, boolean sticky, int userId) {
+            int resultCode, String resultData, Bundle resultExtras,
+            String requiredPermission, Bundle options, boolean serialized, boolean sticky,
+            int userId) {
         synchronized(this) {
             intent = verifyBroadcastLocked(intent);
 
             final long origId = Binder.clearCallingIdentity();
             int res = broadcastIntentLocked(null, packageName, intent, resolvedType,
-                    resultTo, resultCode, resultData, map, requiredPermission,
-                    AppOpsManager.OP_NONE, serialized, sticky, -1, uid, userId);
+                    resultTo, resultCode, resultData, resultExtras, requiredPermission,
+                    AppOpsManager.OP_NONE, options, serialized, sticky, -1, uid, userId);
             Binder.restoreCallingIdentity(origId);
             return res;
         }
@@ -17162,8 +17184,8 @@
                         | Intent.FLAG_RECEIVER_REPLACE_PENDING
                         | Intent.FLAG_RECEIVER_FOREGROUND);
                 broadcastIntentLocked(null, null, intent, null, null, 0, null, null,
-                        null, AppOpsManager.OP_NONE, false, false, MY_PID,
-                        Process.SYSTEM_UID, UserHandle.USER_ALL);
+                        null, AppOpsManager.OP_NONE, null, false, false,
+                        MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
                 if ((changes&ActivityInfo.CONFIG_LOCALE) != 0) {
                     intent = new Intent(Intent.ACTION_LOCALE_CHANGED);
                     intent.addFlags(Intent.FLAG_RECEIVER_FOREGROUND);
@@ -17172,7 +17194,7 @@
                     }
                     broadcastIntentLocked(null, null, intent,
                             null, null, 0, null, null, null, AppOpsManager.OP_NONE,
-                            false, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
+                            null, false, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
                 }
             }
         }
@@ -19642,7 +19664,7 @@
                     intent.putExtra(Intent.EXTRA_USER_HANDLE, userId);
                     broadcastIntentLocked(null, null, intent,
                             null, null, 0, null, null, null, AppOpsManager.OP_NONE,
-                            false, false, MY_PID, Process.SYSTEM_UID, userId);
+                            null, false, false, MY_PID, Process.SYSTEM_UID, userId);
                 }
 
                 if ((userInfo.flags&UserInfo.FLAG_INITIALIZED) == 0) {
@@ -19657,8 +19679,7 @@
                                         onUserInitialized(uss, foreground, oldUserId, userId);
                                     }
                                 }, 0, null, null, null, AppOpsManager.OP_NONE,
-                                true, false, MY_PID, Process.SYSTEM_UID,
-                                userId);
+                                null, true, false, MY_PID, Process.SYSTEM_UID, userId);
                         uss.initializing = true;
                     } else {
                         getUserManagerLocked().makeInitialized(userInfo.id);
@@ -19680,13 +19701,13 @@
                     broadcastIntentLocked(null, null, intent,
                             null, new IIntentReceiver.Stub() {
                                 @Override
-                                public void performReceive(Intent intent, int resultCode, String data,
-                                        Bundle extras, boolean ordered, boolean sticky, int sendingUser)
-                                        throws RemoteException {
+                                public void performReceive(Intent intent, int resultCode,
+                                        String data, Bundle extras, boolean ordered, boolean sticky,
+                                        int sendingUser) throws RemoteException {
                                 }
                             }, 0, null, null,
                             INTERACT_ACROSS_USERS, AppOpsManager.OP_NONE,
-                            true, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
+                            null, true, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
                 }
             }
         } finally {
@@ -19724,7 +19745,7 @@
                     intent.putExtra(Intent.EXTRA_USER_HANDLE, profileUserId);
                     broadcastIntentLocked(null, null, intent,
                             null, null, 0, null, null, null, AppOpsManager.OP_NONE,
-                            false, false, MY_PID, Process.SYSTEM_UID, profileUserId);
+                            null, false, false, MY_PID, Process.SYSTEM_UID, profileUserId);
                 }
             }
             if (newUserId >= 0) {
@@ -19739,7 +19760,7 @@
                     intent.putExtra(Intent.EXTRA_USER_HANDLE, profileUserId);
                     broadcastIntentLocked(null, null, intent,
                             null, null, 0, null, null, null, AppOpsManager.OP_NONE,
-                            false, false, MY_PID, Process.SYSTEM_UID, profileUserId);
+                            null, false, false, MY_PID, Process.SYSTEM_UID, profileUserId);
                 }
                 intent = new Intent(Intent.ACTION_USER_SWITCHED);
                 intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
@@ -19748,7 +19769,7 @@
                 broadcastIntentLocked(null, null, intent,
                         null, null, 0, null, null,
                         android.Manifest.permission.MANAGE_USERS, AppOpsManager.OP_NONE,
-                        false, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
+                        null, false, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
             }
         } finally {
             Binder.restoreCallingIdentity(ident);
@@ -19925,7 +19946,7 @@
                 broadcastIntentLocked(null, null, intent,
                         null, null, 0, null, null,
                         android.Manifest.permission.RECEIVE_BOOT_COMPLETED, AppOpsManager.OP_NONE,
-                        true, false, MY_PID, Process.SYSTEM_UID, userId);
+                        null, true, false, MY_PID, Process.SYSTEM_UID, userId);
             }
         }
     }
@@ -20057,14 +20078,14 @@
                         mSystemServiceManager.stopUser(userId);
                         broadcastIntentLocked(null, null, shutdownIntent,
                                 null, shutdownReceiver, 0, null, null, null, AppOpsManager.OP_NONE,
-                                true, false, MY_PID, Process.SYSTEM_UID, userId);
+                                null, true, false, MY_PID, Process.SYSTEM_UID, userId);
                     }
                 };
                 // Kick things off.
                 broadcastIntentLocked(null, null, stoppingIntent,
                         null, stoppingReceiver, 0, null, null,
                         INTERACT_ACROSS_USERS, AppOpsManager.OP_NONE,
-                        true, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
+                        null, true, false, MY_PID, Process.SYSTEM_UID, UserHandle.USER_ALL);
             } finally {
                 Binder.restoreCallingIdentity(ident);
             }
diff --git a/services/core/java/com/android/server/am/ActivityStack.java b/services/core/java/com/android/server/am/ActivityStack.java
index eb5af9e5..0714d36 100644
--- a/services/core/java/com/android/server/am/ActivityStack.java
+++ b/services/core/java/com/android/server/am/ActivityStack.java
@@ -1326,7 +1326,12 @@
                         if (r != starting) {
                             mStackSupervisor.startSpecificActivityLocked(
                                     r, noStackActivityResumed, false);
-                            noStackActivityResumed = false;
+                            if (activityNdx >= activities.size()) {
+                                // Record may be removed if its process needs to restart.
+                                activityNdx = activities.size() - 1;
+                            } else {
+                                noStackActivityResumed = false;
+                            }
                         }
 
                     } else if (r.visible) {
diff --git a/services/core/java/com/android/server/am/BatteryStatsService.java b/services/core/java/com/android/server/am/BatteryStatsService.java
index c973386..3854e51 100644
--- a/services/core/java/com/android/server/am/BatteryStatsService.java
+++ b/services/core/java/com/android/server/am/BatteryStatsService.java
@@ -42,6 +42,7 @@
 import android.telephony.TelephonyManager;
 import android.util.Slog;
 
+import android.util.TimeUtils;
 import com.android.internal.annotations.GuardedBy;
 import com.android.internal.app.IBatteryStats;
 import com.android.internal.os.BatteryStatsHelper;
@@ -64,16 +65,22 @@
         implements PowerManagerInternal.LowPowerModeListener {
     static final String TAG = "BatteryStatsService";
 
-    private boolean mFirstExternalStatsUpdate = true;
     static IBatteryStats sService;
     final BatteryStatsImpl mStats;
     final BatteryStatsHandler mHandler;
     Context mContext;
     PowerManagerInternal mPowerManagerInternal;
 
+    final int UPDATE_CPU = 0x01;
+    final int UPDATE_WIFI = 0x02;
+    final int UPDATE_RADIO = 0x04;
+    final int UPDATE_BT = 0x08;
+    final int UPDATE_ALL = UPDATE_CPU | UPDATE_WIFI | UPDATE_RADIO | UPDATE_BT;
+
     class BatteryStatsHandler extends Handler implements BatteryStatsImpl.ExternalStatsSync {
         public static final int MSG_SYNC_EXTERNAL_STATS = 1;
         public static final int MSG_WRITE_TO_DISK = 2;
+        private int mUpdateFlags = 0;
 
         public BatteryStatsHandler(Looper looper) {
             super(looper);
@@ -83,11 +90,17 @@
         public void handleMessage(Message msg) {
             switch (msg.what) {
                 case MSG_SYNC_EXTERNAL_STATS:
-                    updateExternalStats((String)msg.obj, false);
+                    final int updateFlags;
+                    synchronized (this) {
+                        removeMessages(MSG_SYNC_EXTERNAL_STATS);
+                        updateFlags = mUpdateFlags;
+                        mUpdateFlags = 0;
+                    }
+                    updateExternalStats((String)msg.obj, updateFlags);
                     break;
 
                 case MSG_WRITE_TO_DISK:
-                    updateExternalStats("write", true);
+                    updateExternalStats("write", UPDATE_ALL);
                     synchronized (mStats) {
                         mStats.writeAsyncLocked();
                     }
@@ -97,9 +110,20 @@
 
         @Override
         public void scheduleSync(String reason) {
-            if (!hasMessages(MSG_SYNC_EXTERNAL_STATS)) {
-                Message msg = Message.obtain(this, MSG_SYNC_EXTERNAL_STATS, reason);
-                sendMessage(msg);
+            scheduleSyncImpl(reason, UPDATE_ALL);
+        }
+
+        @Override
+        public void scheduleWifiSync(String reason) {
+            scheduleSyncImpl(reason, UPDATE_WIFI);
+        }
+
+        private void scheduleSyncImpl(String reason, int updateFlags) {
+            synchronized (this) {
+                if (mUpdateFlags == 0) {
+                    sendMessage(Message.obtain(this, MSG_SYNC_EXTERNAL_STATS, reason));
+                }
+                mUpdateFlags |= updateFlags;
             }
         }
     }
@@ -137,7 +161,7 @@
     public void shutdown() {
         Slog.w("BatteryStats", "Writing battery stats before shutdown...");
 
-        updateExternalStats("shutdown", true);
+        updateExternalStats("shutdown", UPDATE_ALL);
         synchronized (mStats) {
             mStats.shutdownLocked();
         }
@@ -237,7 +261,7 @@
         //Slog.i("foo", "SENDING BATTERY INFO:");
         //mStats.dumpLocked(new LogPrinter(Log.INFO, "foo", Log.LOG_ID_SYSTEM));
         Parcel out = Parcel.obtain();
-        updateExternalStats("get-stats", true);
+        updateExternalStats("get-stats", UPDATE_ALL);
         synchronized (mStats) {
             mStats.writeToParcel(out, 0);
         }
@@ -252,7 +276,7 @@
         //Slog.i("foo", "SENDING BATTERY INFO:");
         //mStats.dumpLocked(new LogPrinter(Log.INFO, "foo", Log.LOG_ID_SYSTEM));
         Parcel out = Parcel.obtain();
-        updateExternalStats("get-stats", true);
+        updateExternalStats("get-stats", UPDATE_ALL);
         synchronized (mStats) {
             mStats.writeToParcel(out, 0);
         }
@@ -603,8 +627,10 @@
 
