Merge "ConnectivityController tracks jobs by UID."
diff --git a/Android.bp b/Android.bp
index f9b60e6..d94bd84 100644
--- a/Android.bp
+++ b/Android.bp
@@ -560,6 +560,7 @@
         "telephony/java/com/android/internal/telephony/IOnSubscriptionsChangedListener.aidl",
         "telephony/java/com/android/internal/telephony/IPhoneStateListener.aidl",
         "telephony/java/com/android/internal/telephony/IPhoneSubInfo.aidl",
+        "telephony/java/com/android/internal/telephony/IRcs.aidl",
         "telephony/java/com/android/internal/telephony/ISms.aidl",
         "telephony/java/com/android/internal/telephony/ISub.aidl",
         "telephony/java/com/android/internal/telephony/IAns.aidl",
@@ -1220,11 +1221,6 @@
     srcs_lib_whitelist_dirs: frameworks_base_subdirs,
     srcs_lib_whitelist_pkgs: packages_to_document,
     libs: [
-        "core-oj",
-        "core-libart",
-        "conscrypt",
-        "bouncycastle",
-        "okhttp",
         "ext",
         "framework",
         "voip-common",
diff --git a/Android.mk b/Android.mk
index ba153ee..770ec20 100644
--- a/Android.mk
+++ b/Android.mk
@@ -113,6 +113,17 @@
 	$(call commit-change-for-toc,$(INTERNAL_PLATFORM_HIDDENAPI_DARK_GREYLIST))
 	$(call commit-change-for-toc,$(INTERNAL_PLATFORM_HIDDENAPI_BLACKLIST))
 
+$(INTERNAL_PLATFORM_HIDDENAPI_GREYLIST_METADATA): \
+    frameworks/base/tools/hiddenapi/merge_csv.py \
+    $(PRIVATE_METADATA_INPUTS)
+	frameworks/base/tools/hiddenapi/merge_csv.py $(PRIVATE_METADATA_INPUTS) > $@
+
+$(call dist-for-goals,droidcore,$(INTERNAL_PLATFORM_HIDDENAPI_WHITELIST))
+$(call dist-for-goals,droidcore,$(INTERNAL_PLATFORM_HIDDENAPI_LIGHT_GREYLIST))
+$(call dist-for-goals,droidcore,$(INTERNAL_PLATFORM_HIDDENAPI_DARK_GREYLIST))
+$(call dist-for-goals,droidcore,$(INTERNAL_PLATFORM_HIDDENAPI_BLACKLIST))
+$(call dist-for-goals,droidcore,$(INTERNAL_PLATFORM_HIDDENAPI_GREYLIST_METADATA))
+
 # Include subdirectory makefiles
 # ============================================================
 
diff --git a/PREUPLOAD.cfg b/PREUPLOAD.cfg
index ff40f75..5c21221 100644
--- a/PREUPLOAD.cfg
+++ b/PREUPLOAD.cfg
@@ -5,6 +5,7 @@
                       packages/PrintRecommendationService/
                       packages/PrintSpooler/
                       packages/PackageInstaller/
+                      packages/SystemUI/
                       services/print/
                       services/usb/
                       telephony/
diff --git a/api/current.txt b/api/current.txt
index 0ffa38b..21bab7c 100755
--- a/api/current.txt
+++ b/api/current.txt
@@ -1403,6 +1403,7 @@
     field public static final int textFilterEnabled = 16843007; // 0x10100ff
     field public static final int textFontWeight = 16844165; // 0x1010585
     field public static final int textIsSelectable = 16843542; // 0x1010316
+    field public static final int textLocale = 16844178; // 0x1010592
     field public static final int textOff = 16843045; // 0x1010125
     field public static final int textOn = 16843044; // 0x1010124
     field public static final int textScaleX = 16843089; // 0x1010151
@@ -5675,6 +5676,7 @@
     method public java.lang.CharSequence getName();
     method public android.net.Uri getSound();
     method public long[] getVibrationPattern();
+    method public boolean hasUserSetImportance();
     method public void setBypassDnd(boolean);
     method public void setDescription(java.lang.String);
     method public void setGroup(java.lang.String);
@@ -6522,6 +6524,8 @@
     method public java.util.List<java.lang.String> getDelegatedScopes(android.content.ComponentName, java.lang.String);
     method public java.lang.CharSequence getDeviceOwnerLockScreenInfo();
     method public java.lang.CharSequence getEndUserSessionMessage(android.content.ComponentName);
+    method public java.lang.String getGlobalPrivateDnsHost(android.content.ComponentName);
+    method public int getGlobalPrivateDnsMode(android.content.ComponentName);
     method public java.util.List<byte[]> getInstalledCaCerts(android.content.ComponentName);
     method public java.util.List<java.lang.String> getKeepUninstalledPackages(android.content.ComponentName);
     method public int getKeyguardDisabledFeatures(android.content.ComponentName);
@@ -6625,6 +6629,7 @@
     method public void setDelegatedScopes(android.content.ComponentName, java.lang.String, java.util.List<java.lang.String>);
     method public void setDeviceOwnerLockScreenInfo(android.content.ComponentName, java.lang.CharSequence);
     method public void setEndUserSessionMessage(android.content.ComponentName, java.lang.CharSequence);
+    method public void setGlobalPrivateDns(android.content.ComponentName, int, java.lang.String);
     method public void setGlobalSetting(android.content.ComponentName, java.lang.String, java.lang.String);
     method public void setKeepUninstalledPackages(android.content.ComponentName, java.util.List<java.lang.String>);
     method public boolean setKeyPairCertificate(android.content.ComponentName, java.lang.String, java.util.List<java.security.cert.Certificate>, boolean);
@@ -6801,6 +6806,10 @@
     field public static final int PERMISSION_POLICY_PROMPT = 0; // 0x0
     field public static final java.lang.String POLICY_DISABLE_CAMERA = "policy_disable_camera";
     field public static final java.lang.String POLICY_DISABLE_SCREEN_CAPTURE = "policy_disable_screen_capture";
+    field public static final int PRIVATE_DNS_MODE_OFF = 1; // 0x1
+    field public static final int PRIVATE_DNS_MODE_OPPORTUNISTIC = 2; // 0x2
+    field public static final int PRIVATE_DNS_MODE_PROVIDER_HOSTNAME = 3; // 0x3
+    field public static final int PRIVATE_DNS_MODE_UNKNOWN = 0; // 0x0
     field public static final int RESET_PASSWORD_DO_NOT_ASK_CREDENTIALS_ON_BOOT = 2; // 0x2
     field public static final int RESET_PASSWORD_REQUIRE_ENTRY = 1; // 0x1
     field public static final int SKIP_SETUP_WIZARD = 1; // 0x1
@@ -9160,6 +9169,7 @@
     method public int bulkInsert(android.net.Uri, android.content.ContentValues[]);
     method public android.os.Bundle call(java.lang.String, java.lang.String, android.os.Bundle);
     method public android.net.Uri canonicalize(android.net.Uri);
+    method public final android.content.ContentProvider.CallingIdentity clearCallingIdentity();
     method public abstract int delete(android.net.Uri, java.lang.String, java.lang.String[]);
     method public void dump(java.io.FileDescriptor, java.io.PrintWriter, java.lang.String[]);
     method public final java.lang.String getCallingPackage();
@@ -9187,6 +9197,7 @@
     method public android.database.Cursor query(android.net.Uri, java.lang.String[], java.lang.String, java.lang.String[], java.lang.String, android.os.CancellationSignal);
     method public android.database.Cursor query(android.net.Uri, java.lang.String[], android.os.Bundle, android.os.CancellationSignal);
     method public boolean refresh(android.net.Uri, android.os.Bundle, android.os.CancellationSignal);
+    method public final void restoreCallingIdentity(android.content.ContentProvider.CallingIdentity);
     method protected final void setPathPermissions(android.content.pm.PathPermission[]);
     method protected final void setReadPermission(java.lang.String);
     method protected final void setWritePermission(java.lang.String);
@@ -9195,6 +9206,9 @@
     method public abstract int update(android.net.Uri, android.content.ContentValues, java.lang.String, java.lang.String[]);
   }
 
+  public final class ContentProvider.CallingIdentity {
+  }
+
   public static abstract interface ContentProvider.PipeDataWriter<T> {
     method public abstract void writeDataToPipe(android.os.ParcelFileDescriptor, android.net.Uri, java.lang.String, android.os.Bundle, T);
   }
@@ -9309,6 +9323,7 @@
     method public final android.net.Uri insert(android.net.Uri, android.content.ContentValues);
     method public static boolean isSyncActive(android.accounts.Account, java.lang.String);
     method public static boolean isSyncPending(android.accounts.Account, java.lang.String);
+    method public android.graphics.Bitmap loadThumbnail(android.net.Uri, android.util.Size, android.os.CancellationSignal) throws java.io.IOException;
     method public void notifyChange(android.net.Uri, android.database.ContentObserver);
     method public void notifyChange(android.net.Uri, android.database.ContentObserver, boolean);
     method public void notifyChange(android.net.Uri, android.database.ContentObserver, int);
@@ -15302,20 +15317,9 @@
     method public java.nio.ByteBuffer getBuffer();
     method public java.io.File getFile();
     method public android.os.LocaleList getLocaleList();
+    method public int getSlant();
     method public int getTtcIndex();
     method public int getWeight();
-    method public boolean isItalic();
-    field public static final int FONT_WEIGHT_BLACK = 900; // 0x384
-    field public static final int FONT_WEIGHT_BOLD = 700; // 0x2bc
-    field public static final int FONT_WEIGHT_EXTRA_BOLD = 800; // 0x320
-    field public static final int FONT_WEIGHT_EXTRA_LIGHT = 200; // 0xc8
-    field public static final int FONT_WEIGHT_LIGHT = 300; // 0x12c
-    field public static final int FONT_WEIGHT_MAX = 1000; // 0x3e8
-    field public static final int FONT_WEIGHT_MEDIUM = 500; // 0x1f4
-    field public static final int FONT_WEIGHT_MIN = 1; // 0x1
-    field public static final int FONT_WEIGHT_NORMAL = 400; // 0x190
-    field public static final int FONT_WEIGHT_SEMI_BOLD = 600; // 0x258
-    field public static final int FONT_WEIGHT_THIN = 100; // 0x64
   }
 
   public static class Font.Builder {
@@ -15328,7 +15332,7 @@
     method public android.graphics.fonts.Font build() throws java.io.IOException;
     method public android.graphics.fonts.Font.Builder setFontVariationSettings(java.lang.String);
     method public android.graphics.fonts.Font.Builder setFontVariationSettings(android.graphics.fonts.FontVariationAxis[]);
-    method public android.graphics.fonts.Font.Builder setItalic(boolean);
+    method public android.graphics.fonts.Font.Builder setSlant(int);
     method public android.graphics.fonts.Font.Builder setTtcIndex(int);
     method public android.graphics.fonts.Font.Builder setWeight(int);
   }
@@ -15344,6 +15348,26 @@
     method public android.graphics.fonts.FontFamily build();
   }
 
+  public final class FontStyle {
+    ctor public FontStyle();
+    ctor public FontStyle(int, int);
+    method public int getSlant();
+    method public int getWeight();
+    field public static final int FONT_SLANT_ITALIC = 1; // 0x1
+    field public static final int FONT_SLANT_UPRIGHT = 0; // 0x0
+    field public static final int FONT_WEIGHT_BLACK = 900; // 0x384
+    field public static final int FONT_WEIGHT_BOLD = 700; // 0x2bc
+    field public static final int FONT_WEIGHT_EXTRA_BOLD = 800; // 0x320
+    field public static final int FONT_WEIGHT_EXTRA_LIGHT = 200; // 0xc8
+    field public static final int FONT_WEIGHT_LIGHT = 300; // 0x12c
+    field public static final int FONT_WEIGHT_MAX = 1000; // 0x3e8
+    field public static final int FONT_WEIGHT_MEDIUM = 500; // 0x1f4
+    field public static final int FONT_WEIGHT_MIN = 1; // 0x1
+    field public static final int FONT_WEIGHT_NORMAL = 400; // 0x190
+    field public static final int FONT_WEIGHT_SEMI_BOLD = 600; // 0x258
+    field public static final int FONT_WEIGHT_THIN = 100; // 0x64
+  }
+
   public final class FontVariationAxis {
     ctor public FontVariationAxis(java.lang.String, float);
     method public static android.graphics.fonts.FontVariationAxis[] fromFontVariationSettings(java.lang.String);
@@ -15461,8 +15485,8 @@
 
   public static class MeasuredText.Builder {
     ctor public MeasuredText.Builder(char[]);
-    method public android.graphics.text.MeasuredText.Builder addReplacementRun(android.graphics.Paint, int, int, float);
-    method public android.graphics.text.MeasuredText.Builder addStyleRun(android.graphics.Paint, int, int, boolean);
+    method public android.graphics.text.MeasuredText.Builder appendReplacementRun(android.graphics.Paint, int, float);
+    method public android.graphics.text.MeasuredText.Builder appendStyleRun(android.graphics.Paint, int, boolean);
     method public android.graphics.text.MeasuredText build();
     method public android.graphics.text.MeasuredText.Builder setComputeHyphenation(boolean);
     method public android.graphics.text.MeasuredText.Builder setComputeLayout(boolean);
@@ -25166,6 +25190,7 @@
     method public static android.net.Uri getValidRingtoneUri(android.content.Context);
     method public int inferStreamType();
     method public static boolean isDefault(android.net.Uri);
+    method public static android.content.res.AssetFileDescriptor openDefaultRingtoneUri(android.content.Context, android.net.Uri) throws java.io.FileNotFoundException;
     method public static void setActualDefaultRingtoneUri(android.content.Context, int, android.net.Uri);
     method public deprecated void setIncludeDrm(boolean);
     method public void setStopPreviousRingtone(boolean);
@@ -27438,6 +27463,7 @@
   public static class ConnectivityManager.NetworkCallback {
     ctor public ConnectivityManager.NetworkCallback();
     method public void onAvailable(android.net.Network);
+    method public void onBlockedStatusChanged(android.net.Network, boolean);
     method public void onCapabilitiesChanged(android.net.Network, android.net.NetworkCapabilities);
     method public void onLinkPropertiesChanged(android.net.Network, android.net.LinkProperties);
     method public void onLosing(android.net.Network, int);
@@ -27709,16 +27735,16 @@
 
   public class NetworkInfo implements android.os.Parcelable {
     method public int describeContents();
-    method public android.net.NetworkInfo.DetailedState getDetailedState();
+    method public deprecated android.net.NetworkInfo.DetailedState getDetailedState();
     method public java.lang.String getExtraInfo();
     method public deprecated java.lang.String getReason();
     method public deprecated android.net.NetworkInfo.State getState();
-    method public int getSubtype();
-    method public java.lang.String getSubtypeName();
+    method public deprecated int getSubtype();
+    method public deprecated java.lang.String getSubtypeName();
     method public deprecated int getType();
     method public deprecated java.lang.String getTypeName();
     method public deprecated boolean isAvailable();
-    method public boolean isConnected();
+    method public deprecated boolean isConnected();
     method public deprecated boolean isConnectedOrConnecting();
     method public deprecated boolean isFailover();
     method public deprecated boolean isRoaming();
@@ -29714,6 +29740,65 @@
     field public static final int EGL_WINDOW_BIT = 4; // 0x4
   }
 
+  public class EGL15 {
+    ctor public EGL15();
+    method public static int eglClientWaitSync(android.opengl.EGLDisplay, android.opengl.EGLSync, int, long);
+    method public static android.opengl.EGLSurface eglCreatePlatformPixmapSurface(android.opengl.EGLDisplay, android.opengl.EGLConfig, java.nio.Buffer, long[], int);
+    method public static android.opengl.EGLSurface eglCreatePlatformWindowSurface(android.opengl.EGLDisplay, android.opengl.EGLConfig, java.nio.Buffer, long[], int);
+    method public static android.opengl.EGLSync eglCreateSync(android.opengl.EGLDisplay, int, long[], int);
+    method public static boolean eglDestroySync(android.opengl.EGLDisplay, android.opengl.EGLSync);
+    method public static android.opengl.EGLDisplay eglGetPlatformDisplay(int, long, long[], int);
+    method public static boolean eglGetSyncAttrib(android.opengl.EGLDisplay, android.opengl.EGLSync, int, long[], int);
+    method public static boolean eglWaitSync(android.opengl.EGLDisplay, android.opengl.EGLSync, int);
+    field public static final int EGL_CL_EVENT_HANDLE = 12444; // 0x309c
+    field public static final int EGL_CONDITION_SATISFIED = 12534; // 0x30f6
+    field public static final int EGL_CONTEXT_MAJOR_VERSION = 12440; // 0x3098
+    field public static final int EGL_CONTEXT_MINOR_VERSION = 12539; // 0x30fb
+    field public static final int EGL_CONTEXT_OPENGL_COMPATIBILITY_PROFILE_BIT = 2; // 0x2
+    field public static final int EGL_CONTEXT_OPENGL_CORE_PROFILE_BIT = 1; // 0x1
+    field public static final int EGL_CONTEXT_OPENGL_DEBUG = 12720; // 0x31b0
+    field public static final int EGL_CONTEXT_OPENGL_FORWARD_COMPATIBLE = 12721; // 0x31b1
+    field public static final int EGL_CONTEXT_OPENGL_PROFILE_MASK = 12541; // 0x30fd
+    field public static final int EGL_CONTEXT_OPENGL_RESET_NOTIFICATION_STRATEGY = 12733; // 0x31bd
+    field public static final int EGL_CONTEXT_OPENGL_ROBUST_ACCESS = 12722; // 0x31b2
+    field public static final long EGL_FOREVER = -1L; // 0xffffffffffffffffL
+    field public static final int EGL_GL_COLORSPACE = 12445; // 0x309d
+    field public static final int EGL_GL_COLORSPACE_LINEAR = 12426; // 0x308a
+    field public static final int EGL_GL_COLORSPACE_SRGB = 12425; // 0x3089
+    field public static final int EGL_GL_RENDERBUFFER = 12473; // 0x30b9
+    field public static final int EGL_GL_TEXTURE_2D = 12465; // 0x30b1
+    field public static final int EGL_GL_TEXTURE_3D = 12466; // 0x30b2
+    field public static final int EGL_GL_TEXTURE_CUBE_MAP_NEGATIVE_X = 12468; // 0x30b4
+    field public static final int EGL_GL_TEXTURE_CUBE_MAP_NEGATIVE_Y = 12470; // 0x30b6
+    field public static final int EGL_GL_TEXTURE_CUBE_MAP_NEGATIVE_Z = 12472; // 0x30b8
+    field public static final int EGL_GL_TEXTURE_CUBE_MAP_POSITIVE_X = 12467; // 0x30b3
+    field public static final int EGL_GL_TEXTURE_CUBE_MAP_POSITIVE_Y = 12469; // 0x30b5
+    field public static final int EGL_GL_TEXTURE_CUBE_MAP_POSITIVE_Z = 12471; // 0x30b7
+    field public static final int EGL_GL_TEXTURE_LEVEL = 12476; // 0x30bc
+    field public static final int EGL_GL_TEXTURE_ZOFFSET = 12477; // 0x30bd
+    field public static final int EGL_IMAGE_PRESERVED = 12498; // 0x30d2
+    field public static final int EGL_LOSE_CONTEXT_ON_RESET = 12735; // 0x31bf
+    field public static final android.opengl.EGLContext EGL_NO_CONTEXT;
+    field public static final android.opengl.EGLDisplay EGL_NO_DISPLAY;
+    field public static final android.opengl.EGLImage EGL_NO_IMAGE;
+    field public static final int EGL_NO_RESET_NOTIFICATION = 12734; // 0x31be
+    field public static final android.opengl.EGLSurface EGL_NO_SURFACE;
+    field public static final android.opengl.EGLSync EGL_NO_SYNC;
+    field public static final int EGL_OPENGL_ES3_BIT = 64; // 0x40
+    field public static final int EGL_PLATFORM_ANDROID_KHR = 12609; // 0x3141
+    field public static final int EGL_SIGNALED = 12530; // 0x30f2
+    field public static final int EGL_SYNC_CL_EVENT = 12542; // 0x30fe
+    field public static final int EGL_SYNC_CL_EVENT_COMPLETE = 12543; // 0x30ff
+    field public static final int EGL_SYNC_CONDITION = 12536; // 0x30f8
+    field public static final int EGL_SYNC_FENCE = 12537; // 0x30f9
+    field public static final int EGL_SYNC_FLUSH_COMMANDS_BIT = 1; // 0x1
+    field public static final int EGL_SYNC_PRIOR_COMMANDS_COMPLETE = 12528; // 0x30f0
+    field public static final int EGL_SYNC_STATUS = 12529; // 0x30f1
+    field public static final int EGL_SYNC_TYPE = 12535; // 0x30f7
+    field public static final int EGL_TIMEOUT_EXPIRED = 12533; // 0x30f5
+    field public static final int EGL_UNSIGNALED = 12531; // 0x30f3
+  }
+
   public class EGLConfig extends android.opengl.EGLObjectHandle {
   }
 
@@ -29733,6 +29818,9 @@
     field public static final int EGL_RECORDABLE_ANDROID = 12610; // 0x3142
   }
 
+  public class EGLImage extends android.opengl.EGLObjectHandle {
+  }
+
   public abstract class EGLObjectHandle {
     ctor protected deprecated EGLObjectHandle(int);
     ctor protected EGLObjectHandle(long);
@@ -29743,6 +29831,9 @@
   public class EGLSurface extends android.opengl.EGLObjectHandle {
   }
 
+  public class EGLSync extends android.opengl.EGLObjectHandle {
+  }
+
   public class ETC1 {
     ctor public ETC1();
     method public static void decodeBlock(java.nio.Buffer, java.nio.Buffer);
@@ -33804,6 +33895,7 @@
     field public static final java.lang.String DISALLOW_CONFIG_LOCALE = "no_config_locale";
     field public static final java.lang.String DISALLOW_CONFIG_LOCATION = "no_config_location";
     field public static final java.lang.String DISALLOW_CONFIG_MOBILE_NETWORKS = "no_config_mobile_networks";
+    field public static final java.lang.String DISALLOW_CONFIG_PRIVATE_DNS = "disallow_config_private_dns";
     field public static final java.lang.String DISALLOW_CONFIG_SCREEN_TIMEOUT = "no_config_screen_timeout";
     field public static final java.lang.String DISALLOW_CONFIG_TETHERING = "no_config_tethering";
     field public static final java.lang.String DISALLOW_CONFIG_VPN = "no_config_vpn";
@@ -36736,7 +36828,7 @@
 
   public static abstract interface MediaStore.Audio.AlbumColumns {
     field public static final java.lang.String ALBUM = "album";
-    field public static final java.lang.String ALBUM_ART = "album_art";
+    field public static final deprecated java.lang.String ALBUM_ART = "album_art";
     field public static final java.lang.String ALBUM_ID = "album_id";
     field public static final java.lang.String ALBUM_KEY = "album_key";
     field public static final java.lang.String ARTIST = "artist";
@@ -36858,7 +36950,7 @@
   }
 
   public static abstract interface MediaStore.Audio.PlaylistsColumns {
-    field public static final java.lang.String DATA = "_data";
+    field public static final deprecated java.lang.String DATA = "_data";
     field public static final java.lang.String DATE_ADDED = "date_added";
     field public static final java.lang.String DATE_MODIFIED = "date_modified";
     field public static final java.lang.String NAME = "name";
@@ -36920,15 +37012,15 @@
 
   public static class MediaStore.Images.Thumbnails implements android.provider.BaseColumns {
     ctor public MediaStore.Images.Thumbnails();
-    method public static void cancelThumbnailRequest(android.content.ContentResolver, long);
-    method public static void cancelThumbnailRequest(android.content.ContentResolver, long, long);
+    method public static deprecated void cancelThumbnailRequest(android.content.ContentResolver, long);
+    method public static deprecated void cancelThumbnailRequest(android.content.ContentResolver, long, long);
     method public static android.net.Uri getContentUri(java.lang.String);
-    method public static android.graphics.Bitmap getThumbnail(android.content.ContentResolver, long, int, android.graphics.BitmapFactory.Options);
-    method public static android.graphics.Bitmap getThumbnail(android.content.ContentResolver, long, long, int, android.graphics.BitmapFactory.Options);
+    method public static deprecated android.graphics.Bitmap getThumbnail(android.content.ContentResolver, long, int, android.graphics.BitmapFactory.Options);
+    method public static deprecated android.graphics.Bitmap getThumbnail(android.content.ContentResolver, long, long, int, android.graphics.BitmapFactory.Options);
     method public static final android.database.Cursor query(android.content.ContentResolver, android.net.Uri, java.lang.String[]);
     method public static final android.database.Cursor queryMiniThumbnail(android.content.ContentResolver, long, int, java.lang.String[]);
     method public static final android.database.Cursor queryMiniThumbnails(android.content.ContentResolver, android.net.Uri, int, java.lang.String[]);
-    field public static final java.lang.String DATA = "_data";
+    field public static final deprecated java.lang.String DATA = "_data";
     field public static final java.lang.String DEFAULT_SORT_ORDER = "image_id ASC";
     field public static final android.net.Uri EXTERNAL_CONTENT_URI;
     field public static final int FULL_SCREEN_KIND = 2; // 0x2
@@ -36943,7 +37035,7 @@
   }
 
   public static abstract interface MediaStore.MediaColumns implements android.provider.BaseColumns {
-    field public static final java.lang.String DATA = "_data";
+    field public static final deprecated java.lang.String DATA = "_data";
     field public static final java.lang.String DATE_ADDED = "date_added";
     field public static final java.lang.String DATE_MODIFIED = "date_modified";
     field public static final java.lang.String DISPLAY_NAME = "_display_name";
@@ -36971,12 +37063,12 @@
 
   public static class MediaStore.Video.Thumbnails implements android.provider.BaseColumns {
     ctor public MediaStore.Video.Thumbnails();
-    method public static void cancelThumbnailRequest(android.content.ContentResolver, long);
-    method public static void cancelThumbnailRequest(android.content.ContentResolver, long, long);
+    method public static deprecated void cancelThumbnailRequest(android.content.ContentResolver, long);
+    method public static deprecated void cancelThumbnailRequest(android.content.ContentResolver, long, long);
     method public static android.net.Uri getContentUri(java.lang.String);
-    method public static android.graphics.Bitmap getThumbnail(android.content.ContentResolver, long, int, android.graphics.BitmapFactory.Options);
-    method public static android.graphics.Bitmap getThumbnail(android.content.ContentResolver, long, long, int, android.graphics.BitmapFactory.Options);
-    field public static final java.lang.String DATA = "_data";
+    method public static deprecated android.graphics.Bitmap getThumbnail(android.content.ContentResolver, long, int, android.graphics.BitmapFactory.Options);
+    method public static deprecated android.graphics.Bitmap getThumbnail(android.content.ContentResolver, long, long, int, android.graphics.BitmapFactory.Options);
+    field public static final deprecated java.lang.String DATA = "_data";
     field public static final java.lang.String DEFAULT_SORT_ORDER = "video_id ASC";
     field public static final android.net.Uri EXTERNAL_CONTENT_URI;
     field public static final int FULL_SCREEN_KIND = 2; // 0x2
@@ -43033,6 +43125,7 @@
     method public static int getDefaultSubscriptionId();
     method public static int getDefaultVoiceSubscriptionId();
     method public java.util.List<android.telephony.SubscriptionInfo> getOpportunisticSubscriptions(int);
+    method public static int getSlotIndex(int);
     method public static int[] getSubscriptionIds(int);
     method public java.util.List<android.telephony.SubscriptionPlan> getSubscriptionPlans(int);
     method public boolean isActiveSubscriptionId(int);
@@ -43053,6 +43146,7 @@
     field public static final int DATA_ROAMING_ENABLE = 1; // 0x1
     field public static final int DEFAULT_SUBSCRIPTION_ID = 2147483647; // 0x7fffffff
     field public static final java.lang.String EXTRA_SUBSCRIPTION_INDEX = "android.telephony.extra.SUBSCRIPTION_INDEX";
+    field public static final int INVALID_SIM_SLOT_INDEX = -1; // 0xffffffff
     field public static final int INVALID_SUBSCRIPTION_ID = -1; // 0xffffffff
   }
 
@@ -43427,7 +43521,8 @@
 
 package android.telephony.emergency {
 
-  public final class EmergencyNumber implements android.os.Parcelable {
+  public final class EmergencyNumber implements java.lang.Comparable android.os.Parcelable {
+    method public int compareTo(android.telephony.emergency.EmergencyNumber);
     method public int describeContents();
     method public java.lang.String getCountryIso();
     method public int getEmergencyNumberSourceBitmask();
@@ -45187,6 +45282,7 @@
     method public int getSpanTypeId();
     method public android.content.res.ColorStateList getTextColor();
     method public int getTextFontWeight();
+    method public android.os.LocaleList getTextLocales();
     method public int getTextSize();
     method public int getTextStyle();
     method public android.graphics.Typeface getTypeface();
@@ -51338,6 +51434,7 @@
     method public default android.view.textclassifier.TextClassification classifyText(android.view.textclassifier.TextClassification.Request);
     method public default android.view.textclassifier.TextClassification classifyText(java.lang.CharSequence, int, int, android.os.LocaleList);
     method public default void destroy();
+    method public default android.view.textclassifier.TextLanguage detectLanguage(android.view.textclassifier.TextLanguage.Request);
     method public default android.view.textclassifier.TextLinks generateLinks(android.view.textclassifier.TextLinks.Request);
     method public default int getMaxGenerateLinksTextLength();
     method public default boolean isDestroyed();
@@ -51378,6 +51475,39 @@
     field public static final android.os.Parcelable.Creator<android.view.textclassifier.TextClassifier.EntityConfig> CREATOR;
   }
 
+  public final class TextLanguage implements android.os.Parcelable {
+    method public int describeContents();
+    method public float getConfidenceScore(android.icu.util.ULocale);
+    method public android.os.Bundle getExtras();
+    method public java.lang.String getId();
+    method public android.icu.util.ULocale getLocale(int);
+    method public int getLocaleHypothesisCount();
+    method public void writeToParcel(android.os.Parcel, int);
+    field public static final android.os.Parcelable.Creator<android.view.textclassifier.TextLanguage> CREATOR;
+  }
+
+  public static final class TextLanguage.Builder {
+    ctor public TextLanguage.Builder();
+    method public android.view.textclassifier.TextLanguage build();
+    method public android.view.textclassifier.TextLanguage.Builder putLocale(android.icu.util.ULocale, float);
+    method public android.view.textclassifier.TextLanguage.Builder setExtras(android.os.Bundle);
+    method public android.view.textclassifier.TextLanguage.Builder setId(java.lang.String);
+  }
+
+  public static final class TextLanguage.Request implements android.os.Parcelable {
+    method public int describeContents();
+    method public android.os.Bundle getExtras();
+    method public java.lang.CharSequence getText();
+    method public void writeToParcel(android.os.Parcel, int);
+    field public static final android.os.Parcelable.Creator<android.view.textclassifier.TextLanguage.Request> CREATOR;
+  }
+
+  public static final class TextLanguage.Request.Builder {
+    ctor public TextLanguage.Request.Builder(java.lang.CharSequence);
+    method public android.view.textclassifier.TextLanguage.Request build();
+    method public android.view.textclassifier.TextLanguage.Request.Builder setExtras(android.os.Bundle);
+  }
+
   public final class TextLinks implements android.os.Parcelable {
     method public int apply(android.text.Spannable, int, java.util.function.Function<android.view.textclassifier.TextLinks.TextLink, android.view.textclassifier.TextLinks.TextLinkSpan>);
     method public int describeContents();
@@ -52298,6 +52428,7 @@
     field public static final int ERROR_UNSAFE_RESOURCE = -16; // 0xfffffff0
     field public static final int ERROR_UNSUPPORTED_AUTH_SCHEME = -3; // 0xfffffffd
     field public static final int ERROR_UNSUPPORTED_SCHEME = -10; // 0xfffffff6
+    field public static final int SAFE_BROWSING_THREAT_BILLING = 4; // 0x4
     field public static final int SAFE_BROWSING_THREAT_MALWARE = 1; // 0x1
     field public static final int SAFE_BROWSING_THREAT_PHISHING = 2; // 0x2
     field public static final int SAFE_BROWSING_THREAT_UNKNOWN = 0; // 0x0
diff --git a/api/system-current.txt b/api/system-current.txt
index eccc0ea..26036ea 100644
--- a/api/system-current.txt
+++ b/api/system-current.txt
@@ -1012,7 +1012,6 @@
     field public static final java.lang.String EXTRA_REMOTE_CALLBACK = "android.intent.extra.REMOTE_CALLBACK";
     field public static final java.lang.String EXTRA_RESULT_NEEDED = "android.intent.extra.RESULT_NEEDED";
     field public static final java.lang.String EXTRA_UNKNOWN_INSTANT_APP = "android.intent.extra.UNKNOWN_INSTANT_APP";
-    field public static final java.lang.String EXTRA_USER_ID = "android.intent.extra.USER_ID";
     field public static final java.lang.String EXTRA_VERIFICATION_BUNDLE = "android.intent.extra.VERIFICATION_BUNDLE";
   }
 
@@ -4472,6 +4471,23 @@
     field public static final java.lang.String VOLUME_HUSH_GESTURE = "volume_hush_gesture";
   }
 
+  public static final class Telephony.Carriers implements android.provider.BaseColumns {
+    field public static final java.lang.String APN_SET_ID = "apn_set_id";
+    field public static final int CARRIER_EDITED = 4; // 0x4
+    field public static final java.lang.String EDITED = "edited";
+    field public static final java.lang.String MAX_CONNS = "max_conns";
+    field public static final java.lang.String MAX_CONNS_TIME = "max_conns_time";
+    field public static final java.lang.String MODEM_COGNITIVE = "modem_cognitive";
+    field public static final java.lang.String MTU = "mtu";
+    field public static final int NO_SET_SET = 0; // 0x0
+    field public static final int UNEDITED = 0; // 0x0
+    field public static final int USER_DELETED = 2; // 0x2
+    field public static final java.lang.String USER_EDITABLE = "user_editable";
+    field public static final int USER_EDITED = 1; // 0x1
+    field public static final java.lang.String USER_VISIBLE = "user_visible";
+    field public static final java.lang.String WAIT_TIME = "wait_time";
+  }
+
   public final class TimeZoneRulesDataContract {
     field public static final java.lang.String AUTHORITY = "com.android.timezone";
   }
@@ -5340,6 +5356,11 @@
     field public static final int RESULT_SUCCESS = 0; // 0x0
   }
 
+  public class PhoneStateListener {
+    method public void onRadioPowerStateChanged(int);
+    field public static final int LISTEN_RADIO_POWER_STATE_CHANGED = 8388608; // 0x800000
+  }
+
   public class ServiceState implements android.os.Parcelable {
     method public android.telephony.NetworkRegistrationState getNetworkRegistrationState(int, int);
     method public java.util.List<android.telephony.NetworkRegistrationState> getNetworkRegistrationStates();
@@ -5467,6 +5488,7 @@
     method public boolean getEmergencyCallbackMode();
     method public java.lang.String getIsimDomain();
     method public int getPreferredNetworkType(int);
+    method public int getRadioPowerState();
     method public int getSimApplicationState();
     method public int getSimCardState();
     method public java.util.List<android.telephony.TelephonyHistogram> getTelephonyHistograms();
@@ -5481,6 +5503,7 @@
     method public deprecated boolean isVisualVoicemailEnabled(android.telecom.PhoneAccountHandle);
     method public boolean needsOtaServiceProvisioning();
     method public int setAllowedCarriers(int, java.util.List<android.service.carrier.CarrierIdentifier>);
+    method public void setCarrierDataEnabled(boolean);
     method public void setDataActivationState(int);
     method public deprecated void setDataEnabled(int, boolean);
     method public void setDataRoamingEnabled(boolean);
@@ -5530,6 +5553,9 @@
     field public static final int NETWORK_MODE_TDSCDMA_WCDMA = 14; // 0xe
     field public static final int NETWORK_MODE_WCDMA_ONLY = 2; // 0x2
     field public static final int NETWORK_MODE_WCDMA_PREF = 0; // 0x0
+    field public static final int RADIO_POWER_OFF = 0; // 0x0
+    field public static final int RADIO_POWER_ON = 1; // 0x1
+    field public static final int RADIO_POWER_UNAVAILABLE = 2; // 0x2
     field public static final int SIM_ACTIVATION_STATE_ACTIVATED = 2; // 0x2
     field public static final int SIM_ACTIVATION_STATE_ACTIVATING = 1; // 0x1
     field public static final int SIM_ACTIVATION_STATE_DEACTIVATED = 3; // 0x3
@@ -5596,17 +5622,12 @@
   }
 
   public final class DataProfile implements android.os.Parcelable {
-    ctor public DataProfile(int, java.lang.String, java.lang.String, int, java.lang.String, java.lang.String, int, int, int, int, boolean, int, java.lang.String, int, int, java.lang.String, java.lang.String, boolean);
-    ctor public DataProfile(android.os.Parcel);
-    method public int describeContents();
     method public java.lang.String getApn();
     method public int getAuthType();
     method public int getBearerBitmap();
     method public int getMaxConns();
     method public int getMaxConnsTime();
     method public int getMtu();
-    method public java.lang.String getMvnoMatchData();
-    method public java.lang.String getMvnoType();
     method public java.lang.String getPassword();
     method public int getProfileId();
     method public java.lang.String getProtocol();
@@ -5616,9 +5637,8 @@
     method public java.lang.String getUserName();
     method public int getWaitTime();
     method public boolean isEnabled();
-    method public boolean isModemCognitive();
-    method public void writeToParcel(android.os.Parcel, int);
-    field public static final android.os.Parcelable.Creator<android.telephony.data.DataProfile> CREATOR;
+    method public boolean isPersistent();
+    method public boolean isPreferred();
     field public static final int TYPE_3GPP = 1; // 0x1
     field public static final int TYPE_3GPP2 = 2; // 0x2
     field public static final int TYPE_COMMON = 0; // 0x0
@@ -5944,11 +5964,13 @@
   }
 
   public final class ImsExternalCallState implements android.os.Parcelable {
+    ctor public ImsExternalCallState(java.lang.String, android.net.Uri, android.net.Uri, boolean, int, int, boolean);
     method public int describeContents();
     method public android.net.Uri getAddress();
     method public int getCallId();
     method public int getCallState();
     method public int getCallType();
+    method public android.net.Uri getLocalAddress();
     method public boolean isCallHeld();
     method public boolean isCallPullable();
     method public void writeToParcel(android.os.Parcel, int);
@@ -6368,7 +6390,8 @@
   }
 
   public static class MmTelFeature.MmTelCapabilities {
-    ctor public MmTelFeature.MmTelCapabilities(android.telephony.ims.feature.ImsFeature.Capabilities);
+    ctor public MmTelFeature.MmTelCapabilities();
+    ctor public deprecated MmTelFeature.MmTelCapabilities(android.telephony.ims.feature.ImsFeature.Capabilities);
     ctor public MmTelFeature.MmTelCapabilities(int);
     method public final void addCapabilities(int);
     method public final boolean isCapable(int);
diff --git a/api/system-removed.txt b/api/system-removed.txt
index 2246562..4e7a114 100644
--- a/api/system-removed.txt
+++ b/api/system-removed.txt
@@ -91,38 +91,6 @@
 
 }
 
-package android.security.keystore.recovery {
-
-  public final class KeyChainSnapshot implements android.os.Parcelable {
-    method public deprecated byte[] getTrustedHardwarePublicKey();
-  }
-
-  public class RecoveryController {
-    method public deprecated byte[] generateAndStoreKey(java.lang.String, byte[]) throws android.security.keystore.recovery.InternalRecoveryServiceException, android.security.keystore.recovery.LockScreenRequiredException;
-    method public deprecated java.security.Key generateKey(java.lang.String, byte[]) throws android.security.keystore.recovery.InternalRecoveryServiceException, android.security.keystore.recovery.LockScreenRequiredException;
-    method public deprecated java.util.List<java.lang.String> getAliases(java.lang.String) throws android.security.keystore.recovery.InternalRecoveryServiceException;
-    method public deprecated android.security.keystore.recovery.KeyChainSnapshot getRecoveryData() throws android.security.keystore.recovery.InternalRecoveryServiceException;
-    method public deprecated int getRecoveryStatus(java.lang.String, java.lang.String) throws android.security.keystore.recovery.InternalRecoveryServiceException;
-    method public deprecated void initRecoveryService(java.lang.String, byte[]) throws java.security.cert.CertificateException, android.security.keystore.recovery.InternalRecoveryServiceException;
-    method public deprecated void setRecoveryStatus(java.lang.String, java.lang.String, int) throws android.security.keystore.recovery.InternalRecoveryServiceException, android.content.pm.PackageManager.NameNotFoundException;
-  }
-
-  public class RecoverySession implements java.lang.AutoCloseable {
-    method public deprecated java.util.Map<java.lang.String, byte[]> recoverKeys(byte[], java.util.List<android.security.keystore.recovery.WrappedApplicationKey>) throws android.security.keystore.recovery.DecryptionFailedException, android.security.keystore.recovery.InternalRecoveryServiceException, android.security.keystore.recovery.SessionExpiredException;
-    method public deprecated byte[] start(byte[], byte[], byte[], java.util.List<android.security.keystore.recovery.KeyChainProtectionParams>) throws java.security.cert.CertificateException, android.security.keystore.recovery.InternalRecoveryServiceException;
-    method public deprecated byte[] start(java.security.cert.CertPath, byte[], byte[], java.util.List<android.security.keystore.recovery.KeyChainProtectionParams>) throws java.security.cert.CertificateException, android.security.keystore.recovery.InternalRecoveryServiceException;
-  }
-
-  public final class WrappedApplicationKey implements android.os.Parcelable {
-    method public deprecated byte[] getAccount();
-  }
-
-  public static class WrappedApplicationKey.Builder {
-    method public deprecated android.security.keystore.recovery.WrappedApplicationKey.Builder setAccount(byte[]);
-  }
-
-}
-
 package android.service.notification {
 
   public abstract class NotificationListenerService extends android.app.Service {
diff --git a/cmds/statsd/Android.mk b/cmds/statsd/Android.mk
index c396cd1..5818f5d 100644
--- a/cmds/statsd/Android.mk
+++ b/cmds/statsd/Android.mk
@@ -46,6 +46,7 @@
     src/logd/LogEvent.cpp \
     src/logd/LogListener.cpp \
     src/matchers/CombinationLogMatchingTracker.cpp \
+    src/matchers/EventMatcherWizard.cpp \
     src/matchers/matcher_util.cpp \
     src/matchers/SimpleLogMatchingTracker.cpp \
     src/metrics/MetricProducer.cpp \
@@ -217,6 +218,7 @@
     tests/metrics/metrics_test_helper.cpp \
     tests/statsd_test_util.cpp \
     tests/e2e/WakelockDuration_e2e_test.cpp \
+    tests/e2e/MetricActivation_e2e_test.cpp \
     tests/e2e/MetricConditionLink_e2e_test.cpp \
     tests/e2e/Alarm_e2e_test.cpp \
     tests/e2e/Attribution_e2e_test.cpp \
diff --git a/cmds/statsd/src/StatsLogProcessor.h b/cmds/statsd/src/StatsLogProcessor.h
index 6a9e8a1..3e8b9b8 100644
--- a/cmds/statsd/src/StatsLogProcessor.h
+++ b/cmds/statsd/src/StatsLogProcessor.h
@@ -194,7 +194,7 @@
     FRIEND_TEST(GaugeMetricE2eTest, TestMultipleFieldsForPushedEvent);
     FRIEND_TEST(GaugeMetricE2eTest, TestRandomSamplePulledEvents);
     FRIEND_TEST(GaugeMetricE2eTest, TestRandomSamplePulledEvent_LateAlarm);
-    FRIEND_TEST(GaugeMetricE2eTest, TestAllConditionChangesSamplePulledEvents);
+    FRIEND_TEST(GaugeMetricE2eTest, TestConditionChangeToTrueSamplePulledEvents);
     FRIEND_TEST(ValueMetricE2eTest, TestPulledEvents);
     FRIEND_TEST(ValueMetricE2eTest, TestPulledEvents_LateAlarm);
 
@@ -219,6 +219,7 @@
 
     FRIEND_TEST(AlarmE2eTest, TestMultipleAlarms);
     FRIEND_TEST(ConfigTtlE2eTest, TestCountMetric);
+    FRIEND_TEST(MetricActivationE2eTest, TestCountMetric);
 };
 
 }  // namespace statsd
diff --git a/cmds/statsd/src/atoms.proto b/cmds/statsd/src/atoms.proto
index 4045996..c2fed66 100644
--- a/cmds/statsd/src/atoms.proto
+++ b/cmds/statsd/src/atoms.proto
@@ -143,10 +143,11 @@
         BatteryCausedShutdown battery_caused_shutdown = 93;
         PhoneServiceStateChanged phone_service_state_changed = 94;
         PhoneStateChanged phone_state_changed = 95;
+        UserRestrictionChanged user_restriction_changed = 96;
     }
 
     // Pulled events will start at field 10000.
-    // Next: 10025
+    // Next: 10037
     oneof pulled {
         WifiBytesTransfer wifi_bytes_transfer = 10000;
         WifiBytesTransferByFgBg wifi_bytes_transfer_by_fg_bg = 10001;
@@ -183,7 +184,7 @@
         DiskIo disk_io = 10032;
         PowerProfile power_profile = 10033;
         ProcStats proc_stats_pkg_proc = 10034;
-        ProcessCpuTime process_cpu_time = 10035;
+        NativeProcessMemoryState native_process_memory_state = 10036;
     }
 
     // DO NOT USE field numbers above 100,000 in AOSP.
@@ -2345,6 +2346,31 @@
 }
 
 /*
+ * Logs the memory stats for a native process (from procfs).
+ */
+message NativeProcessMemoryState {
+  // The uid if available. -1 means not available.
+  optional int32 uid = 1 [(is_uid) = true];
+
+  // The process name.
+  optional string process_name = 2;
+
+  // # of page-faults
+  optional int64 page_fault = 3;
+
+  // # of major page-faults
+  optional int64 page_major_fault = 4;
+
+  // RSS
+  optional int64 rss_in_bytes = 5;
+
+  // RSS high watermark.
+  // Peak RSS usage of the process. Value is read from the VmHWM field in /proc/PID/status or
+  // from memory.max_usage_in_bytes under /dev/memcg if the device uses per-app memory cgroups.
+  optional int64 rss_high_watermark_in_bytes = 6;
+}
+
+/*
  * Elapsed real time from SystemClock.
  */
 message SystemElapsedRealtime {
@@ -3009,17 +3035,15 @@
 }
 
 /**
- * Pulls process user time and system time. Puller takes a snapshot of all pids
- * in the system and returns cpu stats for those that are working at the time.
- * Dead pids will be dropped. Kernel processes are excluded.
- * Min cool-down is 5 sec.
+ * Logs when a user restriction was added or removed.
+ *
+ * Logged from:
+ *   frameworks/base/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
  */
-message ProcessCpuTime {
-    optional int32 uid = 1 [(is_uid) = true];
-
-    optional string process_name = 2;
-    // Process cpu time in user space, cumulative from boot/process start
-    optional int64 user_time_millis = 3;
-    // Process cpu time in system space, cumulative from boot/process start
-    optional int64 system_time_millis = 4;
+message UserRestrictionChanged {
+    // The raw string of the user restriction as defined in UserManager.
+    // Allowed values are defined in UserRestrictionsUtils#USER_RESTRICTIONS.
+    optional string restriction = 1;
+    // Whether the restriction is enabled or disabled.
+    optional bool enabled = 2;
 }
\ No newline at end of file
diff --git a/cmds/statsd/src/external/StatsPullerManager.cpp b/cmds/statsd/src/external/StatsPullerManager.cpp
index 4c74c17..1a9ba8a 100644
--- a/cmds/statsd/src/external/StatsPullerManager.cpp
+++ b/cmds/statsd/src/external/StatsPullerManager.cpp
@@ -170,6 +170,12 @@
           {2, 3},
           1 * NS_PER_SEC,
           new StatsCompanionServicePuller(android::util::PROCESS_MEMORY_STATE)}},
+        // native_process_memory_state
+        {android::util::NATIVE_PROCESS_MEMORY_STATE,
+         {{3, 4, 5, 6},
+          {2},
+          1 * NS_PER_SEC,
+          new StatsCompanionServicePuller(android::util::NATIVE_PROCESS_MEMORY_STATE)}},
         // temperature
         {android::util::TEMPERATURE, {{}, {}, 1 * NS_PER_SEC, new ResourceThermalManagerPuller()}},
         // binder_calls
@@ -223,9 +229,6 @@
         // PowerProfile constants for power model calculations.
         {android::util::POWER_PROFILE,
          {{}, {}, 1 * NS_PER_SEC, new StatsCompanionServicePuller(android::util::POWER_PROFILE)}},
-        // Process cpu stats. Min cool-down is 5 sec, inline with what AcitivityManagerService uses.
-        {android::util::PROCESS_CPU_TIME,
-         {{}, {}, 5 * NS_PER_SEC, new StatsCompanionServicePuller(android::util::PROCESS_CPU_TIME)}},
 };
 
 StatsPullerManager::StatsPullerManager() : mNextPullTimeNs(NO_ALARM_UPDATE) {
diff --git a/cmds/statsd/src/matchers/EventMatcherWizard.cpp b/cmds/statsd/src/matchers/EventMatcherWizard.cpp
new file mode 100644
index 0000000..8418e98
--- /dev/null
+++ b/cmds/statsd/src/matchers/EventMatcherWizard.cpp
@@ -0,0 +1,38 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "EventMatcherWizard.h"
+#include <unordered_set>
+
+namespace android {
+namespace os {
+namespace statsd {
+
+using std::map;
+using std::string;
+using std::vector;
+
+MatchingState EventMatcherWizard::matchLogEvent(const LogEvent& event, int matcher_index) {
+    if (matcher_index < 0 || matcher_index >= (int)mAllEventMatchers.size()) {
+        return MatchingState::kNotComputed;
+    }
+    vector<MatchingState> matcherCache(mAllEventMatchers.size(), MatchingState::kNotComputed);
+    mAllEventMatchers[matcher_index]->onLogEvent(event, mAllEventMatchers, matcherCache);
+    return matcherCache[matcher_index];
+}
+
+}  // namespace statsd
+}  // namespace os
+}  // namespace android
\ No newline at end of file
diff --git a/cmds/statsd/src/matchers/EventMatcherWizard.h b/cmds/statsd/src/matchers/EventMatcherWizard.h
new file mode 100644
index 0000000..57ec2b3
--- /dev/null
+++ b/cmds/statsd/src/matchers/EventMatcherWizard.h
@@ -0,0 +1,41 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include "LogMatchingTracker.h"
+
+namespace android {
+namespace os {
+namespace statsd {
+
+class EventMatcherWizard : public virtual android::RefBase {
+public:
+    EventMatcherWizard(){};  // for testing
+    EventMatcherWizard(const std::vector<sp<LogMatchingTracker>>& eventTrackers)
+        : mAllEventMatchers(eventTrackers){};
+
+    virtual ~EventMatcherWizard(){};
+
+    MatchingState matchLogEvent(const LogEvent& event, int matcher_index);
+
+private:
+    std::vector<sp<LogMatchingTracker>> mAllEventMatchers;
+};
+
+}  // namespace statsd
+}  // namespace os
+}  // namespace android
diff --git a/cmds/statsd/src/metrics/GaugeMetricProducer.cpp b/cmds/statsd/src/metrics/GaugeMetricProducer.cpp
index 02b9773..f5a16e9 100644
--- a/cmds/statsd/src/metrics/GaugeMetricProducer.cpp
+++ b/cmds/statsd/src/metrics/GaugeMetricProducer.cpp
@@ -69,11 +69,16 @@
 
 GaugeMetricProducer::GaugeMetricProducer(const ConfigKey& key, const GaugeMetric& metric,
                                          const int conditionIndex,
-                                         const sp<ConditionWizard>& wizard, const int pullTagId,
+                                         const sp<ConditionWizard>& wizard,
+                                         const int whatMatcherIndex,
+                                         const sp<EventMatcherWizard>& matcherWizard,
+                                         const int pullTagId,
                                          const int triggerAtomId, const int atomId,
                                          const int64_t timeBaseNs, const int64_t startTimeNs,
                                          const sp<StatsPullerManager>& pullerManager)
     : MetricProducer(metric.id(), key, timeBaseNs, conditionIndex, wizard),
+      mWhatMatcherIndex(whatMatcherIndex),
+      mEventMatcherWizard(matcherWizard),
       mPullerManager(pullerManager),
       mPullTagId(pullTagId),
       mTriggerAtomId(triggerAtomId),
@@ -136,7 +141,7 @@
     // Adjust start for partial bucket
     mCurrentBucketStartTimeNs = startTimeNs;
     if (mIsPulled) {
-        pullLocked(startTimeNs);
+        pullAndMatchEventsLocked(startTimeNs);
     }
 
     VLOG("Gauge metric %lld created. bucket size %lld start_time: %lld sliced %d",
@@ -302,7 +307,7 @@
     mPastBuckets.clear();
 }
 
-void GaugeMetricProducer::pullLocked(const int64_t timestampNs) {
+void GaugeMetricProducer::pullAndMatchEventsLocked(const int64_t timestampNs) {
     bool triggerPuller = false;
     switch(mSamplingType) {
         // When the metric wants to do random sampling and there is already one gauge atom for the
@@ -331,7 +336,10 @@
         return;
     }
     for (const auto& data : allData) {
-        onMatchedLogEventLocked(0, *data);
+        if (mEventMatcherWizard->matchLogEvent(
+                *data, mWhatMatcherIndex) == MatchingState::kMatched) {
+            onMatchedLogEventLocked(mWhatMatcherIndex, *data);
+        }
     }
 }
 
@@ -341,7 +349,7 @@
     flushIfNeededLocked(eventTimeNs);
     mCondition = conditionMet;
     if (mIsPulled) {
-        pullLocked(eventTimeNs);
+        pullAndMatchEventsLocked(eventTimeNs);
     }  // else: Push mode. No need to proactively pull the gauge data.
 }
 
@@ -354,7 +362,7 @@
     // pull for every dimension.
     mCondition = overallCondition;
     if (mIsPulled) {
-        pullLocked(eventTimeNs);
+        pullAndMatchEventsLocked(eventTimeNs);
     }  // else: Push mode. No need to proactively pull the gauge data.
 }
 
@@ -387,7 +395,10 @@
         return;
     }
     for (const auto& data : allData) {
-        onMatchedLogEventLocked(0, *data);
+        if (mEventMatcherWizard->matchLogEvent(
+                *data, mWhatMatcherIndex) == MatchingState::kMatched) {
+            onMatchedLogEventLocked(mWhatMatcherIndex, *data);
+        }
     }
 }
 
@@ -426,7 +437,7 @@
     flushIfNeededLocked(eventTimeNs);
 
     if (mTriggerAtomId == event.GetTagId()) {
-        pullLocked(eventTimeNs);
+        pullAndMatchEventsLocked(eventTimeNs);
         return;
     }
 
diff --git a/cmds/statsd/src/metrics/GaugeMetricProducer.h b/cmds/statsd/src/metrics/GaugeMetricProducer.h
index 6379389..99827bb 100644
--- a/cmds/statsd/src/metrics/GaugeMetricProducer.h
+++ b/cmds/statsd/src/metrics/GaugeMetricProducer.h
@@ -24,6 +24,7 @@
 #include "../external/PullDataReceiver.h"
 #include "../external/StatsPullerManager.h"
 #include "../matchers/matcher_util.h"
+#include "../matchers/EventMatcherWizard.h"
 #include "MetricProducer.h"
 #include "frameworks/base/cmds/statsd/src/statsd_config.pb.h"
 #include "../stats_util.h"
@@ -56,7 +57,9 @@
 class GaugeMetricProducer : public virtual MetricProducer, public virtual PullDataReceiver {
 public:
     GaugeMetricProducer(const ConfigKey& key, const GaugeMetric& gaugeMetric,
-                        const int conditionIndex, const sp<ConditionWizard>& wizard,
+                        const int conditionIndex, const sp<ConditionWizard>& conditionWizard,
+                        const int whatMatcherIndex,
+                        const sp<EventMatcherWizard>& matcherWizard,
                         const int pullTagId, const int triggerAtomId, const int atomId,
                         const int64_t timeBaseNs, const int64_t startTimeNs,
                         const sp<StatsPullerManager>& pullerManager);
@@ -78,7 +81,7 @@
         flushCurrentBucketLocked(eventTimeNs);
         mCurrentBucketStartTimeNs = eventTimeNs;
         if (mIsPulled) {
-            pullLocked(eventTimeNs);
+            pullAndMatchEventsLocked(eventTimeNs);
         }
     };
 
@@ -113,7 +116,11 @@
 
     void flushCurrentBucketLocked(const int64_t& eventTimeNs) override;
 
-    void pullLocked(const int64_t timestampNs);
+    void pullAndMatchEventsLocked(const int64_t timestampNs);
+
+    const int mWhatMatcherIndex;
+
+    sp<EventMatcherWizard> mEventMatcherWizard;
 
     sp<StatsPullerManager> mPullerManager;
     // tagId for pulled data. -1 if this is not pulled
diff --git a/cmds/statsd/src/metrics/MetricProducer.cpp b/cmds/statsd/src/metrics/MetricProducer.cpp
index df08181..f87849e 100644
--- a/cmds/statsd/src/metrics/MetricProducer.cpp
+++ b/cmds/statsd/src/metrics/MetricProducer.cpp
@@ -64,8 +64,54 @@
         onMatchedLogEventInternalLocked(
                 matcherIndex, metricKey, conditionKey, condition, event);
     }
+}
 
- }
+bool MetricProducer::evaluateActiveStateLocked(int64_t elapsedTimestampNs) {
+    bool isActive = mEventActivationMap.empty();
+    for (auto& it : mEventActivationMap) {
+        if (it.second.state == ActivationState::kActive &&
+            elapsedTimestampNs > it.second.ttl_ns + it.second.activation_ns) {
+            it.second.state = ActivationState::kNotActive;
+        }
+        if (it.second.state == ActivationState::kActive) {
+            isActive = true;
+        }
+    }
+    return isActive;
+}
+
+void MetricProducer::flushIfExpire(int64_t elapsedTimestampNs) {
+    std::lock_guard<std::mutex> lock(mMutex);
+    if (!mIsActive) {
+        return;
+    }
+    mIsActive = evaluateActiveStateLocked(elapsedTimestampNs);
+    if (!mIsActive) {
+        flushLocked(elapsedTimestampNs);
+    }
+}
+
+void MetricProducer::addActivation(int activationTrackerIndex, int64_t ttl_seconds) {
+    std::lock_guard<std::mutex> lock(mMutex);
+    // When a metric producer does not depend on any activation, its mIsActive is true.
+    // Therefor, if this is the 1st activation, mIsActive will turn to false. Otherwise it does not
+    // change.
+    if  (mEventActivationMap.empty()) {
+        mIsActive = false;
+    }
+    mEventActivationMap[activationTrackerIndex].ttl_ns = ttl_seconds * NS_PER_SEC;
+}
+
+void MetricProducer::activateLocked(int activationTrackerIndex, int64_t elapsedTimestampNs) {
+    auto it = mEventActivationMap.find(activationTrackerIndex);
+    if (it == mEventActivationMap.end()) {
+        return;
+    }
+    it->second.activation_ns = elapsedTimestampNs;
+    it->second.state = ActivationState::kActive;
+    mIsActive = true;
+}
+
 
 }  // namespace statsd
 }  // namespace os
diff --git a/cmds/statsd/src/metrics/MetricProducer.h b/cmds/statsd/src/metrics/MetricProducer.h
index 6fe4bfb..b21fd50 100644
--- a/cmds/statsd/src/metrics/MetricProducer.h
+++ b/cmds/statsd/src/metrics/MetricProducer.h
@@ -34,6 +34,17 @@
 namespace os {
 namespace statsd {
 
+// If the metric has no activation requirement, it will be active once the metric producer is
+// created.
+// If the metric needs to be activated by atoms, the metric producer will start
+// with kNotActive state, turn to kActive when the activation event arrives, become kNotActive
+// when it reaches the duration limit (timebomb). If the activation event arrives again before
+// or after it expires, the event producer will be re-activated and ttl will be reset.
+enum ActivationState {
+    kNotActive = 0,
+    kActive = 1,
+};
+
 // A MetricProducer is responsible for compute one single metrics, creating stats log report, and
 // writing the report to dropbox. MetricProducers should respond to package changes as required in
 // PackageInfoListener, but if none of the metrics are slicing by package name, then the update can
@@ -54,7 +65,8 @@
           mContainANYPositionInDimensionsInWhat(false),
           mSliceByPositionALL(false),
           mSameConditionDimensionsInTracker(false),
-          mHasLinksToAllConditionDimensionsInTracker(false) {
+          mHasLinksToAllConditionDimensionsInTracker(false),
+          mIsActive(true) {
     }
 
     virtual ~MetricProducer(){};
@@ -93,17 +105,23 @@
     // Consume the parsed stats log entry that already matched the "what" of the metric.
     void onMatchedLogEvent(const size_t matcherIndex, const LogEvent& event) {
         std::lock_guard<std::mutex> lock(mMutex);
-        onMatchedLogEventLocked(matcherIndex, event);
+        if (mIsActive) {
+            onMatchedLogEventLocked(matcherIndex, event);
+        }
     }
 
     void onConditionChanged(const bool condition, const int64_t eventTime) {
         std::lock_guard<std::mutex> lock(mMutex);
-        onConditionChangedLocked(condition, eventTime);
+        if (mIsActive) {
+            onConditionChangedLocked(condition, eventTime);
+        }
     }
 
     void onSlicedConditionMayChange(bool overallCondition, const int64_t eventTime) {
         std::lock_guard<std::mutex> lock(mMutex);
-        onSlicedConditionMayChangeLocked(overallCondition, eventTime);
+        if (mIsActive) {
+            onSlicedConditionMayChangeLocked(overallCondition, eventTime);
+        }
     }
 
     bool isConditionSliced() const {
@@ -177,6 +195,15 @@
         return mCurrentBucketNum;
     }
 
+    void activate(int activationTrackerIndex, int64_t elapsedTimestampNs) {
+        std::lock_guard<std::mutex> lock(mMutex);
+        activateLocked(activationTrackerIndex, elapsedTimestampNs);
+    }
+
+    void addActivation(int activationTrackerIndex, int64_t ttl_seconds);
+
+    void flushIfExpire(int64_t elapsedTimestampNs);
+
 protected:
     virtual void onConditionChangedLocked(const bool condition, const int64_t eventTime) = 0;
     virtual void onSlicedConditionMayChangeLocked(bool overallCondition,
@@ -189,6 +216,10 @@
     virtual size_t byteSizeLocked() const = 0;
     virtual void dumpStatesLocked(FILE* out, bool verbose) const = 0;
 
+    bool evaluateActiveStateLocked(int64_t elapsedTimestampNs);
+
+    void activateLocked(int activationTrackerIndex, int64_t elapsedTimestampNs);
+
     /**
      * Flushes the current bucket if the eventTime is after the current bucket's end time. This will
        also flush the current partial bucket in memory.
@@ -198,9 +229,9 @@
     /**
      * Flushes all the data including the current partial bucket.
      */
-    virtual void flushLocked(const int64_t& eventTime) {
-        flushIfNeededLocked(eventTime);
-        flushCurrentBucketLocked(eventTime);
+    virtual void flushLocked(const int64_t& eventTimeNs) {
+        flushIfNeededLocked(eventTimeNs);
+        flushCurrentBucketLocked(eventTimeNs);
     };
 
     /**
@@ -295,6 +326,21 @@
     virtual void onMatchedLogEventLocked(const size_t matcherIndex, const LogEvent& event);
 
     mutable std::mutex mMutex;
+
+    struct Activation {
+        Activation() : ttl_ns(0), activation_ns(0), state(ActivationState::kNotActive)  {}
+
+        int64_t ttl_ns;
+        int64_t activation_ns;
+        ActivationState state;
+    };
+    // When the metric producer has multiple activations, these activations are ORed to determine
+    // whether the metric producer is ready to generate metrics.
+    std::unordered_map<int, Activation> mEventActivationMap;
+
+    bool mIsActive;
+
+    FRIEND_TEST(MetricActivationE2eTest, TestCountMetric);
 };
 
 }  // namespace statsd
diff --git a/cmds/statsd/src/metrics/MetricsManager.cpp b/cmds/statsd/src/metrics/MetricsManager.cpp
index 0e5ef4d..f85ba1f 100644
--- a/cmds/statsd/src/metrics/MetricsManager.cpp
+++ b/cmds/statsd/src/metrics/MetricsManager.cpp
@@ -73,7 +73,8 @@
             key, config, *uidMap, pullerManager, anomalyAlarmMonitor, periodicAlarmMonitor,
             timeBaseNs, currentTimeNs, mTagIds, mAllAtomMatchers, mAllConditionTrackers,
             mAllMetricProducers, mAllAnomalyTrackers, mAllPeriodicAlarmTrackers,
-            mConditionToMetricMap, mTrackerToMetricMap, mTrackerToConditionMap, mNoReportMetricIds);
+            mConditionToMetricMap, mTrackerToMetricMap, mTrackerToConditionMap,
+            mActivationAtomTrackerToMetricMap, mMetricIndexesWithActivation, mNoReportMetricIds);
 
     mHashStringsInReport = config.hash_strings_in_metric_report();
 
@@ -298,7 +299,12 @@
     }
 
     int tagId = event.GetTagId();
-    int64_t eventTime = event.GetElapsedTimestampNs();
+    int64_t eventTimeNs = event.GetElapsedTimestampNs();
+
+    for (int metric : mMetricIndexesWithActivation) {
+        mAllMetricProducers[metric]->flushIfExpire(eventTimeNs);
+    }
+
     if (mTagIds.find(tagId) == mTagIds.end()) {
         // not interesting...
         return;
@@ -310,6 +316,14 @@
         matcher->onLogEvent(event, mAllAtomMatchers, matcherCache);
     }
 
+    for (const auto& it : mActivationAtomTrackerToMetricMap) {
+        if (matcherCache[it.first] == MatchingState::kMatched) {
+            for (int metricIndex : it.second) {
+                mAllMetricProducers[metricIndex]->activate(it.first, eventTimeNs);
+            }
+        }
+    }
+
     // A bitmap to see which ConditionTracker needs to be re-evaluated.
     vector<bool> conditionToBeEvaluated(mAllConditionTrackers.size(), false);
 
@@ -347,13 +361,13 @@
                 // Push the new condition to it directly.
                 if (!mAllMetricProducers[metricIndex]->isConditionSliced()) {
                     mAllMetricProducers[metricIndex]->onConditionChanged(conditionCache[i],
-                                                                         eventTime);
+                                                                         eventTimeNs);
                     // metric cares about sliced conditions, and it may have changed. Send
                     // notification, and the metric can query the sliced conditions that are
                     // interesting to it.
                 } else {
                     mAllMetricProducers[metricIndex]->onSlicedConditionMayChange(conditionCache[i],
-                                                                                 eventTime);
+                                                                                 eventTimeNs);
                 }
             }
         }
diff --git a/cmds/statsd/src/metrics/MetricsManager.h b/cmds/statsd/src/metrics/MetricsManager.h
index dfbb69f..649222ff 100644
--- a/cmds/statsd/src/metrics/MetricsManager.h
+++ b/cmds/statsd/src/metrics/MetricsManager.h
@@ -195,6 +195,11 @@
     // maps from ConditionTracker to MetricProducer
     std::unordered_map<int, std::vector<int>> mConditionToMetricMap;
 
+    // maps from life span triggering event to MetricProducers.
+    std::unordered_map<int, std::vector<int>> mActivationAtomTrackerToMetricMap;
+
+    std::vector<int> mMetricIndexesWithActivation;
+
     void initLogSourceWhiteList();
 
     // The metrics that don't need to be uploaded or even reported.
@@ -207,7 +212,7 @@
     FRIEND_TEST(GaugeMetricE2eTest, TestMultipleFieldsForPushedEvent);
     FRIEND_TEST(GaugeMetricE2eTest, TestRandomSamplePulledEvents);
     FRIEND_TEST(GaugeMetricE2eTest, TestRandomSamplePulledEvent_LateAlarm);
-    FRIEND_TEST(GaugeMetricE2eTest, TestAllConditionChangesSamplePulledEvents);
+    FRIEND_TEST(GaugeMetricE2eTest, TestConditionChangeToTrueSamplePulledEvents);
     FRIEND_TEST(ValueMetricE2eTest, TestPulledEvents);
     FRIEND_TEST(ValueMetricE2eTest, TestPulledEvents_LateAlarm);
     FRIEND_TEST(DimensionInConditionE2eTest, TestCreateCountMetric_NoLink_OR_CombinationCondition);
@@ -230,6 +235,7 @@
 
     FRIEND_TEST(AlarmE2eTest, TestMultipleAlarms);
     FRIEND_TEST(ConfigTtlE2eTest, TestCountMetric);
+    FRIEND_TEST(MetricActivationE2eTest, TestCountMetric);
 };
 
 }  // namespace statsd
diff --git a/cmds/statsd/src/metrics/metrics_manager_util.cpp b/cmds/statsd/src/metrics/metrics_manager_util.cpp
index 75d6df9..136ba07 100644
--- a/cmds/statsd/src/metrics/metrics_manager_util.cpp
+++ b/cmds/statsd/src/metrics/metrics_manager_util.cpp
@@ -25,6 +25,7 @@
 #include "../external/StatsPullerManager.h"
 #include "../matchers/CombinationLogMatchingTracker.h"
 #include "../matchers/SimpleLogMatchingTracker.h"
+#include "../matchers/EventMatcherWizard.h"
 #include "../metrics/CountMetricProducer.h"
 #include "../metrics/DurationMetricProducer.h"
 #include "../metrics/EventMetricProducer.h"
@@ -294,6 +295,7 @@
                  unordered_map<int, std::vector<int>>& trackerToMetricMap,
                  unordered_map<int64_t, int>& metricMap, std::set<int64_t>& noReportMetricIds) {
     sp<ConditionWizard> wizard = new ConditionWizard(allConditionTrackers);
+    sp<EventMatcherWizard> matcherWizard = new EventMatcherWizard(allAtomMatchers);
     const int allMetricsCount = config.count_metric_size() + config.duration_metric_size() +
                                 config.event_metric_size() + config.value_metric_size();
     allMetricProducers.reserve(allMetricsCount);
@@ -563,7 +565,8 @@
         }
 
         sp<MetricProducer> gaugeProducer = new GaugeMetricProducer(
-                key, metric, conditionIndex, wizard, pullTagId, triggerAtomId, atomTagId,
+                key, metric, conditionIndex, wizard,
+                trackerIndex, matcherWizard, pullTagId, triggerAtomId, atomTagId,
                 timeBaseTimeNs, currentTimeNs, pullerManager);
         allMetricProducers.push_back(gaugeProducer);
     }
@@ -682,6 +685,44 @@
     return true;
 }
 
+bool initMetricActivations(const ConfigKey& key, const StatsdConfig& config,
+                           const int64_t currentTimeNs,
+                           const unordered_map<int64_t, int> &logEventTrackerMap,
+                           const unordered_map<int64_t, int> &metricProducerMap,
+                           vector<sp<MetricProducer>>& allMetricProducers,
+                           unordered_map<int, std::vector<int>>& activationAtomTrackerToMetricMap,
+                           vector<int>& metricsWithActivation) {
+    for (int i = 0; i < config.metric_activation_size(); ++i) {
+        const MetricActivation& metric_activation = config.metric_activation(i);
+        auto itr = metricProducerMap.find(metric_activation.metric_id());
+        if (itr == metricProducerMap.end()) {
+            ALOGE("Metric id not found in metric activation: %lld",
+                (long long)metric_activation.metric_id());
+            return false;
+        }
+        const int metricTrackerIndex = itr->second;
+        if (metricTrackerIndex < 0 || metricTrackerIndex >= (int)allMetricProducers.size()) {
+            ALOGE("Invalid metric tracker index.");
+            return false;
+        }
+        metricsWithActivation.push_back(metricTrackerIndex);
+        for (int j = 0; j < metric_activation.event_activation_size(); ++j) {
+            const EventActivation& activation = metric_activation.event_activation(j);
+            auto logTrackerIt = logEventTrackerMap.find(activation.atom_matcher_id());
+            if (logTrackerIt == logEventTrackerMap.end()) {
+                ALOGE("Atom matcher not found for event activation.");
+                return false;
+            }
+            const int atomMatcherIndex = logTrackerIt->second;
+            activationAtomTrackerToMetricMap[atomMatcherIndex].push_back(
+                metricTrackerIndex);
+            allMetricProducers[metricTrackerIndex]->addActivation(
+                atomMatcherIndex, activation.ttl_seconds());
+        }
+    }
+    return true;
+}
+
 bool initStatsdConfig(const ConfigKey& key, const StatsdConfig& config, UidMap& uidMap,
                       const sp<StatsPullerManager>& pullerManager,
                       const sp<AlarmMonitor>& anomalyAlarmMonitor,
@@ -695,6 +736,8 @@
                       unordered_map<int, std::vector<int>>& conditionToMetricMap,
                       unordered_map<int, std::vector<int>>& trackerToMetricMap,
                       unordered_map<int, std::vector<int>>& trackerToConditionMap,
+                      unordered_map<int, std::vector<int>>& activationAtomTrackerToMetricMap,
+                      vector<int>& metricsWithActivation,
                       std::set<int64_t>& noReportMetricIds) {
     unordered_map<int64_t, int> logTrackerMap;
     unordered_map<int64_t, int> conditionTrackerMap;
@@ -729,6 +772,11 @@
         ALOGE("initAlarms failed");
         return false;
     }
+    if (!initMetricActivations(key, config, currentTimeNs, logTrackerMap, metricProducerMap,
+            allMetricProducers, activationAtomTrackerToMetricMap, metricsWithActivation)) {
+        ALOGE("initMetricActivations failed");
+        return false;
+    }
 
     return true;
 }
diff --git a/cmds/statsd/src/metrics/metrics_manager_util.h b/cmds/statsd/src/metrics/metrics_manager_util.h
index c660149..9ffceda 100644
--- a/cmds/statsd/src/metrics/metrics_manager_util.h
+++ b/cmds/statsd/src/metrics/metrics_manager_util.h
@@ -108,6 +108,8 @@
                       std::unordered_map<int, std::vector<int>>& conditionToMetricMap,
                       std::unordered_map<int, std::vector<int>>& trackerToMetricMap,
                       std::unordered_map<int, std::vector<int>>& trackerToConditionMap,
+                      unordered_map<int, std::vector<int>>& lifeSpanEventTrackerToMetricMap,
+                      vector<int>& metricsWithLifeSpan,
                       std::set<int64_t>& noReportMetricIds);
 
 bool isStateTracker(const SimplePredicate& simplePredicate, std::vector<Matcher>* primaryKeys);
diff --git a/cmds/statsd/src/statsd_config.proto b/cmds/statsd/src/statsd_config.proto
index d19e247..d5f81a59 100644
--- a/cmds/statsd/src/statsd_config.proto
+++ b/cmds/statsd/src/statsd_config.proto
@@ -347,6 +347,17 @@
   optional float probability_of_informing = 7 [default = 1.1];
 }
 
+message EventActivation {
+  optional int64 atom_matcher_id = 1;
+  optional int64 ttl_seconds = 2;
+}
+
+message MetricActivation {
+  optional int64 metric_id = 1;
+
+  repeated EventActivation event_activation = 2;
+}
+
 message StatsdConfig {
   optional int64 id = 1;
 
@@ -384,6 +395,8 @@
 
   optional bool hash_strings_in_metric_report = 16 [default = true];
 
+  repeated MetricActivation metric_activation = 17;
+
   // Field number 1000 is reserved for later use.
   reserved 1000;
 }
diff --git a/cmds/statsd/tests/MetricsManager_test.cpp b/cmds/statsd/tests/MetricsManager_test.cpp
index 8fbb58a..f8184d8 100644
--- a/cmds/statsd/tests/MetricsManager_test.cpp
+++ b/cmds/statsd/tests/MetricsManager_test.cpp
@@ -282,13 +282,17 @@
     unordered_map<int, std::vector<int>> conditionToMetricMap;
     unordered_map<int, std::vector<int>> trackerToMetricMap;
     unordered_map<int, std::vector<int>> trackerToConditionMap;
+    unordered_map<int, std::vector<int>> lifeSpanEventTrackerToMetricMap;
+    vector<int> metricsWithLifeSpan;
     std::set<int64_t> noReportMetricIds;
 
     EXPECT_TRUE(initStatsdConfig(kConfigKey, config, uidMap, pullerManager, anomalyAlarmMonitor,
                                  periodicAlarmMonitor, timeBaseSec, timeBaseSec, allTagIds,
                                  allAtomMatchers, allConditionTrackers, allMetricProducers,
                                  allAnomalyTrackers, allAlarmTrackers, conditionToMetricMap,
-                                 trackerToMetricMap, trackerToConditionMap, noReportMetricIds));
+                                 trackerToMetricMap, trackerToConditionMap,
+                                 lifeSpanEventTrackerToMetricMap, metricsWithLifeSpan,
+                                 noReportMetricIds));
     EXPECT_EQ(1u, allMetricProducers.size());
     EXPECT_EQ(1u, allAnomalyTrackers.size());
     EXPECT_EQ(1u, noReportMetricIds.size());
@@ -309,13 +313,17 @@
     unordered_map<int, std::vector<int>> conditionToMetricMap;
     unordered_map<int, std::vector<int>> trackerToMetricMap;
     unordered_map<int, std::vector<int>> trackerToConditionMap;
+    unordered_map<int, std::vector<int>> lifeSpanEventTrackerToMetricMap;
+    vector<int> metricsWithLifeSpan;
     std::set<int64_t> noReportMetricIds;
 
     EXPECT_FALSE(initStatsdConfig(kConfigKey, config, uidMap, pullerManager, anomalyAlarmMonitor,
                                   periodicAlarmMonitor, timeBaseSec, timeBaseSec, allTagIds,
                                   allAtomMatchers, allConditionTrackers, allMetricProducers,
                                   allAnomalyTrackers, allAlarmTrackers, conditionToMetricMap,
-                                  trackerToMetricMap, trackerToConditionMap, noReportMetricIds));
+                                  trackerToMetricMap, trackerToConditionMap,
+                                  lifeSpanEventTrackerToMetricMap, metricsWithLifeSpan,
+                                  noReportMetricIds));
 }
 
 TEST(MetricsManagerTest, TestCircleLogMatcherDependency) {
@@ -333,13 +341,17 @@
     unordered_map<int, std::vector<int>> conditionToMetricMap;
     unordered_map<int, std::vector<int>> trackerToMetricMap;
     unordered_map<int, std::vector<int>> trackerToConditionMap;
+    unordered_map<int, std::vector<int>> lifeSpanEventTrackerToMetricMap;
+    vector<int> metricsWithLifeSpan;
     std::set<int64_t> noReportMetricIds;
 
     EXPECT_FALSE(initStatsdConfig(kConfigKey, config, uidMap, pullerManager, anomalyAlarmMonitor,
                                   periodicAlarmMonitor, timeBaseSec, timeBaseSec, allTagIds,
                                   allAtomMatchers, allConditionTrackers, allMetricProducers,
                                   allAnomalyTrackers, allAlarmTrackers, conditionToMetricMap,
-                                  trackerToMetricMap, trackerToConditionMap, noReportMetricIds));
+                                  trackerToMetricMap, trackerToConditionMap,
+                                  lifeSpanEventTrackerToMetricMap, metricsWithLifeSpan,
+                                  noReportMetricIds));
 }
 
 TEST(MetricsManagerTest, TestMissingMatchers) {
@@ -357,12 +369,16 @@
     unordered_map<int, std::vector<int>> conditionToMetricMap;
     unordered_map<int, std::vector<int>> trackerToMetricMap;
     unordered_map<int, std::vector<int>> trackerToConditionMap;
+    unordered_map<int, std::vector<int>> lifeSpanEventTrackerToMetricMap;
+    vector<int> metricsWithLifeSpan;
     std::set<int64_t> noReportMetricIds;
     EXPECT_FALSE(initStatsdConfig(kConfigKey, config, uidMap, pullerManager, anomalyAlarmMonitor,
                                   periodicAlarmMonitor, timeBaseSec, timeBaseSec, allTagIds,
                                   allAtomMatchers, allConditionTrackers, allMetricProducers,
                                   allAnomalyTrackers, allAlarmTrackers, conditionToMetricMap,
-                                  trackerToMetricMap, trackerToConditionMap, noReportMetricIds));
+                                  trackerToMetricMap, trackerToConditionMap,
+                                  lifeSpanEventTrackerToMetricMap, metricsWithLifeSpan,
+                                  noReportMetricIds));
 }
 
 TEST(MetricsManagerTest, TestMissingPredicate) {
@@ -380,12 +396,16 @@
     unordered_map<int, std::vector<int>> conditionToMetricMap;
     unordered_map<int, std::vector<int>> trackerToMetricMap;
     unordered_map<int, std::vector<int>> trackerToConditionMap;
+    unordered_map<int, std::vector<int>> lifeSpanEventTrackerToMetricMap;
+    vector<int> metricsWithLifeSpan;
     std::set<int64_t> noReportMetricIds;
     EXPECT_FALSE(initStatsdConfig(kConfigKey, config, uidMap, pullerManager, anomalyAlarmMonitor,
                                   periodicAlarmMonitor, timeBaseSec, timeBaseSec, allTagIds,
                                   allAtomMatchers, allConditionTrackers, allMetricProducers,
                                   allAnomalyTrackers, allAlarmTrackers, conditionToMetricMap,
-                                  trackerToMetricMap, trackerToConditionMap, noReportMetricIds));
+                                  trackerToMetricMap, trackerToConditionMap,
+                                  lifeSpanEventTrackerToMetricMap, metricsWithLifeSpan,
+                                  noReportMetricIds));
 }
 
 TEST(MetricsManagerTest, TestCirclePredicateDependency) {
@@ -403,13 +423,17 @@
     unordered_map<int, std::vector<int>> conditionToMetricMap;
     unordered_map<int, std::vector<int>> trackerToMetricMap;
     unordered_map<int, std::vector<int>> trackerToConditionMap;
+    unordered_map<int, std::vector<int>> lifeSpanEventTrackerToMetricMap;
+    vector<int> metricsWithLifeSpan;
     std::set<int64_t> noReportMetricIds;
 
     EXPECT_FALSE(initStatsdConfig(kConfigKey, config, uidMap, pullerManager, anomalyAlarmMonitor,
                                   periodicAlarmMonitor, timeBaseSec, timeBaseSec, allTagIds,
                                   allAtomMatchers, allConditionTrackers, allMetricProducers,
                                   allAnomalyTrackers, allAlarmTrackers, conditionToMetricMap,
-                                  trackerToMetricMap, trackerToConditionMap, noReportMetricIds));
+                                  trackerToMetricMap, trackerToConditionMap,
+                                  lifeSpanEventTrackerToMetricMap, metricsWithLifeSpan,
+                                  noReportMetricIds));
 }
 
 TEST(MetricsManagerTest, testAlertWithUnknownMetric) {
@@ -427,13 +451,17 @@
     unordered_map<int, std::vector<int>> conditionToMetricMap;
     unordered_map<int, std::vector<int>> trackerToMetricMap;
     unordered_map<int, std::vector<int>> trackerToConditionMap;
+    unordered_map<int, std::vector<int>> lifeSpanEventTrackerToMetricMap;
+    vector<int> metricsWithLifeSpan;
     std::set<int64_t> noReportMetricIds;
 
     EXPECT_FALSE(initStatsdConfig(kConfigKey, config, uidMap, pullerManager, anomalyAlarmMonitor,
                                   periodicAlarmMonitor, timeBaseSec, timeBaseSec, allTagIds,
                                   allAtomMatchers, allConditionTrackers, allMetricProducers,
                                   allAnomalyTrackers, allAlarmTrackers, conditionToMetricMap,
-                                  trackerToMetricMap, trackerToConditionMap, noReportMetricIds));
+                                  trackerToMetricMap, trackerToConditionMap,
+                                  lifeSpanEventTrackerToMetricMap, metricsWithLifeSpan,
+                                  noReportMetricIds));
 }
 
 #else
diff --git a/cmds/statsd/tests/e2e/GaugeMetric_e2e_pull_test.cpp b/cmds/statsd/tests/e2e/GaugeMetric_e2e_pull_test.cpp
index 5729feb..d7b9c11 100644
--- a/cmds/statsd/tests/e2e/GaugeMetric_e2e_pull_test.cpp
+++ b/cmds/statsd/tests/e2e/GaugeMetric_e2e_pull_test.cpp
@@ -200,8 +200,8 @@
     EXPECT_GT(data.bucket_info(5).atom(0).temperature().temperature_deci_celsius(), 0);
 }
 
-TEST(GaugeMetricE2eTest, TestAllConditionChangesSamplePulledEvents) {
-    auto config = CreateStatsdConfig(GaugeMetric::ALL_CONDITION_CHANGES);
+TEST(GaugeMetricE2eTest, TestConditionChangeToTrueSamplePulledEvents) {
+    auto config = CreateStatsdConfig(GaugeMetric::CONDITION_CHANGE_TO_TRUE);
     int64_t baseTimeNs = 10 * NS_PER_SEC;
     int64_t configAddedTimeNs = 10 * 60 * NS_PER_SEC + baseTimeNs;
     int64_t bucketSizeNs =
diff --git a/cmds/statsd/tests/e2e/MetricActivation_e2e_test.cpp b/cmds/statsd/tests/e2e/MetricActivation_e2e_test.cpp
new file mode 100644
index 0000000..0f13a4a
--- /dev/null
+++ b/cmds/statsd/tests/e2e/MetricActivation_e2e_test.cpp
@@ -0,0 +1,242 @@
+// Copyright (C) 2018 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <gtest/gtest.h>
+
+#include "src/StatsLogProcessor.h"
+#include "src/stats_log_util.h"
+#include "tests/statsd_test_util.h"
+
+#include <vector>
+
+namespace android {
+namespace os {
+namespace statsd {
+
+#ifdef __ANDROID__
+
+namespace {
+
+StatsdConfig CreateStatsdConfig() {
+    StatsdConfig config;
+    config.add_allowed_log_source("AID_ROOT"); // LogEvent defaults to UID of root.
+    auto crashMatcher = CreateProcessCrashAtomMatcher();
+    auto screenOnMatcher = CreateScreenTurnedOnAtomMatcher();
+    auto saverModeMatcher = CreateBatterySaverModeStartAtomMatcher();
+
+    *config.add_atom_matcher() = saverModeMatcher;
+    *config.add_atom_matcher() = crashMatcher;
+    *config.add_atom_matcher() = screenOnMatcher;
+
+    int64_t metricId = 123456;
+    auto countMetric = config.add_count_metric();
+    countMetric->set_id(metricId);
+    countMetric->set_what(crashMatcher.id());
+    countMetric->set_bucket(FIVE_MINUTES);
+    countMetric->mutable_dimensions_in_what()->set_field(
+        android::util::PROCESS_LIFE_CYCLE_STATE_CHANGED);
+    countMetric->mutable_dimensions_in_what()->add_child()->set_field(1);  // uid field
+
+    auto metric_activation1 = config.add_metric_activation();
+    metric_activation1->set_metric_id(metricId);
+    auto event_activation1 = metric_activation1->add_event_activation();
+    event_activation1->set_atom_matcher_id(saverModeMatcher.id());
+    event_activation1->set_ttl_seconds(60 * 6);  // 6 minutes
+    auto event_activation2 = metric_activation1->add_event_activation();
+    event_activation2->set_atom_matcher_id(screenOnMatcher.id());
+    event_activation2->set_ttl_seconds(60 * 2);  // 2 minutes
+
+    return config;
+}
+
+}  // namespace
+
+TEST(MetricActivationE2eTest, TestCountMetric) {
+    auto config = CreateStatsdConfig();
+
+    int64_t bucketStartTimeNs = 10000000000;
+    int64_t bucketSizeNs =
+        TimeUnitToBucketSizeInMillis(config.count_metric(0).bucket()) * 1000000;
+
+    ConfigKey cfgKey;
+    auto processor = CreateStatsLogProcessor(bucketStartTimeNs, bucketStartTimeNs, config, cfgKey);
+    EXPECT_EQ(processor->mMetricsManagers.size(), 1u);
+    EXPECT_TRUE(processor->mMetricsManagers.begin()->second->isConfigValid());
+    sp<MetricProducer> metricProducer =
+        processor->mMetricsManagers.begin()->second->mAllMetricProducers[0];
+    auto& eventActivationMap = metricProducer->mEventActivationMap;
+
+    EXPECT_FALSE(metricProducer->mIsActive);
+    // Two activations: one is triggered by battery saver mode (tracker index 0), the other is
+    // triggered by screen on event (tracker index 2).
+    EXPECT_EQ(eventActivationMap.size(), 2u);
+    EXPECT_TRUE(eventActivationMap.find(0) != eventActivationMap.end());
+    EXPECT_TRUE(eventActivationMap.find(2) != eventActivationMap.end());
+    EXPECT_EQ(eventActivationMap[0].state, ActivationState::kNotActive);
+    EXPECT_EQ(eventActivationMap[0].activation_ns, 0);
+    EXPECT_EQ(eventActivationMap[0].ttl_ns, 60 * 6 * NS_PER_SEC);
+    EXPECT_EQ(eventActivationMap[2].state, ActivationState::kNotActive);
+    EXPECT_EQ(eventActivationMap[2].activation_ns, 0);
+    EXPECT_EQ(eventActivationMap[2].ttl_ns, 60 * 2 * NS_PER_SEC);
+
+    std::unique_ptr<LogEvent> event;
+
+    event = CreateAppCrashEvent(111, bucketStartTimeNs + 5);
+    processor->OnLogEvent(event.get());
+    EXPECT_FALSE(metricProducer->mIsActive);
+
+    // Activated by battery save mode.
+    event = CreateBatterySaverOnEvent(bucketStartTimeNs + 10);
+    processor->OnLogEvent(event.get());
+    EXPECT_TRUE(metricProducer->mIsActive);
+    EXPECT_EQ(eventActivationMap[0].state, ActivationState::kActive);
+    EXPECT_EQ(eventActivationMap[0].activation_ns, bucketStartTimeNs + 10);
+    EXPECT_EQ(eventActivationMap[0].ttl_ns, 60 * 6 * NS_PER_SEC);
+    EXPECT_EQ(eventActivationMap[2].state, ActivationState::kNotActive);
+    EXPECT_EQ(eventActivationMap[2].activation_ns, 0);
+    EXPECT_EQ(eventActivationMap[2].ttl_ns, 60 * 2 * NS_PER_SEC);
+
+    // First processed event.
+    event = CreateAppCrashEvent(222, bucketStartTimeNs + 15);
+    processor->OnLogEvent(event.get());
+
+    // Activated by screen on event.
+    event = CreateScreenStateChangedEvent(android::view::DISPLAY_STATE_ON,
+                                          bucketStartTimeNs + 20);
+    processor->OnLogEvent(event.get());
+    EXPECT_TRUE(metricProducer->mIsActive);
+    EXPECT_EQ(eventActivationMap[0].state, ActivationState::kActive);
+    EXPECT_EQ(eventActivationMap[0].activation_ns, bucketStartTimeNs + 10);
+    EXPECT_EQ(eventActivationMap[0].ttl_ns, 60 * 6 * NS_PER_SEC);
+    EXPECT_EQ(eventActivationMap[2].state, ActivationState::kActive);
+    EXPECT_EQ(eventActivationMap[2].activation_ns, bucketStartTimeNs + 20);
+    EXPECT_EQ(eventActivationMap[2].ttl_ns, 60 * 2 * NS_PER_SEC);
+
+    // 2nd processed event.
+    // The activation by screen_on event expires, but the one by battery save mode is still active.
+    event = CreateAppCrashEvent(333, bucketStartTimeNs + NS_PER_SEC * 60 * 2 + 25);
+    processor->OnLogEvent(event.get());
+    EXPECT_TRUE(metricProducer->mIsActive);
+    EXPECT_EQ(eventActivationMap[0].state, ActivationState::kActive);
+    EXPECT_EQ(eventActivationMap[0].activation_ns, bucketStartTimeNs + 10);
+    EXPECT_EQ(eventActivationMap[0].ttl_ns, 60 * 6 * NS_PER_SEC);
+    EXPECT_EQ(eventActivationMap[2].state, ActivationState::kNotActive);
+    EXPECT_EQ(eventActivationMap[2].activation_ns, bucketStartTimeNs + 20);
+    EXPECT_EQ(eventActivationMap[2].ttl_ns, 60 * 2 * NS_PER_SEC);
+
+    // 3rd processed event.
+    event = CreateAppCrashEvent(444, bucketStartTimeNs + NS_PER_SEC * 60 * 5 + 25);
+    processor->OnLogEvent(event.get());
+
+    // All activations expired.
+    event = CreateAppCrashEvent(555, bucketStartTimeNs + NS_PER_SEC * 60 * 8);
+    processor->OnLogEvent(event.get());
+    EXPECT_FALSE(metricProducer->mIsActive);
+    EXPECT_EQ(eventActivationMap[0].state, ActivationState::kNotActive);
+    EXPECT_EQ(eventActivationMap[0].activation_ns, bucketStartTimeNs + 10);
+    EXPECT_EQ(eventActivationMap[0].ttl_ns, 60 * 6 * NS_PER_SEC);
+    EXPECT_EQ(eventActivationMap[2].state, ActivationState::kNotActive);
+    EXPECT_EQ(eventActivationMap[2].activation_ns, bucketStartTimeNs + 20);
+    EXPECT_EQ(eventActivationMap[2].ttl_ns, 60 * 2 * NS_PER_SEC);
+
+    // Re-activate.
+    event = CreateScreenStateChangedEvent(android::view::DISPLAY_STATE_ON,
+                                          bucketStartTimeNs + NS_PER_SEC * 60 * 10 + 10);
+    processor->OnLogEvent(event.get());
+    EXPECT_TRUE(metricProducer->mIsActive);
+    EXPECT_EQ(eventActivationMap[0].state, ActivationState::kNotActive);
+    EXPECT_EQ(eventActivationMap[0].activation_ns, bucketStartTimeNs + 10);
+    EXPECT_EQ(eventActivationMap[0].ttl_ns, 60 * 6 * NS_PER_SEC);
+    EXPECT_EQ(eventActivationMap[2].state, ActivationState::kActive);
+    EXPECT_EQ(eventActivationMap[2].activation_ns, bucketStartTimeNs + NS_PER_SEC * 60 * 10 + 10);
+    EXPECT_EQ(eventActivationMap[2].ttl_ns, 60 * 2 * NS_PER_SEC);
+
+    event = CreateAppCrashEvent(666, bucketStartTimeNs + NS_PER_SEC * 60 * 11 + 1);
+    processor->OnLogEvent(event.get());
+
+    ConfigMetricsReportList reports;
+    vector<uint8_t> buffer;
+    processor->onDumpReport(cfgKey, bucketStartTimeNs + NS_PER_SEC * 60 * 15 + 1, false, ADB_DUMP,
+                            &buffer);
+    EXPECT_TRUE(buffer.size() > 0);
+    EXPECT_TRUE(reports.ParseFromArray(&buffer[0], buffer.size()));
+    backfillDimensionPath(&reports);
+    backfillStartEndTimestamp(&reports);
+    EXPECT_EQ(1, reports.reports_size());
+    EXPECT_EQ(1, reports.reports(0).metrics_size());
+    EXPECT_EQ(4, reports.reports(0).metrics(0).count_metrics().data_size());
+
+    StatsLogReport::CountMetricDataWrapper countMetrics;
+    sortMetricDataByDimensionsValue(
+            reports.reports(0).metrics(0).count_metrics(), &countMetrics);
+    EXPECT_EQ(4, countMetrics.data_size());
+
+    auto data = countMetrics.data(0);
+    EXPECT_EQ(android::util::PROCESS_LIFE_CYCLE_STATE_CHANGED, data.dimensions_in_what().field());
+    EXPECT_EQ(1, data.dimensions_in_what().value_tuple().dimensions_value_size());
+    EXPECT_EQ(1 /* uid field */,
+              data.dimensions_in_what().value_tuple().dimensions_value(0).field());
+    EXPECT_EQ(222, data.dimensions_in_what().value_tuple().dimensions_value(0).value_int());
+    EXPECT_EQ(1, data.bucket_info_size());
+    EXPECT_EQ(1, data.bucket_info(0).count());
+    EXPECT_EQ(bucketStartTimeNs, data.bucket_info(0).start_bucket_elapsed_nanos());
+    EXPECT_EQ(bucketStartTimeNs + bucketSizeNs, data.bucket_info(0).end_bucket_elapsed_nanos());
+
+    data = countMetrics.data(1);
+    EXPECT_EQ(android::util::PROCESS_LIFE_CYCLE_STATE_CHANGED, data.dimensions_in_what().field());
+    EXPECT_EQ(1, data.dimensions_in_what().value_tuple().dimensions_value_size());
+    EXPECT_EQ(1 /* uid field */,
+              data.dimensions_in_what().value_tuple().dimensions_value(0).field());
+    EXPECT_EQ(333, data.dimensions_in_what().value_tuple().dimensions_value(0).value_int());
+    EXPECT_EQ(1, data.bucket_info_size());
+    EXPECT_EQ(1, data.bucket_info(0).count());
+    EXPECT_EQ(bucketStartTimeNs, data.bucket_info(0).start_bucket_elapsed_nanos());
+    EXPECT_EQ(bucketStartTimeNs + bucketSizeNs, data.bucket_info(0).end_bucket_elapsed_nanos());
+
+    data = countMetrics.data(2);
+    EXPECT_EQ(android::util::PROCESS_LIFE_CYCLE_STATE_CHANGED, data.dimensions_in_what().field());
+    EXPECT_EQ(1, data.dimensions_in_what().value_tuple().dimensions_value_size());
+    EXPECT_EQ(1 /* uid field */,
+              data.dimensions_in_what().value_tuple().dimensions_value(0).field());
+    EXPECT_EQ(444, data.dimensions_in_what().value_tuple().dimensions_value(0).value_int());
+    EXPECT_EQ(1, data.bucket_info_size());
+    EXPECT_EQ(1, data.bucket_info(0).count());
+    // Partial bucket as metric is deactivated.
+    EXPECT_EQ(bucketStartTimeNs + bucketSizeNs, data.bucket_info(0).start_bucket_elapsed_nanos());
+    EXPECT_EQ(bucketStartTimeNs + NS_PER_SEC * 60 * 8,
+              data.bucket_info(0).end_bucket_elapsed_nanos());
+
+    data = countMetrics.data(3);
+    EXPECT_EQ(android::util::PROCESS_LIFE_CYCLE_STATE_CHANGED, data.dimensions_in_what().field());
+    EXPECT_EQ(1, data.dimensions_in_what().value_tuple().dimensions_value_size());
+    EXPECT_EQ(1 /* uid field */,
+              data.dimensions_in_what().value_tuple().dimensions_value(0).field());
+    EXPECT_EQ(666, data.dimensions_in_what().value_tuple().dimensions_value(0).value_int());
+    EXPECT_EQ(1, data.bucket_info_size());
+    EXPECT_EQ(1, data.bucket_info(0).count());
+    EXPECT_EQ(bucketStartTimeNs + 2 * bucketSizeNs,
+              data.bucket_info(0).start_bucket_elapsed_nanos());
+    EXPECT_EQ(bucketStartTimeNs + 3 * bucketSizeNs,
+              data.bucket_info(0).end_bucket_elapsed_nanos());
+
+}
+
+
+#else
+GTEST_LOG_(INFO) << "This test does nothing.\n";
+#endif
+
+}  // namespace statsd
+}  // namespace os
+}  // namespace android
diff --git a/cmds/statsd/tests/metrics/GaugeMetricProducer_test.cpp b/cmds/statsd/tests/metrics/GaugeMetricProducer_test.cpp
index bf58b9c..60bd4a7 100644
--- a/cmds/statsd/tests/metrics/GaugeMetricProducer_test.cpp
+++ b/cmds/statsd/tests/metrics/GaugeMetricProducer_test.cpp
@@ -12,6 +12,7 @@
 // See the License for the specific language governing permissions and
 // limitations under the License.
 