         // There was a change in WiFi power state.
         // Collect data now for the past activity.
-        mHandler.scheduleSync("wifi-data");
         synchronized (mStats) {
+            if (mStats.isOnBattery()) {
+                mHandler.scheduleWifiSync("wifi-data");
+            }
             mStats.noteWifiRadioPowerState(powerState, tsNanos);
         }
     }
@@ -767,10 +793,10 @@
     }
 
     @Override
-    public void noteDeviceIdleMode(boolean enabled, boolean fromActive, boolean fromMotion) {
+    public void noteDeviceIdleMode(boolean enabled, String activeReason, int activeUid) {
         enforceCallingPermission();
         synchronized (mStats) {
-            mStats.noteDeviceIdleModeLocked(enabled, fromActive, fromMotion);
+            mStats.noteDeviceIdleModeLocked(enabled, activeReason, activeUid);
         }
     }
 
@@ -807,7 +833,7 @@
 
         // Sync external stats first as the battery has changed states. If we don't sync
         // immediately here, we may not collect the relevant data later.
-        updateExternalStats("battery-state", false);
+        updateExternalStats("battery-state", UPDATE_ALL);
         synchronized (mStats) {
             mStats.setBatteryStateLocked(status, health, plugType, level, temp, volt);
         }
@@ -961,9 +987,9 @@
                         pw.println("Battery stats reset.");
                         noOutput = true;
                     }
-                    updateExternalStats("dump", true);
+                    updateExternalStats("dump", UPDATE_ALL);
                 } else if ("--write".equals(arg)) {
-                    updateExternalStats("dump", true);
+                    updateExternalStats("dump", UPDATE_ALL);
                     synchronized (mStats) {
                         mStats.writeSyncLocked();
                         pw.println("Battery stats written.");
@@ -1027,7 +1053,7 @@
                 flags |= BatteryStats.DUMP_DEVICE_WIFI_ONLY;
             }
             // Fetch data from external sources and update the BatteryStatsImpl object with them.
-            updateExternalStats("dump", true);
+            updateExternalStats("dump", UPDATE_ALL);
         } finally {
             Binder.restoreCallingIdentity(ident);
         }
@@ -1119,6 +1145,12 @@
                     return null;
                 }
 
+                final long timePeriodMs = info.mTimestamp - mLastInfo.mTimestamp;
+                final long lastIdleMs = mLastInfo.mControllerIdleTimeMs;
+                final long lastTxMs = mLastInfo.mControllerTxTimeMs;
+                final long lastRxMs = mLastInfo.mControllerRxTimeMs;
+                final long lastEnergy = mLastInfo.mControllerEnergyUsed;
+
                 // We will modify the last info object to be the delta, and store the new
                 // WifiActivityEnergyInfo object as our last one.
                 final WifiActivityEnergyInfo result = mLastInfo;
@@ -1126,19 +1158,16 @@
                 result.mStackState = info.getStackState();
 
                 // These times seem to be the most reliable.
-                result.mControllerTxTimeMs =
-                        info.mControllerTxTimeMs - mLastInfo.mControllerTxTimeMs;
-                result.mControllerRxTimeMs =
-                        info.mControllerRxTimeMs - mLastInfo.mControllerRxTimeMs;
+                result.mControllerTxTimeMs = info.mControllerTxTimeMs - lastTxMs;
+                result.mControllerRxTimeMs = info.mControllerRxTimeMs - lastRxMs;
 
                 // WiFi calculates the idle time as a difference from the on time and the various
                 // Rx + Tx times. There seems to be some missing time there because this sometimes
                 // becomes negative. Just cap it at 0 and move on.
                 // b/21613534
-                result.mControllerIdleTimeMs =
-                        Math.max(0, info.mControllerIdleTimeMs - mLastInfo.mControllerIdleTimeMs);
+                result.mControllerIdleTimeMs = Math.max(0, info.mControllerIdleTimeMs - lastIdleMs);
                 result.mControllerEnergyUsed =
-                        Math.max(0, info.mControllerEnergyUsed - mLastInfo.mControllerEnergyUsed);
+                        Math.max(0, info.mControllerEnergyUsed - lastEnergy);
 
                 if (result.mControllerTxTimeMs < 0 ||
                         result.mControllerRxTimeMs < 0) {
@@ -1151,6 +1180,34 @@
 
                     Slog.v(TAG, "WiFi energy data was reset, new WiFi energy data is " + result);
                 }
+
+                final long totalTimeMs = result.mControllerIdleTimeMs + result.mControllerRxTimeMs +
+                        result.mControllerTxTimeMs;
+                if (totalTimeMs > timePeriodMs) {
+                    StringBuilder sb = new StringBuilder();
+                    sb.append("Total time ");
+                    TimeUtils.formatDuration(totalTimeMs, sb);
+                    sb.append(" is longer than sample period ");
+                    TimeUtils.formatDuration(timePeriodMs, sb);
+                    sb.append(".\n");
+                    sb.append("Previous WiFi snapshot: ").append("idle=");
+                    TimeUtils.formatDuration(lastIdleMs, sb);
+                    sb.append(" rx=");
+                    TimeUtils.formatDuration(lastRxMs, sb);
+                    sb.append(" tx=");
+                    TimeUtils.formatDuration(lastTxMs, sb);
+                    sb.append(" e=").append(lastEnergy);
+                    sb.append("\n");
+                    sb.append("Current WiFi snapshot: ").append("idle=");
+                    TimeUtils.formatDuration(info.mControllerIdleTimeMs, sb);
+                    sb.append(" rx=");
+                    TimeUtils.formatDuration(info.mControllerRxTimeMs, sb);
+                    sb.append(" tx=");
+                    TimeUtils.formatDuration(info.mControllerTxTimeMs, sb);
+                    sb.append(" e=").append(info.mControllerEnergyUsed);
+                    Slog.wtf(TAG, sb.toString());
+                }
+
                 mLastInfo = info;
                 return result;
             }
@@ -1184,15 +1241,12 @@
      * We first grab a lock specific to this method, then once all the data has been collected,
      * we grab the mStats lock and update the data.
      *
-     * TODO(adamlesinski): When we start distributing bluetooth data to apps, we'll want to
-     * separate these external stats so that they can be collected individually and on different
-     * intervals.
-     *
      * @param reason The reason why this collection was requested. Useful for debugging.
-     * @param force If false, some stats may decide not to be collected for efficiency as their
-     *              results aren't needed immediately. When true, collect all stats unconditionally.
+     * @param updateFlags Which external stats to update. Can be a combination of
+     *                    {@link #UPDATE_CPU}, {@link #UPDATE_RADIO}, {@link #UPDATE_WIFI},
+     *                    and {@link #UPDATE_BT}.
      */
-    void updateExternalStats(String reason, boolean force) {
+    void updateExternalStats(final String reason, final int updateFlags) {
         synchronized (mExternalStatsLock) {
             if (mContext == null) {
                 // We haven't started yet (which means the BatteryStatsImpl object has
@@ -1200,34 +1254,46 @@
                 return;
             }
 
-            final WifiActivityEnergyInfo wifiEnergyInfo = pullWifiEnergyInfoLocked();
-            final BluetoothActivityEnergyInfo bluetoothEnergyInfo;
-            if (force) {
+            if (BatteryStatsImpl.DEBUG_ENERGY) {
+                Slog.d(TAG, "Updating external stats: reason=" + reason);
+            }
+
+            WifiActivityEnergyInfo wifiEnergyInfo = null;
+            if ((updateFlags & UPDATE_WIFI) != 0) {
+                wifiEnergyInfo = pullWifiEnergyInfoLocked();
+            }
+
+            BluetoothActivityEnergyInfo bluetoothEnergyInfo = null;
+            if ((updateFlags & UPDATE_BT) != 0) {
                 // We only pull bluetooth stats when we have to, as we are not distributing its
                 // use amongst apps and the sampling frequency does not matter.
                 bluetoothEnergyInfo = pullBluetoothEnergyInfoLocked();
-            } else {
-                bluetoothEnergyInfo = null;
             }
 
             synchronized (mStats) {
+                final long elapsedRealtime = SystemClock.elapsedRealtime();
+                final long uptime = SystemClock.uptimeMillis();
                 if (mStats.mRecordAllHistory) {
-                    final long elapsedRealtime = SystemClock.elapsedRealtime();
-                    final long uptime = SystemClock.uptimeMillis();
                     mStats.addHistoryEventLocked(elapsedRealtime, uptime,
                             BatteryStats.HistoryItem.EVENT_COLLECT_EXTERNAL_STATS, reason, 0);
                 }
-                mStats.updateCpuTimeLocked(mFirstExternalStatsUpdate);
-                mStats.updateKernelWakelocksLocked();
-                mStats.updateMobileRadioStateLocked(SystemClock.elapsedRealtime());
-                mStats.updateWifiStateLocked(wifiEnergyInfo);
-                mStats.updateBluetoothStateLocked(bluetoothEnergyInfo);
-            }
 
-            if (mFirstExternalStatsUpdate) {
-                // We have read the stats for the first time, which means we have a baseline
-                // from which to calculate delta.
-                mFirstExternalStatsUpdate = false;
+                if ((updateFlags & UPDATE_CPU) != 0) {
+                    mStats.updateCpuTimeLocked();
+                    mStats.updateKernelWakelocksLocked();
+                }
+
+                if ((updateFlags & UPDATE_RADIO) != 0) {
+                    mStats.updateMobileRadioStateLocked(elapsedRealtime);
+                }
+
+                if ((updateFlags & UPDATE_WIFI) != 0) {
+                    mStats.updateWifiStateLocked(wifiEnergyInfo);
+                }
+
+                if ((updateFlags & UPDATE_BT) != 0) {
+                    mStats.updateBluetoothStateLocked(bluetoothEnergyInfo);
+                }
             }
         }
     }
diff --git a/services/core/java/com/android/server/am/BroadcastQueue.java b/services/core/java/com/android/server/am/BroadcastQueue.java
index 80b8a93..2335071 100644
--- a/services/core/java/com/android/server/am/BroadcastQueue.java
+++ b/services/core/java/com/android/server/am/BroadcastQueue.java
@@ -26,6 +26,7 @@
 import android.app.ActivityManager;
 import android.app.AppGlobals;
 import android.app.AppOpsManager;
+import android.app.BroadcastOptions;
 import android.content.ComponentName;
 import android.content.IIntentReceiver;
 import android.content.Intent;
@@ -43,6 +44,7 @@
 import android.os.UserHandle;
 import android.util.EventLog;
 import android.util.Slog;
+import com.android.server.DeviceIdleController;
 
 import static com.android.server.am.ActivityManagerDebugConfig.*;
 
@@ -146,6 +148,8 @@
 
     static final int BROADCAST_INTENT_MSG = ActivityManagerService.FIRST_BROADCAST_QUEUE_MSG;
     static final int BROADCAST_TIMEOUT_MSG = ActivityManagerService.FIRST_BROADCAST_QUEUE_MSG + 1;
+    static final int SCHEDULE_TEMP_WHITELIST_MSG
+            = ActivityManagerService.FIRST_BROADCAST_QUEUE_MSG + 2;
 
     final BroadcastHandler mHandler;
 
@@ -167,6 +171,13 @@
                         broadcastTimeoutLocked(true);
                     }
                 } break;
+                case SCHEDULE_TEMP_WHITELIST_MSG: {
+                    DeviceIdleController.LocalService dic = mService.mLocalDeviceIdleController;
+                    if (dic != null) {
+                        dic.addPowerSaveTempWhitelistAppDirect(UserHandle.getAppId(msg.arg1),
+                                msg.arg2);
+                    }
+                } break;
             }
         }
     };
@@ -547,6 +558,19 @@
         }
     }
 
+    final void scheduleTempWhitelistLocked(int uid, long duration) {
+        if (duration > Integer.MAX_VALUE) {
+            duration = Integer.MAX_VALUE;
+        }
+        // XXX ideally we should pause the broadcast until everything behind this is done,
+        // or else we will likely start dispatching the broadcast before we have opened
+        // access to the app (there is a lot of asynchronicity behind this).  It is probably
+        // not that big a deal, however, because the main purpose here is to allow apps
+        // to hold wake locks, and they will be able to acquire their wake lock immediately
+        // it just won't be enabled until we get through this work.
+        mHandler.obtainMessage(SCHEDULE_TEMP_WHITELIST_MSG, uid, (int)duration).sendToTarget();
+    }
+
     final void processNextBroadcast(boolean fromMsg) {
         synchronized(mService) {
             BroadcastRecord r;
@@ -721,7 +745,9 @@
                 setBroadcastTimeoutLocked(timeoutTime);
             }
 
-            Object nextReceiver = r.receivers.get(recIdx);
+            final BroadcastOptions brOptions = r.options;
+            final Object nextReceiver = r.receivers.get(recIdx);
+
             if (nextReceiver instanceof BroadcastFilter) {
                 // Simple case: this is a registered receiver who gets
                 // a direct call.
@@ -739,6 +765,11 @@
                             + r.ordered + " receiver=" + r.receiver);
                     r.state = BroadcastRecord.IDLE;
                     scheduleBroadcastsLocked();
+                } else {
+                    if (brOptions != null && brOptions.getTemporaryAppWhitelistDuration() > 0) {
+                        scheduleTempWhitelistLocked(filter.owningUid,
+                                brOptions.getTemporaryAppWhitelistDuration());
+                    }
                 }
                 return;
             }
@@ -882,6 +913,11 @@
                         + info.activityInfo.applicationInfo.uid);
             }
 
+            if (brOptions != null && brOptions.getTemporaryAppWhitelistDuration() > 0) {
+                scheduleTempWhitelistLocked(receiverUid,
+                        brOptions.getTemporaryAppWhitelistDuration());
+            }
+
             // Broadcast is being executed, its package can't be stopped.
             try {
                 AppGlobals.getPackageManager().setPackageStoppedState(
diff --git a/services/core/java/com/android/server/am/BroadcastRecord.java b/services/core/java/com/android/server/am/BroadcastRecord.java
index c050d03f..b943222 100644
--- a/services/core/java/com/android/server/am/BroadcastRecord.java
+++ b/services/core/java/com/android/server/am/BroadcastRecord.java
@@ -17,6 +17,7 @@
 package com.android.server.am;
 
 import android.app.AppOpsManager;
+import android.app.BroadcastOptions;
 import android.content.IIntentReceiver;
 import android.content.ComponentName;
 import android.content.Intent;
@@ -52,6 +53,7 @@
     final String resolvedType; // the resolved data type
     final String requiredPermission; // a permission the caller has required
     final int appOp;        // an app op that is associated with this broadcast
+    final BroadcastOptions options; // BroadcastOptions supplied by caller
     final List receivers;   // contains BroadcastFilter and ResolveInfo
     IIntentReceiver resultTo; // who receives final result if non-null
     long enqueueClockTime;  // the clock time the broadcast was enqueued
@@ -105,6 +107,9 @@
             pw.print(prefix); pw.print("requiredPermission="); pw.print(requiredPermission);
                     pw.print("  appOp="); pw.println(appOp);
         }
+        if (options != null) {
+            pw.print(prefix); pw.print("options="); pw.println(options.toBundle());
+        }
         pw.print(prefix); pw.print("enqueueClockTime=");
                 pw.print(new Date(enqueueClockTime));
                 pw.print(" dispatchClockTime=");
@@ -180,8 +185,8 @@
     BroadcastRecord(BroadcastQueue _queue,
             Intent _intent, ProcessRecord _callerApp, String _callerPackage,
             int _callingPid, int _callingUid, String _resolvedType, String _requiredPermission,
-            int _appOp, List _receivers, IIntentReceiver _resultTo, int _resultCode,
-            String _resultData, Bundle _resultExtras, boolean _serialized,
+            int _appOp, BroadcastOptions _options, List _receivers, IIntentReceiver _resultTo,
+            int _resultCode, String _resultData, Bundle _resultExtras, boolean _serialized,
             boolean _sticky, boolean _initialSticky,
             int _userId) {
         queue = _queue;
@@ -194,6 +199,7 @@
         resolvedType = _resolvedType;
         requiredPermission = _requiredPermission;
         appOp = _appOp;
+        options = _options;
         receivers = _receivers;
         resultTo = _resultTo;
         resultCode = _resultCode;
diff --git a/services/core/java/com/android/server/am/PendingIntentRecord.java b/services/core/java/com/android/server/am/PendingIntentRecord.java
index 531de46..ece3ffb 100644
--- a/services/core/java/com/android/server/am/PendingIntentRecord.java
+++ b/services/core/java/com/android/server/am/PendingIntentRecord.java
@@ -199,9 +199,9 @@
     }
 
     public int send(int code, Intent intent, String resolvedType, IIntentReceiver finishedReceiver,
-            String requiredPermission) throws TransactionTooLargeException {
+            String requiredPermission, Bundle options) throws TransactionTooLargeException {
         return sendInner(code, intent, resolvedType, finishedReceiver,
-                requiredPermission, null, null, 0, 0, 0, null, null);
+                requiredPermission, null, null, 0, 0, 0, options, null);
     }
 
     int sendInner(int code, Intent intent, String resolvedType, IIntentReceiver finishedReceiver,
@@ -293,9 +293,9 @@
                             // If a completion callback has been requested, require
                             // that the broadcast be delivered synchronously
                             int sent = owner.broadcastIntentInPackage(key.packageName, uid,
-                                    finalIntent, resolvedType,
-                                    finishedReceiver, code, null, null,
-                                requiredPermission, (finishedReceiver != null), false, userId);
+                                    finalIntent, resolvedType, finishedReceiver, code, null, null,
+                                    requiredPermission, options, (finishedReceiver != null),
+                                    false, userId);
                             if (sent == ActivityManager.BROADCAST_SUCCESS) {
                                 sendFinish = false;
                             }
diff --git a/services/core/java/com/android/server/am/ServiceRecord.java b/services/core/java/com/android/server/am/ServiceRecord.java
index 236af37..87cb40e 100644
--- a/services/core/java/com/android/server/am/ServiceRecord.java
+++ b/services/core/java/com/android/server/am/ServiceRecord.java
@@ -445,6 +445,11 @@
                             // icon, but this used to be able to slip through, so for
                             // those dirty apps we will create a notification clearly
                             // blaming the app.
+                            Slog.v(TAG, "Attempted to start a foreground service ("
+                                    + name
+                                    + ") with a broken notification (no icon: "
+                                    + localForegroundNoti
+                                    + ")");
 
                             CharSequence appName = appInfo.loadLabel(
                                     ams.mContext.getPackageManager());
@@ -461,6 +466,12 @@
                                 // it's ugly, but it clearly identifies the app
                                 notiBuilder.setSmallIcon(appInfo.icon);
 
+                                // mark as foreground
+                                notiBuilder.setFlag(Notification.FLAG_FOREGROUND_SERVICE, true);
+
+                                // we are doing the app a kindness here
+                                notiBuilder.setPriority(Notification.PRIORITY_MIN);
+
                                 Intent runningIntent = new Intent(
                                         Settings.ACTION_APPLICATION_DETAILS_SETTINGS);
                                 runningIntent.setData(Uri.fromParts("package",
@@ -498,6 +509,8 @@
                         nm.enqueueNotification(localPackageName, localPackageName,
                                 appUid, appPid, null, localForegroundId, localForegroundNoti,
                                 outId, userId);
+
+                        foregroundNoti = localForegroundNoti; // save it for amending next time
                     } catch (RuntimeException e) {
                         Slog.w(TAG, "Error showing notification for service", e);
                         // If it gave us a garbage notification, it doesn't
diff --git a/services/core/java/com/android/server/audio/AudioService.java b/services/core/java/com/android/server/audio/AudioService.java
index d39b25f..47d3bde 100644
--- a/services/core/java/com/android/server/audio/AudioService.java
+++ b/services/core/java/com/android/server/audio/AudioService.java
@@ -1542,11 +1542,7 @@
 
     // UI update and Broadcast Intent
     private void sendVolumeUpdate(int streamType, int oldIndex, int index, int flags) {
-        if (!isPlatformVoice() && (streamType == AudioSystem.STREAM_RING)) {
-            streamType = AudioSystem.STREAM_NOTIFICATION;
-        } else {
-            streamType = mStreamVolumeAlias[streamType];
-        }
+        streamType = mStreamVolumeAlias[streamType];
 
         if (streamType == AudioSystem.STREAM_MUSIC) {
             flags = updateFlagsForSystemAudio(flags);
diff --git a/services/core/java/com/android/server/audio/MediaFocusControl.java b/services/core/java/com/android/server/audio/MediaFocusControl.java
index 4ccb5ad..f72b598 100644
--- a/services/core/java/com/android/server/audio/MediaFocusControl.java
+++ b/services/core/java/com/android/server/audio/MediaFocusControl.java
@@ -46,10 +46,12 @@
 import android.os.Bundle;
 import android.os.Handler;
 import android.os.IBinder;
+import android.os.IDeviceIdleController;
 import android.os.Looper;
 import android.os.Message;
 import android.os.PowerManager;
 import android.os.RemoteException;
+import android.os.ServiceManager;
 import android.os.UserHandle;
 import android.provider.Settings;
 import android.speech.RecognizerIntent;
@@ -1086,6 +1088,14 @@
             voiceIntent = new Intent(android.speech.RecognizerIntent.ACTION_WEB_SEARCH);
             Log.i(TAG, "voice-based interactions: about to use ACTION_WEB_SEARCH");
         } else {
+            IDeviceIdleController dic = IDeviceIdleController.Stub.asInterface(
+                    ServiceManager.getService(Context.DEVICE_IDLE_CONTROLLER));
+            if (dic != null) {
+                try {
+                    dic.exitIdle("voice-search");
+                } catch (RemoteException e) {
+                }
+            }
             voiceIntent = new Intent(RecognizerIntent.ACTION_VOICE_SEARCH_HANDS_FREE);
             voiceIntent.putExtra(RecognizerIntent.EXTRA_SECURE,
                     isLocked && mKeyguardManager.isKeyguardSecure());
diff --git a/services/core/java/com/android/server/media/MediaSessionRecord.java b/services/core/java/com/android/server/media/MediaSessionRecord.java
index dca762c..569a0fc 100644
--- a/services/core/java/com/android/server/media/MediaSessionRecord.java
+++ b/services/core/java/com/android/server/media/MediaSessionRecord.java
@@ -242,19 +242,17 @@
         }
         if (mVolumeType == PlaybackInfo.PLAYBACK_TYPE_LOCAL) {
             int stream = AudioAttributes.toLegacyStreamType(mAudioAttrs);
+            // Adjust the volume with a handler not to be blocked by other system service.
             if (useSuggested) {
                 if (AudioSystem.isStreamActive(stream, 0)) {
-                    mAudioManagerInternal.adjustSuggestedStreamVolumeForUid(stream, direction,
-                            flags, packageName, uid);
+                    postAdjustSuggestedStreamVolume(stream, direction, flags, packageName, uid);
                 } else {
                     flags |= previousFlagPlaySound;
-                    mAudioManagerInternal.adjustSuggestedStreamVolumeForUid(
-                            AudioManager.USE_DEFAULT_STREAM_TYPE, direction, flags, packageName,
-                            uid);
+                    postAdjustSuggestedStreamVolume(AudioManager.USE_DEFAULT_STREAM_TYPE, direction,
+                            flags, packageName, uid);
                 }
             } else {
-                mAudioManagerInternal.adjustStreamVolumeForUid(stream, direction, flags,
-                        packageName, uid);
+                postAdjustStreamVolume(stream, direction, flags, packageName, uid);
             }
         } else {
             if (mVolumeControlType == VolumeProvider.VOLUME_CONTROL_FIXED) {
@@ -461,6 +459,28 @@
         return mPackageName + "/" + mTag;
     }
 