+#include "src/matchers/SimpleLogMatchingTracker.h"
 #include "src/metrics/GaugeMetricProducer.h"
 #include "src/stats_log_util.h"
 #include "logd/LogEvent.h"
@@ -40,6 +41,8 @@
 const ConfigKey kConfigKey(0, 12345);
 const int tagId = 1;
 const int64_t metricId = 123;
+const int64_t atomMatcherId = 678;
+const int logEventMatcherIndex = 0;
 const int64_t bucketStartTimeNs = 10 * NS_PER_SEC;
 const int64_t bucketSizeNs = TimeUnitToBucketSizeInMillis(ONE_MINUTE) * 1000000LL;
 const int64_t bucket2StartTimeNs = bucketStartTimeNs + bucketSizeNs;
@@ -61,11 +64,19 @@
     gaugeFieldMatcher->add_child()->set_field(3);
 
     sp<MockConditionWizard> wizard = new NaggyMock<MockConditionWizard>();
+
+    UidMap uidMap;
+    SimpleAtomMatcher atomMatcher;
+    atomMatcher.set_atom_id(tagId);
+    sp<EventMatcherWizard> eventMatcherWizard = new EventMatcherWizard({
+        new SimpleLogMatchingTracker(atomMatcherId, logEventMatcherIndex, atomMatcher, uidMap)});
+
     sp<MockStatsPullerManager> pullerManager = new StrictMock<MockStatsPullerManager>();
 
     // statsd started long ago.
     // The metric starts in the middle of the bucket
     GaugeMetricProducer gaugeProducer(kConfigKey, metric, -1 /*-1 meaning no condition*/, wizard,
+                                      logEventMatcherIndex, eventMatcherWizard,
                                       -1, -1, tagId, 5, 600 * NS_PER_SEC + NS_PER_SEC / 2,
                                       pullerManager);
 
@@ -86,6 +97,12 @@
 
     sp<MockConditionWizard> wizard = new NaggyMock<MockConditionWizard>();
 
+    UidMap uidMap;
+    SimpleAtomMatcher atomMatcher;
+    atomMatcher.set_atom_id(tagId);
+    sp<EventMatcherWizard> eventMatcherWizard = new EventMatcherWizard({
+        new SimpleLogMatchingTracker(atomMatcherId, logEventMatcherIndex, atomMatcher, uidMap)});
+
     sp<MockStatsPullerManager> pullerManager = new StrictMock<MockStatsPullerManager>();
     EXPECT_CALL(*pullerManager, RegisterReceiver(tagId, _, _, _)).WillOnce(Return());
     EXPECT_CALL(*pullerManager, UnRegisterReceiver(tagId, _)).WillOnce(Return());
@@ -103,6 +120,7 @@
             }));
 
     GaugeMetricProducer gaugeProducer(kConfigKey, metric, -1 /*-1 meaning no condition*/, wizard,
+                                      logEventMatcherIndex, eventMatcherWizard,
                                       tagId, -1, tagId, bucketStartTimeNs, bucketStartTimeNs,
                                       pullerManager);
 
@@ -178,7 +196,15 @@
     alert.set_num_buckets(100);
     sp<MockConditionWizard> wizard = new NaggyMock<MockConditionWizard>();
     sp<MockStatsPullerManager> pullerManager = new StrictMock<MockStatsPullerManager>();
+
+    UidMap uidMap;
+    SimpleAtomMatcher atomMatcher;
+    atomMatcher.set_atom_id(tagId);
+    sp<EventMatcherWizard> eventMatcherWizard = new EventMatcherWizard({
+        new SimpleLogMatchingTracker(atomMatcherId, logEventMatcherIndex, atomMatcher, uidMap)});
+
     GaugeMetricProducer gaugeProducer(kConfigKey, metric, -1 /*-1 meaning no condition*/, wizard,
+                                      logEventMatcherIndex, eventMatcherWizard,
                                       -1 /* -1 means no pulling */, -1, tagId, bucketStartTimeNs,
                                       bucketStartTimeNs, pullerManager);
 
@@ -246,6 +272,12 @@
 
     sp<MockConditionWizard> wizard = new NaggyMock<MockConditionWizard>();
 
+    UidMap uidMap;
+    SimpleAtomMatcher atomMatcher;
+    atomMatcher.set_atom_id(tagId);
+    sp<EventMatcherWizard> eventMatcherWizard = new EventMatcherWizard({
+        new SimpleLogMatchingTracker(atomMatcherId, logEventMatcherIndex, atomMatcher, uidMap)});
+
     sp<MockStatsPullerManager> pullerManager = new StrictMock<MockStatsPullerManager>();
     EXPECT_CALL(*pullerManager, RegisterReceiver(tagId, _, _, _)).WillOnce(Return());
     EXPECT_CALL(*pullerManager, UnRegisterReceiver(tagId, _)).WillOnce(Return());
@@ -263,6 +295,7 @@
             }));
 
     GaugeMetricProducer gaugeProducer(kConfigKey, metric, -1 /*-1 meaning no condition*/, wizard,
+                                      logEventMatcherIndex, eventMatcherWizard,
                                       tagId, -1, tagId, bucketStartTimeNs, bucketStartTimeNs,
                                       pullerManager);
 
@@ -315,6 +348,12 @@
 
     sp<MockConditionWizard> wizard = new NaggyMock<MockConditionWizard>();
 
+    UidMap uidMap;
+    SimpleAtomMatcher atomMatcher;
+    atomMatcher.set_atom_id(tagId);
+    sp<EventMatcherWizard> eventMatcherWizard = new EventMatcherWizard({
+        new SimpleLogMatchingTracker(atomMatcherId, logEventMatcherIndex, atomMatcher, uidMap)});
+
     sp<MockStatsPullerManager> pullerManager = new StrictMock<MockStatsPullerManager>();
     EXPECT_CALL(*pullerManager, RegisterReceiver(tagId, _, _, _)).WillOnce(Return());
     EXPECT_CALL(*pullerManager, UnRegisterReceiver(tagId, _)).WillOnce(Return());
@@ -330,7 +369,8 @@
                 return true;
             }));
 
-    GaugeMetricProducer gaugeProducer(kConfigKey, metric, 1, wizard, tagId, -1, tagId,
+    GaugeMetricProducer gaugeProducer(kConfigKey, metric, 1, wizard,
+                                      logEventMatcherIndex, eventMatcherWizard, tagId, -1, tagId,
                                       bucketStartTimeNs, bucketStartTimeNs, pullerManager);
 
     gaugeProducer.onConditionChanged(true, bucketStartTimeNs + 8);
@@ -388,6 +428,12 @@
     dim->set_field(conditionTag);
     dim->add_child()->set_field(1);
 
+    UidMap uidMap;
+    SimpleAtomMatcher atomMatcher;
+    atomMatcher.set_atom_id(tagId);
+    sp<EventMatcherWizard> eventMatcherWizard = new EventMatcherWizard({
+        new SimpleLogMatchingTracker(atomMatcherId, logEventMatcherIndex, atomMatcher, uidMap)});
+
     sp<MockConditionWizard> wizard = new NaggyMock<MockConditionWizard>();
     EXPECT_CALL(*wizard, query(_, _, _, _, _, _))
             .WillRepeatedly(
@@ -420,7 +466,8 @@
                 return true;
             }));
 
-    GaugeMetricProducer gaugeProducer(kConfigKey, metric, 1, wizard, tagId, -1, tagId,
+    GaugeMetricProducer gaugeProducer(kConfigKey, metric, 1, wizard,
+                                      logEventMatcherIndex, eventMatcherWizard, tagId, -1, tagId,
                                       bucketStartTimeNs, bucketStartTimeNs, pullerManager);
 
     gaugeProducer.onSlicedConditionMayChange(true, bucketStartTimeNs + 8);
@@ -463,7 +510,15 @@
     auto gaugeFieldMatcher = metric.mutable_gauge_fields_filter()->mutable_fields();
     gaugeFieldMatcher->set_field(tagId);
     gaugeFieldMatcher->add_child()->set_field(2);
+
+    UidMap uidMap;
+    SimpleAtomMatcher atomMatcher;
+    atomMatcher.set_atom_id(tagId);
+    sp<EventMatcherWizard> eventMatcherWizard = new EventMatcherWizard({
+        new SimpleLogMatchingTracker(atomMatcherId, logEventMatcherIndex, atomMatcher, uidMap)});
+
     GaugeMetricProducer gaugeProducer(kConfigKey, metric, -1 /*-1 meaning no condition*/, wizard,
+                                      logEventMatcherIndex, eventMatcherWizard,
                                       tagId, -1, tagId, bucketStartTimeNs, bucketStartTimeNs,
                                       pullerManager);
 
@@ -542,6 +597,12 @@
 
     sp<MockConditionWizard> wizard = new NaggyMock<MockConditionWizard>();
 
+    UidMap uidMap;
+    SimpleAtomMatcher atomMatcher;
+    atomMatcher.set_atom_id(tagId);
+    sp<EventMatcherWizard> eventMatcherWizard = new EventMatcherWizard({
+        new SimpleLogMatchingTracker(atomMatcherId, logEventMatcherIndex, atomMatcher, uidMap)});
+
     sp<MockStatsPullerManager> pullerManager = new StrictMock<MockStatsPullerManager>();
     EXPECT_CALL(*pullerManager, Pull(tagId, _, _))
             .WillOnce(Invoke([](int tagId, int64_t timeNs,
@@ -574,6 +635,7 @@
 
     int triggerId = 5;
     GaugeMetricProducer gaugeProducer(kConfigKey, metric, -1 /*-1 meaning no condition*/, wizard,
+                                      logEventMatcherIndex, eventMatcherWizard,
                                       tagId, triggerId, tagId, bucketStartTimeNs, bucketStartTimeNs,
                                       pullerManager);
 
@@ -632,6 +694,12 @@
 
     sp<MockConditionWizard> wizard = new NaggyMock<MockConditionWizard>();
 
+    UidMap uidMap;
+    SimpleAtomMatcher atomMatcher;
+    atomMatcher.set_atom_id(tagId);
+    sp<EventMatcherWizard> eventMatcherWizard = new EventMatcherWizard({
+        new SimpleLogMatchingTracker(atomMatcherId, logEventMatcherIndex, atomMatcher, uidMap)});
+
     sp<MockStatsPullerManager> pullerManager = new StrictMock<MockStatsPullerManager>();
     EXPECT_CALL(*pullerManager, Pull(tagId, _, _))
             .WillOnce(Invoke([](int tagId, int64_t timeNs,
@@ -667,6 +735,7 @@
 
     int triggerId = 5;
     GaugeMetricProducer gaugeProducer(kConfigKey, metric, -1 /*-1 meaning no condition*/, wizard,
+                                      logEventMatcherIndex, eventMatcherWizard,
                                       tagId, triggerId, tagId, bucketStartTimeNs, bucketStartTimeNs,
                                       pullerManager);
 
diff --git a/config/hiddenapi-light-greylist.txt b/config/hiddenapi-light-greylist.txt
index 857c390..bbc3f35 100644
--- a/config/hiddenapi-light-greylist.txt
+++ b/config/hiddenapi-light-greylist.txt
@@ -1383,62 +1383,6 @@
 Landroid/service/wallpaper/IWallpaperEngine;->setVisibility(Z)V
 Landroid/service/wallpaper/IWallpaperService$Stub;->asInterface(Landroid/os/IBinder;)Landroid/service/wallpaper/IWallpaperService;
 Landroid/speech/IRecognitionListener;->onEvent(ILandroid/os/Bundle;)V
-Landroid/system/Int32Ref;->value:I
-Landroid/system/OsConstants;-><init>()V
-Landroid/system/OsConstants;->AF_NETLINK:I
-Landroid/system/OsConstants;->AF_PACKET:I
-Landroid/system/OsConstants;->ARPHRD_ETHER:I
-Landroid/system/OsConstants;->ARPHRD_LOOPBACK:I
-Landroid/system/OsConstants;->CAP_TO_INDEX(I)I
-Landroid/system/OsConstants;->CAP_TO_MASK(I)I
-Landroid/system/OsConstants;->ENONET:I
-Landroid/system/OsConstants;->ETH_P_ALL:I
-Landroid/system/OsConstants;->ETH_P_ARP:I
-Landroid/system/OsConstants;->ETH_P_IP:I
-Landroid/system/OsConstants;->ETH_P_IPV6:I
-Landroid/system/OsConstants;->EUSERS:I
-Landroid/system/OsConstants;->ICMP6_ECHO_REPLY:I
-Landroid/system/OsConstants;->ICMP6_ECHO_REQUEST:I
-Landroid/system/OsConstants;->ICMP_ECHO:I
-Landroid/system/OsConstants;->ICMP_ECHOREPLY:I
-Landroid/system/OsConstants;->initConstants()V
-Landroid/system/OsConstants;->IP_MULTICAST_ALL:I
-Landroid/system/OsConstants;->IP_RECVTOS:I
-Landroid/system/OsConstants;->MAP_POPULATE:I
-Landroid/system/OsConstants;->NETLINK_NETFILTER:I
-Landroid/system/OsConstants;->NETLINK_ROUTE:I
-Landroid/system/OsConstants;->O_DIRECT:I
-Landroid/system/OsConstants;->placeholder()I
-Landroid/system/OsConstants;->PR_CAP_AMBIENT:I
-Landroid/system/OsConstants;->PR_CAP_AMBIENT_RAISE:I
-Landroid/system/OsConstants;->RLIMIT_NOFILE:I
-Landroid/system/OsConstants;->RTMGRP_IPV4_IFADDR:I
-Landroid/system/OsConstants;->RTMGRP_IPV4_MROUTE:I
-Landroid/system/OsConstants;->RTMGRP_IPV4_ROUTE:I
-Landroid/system/OsConstants;->RTMGRP_IPV4_RULE:I
-Landroid/system/OsConstants;->RTMGRP_IPV6_IFADDR:I
-Landroid/system/OsConstants;->RTMGRP_IPV6_IFINFO:I
-Landroid/system/OsConstants;->RTMGRP_IPV6_MROUTE:I
-Landroid/system/OsConstants;->RTMGRP_IPV6_PREFIX:I
-Landroid/system/OsConstants;->RTMGRP_IPV6_ROUTE:I
-Landroid/system/OsConstants;->RTMGRP_LINK:I
-Landroid/system/OsConstants;->RTMGRP_NEIGH:I
-Landroid/system/OsConstants;->RTMGRP_NOTIFY:I
-Landroid/system/OsConstants;->RTMGRP_TC:I
-Landroid/system/OsConstants;->SO_DOMAIN:I
-Landroid/system/OsConstants;->SO_PROTOCOL:I
-Landroid/system/OsConstants;->SPLICE_F_MORE:I
-Landroid/system/OsConstants;->SPLICE_F_MOVE:I
-Landroid/system/OsConstants;->SPLICE_F_NONBLOCK:I
-Landroid/system/OsConstants;->TIOCOUTQ:I
-Landroid/system/OsConstants;->UDP_ENCAP:I
-Landroid/system/OsConstants;->UDP_ENCAP_ESPINUDP:I
-Landroid/system/OsConstants;->UDP_ENCAP_ESPINUDP_NON_IKE:I
-Landroid/system/OsConstants;->UNIX_PATH_MAX:I
-Landroid/system/OsConstants;->XATTR_CREATE:I
-Landroid/system/OsConstants;->XATTR_REPLACE:I
-Landroid/system/OsConstants;->_LINUX_CAPABILITY_VERSION_3:I
-Landroid/system/StructTimeval;->fromMillis(J)Landroid/system/StructTimeval;
 Landroid/telephony/CarrierMessagingServiceManager;-><init>()V
 Landroid/telephony/TelephonyManager$MultiSimVariants;->values()[Landroid/telephony/TelephonyManager$MultiSimVariants;
 Landroid/util/Singleton;-><init>()V
@@ -2339,93 +2283,6 @@
 Lcom/google/android/mms/util/PduCache;->purgeAll()V
 Lcom/google/android/mms/util/PduCacheEntry;->getPdu()Lcom/google/android/mms/pdu/GenericPdu;
 Lcom/google/android/mms/util/SqliteWrapper;->insert(Landroid/content/Context;Landroid/content/ContentResolver;Landroid/net/Uri;Landroid/content/ContentValues;)Landroid/net/Uri;
-Ldalvik/system/BaseDexClassLoader;-><init>(Ljava/lang/String;Ljava/io/File;Ljava/lang/String;Ljava/lang/ClassLoader;Z)V
-Ldalvik/system/BaseDexClassLoader;->addDexPath(Ljava/lang/String;)V
-Ldalvik/system/BaseDexClassLoader;->addDexPath(Ljava/lang/String;Z)V
-Ldalvik/system/BaseDexClassLoader;->getLdLibraryPath()Ljava/lang/String;
-Ldalvik/system/BaseDexClassLoader;->pathList:Ldalvik/system/DexPathList;
-Ldalvik/system/BlockGuard$BlockGuardPolicyException;-><init>(IILjava/lang/String;)V
-Ldalvik/system/BlockGuard$BlockGuardPolicyException;->mMessage:Ljava/lang/String;
-Ldalvik/system/BlockGuard$BlockGuardPolicyException;->mPolicyState:I
-Ldalvik/system/BlockGuard$BlockGuardPolicyException;->mPolicyViolated:I
-Ldalvik/system/BlockGuard$Policy;->onNetwork()V
-Ldalvik/system/BlockGuard$Policy;->onReadFromDisk()V
-Ldalvik/system/BlockGuard;->getThreadPolicy()Ldalvik/system/BlockGuard$Policy;
-Ldalvik/system/BlockGuard;->LAX_POLICY:Ldalvik/system/BlockGuard$Policy;
-Ldalvik/system/BlockGuard;->setThreadPolicy(Ldalvik/system/BlockGuard$Policy;)V
-Ldalvik/system/BlockGuard;->threadPolicy:Ljava/lang/ThreadLocal;
-Ldalvik/system/CloseGuard$DefaultReporter;-><init>()V
-Ldalvik/system/CloseGuard$Reporter;->report(Ljava/lang/String;Ljava/lang/Throwable;)V
-Ldalvik/system/CloseGuard;-><init>()V
-Ldalvik/system/CloseGuard;->close()V
-Ldalvik/system/CloseGuard;->get()Ldalvik/system/CloseGuard;
-Ldalvik/system/CloseGuard;->open(Ljava/lang/String;)V
-Ldalvik/system/CloseGuard;->setEnabled(Z)V
-Ldalvik/system/CloseGuard;->setReporter(Ldalvik/system/CloseGuard$Reporter;)V
-Ldalvik/system/CloseGuard;->warnIfOpen()V
-Ldalvik/system/DexFile$DFEnum;->mNameList:[Ljava/lang/String;
-Ldalvik/system/DexFile;->getClassNameList(Ljava/lang/Object;)[Ljava/lang/String;
-Ldalvik/system/DexFile;->isBackedByOatFile()Z
-Ldalvik/system/DexFile;->loadClassBinaryName(Ljava/lang/String;Ljava/lang/ClassLoader;Ljava/util/List;)Ljava/lang/Class;
-Ldalvik/system/DexFile;->loadDex(Ljava/lang/String;Ljava/lang/String;ILjava/lang/ClassLoader;[Ldalvik/system/DexPathList$Element;)Ldalvik/system/DexFile;
-Ldalvik/system/DexFile;->mCookie:Ljava/lang/Object;
-Ldalvik/system/DexFile;->mFileName:Ljava/lang/String;
-Ldalvik/system/DexFile;->mInternalCookie:Ljava/lang/Object;
-Ldalvik/system/DexFile;->openDexFile(Ljava/lang/String;Ljava/lang/String;ILjava/lang/ClassLoader;[Ldalvik/system/DexPathList$Element;)Ljava/lang/Object;
-Ldalvik/system/DexFile;->openDexFileNative(Ljava/lang/String;Ljava/lang/String;ILjava/lang/ClassLoader;[Ldalvik/system/DexPathList$Element;)Ljava/lang/Object;
-Ldalvik/system/DexPathList$Element;-><init>(Ldalvik/system/DexFile;Ljava/io/File;)V
-Ldalvik/system/DexPathList$Element;-><init>(Ljava/io/File;ZLjava/io/File;Ldalvik/system/DexFile;)V
-Ldalvik/system/DexPathList$Element;->dexFile:Ldalvik/system/DexFile;
-Ldalvik/system/DexPathList$Element;->path:Ljava/io/File;
-Ldalvik/system/DexPathList$NativeLibraryElement;-><init>(Ljava/io/File;)V
-Ldalvik/system/DexPathList$NativeLibraryElement;->path:Ljava/io/File;
-Ldalvik/system/DexPathList;-><init>(Ljava/lang/ClassLoader;Ljava/lang/String;Ljava/lang/String;Ljava/io/File;)V
-Ldalvik/system/DexPathList;->addDexPath(Ljava/lang/String;Ljava/io/File;)V
-Ldalvik/system/DexPathList;->addNativePath(Ljava/util/Collection;)V
-Ldalvik/system/DexPathList;->definingContext:Ljava/lang/ClassLoader;
-Ldalvik/system/DexPathList;->dexElements:[Ldalvik/system/DexPathList$Element;
-Ldalvik/system/DexPathList;->dexElementsSuppressedExceptions:[Ljava/io/IOException;
-Ldalvik/system/DexPathList;->loadDexFile(Ljava/io/File;Ljava/io/File;Ljava/lang/ClassLoader;[Ldalvik/system/DexPathList$Element;)Ldalvik/system/DexFile;
-Ldalvik/system/DexPathList;->makeDexElements(Ljava/util/List;Ljava/io/File;Ljava/util/List;Ljava/lang/ClassLoader;)[Ldalvik/system/DexPathList$Element;
-Ldalvik/system/DexPathList;->makeInMemoryDexElements([Ljava/nio/ByteBuffer;Ljava/util/List;)[Ldalvik/system/DexPathList$Element;
-Ldalvik/system/DexPathList;->makePathElements(Ljava/util/List;)[Ldalvik/system/DexPathList$NativeLibraryElement;
-Ldalvik/system/DexPathList;->makePathElements(Ljava/util/List;Ljava/io/File;Ljava/util/List;)[Ldalvik/system/DexPathList$Element;
-Ldalvik/system/DexPathList;->nativeLibraryDirectories:Ljava/util/List;
-Ldalvik/system/DexPathList;->nativeLibraryPathElements:[Ldalvik/system/DexPathList$NativeLibraryElement;
-Ldalvik/system/DexPathList;->splitPaths(Ljava/lang/String;Z)Ljava/util/List;
-Ldalvik/system/DexPathList;->systemNativeLibraryDirectories:Ljava/util/List;
-Ldalvik/system/SocketTagger;->get()Ldalvik/system/SocketTagger;
-Ldalvik/system/SocketTagger;->tag(Ljava/net/Socket;)V
-Ldalvik/system/SocketTagger;->untag(Ljava/net/Socket;)V
-Ldalvik/system/VMDebug;->allowHiddenApiReflectionFrom(Ljava/lang/Class;)V
-Ldalvik/system/VMDebug;->dumpReferenceTables()V
-Ldalvik/system/VMDebug;->isDebuggerConnected()Z
-Ldalvik/system/VMRuntime;->addressOf(Ljava/lang/Object;)J
-Ldalvik/system/VMRuntime;->clearGrowthLimit()V
-Ldalvik/system/VMRuntime;->gcSoftReferences()V
-Ldalvik/system/VMRuntime;->getCurrentInstructionSet()Ljava/lang/String;
-Ldalvik/system/VMRuntime;->getExternalBytesAllocated()J
-Ldalvik/system/VMRuntime;->getInstructionSet(Ljava/lang/String;)Ljava/lang/String;
-Ldalvik/system/VMRuntime;->getMinimumHeapSize()J
-Ldalvik/system/VMRuntime;->getRuntime()Ldalvik/system/VMRuntime;
-Ldalvik/system/VMRuntime;->is64Bit()Z
-Ldalvik/system/VMRuntime;->is64BitAbi(Ljava/lang/String;)Z
-Ldalvik/system/VMRuntime;->newNonMovableArray(Ljava/lang/Class;I)Ljava/lang/Object;
-Ldalvik/system/VMRuntime;->registerNativeAllocation(I)V
-Ldalvik/system/VMRuntime;->registerNativeFree(I)V
-Ldalvik/system/VMRuntime;->runFinalization(J)V
-Ldalvik/system/VMRuntime;->runFinalizationSync()V
-Ldalvik/system/VMRuntime;->setMinimumHeapSize(J)J
-Ldalvik/system/VMRuntime;->setTargetHeapUtilization(F)F
-Ldalvik/system/VMRuntime;->setTargetSdkVersion(I)V
-Ldalvik/system/VMRuntime;->trackExternalAllocation(J)Z
-Ldalvik/system/VMRuntime;->trackExternalFree(J)V
-Ldalvik/system/VMRuntime;->vmInstructionSet()Ljava/lang/String;
-Ldalvik/system/VMRuntime;->vmLibrary()Ljava/lang/String;
-Ldalvik/system/VMStack;->fillStackTraceElements(Ljava/lang/Thread;[Ljava/lang/StackTraceElement;)I
-Ldalvik/system/VMStack;->getCallingClassLoader()Ljava/lang/ClassLoader;
-Ldalvik/system/VMStack;->getStackClass2()Ljava/lang/Class;
-Ldalvik/system/VMStack;->getThreadStackTrace(Ljava/lang/Thread;)[Ljava/lang/StackTraceElement;
 Ljava/io/Console;->encoding()Ljava/lang/String;
 Ljava/io/File;->filePath:Ljava/nio/file/Path;
 Ljava/io/File;->fs:Ljava/io/FileSystem;
@@ -2501,18 +2358,6 @@
 Ljava/lang/Class;->objectSize:I
 Ljava/lang/Class;->status:I
 Ljava/lang/ClassLoader;->parent:Ljava/lang/ClassLoader;
-Ljava/lang/Daemons$Daemon;->isRunning()Z
-Ljava/lang/Daemons$Daemon;->start()V
-Ljava/lang/Daemons$Daemon;->stop()V
-Ljava/lang/Daemons$Daemon;->thread:Ljava/lang/Thread;
-Ljava/lang/Daemons$FinalizerDaemon;->finalizingObject:Ljava/lang/Object;
-Ljava/lang/Daemons$FinalizerDaemon;->INSTANCE:Ljava/lang/Daemons$FinalizerDaemon;
-Ljava/lang/Daemons$FinalizerWatchdogDaemon;->INSTANCE:Ljava/lang/Daemons$FinalizerWatchdogDaemon;
-Ljava/lang/Daemons$ReferenceQueueDaemon;->INSTANCE:Ljava/lang/Daemons$ReferenceQueueDaemon;
-Ljava/lang/Daemons;->MAX_FINALIZE_NANOS:J
-Ljava/lang/Daemons;->requestHeapTrim()V
-Ljava/lang/Daemons;->start()V
-Ljava/lang/Daemons;->stop()V
 Ljava/lang/Double;->value:D
 Ljava/lang/Enum;->getSharedConstants(Ljava/lang/Class;)[Ljava/lang/Enum;
 Ljava/lang/Enum;->name:Ljava/lang/String;
@@ -2522,11 +2367,6 @@
 Ljava/lang/invoke/MethodHandles$Lookup;-><init>(Ljava/lang/Class;I)V
 Ljava/lang/Long;->value:J
 Ljava/lang/Object;->identityHashCode(Ljava/lang/Object;)I
-Ljava/lang/ref/FinalizerReference;->add(Ljava/lang/Object;)V
-Ljava/lang/ref/FinalizerReference;->head:Ljava/lang/ref/FinalizerReference;
-Ljava/lang/ref/FinalizerReference;->next:Ljava/lang/ref/FinalizerReference;
-Ljava/lang/ref/FinalizerReference;->queue:Ljava/lang/ref/ReferenceQueue;
-Ljava/lang/ref/FinalizerReference;->remove(Ljava/lang/ref/FinalizerReference;)V
 Ljava/lang/ref/Reference;->getReferent()Ljava/lang/Object;
 Ljava/lang/ref/Reference;->referent:Ljava/lang/Object;
 Ljava/lang/ref/ReferenceQueue;->add(Ljava/lang/ref/Reference;)V
@@ -2669,12 +2509,6 @@
 Ljava/nio/charset/Charset;->defaultCharset:Ljava/nio/charset/Charset;
 Ljava/nio/charset/CharsetEncoder;->canEncode(Ljava/nio/CharBuffer;)Z
 Ljava/nio/DirectByteBuffer;-><init>(JI)V
-Ljava/nio/NIOAccess;->getBaseArray(Ljava/nio/Buffer;)Ljava/lang/Object;
-Ljava/nio/NIOAccess;->getBaseArrayOffset(Ljava/nio/Buffer;)I
-Ljava/nio/NIOAccess;->getBasePointer(Ljava/nio/Buffer;)J
-Ljava/nio/NioUtils;->freeDirectBuffer(Ljava/nio/ByteBuffer;)V
-Ljava/nio/NioUtils;->unsafeArray(Ljava/nio/ByteBuffer;)[B
-Ljava/nio/NioUtils;->unsafeArrayOffset(Ljava/nio/ByteBuffer;)I
 Ljava/security/KeyPairGenerator;->getInstance(Lsun/security/jca/GetInstance$Instance;Ljava/lang/String;)Ljava/security/KeyPairGenerator;
 Ljava/security/KeyStore;->keyStoreSpi:Ljava/security/KeyStoreSpi;
 Ljava/security/Signature;->getInstance(Lsun/security/jca/GetInstance$Instance;Ljava/lang/String;)Ljava/security/Signature;
@@ -2790,9 +2624,6 @@
 Ljavax/net/ssl/SSLServerSocketFactory;->defaultServerSocketFactory:Ljavax/net/ssl/SSLServerSocketFactory;
 Ljavax/net/ssl/SSLSocketFactory;->createSocket(Ljava/net/Socket;Ljava/io/InputStream;Z)Ljava/net/Socket;
 Ljavax/net/ssl/SSLSocketFactory;->defaultSocketFactory:Ljavax/net/ssl/SSLSocketFactory;
-Llibcore/icu/ICU;->addLikelySubtags(Ljava/util/Locale;)Ljava/util/Locale;
-Llibcore/util/BasicLruCache;->map:Ljava/util/LinkedHashMap;
-Llibcore/util/ZoneInfo;->mTransitions:[J
 Lorg/ccil/cowan/tagsoup/AttributesImpl;->data:[Ljava/lang/String;
 Lorg/ccil/cowan/tagsoup/AttributesImpl;->length:I
 Lorg/ccil/cowan/tagsoup/ElementType;->theAtts:Lorg/ccil/cowan/tagsoup/AttributesImpl;
@@ -2811,100 +2642,6 @@
 Lorg/ccil/cowan/tagsoup/Schema;->thePrefix:Ljava/lang/String;
 Lorg/ccil/cowan/tagsoup/Schema;->theRoot:Lorg/ccil/cowan/tagsoup/ElementType;
 Lorg/ccil/cowan/tagsoup/Schema;->theURI:Ljava/lang/String;
-Lorg/json/JSONArray;->values:Ljava/util/List;
-Lorg/json/JSONArray;->writeTo(Lorg/json/JSONStringer;)V
-Lorg/json/JSONObject;->append(Ljava/lang/String;Ljava/lang/Object;)Lorg/json/JSONObject;
-Lorg/json/JSONObject;->checkName(Ljava/lang/String;)Ljava/lang/String;
-Lorg/json/JSONObject;->keySet()Ljava/util/Set;
-Lorg/json/JSONObject;->nameValuePairs:Ljava/util/LinkedHashMap;
-Lorg/json/JSONObject;->NEGATIVE_ZERO:Ljava/lang/Double;
-Lorg/json/JSONObject;->writeTo(Lorg/json/JSONStringer;)V
-Lorg/json/JSONStringer;-><init>(I)V
-Lorg/json/JSONStringer;->beforeKey()V
-Lorg/json/JSONStringer;->beforeValue()V
-Lorg/json/JSONStringer;->close(Lorg/json/JSONStringer$Scope;Lorg/json/JSONStringer$Scope;Ljava/lang/String;)Lorg/json/JSONStringer;
-Lorg/json/JSONStringer;->indent:Ljava/lang/String;
-Lorg/json/JSONStringer;->newline()V
-Lorg/json/JSONStringer;->open(Lorg/json/JSONStringer$Scope;Ljava/lang/String;)Lorg/json/JSONStringer;
-Lorg/json/JSONStringer;->out:Ljava/lang/StringBuilder;
-Lorg/json/JSONStringer;->peek()Lorg/json/JSONStringer$Scope;
-Lorg/json/JSONStringer;->replaceTop(Lorg/json/JSONStringer$Scope;)V
-Lorg/json/JSONStringer;->stack:Ljava/util/List;
-Lorg/json/JSONStringer;->string(Ljava/lang/String;)V
-Lorg/json/JSONTokener;->in:Ljava/lang/String;
-Lorg/json/JSONTokener;->nextCleanInternal()I
-Lorg/json/JSONTokener;->nextToInternal(Ljava/lang/String;)Ljava/lang/String;
-Lorg/json/JSONTokener;->pos:I
-Lorg/json/JSONTokener;->readArray()Lorg/json/JSONArray;
-Lorg/json/JSONTokener;->readEscapeCharacter()C
-Lorg/json/JSONTokener;->readLiteral()Ljava/lang/Object;
-Lorg/json/JSONTokener;->readObject()Lorg/json/JSONObject;
-Lorg/json/JSONTokener;->skipToEndOfLine()V
-Lorg/w3c/dom/ls/LSSerializerFilter;->getWhatToShow()I
-Lorg/w3c/dom/traversal/NodeFilter;->acceptNode(Lorg/w3c/dom/Node;)S
-Lorg/w3c/dom/traversal/NodeIterator;->detach()V
-Lorg/w3c/dom/traversal/NodeIterator;->nextNode()Lorg/w3c/dom/Node;
-Lorg/xml/sax/ext/Attributes2Impl;->declared:[Z
-Lorg/xml/sax/ext/Attributes2Impl;->specified:[Z
-Lorg/xml/sax/ext/Locator2Impl;->encoding:Ljava/lang/String;
-Lorg/xml/sax/ext/Locator2Impl;->version:Ljava/lang/String;
-Lorg/xml/sax/helpers/AttributesImpl;->badIndex(I)V
-Lorg/xml/sax/helpers/AttributesImpl;->data:[Ljava/lang/String;
-Lorg/xml/sax/helpers/AttributesImpl;->ensureCapacity(I)V
-Lorg/xml/sax/helpers/AttributesImpl;->length:I
-Lorg/xml/sax/helpers/LocatorImpl;->columnNumber:I
-Lorg/xml/sax/helpers/LocatorImpl;->lineNumber:I
-Lorg/xml/sax/helpers/LocatorImpl;->publicId:Ljava/lang/String;
-Lorg/xml/sax/helpers/LocatorImpl;->systemId:Ljava/lang/String;
-Lorg/xml/sax/helpers/NamespaceSupport;->contextPos:I
-Lorg/xml/sax/helpers/NamespaceSupport;->contexts:[Lorg/xml/sax/helpers/NamespaceSupport$Context;
-Lorg/xml/sax/helpers/NamespaceSupport;->currentContext:Lorg/xml/sax/helpers/NamespaceSupport$Context;
-Lorg/xml/sax/helpers/NamespaceSupport;->EMPTY_ENUMERATION:Ljava/util/Enumeration;
-Lorg/xml/sax/helpers/NamespaceSupport;->namespaceDeclUris:Z
-Lorg/xml/sax/helpers/ParserAdapter;->attAdapter:Lorg/xml/sax/helpers/ParserAdapter$AttributeListAdapter;
-Lorg/xml/sax/helpers/ParserAdapter;->atts:Lorg/xml/sax/helpers/AttributesImpl;
-Lorg/xml/sax/helpers/ParserAdapter;->checkNotParsing(Ljava/lang/String;Ljava/lang/String;)V
-Lorg/xml/sax/helpers/ParserAdapter;->contentHandler:Lorg/xml/sax/ContentHandler;
-Lorg/xml/sax/helpers/ParserAdapter;->dtdHandler:Lorg/xml/sax/DTDHandler;
-Lorg/xml/sax/helpers/ParserAdapter;->entityResolver:Lorg/xml/sax/EntityResolver;
-Lorg/xml/sax/helpers/ParserAdapter;->errorHandler:Lorg/xml/sax/ErrorHandler;
-Lorg/xml/sax/helpers/ParserAdapter;->locator:Lorg/xml/sax/Locator;
-Lorg/xml/sax/helpers/ParserAdapter;->makeException(Ljava/lang/String;)Lorg/xml/sax/SAXParseException;
-Lorg/xml/sax/helpers/ParserAdapter;->nameParts:[Ljava/lang/String;
-Lorg/xml/sax/helpers/ParserAdapter;->namespaces:Z
-Lorg/xml/sax/helpers/ParserAdapter;->nsSupport:Lorg/xml/sax/helpers/NamespaceSupport;
-Lorg/xml/sax/helpers/ParserAdapter;->parser:Lorg/xml/sax/Parser;
-Lorg/xml/sax/helpers/ParserAdapter;->parsing:Z
-Lorg/xml/sax/helpers/ParserAdapter;->prefixes:Z
-Lorg/xml/sax/helpers/ParserAdapter;->processName(Ljava/lang/String;ZZ)[Ljava/lang/String;
-Lorg/xml/sax/helpers/ParserAdapter;->reportError(Ljava/lang/String;)V
-Lorg/xml/sax/helpers/ParserAdapter;->setup(Lorg/xml/sax/Parser;)V
-Lorg/xml/sax/helpers/ParserAdapter;->setupParser()V
-Lorg/xml/sax/helpers/ParserAdapter;->uris:Z
-Lorg/xml/sax/helpers/XMLFilterImpl;->contentHandler:Lorg/xml/sax/ContentHandler;
-Lorg/xml/sax/helpers/XMLFilterImpl;->dtdHandler:Lorg/xml/sax/DTDHandler;
-Lorg/xml/sax/helpers/XMLFilterImpl;->entityResolver:Lorg/xml/sax/EntityResolver;
-Lorg/xml/sax/helpers/XMLFilterImpl;->errorHandler:Lorg/xml/sax/ErrorHandler;
-Lorg/xml/sax/helpers/XMLFilterImpl;->locator:Lorg/xml/sax/Locator;
-Lorg/xml/sax/helpers/XMLFilterImpl;->parent:Lorg/xml/sax/XMLReader;
-Lorg/xml/sax/helpers/XMLFilterImpl;->setupParse()V
-Lorg/xml/sax/helpers/XMLReaderAdapter;->documentHandler:Lorg/xml/sax/DocumentHandler;
-Lorg/xml/sax/helpers/XMLReaderAdapter;->qAtts:Lorg/xml/sax/helpers/XMLReaderAdapter$AttributesAdapter;
-Lorg/xml/sax/helpers/XMLReaderAdapter;->setup(Lorg/xml/sax/XMLReader;)V
-Lorg/xml/sax/helpers/XMLReaderAdapter;->setupXMLReader()V
-Lorg/xml/sax/helpers/XMLReaderAdapter;->xmlReader:Lorg/xml/sax/XMLReader;
-Lorg/xml/sax/helpers/XMLReaderFactory;->loadClass(Ljava/lang/ClassLoader;Ljava/lang/String;)Lorg/xml/sax/XMLReader;
-Lorg/xml/sax/InputSource;->byteStream:Ljava/io/InputStream;
-Lorg/xml/sax/InputSource;->characterStream:Ljava/io/Reader;
-Lorg/xml/sax/InputSource;->encoding:Ljava/lang/String;
-Lorg/xml/sax/InputSource;->publicId:Ljava/lang/String;
-Lorg/xml/sax/InputSource;->systemId:Ljava/lang/String;
-Lorg/xml/sax/SAXException;->exception:Ljava/lang/Exception;
-Lorg/xml/sax/SAXParseException;->columnNumber:I
-Lorg/xml/sax/SAXParseException;->init(Ljava/lang/String;Ljava/lang/String;II)V
-Lorg/xml/sax/SAXParseException;->lineNumber:I
-Lorg/xml/sax/SAXParseException;->publicId:Ljava/lang/String;
-Lorg/xml/sax/SAXParseException;->systemId:Ljava/lang/String;
 Lsun/misc/Cleaner;->clean()V
 Lsun/misc/Unsafe;->addressSize()I
 Lsun/misc/Unsafe;->allocateInstance(Ljava/lang/Class;)Ljava/lang/Object;
diff --git a/config/hiddenapi-vendor-list.txt b/config/hiddenapi-vendor-list.txt
index 45e38cf9..e5e64d3 100644
--- a/config/hiddenapi-vendor-list.txt
+++ b/config/hiddenapi-vendor-list.txt
@@ -122,14 +122,6 @@
 Landroid/os/UserManager;->hasUserRestriction(Ljava/lang/String;Landroid/os/UserHandle;)Z
 Landroid/os/UserManager;->isAdminUser()Z
 Landroid/R$styleable;->CheckBoxPreference:[I
-Landroid/system/NetlinkSocketAddress;-><init>(II)V
-Landroid/system/Os;->bind(Ljava/io/FileDescriptor;Ljava/net/SocketAddress;)V
-Landroid/system/Os;->connect(Ljava/io/FileDescriptor;Ljava/net/SocketAddress;)V
-Landroid/system/Os;->sendto(Ljava/io/FileDescriptor;[BIIILjava/net/SocketAddress;)I
-Landroid/system/Os;->setsockoptIfreq(Ljava/io/FileDescriptor;IILjava/lang/String;)V
-Landroid/system/Os;->setsockoptTimeval(Ljava/io/FileDescriptor;IILandroid/system/StructTimeval;)V
-Landroid/system/PacketSocketAddress;-><init>(I[B)V
-Landroid/system/PacketSocketAddress;-><init>(SI)V
 Landroid/telephony/ims/compat/feature/MMTelFeature;-><init>()V
 Landroid/telephony/ims/compat/ImsService;-><init>()V
 Landroid/telephony/ims/compat/stub/ImsCallSessionImplBase;-><init>()V
diff --git a/config/preloaded-classes b/config/preloaded-classes
index 56ca98f..1a8a32e 100644
--- a/config/preloaded-classes
+++ b/config/preloaded-classes
@@ -2354,6 +2354,7 @@
 android.nfc.NfcAdapter$CreateNdefMessageCallback
 android.nfc.NfcManager
 android.opengl.EGL14
+android.opengl.EGL15
 android.opengl.EGLConfig
 android.opengl.EGLContext
 android.opengl.EGLDisplay
diff --git a/core/java/android/app/Activity.java b/core/java/android/app/Activity.java
index aca80b4..3cc5e37 100644
--- a/core/java/android/app/Activity.java
+++ b/core/java/android/app/Activity.java
@@ -4678,7 +4678,7 @@
         if (decor != null) {
             decor.cancelPendingInputEvents();
         }
-        if (options != null && !isTopOfTask()) {
+        if (options != null) {
             mActivityTransitionState.startExitOutTransition(this, options);
         }
     }
@@ -4882,6 +4882,7 @@
             Bundle options)
             throws IntentSender.SendIntentException {
         try {
+            options = transferSpringboardActivityOptions(options);
             String resolvedType = null;
             if (fillInIntent != null) {
                 fillInIntent.migrateExtraStreamToClipData();
@@ -4898,6 +4899,12 @@
                 throw new IntentSender.SendIntentException();
             }
             Instrumentation.checkStartActivityResult(result, null);
+
+            if (options != null) {
+                // Only when the options are not null, as the intent can point to something other
+                // than an Activity.
+                cancelInputsAndStartExitTransition(options);
+            }
         } catch (RemoteException e) {
         }
         if (requestCode >= 0) {
@@ -6471,7 +6478,7 @@
      *
      * @return true if this is the topmost, non-finishing activity in its task.
      */
-    private boolean isTopOfTask() {
+    final boolean isTopOfTask() {
         if (mToken == null || mWindow == null) {
             return false;
         }
diff --git a/core/java/android/app/ActivityManagerInternal.java b/core/java/android/app/ActivityManagerInternal.java
index 296c063..069effd 100644
--- a/core/java/android/app/ActivityManagerInternal.java
+++ b/core/java/android/app/ActivityManagerInternal.java
@@ -124,17 +124,6 @@
     public abstract void notifyNetworkPolicyRulesUpdated(int uid, long procStateSeq);
 
     /**
-     * Saves the current activity manager state and includes the saved state in the next dump of
-     * activity manager.
-     */
-    public abstract void saveANRState(String reason);
-
-    /**
-     * Clears the previously saved activity manager ANR state.
-     */
-    public abstract void clearSavedANRState();
-
-    /**
      * @return true if runtime was restarted, false if it's normal boot
      */
     public abstract boolean isRuntimeRestarted();
@@ -166,10 +155,19 @@
 
     /**
      * Returns a list that contains the memory stats for currently running processes.
+     *
+     * Only processes managed by ActivityManagerService are included.
      */
     public abstract List<ProcessMemoryState> getMemoryStateForProcesses();
 
     /**
+     * Returns a list that contains the memory stats for monitored native processes.
+     *
+     * The list of the monitored processes is defined in MemoryStatUtil class.
+     */
+    public abstract List<ProcessMemoryState> getMemoryStateForNativeProcesses();
+
+    /**
      * Checks to see if the calling pid is allowed to handle the user. Returns adjusted user id as
      * needed.
      */
@@ -188,9 +186,6 @@
     /** Trims memory usage in the system by removing/stopping unused application processes. */
     public abstract void trimApplications();
 
-    /** Closes all system dialogs. */
-    public abstract void closeSystemDialogs(String reason);
-
     /** Kill the processes in the list due to their tasks been removed. */
     public abstract void killProcessesForRemovedTask(ArrayList<Object> procsToKill);
 
@@ -249,4 +244,40 @@
     public abstract void updateOomLevelsForDisplay(int displayId);
     public abstract boolean isActivityStartsLoggingEnabled();
     public abstract void reportCurKeyguardUsageEvent(boolean keyguardShowing);
+
+    /** Input dispatch timeout to a window, start the ANR process. */
+    public abstract long inputDispatchingTimedOut(int pid, boolean aboveSystem, String reason);
+    public abstract boolean inputDispatchingTimedOut(Object proc, String activityShortComponentName,
+            ApplicationInfo aInfo, String parentShortComponentName, Object parentProc,
+            boolean aboveSystem, String reason);
+
+    /**
+     * Sends {@link android.content.Intent#ACTION_CONFIGURATION_CHANGED} with all the appropriate
+     * flags.
+     */
+    public abstract void broadcastGlobalConfigurationChanged(int changes, boolean initLocale);
+
+    /**
+     * Sends {@link android.content.Intent#ACTION_CLOSE_SYSTEM_DIALOGS} with all the appropriate
+     * flags.
+     */
+    public abstract void broadcastCloseSystemDialogs(String reason);
+
+    /**
+     * Kills all background processes, except those matching any of the specified properties.
+     *
+     * @param minTargetSdk the target SDK version at or above which to preserve processes,
+     *                     or {@code -1} to ignore the target SDK
+     * @param maxProcState the process state at or below which to preserve processes,
+     *                     or {@code -1} to ignore the process state
+     */
+    public abstract void killAllBackgroundProcessesExcept(int minTargetSdk, int maxProcState);
+
+    /** Starts a given process. */
+    public abstract void startProcess(String processName, ApplicationInfo info,
+            boolean knownToBeDead, String hostingType, ComponentName hostingName);
+
+    /** Starts up the starting activity process for debugging if needed. */
+    public abstract void setDebugFlagsForStartingActivity(ActivityInfo aInfo, int startFlags,
+            ProfilerInfo profilerInfo);
 }
diff --git a/core/java/android/app/ActivityOptions.java b/core/java/android/app/ActivityOptions.java
index 3c9a2d4..94b42ff 100644
--- a/core/java/android/app/ActivityOptions.java
+++ b/core/java/android/app/ActivityOptions.java
@@ -195,6 +195,13 @@
     private static final String KEY_LAUNCH_TASK_ID = "android.activity.launchTaskId";
 
     /**
+     * See {@link #setPendingIntentLaunchFlags(int)}
+     * @hide
+     */
+    private static final String KEY_PENDING_INTENT_LAUNCH_FLAGS =
+            "android.activity.pendingIntentLaunchFlags";
+
+    /**
      * See {@link #setTaskOverlay}.
      * @hide
      */
@@ -309,6 +316,7 @@
     @WindowConfiguration.ActivityType
     private int mLaunchActivityType = ACTIVITY_TYPE_UNDEFINED;
     private int mLaunchTaskId = -1;
+    private int mPendingIntentLaunchFlags;
     private int mSplitScreenCreateMode = SPLIT_SCREEN_CREATE_MODE_TOP_OR_LEFT;
     private boolean mLockTaskMode = false;
     private boolean mDisallowEnterPictureInPictureWhileLaunching;
@@ -932,6 +940,7 @@
         mLaunchWindowingMode = opts.getInt(KEY_LAUNCH_WINDOWING_MODE, WINDOWING_MODE_UNDEFINED);
         mLaunchActivityType = opts.getInt(KEY_LAUNCH_ACTIVITY_TYPE, ACTIVITY_TYPE_UNDEFINED);
         mLaunchTaskId = opts.getInt(KEY_LAUNCH_TASK_ID, -1);
+        mPendingIntentLaunchFlags = opts.getInt(KEY_PENDING_INTENT_LAUNCH_FLAGS, 0);
         mTaskOverlay = opts.getBoolean(KEY_TASK_OVERLAY, false);
         mTaskOverlayCanResume = opts.getBoolean(KEY_TASK_OVERLAY_CAN_RESUME, false);
         mAvoidMoveToFront = opts.getBoolean(KEY_AVOID_MOVE_TO_FRONT, false);
@@ -1233,6 +1242,22 @@
     }
 
     /**
+     * Specifies intent flags to be applied for any activity started from a PendingIntent.
+     *
+     * @hide
+     */
+    public void setPendingIntentLaunchFlags(@android.content.Intent.Flags int flags) {
+        mPendingIntentLaunchFlags = flags;
+    }
+
+    /**
+     * @hide
+     */
+    public int getPendingIntentLaunchFlags() {
+        return mPendingIntentLaunchFlags;
+    }
+
+    /**
      * Set's whether the activity launched with this option should be a task overlay. That is the
      * activity will always be the top activity of the task.  If {@param canResume} is true, then
      * the task will also not be moved to the front of the stack.
@@ -1463,6 +1488,9 @@
         if (mLaunchTaskId != -1) {
             b.putInt(KEY_LAUNCH_TASK_ID, mLaunchTaskId);
         }
+        if (mPendingIntentLaunchFlags != 0) {
+            b.putInt(KEY_PENDING_INTENT_LAUNCH_FLAGS, mPendingIntentLaunchFlags);
+        }
         if (mTaskOverlay) {
             b.putBoolean(KEY_TASK_OVERLAY, mTaskOverlay);
         }
diff --git a/core/java/android/app/ActivityTransitionCoordinator.java b/core/java/android/app/ActivityTransitionCoordinator.java
index 9b2bfc5..4b87a64 100644
--- a/core/java/android/app/ActivityTransitionCoordinator.java
+++ b/core/java/android/app/ActivityTransitionCoordinator.java
@@ -193,6 +193,13 @@
      */
     public static final int MSG_SHARED_ELEMENT_DESTINATION = 107;
 
+    /**
+     * Sent by Activity#startActivity to notify the entering activity that enter animation for
+     * back is allowed. If this message is not received, the default exit animation will run when
+     * backing out of an activity (instead of the 'reverse' shared element transition).
+     */
+    public static final int MSG_ALLOW_RETURN_TRANSITION = 108;
+
     private Window mWindow;
     final protected ArrayList<String> mAllSharedElementNames;
     final protected ArrayList<View> mSharedElements = new ArrayList<View>();
@@ -346,8 +353,6 @@
         return new ArrayList<View>(mSharedElements);
     }
 
-    public ArrayList<String> getAllSharedElementNames() { return mAllSharedElementNames; }
-
     protected Transition setTargets(Transition transition, boolean add) {
         if (transition == null || (add &&
                 (mTransitioningViews == null || mTransitioningViews.isEmpty()))) {
diff --git a/core/java/android/app/ActivityTransitionState.java b/core/java/android/app/ActivityTransitionState.java
index b8f5a8e..3201feb 100644
--- a/core/java/android/app/ActivityTransitionState.java
+++ b/core/java/android/app/ActivityTransitionState.java
@@ -35,7 +35,7 @@
  */
 class ActivityTransitionState {
 
-    private static final String ENTERING_SHARED_ELEMENTS = "android:enteringSharedElements";
+    private static final String PENDING_EXIT_SHARED_ELEMENTS = "android:pendingExitSharedElements";
 
     private static final String EXITING_MAPPED_FROM = "android:exitingMappedFrom";
 
@@ -43,9 +43,9 @@
 
     /**
      * The shared elements that the calling Activity has said that they transferred to this
-     * Activity.
+     * Activity and will be transferred back during exit animation.
      */
-    private ArrayList<String> mEnteringNames;
+    private ArrayList<String> mPendingExitNames;
 
     /**
      * The names of shared elements that were shared to the called Activity.
@@ -112,8 +112,7 @@
 
     public int addExitTransitionCoordinator(ExitTransitionCoordinator exitTransitionCoordinator) {
         if (mExitTransitionCoordinators == null) {
-            mExitTransitionCoordinators =
-                    new SparseArray<WeakReference<ExitTransitionCoordinator>>();
+            mExitTransitionCoordinators = new SparseArray<>();
         }
         WeakReference<ExitTransitionCoordinator> ref = new WeakReference(exitTransitionCoordinator);
         // clean up old references:
@@ -132,7 +131,7 @@
     public void readState(Bundle bundle) {
         if (bundle != null) {
             if (mEnterTransitionCoordinator == null || mEnterTransitionCoordinator.isReturning()) {
-                mEnteringNames = bundle.getStringArrayList(ENTERING_SHARED_ELEMENTS);
+                mPendingExitNames = bundle.getStringArrayList(PENDING_EXIT_SHARED_ELEMENTS);
             }
             if (mEnterTransitionCoordinator == null) {
                 mExitingFrom = bundle.getStringArrayList(EXITING_MAPPED_FROM);
@@ -141,9 +140,21 @@
         }
     }
 
+    /**
+     * Returns the element names to be used for exit animation. It caches the list internally so
+     * that it is preserved through activty destroy and restore.
+     */
+    private ArrayList<String> getPendingExitNames() {
+        if (mPendingExitNames == null && mEnterTransitionCoordinator != null) {
+            mPendingExitNames = mEnterTransitionCoordinator.getPendingExitSharedElementNames();
+        }
+        return mPendingExitNames;
+    }
+
     public void saveState(Bundle bundle) {
-        if (mEnteringNames != null) {
-            bundle.putStringArrayList(ENTERING_SHARED_ELEMENTS, mEnteringNames);
+        ArrayList<String> pendingExitNames = getPendingExitNames();
+        if (pendingExitNames != null) {
+            bundle.putStringArrayList(PENDING_EXIT_SHARED_ELEMENTS, pendingExitNames);
         }
         if (mExitingFrom != null) {
             bundle.putStringArrayList(EXITING_MAPPED_FROM, mExitingFrom);
@@ -226,7 +237,7 @@
             }
         } else {
             mEnterTransitionCoordinator.namedViewsReady(null, null);
-            mEnteringNames = mEnterTransitionCoordinator.getAllSharedElementNames();
+            mPendingExitNames = null;
         }
 
         mExitingFrom = null;
@@ -268,7 +279,7 @@
     }
 
     public void clear() {
-        mEnteringNames = null;
+        mPendingExitNames = null;
         mExitingFrom = null;
         mExitingTo = null;
         mExitingToView = null;
@@ -296,7 +307,8 @@
     }
 
     public boolean startExitBackTransition(final Activity activity) {
-        if (mEnteringNames == null || mCalledExitCoordinator != null) {
+        ArrayList<String> pendingExitNames = getPendingExitNames();
+        if (pendingExitNames == null || mCalledExitCoordinator != null) {
             return false;
         } else {
             if (!mHasExited) {
@@ -315,7 +327,7 @@
                 }
 
                 mReturnExitCoordinator = new ExitTransitionCoordinator(activity,
-                        activity.getWindow(), activity.mEnterTransitionListener, mEnteringNames,
+                        activity.getWindow(), activity.mEnterTransitionListener, pendingExitNames,
                         null, null, true);
                 if (enterViewsTransition != null && decor != null) {
                     enterViewsTransition.resume(decor);
diff --git a/core/java/android/app/EnterTransitionCoordinator.java b/core/java/android/app/EnterTransitionCoordinator.java
index ab847fd..bce243c 100644
--- a/core/java/android/app/EnterTransitionCoordinator.java
+++ b/core/java/android/app/EnterTransitionCoordinator.java
@@ -65,6 +65,7 @@
     private OneShotPreDrawListener mViewsReadyListener;
     private final boolean mIsCrossTask;
     private Drawable mReplacedBackground;
+    private ArrayList<String> mPendingExitNames;
 
     public EnterTransitionCoordinator(Activity activity, ResultReceiver resultReceiver,
             ArrayList<String> sharedElementNames, boolean isReturning, boolean isCrossTask) {
@@ -249,6 +250,11 @@
             case MSG_CANCEL:
                 cancel();
                 break;
+            case MSG_ALLOW_RETURN_TRANSITION:
+                if (!mIsCanceled) {
+                    mPendingExitNames = mAllSharedElementNames;
+                }
+                break;
         }
     }
 
@@ -256,6 +262,10 @@
         return mIsReturning && mResultReceiver != null;
     }
 
+    public ArrayList<String> getPendingExitSharedElementNames() {
+        return mPendingExitNames;
+    }
+
     /**
      * This is called onResume. If an Activity is resuming and the transitions
      * haven't started yet, force the views to appear. This is likely to be
diff --git a/core/java/android/app/ExitTransitionCoordinator.java b/core/java/android/app/ExitTransitionCoordinator.java
index df31da9..48a711e 100644
--- a/core/java/android/app/ExitTransitionCoordinator.java
+++ b/core/java/android/app/ExitTransitionCoordinator.java
@@ -433,6 +433,11 @@
             if (!mSharedElementNotified) {
                 mSharedElementNotified = true;
                 delayCancel();
+
+                if (!mActivity.isTopOfTask()) {
+                    mResultReceiver.send(MSG_ALLOW_RETURN_TRANSITION, null);
+                }
+
                 if (mListener == null) {
                     mResultReceiver.send(MSG_TAKE_SHARED_ELEMENTS, mSharedElementBundle);
                     notifyExitComplete();
diff --git a/core/java/android/app/FragmentTransition.java b/core/java/android/app/FragmentTransition.java
index ceb828b..0e428ae 100644
--- a/core/java/android/app/FragmentTransition.java
+++ b/core/java/android/app/FragmentTransition.java
@@ -1013,6 +1013,11 @@
                     replaceTargets(sharedElementTransition, sharedElementsIn, null);
                 }
             }
+
+            @Override
+            public void onTransitionEnd(Transition transition) {
+                transition.removeListener(this);
+            }
         });
     }
 
diff --git a/core/java/android/app/NotificationChannel.java b/core/java/android/app/NotificationChannel.java
index 848def6..9f93e17 100644
--- a/core/java/android/app/NotificationChannel.java
+++ b/core/java/android/app/NotificationChannel.java
@@ -603,9 +603,10 @@
     }
 
     /**
-     * @hide
+     * Returns whether the user has chosen the importance of this channel, either to affirm the
+     * initial selection from the app, or changed it to be higher or lower.
      */
-    public boolean isImportanceLocked() {
+    public boolean hasUserSetImportance() {
         return (mUserLockedFields & USER_LOCKED_IMPORTANCE) != 0;
     }
 
diff --git a/core/java/android/app/admin/DevicePolicyManager.java b/core/java/android/app/admin/DevicePolicyManager.java
index 74fb4df..92daf08 100644
--- a/core/java/android/app/admin/DevicePolicyManager.java
+++ b/core/java/android/app/admin/DevicePolicyManager.java
@@ -51,6 +51,7 @@
 import android.graphics.Bitmap;
 import android.net.ProxyInfo;
 import android.net.Uri;
+import android.os.Binder;
 import android.os.Bundle;
 import android.os.Parcelable;
 import android.os.PersistableBundle;
@@ -1898,6 +1899,36 @@
     public static final String ACTION_PROFILE_OWNER_CHANGED =
             "android.app.action.PROFILE_OWNER_CHANGED";
 
+    /** @hide */
+    @Retention(RetentionPolicy.SOURCE)
+    @IntDef(flag = true, prefix = {"PRIVATE_DNS_MODE_"}, value = {
+            PRIVATE_DNS_MODE_UNKNOWN,
+            PRIVATE_DNS_MODE_OFF,
+            PRIVATE_DNS_MODE_OPPORTUNISTIC,
+            PRIVATE_DNS_MODE_PROVIDER_HOSTNAME
+    })
+    public @interface PrivateDnsMode {}
+
+    /**
+     * Specifies that the Private DNS setting is in an unknown state.
+     */
+    public static final int PRIVATE_DNS_MODE_UNKNOWN = 0;
+
+    /**
+     * Specifies that Private DNS was turned off completely.
+     */
+    public static final int PRIVATE_DNS_MODE_OFF = 1;
+
+    /**
+     * Specifies that the device owner requested opportunistic DNS over TLS
+     */
+    public static final int PRIVATE_DNS_MODE_OPPORTUNISTIC = 2;
+
+    /**
+     * Specifies that the device owner configured a specific host to use for Private DNS.
+     */
+    public static final int PRIVATE_DNS_MODE_PROVIDER_HOSTNAME = 3;
+
     /**
      * Return true if the given administrator component is currently active (enabled) in the system.
      *
@@ -5756,7 +5787,8 @@
         }
         if (mService != null) {
             try {
-                return mService.checkDeviceIdentifierAccess(packageName, userId);
+                return mService.checkDeviceIdentifierAccess(packageName, userId,
+                        Binder.getCallingPid(), Binder.getCallingUid());
             } catch (RemoteException re) {
                 throw re.rethrowFromSystemServer();
             }
@@ -9754,4 +9786,80 @@
             throw re.rethrowFromSystemServer();
         }
     }
+
+
+    /**
+     * Sets the global Private DNS mode and host to be used.
+     * May only be called by the device owner.
+     *
+     * @param admin which {@link DeviceAdminReceiver} this request is associated with.
+     * @param mode Which mode to set - either {@code PRIVATE_DNS_MODE_OPPORTUNISTIC} or
+     *             {@code PRIVATE_DNS_MODE_PROVIDER_HOSTNAME}.
+     *             Since the opportunistic mode defaults to ordinary DNS lookups, the
+     *             option to turn it completely off is not available, so this method
+     *             may not be called with {@code PRIVATE_DNS_MODE_OFF}.
+     * @param privateDnsHost The hostname of a server that implements DNS over TLS (RFC7858), if
+     *                       {@code PRIVATE_DNS_MODE_PROVIDER_HOSTNAME} was specified as the mode,
+     *                       null otherwise.
+     * @throws IllegalArgumentException in the following cases: if a {@code privateDnsHost} was
+     * provided but the mode was not {@code PRIVATE_DNS_MODE_PROVIDER_HOSTNAME}, if the mode
+     * specified was {@code PRIVATE_DNS_MODE_PROVIDER_HOSTNAME} but {@code privateDnsHost} does
+     * not look like a valid hostname, or if the mode specified is not one of the two valid modes.
+     *
+     * @throws SecurityException if the caller is not the device owner.
+     */
+    public void setGlobalPrivateDns(@NonNull ComponentName admin,
+            @PrivateDnsMode int mode, @Nullable String privateDnsHost) {
+        throwIfParentInstance("setGlobalPrivateDns");
+        if (mService == null) {
+            return;
+        }
+
+        try {
+            mService.setGlobalPrivateDns(admin, mode, privateDnsHost);
+        } catch (RemoteException re) {
+            throw re.rethrowFromSystemServer();
+        }
+    }
+
+    /**
+     * Returns the system-wide Private DNS mode.
+     *
+     * @param admin which {@link DeviceAdminReceiver} this request is associated with.
+     * @return one of {@code PRIVATE_DNS_MODE_OFF}, {@code PRIVATE_DNS_MODE_OPPORTUNISTIC},
+     * {@code PRIVATE_DNS_MODE_PROVIDER_HOSTNAME} or {@code PRIVATE_DNS_MODE_UNKNOWN}.
+     * @throws SecurityException if the caller is not the device owner.
+     */
+    public int getGlobalPrivateDnsMode(@NonNull ComponentName admin) {
+        throwIfParentInstance("setGlobalPrivateDns");
+        if (mService == null) {
+            return PRIVATE_DNS_MODE_UNKNOWN;
+        }
+
+        try {
+            return mService.getGlobalPrivateDnsMode(admin);
+        } catch (RemoteException re) {
+            throw re.rethrowFromSystemServer();
+        }
+    }
+
+    /**
+     * Returns the system-wide Private DNS host.
+     *
+     * @param admin which {@link DeviceAdminReceiver} this request is associated with.
+     * @return The hostname used for Private DNS queries.
+     * @throws SecurityException if the caller is not the device owner.
+     */
+    public String getGlobalPrivateDnsHost(@NonNull ComponentName admin) {
+        throwIfParentInstance("setGlobalPrivateDns");
+        if (mService == null) {
+            return null;
+        }
+
+        try {
+            return mService.getGlobalPrivateDnsHost(admin);
+        } catch (RemoteException re) {
+            throw re.rethrowFromSystemServer();
+        }
+    }
 }
diff --git a/core/java/android/app/admin/IDevicePolicyManager.aidl b/core/java/android/app/admin/IDevicePolicyManager.aidl
index 5e45450..ce1f4ef 100644
--- a/core/java/android/app/admin/IDevicePolicyManager.aidl
+++ b/core/java/android/app/admin/IDevicePolicyManager.aidl
@@ -153,7 +153,7 @@
     void clearProfileOwner(in ComponentName who);
     boolean hasUserSetupCompleted();
 
-    boolean checkDeviceIdentifierAccess(in String packageName, int userHandle);
+    boolean checkDeviceIdentifierAccess(in String packageName, int userHandle, int pid, int uid);
 
     void setDeviceOwnerLockScreenInfo(in ComponentName who, CharSequence deviceOwnerInfo);
     CharSequence getDeviceOwnerLockScreenInfo();
@@ -413,4 +413,8 @@
     boolean isOverrideApnEnabled(in ComponentName admin);
 
     boolean isMeteredDataDisabledPackageForUser(in ComponentName admin, String packageName, int userId);
+
+    void setGlobalPrivateDns(in ComponentName admin, int mode, in String privateDnsHost);
+    int getGlobalPrivateDnsMode(in ComponentName admin);
+    String getGlobalPrivateDnsHost(in ComponentName admin);
 }
diff --git a/core/java/android/bluetooth/BluetoothA2dpSink.java b/core/java/android/bluetooth/BluetoothA2dpSink.java
index fda2f89..cb996f3 100755
--- a/core/java/android/bluetooth/BluetoothA2dpSink.java
+++ b/core/java/android/bluetooth/BluetoothA2dpSink.java
@@ -24,6 +24,7 @@
 import android.os.Binder;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -183,7 +184,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth A2DP Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothAvrcpController.java b/core/java/android/bluetooth/BluetoothAvrcpController.java
index e7c8944..c447868 100644
--- a/core/java/android/bluetooth/BluetoothAvrcpController.java
+++ b/core/java/android/bluetooth/BluetoothAvrcpController.java
@@ -23,6 +23,7 @@
 import android.os.Binder;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -138,7 +139,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth AVRCP Controller Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothGatt.java b/core/java/android/bluetooth/BluetoothGatt.java
index 9b7c173..d616b8f 100644
--- a/core/java/android/bluetooth/BluetoothGatt.java
+++ b/core/java/android/bluetooth/BluetoothGatt.java
@@ -57,6 +57,7 @@
     private int mAuthRetryState;
     private int mConnState;
     private final Object mStateLock = new Object();
+    private final Object mDeviceBusyLock = new Object();
     @UnsupportedAppUsage
     private Boolean mDeviceBusy = false;
     @UnsupportedAppUsage
@@ -282,7 +283,7 @@
                         }
                     }
 
-                    synchronized (mDeviceBusy) {
+                    synchronized (mDeviceBusyLock) {
                         mDeviceBusy = false;
                     }
                 }
@@ -357,7 +358,7 @@
                         return;
                     }
 
-                    synchronized (mDeviceBusy) {
+                    synchronized (mDeviceBusyLock) {
                         mDeviceBusy = false;
                     }
 
@@ -413,7 +414,7 @@
                         return;
                     }
 
-                    synchronized (mDeviceBusy) {
+                    synchronized (mDeviceBusyLock) {
                         mDeviceBusy = false;
                     }
 
@@ -496,7 +497,7 @@
                         return;
                     }
 
-                    synchronized (mDeviceBusy) {
+                    synchronized (mDeviceBusyLock) {
                         mDeviceBusy = false;
                     }
 
@@ -547,7 +548,7 @@
                         return;
                     }
 
-                    synchronized (mDeviceBusy) {
+                    synchronized (mDeviceBusyLock) {
                         mDeviceBusy = false;
                     }
 
@@ -596,7 +597,7 @@
                         return;
                     }
 
-                    synchronized (mDeviceBusy) {
+                    synchronized (mDeviceBusyLock) {
                         mDeviceBusy = false;
                     }
 
@@ -1098,7 +1099,7 @@
         BluetoothDevice device = service.getDevice();
         if (device == null) return false;
 
-        synchronized (mDeviceBusy) {
+        synchronized (mDeviceBusyLock) {
             if (mDeviceBusy) return false;
             mDeviceBusy = true;
         }
@@ -1132,7 +1133,7 @@
         if (VDBG) Log.d(TAG, "readUsingCharacteristicUuid() - uuid: " + uuid);
         if (mService == null || mClientIf == 0) return false;
 
-        synchronized (mDeviceBusy) {
+        synchronized (mDeviceBusyLock) {
             if (mDeviceBusy) return false;
             mDeviceBusy = true;
         }
@@ -1178,7 +1179,7 @@
         BluetoothDevice device = service.getDevice();
         if (device == null) return false;
 
-        synchronized (mDeviceBusy) {
+        synchronized (mDeviceBusyLock) {
             if (mDeviceBusy) return false;
             mDeviceBusy = true;
         }
@@ -1221,7 +1222,7 @@
         BluetoothDevice device = service.getDevice();
         if (device == null) return false;
 
-        synchronized (mDeviceBusy) {
+        synchronized (mDeviceBusyLock) {
             if (mDeviceBusy) return false;
             mDeviceBusy = true;
         }
@@ -1262,7 +1263,7 @@
         BluetoothDevice device = service.getDevice();
         if (device == null) return false;
 
-        synchronized (mDeviceBusy) {
+        synchronized (mDeviceBusyLock) {
             if (mDeviceBusy) return false;
             mDeviceBusy = true;
         }
@@ -1330,7 +1331,7 @@
         if (VDBG) Log.d(TAG, "executeReliableWrite() - device: " + mDevice.getAddress());
         if (mService == null || mClientIf == 0) return false;
 
-        synchronized (mDeviceBusy) {
+        synchronized (mDeviceBusyLock) {
             if (mDeviceBusy) return false;
             mDeviceBusy = true;
         }
diff --git a/core/java/android/bluetooth/BluetoothHeadsetClient.java b/core/java/android/bluetooth/BluetoothHeadsetClient.java
index ec18d42..549c1fa 100644
--- a/core/java/android/bluetooth/BluetoothHeadsetClient.java
+++ b/core/java/android/bluetooth/BluetoothHeadsetClient.java
@@ -25,6 +25,7 @@
 import android.os.Bundle;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -428,7 +429,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth Headset Client Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothHealth.java b/core/java/android/bluetooth/BluetoothHealth.java
index b967fb2..22d41d9 100644
--- a/core/java/android/bluetooth/BluetoothHealth.java
+++ b/core/java/android/bluetooth/BluetoothHealth.java
@@ -24,6 +24,7 @@
 import android.os.IBinder;
 import android.os.ParcelFileDescriptor;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -491,7 +492,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth Health Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothHearingAid.java b/core/java/android/bluetooth/BluetoothHearingAid.java
index 606f00a..47c4ee6 100644
--- a/core/java/android/bluetooth/BluetoothHearingAid.java
+++ b/core/java/android/bluetooth/BluetoothHearingAid.java
@@ -29,6 +29,7 @@
 import android.os.Binder;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import com.android.internal.annotations.GuardedBy;
@@ -205,7 +206,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                android.os.Process.myUserHandle())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth Hearing Aid Service with " + intent);
             return;
         }
diff --git a/core/java/android/bluetooth/BluetoothHidDevice.java b/core/java/android/bluetooth/BluetoothHidDevice.java
index 3bc8544..e44f36e 100644
--- a/core/java/android/bluetooth/BluetoothHidDevice.java
+++ b/core/java/android/bluetooth/BluetoothHidDevice.java
@@ -24,6 +24,7 @@
 import android.content.ServiceConnection;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -454,7 +455,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth HID Device Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothHidHost.java b/core/java/android/bluetooth/BluetoothHidHost.java
index 0ca39f1..58a2522 100644
--- a/core/java/android/bluetooth/BluetoothHidHost.java
+++ b/core/java/android/bluetooth/BluetoothHidHost.java
@@ -25,6 +25,7 @@
 import android.os.Binder;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -279,7 +280,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth HID Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothMap.java b/core/java/android/bluetooth/BluetoothMap.java
index 98c23c6..fc5f830 100644
--- a/core/java/android/bluetooth/BluetoothMap.java
+++ b/core/java/android/bluetooth/BluetoothMap.java
@@ -24,6 +24,7 @@
 import android.os.Binder;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -110,7 +111,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth MAP Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothMapClient.java b/core/java/android/bluetooth/BluetoothMapClient.java
index 559a59b..1c82e19 100644
--- a/core/java/android/bluetooth/BluetoothMapClient.java
+++ b/core/java/android/bluetooth/BluetoothMapClient.java
@@ -25,6 +25,7 @@
 import android.net.Uri;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -128,7 +129,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth MAP MCE Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothPan.java b/core/java/android/bluetooth/BluetoothPan.java
index 58be732..8923d73 100644
--- a/core/java/android/bluetooth/BluetoothPan.java
+++ b/core/java/android/bluetooth/BluetoothPan.java
@@ -26,6 +26,7 @@
 import android.os.Binder;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -150,7 +151,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth Pan Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothPbap.java b/core/java/android/bluetooth/BluetoothPbap.java
index ae264e1..a601df0 100644
--- a/core/java/android/bluetooth/BluetoothPbap.java
+++ b/core/java/android/bluetooth/BluetoothPbap.java
@@ -24,6 +24,7 @@
 import android.content.ServiceConnection;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -164,7 +165,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth Pbap Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothPbapClient.java b/core/java/android/bluetooth/BluetoothPbapClient.java
index 1446adc..cbc96c0 100644
--- a/core/java/android/bluetooth/BluetoothPbapClient.java
+++ b/core/java/android/bluetooth/BluetoothPbapClient.java
@@ -23,6 +23,7 @@
 import android.os.Binder;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -116,7 +117,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth PBAP Client Service with " + intent);
             return false;
         }
diff --git a/core/java/android/bluetooth/BluetoothSap.java b/core/java/android/bluetooth/BluetoothSap.java
index 1b73206..ebf6bed 100644
--- a/core/java/android/bluetooth/BluetoothSap.java
+++ b/core/java/android/bluetooth/BluetoothSap.java
@@ -24,6 +24,7 @@
 import android.os.Binder;
 import android.os.IBinder;
 import android.os.RemoteException;
+import android.os.UserHandle;
 import android.util.Log;
 
 import java.util.ArrayList;
@@ -148,7 +149,7 @@
         ComponentName comp = intent.resolveSystemService(mContext.getPackageManager(), 0);
         intent.setComponent(comp);
         if (comp == null || !mContext.bindServiceAsUser(intent, mConnection, 0,
-                mContext.getUser())) {
+                UserHandle.CURRENT_OR_SELF)) {
             Log.e(TAG, "Could not bind to Bluetooth SAP Service with " + intent);
             return false;
         }
diff --git a/core/java/android/content/ContentProvider.java b/core/java/android/content/ContentProvider.java
index 2a03787..145c9273 100644
--- a/core/java/android/content/ContentProvider.java
+++ b/core/java/android/content/ContentProvider.java
@@ -822,6 +822,48 @@
     }
 
     /**
+     * Opaque token representing the identity of an incoming IPC.
+     */
+    public final class CallingIdentity {
+        /** {@hide} */
+        public final long binderToken;
+        /** {@hide} */
+        public final String callingPackage;
+
+        /** {@hide} */
+        public CallingIdentity(long binderToken, String callingPackage) {
+            this.binderToken = binderToken;
+            this.callingPackage = callingPackage;
+        }
+    }
+
+    /**
+     * Reset the identity of the incoming IPC on the current thread.
+     * <p>
+     * Internally this calls {@link Binder#clearCallingIdentity()} and also
+     * clears any value stored in {@link #getCallingPackage()}.
+     *
+     * @return Returns an opaque token that can be used to restore the original
+     *         calling identity by passing it to
+     *         {@link #restoreCallingIdentity}.
+     */
+    public final @NonNull CallingIdentity clearCallingIdentity() {
+        return new CallingIdentity(Binder.clearCallingIdentity(), setCallingPackage(null));
+    }
+
+    /**
+     * Restore the identity of the incoming IPC on the current thread back to a
+     * previously identity that was returned by {@link #clearCallingIdentity}.
+     * <p>
+     * Internally this calls {@link Binder#restoreCallingIdentity(long)} and
+     * also restores any value stored in {@link #getCallingPackage()}.
+     */
+    public final void restoreCallingIdentity(@NonNull CallingIdentity identity) {
+        Binder.restoreCallingIdentity(identity.binderToken);
+        mCallingPackage.set(identity.callingPackage);
+    }
+
+    /**
      * Change the authorities of the ContentProvider.
      * This is normally set for you from its manifest information when the provider is first
      * created.
diff --git a/core/java/android/content/ContentResolver.java b/core/java/android/content/ContentResolver.java
index c19909d..599c2d2 100644
--- a/core/java/android/content/ContentResolver.java
+++ b/core/java/android/content/ContentResolver.java
@@ -35,6 +35,12 @@
 import android.database.CrossProcessCursorWrapper;
 import android.database.Cursor;
 import android.database.IContentObserver;
+import android.graphics.Bitmap;
+import android.graphics.Canvas;
+import android.graphics.ImageDecoder;
+import android.graphics.ImageDecoder.ImageInfo;
+import android.graphics.ImageDecoder.Source;
+import android.graphics.PixelFormat;
 import android.graphics.Point;
 import android.graphics.drawable.Drawable;
 import android.net.Uri;
@@ -49,9 +55,11 @@
 import android.os.ServiceManager;
 import android.os.SystemClock;
 import android.os.UserHandle;
+import android.provider.DocumentsContract;
 import android.text.TextUtils;
 import android.util.EventLog;
 import android.util.Log;
+import android.util.Size;
 
 import com.android.internal.util.MimeIconUtils;
 import com.android.internal.util.Preconditions;
@@ -68,6 +76,7 @@
 import java.lang.annotation.RetentionPolicy;
 import java.util.ArrayList;
 import java.util.List;
+import java.util.Objects;
 import java.util.Random;
 import java.util.concurrent.atomic.AtomicBoolean;
 
@@ -3188,4 +3197,62 @@
         }
         return query;
     }
+
+    /**
+     * Convenience method that efficiently loads a visual thumbnail for the
+     * given {@link Uri}. Internally calls
+     * {@link ContentProvider#openTypedAssetFile} on the remote provider, but
+     * also defensively resizes any returned content to match the requested
+     * target size.
+     *
+     * @param uri The item that should be visualized as a thumbnail.
+     * @param size The target area on the screen where this thumbnail will be
+     *            shown. This is passed to the provider as {@link #EXTRA_SIZE}
+     *            to help it avoid downloading or generating heavy resources.
+     * @param signal A signal to cancel the operation in progress.
+     * @return Valid {@link Bitmap} which is a visual thumbnail.
+     * @throws IOException If any trouble was encountered while generating or
+     *             loading the thumbnail, or if
+     *             {@link CancellationSignal#cancel()} was invoked.
+     */
+    public @NonNull Bitmap loadThumbnail(@NonNull Uri uri, @NonNull Size size,
+            @Nullable CancellationSignal signal) throws IOException {
+        Objects.requireNonNull(uri);
+        Objects.requireNonNull(size);
+
+        try (ContentProviderClient client = acquireContentProviderClient(uri)) {
+            return loadThumbnail(client, uri, size, signal, ImageDecoder.ALLOCATOR_DEFAULT);
+        }
+    }
+
+    /** {@hide} */
+    public static Bitmap loadThumbnail(@NonNull ContentProviderClient client, @NonNull Uri uri,
+            @NonNull Size size, @Nullable CancellationSignal signal, int allocator)
+            throws IOException {
+        Objects.requireNonNull(client);
+        Objects.requireNonNull(uri);
+        Objects.requireNonNull(size);
+
+        // Convert to Point, since that's what the API is defined as
+        final Bundle opts = new Bundle();
+        opts.putParcelable(EXTRA_SIZE, Point.convert(size));
+
+        return ImageDecoder.decodeBitmap(ImageDecoder.createSource(() -> {
+            return client.openTypedAssetFileDescriptor(uri, "image/*", opts, signal);
+        }), (ImageDecoder decoder, ImageInfo info, Source source) -> {
+            decoder.setAllocator(allocator);
+
+            // One last-ditch check to see if we've been canceled.
+            if (signal != null) signal.throwIfCanceled();
+
+            // We requested a rough thumbnail size, but the remote size may have
+            // returned something giant, so defensively scale down as needed.
+            final int widthSample = info.getSize().getWidth() / size.getWidth();
+            final int heightSample = info.getSize().getHeight() / size.getHeight();
+            final int sample = Math.min(widthSample, heightSample);
+            if (sample > 1) {
+                decoder.setTargetSampleSize(sample);
+            }
+        });
+    }
 }
diff --git a/core/java/android/content/Intent.java b/core/java/android/content/Intent.java
index 8913748..c0463e9 100644
--- a/core/java/android/content/Intent.java
+++ b/core/java/android/content/Intent.java
@@ -4453,7 +4453,6 @@
      *
      * @hide
      */
-    @SystemApi
     public static final String EXTRA_USER_ID = "android.intent.extra.USER_ID";
 