+    private void postAdjustSuggestedStreamVolume(final int streamType, final int direction,
+            final int flags, final String callingPackage, final int uid) {
+        mHandler.post(new Runnable() {
+            @Override
+            public void run() {
+                mAudioManagerInternal.adjustSuggestedStreamVolumeForUid(streamType, direction,
+                        flags, callingPackage, uid);
+            }
+        });
+    }
+
+    private void postAdjustStreamVolume(final int streamType, final int direction, final int flags,
+            final String callingPackage, final int uid) {
+        mHandler.post(new Runnable() {
+            @Override
+            public void run() {
+                mAudioManagerInternal.adjustStreamVolumeForUid(streamType, direction, flags,
+                        callingPackage, uid);
+            }
+        });
+    }
+
     private String getShortMetadataString() {
         int fields = mMetadata == null ? 0 : mMetadata.size();
         MediaDescription description = mMetadata == null ? null : mMetadata
diff --git a/services/core/java/com/android/server/net/LockdownVpnTracker.java b/services/core/java/com/android/server/net/LockdownVpnTracker.java
index 0f88883..9db6a06 100644
--- a/services/core/java/com/android/server/net/LockdownVpnTracker.java
+++ b/services/core/java/com/android/server/net/LockdownVpnTracker.java
@@ -17,6 +17,7 @@
 package com.android.server.net;
 
 import static android.Manifest.permission.CONNECTIVITY_INTERNAL;
+import static android.net.NetworkPolicyManager.FIREWALL_CHAIN_NONE;
 import static android.net.NetworkPolicyManager.FIREWALL_RULE_ALLOW;
 import static android.net.NetworkPolicyManager.FIREWALL_RULE_DEFAULT;
 
@@ -201,8 +202,8 @@
                     setFirewallEgressSourceRule(addr, true);
                 }
 
-                mNetService.setFirewallUidRule(ROOT_UID, FIREWALL_RULE_ALLOW);
-                mNetService.setFirewallUidRule(Os.getuid(), FIREWALL_RULE_ALLOW);
+                mNetService.setFirewallUidRule(FIREWALL_CHAIN_NONE, ROOT_UID, FIREWALL_RULE_ALLOW);
+                mNetService.setFirewallUidRule(FIREWALL_CHAIN_NONE, Os.getuid(), FIREWALL_RULE_ALLOW);
 
                 mErrorCount = 0;
                 mAcceptedIface = iface;
@@ -291,8 +292,8 @@
                     setFirewallEgressSourceRule(addr, false);
                 }
 
-                mNetService.setFirewallUidRule(ROOT_UID, FIREWALL_RULE_DEFAULT);
-                mNetService.setFirewallUidRule(Os.getuid(), FIREWALL_RULE_DEFAULT);
+                mNetService.setFirewallUidRule(FIREWALL_CHAIN_NONE, ROOT_UID, FIREWALL_RULE_DEFAULT);
+                mNetService.setFirewallUidRule(FIREWALL_CHAIN_NONE,Os.getuid(), FIREWALL_RULE_DEFAULT);
 
                 mAcceptedSourceAddr = null;
             }
diff --git a/services/core/java/com/android/server/net/NetworkPolicyManagerService.java b/services/core/java/com/android/server/net/NetworkPolicyManagerService.java
index e009455..b0550d6 100644
--- a/services/core/java/com/android/server/net/NetworkPolicyManagerService.java
+++ b/services/core/java/com/android/server/net/NetworkPolicyManagerService.java
@@ -36,8 +36,10 @@
 import static android.net.NetworkPolicy.SNOOZE_NEVER;
 import static android.net.NetworkPolicy.WARNING_DISABLED;
 import static android.net.NetworkPolicyManager.EXTRA_NETWORK_TEMPLATE;
+import static android.net.NetworkPolicyManager.FIREWALL_CHAIN_DOZABLE;
+import static android.net.NetworkPolicyManager.FIREWALL_CHAIN_STANDBY;
+import static android.net.NetworkPolicyManager.FIREWALL_RULE_ALLOW;
 import static android.net.NetworkPolicyManager.FIREWALL_RULE_DENY;
-import static android.net.NetworkPolicyManager.FIREWALL_RULE_DEFAULT;
 import static android.net.NetworkPolicyManager.POLICY_ALLOW_BACKGROUND_BATTERY_SAVE;
 import static android.net.NetworkPolicyManager.POLICY_NONE;
 import static android.net.NetworkPolicyManager.POLICY_REJECT_METERED_BACKGROUND;
@@ -80,7 +82,6 @@
 import android.app.AppOpsManager;
 import android.app.IActivityManager;
 import android.app.INotificationManager;
-import android.app.IProcessObserver;
 import android.app.IUidObserver;
 import android.app.Notification;
 import android.app.PendingIntent;
@@ -141,7 +142,6 @@
 import android.util.NtpTrustedTime;
 import android.util.Pair;
 import android.util.Slog;
-import android.util.SparseArray;
 import android.util.SparseBooleanArray;
 import android.util.SparseIntArray;
 import android.util.TrustedTime;
@@ -279,6 +279,7 @@
     final SparseIntArray mUidPolicy = new SparseIntArray();
     /** Currently derived rules for each UID. */
     final SparseIntArray mUidRules = new SparseIntArray();
+    final SparseBooleanArray mFirewallChainStates = new SparseBooleanArray();
 
     /**
      * UIDs that have been white-listed to always be able to have network access
@@ -412,8 +413,6 @@
 
         mUsageStats = LocalServices.getService(UsageStatsManagerInternal.class);
 
-        final PackageManager pm = mContext.getPackageManager();
-
         synchronized (mRulesLock) {
             updatePowerSaveWhitelistLocked();
             mPowerManagerInternal = LocalServices.getService(PowerManagerInternal.class);
@@ -1103,7 +1102,7 @@
         // will not have a bandwidth limit.  Also only do this if restrict
         // background data use is *not* enabled, since that takes precendence
         // use over those networks can have a cost associated with it).
-        final boolean powerSave = (mRestrictPower || mDeviceIdleMode) && !mRestrictBackground;
+        final boolean powerSave = mRestrictPower && !mRestrictBackground;
 
         // First, generate identities of all connected networks so we can
         // quickly compare them against all defined policies below.
@@ -2024,6 +2023,29 @@
         }
     }
 
+    void updateRulesForDeviceIdleLocked() {
+        if (mDeviceIdleMode) {
+            // sync the whitelists before enable dozable chain.  We don't care about the rules if
+            // we are disabling the chain.
+            SparseIntArray uidRules = new SparseIntArray();
+            final List<UserInfo> users = mUserManager.getUsers();
+            for (UserInfo user : users) {
+                for (int i = mPowerSaveTempWhitelistAppIds.size() - 1; i >= 0; i--) {
+                    int appId = mPowerSaveTempWhitelistAppIds.keyAt(i);
+                    int uid = UserHandle.getUid(user.id, appId);
+                    uidRules.put(uid, FIREWALL_RULE_ALLOW);
+                }
+                for (int i = mPowerSaveWhitelistAppIds.size() - 1; i >= 0; i--) {
+                    int appId = mPowerSaveWhitelistAppIds.keyAt(i);
+                    int uid = UserHandle.getUid(user.id, appId);
+                    uidRules.put(uid, FIREWALL_RULE_ALLOW);
+                }
+            }
+            setUidFirewallRules(FIREWALL_CHAIN_DOZABLE, uidRules);
+        }
+        enableFirewallChain(FIREWALL_CHAIN_DOZABLE, mDeviceIdleMode);
+    }
+
     /**
      * Update rules that might be changed by {@link #mRestrictBackground},
      * {@link #mRestrictPower}, or {@link #mDeviceIdleMode} value.
@@ -2034,10 +2056,12 @@
         // If we are in restrict power mode, we allow all important apps
         // to have data access.  Otherwise, we restrict data access to only
         // the top apps.
-        mCurForegroundState = (!mRestrictBackground && (mRestrictPower || mDeviceIdleMode))
+        mCurForegroundState = (!mRestrictBackground && mRestrictPower)
                 ? ActivityManager.PROCESS_STATE_FOREGROUND_SERVICE
                 : ActivityManager.PROCESS_STATE_TOP;
 
+        updateRulesForDeviceIdleLocked();
+
         // update rules for all installed applications
         final List<UserInfo> users = mUserManager.getUsers();
         final List<ApplicationInfo> apps = pm.getInstalledApplications(
@@ -2131,7 +2155,7 @@
                 // uid in background, and global background disabled
                 uidRules = RULE_REJECT_METERED;
             }
-        } else if (mRestrictPower || mDeviceIdleMode) {
+        } else if (mRestrictPower) {
             final boolean whitelisted = mPowerSaveWhitelistAppIds.get(appId)
                     || mPowerSaveTempWhitelistAppIds.get(appId);
             if (!whitelisted && !uidForeground
@@ -2162,7 +2186,12 @@
         final boolean oldFirewallReject = (oldRules & RULE_REJECT_ALL) != 0;
         final boolean firewallReject = (uidRules & RULE_REJECT_ALL) != 0;
         if (oldFirewallReject != firewallReject) {
-            setUidFirewallRules(uid, firewallReject);
+            setUidFirewallRule(FIREWALL_CHAIN_STANDBY, uid, firewallReject);
+            if (mDeviceIdleMode && !firewallReject) {
+                // if we are in device idle mode, and we decide to allow this uid.  we need to punch
+                // a hole in the device idle chain.
+                setUidFirewallRule(FIREWALL_CHAIN_DOZABLE, uid, false);
+            }
         }
 
         // dispatch changed rule to existing listeners
@@ -2314,14 +2343,20 @@
     }
 
     /**
-     * Add or remove a uid to the firewall blacklist for all network ifaces.
-     * @param uid
-     * @param rejectOnAll
+     * Set uid rules on a particular firewall chain. This is going to synchronize the rules given
+     * here to netd.  It will clean up dead rules and make sure the target chain only contains rules
+     * specified here.
      */
-    private void setUidFirewallRules(int uid, boolean rejectOnAll) {
+    private void setUidFirewallRules(int chain, SparseIntArray uidRules) {
         try {
-            mNetworkManager.setFirewallUidRule(uid,
-                    rejectOnAll ? FIREWALL_RULE_DENY : FIREWALL_RULE_DEFAULT);
+            int size = uidRules.size();
+            int[] uids = new int[size];
+            int[] rules = new int[size];
+            for(int index = size - 1; index >= 0; --index) {
+                uids[index] = uidRules.keyAt(index);
+                rules[index] = uidRules.valueAt(index);
+            }
+            mNetworkManager.setFirewallUidRules(chain, uids, rules);
         } catch (IllegalStateException e) {
             Log.wtf(TAG, "problem setting firewall uid rules", e);
         } catch (RemoteException e) {
@@ -2329,6 +2364,38 @@
         }
     }
 
+    /**
+     * Add or remove a uid to the firewall blacklist for all network ifaces.
+     */
+    private void setUidFirewallRule(int chain, int uid, boolean rejectOnAll) {
+        try {
+            mNetworkManager.setFirewallUidRule(chain, uid,
+                    rejectOnAll ? FIREWALL_RULE_DENY : FIREWALL_RULE_ALLOW);
+        } catch (IllegalStateException e) {
+            Log.wtf(TAG, "problem setting firewall uid rules", e);
+        } catch (RemoteException e) {
+            // ignored; service lives in system_server
+        }
+    }
+
+    /**
+     * Add or remove a uid to the firewall blacklist for all network ifaces.
+     */
+    private void enableFirewallChain(int chain, boolean enable) {
+        if (mFirewallChainStates.indexOfKey(chain) >= 0 &&
+                mFirewallChainStates.get(chain) == enable) {
+            // All is the same, nothing to do.
+            return;
+        }
+        try {
+            mNetworkManager.setFirewallChainEnabled(chain, enable);
+        } catch (IllegalStateException e) {
+            Log.wtf(TAG, "problem enable firewall chain", e);
+        } catch (RemoteException e) {
+            // ignored; service lives in system_server
+        }
+    }
+
     private long getTotalBytes(NetworkTemplate template, long start, long end) {
         try {
             return mNetworkStats.getNetworkTotalBytes(template, start, end);
diff --git a/services/core/java/com/android/server/pm/PackageManagerService.java b/services/core/java/com/android/server/pm/PackageManagerService.java
index 5b7dd70..cbb90ba 100644
--- a/services/core/java/com/android/server/pm/PackageManagerService.java
+++ b/services/core/java/com/android/server/pm/PackageManagerService.java
@@ -1586,6 +1586,11 @@
                 grantRequestedRuntimePermissionsForUser(pkg, someUserId);
             }
         }
+
+        // We could have touched GID membership, so flush out packages.list
+        synchronized (mPackages) {
+            mSettings.writePackageListLPr();
+        }
     }
 
     private void grantRequestedRuntimePermissionsForUser(PackageParser.Package pkg, int userId) {
@@ -7719,7 +7724,7 @@
                 }
             }
         }
-        
+
         if (pkgInfo != null) {
             grantPermissionsLPw(pkgInfo, (flags&UPDATE_PERMISSIONS_REPLACE_PKG) != 0, changingPkg);
         }
@@ -7999,7 +8004,7 @@
 
         // Persist the runtime permissions state for users with changes.
         for (int userId : changedRuntimePermissionUserIds) {
-            mSettings.writeRuntimePermissionsForUserLPr(userId, true);
+            mSettings.writeRuntimePermissionsForUserLPr(userId, false);
         }
     }
 
@@ -8808,7 +8813,7 @@
                         }
                         am.broadcastIntent(null, intent, null, finishedReceiver,
                                 0, null, null, null, android.app.AppOpsManager.OP_NONE,
-                                finishedReceiver != null, false, id);
+                                null, finishedReceiver != null, false, id);
                     }
                 } catch (RemoteException ex) {
                 }
@@ -8982,7 +8987,7 @@
                         .addFlags(Intent.FLAG_INCLUDE_STOPPED_PACKAGES)
                         .setPackage(packageName);
                 am.broadcastIntent(null, bcIntent, null, null, 0, null, null, null,
-                        android.app.AppOpsManager.OP_NONE, false, false, userId);
+                        android.app.AppOpsManager.OP_NONE, null, false, false, userId);
             }
         } catch (RemoteException e) {
             // shouldn't happen
@@ -14085,7 +14090,9 @@
                 }
             }
 
-            if (!checkin && dumpState.isDumping(DumpState.DUMP_DOMAIN_PREFERRED)) {
+            if (!checkin
+                    && dumpState.isDumping(DumpState.DUMP_DOMAIN_PREFERRED)
+                    && packageName == null) {
                 pw.println();
                 int count = mSettings.mPackages.size();
                 if (count == 0) {
diff --git a/services/core/java/com/android/server/policy/PhoneWindowManager.java b/services/core/java/com/android/server/policy/PhoneWindowManager.java
index dbcfa19..bd545df 100644
--- a/services/core/java/com/android/server/policy/PhoneWindowManager.java
+++ b/services/core/java/com/android/server/policy/PhoneWindowManager.java
@@ -56,6 +56,7 @@
 import android.os.FactoryTest;
 import android.os.Handler;
 import android.os.IBinder;
+import android.os.IDeviceIdleController;
 import android.os.Looper;
 import android.os.Message;
 import android.os.Messenger;
@@ -2734,6 +2735,14 @@
                 if (!keyguardOn) {
                     voiceIntent = new Intent(RecognizerIntent.ACTION_WEB_SEARCH);
                 } else {
+                    IDeviceIdleController dic = IDeviceIdleController.Stub.asInterface(
+                            ServiceManager.getService(Context.DEVICE_IDLE_CONTROLLER));
+                    if (dic != null) {
+                        try {
+                            dic.exitIdle("voice-search");
+                        } catch (RemoteException e) {
+                        }
+                    }
                     voiceIntent = new Intent(RecognizerIntent.ACTION_VOICE_SEARCH_HANDS_FREE);
                     voiceIntent.putExtra(RecognizerIntent.EXTRA_SECURE, true);
                 }
@@ -3739,13 +3748,14 @@
             attrs.gravity = Gravity.BOTTOM;
             mDockLayer = win.getSurfaceLayer();
         } else if (attrs.type == TYPE_VOICE_INTERACTION) {
-            pf.left = df.left = of.left = cf.left = vf.left = mUnrestrictedScreenLeft;
+            pf.left = df.left = of.left = mUnrestrictedScreenLeft;
             pf.top = df.top = of.top = mUnrestrictedScreenTop;
-            pf.right = df.right = of.right = cf.right = vf.right = mUnrestrictedScreenLeft
-                    + mUnrestrictedScreenWidth;
-            pf.bottom = df.bottom = of.bottom = cf.bottom = mUnrestrictedScreenTop
-                    + mUnrestrictedScreenHeight;
+            pf.right = df.right = of.right = mUnrestrictedScreenLeft + mUnrestrictedScreenWidth;
+            pf.bottom = df.bottom = of.bottom = mUnrestrictedScreenTop + mUnrestrictedScreenHeight;
             cf.bottom = vf.bottom = mStableBottom;
+            // Note: In Phone landscape mode, the button bar should also be excluded.
+            cf.right = vf.right = mStableRight;
+            cf.left = vf.left = mStableLeft;
             cf.top = vf.top = mStableTop;
         } else if (win == mStatusBar) {
             pf.left = df.left = of.left = mUnrestrictedScreenLeft;
@@ -5191,6 +5201,14 @@
     }
 
     void launchVoiceAssistWithWakeLock(boolean keyguardActive) {
+        IDeviceIdleController dic = IDeviceIdleController.Stub.asInterface(
+                ServiceManager.getService(Context.DEVICE_IDLE_CONTROLLER));
+        if (dic != null) {
+            try {
+                dic.exitIdle("voice-search");
+            } catch (RemoteException e) {
+            }
+        }
         Intent voiceIntent =
             new Intent(RecognizerIntent.ACTION_VOICE_SEARCH_HANDS_FREE);
         voiceIntent.putExtra(RecognizerIntent.EXTRA_SECURE, keyguardActive);
diff --git a/services/core/java/com/android/server/wm/WindowManagerService.java b/services/core/java/com/android/server/wm/WindowManagerService.java
index 1b63ca0..ace5997 100644
--- a/services/core/java/com/android/server/wm/WindowManagerService.java
+++ b/services/core/java/com/android/server/wm/WindowManagerService.java
@@ -7139,20 +7139,14 @@
 
     public Configuration computeNewConfiguration() {
         synchronized (mWindowMap) {
-            if (!mDisplayReady) {
-                return null;
-            }
-            Configuration config = computeNewConfigurationLocked();
-            if (mWaitingForConfig) {
-                mWaitingForConfig = false;
-                mLastFinishedFreezeSource = "new-config";
-                performLayoutAndPlaceSurfacesLocked();
-            }
-            return config;
+            return computeNewConfigurationLocked();
         }
     }
 
-    Configuration computeNewConfigurationLocked() {
+    private Configuration computeNewConfigurationLocked() {
+        if (!mDisplayReady) {
+            return null;
+        }
         Configuration config = new Configuration();
         config.fontScale = 0;
         computeScreenConfigurationLocked(config);
@@ -9678,7 +9672,7 @@
 
     /**
      * Extracted from {@link #performLayoutAndPlaceSurfacesLockedInner} to reduce size of method.
-     *  @param w WindowState this method is applied to.
+     * @param w WindowState this method is applied to.
      * @param innerDw Width of app window.
      * @param innerDh Height of app window.
      */
diff --git a/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java b/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
index f1f61f3..3b62b61 100644
--- a/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
+++ b/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
@@ -211,6 +211,7 @@
         DEVICE_OWNER_USER_RESTRICTIONS.add(UserManager.DISALLOW_SMS);
         DEVICE_OWNER_USER_RESTRICTIONS.add(UserManager.DISALLOW_FUN);
         DEVICE_OWNER_USER_RESTRICTIONS.add(UserManager.DISALLOW_SAFE_BOOT);
+        DEVICE_OWNER_USER_RESTRICTIONS.add(UserManager.DISALLOW_CREATE_WINDOWS);
     }
 
     // The following user restrictions cannot be changed by any active admin, including device
diff --git a/services/java/com/android/server/SystemServer.java b/services/java/com/android/server/SystemServer.java
index 29c65db..76226b4 100644
--- a/services/java/com/android/server/SystemServer.java
+++ b/services/java/com/android/server/SystemServer.java
@@ -292,7 +292,7 @@
     private void createSystemContext() {
         ActivityThread activityThread = ActivityThread.systemMain();
         mSystemContext = activityThread.getSystemContext();
-        mSystemContext.setTheme(android.R.style.Theme_Material_DayNight_DarkActionBar);
+        mSystemContext.setTheme(android.R.style.Theme_DeviceDefault_Light_DarkActionBar);
     }
 
     /**
diff --git a/services/usage/java/com/android/server/usage/UsageStatsService.java b/services/usage/java/com/android/server/usage/UsageStatsService.java
index 75b8278..3767fce 100644
--- a/services/usage/java/com/android/server/usage/UsageStatsService.java
+++ b/services/usage/java/com/android/server/usage/UsageStatsService.java
@@ -981,7 +981,7 @@
         }
     }
 