     /**
@@ -5009,8 +5008,7 @@
             "android.intent.extra.user_handle";
 
     /**
-     * The UserHandle carried with broadcasts intents related to addition and removal of managed
-     * profiles - {@link #ACTION_MANAGED_PROFILE_ADDED} and {@link #ACTION_MANAGED_PROFILE_REMOVED}.
+     * The UserHandle carried with intents.
      */
     public static final String EXTRA_USER =
             "android.intent.extra.USER";
diff --git a/core/java/android/hardware/location/ContextHubClient.java b/core/java/android/hardware/location/ContextHubClient.java
index 6609b76..5de89e3 100644
--- a/core/java/android/hardware/location/ContextHubClient.java
+++ b/core/java/android/hardware/location/ContextHubClient.java
@@ -105,12 +105,15 @@
      *
      * This method should be used if the caller wants to receive notifications even after the
      * process exits. The client must have an open connection with the Context Hub Service (i.e. it
-     * cannot have been closed through the {@link #close()} method). If registered successfully,
-     * intents will be delivered regarding events for the specified nanoapp from the attached
-     * Context Hub. Any unicast messages for this client will also be delivered. The intent will
-     * have an extra {@link #EXTRA_EVENT_TYPE} of type {@link ContextHubManager.Event}, which will
-     * contain the type of the event. See {@link ContextHubManager.Event} for description of each
-     * event type.
+     * cannot have been closed through the {@link #close()} method). Only one PendingIntent can be
+     * registered at a time for a single ContextHubClient. If registered successfully, intents will
+     * be delivered regarding events for the specified nanoapp from the attached Context Hub. Any
+     * unicast messages for this client will also be delivered. The intent will have an extra
+     * {@link ContextHubManager.EXTRA_CONTEXT_HUB_INFO} of type {@link ContextHubInfo}, which
+     * describes the Context Hub the intent event was for. The intent will also have an extra
+     * {@link ContextHubManager.EXTRA_EVENT_TYPE} of type {@link ContextHubManager.Event}, which
+     * will contain the type of the event. See {@link ContextHubManager.Event} for description of
+     * each event type, along with event-specific extra fields.
      *
      * When the intent is received, this client can be recreated through
      * {@link ContextHubManager.createClient(PendingIntent, ContextHubInfo,
diff --git a/core/java/android/net/ConnectivityManager.java b/core/java/android/net/ConnectivityManager.java
index 1fbfa40..4714587 100644
--- a/core/java/android/net/ConnectivityManager.java
+++ b/core/java/android/net/ConnectivityManager.java
@@ -2816,10 +2816,11 @@
          * @param network The {@link Network} of the satisfying network.
          * @param networkCapabilities The {@link NetworkCapabilities} of the satisfying network.
          * @param linkProperties The {@link LinkProperties} of the satisfying network.
+         * @param blocked Whether access to the {@link Network} is blocked due to system policy.
          * @hide
          */
         public void onAvailable(Network network, NetworkCapabilities networkCapabilities,
-                LinkProperties linkProperties) {
+                LinkProperties linkProperties, boolean blocked) {
             // Internally only this method is called when a new network is available, and
             // it calls the callback in the same way and order that older versions used
             // to call so as not to change the behavior.
@@ -2830,6 +2831,7 @@
             }
             onCapabilitiesChanged(network, networkCapabilities);
             onLinkPropertiesChanged(network, linkProperties);
+            onBlockedStatusChanged(network, blocked);
         }
 
         /**
@@ -2837,7 +2839,8 @@
          * This callback may be called more than once if the {@link Network} that is
          * satisfying the request changes. This will always immediately be followed by a
          * call to {@link #onCapabilitiesChanged(Network, NetworkCapabilities)} then by a
-         * call to {@link #onLinkPropertiesChanged(Network, LinkProperties)}.
+         * call to {@link #onLinkPropertiesChanged(Network, LinkProperties)}, and a call to
+         * {@link #onBlockedStatusChanged(Network, boolean)}.
          *
          * @param network The {@link Network} of the satisfying network.
          */
@@ -2916,6 +2919,14 @@
          */
         public void onNetworkResumed(Network network) {}
 
+        /**
+         * Called when access to the specified network is blocked or unblocked.
+         *
+         * @param network The {@link Network} whose blocked status has changed.
+         * @param blocked The blocked status of this {@link Network}.
+         */
+        public void onBlockedStatusChanged(Network network, boolean blocked) {}
+
         private NetworkRequest networkRequest;
     }
 
@@ -2962,6 +2973,8 @@
     public static final int CALLBACK_SUSPENDED           = BASE + 9;
     /** @hide */
     public static final int CALLBACK_RESUMED             = BASE + 10;
+    /** @hide */
+    public static final int CALLBACK_BLK_CHANGED         = BASE + 11;
 
     /** @hide */
     public static String getCallbackName(int whichCallback) {
@@ -2976,6 +2989,7 @@
             case EXPIRE_LEGACY_REQUEST: return "EXPIRE_LEGACY_REQUEST";
             case CALLBACK_SUSPENDED:    return "CALLBACK_SUSPENDED";
             case CALLBACK_RESUMED:      return "CALLBACK_RESUMED";
+            case CALLBACK_BLK_CHANGED:  return "CALLBACK_BLK_CHANGED";
             default:
                 return Integer.toString(whichCallback);
         }
@@ -3022,7 +3036,7 @@
                 case CALLBACK_AVAILABLE: {
                     NetworkCapabilities cap = getObject(message, NetworkCapabilities.class);
                     LinkProperties lp = getObject(message, LinkProperties.class);
-                    callback.onAvailable(network, cap, lp);
+                    callback.onAvailable(network, cap, lp, message.arg1 != 0);
                     break;
                 }
                 case CALLBACK_LOSING: {
@@ -3055,6 +3069,10 @@
                     callback.onNetworkResumed(network);
                     break;
                 }
+                case CALLBACK_BLK_CHANGED: {
+                    boolean blocked = message.arg1 != 0;
+                    callback.onBlockedStatusChanged(network, blocked);
+                }
             }
         }
 
diff --git a/core/java/android/net/NetworkCapabilities.java b/core/java/android/net/NetworkCapabilities.java
index 12b6f9e..0bdfca7 100644
--- a/core/java/android/net/NetworkCapabilities.java
+++ b/core/java/android/net/NetworkCapabilities.java
@@ -1590,4 +1590,14 @@
         Preconditions.checkArgument(isValidCapability(capability),
                 "NetworkCapability " + capability + "out of range");
     }
+
+    /**
+     * Check if this {@code NetworkCapability} instance is metered.
+     *
+     * @return {@code true} if {@code NET_CAPABILITY_NOT_METERED} is not set on this instance.
+     * @hide
+     */
+    public boolean isMetered() {
+        return !hasCapability(NET_CAPABILITY_NOT_METERED);
+    }
 }
diff --git a/core/java/android/net/NetworkInfo.java b/core/java/android/net/NetworkInfo.java
index d912dd10..1a1d2d334 100644
--- a/core/java/android/net/NetworkInfo.java
+++ b/core/java/android/net/NetworkInfo.java
@@ -202,7 +202,9 @@
      * Return a network-type-specific integer describing the subtype
      * of the network.
      * @return the network subtype
+     * @deprecated Use {@link android.telephony.TelephonyManager#getDataNetworkType} instead.
      */
+    @Deprecated
     public int getSubtype() {
         synchronized (this) {
             return mSubtype;
@@ -243,7 +245,9 @@
     /**
      * Return a human-readable name describing the subtype of the network.
      * @return the name of the network subtype
+     * @deprecated Use {@link android.telephony.TelephonyManager#getDataNetworkType} instead.
      */
+    @Deprecated
     public String getSubtypeName() {
         synchronized (this) {
             return mSubtypeName;
@@ -278,7 +282,15 @@
      * connections and pass data.
      * <p>Always call this before attempting to perform data transactions.
      * @return {@code true} if network connectivity exists, {@code false} otherwise.
+     * @deprecated Apps should instead use the
+     *             {@link android.net.ConnectivityManager.NetworkCallback} API to
+     *             learn about connectivity changes. See
+     *             {@link ConnectivityManager#registerDefaultNetworkCallback} and
+     *             {@link ConnectivityManager#registerNetworkCallback}. These will
+     *             give a more accurate picture of the connectivity state of
+     *             the device and let apps react more easily and quickly to changes.
      */
+    @Deprecated
     public boolean isConnected() {
         synchronized (this) {
             return mState == State.CONNECTED;
@@ -411,7 +423,15 @@
     /**
      * Reports the current fine-grained state of the network.
      * @return the fine-grained state
+     * @deprecated Apps should instead use the
+     *             {@link android.net.ConnectivityManager.NetworkCallback} API to
+     *             learn about connectivity changes. See
+     *             {@link ConnectivityManager#registerDefaultNetworkCallback} and
+     *             {@link ConnectivityManager#registerNetworkCallback}. These will
+     *             give a more accurate picture of the connectivity state of
+     *             the device and let apps react more easily and quickly to changes.
      */
+    @Deprecated
     public DetailedState getDetailedState() {
         synchronized (this) {
             return mDetailedState;
diff --git a/core/java/android/net/NetworkUtils.java b/core/java/android/net/NetworkUtils.java
index 34e9476..c431e40e 100644
--- a/core/java/android/net/NetworkUtils.java
+++ b/core/java/android/net/NetworkUtils.java
@@ -16,8 +16,13 @@
 
 package android.net;
 
+import static android.system.OsConstants.AF_INET;
+import static android.system.OsConstants.AF_INET6;
+
+import android.annotation.NonNull;
 import android.annotation.UnsupportedAppUsage;
 import android.os.Parcel;
+import android.system.Os;
 import android.util.Log;
 import android.util.Pair;
 
@@ -570,4 +575,30 @@
         }
         return routedIPCount;
     }
+
+    private static final int[] ADDRESS_FAMILIES = new int[] {AF_INET, AF_INET6};
+
+    /**
+     * Returns true if the hostname is weakly validated.
+     * @param hostname Name of host to validate.
+     * @return True if it's a valid-ish hostname.
+     *
+     * @hide
+     */
+    public static boolean isWeaklyValidatedHostname(@NonNull String hostname) {
+        // TODO(b/34953048): Use a validation method that permits more accurate,
+        // but still inexpensive, checking of likely valid DNS hostnames.
+        final String weakHostnameRegex = "^[a-zA-Z0-9_.-]+$";
+        if (!hostname.matches(weakHostnameRegex)) {
+            return false;
+        }
+
+        for (int address_family : ADDRESS_FAMILIES) {
+            if (Os.inet_pton(address_family, hostname) != null) {
+                return false;
+            }
+        }
+
+        return true;
+    }
 }
diff --git a/core/java/android/net/Uri.java b/core/java/android/net/Uri.java
index 40465ce..d09f33b 100644
--- a/core/java/android/net/Uri.java
+++ b/core/java/android/net/Uri.java
@@ -1102,19 +1102,18 @@
         public String getHost() {
             @SuppressWarnings("StringEquality")
             boolean cached = (host != NOT_CACHED);
-            return cached ? host
-                    : (host = parseHost());
+            return cached ? host : (host = parseHost());
         }
 
         private String parseHost() {
-            String authority = getEncodedAuthority();
+            final String authority = getEncodedAuthority();
             if (authority == null) {
                 return null;
             }
 
             // Parse out user info and then port.
             int userInfoSeparator = authority.lastIndexOf('@');
-            int portSeparator = authority.indexOf(':', userInfoSeparator);
+            int portSeparator = findPortSeparator(authority);
 
             String encodedHost = portSeparator == NOT_FOUND
                     ? authority.substring(userInfoSeparator + 1)
@@ -1132,16 +1131,8 @@
         }
 
         private int parsePort() {
-            String authority = getEncodedAuthority();
-            if (authority == null) {
-                return -1;
-            }
-
-            // Make sure we look for the port separtor *after* the user info
-            // separator. We have URLs with a ':' in the user info.
-            int userInfoSeparator = authority.lastIndexOf('@');
-            int portSeparator = authority.indexOf(':', userInfoSeparator);
-
+            final String authority = getEncodedAuthority();
+            int portSeparator = findPortSeparator(authority);
             if (portSeparator == NOT_FOUND) {
                 return -1;
             }
@@ -1154,6 +1145,24 @@
                 return -1;
             }
         }
+
+        private int findPortSeparator(String authority) {
+            if (authority == null) {
+                return NOT_FOUND;
+            }
+
+            // Reverse search for the ':' character that breaks as soon as a char that is neither
+            // a colon nor an ascii digit is encountered. Thanks to the goodness of UTF-16 encoding,
+            // it's not possible that a surrogate matches one of these, so this loop can just
+            // look for characters rather than care about code points.
+            for (int i = authority.length() - 1; i >= 0; --i) {
+                final int character = authority.charAt(i);
+                if (':' == character) return i;
+                // Character.isDigit would include non-ascii digits
+                if (character < '0' || character > '9') return NOT_FOUND;
+            }
+            return NOT_FOUND;
+        }
     }
 
     /**
diff --git a/core/java/android/os/Build.java b/core/java/android/os/Build.java
index 412a700..292543c 100644
--- a/core/java/android/os/Build.java
+++ b/core/java/android/os/Build.java
@@ -130,9 +130,9 @@
      * <a href="/training/articles/security-key-attestation.html">key attestation</a> to obtain
      * proof of the device's original identifiers.
      *
-     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE or for the calling package to be the
-     * device or profile owner. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, or for the calling package to be the
+     * device or profile owner and have the READ_PHONE_STATE permission. Profile owner access is
+     * deprecated and will be removed in a future release.
      *
      * @return The serial number if specified.
      */
diff --git a/core/java/android/os/FileUtils.java b/core/java/android/os/FileUtils.java
index a9cb0d9..f71fdd7 100644
--- a/core/java/android/os/FileUtils.java
+++ b/core/java/android/os/FileUtils.java
@@ -1198,6 +1198,19 @@
 
     /** {@hide} */
     public static int translateModeStringToPosix(String mode) {
+        // Sanity check for invalid chars
+        for (int i = 0; i < mode.length(); i++) {
+            switch (mode.charAt(i)) {
+                case 'r':
+                case 'w':
+                case 't':
+                case 'a':
+                    break;
+                default:
+                    throw new IllegalArgumentException("Bad mode: " + mode);
+            }
+        }
+
         int res = 0;
         if (mode.startsWith("rw")) {
             res |= O_RDWR | O_CREAT;
diff --git a/core/java/android/os/GraphicsEnvironment.java b/core/java/android/os/GraphicsEnvironment.java
index df3aae2..0c56d48 100644
--- a/core/java/android/os/GraphicsEnvironment.java
+++ b/core/java/android/os/GraphicsEnvironment.java
@@ -19,6 +19,8 @@
 import android.content.Context;
 import android.content.pm.ApplicationInfo;
 import android.content.pm.PackageManager;
+import android.content.res.AssetFileDescriptor;
+import android.content.res.AssetManager;
 import android.opengl.EGL14;
 import android.os.Build;
 import android.os.SystemProperties;
@@ -27,7 +29,14 @@
 
 import dalvik.system.VMRuntime;
 
+import java.io.BufferedReader;
 import java.io.File;
+import java.io.FileDescriptor;
+import java.io.IOException;
+import java.io.InputStream;
+import java.io.InputStreamReader;
+import java.util.HashSet;
+import java.util.Set;
 
 /** @hide */
 public class GraphicsEnvironment {
@@ -44,8 +53,10 @@
     private static final boolean DEBUG = false;
     private static final String TAG = "GraphicsEnvironment";
     private static final String PROPERTY_GFX_DRIVER = "ro.gfx.driver.0";
+    private static final String PROPERTY_GFX_DRIVER_WHITELIST = "ro.gfx.driver.whitelist.0";
     private static final String ANGLE_PACKAGE_NAME = "com.android.angle";
     private static final String GLES_MODE_METADATA_KEY = "com.android.angle.GLES_MODE";
+    private static final String ANGLE_RULES_FILE = "a4a_rules.json";
 
     private ClassLoader mClassLoader;
     private String mLayerPath;
@@ -242,8 +253,40 @@
 
         if (DEBUG) Log.v(TAG, "ANGLE package libs: " + paths);
 
+        // Pass the rules file to loader for ANGLE decisions
+        AssetManager angleAssets = null;
+        try {
+            angleAssets =
+                context.getPackageManager().getResourcesForApplication(angleInfo).getAssets();
+        } catch (PackageManager.NameNotFoundException e) {
+            Log.w(TAG, "Failed to get AssetManager for '" + ANGLE_PACKAGE_NAME + "'");
+            return;
+        }
+
+        AssetFileDescriptor assetsFd = null;
+        try {
+            assetsFd = angleAssets.openFd(ANGLE_RULES_FILE);
+        } catch (IOException e) {
+            Log.w(TAG, "Failed to get AssetFileDescriptor for " + ANGLE_RULES_FILE + " from "
+                       + "'" + ANGLE_PACKAGE_NAME + "'");
+            return;
+        }
+
+        FileDescriptor rulesFd = null;
+        long rulesOffset = 0;
+        long rulesLength = 0;
+        if (assetsFd != null) {
+            rulesFd = assetsFd.getFileDescriptor();
+            rulesOffset = assetsFd.getStartOffset();
+            rulesLength = assetsFd.getLength();
+        } else {
+            Log.w(TAG, "Failed to get file descriptor for " + ANGLE_RULES_FILE);
+            return;
+        }
+
         // Further opt-in logic is handled in native, so pass relevant info down
-        setAngleInfo(paths, packageName, appPref, devOptIn);
+        setAngleInfo(paths, packageName, appPref, devOptIn,
+                     rulesFd, rulesOffset, rulesLength);
     }
 
     /**
@@ -262,6 +305,15 @@
             if (DEBUG) Log.v(TAG, "ignoring driver package for privileged/non-updated system app");
             return;
         }
+        Set<String> whitelist = loadWhitelist(context, driverPackageName);
+
+        // Empty whitelist implies no updatable graphics driver. Typically, the pre-installed
+        // updatable graphics driver is supposed to be a place holder and contains no graphics
+        // driver and whitelist.
+        if (whitelist == null || whitelist.isEmpty()) {
+            return;
+        }
+
         ApplicationInfo driverInfo;
         try {
             driverInfo = context.getPackageManager().getApplicationInfo(driverPackageName,
@@ -270,6 +322,22 @@
             Log.w(TAG, "driver package '" + driverPackageName + "' not installed");
             return;
         }
+        if (!whitelist.contains(context.getPackageName())) {
+            if (DEBUG) {
+                Log.w(TAG, context.getPackageName() + " is not on the whitelist.");
+            }
+            return;
+        }
+
+        // O drivers are restricted to the sphal linker namespace, so don't try to use
+        // packages unless they declare they're compatible with that restriction.
+        if (driverInfo.targetSdkVersion < Build.VERSION_CODES.O) {
+            if (DEBUG) {
+                Log.w(TAG, "updated driver package is not known to be compatible with O");
+            }
+            return;
+        }
+
         String abi = chooseAbi(driverInfo);
         if (abi == null) {
             if (DEBUG) {
@@ -280,12 +348,6 @@
             }
             return;
         }
-        if (driverInfo.targetSdkVersion < Build.VERSION_CODES.O) {
-            // O drivers are restricted to the sphal linker namespace, so don't try to use
-            // packages unless they declare they're compatible with that restriction.
-            Log.w(TAG, "updated driver package is not known to be compatible with O");
-            return;
-        }
 
         StringBuilder sb = new StringBuilder();
         sb.append(driverInfo.nativeLibraryDir)
@@ -331,10 +393,39 @@
         return null;
     }
 
+    private static Set<String> loadWhitelist(Context context, String driverPackageName) {
+        String whitelistName = SystemProperties.get(PROPERTY_GFX_DRIVER_WHITELIST);
+        if (whitelistName == null || whitelistName.isEmpty()) {
+            return null;
+        }
+        try {
+            Context driverContext = context.createPackageContext(driverPackageName,
+                                                                 Context.CONTEXT_RESTRICTED);
+            AssetManager assets = driverContext.getAssets();
+            InputStream stream = assets.open(whitelistName);
+            BufferedReader reader = new BufferedReader(new InputStreamReader(stream));
+            Set<String> whitelist = new HashSet<>();
+            for (String line; (line = reader.readLine()) != null; ) {
+                whitelist.add(line);
+            }
+            return whitelist;
+        } catch (PackageManager.NameNotFoundException e) {
+            if (DEBUG) {
+                Log.w(TAG, "driver package '" + driverPackageName + "' not installed");
+            }
+        } catch (IOException e) {
+            if (DEBUG) {
+                Log.w(TAG, "Failed to load whitelist driver package, abort.");
+            }
+        }
+        return null;
+    }
+
     private static native int getCanLoadSystemLibraries();
     private static native void setLayerPaths(ClassLoader classLoader, String layerPaths);
     private static native void setDebugLayers(String layers);
     private static native void setDriverPath(String path);
     private static native void setAngleInfo(String path, String appPackage, String appPref,
-                                            boolean devOptIn);
+                                            boolean devOptIn, FileDescriptor rulesFd,
+                                            long rulesOffset, long rulesLength);
 }
diff --git a/core/java/android/os/UserManager.java b/core/java/android/os/UserManager.java
index 7ea2008..00b989e 100644
--- a/core/java/android/os/UserManager.java
+++ b/core/java/android/os/UserManager.java
@@ -272,6 +272,10 @@
      *
      * Specifies if all users on the device are disallowed from enabling the
      * "Unknown Sources" setting, that allows installation of apps from unknown sources.
+     *
+     * This restriction can be enabled by the profile owner, in which case all accounts and
+     * profiles will be affected.
+     *
      * The default value is <code>false</code>.
      *
      * <p>Key for user restrictions.
@@ -983,6 +987,21 @@
     public static final String DISALLOW_PRINTING = "no_printing";
 
     /**
+     * Specifies whether the user is allowed to modify private DNS settings.
+     *
+     * <p>The default value is <code>false</code>.
+     *
+     * <p>This user restriction can only be applied by the Device Owner.
+     * <p>Key for user restrictions.
+     * <p>Type: Boolean
+     * @see DevicePolicyManager#addUserRestriction(ComponentName, String)
+     * @see DevicePolicyManager#clearUserRestriction(ComponentName, String)
+     * @see #getUserRestrictions()
+     */
+    public static final String DISALLOW_CONFIG_PRIVATE_DNS =
+            "disallow_config_private_dns";
+
+    /**
      * Application restriction key that is used to indicate the pending arrival
      * of real restrictions for the app.
      *
diff --git a/core/java/android/os/storage/StorageManager.java b/core/java/android/os/storage/StorageManager.java
index 50ca4ab..df771df 100644
--- a/core/java/android/os/storage/StorageManager.java
+++ b/core/java/android/os/storage/StorageManager.java
@@ -1538,6 +1538,9 @@
      * @hide
      */
     public File translateAppToSystem(File file, String packageName) {
+        // We can only translate absolute paths
+        if (!file.isAbsolute()) return file;
+
         try {
             return new File(mStorageManager.translateAppToSystem(file.getAbsolutePath(),
                     packageName, mContext.getUserId()));
@@ -1553,6 +1556,9 @@
      * @hide
      */
     public File translateSystemToApp(File file, String packageName) {
+        // We can only translate absolute paths
+        if (!file.isAbsolute()) return file;
+
         try {
             return new File(mStorageManager.translateSystemToApp(file.getAbsolutePath(),
                     packageName, mContext.getUserId()));
diff --git a/core/java/android/provider/DocumentsContract.java b/core/java/android/provider/DocumentsContract.java
index 8c40e0e..954d18a 100644
--- a/core/java/android/provider/DocumentsContract.java
+++ b/core/java/android/provider/DocumentsContract.java
@@ -34,6 +34,7 @@
 import android.database.Cursor;
 import android.graphics.Bitmap;
 import android.graphics.BitmapFactory;
+import android.graphics.ImageDecoder;
 import android.graphics.Matrix;
 import android.graphics.Point;
 import android.media.ExifInterface;
@@ -53,6 +54,7 @@
 import android.system.Os;
 import android.util.DataUnit;
 import android.util.Log;
+import android.util.Size;
 
 import libcore.io.IoUtils;
 
@@ -136,10 +138,11 @@
     public static final String EXTRA_EXCLUDE_SELF = "android.provider.extra.EXCLUDE_SELF";
 
     /**
-     * Included in {@link AssetFileDescriptor#getExtras()} when returned
-     * thumbnail should be rotated.
+     * An extra number of degrees that an image should be rotated during the
+     * decode process to be presented correctly.
      *
-     * @see MediaStore.Images.ImageColumns#ORIENTATION
+     * @see AssetFileDescriptor#getExtras()
+     * @see android.provider.MediaStore.Images.ImageColumns#ORIENTATION
      */
     public static final String EXTRA_ORIENTATION = "android.provider.extra.ORIENTATION";
 
@@ -1093,75 +1096,10 @@
 
     /** {@hide} */
     @UnsupportedAppUsage
-    public static Bitmap getDocumentThumbnail(
-            ContentProviderClient client, Uri documentUri, Point size, CancellationSignal signal)
-            throws RemoteException, IOException {
-        final Bundle openOpts = new Bundle();
-        openOpts.putParcelable(ContentResolver.EXTRA_SIZE, size);
-
-        AssetFileDescriptor afd = null;
-        Bitmap bitmap = null;
-        try {
-            afd = client.openTypedAssetFileDescriptor(documentUri, "image/*", openOpts, signal);
-
-            final FileDescriptor fd = afd.getFileDescriptor();
-            final long offset = afd.getStartOffset();
-
-            // Try seeking on the returned FD, since it gives us the most
-            // optimal decode path; otherwise fall back to buffering.
-            BufferedInputStream is = null;
-            try {
-                Os.lseek(fd, offset, SEEK_SET);
-            } catch (ErrnoException e) {
-                is = new BufferedInputStream(new FileInputStream(fd), THUMBNAIL_BUFFER_SIZE);
-                is.mark(THUMBNAIL_BUFFER_SIZE);
-            }
-
-            // We requested a rough thumbnail size, but the remote size may have
-            // returned something giant, so defensively scale down as needed.
-            final BitmapFactory.Options opts = new BitmapFactory.Options();
-            opts.inJustDecodeBounds = true;
-            if (is != null) {
-                BitmapFactory.decodeStream(is, null, opts);
-            } else {
-                BitmapFactory.decodeFileDescriptor(fd, null, opts);
-            }
-
-            final int widthSample = opts.outWidth / size.x;
-            final int heightSample = opts.outHeight / size.y;
-
-            opts.inJustDecodeBounds = false;
-            opts.inSampleSize = Math.min(widthSample, heightSample);
-            if (is != null) {
-                is.reset();
-                bitmap = BitmapFactory.decodeStream(is, null, opts);
-            } else {
-                try {
-                    Os.lseek(fd, offset, SEEK_SET);
-                } catch (ErrnoException e) {
-                    e.rethrowAsIOException();
-                }
-                bitmap = BitmapFactory.decodeFileDescriptor(fd, null, opts);
-            }
-
-            // Transform the bitmap if requested. We use a side-channel to
-            // communicate the orientation, since EXIF thumbnails don't contain
-            // the rotation flags of the original image.
-            final Bundle extras = afd.getExtras();
-            final int orientation = (extras != null) ? extras.getInt(EXTRA_ORIENTATION, 0) : 0;
-            if (orientation != 0) {
-                final int width = bitmap.getWidth();
-                final int height = bitmap.getHeight();
-
-                final Matrix m = new Matrix();
-                m.setRotate(orientation, width / 2, height / 2);
-                bitmap = Bitmap.createBitmap(bitmap, 0, 0, width, height, m, false);
-            }
-        } finally {
-            IoUtils.closeQuietly(afd);
-        }
-
-        return bitmap;
+    public static Bitmap getDocumentThumbnail(ContentProviderClient client, Uri documentUri,
+            Point size, CancellationSignal signal) throws IOException {
+        return ContentResolver.loadThumbnail(client, documentUri, Point.convert(size), signal,
+                ImageDecoder.ALLOCATOR_DEFAULT);
     }
 
     /**
diff --git a/core/java/android/provider/MediaStore.java b/core/java/android/provider/MediaStore.java
index 828fd73..f5660b9 100644
--- a/core/java/android/provider/MediaStore.java
+++ b/core/java/android/provider/MediaStore.java
@@ -29,7 +29,6 @@
 import android.content.Context;
 import android.content.Intent;
 import android.content.UriPermission;
-import android.content.res.AssetFileDescriptor;
 import android.database.Cursor;
 import android.database.DatabaseUtils;
 import android.graphics.Bitmap;
@@ -39,6 +38,7 @@
 import android.os.Bundle;
 import android.os.CancellationSignal;
 import android.os.Environment;
+import android.os.OperationCanceledException;
 import android.os.RemoteException;
 import android.service.media.CameraPrewarmService;
 import android.util.ArrayMap;
@@ -402,7 +402,16 @@
          * access.
          * <p>
          * Type: TEXT
+         *
+         * @deprecated Apps may not have filesystem permissions to directly
+         *             access this path. Instead of trying to open this path
+         *             directly, apps should use
+         *             {@link ContentResolver#openFileDescriptor(Uri, String)}
+         *             to gain access. This value will always be {@code NULL}
+         *             for apps targeting
+         *             {@link android.os.Build.VERSION_CODES#Q} or higher.
          */
+        @Deprecated
         public static final String DATA = "_data";
 
         /**
@@ -641,6 +650,7 @@
      * This class is used internally by Images.Thumbnails and Video.Thumbnails, it's not intended
      * to be accessed elsewhere.
      */
+    @Deprecated
     private static class InternalThumbnails implements BaseColumns {
         /**
          * Currently outstanding thumbnail requests that can be cancelled.
@@ -654,13 +664,14 @@
          *
          * @see #cancelThumbnail(ContentResolver, Uri)
          */
+        @Deprecated
         static @Nullable Bitmap getThumbnail(@NonNull ContentResolver cr, @NonNull Uri uri,
                 int kind, @Nullable BitmapFactory.Options opts) {
-            final Bundle openOpts = new Bundle();
+            final Point size;
             if (kind == ThumbnailConstants.MICRO_KIND) {
-                openOpts.putParcelable(ContentResolver.EXTRA_SIZE, ThumbnailConstants.MICRO_SIZE);
+                size = ThumbnailConstants.MICRO_SIZE;
             } else if (kind == ThumbnailConstants.MINI_KIND) {
-                openOpts.putParcelable(ContentResolver.EXTRA_SIZE, ThumbnailConstants.MINI_SIZE);
+                size = ThumbnailConstants.MINI_SIZE;
             } else {
                 throw new IllegalArgumentException("Unsupported kind: " + kind);
             }
@@ -674,9 +685,8 @@
                 }
             }
 
-            try (AssetFileDescriptor afd = cr.openTypedAssetFileDescriptor(uri,
-                    "image/*", openOpts, signal)) {
-                return BitmapFactory.decodeFileDescriptor(afd.getFileDescriptor(), null, opts);
+            try {
+                return cr.loadThumbnail(uri, Point.convert(size), signal);
             } catch (IOException e) {
                 Log.w(TAG, "Failed to obtain thumbnail for " + uri, e);
                 return null;
@@ -693,6 +703,7 @@
          * Only the original process which made the request can cancel their own
          * requests.
          */
+        @Deprecated
         static void cancelThumbnail(@NonNull ContentResolver cr, @NonNull Uri uri) {
             synchronized (sPending) {
                 final CancellationSignal signal = sPending.get(uri);
@@ -936,9 +947,8 @@
         }
 
         /**
-         * This class allows developers to query and get two kinds of thumbnails:
-         * MINI_KIND: 512 x 384 thumbnail
-         * MICRO_KIND: 96 x 96 thumbnail
+         * This class provides utility methods to obtain thumbnails for various
+         * {@link Images} items.
          */
         public static class Thumbnails implements BaseColumns {
             public static final Cursor query(ContentResolver cr, Uri uri, String[] projection) {
@@ -958,13 +968,19 @@
             }
 
             /**
-             * This method cancels the thumbnail request so clients waiting for getThumbnail will be
-             * interrupted and return immediately. Only the original process which made the getThumbnail
-             * requests can cancel their own requests.
+             * Cancel any outstanding {@link #getThumbnail} requests, causing
+             * them to return by throwing a {@link OperationCanceledException}.
+             * <p>
+             * This method has no effect on
+             * {@link ContentResolver#loadThumbnail} calls, since they provide
+             * their own {@link CancellationSignal}.
              *
-             * @param cr ContentResolver
-             * @param origId original image id
+             * @deprecated Callers should migrate to using
+             *             {@link ContentResolver#loadThumbnail}, since it
+             *             offers richer control over requested thumbnail sizes
+             *             and cancellation behavior.
              */
+            @Deprecated
             public static void cancelThumbnailRequest(ContentResolver cr, long origId) {
                 final Uri uri = ContentUris.withAppendedId(
                         Images.Media.EXTERNAL_CONTENT_URI, origId);
@@ -972,51 +988,66 @@
             }
 
             /**
-             * This method checks if the thumbnails of the specified image (origId) has been created.
-             * It will be blocked until the thumbnails are generated.
+             * Return thumbnail representing a specific image item. If a
+             * thumbnail doesn't exist, this method will block until it's
+             * generated. Callers are responsible for their own in-memory
+             * caching of returned values.
              *
-             * @param cr ContentResolver used to dispatch queries to MediaProvider.
-             * @param origId Original image id associated with thumbnail of interest.
-             * @param kind The type of thumbnail to fetch. Should be either MINI_KIND or MICRO_KIND.
-             * @param options this is only used for MINI_KIND when decoding the Bitmap
-             * @return A Bitmap instance. It could be null if the original image
-             *         associated with origId doesn't exist or memory is not enough.
+             * @param imageId the image item to obtain a thumbnail for.
+             * @param kind optimal thumbnail size desired.
+             * @return decoded thumbnail, or {@code null} if problem was
+             *         encountered.
+             * @deprecated Callers should migrate to using
+             *             {@link ContentResolver#loadThumbnail}, since it
+             *             offers richer control over requested thumbnail sizes
+             *             and cancellation behavior.
              */
-            public static Bitmap getThumbnail(ContentResolver cr, long origId, int kind,
+            @Deprecated
+            public static Bitmap getThumbnail(ContentResolver cr, long imageId, int kind,
                     BitmapFactory.Options options) {
                 final Uri uri = ContentUris.withAppendedId(
-                        Images.Media.EXTERNAL_CONTENT_URI, origId);
+                        Images.Media.EXTERNAL_CONTENT_URI, imageId);
                 return InternalThumbnails.getThumbnail(cr, uri, kind, options);
             }
 
             /**
-             * This method cancels the thumbnail request so clients waiting for getThumbnail will be
-             * interrupted and return immediately. Only the original process which made the getThumbnail
-             * requests can cancel their own requests.
+             * Cancel any outstanding {@link #getThumbnail} requests, causing
+             * them to return by throwing a {@link OperationCanceledException}.
+             * <p>
+             * This method has no effect on
+             * {@link ContentResolver#loadThumbnail} calls, since they provide
+             * their own {@link CancellationSignal}.
              *
-             * @param cr ContentResolver
-             * @param origId original image id
-             * @param groupId the same groupId used in getThumbnail.
+             * @deprecated Callers should migrate to using
+             *             {@link ContentResolver#loadThumbnail}, since it
+             *             offers richer control over requested thumbnail sizes
+             *             and cancellation behavior.
              */
-            public static void cancelThumbnailRequest(ContentResolver cr, long origId, long groupId) {
+            @Deprecated
+            public static void cancelThumbnailRequest(ContentResolver cr, long origId,
+                    long groupId) {
                 cancelThumbnailRequest(cr, origId);
             }
 
             /**
-             * This method checks if the thumbnails of the specified image (origId) has been created.
-             * It will be blocked until the thumbnails are generated.
+             * Return thumbnail representing a specific image item. If a
+             * thumbnail doesn't exist, this method will block until it's
+             * generated. Callers are responsible for their own in-memory
+             * caching of returned values.
              *
-             * @param cr ContentResolver used to dispatch queries to MediaProvider.
-             * @param origId Original image id associated with thumbnail of interest.
-             * @param groupId the id of group to which this request belongs
-             * @param kind The type of thumbnail to fetch. Should be either MINI_KIND or MICRO_KIND.
-             * @param options this is only used for MINI_KIND when decoding the Bitmap
-             * @return A Bitmap instance. It could be null if the original image
-             *         associated with origId doesn't exist or memory is not enough.
+             * @param imageId the image item to obtain a thumbnail for.
+             * @param kind optimal thumbnail size desired.
+             * @return decoded thumbnail, or {@code null} if problem was
+             *         encountered.
+             * @deprecated Callers should migrate to using
+             *             {@link ContentResolver#loadThumbnail}, since it
+             *             offers richer control over requested thumbnail sizes
+             *             and cancellation behavior.
              */
-            public static Bitmap getThumbnail(ContentResolver cr, long origId, long groupId,
+            @Deprecated
+            public static Bitmap getThumbnail(ContentResolver cr, long imageId, long groupId,
                     int kind, BitmapFactory.Options options) {
-                return getThumbnail(cr, origId, kind, options);
+                return getThumbnail(cr, imageId, kind, options);
             }
 
             /**
@@ -1059,7 +1090,16 @@
              * access.
              * <p>
              * Type: TEXT
+             *
+             * @deprecated Apps may not have filesystem permissions to directly
+             *             access this path. Instead of trying to open this path
+             *             directly, apps should use
+             *             {@link ContentResolver#loadThumbnail}
+             *             to gain access. This value will always be
+             *             {@code NULL} for apps targeting
+             *             {@link android.os.Build.VERSION_CODES#Q} or higher.
              */
+            @Deprecated
             public static final String DATA = "_data";
 
             /**
@@ -1509,7 +1549,16 @@
              * access.
              * <p>
              * Type: TEXT
+             *
+             * @deprecated Apps may not have filesystem permissions to directly
+             *             access this path. Instead of trying to open this path
+             *             directly, apps should use
+             *             {@link ContentResolver#openFileDescriptor(Uri, String)}
+             *             to gain access. This value will always be
+             *             {@code NULL} for apps targeting
+             *             {@link android.os.Build.VERSION_CODES#Q} or higher.
              */
+            @Deprecated
             public static final String DATA = "_data";
 
             /**
@@ -1790,7 +1839,16 @@
             /**
              * Cached album art.
              * <P>Type: TEXT</P>
+             *
+             * @deprecated Apps may not have filesystem permissions to directly
+             *             access this path. Instead of trying to open this path
+             *             directly, apps should use
+             *             {@link ContentResolver#loadThumbnail}
+             *             to gain access. This value will always be
+             *             {@code NULL} for apps targeting
+             *             {@link android.os.Build.VERSION_CODES#Q} or higher.
              */
+            @Deprecated
             public static final String ALBUM_ART = "album_art";
         }
 
@@ -2009,20 +2067,24 @@
         }
 
         /**
-         * This class allows developers to query and get two kinds of thumbnails:
-         * MINI_KIND: 512 x 384 thumbnail
-         * MICRO_KIND: 96 x 96 thumbnail
-         *
+         * This class provides utility methods to obtain thumbnails for various
+         * {@link Video} items.
          */
         public static class Thumbnails implements BaseColumns {
             /**
-             * This method cancels the thumbnail request so clients waiting for getThumbnail will be
-             * interrupted and return immediately. Only the original process which made the getThumbnail
-             * requests can cancel their own requests.
+             * Cancel any outstanding {@link #getThumbnail} requests, causing
+             * them to return by throwing a {@link OperationCanceledException}.
+             * <p>
+             * This method has no effect on
+             * {@link ContentResolver#loadThumbnail} calls, since they provide
+             * their own {@link CancellationSignal}.
              *
-             * @param cr ContentResolver
-             * @param origId original video id
+             * @deprecated Callers should migrate to using
+             *             {@link ContentResolver#loadThumbnail}, since it
+             *             offers richer control over requested thumbnail sizes
+             *             and cancellation behavior.
              */
+            @Deprecated
             public static void cancelThumbnailRequest(ContentResolver cr, long origId) {
                 final Uri uri = ContentUris.withAppendedId(
                         Video.Media.EXTERNAL_CONTENT_URI, origId);
@@ -2030,51 +2092,66 @@
             }
 
             /**
-             * This method checks if the thumbnails of the specified image (origId) has been created.
-             * It will be blocked until the thumbnails are generated.
+             * Return thumbnail representing a specific video item. If a
+             * thumbnail doesn't exist, this method will block until it's
+             * generated. Callers are responsible for their own in-memory
+             * caching of returned values.
              *
-             * @param cr ContentResolver used to dispatch queries to MediaProvider.
-             * @param origId Original image id associated with thumbnail of interest.
-             * @param kind The type of thumbnail to fetch. Should be either MINI_KIND or MICRO_KIND.
-             * @param options this is only used for MINI_KIND when decoding the Bitmap
-             * @return A Bitmap instance. It could be null if the original image
-             *         associated with origId doesn't exist or memory is not enough.
+             * @param videoId the video item to obtain a thumbnail for.
+             * @param kind optimal thumbnail size desired.
+             * @return decoded thumbnail, or {@code null} if problem was
+             *         encountered.
+             * @deprecated Callers should migrate to using
+             *             {@link ContentResolver#loadThumbnail}, since it
+             *             offers richer control over requested thumbnail sizes
+             *             and cancellation behavior.
              */
-            public static Bitmap getThumbnail(ContentResolver cr, long origId, int kind,
+            @Deprecated
+            public static Bitmap getThumbnail(ContentResolver cr, long videoId, int kind,
                     BitmapFactory.Options options) {
                 final Uri uri = ContentUris.withAppendedId(
-                        Video.Media.EXTERNAL_CONTENT_URI, origId);
+                        Video.Media.EXTERNAL_CONTENT_URI, videoId);
                 return InternalThumbnails.getThumbnail(cr, uri, kind, options);
             }
 
             /**
-             * This method checks if the thumbnails of the specified image (origId) has been created.
-             * It will be blocked until the thumbnails are generated.
+             * Cancel any outstanding {@link #getThumbnail} requests, causing
+             * them to return by throwing a {@link OperationCanceledException}.
+             * <p>
+             * This method has no effect on
+             * {@link ContentResolver#loadThumbnail} calls, since they provide
+             * their own {@link CancellationSignal}.
              *
-             * @param cr ContentResolver used to dispatch queries to MediaProvider.
-             * @param origId Original image id associated with thumbnail of interest.
-             * @param groupId the id of group to which this request belongs
-             * @param kind The type of thumbnail to fetch. Should be either MINI_KIND or MICRO_KIND
-             * @param options this is only used for MINI_KIND when decoding the Bitmap
-             * @return A Bitmap instance. It could be null if the original image associated with
-             *         origId doesn't exist or memory is not enough.
+             * @deprecated Callers should migrate to using
+             *             {@link ContentResolver#loadThumbnail}, since it
+             *             offers richer control over requested thumbnail sizes
+             *             and cancellation behavior.
              */
-            public static Bitmap getThumbnail(ContentResolver cr, long origId, long groupId,
-                    int kind, BitmapFactory.Options options) {
-                return getThumbnail(cr, origId, kind, options);
+            @Deprecated
+            public static void cancelThumbnailRequest(ContentResolver cr, long videoId,
+                    long groupId) {
+                cancelThumbnailRequest(cr, videoId);
             }
 
             /**
-             * This method cancels the thumbnail request so clients waiting for getThumbnail will be
-             * interrupted and return immediately. Only the original process which made the getThumbnail
-             * requests can cancel their own requests.
+             * Return thumbnail representing a specific video item. If a
+             * thumbnail doesn't exist, this method will block until it's
+             * generated. Callers are responsible for their own in-memory
+             * caching of returned values.
              *
-             * @param cr ContentResolver
-             * @param origId original video id
-             * @param groupId the same groupId used in getThumbnail.
+             * @param videoId the video item to obtain a thumbnail for.
+             * @param kind optimal thumbnail size desired.
+             * @return decoded thumbnail, or {@code null} if problem was
+             *         encountered.
+             * @deprecated Callers should migrate to using
+             *             {@link ContentResolver#loadThumbnail}, since it
+             *             offers richer control over requested thumbnail sizes
+             *             and cancellation behavior.
              */
-            public static void cancelThumbnailRequest(ContentResolver cr, long origId, long groupId) {
-                cancelThumbnailRequest(cr, origId);
+            @Deprecated
+            public static Bitmap getThumbnail(ContentResolver cr, long videoId, long groupId,
+                    int kind, BitmapFactory.Options options) {
+                return getThumbnail(cr, videoId, kind, options);
             }
 
             /**
@@ -2110,14 +2187,17 @@
             /**
              * Path to the thumbnail file on disk.
              * <p>
-             * Note that apps may not have filesystem permissions to directly
-             * access this path. Instead of trying to open this path directly,
-             * apps should use
-             * {@link ContentResolver#openFileDescriptor(Uri, String)} to gain
-             * access.
-             * <p>
              * Type: TEXT
+             *
+             * @deprecated Apps may not have filesystem permissions to directly
+             *             access this path. Instead of trying to open this path
+             *             directly, apps should use
+             *             {@link ContentResolver#openFileDescriptor(Uri, String)}
+             *             to gain access. This value will always be
+             *             {@code NULL} for apps targeting
+             *             {@link android.os.Build.VERSION_CODES#Q} or higher.
              */
+            @Deprecated
             public static final String DATA = "_data";
 
             /**
diff --git a/core/java/android/provider/Settings.java b/core/java/android/provider/Settings.java
index c6e4574..ad64021 100644
--- a/core/java/android/provider/Settings.java
+++ b/core/java/android/provider/Settings.java
@@ -1473,12 +1473,13 @@
      * <p> If an user action is disabled by policy, this dialog can be triggered to let
      * the user know about this.
      * <p>
-     * Input: Nothing.
+     * Input: {@link Intent#EXTRA_USER}: The user of the admin.
      * <p>
      * Output: Nothing.
      *
      * @hide
      */
+    // Intent#EXTRA_USER_ID can also be used
     @SystemApi
     @SdkConstant(SdkConstantType.ACTIVITY_INTENT_ACTION)
     public static final String ACTION_SHOW_ADMIN_SUPPORT_DETAILS
@@ -1613,6 +1614,11 @@
     public static final String CALL_METHOD_GET_GLOBAL = "GET_global";
 
     /**
+     * @hide - Private call() method on SettingsProvider to read from 'config' table.
+     */
+    public static final String CALL_METHOD_GET_CONFIG = "GET_config";
+
+    /**
      * @hide - Specifies that the caller of the fast-path call()-based flow tracks
      * the settings generation in order to cache values locally. If this key is
      * mapped to a <code>null</code> string extra in the request bundle, the response
@@ -1671,9 +1677,15 @@
     /** @hide - Private call() method to write to 'global' table */
     public static final String CALL_METHOD_PUT_GLOBAL= "PUT_global";
 
+    /** @hide - Private call() method to write to 'configuration' table */
+    public static final String CALL_METHOD_PUT_CONFIG = "PUT_config";
+
     /** @hide - Private call() method to reset to defaults the 'global' table */
     public static final String CALL_METHOD_RESET_GLOBAL = "RESET_global";
 
+    /** @hide - Private call() method to reset to defaults the 'configuration' table */
+    public static final String CALL_METHOD_RESET_CONFIG = "RESET_config";
+
     /** @hide - Private call() method to reset to defaults the 'secure' table */
     public static final String CALL_METHOD_RESET_SECURE = "RESET_secure";
 
@@ -12369,6 +12381,28 @@
                 "sms_access_restriction_enabled";
 
         /**
+         * If set to 1, an app must have the READ_PRIVILEGED_PHONE_STATE permission (or be a device
+         * / profile owner with the READ_PHONE_STATE permission) to access device identifiers.
+         *
+         * STOPSHIP: Remove this once we ship with the new device identifier check enabled.
+         *
+         * @hide
+         */
+        public static final String PRIVILEGED_DEVICE_IDENTIFIER_CHECK_ENABLED =
+                "privileged_device_identifier_check_enabled";
+
+        /**
+         * If set to 1, an app that is targeting Q and does not meet the new requirements to access
+         * device identifiers will receive a SecurityException.
+         *
+         * STOPSHIP: Remove this once we ship with the new device identifier check enabled.
+         *
+         * @hide
+         */
+        public static final String PRIVILEGED_DEVICE_IDENTIFIER_TARGET_Q_BEHAVIOR_ENABLED =
+                "privileged_device_identifier_target_q_behavior_enabled";
+
+        /**
          * If set to 1, SettingsProvider's restoreAnyVersion="true" attribute will be ignored
          * and restoring to lower version of platform API will be skipped.
          *
@@ -13438,6 +13472,112 @@
     }
 
     /**
+     * Configuration system settings, containing settings which are applied identically for all
+     * defined users. Only Android can read these and only a specific configuration service can
+     * write these.
+     *
+     * @hide
+     */
+    public static final class Config extends NameValueTable {
+        /**
+         * The content:// style URL for the config table.
+         *
+         * TODO(b/113100523): Move this to DeviceConfig.java when it is added, and expose it as a
+         *     System API.
+         */
+        private static final Uri CONTENT_URI =
+                Uri.parse("content://" + AUTHORITY + "/config");
+
+        private static final ContentProviderHolder sProviderHolder =
+                new ContentProviderHolder(CONTENT_URI);
+
+        // Populated lazily, guarded by class object:
+        private static final NameValueCache sNameValueCache = new NameValueCache(
+                CONTENT_URI,
+                CALL_METHOD_GET_CONFIG,
+                CALL_METHOD_PUT_CONFIG,
+                sProviderHolder);
+
+        /**
+         * Look up a name in the database.
+         * @param resolver to access the database with
+         * @param name to look up in the table
+         * @return the corresponding value, or null if not present
+         *
+         * @hide
+         */
+        // TODO(b/117663715): require a new read permission
+        static String getString(ContentResolver resolver, String name) {
+            return sNameValueCache.getStringForUser(resolver, name, resolver.getUserId());
+        }
+
+        /**
+         * Store a name/value pair into the database.
+         * <p>
+         * The method takes an optional tag to associate with the setting which can be used to clear
+         * only settings made by your package and associated with this tag by passing the tag to
+         * {@link #resetToDefaults(ContentResolver, String)}. The value of this setting can be
+         * overridden by future calls to this or other put methods, and the tag provided in those
+         * calls, which may be null, will override the tag provided in this call. Any call to a put
+         * method which does not accept a tag will effectively set the tag to null.
+         * </p><p>
+         * Also the method takes an argument whether to make the value the default for this setting.
+         * If the system already specified a default value, then the one passed in here will
+         * <strong>not</strong> be set as the default.
+         * </p>
+         *
+         * @param resolver to access the database with.
+         * @param name to store.
+         * @param value to associate with the name.
+         * @param tag to associated with the setting.
+         * @param makeDefault whether to make the value the default one.
+         * @return true if the value was set, false on database errors.
+         *
+         * @see #resetToDefaults(ContentResolver, String)
+         *
+         * @hide
+         */
+        // TODO(b/117663715): require a new write permission restricted to a single source
+        @RequiresPermission(Manifest.permission.WRITE_SECURE_SETTINGS)
+        static boolean putString(@NonNull ContentResolver resolver,
+                @NonNull String name, @Nullable String value, @Nullable String tag,
+                boolean makeDefault) {
+            return sNameValueCache.putStringForUser(resolver, name, value, tag, makeDefault,
+                    resolver.getUserId());
+        }
+
+        /**
+         * Reset the settings to their defaults. This would reset <strong>only</strong> settings set
+         * by the caller's package. Passing in the optional tag will reset only settings changed by
+         * your package and associated with this tag.
+         *
+         * @param resolver Handle to the content resolver.
+         * @param tag Optional tag which should be associated with the settings to reset.
+         *
+         * @see #putString(ContentResolver, String, String, String, boolean)
+         *
+         * @hide
+         */
+        // TODO(b/117663715): require a new write permission restricted to a single source
+        @RequiresPermission(Manifest.permission.WRITE_SECURE_SETTINGS)
+        static void resetToDefaults(@NonNull ContentResolver resolver,
+                @Nullable String tag) {
+            try {
+                Bundle arg = new Bundle();
+                arg.putInt(CALL_METHOD_USER_KEY, resolver.getUserId());
+                if (tag != null) {
+                    arg.putString(CALL_METHOD_TAG_KEY, tag);
+                }
+                arg.putInt(CALL_METHOD_RESET_MODE_KEY, RESET_MODE_PACKAGE_DEFAULTS);
+                IContentProvider cp = sProviderHolder.getProvider(resolver);
+                cp.call(resolver.getPackageName(), CALL_METHOD_RESET_CONFIG, null, arg);
+            } catch (RemoteException e) {
+                Log.w(TAG, "Can't reset to defaults for " + CONTENT_URI, e);
+            }
+        }
+    }
+
+    /**
      * User-defined bookmarks and shortcuts.  The target of each bookmark is an
      * Intent URL, allowing it to be either a web page or a particular
      * application activity.
diff --git a/core/java/android/security/keystore/recovery/KeyChainSnapshot.java b/core/java/android/security/keystore/recovery/KeyChainSnapshot.java
index c748c87..035b226 100644
--- a/core/java/android/security/keystore/recovery/KeyChainSnapshot.java
+++ b/core/java/android/security/keystore/recovery/KeyChainSnapshot.java
@@ -113,19 +113,6 @@
     }
 
     /**
-     * Public key used to encrypt {@code encryptedRecoveryKeyBlob}.
-     *
-     * See implementation for binary key format.
-     *
-     * @deprecated Use {@link #getTrustedHardwareCertPath} instead.
-     * @removed
-     */
-    @Deprecated
-    public @NonNull byte[] getTrustedHardwarePublicKey() {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
      * CertPath containing the public key used to encrypt {@code encryptedRecoveryKeyBlob}.
      */
     public @NonNull CertPath getTrustedHardwareCertPath() {
@@ -223,18 +210,6 @@
         }
 
         /**
-         * Sets public key used to encrypt recovery blob.
-         *
-         * @param publicKey The public key
-         * @return This builder.
-         * @removed Use {@link #setTrustedHardwareCertPath} instead.
-         */
-        @Deprecated
-        public Builder setTrustedHardwarePublicKey(byte[] publicKey) {
-            throw new UnsupportedOperationException();
-        }
-
-        /**
          * Sets CertPath used to validate the trusted hardware public key. The CertPath should
          * contain a certificate of the trusted hardware public key and any necessary intermediate
          * certificates.
diff --git a/core/java/android/security/keystore/recovery/RecoveryController.java b/core/java/android/security/keystore/recovery/RecoveryController.java
index 70054fc..31a5962 100644
--- a/core/java/android/security/keystore/recovery/RecoveryController.java
+++ b/core/java/android/security/keystore/recovery/RecoveryController.java
@@ -23,7 +23,6 @@
 import android.app.KeyguardManager;
 import android.app.PendingIntent;
 import android.content.Context;
-import android.content.pm.PackageManager.NameNotFoundException;
 import android.os.RemoteException;
 import android.os.ServiceManager;
 import android.os.ServiceSpecificException;
@@ -301,18 +300,6 @@
     }
 
     /**
-     * @deprecated Use {@link #initRecoveryService(String, byte[], byte[])} instead.
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    public void initRecoveryService(
-            @NonNull String rootCertificateAlias, @NonNull byte[] signedPublicKeyList)
-            throws CertificateException, InternalRecoveryServiceException {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
      * Initializes the recovery service for the calling application. The detailed steps should be:
      * <ol>
      *     <li>Parse {@code signatureFile} to get relevant information.
@@ -363,16 +350,6 @@
     }
 
     /**
-     * @deprecated Use {@link #getKeyChainSnapshot()}
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    public @Nullable KeyChainSnapshot getRecoveryData() throws InternalRecoveryServiceException {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
      * Returns data necessary to store all recoverable keys. Key material is
      * encrypted with user secret and recovery public key.
      *
@@ -440,17 +417,6 @@
     }
 
     /**
-     * @deprecated Use {@link #getAliases()}.
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    public List<String> getAliases(@Nullable String packageName)
-            throws InternalRecoveryServiceException {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
      * Returns a list of aliases of keys belonging to the application.
      */
     @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
@@ -466,18 +432,6 @@
     }
 
     /**
-     * @deprecated Use {@link #setRecoveryStatus(String, int)}
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    public void setRecoveryStatus(
-            @NonNull String packageName, String alias, int status)
-            throws NameNotFoundException, InternalRecoveryServiceException {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
      * Sets the recovery status for given key. It is used to notify the keystore that the key was
      * successfully stored on the server or that there was an error. An application can check this
      * value using {@link #getRecoveryStatus(String, String)}.
@@ -501,17 +455,6 @@
     }
 
     /**
-     * @deprecated Use {@link #getRecoveryStatus(String)}.
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    public int getRecoveryStatus(String packageName, String alias)
-            throws InternalRecoveryServiceException {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
      * Returns the recovery status for the key with the given {@code alias}.
      *
      * <ul>
@@ -584,39 +527,6 @@
     }
 
     /**
-     * Deprecated.
-     * Generates a AES256/GCM/NoPADDING key called {@code alias} and loads it into the recoverable
-     * key store. Returns the raw material of the key.
-     *
-     * @param alias The key alias.
-     * @param account The account associated with the key
-     * @throws InternalRecoveryServiceException if an unexpected error occurred in the recovery
-     *     service.
-     * @throws LockScreenRequiredException if the user has not set a lock screen. This is required
-     *     to generate recoverable keys, as the snapshots are encrypted using a key derived from the
-     *     lock screen.
-     * @deprecated Use {@link #generateKey(String)}
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    public byte[] generateAndStoreKey(@NonNull String alias, byte[] account)
-            throws InternalRecoveryServiceException, LockScreenRequiredException {
-        throw new UnsupportedOperationException("Operation is not supported, use generateKey");
-    }
-
-    /**
-     * @deprecated Use {@link #generateKey(String)}.
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    public Key generateKey(@NonNull String alias, byte[] account)
-            throws InternalRecoveryServiceException, LockScreenRequiredException {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
      * Generates a recoverable key with the given {@code alias}.
      *
      * @throws InternalRecoveryServiceException if an unexpected error occurred in the recovery
diff --git a/core/java/android/security/keystore/recovery/RecoverySession.java b/core/java/android/security/keystore/recovery/RecoverySession.java
index 3bb6421..42e7182 100644
--- a/core/java/android/security/keystore/recovery/RecoverySession.java
+++ b/core/java/android/security/keystore/recovery/RecoverySession.java
@@ -78,36 +78,6 @@
     }
 
     /**
-     * @deprecated Use {@link #start(String, CertPath, byte[], byte[], List)} instead.
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    @NonNull public byte[] start(
-            @NonNull byte[] verifierPublicKey,
-            @NonNull byte[] vaultParams,
-            @NonNull byte[] vaultChallenge,
-            @NonNull List<KeyChainProtectionParams> secrets)
-            throws CertificateException, InternalRecoveryServiceException {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
-     * @deprecated Use {@link #start(String, CertPath, byte[], byte[], List)} instead.
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    @NonNull public byte[] start(
-            @NonNull CertPath verifierCertPath,
-            @NonNull byte[] vaultParams,
-            @NonNull byte[] vaultChallenge,
-            @NonNull List<KeyChainProtectionParams> secrets)
-            throws CertificateException, InternalRecoveryServiceException {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
      * Starts a recovery session and returns a blob with proof of recovery secret possession.
      * The method generates a symmetric key for a session, which trusted remote device can use to
      * return recovery key.
@@ -162,20 +132,6 @@
     }
 
     /**
-     * @deprecated Use {@link #recoverKeyChainSnapshot(byte[], List)} instead.
-     * @removed
-     */
-    @Deprecated
-    @RequiresPermission(android.Manifest.permission.RECOVER_KEYSTORE)
-    public Map<String, byte[]> recoverKeys(
-            @NonNull byte[] recoveryKeyBlob,
-            @NonNull List<WrappedApplicationKey> applicationKeys)
-            throws SessionExpiredException, DecryptionFailedException,
-            InternalRecoveryServiceException {
-        throw new UnsupportedOperationException();
-    }
-
-    /**
      * Imports key chain snapshot recovered from a remote vault.
      *
      * @param recoveryKeyBlob Recovery blob encrypted by symmetric key generated for this session.
diff --git a/core/java/android/security/keystore/recovery/WrappedApplicationKey.java b/core/java/android/security/keystore/recovery/WrappedApplicationKey.java
index 187a671..ae4448f 100644
--- a/core/java/android/security/keystore/recovery/WrappedApplicationKey.java
+++ b/core/java/android/security/keystore/recovery/WrappedApplicationKey.java
@@ -75,15 +75,6 @@
         }
 
         /**
-         * @deprecated AOSP does not associate keys with accounts. This may be done by system app.
-         * @removed
-         */
-        @Deprecated
-        public Builder setAccount(@NonNull byte[] account) {
-            throw new UnsupportedOperationException();
-        }
-
-        /**
          * Sets key material encrypted by recovery key.
          *
          * @param encryptedKeyMaterial The key material
@@ -133,15 +124,6 @@
         return mEncryptedKeyMaterial;
     }
 
-    /**
-     * @deprecated AOSP does not associate keys with accounts. This may be done by system app.
-     * @removed
-     */
-    @Deprecated
-    public @NonNull byte[] getAccount() {
-        throw new UnsupportedOperationException();
-    }
-
     public static final Parcelable.Creator<WrappedApplicationKey> CREATOR =
             new Parcelable.Creator<WrappedApplicationKey>() {
                 public WrappedApplicationKey createFromParcel(Parcel in) {
diff --git a/core/java/android/service/notification/NotificationListenerService.java b/core/java/android/service/notification/NotificationListenerService.java
index d7fe15d..b8e0387 100644
--- a/core/java/android/service/notification/NotificationListenerService.java
+++ b/core/java/android/service/notification/NotificationListenerService.java
@@ -737,7 +737,8 @@
      * <p>This method will throw a security exception if you don't have access to notifications
      * for the given user.</p>
      * <p>The caller must have {@link CompanionDeviceManager#getAssociations() an associated
-     * device} in order to use this method.
+     * device} or be the {@link NotificationAssistantService notification assistant} in order to
+     * use this method.
      *
      * @param pkg The package to retrieve channels for.
      */
@@ -760,7 +761,8 @@
      * <p>This method will throw a security exception if you don't have access to notifications
      * for the given user.</p>
      * <p>The caller must have {@link CompanionDeviceManager#getAssociations() an associated
-     * device} in order to use this method.
+     * device} or be the {@link NotificationAssistantService notification assistant} in order to
+     * use this method.
      *
      * @param pkg The package to retrieve channel groups for.
      */
diff --git a/core/java/android/speech/tts/TextToSpeechService.java b/core/java/android/speech/tts/TextToSpeechService.java
index 10d7911..ec63cd9 100644
--- a/core/java/android/speech/tts/TextToSpeechService.java
+++ b/core/java/android/speech/tts/TextToSpeechService.java
@@ -1112,7 +1112,6 @@
 
         @Override
         protected void playImpl() {
-            dispatchOnStart();
             super.playImpl();
             try {
               mFileOutputStream.close();
diff --git a/core/java/android/text/Layout.java b/core/java/android/text/Layout.java
index 0808cdd..3ab8a0a 100644
--- a/core/java/android/text/Layout.java
+++ b/core/java/android/text/Layout.java
@@ -1806,6 +1806,7 @@
         }
 
     }
+
     /**
      * Fills in the specified Path with a representation of a cursor
      * at the specified offset.  This will often be a vertical line
@@ -1821,7 +1822,6 @@
 
         boolean clamped = shouldClampCursor(line);
         float h1 = getPrimaryHorizontal(point, clamped) - 0.5f;
-        float h2 = isLevelBoundary(point) ? getSecondaryHorizontal(point, clamped) - 0.5f : h1;
 
         int caps = TextKeyListener.getMetaState(editingBuffer, TextKeyListener.META_SHIFT_ON) |
                    TextKeyListener.getMetaState(editingBuffer, TextKeyListener.META_SELECTING);
@@ -1839,34 +1839,24 @@
 
         if (h1 < 0.5f)
             h1 = 0.5f;
-        if (h2 < 0.5f)
-            h2 = 0.5f;
 
-        if (Float.compare(h1, h2) == 0) {
-            dest.moveTo(h1, top);
-            dest.lineTo(h1, bottom);
-        } else {
-            dest.moveTo(h1, top);
-            dest.lineTo(h1, (top + bottom) >> 1);
-
-            dest.moveTo(h2, (top + bottom) >> 1);
-            dest.lineTo(h2, bottom);
-        }
+        dest.moveTo(h1, top);
+        dest.lineTo(h1, bottom);
 
         if (caps == 2) {
-            dest.moveTo(h2, bottom);
-            dest.lineTo(h2 - dist, bottom + dist);
-            dest.lineTo(h2, bottom);
-            dest.lineTo(h2 + dist, bottom + dist);
+            dest.moveTo(h1, bottom);
+            dest.lineTo(h1 - dist, bottom + dist);
+            dest.lineTo(h1, bottom);
+            dest.lineTo(h1 + dist, bottom + dist);
         } else if (caps == 1) {
-            dest.moveTo(h2, bottom);
-            dest.lineTo(h2 - dist, bottom + dist);
+            dest.moveTo(h1, bottom);
+            dest.lineTo(h1 - dist, bottom + dist);
 
-            dest.moveTo(h2 - dist, bottom + dist - 0.5f);
-            dest.lineTo(h2 + dist, bottom + dist - 0.5f);
+            dest.moveTo(h1 - dist, bottom + dist - 0.5f);
+            dest.lineTo(h1 + dist, bottom + dist - 0.5f);
 
-            dest.moveTo(h2 + dist, bottom + dist);
-            dest.lineTo(h2, bottom);
+            dest.moveTo(h1 + dist, bottom + dist);
+            dest.lineTo(h1, bottom);
         }
 
         if (fn == 2) {
diff --git a/core/java/android/text/MeasuredParagraph.java b/core/java/android/text/MeasuredParagraph.java
index 0a2d65c..f9370a8 100644
--- a/core/java/android/text/MeasuredParagraph.java
+++ b/core/java/android/text/MeasuredParagraph.java
@@ -505,7 +505,7 @@
             }
             mWholeWidth += width;
         } else {
-            builder.addReplacementRun(mCachedPaint, start, end, width);
+            builder.appendReplacementRun(mCachedPaint, end - start, width);
         }
     }
 
@@ -520,7 +520,7 @@
                         mCopiedBuffer, start, end - start, start, end - start, false /* isRtl */,
                         mWidths.getRawArray(), start);
             } else {
-                builder.addStyleRun(mCachedPaint, start, end, false /* isRtl */);
+                builder.appendStyleRun(mCachedPaint, end - start, false /* isRtl */);
             }
         } else {
             // If there is multiple bidi levels, split into individual bidi level and apply style.
@@ -536,7 +536,7 @@
                                 mCopiedBuffer, levelStart, levelLength, levelStart, levelLength,
                                 isRtl, mWidths.getRawArray(), levelStart);
                     } else {
-                        builder.addStyleRun(mCachedPaint, levelStart, levelEnd, isRtl);
+                        builder.appendStyleRun(mCachedPaint, levelEnd - levelStart, isRtl);
                     }
                     if (levelEnd == end) {
                         break;
diff --git a/core/java/android/text/style/TextAppearanceSpan.java b/core/java/android/text/style/TextAppearanceSpan.java
index 648bd1b..2355769 100644
--- a/core/java/android/text/style/TextAppearanceSpan.java
+++ b/core/java/android/text/style/TextAppearanceSpan.java
@@ -22,7 +22,8 @@
 import android.content.res.TypedArray;
 import android.graphics.LeakyTypefaceStorage;
 import android.graphics.Typeface;
-import android.graphics.fonts.Font;
+import android.graphics.fonts.FontStyle;
+import android.os.LocaleList;
 import android.os.Parcel;
 import android.text.ParcelableSpan;
 import android.text.TextPaint;
@@ -66,6 +67,7 @@
     private final Typeface mTypeface;
 
     private final int mTextFontWeight;
+    private final LocaleList mTextLocales;
 
     private final float mShadowRadius;
     private final float mShadowDx;
@@ -149,6 +151,19 @@
         mTextFontWeight = a.getInt(com.android.internal.R.styleable
                 .TextAppearance_textFontWeight, -1);
 
+        final String localeString = a.getString(com.android.internal.R.styleable
+                .TextAppearance_textLocale);
+        if (localeString != null) {
+            LocaleList localeList = LocaleList.forLanguageTags(localeString);
+            if (!localeList.isEmpty()) {
+                mTextLocales = localeList;
+            } else {
+                mTextLocales = null;
+            }
+        } else {
+            mTextLocales = null;
+        }
+
         mShadowRadius = a.getFloat(com.android.internal.R.styleable
                 .TextAppearance_shadowRadius, 0.0f);
         mShadowDx = a.getFloat(com.android.internal.R.styleable
@@ -201,6 +216,7 @@
         mTypeface = null;
 
         mTextFontWeight = -1;
+        mTextLocales = null;
 
         mShadowRadius = 0.0f;
         mShadowDx = 0.0f;
@@ -233,6 +249,7 @@
         mTypeface = LeakyTypefaceStorage.readTypefaceFromParcel(src);
 
         mTextFontWeight = src.readInt();
+        mTextLocales = src.readParcelable(LocaleList.class.getClassLoader());
 
         mShadowRadius = src.readFloat();
         mShadowDx = src.readFloat();
@@ -285,6 +302,7 @@
         LeakyTypefaceStorage.writeTypefaceToParcel(mTypeface, dest);
 
         dest.writeInt(mTextFontWeight);
+        dest.writeParcelable(mTextLocales, flags);
 
         dest.writeFloat(mShadowRadius);
         dest.writeFloat(mShadowDx);
@@ -349,6 +367,15 @@
     }
 
     /**
+     * Returns the {@link android.os.LocaleList} specified by this span, or <code>null</code>
+     * if it does not specify one.
+     */
+    @Nullable
+    public LocaleList getTextLocales() {
+        return mTextLocales;
+    }
+
+    /**
      * Returns the typeface specified by this span, or <code>null</code>
      * if it does not specify one.
      */
@@ -463,7 +490,7 @@
         if (styledTypeface != null) {
             final Typeface readyTypeface;
             if (mTextFontWeight >= 0) {
-                final int weight = Math.min(Font.FONT_WEIGHT_MAX, mTextFontWeight);
+                final int weight = Math.min(FontStyle.FONT_WEIGHT_MAX, mTextFontWeight);
                 final boolean italic = (style & Typeface.ITALIC) != 0;
                 readyTypeface = ds.setTypeface(Typeface.create(styledTypeface, weight, italic));
             } else {
@@ -487,6 +514,10 @@
             ds.setTextSize(mTextSize);
         }
 
+        if (mTextLocales != null) {
+            ds.setTextLocales(mTextLocales);
+        }
+
         if (mHasElegantTextHeight) {
             ds.setElegantTextHeight(mElegantTextHeight);
         }
diff --git a/core/java/android/transition/TransitionManager.java b/core/java/android/transition/TransitionManager.java
index 4608e20..0e5252e 100644
--- a/core/java/android/transition/TransitionManager.java
+++ b/core/java/android/transition/TransitionManager.java
@@ -315,6 +315,7 @@
                     ArrayList<Transition> currentTransitions =
                             runningTransitions.get(mSceneRoot);
                     currentTransitions.remove(transition);
+                    transition.removeListener(this);
                 }
             });
             mTransition.captureValues(mSceneRoot, false);
diff --git a/core/java/android/util/FeatureFlagUtils.java b/core/java/android/util/FeatureFlagUtils.java
index 183e833..db2c190 100644
--- a/core/java/android/util/FeatureFlagUtils.java
+++ b/core/java/android/util/FeatureFlagUtils.java
@@ -47,7 +47,7 @@
         DEFAULT_FLAGS.put("settings_mobile_network_v2", "false");
         DEFAULT_FLAGS.put("settings_data_usage_v2", "false");
         DEFAULT_FLAGS.put("settings_seamless_transfer", "false");
-        DEFAULT_FLAGS.put(HEARING_AID_SETTINGS, "true");
+        DEFAULT_FLAGS.put(HEARING_AID_SETTINGS, "false");
         DEFAULT_FLAGS.put(EMERGENCY_DIAL_SHORTCUTS, "false");
     }
 
diff --git a/core/java/android/view/MotionEvent.java b/core/java/android/view/MotionEvent.java
index 29c58dc..b59d8c7 100644
--- a/core/java/android/view/MotionEvent.java
+++ b/core/java/android/view/MotionEvent.java
@@ -1776,6 +1776,47 @@
     static public MotionEvent obtain(long downTime, long eventTime, int action,
             float x, float y, float pressure, float size, int metaState,
             float xPrecision, float yPrecision, int deviceId, int edgeFlags) {
+        return obtain(downTime, eventTime, action, x, y, pressure, size, metaState,
+                xPrecision, yPrecision, deviceId, edgeFlags, InputDevice.SOURCE_UNKNOWN,
+                DEFAULT_DISPLAY);
+    }
+
+    /**
+     * Create a new MotionEvent, filling in all of the basic values that
+     * define the motion.
+     *
+     * @param downTime The time (in ms) when the user originally pressed down to start
+     * a stream of position events.  This must be obtained from {@link SystemClock#uptimeMillis()}.
+     * @param eventTime  The the time (in ms) when this specific event was generated.  This
+     * must be obtained from {@link SystemClock#uptimeMillis()}.
+     * @param action The kind of action being performed, such as {@link #ACTION_DOWN}.
+     * @param x The X coordinate of this event.
+     * @param y The Y coordinate of this event.
+     * @param pressure The current pressure of this event.  The pressure generally
+     * ranges from 0 (no pressure at all) to 1 (normal pressure), however
+     * values higher than 1 may be generated depending on the calibration of
+     * the input device.
+     * @param size A scaled value of the approximate size of the area being pressed when
+     * touched with the finger. The actual value in pixels corresponding to the finger
+     * touch is normalized with a device specific range of values
+     * and scaled to a value between 0 and 1.
+     * @param metaState The state of any meta / modifier keys that were in effect when
+     * the event was generated.
+     * @param xPrecision The precision of the X coordinate being reported.
+     * @param yPrecision The precision of the Y coordinate being reported.
+     * @param deviceId The id for the device that this event came from.  An id of
+     * zero indicates that the event didn't come from a physical device; other
+     * numbers are arbitrary and you shouldn't depend on the values.
+     * @param source The source of this event.
+     * @param edgeFlags A bitfield indicating which edges, if any, were touched by this
+     * MotionEvent.
+     * @param displayId The display ID associated with this event.
+     * @hide
+     */
+    public static MotionEvent obtain(long downTime, long eventTime, int action,
+            float x, float y, float pressure, float size, int metaState,
+            float xPrecision, float yPrecision, int deviceId, int edgeFlags, int source,
+            int displayId) {
         MotionEvent ev = obtain();
         synchronized (gSharedTempLock) {
             ensureSharedTempPointerCapacity(1);
@@ -1791,7 +1832,7 @@
             pc[0].size = size;
 
             ev.mNativePtr = nativeInitialize(ev.mNativePtr,
-                    deviceId, InputDevice.SOURCE_UNKNOWN, DEFAULT_DISPLAY,
+                    deviceId, source, displayId,
                     action, 0, edgeFlags, metaState, 0,
                     0, 0, xPrecision, yPrecision,
                     downTime * NS_PER_MS, eventTime * NS_PER_MS,
diff --git a/core/java/android/view/ViewGroup.java b/core/java/android/view/ViewGroup.java
index 1b3e62d..58febb05 100644
--- a/core/java/android/view/ViewGroup.java
+++ b/core/java/android/view/ViewGroup.java
@@ -541,11 +541,11 @@
     private static final int CHILD_TOP_INDEX = 1;
 
     // Child views of this ViewGroup
-    @UnsupportedAppUsage
+    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
     private View[] mChildren;
     // Number of valid children in the mChildren array, the rest should be null or not
     // considered as children
-    @UnsupportedAppUsage
+    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
     private int mChildrenCount;
 
     // Whether layout calls are currently being suppressed, controlled by calls to
diff --git a/core/java/android/view/inputmethod/InputMethodManager.java b/core/java/android/view/inputmethod/InputMethodManager.java
index e8e4b4ab..e370e11 100644
--- a/core/java/android/view/inputmethod/InputMethodManager.java
+++ b/core/java/android/view/inputmethod/InputMethodManager.java
@@ -59,7 +59,10 @@
 import android.view.autofill.AutofillManager;
 
 import com.android.internal.annotations.GuardedBy;
+import com.android.internal.inputmethod.InputMethodDebug;
 import com.android.internal.inputmethod.InputMethodPrivilegedOperationsRegistry;
+import com.android.internal.inputmethod.StartInputReason;
+import com.android.internal.inputmethod.UnbindReason;
 import com.android.internal.os.SomeArgs;
 import com.android.internal.view.IInputConnectionWrapper;
 import com.android.internal.view.IInputContext;
@@ -67,7 +70,6 @@
 import com.android.internal.view.IInputMethodManager;
 import com.android.internal.view.IInputMethodSession;
 import com.android.internal.view.InputBindResult;
-import com.android.internal.view.InputMethodClient;
 
 import java.io.FileDescriptor;
 import java.io.PrintWriter;
@@ -540,17 +542,16 @@
                         mCurId = res.id;
                         mBindSequence = res.sequence;
                     }
-                    startInputInner(InputMethodClient.START_INPUT_REASON_BOUND_TO_IMMS,
-                            null, 0, 0, 0);
+                    startInputInner(StartInputReason.BOUND_TO_IMMS, null, 0, 0, 0);
                     return;
                 }
                 case MSG_UNBIND: {
                     final int sequence = msg.arg1;
-                    @InputMethodClient.UnbindReason
+                    @UnbindReason
                     final int reason = msg.arg2;
                     if (DEBUG) {
                         Log.i(TAG, "handleMessage: MSG_UNBIND " + sequence +
-                                " reason=" + InputMethodClient.getUnbindReason(reason));
+                                " reason=" + InputMethodDebug.unbindReasonToString(reason));
                     }
                     final boolean startInput;
                     synchronized (mH) {
@@ -567,8 +568,7 @@
                     }
                     if (startInput) {
                         startInputInner(
-                                InputMethodClient.START_INPUT_REASON_UNBOUND_FROM_IMMS, null, 0, 0,
-                                0);
+                                StartInputReason.UNBOUND_FROM_IMMS, null, 0, 0, 0);
                     }
                     return;
                 }
@@ -597,9 +597,8 @@
                         // handling this message.
                         if (mServedView != null && canStartInput(mServedView)) {
                             if (checkFocusNoStartInput(mRestartOnNextWindowFocus)) {
-                                final int reason = active ?
-                                        InputMethodClient.START_INPUT_REASON_ACTIVATED_BY_IMMS :
-                                        InputMethodClient.START_INPUT_REASON_DEACTIVATED_BY_IMMS;
+                                final int reason = active ? StartInputReason.ACTIVATED_BY_IMMS
+                                        : StartInputReason.DEACTIVATED_BY_IMMS;
                                 startInputInner(reason, null, 0, 0, 0);
                             }
                         }
@@ -696,7 +695,7 @@
         }
 
         @Override
-        public void onUnbindMethod(int sequence, @InputMethodClient.UnbindReason int unbindReason) {
+        public void onUnbindMethod(int sequence, @UnbindReason int unbindReason) {
             mH.obtainMessage(MSG_UNBIND, sequence, unbindReason).sendToTarget();
         }
 
@@ -1052,13 +1051,6 @@
         mNextServedView = null;
         if (mServedView != null) {
             if (DEBUG) Log.v(TAG, "FINISH INPUT: mServedView=" + dumpViewInfo(mServedView));
-            if (mCurrentTextBoxAttribute != null) {
-                try {
-                    mService.finishInput(mClient);
-                } catch (RemoteException e) {
-                    throw e.rethrowFromSystemServer();
-                }
-            }
             mServedView = null;
             mCompletions = null;
             mServedConnecting = false;
@@ -1393,11 +1385,10 @@
             mServedConnecting = true;
         }
 
-        startInputInner(InputMethodClient.START_INPUT_REASON_APP_CALLED_RESTART_INPUT_API, null, 0,
-                0, 0);
+        startInputInner(StartInputReason.APP_CALLED_RESTART_INPUT_API, null, 0, 0, 0);
     }
 
-    boolean startInputInner(@InputMethodClient.StartInputReason final int startInputReason,
+    boolean startInputInner(@StartInputReason int startInputReason,
             @Nullable IBinder windowGainingFocus, int controlFlags, int softInputMode,
             int windowFlags) {
         final View view;
@@ -1407,7 +1398,7 @@
             // Make sure we have a window token for the served view.
             if (DEBUG) {
                 Log.v(TAG, "Starting input: view=" + dumpViewInfo(view) +
-                        " reason=" + InputMethodClient.getStartInputReason(startInputReason));
+                        " reason=" + InputMethodDebug.startInputReasonToString(startInputReason));
             }
             if (view == null) {
                 if (DEBUG) Log.v(TAG, "ABORT input: no served view!");
@@ -1526,7 +1517,7 @@
                 if (res == null) {
                     Log.wtf(TAG, "startInputOrWindowGainedFocus must not return"
                             + " null. startInputReason="
-                            + InputMethodClient.getStartInputReason(startInputReason)
+                            + InputMethodDebug.startInputReasonToString(startInputReason)
                             + " editorInfo=" + tba
                             + " controlFlags=#" + Integer.toHexString(controlFlags));
                     return false;
@@ -1661,7 +1652,7 @@
     @UnsupportedAppUsage
     public void checkFocus() {
         if (checkFocusNoStartInput(false)) {
-            startInputInner(InputMethodClient.START_INPUT_REASON_CHECK_FOCUS, null, 0, 0, 0);
+            startInputInner(StartInputReason.CHECK_FOCUS, null, 0, 0, 0);
         }
     }
 
@@ -1724,7 +1715,7 @@
         boolean forceNewFocus = false;
         synchronized (mH) {
             if (DEBUG) Log.v(TAG, "onWindowFocus: " + focusedView
-                    + " softInputMode=" + InputMethodClient.softInputModeToString(softInputMode)
+                    + " softInputMode=" + InputMethodDebug.softInputModeToString(softInputMode)
                     + " first=" + first + " flags=#"
                     + Integer.toHexString(windowFlags));
             if (mRestartOnNextWindowFocus) {
@@ -1751,8 +1742,8 @@
             // should be done in conjunction with telling the system service
             // about the window gaining focus, to help make the transition
             // smooth.
-            if (startInputInner(InputMethodClient.START_INPUT_REASON_WINDOW_FOCUS_GAIN,
-                    rootView.getWindowToken(), controlFlags, softInputMode, windowFlags)) {
+            if (startInputInner(StartInputReason.WINDOW_FOCUS_GAIN, rootView.getWindowToken(),
+                    controlFlags, softInputMode, windowFlags)) {
                 return;
             }
         }
@@ -1763,7 +1754,7 @@
             try {
                 if (DEBUG) Log.v(TAG, "Reporting focus gain, without startInput");
                 mService.startInputOrWindowGainedFocus(
-                        InputMethodClient.START_INPUT_REASON_WINDOW_FOCUS_GAIN_REPORT_ONLY, mClient,
+                        StartInputReason.WINDOW_FOCUS_GAIN_REPORT_ONLY, mClient,
                         rootView.getWindowToken(), controlFlags, softInputMode, windowFlags, null,
                         null, 0 /* missingMethodFlags */,
                         rootView.getContext().getApplicationInfo().targetSdkVersion);
diff --git a/core/java/android/view/textclassifier/TextClassifier.java b/core/java/android/view/textclassifier/TextClassifier.java
index 9692579..2e92f14 100644
--- a/core/java/android/view/textclassifier/TextClassifier.java
+++ b/core/java/android/view/textclassifier/TextClassifier.java
@@ -21,7 +21,6 @@
 import android.annotation.NonNull;
 import android.annotation.Nullable;
 import android.annotation.StringDef;
-import android.annotation.UnsupportedAppUsage;
 import android.annotation.WorkerThread;
 import android.os.LocaleList;
 import android.os.Looper;
@@ -212,34 +211,13 @@
         return suggestSelection(request);
     }
 
-    // TODO: Remove once apps can build against the latest sdk.
-    /** @hide */
-    @UnsupportedAppUsage
-    default TextSelection suggestSelection(
-            @NonNull CharSequence text,
-            @IntRange(from = 0) int selectionStartIndex,
-            @IntRange(from = 0) int selectionEndIndex,
-            @Nullable TextSelection.Options options) {
-        if (options == null) {
-            return suggestSelection(new TextSelection.Request.Builder(
-                    text, selectionStartIndex, selectionEndIndex).build());
-        } else if (options.getRequest() != null) {
-            return suggestSelection(options.getRequest());
-        } else {
-            return suggestSelection(
-                    new TextSelection.Request.Builder(text, selectionStartIndex, selectionEndIndex)
-                            .setDefaultLocales(options.getDefaultLocales())
-                            .build());
-        }
-    }
-
     /**
      * Classifies the specified text and returns a {@link TextClassification} object that can be
      * used to generate a widget for handling the classified text.
      *
      * <p><strong>NOTE: </strong>Call on a worker thread.
      *
-     * <strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
+     * <p><strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
      * throw an {@link IllegalStateException}. See {@link #isDestroyed()}.
      *
      * @param request the text classification request
@@ -262,7 +240,7 @@
      * {@link #classifyText(TextClassification.Request)}. If that method calls this method,
      * a stack overflow error will happen.
      *
-     * <strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
+     * <p><strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
      * throw an {@link IllegalStateException}. See {@link #isDestroyed()}.
      *
      * @param text text providing context for the text to classify (which is specified
@@ -292,34 +270,13 @@
         return classifyText(request);
     }
 
-    // TODO: Remove once apps can build against the latest sdk.
-    /** @hide */
-    @UnsupportedAppUsage
-    default TextClassification classifyText(
-            @NonNull CharSequence text,
-            @IntRange(from = 0) int startIndex,
-            @IntRange(from = 0) int endIndex,
-            @Nullable TextClassification.Options options) {
-        if (options == null) {
-            return classifyText(
-                    new TextClassification.Request.Builder(text, startIndex, endIndex).build());
-        } else if (options.getRequest() != null) {
-            return classifyText(options.getRequest());
-        } else {
-            return classifyText(new TextClassification.Request.Builder(text, startIndex, endIndex)
-                    .setDefaultLocales(options.getDefaultLocales())
-                    .setReferenceTime(options.getReferenceTime())
-                    .build());
-        }
-    }
-
     /**
      * Generates and returns a {@link TextLinks} that may be applied to the text to annotate it with
      * links information.
      *
      * <p><strong>NOTE: </strong>Call on a worker thread.
      *
-     * <strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
+     * <p><strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
      * throw an {@link IllegalStateException}. See {@link #isDestroyed()}.
      *
      * @param request the text links request
@@ -334,27 +291,10 @@
         return new TextLinks.Builder(request.getText().toString()).build();
     }
 
-    // TODO: Remove once apps can build against the latest sdk.
-    /** @hide */
-    @UnsupportedAppUsage
-    default TextLinks generateLinks(
-            @NonNull CharSequence text, @Nullable TextLinks.Options options) {
-        if (options == null) {
-            return generateLinks(new TextLinks.Request.Builder(text).build());
-        } else if (options.getRequest() != null) {
-            return generateLinks(options.getRequest());
-        } else {
-            return generateLinks(new TextLinks.Request.Builder(text)
-                    .setDefaultLocales(options.getDefaultLocales())
-                    .setEntityConfig(options.getEntityConfig())
-                    .build());
-        }
-    }
-
     /**
      * Returns the maximal length of text that can be processed by generateLinks.
      *
-     * <strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
+     * <p><strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
      * throw an {@link IllegalStateException}. See {@link #isDestroyed()}.
      *
      * @see #generateLinks(TextLinks.Request)
@@ -365,9 +305,29 @@
     }
 
     /**
+     * Detects the language of the specified text.
+     *
+     * <p><strong>NOTE: </strong>Call on a worker thread.
+     *
+     *
+     * <p><strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
+     * throw an {@link IllegalStateException}. See {@link #isDestroyed()}.
+     *
+     * @param request the {@link TextLanguage} request.
+     * @return the {@link TextLanguage} result.
+     */
+    @WorkerThread
+    @NonNull
+    default TextLanguage detectLanguage(@NonNull TextLanguage.Request request) {
+        Preconditions.checkNotNull(request);
+        Utils.checkMainThread();
+        return TextLanguage.EMPTY;
+    }
+
+    /**
      * Reports a selection event.
      *
-     * <strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
+     * <p><strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to this method should
      * throw an {@link IllegalStateException}. See {@link #isDestroyed()}.
      */
     default void onSelectionEvent(@NonNull SelectionEvent event) {}
@@ -375,7 +335,7 @@
     /**
      * Destroys this TextClassifier.
      *
-     * <strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to its methods should
+     * <p><strong>NOTE: </strong>If a TextClassifier has been destroyed, calls to its methods should
      * throw an {@link IllegalStateException}. See {@link #isDestroyed()}.
      *
      * <p>Subsequent calls to this method are no-ops.
@@ -385,7 +345,7 @@
     /**
      * Returns whether or not this TextClassifier has been destroyed.
      *
-     * <strong>NOTE: </strong>If a TextClassifier has been destroyed, caller should not interact
+     * <p><strong>NOTE: </strong>If a TextClassifier has been destroyed, caller should not interact
      * with the classifier and an attempt to do so would throw an {@link IllegalStateException}.
      * However, this method should never throw an {@link IllegalStateException}.
      *
@@ -396,9 +356,7 @@
     }
 
     /** @hide **/
-    default void dump(@NonNull IndentingPrintWriter printWriter) {
-
-    }
+    default void dump(@NonNull IndentingPrintWriter printWriter) {}
 