-    private class BinderService extends IUsageStatsManager.Stub {
+    private final class BinderService extends IUsageStatsManager.Stub {
 
         private boolean hasPermission(String callingPackage) {
             final int callingUid = Binder.getCallingUid();
@@ -1121,7 +1121,7 @@
      * ActivityManagerService will call these methods holding the 'am' lock, which means we
      * shouldn't be doing any IO work or other long running tasks in these methods.
      */
-    private class LocalService extends UsageStatsManagerInternal {
+    private final class LocalService extends UsageStatsManagerInternal {
 
         @Override
         public void reportEvent(ComponentName component, int userId, int eventType) {
diff --git a/services/voiceinteraction/java/com/android/server/voiceinteraction/VoiceInteractionSessionConnection.java b/services/voiceinteraction/java/com/android/server/voiceinteraction/VoiceInteractionSessionConnection.java
index 0b430ca0..47a230a 100644
--- a/services/voiceinteraction/java/com/android/server/voiceinteraction/VoiceInteractionSessionConnection.java
+++ b/services/voiceinteraction/java/com/android/server/voiceinteraction/VoiceInteractionSessionConnection.java
@@ -180,8 +180,6 @@
 
     public boolean showLocked(Bundle args, int flags,
             IVoiceInteractionSessionShowCallback showCallback) {
-        // For now we never allow screenshots.
-        flags &= ~VoiceInteractionSession.SHOW_WITH_SCREENSHOT;
         if (mBound) {
             if (!mFullyBound) {
                 mFullyBound = mContext.bindServiceAsUser(mBindIntent, mFullConnection,
@@ -190,13 +188,15 @@
                         new UserHandle(mUser));
             }
             mShown = true;
+            boolean allDataEnabled = Settings.Secure.getIntForUser(mContext.getContentResolver(),
+                    Settings.Secure.ASSIST_STRUCTURE_ENABLED, 1, mUser) != 0;
             mShowArgs = args;
             mShowFlags = flags;
             mHaveAssistData = false;
             if ((flags& VoiceInteractionSession.SHOW_WITH_ASSIST) != 0) {
                 if (mAppOps.noteOpNoThrow(AppOpsManager.OP_ASSIST_STRUCTURE, mCallingUid,
                         mSessionComponentName.getPackageName()) == AppOpsManager.MODE_ALLOWED
-                        && isStructureEnabled()) {
+                        && allDataEnabled) {
                     try {
                         mAm.requestAssistContextExtras(ActivityManager.ASSIST_CONTEXT_FULL,
                                 mAssistReceiver);
@@ -212,7 +212,8 @@
             mHaveScreenshot = false;
             if ((flags& VoiceInteractionSession.SHOW_WITH_SCREENSHOT) != 0) {
                 if (mAppOps.noteOpNoThrow(AppOpsManager.OP_ASSIST_SCREENSHOT, mCallingUid,
-                        mSessionComponentName.getPackageName()) == AppOpsManager.MODE_ALLOWED) {
+                        mSessionComponentName.getPackageName()) == AppOpsManager.MODE_ALLOWED
+                        && allDataEnabled) {
                     try {
                         mIWindowManager.requestAssistScreenshot(mScreenshotReceiver);
                     } catch (RemoteException e) {
@@ -466,11 +467,6 @@
         mService = null;
     }
 
-    private boolean isStructureEnabled() {
-        return Settings.Secure.getIntForUser(mContext.getContentResolver(),
-                Settings.Secure.ASSIST_STRUCTURE_ENABLED, 1, mUser) != 0;
-    }
-
     public void dump(String prefix, PrintWriter pw) {
         pw.print(prefix); pw.print("mToken="); pw.println(mToken);
         pw.print(prefix); pw.print("mShown="); pw.println(mShown);
diff --git a/telecomm/java/android/telecom/TelecomManager.java b/telecomm/java/android/telecom/TelecomManager.java
index 0cd8c19..a0669e4 100644
--- a/telecomm/java/android/telecom/TelecomManager.java
+++ b/telecomm/java/android/telecom/TelecomManager.java
@@ -477,39 +477,6 @@
     }
 
     /**
-     * Sets the SIM call manager to the specified phone account.
-     *
-     * @param accountHandle The phone account handle of the account to set as the sim call manager.
-     * @hide
-     */
-    public void setSimCallManager(PhoneAccountHandle accountHandle) {
-        try {
-            if (isServiceConnected()) {
-                getTelecomService().setSimCallManager(accountHandle);
-            }
-        } catch (RemoteException e) {
-            Log.e(TAG, "Error calling ITelecomService#setSimCallManager");
-        }
-    }
-
-    /**
-     * Returns the list of registered SIM call managers.
-     *
-     * @return List of registered SIM call managers.
-     * @hide
-     */
-    public List<PhoneAccountHandle> getSimCallManagers() {
-        try {
-            if (isServiceConnected()) {
-                return getTelecomService().getSimCallManagers(mContext.getOpPackageName());
-            }
-        } catch (RemoteException e) {
-            Log.e(TAG, "Error calling ITelecomService#getSimCallManagers");
-        }
-        return new ArrayList<>();
-    }
-
-    /**
      * Returns the current connection manager. Apps must be prepared for this method to return
      * {@code null}, indicating that there currently exists no user-chosen default
      * {@code PhoneAccount}.
diff --git a/telecomm/java/com/android/internal/telecom/ITelecomService.aidl b/telecomm/java/com/android/internal/telecom/ITelecomService.aidl
index ea6a74a..fb0f6da 100644
--- a/telecomm/java/com/android/internal/telecom/ITelecomService.aidl
+++ b/telecomm/java/com/android/internal/telecom/ITelecomService.aidl
@@ -93,16 +93,6 @@
     PhoneAccountHandle getSimCallManager();
 
     /**
-     * @see TelecomServiceImpl#setSimCallManager
-     */
-    void setSimCallManager(in PhoneAccountHandle account);
-
-    /**
-     * @see TelecomServiceImpl#getSimCallManagers
-     */
-    List<PhoneAccountHandle> getSimCallManagers(String callingPackage);
-
-    /**
      * @see TelecomServiceImpl#registerPhoneAccount
      */
     void registerPhoneAccount(in PhoneAccount metadata);
diff --git a/telephony/java/android/telephony/CarrierConfigManager.java b/telephony/java/android/telephony/CarrierConfigManager.java
index f85a820..01cab33 100644
--- a/telephony/java/android/telephony/CarrierConfigManager.java
+++ b/telephony/java/android/telephony/CarrierConfigManager.java
@@ -125,6 +125,10 @@
     public static final String
             KEY_HIDE_CARRIER_NETWORK_SETTINGS_BOOL = "hide_carrier_network_settings_bool";
 
+    /** Control whether users can reach the SIM lock settings. */
+    public static final String
+            KEY_HIDE_SIM_LOCK_SETTINGS_BOOL = "hide_sim_lock_settings_bool";
+
     /** Control whether users can edit APNs in Settings. */
     public static final String KEY_APN_EXPAND_BOOL = "apn_expand_bool";
 
@@ -178,6 +182,34 @@
     public static final String
             KEY_DISABLE_CDMA_ACTIVATION_CODE_BOOL = "disable_cdma_activation_code_bool";
 
+   /**
+     * Override the platform's notion of a network operator being considered roaming.
+     * Value is string array of MCCMNCs to be considered roaming for 3GPP RATs.
+     */
+    public static final String
+            KEY_GSM_ROAMING_NETWORKS_STRING_ARRAY = "gsm_roaming_networks_string_array";
+
+    /**
+     * Override the platform's notion of a network operator being considered not roaming.
+     * Value is string array of MCCMNCs to be considered not roaming for 3GPP RATs.
+     */
+    public static final String
+            KEY_GSM_NONROAMING_NETWORKS_STRING_ARRAY = "gsm_nonroaming_networks_string_array";
+
+    /**
+     * Override the platform's notion of a network operator being considered roaming.
+     * Value is string array of SIDs to be considered roaming for 3GPP2 RATs.
+     */
+    public static final String
+            KEY_CDMA_ROAMING_NETWORKS_STRING_ARRAY = "cdma_roaming_networks_string_array";
+
+    /**
+     * Override the platform's notion of a network operator being considered non roaming.
+     * Value is string array of SIDs to be considered not roaming for 3GPP2 RATs.
+     */
+    public static final String
+            KEY_CDMA_NONROAMING_NETWORKS_STRING_ARRAY = "cdma_nonroaming_networks_string_array";
+
     /**
      * Flag specifying whether VoLTE should be available for carrier, independent of carrier
      * provisioning. If false: hard disabled. If true: then depends on carrier provisioning,
@@ -320,6 +352,7 @@
         sDefaults.putBoolean(KEY_ENABLE_DIALER_KEY_VIBRATION_BOOL, true);
         sDefaults.putBoolean(KEY_HAS_IN_CALL_NOISE_SUPPRESSION_BOOL, false);
         sDefaults.putBoolean(KEY_HIDE_CARRIER_NETWORK_SETTINGS_BOOL, false);
+        sDefaults.putBoolean(KEY_HIDE_SIM_LOCK_SETTINGS_BOOL, false);
         sDefaults.putBoolean(KEY_IGNORE_SIM_NETWORK_LOCKED_EVENTS_BOOL, false);
         sDefaults.putBoolean(KEY_OPERATOR_SELECTION_EXPAND_BOOL, true);
         sDefaults.putBoolean(KEY_PREFER_2G_BOOL, true);
@@ -345,6 +378,11 @@
         sDefaults.putString(KEY_CI_ACTION_ON_SYS_UPDATE_EXTRA_STRING, "");
         sDefaults.putString(KEY_CI_ACTION_ON_SYS_UPDATE_EXTRA_VAL_STRING, "");
 
+        sDefaults.putStringArray(KEY_GSM_ROAMING_NETWORKS_STRING_ARRAY, null);
+        sDefaults.putStringArray(KEY_GSM_NONROAMING_NETWORKS_STRING_ARRAY, null);
+        sDefaults.putStringArray(KEY_CDMA_ROAMING_NETWORKS_STRING_ARRAY, null);
+        sDefaults.putStringArray(KEY_CDMA_NONROAMING_NETWORKS_STRING_ARRAY, null);
+
         // MMS defaults
         sDefaults.putBoolean(KEY_MMS_ALIAS_ENABLED_BOOL, false);
         sDefaults.putBoolean(KEY_MMS_ALLOW_ATTACH_AUDIO_BOOL, true);
diff --git a/telephony/java/android/telephony/DisconnectCause.java b/telephony/java/android/telephony/DisconnectCause.java
index 674777e..8443490 100644
--- a/telephony/java/android/telephony/DisconnectCause.java
+++ b/telephony/java/android/telephony/DisconnectCause.java
@@ -153,17 +153,17 @@
     /**
      * The outgoing call failed with an unknown cause.
      */
-    public static final int OUTGOING_FAILURE = 43;
+    public static final int OUTGOING_FAILURE               = 43;
 
     /**
      * The outgoing call was canceled by the {@link android.telecom.ConnectionService}.
      */
-    public static final int OUTGOING_CANCELED = 44;
+    public static final int OUTGOING_CANCELED              = 44;
 
     /**
      * The call, which was an IMS call, disconnected because it merged with another call.
      */
-    public static final int IMS_MERGED_SUCCESSFULLY = 45;
+    public static final int IMS_MERGED_SUCCESSFULLY        = 45;
 
     /**
      * Stk Call Control modified DIAL request to USSD request.
@@ -181,6 +181,12 @@
      */
     public static final int DIAL_MODIFIED_TO_DIAL          = 48;
 