     /**
      * Configuration object for specifying what entities to identify.
diff --git a/core/java/android/view/textclassifier/TextLanguage.java b/core/java/android/view/textclassifier/TextLanguage.java
new file mode 100644
index 0000000..d28459e
--- /dev/null
+++ b/core/java/android/view/textclassifier/TextLanguage.java
@@ -0,0 +1,307 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.view.textclassifier;
+
+import android.annotation.FloatRange;
+import android.annotation.IntRange;
+import android.annotation.NonNull;
+import android.annotation.Nullable;
+import android.icu.util.ULocale;
+import android.os.Bundle;
+import android.os.Parcel;
+import android.os.Parcelable;
+import android.util.ArrayMap;
+
+import com.android.internal.util.Preconditions;
+
+import java.util.Locale;
+import java.util.Map;
+
+/**
+ * Represents the result of language detection of a piece of text.
+ * <p>
+ * This contains a list of locales, each paired with a confidence score, sorted in decreasing
+ * order of those scores. E.g., for a given input text, the model may return
+ * {@code [<"en", 0.85>, <"fr", 0.15>]}. This sample result means the model reports that it is
+ * 85% likely that the entire text is in English and 15% likely that the entire text is in French,
+ * etc. It does not mean that 85% of the input is in English and 15% is in French.
+ */
+public final class TextLanguage implements Parcelable {
+
+    public static final Creator<TextLanguage> CREATOR = new Creator<TextLanguage>() {
+        @Override
+        public TextLanguage createFromParcel(Parcel in) {
+            return readFromParcel(in);
+        }
+
+        @Override
+        public TextLanguage[] newArray(int size) {
+            return new TextLanguage[size];
+        }
+    };
+
+    static final TextLanguage EMPTY = new Builder().build();
+
+    @Nullable private final String mId;
+    private final EntityConfidence mEntityConfidence;
+    private final Bundle mBundle;
+
+    private TextLanguage(
+            @Nullable String id,
+            EntityConfidence entityConfidence,
+            Bundle bundle) {
+        mId = id;
+        mEntityConfidence = entityConfidence;
+        mBundle = bundle;
+    }
+
+    /**
+     * Returns the id, if one exists, for this object.
+     */
+    @Nullable
+    public String getId() {
+        return mId;
+    }
+
+    /**
+     * Returns the number of possible locales for the processed text.
+     */
+    @IntRange(from = 0)
+    public int getLocaleHypothesisCount() {
+        return mEntityConfidence.getEntities().size();
+    }
+
+    /**
+     * Returns the language locale at the specified index. Locales are ordered from high
+     * confidence to low confidence.
+     *
+     * @throws IndexOutOfBoundsException if the specified index is out of range.
+     * @see #getLocaleCount() for the number of locales available.
+     */
+    @NonNull
+    public ULocale getLocale(int index) {
+        return ULocale.forLanguageTag(mEntityConfidence.getEntities().get(index));
+    }
+
+    /**
+     * Returns the confidence score for the specified language locale. The value ranges from
+     * 0 (low confidence) to 1 (high confidence). 0 indicates that the locale was not found for
+     * the processed text.
+     */
+    @FloatRange(from = 0.0, to = 1.0)
+    public float getConfidenceScore(@NonNull ULocale locale) {
+        return mEntityConfidence.getConfidenceScore(locale.toLanguageTag());
+    }
+
+    /**
+     * Returns a bundle containing non-structured extra information about this result.
+     *
+     * <p><b>NOTE: </b>Each call to this method returns a new bundle copy so clients should prefer
+     * to hold a reference to the returned bundle rather than frequently calling this method.
+     */
+    @NonNull
+    public Bundle getExtras() {
+        return mBundle.deepCopy();
+    }
+
+    @Override
+    public String toString() {
+        return String.format(
+                Locale.US,
+                "TextLanguage {id=%s, locales=%s, bundle=%s}",
+                mId, mEntityConfidence, mBundle);
+    }
+
+    @Override
+    public int describeContents() {
+        return 0;
+    }
+
+    @Override
+    public void writeToParcel(Parcel dest, int flags) {
+        dest.writeString(mId);
+        mEntityConfidence.writeToParcel(dest, flags);
+        dest.writeBundle(mBundle);
+    }
+
+    private static TextLanguage readFromParcel(Parcel in) {
+        return new TextLanguage(
+                in.readString(),
+                EntityConfidence.CREATOR.createFromParcel(in),
+                in.readBundle());
+    }
+
+    /**
+     * Builder used to build TextLanguage objects.
+     */
+    public static final class Builder {
+
+        @Nullable private String mId;
+        private final Map<String, Float> mEntityConfidenceMap = new ArrayMap<>();
+        @Nullable private Bundle mBundle;
+
+        /**
+         * Sets a language locale for the processed text and assigns a confidence score. If the
+         * locale has already been set, this updates it.
+         *
+         * @param confidenceScore a value from 0 (low confidence) to 1 (high confidence).
+         *      0 implies the locale does not exist for the processed text.
+         *      Values greater than 1 are clamped to 1.
+         */
+        @NonNull
+        public Builder putLocale(
+                @NonNull ULocale locale,
+                @FloatRange(from = 0.0, to = 1.0) float confidenceScore) {
+            Preconditions.checkNotNull(locale);
+            mEntityConfidenceMap.put(locale.toLanguageTag(), confidenceScore);
+            return this;
+        }
+
+        /**
+         * Sets an optional id for the TextLanguage object.
+         */
+        @NonNull
+        public Builder setId(@Nullable String id) {
+            mId = id;
+            return this;
+        }
+
+        /**
+         * Sets a bundle containing non-structured extra information about the TextLanguage object.
+         */
+        @NonNull
+        public Builder setExtras(@NonNull Bundle bundle) {
+            mBundle = Preconditions.checkNotNull(bundle);
+            return this;
+        }
+
+        /**
+         * Builds and returns a new TextLanguage object.
+         * <p>
+         * If necessary, this method will verify fields, clamp them, and make them immutable.
+         */
+        @NonNull
+        public TextLanguage build() {
+            mBundle = mBundle == null ? new Bundle() : mBundle.deepCopy();
+            return new TextLanguage(
+                    mId,
+                    new EntityConfidence(mEntityConfidenceMap),
+                    mBundle);
+        }
+    }
+
+    /**
+     * A request object for detecting the language of a piece of text.
+     */
+    public static final class Request implements Parcelable {
+
+        public static final Creator<Request> CREATOR = new Creator<Request>() {
+            @Override
+            public Request createFromParcel(Parcel in) {
+                return readFromParcel(in);
+            }
+
+            @Override
+            public Request[] newArray(int size) {
+                return new Request[size];
+            }
+        };
+
+        private final CharSequence mText;
+        private final Bundle mBundle;
+
+        private Request(CharSequence text, Bundle bundle) {
+            mText = text;
+            mBundle = bundle;
+        }
+
+        /**
+         * Returns the text to process.
+         */
+        @NonNull
+        public CharSequence getText() {
+            return mText;
+        }
+
+        /**
+         * Returns a bundle containing non-structured extra information about this request.
+         *
+         * <p><b>NOTE: </b>Each call to this method returns a new bundle copy so clients should
+         * prefer to hold a reference to the returned bundle rather than frequently calling this
+         * method.
+         */
+        @NonNull
+        public Bundle getExtras() {
+            return mBundle.deepCopy();
+        }
+
+        @Override
+        public int describeContents() {
+            return 0;
+        }
+
+        @Override
+        public void writeToParcel(Parcel dest, int flags) {
+            dest.writeCharSequence(mText);
+            dest.writeBundle(mBundle);
+        }
+
+        private static Request readFromParcel(Parcel in) {
+            return new Request(
+                    in.readCharSequence(),
+                    in.readBundle());
+        }
+
+        /**
+         * A builder for building TextLanguage requests.
+         */
+        public static final class Builder {
+
+            private final CharSequence mText;
+            @Nullable private Bundle mBundle;
+
+            /**
+             * Creates a builder to build TextLanguage requests.
+             *
+             * @param text the text to process.
+             */
+            public Builder(@NonNull CharSequence text) {
+                mText = Preconditions.checkNotNull(text);
+            }
+
+            /**
+             * Sets a bundle containing non-structured extra information about the request.
+             */
+            @NonNull
+            public Builder setExtras(@NonNull Bundle bundle) {
+                mBundle = Preconditions.checkNotNull(bundle);
+                return this;
+            }
+
+            /**
+             * Builds and returns a new TextLanguage request object.
+             * <p>
+             * If necessary, this method will verify fields, clamp them, and make them immutable.
+             */
+            @NonNull
+            public Request build() {
+                mBundle = mBundle == null ? new Bundle() : mBundle.deepCopy();
+                return new Request(mText.toString(), mBundle);
+            }
+        }
+    }
+}
diff --git a/core/java/android/webkit/WebViewClient.java b/core/java/android/webkit/WebViewClient.java
index bdd7a09..300bb6f 100644
--- a/core/java/android/webkit/WebViewClient.java
+++ b/core/java/android/webkit/WebViewClient.java
@@ -282,19 +282,28 @@
             SAFE_BROWSING_THREAT_UNKNOWN,
             SAFE_BROWSING_THREAT_MALWARE,
             SAFE_BROWSING_THREAT_PHISHING,
-            SAFE_BROWSING_THREAT_UNWANTED_SOFTWARE
+            SAFE_BROWSING_THREAT_UNWANTED_SOFTWARE,
+            SAFE_BROWSING_THREAT_BILLING,
     })
     @Retention(RetentionPolicy.SOURCE)
     public @interface SafeBrowsingThreat {}
 
-    /** The resource was blocked for an unknown reason */
+    /** The resource was blocked for an unknown reason. */
     public static final int SAFE_BROWSING_THREAT_UNKNOWN = 0;
-    /** The resource was blocked because it contains malware */
+    /** The resource was blocked because it contains malware. */
     public static final int SAFE_BROWSING_THREAT_MALWARE = 1;
-    /** The resource was blocked because it contains deceptive content */
+    /** The resource was blocked because it contains deceptive content. */
     public static final int SAFE_BROWSING_THREAT_PHISHING = 2;
-    /** The resource was blocked because it contains unwanted software */
+    /** The resource was blocked because it contains unwanted software. */
     public static final int SAFE_BROWSING_THREAT_UNWANTED_SOFTWARE = 3;
+    /**
+     * The resource was blocked because it may trick the user into a billing agreement.
+     *
+     * <p>This constant is only used when targetSdkVersion is at least {@link
+     * android.os.Build.VERSION_CODES#Q}. Otherwise, {@link #SAFE_BROWSING_THREAT_UNKNOWN} is used
+     * instead.
+     */
+    public static final int SAFE_BROWSING_THREAT_BILLING = 4;
 
     /**
      * Report an error to the host application. These errors are unrecoverable
diff --git a/core/java/android/widget/RemoteViews.java b/core/java/android/widget/RemoteViews.java
index 8f17e96..4d03123 100644
--- a/core/java/android/widget/RemoteViews.java
+++ b/core/java/android/widget/RemoteViews.java
@@ -370,10 +370,12 @@
                 // TODO: Unregister this handler if PendingIntent.FLAG_ONE_SHOT?
                 Context context = view.getContext();
                 ActivityOptions opts = getActivityOptions(context);
+                // The NEW_TASK flags are applied through the activity options and not as a part of
+                // the call to startIntentSender() to ensure that they are consistently applied to
+                // both mutable and immutable PendingIntents.
                 context.startIntentSender(
                         pendingIntent.getIntentSender(), fillInIntent,
-                        Intent.FLAG_ACTIVITY_NEW_TASK,
-                        Intent.FLAG_ACTIVITY_NEW_TASK, 0, opts.toBundle());
+                        0, 0, 0, opts.toBundle());
             } catch (IntentSender.SendIntentException e) {
                 android.util.Log.e(LOG_TAG, "Cannot send pending intent: ", e);
                 return false;
@@ -401,10 +403,15 @@
                 windowAnimationStyle.recycle();
 
                 if (enterAnimationId != 0) {
-                    return ActivityOptions.makeCustomAnimation(context, enterAnimationId, 0);
+                    final ActivityOptions opts = ActivityOptions.makeCustomAnimation(context,
+                            enterAnimationId, 0);
+                    opts.setPendingIntentLaunchFlags(Intent.FLAG_ACTIVITY_NEW_TASK);
+                    return opts;
                 }
             }
-            return ActivityOptions.makeBasic();
+            final ActivityOptions opts = ActivityOptions.makeBasic();
+            opts.setPendingIntentLaunchFlags(Intent.FLAG_ACTIVITY_NEW_TASK);
+            return opts;
         }
     }
 
diff --git a/core/java/android/widget/TextView.java b/core/java/android/widget/TextView.java
index f74c234..66809db 100644
--- a/core/java/android/widget/TextView.java
+++ b/core/java/android/widget/TextView.java
@@ -63,7 +63,7 @@
 import android.graphics.RectF;
 import android.graphics.Typeface;
 import android.graphics.drawable.Drawable;
-import android.graphics.fonts.Font;
+import android.graphics.fonts.FontStyle;
 import android.graphics.fonts.FontVariationAxis;
 import android.icu.text.DecimalFormatSymbols;
 import android.os.AsyncTask;
@@ -2073,7 +2073,7 @@
      */
     private void setTypefaceFromAttrs(@Nullable Typeface typeface, @Nullable String familyName,
             @XMLTypefaceAttr int typefaceIndex, @Typeface.Style int style,
-            @IntRange(from = -1, to = Font.FONT_WEIGHT_MAX) int weight) {
+            @IntRange(from = -1, to = FontStyle.FONT_WEIGHT_MAX) int weight) {
         if (typeface == null && familyName != null) {
             // Lookup normal Typeface from system font map.
             final Typeface normalTypeface = Typeface.create(familyName, Typeface.NORMAL);
@@ -2100,9 +2100,9 @@
     }
 
     private void resolveStyleAndSetTypeface(@NonNull Typeface typeface, @Typeface.Style int style,
-            @IntRange(from = -1, to = Font.FONT_WEIGHT_MAX) int weight) {
+            @IntRange(from = -1, to = FontStyle.FONT_WEIGHT_MAX) int weight) {
         if (weight >= 0) {
-            weight = Math.min(Font.FONT_WEIGHT_MAX, weight);
+            weight = Math.min(FontStyle.FONT_WEIGHT_MAX, weight);
             final boolean italic = (style & Typeface.ITALIC) != 0;
             setTypeface(Typeface.create(typeface, weight, italic));
         } else {
@@ -3517,6 +3517,7 @@
         ColorStateList mTextColorHint = null;
         ColorStateList mTextColorLink = null;
         int mTextSize = -1;
+        LocaleList mTextLocales = null;
         String mFontFamily = null;
         Typeface mFontTypeface = null;
         boolean mFontFamilyExplicit = false;
@@ -3543,6 +3544,7 @@
                     + "    mTextColorHint:" + mTextColorHint + "\n"
                     + "    mTextColorLink:" + mTextColorLink + "\n"
                     + "    mTextSize:" + mTextSize + "\n"
+                    + "    mTextLocales:" + mTextLocales + "\n"
                     + "    mFontFamily:" + mFontFamily + "\n"
                     + "    mFontTypeface:" + mFontTypeface + "\n"
                     + "    mFontFamilyExplicit:" + mFontFamilyExplicit + "\n"
@@ -3579,6 +3581,8 @@
                 com.android.internal.R.styleable.TextAppearance_textColorLink);
         sAppearanceValues.put(com.android.internal.R.styleable.TextView_textSize,
                 com.android.internal.R.styleable.TextAppearance_textSize);
+        sAppearanceValues.put(com.android.internal.R.styleable.TextView_textLocale,
+                com.android.internal.R.styleable.TextAppearance_textLocale);
         sAppearanceValues.put(com.android.internal.R.styleable.TextView_typeface,
                 com.android.internal.R.styleable.TextAppearance_typeface);
         sAppearanceValues.put(com.android.internal.R.styleable.TextView_fontFamily,
@@ -3652,6 +3656,15 @@
                     attributes.mTextSize =
                             appearance.getDimensionPixelSize(attr, attributes.mTextSize);
                     break;
+                case com.android.internal.R.styleable.TextAppearance_textLocale:
+                    final String localeString = appearance.getString(attr);
+                    if (localeString != null) {
+                        final LocaleList localeList = LocaleList.forLanguageTags(localeString);
+                        if (!localeList.isEmpty()) {
+                            attributes.mTextLocales = localeList;
+                        }
+                    }
+                    break;
                 case com.android.internal.R.styleable.TextAppearance_typeface:
                     attributes.mTypefaceIndex = appearance.getInt(attr, attributes.mTypefaceIndex);
                     if (attributes.mTypefaceIndex != -1 && !attributes.mFontFamilyExplicit) {
@@ -3738,6 +3751,10 @@
             setRawTextSize(attributes.mTextSize, true /* shouldRequestLayout */);
         }
 
+        if (attributes.mTextLocales != null) {
+            setTextLocales(attributes.mTextLocales);
+        }
+
         if (attributes.mTypefaceIndex != -1 && !attributes.mFontFamilyExplicit) {
             attributes.mFontFamily = null;
         }
diff --git a/core/java/com/android/internal/inputmethod/InputMethodDebug.java b/core/java/com/android/internal/inputmethod/InputMethodDebug.java
new file mode 100644
index 0000000..a5dc3d1
--- /dev/null
+++ b/core/java/com/android/internal/inputmethod/InputMethodDebug.java
@@ -0,0 +1,158 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.internal.inputmethod;
+
+import android.view.WindowManager;
+import android.view.WindowManager.LayoutParams.SoftInputModeFlags;
+
+/**
+ * Provides useful methods for debugging.
+ */
+public final class InputMethodDebug {
+    /**
+     * Not intended to be instantiated.
+     */
+    private InputMethodDebug() {
+    }
+
+    /**
+     * Converts {@link StartInputReason} to {@link String} for debug logging.
+     *
+     * @param reason integer constant for {@link StartInputReason}.
+     * @return {@link String} message corresponds for the given {@code reason}.
+     */
+    public static String startInputReasonToString(@StartInputReason int reason) {
+        switch (reason) {
+            case StartInputReason.UNSPECIFIED:
+                return "UNSPECIFIED";
+            case StartInputReason.WINDOW_FOCUS_GAIN:
+                return "WINDOW_FOCUS_GAIN";
+            case StartInputReason.WINDOW_FOCUS_GAIN_REPORT_ONLY:
+                return "WINDOW_FOCUS_GAIN_REPORT_ONLY";
+            case StartInputReason.APP_CALLED_RESTART_INPUT_API:
+                return "APP_CALLED_RESTART_INPUT_API";
+            case StartInputReason.CHECK_FOCUS:
+                return "CHECK_FOCUS";
+            case StartInputReason.BOUND_TO_IMMS:
+                return "BOUND_TO_IMMS";
+            case StartInputReason.UNBOUND_FROM_IMMS:
+                return "UNBOUND_FROM_IMMS";
+            case StartInputReason.ACTIVATED_BY_IMMS:
+                return "ACTIVATED_BY_IMMS";
+            case StartInputReason.DEACTIVATED_BY_IMMS:
+                return "DEACTIVATED_BY_IMMS";
+            case StartInputReason.SESSION_CREATED_BY_IME:
+                return "SESSION_CREATED_BY_IME";
+            default:
+                return "Unknown=" + reason;
+        }
+    }
+
+    /**
+     * Converts {@link UnbindReason} to {@link String} for debug logging.
+     *
+     * @param reason integer constant for {@link UnbindReason}.
+     * @return {@link String} message corresponds for the given {@code reason}.
+     */
+    public static String unbindReasonToString(@UnbindReason int reason) {
+        switch (reason) {
+            case UnbindReason.UNSPECIFIED:
+                return "UNSPECIFIED";
+            case UnbindReason.SWITCH_CLIENT:
+                return "SWITCH_CLIENT";
+            case UnbindReason.SWITCH_IME:
+                return "SWITCH_IME";
+            case UnbindReason.DISCONNECT_IME:
+                return "DISCONNECT_IME";
+            case UnbindReason.NO_IME:
+                return "NO_IME";
+            case UnbindReason.SWITCH_IME_FAILED:
+                return "SWITCH_IME_FAILED";
+            case UnbindReason.SWITCH_USER:
+                return "SWITCH_USER";
+            default:
+                return "Unknown=" + reason;
+        }
+    }
+
+    /**
+     * Converts {@link SoftInputModeFlags} to {@link String} for debug logging.
+     *
+     * @param softInputMode integer constant for {@link SoftInputModeFlags}.
+     * @return {@link String} message corresponds for the given {@code softInputMode}.
+     */
+    public static String softInputModeToString(@SoftInputModeFlags int softInputMode) {
+        final StringBuilder sb = new StringBuilder();
+        final int state = softInputMode & WindowManager.LayoutParams.SOFT_INPUT_MASK_STATE;
+        final int adjust = softInputMode & WindowManager.LayoutParams.SOFT_INPUT_MASK_ADJUST;
+        final boolean isForwardNav =
+                (softInputMode & WindowManager.LayoutParams.SOFT_INPUT_IS_FORWARD_NAVIGATION) != 0;
+
+        switch (state) {
+            case WindowManager.LayoutParams.SOFT_INPUT_STATE_UNSPECIFIED:
+                sb.append("STATE_UNSPECIFIED");
+                break;
+            case WindowManager.LayoutParams.SOFT_INPUT_STATE_UNCHANGED:
+                sb.append("STATE_UNCHANGED");
+                break;
+            case WindowManager.LayoutParams.SOFT_INPUT_STATE_HIDDEN:
+                sb.append("STATE_HIDDEN");
+                break;
+            case WindowManager.LayoutParams.SOFT_INPUT_STATE_ALWAYS_HIDDEN:
+                sb.append("STATE_ALWAYS_HIDDEN");
+                break;
+            case WindowManager.LayoutParams.SOFT_INPUT_STATE_VISIBLE:
+                sb.append("STATE_VISIBLE");
+                break;
+            case WindowManager.LayoutParams.SOFT_INPUT_STATE_ALWAYS_VISIBLE:
+                sb.append("STATE_ALWAYS_VISIBLE");
+                break;
+            default:
+                sb.append("STATE_UNKNOWN(");
+                sb.append(state);
+                sb.append(")");
+                break;
+        }
+
+        switch (adjust) {
+            case WindowManager.LayoutParams.SOFT_INPUT_ADJUST_UNSPECIFIED:
+                sb.append("|ADJUST_UNSPECIFIED");
+                break;
+            case WindowManager.LayoutParams.SOFT_INPUT_ADJUST_RESIZE:
+                sb.append("|ADJUST_RESIZE");
+                break;
+            case WindowManager.LayoutParams.SOFT_INPUT_ADJUST_PAN:
+                sb.append("|ADJUST_PAN");
+                break;
+            case WindowManager.LayoutParams.SOFT_INPUT_ADJUST_NOTHING:
+                sb.append("|ADJUST_NOTHING");
+                break;
+            default:
+                sb.append("|ADJUST_UNKNOWN(");
+                sb.append(adjust);
+                sb.append(")");
+                break;
+        }
+
+        if (isForwardNav) {
+            // This is a special bit that is set by the system only during the window navigation.
+            sb.append("|IS_FORWARD_NAVIGATION");
+        }
+
+        return sb.toString();
+    }
+}
diff --git a/core/java/com/android/internal/inputmethod/StartInputReason.java b/core/java/com/android/internal/inputmethod/StartInputReason.java
new file mode 100644
index 0000000..a01c459
--- /dev/null
+++ b/core/java/com/android/internal/inputmethod/StartInputReason.java
@@ -0,0 +1,92 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.internal.inputmethod;
+
+import static java.lang.annotation.RetentionPolicy.SOURCE;
+
+import android.annotation.IntDef;
+
+import java.lang.annotation.Retention;
+
+/**
+ * Describes the reason why {@link android.view.inputmethod.InputMethodManager} is calling
+ * {@link com.android.internal.view.IInputMethodManager#startInputOrWindowGainedFocus}.
+ */
+@Retention(SOURCE)
+@IntDef(value = {
+        StartInputReason.UNSPECIFIED,
+        StartInputReason.WINDOW_FOCUS_GAIN,
+        StartInputReason.WINDOW_FOCUS_GAIN_REPORT_ONLY,
+        StartInputReason.APP_CALLED_RESTART_INPUT_API,
+        StartInputReason.CHECK_FOCUS,
+        StartInputReason.BOUND_TO_IMMS,
+        StartInputReason.UNBOUND_FROM_IMMS,
+        StartInputReason.ACTIVATED_BY_IMMS,
+        StartInputReason.DEACTIVATED_BY_IMMS,
+        StartInputReason.SESSION_CREATED_BY_IME})
+public @interface StartInputReason {
+    /**
+     * Reason is not specified.
+     */
+    int UNSPECIFIED = 0;
+    /**
+     * {@link android.view.Window} gained focus and it made the focused {@link android.view.View}
+     * to (re)start a new connection.
+     */
+    int WINDOW_FOCUS_GAIN = 1;
+    /**
+     * {@link android.view.Window} gained focus but there is no {@link android.view.View} that is
+     * eligible to have IME focus. {@link android.view.inputmethod.InputMethodManager} just reports
+     * this window focus change event.
+     */
+    int WINDOW_FOCUS_GAIN_REPORT_ONLY = 2;
+    /**
+     * {@link android.view.inputmethod.InputMethodManager#restartInput(android.view.View)} is
+     * either explicitly called by the application or indirectly called by some Framework class
+     * (e.g. {@link android.widget.EditText}).
+     */
+    int APP_CALLED_RESTART_INPUT_API = 3;
+    /**
+     * {@link android.view.View} requested a new connection because of view focus change.
+     */
+    int CHECK_FOCUS = 4;
+    /**
+     * {@link android.view.inputmethod.InputMethodManager} is responding to
+     * {@link com.android.internal.view.IInputMethodClient#onBindMethod}.
+     */
+    int BOUND_TO_IMMS = 5;
+    /**
+     * {@link android.view.inputmethod.InputMethodManager} is responding to
+     * {@link com.android.internal.view.IInputMethodClient#onUnbindMethod}.
+     */
+    int UNBOUND_FROM_IMMS = 6;
+    /**
+     * {@link android.view.inputmethod.InputMethodManager} is responding to
+     * {@link com.android.internal.view.IInputMethodClient#setActive}.
+     */
+    int ACTIVATED_BY_IMMS = 7;
+    /**
+     * {@link android.view.inputmethod.InputMethodManager} is responding to
+     * {@link com.android.internal.view.IInputMethodClient#setActive}.
+     */
+    int DEACTIVATED_BY_IMMS = 8;
+    /**
+     * {@link com.android.server.inputmethod.InputMethodManagerService} is responding to
+     * {@link com.android.internal.view.IInputSessionCallback#sessionCreated}.
+     */
+    int SESSION_CREATED_BY_IME = 9;
+}
diff --git a/core/java/com/android/internal/inputmethod/UnbindReason.java b/core/java/com/android/internal/inputmethod/UnbindReason.java
new file mode 100644
index 0000000..f0f18f1
--- /dev/null
+++ b/core/java/com/android/internal/inputmethod/UnbindReason.java
@@ -0,0 +1,69 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.internal.inputmethod;
+
+import static java.lang.annotation.RetentionPolicy.SOURCE;
+
+import android.annotation.IntDef;
+
+import java.lang.annotation.Retention;
+
+/**
+ * Describes the reason why {@link com.android.server.inputmethod.InputMethodManagerService} is
+ * calling {@link com.android.internal.view.IInputMethodClient#onUnbindMethod}.
+ */
+@Retention(SOURCE)
+@IntDef(value = {
+        UnbindReason.UNSPECIFIED,
+        UnbindReason.SWITCH_CLIENT,
+        UnbindReason.SWITCH_IME,
+        UnbindReason.DISCONNECT_IME,
+        UnbindReason.NO_IME,
+        UnbindReason.SWITCH_IME_FAILED,
+        UnbindReason.SWITCH_USER})
+public @interface UnbindReason {
+    /**
+     * Reason is not specified.
+     */
+    int UNSPECIFIED = 0;
+    /**
+     * When a new IME client becomes active, the previous IME client will unbound from the current
+     * IME.
+     */
+    int SWITCH_CLIENT = 1;
+    /**
+     * Before a new IME becomes active, the current IME client be unbound from the previous IME.
+     */
+    int SWITCH_IME = 2;
+    /**
+     * When the current IME is disconnected, the current IME client will be unbound.
+     */
+    int DISCONNECT_IME = 3;
+    /**
+     * When the system loses the last enabled IME, the current IME client will be unbound.
+     */
+    int NO_IME = 4;
+    /**
+     * When the system failed to switch to another IME, the current IME client will be unbound.
+     */
+    int SWITCH_IME_FAILED = 5;
+    /**
+     * When a new user becomes foreground, the previous IME client will be unbound from the previous
+     * user's active IME.
+     */
+    int SWITCH_USER = 6;
+}
diff --git a/core/java/com/android/internal/os/KernelWakelockReader.java b/core/java/com/android/internal/os/KernelWakelockReader.java
index 46667d1..2442d0b 100644
--- a/core/java/com/android/internal/os/KernelWakelockReader.java
+++ b/core/java/com/android/internal/os/KernelWakelockReader.java
@@ -158,7 +158,7 @@
                                          PROC_WAKELOCKS_FORMAT,
                         nameStringArray, wlData, null);
 
-                name = nameStringArray[0];
+                name = nameStringArray[0].trim();
                 count = (int) wlData[1];
 
                 if (wakeup_sources) {
diff --git a/core/java/com/android/internal/view/IInputMethodClient.aidl b/core/java/com/android/internal/view/IInputMethodClient.aidl
index 2618356..17b2bc4 100644
--- a/core/java/com/android/internal/view/IInputMethodClient.aidl
+++ b/core/java/com/android/internal/view/IInputMethodClient.aidl
@@ -24,7 +24,6 @@
  */
 oneway interface IInputMethodClient {
     void onBindMethod(in InputBindResult res);
-    // unbindReason corresponds to InputMethodClient.UnbindReason.
     void onUnbindMethod(int sequence, int unbindReason);
     void setActive(boolean active, boolean fullscreen);
     void reportFullscreenMode(boolean fullscreen);
diff --git a/core/java/com/android/internal/view/IInputMethodManager.aidl b/core/java/com/android/internal/view/IInputMethodManager.aidl
index dceacda..29c55c2 100644
--- a/core/java/com/android/internal/view/IInputMethodManager.aidl
+++ b/core/java/com/android/internal/view/IInputMethodManager.aidl
@@ -46,7 +46,6 @@
     // Currently there is a bug that aidl doesn't accept List<Parcelable>
     List getShortcutInputMethodsAndSubtypes();
 
-    void finishInput(in IInputMethodClient client);
     boolean showSoftInput(in IInputMethodClient client, int flags,
             in ResultReceiver resultReceiver);
     boolean hideSoftInput(in IInputMethodClient client, int flags,
@@ -55,7 +54,7 @@
     // has gained focus, and if 'attribute' is non-null then also does startInput.
     // @NonNull
     InputBindResult startInputOrWindowGainedFocus(
-            /* @InputMethodClient.StartInputReason */ int startInputReason,
+            /* @StartInputReason */ int startInputReason,
             in IInputMethodClient client, in IBinder windowToken, int controlFlags,
             /* @android.view.WindowManager.LayoutParams.SoftInputModeFlags */ int softInputMode,
             int windowFlags, in EditorInfo attribute, IInputContext inputContext,
diff --git a/core/java/com/android/internal/view/InputMethodClient.java b/core/java/com/android/internal/view/InputMethodClient.java
deleted file mode 100644
index bbd33a2..0000000
--- a/core/java/com/android/internal/view/InputMethodClient.java
+++ /dev/null
@@ -1,169 +0,0 @@
-/*
- * Copyright (C) 2015 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-package com.android.internal.view;
-
-import android.annotation.IntDef;
-import android.view.WindowManager.LayoutParams;
-import android.view.WindowManager.LayoutParams.SoftInputModeFlags;
-
-import java.lang.annotation.Retention;
-
-import static java.lang.annotation.RetentionPolicy.SOURCE;
-
-public final class InputMethodClient {
-    public static final int START_INPUT_REASON_UNSPECIFIED = 0;
-    public static final int START_INPUT_REASON_WINDOW_FOCUS_GAIN = 1;
-    public static final int START_INPUT_REASON_WINDOW_FOCUS_GAIN_REPORT_ONLY = 2;
-    public static final int START_INPUT_REASON_APP_CALLED_RESTART_INPUT_API = 3;
-    public static final int START_INPUT_REASON_CHECK_FOCUS = 4;
-    public static final int START_INPUT_REASON_BOUND_TO_IMMS = 5;
-    public static final int START_INPUT_REASON_UNBOUND_FROM_IMMS = 6;
-    public static final int START_INPUT_REASON_ACTIVATED_BY_IMMS = 7;
-    public static final int START_INPUT_REASON_DEACTIVATED_BY_IMMS = 8;
-    public static final int START_INPUT_REASON_SESSION_CREATED_BY_IME = 9;
-
-    @Retention(SOURCE)
-    @IntDef({START_INPUT_REASON_UNSPECIFIED, START_INPUT_REASON_WINDOW_FOCUS_GAIN,
-            START_INPUT_REASON_WINDOW_FOCUS_GAIN_REPORT_ONLY,
-            START_INPUT_REASON_APP_CALLED_RESTART_INPUT_API, START_INPUT_REASON_CHECK_FOCUS,
-            START_INPUT_REASON_BOUND_TO_IMMS, START_INPUT_REASON_ACTIVATED_BY_IMMS,
-            START_INPUT_REASON_DEACTIVATED_BY_IMMS, START_INPUT_REASON_SESSION_CREATED_BY_IME})
-    public @interface StartInputReason {}
-
-    public static String getStartInputReason(@StartInputReason final int reason) {
-        switch (reason) {
-            case START_INPUT_REASON_UNSPECIFIED:
-                return "UNSPECIFIED";
-            case START_INPUT_REASON_WINDOW_FOCUS_GAIN:
-                return "WINDOW_FOCUS_GAIN";
-            case START_INPUT_REASON_WINDOW_FOCUS_GAIN_REPORT_ONLY:
-                return "WINDOW_FOCUS_GAIN_REPORT_ONLY";
-            case START_INPUT_REASON_APP_CALLED_RESTART_INPUT_API:
-                return "APP_CALLED_RESTART_INPUT_API";
-            case START_INPUT_REASON_CHECK_FOCUS:
-                return "CHECK_FOCUS";
-            case START_INPUT_REASON_BOUND_TO_IMMS:
-                return "BOUND_TO_IMMS";
-            case START_INPUT_REASON_UNBOUND_FROM_IMMS:
-                return "UNBOUND_FROM_IMMS";
-            case START_INPUT_REASON_ACTIVATED_BY_IMMS:
-                return "ACTIVATED_BY_IMMS";
-            case START_INPUT_REASON_DEACTIVATED_BY_IMMS:
-                return "DEACTIVATED_BY_IMMS";
-            case START_INPUT_REASON_SESSION_CREATED_BY_IME:
-                return "SESSION_CREATED_BY_IME";
-            default:
-                return "Unknown=" + reason;
-        }
-    }
-
-    public static final int UNBIND_REASON_UNSPECIFIED = 0;
-    public static final int UNBIND_REASON_SWITCH_CLIENT = 1;
-    public static final int UNBIND_REASON_SWITCH_IME = 2;
-    public static final int UNBIND_REASON_DISCONNECT_IME = 3;
-    public static final int UNBIND_REASON_NO_IME = 4;
-    public static final int UNBIND_REASON_SWITCH_IME_FAILED = 5;
-    public static final int UNBIND_REASON_SWITCH_USER = 6;
-
-    @Retention(SOURCE)
-    @IntDef({UNBIND_REASON_UNSPECIFIED, UNBIND_REASON_SWITCH_CLIENT, UNBIND_REASON_SWITCH_IME,
-            UNBIND_REASON_DISCONNECT_IME, UNBIND_REASON_NO_IME, UNBIND_REASON_SWITCH_IME_FAILED,
-            UNBIND_REASON_SWITCH_USER})
-    public @interface UnbindReason {}
-
-    public static String getUnbindReason(@UnbindReason final int reason) {
-        switch (reason) {
-            case UNBIND_REASON_UNSPECIFIED:
-                return "UNSPECIFIED";
-            case UNBIND_REASON_SWITCH_CLIENT:
-                return "SWITCH_CLIENT";
-            case UNBIND_REASON_SWITCH_IME:
-                return "SWITCH_IME";
-            case UNBIND_REASON_DISCONNECT_IME:
-                return "DISCONNECT_IME";
-            case UNBIND_REASON_NO_IME:
-                return "NO_IME";
-            case UNBIND_REASON_SWITCH_IME_FAILED:
-                return "SWITCH_IME_FAILED";
-            case UNBIND_REASON_SWITCH_USER:
-                return "SWITCH_USER";
-            default:
-                return "Unknown=" + reason;
-        }
-    }
-
-    public static String softInputModeToString(@SoftInputModeFlags final int softInputMode) {
-        final StringBuilder sb = new StringBuilder();
-        final int state = softInputMode & LayoutParams.SOFT_INPUT_MASK_STATE;
-        final int adjust = softInputMode & LayoutParams.SOFT_INPUT_MASK_ADJUST;
-        final boolean isForwardNav =
-                (softInputMode & LayoutParams.SOFT_INPUT_IS_FORWARD_NAVIGATION) != 0;
-
-        switch (state) {
-            case LayoutParams.SOFT_INPUT_STATE_UNSPECIFIED:
-                sb.append("STATE_UNSPECIFIED");
-                break;
-            case LayoutParams.SOFT_INPUT_STATE_UNCHANGED:
-                sb.append("STATE_UNCHANGED");
-                break;
-            case LayoutParams.SOFT_INPUT_STATE_HIDDEN:
-                sb.append("STATE_HIDDEN");
-                break;
-            case LayoutParams.SOFT_INPUT_STATE_ALWAYS_HIDDEN:
-                sb.append("STATE_ALWAYS_HIDDEN");
-                break;
-            case LayoutParams.SOFT_INPUT_STATE_VISIBLE:
-                sb.append("STATE_VISIBLE");
-                break;
-            case LayoutParams.SOFT_INPUT_STATE_ALWAYS_VISIBLE:
-                sb.append("STATE_ALWAYS_VISIBLE");
-                break;
-            default:
-                sb.append("STATE_UNKNOWN(");
-                sb.append(state);
-                sb.append(")");
-                break;
-        }
-
-        switch (adjust) {
-            case LayoutParams.SOFT_INPUT_ADJUST_UNSPECIFIED:
-                sb.append("|ADJUST_UNSPECIFIED");
-                break;
-            case LayoutParams.SOFT_INPUT_ADJUST_RESIZE:
-                sb.append("|ADJUST_RESIZE");
-                break;
-            case LayoutParams.SOFT_INPUT_ADJUST_PAN:
-                sb.append("|ADJUST_PAN");
-                break;
-            case LayoutParams.SOFT_INPUT_ADJUST_NOTHING:
-                sb.append("|ADJUST_NOTHING");
-                break;
-            default:
-                sb.append("|ADJUST_UNKNOWN(");
-                sb.append(adjust);
-                sb.append(")");
-                break;
-        }
-
-        if (isForwardNav) {
-            // This is a special bit that is set by the system only during the window navigation.
-            sb.append("|IS_FORWARD_NAVIGATION");
-        }
-
-        return sb.toString();
-    }
-}
diff --git a/core/java/com/google/android/collect/Lists.java b/core/java/com/google/android/collect/Lists.java
index c029bb2..3ea873b 100644
--- a/core/java/com/google/android/collect/Lists.java
+++ b/core/java/com/google/android/collect/Lists.java
@@ -16,6 +16,7 @@
 
 package com.google.android.collect;
 
+import android.annotation.UnsupportedAppUsage;
 import java.util.ArrayList;
 import java.util.Collections;
 
@@ -33,6 +34,7 @@
      *
      * @return a newly-created, initially-empty {@code ArrayList}
      */
+    @UnsupportedAppUsage
     public static <E> ArrayList<E> newArrayList() {
         return new ArrayList<E>();
     }
diff --git a/core/java/com/google/android/collect/Maps.java b/core/java/com/google/android/collect/Maps.java
index fc2c9fe..6ba3320 100644
--- a/core/java/com/google/android/collect/Maps.java
+++ b/core/java/com/google/android/collect/Maps.java
@@ -16,6 +16,7 @@
 
 package com.google.android.collect;
 
+import android.annotation.UnsupportedAppUsage;
 import android.util.ArrayMap;
 
 import java.util.HashMap;
@@ -29,6 +30,7 @@
      *
      * @return a newly-created, initially-empty {@code HashMap}
      */
+    @UnsupportedAppUsage
     public static <K, V> HashMap<K, V> newHashMap() {
         return new HashMap<K, V>();
     }
diff --git a/core/jni/Android.bp b/core/jni/Android.bp
index ed6445d..59c29e2 100644
--- a/core/jni/Android.bp
+++ b/core/jni/Android.bp
@@ -45,6 +45,7 @@
         "android_app_NativeActivity.cpp",
         "android_app_admin_SecurityLog.cpp",
         "android_opengl_EGL14.cpp",
+        "android_opengl_EGL15.cpp",
         "android_opengl_EGLExt.cpp",
         "android_opengl_GLES10.cpp",
         "android_opengl_GLES10Ext.cpp",
@@ -239,6 +240,7 @@
 
     shared_libs: [
         "libbpf",
+        "libnetdbpf",
         "libnetdutils",
         "libmemtrack",
         "libandroidfw",
diff --git a/core/jni/AndroidRuntime.cpp b/core/jni/AndroidRuntime.cpp
index c05bad2..eada690 100644
--- a/core/jni/AndroidRuntime.cpp
+++ b/core/jni/AndroidRuntime.cpp
@@ -77,6 +77,7 @@
 extern int register_com_google_android_gles_jni_EGLImpl(JNIEnv* env);
 extern int register_com_google_android_gles_jni_GLImpl(JNIEnv* env);
 extern int register_android_opengl_jni_EGL14(JNIEnv* env);
+extern int register_android_opengl_jni_EGL15(JNIEnv* env);
 extern int register_android_opengl_jni_EGLExt(JNIEnv* env);
 extern int register_android_opengl_jni_GLES10(JNIEnv* env);
 extern int register_android_opengl_jni_GLES10Ext(JNIEnv* env);
@@ -1367,6 +1368,7 @@
     REG_JNI(register_com_google_android_gles_jni_EGLImpl),
     REG_JNI(register_com_google_android_gles_jni_GLImpl),
     REG_JNI(register_android_opengl_jni_EGL14),
+    REG_JNI(register_android_opengl_jni_EGL15),
     REG_JNI(register_android_opengl_jni_EGLExt),
     REG_JNI(register_android_opengl_jni_GLES10),
     REG_JNI(register_android_opengl_jni_GLES10Ext),
diff --git a/core/jni/android/graphics/NinePatch.cpp b/core/jni/android/graphics/NinePatch.cpp
index 2619107..bb291e7 100644
--- a/core/jni/android/graphics/NinePatch.cpp
+++ b/core/jni/android/graphics/NinePatch.cpp
@@ -23,8 +23,6 @@
 #include <hwui/Paint.h>
 #include <utils/Log.h>
 
-#include <ResourceCache.h>
-
 #include "SkCanvas.h"
 #include "SkLatticeIter.h"
 #include "SkRegion.h"
@@ -83,12 +81,7 @@
 
     static void finalize(JNIEnv* env, jobject, jlong patchHandle) {
         int8_t* patch = reinterpret_cast<int8_t*>(patchHandle);
-        if (android::uirenderer::ResourceCache::hasInstance()) {
-            Res_png_9patch* p = (Res_png_9patch*) patch;
-            android::uirenderer::ResourceCache::getInstance().destructor(p);
-        } else {
-            delete[] patch;
-        }
+        delete[] patch;
     }
 
     static jlong getTransparentRegion(JNIEnv* env, jobject, jobject jbitmap,
diff --git a/core/jni/android_opengl_EGL15.cpp b/core/jni/android_opengl_EGL15.cpp
new file mode 100644
index 0000000..4a30bab
--- /dev/null
+++ b/core/jni/android_opengl_EGL15.cpp
@@ -0,0 +1,557 @@
+/*
+** Copyright 2018, The Android Open Source Project
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+**
+**     http://www.apache.org/licenses/LICENSE-2.0
+**
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+*/
+
+#pragma GCC diagnostic ignored "-Wunused-variable"
+#pragma GCC diagnostic ignored "-Wunused-function"
+
+#include "jni.h"
+#include <nativehelper/JNIHelp.h>
+#include <android_runtime/AndroidRuntime.h>
+#include <utils/misc.h>
+
+#include <assert.h>
+#include <EGL/egl.h>
+
+#include <ui/ANativeObjectBase.h>
+
+static int initialized = 0;
+
+// classes from EGL 1.4
+static jclass egldisplayClass;
+static jclass eglsurfaceClass;
+static jclass eglconfigClass;
+static jclass eglcontextClass;
+static jclass bufferClass;
+static jclass nioAccessClass;
+
+static jfieldID positionID;
+static jfieldID limitID;
+static jfieldID elementSizeShiftID;
+
+static jmethodID getBasePointerID;
+static jmethodID getBaseArrayID;
+static jmethodID getBaseArrayOffsetID;
+
+static jmethodID egldisplayGetHandleID;
+static jmethodID eglconfigGetHandleID;
+static jmethodID eglcontextGetHandleID;
+static jmethodID eglsurfaceGetHandleID;
+
+static jmethodID egldisplayConstructor;
+static jmethodID eglcontextConstructor;
+static jmethodID eglsurfaceConstructor;
+static jmethodID eglconfigConstructor;
+
+static jobject eglNoContextObject;
+static jobject eglNoDisplayObject;
+static jobject eglNoSurfaceObject;
+
+// classes from EGL 1.5
+static jclass eglimageClass;
+static jclass eglsyncClass;
+
+static jmethodID eglimageGetHandleID;
+static jmethodID eglsyncGetHandleID;
+
+static jmethodID eglimageConstructor;
+static jmethodID eglsyncConstructor;
+
+static jobject eglNoImageObject;
+static jobject eglNoSyncObject;
+
+/* Cache method IDs each time the class is loaded. */
+
+static void
+nativeClassInit(JNIEnv *_env, jclass glImplClass)
+{
+    // EGL 1.4 Init
+    jclass eglconfigClassLocal = _env->FindClass("android/opengl/EGLConfig");
+    eglconfigClass = (jclass) _env->NewGlobalRef(eglconfigClassLocal);
+    jclass eglcontextClassLocal = _env->FindClass("android/opengl/EGLContext");
+    eglcontextClass = (jclass) _env->NewGlobalRef(eglcontextClassLocal);
+    jclass egldisplayClassLocal = _env->FindClass("android/opengl/EGLDisplay");
+    egldisplayClass = (jclass) _env->NewGlobalRef(egldisplayClassLocal);
+    jclass eglsurfaceClassLocal = _env->FindClass("android/opengl/EGLSurface");
+    eglsurfaceClass = (jclass) _env->NewGlobalRef(eglsurfaceClassLocal);
+
+    eglconfigGetHandleID = _env->GetMethodID(eglconfigClass, "getNativeHandle", "()J");
+    eglcontextGetHandleID = _env->GetMethodID(eglcontextClass, "getNativeHandle", "()J");
+    egldisplayGetHandleID = _env->GetMethodID(egldisplayClass, "getNativeHandle", "()J");
+    eglsurfaceGetHandleID = _env->GetMethodID(eglsurfaceClass, "getNativeHandle", "()J");
+
+
+    eglconfigConstructor = _env->GetMethodID(eglconfigClass, "<init>", "(J)V");
+    eglcontextConstructor = _env->GetMethodID(eglcontextClass, "<init>", "(J)V");
+    egldisplayConstructor = _env->GetMethodID(egldisplayClass, "<init>", "(J)V");
+    eglsurfaceConstructor = _env->GetMethodID(eglsurfaceClass, "<init>", "(J)V");
+
+    jobject localeglNoContextObject = _env->NewObject(eglcontextClass, eglcontextConstructor, reinterpret_cast<jlong>(EGL_NO_CONTEXT));
+    eglNoContextObject = _env->NewGlobalRef(localeglNoContextObject);
+    jobject localeglNoDisplayObject = _env->NewObject(egldisplayClass, egldisplayConstructor, reinterpret_cast<jlong>(EGL_NO_DISPLAY));
+    eglNoDisplayObject = _env->NewGlobalRef(localeglNoDisplayObject);
+    jobject localeglNoSurfaceObject = _env->NewObject(eglsurfaceClass, eglsurfaceConstructor, reinterpret_cast<jlong>(EGL_NO_SURFACE));
+    eglNoSurfaceObject = _env->NewGlobalRef(localeglNoSurfaceObject);
+
+
+    jclass eglClass = _env->FindClass("android/opengl/EGL15");
+    jfieldID noContextFieldID = _env->GetStaticFieldID(eglClass, "EGL_NO_CONTEXT", "Landroid/opengl/EGLContext;");
+    _env->SetStaticObjectField(eglClass, noContextFieldID, eglNoContextObject);
+
+    jfieldID noDisplayFieldID = _env->GetStaticFieldID(eglClass, "EGL_NO_DISPLAY", "Landroid/opengl/EGLDisplay;");
+    _env->SetStaticObjectField(eglClass, noDisplayFieldID, eglNoDisplayObject);
+
+    jfieldID noSurfaceFieldID = _env->GetStaticFieldID(eglClass, "EGL_NO_SURFACE", "Landroid/opengl/EGLSurface;");
+    _env->SetStaticObjectField(eglClass, noSurfaceFieldID, eglNoSurfaceObject);
+
+    // EGL 1.5 init
+    jclass nioAccessClassLocal = _env->FindClass("java/nio/NIOAccess");
+    nioAccessClass = (jclass) _env->NewGlobalRef(nioAccessClassLocal);
+
+    jclass bufferClassLocal = _env->FindClass("java/nio/Buffer");
+    bufferClass = (jclass) _env->NewGlobalRef(bufferClassLocal);
+
+    getBasePointerID = _env->GetStaticMethodID(nioAccessClass,
+            "getBasePointer", "(Ljava/nio/Buffer;)J");
+    getBaseArrayID = _env->GetStaticMethodID(nioAccessClass,
+            "getBaseArray", "(Ljava/nio/Buffer;)Ljava/lang/Object;");
+    getBaseArrayOffsetID = _env->GetStaticMethodID(nioAccessClass,
+            "getBaseArrayOffset", "(Ljava/nio/Buffer;)I");
+
+    positionID = _env->GetFieldID(bufferClass, "position", "I");
+    limitID = _env->GetFieldID(bufferClass, "limit", "I");
+    elementSizeShiftID =
+        _env->GetFieldID(bufferClass, "_elementSizeShift", "I");
+
+    jclass eglimageClassLocal = _env->FindClass("android/opengl/EGLImage");
+    eglimageClass = (jclass) _env->NewGlobalRef(eglimageClassLocal);
+    jclass eglsyncClassLocal = _env->FindClass("android/opengl/EGLSync");
+    eglsyncClass = (jclass) _env->NewGlobalRef(eglsyncClassLocal);
+
+    eglimageGetHandleID = _env->GetMethodID(eglimageClass, "getNativeHandle", "()J");
+    eglsyncGetHandleID = _env->GetMethodID(eglsyncClass, "getNativeHandle", "()J");
+
+    eglimageConstructor = _env->GetMethodID(eglimageClass, "<init>", "(J)V");
+    eglsyncConstructor = _env->GetMethodID(eglsyncClass, "<init>", "(J)V");
+
+    jfieldID noImageFieldID = _env->GetStaticFieldID(eglClass, "EGL_NO_IMAGE", "Landroid/opengl/EGLImage;");
+    _env->SetStaticObjectField(eglClass, noImageFieldID, eglNoImageObject);
+
+    jfieldID noSyncFieldID = _env->GetStaticFieldID(eglClass, "EGL_NO_SYNC", "Landroid/opengl/EGLSync;");
+    _env->SetStaticObjectField(eglClass, noSyncFieldID, eglNoSyncObject);
+}
+
+static void *
+getPointer(JNIEnv *_env, jobject buffer, jarray *array, jint *remaining, jint *offset)
+{
+    jint position;
+    jint limit;
+    jint elementSizeShift;
+    jlong pointer;
+
+    position = _env->GetIntField(buffer, positionID);
+    limit = _env->GetIntField(buffer, limitID);
+    elementSizeShift = _env->GetIntField(buffer, elementSizeShiftID);
+    *remaining = (limit - position) << elementSizeShift;
+    pointer = _env->CallStaticLongMethod(nioAccessClass,
+            getBasePointerID, buffer);
+    if (pointer != 0L) {
+        *array = NULL;
+        return reinterpret_cast<void*>(pointer);
+    }
+    eglimageGetHandleID = _env->GetMethodID(eglimageClass, "getNativeHandle", "()J");
+    eglsyncGetHandleID = _env->GetMethodID(eglsyncClass, "getNativeHandle", "()J");
+
+    *array = (jarray) _env->CallStaticObjectMethod(nioAccessClass,
+            getBaseArrayID, buffer);
+    *offset = _env->CallStaticIntMethod(nioAccessClass,
+            getBaseArrayOffsetID, buffer);
+
+    return NULL;
+}
+
+static void
+releasePointer(JNIEnv *_env, jarray array, void *data, jboolean commit)
+{
+    _env->ReleasePrimitiveArrayCritical(array, data,
+                       commit ? 0 : JNI_ABORT);
+}
+
+static void *
+fromEGLHandle(JNIEnv *_env, jmethodID mid, jobject obj) {
+    if (obj == NULL){
+        jniThrowException(_env, "java/lang/IllegalArgumentException",
+                          "Object is set to null.");
+    }
+
+    jlong handle = _env->CallLongMethod(obj, mid);
+    return reinterpret_cast<void*>(handle);
+}
+
+static jobject
+toEGLHandle(JNIEnv *_env, jclass cls, jmethodID con, void * handle) {
+    if (cls == eglimageClass &&
+       (EGLImage)handle == EGL_NO_IMAGE) {
+           return eglNoImageObject;
+    }
+
+    return _env->NewObject(cls, con, reinterpret_cast<jlong>(handle));
+}
+
+// --------------------------------------------------------------------------
+/* EGLSync eglCreateSync ( EGLDisplay dpy, EGLenum type, const EGLAttrib *attrib_list ) */
+static jobject
+android_eglCreateSync
+  (JNIEnv *_env, jobject _this, jobject dpy, jint type, jlongArray attrib_list_ref, jint offset) {
+    jint _exception = 0;
+    const char * _exceptionType = NULL;
+    const char * _exceptionMessage = NULL;
+    EGLSync _returnValue = (EGLSync) 0;
+    EGLDisplay dpy_native = (EGLDisplay) fromEGLHandle(_env, egldisplayGetHandleID, dpy);
+    EGLAttrib *attrib_list_base = (EGLAttrib *) 0;
+    jint _remaining;
+    EGLAttrib *attrib_list = (EGLAttrib *) 0;
+
+    if (!attrib_list_ref) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "attrib_list == null";
+        goto exit;
+    }
+    if (offset < 0) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "offset < 0";
+        goto exit;
+    }
+    _remaining = _env->GetArrayLength(attrib_list_ref) - offset;
+    attrib_list_base = (EGLAttrib *)
+        _env->GetLongArrayElements(attrib_list_ref, (jboolean *)0);
+    attrib_list = attrib_list_base + offset;
+
+    _returnValue = eglCreateSync(
+        (EGLDisplay)dpy_native,
+        (EGLenum)type,
+        (EGLAttrib *)attrib_list
+    );
+
+exit:
+    if (attrib_list_base) {
+        _env->ReleaseLongArrayElements(attrib_list_ref, (jlong*)attrib_list_base,
+            JNI_ABORT);
+    }
+    if (_exception) {
+        jniThrowException(_env, _exceptionType, _exceptionMessage);
+    }
+    return toEGLHandle(_env, eglsyncClass, eglsyncConstructor, _returnValue);
+}
+
+/* EGLBoolean eglDestroySync ( EGLDisplay dpy, EGLSync sync ) */
+static jboolean
+android_eglDestroySync
+  (JNIEnv *_env, jobject _this, jobject dpy, jobject sync) {
+    EGLBoolean _returnValue = (EGLBoolean) 0;
+    EGLDisplay dpy_native = (EGLDisplay) fromEGLHandle(_env, egldisplayGetHandleID, dpy);
+    EGLSync sync_native = (EGLSync) fromEGLHandle(_env, eglsyncGetHandleID, sync);
+
+    _returnValue = eglDestroySync(
+        (EGLDisplay)dpy_native,
+        (EGLSync)sync_native
+    );
+    return (jboolean)_returnValue;
+}
+
+/* EGLint eglClientWaitSync ( EGLDisplay dpy, EGLSync sync, EGLint flags, EGLTime timeout ) */
+static jint
+android_eglClientWaitSync
+  (JNIEnv *_env, jobject _this, jobject dpy, jobject sync, jint flags, jlong timeout) {
+    EGLint _returnValue = (EGLint) 0;
+    EGLDisplay dpy_native = (EGLDisplay) fromEGLHandle(_env, egldisplayGetHandleID, dpy);
+    EGLSync sync_native = (EGLSync) fromEGLHandle(_env, eglsyncGetHandleID, sync);
+
+    _returnValue = eglClientWaitSync(
+        (EGLDisplay)dpy_native,
+        (EGLSync)sync_native,
+        (EGLint)flags,
+        (EGLTime)timeout
+    );
+    return (jint)_returnValue;
+}
+
+/* EGLBoolean eglGetSyncAttrib ( EGLDisplay dpy, EGLSync sync, EGLint attribute, EGLAttrib *value ) */
+static jboolean
+android_eglGetSyncAttrib
+  (JNIEnv *_env, jobject _this, jobject dpy, jobject sync, jint attribute, jlongArray value_ref, jint offset) {
+    jint _exception = 0;
+    const char * _exceptionType = NULL;
+    const char * _exceptionMessage = NULL;
+    EGLBoolean _returnValue = (EGLBoolean) 0;
+    EGLDisplay dpy_native = (EGLDisplay) fromEGLHandle(_env, egldisplayGetHandleID, dpy);
+    EGLSync sync_native = (EGLSync) fromEGLHandle(_env, eglsyncGetHandleID, sync);
+    EGLAttrib *value_base = (EGLAttrib *) 0;
+    jint _remaining;
+    EGLAttrib *value = (EGLAttrib *) 0;
+
+    if (!value_ref) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "value == null";
+        goto exit;
+    }
+    if (offset < 0) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "offset < 0";
+        goto exit;
+    }
+    _remaining = _env->GetArrayLength(value_ref) - offset;
+    value_base = (EGLAttrib *)
+        _env->GetLongArrayElements(value_ref, (jboolean *)0);
+    value = value_base + offset;
+
+    _returnValue = eglGetSyncAttrib(
+        (EGLDisplay)dpy_native,
+        (EGLSync)sync_native,
+        (EGLint)attribute,
+        (EGLAttrib *)value
+    );
+
+exit:
+    if (value_base) {
+        _env->ReleaseLongArrayElements(value_ref, (jlong*)value_base,
+            _exception ? JNI_ABORT: 0);
+    }
+    if (_exception) {
+        jniThrowException(_env, _exceptionType, _exceptionMessage);
+    }
+    return (jboolean)_returnValue;
+}
+
+/* EGLDisplay eglGetPlatformDisplay ( EGLenum platform, EGLAttrib native_display, const EGLAttrib *attrib_list ) */
+static jobject
+android_eglGetPlatformDisplay
+  (JNIEnv *_env, jobject _this, jint platform, jlong native_display, jlongArray attrib_list_ref, jint offset) {
+    jint _exception = 0;
+    const char * _exceptionType = NULL;
+    const char * _exceptionMessage = NULL;
+    EGLDisplay _returnValue = (EGLDisplay) 0;
+    EGLAttrib *attrib_list_base = (EGLAttrib *) 0;
+    jint _remaining;
+    EGLAttrib *attrib_list = (EGLAttrib *) 0;
+
+    if (!attrib_list_ref) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "attrib_list == null";
+        goto exit;
+    }
+    if (offset < 0) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "offset < 0";
+        goto exit;
+    }
+    _remaining = _env->GetArrayLength(attrib_list_ref) - offset;
+    attrib_list_base = (EGLAttrib *)
+        _env->GetLongArrayElements(attrib_list_ref, (jboolean *)0);
+    attrib_list = attrib_list_base + offset;
+
+    _returnValue = eglGetPlatformDisplay(
+        (EGLenum)platform,
+        (void *)native_display,
+        (EGLAttrib *)attrib_list
+    );
+
+exit:
+    if (attrib_list_base) {
+        _env->ReleaseLongArrayElements(attrib_list_ref, (jlong*)attrib_list_base,
+            JNI_ABORT);
+    }
+    if (_exception) {
+        jniThrowException(_env, _exceptionType, _exceptionMessage);
+    }
+    return toEGLHandle(_env, egldisplayClass, egldisplayConstructor, _returnValue);
+}
+
+/* EGLSurface eglCreatePlatformWindowSurface ( EGLDisplay dpy, EGLConfig config, void *native_window, const EGLAttrib *attrib_list ) */
+static jobject
+android_eglCreatePlatformWindowSurface
+  (JNIEnv *_env, jobject _this, jobject dpy, jobject config, jobject native_window_buf, jlongArray attrib_list_ref, jint offset) {
+    jint _exception = 0;
+    const char * _exceptionType = NULL;
+    const char * _exceptionMessage = NULL;
+    jarray _array = (jarray) 0;
+    jint _bufferOffset = (jint) 0;
+    EGLSurface _returnValue = (EGLSurface) 0;
+    EGLDisplay dpy_native = (EGLDisplay) fromEGLHandle(_env, egldisplayGetHandleID, dpy);
+    EGLConfig config_native = (EGLConfig) fromEGLHandle(_env, eglconfigGetHandleID, config);
+    jint _native_windowRemaining;
+    void *native_window = (void *) 0;
+    EGLAttrib *attrib_list_base = (EGLAttrib *) 0;
+    jint _attrib_listRemaining;
+    EGLAttrib *attrib_list = (EGLAttrib *) 0;
+
+    if (!native_window_buf) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "native_window == null";
+        goto exit;
+    }
+    native_window = (void *)getPointer(_env, native_window_buf, (jarray*)&_array, &_native_windowRemaining, &_bufferOffset);
+    if (!attrib_list_ref) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "attrib_list == null";
+        goto exit;
+    }
+    if (offset < 0) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "offset < 0";
+        goto exit;
+    }
+    _attrib_listRemaining = _env->GetArrayLength(attrib_list_ref) - offset;
+    attrib_list_base = (EGLAttrib *)
+        _env->GetLongArrayElements(attrib_list_ref, (jboolean *)0);
+    attrib_list = attrib_list_base + offset;
+
+    if (native_window == NULL) {
+        char * _native_windowBase = (char *)_env->GetPrimitiveArrayCritical(_array, (jboolean *) 0);
+        native_window = (void *) (_native_windowBase + _bufferOffset);
+    }
+    _returnValue = eglCreatePlatformWindowSurface(
+        (EGLDisplay)dpy_native,
+        (EGLConfig)config_native,
+        (void *)native_window,
+        (EGLAttrib *)attrib_list
+    );
+
+exit:
+    if (attrib_list_base) {
+        _env->ReleaseLongArrayElements(attrib_list_ref, (jlong*)attrib_list_base,
+            JNI_ABORT);
+    }
+    if (_array) {
+        releasePointer(_env, _array, native_window, _exception ? JNI_FALSE : JNI_TRUE);
+    }
+    if (_exception) {
+        jniThrowException(_env, _exceptionType, _exceptionMessage);
+    }
+    return toEGLHandle(_env, eglsurfaceClass, eglsurfaceConstructor, _returnValue);
+}
+
+/* EGLSurface eglCreatePlatformPixmapSurface ( EGLDisplay dpy, EGLConfig config, void *native_pixmap, const EGLAttrib *attrib_list ) */
+static jobject
+android_eglCreatePlatformPixmapSurface
+  (JNIEnv *_env, jobject _this, jobject dpy, jobject config, jobject native_pixmap_buf, jlongArray attrib_list_ref, jint offset) {
+    jint _exception = 0;
+    const char * _exceptionType = NULL;
+    const char * _exceptionMessage = NULL;
+    jarray _array = (jarray) 0;
+    jint _bufferOffset = (jint) 0;
+    EGLSurface _returnValue = (EGLSurface) 0;
+    EGLDisplay dpy_native = (EGLDisplay) fromEGLHandle(_env, egldisplayGetHandleID, dpy);
+    EGLConfig config_native = (EGLConfig) fromEGLHandle(_env, eglconfigGetHandleID, config);
+    jint _native_pixmapRemaining;
+    void *native_pixmap = (void *) 0;
+    EGLAttrib *attrib_list_base = (EGLAttrib *) 0;
+    jint _attrib_listRemaining;
+    EGLAttrib *attrib_list = (EGLAttrib *) 0;
+
+    if (!native_pixmap_buf) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "native_pixmap == null";
+        goto exit;
+    }
+    native_pixmap = (void *)getPointer(_env, native_pixmap_buf, (jarray*)&_array, &_native_pixmapRemaining, &_bufferOffset);
+    if (!attrib_list_ref) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "attrib_list == null";
+        goto exit;
+    }
+    if (offset < 0) {
+        _exception = 1;
+        _exceptionType = "java/lang/IllegalArgumentException";
+        _exceptionMessage = "offset < 0";
+        goto exit;
+    }
+    _attrib_listRemaining = _env->GetArrayLength(attrib_list_ref) - offset;
+    attrib_list_base = (EGLAttrib *)
+        _env->GetLongArrayElements(attrib_list_ref, (jboolean *)0);
+    attrib_list = attrib_list_base + offset;
+
+    if (native_pixmap == NULL) {
+        char * _native_pixmapBase = (char *)_env->GetPrimitiveArrayCritical(_array, (jboolean *) 0);
+        native_pixmap = (void *) (_native_pixmapBase + _bufferOffset);
+    }
+    _returnValue = eglCreatePlatformPixmapSurface(
+        (EGLDisplay)dpy_native,
+        (EGLConfig)config_native,
+        (void *)native_pixmap,
+        (EGLAttrib *)attrib_list
+    );
+
+exit:
+    if (attrib_list_base) {
+        _env->ReleaseLongArrayElements(attrib_list_ref, (jlong*)attrib_list_base,
+            JNI_ABORT);
+    }
+    if (_array) {
+        releasePointer(_env, _array, native_pixmap, _exception ? JNI_FALSE : JNI_TRUE);
+    }
+    if (_exception) {
+        jniThrowException(_env, _exceptionType, _exceptionMessage);
+    }
+    return toEGLHandle(_env, eglsurfaceClass, eglsurfaceConstructor, _returnValue);
+}
+
+/* EGLBoolean eglWaitSync ( EGLDisplay dpy, EGLSync sync, EGLint flags ) */
+static jboolean
+android_eglWaitSync
+  (JNIEnv *_env, jobject _this, jobject dpy, jobject sync, jint flags) {
+    EGLBoolean _returnValue = (EGLBoolean) 0;
+    EGLDisplay dpy_native = (EGLDisplay) fromEGLHandle(_env, egldisplayGetHandleID, dpy);
+    EGLSync sync_native = (EGLSync) fromEGLHandle(_env, eglsyncGetHandleID, sync);
+
+    _returnValue = eglWaitSync(
+        (EGLDisplay)dpy_native,
+        (EGLSync)sync_native,
+        (EGLint)flags
+    );
+    return (jboolean)_returnValue;
+}
+
+static const char *classPathName = "android/opengl/EGL15";
+
+static const JNINativeMethod methods[] = {
+{"_nativeClassInit", "()V", (void*)nativeClassInit },
+{"eglCreateSync", "(Landroid/opengl/EGLDisplay;I[JI)Landroid/opengl/EGLSync;", (void *) android_eglCreateSync },
+{"eglDestroySync", "(Landroid/opengl/EGLDisplay;Landroid/opengl/EGLSync;)Z", (void *) android_eglDestroySync },
+{"eglClientWaitSync", "(Landroid/opengl/EGLDisplay;Landroid/opengl/EGLSync;IJ)I", (void *) android_eglClientWaitSync },
+{"eglGetSyncAttrib", "(Landroid/opengl/EGLDisplay;Landroid/opengl/EGLSync;I[JI)Z", (void *) android_eglGetSyncAttrib },
+{"eglGetPlatformDisplay", "(IJ[JI)Landroid/opengl/EGLDisplay;", (void *) android_eglGetPlatformDisplay },
+{"eglCreatePlatformWindowSurface", "(Landroid/opengl/EGLDisplay;Landroid/opengl/EGLConfig;Ljava/nio/Buffer;[JI)Landroid/opengl/EGLSurface;", (void *) android_eglCreatePlatformWindowSurface },
+{"eglCreatePlatformPixmapSurface", "(Landroid/opengl/EGLDisplay;Landroid/opengl/EGLConfig;Ljava/nio/Buffer;[JI)Landroid/opengl/EGLSurface;", (void *) android_eglCreatePlatformPixmapSurface },
+{"eglWaitSync", "(Landroid/opengl/EGLDisplay;Landroid/opengl/EGLSync;I)Z", (void *) android_eglWaitSync },
+};
+
+int register_android_opengl_jni_EGL15(JNIEnv *_env)
+{
+    int err;
+    err = android::AndroidRuntime::registerNativeMethods(_env, classPathName, methods, NELEM(methods));
+    return err;
+}
diff --git a/core/jni/android_os_GraphicsEnvironment.cpp b/core/jni/android_os_GraphicsEnvironment.cpp
index 92235ad..e64da5c 100644
--- a/core/jni/android_os_GraphicsEnvironment.cpp
+++ b/core/jni/android_os_GraphicsEnvironment.cpp
@@ -32,12 +32,16 @@
     android::GraphicsEnv::getInstance().setDriverPath(pathChars.c_str());
 }
 
-void setAngleInfo_native(JNIEnv* env, jobject clazz, jstring path, jstring appName, jstring appPref, jboolean devOptIn) {
+void setAngleInfo_native(JNIEnv* env, jobject clazz, jstring path, jstring appName, jstring appPref, jboolean devOptIn,
+                         jobject rulesFd, jlong rulesOffset, jlong rulesLength) {
     ScopedUtfChars pathChars(env, path);
     ScopedUtfChars appNameChars(env, appName);
     ScopedUtfChars appPrefChars(env, appPref);
+
+    int rulesFd_native = jniGetFDFromFileDescriptor(env, rulesFd);
+
     android::GraphicsEnv::getInstance().setAngleInfo(pathChars.c_str(), appNameChars.c_str(),
-            appPrefChars.c_str(), devOptIn);
+            appPrefChars.c_str(), devOptIn, rulesFd_native, rulesOffset, rulesLength);
 }
 
 void setLayerPaths_native(JNIEnv* env, jobject clazz, jobject classLoader, jstring layerPaths) {
@@ -57,7 +61,7 @@
 const JNINativeMethod g_methods[] = {
     { "getCanLoadSystemLibraries", "()I", reinterpret_cast<void*>(getCanLoadSystemLibraries_native) },
     { "setDriverPath", "(Ljava/lang/String;)V", reinterpret_cast<void*>(setDriverPath) },
-    { "setAngleInfo", "(Ljava/lang/String;Ljava/lang/String;Ljava/lang/String;Z)V", reinterpret_cast<void*>(setAngleInfo_native) },
+    { "setAngleInfo", "(Ljava/lang/String;Ljava/lang/String;Ljava/lang/String;ZLjava/io/FileDescriptor;JJ)V", reinterpret_cast<void*>(setAngleInfo_native) },
     { "setLayerPaths", "(Ljava/lang/ClassLoader;Ljava/lang/String;)V", reinterpret_cast<void*>(setLayerPaths_native) },
     { "setDebugLayers", "(Ljava/lang/String;)V", reinterpret_cast<void*>(setDebugLayers_native) },
 };
diff --git a/core/jni/com_android_internal_net_NetworkStatsFactory.cpp b/core/jni/com_android_internal_net_NetworkStatsFactory.cpp
index 109e65c..b3ff4db 100644
--- a/core/jni/com_android_internal_net_NetworkStatsFactory.cpp
+++ b/core/jni/com_android_internal_net_NetworkStatsFactory.cpp
@@ -32,8 +32,8 @@
 #include <utils/misc.h>
 
 #include "android-base/unique_fd.h"
-#include "bpf/BpfNetworkStats.h"
 #include "bpf/BpfUtils.h"
+#include "netdbpf/BpfNetworkStats.h"
 
 using android::bpf::hasBpfSupport;
 using android::bpf::parseBpfNetworkStatsDetail;
diff --git a/core/proto/android/os/system_properties.proto b/core/proto/android/os/system_properties.proto
index a41edf3..1f63be9 100644
--- a/core/proto/android/os/system_properties.proto
+++ b/core/proto/android/os/system_properties.proto
@@ -512,7 +512,9 @@
         optional int32  vts_coverage = 43;
         optional string zygote = 44;
 
-        // Next Tag: 45
+        optional string gfx_driver_whitelist_0 = 45;
+
+        // Next Tag: 46
     }
     optional Ro ro = 21;
 
diff --git a/core/res/res/values/attrs.xml b/core/res/res/values/attrs.xml
index cdb65ed..9bedab5 100644
--- a/core/res/res/values/attrs.xml
+++ b/core/res/res/values/attrs.xml
@@ -4551,6 +4551,11 @@
         <attr name="typeface" />
         <!-- Font family (named by string or as a font resource reference) for the text. -->
         <attr name="fontFamily" />
+        <!-- Specifies the {@link android.os.LocaleList} for the text.
+             May be a string value, which is a comma-separated language tag list, such as "ja-JP,zh-CN".
+             When not specified or an empty string is given, it will fallback to the default one.
+             {@see android.os.LocaleList#forLanguageTags(String)} -->
+        <attr name="textLocale" format="string" />
         <!-- Color of the text selection highlight. -->
         <attr name="textColorHighlight" />
         <!-- Color of the hint text. -->
@@ -4642,6 +4647,13 @@
         <attr name="textFontWeight" />
         <!-- Font family (named by string or as a font resource reference) for the text. -->
         <attr name="fontFamily" />
+        <!-- Specifies the {@link android.os.LocaleList} for the text in this TextView.
+             If not given, the system default will be used.
+             May be a string value, which is a comma-separated language tag list, such as "ja-JP,zh-CN".
+             When not specified or an empty string is given, it will fallback to the default one.
+             {@see android.os.LocaleList#forLanguageTags(String)}
+             {@see android.text.TextView#setTextLocales(android.os.LocaleList)} -->
+        <attr name="textLocale" format="string" />
         <!-- Text color for links. -->
         <attr name="textColorLink" />
         <!-- Makes the cursor visible (the default) or invisible. -->
diff --git a/core/res/res/values/public.xml b/core/res/res/values/public.xml
index 9551718..31212a6 100644
--- a/core/res/res/values/public.xml
+++ b/core/res/res/values/public.xml
@@ -2915,6 +2915,7 @@
         <public name="minimumUiTimeout" />
         <public name="isLightTheme" />
         <public name="isSplitRequired" />
+        <public name="textLocale" />
     </public-group>
 
     <public-group type="drawable" first-id="0x010800b4">
diff --git a/core/res/res/values/strings.xml b/core/res/res/values/strings.xml
index fa44061..9ea82a9 100644
--- a/core/res/res/values/strings.xml
+++ b/core/res/res/values/strings.xml
@@ -2924,55 +2924,55 @@
     <!-- Title for EditText context menu [CHAR LIMIT=20] -->
     <string name="editTextMenuTitle">Text actions</string>
 
-    <!-- Label for item in the text selection menu to trigger an Email app. Should be a verb. [CHAR LIMIT=20] -->
+    <!-- Label for item in the text selection menu to trigger an Email app. Should be a verb. [CHAR LIMIT=30] -->
     <string name="email">Email</string>
 
     <!-- Accessibility description for an item in the text selection menu to trigger an Email app [CHAR LIMIT=NONE] -->
     <string name="email_desc">Email selected address</string>
 
-    <!-- Label for item in the text selection menu to trigger a Dialer app. Should be a verb. [CHAR LIMIT=20] -->
+    <!-- Label for item in the text selection menu to trigger a Dialer app. Should be a verb. [CHAR LIMIT=30] -->
     <string name="dial">Call</string>
 
     <!-- Accessibility description for an item in the text selection menu to call a phone number [CHAR LIMIT=NONE] -->
     <string name="dial_desc">Call selected phone number</string>
 
-    <!-- Label for item in the text selection menu to trigger a Map app. Should be a verb. [CHAR LIMIT=20] -->
+    <!-- Label for item in the text selection menu to trigger a Map app. Should be a verb. [CHAR LIMIT=30] -->
     <string name="map">Map</string>
 
     <!-- Accessibility description for an item in the text selection menu to open maps for an address [CHAR LIMIT=NONE] -->
     <string name="map_desc">Locate selected address</string>
 
-    <!-- Label for item in the text selection menu to trigger a Browser app. Should be a verb. [CHAR LIMIT=20] -->
+    <!-- Label for item in the text selection menu to trigger a Browser app. Should be a verb. [CHAR LIMIT=30] -->
     <string name="browse">Open</string>
 
     <!-- Accessibility description for an item in the text selection menu to open a URL in a browser [CHAR LIMIT=NONE] -->
     <string name="browse_desc">Open selected URL</string>
 
-    <!-- Label for item in the text selection menu to trigger an SMS app. Should be a verb. [CHAR LIMIT=20] -->
+    <!-- Label for item in the text selection menu to trigger an SMS app. Should be a verb. [CHAR LIMIT=30] -->
     <string name="sms">Message</string>
 
     <!-- Accessibility description for an item in the text selection menu to send an SMS to a phone number [CHAR LIMIT=NONE] -->
     <string name="sms_desc">Message selected phone number</string>
 
-    <!-- Label for item in the text selection menu to trigger adding a contact. Should be a verb. [CHAR LIMIT=20] -->
+    <!-- Label for item in the text selection menu to trigger adding a contact. Should be a verb. [CHAR LIMIT=30] -->
     <string name="add_contact">Add</string>
 
     <!-- Accessibility description for an item in the text selection menu to add the selected detail to contacts [CHAR LIMIT=NONE] -->
     <string name="add_contact_desc">Add to contacts</string>
 
-    <!-- Label for item in the text selection menu to view the calendar for the selected time/date. Should be a verb. [CHAR LIMIT=20] -->
+    <!-- Label for item in the text selection menu to view the calendar for the selected time/date. Should be a verb. [CHAR LIMIT=30] -->
     <string name="view_calendar">View</string>
 
     <!-- Accessibility description for an item in the text selection menu to view the calendar for a date [CHAR LIMIT=NONE]-->
     <string name="view_calendar_desc">View selected time in calendar</string>
 
-    <!-- Label for item in the text selection menu to create a calendar event at the selected time/date. Should be a verb. [CHAR LIMIT=20] -->
+    <!-- Label for item in the text selection menu to create a calendar event at the selected time/date. Should be a verb. [CHAR LIMIT=30] -->
     <string name="add_calendar_event">Schedule</string>
 
     <!-- Accessibility description for an item in the text selection menu to schedule an event for a date [CHAR LIMIT=NONE] -->
     <string name="add_calendar_event_desc">Schedule event for selected time</string>
 
-    <!-- Label for item in the text selection menu to track a selected flight number. Should be a verb. [CHAR LIMIT=20] -->
+    <!-- Label for item in the text selection menu to track a selected flight number. Should be a verb. [CHAR LIMIT=30] -->
     <string name="view_flight">Track</string>
 
     <!-- Accessibility description for an item in the text selection menu to track a flight [CHAR LIMIT=NONE] -->
diff --git a/core/tests/coretests/assets/fonts/1em_bidi_font.ttf b/core/tests/coretests/assets/fonts/1em_bidi_font.ttf
new file mode 100644
index 0000000..4599254
--- /dev/null
+++ b/core/tests/coretests/assets/fonts/1em_bidi_font.ttf
Binary files differ
diff --git a/core/tests/coretests/src/android/content/ContentResolverTest.java b/core/tests/coretests/src/android/content/ContentResolverTest.java
index 6256d08..0036186 100644
--- a/core/tests/coretests/src/android/content/ContentResolverTest.java
+++ b/core/tests/coretests/src/android/content/ContentResolverTest.java
@@ -13,31 +13,149 @@
  * See the License for the specific language governing permissions and
  * limitations under the License.
  */
+
 package android.content;
 
-import android.content.ContentResolver;
-import android.provider.ContactsContract;
-import android.test.AndroidTestCase;
-import android.test.suitebuilder.annotation.LargeTest;
-import android.test.suitebuilder.annotation.Suppress;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertTrue;
+import static org.mockito.ArgumentMatchers.any;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.when;
 
-@Suppress  // Failing.
-public class ContentResolverTest extends AndroidTestCase {
-    private ContentResolver mContentResolver;
+import android.content.res.AssetFileDescriptor;
+import android.graphics.Bitmap;
+import android.graphics.Canvas;
+import android.graphics.Color;
+import android.graphics.ImageDecoder;
+import android.graphics.Paint;
+import android.net.Uri;
+import android.os.MemoryFile;
+import android.os.ParcelFileDescriptor;
+import android.support.test.InstrumentationRegistry;
+import android.support.test.runner.AndroidJUnit4;
+import android.util.Size;
 
-    @Override
-    protected void setUp() throws Exception {
-        super.setUp();
-        mContentResolver = mContext.getContentResolver();
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+
+@RunWith(AndroidJUnit4.class)
+public class ContentResolverTest {
+
+    private ContentResolver mResolver;
+    private IContentProvider mProvider;
+    private ContentProviderClient mClient;
+
+    private int mSize = 256_000;
+    private MemoryFile mImage;
+
+    @Before
+    public void setUp() throws Exception {
+        mResolver = InstrumentationRegistry.getInstrumentation().getTargetContext()
+                .getContentResolver();
+        mProvider = mock(IContentProvider.class);
+        mClient = new ContentProviderClient(mResolver, mProvider, false);
+
+        mImage = new MemoryFile("temp.png", mSize);
     }
 
-    @LargeTest
-    public void testCursorFinalizer() throws Exception {
-        // TODO: Want a test case that more predictably reproduce this issue. Selected
-        // 600 as this causes the problem 100% of the runs on current hw, it might not
-        // do so on some other configuration though.
-        for (int i = 0; i < 600; i++) {
-            mContentResolver.query(ContactsContract.Contacts.CONTENT_URI, null, null, null, null);
-        }
+    @After
+    public void tearDown() throws Exception {
+        mImage.close();
+        mImage = null;
+    }
+
+    private void initImage(int width, int height) throws Exception {
+        final Bitmap bitmap = Bitmap.createBitmap(width, height, Bitmap.Config.ARGB_8888);
+        final Canvas canvas = new Canvas(bitmap);
+
+        canvas.drawColor(Color.RED);
+
+        final Paint paint = new Paint();
+        paint.setColor(Color.BLUE);
+        paint.setStyle(Paint.Style.FILL);
+        canvas.drawRect(0, 0, width / 2, height / 2, paint);
+
+        bitmap.compress(Bitmap.CompressFormat.PNG, 90, mImage.getOutputStream());
+
+        final AssetFileDescriptor afd = new AssetFileDescriptor(
+                new ParcelFileDescriptor(mImage.getFileDescriptor()), 0, mSize, null);
+        when(mProvider.openTypedAssetFile(any(), any(), any(), any(), any())).thenReturn(afd);
+    }
+
+    private static void assertImageAspectAndContents(Bitmap bitmap) {
+        // And correct aspect ratio
+        final int before = (100 * 1280) / 960;
+        final int after = (100 * bitmap.getWidth()) / bitmap.getHeight();
+        assertEquals(before, after);
+
+        // And scaled correctly
+        final int halfX = bitmap.getWidth() / 2;
+        final int halfY = bitmap.getHeight() / 2;
+        assertEquals(Color.BLUE, bitmap.getPixel(halfX - 10, halfY - 10));
+        assertEquals(Color.RED, bitmap.getPixel(halfX + 10, halfY - 10));
+        assertEquals(Color.RED, bitmap.getPixel(halfX - 10, halfY + 10));
+        assertEquals(Color.RED, bitmap.getPixel(halfX + 10, halfY + 10));
+    }
+
+    @Test
+    public void testLoadThumbnail_Normal() throws Exception {
+        initImage(1280, 960);
+
+        Bitmap res = ContentResolver.loadThumbnail(mClient,
+                Uri.parse("content://com.example/"), new Size(1280, 960), null,
+                ImageDecoder.ALLOCATOR_SOFTWARE);
+
+        // Size should be untouched
+        assertEquals(1280, res.getWidth());
+        assertEquals(960, res.getHeight());
+
+        assertImageAspectAndContents(res);
+    }
+
+    @Test
+    public void testLoadThumbnail_Scaling() throws Exception {
+        initImage(1280, 960);
+
+        Bitmap res = ContentResolver.loadThumbnail(mClient,
+                Uri.parse("content://com.example/"), new Size(320, 240), null,
+                ImageDecoder.ALLOCATOR_SOFTWARE);
+
+        // Size should be much smaller
+        assertTrue(res.getWidth() <= 640);
+        assertTrue(res.getHeight() <= 480);
+
+        assertImageAspectAndContents(res);
+    }
+
+    @Test
+    public void testLoadThumbnail_Aspect() throws Exception {
+        initImage(1280, 960);
+
+        Bitmap res = ContentResolver.loadThumbnail(mClient,
+                Uri.parse("content://com.example/"), new Size(240, 320), null,
+                ImageDecoder.ALLOCATOR_SOFTWARE);
+
+        // Size should be much smaller
+        assertTrue(res.getWidth() <= 640);
+        assertTrue(res.getHeight() <= 480);
+
+        assertImageAspectAndContents(res);
+    }
+
+    @Test
+    public void testLoadThumbnail_Tiny() throws Exception {
+        initImage(32, 24);
+
+        Bitmap res = ContentResolver.loadThumbnail(mClient,
+                Uri.parse("content://com.example/"), new Size(320, 240), null,
+                ImageDecoder.ALLOCATOR_SOFTWARE);
+
+        // Size should be untouched
+        assertEquals(32, res.getWidth());
+        assertEquals(24, res.getHeight());
+
+        assertImageAspectAndContents(res);
     }
 }
diff --git a/core/tests/coretests/src/android/os/FileUtilsTest.java b/core/tests/coretests/src/android/os/FileUtilsTest.java
index 80281b6..6966448 100644
--- a/core/tests/coretests/src/android/os/FileUtilsTest.java
+++ b/core/tests/coretests/src/android/os/FileUtilsTest.java
@@ -41,6 +41,7 @@
 import static org.junit.Assert.assertEquals;
 import static org.junit.Assert.assertFalse;
 import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
 
 import android.content.Context;
 import android.os.FileUtils.MemoryPipe;
@@ -510,6 +511,20 @@
                 MODE_WRITE_ONLY | MODE_CREATE | MODE_APPEND);
     }
 
+    @Test
+    public void testTranslateMode_Invalid() throws Exception {
+        try {
+            translateModeStringToPosix("rwx");
+            fail();
+        } catch (IllegalArgumentException expected) {
+        }
+        try {
+            translateModeStringToPosix("");
+            fail();
+        } catch (IllegalArgumentException expected) {
+        }
+    }
+
     private static void assertTranslate(String string, int posix, int pfd) {
         assertEquals(posix, translateModeStringToPosix(string));
         assertEquals(string, translateModePosixToString(posix));
diff --git a/core/tests/coretests/src/android/provider/SettingsBackupTest.java b/core/tests/coretests/src/android/provider/SettingsBackupTest.java
index 632c37f..9778acb 100644
--- a/core/tests/coretests/src/android/provider/SettingsBackupTest.java
+++ b/core/tests/coretests/src/android/provider/SettingsBackupTest.java
@@ -368,6 +368,8 @@
                     Settings.Global.PRIV_APP_OOB_ENABLED,
                     Settings.Global.PRIV_APP_OOB_LIST,
                     Settings.Global.PRIVATE_DNS_DEFAULT_MODE,
+                    Settings.Global.PRIVILEGED_DEVICE_IDENTIFIER_CHECK_ENABLED,
+                    Settings.Global.PRIVILEGED_DEVICE_IDENTIFIER_TARGET_Q_BEHAVIOR_ENABLED,
                     Settings.Global.PROVISIONING_APN_ALARM_DELAY_IN_MS,
                     Settings.Global.RADIO_BLUETOOTH,
                     Settings.Global.RADIO_CELL,
diff --git a/core/tests/coretests/src/android/text/LayoutBidiCursorPathTest.java b/core/tests/coretests/src/android/text/LayoutBidiCursorPathTest.java
new file mode 100644
index 0000000..1208d7c
--- /dev/null
+++ b/core/tests/coretests/src/android/text/LayoutBidiCursorPathTest.java
@@ -0,0 +1,166 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.text;
+
+import static org.junit.Assert.assertArrayEquals;
+
+import android.content.Context;
+import android.graphics.Path;
+import android.graphics.Typeface;
+import android.platform.test.annotations.Presubmit;
+import android.support.test.InstrumentationRegistry;
+import android.support.test.filters.SmallTest;
+import android.support.test.runner.AndroidJUnit4;
+import android.text.method.MetaKeyKeyListener;
+import android.view.KeyEvent;
+
+import org.junit.Before;
+import org.junit.Test;
+import org.junit.runner.RunWith;
+
+@Presubmit
+@SmallTest
+@RunWith(AndroidJUnit4.class)
+public class LayoutBidiCursorPathTest {
+
+    private static final float BIDI_TEXT_SIZE = 12f;
+    private static final String LTR_TEXT = "hello";
+    private static final String RTL_TEXT = "مرحبا";
+
+    private SpannableStringBuilder mBidiText;
+    private TextPaint mTextPaint;
+
+    @Before
+    public void setup() {
+        mBidiText = new SpannableStringBuilder(LTR_TEXT + RTL_TEXT);
+
+        final Context context = InstrumentationRegistry.getTargetContext();
+        mTextPaint = new TextPaint();
+        mTextPaint.setTypeface(
+                Typeface.createFromAsset(context.getAssets(), "fonts/1em_bidi_font.ttf"));
+        mTextPaint.setTextSize(BIDI_TEXT_SIZE);
+    }
+
+    @Test
+    public void testGetCursorPathSegments() {
+        // Setup layout and Act.
+        final Path actualPath = new Path();
+        setupLayoutAndGetCursorPath(actualPath);
+
+        // Expected path.
+        final float h1 = BIDI_TEXT_SIZE * LTR_TEXT.length() - 0.5f;
+        final int top = 0;
+        // sTypoLineGap is set to 1/5 of the Height in font metrics of the font file used here.
+        final int bottom = Math.round(BIDI_TEXT_SIZE + BIDI_TEXT_SIZE / 5f);
+
+        final Path expectedPath = new Path();
+
+        expectedPath.moveTo(h1, top);
+        expectedPath.lineTo(h1, bottom);
+
+        // Assert.
+        assertArrayEquals(expectedPath.approximate(0f), actualPath.approximate(0f), 0f);
+    }
+
+    @Test
+    public void testGetCursorPath_whenShiftIsPressed() {
+        // When shift is pressed a triangle is drawn at the bottom quarter of the cursor.
+        // Set up key.
+        final MetaKeyKeyListener metaKeyKeyListener = new MetaKeyKeyListener() {};
+        metaKeyKeyListener
+            .onKeyDown(null /*view*/, mBidiText, KeyEvent.KEYCODE_SHIFT_RIGHT, null /*keyEvent*/);
+
+        // Setup layout and Act.
+        final Path actualPath = new Path();
+        setupLayoutAndGetCursorPath(actualPath);
+
+        // Expected path.
+        final float h1 = BIDI_TEXT_SIZE * LTR_TEXT.length() - 0.5f;
+        final int top = 0;
+        // sTypoLineGap is set to 1/5 of the Height in font metrics of the font file used here.
+        int bottom = Math.round(BIDI_TEXT_SIZE + BIDI_TEXT_SIZE / 5f);
+        // Draw a triangle at the bottom quarter of the cursor, thus cut the cursor to its 3/4
+        // length.
+        final int dist = (bottom - top) / 4;
+        bottom -= dist;
+
+        final Path expectedPath = new Path();
+
+        expectedPath.moveTo(h1, top);
+        expectedPath.lineTo(h1, bottom);
+
+        expectedPath.moveTo(h1, bottom);
+        expectedPath.lineTo(h1 - dist, bottom + dist);
+
+        expectedPath.moveTo(h1 - dist, bottom + dist - 0.5f);
+        expectedPath.lineTo(h1 + dist, bottom + dist - 0.5f);
+
+        expectedPath.moveTo(h1 + dist, bottom + dist);
+        expectedPath.lineTo(h1, bottom);
+
+        // Assert.
+        assertArrayEquals(expectedPath.approximate(0f), actualPath.approximate(0f), 0f);
+    }
+
+    @Test
+    public void testGetCursorPath_whenAltIsPressed() {
+        // When alt is pressed a triangle is drawn at the top quarter of the cursor.
+        // Set up key.
+        final MetaKeyKeyListener metaKeyKeyListener = new MetaKeyKeyListener() {};
+        metaKeyKeyListener
+            .onKeyDown(null /*view*/, mBidiText, KeyEvent.KEYCODE_ALT_RIGHT, null /*keyEvent*/);
+
+        // Setup layout and Act.
+        final Path actualPath = new Path();
+        setupLayoutAndGetCursorPath(actualPath);
+
+        // Expected path.
+        final float h1 = BIDI_TEXT_SIZE * LTR_TEXT.length() - 0.5f;
+        int top = 0;
+        // sTypoLineGap is set to 1/5 of the Height in font metrics of the font file used here.
+        final int bottom = Math.round(BIDI_TEXT_SIZE + BIDI_TEXT_SIZE / 5f);
+        // Draw a triangle at the top quarter of the cursor, thus cut the cursor to its 3/4 length.
+        final int dist = (bottom - top) / 4;
+        top += dist;
+
+        final Path expectedPath = new Path();
+
+        expectedPath.moveTo(h1, top);
+        expectedPath.lineTo(h1, bottom);
+
+        expectedPath.moveTo(h1, top);
+        expectedPath.lineTo(h1 - dist, top - dist);
+
+        expectedPath.moveTo(h1 - dist, top - dist + 0.5f);
+        expectedPath.lineTo(h1 + dist, top - dist + 0.5f);
+
+        expectedPath.moveTo(h1 + dist, top - dist);
+        expectedPath.lineTo(h1, top);
+
+        // Assert.
+        assertArrayEquals(expectedPath.approximate(0f), actualPath.approximate(0f), 0f);
+    }
+
+    private void setupLayoutAndGetCursorPath(Path path) {
+        final Layout layout = StaticLayout.Builder.obtain(
+                mBidiText, 0, mBidiText.length(),  mTextPaint, Integer.MAX_VALUE)
+                .setIncludePad(false)
+                .build();
+
+        layout.getCursorPath(LTR_TEXT.length(), path, mBidiText);
+    }
+}
diff --git a/core/tests/coretests/src/android/text/method/ForwardDeleteTest.java b/core/tests/coretests/src/android/text/method/ForwardDeleteTest.java
index c98e646..7360e9f 100644
--- a/core/tests/coretests/src/android/text/method/ForwardDeleteTest.java
+++ b/core/tests/coretests/src/android/text/method/ForwardDeleteTest.java
@@ -20,7 +20,6 @@
 import android.support.test.InstrumentationRegistry;
 import android.support.test.filters.SmallTest;
 import android.support.test.runner.AndroidJUnit4;
-import android.test.suitebuilder.annotation.Suppress;
 import android.text.InputType;
 import android.util.KeyUtils;
 import android.view.KeyEvent;
@@ -239,7 +238,6 @@
     }
 
     @Test
-    @Suppress
     public void testEmojiModifier() {
         EditorState state = new EditorState();
 
@@ -256,20 +254,15 @@
         // Isolated multiple emoji modifier
         state.setByString("| U+1F3FB U+1F3FB");
         forwardDelete(state, 0);
-        state.assertEquals("| U+1F3FB");
-        forwardDelete(state, 0);
         state.assertEquals("|");
 
         // Multiple emoji modifiers
         state.setByString("| U+1F466 U+1F3FB U+1F3FB");
         forwardDelete(state, 0);
-        state.assertEquals("| U+1F3FB");
-        forwardDelete(state, 0);
         state.assertEquals("|");
     }
 
     @Test
-    @Suppress
     public void testMixedEdgeCases() {
         EditorState state = new EditorState();
 
@@ -318,7 +311,7 @@
         // COMBINING ENCLOSING KEYCAP + emoji modifier
         state.setByString("| '1' U+20E3 U+1F3FB");
         forwardDelete(state, 0);
-        state.assertEquals("| U+1F3FB");
+        state.assertEquals("|");
 
         // Emoji modifier + COMBINING ENCLOSING KEYCAP
         state.setByString("| U+1F466 U+1F3FB U+20E3");
@@ -360,7 +353,7 @@
         // Variation selector + emoji modifier
         state.setByString("| U+2665 U+FE0F U+1F3FB");
         forwardDelete(state, 0);
-        state.assertEquals("| U+1F3FB");
+        state.assertEquals("|");
 
         // Emoji modifier + variation selector
         state.setByString("| U+1F466 U+1F3FB U+FE0F");
@@ -396,7 +389,7 @@
         // Start with ZERO WIDTH JOINER + emoji modifier
         state.setByString("| U+200D U+1F3FB");
         forwardDelete(state, 0);
-        state.assertEquals("| U+1F3FB");
+        state.assertEquals("|");
 
         // ZERO WIDTH JOINER + emoji modifier
         state.setByString("| U+1F469 U+200D U+1F3FB");
@@ -418,8 +411,6 @@
         // Regional indicator symbol + emoji modifier
         state.setByString("| U+1F1FA U+1F3FB");
         forwardDelete(state, 0);
-        state.assertEquals("| U+1F3FB");
-        forwardDelete(state, 0);
         state.assertEquals("|");
 
         // Emoji modifier + regional indicator symbol
diff --git a/core/tests/coretests/src/android/view/MotionEventTest.java b/core/tests/coretests/src/android/view/MotionEventTest.java
index 1a480c7..023526f 100644
--- a/core/tests/coretests/src/android/view/MotionEventTest.java
+++ b/core/tests/coretests/src/android/view/MotionEventTest.java
@@ -54,6 +54,13 @@
         MotionEvent motionEvent = MotionEvent.obtain(0, 0, ACTION_DOWN,
                 pointerCount, properties, coords,
                 0, 0, 0, 0, 0, 0, InputDevice.SOURCE_TOUCHSCREEN, displayId, 0);
+
+        MotionEvent motionEvent_Single = MotionEvent.obtain(0 /* downTime */, 0 /* eventTime */,
+                ACTION_DOWN /* action */, 0f /* x */, 0f /* y */, 0/* pressure */, 0 /* size */,
+                0 /* metaState */, 0 /* xPrecision */, 0 /* yPrecision */,
+                0 /* deviceId */, 0 /* edgeFlags */, InputDevice.SOURCE_TOUCHSCREEN, displayId);
+
+        assertEquals(displayId, motionEvent_Single.getDisplayId());
         assertEquals(displayId, motionEvent.getDisplayId());
 
         displayId = 5;
diff --git a/core/tests/coretests/src/android/view/textclassifier/TextLanguageTest.java b/core/tests/coretests/src/android/view/textclassifier/TextLanguageTest.java
new file mode 100644
index 0000000..75ca769
--- /dev/null
+++ b/core/tests/coretests/src/android/view/textclassifier/TextLanguageTest.java
@@ -0,0 +1,85 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.view.textclassifier;
+
+import static org.junit.Assert.assertEquals;
+
+import android.icu.util.ULocale;
+import android.os.Bundle;
+import android.os.Parcel;
+import android.support.test.filters.SmallTest;
+import android.support.test.runner.AndroidJUnit4;
+
+import org.junit.Test;
+import org.junit.runner.RunWith;
+
+/**
+ * Tests for TextLanguage.
+ */
+@SmallTest
+@RunWith(AndroidJUnit4.class)
+public final class TextLanguageTest {
+
+    private static final float EPSILON = 0.000001f;
+
+    @Test
+    public void testParcel() throws Exception {
+        final String bundleKey = "experiment.int";
+        final Bundle bundle = new Bundle();
+        bundle.putInt(bundleKey, 1234);
+
+        final TextLanguage reference = new TextLanguage.Builder()
+                .setId("id")
+                .setExtras(bundle)
+                .putLocale(ULocale.ENGLISH, 0.8f)
+                .putLocale(ULocale.GERMAN, 0.2f)
+                .build();
+
+        final Parcel parcel = Parcel.obtain();
+        reference.writeToParcel(parcel, 0);
+        parcel.setDataPosition(0);
+        final TextLanguage result = TextLanguage.CREATOR.createFromParcel(parcel);
+
+        assertEquals("id", result.getId());
+        assertEquals(1234, result.getExtras().getInt(bundleKey));
+        assertEquals(2, result.getLocaleHypothesisCount());
+        assertEquals(ULocale.ENGLISH, result.getLocale(0));
+        assertEquals(0.8f, result.getConfidenceScore(ULocale.ENGLISH), EPSILON);
+        assertEquals(ULocale.GERMAN, result.getLocale(1));
+        assertEquals(0.2f, result.getConfidenceScore(ULocale.GERMAN), EPSILON);
+    }
+
+    @Test
+    public void testRequestParcel() throws Exception {
+        final String text = "This is random text";
+        final String bundleKey = "experiment.str";
+        final Bundle bundle = new Bundle();
+        bundle.putString(bundleKey, "bundle");
+
+        final TextLanguage.Request reference = new TextLanguage.Request.Builder(text)
+                .setExtras(bundle)
+                .build();
+
+        final Parcel parcel = Parcel.obtain();
+        reference.writeToParcel(parcel, 0);
+        parcel.setDataPosition(0);
+        final TextLanguage.Request result = TextLanguage.Request.CREATOR.createFromParcel(parcel);
+
+        assertEquals(text, result.getText());
+        assertEquals("bundle", result.getExtras().getString(bundleKey));
+    }
+}
diff --git a/graphics/java/android/graphics/Point.java b/graphics/java/android/graphics/Point.java
index f291e27..ea93501 100644
--- a/graphics/java/android/graphics/Point.java
+++ b/graphics/java/android/graphics/Point.java
@@ -19,6 +19,7 @@
 import android.annotation.NonNull;
 import android.os.Parcel;
 import android.os.Parcelable;
+import android.util.Size;
 import android.util.proto.ProtoOutputStream;
 
 import java.io.PrintWriter;
@@ -168,4 +169,14 @@
         x = in.readInt();
         y = in.readInt();
     }
+
+    /** {@hide} */
+    public static @NonNull Point convert(@NonNull Size size) {
+        return new Point(size.getWidth(), size.getHeight());
+    }
+
+    /** {@hide} */
+    public static @NonNull Size convert(@NonNull Point point) {
+        return new Size(point.x, point.y);
+    }
 }
diff --git a/graphics/java/android/graphics/Typeface.java b/graphics/java/android/graphics/Typeface.java
index 7ad207f..ba47300 100644
--- a/graphics/java/android/graphics/Typeface.java
+++ b/graphics/java/android/graphics/Typeface.java
@@ -27,6 +27,7 @@
 import android.annotation.Nullable;
 import android.annotation.UnsupportedAppUsage;
 import android.content.res.AssetManager;
+import android.graphics.fonts.FontStyle;
 import android.graphics.fonts.FontVariationAxis;
 import android.graphics.fonts.SystemFonts;
 import android.net.Uri;
@@ -148,7 +149,7 @@
     @UnsupportedAppUsage
     private @Style int mStyle = 0;
 
-    private @IntRange(from = 0, to = android.graphics.fonts.Font.FONT_WEIGHT_MAX) int mWeight = 0;
+    private @IntRange(from = 0, to = FontStyle.FONT_WEIGHT_MAX) int mWeight = 0;
 
     // Value for weight and italic. Indicates the value is resolved by font metadata.
     // Must be the same as the C++ constant in core/jni/android/graphics/FontFamily.cpp
diff --git a/graphics/java/android/graphics/fonts/Font.java b/graphics/java/android/graphics/fonts/Font.java
index bd1ac25..f426b2d 100644
--- a/graphics/java/android/graphics/fonts/Font.java
+++ b/graphics/java/android/graphics/fonts/Font.java
@@ -51,61 +51,6 @@
     private static final int STYLE_NORMAL = 0;
 
     /**
-     * A minimum weight value for the font
-     */
-    public static final int FONT_WEIGHT_MIN = 1;
-
-    /**
-     * A font weight value for the thin weight
-     */
-    public static final int FONT_WEIGHT_THIN = 100;
-
-    /**
-     * A font weight value for the extra-light weight
-     */
-    public static final int FONT_WEIGHT_EXTRA_LIGHT = 200;
-
-    /**
-     * A font weight value for the light weight
-     */
-    public static final int FONT_WEIGHT_LIGHT = 300;
-
-    /**
-     * A font weight value for the normal weight
-     */
-    public static final int FONT_WEIGHT_NORMAL = 400;
-
-    /**
-     * A font weight value for the medium weight
-     */
-    public static final int FONT_WEIGHT_MEDIUM = 500;
-
-    /**
-     * A font weight value for the semi-bold weight
-     */
-    public static final int FONT_WEIGHT_SEMI_BOLD = 600;
-
-    /**
-     * A font weight value for the bold weight.
-     */
-    public static final int FONT_WEIGHT_BOLD = 700;
-
-    /**
-     * A font weight value for the extra-bold weight
-     */
-    public static final int FONT_WEIGHT_EXTRA_BOLD = 800;
-
-    /**
-     * A font weight value for the black weight
-     */
-    public static final int FONT_WEIGHT_BLACK = 900;
-
-    /**
-     * A maximum weight value for the font
-     */
-    public static final int FONT_WEIGHT_MAX = 1000;
-
-    /**
      * A builder class for creating new Font.
      */
     public static class Builder {
@@ -275,66 +220,68 @@
          *  <tr>
          *  <td align="center">100</td>
          *  <td align="center">Thin</td>
-         *  <td align="center">{@link Font#FONT_WEIGHT_THIN}</td>
+         *  <td align="center">{@link FontStyle#FONT_WEIGHT_THIN}</td>
          *  </tr>
          *  <tr>
          *  <td align="center">200</td>
          *  <td align="center">Extra Light (Ultra Light)</td>
-         *  <td align="center">{@link Font#FONT_WEIGHT_EXTRA_LIGHT}</td>
+         *  <td align="center">{@link FontStyle#FONT_WEIGHT_EXTRA_LIGHT}</td>
          *  </tr>
          *  <tr>
          *  <td align="center">300</td>
          *  <td align="center">Light</td>
-         *  <td align="center">{@link Font#FONT_WEIGHT_LIGHT}</td>
+         *  <td align="center">{@link FontStyle#FONT_WEIGHT_LIGHT}</td>
          *  </tr>
          *  <tr>
          *  <td align="center">400</td>
          *  <td align="center">Normal (Regular)</td>
-         *  <td align="center">{@link Font#FONT_WEIGHT_NORMAL}</td>
+         *  <td align="center">{@link FontStyle#FONT_WEIGHT_NORMAL}</td>
          *  </tr>
          *  <tr>
          *  <td align="center">500</td>
          *  <td align="center">Medium</td>
-         *  <td align="center">{@link Font#FONT_WEIGHT_MEDIUM}</td>
+         *  <td align="center">{@link FontStyle#FONT_WEIGHT_MEDIUM}</td>
          *  </tr>
          *  <tr>
          *  <td align="center">600</td>
          *  <td align="center">Semi Bold (Demi Bold)</td>
-         *  <td align="center">{@link Font#FONT_WEIGHT_SEMI_BOLD}</td>
+         *  <td align="center">{@link FontStyle#FONT_WEIGHT_SEMI_BOLD}</td>
          *  </tr>
          *  <tr>
          *  <td align="center">700</td>
          *  <td align="center">Bold</td>
-         *  <td align="center">{@link Font#FONT_WEIGHT_BOLD}</td>
+         *  <td align="center">{@link FontStyle#FONT_WEIGHT_BOLD}</td>
          *  </tr>
          *  <tr>
          *  <td align="center">800</td>
          *  <td align="center">Extra Bold (Ultra Bold)</td>
-         *  <td align="center">{@link Font#FONT_WEIGHT_EXTRA_BOLD}</td>
+         *  <td align="center">{@link FontStyle#FONT_WEIGHT_EXTRA_BOLD}</td>
          *  </tr>
          *  <tr>
          *  <td align="center">900</td>
          *  <td align="center">Black (Heavy)</td>
-         *  <td align="center">{@link Font#FONT_WEIGHT_BLACK}</td>
+         *  <td align="center">{@link FontStyle#FONT_WEIGHT_BLACK}</td>
          *  </tr>
          *  </tbody>
          * </p>
          *
-         * @see Font#FONT_WEIGHT_THIN
-         * @see Font#FONT_WEIGHT_EXTRA_LIGHT
-         * @see Font#FONT_WEIGHT_LIGHT
-         * @see Font#FONT_WEIGHT_NORMAL
-         * @see Font#FONT_WEIGHT_MEDIUM
-         * @see Font#FONT_WEIGHT_SEMI_BOLD
-         * @see Font#FONT_WEIGHT_BOLD
-         * @see Font#FONT_WEIGHT_EXTRA_BOLD
-         * @see Font#FONT_WEIGHT_BLACK
+         * @see FontStyle#FONT_WEIGHT_THIN
+         * @see FontStyle#FONT_WEIGHT_EXTRA_LIGHT
+         * @see FontStyle#FONT_WEIGHT_LIGHT
+         * @see FontStyle#FONT_WEIGHT_NORMAL
+         * @see FontStyle#FONT_WEIGHT_MEDIUM
+         * @see FontStyle#FONT_WEIGHT_SEMI_BOLD
+         * @see FontStyle#FONT_WEIGHT_BOLD
+         * @see FontStyle#FONT_WEIGHT_EXTRA_BOLD
+         * @see FontStyle#FONT_WEIGHT_BLACK
          * @param weight a weight value
          * @return this builder
          */
         public @NonNull Builder setWeight(
-                @IntRange(from = FONT_WEIGHT_MIN, to = FONT_WEIGHT_MAX) int weight) {
-            Preconditions.checkArgument(FONT_WEIGHT_MIN <= weight && weight <= FONT_WEIGHT_MAX);
+                @IntRange(from = FontStyle.FONT_WEIGHT_MIN, to = FontStyle.FONT_WEIGHT_MAX)
+                int weight) {
+            Preconditions.checkArgument(
+                    FontStyle.FONT_WEIGHT_MIN <= weight && weight <= FontStyle.FONT_WEIGHT_MAX);
             mWeight = weight;
             return this;
         }
@@ -346,13 +293,12 @@
          * will resolve the style by reading font tables.
          *
          * For example, if you want to use italic font as upright font, call {@code
-         * setItalic(false)} explicitly.
+         * setSlant(false)} explicitly.
          *
-         * @param italic {@code true} if the font is italic. Otherwise {@code false}.
          * @return this builder
          */
-        public @NonNull Builder setItalic(boolean italic) {
-            mItalic = italic ? STYLE_ITALIC : STYLE_NORMAL;
+        public @NonNull Builder setSlant(@FontStyle.FontSlant int slant) {
+            mItalic = slant == FontStyle.FONT_SLANT_UPRIGHT ? STYLE_NORMAL : STYLE_ITALIC;
             return this;
         }
 
@@ -414,8 +360,11 @@
                     mItalic = STYLE_NORMAL;
                 }
             }
-            mWeight = Math.max(FONT_WEIGHT_MIN, Math.min(FONT_WEIGHT_MAX, mWeight));
+            mWeight = Math.max(FontStyle.FONT_WEIGHT_MIN,
+                    Math.min(FontStyle.FONT_WEIGHT_MAX, mWeight));
             final boolean italic = (mItalic == STYLE_ITALIC);
+            final int slant = (mItalic == STYLE_ITALIC)
+                    ? FontStyle.FONT_SLANT_ITALIC : FontStyle.FONT_SLANT_UPRIGHT;
             final long builderPtr = nInitBuilder();
             if (mAxes != null) {
                 for (FontVariationAxis axis : mAxes) {
@@ -424,8 +373,8 @@
             }
             final ByteBuffer readonlyBuffer = mBuffer.asReadOnlyBuffer();
             final long ptr = nBuild(builderPtr, readonlyBuffer, mWeight, italic, mTtcIndex);
-            final Font font = new Font(ptr, readonlyBuffer, mFile, mWeight, italic, mTtcIndex,
-                    mAxes, mLocaleList);
+            final Font font = new Font(ptr, readonlyBuffer, mFile,
+                    new FontStyle(mWeight, slant), mTtcIndex, mAxes, mLocaleList);
             sFontRegistory.registerNativeAllocation(font, ptr);
             return font;
         }
@@ -454,8 +403,7 @@
     private final long mNativePtr;  // address of the shared ptr of minikin::Font
     private final @NonNull ByteBuffer mBuffer;
     private final @Nullable File mFile;
-    private final @IntRange(from = 0, to = 1000) int mWeight;
-    private final boolean mItalic;
+    private final FontStyle mFontStyle;
     private final @IntRange(from = 0) int mTtcIndex;
     private final @Nullable FontVariationAxis[] mAxes;
     private final @NonNull String mLocaleList;
@@ -464,13 +412,11 @@
      * Use Builder instead
      */
     private Font(long nativePtr, @NonNull ByteBuffer buffer, @Nullable File file,
-            @IntRange(from = 0, to = 1000) int weight, boolean italic,
-            @IntRange(from = 0) int ttcIndex, @Nullable FontVariationAxis[] axes,
-            @NonNull String localeList) {
+            @NonNull FontStyle fontStyle, @IntRange(from = 0) int ttcIndex,
+            @Nullable FontVariationAxis[] axes, @NonNull String localeList) {
         mBuffer = buffer;
         mFile = file;
-        mWeight = weight;
-        mItalic = italic;
+        mFontStyle = fontStyle;
         mNativePtr = nativePtr;
         mTtcIndex = ttcIndex;
         mAxes = axes;
@@ -504,17 +450,17 @@
      * @return a weight value
      */
     public @IntRange(from = 0, to = 1000)int getWeight() {
-        return mWeight;
+        return mFontStyle.getWeight();
     }
 
     /**
-     * Returns true if this font is marked as italic, otherwise returns false.
+     * Get a slant value associated with this font.
      *
-     * @see Builder#setItalic(boolean)
-     * @return true if italic, otherwise false
+     * @see Builder#setSlant(boolean)
+     * @return a slant value
      */
-    public boolean isItalic() {
-        return mItalic;
+    public @FontStyle.FontSlant int getSlant() {
+        return mFontStyle.getSlant();
     }
 
     /**
@@ -564,21 +510,20 @@
             return false;
         }
         Font f = (Font) o;
-        return f.mWeight == mWeight && f.mItalic == mItalic && f.mTtcIndex == mTtcIndex
+        return mFontStyle.equals(f.mFontStyle) && f.mTtcIndex == mTtcIndex
                 && Arrays.equals(f.mAxes, mAxes) && f.mBuffer.equals(mBuffer);
     }
 
     @Override
     public int hashCode() {
-        return Objects.hash(mWeight, mItalic, mTtcIndex, Arrays.hashCode(mAxes), mBuffer);
+        return Objects.hash(mFontStyle, mTtcIndex, Arrays.hashCode(mAxes), mBuffer);
     }
 
     @Override
     public String toString() {
         return "Font {"
             + "path=" + mFile
-            + ", weight=" + mWeight
-            + ", italic=" + mItalic
+            + ", style=" + mFontStyle
             + ", ttcIndex=" + mTtcIndex
             + ", axes=" + FontVariationAxis.toFontVariationSettings(mAxes)
             + ", localeList=" + mLocaleList
diff --git a/graphics/java/android/graphics/fonts/FontFamily.java b/graphics/java/android/graphics/fonts/FontFamily.java
index 3bcdc31..52a37da 100644
--- a/graphics/java/android/graphics/fonts/FontFamily.java
+++ b/graphics/java/android/graphics/fonts/FontFamily.java
@@ -124,7 +124,7 @@
         }
 
         private static int makeStyleIdentifier(@NonNull Font font) {
-            return font.getWeight() | (font.isItalic() ? (1 << 16) : 0);
+            return font.getWeight() | (font.getSlant()  << 16);
         }
 
         private static native long nInitBuilder();
diff --git a/graphics/java/android/graphics/fonts/FontStyle.java b/graphics/java/android/graphics/fonts/FontStyle.java
new file mode 100644
index 0000000..82fc7ac
--- /dev/null
+++ b/graphics/java/android/graphics/fonts/FontStyle.java
@@ -0,0 +1,256 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.graphics.fonts;
+
+import android.annotation.IntDef;
+import android.annotation.IntRange;
+import android.annotation.Nullable;
+
+import com.android.internal.util.Preconditions;
+
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
+import java.util.Objects;
+
+/**
+ * A font style object.
+ *
+ * This class represents a single font style which is a pair of weight value and slant value.
+ * Here are common font styles examples:
+ * <p>
+ * <pre>
+ * <code>
+ * final FontStyle NORMAL = new FontStyle(FONT_WEIGHT_NORMAL, FONT_SLANT_UPRIGHT);
+ * final FontStyle BOLD = new FontStyle(FONT_WEIGHT_BOLD, FONT_SLANT_UPRIGHT);
+ * final FontStyle ITALIC = new FontStyle(FONT_WEIGHT_NORMAL, FONT_SLANT_ITALIC);
+ * final FontStyle BOLD_ITALIC = new FontStyle(FONT_WEIGHT_BOLD, FONT_SLANT_ITALIC);
+ * </code>
+ * </pre>
+ * </p>
+ *
+ */
+public final class FontStyle {
+    private static final String TAG = "FontStyle";
+
+    /**
+     * A minimum weight value for the font
+     */
+    public static final int FONT_WEIGHT_MIN = 1;
+
+    /**
+     * A font weight value for the thin weight
+     */
+    public static final int FONT_WEIGHT_THIN = 100;
+
+    /**
+     * A font weight value for the extra-light weight
+     */
+    public static final int FONT_WEIGHT_EXTRA_LIGHT = 200;
+
+    /**
+     * A font weight value for the light weight
+     */
+    public static final int FONT_WEIGHT_LIGHT = 300;
+
+    /**
+     * A font weight value for the normal weight
+     */
+    public static final int FONT_WEIGHT_NORMAL = 400;
+
+    /**
+     * A font weight value for the medium weight
+     */
+    public static final int FONT_WEIGHT_MEDIUM = 500;
+
+    /**
+     * A font weight value for the semi-bold weight
+     */
+    public static final int FONT_WEIGHT_SEMI_BOLD = 600;
+
+    /**
+     * A font weight value for the bold weight.
+     */
+    public static final int FONT_WEIGHT_BOLD = 700;
+
+    /**
+     * A font weight value for the extra-bold weight
+     */
+    public static final int FONT_WEIGHT_EXTRA_BOLD = 800;
+
+    /**
+     * A font weight value for the black weight
+     */
+    public static final int FONT_WEIGHT_BLACK = 900;
+
+    /**
+     * A maximum weight value for the font
+     */
+    public static final int FONT_WEIGHT_MAX = 1000;
+
+    /**
+     * A font slant value for upright
+     */
+    public static final int FONT_SLANT_UPRIGHT = 0;
+
+    /**
+     * A font slant value for italic
+     */
+    public static final int FONT_SLANT_ITALIC = 1;
+
+    // TODO: Support FONT_SLANT_OBLIQUE
+
+    /** @hide */
+    @IntDef(prefix = { "FONT_SLANT_" }, value = {
+            FONT_SLANT_UPRIGHT,
+            FONT_SLANT_ITALIC
+    })
+    @Retention(RetentionPolicy.SOURCE)
+    public @interface FontSlant {}
+
+    private final @IntRange(from = 0, to = 1000) int mWeight;
+    private final @FontSlant int mSlant;
+    // TODO: Support width
+
+    public FontStyle() {
+        mWeight = FONT_WEIGHT_NORMAL;
+        mSlant = FONT_SLANT_UPRIGHT;
+    }
+
+    /**
+     * Create FontStyle with specific weight and italic
+     *
+     * <p>
+     *  <table>
+     *  <thead>
+     *  <tr>
+     *  <th align="center">Value</th>
+     *  <th align="center">Name</th>
+     *  <th align="center">Android Definition</th>
+     *  </tr>
+     *  </thead>
+     *  <tbody>
+     *  <tr>
+     *  <td align="center">100</td>
+     *  <td align="center">Thin</td>
+     *  <td align="center">{@link FontStyle#FONT_WEIGHT_THIN}</td>
+     *  </tr>
+     *  <tr>
+     *  <td align="center">200</td>
+     *  <td align="center">Extra Light (Ultra Light)</td>
+     *  <td align="center">{@link FontStyle#FONT_WEIGHT_EXTRA_LIGHT}</td>
+     *  </tr>
+     *  <tr>
+     *  <td align="center">300</td>
+     *  <td align="center">Light</td>
+     *  <td align="center">{@link FontStyle#FONT_WEIGHT_LIGHT}</td>
+     *  </tr>
+     *  <tr>
+     *  <td align="center">400</td>
+     *  <td align="center">Normal (Regular)</td>
+     *  <td align="center">{@link FontStyle#FONT_WEIGHT_NORMAL}</td>
+     *  </tr>
+     *  <tr>
+     *  <td align="center">500</td>
+     *  <td align="center">Medium</td>
+     *  <td align="center">{@link FontStyle#FONT_WEIGHT_MEDIUM}</td>
+     *  </tr>
+     *  <tr>
+     *  <td align="center">600</td>
+     *  <td align="center">Semi Bold (Demi Bold)</td>
+     *  <td align="center">{@link FontStyle#FONT_WEIGHT_SEMI_BOLD}</td>
+     *  </tr>
+     *  <tr>
+     *  <td align="center">700</td>
+     *  <td align="center">Bold</td>
+     *  <td align="center">{@link FontStyle#FONT_WEIGHT_BOLD}</td>
+     *  </tr>
+     *  <tr>
+     *  <td align="center">800</td>
+     *  <td align="center">Extra Bold (Ultra Bold)</td>
+     *  <td align="center">{@link FontStyle#FONT_WEIGHT_EXTRA_BOLD}</td>
+     *  </tr>
+     *  <tr>
+     *  <td align="center">900</td>
+     *  <td align="center">Black (Heavy)</td>
+     *  <td align="center">{@link FontStyle#FONT_WEIGHT_BLACK}</td>
+     *  </tr>
+     *  </tbody>
+     * </p>
+     *
+     * @see FontStyle#FONT_WEIGHT_THIN
+     * @see FontStyle#FONT_WEIGHT_EXTRA_LIGHT
+     * @see FontStyle#FONT_WEIGHT_LIGHT
+     * @see FontStyle#FONT_WEIGHT_NORMAL
+     * @see FontStyle#FONT_WEIGHT_MEDIUM
+     * @see FontStyle#FONT_WEIGHT_SEMI_BOLD
+     * @see FontStyle#FONT_WEIGHT_BOLD
+     * @see FontStyle#FONT_WEIGHT_EXTRA_BOLD
+     * @see FontStyle#FONT_WEIGHT_BLACK
+     * @param weight a weight value
+     * @param slant a slant value
+     */
+    public FontStyle(int weight, @FontSlant int slant) {
+        Preconditions.checkArgument(FONT_WEIGHT_MIN <= weight && weight <= FONT_WEIGHT_MAX,
+                "weight value must be [" + FONT_WEIGHT_MIN + ", " + FONT_WEIGHT_MAX + "]");
+        Preconditions.checkArgument(slant == FONT_SLANT_UPRIGHT || slant == FONT_SLANT_ITALIC,
+                "slant value must be FONT_SLANT_UPRIGHT or FONT_SLANT_UPRIGHT");
+        mWeight = weight;
+        mSlant = slant;
+    }
+
+
+     /**
+      * Gets the weight value
+      *
+      * @see FontStyle#setWeight(int)
+      * @return a weight value
+      */
+    public @IntRange(from = 0, to = 1000) int getWeight() {
+        return mWeight;
+    }
+
+    /**
+     * Gets the slant value
+     *
+     * @return a slant value
+     */
+    public @FontSlant int getSlant() {
+        return mSlant;
+    }
+
+    @Override
+    public boolean equals(@Nullable Object o) {
+        if (o == this) {
+            return true;
+        }
+        if (o == null || !(o instanceof FontStyle)) {
+            return false;
+        }
+        FontStyle fontStyle = (FontStyle) o;
+        return fontStyle.mWeight == mWeight && fontStyle.mSlant == mSlant;
+    }
+
+    @Override
+    public int hashCode() {
+        return Objects.hash(mWeight, mSlant);
+    }
+
+    @Override
+    public String toString() {
+        return "FontStyle { weight=" + mWeight + ", slant=" + mSlant + "}";
+    }
+}
diff --git a/graphics/java/android/graphics/fonts/SystemFonts.java b/graphics/java/android/graphics/fonts/SystemFonts.java
index 2d21bbb..750adb2 100644
--- a/graphics/java/android/graphics/fonts/SystemFonts.java
+++ b/graphics/java/android/graphics/fonts/SystemFonts.java
@@ -192,7 +192,8 @@
             try {
                 font = new Font.Builder(buffer, new File(fullPath), languageTags)
                         .setWeight(fontConfig.getWeight())
-                        .setItalic(fontConfig.isItalic())
+                        .setSlant(fontConfig.isItalic() ? FontStyle.FONT_SLANT_ITALIC
+                                : FontStyle.FONT_SLANT_UPRIGHT)
                         .setTtcIndex(fontConfig.getTtcIndex())
                         .setFontVariationSettings(fontConfig.getAxes())
                         .build();
diff --git a/graphics/java/android/graphics/text/LineBreaker.java b/graphics/java/android/graphics/text/LineBreaker.java
index 8d38f96..1647909 100644
--- a/graphics/java/android/graphics/text/LineBreaker.java
+++ b/graphics/java/android/graphics/text/LineBreaker.java
@@ -38,11 +38,14 @@
  * <pre>
  * <code>
  * Paint paint = new Paint();
+ * Paint bigPaint = new Paint();
+ * bigPaint.setTextSize(paint.getTextSize() * 2.0);
  * String text = "Hello, Android.";
  *
  * // Prepare the measured text
  * MeasuredText mt = new MeasuredText.Builder(text.toCharArray())
- *     .addStyleRun(paint, 0, text.length(), false)  // Use paint for whole paragraph.
+ *     .appendStyleRun(paint, 7, false)  // Use paint for "Hello, "
+ *     .appednStyleRun(bigPaint, 8, false)  // Use bigPaint for "Hello, "
  *     .build();
  *
  * LineBreaker lb = new LineBreaker.Builder()
diff --git a/graphics/java/android/graphics/text/MeasuredText.java b/graphics/java/android/graphics/text/MeasuredText.java
index 852e66e..3efe655 100644
--- a/graphics/java/android/graphics/text/MeasuredText.java
+++ b/graphics/java/android/graphics/text/MeasuredText.java
@@ -31,6 +31,21 @@
 
 /**
  * Result of text shaping of the single paragraph string.
+ *
+ * <p>
+ * <pre>
+ * <code>
+ * Paint paint = new Paint();
+ * Paint bigPaint = new Paint();
+ * bigPaint.setTextSize(paint.getTextSize() * 2.0);
+ * String text = "Hello, Android.";
+ * MeasuredText mt = new MeasuredText.Builder(text.toCharArray())
+ *      .appendStyleRun(paint, 7, false)  // Use paint for "Hello, "
+ *      .appendStyleRun(bigPaint, 8, false)  // Use bigPaint for "Hello, "
+ *      .build();
+ * </code>
+ * </pre>
+ * </p>
  */
 public class MeasuredText {
     private static final NativeAllocationRegistry sRegistry = new NativeAllocationRegistry(
@@ -136,6 +151,19 @@
 
     /**
      * Helper class for creating a {@link MeasuredText}.
+     * <p>
+     * <pre>
+     * <code>
+     * Paint paint = new Paint();
+     * String text = "Hello, Android.";
+     * MeasuredText mt = new MeasuredText.Builder(text.toCharArray())
+     *      .appendStyleRun(paint, text.length, false)
+     *      .build();
+     * </code>
+     * </pre>
+     * </p>
+     *
+     * Note: The appendStyle and appendReplacementRun should be called to cover the text length.
      */
     public static class Builder {
         private long mNativePtr;
@@ -143,6 +171,7 @@
         private final @NonNull char[] mText;
         private boolean mComputeHyphenation = false;
         private boolean mComputeLayout = true;
+        private int mCurrentOffset = 0;
 
         /**
          * Construct a builder.
@@ -159,35 +188,50 @@
         }
 
         /**
-         * Apply styles to the given range.
+         * Apply styles to the given length.
+         *
+         * Keeps an internal offset which increases at every append. The initial value for this
+         * offset is zero. After the style is applied the internal offset is moved to {@code offset
+         * + length}, and next call will start from this new position.
          *
          * @param paint a paint
-         * @param start an inclusive start index of the range
-         * @param end an exclusive end index of the range
+         * @param length a length to be applied with a given paint, can not exceed the length of the
+         *               text
          * @param isRtl true if the text is in RTL context, otherwise false.
          */
-        public Builder addStyleRun(@NonNull Paint paint,
-                @IntRange(from = 0) int start, @IntRange(from = 0) int end, boolean isRtl) {
+        public Builder appendStyleRun(@NonNull Paint paint, @IntRange(from = 0) int length,
+                boolean isRtl) {
             Preconditions.checkNotNull(paint);
-            nAddStyleRun(mNativePtr, paint.getNativeInstance(), start, end, isRtl);
+            Preconditions.checkArgument(length > 0, "length can not be negative");
+            final int end = mCurrentOffset + length;
+            Preconditions.checkArgument(end <= mText.length, "Style exceeds the text length");
+            nAddStyleRun(mNativePtr, paint.getNativeInstance(), mCurrentOffset, end, isRtl);
+            mCurrentOffset = end;
             return this;
         }
 
         /**
-         * Used to inform the text layout that the given range is replaced with the object of given
+         * Used to inform the text layout that the given length is replaced with the object of given
          * width.
          *
-         * Informs the layout engine that the given range should not be processed, instead the
+         * Keeps an internal offset which increases at every append. The initial value for this
+         * offset is zero. After the style is applied the internal offset is moved to {@code offset
+         * + length}, and next call will start from this new position.
+         *
+         * Informs the layout engine that the given length should not be processed, instead the
          * provided width should be used for calculating the width of that range.
          *
-         * @param start an inclusive start index of the range
-         * @param end an exclusive end index of the range
+         * @param length a length to be replaced with the object, can not exceed the length of the
+         *               text
          * @param width a replacement width of the range
          */
-        public Builder addReplacementRun(@NonNull Paint paint,
-                @IntRange(from = 0) int start, @IntRange(from = 0) int end,
-                @FloatRange(from = 0) float width) {
-            nAddReplacementRun(mNativePtr, paint.getNativeInstance(), start, end, width);
+        public Builder appendReplacementRun(@NonNull Paint paint,
+                @IntRange(from = 0) int length, @FloatRange(from = 0) float width) {
+            Preconditions.checkArgument(length > 0, "length can not be negative");
+            final int end = mCurrentOffset + length;
+            Preconditions.checkArgument(end <= mText.length, "Replacement exceeds the text length");
+            nAddReplacementRun(mNativePtr, paint.getNativeInstance(), mCurrentOffset, end, width);
+            mCurrentOffset = end;
             return this;
         }
 
@@ -230,9 +274,14 @@
          *
          * Once you called build() method, you can't reuse the Builder class again.
          * @throws IllegalStateException if this Builder is reused.
+         * @throws IllegalStateException if the whole text is not covered by one or more runs (style
+         *                               or replacement)
          */
         public MeasuredText build() {
             ensureNativePtrNoReuse();
+            if (mCurrentOffset != mText.length) {
+                throw new IllegalStateException("Style info has not been provided for all text.");
+            }
             try {
                 long ptr = nBuildMeasuredText(mNativePtr, mText, mComputeHyphenation,
                         mComputeLayout);
diff --git a/libs/hwui/Android.bp b/libs/hwui/Android.bp
index e3ec45b..503951d 100644
--- a/libs/hwui/Android.bp
+++ b/libs/hwui/Android.bp
@@ -202,9 +202,7 @@
         "AnimationContext.cpp",
         "Animator.cpp",
         "AnimatorManager.cpp",
-        "CanvasState.cpp",
         "CanvasTransform.cpp",
-        "ClipArea.cpp",
         "DamageAccumulator.cpp",
         "DeferredLayerUpdater.cpp",
         "DeviceInfo.cpp",
@@ -227,9 +225,7 @@
         "RecordingCanvas.cpp",
         "RenderNode.cpp",
         "RenderProperties.cpp",
-        "ResourceCache.cpp",
         "SkiaCanvas.cpp",
-        "Snapshot.cpp",
         "TreeInfo.cpp",
         "VectorDrawable.cpp",
         "protos/graphicsstats.proto",
@@ -308,8 +304,6 @@
         "tests/unit/main.cpp",
         "tests/unit/CacheManagerTests.cpp",
         "tests/unit/CanvasContextTests.cpp",
-        "tests/unit/CanvasStateTests.cpp",
-        "tests/unit/ClipAreaTests.cpp",
         "tests/unit/DamageAccumulatorTests.cpp",
         "tests/unit/DeferredLayerUpdaterTests.cpp",
         "tests/unit/FatVectorTests.cpp",
@@ -328,7 +322,6 @@
         "tests/unit/SkiaPipelineTests.cpp",
         "tests/unit/SkiaRenderPropertiesTests.cpp",
         "tests/unit/SkiaCanvasTests.cpp",
-        "tests/unit/SnapshotTests.cpp",
         "tests/unit/StringUtilsTests.cpp",
         "tests/unit/TestUtilsTests.cpp",
         "tests/unit/ThreadBaseTests.cpp",
diff --git a/libs/hwui/CanvasState.cpp b/libs/hwui/CanvasState.cpp
deleted file mode 100644
index d18c4ab..0000000
--- a/libs/hwui/CanvasState.cpp
+++ /dev/null
@@ -1,284 +0,0 @@
-/*
- * Copyright (C) 2014 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "CanvasState.h"
-#include "hwui/Canvas.h"
-#include "utils/MathUtils.h"
-
-namespace android {
-namespace uirenderer {
-
-CanvasState::CanvasState(CanvasStateClient& renderer)
-        : mWidth(-1), mHeight(-1), mSaveCount(1), mCanvas(renderer), mSnapshot(&mFirstSnapshot) {}
-
-CanvasState::~CanvasState() {
-    // First call freeSnapshot on all but mFirstSnapshot
-    // to invoke all the dtors
-    freeAllSnapshots();
-
-    // Now actually release the memory
-    while (mSnapshotPool) {
-        void* temp = mSnapshotPool;
-        mSnapshotPool = mSnapshotPool->previous;
-        free(temp);
-    }
-}
-
-void CanvasState::initializeRecordingSaveStack(int viewportWidth, int viewportHeight) {
-    if (mWidth != viewportWidth || mHeight != viewportHeight) {
-        mWidth = viewportWidth;
-        mHeight = viewportHeight;
-        mFirstSnapshot.initializeViewport(viewportWidth, viewportHeight);
-        mCanvas.onViewportInitialized();
-    }
-
-    freeAllSnapshots();
-    mSnapshot = allocSnapshot(&mFirstSnapshot, SaveFlags::MatrixClip);
-    mSnapshot->setRelativeLightCenter(Vector3());
-    mSaveCount = 1;
-}
-
-void CanvasState::initializeSaveStack(int viewportWidth, int viewportHeight, float clipLeft,
-                                      float clipTop, float clipRight, float clipBottom,
-                                      const Vector3& lightCenter) {
-    if (mWidth != viewportWidth || mHeight != viewportHeight) {
-        mWidth = viewportWidth;
-        mHeight = viewportHeight;
-        mFirstSnapshot.initializeViewport(viewportWidth, viewportHeight);
-        mCanvas.onViewportInitialized();
-    }
-
-    freeAllSnapshots();
-    mSnapshot = allocSnapshot(&mFirstSnapshot, SaveFlags::MatrixClip);
-    mSnapshot->setClip(clipLeft, clipTop, clipRight, clipBottom);
-    mSnapshot->fbo = mCanvas.getTargetFbo();
-    mSnapshot->setRelativeLightCenter(lightCenter);
-    mSaveCount = 1;
-}
-
-Snapshot* CanvasState::allocSnapshot(Snapshot* previous, int savecount) {
-    void* memory;
-    if (mSnapshotPool) {
-        memory = mSnapshotPool;
-        mSnapshotPool = mSnapshotPool->previous;
-        mSnapshotPoolCount--;
-    } else {
-        memory = malloc(sizeof(Snapshot));
-    }
-    return new (memory) Snapshot(previous, savecount);
-}
-
-void CanvasState::freeSnapshot(Snapshot* snapshot) {
-    snapshot->~Snapshot();
-    // Arbitrary number, just don't let this grown unbounded
-    if (mSnapshotPoolCount > 10) {
-        free((void*)snapshot);
-    } else {
-        snapshot->previous = mSnapshotPool;
-        mSnapshotPool = snapshot;
-        mSnapshotPoolCount++;
-    }
-}
-
-void CanvasState::freeAllSnapshots() {
-    while (mSnapshot != &mFirstSnapshot) {
-        Snapshot* temp = mSnapshot;
-        mSnapshot = mSnapshot->previous;
-        freeSnapshot(temp);
-    }
-}
-
-///////////////////////////////////////////////////////////////////////////////
-// Save (layer)
-///////////////////////////////////////////////////////////////////////////////
-
-/**
- * Guaranteed to save without side-effects
- *
- * This approach, here and in restoreSnapshot(), allows subclasses to directly manipulate the save
- * stack, and ensures restoreToCount() doesn't call back into subclass overrides.
- */
-int CanvasState::saveSnapshot(int flags) {
-    mSnapshot = allocSnapshot(mSnapshot, flags);
-    return mSaveCount++;
-}
-
-int CanvasState::save(int flags) {
-    return saveSnapshot(flags);
-}
-
-/**
- * Guaranteed to restore without side-effects.
- */
-void CanvasState::restoreSnapshot() {
-    Snapshot* toRemove = mSnapshot;
-    Snapshot* toRestore = mSnapshot->previous;
-
-    mSaveCount--;
-    mSnapshot = toRestore;
-
-    // subclass handles restore implementation
-    mCanvas.onSnapshotRestored(*toRemove, *toRestore);
-
-    freeSnapshot(toRemove);
-}
-
-void CanvasState::restore() {
-    if (mSaveCount > 1) {
-        restoreSnapshot();
-    }
-}
-
-void CanvasState::restoreToCount(int saveCount) {
-    if (saveCount < 1) saveCount = 1;
-
-    while (mSaveCount > saveCount) {
-        restoreSnapshot();
-    }
-}
-
-///////////////////////////////////////////////////////////////////////////////
-// Matrix
-///////////////////////////////////////////////////////////////////////////////
-
-void CanvasState::getMatrix(SkMatrix* matrix) const {
-    mSnapshot->transform->copyTo(*matrix);
-}
-
-void CanvasState::translate(float dx, float dy, float dz) {
-    mSnapshot->transform->translate(dx, dy, dz);
-}
-
-void CanvasState::rotate(float degrees) {
-    mSnapshot->transform->rotate(degrees, 0.0f, 0.0f, 1.0f);
-}
-
-void CanvasState::scale(float sx, float sy) {
-    mSnapshot->transform->scale(sx, sy, 1.0f);
-}
-
-void CanvasState::skew(float sx, float sy) {
-    mSnapshot->transform->skew(sx, sy);
-}
-
-void CanvasState::setMatrix(const SkMatrix& matrix) {
-    mSnapshot->transform->load(matrix);
-}
-
-void CanvasState::setMatrix(const Matrix4& matrix) {
-    *(mSnapshot->transform) = matrix;
-}
-
-void CanvasState::concatMatrix(const SkMatrix& matrix) {
-    mat4 transform(matrix);
-    mSnapshot->transform->multiply(transform);
-}
-
-void CanvasState::concatMatrix(const Matrix4& matrix) {
-    mSnapshot->transform->multiply(matrix);
-}
-
-///////////////////////////////////////////////////////////////////////////////
-// Clip
-///////////////////////////////////////////////////////////////////////////////
-
-bool CanvasState::clipRect(float left, float top, float right, float bottom, SkClipOp op) {
-    mSnapshot->clip(Rect(left, top, right, bottom), op);
-    return !mSnapshot->clipIsEmpty();
-}
-
-bool CanvasState::clipPath(const SkPath* path, SkClipOp op) {
-    mSnapshot->clipPath(*path, op);
-    return !mSnapshot->clipIsEmpty();
-}
-
-void CanvasState::setClippingOutline(LinearAllocator& allocator, const Outline* outline) {
-    Rect bounds;
-    float radius;
-    if (!outline->getAsRoundRect(&bounds, &radius)) return;  // only RR supported
-
-    bool outlineIsRounded = MathUtils::isPositive(radius);
-    if (!outlineIsRounded || currentTransform()->isSimple()) {
-        // TODO: consider storing this rect separately, so that this can't be replaced with clip ops
-        clipRect(bounds.left, bounds.top, bounds.right, bounds.bottom, SkClipOp::kIntersect);
-    }
-    if (outlineIsRounded) {
-        setClippingRoundRect(allocator, bounds, radius, false);
-    }
-}
-
-///////////////////////////////////////////////////////////////////////////////
-// Quick Rejection
-///////////////////////////////////////////////////////////////////////////////
-
-/**
- * Calculates whether content drawn within the passed bounds would be outside of, or intersect with
- * the clipRect. Does not modify the scissor.
- *
- * @param clipRequired if not null, will be set to true if element intersects clip
- *         (and wasn't rejected)
- *
- * @param snapOut if set, the geometry will be treated as having an AA ramp.
- *         See Rect::snapGeometryToPixelBoundaries()
- */
-bool CanvasState::calculateQuickRejectForScissor(float left, float top, float right, float bottom,
-                                                 bool* clipRequired, bool* roundRectClipRequired,
-                                                 bool snapOut) const {
-    if (bottom <= top || right <= left) {
-        return true;
-    }
-
-    Rect r(left, top, right, bottom);
-    currentTransform()->mapRect(r);
-    r.snapGeometryToPixelBoundaries(snapOut);
-
-    Rect clipRect(currentRenderTargetClip());
-    clipRect.snapToPixelBoundaries();
-
-    if (!clipRect.intersects(r)) return true;
-
-    // clip is required if geometry intersects clip rect
-    if (clipRequired) {
-        *clipRequired = !clipRect.contains(r);
-    }
-
-    // round rect clip is required if RR clip exists, and geometry intersects its corners
-    if (roundRectClipRequired) {
-        *roundRectClipRequired = mSnapshot->roundRectClipState != nullptr &&
-                                 mSnapshot->roundRectClipState->areaRequiresRoundRectClip(r);
-    }
-    return false;
-}
-
-bool CanvasState::quickRejectConservative(float left, float top, float right, float bottom) const {
-    if (bottom <= top || right <= left) {
-        return true;
-    }
-
-    Rect r(left, top, right, bottom);
-    currentTransform()->mapRect(r);
-    r.roundOut();  // rounded out to be conservative
-
-    Rect clipRect(currentRenderTargetClip());
-    clipRect.snapToPixelBoundaries();
-
-    if (!clipRect.intersects(r)) return true;
-
-    return false;
-}
-
-}  // namespace uirenderer
-}  // namespace android
diff --git a/libs/hwui/CanvasState.h b/libs/hwui/CanvasState.h
deleted file mode 100644
index 9ac35ff..0000000
--- a/libs/hwui/CanvasState.h
+++ /dev/null
@@ -1,195 +0,0 @@
-/*
- * Copyright (C) 2014 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#pragma once
-
-#include "Snapshot.h"
-
-#include <SkClipOp.h>
-#include <SkMatrix.h>
-#include <SkPath.h>
-#include <SkRegion.h>
-
-namespace android {
-namespace uirenderer {
-
-/**
- * Abstract base class for any class containing CanvasState.
- * Defines three mandatory callbacks.
- */
-class CanvasStateClient {
-public:
-    CanvasStateClient() {}
-    virtual ~CanvasStateClient() {}
-
-    /**
-     * Callback allowing embedder to take actions in the middle of a
-     * setViewport() call.
-     */
-    virtual void onViewportInitialized() = 0;
-
-    /**
-     * Callback allowing embedder to take actions in the middle of a
-     * restore() call.  May be called several times sequentially.
-     */
-    virtual void onSnapshotRestored(const Snapshot& removed, const Snapshot& restored) = 0;
-
-    /**
-     * Allows subclasses to control what value is stored in snapshot's
-     * fbo field in * initializeSaveStack.
-     */
-    virtual GLuint getTargetFbo() const = 0;
-
-};  // class CanvasStateClient
-
-/**
- * Implements Canvas state methods on behalf of Renderers.
- *
- * Manages the Snapshot stack, implementing matrix, save/restore, and clipping methods in the
- * Renderer interface. Drawing and recording classes that include a CanvasState will have
- * different use cases:
- *
- * Drawing code maintaining canvas state (e.g. FrameBuilder) can query attributes (such as
- * transform) or hook into changes (e.g. save/restore) with minimal surface area for manipulating
- * the stack itself.
- *
- * Recording code maintaining canvas state (e.g. RecordingCanvas) can both record and pass
- * through state operations to CanvasState, so that not only will querying operations work
- * (getClip/Matrix), but so that quickRejection can also be used.
- */
-
-class CanvasState {
-public:
-    explicit CanvasState(CanvasStateClient& renderer);
-    ~CanvasState();
-
-    /**
-     * Initializes the first snapshot, computing the projection matrix,
-     * and stores the dimensions of the render target.
-     */
-    void initializeRecordingSaveStack(int viewportWidth, int viewportHeight);
-
-    /**
-     * Initializes the first snapshot, computing the projection matrix,
-     * and stores the dimensions of the render target.
-     */
-    void initializeSaveStack(int viewportWidth, int viewportHeight, float clipLeft, float clipTop,
-                             float clipRight, float clipBottom, const Vector3& lightCenter);
-
-    bool hasRectToRectTransform() const { return CC_LIKELY(currentTransform()->rectToRect()); }
-
-    // Save (layer)
-    int getSaveCount() const { return mSaveCount; }
-    int save(int flags);
-    void restore();
-    void restoreToCount(int saveCount);
-
-    // Save/Restore without side-effects
-    int saveSnapshot(int flags);
-    void restoreSnapshot();
-
-    // Matrix
-    void getMatrix(SkMatrix* outMatrix) const;
-    void translate(float dx, float dy, float dz = 0.0f);
-    void rotate(float degrees);
-    void scale(float sx, float sy);
-    void skew(float sx, float sy);
-
-    void setMatrix(const SkMatrix& matrix);
-    void setMatrix(const Matrix4& matrix);  // internal only convenience method
-    void concatMatrix(const SkMatrix& matrix);
-    void concatMatrix(const Matrix4& matrix);  // internal only convenience method
-
-    // Clip
-    const Rect& getLocalClipBounds() const { return mSnapshot->getLocalClip(); }
-    const Rect& getRenderTargetClipBounds() const { return mSnapshot->getRenderTargetClip(); }
-
-    bool quickRejectConservative(float left, float top, float right, float bottom) const;
-
-    bool clipRect(float left, float top, float right, float bottom, SkClipOp op);
-    bool clipPath(const SkPath* path, SkClipOp op);
-
-    /**
-     * Sets a "clipping outline", which is independent from the regular clip.
-     * Currently only supports rectangles or rounded rectangles; passing in a
-     * more complicated outline fails silently. Replaces any previous clipping
-     * outline.
-     */
-    void setClippingOutline(LinearAllocator& allocator, const Outline* outline);
-    void setClippingRoundRect(LinearAllocator& allocator, const Rect& rect, float radius,
-                              bool highPriority = true) {
-        mSnapshot->setClippingRoundRect(allocator, rect, radius, highPriority);
-    }
-    void setProjectionPathMask(const SkPath* path) { mSnapshot->setProjectionPathMask(path); }
-
-    /**
-     * Returns true if drawing in the rectangle (left, top, right, bottom)
-     * will be clipped out. Is conservative: might return false when subpixel-
-     * perfect tests would return true.
-     */
-    bool calculateQuickRejectForScissor(float left, float top, float right, float bottom,
-                                        bool* clipRequired, bool* roundRectClipRequired,
-                                        bool snapOut) const;
-
-    void scaleAlpha(float alpha) { mSnapshot->alpha *= alpha; }
-
-    inline const mat4* currentTransform() const { return currentSnapshot()->transform; }
-    inline const Rect& currentRenderTargetClip() const {
-        return currentSnapshot()->getRenderTargetClip();
-    }
-    inline int currentFlags() const { return currentSnapshot()->flags; }
-    const Vector3& currentLightCenter() const {
-        return currentSnapshot()->getRelativeLightCenter();
-    }
-    int getViewportWidth() const { return currentSnapshot()->getViewportWidth(); }
-    int getViewportHeight() const { return currentSnapshot()->getViewportHeight(); }
-    int getWidth() const { return mWidth; }
-    int getHeight() const { return mHeight; }
-    bool clipIsSimple() const { return currentSnapshot()->clipIsSimple(); }
-
-    inline const Snapshot* currentSnapshot() const { return mSnapshot; }
-    inline Snapshot* writableSnapshot() { return mSnapshot; }
-    inline const Snapshot* firstSnapshot() const { return &mFirstSnapshot; }
-
-private:
-    Snapshot* allocSnapshot(Snapshot* previous, int savecount);
-    void freeSnapshot(Snapshot* snapshot);
-    void freeAllSnapshots();
-
-    /// Dimensions of the drawing surface
-    int mWidth, mHeight;
-
-    /// Number of saved states
-    int mSaveCount;
-
-    /// Base state
-    Snapshot mFirstSnapshot;
-
-    /// Host providing callbacks
-    CanvasStateClient& mCanvas;
-
-    /// Current state
-    Snapshot* mSnapshot;
-
-    // Pool of allocated snapshots to re-use
-    // NOTE: The dtors have already been invoked!
-    Snapshot* mSnapshotPool = nullptr;
-    int mSnapshotPoolCount = 0;
-
-};  // class CanvasState
-
-};  // namespace uirenderer
-};  // namespace android
diff --git a/libs/hwui/ClipArea.cpp b/libs/hwui/ClipArea.cpp
deleted file mode 100644
index 27d93cf..0000000
--- a/libs/hwui/ClipArea.cpp
+++ /dev/null
@@ -1,534 +0,0 @@
-/*
- * Copyright (C) 2015 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-#include "ClipArea.h"
-
-#include "utils/LinearAllocator.h"
-
-#include <SkPath.h>
-#include <limits>
-#include <type_traits>
-
-namespace android {
-namespace uirenderer {
-
-static void handlePoint(Rect& transformedBounds, const Matrix4& transform, float x, float y) {
-    Vertex v = {x, y};
-    transform.mapPoint(v.x, v.y);
-    transformedBounds.expandToCover(v.x, v.y);
-}
-
-Rect transformAndCalculateBounds(const Rect& r, const Matrix4& transform) {
-    const float kMinFloat = std::numeric_limits<float>::lowest();
-    const float kMaxFloat = std::numeric_limits<float>::max();
-    Rect transformedBounds = {kMaxFloat, kMaxFloat, kMinFloat, kMinFloat};
-    handlePoint(transformedBounds, transform, r.left, r.top);
-    handlePoint(transformedBounds, transform, r.right, r.top);
-    handlePoint(transformedBounds, transform, r.left, r.bottom);
-    handlePoint(transformedBounds, transform, r.right, r.bottom);
-    return transformedBounds;
-}
-
-void ClipBase::dump() const {
-    ALOGD("mode %d" RECT_STRING, mode, RECT_ARGS(rect));
-}
-
-/*
- * TransformedRectangle
- */
-
-TransformedRectangle::TransformedRectangle() {}
-
-TransformedRectangle::TransformedRectangle(const Rect& bounds, const Matrix4& transform)
-        : mBounds(bounds), mTransform(transform) {}
-
-bool TransformedRectangle::canSimplyIntersectWith(const TransformedRectangle& other) const {
-    return mTransform == other.mTransform;
-}
-
-void TransformedRectangle::intersectWith(const TransformedRectangle& other) {
-    mBounds.doIntersect(other.mBounds);
-}
-
-bool TransformedRectangle::isEmpty() const {
-    return mBounds.isEmpty();
-}
-
-/*
- * RectangleList
- */
-
-RectangleList::RectangleList() : mTransformedRectanglesCount(0) {}
-
-bool RectangleList::isEmpty() const {
-    if (mTransformedRectanglesCount < 1) {
-        return true;
-    }
-
-    for (int i = 0; i < mTransformedRectanglesCount; i++) {
-        if (mTransformedRectangles[i].isEmpty()) {
-            return true;
-        }
-    }
-    return false;
-}
-
-int RectangleList::getTransformedRectanglesCount() const {
-    return mTransformedRectanglesCount;
-}
-
-const TransformedRectangle& RectangleList::getTransformedRectangle(int i) const {
-    return mTransformedRectangles[i];
-}
-
-void RectangleList::setEmpty() {
-    mTransformedRectanglesCount = 0;
-}
-
-void RectangleList::set(const Rect& bounds, const Matrix4& transform) {
-    mTransformedRectanglesCount = 1;
-    mTransformedRectangles[0] = TransformedRectangle(bounds, transform);
-}
-
-bool RectangleList::intersectWith(const Rect& bounds, const Matrix4& transform) {
-    TransformedRectangle newRectangle(bounds, transform);
-
-    // Try to find a rectangle with a compatible transformation
-    int index = 0;
-    for (; index < mTransformedRectanglesCount; index++) {
-        TransformedRectangle& tr(mTransformedRectangles[index]);
-        if (tr.canSimplyIntersectWith(newRectangle)) {
-            tr.intersectWith(newRectangle);
-            return true;
-        }
-    }
-
-    // Add it to the list if there is room
-    if (index < kMaxTransformedRectangles) {
-        mTransformedRectangles[index] = newRectangle;
-        mTransformedRectanglesCount += 1;
-        return true;
-    }
-
-    // This rectangle list is full
-    return false;
-}
-
-Rect RectangleList::calculateBounds() const {
-    Rect bounds;
-    for (int index = 0; index < mTransformedRectanglesCount; index++) {
-        const TransformedRectangle& tr(mTransformedRectangles[index]);
-        if (index == 0) {
-            bounds = tr.transformedBounds();
-        } else {
-            bounds.doIntersect(tr.transformedBounds());
-        }
-    }
-    return bounds;
-}
-
-static SkPath pathFromTransformedRectangle(const Rect& bounds, const Matrix4& transform) {
-    SkPath rectPath;
-    SkPath rectPathTransformed;
-    rectPath.addRect(bounds.left, bounds.top, bounds.right, bounds.bottom);
-    SkMatrix skTransform;
-    transform.copyTo(skTransform);
-    rectPath.transform(skTransform, &rectPathTransformed);
-    return rectPathTransformed;
-}
-
-SkRegion RectangleList::convertToRegion(const SkRegion& clip) const {
-    SkRegion rectangleListAsRegion;
-    for (int index = 0; index < mTransformedRectanglesCount; index++) {
-        const TransformedRectangle& tr(mTransformedRectangles[index]);
-        SkPath rectPathTransformed =
-                pathFromTransformedRectangle(tr.getBounds(), tr.getTransform());
-        if (index == 0) {
-            rectangleListAsRegion.setPath(rectPathTransformed, clip);
-        } else {
-            SkRegion rectRegion;
-            rectRegion.setPath(rectPathTransformed, clip);
-            rectangleListAsRegion.op(rectRegion, SkRegion::kIntersect_Op);
-        }
-    }
-    return rectangleListAsRegion;
-}
-
-void RectangleList::transform(const Matrix4& transform) {
-    for (int index = 0; index < mTransformedRectanglesCount; index++) {
-        mTransformedRectangles[index].transform(transform);
-    }
-}
-
-/*
- * ClipArea
- */
-
-ClipArea::ClipArea() : mMode(ClipMode::Rectangle) {}
-
-/*
- * Interface
- */
-
-void ClipArea::setViewportDimensions(int width, int height) {
-    mPostViewportClipObserved = false;
-    mViewportBounds.set(0, 0, width, height);
-    mClipRect = mViewportBounds;
-}
-
-void ClipArea::setEmpty() {
-    onClipUpdated();
-    mMode = ClipMode::Rectangle;
-    mClipRect.setEmpty();
-    mClipRegion.setEmpty();
-    mRectangleList.setEmpty();
-}
-
-void ClipArea::setClip(float left, float top, float right, float bottom) {
-    onClipUpdated();
-    mMode = ClipMode::Rectangle;
-    mClipRect.set(left, top, right, bottom);
-    mClipRegion.setEmpty();
-}
-
-void ClipArea::clipRectWithTransform(const Rect& r, const mat4* transform, SkRegion::Op op) {
-    if (op == SkRegion::kReplace_Op) mReplaceOpObserved = true;
-    if (!mPostViewportClipObserved && op == SkRegion::kIntersect_Op) op = SkRegion::kReplace_Op;
-    onClipUpdated();
-    switch (mMode) {
-        case ClipMode::Rectangle:
-            rectangleModeClipRectWithTransform(r, transform, op);
-            break;
-        case ClipMode::RectangleList:
-            rectangleListModeClipRectWithTransform(r, transform, op);
-            break;
-        case ClipMode::Region:
-            regionModeClipRectWithTransform(r, transform, op);
-            break;
-    }
-}
-
-void ClipArea::clipRegion(const SkRegion& region, SkRegion::Op op) {
-    if (op == SkRegion::kReplace_Op) mReplaceOpObserved = true;
-    if (!mPostViewportClipObserved && op == SkRegion::kIntersect_Op) op = SkRegion::kReplace_Op;
-    onClipUpdated();
-    enterRegionMode();
-    mClipRegion.op(region, op);
-    onClipRegionUpdated();
-}
-
-void ClipArea::clipPathWithTransform(const SkPath& path, const mat4* transform, SkRegion::Op op) {
-    if (op == SkRegion::kReplace_Op) mReplaceOpObserved = true;
-    if (!mPostViewportClipObserved && op == SkRegion::kIntersect_Op) op = SkRegion::kReplace_Op;
-    onClipUpdated();
-    SkMatrix skTransform;
-    transform->copyTo(skTransform);
-    SkPath transformed;
-    path.transform(skTransform, &transformed);
-    SkRegion region;
-    regionFromPath(transformed, region);
-    enterRegionMode();
-    mClipRegion.op(region, op);
-    onClipRegionUpdated();
-}
-
-/*
- * Rectangle mode
- */
-
-void ClipArea::enterRectangleMode() {
-    // Entering rectangle mode discards any
-    // existing clipping information from the other modes.
-    // The only way this occurs is by a clip setting operation.
-    mMode = ClipMode::Rectangle;
-}
-
-void ClipArea::rectangleModeClipRectWithTransform(const Rect& r, const mat4* transform,
-                                                  SkRegion::Op op) {
-    if (op == SkRegion::kReplace_Op && transform->rectToRect()) {
-        mClipRect = r;
-        transform->mapRect(mClipRect);
-        return;
-    } else if (op != SkRegion::kIntersect_Op) {
-        enterRegionMode();
-        regionModeClipRectWithTransform(r, transform, op);
-        return;
-    }
-
-    if (transform->rectToRect()) {
-        Rect transformed(r);
-        transform->mapRect(transformed);
-        mClipRect.doIntersect(transformed);
-        return;
-    }
-
-    enterRectangleListMode();
-    rectangleListModeClipRectWithTransform(r, transform, op);
-}
-
-/*
- * RectangleList mode implementation
- */
-
-void ClipArea::enterRectangleListMode() {
-    // Is is only legal to enter rectangle list mode from
-    // rectangle mode, since rectangle list mode cannot represent
-    // all clip areas that can be represented by a region.
-    ALOG_ASSERT(mMode == ClipMode::Rectangle);
-    mMode = ClipMode::RectangleList;
-    mRectangleList.set(mClipRect, Matrix4::identity());
-}
-
-void ClipArea::rectangleListModeClipRectWithTransform(const Rect& r, const mat4* transform,
-                                                      SkRegion::Op op) {
-    if (op != SkRegion::kIntersect_Op || !mRectangleList.intersectWith(r, *transform)) {
-        enterRegionMode();
-        regionModeClipRectWithTransform(r, transform, op);
-    }
-}
-
-/*
- * Region mode implementation
- */
-
-void ClipArea::enterRegionMode() {
-    ClipMode oldMode = mMode;
-    mMode = ClipMode::Region;
-    if (oldMode != ClipMode::Region) {
-        if (oldMode == ClipMode::Rectangle) {
-            mClipRegion.setRect(mClipRect.toSkIRect());
-        } else {
-            mClipRegion = mRectangleList.convertToRegion(createViewportRegion());
-            onClipRegionUpdated();
-        }
-    }
-}
-
-void ClipArea::regionModeClipRectWithTransform(const Rect& r, const mat4* transform,
-                                               SkRegion::Op op) {
-    SkPath transformedRect = pathFromTransformedRectangle(r, *transform);
-    SkRegion transformedRectRegion;
-    regionFromPath(transformedRect, transformedRectRegion);
-    mClipRegion.op(transformedRectRegion, op);
-    onClipRegionUpdated();
-}
-
-void ClipArea::onClipRegionUpdated() {
-    if (!mClipRegion.isEmpty()) {
-        mClipRect.set(mClipRegion.getBounds());
-
-        if (mClipRegion.isRect()) {
-            mClipRegion.setEmpty();
-            enterRectangleMode();
-        }
-    } else {
-        mClipRect.setEmpty();
-    }
-}
-
-/**
- * Clip serialization
- */
-
-const ClipBase* ClipArea::serializeClip(LinearAllocator& allocator) {
-    if (!mPostViewportClipObserved) {
-        // Only initial clip-to-viewport observed, so no serialization of clip necessary
-        return nullptr;
-    }
-
-    static_assert(std::is_trivially_destructible<Rect>::value,
-                  "expect Rect to be trivially destructible");
-    static_assert(std::is_trivially_destructible<RectangleList>::value,
-                  "expect RectangleList to be trivially destructible");
-
-    if (mLastSerialization == nullptr) {
-        ClipBase* serialization = nullptr;
-        switch (mMode) {
-            case ClipMode::Rectangle:
-                serialization = allocator.create<ClipRect>(mClipRect);
-                break;
-            case ClipMode::RectangleList:
-                serialization = allocator.create<ClipRectList>(mRectangleList);
-                serialization->rect = mRectangleList.calculateBounds();
-                break;
-            case ClipMode::Region:
-                serialization = allocator.create<ClipRegion>(mClipRegion);
-                serialization->rect.set(mClipRegion.getBounds());
-                break;
-        }
-        serialization->intersectWithRoot = mReplaceOpObserved;
-        // TODO: this is only done for draw time, should eventually avoid for record time
-        serialization->rect.snapToPixelBoundaries();
-        mLastSerialization = serialization;
-    }
-    return mLastSerialization;
-}
-
-inline static const RectangleList& getRectList(const ClipBase* scb) {
-    return reinterpret_cast<const ClipRectList*>(scb)->rectList;
-}
-
-inline static const SkRegion& getRegion(const ClipBase* scb) {
-    return reinterpret_cast<const ClipRegion*>(scb)->region;
-}
-
-// Conservative check for too many rectangles to fit in rectangle list.
-// For simplicity, doesn't account for rect merging
-static bool cannotFitInRectangleList(const ClipArea& clipArea, const ClipBase* scb) {
-    int currentRectCount = clipArea.isRectangleList()
-                                   ? clipArea.getRectangleList().getTransformedRectanglesCount()
-                                   : 1;
-    int recordedRectCount = (scb->mode == ClipMode::RectangleList)
-                                    ? getRectList(scb).getTransformedRectanglesCount()
-                                    : 1;
-    return currentRectCount + recordedRectCount > RectangleList::kMaxTransformedRectangles;
-}
-
-static const ClipRect sEmptyClipRect(Rect(0, 0));
-
-const ClipBase* ClipArea::serializeIntersectedClip(LinearAllocator& allocator,
-                                                   const ClipBase* recordedClip,
-                                                   const Matrix4& recordedClipTransform) {
-    // if no recordedClip passed, just serialize current state
-    if (!recordedClip) return serializeClip(allocator);
-
-    // if either is empty, clip is empty
-    if (CC_UNLIKELY(recordedClip->rect.isEmpty()) || mClipRect.isEmpty()) return &sEmptyClipRect;
-
-    if (!mLastResolutionResult || recordedClip != mLastResolutionClip ||
-        recordedClipTransform != mLastResolutionTransform) {
-        mLastResolutionClip = recordedClip;
-        mLastResolutionTransform = recordedClipTransform;
-
-        if (CC_LIKELY(mMode == ClipMode::Rectangle && recordedClip->mode == ClipMode::Rectangle &&
-                      recordedClipTransform.rectToRect())) {
-            // common case - result is a single rectangle
-            auto rectClip = allocator.create<ClipRect>(recordedClip->rect);
-            recordedClipTransform.mapRect(rectClip->rect);
-            rectClip->rect.doIntersect(mClipRect);
-            rectClip->rect.snapToPixelBoundaries();
-            mLastResolutionResult = rectClip;
-        } else if (CC_UNLIKELY(mMode == ClipMode::Region ||
-                               recordedClip->mode == ClipMode::Region ||
-                               cannotFitInRectangleList(*this, recordedClip))) {
-            // region case
-            SkRegion other;
-            switch (recordedClip->mode) {
-                case ClipMode::Rectangle:
-                    if (CC_LIKELY(recordedClipTransform.rectToRect())) {
-                        // simple transform, skip creating SkPath
-                        Rect resultClip(recordedClip->rect);
-                        recordedClipTransform.mapRect(resultClip);
-                        other.setRect(resultClip.toSkIRect());
-                    } else {
-                        SkPath transformedRect = pathFromTransformedRectangle(
-                                recordedClip->rect, recordedClipTransform);
-                        other.setPath(transformedRect, createViewportRegion());
-                    }
-                    break;
-                case ClipMode::RectangleList: {
-                    RectangleList transformedList(getRectList(recordedClip));
-                    transformedList.transform(recordedClipTransform);
-                    other = transformedList.convertToRegion(createViewportRegion());
-                    break;
-                }
-                case ClipMode::Region:
-                    other = getRegion(recordedClip);
-                    applyTransformToRegion(recordedClipTransform, &other);
-            }
-
-            ClipRegion* regionClip = allocator.create<ClipRegion>();
-            switch (mMode) {
-                case ClipMode::Rectangle:
-                    regionClip->region.op(mClipRect.toSkIRect(), other, SkRegion::kIntersect_Op);
-                    break;
-                case ClipMode::RectangleList:
-                    regionClip->region.op(mRectangleList.convertToRegion(createViewportRegion()),
-                                          other, SkRegion::kIntersect_Op);
-                    break;
-                case ClipMode::Region:
-                    regionClip->region.op(mClipRegion, other, SkRegion::kIntersect_Op);
-                    break;
-            }
-            // Don't need to snap, since region's in int bounds
-            regionClip->rect.set(regionClip->region.getBounds());
-            mLastResolutionResult = regionClip;
-        } else {
-            auto rectListClip = allocator.create<ClipRectList>(mRectangleList);
-            auto&& rectList = rectListClip->rectList;
-            if (mMode == ClipMode::Rectangle) {
-                rectList.set(mClipRect, Matrix4::identity());
-            }
-
-            if (recordedClip->mode == ClipMode::Rectangle) {
-                rectList.intersectWith(recordedClip->rect, recordedClipTransform);
-            } else {
-                const RectangleList& other = getRectList(recordedClip);
-                for (int i = 0; i < other.getTransformedRectanglesCount(); i++) {
-                    auto&& tr = other.getTransformedRectangle(i);
-                    Matrix4 totalTransform(recordedClipTransform);
-                    totalTransform.multiply(tr.getTransform());
-                    rectList.intersectWith(tr.getBounds(), totalTransform);
-                }
-            }
-            rectListClip->rect = rectList.calculateBounds();
-            rectListClip->rect.snapToPixelBoundaries();
-            mLastResolutionResult = rectListClip;
-        }
-    }
-    return mLastResolutionResult;
-}
-
-void ClipArea::applyClip(const ClipBase* clip, const Matrix4& transform) {
-    if (!clip) return;  // nothing to do
-
-    if (CC_LIKELY(clip->mode == ClipMode::Rectangle)) {
-        clipRectWithTransform(clip->rect, &transform, SkRegion::kIntersect_Op);
-    } else if (CC_LIKELY(clip->mode == ClipMode::RectangleList)) {
-        auto&& rectList = getRectList(clip);
-        for (int i = 0; i < rectList.getTransformedRectanglesCount(); i++) {
-            auto&& tr = rectList.getTransformedRectangle(i);
-            Matrix4 totalTransform(transform);
-            totalTransform.multiply(tr.getTransform());
-            clipRectWithTransform(tr.getBounds(), &totalTransform, SkRegion::kIntersect_Op);
-        }
-    } else {
-        SkRegion region(getRegion(clip));
-        applyTransformToRegion(transform, &region);
-        clipRegion(region, SkRegion::kIntersect_Op);
-    }
-}
-
-void ClipArea::applyTransformToRegion(const Matrix4& transform, SkRegion* region) {
-    if (transform.rectToRect() && !transform.isPureTranslate()) {
-        // handle matrices with scale manually by mapping each rect
-        SkRegion other;
-        SkRegion::Iterator it(*region);
-        while (!it.done()) {
-            Rect rect(it.rect());
-            transform.mapRect(rect);
-            rect.snapGeometryToPixelBoundaries(true);
-            other.op(rect.left, rect.top, rect.right, rect.bottom, SkRegion::kUnion_Op);
-            it.next();
-        }
-        region->swap(other);
-    } else {
-        // TODO: handle non-translate transforms properly!
-        region->translate(transform.getTranslateX(), transform.getTranslateY());
-    }
-}
-
-} /* namespace uirenderer */
-} /* namespace android */
diff --git a/libs/hwui/ClipArea.h b/libs/hwui/ClipArea.h
deleted file mode 100644
index a7a1180..0000000
--- a/libs/hwui/ClipArea.h
+++ /dev/null
@@ -1,212 +0,0 @@
-/*
- * Copyright (C) 2015 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-#ifndef CLIPAREA_H
-#define CLIPAREA_H
-
-#include "Matrix.h"
-#include "Rect.h"
-#include "utils/Pair.h"
-
-#include <SkRegion.h>
-
-namespace android {
-namespace uirenderer {
-
-class LinearAllocator;
-
-Rect transformAndCalculateBounds(const Rect& r, const Matrix4& transform);
-
-class TransformedRectangle {
-public:
-    TransformedRectangle();
-    TransformedRectangle(const Rect& bounds, const Matrix4& transform);
-
-    bool canSimplyIntersectWith(const TransformedRectangle& other) const;
-    void intersectWith(const TransformedRectangle& other);
-
-    bool isEmpty() const;
-
-    const Rect& getBounds() const { return mBounds; }
-
-    Rect transformedBounds() const {
-        Rect transformedBounds(transformAndCalculateBounds(mBounds, mTransform));
-        return transformedBounds;
-    }
-
-    const Matrix4& getTransform() const { return mTransform; }
-
-    void transform(const Matrix4& transform) {
-        Matrix4 t;
-        t.loadMultiply(transform, mTransform);
-        mTransform = t;
-    }
-
-private:
-    Rect mBounds;
-    Matrix4 mTransform;
-};
-
-class RectangleList {
-public:
-    RectangleList();
-
-    bool isEmpty() const;
-    int getTransformedRectanglesCount() const;
-    const TransformedRectangle& getTransformedRectangle(int i) const;
-
-    void setEmpty();
-    void set(const Rect& bounds, const Matrix4& transform);
-    bool intersectWith(const Rect& bounds, const Matrix4& transform);
-    void transform(const Matrix4& transform);
-
-    SkRegion convertToRegion(const SkRegion& clip) const;
-    Rect calculateBounds() const;
-
-    enum { kMaxTransformedRectangles = 5 };
-
-private:
-    int mTransformedRectanglesCount;
-    TransformedRectangle mTransformedRectangles[kMaxTransformedRectangles];
-};
-
-enum class ClipMode {
-    Rectangle,
-    RectangleList,
-
-    // region and path - intersected. if either is empty, don't use
-    Region
-};
-
-struct ClipBase {
-    explicit ClipBase(ClipMode mode) : mode(mode) {}
-    explicit ClipBase(const Rect& rect) : mode(ClipMode::Rectangle), rect(rect) {}
-    const ClipMode mode;
-    bool intersectWithRoot = false;
-    // Bounds of the clipping area, used to define the scissor, and define which
-    // portion of the stencil is updated/used
-    Rect rect;
-
-    void dump() const;
-};
-
-struct ClipRect : ClipBase {
-    explicit ClipRect(const Rect& rect) : ClipBase(rect) {}
-};
-
-struct ClipRectList : ClipBase {
-    explicit ClipRectList(const RectangleList& rectList)
-            : ClipBase(ClipMode::RectangleList), rectList(rectList) {}
-    RectangleList rectList;
-};
-
-struct ClipRegion : ClipBase {
-    explicit ClipRegion(const SkRegion& region) : ClipBase(ClipMode::Region), region(region) {}
-    ClipRegion() : ClipBase(ClipMode::Region) {}
-    SkRegion region;
-};
-
-class ClipArea {
-public:
-    ClipArea();
-
-    void setViewportDimensions(int width, int height);
-
-    bool isEmpty() const { return mClipRect.isEmpty(); }
-
-    void setEmpty();
-    void setClip(float left, float top, float right, float bottom);
-    void clipRectWithTransform(const Rect& r, const mat4* transform, SkRegion::Op op);
-    void clipPathWithTransform(const SkPath& path, const mat4* transform, SkRegion::Op op);
-
-    const Rect& getClipRect() const { return mClipRect; }
-
-    const SkRegion& getClipRegion() const { return mClipRegion; }
-
-    const RectangleList& getRectangleList() const { return mRectangleList; }
-
-    bool isRegion() const { return ClipMode::Region == mMode; }
-
-    bool isSimple() const { return mMode == ClipMode::Rectangle; }
-
-    bool isRectangleList() const { return mMode == ClipMode::RectangleList; }
-
-    WARN_UNUSED_RESULT const ClipBase* serializeClip(LinearAllocator& allocator);
-    WARN_UNUSED_RESULT const ClipBase* serializeIntersectedClip(
-            LinearAllocator& allocator, const ClipBase* recordedClip,
-            const Matrix4& recordedClipTransform);
-    void applyClip(const ClipBase* recordedClip, const Matrix4& recordedClipTransform);
-
-    static void applyTransformToRegion(const Matrix4& transform, SkRegion* region);
-
-private:
-    void enterRectangleMode();
-    void rectangleModeClipRectWithTransform(const Rect& r, const mat4* transform, SkRegion::Op op);
-
-    void enterRectangleListMode();
-    void rectangleListModeClipRectWithTransform(const Rect& r, const mat4* transform,
-                                                SkRegion::Op op);
-
-    void enterRegionModeFromRectangleMode();
-    void enterRegionModeFromRectangleListMode();
-    void enterRegionMode();
-    void regionModeClipRectWithTransform(const Rect& r, const mat4* transform, SkRegion::Op op);
-
-    void clipRegion(const SkRegion& region, SkRegion::Op op);
-    void ensureClipRegion();
-    void onClipRegionUpdated();
-
-    // Called by every state modifying public method.
-    void onClipUpdated() {
-        mPostViewportClipObserved = true;
-        mLastSerialization = nullptr;
-        mLastResolutionResult = nullptr;
-    }
-
-    SkRegion createViewportRegion() { return SkRegion(mViewportBounds.toSkIRect()); }
-
-    void regionFromPath(const SkPath& path, SkRegion& pathAsRegion) {
-        // TODO: this should not mask every path to the viewport - this makes it impossible to use
-        // paths to clip to larger areas (which is valid e.g. with SkRegion::kReplace_Op)
-        pathAsRegion.setPath(path, createViewportRegion());
-    }
-
-    ClipMode mMode;
-    bool mPostViewportClipObserved = false;
-    bool mReplaceOpObserved = false;
-
-    /**
-     * If mLastSerialization is non-null, it represents an already serialized copy
-     * of the current clip state. If null, it has not been computed.
-     */
-    const ClipBase* mLastSerialization = nullptr;
-
-    /**
-     * This pair of pointers is a single entry cache of most recently seen
-     */
-    const ClipBase* mLastResolutionResult = nullptr;
-    const ClipBase* mLastResolutionClip = nullptr;
-    Matrix4 mLastResolutionTransform;
-
-    Rect mViewportBounds;
-    Rect mClipRect;
-    SkRegion mClipRegion;
-    RectangleList mRectangleList;
-};
-
-} /* namespace uirenderer */
-} /* namespace android */
-
-#endif /* CLIPAREA_H_ */
diff --git a/libs/hwui/FloatColor.h b/libs/hwui/FloatColor.h
deleted file mode 100644
index b424f97..0000000
--- a/libs/hwui/FloatColor.h
+++ /dev/null
@@ -1,71 +0,0 @@
-/*
- * Copyright (C) 2015 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-#ifndef FLOATCOLOR_H
-#define FLOATCOLOR_H
-
-#include "utils/Color.h"
-#include "utils/Macros.h"
-#include "utils/MathUtils.h"
-
-#include <stdint.h>
-
-namespace android {
-namespace uirenderer {
-
-struct FloatColor {
-    // "color" is a gamma-encoded sRGB color
-    // After calling this method, the color is stored as a pre-multiplied linear color
-    // if linear blending is enabled. Otherwise, the color is stored as a pre-multiplied
-    // gamma-encoded sRGB color
-    void set(uint32_t color) {
-        a = ((color >> 24) & 0xff) / 255.0f;
-        r = a * EOCF(((color >> 16) & 0xff) / 255.0f);
-        g = a * EOCF(((color >> 8) & 0xff) / 255.0f);
-        b = a * EOCF(((color)&0xff) / 255.0f);
-    }
-
-    // "color" is a gamma-encoded sRGB color
-    // After calling this method, the color is stored as a un-premultiplied linear color
-    // if linear blending is enabled. Otherwise, the color is stored as a un-premultiplied
-    // gamma-encoded sRGB color
-    void setUnPreMultiplied(uint32_t color) {
-        a = ((color >> 24) & 0xff) / 255.0f;
-        r = EOCF(((color >> 16) & 0xff) / 255.0f);
-        g = EOCF(((color >> 8) & 0xff) / 255.0f);
-        b = EOCF(((color)&0xff) / 255.0f);
-    }
-
-    bool isNotBlack() { return a < 1.0f || r > 0.0f || g > 0.0f || b > 0.0f; }
-
-    bool operator==(const FloatColor& other) const {
-        return MathUtils::areEqual(r, other.r) && MathUtils::areEqual(g, other.g) &&
-               MathUtils::areEqual(b, other.b) && MathUtils::areEqual(a, other.a);
-    }
-
-    bool operator!=(const FloatColor& other) const { return !(*this == other); }
-
-    float r;
-    float g;
-    float b;
-    float a;
-};
-
-REQUIRE_COMPATIBLE_LAYOUT(FloatColor);
-
-} /* namespace uirenderer */
-} /* namespace android */
-
-#endif /* FLOATCOLOR_H */
diff --git a/libs/hwui/ResourceCache.cpp b/libs/hwui/ResourceCache.cpp
deleted file mode 100644
index 65bee47..0000000
--- a/libs/hwui/ResourceCache.cpp
+++ /dev/null
@@ -1,145 +0,0 @@
-/*
- * Copyright (C) 2010 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "ResourceCache.h"
-
-namespace android {
-
-using namespace uirenderer;
-ANDROID_SINGLETON_STATIC_INSTANCE(ResourceCache);
-
-namespace uirenderer {
-
-///////////////////////////////////////////////////////////////////////////////
-// Resource cache
-///////////////////////////////////////////////////////////////////////////////
-
-void ResourceCache::logCache() {
-    ALOGD("ResourceCache: cacheReport:");
-    for (size_t i = 0; i < mCache->size(); ++i) {
-        ResourceReference* ref = mCache->valueAt(i);
-        ALOGD("  ResourceCache: mCache(%zu): resource, ref = 0x%p, 0x%p", i, mCache->keyAt(i),
-              mCache->valueAt(i));
-        ALOGD("  ResourceCache: mCache(%zu): refCount, destroyed, type = %d, %d, %d", i,
-              ref->refCount, ref->destroyed, ref->resourceType);
-    }
-}
-
-ResourceCache::ResourceCache() {
-    Mutex::Autolock _l(mLock);
-    mCache = new KeyedVector<const void*, ResourceReference*>();
-}
-
-ResourceCache::~ResourceCache() {
-    Mutex::Autolock _l(mLock);
-    delete mCache;
-}
-
-void ResourceCache::lock() {
-    mLock.lock();
-}
-
-void ResourceCache::unlock() {
-    mLock.unlock();
-}
-
-void ResourceCache::incrementRefcount(void* resource, ResourceType resourceType) {
-    Mutex::Autolock _l(mLock);
-    incrementRefcountLocked(resource, resourceType);
-}
-
-void ResourceCache::incrementRefcount(const Res_png_9patch* patchResource) {
-    incrementRefcount((void*)patchResource, kNinePatch);
-}
-
-void ResourceCache::incrementRefcountLocked(void* resource, ResourceType resourceType) {
-    ssize_t index = mCache->indexOfKey(resource);
-    ResourceReference* ref = index >= 0 ? mCache->valueAt(index) : nullptr;
-    if (ref == nullptr || mCache->size() == 0) {
-        ref = new ResourceReference(resourceType);
-        mCache->add(resource, ref);
-    }
-    ref->refCount++;
-}
-
-void ResourceCache::decrementRefcount(void* resource) {
-    Mutex::Autolock _l(mLock);
-    decrementRefcountLocked(resource);
-}
-
-void ResourceCache::decrementRefcount(const Res_png_9patch* patchResource) {
-    decrementRefcount((void*)patchResource);
-}
-
-void ResourceCache::decrementRefcountLocked(void* resource) {
-    ssize_t index = mCache->indexOfKey(resource);
-    ResourceReference* ref = index >= 0 ? mCache->valueAt(index) : nullptr;
-    if (ref == nullptr) {
-        // Should not get here - shouldn't get a call to decrement if we're not yet tracking it
-        return;
-    }
-    ref->refCount--;
-    if (ref->refCount == 0) {
-        deleteResourceReferenceLocked(resource, ref);
-    }
-}
-
-void ResourceCache::decrementRefcountLocked(const Res_png_9patch* patchResource) {
-    decrementRefcountLocked((void*)patchResource);
-}
-
-void ResourceCache::destructor(Res_png_9patch* resource) {
-    Mutex::Autolock _l(mLock);
-    destructorLocked(resource);
-}
-
-void ResourceCache::destructorLocked(Res_png_9patch* resource) {
-    ssize_t index = mCache->indexOfKey(resource);
-    ResourceReference* ref = index >= 0 ? mCache->valueAt(index) : nullptr;
-    if (ref == nullptr) {
-        // If we're not tracking this resource, just delete it
-        // A Res_png_9patch is actually an array of byte that's larger
-        // than sizeof(Res_png_9patch). It must be freed as an array.
-        delete[](int8_t*) resource;
-        return;
-    }
-    ref->destroyed = true;
-    if (ref->refCount == 0) {
-        deleteResourceReferenceLocked(resource, ref);
-    }
-}
-
-/**
- * This method should only be called while the mLock mutex is held (that mutex is grabbed
- * by the various destructor() and recycle() methods which call this method).
- */
-void ResourceCache::deleteResourceReferenceLocked(const void* resource, ResourceReference* ref) {
-    if (ref->destroyed) {
-        switch (ref->resourceType) {
-            case kNinePatch: {
-                // A Res_png_9patch is actually an array of byte that's larger
-                // than sizeof(Res_png_9patch). It must be freed as an array.
-                int8_t* patch = (int8_t*)resource;
-                delete[] patch;
-            } break;
-        }
-    }
-    mCache->removeItem(resource);
-    delete ref;
-}
-
-};  // namespace uirenderer
-};  // namespace android
diff --git a/libs/hwui/ResourceCache.h b/libs/hwui/ResourceCache.h
deleted file mode 100644
index fd3f9fd..0000000
--- a/libs/hwui/ResourceCache.h
+++ /dev/null
@@ -1,103 +0,0 @@
-/*
- * Copyright (C) 2010 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#ifndef ANDROID_HWUI_RESOURCE_CACHE_H
-#define ANDROID_HWUI_RESOURCE_CACHE_H
-
-#include <cutils/compiler.h>
-
-#include <SkBitmap.h>
-#include <SkPixelRef.h>
-
-#include <utils/KeyedVector.h>
-#include <utils/Singleton.h>
-
-#include <androidfw/ResourceTypes.h>
-
-namespace android {
-namespace uirenderer {
-
-class Layer;
-
-/**
- * Type of Resource being cached
- */
-enum ResourceType {
-    kNinePatch,
-};
-
-class ResourceReference {
-public:
-    explicit ResourceReference(ResourceType type) {
-        refCount = 0;
-        destroyed = false;
-        resourceType = type;
-    }
-
-    int refCount;
-    bool destroyed;
-    ResourceType resourceType;
-};
-
-class ANDROID_API ResourceCache : public Singleton<ResourceCache> {
-    ResourceCache();
-    ~ResourceCache();
-
-    friend class Singleton<ResourceCache>;
-
-public:
-    /**
-     * When using these two methods, make sure to only invoke the *Locked()
-     * variants of increment/decrementRefcount(), recyle() and destructor()
-     */
-    void lock();
-    void unlock();
-
-    void incrementRefcount(const Res_png_9patch* resource);
-
-    void decrementRefcount(const Res_png_9patch* resource);
-
-    void decrementRefcountLocked(const Res_png_9patch* resource);
-
-    void destructor(Res_png_9patch* resource);
-
-    void destructorLocked(Res_png_9patch* resource);
-
-private:
-    void deleteResourceReferenceLocked(const void* resource, ResourceReference* ref);
-
-    void incrementRefcount(void* resource, ResourceType resourceType);
-    void incrementRefcountLocked(void* resource, ResourceType resourceType);
-
-    void decrementRefcount(void* resource);
-    void decrementRefcountLocked(void* resource);
-
-    void logCache();
-
-    /**
-     * Used to increment, decrement, and destroy. Incrementing is generally accessed on the UI
-     * thread, but destroying resources may be called from the GC thread, the finalizer thread,
-     * or a reference queue finalization thread.
-     */
-    mutable Mutex mLock;
-
-    KeyedVector<const void*, ResourceReference*>* mCache;
-};
-
-};  // namespace uirenderer
-};  // namespace android
-
-#endif  // ANDROID_HWUI_RESOURCE_CACHE_H
diff --git a/libs/hwui/Snapshot.cpp b/libs/hwui/Snapshot.cpp
deleted file mode 100644
index f1a1bef..0000000
--- a/libs/hwui/Snapshot.cpp
+++ /dev/null
@@ -1,209 +0,0 @@
-/*
- * Copyright (C) 2012 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "Snapshot.h"
-
-#include "hwui/Canvas.h"
-
-namespace android {
-namespace uirenderer {
-
-///////////////////////////////////////////////////////////////////////////////
-// Constructors
-///////////////////////////////////////////////////////////////////////////////
-
-Snapshot::Snapshot()
-        : flags(0)
-        , previous(nullptr)
-        , layer(nullptr)
-        , fbo(0)
-        , alpha(1.0f)
-        , roundRectClipState(nullptr)
-        , projectionPathMask(nullptr)
-        , mClipArea(&mClipAreaRoot) {
-    transform = &mTransformRoot;
-    mRelativeLightCenter.x = mRelativeLightCenter.y = mRelativeLightCenter.z = 0;
-}
-
-/**
- * Copies the specified snapshot/ The specified snapshot is stored as
- * the previous snapshot.
- */
-Snapshot::Snapshot(Snapshot* s, int saveFlags)
-        : flags(0)
-        , previous(s)
-        , layer(s->layer)
-        , fbo(s->fbo)
-        , alpha(s->alpha)
-        , roundRectClipState(s->roundRectClipState)
-        , projectionPathMask(s->projectionPathMask)
-        , mClipArea(nullptr)
-        , mViewportData(s->mViewportData)
-        , mRelativeLightCenter(s->mRelativeLightCenter) {
-    if (saveFlags & SaveFlags::Matrix) {
-        mTransformRoot = *s->transform;
-        transform = &mTransformRoot;
-    } else {
-        transform = s->transform;
-    }
-
-    if (saveFlags & SaveFlags::Clip) {
-        mClipAreaRoot = s->getClipArea();
-        mClipArea = &mClipAreaRoot;
-    } else {
-        mClipArea = s->mClipArea;
-    }
-}
-
-///////////////////////////////////////////////////////////////////////////////
-// Clipping
-///////////////////////////////////////////////////////////////////////////////
-
-void Snapshot::clip(const Rect& localClip, SkClipOp op) {
-    flags |= Snapshot::kFlagClipSet;
-    mClipArea->clipRectWithTransform(localClip, transform, static_cast<SkRegion::Op>(op));
-}
-
-void Snapshot::clipPath(const SkPath& path, SkClipOp op) {
-    flags |= Snapshot::kFlagClipSet;
-    mClipArea->clipPathWithTransform(path, transform, static_cast<SkRegion::Op>(op));
-}
-
-void Snapshot::setClip(float left, float top, float right, float bottom) {
-    flags |= Snapshot::kFlagClipSet;
-    mClipArea->setClip(left, top, right, bottom);
-}
-
-bool Snapshot::hasPerspectiveTransform() const {
-    return transform->isPerspective();
-}
-
-const Rect& Snapshot::getLocalClip() {
-    mat4 inverse;
-    inverse.loadInverse(*transform);
-
-    mLocalClip.set(mClipArea->getClipRect());
-    inverse.mapRect(mLocalClip);
-
-    return mLocalClip;
-}
-
-void Snapshot::resetClip(float left, float top, float right, float bottom) {
-    // TODO: This is incorrect, when we start rendering into a new layer,
-    // we may have to modify the previous snapshot's clip rect and clip
-    // region if the previous restore() call did not restore the clip
-    mClipArea = &mClipAreaRoot;
-    setClip(left, top, right, bottom);
-}
-
-///////////////////////////////////////////////////////////////////////////////
-// Clipping round rect
-///////////////////////////////////////////////////////////////////////////////
-
-void Snapshot::setClippingRoundRect(LinearAllocator& allocator, const Rect& bounds, float radius,
-                                    bool highPriority) {
-    if (bounds.isEmpty()) {
-        mClipArea->setEmpty();
-        return;
-    }
-
-    if (roundRectClipState && roundRectClipState->highPriority) {
-        // ignore, don't replace, already have a high priority clip
-        return;
-    }
-
-    RoundRectClipState* state = new (allocator) RoundRectClipState;
-
-    state->highPriority = highPriority;
-
-    // store the inverse drawing matrix
-    Matrix4 roundRectDrawingMatrix = getOrthoMatrix();
-    roundRectDrawingMatrix.multiply(*transform);
-    state->matrix.loadInverse(roundRectDrawingMatrix);
-
-    // compute area under rounded corners - only draws overlapping these rects need to be clipped
-    for (int i = 0; i < 4; i++) {
-        state->dangerRects[i] = bounds;
-    }
-    state->dangerRects[0].bottom = state->dangerRects[1].bottom = bounds.top + radius;
-    state->dangerRects[0].right = state->dangerRects[2].right = bounds.left + radius;
-    state->dangerRects[1].left = state->dangerRects[3].left = bounds.right - radius;
-    state->dangerRects[2].top = state->dangerRects[3].top = bounds.bottom - radius;
-    for (int i = 0; i < 4; i++) {
-        transform->mapRect(state->dangerRects[i]);
-
-        // round danger rects out as though they are AA geometry (since they essentially are)
-        state->dangerRects[i].snapGeometryToPixelBoundaries(true);
-    }
-
-    // store RR area
-    state->innerRect = bounds;
-    state->innerRect.inset(radius);
-    state->radius = radius;
-
-    // store as immutable so, for this frame, pointer uniquely identifies this bundle of shader info
-    roundRectClipState = state;
-}
-
-void Snapshot::setProjectionPathMask(const SkPath* path) {
-    projectionPathMask = path;
-}
-
-static Snapshot* getClipRoot(Snapshot* target) {
-    while (target->previous && target->previous->previous) {
-        target = target->previous;
-    }
-    return target;
-}
-
-const ClipBase* Snapshot::serializeIntersectedClip(LinearAllocator& allocator,
-                                                   const ClipBase* recordedClip,
-                                                   const Matrix4& recordedClipTransform) {
-    auto target = this;
-    if (CC_UNLIKELY(recordedClip && recordedClip->intersectWithRoot)) {
-        // Clip must be intersected with root, instead of current clip.
-        target = getClipRoot(this);
-    }
-
-    return target->mClipArea->serializeIntersectedClip(allocator, recordedClip,
-                                                       recordedClipTransform);
-}
-
-void Snapshot::applyClip(const ClipBase* recordedClip, const Matrix4& transform) {
-    if (CC_UNLIKELY(recordedClip && recordedClip->intersectWithRoot)) {
-        // current clip is being replaced, but must intersect with clip root
-        *mClipArea = *(getClipRoot(this)->mClipArea);
-    }
-    mClipArea->applyClip(recordedClip, transform);
-}
-
-///////////////////////////////////////////////////////////////////////////////
-// Queries
-///////////////////////////////////////////////////////////////////////////////
-
-void Snapshot::dump() const {
-    ALOGD("Snapshot %p, flags %x, prev %p, height %d, hasComplexClip %d", this, flags, previous,
-          getViewportHeight(), !mClipArea->isSimple());
-    const Rect& clipRect(mClipArea->getClipRect());
-    ALOGD("  ClipRect %.1f %.1f %.1f %.1f, clip simple %d", clipRect.left, clipRect.top,
-          clipRect.right, clipRect.bottom, mClipArea->isSimple());
-
-    ALOGD("  Transform (at %p):", transform);
-    transform->dump();
-}
-
-};  // namespace uirenderer
-};  // namespace android
diff --git a/libs/hwui/Snapshot.h b/libs/hwui/Snapshot.h
deleted file mode 100644
index 655f819..0000000
--- a/libs/hwui/Snapshot.h
+++ /dev/null
@@ -1,279 +0,0 @@
-/*
- * Copyright (C) 2010 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#pragma once
-
-#include <GLES2/gl2.h>
-#include <GLES2/gl2ext.h>
-
-#include <ui/Region.h>
-#include <utils/LinearAllocator.h>
-#include <utils/RefBase.h>
-
-#include <SkClipOp.h>
-#include <SkRegion.h>
-
-#include "ClipArea.h"
-#include "Layer.h"
-#include "Matrix.h"
-#include "Outline.h"
-#include "Rect.h"
-#include "utils/Macros.h"
-
-namespace android {
-namespace uirenderer {
-
-/**
- * Temporary structure holding information for a single outline clip.
- *
- * These structures are treated as immutable once created, and only exist for a single frame, which
- * is why they may only be allocated with a LinearAllocator.
- */
-class RoundRectClipState {
-public:
-    static void* operator new(size_t size) = delete;
-    static void* operator new(size_t size, LinearAllocator& allocator) {
-        return allocator.alloc<RoundRectClipState>(size);
-    }
-
-    bool areaRequiresRoundRectClip(const Rect& rect) const {
-        return rect.intersects(dangerRects[0]) || rect.intersects(dangerRects[1]) ||
-               rect.intersects(dangerRects[2]) || rect.intersects(dangerRects[3]);
-    }
-
-    bool highPriority;
-    Matrix4 matrix;
-    Rect dangerRects[4];
-    Rect innerRect;
-    float radius;
-};
-
-/**
- * A snapshot holds information about the current state of the rendering
- * surface. A snapshot is usually created whenever the user calls save()
- * and discarded when the user calls restore(). Once a snapshot is created,
- * it can hold information for deferred rendering.
- *
- * Each snapshot has a link to a previous snapshot, indicating the previous
- * state of the renderer.
- */
-class Snapshot {
-public:
-    Snapshot();
-    Snapshot(Snapshot* s, int saveFlags);
-
-    /**
-     * Various flags set on ::flags.
-     */
-    enum Flags {
-        /**
-         * Indicates that the clip region was modified. When this
-         * snapshot is restored so must the clip.
-         */
-        kFlagClipSet = 0x1,
-        /**
-         * Indicates that this snapshot was created when saving
-         * a new layer.
-         */
-        kFlagIsLayer = 0x2,
-        /**
-         * Indicates that this snapshot is a special type of layer
-         * backed by an FBO. This flag only makes sense when the
-         * flag kFlagIsLayer is also set.
-         *
-         * Viewport has been modified to fit the new Fbo, and must be
-         * restored when this snapshot is restored.
-         */
-        kFlagIsFboLayer = 0x4,
-    };
-
-    /**
-     * Modifies the current clip with the new clip rectangle and
-     * the specified operation. The specified rectangle is transformed
-     * by this snapshot's trasnformation.
-     */
-    void clip(const Rect& localClip, SkClipOp op);
-
-    /**
-     * Modifies the current clip with the new clip rectangle and
-     * the specified operation. The specified rectangle is considered
-     * already transformed.
-     */
-    void clipTransformed(const Rect& r, SkClipOp op = SkClipOp::kIntersect);
-
-    /**
-     * Modifies the current clip with the specified path and operation.
-     */
-    void clipPath(const SkPath& path, SkClipOp op);
-
-    /**
-     * Sets the current clip.
-     */
-    void setClip(float left, float top, float right, float bottom);
-
-    /**
-     * Returns the current clip in local coordinates. The clip rect is
-     * transformed by the inverse transform matrix.
-     */
-    ANDROID_API const Rect& getLocalClip();
-
-    /**
-     * Returns the current clip in render target coordinates.
-     */
-    const Rect& getRenderTargetClip() const { return mClipArea->getClipRect(); }
-
-    /*
-     * Accessor functions so that the clip area can stay private
-     */
-    bool clipIsEmpty() const { return mClipArea->isEmpty(); }
-    const SkRegion& getClipRegion() const { return mClipArea->getClipRegion(); }
-    bool clipIsSimple() const { return mClipArea->isSimple(); }
-    const ClipArea& getClipArea() const { return *mClipArea; }
-    ClipArea& mutateClipArea() { return *mClipArea; }
-
-    WARN_UNUSED_RESULT const ClipBase* serializeIntersectedClip(
-            LinearAllocator& allocator, const ClipBase* recordedClip,
-            const Matrix4& recordedClipTransform);
-    void applyClip(const ClipBase* clip, const Matrix4& transform);
-
-    /**
-     * Resets the clip to the specified rect.
-     */
-    void resetClip(float left, float top, float right, float bottom);
-
-    void initializeViewport(int width, int height) {
-        mViewportData.initialize(width, height);
-        mClipAreaRoot.setViewportDimensions(width, height);
-    }
-
-    int getViewportWidth() const { return mViewportData.mWidth; }
-    int getViewportHeight() const { return mViewportData.mHeight; }
-    const Matrix4& getOrthoMatrix() const { return mViewportData.mOrthoMatrix; }
-
-    const Vector3& getRelativeLightCenter() const { return mRelativeLightCenter; }
-    void setRelativeLightCenter(const Vector3& lightCenter) { mRelativeLightCenter = lightCenter; }
-
-    /**
-     * Sets (and replaces) the current clipping outline
-     *
-     * If the current round rect clip is high priority, the incoming clip is ignored.
-     */
-    void setClippingRoundRect(LinearAllocator& allocator, const Rect& bounds, float radius,
-                              bool highPriority);
-
-    /**
-     * Sets (and replaces) the current projection mask
-     */
-    void setProjectionPathMask(const SkPath* path);
-
-    /**
-     * Indicates whether the current transform has perspective components.
-     */
-    bool hasPerspectiveTransform() const;
-
-    /**
-     * Dirty flags.
-     */
-    int flags;
-
-    /**
-     * Previous snapshot.
-     */
-    Snapshot* previous;
-
-    /**
-     * A pointer to the currently active layer.
-     *
-     * This snapshot does not own the layer, this pointer must not be freed.
-     */
-    Layer* layer;
-
-    /**
-     * Target FBO used for rendering. Set to 0 when rendering directly
-     * into the framebuffer.
-     */
-    GLuint fbo;
-
-    /**
-     * Local transformation. Holds the current translation, scale and
-     * rotation values.
-     *
-     * This is a reference to a matrix owned by this snapshot or another
-     *  snapshot. This pointer must not be freed. See ::mTransformRoot.
-     */
-    mat4* transform;
-
-    /**
-     * Current alpha value. This value is 1 by default, but may be set by a DisplayList which
-     * has translucent rendering in a non-overlapping View. This value will be used by
-     * the renderer to set the alpha in the current color being used for ensuing drawing
-     * operations. The value is inherited by child snapshots because the same value should
-     * be applied to descendants of the current DisplayList (for example, a TextView contains
-     * the base alpha value which should be applied to the child DisplayLists used for drawing
-     * the actual text).
-     */
-    float alpha;
-
-    /**
-     * Current clipping round rect.
-     *
-     * Points to data not owned by the snapshot, and may only be replaced by subsequent RR clips,
-     * never modified.
-     */
-    const RoundRectClipState* roundRectClipState;
-
-    /**
-     * Current projection masking path - used exclusively to mask projected, tessellated circles.
-     */
-    const SkPath* projectionPathMask;
-
-    void dump() const;
-
-private:
-    struct ViewportData {
-        ViewportData() : mWidth(0), mHeight(0) {}
-        void initialize(int width, int height) {
-            mWidth = width;
-            mHeight = height;
-            mOrthoMatrix.loadOrtho(0, width, height, 0, -1, 1);
-        }
-
-        /*
-         * Width and height of current viewport.
-         *
-         * The viewport is always defined to be (0, 0, width, height).
-         */
-        int mWidth;
-        int mHeight;
-        /**
-         * Contains the current orthographic, projection matrix.
-         */
-        mat4 mOrthoMatrix;
-    };
-
-    mat4 mTransformRoot;
-
-    ClipArea mClipAreaRoot;
-    ClipArea* mClipArea;
-    Rect mLocalClip;
-
-    ViewportData mViewportData;
-    Vector3 mRelativeLightCenter;
-
-};  // class Snapshot
-
-};  // namespace uirenderer
-};  // namespace android
diff --git a/libs/hwui/Vertex.h b/libs/hwui/Vertex.h
index a6aae55..f091277 100644
--- a/libs/hwui/Vertex.h
+++ b/libs/hwui/Vertex.h
@@ -19,7 +19,6 @@
 