+    /**
+     * The call was terminated because CDMA phone service and roaming have already been activated.
+     * {@hide}
+     */
+    public static final int CDMA_ALREADY_ACTIVATED         = 49;
+
     //*********************************************************************************************
     // When adding a disconnect type:
     // 1) Please assign the new type the next id value below.
@@ -189,14 +195,14 @@
     // 4) Update toString() with the newly added disconnect type.
     // 5) Update android.telecom.DisconnectCauseUtil with any mappings to a telecom.DisconnectCause.
     //
-    // NextId: 49
+    // NextId: 50
     //*********************************************************************************************
 
     /** Smallest valid value for call disconnect codes. */
     public static final int MINIMUM_VALID_VALUE = NOT_DISCONNECTED;
 
     /** Largest valid value for call disconnect codes. */
-    public static final int MAXIMUM_VALID_VALUE = DIAL_MODIFIED_TO_DIAL;
+    public static final int MAXIMUM_VALID_VALUE = CDMA_ALREADY_ACTIVATED;
 
     /** Private constructor to avoid class instantiation. */
     private DisconnectCause() {
@@ -302,6 +308,8 @@
             return "OUTGOING_CANCELED";
         case IMS_MERGED_SUCCESSFULLY:
             return "IMS_MERGED_SUCCESSFULLY";
+        case CDMA_ALREADY_ACTIVATED:
+            return "CDMA_ALREADY_ACTIVATED";
         default:
             return "INVALID: " + cause;
         }
diff --git a/telephony/java/android/telephony/SubscriptionManager.java b/telephony/java/android/telephony/SubscriptionManager.java
index e085d89..fa1ed54 100644
--- a/telephony/java/android/telephony/SubscriptionManager.java
+++ b/telephony/java/android/telephony/SubscriptionManager.java
@@ -1124,13 +1124,14 @@
      * {@hide}
      */
     public static int getSimStateForSlotIdx(int slotIdx) {
-        int simState;
+        int simState = TelephonyManager.SIM_STATE_UNKNOWN;
 
         try {
             ISub iSub = ISub.Stub.asInterface(ServiceManager.getService("isub"));
-            simState = iSub.getSimStateForSlotIdx(slotIdx);
+            if (iSub != null) {
+                simState = iSub.getSimStateForSlotIdx(slotIdx);
+            }
         } catch (RemoteException ex) {
-            simState = TelephonyManager.SIM_STATE_UNKNOWN;
         }
         logd("getSimStateForSubscriber: simState=" + simState + " slotIdx=" + slotIdx);
         return simState;
@@ -1144,7 +1145,9 @@
     public boolean isActiveSubId(int subId) {
         try {
             ISub iSub = ISub.Stub.asInterface(ServiceManager.getService("isub"));
-            return iSub.isActiveSubId(subId);
+            if (iSub != null) {
+                return iSub.isActiveSubId(subId);
+            }
         } catch (RemoteException ex) {
         }
         return false;
diff --git a/telephony/java/android/telephony/TelephonyManager.java b/telephony/java/android/telephony/TelephonyManager.java
index 6a8b065..f77d268 100644
--- a/telephony/java/android/telephony/TelephonyManager.java
+++ b/telephony/java/android/telephony/TelephonyManager.java
@@ -2139,7 +2139,7 @@
         try {
             ITelephony telephony = getITelephony();
             if (telephony != null)
-                return telephony.getMergedSubscriberIds();
+                return telephony.getMergedSubscriberIds(mContext.getOpPackageName());
         } catch (RemoteException ex) {
         } catch (NullPointerException ex) {
         }
diff --git a/telephony/java/com/android/internal/telephony/ITelephony.aidl b/telephony/java/com/android/internal/telephony/ITelephony.aidl
index c253b4f..44754ab 100644
--- a/telephony/java/com/android/internal/telephony/ITelephony.aidl
+++ b/telephony/java/com/android/internal/telephony/ITelephony.aidl
@@ -795,7 +795,7 @@
      */
     String getLine1AlphaTagForDisplay(int subId, String callingPackage);
 
-    String[] getMergedSubscriberIds();
+    String[] getMergedSubscriberIds(String callingPackage);
 
     /**
      * Override the operator branding for the current ICCID.
diff --git a/test-runner/src/android/test/mock/MockContext.java b/test-runner/src/android/test/mock/MockContext.java
index 04ded9d..e5e3e44 100644
--- a/test-runner/src/android/test/mock/MockContext.java
+++ b/test-runner/src/android/test/mock/MockContext.java
@@ -16,6 +16,7 @@
 
 package android.test.mock;
 
+import android.annotation.SystemApi;
 import android.content.ComponentName;
 import android.content.ContentResolver;
 import android.content.Context;
@@ -317,6 +318,13 @@
     }
 
     /** @hide */
+    @SystemApi
+    @Override
+    public void sendBroadcast(Intent intent, String receiverPermission, Bundle options) {
+        throw new UnsupportedOperationException();
+    }
+
+    /** @hide */
     @Override
     public void sendBroadcast(Intent intent, String receiverPermission, int appOp) {
         throw new UnsupportedOperationException();
@@ -336,6 +344,15 @@
     }
 
     /** @hide */
+    @SystemApi
+    @Override
+    public void sendOrderedBroadcast(Intent intent, String receiverPermission,
+            Bundle options, BroadcastReceiver resultReceiver, Handler scheduler, int initialCode, String initialData,
+            Bundle initialExtras) {
+        throw new UnsupportedOperationException();
+    }
+
+    /** @hide */
     @Override
     public void sendOrderedBroadcast(Intent intent, String receiverPermission, int appOp,
             BroadcastReceiver resultReceiver, Handler scheduler, int initialCode, String initialData,
diff --git a/tests/VectorDrawableTest/res/drawable/vector_drawable04.xml b/tests/VectorDrawableTest/res/drawable/vector_drawable04.xml
index d282fc9..0f3fb95 100644
--- a/tests/VectorDrawableTest/res/drawable/vector_drawable04.xml
+++ b/tests/VectorDrawableTest/res/drawable/vector_drawable04.xml
@@ -13,37 +13,41 @@
      limitations under the License.
 -->
 <vector xmlns:android="http://schemas.android.com/apk/res/android"
-            android:width="64dp"
-            android:height="64dp"
-            android:viewportWidth="7.30625"
-            android:viewportHeight="12.25"
-            android:autoMirrored="true">
+    android:autoMirrored="true"
+    android:height="64dp"
+    android:viewportHeight="12.25"
+    android:viewportWidth="7.30625"
+    android:width="64dp" >
 
     <group>
         <clip-path
-                android:name="clip1"
-                android:pathData="
+            android:name="clip1"
+            android:pathData="
                 M 3.65, 6.125
                 m-.001, 0
                 a .001,.001 0 1,0 .002,0
-                a .001,.001 0 1,0-.002,0z"/>
-        <path
-                android:name="one"
-                android:pathData="M 1.215625,9.5l 1.9375,0.0 0.0-6.671875-2.109375,0.421875 0.0-1.078125
-                l 2.09375-0.421875 1.1874998,0.0 0.0,7.75 1.9375,0.0 0.0,1.0
-                l-5.046875,0.0 0.0-1.0Z"
-                android:fillColor="#ff88ff"/>
+                a .001,.001 0 1,0-.002,0z" />
 
+        <path
+            android:name="one"
+            android:fillColor="#ff88ff"
+            android:pathData="M 1.215625,9.5l 1.9375,0.0 0.0-6.671875-2.109375,0.421875 0.0-1.078125
+                l 2.09375-0.421875 1.1874998,0.0 0.0,7.75 1.9375,0.0 0.0,1.0
+                l-5.046875,0.0 0.0-1.0Z" />
+    </group>
+    <group>
         <clip-path
-                android:name="clip2"
-                android:pathData="
+            android:name="clip2"
+            android:pathData="
                 M 3.65, 6.125
                 m-6, 0
                 a 6,6 0 1,0 12,0
-                a 6,6 0 1,0-12,0z"/>
+                a 6,6 0 1,0-12,0z" />
+
         <path
-                android:name="two"
-                android:pathData="M 2.534375,9.6875l 4.140625,0.0 0.0,1.0-5.5625,0.0 0.0-1.0q 0.671875-0.6875 1.828125-1.859375
+            android:name="two"
+            android:fillColor="#ff88ff"
+            android:pathData="M 2.534375,9.6875l 4.140625,0.0 0.0,1.0-5.5625,0.0 0.0-1.0q 0.671875-0.6875 1.828125-1.859375
                         q 1.1718752-1.1875 1.4687502-1.53125 0.578125-0.625 0.796875-1.0625
                         q 0.234375-0.453125 0.234375-0.875 0.0-0.703125-0.5-1.140625
                         q-0.484375-0.4375-1.2656252-0.4375-0.5625,0.0-1.1875,0.1875
@@ -51,7 +55,7 @@
                         q 0.625-0.15625 1.140625-0.15625 1.3593752,0.0 2.1718752,0.6875
                         q 0.8125,0.671875 0.8125,1.8125 0.0,0.53125-0.203125,1.015625
                         q-0.203125,0.484375-0.734375,1.140625-0.15625,0.171875-0.9375,0.984375
-                        q-0.78125024,0.8125-2.2187502,2.265625Z"
-                android:fillColor="#ff88ff"/>
+                        q-0.78125024,0.8125-2.2187502,2.265625Z" />
     </group>
-</vector>
+
+</vector>
\ No newline at end of file
diff --git a/tools/aapt2/BinaryResourceParser.cpp b/tools/aapt2/BinaryResourceParser.cpp
index 3559f43..4f1947a 100644
--- a/tools/aapt2/BinaryResourceParser.cpp
+++ b/tools/aapt2/BinaryResourceParser.cpp
@@ -116,9 +116,11 @@
 BinaryResourceParser::BinaryResourceParser(const std::shared_ptr<ResourceTable>& table,
                                            const std::shared_ptr<IResolver>& resolver,
                                            const Source& source,
+                                           const std::u16string& defaultPackage,
                                            const void* data,
                                            size_t len) :
-        mTable(table), mResolver(resolver), mSource(source), mData(data), mDataLen(len) {
+        mTable(table), mResolver(resolver), mSource(source), mDefaultPackage(defaultPackage),
+        mData(data), mDataLen(len) {
 }
 
 bool BinaryResourceParser::parse() {
@@ -177,6 +179,9 @@
             if (!type) {
                 return false;
             }
+            if (outSymbol->package.empty()) {
+                outSymbol->package = mTable->getPackage();
+            }
             outSymbol->type = *type;
 
             // Since we scan the symbol table in order, we can start looking for the
@@ -350,7 +355,22 @@
 
     size_t len = strnlen16(reinterpret_cast<const char16_t*>(packageHeader->name),
             sizeof(packageHeader->name) / sizeof(packageHeader->name[0]));
-    mTable->setPackage(StringPiece16(reinterpret_cast<const char16_t*>(packageHeader->name), len));
+    if (mTable->getPackage().empty() && len == 0) {
+        mTable->setPackage(mDefaultPackage);
+    } else if (len > 0) {
+        StringPiece16 thisPackage(reinterpret_cast<const char16_t*>(packageHeader->name), len);
+        if (mTable->getPackage().empty()) {
+            mTable->setPackage(thisPackage);
+        } else if (thisPackage != mTable->getPackage()) {
+            Logger::error(mSource)
+                    << "incompatible packages: "
+                    << mTable->getPackage()
+                    << " vs. "
+                    << thisPackage
+                    << std::endl;
+            return false;
+        }
+    }
 