 #include "Vector.h"
 
-#include "FloatColor.h"
 #include "utils/Macros.h"
 
 namespace android {
diff --git a/libs/hwui/hwui/Bitmap.cpp b/libs/hwui/hwui/Bitmap.cpp
index b04194f..753557c 100644
--- a/libs/hwui/hwui/Bitmap.cpp
+++ b/libs/hwui/hwui/Bitmap.cpp
@@ -224,6 +224,7 @@
             break;
         case PixelStorageType::Heap:
             free(mPixelStorage.heap.address);
+            mallopt(M_PURGE, 0);
             break;
         case PixelStorageType::Hardware:
             auto buffer = mPixelStorage.hardware.buffer;
diff --git a/libs/hwui/hwui/MinikinSkia.cpp b/libs/hwui/hwui/MinikinSkia.cpp
index 0022c93..c6e4c154b 100644
--- a/libs/hwui/hwui/MinikinSkia.cpp
+++ b/libs/hwui/hwui/MinikinSkia.cpp
@@ -141,7 +141,7 @@
     // select only flags that might affect text layout
     flags &= (SkPaint::kAntiAlias_Flag | SkPaint::kFakeBoldText_Flag | SkPaint::kLinearText_Flag |
               SkPaint::kSubpixelText_Flag | SkPaint::kEmbeddedBitmapText_Flag |
-              SkPaint::kAutoHinting_Flag | SkPaint::kVerticalText_Flag);
+              SkPaint::kAutoHinting_Flag);
     flags |= (hinting << 16);
     return flags;
 }
diff --git a/libs/hwui/tests/common/TestUtils.h b/libs/hwui/tests/common/TestUtils.h
index a00b8db..c5db861d 100644
--- a/libs/hwui/tests/common/TestUtils.h
+++ b/libs/hwui/tests/common/TestUtils.h
@@ -21,7 +21,6 @@
 #include <Properties.h>
 #include <Rect.h>
 #include <RenderNode.h>
-#include <Snapshot.h>
 #include <hwui/Bitmap.h>
 #include <pipeline/skia/SkiaRecordingCanvas.h>
 #include <private/hwui/DrawGlInfo.h>
@@ -141,14 +140,6 @@
         return true;
     }
 
-    static std::unique_ptr<Snapshot> makeSnapshot(const Matrix4& transform, const Rect& clip) {
-        std::unique_ptr<Snapshot> snapshot(new Snapshot());
-        // store clip first, so it isn't transformed
-        snapshot->setClip(clip.left, clip.top, clip.right, clip.bottom);
-        *(snapshot->transform) = transform;
-        return snapshot;
-    }
-
     static sk_sp<Bitmap> createBitmap(int width, int height,
                                       SkColorType colorType = kN32_SkColorType) {
         SkImageInfo info = SkImageInfo::Make(width, height, colorType, kPremul_SkAlphaType);
diff --git a/libs/hwui/tests/microbench/DisplayListCanvasBench.cpp b/libs/hwui/tests/microbench/DisplayListCanvasBench.cpp
index 9388c20..70423a7 100644
--- a/libs/hwui/tests/microbench/DisplayListCanvasBench.cpp
+++ b/libs/hwui/tests/microbench/DisplayListCanvasBench.cpp
@@ -16,7 +16,6 @@
 
 #include <benchmark/benchmark.h>
 
-#include "CanvasState.h"
 #include "DisplayList.h"
 #include "hwui/Canvas.h"
 #include "pipeline/skia/SkiaDisplayList.h"
@@ -116,52 +115,6 @@
 }
 BENCHMARK(BM_DisplayListCanvas_record_simpleBitmapView);
 
-class NullClient : public CanvasStateClient {
-    void onViewportInitialized() override {}
-    void onSnapshotRestored(const Snapshot& removed, const Snapshot& restored) {}
-    GLuint getTargetFbo() const override { return 0; }
-};
-
-void BM_CanvasState_saverestore(benchmark::State& benchState) {
-    NullClient client;
-    CanvasState state(client);
-    state.initializeSaveStack(100, 100, 0, 0, 100, 100, Vector3());
-
-    while (benchState.KeepRunning()) {
-        state.save(SaveFlags::MatrixClip);
-        state.save(SaveFlags::MatrixClip);
-        benchmark::DoNotOptimize(&state);
-        state.restore();
-        state.restore();
-    }
-}
-BENCHMARK(BM_CanvasState_saverestore);
-
-void BM_CanvasState_init(benchmark::State& benchState) {
-    NullClient client;
-    CanvasState state(client);
-    state.initializeSaveStack(100, 100, 0, 0, 100, 100, Vector3());
-
-    while (benchState.KeepRunning()) {
-        state.initializeSaveStack(100, 100, 0, 0, 100, 100, Vector3());
-        benchmark::DoNotOptimize(&state);
-    }
-}
-BENCHMARK(BM_CanvasState_init);
-
-void BM_CanvasState_translate(benchmark::State& benchState) {
-    NullClient client;
-    CanvasState state(client);
-    state.initializeSaveStack(100, 100, 0, 0, 100, 100, Vector3());
-
-    while (benchState.KeepRunning()) {
-        state.translate(5, 5, 0);
-        benchmark::DoNotOptimize(&state);
-        state.translate(-5, -5, 0);
-    }
-}
-BENCHMARK(BM_CanvasState_translate);
-
 void BM_DisplayListCanvas_basicViewGroupDraw(benchmark::State& benchState) {
     sp<RenderNode> child = TestUtils::createNode(50, 50, 100, 100, [](auto& props, auto& canvas) {
         canvas.drawColor(0xFFFFFFFF, SkBlendMode::kSrcOver);
diff --git a/libs/hwui/tests/unit/CanvasStateTests.cpp b/libs/hwui/tests/unit/CanvasStateTests.cpp
deleted file mode 100644
index 4c03811..0000000
--- a/libs/hwui/tests/unit/CanvasStateTests.cpp
+++ /dev/null
@@ -1,160 +0,0 @@
-/*
- * Copyright (C) 2015 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include "CanvasState.h"
-
-#include "Matrix.h"
-#include "Rect.h"
-#include "hwui/Canvas.h"
-#include "utils/LinearAllocator.h"
-
-#include <SkClipOp.h>
-#include <SkPath.h>
-#include <gtest/gtest.h>
-
-namespace android {
-namespace uirenderer {
-
-class NullClient : public CanvasStateClient {
-    void onViewportInitialized() override {}
-    void onSnapshotRestored(const Snapshot& removed, const Snapshot& restored) {}
-    GLuint getTargetFbo() const override { return 0; }
-};
-
-static NullClient sNullClient;
-
-static bool approxEqual(const Matrix4& a, const Matrix4& b) {
-    for (int i = 0; i < 16; i++) {
-        if (!MathUtils::areEqual(a[i], b[i])) {
-            return false;
-        }
-    }
-    return true;
-}
-
-TEST(CanvasState, gettersAndSetters) {
-    CanvasState state(sNullClient);
-    state.initializeSaveStack(200, 200, 0, 0, 200, 200, Vector3());
-
-    ASSERT_EQ(state.getWidth(), 200);
-    ASSERT_EQ(state.getHeight(), 200);
-
-    Matrix4 simpleTranslate;
-    simpleTranslate.loadTranslate(10, 20, 0);
-    state.setMatrix(simpleTranslate);
-
-    ASSERT_EQ(state.getRenderTargetClipBounds(), Rect(200, 200));
-    ASSERT_EQ(state.getLocalClipBounds(), Rect(-10, -20, 190, 180));
-    EXPECT_TRUE(approxEqual(*state.currentTransform(), simpleTranslate));
-    EXPECT_TRUE(state.clipIsSimple());
-}
-
-TEST(CanvasState, simpleClipping) {
-    CanvasState state(sNullClient);
-    state.initializeSaveStack(200, 200, 0, 0, 200, 200, Vector3());
-
-    state.clipRect(0, 0, 100, 100, SkClipOp::kIntersect);
-    ASSERT_EQ(state.getRenderTargetClipBounds(), Rect(100, 100));
-
-    state.clipRect(10, 10, 200, 200, SkClipOp::kIntersect);
-    ASSERT_EQ(state.getRenderTargetClipBounds(), Rect(10, 10, 100, 100));
-
-    state.clipRect(50, 50, 150, 150, SkClipOp::kReplace_deprecated);
-    ASSERT_EQ(state.getRenderTargetClipBounds(), Rect(50, 50, 150, 150));
-}
-
-TEST(CanvasState, complexClipping) {
-    CanvasState state(sNullClient);
-    state.initializeSaveStack(200, 200, 0, 0, 200, 200, Vector3());
-
-    state.save(SaveFlags::MatrixClip);
-    {
-        // rotated clip causes complex clip
-        state.rotate(10);
-        EXPECT_TRUE(state.clipIsSimple());
-        state.clipRect(0, 0, 200, 200, SkClipOp::kIntersect);
-        EXPECT_FALSE(state.clipIsSimple());
-    }
-    state.restore();
-
-    state.save(SaveFlags::MatrixClip);
-    {
-        // subtracted clip causes complex clip
-        EXPECT_TRUE(state.clipIsSimple());
-        state.clipRect(50, 50, 150, 150, SkClipOp::kDifference);
-        EXPECT_FALSE(state.clipIsSimple());
-    }
-    state.restore();
-
-    state.save(SaveFlags::MatrixClip);
-    {
-        // complex path causes complex clip
-        SkPath path;
-        path.addOval(SkRect::MakeWH(200, 200));
-        EXPECT_TRUE(state.clipIsSimple());
-        state.clipPath(&path, SkClipOp::kDifference);
-        EXPECT_FALSE(state.clipIsSimple());
-    }
-    state.restore();
-}
-
-TEST(CanvasState, saveAndRestore) {
-    CanvasState state(sNullClient);
-    state.initializeSaveStack(200, 200, 0, 0, 200, 200, Vector3());
-
-    state.save(SaveFlags::Clip);
-    {
-        state.clipRect(0, 0, 10, 10, SkClipOp::kIntersect);
-        ASSERT_EQ(state.getRenderTargetClipBounds(), Rect(10, 10));
-    }
-    state.restore();
-    ASSERT_EQ(state.getRenderTargetClipBounds(), Rect(200, 200));  // verify restore
-
-    Matrix4 simpleTranslate;
-    simpleTranslate.loadTranslate(10, 10, 0);
-    state.save(SaveFlags::Matrix);
-    {
-        state.translate(10, 10, 0);
-        EXPECT_TRUE(approxEqual(*state.currentTransform(), simpleTranslate));
-    }
-    state.restore();
-    EXPECT_FALSE(approxEqual(*state.currentTransform(), simpleTranslate));
-}
-
-TEST(CanvasState, saveAndRestoreButNotTooMuch) {
-    CanvasState state(sNullClient);
-    state.initializeSaveStack(200, 200, 0, 0, 200, 200, Vector3());
-
-    state.save(SaveFlags::Matrix);  // NOTE: clip not saved
-    {
-        state.clipRect(0, 0, 10, 10, SkClipOp::kIntersect);
-        ASSERT_EQ(state.getRenderTargetClipBounds(), Rect(10, 10));
-    }
-    state.restore();
-    ASSERT_EQ(state.getRenderTargetClipBounds(), Rect(10, 10));  // verify not restored
-
-    Matrix4 simpleTranslate;
-    simpleTranslate.loadTranslate(10, 10, 0);
-    state.save(SaveFlags::Clip);  // NOTE: matrix not saved
-    {
-        state.translate(10, 10, 0);
-        EXPECT_TRUE(approxEqual(*state.currentTransform(), simpleTranslate));
-    }
-    state.restore();
-    EXPECT_TRUE(approxEqual(*state.currentTransform(), simpleTranslate));  // verify not restored
-}
-}
-}
diff --git a/libs/hwui/tests/unit/ClipAreaTests.cpp b/libs/hwui/tests/unit/ClipAreaTests.cpp
deleted file mode 100644
index 450bb67..0000000
--- a/libs/hwui/tests/unit/ClipAreaTests.cpp
+++ /dev/null
@@ -1,353 +0,0 @@
-/*
- * Copyright (C) 2015 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include <SkPath.h>
-#include <SkRegion.h>
-#include <gtest/gtest.h>
-
-#include "ClipArea.h"
-
-#include "Matrix.h"
-#include "Rect.h"
-#include "utils/LinearAllocator.h"
-
-namespace android {
-namespace uirenderer {
-
-static Rect kViewportBounds(2048, 2048);
-
-static ClipArea createClipArea() {
-    ClipArea area;
-    area.setViewportDimensions(kViewportBounds.getWidth(), kViewportBounds.getHeight());
-    return area;
-}
-
-TEST(TransformedRectangle, basics) {
-    Rect r(0, 0, 100, 100);
-    Matrix4 minus90;
-    minus90.loadRotate(-90);
-    minus90.mapRect(r);
-    Rect r2(20, 40, 120, 60);
-
-    Matrix4 m90;
-    m90.loadRotate(90);
-    TransformedRectangle tr(r, m90);
-    EXPECT_TRUE(tr.canSimplyIntersectWith(tr));
-
-    Matrix4 m0;
-    TransformedRectangle tr0(r2, m0);
-    EXPECT_FALSE(tr.canSimplyIntersectWith(tr0));
-
-    Matrix4 m45;
-    m45.loadRotate(45);
-    TransformedRectangle tr2(r, m45);
-    EXPECT_FALSE(tr2.canSimplyIntersectWith(tr));
-}
-
-TEST(RectangleList, basics) {
-    RectangleList list;
-    EXPECT_TRUE(list.isEmpty());
-
-    Rect r(0, 0, 100, 100);
-    Matrix4 m45;
-    m45.loadRotate(45);
-    list.set(r, m45);
-    EXPECT_FALSE(list.isEmpty());
-
-    Rect r2(20, 20, 200, 200);
-    list.intersectWith(r2, m45);
-    EXPECT_FALSE(list.isEmpty());
-    EXPECT_EQ(1, list.getTransformedRectanglesCount());
-
-    Rect r3(20, 20, 200, 200);
-    Matrix4 m30;
-    m30.loadRotate(30);
-    list.intersectWith(r2, m30);
-    EXPECT_FALSE(list.isEmpty());
-    EXPECT_EQ(2, list.getTransformedRectanglesCount());
-
-    SkRegion clip;
-    clip.setRect(0, 0, 2000, 2000);
-    SkRegion rgn(list.convertToRegion(clip));
-    EXPECT_FALSE(rgn.isEmpty());
-}
-
-TEST(ClipArea, basics) {
-    ClipArea area(createClipArea());
-    EXPECT_FALSE(area.isEmpty());
-}
-
-TEST(ClipArea, paths) {
-    ClipArea area(createClipArea());
-    SkPath path;
-    SkScalar r = 100;
-    path.addCircle(r, r, r);
-    area.clipPathWithTransform(path, &Matrix4::identity(), SkRegion::kIntersect_Op);
-    EXPECT_FALSE(area.isEmpty());
-    EXPECT_FALSE(area.isSimple());
-    EXPECT_FALSE(area.isRectangleList());
-
-    Rect clipRect(area.getClipRect());
-    Rect expected(0, 0, r * 2, r * 2);
-    EXPECT_EQ(expected, clipRect);
-    SkRegion clipRegion(area.getClipRegion());
-    auto skRect(clipRegion.getBounds());
-    Rect regionBounds;
-    regionBounds.set(skRect);
-    EXPECT_EQ(expected, regionBounds);
-}
-
-TEST(ClipArea, replaceNegative) {
-    ClipArea area(createClipArea());
-    area.setClip(0, 0, 100, 100);
-
-    Rect expected(-50, -50, 50, 50);
-    area.clipRectWithTransform(expected, &Matrix4::identity(), SkRegion::kReplace_Op);
-    EXPECT_EQ(expected, area.getClipRect());
-}
-
-TEST(ClipArea, serializeClip) {
-    ClipArea area(createClipArea());
-    LinearAllocator allocator;
-
-    // unset clip
-    EXPECT_EQ(nullptr, area.serializeClip(allocator));
-
-    // rect clip
-    area.setClip(0, 0, 200, 200);
-    {
-        auto serializedClip = area.serializeClip(allocator);
-        ASSERT_NE(nullptr, serializedClip);
-        ASSERT_EQ(ClipMode::Rectangle, serializedClip->mode);
-        ASSERT_FALSE(serializedClip->intersectWithRoot) << "No replace, so no intersectWithRoot";
-        EXPECT_EQ(Rect(200, 200), serializedClip->rect);
-        EXPECT_EQ(serializedClip, area.serializeClip(allocator))
-                << "Requery of clip on unmodified ClipArea must return same pointer.";
-    }
-
-    // rect list
-    Matrix4 rotate;
-    rotate.loadRotate(5.0f);
-    area.clipRectWithTransform(Rect(50, 50, 150, 150), &rotate, SkRegion::kIntersect_Op);
-    {
-        auto serializedClip = area.serializeClip(allocator);
-        ASSERT_NE(nullptr, serializedClip);
-        ASSERT_EQ(ClipMode::RectangleList, serializedClip->mode);
-        ASSERT_FALSE(serializedClip->intersectWithRoot) << "No replace, so no intersectWithRoot";
-        auto clipRectList = reinterpret_cast<const ClipRectList*>(serializedClip);
-        EXPECT_EQ(2, clipRectList->rectList.getTransformedRectanglesCount());
-        EXPECT_EQ(Rect(37, 54, 145, 163), clipRectList->rect);
-        EXPECT_EQ(serializedClip, area.serializeClip(allocator))
-                << "Requery of clip on unmodified ClipArea must return same pointer.";
-    }
-
-    // region
-    SkPath circlePath;
-    circlePath.addCircle(100, 100, 100);
-    area.clipPathWithTransform(circlePath, &Matrix4::identity(), SkRegion::kReplace_Op);
-    {
-        auto serializedClip = area.serializeClip(allocator);
-        ASSERT_NE(nullptr, serializedClip);
-        ASSERT_EQ(ClipMode::Region, serializedClip->mode);
-        ASSERT_TRUE(serializedClip->intersectWithRoot) << "Replace op, so expect intersectWithRoot";
-        auto clipRegion = reinterpret_cast<const ClipRegion*>(serializedClip);
-        EXPECT_EQ(SkIRect::MakeWH(200, 200), clipRegion->region.getBounds())
-                << "Clip region should be 200x200";
-        EXPECT_EQ(Rect(200, 200), clipRegion->rect);
-        EXPECT_EQ(serializedClip, area.serializeClip(allocator))
-                << "Requery of clip on unmodified ClipArea must return same pointer.";
-    }
-}
-
-TEST(ClipArea, serializeClip_pathIntersectWithRoot) {
-    ClipArea area(createClipArea());
-    LinearAllocator allocator;
-    SkPath circlePath;
-    circlePath.addCircle(100, 100, 100);
-    area.clipPathWithTransform(circlePath, &Matrix4::identity(), SkRegion::kIntersect_Op);
-
-    auto serializedClip = area.serializeClip(allocator);
-    ASSERT_NE(nullptr, serializedClip);
-    EXPECT_FALSE(serializedClip->intersectWithRoot) << "No replace, so no intersectWithRoot";
-}
-
-TEST(ClipArea, serializeIntersectedClip) {
-    ClipArea area(createClipArea());
-    LinearAllocator allocator;
-
-    // simple state;
-    EXPECT_EQ(nullptr, area.serializeIntersectedClip(allocator, nullptr, Matrix4::identity()));
-    area.setClip(0, 0, 200, 200);
-    {
-        auto origRectClip = area.serializeClip(allocator);
-        ASSERT_NE(nullptr, origRectClip);
-        EXPECT_EQ(origRectClip,
-                  area.serializeIntersectedClip(allocator, nullptr, Matrix4::identity()));
-    }
-
-    // rect
-    {
-        ClipRect recordedClip(Rect(100, 100));
-        Matrix4 translateScale;
-        translateScale.loadTranslate(100, 100, 0);
-        translateScale.scale(2, 3, 1);
-        auto resolvedClip = area.serializeIntersectedClip(allocator, &recordedClip, translateScale);
-        ASSERT_NE(nullptr, resolvedClip);
-        ASSERT_EQ(ClipMode::Rectangle, resolvedClip->mode);
-        EXPECT_EQ(Rect(100, 100, 200, 200), resolvedClip->rect);
-
-        EXPECT_EQ(resolvedClip,
-                  area.serializeIntersectedClip(allocator, &recordedClip, translateScale))
-                << "Must return previous serialization, since input is same";
-
-        ClipRect recordedClip2(Rect(100, 100));
-        EXPECT_NE(resolvedClip,
-                  area.serializeIntersectedClip(allocator, &recordedClip2, translateScale))
-                << "Shouldn't return previous serialization, since matrix location is different";
-    }
-
-    // rect list
-    Matrix4 rotate;
-    rotate.loadRotate(2.0f);
-    area.clipRectWithTransform(Rect(200, 200), &rotate, SkRegion::kIntersect_Op);
-    {
-        ClipRect recordedClip(Rect(100, 100));
-        auto resolvedClip =
-                area.serializeIntersectedClip(allocator, &recordedClip, Matrix4::identity());
-        ASSERT_NE(nullptr, resolvedClip);
-        ASSERT_EQ(ClipMode::RectangleList, resolvedClip->mode);
-        auto clipRectList = reinterpret_cast<const ClipRectList*>(resolvedClip);
-        EXPECT_EQ(2, clipRectList->rectList.getTransformedRectanglesCount());
-    }
-
-    // region
-    SkPath circlePath;
-    circlePath.addCircle(100, 100, 100);
-    area.clipPathWithTransform(circlePath, &Matrix4::identity(), SkRegion::kReplace_Op);
-    {
-        SkPath ovalPath;
-        ovalPath.addOval(SkRect::MakeLTRB(50, 0, 150, 200));
-
-        ClipRegion recordedClip;
-        recordedClip.region.setPath(ovalPath, SkRegion(SkIRect::MakeWH(200, 200)));
-        recordedClip.rect = Rect(200, 200);
-
-        Matrix4 translate10x20;
-        translate10x20.loadTranslate(10, 20, 0);
-        auto resolvedClip = area.serializeIntersectedClip(
-                allocator, &recordedClip,
-                translate10x20);  // Note: only translate for now, others not handled correctly
-        ASSERT_NE(nullptr, resolvedClip);
-        ASSERT_EQ(ClipMode::Region, resolvedClip->mode);
-        auto clipRegion = reinterpret_cast<const ClipRegion*>(resolvedClip);
-        EXPECT_EQ(SkIRect::MakeLTRB(60, 20, 160, 200), clipRegion->region.getBounds());
-    }
-}
-
-TEST(ClipArea, serializeIntersectedClip_snap) {
-    ClipArea area(createClipArea());
-    area.setClip(100.2, 100.4, 500.6, 500.8);
-    LinearAllocator allocator;
-
-    {
-        // no recorded clip case
-        auto resolvedClip = area.serializeIntersectedClip(allocator, nullptr, Matrix4::identity());
-        EXPECT_EQ(Rect(100, 100, 501, 501), resolvedClip->rect);
-    }
-    {
-        // recorded clip case
-        ClipRect recordedClip(Rect(100.12, 100.74));
-        Matrix4 translateScale;
-        translateScale.loadTranslate(100, 100, 0);
-        translateScale.scale(2, 3,
-                             1);  // recorded clip will have non-int coords, even after transform
-        auto resolvedClip = area.serializeIntersectedClip(allocator, &recordedClip, translateScale);
-        ASSERT_NE(nullptr, resolvedClip);
-        EXPECT_EQ(ClipMode::Rectangle, resolvedClip->mode);
-        EXPECT_EQ(Rect(100, 100, 300, 402), resolvedClip->rect);
-    }
-}
-
-TEST(ClipArea, serializeIntersectedClip_scale) {
-    ClipArea area(createClipArea());
-    area.setClip(0, 0, 400, 400);
-    LinearAllocator allocator;
-
-    SkPath circlePath;
-    circlePath.addCircle(50, 50, 50);
-
-    ClipRegion recordedClip;
-    recordedClip.region.setPath(circlePath, SkRegion(SkIRect::MakeWH(100, 100)));
-    recordedClip.rect = Rect(100, 100);
-
-    Matrix4 translateScale;
-    translateScale.loadTranslate(100, 100, 0);
-    translateScale.scale(2, 2, 1);
-    auto resolvedClip = area.serializeIntersectedClip(allocator, &recordedClip, translateScale);
-
-    ASSERT_NE(nullptr, resolvedClip);
-    EXPECT_EQ(ClipMode::Region, resolvedClip->mode);
-    EXPECT_EQ(Rect(100, 100, 300, 300), resolvedClip->rect);
-    auto clipRegion = reinterpret_cast<const ClipRegion*>(resolvedClip);
-    EXPECT_EQ(SkIRect::MakeLTRB(100, 100, 300, 300), clipRegion->region.getBounds());
-}
-
-TEST(ClipArea, applyTransformToRegion_identity) {
-    SkRegion region(SkIRect::MakeLTRB(1, 2, 3, 4));
-    ClipArea::applyTransformToRegion(Matrix4::identity(), &region);
-    EXPECT_TRUE(region.isRect());
-    EXPECT_EQ(SkIRect::MakeLTRB(1, 2, 3, 4), region.getBounds());
-}
-
-TEST(ClipArea, applyTransformToRegion_translate) {
-    SkRegion region(SkIRect::MakeLTRB(1, 2, 3, 4));
-    Matrix4 transform;
-    transform.loadTranslate(10, 20, 0);
-    ClipArea::applyTransformToRegion(transform, &region);
-    EXPECT_TRUE(region.isRect());
-    EXPECT_EQ(SkIRect::MakeLTRB(11, 22, 13, 24), region.getBounds());
-}
-
-TEST(ClipArea, applyTransformToRegion_scale) {
-    SkRegion region(SkIRect::MakeLTRB(1, 2, 3, 4));
-    Matrix4 transform;
-    transform.loadScale(2, 3, 1);
-    ClipArea::applyTransformToRegion(transform, &region);
-    EXPECT_TRUE(region.isRect());
-    EXPECT_EQ(SkIRect::MakeLTRB(2, 6, 6, 12), region.getBounds());
-}
-
-TEST(ClipArea, applyTransformToRegion_translateScale) {
-    SkRegion region(SkIRect::MakeLTRB(1, 2, 3, 4));
-    Matrix4 transform;
-    transform.translate(10, 20);
-    transform.scale(2, 3, 1);
-    ClipArea::applyTransformToRegion(transform, &region);
-    EXPECT_TRUE(region.isRect());
-    EXPECT_EQ(SkIRect::MakeLTRB(12, 26, 16, 32), region.getBounds());
-}
-
-TEST(ClipArea, applyTransformToRegion_rotate90) {
-    SkRegion region(SkIRect::MakeLTRB(1, 2, 3, 4));
-    Matrix4 transform;
-    transform.loadRotate(90);
-    ClipArea::applyTransformToRegion(transform, &region);
-    EXPECT_TRUE(region.isRect());
-    EXPECT_EQ(SkIRect::MakeLTRB(-4, 1, -2, 3), region.getBounds());
-}
-
-}  // namespace uirenderer
-}  // namespace android
diff --git a/libs/hwui/tests/unit/RenderNodeDrawableTests.cpp b/libs/hwui/tests/unit/RenderNodeDrawableTests.cpp
index 2926ef3..2c73940 100644
--- a/libs/hwui/tests/unit/RenderNodeDrawableTests.cpp
+++ b/libs/hwui/tests/unit/RenderNodeDrawableTests.cpp
@@ -32,6 +32,7 @@
 #include "pipeline/skia/SkiaRecordingCanvas.h"
 #include "renderthread/CanvasContext.h"
 #include "tests/common/TestUtils.h"
+#include "utils/Color.h"
 
 using namespace android;
 using namespace android::uirenderer;
diff --git a/libs/hwui/tests/unit/SnapshotTests.cpp b/libs/hwui/tests/unit/SnapshotTests.cpp
deleted file mode 100644
index 9d673c8..0000000
--- a/libs/hwui/tests/unit/SnapshotTests.cpp
+++ /dev/null
@@ -1,74 +0,0 @@
-/*
- * Copyright (C) 2016 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include <gtest/gtest.h>
-
-#include <Snapshot.h>
-
-#include <tests/common/TestUtils.h>
-
-using namespace android::uirenderer;
-
-TEST(Snapshot, serializeIntersectedClip) {
-    auto actualRoot = TestUtils::makeSnapshot(Matrix4::identity(), Rect(0, 0, 100, 100));
-    auto root = TestUtils::makeSnapshot(Matrix4::identity(), Rect(10, 10, 90, 90));
-    auto child = TestUtils::makeSnapshot(Matrix4::identity(), Rect(50, 50, 90, 90));
-    root->previous = actualRoot.get();
-    child->previous = root.get();
-
-    LinearAllocator allocator;
-    ClipRect rect(Rect(0, 0, 75, 75));
-    {
-        auto intersectWithChild =
-                child->serializeIntersectedClip(allocator, &rect, Matrix4::identity());
-        ASSERT_NE(nullptr, intersectWithChild);
-        EXPECT_EQ(Rect(50, 50, 75, 75), intersectWithChild->rect) << "Expect intersect with child";
-    }
-
-    rect.intersectWithRoot = true;
-    {
-        auto intersectWithRoot =
-                child->serializeIntersectedClip(allocator, &rect, Matrix4::identity());
-        ASSERT_NE(nullptr, intersectWithRoot);
-        EXPECT_EQ(Rect(10, 10, 75, 75), intersectWithRoot->rect) << "Expect intersect with root";
-    }
-}
-
-TEST(Snapshot, applyClip) {
-    auto actualRoot = TestUtils::makeSnapshot(Matrix4::identity(), Rect(0, 0, 100, 100));
-    auto root = TestUtils::makeSnapshot(Matrix4::identity(), Rect(10, 10, 90, 90));
-    root->previous = actualRoot.get();
-
-    ClipRect rect(Rect(0, 0, 75, 75));
-    {
-        auto child = TestUtils::makeSnapshot(Matrix4::identity(), Rect(50, 50, 90, 90));
-        child->previous = root.get();
-        child->applyClip(&rect, Matrix4::identity());
-
-        EXPECT_TRUE(child->getClipArea().isSimple());
-        EXPECT_EQ(Rect(50, 50, 75, 75), child->getRenderTargetClip());
-    }
-
-    {
-        rect.intersectWithRoot = true;
-        auto child = TestUtils::makeSnapshot(Matrix4::identity(), Rect(50, 50, 90, 90));
-        child->previous = root.get();
-        child->applyClip(&rect, Matrix4::identity());
-
-        EXPECT_TRUE(child->getClipArea().isSimple());
-        EXPECT_EQ(Rect(10, 10, 75, 75), child->getRenderTargetClip());
-    }
-}
diff --git a/media/OWNERS b/media/OWNERS
index 1ae2a7b..0abf9ae 100644
--- a/media/OWNERS
+++ b/media/OWNERS
@@ -9,4 +9,4 @@
 wjia@google.com
 jaewan@google.com
 chz@google.com
-
+dwkang@google.com
diff --git a/media/java/android/media/AudioManager.java b/media/java/android/media/AudioManager.java
index c074cce..e8c97bc 100644
--- a/media/java/android/media/AudioManager.java
+++ b/media/java/android/media/AudioManager.java
@@ -3942,18 +3942,31 @@
     }
 
      /**
-     * Indicate Hearing Aid connection state change.
+     * Indicate Hearing Aid connection state change and eventually suppress
+     * the {@link AudioManager.ACTION_AUDIO_BECOMING_NOISY} intent.
      * @param device Bluetooth device connected/disconnected
      * @param state new connection state (BluetoothProfile.STATE_xxx)
+     * @param musicDevice Default get system volume for the connecting device.
+     * (either {@link android.bluetooth.BluetoothProfile.hearingaid} or
+     * {@link android.bluetooth.BluetoothProfile.HEARING_AID})
+     * @param suppressNoisyIntent if true the
+     * {@link AudioManager.ACTION_AUDIO_BECOMING_NOISY} intent will not be sent.
+     * @return a delay in ms that the caller should wait before broadcasting
+     * BluetoothHearingAid.ACTION_CONNECTION_STATE_CHANGED intent.
      * {@hide}
      */
-    public void setHearingAidDeviceConnectionState(BluetoothDevice device, int state) {
+    public int setBluetoothHearingAidDeviceConnectionState(
+                BluetoothDevice device, int state, boolean suppressNoisyIntent,
+                int musicDevice) {
         final IAudioService service = getService();
+        int delay = 0;
         try {
-            service.setHearingAidDeviceConnectionState(device, state);
+            delay = service.setBluetoothHearingAidDeviceConnectionState(device,
+                state, suppressNoisyIntent, musicDevice);
         } catch (RemoteException e) {
             throw e.rethrowFromSystemServer();
         }
+        return delay;
     }
 
      /**
diff --git a/media/java/android/media/IAudioService.aidl b/media/java/android/media/IAudioService.aidl
index 569db16..abd6411 100644
--- a/media/java/android/media/IAudioService.aidl
+++ b/media/java/android/media/IAudioService.aidl
@@ -151,8 +151,6 @@
     void setWiredDeviceConnectionState(int type, int state, String address, String name,
             String caller);
 
-    void setHearingAidDeviceConnectionState(in BluetoothDevice device, int state);
-
     int setBluetoothA2dpDeviceConnectionState(in BluetoothDevice device, int state, int profile);
 
     void handleBluetoothA2dpDeviceConfigChange(in BluetoothDevice device);
@@ -210,6 +208,9 @@
 
     oneway void playerHasOpPlayAudio(in int piid, in boolean hasOpPlayAudio);
 
+    int setBluetoothHearingAidDeviceConnectionState(in BluetoothDevice device,
+            int state, boolean suppressNoisyIntent, int musicDevice);
+
     int setBluetoothA2dpDeviceConnectionStateSuppressNoisyIntent(in BluetoothDevice device,
             int state, int profile, boolean suppressNoisyIntent, int a2dpVolume);
 
diff --git a/media/java/android/media/MediaDrm.java b/media/java/android/media/MediaDrm.java
index 6d122d7..ee12b91 100644
--- a/media/java/android/media/MediaDrm.java
+++ b/media/java/android/media/MediaDrm.java
@@ -1192,15 +1192,17 @@
     public static final int SECURITY_LEVEL_HW_SECURE_ALL = 5;
 
     /**
-     * The maximum security level supported by the device. This is the default
-     * security level when a session is opened.
+     * Indicates that the maximum security level supported by the device should
+     * be used when opening a session. This is the default security level
+     * selected when a session is opened.
      * @hide
      */
     public static final int SECURITY_LEVEL_MAX = 6;
 
     /**
-     * The maximum security level supported by the device. This is the default
-     * security level when a session is opened.
+     * Returns a value that may be passed as a parameter to {@link #openSession(int)}
+     * requesting that the session be opened at the maximum security level of
+     * the device.
      */
     public static final int getMaxSecurityLevel() {
         return SECURITY_LEVEL_MAX;
diff --git a/media/java/android/media/MediaPlayer2.java b/media/java/android/media/MediaPlayer2.java
index db6da8c..e94413c 100644
--- a/media/java/android/media/MediaPlayer2.java
+++ b/media/java/android/media/MediaPlayer2.java
@@ -37,7 +37,6 @@
 import java.util.ArrayList;
 import java.util.List;
 import java.util.Map;
-import java.util.Set;
 import java.util.UUID;
 import java.util.concurrent.Executor;
 
@@ -1025,50 +1024,6 @@
     public abstract MediaTimestamp getTimestamp();
 
     /**
-     * Gets the media metadata.
-     *
-     * @param update_only controls whether the full set of available
-     * metadata is returned or just the set that changed since the
-     * last call. See {@see #METADATA_UPDATE_ONLY} and {@see
-     * #METADATA_ALL}.
-     *
-     * @param apply_filter if true only metadata that matches the
-     * filter is returned. See {@see #APPLY_METADATA_FILTER} and {@see
-     * #BYPASS_METADATA_FILTER}.
-     *
-     * @return The metadata, possibly empty. null if an error occured.
-     // FIXME: unhide.
-     * {@hide}
-     */
-    public Metadata getMetadata(final boolean update_only,
-            final boolean apply_filter) {
-        return null;
-    }
-
-    /**
-     * Set a filter for the metadata update notification and update
-     * retrieval. The caller provides 2 set of metadata keys, allowed
-     * and blocked. The blocked set always takes precedence over the
-     * allowed one.
-     * Metadata.MATCH_ALL and Metadata.MATCH_NONE are 2 sets available as
-     * shorthands to allow/block all or no metadata.
-     *
-     * By default, there is no filter set.
-     *
-     * @param allow Is the set of metadata the client is interested
-     *              in receiving new notifications for.
-     * @param block Is the set of metadata the client is not interested
-     *              in receiving new notifications for.
-     * @return The call status code.
-     *
-     // FIXME: unhide.
-     * {@hide}
-     */
-    public int setMetadataFilter(Set<Integer> allow, Set<Integer> block) {
-        return 0;
-    }
-
-    /**
      * Resets the MediaPlayer2 to its uninitialized state. After calling
      * this method, you will have to initialize it again by setting the
      * data source and calling prepare().
@@ -2266,38 +2221,4 @@
         public static final String ERROR_CODE = "android.media.mediaplayer.errcode";
 
     }
-
-    /**
-       Constant to retrieve only the new metadata since the last
-       call.
-       // FIXME: unhide.
-       // FIXME: add link to getMetadata(boolean, boolean)
-       {@hide}
-     */
-    public static final boolean METADATA_UPDATE_ONLY = true;
-
-    /**
-       Constant to retrieve all the metadata.
-       // FIXME: unhide.
-       // FIXME: add link to getMetadata(boolean, boolean)
-       {@hide}
-     */
-    public static final boolean METADATA_ALL = false;
-
-    /**
-       Constant to enable the metadata filter during retrieval.
-       // FIXME: unhide.
-       // FIXME: add link to getMetadata(boolean, boolean)
-       {@hide}
-     */
-    public static final boolean APPLY_METADATA_FILTER = true;
-
-    /**
-       Constant to disable the metadata filter during retrieval.
-       // FIXME: unhide.
-       // FIXME: add link to getMetadata(boolean, boolean)
-       {@hide}
-     */
-    public static final boolean BYPASS_METADATA_FILTER = false;
-
 }
diff --git a/media/java/android/media/MediaPlayer2Impl.java b/media/java/android/media/MediaPlayer2Impl.java
index 084b204..71df7dc 100644
--- a/media/java/android/media/MediaPlayer2Impl.java
+++ b/media/java/android/media/MediaPlayer2Impl.java
@@ -25,7 +25,6 @@
 import android.content.res.AssetFileDescriptor;
 import android.graphics.SurfaceTexture;
 import android.graphics.Rect;
-import android.media.MediaPlayer2Proto;
 import android.media.MediaPlayer2Proto.PlayerMessage;
 import android.media.MediaPlayer2Proto.Value;
 import android.net.Uri;
@@ -683,7 +682,9 @@
             case DataSourceDesc.TYPE_CALLBACK:
                 handleDataSource(isCurrent,
                                  srcId,
-                                 dsd.getMedia2DataSource());
+                                 dsd.getMedia2DataSource(),
+                                 dsd.getStartPosition(),
+                                 dsd.getEndPosition());
                 break;
 
             case DataSourceDesc.TYPE_FD:
@@ -691,7 +692,9 @@
                                  srcId,
                                  dsd.getFileDescriptor(),
                                  dsd.getFileDescriptorOffset(),
-                                 dsd.getFileDescriptorLength());
+                                 dsd.getFileDescriptorLength(),
+                                 dsd.getStartPosition(),
+                                 dsd.getEndPosition());
                 break;
 
             case DataSourceDesc.TYPE_URI:
@@ -700,7 +703,9 @@
                                  dsd.getUriContext(),
                                  dsd.getUri(),
                                  dsd.getUriHeaders(),
-                                 dsd.getUriCookies());
+                                 dsd.getUriCookies(),
+                                 dsd.getStartPosition(),
+                                 dsd.getEndPosition());
                 break;
 
             default:
@@ -730,67 +735,77 @@
     private void handleDataSource(
             boolean isCurrent, long srcId,
             @NonNull Context context, @NonNull Uri uri,
-            @Nullable Map<String, String> headers, @Nullable List<HttpCookie> cookies)
+            @Nullable Map<String, String> headers, @Nullable List<HttpCookie> cookies,
+            long startPos, long endPos)
             throws IOException {
-        // The context and URI usually belong to the calling user. Get a resolver for that user
-        // and strip out the userId from the URI if present.
+        // The context and URI usually belong to the calling user. Get a resolver for that user.
         final ContentResolver resolver = context.getContentResolver();
         final String scheme = uri.getScheme();
-        final String authority = ContentProvider.getAuthorityWithoutUserId(uri.getAuthority());
         if (ContentResolver.SCHEME_FILE.equals(scheme)) {
-            handleDataSource(isCurrent, srcId, uri.getPath(), null, null);
+            handleDataSource(isCurrent, srcId, uri.getPath(), null, null, startPos, endPos);
             return;
         }
 
-        if (ContentResolver.SCHEME_CONTENT.equals(scheme)
-                && Settings.AUTHORITY.equals(authority)) {
-            // Try cached ringtone first since the actual provider may not be
-            // encryption aware, or it may be stored on CE media storage
-            final int type = RingtoneManager.getDefaultType(uri);
-            final Uri cacheUri = RingtoneManager.getCacheForType(type, context.getUserId());
-            final Uri actualUri = RingtoneManager.getActualDefaultRingtoneUri(context, type);
-            if (attemptDataSource(isCurrent, srcId, resolver, cacheUri)) {
+        final int ringToneType = RingtoneManager.getDefaultType(uri);
+        try {
+            AssetFileDescriptor afd;
+            // Try requested Uri locally first
+            if (ContentResolver.SCHEME_CONTENT.equals(scheme) && ringToneType != -1) {
+                afd = RingtoneManager.openDefaultRingtoneUri(context, uri);
+                if (attemptDataSource(isCurrent, srcId, afd, startPos, endPos)) {
+                    return;
+                }
+                final Uri actualUri = RingtoneManager.getActualDefaultRingtoneUri(
+                        context, ringToneType);
+                afd = resolver.openAssetFileDescriptor(actualUri, "r");
+            } else {
+                afd = resolver.openAssetFileDescriptor(uri, "r");
+            }
+            if (attemptDataSource(isCurrent, srcId, afd, startPos, endPos)) {
                 return;
             }
-            if (attemptDataSource(isCurrent, srcId, resolver, actualUri)) {
-                return;
-            }
-            handleDataSource(isCurrent, srcId, uri.toString(), headers, cookies);
-        } else {
-            // Try requested Uri locally first, or fallback to media server
-            if (attemptDataSource(isCurrent, srcId, resolver, uri)) {
-                return;
-            }
-            handleDataSource(isCurrent, srcId, uri.toString(), headers, cookies);
+        } catch (NullPointerException | SecurityException | IOException ex) {
+            Log.w(TAG, "Couldn't open " + uri + ": " + ex);
+            // Fallback to media server
         }
+        handleDataSource(isCurrent, srcId, uri.toString(), headers, cookies, startPos, endPos);
     }
 
-    private boolean attemptDataSource(
-            boolean isCurrent, long srcId, ContentResolver resolver, Uri uri) {
-        try (AssetFileDescriptor afd = resolver.openAssetFileDescriptor(uri, "r")) {
+    private boolean attemptDataSource(boolean isCurrent, long srcId, AssetFileDescriptor afd,
+            long startPos, long endPos) throws IOException {
+        try {
             if (afd.getDeclaredLength() < 0) {
                 handleDataSource(isCurrent,
-                                 srcId,
-                                 afd.getFileDescriptor(),
-                                 0,
-                                 DataSourceDesc.LONG_MAX);
+                        srcId,
+                        afd.getFileDescriptor(),
+                        0,
+                        DataSourceDesc.LONG_MAX,
+                        startPos,
+                        endPos);
             } else {
                 handleDataSource(isCurrent,
-                                 srcId,
-                                 afd.getFileDescriptor(),
-                                 afd.getStartOffset(),
-                                 afd.getDeclaredLength());
+                        srcId,
+                        afd.getFileDescriptor(),
+                        afd.getStartOffset(),
+                        afd.getDeclaredLength(),
+                        startPos,
+                        endPos);
             }
             return true;
         } catch (NullPointerException | SecurityException | IOException ex) {
-            Log.w(TAG, "Couldn't open " + uri + ": " + ex);
+            Log.w(TAG, "Couldn't open srcId:" + srcId + ": " + ex);
             return false;
+        } finally {
+            if (afd != null) {
+                afd.close();
+            }
         }
     }
 
     private void handleDataSource(
             boolean isCurrent, long srcId,
-            String path, Map<String, String> headers, List<HttpCookie> cookies)
+            String path, Map<String, String> headers, List<HttpCookie> cookies,
+            long startPos, long endPos)
             throws IOException {
         String[] keys = null;
         String[] values = null;
@@ -806,11 +821,12 @@
                 ++i;
             }
         }
-        handleDataSource(isCurrent, srcId, path, keys, values, cookies);
+        handleDataSource(isCurrent, srcId, path, keys, values, cookies, startPos, endPos);
     }
 
     private void handleDataSource(boolean isCurrent, long srcId,
-            String path, String[] keys, String[] values, List<HttpCookie> cookies)
+            String path, String[] keys, String[] values, List<HttpCookie> cookies,
+            long startPos, long endPos)
             throws IOException {
         final Uri uri = Uri.parse(path);
         final String scheme = uri.getScheme();
@@ -824,7 +840,9 @@
                 Media2HTTPService.createHTTPService(path, cookies),
                 path,
                 keys,
-                values);
+                values,
+                startPos,
+                endPos);
             return;
         }
 
@@ -832,7 +850,7 @@
         if (file.exists()) {
             FileInputStream is = new FileInputStream(file);
             FileDescriptor fd = is.getFD();
-            handleDataSource(isCurrent, srcId, fd, 0, DataSourceDesc.LONG_MAX);
+            handleDataSource(isCurrent, srcId, fd, 0, DataSourceDesc.LONG_MAX, startPos, endPos);
             is.close();
         } else {
             throw new IOException("handleDataSource failed.");
@@ -841,7 +859,8 @@
 
     private native void nativeHandleDataSourceUrl(
             boolean isCurrent, long srcId,
-            Media2HTTPService httpService, String path, String[] keys, String[] values)
+            Media2HTTPService httpService, String path, String[] keys, String[] values,
+            long startPos, long endPos)
             throws IOException;
 
     /**
@@ -855,23 +874,27 @@
      */
     private void handleDataSource(
             boolean isCurrent, long srcId,
-            FileDescriptor fd, long offset, long length) throws IOException {
-        nativeHandleDataSourceFD(isCurrent, srcId, fd, offset, length);
+            FileDescriptor fd, long offset, long length,
+            long startPos, long endPos) throws IOException {
+        nativeHandleDataSourceFD(isCurrent, srcId, fd, offset, length, startPos, endPos);
     }
 
     private native void nativeHandleDataSourceFD(boolean isCurrent, long srcId,
-            FileDescriptor fd, long offset, long length) throws IOException;
+            FileDescriptor fd, long offset, long length,
+            long startPos, long endPos) throws IOException;
 
     /**
      * @throws IllegalStateException if it is called in an invalid state
      * @throws IllegalArgumentException if dataSource is not a valid Media2DataSource
      */
-    private void handleDataSource(boolean isCurrent, long srcId, Media2DataSource dataSource) {
-        nativeHandleDataSourceCallback(isCurrent, srcId, dataSource);
+    private void handleDataSource(boolean isCurrent, long srcId, Media2DataSource dataSource,
+            long startPos, long endPos) {
+        nativeHandleDataSourceCallback(isCurrent, srcId, dataSource, startPos, endPos);
     }
 
     private native void nativeHandleDataSourceCallback(
-            boolean isCurrent, long srcId, Media2DataSource dataSource);
+            boolean isCurrent, long srcId, Media2DataSource dataSource,
+            long startPos, long endPos);
 
     /**
      * @return true if there is a next data source, false otherwise.
diff --git a/media/java/android/media/RingtoneManager.java b/media/java/android/media/RingtoneManager.java
index 66feb1d..8664aa1 100644
--- a/media/java/android/media/RingtoneManager.java
+++ b/media/java/android/media/RingtoneManager.java
@@ -31,6 +31,7 @@
 import android.content.pm.PackageManager;
 import android.content.pm.PackageManager.NameNotFoundException;
 import android.content.pm.UserInfo;
+import android.content.res.AssetFileDescriptor;
 import android.database.Cursor;
 import android.media.MediaScannerConnection.MediaScannerConnectionClient;
 import android.net.Uri;
@@ -1128,6 +1129,38 @@
     }
 
     /**
+     * Opens a raw file descriptor to read the data under the given default URI.
+     *
+     * @param context the Context to use when resolving the Uri.
+     * @param uri The desired default URI to open.
+     * @return a new AssetFileDescriptor pointing to the file. You own this descriptor
+     * and are responsible for closing it when done. This value may be {@code null}.
+     * @throws FileNotFoundException if the provided URI could not be opened.
+     * @see #getDefaultUri
+     */
+    public static AssetFileDescriptor openDefaultRingtoneUri(
+            @NonNull Context context, @NonNull Uri uri) throws FileNotFoundException {
+        // Try cached ringtone first since the actual provider may not be
+        // encryption aware, or it may be stored on CE media storage
+        final int type = getDefaultType(uri);
+        final Uri cacheUri = getCacheForType(type, context.getUserId());
+        final Uri actualUri = getActualDefaultRingtoneUri(context, type);
+        final ContentResolver resolver = context.getContentResolver();
+
+        AssetFileDescriptor afd = null;
+        if (cacheUri != null) {
+            afd = resolver.openAssetFileDescriptor(cacheUri, "r");
+            if (afd != null) {
+                return afd;
+            }
+        }
+        if (actualUri != null) {
+            afd = resolver.openAssetFileDescriptor(actualUri, "r");
+        }
+        return afd;
+    }
+
+    /**
      * Creates a {@link android.media.MediaScannerConnection} to scan a ringtone file and add its
      * information to the internal database.
      *
diff --git a/media/java/android/mtp/MtpDatabase.java b/media/java/android/mtp/MtpDatabase.java
index e67b100..474b671 100755
--- a/media/java/android/mtp/MtpDatabase.java
+++ b/media/java/android/mtp/MtpDatabase.java
@@ -538,8 +538,13 @@
         MtpPropertyGroup propertyGroup;
         for (MtpStorageManager.MtpObject obj : objs) {
             if (property == 0xffffffff) {
+                if (format == 0 && handle != 0 && handle != 0xffffffff) {
+                    // return properties based on the object's format
+                    format = obj.getFormat();
+                }
                 // Get all properties supported by this object
-                propertyGroup = mPropertyGroupsByFormat.get(obj.getFormat());
+                // format should be the same between get & put
+                propertyGroup = mPropertyGroupsByFormat.get(format);
                 if (propertyGroup == null) {
                     int[] propertyList = getSupportedObjectProperties(format);
                     propertyGroup = new MtpPropertyGroup(mMediaProvider, mVolumeName,
diff --git a/media/jni/Android.bp b/media/jni/Android.bp
index 3870124..fa9ab1f7 100644
--- a/media/jni/Android.bp
+++ b/media/jni/Android.bp
@@ -128,6 +128,7 @@
         "libmediametrics",
         "libmediaplayer2",
         "libmediaplayer2-protos",
+        "libmediandk_utils",
         "libmediautils",
         "libnetd_client",  // for setNetworkForUser
         "libprotobuf-cpp-lite",
diff --git a/media/jni/android_media_MediaPlayer2.cpp b/media/jni/android_media_MediaPlayer2.cpp
index 352df81..61c28ed 100644
--- a/media/jni/android_media_MediaPlayer2.cpp
+++ b/media/jni/android_media_MediaPlayer2.cpp
@@ -283,7 +283,8 @@
 static void
 android_media_MediaPlayer2_handleDataSourceUrl(
         JNIEnv *env, jobject thiz, jboolean isCurrent, jlong srcId,
-        jobject httpServiceObj, jstring path, jobjectArray keys, jobjectArray values) {
+        jobject httpServiceObj, jstring path, jobjectArray keys, jobjectArray values,
+        jlong startPos, jlong endPos) {
 
     sp<MediaPlayer2> mp = getMediaPlayer(env, thiz);
     if (mp == NULL) {
@@ -300,7 +301,8 @@
     if (tmp == NULL) {  // Out of memory
         return;
     }
-    ALOGV("handleDataSourceUrl: path %s, srcId %lld", tmp, (long long)srcId);
+    ALOGV("handleDataSourceUrl: path %s, srcId %lld, start %lld, end %lld",
+          tmp, (long long)srcId, (long long)startPos, (long long)endPos);
 
     if (strncmp(tmp, "content://", 10) == 0) {
         ALOGE("handleDataSourceUrl: content scheme is not supported in native code");
@@ -313,6 +315,8 @@
     dsd->mId = srcId;
     dsd->mType = DataSourceDesc::TYPE_URL;
     dsd->mUrl = tmp;
+    dsd->mStartPositionMs = startPos;
+    dsd->mEndPositionMs = endPos;
 
     env->ReleaseStringUTFChars(path, tmp);
     tmp = NULL;
@@ -341,9 +345,9 @@
 
 static void
 android_media_MediaPlayer2_handleDataSourceFD(
-    JNIEnv *env, jobject thiz, jboolean isCurrent, jlong srcId,
-    jobject fileDescriptor, jlong offset, jlong length)
-{
+        JNIEnv *env, jobject thiz, jboolean isCurrent, jlong srcId,
+        jobject fileDescriptor, jlong offset, jlong length,
+        jlong startPos, jlong endPos) {
     sp<MediaPlayer2> mp = getMediaPlayer(env, thiz);
     if (mp == NULL ) {
         jniThrowException(env, "java/lang/IllegalStateException", NULL);
@@ -355,8 +359,10 @@
         return;
     }
     int fd = jniGetFDFromFileDescriptor(env, fileDescriptor);
-    ALOGV("handleDataSourceFD: srcId=%lld, fd=%d (%s), offset=%lld, length=%lld",
-          (long long)srcId, fd, nameForFd(fd).c_str(), (long long)offset, (long long)length);
+    ALOGV("handleDataSourceFD: srcId=%lld, fd=%d (%s), offset=%lld, length=%lld, "
+          "start=%lld, end=%lld",
+          (long long)srcId, fd, nameForFd(fd).c_str(), (long long)offset, (long long)length,
+          (long long)startPos, (long long)endPos);
 
     struct stat sb;
     int ret = fstat(fd, &sb);
@@ -389,6 +395,8 @@
     dsd->mFD = fd;
     dsd->mFDOffset = offset;
     dsd->mFDLength = length;
+    dsd->mStartPositionMs = startPos;
+    dsd->mEndPositionMs = endPos;
 
     status_t err;
     if (isCurrent) {
@@ -402,7 +410,8 @@
 
 static void
 android_media_MediaPlayer2_handleDataSourceCallback(
-    JNIEnv *env, jobject thiz, jboolean isCurrent, jlong srcId, jobject dataSource)
+    JNIEnv *env, jobject thiz, jboolean isCurrent, jlong srcId, jobject dataSource,
+    jlong startPos, jlong endPos)
 {
     sp<MediaPlayer2> mp = getMediaPlayer(env, thiz);
     if (mp == NULL ) {
@@ -419,6 +428,8 @@
     dsd->mId = srcId;
     dsd->mType = DataSourceDesc::TYPE_CALLBACK;
     dsd->mCallbackSource = callbackDataSource;
+    dsd->mStartPositionMs = startPos;
+    dsd->mEndPositionMs = endPos;
 
     status_t err;
     if (isCurrent) {
@@ -1442,17 +1453,17 @@
     {
         "nativeHandleDataSourceUrl",
         "(ZJLandroid/media/Media2HTTPService;Ljava/lang/String;[Ljava/lang/String;"
-        "[Ljava/lang/String;)V",
+        "[Ljava/lang/String;JJ)V",
         (void *)android_media_MediaPlayer2_handleDataSourceUrl
     },
     {
         "nativeHandleDataSourceFD",
-        "(ZJLjava/io/FileDescriptor;JJ)V",
+        "(ZJLjava/io/FileDescriptor;JJJJ)V",
         (void *)android_media_MediaPlayer2_handleDataSourceFD
     },
     {
         "nativeHandleDataSourceCallback",
-        "(ZJLandroid/media/Media2DataSource;)V",
+        "(ZJLandroid/media/Media2DataSource;JJ)V",
         (void *)android_media_MediaPlayer2_handleDataSourceCallback
     },
     {"nativePlayNextDataSource", "(J)V",                        (void *)android_media_MediaPlayer2_playNextDataSource},
diff --git a/opengl/java/android/opengl/EGL15.java b/opengl/java/android/opengl/EGL15.java
new file mode 100644
index 0000000..9aae6ad
--- /dev/null
+++ b/opengl/java/android/opengl/EGL15.java
@@ -0,0 +1,149 @@
+/*
+** Copyright 2018, The Android Open Source Project
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+**
+**     http://www.apache.org/licenses/LICENSE-2.0
+**
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+*/
+
+package android.opengl;
+
+/**
+ * EGL 1.5
+ *
+ */
+public class EGL15 {
+
+    public static final int EGL_CONTEXT_OPENGL_CORE_PROFILE_BIT            = 0x00000001;
+    public static final int EGL_CONTEXT_OPENGL_COMPATIBILITY_PROFILE_BIT   = 0x00000002;
+    public static final int EGL_OPENGL_ES3_BIT                             = 0x00000040;
+    public static final int EGL_SYNC_FLUSH_COMMANDS_BIT                    = 0x0001;
+    public static final int EGL_GL_COLORSPACE_SRGB                         = 0x3089;
+    public static final int EGL_GL_COLORSPACE_LINEAR                       = 0x308A;
+    public static final int EGL_CONTEXT_MAJOR_VERSION                      = 0x3098;
+    public static final int EGL_CL_EVENT_HANDLE                            = 0x309C;
+    public static final int EGL_GL_COLORSPACE                              = 0x309D;
+    public static final int EGL_GL_TEXTURE_2D                              = 0x30B1;
+    public static final int EGL_GL_TEXTURE_3D                              = 0x30B2;
+    public static final int EGL_GL_TEXTURE_CUBE_MAP_POSITIVE_X             = 0x30B3;
+    public static final int EGL_GL_TEXTURE_CUBE_MAP_NEGATIVE_X             = 0x30B4;
+    public static final int EGL_GL_TEXTURE_CUBE_MAP_POSITIVE_Y             = 0x30B5;
+    public static final int EGL_GL_TEXTURE_CUBE_MAP_NEGATIVE_Y             = 0x30B6;
+    public static final int EGL_GL_TEXTURE_CUBE_MAP_POSITIVE_Z             = 0x30B7;
+    public static final int EGL_GL_TEXTURE_CUBE_MAP_NEGATIVE_Z             = 0x30B8;
+    public static final int EGL_GL_RENDERBUFFER                            = 0x30B9;
+    public static final int EGL_GL_TEXTURE_LEVEL                           = 0x30BC;
+    public static final int EGL_GL_TEXTURE_ZOFFSET                         = 0x30BD;
+    public static final int EGL_IMAGE_PRESERVED                            = 0x30D2;
+    public static final int EGL_SYNC_PRIOR_COMMANDS_COMPLETE               = 0x30F0;
+    public static final int EGL_SYNC_STATUS                                = 0x30F1;
+    public static final int EGL_SIGNALED                                   = 0x30F2;
+    public static final int EGL_UNSIGNALED                                 = 0x30F3;
+    public static final int EGL_TIMEOUT_EXPIRED                            = 0x30F5;
+    public static final int EGL_CONDITION_SATISFIED                        = 0x30F6;
+    public static final int EGL_SYNC_TYPE                                  = 0x30F7;
+    public static final int EGL_SYNC_CONDITION                             = 0x30F8;
+    public static final int EGL_SYNC_FENCE                                 = 0x30F9;
+    public static final int EGL_CONTEXT_MINOR_VERSION                      = 0x30FB;
+    public static final int EGL_CONTEXT_OPENGL_PROFILE_MASK                = 0x30FD;
+    public static final int EGL_SYNC_CL_EVENT                              = 0x30FE;
+    public static final int EGL_SYNC_CL_EVENT_COMPLETE                     = 0x30FF;
+    public static final int EGL_CONTEXT_OPENGL_DEBUG                       = 0x31B0;
+    public static final int EGL_CONTEXT_OPENGL_FORWARD_COMPATIBLE          = 0x31B1;
+    public static final int EGL_CONTEXT_OPENGL_ROBUST_ACCESS               = 0x31B2;
+    public static final int EGL_CONTEXT_OPENGL_RESET_NOTIFICATION_STRATEGY = 0x31BD;
+    public static final int EGL_NO_RESET_NOTIFICATION                      = 0x31BE;
+    public static final int EGL_LOSE_CONTEXT_ON_RESET                      = 0x31BF;
+    public static final int EGL_PLATFORM_ANDROID_KHR                       = 0x3141;
+    public static final long EGL_FOREVER                                   = 0xFFFFFFFFFFFFFFFFL;
+    public static final EGLImage EGL_NO_IMAGE                              = null;
+    public static final EGLSync EGL_NO_SYNC                                = null;
+    public static final EGLContext EGL_NO_CONTEXT                          = null;
+    public static final EGLDisplay EGL_NO_DISPLAY                          = null;
+    public static final EGLSurface EGL_NO_SURFACE                          = null;
+
+    native private static void _nativeClassInit();
+    static {
+        _nativeClassInit();
+    }
+    // C function EGLSync eglCreateSync ( EGLDisplay dpy, EGLenum type, const EGLAttrib *attrib_list )
+
+    public static native EGLSync eglCreateSync(
+        EGLDisplay dpy,
+        int type,
+        long[] attrib_list,
+        int offset
+    );
+
+    // C function EGLBoolean eglDestroySync ( EGLDisplay dpy, EGLSync sync )
+
+    public static native boolean eglDestroySync(
+        EGLDisplay dpy,
+        EGLSync sync
+    );
+
+    // C function EGLint eglClientWaitSync ( EGLDisplay dpy, EGLSync sync, EGLint flags, EGLTime timeout )
+
+    public static native int eglClientWaitSync(
+        EGLDisplay dpy,
+        EGLSync sync,
+        int flags,
+        long timeout
+    );
+
+    // C function EGLBoolean eglGetSyncAttrib ( EGLDisplay dpy, EGLSync sync, EGLint attribute, EGLAttrib *value )
+
+    public static native boolean eglGetSyncAttrib(
+        EGLDisplay dpy,
+        EGLSync sync,
+        int attribute,
+        long[] value,
+        int offset
+    );
+
+    // C function EGLDisplay eglGetPlatformDisplay ( EGLenum platform, EGLAttrib native_display, const EGLAttrib *attrib_list )
+
+    public static native EGLDisplay eglGetPlatformDisplay(
+        int platform,
+        long native_display,
+        long[] attrib_list,
+        int offset
+    );
+
+    // C function EGLSurface eglCreatePlatformWindowSurface ( EGLDisplay dpy, EGLConfig config, void *native_window, const EGLAttrib *attrib_list )
+
+    public static native EGLSurface eglCreatePlatformWindowSurface(
+        EGLDisplay dpy,
+        EGLConfig config,
+        java.nio.Buffer native_window,
+        long[] attrib_list,
+        int offset
+    );
+
+    // C function EGLSurface eglCreatePlatformPixmapSurface ( EGLDisplay dpy, EGLConfig config, void *native_pixmap, const EGLAttrib *attrib_list )
+
+    public static native EGLSurface eglCreatePlatformPixmapSurface(
+        EGLDisplay dpy,
+        EGLConfig config,
+        java.nio.Buffer native_pixmap,
+        long[] attrib_list,
+        int offset
+    );
+
+    // C function EGLBoolean eglWaitSync ( EGLDisplay dpy, EGLSync sync, EGLint flags )
+
+    public static native boolean eglWaitSync(
+        EGLDisplay dpy,
+        EGLSync sync,
+        int flags
+    );
+
+}
diff --git a/opengl/java/android/opengl/EGLImage.java b/opengl/java/android/opengl/EGLImage.java
new file mode 100644
index 0000000..731ce72
--- /dev/null
+++ b/opengl/java/android/opengl/EGLImage.java
@@ -0,0 +1,37 @@
+/*
+**
+** Copyright 2018, The Android Open Source Project
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+**
+**     http://www.apache.org/licenses/LICENSE-2.0
+**
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+*/
+
+package android.opengl;
+
+/**
+ * Wrapper class for native EGLImage objects.
+ *
+ */
+public class EGLImage extends EGLObjectHandle {
+    private EGLImage(long handle) {
+        super(handle);
+    }
+
+    @Override
+    public boolean equals(Object o) {
+        if (this == o) return true;
+        if (!(o instanceof EGLImage)) return false;
+
+        EGLImage that = (EGLImage) o;
+        return getNativeHandle() == that.getNativeHandle();
+    }
+}
diff --git a/opengl/java/android/opengl/EGLSync.java b/opengl/java/android/opengl/EGLSync.java
new file mode 100644
index 0000000..472f9e7
--- /dev/null
+++ b/opengl/java/android/opengl/EGLSync.java
@@ -0,0 +1,37 @@
+/*
+**
+** Copyright 2018, The Android Open Source Project
+**
+** Licensed under the Apache License, Version 2.0 (the "License");
+** you may not use this file except in compliance with the License.
+** You may obtain a copy of the License at
+**
+**     http://www.apache.org/licenses/LICENSE-2.0
+**
+** Unless required by applicable law or agreed to in writing, software
+** distributed under the License is distributed on an "AS IS" BASIS,
+** WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+** See the License for the specific language governing permissions and
+** limitations under the License.
+*/
+
+package android.opengl;
+
+/**
+ * Wrapper class for native EGLSync objects.
+ *
+ */
+public class EGLSync extends EGLObjectHandle {
+    private EGLSync(long handle) {
+        super(handle);
+    }
+
+    @Override
+    public boolean equals(Object o) {
+        if (this == o) return true;
+        if (!(o instanceof EGLSync)) return false;
+
+        EGLSync that = (EGLSync) o;
+        return getNativeHandle() == that.getNativeHandle();
+    }
+}
diff --git a/packages/CarrierDefaultApp/src/com/android/carrierdefaultapp/CarrierActionUtils.java b/packages/CarrierDefaultApp/src/com/android/carrierdefaultapp/CarrierActionUtils.java
index 33cb5964..4518d79 100644
--- a/packages/CarrierDefaultApp/src/com/android/carrierdefaultapp/CarrierActionUtils.java
+++ b/packages/CarrierDefaultApp/src/com/android/carrierdefaultapp/CarrierActionUtils.java
@@ -30,7 +30,7 @@
 import android.text.TextUtils;
 import android.util.Log;
 import com.android.internal.telephony.PhoneConstants;
-import com.android.carrierdefaultapp.R;
+
 /**
  * This util class provides common logic for carrier actions
  */
@@ -102,7 +102,7 @@
                 SubscriptionManager.getDefaultVoiceSubscriptionId());
         logd("onDisableAllMeteredApns subId: " + subId);
         final TelephonyManager telephonyMgr = context.getSystemService(TelephonyManager.class);
-        telephonyMgr.carrierActionSetMeteredApnsEnabled(subId, !ENABLE);
+        telephonyMgr.createForSubscriptionId(subId).setCarrierDataEnabled(!ENABLE);
     }
 
     private static void onEnableAllMeteredApns(Intent intent, Context context) {
@@ -110,7 +110,7 @@
                 SubscriptionManager.getDefaultVoiceSubscriptionId());
         logd("onEnableAllMeteredApns subId: " + subId);
         final TelephonyManager telephonyMgr = context.getSystemService(TelephonyManager.class);
-        telephonyMgr.carrierActionSetMeteredApnsEnabled(subId, ENABLE);
+        telephonyMgr.createForSubscriptionId(subId).setCarrierDataEnabled(ENABLE);
     }
 
     private static void onEnableDefaultURLHandler(Context context) {
diff --git a/packages/CarrierDefaultApp/tests/unit/src/com/android/carrierdefaultapp/CarrierDefaultReceiverTest.java b/packages/CarrierDefaultApp/tests/unit/src/com/android/carrierdefaultapp/CarrierDefaultReceiverTest.java
index f9dbcd4..5d84d64 100644
--- a/packages/CarrierDefaultApp/tests/unit/src/com/android/carrierdefaultapp/CarrierDefaultReceiverTest.java
+++ b/packages/CarrierDefaultApp/tests/unit/src/com/android/carrierdefaultapp/CarrierDefaultReceiverTest.java
@@ -104,6 +104,6 @@
         assertNotNull(pendingIntent);
 
         Rlog.d(TAG, "verify carrier action: disable all metered apns");
-        verify(mTelephonyMgr).carrierActionSetMeteredApnsEnabled(eq(subId), eq(false));
+        verify(mTelephonyMgr).setCarrierDataEnabled(eq(false));
     }
 }
diff --git a/packages/ExtServices/src/android/ext/services/notification/AgingHelper.java b/packages/ExtServices/src/android/ext/services/notification/AgingHelper.java
index 5782ea1..31c9224 100644
--- a/packages/ExtServices/src/android/ext/services/notification/AgingHelper.java
+++ b/packages/ExtServices/src/android/ext/services/notification/AgingHelper.java
@@ -66,7 +66,7 @@
 
     public void onNotificationSeen(NotificationEntry entry) {
         // user has strong opinions about this notification. we can't down rank it, so don't bother.
-        if (entry.getChannel().isImportanceLocked()) {
+        if (entry.getChannel().hasUserSetImportance()) {
             return;
         }
 
diff --git a/packages/ExtServices/src/android/ext/services/notification/Assistant.java b/packages/ExtServices/src/android/ext/services/notification/Assistant.java
index 3333e15..8f33a70 100644
--- a/packages/ExtServices/src/android/ext/services/notification/Assistant.java
+++ b/packages/ExtServices/src/android/ext/services/notification/Assistant.java
@@ -25,7 +25,6 @@
 import android.annotation.NonNull;
 import android.annotation.Nullable;
 import android.app.ActivityThread;
-import android.app.AlarmManager;
 import android.app.INotificationManager;
 import android.app.Notification;
 import android.app.NotificationChannel;
@@ -224,8 +223,9 @@
     }
 
     /** A convenience helper for creating an adjustment for an SBN. */
+    @VisibleForTesting
     @Nullable
-    private Adjustment createEnqueuedNotificationAdjustment(
+    Adjustment createEnqueuedNotificationAdjustment(
             @NonNull NotificationEntry entry,
             @NonNull ArrayList<Notification.Action> smartActions,
             @NonNull ArrayList<CharSequence> smartReplies) {
@@ -237,7 +237,9 @@
             signals.putCharSequenceArrayList(Adjustment.KEY_SMART_REPLIES, smartReplies);
         }
         if (mNotificationCategorizer.shouldSilence(entry)) {
-            signals.putInt(KEY_IMPORTANCE, IMPORTANCE_LOW);
+            final int importance = entry.getImportance() < IMPORTANCE_LOW ? entry.getImportance()
+                    : IMPORTANCE_LOW;
+            signals.putInt(KEY_IMPORTANCE, importance);
         }
 
         return new Adjustment(
diff --git a/packages/ExtServices/tests/src/android/ext/services/notification/AssistantTest.java b/packages/ExtServices/tests/src/android/ext/services/notification/AssistantTest.java
index 2820232..2eb005a 100644
--- a/packages/ExtServices/tests/src/android/ext/services/notification/AssistantTest.java
+++ b/packages/ExtServices/tests/src/android/ext/services/notification/AssistantTest.java
@@ -66,6 +66,7 @@
 import java.io.ByteArrayInputStream;
 import java.io.ByteArrayOutputStream;
 import java.io.FileOutputStream;
+import java.util.ArrayList;
 
 public class AssistantTest extends ServiceTestCase<Assistant> {
 
@@ -466,4 +467,12 @@
 
         assertFalse(mAssistant.mLiveNotifications.containsKey(sbn.getKey()));
     }
+
+    @Test
+    public void testAssistantNeverIncreasesImportanceWhenSuggestingSilent() throws Exception {
+        StatusBarNotification sbn = generateSbn(PKG1, UID1, P1C3, "min notif!", null);
+        Adjustment adjust = mAssistant.createEnqueuedNotificationAdjustment(new NotificationEntry(
+                mPackageManager, sbn, P1C3), new ArrayList<>(), new ArrayList<>());
+        assertEquals(IMPORTANCE_MIN, adjust.getSignals().getInt(Adjustment.KEY_IMPORTANCE));
+    }
 }
diff --git a/packages/SettingsLib/Android.bp b/packages/SettingsLib/Android.bp
index d60dbe7..5161344 100644
--- a/packages/SettingsLib/Android.bp
+++ b/packages/SettingsLib/Android.bp
@@ -2,16 +2,14 @@
 
     name: "SettingsLib",
 
-    libs: [
+    static_libs: [
         "androidx.annotation_annotation",
         "androidx.legacy_legacy-support-v4",
         "androidx.recyclerview_recyclerview",
         "androidx.preference_preference",
         "androidx.appcompat_appcompat",
         "androidx.lifecycle_lifecycle-runtime",
-    ],
 
-    static_libs: [
         "SettingsLibHelpUtils",
         "SettingsLibRestrictedLockUtils",
         "SettingsLibAppPreference",
diff --git a/packages/SettingsLib/RestrictedLockUtils/src/com/android/settingslib/RestrictedLockUtils.java b/packages/SettingsLib/RestrictedLockUtils/src/com/android/settingslib/RestrictedLockUtils.java
index e278c10..8529e3e 100644
--- a/packages/SettingsLib/RestrictedLockUtils/src/com/android/settingslib/RestrictedLockUtils.java
+++ b/packages/SettingsLib/RestrictedLockUtils/src/com/android/settingslib/RestrictedLockUtils.java
@@ -80,11 +80,10 @@
             if (admin.component != null) {
                 intent.putExtra(DevicePolicyManager.EXTRA_DEVICE_ADMIN, admin.component);
             }
-            int adminUserId = UserHandle.myUserId();
-            if (admin.user != null) {
-                adminUserId = admin.user.getIdentifier();
-            }
-            intent.putExtra(Intent.EXTRA_USER_ID, adminUserId);
+            final UserHandle adminUser = admin.user != null
+                    ? admin.user
+                    : UserHandle.of(UserHandle.myUserId());
+            intent.putExtra(Intent.EXTRA_USER, adminUser);
         }
         return intent;
     }
diff --git a/packages/SettingsProvider/src/com/android/providers/settings/SettingsProtoDumpUtil.java b/packages/SettingsProvider/src/com/android/providers/settings/SettingsProtoDumpUtil.java
index da1354b..c996620 100644
--- a/packages/SettingsProvider/src/com/android/providers/settings/SettingsProtoDumpUtil.java
+++ b/packages/SettingsProvider/src/com/android/providers/settings/SettingsProtoDumpUtil.java
@@ -35,6 +35,13 @@
 
     static void dumpProtoLocked(SettingsProvider.SettingsRegistry settingsRegistry,
             ProtoOutputStream proto) {
+        // Config settings
+        SettingsState configSettings = settingsRegistry.getSettingsLocked(
+                SettingsProvider.SETTINGS_TYPE_CONFIG, UserHandle.USER_SYSTEM);
+        if (configSettings != null) {
+            // TODO(b/113100523): dump configuration settings after they are added
+        }
+
         // Global settings
         SettingsState globalSettings = settingsRegistry.getSettingsLocked(
                 SettingsProvider.SETTINGS_TYPE_GLOBAL, UserHandle.USER_SYSTEM);
diff --git a/packages/SettingsProvider/src/com/android/providers/settings/SettingsProvider.java b/packages/SettingsProvider/src/com/android/providers/settings/SettingsProvider.java
index 18ec9c3..e0c4d72 100644
--- a/packages/SettingsProvider/src/com/android/providers/settings/SettingsProvider.java
+++ b/packages/SettingsProvider/src/com/android/providers/settings/SettingsProvider.java
@@ -180,6 +180,7 @@
     public static final int SETTINGS_TYPE_SYSTEM = SettingsState.SETTINGS_TYPE_SYSTEM;
     public static final int SETTINGS_TYPE_SECURE = SettingsState.SETTINGS_TYPE_SECURE;
     public static final int SETTINGS_TYPE_SSAID = SettingsState.SETTINGS_TYPE_SSAID;
+    public static final int SETTINGS_TYPE_CONFIG = SettingsState.SETTINGS_TYPE_CONFIG;
 
     private static final Bundle NULL_SETTING_BUNDLE = Bundle.forPair(
             Settings.NameValueTable.VALUE, null);
@@ -189,6 +190,13 @@
     private static final Set<String> OVERLAY_ALLOWED_SYSTEM_INSTANT_APP_SETTINGS = new ArraySet<>();
     private static final Set<String> OVERLAY_ALLOWED_SECURE_INSTANT_APP_SETTINGS = new ArraySet<>();
 
+    /**
+     * TODO(b/113100523): Move this to DeviceConfig.java when it is added, and expose it as a System
+     *     API.
+     */
+    private static final Uri CONFIG_CONTENT_URI =
+            Uri.parse("content://" + Settings.AUTHORITY + "/config");
+
     static {
         for (String name : Resources.getSystem().getStringArray(
                 com.android.internal.R.array.config_allowedGlobalInstantAppSettings)) {
@@ -380,6 +388,11 @@
     public Bundle call(String method, String name, Bundle args) {
         final int requestingUserId = getRequestingUserId(args);
         switch (method) {
+            case Settings.CALL_METHOD_GET_CONFIG: {
+                Setting setting = getConfigSetting(name);
+                return packageValueForCallResult(setting, isTrackingGeneration(args));
+            }
+
             case Settings.CALL_METHOD_GET_GLOBAL: {
                 Setting setting = getGlobalSetting(name);
                 return packageValueForCallResult(setting, isTrackingGeneration(args));
@@ -396,6 +409,14 @@
                 return packageValueForCallResult(setting, isTrackingGeneration(args));
             }
 
+            case Settings.CALL_METHOD_PUT_CONFIG: {
+                String value = getSettingValue(args);
+                String tag = getSettingTag(args);
+                final boolean makeDefault = getSettingMakeDefault(args);
+                insertConfigSetting(name, value, tag, makeDefault, requestingUserId, false);
+                break;
+            }
+
             case Settings.CALL_METHOD_PUT_GLOBAL: {
                 String value = getSettingValue(args);
                 String tag = getSettingTag(args);
@@ -418,6 +439,13 @@
                 break;
             }
 
+            case Settings.CALL_METHOD_RESET_CONFIG: {
+                final int mode = getResetModeEnforcingPermission(args);
+                String tag = getSettingTag(args);
+                resetConfigSetting(requestingUserId, mode, tag);
+                break;
+            }
+
             case Settings.CALL_METHOD_RESET_GLOBAL: {
                 final int mode = getResetModeEnforcingPermission(args);
                 String tag = getSettingTag(args);
@@ -725,6 +753,15 @@
     @GuardedBy("mLock")
     private void dumpForUserLocked(int userId, PrintWriter pw) {
         if (userId == UserHandle.USER_SYSTEM) {
+            pw.println("CONFIG SETTINGS (user " + userId + ")");
+            SettingsState configSettings = mSettingsRegistry.getSettingsLocked(
+                    SETTINGS_TYPE_CONFIG, UserHandle.USER_SYSTEM);
+            if (configSettings != null) {
+                dumpSettingsLocked(configSettings, pw);
+                pw.println();
+                configSettings.dumpHistoricalOperations(pw);
+            }
+
             pw.println("GLOBAL SETTINGS (user " + userId + ")");
             SettingsState globalSettings = mSettingsRegistry.getSettingsLocked(
                     SETTINGS_TYPE_GLOBAL, UserHandle.USER_SYSTEM);
@@ -939,6 +976,69 @@
         });
     }
 
+    private Setting getConfigSetting(String name) {
+        if (DEBUG) {
+            Slog.v(LOG_TAG, "getConfigSetting(" + name + ")");
+        }
+
+        // TODO(b/117663715): Ensure the caller can access the setting.
+        // enforceSettingReadable(name, SETTINGS_TYPE_CONFIG, UserHandle.getCallingUserId());
+
+        // Get the value.
+        synchronized (mLock) {
+            return mSettingsRegistry.getSettingLocked(SETTINGS_TYPE_CONFIG,
+                    UserHandle.USER_SYSTEM, name);
+        }
+    }
+
+    private boolean insertConfigSetting(String name, String value, String tag,
+            boolean makeDefault, int requestingUserId, boolean forceNotify) {
+        if (DEBUG) {
+            Slog.v(LOG_TAG, "insertConfigSetting(" + name + ", " + value  + ", "
+                    + ", " + tag + ", " + makeDefault + ", " + requestingUserId
+                    + ", " + forceNotify + ")");
+        }
+        return mutateConfigSetting(name, value, tag, makeDefault, requestingUserId,
+                MUTATION_OPERATION_INSERT, forceNotify, 0);
+    }
+
+    private void resetConfigSetting(int requestingUserId, int mode, String tag) {
+        if (DEBUG) {
+            Slog.v(LOG_TAG, "resetConfigSetting(" + requestingUserId + ", "
+                    + mode + ", " + tag + ")");
+        }
+        mutateConfigSetting(null, null, tag, false, requestingUserId,
+                MUTATION_OPERATION_RESET, false, mode);
+    }
+
+    private boolean mutateConfigSetting(String name, String value, String tag,
+            boolean makeDefault, int requestingUserId, int operation, boolean forceNotify,
+            int mode) {
+        // TODO(b/117663715): check the new permission when it's added.
+        // enforceWritePermission(Manifest.permission.WRITE_SECURE_SETTINGS);
+
+        // Resolve the userId on whose behalf the call is made.
+        final int callingUserId = resolveCallingUserIdEnforcingPermissionsLocked(requestingUserId);
+
+        // Perform the mutation.
+        synchronized (mLock) {
+            switch (operation) {
+                case MUTATION_OPERATION_INSERT: {
+                    return mSettingsRegistry.insertSettingLocked(SETTINGS_TYPE_CONFIG,
+                            UserHandle.USER_SYSTEM, name, value, tag, makeDefault,
+                            getCallingPackage(), forceNotify, null);
+                }
+
+                case MUTATION_OPERATION_RESET: {
+                    mSettingsRegistry.resetSettingsLocked(SETTINGS_TYPE_CONFIG,
+                            UserHandle.USER_SYSTEM, getCallingPackage(), mode, tag);
+                } return true;
+            }
+        }
+
+        return false;
+    }
+
     private Cursor getAllGlobalSettings(String[] projection) {
         if (DEBUG) {
             Slog.v(LOG_TAG, "getAllGlobalSettings()");
@@ -2132,6 +2232,7 @@
         private static final String SETTINGS_FILE_SYSTEM = "settings_system.xml";
         private static final String SETTINGS_FILE_SECURE = "settings_secure.xml";
         private static final String SETTINGS_FILE_SSAID = "settings_ssaid.xml";
+        private static final String SETTINGS_FILE_CONFIG = "settings_config.xml";
 
         private static final String SSAID_USER_KEY = "userkey";
 
@@ -2303,6 +2404,13 @@
             // Migrate the setting for this user if needed.
             migrateLegacySettingsForUserIfNeededLocked(userId);
 
+            // Ensure config settings loaded if owner.
+            if (userId == UserHandle.USER_SYSTEM) {
+                final int configKey
+                        = makeKey(SETTINGS_TYPE_CONFIG, UserHandle.USER_SYSTEM);
+                ensureSettingsStateLocked(configKey);
+            }
+
             // Ensure global settings loaded if owner.
             if (userId == UserHandle.USER_SYSTEM) {
                 final int globalKey = makeKey(SETTINGS_TYPE_GLOBAL, UserHandle.USER_SYSTEM);
@@ -2853,6 +2961,10 @@
             }
         }
 
+        private boolean isConfigSettingsKey(int key) {
+            return getTypeFromKey(key) == SETTINGS_TYPE_CONFIG;
+        }
+
         private boolean isGlobalSettingsKey(int key) {
             return getTypeFromKey(key) == SETTINGS_TYPE_GLOBAL;
         }
@@ -2870,7 +2982,11 @@
         }
 
         private File getSettingsFile(int key) {
-            if (isGlobalSettingsKey(key)) {
+            if (isConfigSettingsKey(key)) {
+                final int userId = getUserIdFromKey(key);
+                return new File(Environment.getUserSystemDirectory(userId),
+                        SETTINGS_FILE_CONFIG);
+            } else if (isGlobalSettingsKey(key)) {
                 final int userId = getUserIdFromKey(key);
                 return new File(Environment.getUserSystemDirectory(userId),
                         SETTINGS_FILE_GLOBAL);
@@ -2892,7 +3008,10 @@
         }
 
         private Uri getNotificationUriFor(int key, String name) {
-            if (isGlobalSettingsKey(key)) {
+            if (isConfigSettingsKey(key)) {
+                return (name != null) ? Uri.withAppendedPath(CONFIG_CONTENT_URI, name)
+                        : CONFIG_CONTENT_URI;
+            } else if (isGlobalSettingsKey(key)) {
                 return (name != null) ? Uri.withAppendedPath(Settings.Global.CONTENT_URI, name)
                         : Settings.Global.CONTENT_URI;
             } else if (isSecureSettingsKey(key)) {
@@ -2908,6 +3027,7 @@
 
         private int getMaxBytesPerPackageForType(int type) {
             switch (type) {
+                case SETTINGS_TYPE_CONFIG:
                 case SETTINGS_TYPE_GLOBAL:
                 case SETTINGS_TYPE_SECURE:
                 case SETTINGS_TYPE_SSAID: {
diff --git a/packages/SettingsProvider/src/com/android/providers/settings/SettingsState.java b/packages/SettingsProvider/src/com/android/providers/settings/SettingsState.java
index 389d627..ae2ca3f 100644
--- a/packages/SettingsProvider/src/com/android/providers/settings/SettingsState.java
+++ b/packages/SettingsProvider/src/com/android/providers/settings/SettingsState.java
@@ -34,7 +34,6 @@
 import android.os.UserHandle;
 import android.provider.Settings;
 import android.provider.Settings.Global;
-import android.providers.settings.GlobalSettingsProto;
 import android.providers.settings.SettingsOperationProto;
 import android.text.TextUtils;
 import android.util.ArrayMap;
@@ -67,7 +66,6 @@
 import java.util.ArrayList;
 import java.util.List;
 import java.util.Objects;
-import java.util.Set;
 
 /**
  * This class contains the state for one type of settings. It is responsible
@@ -205,6 +203,7 @@
     public static final int SETTINGS_TYPE_SYSTEM = 1;
     public static final int SETTINGS_TYPE_SECURE = 2;
     public static final int SETTINGS_TYPE_SSAID = 3;
+    public static final int SETTINGS_TYPE_CONFIG = 4;
 
     public static final int SETTINGS_TYPE_MASK = 0xF0000000;
     public static final int SETTINGS_TYPE_SHIFT = 28;
@@ -223,6 +222,9 @@
 
     public static String settingTypeToString(int type) {
         switch (type) {
+            case SETTINGS_TYPE_CONFIG: {
+                return "SETTINGS_CONFIG";
+            }
             case SETTINGS_TYPE_GLOBAL: {
                 return "SETTINGS_GLOBAL";
             }
diff --git a/packages/SettingsProvider/test/src/com/android/providers/settings/SettingsProviderTest.java b/packages/SettingsProvider/test/src/com/android/providers/settings/SettingsProviderTest.java
index 95569dc..572a924 100644
--- a/packages/SettingsProvider/test/src/com/android/providers/settings/SettingsProviderTest.java
+++ b/packages/SettingsProvider/test/src/com/android/providers/settings/SettingsProviderTest.java
@@ -645,7 +645,7 @@
                         return;
                     }
                     final long elapsedTimeMillis = SystemClock.uptimeMillis() - startTimeMillis;
-                    if (elapsedTimeMillis > WAIT_FOR_SETTING_URI_CHANGE_TIMEOUT_MILLIS) {
+                    if (elapsedTimeMillis >= WAIT_FOR_SETTING_URI_CHANGE_TIMEOUT_MILLIS) {
                         fail("Could not change setting for "
                                 + WAIT_FOR_SETTING_URI_CHANGE_TIMEOUT_MILLIS + " ms");
                     }
diff --git a/packages/SystemUI/res/values/config.xml b/packages/SystemUI/res/values/config.xml
index 2fbf42f..6378309 100644
--- a/packages/SystemUI/res/values/config.xml
+++ b/packages/SystemUI/res/values/config.xml
@@ -137,15 +137,9 @@
     <integer name="quick_settings_brightness_dialog_short_timeout">2000</integer>
     <integer name="quick_settings_brightness_dialog_long_timeout">4000</integer>
 
-    <!-- Should "4G" be shown instead of "LTE" when the network is NETWORK_TYPE_LTE? -->
-    <bool name="config_show4GForLTE">true</bool>
-
     <!-- Show indicator for Wifi on but not connected. -->
     <bool name="config_showWifiIndicatorWhenEnabled">false</bool>
 
-    <!-- Should "LTE"/"4G" be shown instead of "LTE+"/"4G+" when on NETWORK_TYPE_LTE_CA? -->
-    <bool name="config_hideLtePlus">false</bool>
-
     <!-- The number of milliseconds before the heads up notification auto-dismisses. -->
     <integer name="heads_up_notification_decay">5000</integer>
 
diff --git a/packages/SystemUI/src/com/android/systemui/SwipeHelper.java b/packages/SystemUI/src/com/android/systemui/SwipeHelper.java
index 0215fda..3fe9944 100644
--- a/packages/SystemUI/src/com/android/systemui/SwipeHelper.java
+++ b/packages/SystemUI/src/com/android/systemui/SwipeHelper.java
@@ -87,6 +87,8 @@
     private Runnable mWatchLongPress;
     private final long mLongPressTimeout;
 
+    protected boolean mSwipingInProgress;
+
     final private int[] mTmpPos = new int[2];
     private final int mFalsingThreshold;
     private boolean mTouchAboveFalsingThreshold;
@@ -127,6 +129,10 @@
         mDisableHwLayers = disableHwLayers;
     }
 
+    public boolean isSwipingInProgress() {
+        return mSwipingInProgress;
+    }
+
     private float getPos(MotionEvent ev) {
         return mSwipeDirection == X ? ev.getX() : ev.getY();
     }
@@ -318,6 +324,7 @@
                     if (Math.abs(delta) > mPagingTouchSlop
                             && Math.abs(delta) > Math.abs(deltaPerpendicular)) {
                         if (mCallback.canChildBeDragged(mCurrView)) {
+                            mSwipingInProgress = true;
                             mCallback.onBeginDrag(mCurrView);
                             mDragging = true;
                             mInitialTouchPos = getPos(ev);
@@ -437,6 +444,7 @@
                     wasRemoved = row.isRemoved();
                 }
                 if (!mCancelled || wasRemoved) {
+                    mSwipingInProgress = false;
                     mCallback.onChildDismissed(animView);
                 }
                 if (endAction != null) {
@@ -626,6 +634,7 @@
                                 !swipedFastEnough() /* useAccelerateInterpolator */);
                     } else {
                         // snappity
+                        mSwipingInProgress = false;
                         mCallback.onDragCancelled(mCurrView);
                         snapChild(mCurrView, 0 /* leftTarget */, velocity);
                     }
diff --git a/packages/SystemUI/src/com/android/systemui/qs/customize/TileAdapter.java b/packages/SystemUI/src/com/android/systemui/qs/customize/TileAdapter.java
index 92f5cae..15d2e66 100644
--- a/packages/SystemUI/src/com/android/systemui/qs/customize/TileAdapter.java
+++ b/packages/SystemUI/src/com/android/systemui/qs/customize/TileAdapter.java
@@ -308,6 +308,7 @@
                     @Override
                     public void onClick(View v) {
                         int position = holder.getAdapterPosition();
+                        if (position == RecyclerView.NO_POSITION) return;
                         if (mAccessibilityAction != ACTION_NONE) {
                             selectPosition(position, v);
                         } else {
@@ -561,6 +562,7 @@
             if (viewHolder == mCurrentDrag) return;
             if (mCurrentDrag != null) {
                 int position = mCurrentDrag.getAdapterPosition();
+                if (position == RecyclerView.NO_POSITION) return;
                 TileInfo info = mTiles.get(position);
                 mCurrentDrag.mTileView.setShowAppLabel(
                         position > mEditIndex && !info.isSystem);
@@ -582,13 +584,14 @@
         @Override
         public boolean canDropOver(RecyclerView recyclerView, ViewHolder current,
                 ViewHolder target) {
-            if (target.getAdapterPosition() == 0){
+            final int position = target.getAdapterPosition();
+            if (position == 0 || position == RecyclerView.NO_POSITION){
                 return false;
             }
             if (!canRemoveTiles() && current.getAdapterPosition() < mEditIndex) {
-                return target.getAdapterPosition() < mEditIndex;
+                return position < mEditIndex;
             }
-            return target.getAdapterPosition() <= mEditIndex + 1;
+            return position <= mEditIndex + 1;
         }
 
         @Override
@@ -610,6 +613,10 @@
         public boolean onMove(RecyclerView recyclerView, ViewHolder viewHolder, ViewHolder target) {
             int from = viewHolder.getAdapterPosition();
             int to = target.getAdapterPosition();
+            if (from == 0 || from == RecyclerView.NO_POSITION ||
+                    to == 0 || to == RecyclerView.NO_POSITION) {
+                return false;
+            }
             return move(from, to, target.itemView);
         }
 
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationViewHierarchyManager.java b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationViewHierarchyManager.java
index f69ad43..5b3082b 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/NotificationViewHierarchyManager.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/NotificationViewHierarchyManager.java
@@ -327,6 +327,17 @@
                     entry.notification) && !entry.row.isRemoved();
             boolean showOnKeyguard = mLockscreenUserManager.shouldShowOnKeyguard(entry
                     .notification);
+            if (!showOnKeyguard) {
+                // min priority notifications should show if their summary is showing
+                if (mGroupManager.isChildInGroupWithSummary(entry.notification)) {
+                    ExpandableNotificationRow summary = mGroupManager.getLogicalGroupSummary(
+                            entry.notification);
+                    if (summary != null && mLockscreenUserManager.shouldShowOnKeyguard(
+                            summary.getStatusBarNotification()))         {
+                        showOnKeyguard = true;
+                    }
+                }
+            }
             if (suppressedSummary
                     || mLockscreenUserManager.shouldHideNotifications(userId)
                     || (isLocked && !showOnKeyguard)) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/VisibilityLocationProvider.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/VisibilityLocationProvider.java
index 81208c4..53ebe74 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/VisibilityLocationProvider.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/VisibilityLocationProvider.java
@@ -24,7 +24,10 @@
 public interface VisibilityLocationProvider {
 
     /**
-     * @return whether the view is in a visible location right now.
+     * Returns whether an ExpandableNotificationRow is in a visible location or not.
+     *
+     * @param row
+     * @return true if row is in a visible location
      */
     boolean isInVisibleLocation(ExpandableNotificationRow row);
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/row/ExpandableNotificationRow.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/row/ExpandableNotificationRow.java
index 23492aa..8110c1c 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/row/ExpandableNotificationRow.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/row/ExpandableNotificationRow.java
@@ -102,6 +102,9 @@
 import com.android.systemui.statusbar.notification.stack.NotificationChildrenContainer;
 import com.android.systemui.statusbar.notification.stack.StackScrollState;
 
+import java.io.FileDescriptor;
+import java.io.PrintWriter;
+import java.lang.reflect.Field;
 import java.util.ArrayList;
 import java.util.List;
 import java.util.function.BooleanSupplier;
@@ -3076,6 +3079,36 @@
         boolean onClick(View v, int x, int y, MenuItem item);
     }
 
+    @Override
+    public void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
+        super.dump(fd, pw, args);
+        pw.println("  Notification: " + getStatusBarNotification().getKey());
+        pw.print("    visibility: " + getVisibility());
+        pw.print(", alpha: " + getAlpha());
+        pw.print(", translation: " + getTranslation());
+        pw.print(", removed: " + isRemoved());
+        pw.print(", privateShowing: " + (getShowingLayout() == mPrivateLayout));
+        pw.println();
+        pw.print("    ");
+        if (mNotificationViewState != null) {
+            mNotificationViewState.dump(fd, pw, args);
+        } else {
+            pw.print("no viewState!!!");
+        }
+        pw.println();
+        pw.println();
+        if (mIsSummaryWithChildren) {
+            List<ExpandableNotificationRow> notificationChildren = getNotificationChildren();
+            pw.println("  Children: " + notificationChildren.size());
+            pw.println("  {");
+            for(ExpandableNotificationRow child : notificationChildren) {
+                child.dump(fd, pw, args);
+            }
+            pw.println("  }");
+            pw.println();
+        }
+    }
+
     /**
      * Background task for executing IPCs to check if the notification is a system notification. The
      * output is used for both the blocking helper and the notification info.
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/row/ExpandableView.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/row/ExpandableView.java
index 46019e3..38d657b 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/row/ExpandableView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/row/ExpandableView.java
@@ -25,16 +25,19 @@
 import android.view.ViewGroup;
 import android.widget.FrameLayout;
 
+import com.android.systemui.Dumpable;
 import com.android.systemui.statusbar.notification.stack.ExpandableViewState;
 import com.android.systemui.statusbar.notification.stack.NotificationStackScrollLayout;
 import com.android.systemui.statusbar.notification.stack.StackScrollState;
 
+import java.io.FileDescriptor;
+import java.io.PrintWriter;
 import java.util.ArrayList;
 
 /**
  * An abstract view for expandable views.
  */
-public abstract class ExpandableView extends FrameLayout {
+public abstract class ExpandableView extends FrameLayout implements Dumpable {
 
     public static final float NO_ROUNDNESS = -1;
     protected OnHeightChangedListener mOnHeightChangedListener;
@@ -559,6 +562,10 @@
         return false;
     }
 
+    @Override
+    public void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
+    }
+
     /**
      * A listener notifying when {@link #getActualHeight} changes.
      */
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationListContainer.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationListContainer.java
index fa75c71..cfb6d99 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationListContainer.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationListContainer.java
@@ -22,6 +22,7 @@
 import android.view.ViewGroup;
 
 import com.android.systemui.plugins.statusbar.NotificationSwipeActionHelper;
+import com.android.systemui.statusbar.notification.VisibilityLocationProvider;
 import com.android.systemui.statusbar.notification.row.ExpandableNotificationRow;
 import com.android.systemui.statusbar.notification.row.ExpandableView;
 import com.android.systemui.statusbar.notification.NotificationData;
@@ -31,7 +32,8 @@
  * Interface representing the entity that contains notifications. It can have
  * notification views added and removed from it, and will manage displaying them to the user.
  */
-public interface NotificationListContainer {
+public interface NotificationListContainer extends ExpandableView.OnHeightChangedListener,
+        VisibilityLocationProvider {
 
     /**
      * Called when a child is being transferred.
@@ -128,14 +130,6 @@
     ViewGroup getViewParentForNotification(NotificationData.Entry entry);
 
     /**
-     * Called when the height of an expandable view changes.
-     *
-     * @param view view whose height changed
-     * @param animate whether this change should be animated
-     */
-    void onHeightChanged(ExpandableView view, boolean animate);
-
-    /**
      * Resets the currently exposed menu view.
      *
      * @param animate whether to animate the closing/change of menu view
@@ -158,13 +152,6 @@
      */
     void cleanUpViewState(View view);
 
-    /**
-     * Returns whether an ExpandableNotificationRow is in a visible location or not.
-     *
-     * @param row
-     * @return true if row is in a visible location
-     */
-    boolean isInVisibleLocation(ExpandableNotificationRow row);
 
     /**
      * Sets a listener to listen for changes in notification locations.
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationStackScrollLayout.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationStackScrollLayout.java
index 33ac390..0bc54a3 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationStackScrollLayout.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationStackScrollLayout.java
@@ -25,6 +25,8 @@
 import android.animation.PropertyValuesHolder;
 import android.animation.TimeAnimator;
 import android.animation.ValueAnimator;
+import android.animation.ValueAnimator.AnimatorUpdateListener;
+import android.annotation.NonNull;
 import android.annotation.Nullable;
 import android.app.WallpaperManager;
 import android.content.Context;
@@ -43,10 +45,6 @@
 import android.provider.Settings;
 import android.service.notification.StatusBarNotification;
 
-import androidx.annotation.NonNull;
-import androidx.annotation.VisibleForTesting;
-import androidx.core.graphics.ColorUtils;
-
 import android.util.AttributeSet;
 import android.util.DisplayMetrics;
 import android.util.Log;
@@ -69,6 +67,8 @@
 import android.widget.OverScroller;
 import android.widget.ScrollView;
 
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.internal.graphics.ColorUtils;
 import com.android.internal.logging.MetricsLogger;
 import com.android.internal.logging.nano.MetricsProto.MetricsEvent;
 import com.android.internal.statusbar.IStatusBarService;
@@ -84,6 +84,7 @@
 import com.android.systemui.colorextraction.SysuiColorExtractor;
 import com.android.systemui.plugins.statusbar.NotificationMenuRowPlugin;
 import com.android.systemui.plugins.statusbar.NotificationMenuRowPlugin.MenuItem;
+import com.android.systemui.plugins.statusbar.NotificationMenuRowPlugin.OnMenuEventListener;
 import com.android.systemui.plugins.statusbar.NotificationSwipeActionHelper;
 import com.android.systemui.statusbar.CommandQueue;
 import com.android.systemui.statusbar.DragDownHelper.DragDownCallback;
@@ -117,7 +118,7 @@
 import com.android.systemui.statusbar.phone.DozeParameters;
 import com.android.systemui.statusbar.phone.HeadsUpAppearanceController;
 import com.android.systemui.statusbar.phone.HeadsUpManagerPhone;
-import com.android.systemui.statusbar.phone.HeadsUpManagerPhone.AnimationStateHandler;
+import com.android.systemui.statusbar.phone.HeadsUpTouchHelper;
 import com.android.systemui.statusbar.phone.LockscreenGestureLogger;
 import com.android.systemui.statusbar.phone.NotificationGroupManager;
 import com.android.systemui.statusbar.phone.NotificationGroupManager.OnGroupChangeListener;
@@ -142,10 +143,8 @@
 /**
  * A layout which handles a dynamic amount of notifications and presents them in a scrollable stack.
  */
-public class NotificationStackScrollLayout extends ViewGroup
-        implements ExpandHelper.Callback, ScrollAdapter, OnHeightChangedListener,
-        OnGroupChangeListener, VisibilityLocationProvider, NotificationListContainer,
-        ConfigurationListener, DragDownCallback, AnimationStateHandler, Dumpable {
+public class NotificationStackScrollLayout extends ViewGroup implements ScrollAdapter,
+        NotificationListContainer, ConfigurationListener, Dumpable {
 
     public static final float BACKGROUND_ALPHA_DIMMED = 0.7f;
     private static final String TAG = "StackScroller";
@@ -160,7 +159,6 @@
 
     private ExpandHelper mExpandHelper;
     private final NotificationSwipeHelper mSwipeHelper;
-    private boolean mSwipingInProgress;
     private int mCurrentStackHeight = Integer.MAX_VALUE;
     private final Paint mBackgroundPaint = new Paint();
     private final boolean mShouldDrawNotificationBackground;
@@ -344,7 +342,7 @@
     private float mDimAmount;
     private ValueAnimator mDimAnimator;
     private ArrayList<ExpandableView> mTmpSortedChildren = new ArrayList<>();
-    private Animator.AnimatorListener mDimEndListener = new AnimatorListenerAdapter() {
+    private final Animator.AnimatorListener mDimEndListener = new AnimatorListenerAdapter() {
         @Override
         public void onAnimationEnd(Animator animation) {
             mDimAnimator = null;
@@ -485,12 +483,12 @@
         mBgColor = context.getColor(R.color.notification_shade_background_color);
         int minHeight = res.getDimensionPixelSize(R.dimen.notification_min_height);
         int maxHeight = res.getDimensionPixelSize(R.dimen.notification_max_height);
-        mExpandHelper = new ExpandHelper(getContext(), this,
+        mExpandHelper = new ExpandHelper(getContext(), mExpandHelperCallback,
                 minHeight, maxHeight);
         mExpandHelper.setEventSource(this);
         mExpandHelper.setScrollAdapter(this);
-        mSwipeHelper = new NotificationSwipeHelper(SwipeHelper.X, new SwipeHelperCallback(),
-                getContext(), new NotificationMenuListener());
+        mSwipeHelper = new NotificationSwipeHelper(SwipeHelper.X, mNotificationCallback,
+                getContext(), mMenuEventListener);
         mStackScrollAlgorithm = createStackScrollAlgorithm(context);
         initView(context);
         mFalsingManager = FalsingManager.getInstance(context);
@@ -530,7 +528,7 @@
 
         inflateEmptyShadeView();
         inflateFooterView();
-        mVisualStabilityManager.setVisibilityLocationProvider(this);
+        mVisualStabilityManager.setVisibilityLocationProvider(this::isInVisibleLocation);
         setLongPressListener(mEntryManager.getNotificationLongClicker());
     }
 
@@ -589,7 +587,7 @@
         return false;
     }
 
-  @ShadeViewRefactor(RefactorComponent.INPUT)
+  @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
   public RemoteInputController.Delegate createDelegate() {
         return new RemoteInputController.Delegate() {
             public void setRemoteInputActive(NotificationData.Entry entry,
@@ -628,7 +626,7 @@
     }
 
     @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     public NotificationSwipeActionHelper getSwipeActionHelper() {
         return mSwipeHelper;
     }
@@ -1245,11 +1243,6 @@
         return firstChild != null ? firstChild.getMinHeight() : mCollapsedSize;
     }
 
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void setLongPressListener(ExpandableNotificationRow.LongPressListener listener) {
-        mLongPressListener = listener;
-    }
-
     @ShadeViewRefactor(RefactorComponent.ADAPTER)
     public void setQsContainer(ViewGroup qsContainer) {
         mQsContainer = qsContainer;
@@ -1273,7 +1266,7 @@
         return false;
     }
 
-    @ShadeViewRefactor(RefactorComponent.INPUT)
+    @ShadeViewRefactor(RefactorComponent.COORDINATOR)
     public ExpandableView getClosestChildAtRawPosition(float touchX, float touchY) {
         getLocationOnScreen(mTempInt2);
         float localTouchY = touchY - mTempInt2[1];
@@ -1303,16 +1296,8 @@
         return closestChild;
     }
 
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public ExpandableView getChildAtRawPosition(float touchX, float touchY) {
-        getLocationOnScreen(mTempInt2);
-        return getChildAtPosition(touchX - mTempInt2[0], touchY - mTempInt2[1]);
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public ExpandableView getChildAtPosition(float touchX, float touchY) {
+    @ShadeViewRefactor(RefactorComponent.COORDINATOR)
+    private ExpandableView getChildAtPosition(float touchX, float touchY) {
         return getChildAtPosition(touchX, touchY, true /* requireMinHeight */);
 
     }
@@ -1325,7 +1310,7 @@
      * @param requireMinHeight Whether a minimum height is required for a child to be returned.
      * @return the child at the given location.
      */
-    @ShadeViewRefactor(RefactorComponent.INPUT)
+    @ShadeViewRefactor(RefactorComponent.COORDINATOR)
     private ExpandableView getChildAtPosition(float touchX, float touchY,
             boolean requireMinHeight) {
         // find the view under the pointer, accounting for GONE views
@@ -1365,71 +1350,9 @@
         return null;
     }
 
-    @Override
-    @ShadeViewRefactor(RefactorComponent.ADAPTER)
-    public boolean canChildBeExpanded(View v) {
-        return v instanceof ExpandableNotificationRow
-                && ((ExpandableNotificationRow) v).isExpandable()
-                && !((ExpandableNotificationRow) v).areGutsExposed()
-                && (mIsExpanded || !((ExpandableNotificationRow) v).isPinned());
-    }
-
-    /* Only ever called as a consequence of an expansion gesture in the shade. */
-    @Override
-    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
-    public void setUserExpandedChild(View v, boolean userExpanded) {
-        if (v instanceof ExpandableNotificationRow) {
-            ExpandableNotificationRow row = (ExpandableNotificationRow) v;
-            if (userExpanded && onKeyguard()) {
-                // Due to a race when locking the screen while touching, a notification may be
-                // expanded even after we went back to keyguard. An example of this happens if
-                // you click in the empty space while expanding a group.
-
-                // We also need to un-user lock it here, since otherwise the content height
-                // calculated might be wrong. We also can't invert the two calls since
-                // un-userlocking it will trigger a layout switch in the content view.
-                row.setUserLocked(false);
-                updateContentHeight();
-                notifyHeightChangeListener(row);
-                return;
-            }
-            row.setUserExpanded(userExpanded, true /* allowChildrenExpansion */);
-            row.onExpandedByGesture(userExpanded);
-        }
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
-    public void setExpansionCancelled(View v) {
-        if (v instanceof ExpandableNotificationRow) {
-            ((ExpandableNotificationRow) v).setGroupExpansionChanging(false);
-        }
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
-    public void setUserLockedChild(View v, boolean userLocked) {
-        if (v instanceof ExpandableNotificationRow) {
-            ((ExpandableNotificationRow) v).setUserLocked(userLocked);
-        }
-        cancelLongPress();
-        requestDisallowInterceptTouchEvent(true);
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.STATE_RESOLVER)
-    public void expansionStateChanged(boolean isExpanding) {
-        mExpandingNotification = isExpanding;
-        if (!mExpandedInThisMotion) {
-            mMaxScrollAfterExpand = mOwnScrollY;
-            mExpandedInThisMotion = true;
-        }
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.COORDINATOR)
-    public int getMaxExpandHeight(ExpandableView view) {
-        return view.getMaxContentHeight();
+    private ExpandableView getChildAtRawPosition(float touchX, float touchY) {
+        getLocationOnScreen(mTempInt2);
+        return getChildAtPosition(touchX - mTempInt2[0], touchY - mTempInt2[1]);
     }
 
     @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
@@ -1526,14 +1449,6 @@
         return mStatusBarState == StatusBarState.KEYGUARD;
     }
 
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    private void setSwipingInProgress(boolean isSwiped) {
-        mSwipingInProgress = isSwiped;
-        if (isSwiped) {
-            requestDisallowInterceptTouchEvent(true);
-        }
-    }
-
     @Override
     @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     protected void onConfigurationChanged(Configuration newConfig) {
@@ -1567,249 +1482,6 @@
         return this;
     }
 
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public boolean onTouchEvent(MotionEvent ev) {
-        boolean isCancelOrUp = ev.getActionMasked() == MotionEvent.ACTION_CANCEL
-                || ev.getActionMasked() == MotionEvent.ACTION_UP;
-        handleEmptySpaceClick(ev);
-        boolean expandWantsIt = false;
-        if (mIsExpanded && !mSwipingInProgress && !mOnlyScrollingInThisMotion) {
-            if (isCancelOrUp) {
-                mExpandHelper.onlyObserveMovements(false);
-            }
-            boolean wasExpandingBefore = mExpandingNotification;
-            expandWantsIt = mExpandHelper.onTouchEvent(ev);
-            if (mExpandedInThisMotion && !mExpandingNotification && wasExpandingBefore
-                    && !mDisallowScrollingInThisMotion) {
-                dispatchDownEventToScroller(ev);
-            }
-        }
-        boolean scrollerWantsIt = false;
-        if (mIsExpanded && !mSwipingInProgress && !mExpandingNotification
-                && !mDisallowScrollingInThisMotion) {
-            scrollerWantsIt = onScrollTouch(ev);
-        }
-        boolean horizontalSwipeWantsIt = false;
-        if (!mIsBeingDragged
-                && !mExpandingNotification
-                && !mExpandedInThisMotion
-                && !mOnlyScrollingInThisMotion
-                && !mDisallowDismissInThisMotion) {
-            horizontalSwipeWantsIt = mSwipeHelper.onTouchEvent(ev);
-        }
-
-        // Check if we need to clear any snooze leavebehinds
-        NotificationGuts guts = mNotificationGutsManager.getExposedGuts();
-        if (guts != null && !NotificationSwipeHelper.isTouchInView(ev, guts)
-                && guts.getGutsContent() instanceof NotificationSnooze) {
-            NotificationSnooze ns = (NotificationSnooze) guts.getGutsContent();
-            if ((ns.isExpanded() && isCancelOrUp)
-                    || (!horizontalSwipeWantsIt && scrollerWantsIt)) {
-                // If the leavebehind is expanded we clear it on the next up event, otherwise we
-                // clear it on the next non-horizontal swipe or expand event.
-                checkSnoozeLeavebehind();
-            }
-        }
-        if (ev.getActionMasked() == MotionEvent.ACTION_UP) {
-            mCheckForLeavebehind = true;
-        }
-        return horizontalSwipeWantsIt || scrollerWantsIt || expandWantsIt || super.onTouchEvent(ev);
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    private void dispatchDownEventToScroller(MotionEvent ev) {
-        MotionEvent downEvent = MotionEvent.obtain(ev);
-        downEvent.setAction(MotionEvent.ACTION_DOWN);
-        onScrollTouch(downEvent);
-        downEvent.recycle();
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public boolean onGenericMotionEvent(MotionEvent event) {
-        if (!isScrollingEnabled() || !mIsExpanded || mSwipingInProgress || mExpandingNotification
-                || mDisallowScrollingInThisMotion) {
-            return false;
-        }
-        if ((event.getSource() & InputDevice.SOURCE_CLASS_POINTER) != 0) {
-            switch (event.getAction()) {
-                case MotionEvent.ACTION_SCROLL: {
-                    if (!mIsBeingDragged) {
-                        final float vscroll = event.getAxisValue(MotionEvent.AXIS_VSCROLL);
-                        if (vscroll != 0) {
-                            final int delta = (int) (vscroll * getVerticalScrollFactor());
-                            final int range = getScrollRange();
-                            int oldScrollY = mOwnScrollY;
-                            int newScrollY = oldScrollY - delta;
-                            if (newScrollY < 0) {
-                                newScrollY = 0;
-                            } else if (newScrollY > range) {
-                                newScrollY = range;
-                            }
-                            if (newScrollY != oldScrollY) {
-                                setOwnScrollY(newScrollY);
-                                return true;
-                            }
-                        }
-                    }
-                }
-            }
-        }
-        return super.onGenericMotionEvent(event);
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    private boolean onScrollTouch(MotionEvent ev) {
-        if (!isScrollingEnabled()) {
-            return false;
-        }
-        if (isInsideQsContainer(ev) && !mIsBeingDragged) {
-            return false;
-        }
-        mForcedScroll = null;
-        initVelocityTrackerIfNotExists();
-        mVelocityTracker.addMovement(ev);
-
-        final int action = ev.getAction();
-
-        switch (action & MotionEvent.ACTION_MASK) {
-            case MotionEvent.ACTION_DOWN: {
-                if (getChildCount() == 0 || !isInContentBounds(ev)) {
-                    return false;
-                }
-                boolean isBeingDragged = !mScroller.isFinished();
-                setIsBeingDragged(isBeingDragged);
-                /*
-                 * If being flinged and user touches, stop the fling. isFinished
-                 * will be false if being flinged.
-                 */
-                if (!mScroller.isFinished()) {
-                    mScroller.forceFinished(true);
-                }
-
-                // Remember where the motion event started
-                mLastMotionY = (int) ev.getY();
-                mDownX = (int) ev.getX();
-                mActivePointerId = ev.getPointerId(0);
-                break;
-            }
-            case MotionEvent.ACTION_MOVE:
-                final int activePointerIndex = ev.findPointerIndex(mActivePointerId);
-                if (activePointerIndex == -1) {
-                    Log.e(TAG, "Invalid pointerId=" + mActivePointerId + " in onTouchEvent");
-                    break;
-                }
-
-                final int y = (int) ev.getY(activePointerIndex);
-                final int x = (int) ev.getX(activePointerIndex);
-                int deltaY = mLastMotionY - y;
-                final int xDiff = Math.abs(x - mDownX);
-                final int yDiff = Math.abs(deltaY);
-                if (!mIsBeingDragged && yDiff > mTouchSlop && yDiff > xDiff) {
-                    setIsBeingDragged(true);
-                    if (deltaY > 0) {
-                        deltaY -= mTouchSlop;
-                    } else {
-                        deltaY += mTouchSlop;
-                    }
-                }
-                if (mIsBeingDragged) {
-                    // Scroll to follow the motion event
-                    mLastMotionY = y;
-                    int range = getScrollRange();
-                    if (mExpandedInThisMotion) {
-                        range = Math.min(range, mMaxScrollAfterExpand);
-                    }
-
-                    float scrollAmount;
-                    if (deltaY < 0) {
-                        scrollAmount = overScrollDown(deltaY);
-                    } else {
-                        scrollAmount = overScrollUp(deltaY, range);
-                    }
-
-                    // Calling customOverScrollBy will call onCustomOverScrolled, which
-                    // sets the scrolling if applicable.
-                    if (scrollAmount != 0.0f) {
-                        // The scrolling motion could not be compensated with the
-                        // existing overScroll, we have to scroll the view
-                        customOverScrollBy((int) scrollAmount, mOwnScrollY,
-                                range, getHeight() / 2);
-                        // If we're scrolling, leavebehinds should be dismissed
-                        checkSnoozeLeavebehind();
-                    }
-                }
-                break;
-            case MotionEvent.ACTION_UP:
-                if (mIsBeingDragged) {
-                    final VelocityTracker velocityTracker = mVelocityTracker;
-                    velocityTracker.computeCurrentVelocity(1000, mMaximumVelocity);
-                    int initialVelocity = (int) velocityTracker.getYVelocity(mActivePointerId);
-
-                    if (shouldOverScrollFling(initialVelocity)) {
-                        onOverScrollFling(true, initialVelocity);
-                    } else {
-                        if (getChildCount() > 0) {
-                            if ((Math.abs(initialVelocity) > mMinimumVelocity)) {
-                                float currentOverScrollTop = getCurrentOverScrollAmount(true);
-                                if (currentOverScrollTop == 0.0f || initialVelocity > 0) {
-                                    fling(-initialVelocity);
-                                } else {
-                                    onOverScrollFling(false, initialVelocity);
-                                }
-                            } else {
-                                if (mScroller.springBack(mScrollX, mOwnScrollY, 0, 0, 0,
-                                        getScrollRange())) {
-                                    animateScroll();
-                                }
-                            }
-                        }
-                    }
-                    mActivePointerId = INVALID_POINTER;
-                    endDrag();
-                }
-
-                break;
-            case MotionEvent.ACTION_CANCEL:
-                if (mIsBeingDragged && getChildCount() > 0) {
-                    if (mScroller.springBack(mScrollX, mOwnScrollY, 0, 0, 0, getScrollRange())) {
-                        animateScroll();
-                    }
-                    mActivePointerId = INVALID_POINTER;
-                    endDrag();
-                }
-                break;
-            case MotionEvent.ACTION_POINTER_DOWN: {
-                final int index = ev.getActionIndex();
-                mLastMotionY = (int) ev.getY(index);
-                mDownX = (int) ev.getX(index);
-                mActivePointerId = ev.getPointerId(index);
-                break;
-            }
-            case MotionEvent.ACTION_POINTER_UP:
-                onSecondaryPointerUp(ev);
-                mLastMotionY = (int) ev.getY(ev.findPointerIndex(mActivePointerId));
-                mDownX = (int) ev.getX(ev.findPointerIndex(mActivePointerId));
-                break;
-        }
-        return true;
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    protected boolean isInsideQsContainer(MotionEvent ev) {
-        return ev.getY() < mQsContainer.getBottom();
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    private void onOverScrollFling(boolean open, int initialVelocity) {
-        if (mOverscrollTopChangedListener != null) {
-            mOverscrollTopChangedListener.flingTopOverscroll(initialVelocity, open);
-        }
-        mDontReportNextOverScroll = true;
-        setOverScrollAmount(0.0f, true, false);
-    }
-
     /**
      * Perform a scroll upwards and adapt the overscroll amounts accordingly
      *
@@ -1817,7 +1489,7 @@
      * @return The amount of scrolling to be performed by the scroller,
      * not handled by the overScroll amount.
      */
-    @ShadeViewRefactor(RefactorComponent.INPUT)
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     private float overScrollUp(int deltaY, int range) {
         deltaY = Math.max(deltaY, 0);
         float currentTopAmount = getCurrentOverScrollAmount(true);
@@ -1876,24 +1548,6 @@
         return scrollAmount;
     }
 
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    private void onSecondaryPointerUp(MotionEvent ev) {
-        final int pointerIndex = (ev.getAction() & MotionEvent.ACTION_POINTER_INDEX_MASK) >>
-                MotionEvent.ACTION_POINTER_INDEX_SHIFT;
-        final int pointerId = ev.getPointerId(pointerIndex);
-        if (pointerId == mActivePointerId) {
-            // This was our active pointer going up. Choose a new
-            // active pointer and adjust accordingly.
-            // TODO: Make this decision more intelligent.
-            final int newPointerIndex = pointerIndex == 0 ? 1 : 0;
-            mLastMotionY = (int) ev.getY(newPointerIndex);
-            mActivePointerId = ev.getPointerId(newPointerIndex);
-            if (mVelocityTracker != null) {
-                mVelocityTracker.clear();
-            }
-        }
-    }
-
     @ShadeViewRefactor(RefactorComponent.STATE_RESOLVER)
     private void initVelocityTrackerIfNotExists() {
         if (mVelocityTracker == null) {
@@ -2636,7 +2290,7 @@
      *                  numbers mean that the finger/cursor is moving down the screen,
      *                  which means we want to scroll towards the top.
      */
-    @ShadeViewRefactor(RefactorComponent.INPUT)
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     protected void fling(int velocityY) {
         if (getChildCount() > 0) {
             int scrollRange = getScrollRange();
@@ -2674,7 +2328,7 @@
      * @return Whether a fling performed on the top overscroll edge lead to the expanded
      * overScroll view (i.e QS).
      */
-    @ShadeViewRefactor(RefactorComponent.INPUT)
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     private boolean shouldOverScrollFling(int initialVelocity) {
         float topOverScroll = getCurrentOverScrollAmount(true);
         return mScrolledToTopOnFirstDown
@@ -2757,7 +2411,7 @@
         return Math.max(desiredPadding, mIntrinsicPadding);
     }
 
-    @ShadeViewRefactor(RefactorComponent.INPUT)
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     private float getRubberBandFactor(boolean onTop) {
         if (!onTop) {
             return RUBBER_BAND_FACTOR_NORMAL;
@@ -2777,99 +2431,13 @@
      * rubberbanded, false if it is technically an overscroll but rather a motion to expand the
      * overscroll view (e.g. expand QS).
      */
-    @ShadeViewRefactor(RefactorComponent.INPUT)
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     private boolean isRubberbanded(boolean onTop) {
         return !onTop || mExpandedInThisMotion || mIsExpansionChanging || mPanelTracking
                 || !mScrolledToTopOnFirstDown;
     }
 
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    private void endDrag() {
-        setIsBeingDragged(false);
 
-        recycleVelocityTracker();
-
-        if (getCurrentOverScrollAmount(true /* onTop */) > 0) {
-            setOverScrollAmount(0, true /* onTop */, true /* animate */);
-        }
-        if (getCurrentOverScrollAmount(false /* onTop */) > 0) {
-            setOverScrollAmount(0, false /* onTop */, true /* animate */);
-        }
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    private void transformTouchEvent(MotionEvent ev, View sourceView, View targetView) {
-        ev.offsetLocation(sourceView.getX(), sourceView.getY());
-        ev.offsetLocation(-targetView.getX(), -targetView.getY());
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public boolean onInterceptTouchEvent(MotionEvent ev) {
-        initDownStates(ev);
-        handleEmptySpaceClick(ev);
-        boolean expandWantsIt = false;
-        if (!mSwipingInProgress && !mOnlyScrollingInThisMotion) {
-            expandWantsIt = mExpandHelper.onInterceptTouchEvent(ev);
-        }
-        boolean scrollWantsIt = false;
-        if (!mSwipingInProgress && !mExpandingNotification) {
-            scrollWantsIt = onInterceptTouchEventScroll(ev);
-        }
-        boolean swipeWantsIt = false;
-        if (!mIsBeingDragged
-                && !mExpandingNotification
-                && !mExpandedInThisMotion
-                && !mOnlyScrollingInThisMotion
-                && !mDisallowDismissInThisMotion) {
-            swipeWantsIt = mSwipeHelper.onInterceptTouchEvent(ev);
-        }
-        // Check if we need to clear any snooze leavebehinds
-        boolean isUp = ev.getActionMasked() == MotionEvent.ACTION_UP;
-        NotificationGuts guts = mNotificationGutsManager.getExposedGuts();
-        if (!NotificationSwipeHelper.isTouchInView(ev, guts) && isUp && !swipeWantsIt &&
-                !expandWantsIt && !scrollWantsIt) {
-            mCheckForLeavebehind = false;
-            mNotificationGutsManager.closeAndSaveGuts(true /* removeLeavebehind */,
-                    false /* force */, false /* removeControls */, -1 /* x */, -1 /* y */,
-                    false /* resetMenu */);
-        }
-        if (ev.getActionMasked() == MotionEvent.ACTION_UP) {
-            mCheckForLeavebehind = true;
-        }
-        return swipeWantsIt || scrollWantsIt || expandWantsIt || super.onInterceptTouchEvent(ev);
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    private void handleEmptySpaceClick(MotionEvent ev) {
-        switch (ev.getActionMasked()) {
-            case MotionEvent.ACTION_MOVE:
-                if (mTouchIsClick && (Math.abs(ev.getY() - mInitialTouchY) > mTouchSlop
-                        || Math.abs(ev.getX() - mInitialTouchX) > mTouchSlop)) {
-                    mTouchIsClick = false;
-                }
-                break;
-            case MotionEvent.ACTION_UP:
-                if (mStatusBarState != StatusBarState.KEYGUARD && mTouchIsClick &&
-                        isBelowLastNotification(mInitialTouchX, mInitialTouchY)) {
-                    mOnEmptySpaceClickListener.onEmptySpaceClicked(mInitialTouchX, mInitialTouchY);
-                }
-                break;
-        }
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    private void initDownStates(MotionEvent ev) {
-        if (ev.getAction() == MotionEvent.ACTION_DOWN) {
-            mExpandedInThisMotion = false;
-            mOnlyScrollingInThisMotion = !mScroller.isFinished();
-            mDisallowScrollingInThisMotion = false;
-            mDisallowDismissInThisMotion = false;
-            mTouchIsClick = true;
-            mInitialTouchX = ev.getX();
-            mInitialTouchY = ev.getY();
-        }
-    }
 
     @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     public void setChildTransferInProgress(boolean childTransferInProgress) {
@@ -2896,15 +2464,6 @@
         mCurrentStackScrollState.removeViewStateForView(child);
     }
 
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void requestDisallowInterceptTouchEvent(boolean disallowIntercept) {
-        super.requestDisallowInterceptTouchEvent(disallowIntercept);
-        if (disallowIntercept) {
-            cancelLongPress();
-        }
-    }
-
     @ShadeViewRefactor(RefactorComponent.COORDINATOR)
     private void onViewRemovedInternal(View child, ViewGroup container) {
         if (mChangePositionInProgress) {
@@ -3600,6 +3159,385 @@
         mGoToFullShadeNeedsAnimation = false;
     }
 
+    @ShadeViewRefactor(RefactorComponent.LAYOUT_ALGORITHM)
+    protected StackScrollAlgorithm createStackScrollAlgorithm(Context context) {
+        return new StackScrollAlgorithm(context);
+    }
+
+    /**
+     * @return Whether a y coordinate is inside the content.
+     */
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
+    public boolean isInContentBounds(float y) {
+        return y < getHeight() - getEmptyBottomMargin();
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public void setLongPressListener(ExpandableNotificationRow.LongPressListener listener) {
+        mLongPressListener = listener;
+    }
+
+    @Override
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public boolean onTouchEvent(MotionEvent ev) {
+        boolean isCancelOrUp = ev.getActionMasked() == MotionEvent.ACTION_CANCEL
+                || ev.getActionMasked() == MotionEvent.ACTION_UP;
+        handleEmptySpaceClick(ev);
+        boolean expandWantsIt = false;
+        boolean swipingInProgress = mSwipeHelper.isSwipingInProgress();
+        if (mIsExpanded && !swipingInProgress && !mOnlyScrollingInThisMotion) {
+            if (isCancelOrUp) {
+                mExpandHelper.onlyObserveMovements(false);
+            }
+            boolean wasExpandingBefore = mExpandingNotification;
+            expandWantsIt = mExpandHelper.onTouchEvent(ev);
+            if (mExpandedInThisMotion && !mExpandingNotification && wasExpandingBefore
+                    && !mDisallowScrollingInThisMotion) {
+                dispatchDownEventToScroller(ev);
+            }
+        }
+        boolean scrollerWantsIt = false;
+        if (mIsExpanded && !swipingInProgress && !mExpandingNotification
+                && !mDisallowScrollingInThisMotion) {
+            scrollerWantsIt = onScrollTouch(ev);
+        }
+        boolean horizontalSwipeWantsIt = false;
+        if (!mIsBeingDragged
+                && !mExpandingNotification
+                && !mExpandedInThisMotion
+                && !mOnlyScrollingInThisMotion
+                && !mDisallowDismissInThisMotion) {
+            horizontalSwipeWantsIt = mSwipeHelper.onTouchEvent(ev);
+        }
+
+        // Check if we need to clear any snooze leavebehinds
+        NotificationGuts guts = mNotificationGutsManager.getExposedGuts();
+        if (guts != null && !NotificationSwipeHelper.isTouchInView(ev, guts)
+                && guts.getGutsContent() instanceof NotificationSnooze) {
+            NotificationSnooze ns = (NotificationSnooze) guts.getGutsContent();
+            if ((ns.isExpanded() && isCancelOrUp)
+                    || (!horizontalSwipeWantsIt && scrollerWantsIt)) {
+                // If the leavebehind is expanded we clear it on the next up event, otherwise we
+                // clear it on the next non-horizontal swipe or expand event.
+                checkSnoozeLeavebehind();
+            }
+        }
+        if (ev.getActionMasked() == MotionEvent.ACTION_UP) {
+            mCheckForLeavebehind = true;
+        }
+        return horizontalSwipeWantsIt || scrollerWantsIt || expandWantsIt || super.onTouchEvent(ev);
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private void dispatchDownEventToScroller(MotionEvent ev) {
+        MotionEvent downEvent = MotionEvent.obtain(ev);
+        downEvent.setAction(MotionEvent.ACTION_DOWN);
+        onScrollTouch(downEvent);
+        downEvent.recycle();
+    }
+
+    @Override
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public boolean onGenericMotionEvent(MotionEvent event) {
+        if (!isScrollingEnabled() || !mIsExpanded || mSwipeHelper.isSwipingInProgress() || mExpandingNotification
+                || mDisallowScrollingInThisMotion) {
+            return false;
+        }
+        if ((event.getSource() & InputDevice.SOURCE_CLASS_POINTER) != 0) {
+            switch (event.getAction()) {
+                case MotionEvent.ACTION_SCROLL: {
+                    if (!mIsBeingDragged) {
+                        final float vscroll = event.getAxisValue(MotionEvent.AXIS_VSCROLL);
+                        if (vscroll != 0) {
+                            final int delta = (int) (vscroll * getVerticalScrollFactor());
+                            final int range = getScrollRange();
+                            int oldScrollY = mOwnScrollY;
+                            int newScrollY = oldScrollY - delta;
+                            if (newScrollY < 0) {
+                                newScrollY = 0;
+                            } else if (newScrollY > range) {
+                                newScrollY = range;
+                            }
+                            if (newScrollY != oldScrollY) {
+                                setOwnScrollY(newScrollY);
+                                return true;
+                            }
+                        }
+                    }
+                }
+            }
+        }
+        return super.onGenericMotionEvent(event);
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private boolean onScrollTouch(MotionEvent ev) {
+        if (!isScrollingEnabled()) {
+            return false;
+        }
+        if (isInsideQsContainer(ev) && !mIsBeingDragged) {
+            return false;
+        }
+        mForcedScroll = null;
+        initVelocityTrackerIfNotExists();
+        mVelocityTracker.addMovement(ev);
+
+        final int action = ev.getAction();
+
+        switch (action & MotionEvent.ACTION_MASK) {
+            case MotionEvent.ACTION_DOWN: {
+                if (getChildCount() == 0 || !isInContentBounds(ev)) {
+                    return false;
+                }
+                boolean isBeingDragged = !mScroller.isFinished();
+                setIsBeingDragged(isBeingDragged);
+                /*
+                 * If being flinged and user touches, stop the fling. isFinished
+                 * will be false if being flinged.
+                 */
+                if (!mScroller.isFinished()) {
+                    mScroller.forceFinished(true);
+                }
+
+                // Remember where the motion event started
+                mLastMotionY = (int) ev.getY();
+                mDownX = (int) ev.getX();
+                mActivePointerId = ev.getPointerId(0);
+                break;
+            }
+            case MotionEvent.ACTION_MOVE:
+                final int activePointerIndex = ev.findPointerIndex(mActivePointerId);
+                if (activePointerIndex == -1) {
+                    Log.e(TAG, "Invalid pointerId=" + mActivePointerId + " in onTouchEvent");
+                    break;
+                }
+
+                final int y = (int) ev.getY(activePointerIndex);
+                final int x = (int) ev.getX(activePointerIndex);
+                int deltaY = mLastMotionY - y;
+                final int xDiff = Math.abs(x - mDownX);
+                final int yDiff = Math.abs(deltaY);
+                if (!mIsBeingDragged && yDiff > mTouchSlop && yDiff > xDiff) {
+                    setIsBeingDragged(true);
+                    if (deltaY > 0) {
+                        deltaY -= mTouchSlop;
+                    } else {
+                        deltaY += mTouchSlop;
+                    }
+                }
+                if (mIsBeingDragged) {
+                    // Scroll to follow the motion event
+                    mLastMotionY = y;
+                    int range = getScrollRange();
+                    if (mExpandedInThisMotion) {
+                        range = Math.min(range, mMaxScrollAfterExpand);
+                    }
+
+                    float scrollAmount;
+                    if (deltaY < 0) {
+                        scrollAmount = overScrollDown(deltaY);
+                    } else {
+                        scrollAmount = overScrollUp(deltaY, range);
+                    }
+
+                    // Calling customOverScrollBy will call onCustomOverScrolled, which
+                    // sets the scrolling if applicable.
+                    if (scrollAmount != 0.0f) {
+                        // The scrolling motion could not be compensated with the
+                        // existing overScroll, we have to scroll the view
+                        customOverScrollBy((int) scrollAmount, mOwnScrollY,
+                                range, getHeight() / 2);
+                        // If we're scrolling, leavebehinds should be dismissed
+                        checkSnoozeLeavebehind();
+                    }
+                }
+                break;
+            case MotionEvent.ACTION_UP:
+                if (mIsBeingDragged) {
+                    final VelocityTracker velocityTracker = mVelocityTracker;
+                    velocityTracker.computeCurrentVelocity(1000, mMaximumVelocity);
+                    int initialVelocity = (int) velocityTracker.getYVelocity(mActivePointerId);
+
+                    if (shouldOverScrollFling(initialVelocity)) {
+                        onOverScrollFling(true, initialVelocity);
+                    } else {
+                        if (getChildCount() > 0) {
+                            if ((Math.abs(initialVelocity) > mMinimumVelocity)) {
+                                float currentOverScrollTop = getCurrentOverScrollAmount(true);
+                                if (currentOverScrollTop == 0.0f || initialVelocity > 0) {
+                                    fling(-initialVelocity);
+                                } else {
+                                    onOverScrollFling(false, initialVelocity);
+                                }
+                            } else {
+                                if (mScroller.springBack(mScrollX, mOwnScrollY, 0, 0, 0,
+                                        getScrollRange())) {
+                                    animateScroll();
+                                }
+                            }
+                        }
+                    }
+                    mActivePointerId = INVALID_POINTER;
+                    endDrag();
+                }
+
+                break;
+            case MotionEvent.ACTION_CANCEL:
+                if (mIsBeingDragged && getChildCount() > 0) {
+                    if (mScroller.springBack(mScrollX, mOwnScrollY, 0, 0, 0, getScrollRange())) {
+                        animateScroll();
+                    }
+                    mActivePointerId = INVALID_POINTER;
+                    endDrag();
+                }
+                break;
+            case MotionEvent.ACTION_POINTER_DOWN: {
+                final int index = ev.getActionIndex();
+                mLastMotionY = (int) ev.getY(index);
+                mDownX = (int) ev.getX(index);
+                mActivePointerId = ev.getPointerId(index);
+                break;
+            }
+            case MotionEvent.ACTION_POINTER_UP:
+                onSecondaryPointerUp(ev);
+                mLastMotionY = (int) ev.getY(ev.findPointerIndex(mActivePointerId));
+                mDownX = (int) ev.getX(ev.findPointerIndex(mActivePointerId));
+                break;
+        }
+        return true;
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    protected boolean isInsideQsContainer(MotionEvent ev) {
+        return ev.getY() < mQsContainer.getBottom();
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private void onOverScrollFling(boolean open, int initialVelocity) {
+        if (mOverscrollTopChangedListener != null) {
+            mOverscrollTopChangedListener.flingTopOverscroll(initialVelocity, open);
+        }
+        mDontReportNextOverScroll = true;
+        setOverScrollAmount(0.0f, true, false);
+    }
+
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private void onSecondaryPointerUp(MotionEvent ev) {
+        final int pointerIndex = (ev.getAction() & MotionEvent.ACTION_POINTER_INDEX_MASK) >>
+                MotionEvent.ACTION_POINTER_INDEX_SHIFT;
+        final int pointerId = ev.getPointerId(pointerIndex);
+        if (pointerId == mActivePointerId) {
+            // This was our active pointer going up. Choose a new
+            // active pointer and adjust accordingly.
+            // TODO: Make this decision more intelligent.
+            final int newPointerIndex = pointerIndex == 0 ? 1 : 0;
+            mLastMotionY = (int) ev.getY(newPointerIndex);
+            mActivePointerId = ev.getPointerId(newPointerIndex);
+            if (mVelocityTracker != null) {
+                mVelocityTracker.clear();
+            }
+        }
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private void endDrag() {
+        setIsBeingDragged(false);
+
+        recycleVelocityTracker();
+
+        if (getCurrentOverScrollAmount(true /* onTop */) > 0) {
+            setOverScrollAmount(0, true /* onTop */, true /* animate */);
+        }
+        if (getCurrentOverScrollAmount(false /* onTop */) > 0) {
+            setOverScrollAmount(0, false /* onTop */, true /* animate */);
+        }
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private void transformTouchEvent(MotionEvent ev, View sourceView, View targetView) {
+        ev.offsetLocation(sourceView.getX(), sourceView.getY());
+        ev.offsetLocation(-targetView.getX(), -targetView.getY());
+    }
+
+    @Override
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public boolean onInterceptTouchEvent(MotionEvent ev) {
+        initDownStates(ev);
+        handleEmptySpaceClick(ev);
+        boolean expandWantsIt = false;
+        boolean swipingInProgress = mSwipeHelper.isSwipingInProgress();
+        if (!swipingInProgress && !mOnlyScrollingInThisMotion) {
+            expandWantsIt = mExpandHelper.onInterceptTouchEvent(ev);
+        }
+        boolean scrollWantsIt = false;
+        if (!swipingInProgress && !mExpandingNotification) {
+            scrollWantsIt = onInterceptTouchEventScroll(ev);
+        }
+        boolean swipeWantsIt = false;
+        if (!mIsBeingDragged
+                && !mExpandingNotification
+                && !mExpandedInThisMotion
+                && !mOnlyScrollingInThisMotion
+                && !mDisallowDismissInThisMotion) {
+            swipeWantsIt = mSwipeHelper.onInterceptTouchEvent(ev);
+        }
+        // Check if we need to clear any snooze leavebehinds
+        boolean isUp = ev.getActionMasked() == MotionEvent.ACTION_UP;
+        NotificationGuts guts = mNotificationGutsManager.getExposedGuts();
+        if (!NotificationSwipeHelper.isTouchInView(ev, guts) && isUp && !swipeWantsIt &&
+                !expandWantsIt && !scrollWantsIt) {
+            mCheckForLeavebehind = false;
+            mNotificationGutsManager.closeAndSaveGuts(true /* removeLeavebehind */,
+                    false /* force */, false /* removeControls */, -1 /* x */, -1 /* y */,
+                    false /* resetMenu */);
+        }
+        if (ev.getActionMasked() == MotionEvent.ACTION_UP) {
+            mCheckForLeavebehind = true;
+        }
+        return swipeWantsIt || scrollWantsIt || expandWantsIt || super.onInterceptTouchEvent(ev);
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private void handleEmptySpaceClick(MotionEvent ev) {
+        switch (ev.getActionMasked()) {
+            case MotionEvent.ACTION_MOVE:
+                if (mTouchIsClick && (Math.abs(ev.getY() - mInitialTouchY) > mTouchSlop
+                        || Math.abs(ev.getX() - mInitialTouchX) > mTouchSlop)) {
+                    mTouchIsClick = false;
+                }
+                break;
+            case MotionEvent.ACTION_UP:
+                if (mStatusBarState != StatusBarState.KEYGUARD && mTouchIsClick &&
+                        isBelowLastNotification(mInitialTouchX, mInitialTouchY)) {
+                    mOnEmptySpaceClickListener.onEmptySpaceClicked(mInitialTouchX, mInitialTouchY);
+                }
+                break;
+        }
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private void initDownStates(MotionEvent ev) {
+        if (ev.getAction() == MotionEvent.ACTION_DOWN) {
+            mExpandedInThisMotion = false;
+            mOnlyScrollingInThisMotion = !mScroller.isFinished();
+            mDisallowScrollingInThisMotion = false;
+            mDisallowDismissInThisMotion = false;
+            mTouchIsClick = true;
+            mInitialTouchX = ev.getX();
+            mInitialTouchY = ev.getY();
+        }
+    }
+
+    @Override
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public void requestDisallowInterceptTouchEvent(boolean disallowIntercept) {
+        super.requestDisallowInterceptTouchEvent(disallowIntercept);
+        if (disallowIntercept) {
+            cancelLongPress();
+        }
+    }
+
     @ShadeViewRefactor(RefactorComponent.INPUT)
     private boolean onInterceptTouchEventScroll(MotionEvent ev) {
         if (!isScrollingEnabled()) {
@@ -3710,11 +3648,6 @@
         return mIsBeingDragged;
     }
 
-    @ShadeViewRefactor(RefactorComponent.LAYOUT_ALGORITHM)
-    protected StackScrollAlgorithm createStackScrollAlgorithm(Context context) {
-        return new StackScrollAlgorithm(context);
-    }
-
     /**
      * @return Whether the specified motion event is actually happening over the content.
      */
@@ -3723,13 +3656,6 @@
         return isInContentBounds(event.getY());
     }
 
-    /**
-     * @return Whether a y coordinate is inside the content.
-     */
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public boolean isInContentBounds(float y) {
-        return y < getHeight() - getEmptyBottomMargin();
-    }
 
     @VisibleForTesting
     @ShadeViewRefactor(RefactorComponent.INPUT)
@@ -3742,6 +3668,83 @@
         }
     }
 
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public void requestDisallowLongPress() {
+        cancelLongPress();
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public void requestDisallowDismiss() {
+        mDisallowDismissInThisMotion = true;
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public void cancelLongPress() {
+        mSwipeHelper.cancelLongPress();
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public void setOnEmptySpaceClickListener(OnEmptySpaceClickListener listener) {
+        mOnEmptySpaceClickListener = listener;
+    }
+
+    /** @hide */
+    @Override
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public boolean performAccessibilityActionInternal(int action, Bundle arguments) {
+        if (super.performAccessibilityActionInternal(action, arguments)) {
+            return true;
+        }
+        if (!isEnabled()) {
+            return false;
+        }
+        int direction = -1;
+        switch (action) {
+            case AccessibilityNodeInfo.ACTION_SCROLL_FORWARD:
+                // fall through
+            case android.R.id.accessibilityActionScrollDown:
+                direction = 1;
+                // fall through
+            case AccessibilityNodeInfo.ACTION_SCROLL_BACKWARD:
+                // fall through
+            case android.R.id.accessibilityActionScrollUp:
+                final int viewportHeight = getHeight() - mPaddingBottom - mTopPadding - mPaddingTop
+                        - mShelf.getIntrinsicHeight();
+                final int targetScrollY = Math.max(0,
+                        Math.min(mOwnScrollY + direction * viewportHeight, getScrollRange()));
+                if (targetScrollY != mOwnScrollY) {
+                    mScroller.startScroll(mScrollX, mOwnScrollY, 0, targetScrollY - mOwnScrollY);
+                    animateScroll();
+                    return true;
+                }
+                break;
+        }
+        return false;
+    }
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    public void closeControlsIfOutsideTouch(MotionEvent ev) {
+        NotificationGuts guts = mNotificationGutsManager.getExposedGuts();
+        NotificationMenuRowPlugin menuRow = mSwipeHelper.getCurrentMenuRow();
+        View translatingParentView = mSwipeHelper.getTranslatingParentView();
+        View view = null;
+        if (guts != null && !guts.getGutsContent().isLeavebehind()) {
+            // Only close visible guts if they're not a leavebehind.
+            view = guts;
+        } else if (menuRow != null && menuRow.isMenuVisible()
+                && translatingParentView != null) {
+            // Checking menu
+            view = translatingParentView;
+        }
+        if (view != null && !NotificationSwipeHelper.isTouchInView(ev, view)) {
+            // Touch was outside visible guts / menu notification, close what's visible
+            mNotificationGutsManager.closeAndSaveGuts(false /* removeLeavebehind */,
+                    false /* force */, true /* removeControls */, -1 /* x */, -1 /* y */,
+                    false /* resetMenu */);
+            resetExposedMenuView(true /* animate */, true /* force */);
+        }
+    }
+
     @Override
     @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     public void onWindowFocusChanged(boolean hasWindowFocus) {
@@ -3760,21 +3763,6 @@
         }
     }
 
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void requestDisallowLongPress() {
-        cancelLongPress();
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void requestDisallowDismiss() {
-        mDisallowDismissInThisMotion = true;
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void cancelLongPress() {
-        mSwipeHelper.cancelLongPress();
-    }
-
     @Override
     @ShadeViewRefactor(RefactorComponent.COORDINATOR)
     public boolean isScrolledToTop() {
@@ -3916,7 +3904,6 @@
     }
 
     @Override
-    @ShadeViewRefactor(RefactorComponent.STATE_RESOLVER)
     public void onHeightChanged(ExpandableView view, boolean needsAnimation) {
         updateContentHeight();
         updateScrollPositionOnExpandInBottom(view);
@@ -3936,7 +3923,6 @@
     }
 
     @Override
-    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     public void onReset(ExpandableView view) {
         updateAnimationState(view);
         updateChronometerForChild(view);
@@ -3969,13 +3955,8 @@
 
     @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     public void setOnHeightChangedListener(
-            ExpandableView.OnHeightChangedListener mOnHeightChangedListener) {
-        this.mOnHeightChangedListener = mOnHeightChangedListener;
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void setOnEmptySpaceClickListener(OnEmptySpaceClickListener listener) {
-        mOnEmptySpaceClickListener = listener;
+            ExpandableView.OnHeightChangedListener onHeightChangedListener) {
+        this.mOnHeightChangedListener = onHeightChangedListener;
     }
 
     @ShadeViewRefactor(RefactorComponent.STATE_RESOLVER)
@@ -4465,7 +4446,7 @@
     @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     public void setGroupManager(NotificationGroupManager groupManager) {
         this.mGroupManager = groupManager;
-        mGroupManager.setOnGroupChangeListener(this);
+        mGroupManager.setOnGroupChangeListener(mOnGroupChangeListener);
     }
 
     @ShadeViewRefactor(RefactorComponent.STATE_RESOLVER)
@@ -4508,33 +4489,6 @@
         return touchY > mTopPadding + mStackTranslation;
     }
 
-    @Override
-    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
-    public void onGroupExpansionChanged(ExpandableNotificationRow changedRow, boolean expanded) {
-        boolean animated = !mGroupExpandedForMeasure && mAnimationsEnabled
-                && (mIsExpanded || changedRow.isPinned());
-        if (animated) {
-            mExpandedGroupView = changedRow;
-            mNeedsAnimation = true;
-        }
-        changedRow.setChildrenExpanded(expanded, animated);
-        if (!mGroupExpandedForMeasure) {
-            onHeightChanged(changedRow, false /* needsAnimation */);
-        }
-        runAfterAnimationFinished(new Runnable() {
-            @Override
-            public void run() {
-                changedRow.onFinishedExpansionChange();
-            }
-        });
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
-    public void onGroupCreatedFromChildren(NotificationGroupManager.NotificationGroup group) {
-        mStatusBar.requestNotificationUpdate();
-    }
-
     /** @hide */
     @Override
     @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
@@ -4567,46 +4521,6 @@
         info.setClassName(ScrollView.class.getName());
     }
 
-    /** @hide */
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public boolean performAccessibilityActionInternal(int action, Bundle arguments) {
-        if (super.performAccessibilityActionInternal(action, arguments)) {
-            return true;
-        }
-        if (!isEnabled()) {
-            return false;
-        }
-        int direction = -1;
-        switch (action) {
-            case AccessibilityNodeInfo.ACTION_SCROLL_FORWARD:
-                // fall through
-            case android.R.id.accessibilityActionScrollDown:
-                direction = 1;
-                // fall through
-            case AccessibilityNodeInfo.ACTION_SCROLL_BACKWARD:
-                // fall through
-            case android.R.id.accessibilityActionScrollUp:
-                final int viewportHeight = getHeight() - mPaddingBottom - mTopPadding - mPaddingTop
-                        - mShelf.getIntrinsicHeight();
-                final int targetScrollY = Math.max(0,
-                        Math.min(mOwnScrollY + direction * viewportHeight, getScrollRange()));
-                if (targetScrollY != mOwnScrollY) {
-                    mScroller.startScroll(mScrollX, mOwnScrollY, 0, targetScrollY - mOwnScrollY);
-                    animateScroll();
-                    return true;
-                }
-                break;
-        }
-        return false;
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
-    public void onGroupsChanged() {
-        mStatusBar.requestNotificationUpdate();
-    }
-
     @ShadeViewRefactor(RefactorComponent.COORDINATOR)
     public void generateChildOrderChangedEvent() {
         if (mIsExpanded && mAnimationsEnabled) {
@@ -4649,7 +4563,7 @@
     public void setHeadsUpManager(HeadsUpManagerPhone headsUpManager) {
         mHeadsUpManager = headsUpManager;
         mHeadsUpManager.addListener(mRoundnessManager);
-        mHeadsUpManager.setAnimationStateHandler(this);
+        mHeadsUpManager.setAnimationStateHandler(this::setHeadsUpGoingAwayAnimationsAllowed);
     }
 
     @ShadeViewRefactor(RefactorComponent.STATE_RESOLVER)
@@ -4912,6 +4826,34 @@
                 mMaxTopPadding,
                 mShouldShowShelfOnly ? "T" : "f",
                 mQsExpansionFraction));
+        int childCount = getChildCount();
+        pw.println("  Number of children: " + childCount);
+        pw.println();
+
+        for (int i = 0; i < childCount; i++) {
+            ExpandableView child = (ExpandableView) getChildAt(i);
+            child.dump(fd, pw, args);
+            if (!(child instanceof ExpandableNotificationRow)) {
+                pw.println("  " + child.getClass().getSimpleName());
+                // Notifications dump it's viewstate as part of their dump to support children
+                ExpandableViewState viewState = mCurrentStackScrollState.getViewStateForView(
+                        child);
+                if (viewState == null) {
+                    pw.println("    no viewState!!!");
+                } else {
+                    pw.print("    ");
+                    viewState.dump(fd, pw, args);
+                    pw.println();
+                    pw.println();
+                }
+            }
+        }
+        pw.println("  Transient Views: " + childCount);
+        int transientViewCount = getTransientViewCount();
+        for (int i = 0; i < transientViewCount; i++) {
+            ExpandableView child = (ExpandableView) getTransientView(i);
+            child.dump(fd, pw, args);
+        }
     }
 
     @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
@@ -5140,67 +5082,7 @@
         return !mEntryManager.getNotificationData().getActiveNotifications().isEmpty();
     }
 
-    // ---------------------- DragDownHelper.OnDragDownListener ------------------------------------
-
-
-    /* Only ever called as a consequence of a lockscreen expansion gesture. */
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public boolean onDraggedDown(View startingChild, int dragLengthY) {
-        if (mStatusBarState == StatusBarState.KEYGUARD
-                && hasActiveNotifications() && (!mStatusBar.isDozing() || mStatusBar.isPulsing())) {
-            mLockscreenGestureLogger.write(
-                    MetricsEvent.ACTION_LS_SHADE,
-                    (int) (dragLengthY / mDisplayMetrics.density),
-                    0 /* velocityDp - N/A */);
-
-            // We have notifications, go to locked shade.
-            mStatusBar.goToLockedShade(startingChild);
-            if (startingChild instanceof ExpandableNotificationRow) {
-                ExpandableNotificationRow row = (ExpandableNotificationRow) startingChild;
-                row.onExpandedByGesture(true /* drag down is always an open */);
-            }
-            return true;
-        } else {
-            // abort gesture.
-            return false;
-        }
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void onDragDownReset() {
-        setDimmed(true /* dimmed */, true /* animated */);
-        resetScrollPosition();
-        resetCheckSnoozeLeavebehind();
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void onCrossedThreshold(boolean above) {
-        setDimmed(!above /* dimmed */, true /* animate */);
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void onTouchSlopExceeded() {
-        cancelLongPress();
-        checkSnoozeLeavebehind();
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void setEmptyDragAmount(float amount) {
-        mNotificationPanel.setEmptyDragAmount(amount);
-    }
-
-    @Override
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public boolean isFalsingCheckNeeded() {
-        return mStatusBarState == StatusBarState.KEYGUARD;
-    }
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
     public void updateSpeedBumpIndex() {
         int speedBumpIndex = 0;
         int currentIndex = 0;
@@ -5241,30 +5123,6 @@
         mSwipeHelper.resetExposedMenuView(animate, force);
     }
 
-
-    @ShadeViewRefactor(RefactorComponent.INPUT)
-    public void closeControlsIfOutsideTouch(MotionEvent ev) {
-        NotificationGuts guts = mNotificationGutsManager.getExposedGuts();
-        NotificationMenuRowPlugin menuRow = mSwipeHelper.getCurrentMenuRow();
-        View translatingParentView = mSwipeHelper.getTranslatingParentView();
-        View view = null;
-        if (guts != null && !guts.getGutsContent().isLeavebehind()) {
-            // Only close visible guts if they're not a leavebehind.
-            view = guts;
-        } else if (menuRow != null && menuRow.isMenuVisible()
-                && translatingParentView != null) {
-            // Checking menu
-            view = translatingParentView;
-        }
-        if (view != null && !NotificationSwipeHelper.isTouchInView(ev, view)) {
-            // Touch was outside visible guts / menu notification, close what's visible
-            mNotificationGutsManager.closeAndSaveGuts(false /* removeLeavebehind */,
-                    false /* force */, true /* removeControls */, -1 /* x */, -1 /* y */,
-                    false /* resetMenu */);
-            resetExposedMenuView(true /* animate */, true /* force */);
-        }
-    }
-
     @ShadeViewRefactor(RefactorComponent.STATE_RESOLVER)
     static class AnimationEvent {
 
@@ -5586,9 +5444,9 @@
       }
     };
 
-    class NotificationMenuListener implements NotificationMenuRowPlugin.OnMenuEventListener {
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private final OnMenuEventListener mMenuEventListener = new OnMenuEventListener() {
         @Override
-        @ShadeViewRefactor(RefactorComponent.INPUT)
         public void onMenuClicked(View view, int x, int y, MenuItem item) {
             if (mLongPressListener == null) {
                 return;
@@ -5602,7 +5460,6 @@
         }
 
         @Override
-        @ShadeViewRefactor(RefactorComponent.INPUT)
         public void onMenuReset(View row) {
             View translatingParentView = mSwipeHelper.getTranslatingParentView();
             if (translatingParentView != null && row == translatingParentView) {
@@ -5612,7 +5469,6 @@
         }
 
         @Override
-        @ShadeViewRefactor(RefactorComponent.INPUT)
         public void onMenuShown(View row) {
             if (row instanceof ExpandableNotificationRow) {
                 MetricsLogger.action(mContext, MetricsEvent.ACTION_REVEAL_GEAR,
@@ -5621,9 +5477,11 @@
             }
             mSwipeHelper.onMenuShown(row);
         }
-    }
+    };
 
-    class SwipeHelperCallback implements NotificationSwipeHelper.NotificationCallback {
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private final NotificationSwipeHelper.NotificationCallback mNotificationCallback =
+            new NotificationSwipeHelper.NotificationCallback() {
         @Override
         public void onDismiss() {
             mNotificationGutsManager.closeAndSaveGuts(true /* removeLeavebehind */,
@@ -5643,10 +5501,8 @@
         }
 
         @Override
-        @ShadeViewRefactor(RefactorComponent.INPUT)
         public void onDragCancelled(View v) {
             mFalsingManager.onNotificatonStopDismissing();
-            setSwipingInProgress(false);
         }
 
         /**
@@ -5654,7 +5510,6 @@
          * re-invoking dismiss logic in case the notification has not made its way out yet).
          */
         @Override
-        @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
         public void onChildDismissed(View view) {
             ExpandableNotificationRow row = (ExpandableNotificationRow) view;
             if (!row.isDismissed()) {
@@ -5673,7 +5528,6 @@
          * @param view view (e.g. notification) to dismiss from the layout
          */
 
-        @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
         public void handleChildViewDismissed(View view) {
             if (mDismissAllInProgress) {
                 return;
@@ -5681,7 +5535,6 @@
 
             boolean isBlockingHelperShown = false;
 
-            setSwipingInProgress(false);
             if (mDragAnimPendingChildren.contains(view)) {
                 // We start the swipe and finish it in the same frame; we don't want a drag
                 // animation.
@@ -5715,13 +5568,11 @@
         }
 
         @Override
-        @ShadeViewRefactor(RefactorComponent.INPUT)
         public boolean isAntiFalsingNeeded() {
             return onKeyguard();
         }
 
         @Override
-        @ShadeViewRefactor(RefactorComponent.INPUT)
         public View getChildAtPosition(MotionEvent ev) {
             View child = NotificationStackScrollLayout.this.getChildAtPosition(ev.getX(),
                     ev.getY());
@@ -5744,10 +5595,8 @@
         }
 
         @Override
-        @ShadeViewRefactor(RefactorComponent.INPUT)
         public void onBeginDrag(View v) {
             mFalsingManager.onNotificatonStartDismissing();
-            setSwipingInProgress(true);
             mAmbientState.onBeginDrag(v);
             updateContinuousShadowDrawing();
             if (mAnimationsEnabled && (mIsExpanded || !isPinnedHeadsUp(v))) {
@@ -5758,7 +5607,6 @@
         }
 
         @Override
-        @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
         public void onChildSnappedBack(View animView, float targetLeft) {
             mAmbientState.onDragFinished(animView);
             updateContinuousShadowDrawing();
@@ -5780,7 +5628,6 @@
         }
 
         @Override
-        @ShadeViewRefactor(RefactorComponent.INPUT)
         public boolean updateSwipeProgress(View animView, boolean dismissable,
                 float swipeProgress) {
             // Returning true prevents alpha fading.
@@ -5788,7 +5635,6 @@
         }
 