     ResChunkPullParser parser(getChunkData(packageHeader->header),
                               getChunkDataLen(packageHeader->header));
diff --git a/tools/aapt2/BinaryResourceParser.h b/tools/aapt2/BinaryResourceParser.h
index 32876cd..3aab301 100644
--- a/tools/aapt2/BinaryResourceParser.h
+++ b/tools/aapt2/BinaryResourceParser.h
@@ -45,6 +45,7 @@
     BinaryResourceParser(const std::shared_ptr<ResourceTable>& table,
                          const std::shared_ptr<IResolver>& resolver,
                          const Source& source,
+                         const std::u16string& defaultPackage,
                          const void* data, size_t len);
 
     BinaryResourceParser(const BinaryResourceParser&) = delete; // No copy.
@@ -97,12 +98,12 @@
 
     const Source mSource;
 
+    // The package name of the resource table.
+    std::u16string mDefaultPackage;
+
     const void* mData;
     const size_t mDataLen;
 
-    // The package name of the resource table.
-    std::u16string mPackage;
-
     // The array of symbol entries. Each element points to an offset
     // in the table and an index into the symbol table string pool.
     const SymbolTable_entry* mSymbolEntries = nullptr;
diff --git a/tools/aapt2/Linker.cpp b/tools/aapt2/Linker.cpp
index f3f04a5..c37cc93 100644
--- a/tools/aapt2/Linker.cpp
+++ b/tools/aapt2/Linker.cpp
@@ -160,7 +160,7 @@
 void Linker::visit(Reference& reference, ValueVisitorArgs& a) {
     Args& args = static_cast<Args&>(a);
 
-    if (!reference.name.isValid()) {
+    if (reference.name.entry.empty()) {
         // We can't have a completely bad reference.
         if (!reference.id.isValid()) {
             Logger::error() << "srsly? " << args.referrer << std::endl;
diff --git a/tools/aapt2/Main.cpp b/tools/aapt2/Main.cpp
index 41c229d..54a7329 100644
--- a/tools/aapt2/Main.cpp
+++ b/tools/aapt2/Main.cpp
@@ -756,8 +756,8 @@
                 zipFile->uncompress(entry));
         assert(uncompressedData);
 
-        BinaryResourceParser parser(table, resolver, source, uncompressedData.get(),
-                                    entry->getUncompressedLen());
+        BinaryResourceParser parser(table, resolver, source, options.appInfo.package, 
+                                    uncompressedData.get(), entry->getUncompressedLen());
         if (!parser.parse()) {
             return false;
         }
@@ -1085,50 +1085,47 @@
     }
 
     bool isStaticLib = false;
+    if (options.phase == AaptOptions::Phase::Link) {
+        flag::requiredFlag("--manifest", "AndroidManifest.xml of your app",
+                [&options](const StringPiece& arg) {
+                    options.manifest = Source{ arg.toString() };
+                });
+
+        flag::optionalFlag("-I", "add an Android APK to link against",
+                [&options](const StringPiece& arg) {
+                    options.libraries.push_back(Source{ arg.toString() });
+                });
+
+        flag::optionalFlag("--java", "directory in which to generate R.java",
+                [&options](const StringPiece& arg) {
+                    options.generateJavaClass = Source{ arg.toString() };
+                });
+
+        flag::optionalFlag("--proguard", "file in which to output proguard rules",
+                [&options](const StringPiece& arg) {
+                    options.generateProguardRules = Source{ arg.toString() };
+                });
+
+        flag::optionalSwitch("--static-lib", "generate a static Android library", true,
+                             &isStaticLib);
+
+        flag::optionalFlag("--binding", "Output directory for binding XML files",
+                [&options](const StringPiece& arg) {
+                    options.bindingOutput = Source{ arg.toString() };
+                });
+        flag::optionalSwitch("--no-version", "Disables automatic style and layout versioning",
+                             false, &options.versionStylesAndLayouts);
+    }
+
     if (options.phase == AaptOptions::Phase::Compile ||
             options.phase == AaptOptions::Phase::Link) {
-        if (options.phase == AaptOptions::Phase::Compile) {
-            flag::requiredFlag("--package", "Android package name",
-                    [&options](const StringPiece& arg) {
-                        options.appInfo.package = util::utf8ToUtf16(arg);
-                    });
-        } else if (options.phase == AaptOptions::Phase::Link) {
-            flag::requiredFlag("--manifest", "AndroidManifest.xml of your app",
-                    [&options](const StringPiece& arg) {
-                        options.manifest = Source{ arg.toString() };
-                    });
-
-            flag::optionalFlag("-I", "add an Android APK to link against",
-                    [&options](const StringPiece& arg) {
-                        options.libraries.push_back(Source{ arg.toString() });
-                    });
-
-            flag::optionalFlag("--java", "directory in which to generate R.java",
-                    [&options](const StringPiece& arg) {
-                        options.generateJavaClass = Source{ arg.toString() };
-                    });
-
-            flag::optionalFlag("--proguard", "file in which to output proguard rules",
-                    [&options](const StringPiece& arg) {
-                        options.generateProguardRules = Source{ arg.toString() };
-                    });
-
-            flag::optionalSwitch("--static-lib", "generate a static Android library", true,
-                                 &isStaticLib);
-
-            flag::optionalFlag("--binding", "Output directory for binding XML files",
-                    [&options](const StringPiece& arg) {
-                        options.bindingOutput = Source{ arg.toString() };
-                    });
-            flag::optionalSwitch("--no-version", "Disables automatic style and layout versioning",
-                                 false, &options.versionStylesAndLayouts);
-        }
-
         // Common flags for all steps.
         flag::requiredFlag("-o", "Output path", [&options](const StringPiece& arg) {
             options.output = Source{ arg.toString() };
         });
-    } else if (options.phase == AaptOptions::Phase::DumpStyleGraph) {
+    }
+
+    if (options.phase == AaptOptions::Phase::DumpStyleGraph) {
         flag::requiredFlag("--style", "Name of the style to dump",
                 [&options](const StringPiece& arg, std::string* outError) -> bool {
                     Reference styleReference;
@@ -1191,7 +1188,7 @@
                 zipFile->uncompress(entry));
         assert(uncompressedData);
 
-        BinaryResourceParser parser(table, resolver, source, uncompressedData.get(),
+        BinaryResourceParser parser(table, resolver, source, {}, uncompressedData.get(),
                                     entry->getUncompressedLen());
         if (!parser.parse()) {
             return false;
@@ -1223,16 +1220,17 @@
         if (!loadAppInfo(options.manifest, &options.appInfo)) {
             return false;
         }
-    }
 
-    // Verify we have some common options set.
-    if (options.appInfo.package.empty()) {
-        Logger::error() << "no package name specified." << std::endl;
-        return false;
+        if (options.appInfo.package.empty()) {
+            Logger::error() << "no package name specified." << std::endl;
+            return false;
+        }
     }
 
     // Every phase needs a resource table.
     std::shared_ptr<ResourceTable> table = std::make_shared<ResourceTable>();
+
+    // The package name is empty when in the compile phase.
     table->setPackage(options.appInfo.package);
     if (options.appInfo.package == u"android") {
         table->setPackageId(0x01);
diff --git a/tools/aapt2/TableFlattener.cpp b/tools/aapt2/TableFlattener.cpp
index 539c48f..b7c04f0 100644
--- a/tools/aapt2/TableFlattener.cpp
+++ b/tools/aapt2/TableFlattener.cpp
@@ -79,7 +79,7 @@
 
         // Write the key.
         if (!Res_INTERNALID(key.id.id) && !key.id.isValid()) {
-            assert(key.name.isValid());
+            assert(!key.name.entry.empty());
             mSymbols->push_back(std::make_pair(ResourceNameRef(key.name),
                     mOut->size() - sizeof(*outMapEntry)));
         }
@@ -284,13 +284,6 @@
 bool TableFlattener::flatten(BigBuffer* out, const ResourceTable& table) {
     const size_t beginning = out->size();
 
-    if (table.getPackage().size() == 0) {
-        Logger::error()
-                << "ResourceTable has no package name."
-                << std::endl;
-        return false;
-    }
-
     if (table.getPackageId() == ResourceTable::kUnsetPackageId) {
         Logger::error()
                 << "ResourceTable has no package ID set."
diff --git a/tools/aapt2/data/Makefile b/tools/aapt2/data/Makefile
index 3387135..91ff5fe 100644
--- a/tools/aapt2/data/Makefile
+++ b/tools/aapt2/data/Makefile
@@ -50,7 +50,7 @@
 # returns: out/values-v4.apk: res/values-v4/styles.xml res/values-v4/colors.xml
 define make-collect-rule
 $(LOCAL_OUT)/$1.apk: $(filter $(LOCAL_RESOURCE_DIR)/$1/%,$(PRIVATE_RESOURCES))
-	$(AAPT) compile --package $(LOCAL_PACKAGE) -o $$@ $$^
+	$(AAPT) compile -o $$@ $$^
 endef
 
 # Collect: out/values-v4.apk <- res/values-v4/styles.xml res/values-v4/colors.xml
diff --git a/tools/aapt2/data/lib/Makefile b/tools/aapt2/data/lib/Makefile
index 372c225..741be9a 100644
--- a/tools/aapt2/data/lib/Makefile
+++ b/tools/aapt2/data/lib/Makefile
@@ -48,7 +48,7 @@
 # returns: out/values-v4.apk: res/values-v4/styles.xml res/values-v4/colors.xml
 define make-collect-rule
 $(LOCAL_OUT)/$1.apk: $(filter $(LOCAL_RESOURCE_DIR)/$1/%,$(PRIVATE_RESOURCES))
-	$(AAPT) compile --package $(LOCAL_PACKAGE) -o $$@ $$^
+	$(AAPT) compile -o $$@ $$^
 endef
 
 # Collect: out/values-v4.apk <- res/values-v4/styles.xml res/values-v4/colors.xml
diff --git a/tools/layoutlib/bridge/src/com/android/layoutlib/bridge/android/BridgeContext.java b/tools/layoutlib/bridge/src/com/android/layoutlib/bridge/android/BridgeContext.java
index 6be5a95..422b2aa 100644
--- a/tools/layoutlib/bridge/src/com/android/layoutlib/bridge/android/BridgeContext.java
+++ b/tools/layoutlib/bridge/src/com/android/layoutlib/bridge/android/BridgeContext.java
@@ -1506,6 +1506,12 @@
     }
 
     @Override
+    public void sendBroadcast(Intent arg0, String arg1, Bundle arg2) {
+        // pass
+
+    }
+
+    @Override
     public void sendBroadcast(Intent intent, String receiverPermission, int appOp) {
         // pass
     }
@@ -1525,6 +1531,14 @@
     }
 
     @Override
+    public void sendOrderedBroadcast(Intent arg0, String arg1,
+            Bundle arg7, BroadcastReceiver arg2, Handler arg3, int arg4, String arg5,
+            Bundle arg6) {
+        // pass
+
+    }
+
+    @Override
     public void sendOrderedBroadcast(Intent intent, String receiverPermission, int appOp,
             BroadcastReceiver resultReceiver, Handler scheduler, int initialCode,
             String initialData, Bundle initialExtras) {