         @Override
-        @ShadeViewRefactor(RefactorComponent.INPUT)
         public float getFalsingThresholdFactor() {
             return mStatusBar.isWakeUpComingFromTouch() ? 1.5f : 1.0f;
         }
@@ -5797,5 +5643,197 @@
         public boolean canChildBeDismissed(View v) {
             return NotificationStackScrollLayout.this.canChildBeDismissed(v);
         }
+    };
+
+    // ---------------------- DragDownHelper.OnDragDownListener ------------------------------------
+
+    @ShadeViewRefactor(RefactorComponent.INPUT)
+    private final DragDownCallback mDragDownCallback = new DragDownCallback() {
+
+        /* Only ever called as a consequence of a lockscreen expansion gesture. */
+        @Override
+        public boolean onDraggedDown(View startingChild, int dragLengthY) {
+            if (mStatusBarState == StatusBarState.KEYGUARD
+                    && hasActiveNotifications() && (!mStatusBar.isDozing()
+                    || mStatusBar.isPulsing())) {
+                mLockscreenGestureLogger.write(
+                        MetricsEvent.ACTION_LS_SHADE,
+                        (int) (dragLengthY / mDisplayMetrics.density),
+                        0 /* velocityDp - N/A */);
+
+                // We have notifications, go to locked shade.
+                mStatusBar.goToLockedShade(startingChild);
+                if (startingChild instanceof ExpandableNotificationRow) {
+                    ExpandableNotificationRow row = (ExpandableNotificationRow) startingChild;
+                    row.onExpandedByGesture(true /* drag down is always an open */);
+                }
+                return true;
+            } else {
+                // abort gesture.
+                return false;
+            }
+        }
+
+        @Override
+        public void onDragDownReset() {
+            setDimmed(true /* dimmed */, true /* animated */);
+            resetScrollPosition();
+            resetCheckSnoozeLeavebehind();
+        }
+
+        @Override
+        public void onCrossedThreshold(boolean above) {
+            setDimmed(!above /* dimmed */, true /* animate */);
+        }
+
+        @Override
+        public void onTouchSlopExceeded() {
+            cancelLongPress();
+            checkSnoozeLeavebehind();
+        }
+
+        @Override
+        public void setEmptyDragAmount(float amount) {
+            mNotificationPanel.setEmptyDragAmount(amount);
+        }
+
+        @Override
+        public boolean isFalsingCheckNeeded() {
+            return mStatusBarState == StatusBarState.KEYGUARD;
+        }
+    };
+
+    public DragDownCallback getDragDownCallback() { return mDragDownCallback; }
+
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
+    private final HeadsUpTouchHelper.Callback mHeadsUpCallback = new HeadsUpTouchHelper.Callback() {
+        @Override
+        public ExpandableView getChildAtRawPosition(float touchX, float touchY) {
+            return NotificationStackScrollLayout.this.getChildAtRawPosition(touchX, touchY);
+        }
+
+        @Override
+        public boolean isExpanded() {
+            return mIsExpanded;
+        }
+
+        @Override
+        public Context getContext() {
+            return mContext;
+        }
+    };
+
+    public HeadsUpTouchHelper.Callback getHeadsUpCallback() { return mHeadsUpCallback; }
+
+
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
+    private final OnGroupChangeListener mOnGroupChangeListener = new OnGroupChangeListener() {
+        @Override
+        public void onGroupExpansionChanged(ExpandableNotificationRow changedRow, boolean expanded) {
+            boolean animated = !mGroupExpandedForMeasure && mAnimationsEnabled
+                    && (mIsExpanded || changedRow.isPinned());
+            if (animated) {
+                mExpandedGroupView = changedRow;
+                mNeedsAnimation = true;
+            }
+            changedRow.setChildrenExpanded(expanded, animated);
+            if (!mGroupExpandedForMeasure) {
+                onHeightChanged(changedRow, false /* needsAnimation */);
+            }
+            runAfterAnimationFinished(new Runnable() {
+                @Override
+                public void run() {
+                    changedRow.onFinishedExpansionChange();
+                }
+            });
+        }
+
+        @Override
+        public void onGroupCreatedFromChildren(NotificationGroupManager.NotificationGroup group) {
+            mStatusBar.requestNotificationUpdate();
+        }
+
+        @Override
+        public void onGroupsChanged() {
+            mStatusBar.requestNotificationUpdate();
+        }
+    };
+
+    @ShadeViewRefactor(RefactorComponent.SHADE_VIEW)
+    private ExpandHelper.Callback mExpandHelperCallback = new ExpandHelper.Callback() {
+        @Override
+        public ExpandableView getChildAtPosition(float touchX, float touchY) {
+            return NotificationStackScrollLayout.this.getChildAtPosition(touchX, touchY);
+        }
+
+        @Override
+        public ExpandableView getChildAtRawPosition(float touchX, float touchY) {
+            return NotificationStackScrollLayout.this.getChildAtRawPosition(touchX, touchY);
+        }
+
+        @Override
+        public boolean canChildBeExpanded(View v) {
+            return v instanceof ExpandableNotificationRow
+                    && ((ExpandableNotificationRow) v).isExpandable()
+                    && !((ExpandableNotificationRow) v).areGutsExposed()
+                    && (mIsExpanded || !((ExpandableNotificationRow) v).isPinned());
+        }
+
+        /* Only ever called as a consequence of an expansion gesture in the shade. */
+        @Override
+        public void setUserExpandedChild(View v, boolean userExpanded) {
+            if (v instanceof ExpandableNotificationRow) {
+                ExpandableNotificationRow row = (ExpandableNotificationRow) v;
+                if (userExpanded && onKeyguard()) {
+                    // Due to a race when locking the screen while touching, a notification may be
+                    // expanded even after we went back to keyguard. An example of this happens if
+                    // you click in the empty space while expanding a group.
+
+                    // We also need to un-user lock it here, since otherwise the content height
+                    // calculated might be wrong. We also can't invert the two calls since
+                    // un-userlocking it will trigger a layout switch in the content view.
+                    row.setUserLocked(false);
+                    updateContentHeight();
+                    notifyHeightChangeListener(row);
+                    return;
+                }
+                row.setUserExpanded(userExpanded, true /* allowChildrenExpansion */);
+                row.onExpandedByGesture(userExpanded);
+            }
+        }
+
+        @Override
+        public void setExpansionCancelled(View v) {
+            if (v instanceof ExpandableNotificationRow) {
+                ((ExpandableNotificationRow) v).setGroupExpansionChanging(false);
+            }
+        }
+
+        @Override
+        public void setUserLockedChild(View v, boolean userLocked) {
+            if (v instanceof ExpandableNotificationRow) {
+                ((ExpandableNotificationRow) v).setUserLocked(userLocked);
+            }
+            cancelLongPress();
+            requestDisallowInterceptTouchEvent(true);
+        }
+
+        @Override
+        public void expansionStateChanged(boolean isExpanding) {
+            mExpandingNotification = isExpanding;
+            if (!mExpandedInThisMotion) {
+                mMaxScrollAfterExpand = mOwnScrollY;
+                mExpandedInThisMotion = true;
+            }
+        }
+
+        @Override
+        public int getMaxExpandHeight(ExpandableView view) {
+            return view.getMaxContentHeight();
+        }
+    };
+
+    public ExpandHelper.Callback getExpandHelperCallback() {
+        return mExpandHelperCallback;
     }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationSwipeHelper.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationSwipeHelper.java
index 028957d..599da3b 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationSwipeHelper.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/NotificationSwipeHelper.java
@@ -31,11 +31,9 @@
 import com.android.systemui.SwipeHelper;
 import com.android.systemui.plugins.statusbar.NotificationMenuRowPlugin;
 import com.android.systemui.plugins.statusbar.NotificationSwipeActionHelper;
-import com.android.systemui.statusbar.notification.ShadeViewRefactor;
 import com.android.systemui.statusbar.notification.row.ExpandableNotificationRow;
 import com.android.systemui.statusbar.notification.row.ExpandableView;
 
-@ShadeViewRefactor(ShadeViewRefactor.RefactorComponent.INPUT)
 class NotificationSwipeHelper extends SwipeHelper
         implements NotificationSwipeActionHelper {
     @VisibleForTesting
@@ -229,6 +227,7 @@
         if (mCallback.isExpanded()) {
             // We don't want to quick-dismiss when it's a heads up as this might lead to closing
             // of the panel early.
+            mSwipingInProgress = false;
             mCallback.handleChildViewDismissed(view);
         }
         mCallback.onDismiss();
@@ -248,6 +247,7 @@
     @Override
     public void snapChild(final View animView, final float targetLeft, float velocity) {
         superSnapChild(animView, targetLeft, velocity);
+        mSwipingInProgress = false;
         mCallback.onDragCancelled(animView);
         if (targetLeft == 0) {
             handleMenuCoveredOrDismissed();
@@ -354,6 +354,7 @@
 
     public void onMenuShown(View animView) {
         setExposedMenuView(getTranslatingParentView());
+        mSwipingInProgress = false;
         mCallback.onDragCancelled(animView);
         Handler handler = getHandler();
 
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/ViewState.java b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/ViewState.java
index 1f3244f..a15fd70 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/ViewState.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/notification/stack/ViewState.java
@@ -25,6 +25,7 @@
 import android.view.View;
 import android.view.animation.Interpolator;
 
+import com.android.systemui.Dumpable;
 import com.android.systemui.Interpolators;
 import com.android.systemui.R;
 import com.android.systemui.statusbar.notification.row.ExpandableView;
@@ -32,12 +33,17 @@
 import com.android.systemui.statusbar.notification.PropertyAnimator;
 import com.android.systemui.statusbar.policy.HeadsUpUtil;
 
+import java.io.FileDescriptor;
+import java.io.PrintWriter;
+import java.lang.reflect.Field;
+import java.lang.reflect.Modifier;
+
 /**
  * A state of a view. This can be used to apply a set of view properties to a view with
  * {@link com.android.systemui.statusbar.notification.stack.StackScrollState} or start
  * animations with {@link com.android.systemui.statusbar.notification.stack.StackStateAnimator}.
 */
-public class ViewState {
+public class ViewState implements Dumpable {
 
     /**
      * Some animation properties that can be used to update running animations but not creating
@@ -710,4 +716,39 @@
             animator.cancel();
         }
     }
+
+    @Override
+    public void dump(FileDescriptor fd, PrintWriter pw, String[] args) {
+        StringBuilder result = new StringBuilder();
+        result.append("ViewState { ");
+
+        boolean first = true;
+        Class currentClass = this.getClass();
+        while (currentClass != null) {
+            Field[] fields = currentClass.getDeclaredFields();
+            // Print field names paired with their values
+            for (Field field : fields) {
+                int modifiers = field.getModifiers();
+                if (Modifier.isStatic(modifiers) || field.isSynthetic()
+                        || Modifier.isTransient(modifiers)) {
+                    continue;
+                }
+                if (!first) {
+                    result.append(", ");
+                }
+                try {
+                    result.append(field.getName());
+                    result.append(": ");
+                    //requires access to private field:
+                    field.setAccessible(true);
+                    result.append(field.get(this));
+                } catch (IllegalAccessException ex) {
+                }
+                first = false;
+            }
+            currentClass = currentClass.getSuperclass();
+        }
+        result.append(" }");
+        pw.print(result);
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/HeadsUpTouchHelper.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/HeadsUpTouchHelper.java
index 4df1e3b..e4a5caa 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/HeadsUpTouchHelper.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/HeadsUpTouchHelper.java
@@ -32,7 +32,7 @@
 public class HeadsUpTouchHelper implements Gefingerpoken {
 
     private HeadsUpManagerPhone mHeadsUpManager;
-    private NotificationStackScrollLayout mStackScroller;
+    private Callback mCallback;
     private int mTrackingPointer;
     private float mTouchSlop;
     private float mInitialTouchX;
@@ -44,12 +44,12 @@
     private ExpandableNotificationRow mPickedChild;
 
     public HeadsUpTouchHelper(HeadsUpManagerPhone headsUpManager,
-            NotificationStackScrollLayout stackScroller,
+            Callback callback,
             NotificationPanelView notificationPanelView) {
         mHeadsUpManager = headsUpManager;
-        mStackScroller = stackScroller;
+        mCallback = callback;
         mPanel = notificationPanelView;
-        Context context = stackScroller.getContext();
+        Context context = mCallback.getContext();
         final ViewConfiguration configuration = ViewConfiguration.get(context);
         mTouchSlop = configuration.getScaledTouchSlop();
     }
@@ -75,13 +75,13 @@
                 mInitialTouchY = y;
                 mInitialTouchX = x;
                 setTrackingHeadsUp(false);
-                ExpandableView child = mStackScroller.getChildAtRawPosition(x, y);
+                ExpandableView child = mCallback.getChildAtRawPosition(x, y);
                 mTouchingHeadsUpView = false;
                 if (child instanceof ExpandableNotificationRow) {
                     mPickedChild = (ExpandableNotificationRow) child;
-                    mTouchingHeadsUpView = !mStackScroller.isExpanded()
+                    mTouchingHeadsUpView = !mCallback.isExpanded()
                             && mPickedChild.isHeadsUp() && mPickedChild.isPinned();
-                } else if (child == null && !mStackScroller.isExpanded()) {
+                } else if (child == null && !mCallback.isExpanded()) {
                     // We might touch above the visible heads up child, but then we still would
                     // like to capture it.
                     NotificationData.Entry topEntry = mHeadsUpManager.getTopEntry();
@@ -174,4 +174,10 @@
         mPickedChild = null;
         mTouchingHeadsUpView = false;
     }
+
+    public interface Callback {
+        ExpandableView getChildAtRawPosition(float touchX, float touchY);
+        boolean isExpanded();
+        Context getContext();
+    }
 }
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarFragment.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarFragment.java
index 99a2cdc..80f3506 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarFragment.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarFragment.java
@@ -284,8 +284,8 @@
         super.onViewCreated(view, savedInstanceState);
         mNavigationBarView = (NavigationBarView) view;
 
-        mNavigationBarView.setDisabledFlags(mDisabledFlags1);
         mNavigationBarView.setComponents(mStatusBar.getPanel());
+        mNavigationBarView.setDisabledFlags(mDisabledFlags1);
         mNavigationBarView.setOnVerticalChangedListener(this::onVerticalChanged);
         mNavigationBarView.setOnTouchListener(this::onNavigationTouch);
         if (savedInstanceState != null) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarView.java
index 980ba87..e92656ae 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NavigationBarView.java
@@ -60,7 +60,6 @@
 import com.android.systemui.Interpolators;
 import com.android.systemui.OverviewProxyService;
 import com.android.systemui.R;
-import com.android.systemui.RecentsComponent;
 import com.android.systemui.SysUiServiceProvider;
 import com.android.systemui.plugins.PluginListener;
 import com.android.systemui.shared.plugins.PluginManager;
@@ -71,7 +70,6 @@
 import com.android.systemui.shared.system.ActivityManagerWrapper;
 import com.android.systemui.shared.system.NavigationBarCompat;
 import com.android.systemui.shared.system.WindowManagerWrapper;
-import com.android.systemui.stackdivider.Divider;
 import com.android.systemui.statusbar.policy.DeadZone;
 import com.android.systemui.statusbar.policy.KeyButtonDrawable;
 
@@ -140,6 +138,7 @@
     private final SparseArray<ButtonDispatcher> mButtonDispatchers = new SparseArray<>();
     private final ContextualButtonGroup mContextualButtonGroup;
     private Configuration mConfiguration;
+    private Configuration mTmpLastConfiguration;
 
     private NavigationBarInflaterView mNavigationInflaterView;
     private RecentsOnboarding mRecentsOnboarding;
@@ -286,6 +285,7 @@
         mRecentsOnboarding = new RecentsOnboarding(context, mOverviewProxyService);
 
         mConfiguration = new Configuration();
+        mTmpLastConfiguration = new Configuration();
         mConfiguration.updateFrom(context.getResources().getConfiguration());
 
         mScreenPinningNotify = new ScreenPinningNotify(mContext);
@@ -445,13 +445,13 @@
     }
 
     private void reloadNavIcons() {
-        updateIcons(Configuration.EMPTY, mConfiguration);
+        updateIcons(Configuration.EMPTY);
     }
 
-    private void updateIcons(Configuration oldConfig, Configuration newConfig) {
-        final boolean orientationChange = oldConfig.orientation != newConfig.orientation;
-        final boolean densityChange = oldConfig.densityDpi != newConfig.densityDpi;
-        final boolean dirChange = oldConfig.getLayoutDirection() != newConfig.getLayoutDirection();
+    private void updateIcons(Configuration oldConfig) {
+        final boolean orientationChange = oldConfig.orientation != mConfiguration.orientation;
+        final boolean densityChange = oldConfig.densityDpi != mConfiguration.densityDpi;
+        final boolean dirChange = oldConfig.getLayoutDirection() != mConfiguration.getLayoutDirection();
 
         if (orientationChange || densityChange) {
             mDockedIcon = getDrawable(R.drawable.ic_sysbar_docked);
@@ -485,7 +485,7 @@
     private void orientBackButton(KeyButtonDrawable drawable) {
         final boolean useAltBack =
                 (mNavigationIconHints & StatusBarManager.NAVIGATION_HINT_BACK_ALT) != 0;
-        final boolean isRtl = getLayoutDirection() == View.LAYOUT_DIRECTION_RTL;
+        final boolean isRtl = mConfiguration.getLayoutDirection() == View.LAYOUT_DIRECTION_RTL;
         float degrees = useAltBack
                 ? (isRtl ? 270 : -90)
                 : (isRtl ? 180 : 0);
@@ -946,26 +946,27 @@
     @Override
     protected void onConfigurationChanged(Configuration newConfig) {
         super.onConfigurationChanged(newConfig);
-        boolean uiCarModeChanged = updateCarMode(newConfig);
+        mTmpLastConfiguration.updateFrom(mConfiguration);
+        mConfiguration.updateFrom(newConfig);
+        boolean uiCarModeChanged = updateCarMode();
         updateTaskSwitchHelper();
-        updateIcons(mConfiguration, newConfig);
+        updateIcons(mTmpLastConfiguration);
         updateRecentsIcon();
-        mRecentsOnboarding.onConfigurationChanged(newConfig);
-        if (uiCarModeChanged || mConfiguration.densityDpi != newConfig.densityDpi
-                || mConfiguration.getLayoutDirection() != newConfig.getLayoutDirection()) {
+        mRecentsOnboarding.onConfigurationChanged(mConfiguration);
+        if (uiCarModeChanged || mTmpLastConfiguration.densityDpi != mConfiguration.densityDpi
+                || mTmpLastConfiguration.getLayoutDirection() != mConfiguration.getLayoutDirection()) {
             // If car mode or density changes, we need to reset the icons.
             updateNavButtonIcons();
         }
-        mConfiguration.updateFrom(newConfig);
     }
 
     /**
      * If the configuration changed, update the carmode and return that it was updated.
      */
-    private boolean updateCarMode(Configuration newConfig) {
+    private boolean updateCarMode() {
         boolean uiCarModeChanged = false;
-        if (newConfig != null) {
-            int uiMode = newConfig.uiMode & Configuration.UI_MODE_TYPE_MASK;
+        if (mConfiguration != null) {
+            int uiMode = mConfiguration.uiMode & Configuration.UI_MODE_TYPE_MASK;
             final boolean isCarMode = (uiMode == Configuration.UI_MODE_TYPE_CAR);
 
             if (isCarMode != mInCarMode) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
index 6d53cd3..7507702 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/NotificationPanelView.java
@@ -2521,8 +2521,8 @@
     @Override
     public void setHeadsUpManager(HeadsUpManagerPhone headsUpManager) {
         super.setHeadsUpManager(headsUpManager);
-        mHeadsUpTouchHelper = new HeadsUpTouchHelper(headsUpManager, mNotificationStackScroller,
-                this);
+        mHeadsUpTouchHelper = new HeadsUpTouchHelper(headsUpManager,
+                mNotificationStackScroller.getHeadsUpCallback(), this);
     }
 
     public void setTrackedHeadsUp(ExpandableNotificationRow pickedChild) {
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBar.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBar.java
index 3bdd601..cc9adb8 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBar.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBar.java
@@ -5277,8 +5277,7 @@
             (Runnable saveImportance, StatusBarNotification sbn) -> {
                 // If the user has security enabled, show challenge if the setting is changed.
                 if (mLockscreenUserManager.isLockscreenPublicMode(sbn.getUser().getIdentifier())
-                        && (mState == StatusBarState.KEYGUARD ||
-                                mState == StatusBarState.SHADE_LOCKED)) {
+                        && mKeyguardManager.isKeyguardLocked()) {
                     onLockedNotificationImportanceChange(() -> {
                         saveImportance.run();
                         return true;
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarWindowView.java b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarWindowView.java
index 45b32c7..ad9b9b3 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarWindowView.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/phone/StatusBarWindowView.java
@@ -58,6 +58,7 @@
 import com.android.internal.view.FloatingActionMode;
 import com.android.internal.widget.FloatingToolbar;
 import com.android.systemui.Dependency;
+import com.android.systemui.ExpandHelper;
 import com.android.systemui.R;
 import com.android.systemui.classifier.FalsingManager;
 import com.android.systemui.statusbar.DragDownHelper;
@@ -182,6 +183,11 @@
         }
     }
 
+    @VisibleForTesting
+    protected NotificationStackScrollLayout getStackScrollLayout() {
+        return mStackScrollLayout;
+    }
+
     @Override
     public FrameLayout.LayoutParams generateLayoutParams(AttributeSet attrs) {
         return new LayoutParams(getContext(), attrs);
@@ -215,8 +221,11 @@
 
     public void setService(StatusBar service) {
         mService = service;
-        setDragDownHelper(new DragDownHelper(getContext(), this, mStackScrollLayout,
-                mStackScrollLayout));
+        NotificationStackScrollLayout stackScrollLayout = getStackScrollLayout();
+        ExpandHelper.Callback expandHelperCallback = stackScrollLayout.getExpandHelperCallback();
+        DragDownHelper.DragDownCallback dragDownCallback = stackScrollLayout.getDragDownCallback();
+        setDragDownHelper(new DragDownHelper(getContext(), this, expandHelperCallback,
+                dragDownCallback));
     }
 
     @VisibleForTesting
@@ -309,7 +318,7 @@
             }
         }
         if (isDown) {
-            mStackScrollLayout.closeControlsIfOutsideTouch(ev);
+            getStackScrollLayout().closeControlsIfOutsideTouch(ev);
         }
         if (mService.isDozing()) {
             mService.mDozeScrimController.extendPulse();
@@ -331,13 +340,14 @@
 
     @Override
     public boolean onInterceptTouchEvent(MotionEvent ev) {
-        if (mService.isDozing() && !mStackScrollLayout.hasPulsingNotifications()) {
+        NotificationStackScrollLayout stackScrollLayout = getStackScrollLayout();
+        if (mService.isDozing() && !stackScrollLayout.hasPulsingNotifications()) {
             // Capture all touch events in always-on.
             return true;
         }
         boolean intercept = false;
         if (mNotificationPanel.isFullyExpanded()
-                && mStackScrollLayout.getVisibility() == View.VISIBLE
+                && stackScrollLayout.getVisibility() == View.VISIBLE
                 && mStatusBarStateController.getState() == StatusBarState.KEYGUARD
                 && !mService.isBouncerShowing()
                 && !mService.isDozing()) {
@@ -349,7 +359,7 @@
         if (intercept) {
             MotionEvent cancellation = MotionEvent.obtain(ev);
             cancellation.setAction(MotionEvent.ACTION_CANCEL);
-            mStackScrollLayout.onInterceptTouchEvent(cancellation);
+            stackScrollLayout.onInterceptTouchEvent(cancellation);
             mNotificationPanel.onInterceptTouchEvent(cancellation);
             cancellation.recycle();
         }
@@ -391,8 +401,9 @@
     }
 
     public void cancelExpandHelper() {
-        if (mStackScrollLayout != null) {
-            mStackScrollLayout.cancelExpandHelper();
+        NotificationStackScrollLayout stackScrollLayout = getStackScrollLayout();
+        if (stackScrollLayout != null) {
+            stackScrollLayout.cancelExpandHelper();
         }
     }
 
diff --git a/packages/SystemUI/src/com/android/systemui/statusbar/policy/NetworkControllerImpl.java b/packages/SystemUI/src/com/android/systemui/statusbar/policy/NetworkControllerImpl.java
index 24a28cb..70a3589 100644
--- a/packages/SystemUI/src/com/android/systemui/statusbar/policy/NetworkControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/statusbar/policy/NetworkControllerImpl.java
@@ -461,6 +461,8 @@
                     MobileSignalController controller = mMobileSignalControllers.valueAt(i);
                     controller.handleBroadcast(intent);
                 }
+                mConfig = Config.readConfig(mContext);
+                mReceiverHandler.post(this::handleConfigurationChanged);
                 break;
             case TelephonyIntents.ACTION_SIM_STATE_CHANGED:
                 // Avoid rebroadcast because SysUI is direct boot aware.
@@ -1042,18 +1044,23 @@
             config.showAtLeast3G = res.getBoolean(R.bool.config_showMin3G);
             config.alwaysShowCdmaRssi =
                     res.getBoolean(com.android.internal.R.bool.config_alwaysUseCdmaRssi);
-            config.show4gForLte = res.getBoolean(R.bool.config_show4GForLTE);
             config.hspaDataDistinguishable =
                     res.getBoolean(R.bool.config_hspa_data_distinguishable);
-            config.hideLtePlus = res.getBoolean(R.bool.config_hideLtePlus);
             config.inflateSignalStrengths = res.getBoolean(R.bool.config_inflateSignalStrength);
 
             CarrierConfigManager configMgr = (CarrierConfigManager)
                     context.getSystemService(Context.CARRIER_CONFIG_SERVICE);
-            PersistableBundle b = configMgr.getConfig();
+            // Handle specific carrier config values for the default data SIM
+            int defaultDataSubId = SubscriptionManager.from(context)
+                    .getDefaultDataSubscriptionId();
+            PersistableBundle b = configMgr.getConfigForSubId(defaultDataSubId);
             if (b != null) {
                 config.alwaysShowDataRatIcon = b.getBoolean(
                         CarrierConfigManager.KEY_ALWAYS_SHOW_DATA_RAT_ICON_BOOL);
+                config.show4gForLte = b.getBoolean(
+                        CarrierConfigManager.KEY_SHOW_4G_FOR_LTE_DATA_ICON_BOOL);
+                config.hideLtePlus = b.getBoolean(
+                        CarrierConfigManager.KEY_HIDE_LTE_PLUS_DATA_ICON_BOOL);
             }
             return config;
         }
diff --git a/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogControllerImpl.java b/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogControllerImpl.java
index a97effd..e20e267 100644
--- a/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogControllerImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogControllerImpl.java
@@ -956,11 +956,13 @@
                 changed |= onVolumeChangedW(stream, 0);
             } else if (action.equals(AudioManager.RINGER_MODE_CHANGED_ACTION)) {
                 final int rm = intent.getIntExtra(AudioManager.EXTRA_RINGER_MODE, -1);
+                if (isInitialStickyBroadcast()) mState.ringerModeExternal = rm;
                 if (D.BUG) Log.d(TAG, "onReceive RINGER_MODE_CHANGED_ACTION rm="
                         + Util.ringerModeToString(rm));
                 changed = updateRingerModeExternalW(rm);
             } else if (action.equals(AudioManager.INTERNAL_RINGER_MODE_CHANGED_ACTION)) {
                 final int rm = intent.getIntExtra(AudioManager.EXTRA_RINGER_MODE, -1);
+                if (isInitialStickyBroadcast()) mState.ringerModeInternal = rm;
                 if (D.BUG) Log.d(TAG, "onReceive INTERNAL_RINGER_MODE_CHANGED_ACTION rm="
                         + Util.ringerModeToString(rm));
                 changed = updateRingerModeInternalW(rm);
diff --git a/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogImpl.java b/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogImpl.java
index 7abac00..798f8bc 100644
--- a/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogImpl.java
+++ b/packages/SystemUI/src/com/android/systemui/volume/VolumeDialogImpl.java
@@ -135,10 +135,6 @@
     private final AccessibilityManagerWrapper mAccessibilityMgr;
     private final Object mSafetyWarningLock = new Object();
     private final Accessibility mAccessibility = new Accessibility();
-    private ColorStateList mActiveTint;
-    private int mActiveAlpha;
-    private ColorStateList mInactiveTint;
-    private int mInactiveAlpha;
 
     private boolean mShowing;
     private boolean mShowA11yStream;
@@ -238,11 +234,6 @@
         lp.gravity = ((FrameLayout.LayoutParams) mDialogView.getLayoutParams()).gravity;
         mWindow.setAttributes(lp);
 
-        mActiveTint = Utils.getColorAccent(mContext);
-        mActiveAlpha = Color.alpha(mActiveTint.getDefaultColor());
-        mInactiveTint = Utils.getColorAttr(mContext, android.R.attr.colorForeground);
-        mInactiveAlpha = getAlphaAttr(android.R.attr.secondaryContentAlpha);
-
         mDialogRowsView = mDialog.findViewById(R.id.volume_dialog_rows);
         mRinger = mDialog.findViewById(R.id.ringer);
         if (mRinger != null) {
@@ -942,8 +933,12 @@
             row.slider.requestFocus();
         }
         boolean useActiveColoring = isActive && row.slider.isEnabled();
-        final ColorStateList tint = useActiveColoring ? mActiveTint : mInactiveTint;
-        final int alpha = useActiveColoring ? mActiveAlpha : mInactiveAlpha;
+        final ColorStateList tint = useActiveColoring
+                ? Utils.getColorAccent(mContext)
+                : Utils.getColorAttr(mContext, android.R.attr.colorForeground);
+        final int alpha = useActiveColoring
+                ? Color.alpha(tint.getDefaultColor())
+                : getAlphaAttr(android.R.attr.secondaryContentAlpha);
         if (tint == row.cachedTint) return;
         row.slider.setProgressTintList(tint);
         row.slider.setThumbTintList(tint);
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/NotificationViewHierarchyManagerTest.java b/packages/SystemUI/tests/src/com/android/systemui/statusbar/NotificationViewHierarchyManagerTest.java
index 15c18e9..6b4ccc4 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/NotificationViewHierarchyManagerTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/NotificationViewHierarchyManagerTest.java
@@ -218,6 +218,9 @@
         public void generateChildOrderChangedEvent() {}
 
         @Override
+        public void onReset(ExpandableView view) {}
+
+        @Override
         public int getContainerChildCount() {
             return mRows.size();
         }
diff --git a/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarWindowViewTest.java b/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarWindowViewTest.java
index 445a194..46335dc 100644
--- a/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarWindowViewTest.java
+++ b/packages/SystemUI/tests/src/com/android/systemui/statusbar/phone/StatusBarWindowViewTest.java
@@ -17,11 +17,11 @@
 package com.android.systemui.statusbar.phone;
 
 import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.spy;
 import static org.mockito.Mockito.verify;
 import static org.mockito.Mockito.when;
 
 import android.os.SystemClock;
-import android.support.test.InstrumentationRegistry;
 import android.support.test.filters.SmallTest;
 import android.support.test.runner.AndroidJUnit4;
 import android.view.MotionEvent;
@@ -31,6 +31,7 @@
 import com.android.systemui.statusbar.DragDownHelper;
 import com.android.systemui.statusbar.StatusBarState;
 import com.android.systemui.statusbar.StatusBarStateController;
+import com.android.systemui.statusbar.notification.stack.NotificationStackScrollLayout;
 
 import org.junit.Before;
 import org.junit.Test;
@@ -43,11 +44,14 @@
     private StatusBarWindowView mView;
     private StatusBar mStatusBar;
     private DragDownHelper mDragDownHelper;
+    private NotificationStackScrollLayout mStackScrollLayout;
 
     @Before
     public void setUp() {
         mDependency.injectMockDependency(StatusBarStateController.class);
-        mView = new StatusBarWindowView(getContext(), null);
+        mView = spy(new StatusBarWindowView(getContext(), null));
+        mStackScrollLayout = mock(NotificationStackScrollLayout.class);
+        when(mView.getStackScrollLayout()).thenReturn(mStackScrollLayout);
         mStatusBar = mock(StatusBar.class);
         mView.setService(mStatusBar);
         mDragDownHelper = mock(DragDownHelper.class);
diff --git a/services/autofill/java/com/android/server/autofill/AutofillManagerService.java b/services/autofill/java/com/android/server/autofill/AutofillManagerService.java
index af33bd0..d3842b7 100644
--- a/services/autofill/java/com/android/server/autofill/AutofillManagerService.java
+++ b/services/autofill/java/com/android/server/autofill/AutofillManagerService.java
@@ -182,9 +182,7 @@
             final int userId = users.get(i).id;
             final boolean disabled = umi.getUserRestriction(userId, UserManager.DISALLOW_AUTOFILL);
             if (disabled) {
-                if (disabled) {
-                    Slog.i(TAG, "Disabling Autofill for user " + userId);
-                }
+                Slog.i(TAG, "Disabling Autofill for user " + userId);
                 mDisabledUsers.put(userId, disabled);
             }
         }
diff --git a/services/autofill/java/com/android/server/autofill/AutofillManagerServiceImpl.java b/services/autofill/java/com/android/server/autofill/AutofillManagerServiceImpl.java
index 78facf8..14d68cb 100644
--- a/services/autofill/java/com/android/server/autofill/AutofillManagerServiceImpl.java
+++ b/services/autofill/java/com/android/server/autofill/AutofillManagerServiceImpl.java
@@ -185,23 +185,6 @@
         updateLocked(disabled);
     }
 
-    @Nullable
-    CharSequence getServiceName() {
-        final String packageName = getServicePackageName();
-        if (packageName == null) {
-            return null;
-        }
-
-        try {
-            final PackageManager pm = mContext.getPackageManager();
-            final ApplicationInfo info = pm.getApplicationInfo(packageName, 0);
-            return pm.getApplicationLabel(info);
-        } catch (Exception e) {
-            Slog.e(TAG, "Could not get label for " + packageName + ": " + e);
-            return packageName;
-        }
-    }
-
     @GuardedBy("mLock")
     private int getServiceUidLocked() {
         if (mInfo == null) {
@@ -226,6 +209,7 @@
         return null;
     }
 
+    @Nullable
     ComponentName getServiceComponentName() {
         synchronized (mLock) {
             if (mInfo == null) {
@@ -706,17 +690,27 @@
         }
     }
 
-    @NonNull
-    CharSequence getServiceLabel() {
-        final CharSequence label = mInfo.getServiceInfo().loadSafeLabel(
+    /**
+     * Gets the user-visibile name of the service this service binds to, or {@code null} if the
+     * service is disabled.
+     */
+    @Nullable
+    @GuardedBy("mLock")
+    public CharSequence getServiceLabelLocked() {
+        return mInfo == null ? null : mInfo.getServiceInfo().loadSafeLabel(
                 mContext.getPackageManager(), 0 /* do not ellipsize */,
                 PackageItemInfo.SAFE_LABEL_FLAG_FIRST_LINE | PackageItemInfo.SAFE_LABEL_FLAG_TRIM);
-        return label;
     }
 
+    /**
+     * Gets the icon of the service this service binds to, or {@code null} if the service is
+     * disabled.
+     */
     @NonNull
-    Drawable getServiceIcon() {
-        return mInfo.getServiceInfo().loadIcon(mContext.getPackageManager());
+    @Nullable
+    @GuardedBy("mLock")
+    Drawable getServiceIconLocked() {
+        return mInfo == null ? null : mInfo.getServiceInfo().loadIcon(mContext.getPackageManager());
     }
 
     /**
@@ -959,7 +953,7 @@
         } else {
             pw.println();
             mInfo.dump(prefix2, pw);
-            pw.print(prefix); pw.print("Service Label: "); pw.println(getServiceLabel());
+            pw.print(prefix); pw.print("Service Label: "); pw.println(getServiceLabelLocked());
             pw.print(prefix); pw.print("Target SDK: "); pw.println(getTargedSdkLocked());
         }
         pw.print(prefix); pw.print("Component from settings: ");
diff --git a/services/autofill/java/com/android/server/autofill/Session.java b/services/autofill/java/com/android/server/autofill/Session.java
index c1b620c..f85749a 100644
--- a/services/autofill/java/com/android/server/autofill/Session.java
+++ b/services/autofill/java/com/android/server/autofill/Session.java
@@ -48,6 +48,7 @@
 import android.content.IntentSender;
 import android.graphics.Bitmap;
 import android.graphics.Rect;
+import android.graphics.drawable.Drawable;
 import android.metrics.LogMaker;
 import android.os.Binder;
 import android.os.Build;
@@ -311,8 +312,8 @@
                                 Slog.d(TAG, "Setting urlBar as id=" + urlBarId + " and domain "
                                         + mUrlBar.getWebDomain());
                             }
-                            final ViewState viewState = new ViewState(Session.this, urlBarId,
-                                    Session.this, ViewState.STATE_URL_BAR);
+                            final ViewState viewState = new ViewState(urlBarId, Session.this,
+                                    ViewState.STATE_URL_BAR);
                             mViewStates.put(urlBarId, viewState);
                         }
                     }
@@ -1749,7 +1750,18 @@
 
                 final IAutoFillManagerClient client = getClient();
                 mPendingSaveUi = new PendingUi(mActivityToken, id, client);
-                getUiForShowing().showSaveUi(mService.getServiceLabel(), mService.getServiceIcon(),
+
+                final CharSequence serviceLabel;
+                final Drawable serviceIcon;
+                synchronized (mLock) {
+                    serviceLabel = mService.getServiceLabelLocked();
+                    serviceIcon = mService.getServiceIconLocked();
+                }
+                if (serviceLabel == null || serviceIcon == null) {
+                    wtf(null, "showSaveLocked(): no service label or icon");
+                    return true;
+                }
+                getUiForShowing().showSaveUi(serviceLabel, serviceIcon,
                         mService.getServicePackageName(), saveInfo, this,
                         mComponentName, this, mPendingSaveUi, isUpdate, mCompatMode);
                 if (client != null) {
@@ -1801,8 +1813,6 @@
         return sanitizers;
     }
 
-    // TODO: this method is called a few times in the save process, we should cache its results into
-    // ViewState.
     @Nullable
     private AutofillValue getSanitizedValue(
             @Nullable ArrayMap<AutofillId, InternalSanitizer> sanitizers,
@@ -1810,13 +1820,22 @@
             @Nullable AutofillValue value) {
         if (sanitizers == null || value == null) return value;
 
-        final InternalSanitizer sanitizer = sanitizers.get(id);
-        if (sanitizer == null) {
-            return value;
-        }
+        final ViewState state = mViewStates.get(id);
+        AutofillValue sanitized = state == null ? null : state.getSanitizedValue();
+        if (sanitized == null) {
+            final InternalSanitizer sanitizer = sanitizers.get(id);
+            if (sanitizer == null) {
+                return value;
+            }
 
-        final AutofillValue sanitized = sanitizer.sanitize(value);
-        if (sDebug) Slog.d(TAG, "Value for " + id + "(" + value + ") sanitized to " + sanitized);
+            sanitized = sanitizer.sanitize(value);
+            if (sDebug) {
+                Slog.d(TAG, "Value for " + id + "(" + value + ") sanitized to " + sanitized);
+            }
+            if (state != null) {
+                state.setSanitizedValue(sanitized);
+            }
+        }
         return sanitized;
     }
 
@@ -2137,7 +2156,7 @@
                     || action == ACTION_VIEW_ENTERED) {
                 if (sVerbose) Slog.v(TAG, "Creating viewState for " + id);
                 boolean isIgnored = isIgnoredLocked(id);
-                viewState = new ViewState(this, id, this,
+                viewState = new ViewState(id, this,
                         isIgnored ? ViewState.STATE_IGNORED : ViewState.STATE_INITIAL);
                 mViewStates.put(id, viewState);
 
@@ -2318,9 +2337,19 @@
             filterText = value.getTextValue().toString();
         }
 
+        final CharSequence serviceLabel;
+        final Drawable serviceIcon;
+        synchronized (mLock) {
+            serviceLabel = mService.getServiceLabelLocked();
+            serviceIcon = mService.getServiceIconLocked();
+        }
+        if (serviceLabel == null || serviceIcon == null) {
+            wtf(null, "onFillReady(): no service label or icon");
+            return;
+        }
         getUiForShowing().showFillUi(filledId, response, filterText,
                 mService.getServicePackageName(), mComponentName,
-                mService.getServiceLabel(), mService.getServiceIcon(), this, id, mCompatMode);
+                serviceLabel, serviceIcon, this, id, mCompatMode);
 
         synchronized (mLock) {
             if (mUiShownTime == 0) {
@@ -2607,7 +2636,7 @@
         if (viewState != null)  {
             viewState.setState(state);
         } else {
-            viewState = new ViewState(this, id, this, state);
+            viewState = new ViewState(id, this, state);
             if (sVerbose) {
                 Slog.v(TAG, "Adding autofillable view with id " + id + " and state " + state);
             }
@@ -2655,12 +2684,6 @@
         }
     }
 
-    CharSequence getServiceName() {
-        synchronized (mLock) {
-            return mService.getServiceName();
-        }
-    }
-
     // TODO: this should never be null, but we got at least one occurrence, probably due to a race.
     @GuardedBy("mLock")
     @Nullable
diff --git a/services/autofill/java/com/android/server/autofill/ViewState.java b/services/autofill/java/com/android/server/autofill/ViewState.java
index a8dae03..2cc6d20 100644
--- a/services/autofill/java/com/android/server/autofill/ViewState.java
+++ b/services/autofill/java/com/android/server/autofill/ViewState.java
@@ -77,7 +77,6 @@
     public final AutofillId id;
 
     private final Listener mListener;
-    private final Session mSession;
 
     private FillResponse mResponse;
     private AutofillValue mCurrentValue;
@@ -87,8 +86,7 @@
     private int mState;
     private String mDatasetId;
 
-    ViewState(Session session, AutofillId id, Listener listener, int state) {
-        mSession = session;
+    ViewState(AutofillId id, Listener listener, int state) {
         this.id = id;
         mListener = listener;
         mState = state;
@@ -141,10 +139,6 @@
         mResponse = response;
     }
 
-    CharSequence getServiceName() {
-        return mSession.getServiceName();
-    }
-
     int getState() {
         return mState;
     }
diff --git a/services/core/java/com/android/server/ConnectivityService.java b/services/core/java/com/android/server/ConnectivityService.java
index b750d79..1c8d99a 100644
--- a/services/core/java/com/android/server/ConnectivityService.java
+++ b/services/core/java/com/android/server/ConnectivityService.java
@@ -35,6 +35,8 @@
 import static android.net.NetworkCapabilities.NET_CAPABILITY_NOT_VPN;
 import static android.net.NetworkCapabilities.NET_CAPABILITY_VALIDATED;
 import static android.net.NetworkCapabilities.TRANSPORT_VPN;
+import static android.net.NetworkPolicyManager.RULE_NONE;
+import static android.net.NetworkPolicyManager.uidRulesToString;
 import static android.os.Process.INVALID_UID;
 import static android.system.OsConstants.IPPROTO_TCP;
 import static android.system.OsConstants.IPPROTO_UDP;
@@ -189,6 +191,7 @@
 import java.util.Arrays;
 import java.util.Collection;
 import java.util.Comparator;
+import java.util.ConcurrentModificationException;
 import java.util.HashMap;
 import java.util.HashSet;
 import java.util.List;
@@ -257,6 +260,14 @@
     @GuardedBy("mVpns")
     private LockdownVpnTracker mLockdownTracker;
 
+    /**
+     * Stale copy of uid rules provided by NPMS. As long as they are accessed only in internal
+     * handler thread, they don't need a lock.
+     */
+    private SparseIntArray mUidRules = new SparseIntArray();
+    /** Flag indicating if background data is restricted. */
+    private boolean mRestrictBackground;
+
     final private Context mContext;
     // 0 is full bad, 100 is full good
     private int mDefaultInetConditionPublished = 0;
@@ -419,6 +430,16 @@
     // Handle private DNS validation status updates.
     private static final int EVENT_PRIVATE_DNS_VALIDATION_UPDATE = 38;
 
+    /**
+     * Used to handle onUidRulesChanged event from NetworkPolicyManagerService.
+     */
+    private static final int EVENT_UID_RULES_CHANGED = 39;
+
+    /**
+     * Used to handle onRestrictBackgroundChanged event from NetworkPolicyManagerService.
+     */
+    private static final int EVENT_DATA_SAVER_CHANGED = 40;
+
     private static String eventName(int what) {
         return sMagicDecoderRing.get(what, Integer.toString(what));
     }
@@ -780,6 +801,9 @@
         mKeyStore = KeyStore.getInstance();
         mTelephonyManager = (TelephonyManager) mContext.getSystemService(Context.TELEPHONY_SERVICE);
 
+        // To ensure uid rules are synchronized with Network Policy, register for
+        // NetworkPolicyManagerService events must happen prior to NetworkPolicyManagerService
+        // reading existing policy from disk.
         try {
             mPolicyManager.registerListener(mPolicyListener);
         } catch (RemoteException e) {
@@ -910,7 +934,8 @@
         registerPrivateDnsSettingsCallbacks();
     }
 
-    private Tethering makeTethering() {
+    @VisibleForTesting
+    protected Tethering makeTethering() {
         // TODO: Move other elements into @Overridden getters.
         final TetheringDependencies deps = new TetheringDependencies() {
             @Override
@@ -1116,11 +1141,6 @@
         if (ignoreBlocked) {
             return false;
         }
-        // Networks are never blocked for system services
-        // TODO: consider moving this check to NetworkPolicyManagerInternal.isUidNetworkingBlocked.
-        if (isSystem(uid)) {
-            return false;
-        }
         synchronized (mVpns) {
             final Vpn vpn = mVpns.get(UserHandle.getUserId(uid));
             if (vpn != null && vpn.isBlockingUid(uid)) {
@@ -1150,6 +1170,17 @@
         mNetworkInfoBlockingLogs.log(action + " " + uid);
     }
 
+    private void maybeLogBlockedStatusChanged(NetworkRequestInfo nri, Network net,
+            boolean blocked) {
+        if (nri == null || net == null || !LOGD_BLOCKED_NETWORKINFO) {
+            return;
+        }
+        String action = blocked ? "BLOCKED" : "UNBLOCKED";
+        log(String.format("Blocked status changed to %s for %d(%d) on netId %d", blocked,
+                nri.mUid, nri.request.requestId, net.netId));
+        mNetworkInfoBlockingLogs.log(action + " " + nri.mUid);
+    }
+
     /**
      * Apply any relevant filters to {@link NetworkState} for the given UID. For
      * example, this may mark the network as {@link DetailedState#BLOCKED} based
@@ -1651,10 +1682,17 @@
     private final INetworkPolicyListener mPolicyListener = new NetworkPolicyManager.Listener() {
         @Override
         public void onUidRulesChanged(int uid, int uidRules) {
-            // TODO: notify UID when it has requested targeted updates
+            mHandler.sendMessage(mHandler.obtainMessage(EVENT_UID_RULES_CHANGED, uid, uidRules));
         }
         @Override
         public void onRestrictBackgroundChanged(boolean restrictBackground) {
+            // caller is NPMS, since we only register with them
+            if (LOGD_BLOCKED_NETWORKINFO) {
+                log("onRestrictBackgroundChanged(restrictBackground=" + restrictBackground + ")");
+            }
+            mHandler.sendMessage(mHandler.obtainMessage(
+                    EVENT_DATA_SAVER_CHANGED, restrictBackground ? 1 : 0, 0));
+
             // TODO: relocate this specific callback in Tethering.
             if (restrictBackground) {
                 log("onRestrictBackgroundChanged(true): disabling tethering");
@@ -1663,6 +1701,50 @@
         }
     };
 
+    void handleUidRulesChanged(int uid, int newRules) {
+        // skip update when we've already applied rules
+        final int oldRules = mUidRules.get(uid, RULE_NONE);
+        if (oldRules == newRules) return;
+
+        maybeNotifyNetworkBlockedForNewUidRules(uid, newRules);
+
+        if (newRules == RULE_NONE) {
+            mUidRules.delete(uid);
+        } else {
+            mUidRules.put(uid, newRules);
+        }
+    }
+
+    void handleRestrictBackgroundChanged(boolean restrictBackground) {
+        if (mRestrictBackground == restrictBackground) return;
+
+        for (final NetworkAgentInfo nai : mNetworkAgentInfos.values()) {
+            final boolean curMetered = nai.networkCapabilities.isMetered();
+            maybeNotifyNetworkBlocked(nai, curMetered, curMetered, mRestrictBackground,
+                    restrictBackground);
+        }
+
+        mRestrictBackground = restrictBackground;
+    }
+
+    private boolean isUidNetworkingWithVpnBlocked(int uid, int uidRules, boolean isNetworkMetered,
+            boolean isBackgroundRestricted) {
+        synchronized (mVpns) {
+            final Vpn vpn = mVpns.get(UserHandle.getUserId(uid));
+            // Because the return value of this function depends on the list of UIDs the
+            // always-on VPN blocks when in lockdown mode, when the always-on VPN changes that
+            // list all state depending on the return value of this function has to be recomputed.
+            // TODO: add a trigger when the always-on VPN sets its blocked UIDs to reevaluate and
+            // send the necessary onBlockedStatusChanged callbacks.
+            if (vpn != null && vpn.isBlockingUid(uid)) {
+                return true;
+            }
+        }
+
+        return mPolicyManagerInternal.isUidNetworkingBlocked(uid, uidRules,
+                isNetworkMetered, isBackgroundRestricted);
+    }
+
     /**
      * Require that the caller is either in the same user or has appropriate permission to interact
      * across users.
@@ -2118,6 +2200,28 @@
         pw.decreaseIndent();
         pw.println();
 
+        pw.print("Restrict background: ");
+        pw.println(mRestrictBackground);
+        pw.println();
+
+        pw.println("Status for known UIDs:");
+        pw.increaseIndent();
+        final int size = mUidRules.size();
+        for (int i = 0; i < size; i++) {
+            // Don't crash if the array is modified while dumping in bugreports.
+            try {
+                final int uid = mUidRules.keyAt(i);
+                final int uidRules = mUidRules.get(uid, RULE_NONE);
+                pw.println("UID=" + uid + " rules=" + uidRulesToString(uidRules));
+            } catch (ArrayIndexOutOfBoundsException e) {
+                pw.println("  ArrayIndexOutOfBoundsException");
+            } catch (ConcurrentModificationException e) {
+                pw.println("  ConcurrentModificationException");
+            }
+        }
+        pw.println();
+        pw.decreaseIndent();
+
         pw.println("Network Requests:");
         pw.increaseIndent();
         dumpNetworkRequests(pw);
@@ -3195,6 +3299,12 @@
                     handlePrivateDnsValidationUpdate(
                             (PrivateDnsValidationUpdate) msg.obj);
                     break;
+                case EVENT_UID_RULES_CHANGED:
+                    handleUidRulesChanged(msg.arg1, msg.arg2);
+                    break;
+                case EVENT_DATA_SAVER_CHANGED:
+                    handleRestrictBackgroundChanged(toBool(msg.arg1));
+                    break;
             }
         }
     }
@@ -3783,6 +3893,8 @@
     private void setLockdownTracker(LockdownVpnTracker tracker) {
         // Shutdown any existing tracker
         final LockdownVpnTracker existing = mLockdownTracker;
+        // TODO: Add a trigger when the always-on VPN enable/disable to reevaluate and send the
+        // necessary onBlockedStatusChanged callbacks.
         mLockdownTracker = null;
         if (existing != null) {
             existing.shutdown();
@@ -4893,12 +5005,20 @@
             notifyNetworkCallbacks(nai, ConnectivityManager.CALLBACK_CAP_CHANGED);
         }
 
-        // Report changes that are interesting for network statistics tracking.
         if (prevNc != null) {
-            final boolean meteredChanged = prevNc.hasCapability(NET_CAPABILITY_NOT_METERED) !=
-                    newNc.hasCapability(NET_CAPABILITY_NOT_METERED);
+            final boolean oldMetered = prevNc.isMetered();
+            final boolean newMetered = newNc.isMetered();
+            final boolean meteredChanged = oldMetered != newMetered;
+
+            if (meteredChanged) {
+                maybeNotifyNetworkBlocked(nai, oldMetered, newMetered, mRestrictBackground,
+                        mRestrictBackground);
+            }
+
             final boolean roamingChanged = prevNc.hasCapability(NET_CAPABILITY_NOT_ROAMING) !=
                     newNc.hasCapability(NET_CAPABILITY_NOT_ROAMING);
+
+            // Report changes that are interesting for network statistics tracking.
             if (meteredChanged || roamingChanged) {
                 notifyIfacesChangedForNetworkStats();
             }
@@ -5028,6 +5148,8 @@
             case ConnectivityManager.CALLBACK_AVAILABLE: {
                 putParcelable(bundle, new NetworkCapabilities(networkAgent.networkCapabilities));
                 putParcelable(bundle, new LinkProperties(networkAgent.linkProperties));
+                // For this notification, arg1 contains the blocked status.
+                msg.arg1 = arg1;
                 break;
             }
             case ConnectivityManager.CALLBACK_LOSING: {
@@ -5045,6 +5167,10 @@
                 putParcelable(bundle, new LinkProperties(networkAgent.linkProperties));
                 break;
             }
+            case ConnectivityManager.CALLBACK_BLK_CHANGED: {
+                msg.arg1 = arg1;
+                break;
+            }
         }
         msg.what = notificationType;
         msg.setData(bundle);
@@ -5600,7 +5726,76 @@
             return;
         }
 
-        callCallbackForRequest(nri, nai, ConnectivityManager.CALLBACK_AVAILABLE, 0);
+        final boolean metered = nai.networkCapabilities.isMetered();
+        final boolean blocked = isUidNetworkingWithVpnBlocked(nri.mUid, mUidRules.get(nri.mUid),
+                metered, mRestrictBackground);
+        callCallbackForRequest(nri, nai, ConnectivityManager.CALLBACK_AVAILABLE, blocked ? 1 : 0);
+    }
+
+    /**
+     * Notify of the blocked state apps with a registered callback matching a given NAI.
+     *
+     * Unlike other callbacks, blocked status is different between each individual uid. So for
+     * any given nai, all requests need to be considered according to the uid who filed it.
+     *
+     * @param nai The target NetworkAgentInfo.
+     * @param oldMetered True if the previous network capabilities is metered.
+     * @param newRestrictBackground True if data saver is enabled.
+     */
+    private void maybeNotifyNetworkBlocked(NetworkAgentInfo nai, boolean oldMetered,
+            boolean newMetered, boolean oldRestrictBackground, boolean newRestrictBackground) {
+
+        for (int i = 0; i < nai.numNetworkRequests(); i++) {
+            NetworkRequest nr = nai.requestAt(i);
+            NetworkRequestInfo nri = mNetworkRequests.get(nr);
+            final int uidRules = mUidRules.get(nri.mUid);
+            final boolean oldBlocked, newBlocked;
+            // mVpns lock needs to be hold here to ensure that the active VPN cannot be changed
+            // between these two calls.
+            synchronized (mVpns) {
+                oldBlocked = isUidNetworkingWithVpnBlocked(nri.mUid, uidRules, oldMetered,
+                        oldRestrictBackground);
+                newBlocked = isUidNetworkingWithVpnBlocked(nri.mUid, uidRules, newMetered,
+                        newRestrictBackground);
+            }
+            if (oldBlocked != newBlocked) {
+                callCallbackForRequest(nri, nai, ConnectivityManager.CALLBACK_BLK_CHANGED,
+                        encodeBool(newBlocked));
+            }
+        }
+    }
+
+    /**
+     * Notify apps with a given UID of the new blocked state according to new uid rules.
+     * @param uid The uid for which the rules changed.
+     * @param newRules The new rules to apply.
+     */
+    private void maybeNotifyNetworkBlockedForNewUidRules(int uid, int newRules) {
+        for (final NetworkAgentInfo nai : mNetworkAgentInfos.values()) {
+            final boolean metered = nai.networkCapabilities.isMetered();
+            final boolean oldBlocked, newBlocked;
+            // TODO: Consider that doze mode or turn on/off battery saver would deliver lots of uid
+            // rules changed event. And this function actually loop through all connected nai and
+            // its requests. It seems that mVpns lock will be grabbed frequently in this case.
+            // Reduce the number of locking or optimize the use of lock are likely needed in future.
+            synchronized (mVpns) {
+                oldBlocked = isUidNetworkingWithVpnBlocked(
+                        uid, mUidRules.get(uid), metered, mRestrictBackground);
+                newBlocked = isUidNetworkingWithVpnBlocked(
+                        uid, newRules, metered, mRestrictBackground);
+            }
+            if (oldBlocked == newBlocked) {
+                return;
+            }
+            final int arg = encodeBool(newBlocked);
+            for (int i = 0; i < nai.numNetworkRequests(); i++) {
+                NetworkRequest nr = nai.requestAt(i);
+                NetworkRequestInfo nri = mNetworkRequests.get(nr);
+                if (nri != null && nri.mUid == uid) {
+                    callCallbackForRequest(nri, nai, ConnectivityManager.CALLBACK_BLK_CHANGED, arg);
+                }
+            }
+        }
     }
 
     private void sendLegacyNetworkBroadcast(NetworkAgentInfo nai, DetailedState state, int type) {
diff --git a/services/core/java/com/android/server/LocationManagerService.java b/services/core/java/com/android/server/LocationManagerService.java
index 232c151..93bdcbb 100644
--- a/services/core/java/com/android/server/LocationManagerService.java
+++ b/services/core/java/com/android/server/LocationManagerService.java
@@ -76,6 +76,7 @@
 import android.util.EventLog;
 import android.util.Log;
 import android.util.Slog;
+
 import com.android.internal.content.PackageMonitor;
 import com.android.internal.location.ProviderProperties;
 import com.android.internal.location.ProviderRequest;
@@ -99,6 +100,7 @@
 import com.android.server.location.LocationRequestStatistics.PackageStatistics;
 import com.android.server.location.MockProvider;
 import com.android.server.location.PassiveProvider;
+
 import java.io.FileDescriptor;
 import java.io.PrintWriter;
 import java.util.ArrayList;
@@ -1764,9 +1766,7 @@
 
         if (enabled) {
             p.enable();
-            if (listeners > 0) {
-                applyRequirementsLocked(provider);
-            }
+            applyRequirementsLocked(provider);
         } else {
             p.disable();
         }
diff --git a/services/core/java/com/android/server/TelephonyRegistry.java b/services/core/java/com/android/server/TelephonyRegistry.java
index 591ec00..65f3c03 100644
--- a/services/core/java/com/android/server/TelephonyRegistry.java
+++ b/services/core/java/com/android/server/TelephonyRegistry.java
@@ -216,6 +216,9 @@
 
     private int mPreferredDataSubId = SubscriptionManager.INVALID_SUBSCRIPTION_ID;
 
+    @TelephonyManager.RadioPowerState
+    private int mRadioPowerState = TelephonyManager.RADIO_POWER_UNAVAILABLE;
+
     private final LocalLog mLocalLog = new LocalLog(100);
 
     private PreciseDataConnectionState mPreciseDataConnectionState =
@@ -762,6 +765,13 @@
                             remove(r.binder);
                         }
                     }
+                    if ((events & PhoneStateListener.LISTEN_RADIO_POWER_STATE_CHANGED) != 0) {
+                        try {
+                            r.callback.onRadioPowerStateChanged(mRadioPowerState);
+                        } catch (RemoteException ex) {
+                            remove(r.binder);
+                        }
+                    }
                 }
             }
         } else {
@@ -1609,6 +1619,32 @@
         }
     }
 
+    public void notifyRadioPowerStateChanged(@TelephonyManager.RadioPowerState int state) {
+        if (!checkNotifyPermission("notifyRadioPowerStateChanged()")) {
+            return;
+        }
+
+        if (VDBG) {
+            log("notifyRadioPowerStateChanged: state= " + state);
+        }
+
+        synchronized (mRecords) {
+            mRadioPowerState = state;
+
+            for (Record r : mRecords) {
+                if (r.matchPhoneStateListenerEvent(
+                        PhoneStateListener.LISTEN_RADIO_POWER_STATE_CHANGED)) {
+                    try {
+                        r.callback.onRadioPowerStateChanged(state);
+                    } catch (RemoteException ex) {
+                        mRemoveList.add(r.binder);
+                    }
+                }
+            }
+            handleRemoveListLocked();
+        }
+    }
+
     @Override
     public void dump(FileDescriptor fd, PrintWriter writer, String[] args) {
         final IndentingPrintWriter pw = new IndentingPrintWriter(writer, "  ");
@@ -1646,6 +1682,7 @@
             pw.println("mVoLteServiceState=" + mVoLteServiceState);
             pw.println("mPhoneCapability=" + mPhoneCapability);
             pw.println("mPreferredDataSubId=" + mPreferredDataSubId);
+            pw.println("mRadioPowerState=" + mRadioPowerState);
 
             pw.decreaseIndent();
 
diff --git a/services/core/java/com/android/server/VibratorService.java b/services/core/java/com/android/server/VibratorService.java
index b2be5e6..793a177 100644
--- a/services/core/java/com/android/server/VibratorService.java
+++ b/services/core/java/com/android/server/VibratorService.java
@@ -1270,26 +1270,36 @@
         public int onCommand(String cmd) {
             if ("vibrate".equals(cmd)) {
                 return runVibrate();
+            } else if ("prebaked".equals(cmd)) {
+                return runPrebaked();
             }
             return handleDefaultCommands(cmd);
         }
 
+        private boolean checkDoNotDisturb() {
+            try {
+                final int zenMode = Settings.Global.getInt(mContext.getContentResolver(),
+                        Settings.Global.ZEN_MODE);
+                if (zenMode != Settings.Global.ZEN_MODE_OFF) {
+                    try (PrintWriter pw = getOutPrintWriter();) {
+                        pw.print("Ignoring because device is on DND mode ");
+                        pw.println(DebugUtils.flagsToString(Settings.Global.class, "ZEN_MODE_",
+                                zenMode));
+                        return true;
+                    }
+                }
+            } catch (SettingNotFoundException e) {
+                // ignore
+            }
+
+            return false;
+        }
+
         private int runVibrate() {
             Trace.traceBegin(Trace.TRACE_TAG_VIBRATOR, "runVibrate");
             try {
-                try {
-                    final int zenMode = Settings.Global.getInt(mContext.getContentResolver(),
-                            Settings.Global.ZEN_MODE);
-                    if (zenMode != Settings.Global.ZEN_MODE_OFF) {
-                        try (PrintWriter pw = getOutPrintWriter();) {
-                            pw.print("Ignoring because device is on DND mode ");
-                            pw.println(DebugUtils.flagsToString(Settings.Global.class, "ZEN_MODE_",
-                                    zenMode));
-                            return 0;
-                        }
-                    }
-                } catch (SettingNotFoundException e) {
-                    // ignore
+                if (checkDoNotDisturb()) {
+                    return 0;
                 }
 
                 final long duration = Long.parseLong(getNextArgRequired());
@@ -1311,6 +1321,30 @@
             }
         }
 
+        private int runPrebaked() {
+            Trace.traceBegin(Trace.TRACE_TAG_VIBRATOR, "runPrebaked");
+            try {
+                if (checkDoNotDisturb()) {
+                    return 0;
+                }
+
+                final int id = Integer.parseInt(getNextArgRequired());
+
+                String description = getNextArg();
+                if (description == null) {
+                    description = "Shell command";
+                }
+
+                VibrationEffect effect =
+                        VibrationEffect.get(id, false);
+                vibrate(Binder.getCallingUid(), description, effect, AudioAttributes.USAGE_UNKNOWN,
+                        "Shell Command", mToken);
+                return 0;
+            } finally {
+                Trace.traceEnd(Trace.TRACE_TAG_VIBRATOR);
+            }
+        }
+
         @Override
         public void onHelp() {
             try (PrintWriter pw = getOutPrintWriter();) {
@@ -1321,6 +1355,9 @@
                 pw.println("  vibrate duration [description]");
                 pw.println("    Vibrates for duration milliseconds; ignored when device is on DND ");
                 pw.println("    (Do Not Disturb) mode.");
+                pw.println("  prebaked effect-id [description]");
+                pw.println("    Vibrates with prebaked effect; ignored when device is on DND ");
+                pw.println("    (Do Not Disturb) mode.");
                 pw.println("");
             }
         }
diff --git a/services/core/java/com/android/server/Watchdog.java b/services/core/java/com/android/server/Watchdog.java
index 0b836f0..9cc550d 100644
--- a/services/core/java/com/android/server/Watchdog.java
+++ b/services/core/java/com/android/server/Watchdog.java
@@ -528,7 +528,7 @@
             Thread dropboxThread = new Thread("watchdogWriteToDropbox") {
                     public void run() {
                         mActivity.addErrorToDropBox(
-                                "watchdog", null, "system_server", null, null,
+                                "watchdog", null, "system_server", null, null, null,
                                 subject, null, stack, null);
                     }
                 };
diff --git a/services/core/java/com/android/server/WiredAccessoryManager.java b/services/core/java/com/android/server/WiredAccessoryManager.java
index fcda83d..3939bee 100644
--- a/services/core/java/com/android/server/WiredAccessoryManager.java
+++ b/services/core/java/com/android/server/WiredAccessoryManager.java
@@ -339,7 +339,8 @@
                         Slog.w(TAG, uei.getSwitchStatePath() +
                                 " not found while attempting to determine initial switch state");
                     } catch (Exception e) {
-                        Slog.e(TAG, "" , e);
+                        Slog.e(TAG, "Error while attempting to determine initial switch state for "
+                                + uei.getDevName() , e);
                     }
                 }
             }
diff --git a/services/core/java/com/android/server/am/ActiveServices.java b/services/core/java/com/android/server/am/ActiveServices.java
index f4ec1f9..4070bca 100644
--- a/services/core/java/com/android/server/am/ActiveServices.java
+++ b/services/core/java/com/android/server/am/ActiveServices.java
@@ -3620,7 +3620,7 @@
                     nextTime = sr.executingStart;
                 }
             }
-            if (timeout != null && mAm.mLruProcesses.contains(proc)) {
+            if (timeout != null && mAm.mProcessList.mLruProcesses.contains(proc)) {
                 Slog.w(TAG, "Timeout executing service: " + timeout);
                 StringWriter sw = new StringWriter();
                 PrintWriter pw = new FastPrintWriter(sw, false, 1024);
@@ -3641,7 +3641,7 @@
         }
 
         if (anrMessage != null) {
-            mAm.mAppErrors.appNotResponding(proc, null, null, false, anrMessage);
+            proc.appNotResponding(null, null, null, null, false, anrMessage);
         }
     }
 
@@ -3666,7 +3666,7 @@
         }
 
         if (app != null) {
-            mAm.mAppErrors.appNotResponding(app, null, null, false,
+            app.appNotResponding(null, null, null, null, false,
                     "Context.startForegroundService() did not then call Service.startForeground(): "
                         + r);
         }
diff --git a/services/core/java/com/android/server/am/ActivityDisplay.java b/services/core/java/com/android/server/am/ActivityDisplay.java
index fecb573..ede13ef 100644
--- a/services/core/java/com/android/server/am/ActivityDisplay.java
+++ b/services/core/java/com/android/server/am/ActivityDisplay.java
@@ -37,16 +37,16 @@
 import static com.android.server.am.ActivityDisplayProto.ID;
 import static com.android.server.am.ActivityDisplayProto.RESUMED_ACTIVITY;
 import static com.android.server.am.ActivityDisplayProto.STACKS;
+import static com.android.server.am.ActivityStack.ActivityState.RESUMED;
+import static com.android.server.am.ActivityStackSupervisor.FindTaskResult;
+import static com.android.server.am.ActivityStackSupervisor.TAG_STATES;
+import static com.android.server.am.ActivityStackSupervisor.TAG_TASKS;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_STACK;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_STATES;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_TASKS;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.POSTFIX_STACK;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.TAG_ATM;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.TAG_WITH_CLASS_NAME;
-import static com.android.server.am.ActivityStack.ActivityState.RESUMED;
-import static com.android.server.am.ActivityStackSupervisor.FindTaskResult;
-import static com.android.server.am.ActivityStackSupervisor.TAG_STATES;
-import static com.android.server.am.ActivityStackSupervisor.TAG_TASKS;
 
 import android.annotation.Nullable;
 import android.app.ActivityOptions;
@@ -873,6 +873,52 @@
         return null;
     }
 
+    ActivityRecord topRunningActivity() {
+        return topRunningActivity(false /* considerKeyguardState */);
+    }
+
+    /**
+     * Returns the top running activity in the focused stack. In the case the focused stack has no
+     * such activity, the next focusable stack on this display is returned.
+     *
+     * @param considerKeyguardState Indicates whether the locked state should be considered. if
+     *                              {@code true} and the keyguard is locked, only activities that
+     *                              can be shown on top of the keyguard will be considered.
+     * @return The top running activity. {@code null} if none is available.
+     */
+    ActivityRecord topRunningActivity(boolean considerKeyguardState) {
+        ActivityRecord topRunning = null;
+        final ActivityStack focusedStack = getFocusedStack();
+        if (focusedStack != null) {
+            topRunning = focusedStack.topRunningActivityLocked();
+        }
+
+        // Look in other focusable stacks.
+        if (topRunning == null) {
+            for (int i = mStacks.size() - 1; i >= 0; --i) {
+                final ActivityStack stack = mStacks.get(i);
+                // Only consider focusable stacks other than the current focused one.
+                if (stack == focusedStack || !stack.isFocusable()) {
+                    continue;
+                }
+                topRunning = stack.topRunningActivityLocked();
+                if (topRunning != null) {
+                    break;
+                }
+            }
+        }
+
+        // This activity can be considered the top running activity if we are not considering
+        // the locked state, the keyguard isn't locked, or we can show when locked.
+        if (topRunning != null && considerKeyguardState
+                && mSupervisor.getKeyguardController().isKeyguardLocked()
+                && !topRunning.canShowWhenLocked()) {
+            return null;
+        }
+
+        return topRunning;
+    }
+
     int getIndexOf(ActivityStack stack) {
         return mStacks.indexOf(stack);
     }
@@ -998,7 +1044,10 @@
      * @see Display#FLAG_SHOULD_SHOW_SYSTEM_DECORATIONS
      */
     boolean supportsSystemDecorations() {
-        return mDisplay.supportsSystemDecorations();
+        return mDisplay.supportsSystemDecorations()
+                // TODO (b/111363427): Remove this and set the new FLAG_SHOULD_SHOW_LAUNCHER flag
+                // (b/114338689) whenever vr 2d display id is set.
+                || mDisplayId == mSupervisor.mService.mVr2dDisplayId;
     }
 
     private boolean shouldDestroyContentOnRemove() {
diff --git a/services/core/java/com/android/server/am/ActivityManagerService.java b/services/core/java/com/android/server/am/ActivityManagerService.java
index d5b618f..d56b523 100644
--- a/services/core/java/com/android/server/am/ActivityManagerService.java
+++ b/services/core/java/com/android/server/am/ActivityManagerService.java
@@ -18,19 +18,16 @@
 
 import static android.Manifest.permission.CHANGE_CONFIGURATION;
 import static android.Manifest.permission.CHANGE_DEVICE_IDLE_TEMP_WHITELIST;
+import static android.Manifest.permission.FILTER_EVENTS;
 import static android.Manifest.permission.INTERACT_ACROSS_USERS;
 import static android.Manifest.permission.INTERACT_ACROSS_USERS_FULL;
-import static android.Manifest.permission.MANAGE_ACTIVITY_STACKS;
 import static android.Manifest.permission.REMOVE_TASKS;
 import static android.app.ActivityManager.PROCESS_STATE_CACHED_ACTIVITY;
 import static android.app.ActivityManager.PROCESS_STATE_LAST_ACTIVITY;
 import static android.app.ActivityManagerInternal.ALLOW_FULL_ONLY;
 import static android.app.ActivityManagerInternal.ALLOW_NON_FULL;
-import static android.app.ActivityThread.PROC_START_SEQ_IDENT;
 import static android.app.AppOpsManager.OP_NONE;
-import static android.content.Intent.FLAG_ACTIVITY_EXCLUDE_FROM_RECENTS;
 import static android.content.Intent.FLAG_ACTIVITY_NEW_TASK;
-import static android.content.Intent.FLAG_ACTIVITY_TASK_ON_HOME;
 import static android.content.pm.ApplicationInfo.HIDDEN_API_ENFORCEMENT_DEFAULT;
 import static android.content.pm.PackageManager.GET_PROVIDERS;
 import static android.content.pm.PackageManager.MATCH_ANY_USER;
@@ -49,8 +46,6 @@
 import static android.os.IServiceManager.DUMP_FLAG_PROTO;
 import static android.os.Process.BLUETOOTH_UID;
 import static android.os.Process.FIRST_APPLICATION_UID;
-import static android.os.Process.FIRST_ISOLATED_UID;
-import static android.os.Process.LAST_ISOLATED_UID;
 import static android.os.Process.NFC_UID;
 import static android.os.Process.PHONE_UID;
 import static android.os.Process.PROC_CHAR;
@@ -69,10 +64,10 @@
 import static android.os.Process.THREAD_GROUP_DEFAULT;
 import static android.os.Process.THREAD_GROUP_RESTRICTED;
 import static android.os.Process.THREAD_GROUP_TOP_APP;
-import static android.os.Process.THREAD_PRIORITY_BACKGROUND;
 import static android.os.Process.THREAD_PRIORITY_FOREGROUND;
-import static android.os.Process.getFreeMemory;
+import static android.os.Process.getPidsForCommands;
 import static android.os.Process.getTotalMemory;
+import static android.os.Process.getUidForPid;
 import static android.os.Process.isThreadInProcess;
 import static android.os.Process.killProcess;
 import static android.os.Process.killProcessQuiet;
@@ -84,7 +79,6 @@
 import static android.os.Process.setProcessGroup;
 import static android.os.Process.setThreadPriority;
 import static android.os.Process.setThreadScheduler;
-import static android.os.Process.startWebView;
 import static android.os.Process.zygoteProcess;
 import static android.provider.Settings.Global.ALWAYS_FINISH_ACTIVITIES;
 import static android.provider.Settings.Global.DEBUG_APP;
@@ -99,9 +93,6 @@
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BROADCAST;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BROADCAST_BACKGROUND;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_BROADCAST_LIGHT;
-import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_CLEANUP;
-import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_CONFIGURATION;
-import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_LOCKTASK;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_LRU;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_MU;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_NETWORK;
@@ -114,15 +105,12 @@
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PROVIDER;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PSS;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_SERVICE;
-import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_SWITCH;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_UID_OBSERVERS;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_USAGE_STATS;
 import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_WHITELISTS;
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_BACKUP;
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_BROADCAST;
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_CLEANUP;
-import static com.android.server.am.ActivityTaskManagerDebugConfig.POSTFIX_CONFIGURATION;
-import static com.android.server.am.ActivityTaskManagerDebugConfig.POSTFIX_LOCKTASK;
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_LRU;
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_MU;
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_NETWORK;
@@ -133,13 +121,32 @@
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PROVIDER;
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_PSS;
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_SERVICE;
-import static com.android.server.am.ActivityTaskManagerDebugConfig.POSTFIX_SWITCH;
 import static com.android.server.am.ActivityManagerDebugConfig.POSTFIX_UID_OBSERVERS;
 import static com.android.server.am.ActivityManagerDebugConfig.TAG_AM;
 import static com.android.server.am.ActivityManagerDebugConfig.TAG_WITH_CLASS_NAME;
-import static com.android.server.am.ActivityStackSupervisor.PRESERVE_WINDOWS;
+import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_CLEANUP;
+import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_CONFIGURATION;
+import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_LOCKTASK;
+import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_SWITCH;
+import static com.android.server.am.ActivityTaskManagerDebugConfig.POSTFIX_CONFIGURATION;
+import static com.android.server.am.ActivityTaskManagerDebugConfig.POSTFIX_LOCKTASK;
+import static com.android.server.am.ActivityTaskManagerDebugConfig.POSTFIX_SWITCH;
+import static com.android.server.am.ActivityTaskManagerService.DUMP_ACTIVITIES_CMD;
+import static com.android.server.am.ActivityTaskManagerService.DUMP_ACTIVITIES_SHORT_CMD;
+import static com.android.server.am.ActivityTaskManagerService.DUMP_CONTAINERS_CMD;
+import static com.android.server.am.ActivityTaskManagerService.DUMP_LASTANR_CMD;
+import static com.android.server.am.ActivityTaskManagerService.DUMP_LASTANR_TRACES_CMD;
+import static com.android.server.am.ActivityTaskManagerService.DUMP_RECENTS_CMD;
+import static com.android.server.am.ActivityTaskManagerService.DUMP_RECENTS_SHORT_CMD;
+import static com.android.server.am.ActivityTaskManagerService.DUMP_STARTER_CMD;
+import static com.android.server.am.ActivityTaskManagerService.KEY_DISPATCHING_TIMEOUT_MS;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_NONE;
+import static com.android.server.am.ActivityTaskManagerService.relaunchReasonToString;
+import static com.android.server.am.MemoryStatUtil.MEMORY_STAT_INTERESTING_NATIVE_PROCESSES;
 import static com.android.server.am.MemoryStatUtil.hasMemcg;
+import static com.android.server.am.MemoryStatUtil.readCmdlineFromProcfs;
 import static com.android.server.am.MemoryStatUtil.readMemoryStatFromFilesystem;
+import static com.android.server.am.MemoryStatUtil.readMemoryStatFromProcfs;
 
 import android.Manifest;
 import android.Manifest.permission;
@@ -152,7 +159,6 @@
 import android.app.ActivityManager.StackInfo;
 import android.app.ActivityManagerInternal;
 import android.app.ActivityManagerProto;
-import android.app.ActivityOptions;
 import android.app.ActivityThread;
 import android.app.AppGlobals;
 import android.app.AppOpsManager;
@@ -181,6 +187,7 @@
 import android.app.PendingIntent;
 import android.app.ProcessMemoryState;
 import android.app.ProfilerInfo;
+import android.app.WaitResult;
 import android.app.WindowConfiguration.ActivityType;
 import android.app.WindowConfiguration.WindowingMode;
 import android.app.backup.IBackupManager;
@@ -250,7 +257,6 @@
 import android.os.PowerManager.ServiceType;
 import android.os.PowerManagerInternal;
 import android.os.Process;
-import android.os.Process.ProcessStartResult;
 import android.os.RemoteCallback;
 import android.os.RemoteCallbackList;
 import android.os.RemoteException;
@@ -266,7 +272,6 @@
 import android.os.UserManager;
 import android.os.WorkSource;
 import android.os.storage.StorageManager;
-import android.os.storage.StorageManagerInternal;
 import android.provider.Settings;
 import android.text.TextUtils;
 import android.text.format.DateUtils;
@@ -276,7 +281,6 @@
 import android.util.DebugUtils;
 import android.util.EventLog;
 import android.util.Log;
-import android.util.LongSparseArray;
 import android.util.Pair;
 import android.util.PrintWriterPrinter;
 import android.util.Slog;
@@ -312,7 +316,6 @@
 import com.android.internal.os.IResultReceiver;
 import com.android.internal.os.ProcessCpuTracker;
 import com.android.internal.os.TransferPipe;
-import com.android.internal.os.Zygote;
 import com.android.internal.telephony.TelephonyIntents;
 import com.android.internal.util.ArrayUtils;
 import com.android.internal.util.DumpUtils;
@@ -343,7 +346,6 @@
 import com.android.server.job.JobSchedulerInternal;
 import com.android.server.pm.Installer;
 import com.android.server.pm.Installer.InstallerException;
-import com.android.server.pm.dex.DexManager;
 import com.android.server.uri.GrantUri;
 import com.android.server.uri.UriGrantsManagerInternal;
 import com.android.server.utils.PriorityDump;
@@ -355,18 +357,15 @@
 
 import libcore.util.EmptyArray;
 
-import java.io.BufferedReader;
 import java.io.File;
 import java.io.FileDescriptor;
 import java.io.FileNotFoundException;
 import java.io.FileOutputStream;
-import java.io.FileReader;
 import java.io.IOException;
 import java.io.InputStreamReader;
 import java.io.PrintWriter;
 import java.io.StringWriter;
 import java.io.UnsupportedEncodingException;
-import java.text.DateFormat;
 import java.text.SimpleDateFormat;
 import java.util.ArrayList;
 import java.util.Arrays;
@@ -395,24 +394,24 @@
      */
     public static final int TOP_APP_PRIORITY_BOOST = -10;
 
-    private static final String TAG = TAG_WITH_CLASS_NAME ? "ActivityManagerService" : TAG_AM;
+    static final String TAG = TAG_WITH_CLASS_NAME ? "ActivityManagerService" : TAG_AM;
     private static final String TAG_BACKUP = TAG + POSTFIX_BACKUP;
     private static final String TAG_BROADCAST = TAG + POSTFIX_BROADCAST;
     private static final String TAG_CLEANUP = TAG + POSTFIX_CLEANUP;
     private static final String TAG_CONFIGURATION = TAG + POSTFIX_CONFIGURATION;
     private static final String TAG_LOCKTASK = TAG + POSTFIX_LOCKTASK;
-    private static final String TAG_LRU = TAG + POSTFIX_LRU;
+    static final String TAG_LRU = TAG + POSTFIX_LRU;
     private static final String TAG_MU = TAG + POSTFIX_MU;
     private static final String TAG_NETWORK = TAG + POSTFIX_NETWORK;
     private static final String TAG_OOM_ADJ = TAG + POSTFIX_OOM_ADJ;
     private static final String TAG_POWER = TAG + POSTFIX_POWER;
     private static final String TAG_PROCESS_OBSERVERS = TAG + POSTFIX_PROCESS_OBSERVERS;
-    private static final String TAG_PROCESSES = TAG + POSTFIX_PROCESSES;
+    static final String TAG_PROCESSES = TAG + POSTFIX_PROCESSES;
     private static final String TAG_PROVIDER = TAG + POSTFIX_PROVIDER;
-    private static final String TAG_PSS = TAG + POSTFIX_PSS;
+    static final String TAG_PSS = TAG + POSTFIX_PSS;
     private static final String TAG_SERVICE = TAG + POSTFIX_SERVICE;
     private static final String TAG_SWITCH = TAG + POSTFIX_SWITCH;
-    private static final String TAG_UID_OBSERVERS = TAG + POSTFIX_UID_OBSERVERS;
+    static final String TAG_UID_OBSERVERS = TAG + POSTFIX_UID_OBSERVERS;
 
     // Mock "pretend we're idle now" broadcast action to the job scheduler; declared
     // here so that while the job scheduler can depend on AMS, the other way around
@@ -434,7 +433,7 @@
 
     static final String SYSTEM_DEBUGGABLE = "ro.debuggable";
 
-    private static final String ANR_TRACE_DIR = "/data/anr";
+    public static final String ANR_TRACE_DIR = "/data/anr";
 
     // Maximum number of receivers an app can register.
     private static final int MAX_RECEIVERS_ALLOWED_PER_APP = 1000;
@@ -446,6 +445,12 @@
     // before we decide it must be hung.
     static final int CONTENT_PROVIDER_PUBLISH_TIMEOUT = 10*1000;
 
+    /**
+     * How long we wait for an provider to be published. Should be longer than
+     * {@link #CONTENT_PROVIDER_PUBLISH_TIMEOUT}.
+     */
+    static final int CONTENT_PROVIDER_WAIT_TIMEOUT = 20 * 1000;
+
     // How long we wait for a launched process to attach to the activity manager
     // before we decide it's never going to come up for real, when the process was
     // started with a wrapper for instrumentation (such as Valgrind) because it
@@ -474,7 +479,7 @@
     private static final int SLOW_UID_OBSERVER_THRESHOLD_MS = 20;
 
     // Necessary ApplicationInfo flags to mark an app as persistent
-    private static final int PERSISTENT_MASK =
+    static final int PERSISTENT_MASK =
             ApplicationInfo.FLAG_SYSTEM|ApplicationInfo.FLAG_PERSISTENT;
 
     // Intent sent when remote bugreport collection has been completed
@@ -489,6 +494,9 @@
      */
     private static final long NETWORK_ACCESS_TIMEOUT_DEFAULT_MS = 200; // 0.2 sec
 
+    // The minimum memory growth threshold (in KB) for low RAM devices.
+    private static final int MINIMUM_MEMORY_GROWTH_THRESHOLD = 10 * 1000; // 10 MB
+
     /**
      * State indicating that there is no need for any blocking for network.
      */
@@ -518,9 +526,6 @@
 
     private Installer mInstaller;
 
-    /** Run all ActivityStacks through this */
-    ActivityStackSupervisor mStackSupervisor;
-
     final InstrumentationReporter mInstrumentationReporter = new InstrumentationReporter();
 
     final ArrayList<ActiveInstrumentation> mActiveInstrumentation = new ArrayList<>();
@@ -560,12 +565,6 @@
     final AppErrors mAppErrors;
 
     /**
-     * Dump of the activity state at the time of the last ANR. Cleared after
-     * {@link WindowManagerService#LAST_ANR_LIFETIME_DURATION_MSECS}
-     */
-    String mLastANRState;
-
-    /**
      * Indicates the maximum time spent waiting for the network rules to get updated.
      */
     @VisibleForTesting
@@ -618,46 +617,12 @@
     final ProcessList mProcessList = new ProcessList();
 
     /**
-     * All of the applications we currently have running organized by name.
-     * The keys are strings of the application package name (as
-     * returned by the package manager), and the keys are ApplicationRecord
-     * objects.
-     */
-    final MyProcessMap mProcessNames = new MyProcessMap();
-    final class MyProcessMap extends ProcessMap<ProcessRecord> {
-        @Override
-        public ProcessRecord put(String name, int uid, ProcessRecord value) {
-            final ProcessRecord r = super.put(name, uid, value);
-            mAtmInternal.onProcessAdded(r.getWindowProcessController());
-            return r;
-        }
-
-        @Override
-        public ProcessRecord remove(String name, int uid) {
-            final ProcessRecord r = super.remove(name, uid);
-            mAtmInternal.onProcessRemoved(name, uid);
-            return r;
-        }
-    }
-
-    /**
      * Tracking long-term execution of processes to look for abuse and other
      * bad app behavior.
      */
     final ProcessStatsService mProcessStats;
 
     /**
-     * The currently running isolated processes.
-     */
-    final SparseArray<ProcessRecord> mIsolatedProcesses = new SparseArray<>();
-
-    /**
-     * Counter for assigning isolated process uids, to avoid frequently reusing the
-     * same ones.
-     */
-    int mNextIsolatedProcessUid = 0;
-
-    /**
      * Non-persistent appId whitelist for background restrictions
      */
     int[] mBackgroundAppIdWhitelist = new int[] {
@@ -758,28 +723,6 @@
     final ArrayList<ProcessRecord> mPersistentStartingProcesses = new ArrayList<ProcessRecord>();
 
     /**
-     * Processes that are being forcibly torn down.
-     */
-    final ArrayList<ProcessRecord> mRemovedProcesses = new ArrayList<ProcessRecord>();
-
-    /**
-     * List of running applications, sorted by recent usage.
-     * The first entry in the list is the least recently used.
-     */
-    final ArrayList<ProcessRecord> mLruProcesses = new ArrayList<ProcessRecord>();
-
-    /**
-     * Where in mLruProcesses that the processes hosting activities start.
-     */
-    int mLruProcessActivityStart = 0;
-
-    /**
-     * Where in mLruProcesses that the processes hosting services start.
-     * This is after (lower index) than mLruProcessesActivityStart.
-     */
-    int mLruProcessServiceStart = 0;
-
-    /**
      * List of processes that should gc as soon as things are idle.
      */
     final ArrayList<ProcessRecord> mProcessesToGc = new ArrayList<ProcessRecord>();
@@ -1095,11 +1038,6 @@
     int mAdjSeq = 0;
 
     /**
-     * Current sequence id for process LRU updating.
-     */
-    int mLruSeq = 0;
-
-    /**
      * Keep track of the non-cached/empty process we last found, to help
      * determine how to distribute cached/empty processes next time.
      */
@@ -1211,31 +1149,6 @@
 
     private final ArraySet<BroadcastQueue> mTmpBroadcastQueue = new ArraySet();
 
-    /**
-     * A global counter for generating sequence numbers.
-     * This value will be used when incrementing sequence numbers in individual uidRecords.
-     *
-     * Having a global counter ensures that seq numbers are monotonically increasing for a
-     * particular uid even when the uidRecord is re-created.
-     */
-    @GuardedBy("this")
-    @VisibleForTesting
-    long mProcStateSeqCounter = 0;
-
-    /**
-     * A global counter for generating sequence numbers to uniquely identify pending process starts.
-     */
-    @GuardedBy("this")
-    private long mProcStartSeqCounter = 0;
-
-    /**
-     * Contains {@link ProcessRecord} objects for pending process starts.
-     *
-     * Mapping: {@link #mProcStartSeqCounter} -> {@link ProcessRecord}
-     */
-    @GuardedBy("this")
-    private final LongSparseArray<ProcessRecord> mPendingStarts = new LongSparseArray<>();
-
     private final Injector mInjector;
 
     static final class ProcessChangeItem {
@@ -1423,9 +1336,6 @@
 
     static final String SERVICE_RECORD_KEY = "servicerecord";
 
-    static ServiceThread sKillThread = null;
-    static KillHandler sKillHandler = null;
-
     long mLastMemUsageReportTime = 0;
 
     /**
@@ -1459,31 +1369,7 @@
      * also corresponds to the merged configuration of the default display.
      */
     Configuration getGlobalConfiguration() {
-        return mStackSupervisor.getConfiguration();
-    }
-
-    final class KillHandler extends Handler {
-        static final int KILL_PROCESS_GROUP_MSG = 4000;
-
-        public KillHandler(Looper looper) {
-            super(looper, null, true);
-        }
-
-        @Override
-        public void handleMessage(Message msg) {
-            switch (msg.what) {
-                case KILL_PROCESS_GROUP_MSG:
-                {
-                    Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "killProcessGroup");
-                    Process.killProcessGroup(msg.arg1 /* uid */, msg.arg2 /* pid */);
-                    Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
-                }
-                break;
-
-                default:
-                    super.handleMessage(msg);
-            }
-        }
+        return mActivityTaskManager.getGlobalConfiguration();
     }
 
     final class UiHandler extends Handler {
@@ -1599,8 +1485,8 @@
             } break;
             case UPDATE_TIME_ZONE: {
                 synchronized (ActivityManagerService.this) {
-                    for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
-                        ProcessRecord r = mLruProcesses.get(i);
+                    for (int i = mProcessList.mLruProcesses.size() - 1; i >= 0; i--) {
+                        ProcessRecord r = mProcessList.mLruProcesses.get(i);
                         if (r.thread != null) {
                             try {
                                 r.thread.updateTimeZone();
@@ -1613,16 +1499,7 @@
             } break;
             case CLEAR_DNS_CACHE_MSG: {
                 synchronized (ActivityManagerService.this) {
-                    for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
-                        ProcessRecord r = mLruProcesses.get(i);
-                        if (r.thread != null) {
-                            try {
-                                r.thread.clearDnsCache();
-                            } catch (RemoteException ex) {
-                                Slog.w(TAG, "Failed to clear dns cache for: " + r.info.processName);
-                            }
-                        }
-                    }
+                    mProcessList.clearAllDnsCacheLocked();
                 }
             } break;
             case UPDATE_HTTP_PROXY_MSG: {
@@ -1638,19 +1515,7 @@
                     pacFileUrl = proxy.getPacFileUrl();
                 }
                 synchronized (ActivityManagerService.this) {
-                    for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
-                        ProcessRecord r = mLruProcesses.get(i);
-                        // Don't dispatch to isolated processes as they can't access
-                        // ConnectivityManager and don't have network privileges anyway.
-                        if (r.thread != null && !r.isolated) {
-                            try {
-                                r.thread.setHttpProxy(host, port, exclList, pacFileUrl);
-                            } catch (RemoteException ex) {
-                                Slog.w(TAG, "Failed to update http proxy for: " +
-                                        r.info.processName);
-                            }
-                        }
-                    }
+                    mProcessList.setAllHttpProxyLocked(host, port, exclList, pacFileUrl);
                 }
             } break;
             case PROC_START_TIMEOUT_MSG: {
@@ -1698,17 +1563,7 @@
                 // The user's time format preference might have changed.
                 // For convenience we re-use the Intent extra values.
                 synchronized (ActivityManagerService.this) {
-                    for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
-                        ProcessRecord r = mLruProcesses.get(i);
-                        if (r.thread != null) {
-                            try {
-                                r.thread.updateTimePrefs(msg.arg1);
-                            } catch (RemoteException ex) {
-                                Slog.w(TAG, "Failed to update preferences for: "
-                                        + r.info.processName);
-                            }
-                        }
-                    }
+                    mProcessList.updateAllTimePrefsLocked(msg.arg1);
                 }
                 break;
             }
@@ -1832,17 +1687,7 @@
             } break;
             case HANDLE_TRUST_STORAGE_UPDATE_MSG: {
                 synchronized (ActivityManagerService.this) {
-                    for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
-                        ProcessRecord r = mLruProcesses.get(i);
-                        if (r.thread != null) {
-                            try {
-                                r.thread.handleTrustStorageUpdate();
-                            } catch (RemoteException ex) {
-                                Slog.w(TAG, "Failed to handle trust storage update for: " +
-                                        r.info.processName);
-                            }
-                        }
-                    }
+                    mProcessList.handleAllTrustStorageUpdateLocked();
                 }
             } break;
             }
@@ -1982,7 +1827,9 @@
             mSystemThread.installSystemApplicationInfo(info, getClass().getClassLoader());
 
             synchronized (this) {
-                ProcessRecord app = newProcessRecordLocked(info, info.processName, false, 0);
+                ProcessRecord app = mProcessList.newProcessRecordLocked(info, info.processName,
+                        false,
+                        0);
                 app.setPersistent(true);
                 app.pid = MY_PID;
                 app.getWindowProcessController().setPid(MY_PID);
@@ -1991,7 +1838,7 @@
                 synchronized (mPidsSelfLocked) {
                     mPidsSelfLocked.put(app.pid, app);
                 }
-                updateLruProcessLocked(app, false, null);
+                mProcessList.updateLruProcessLocked(app, false, null);
                 updateOomAdjLocked();
             }
         } catch (PackageManager.NameNotFoundException e) {
@@ -2017,7 +1864,6 @@
         synchronized (this) {
             mWindowManager = wm;
             mActivityTaskManager.setWindowManager(wm);
-            mStackSupervisor.setWindowManager(wm);
         }
     }
 
@@ -2260,24 +2106,38 @@
 
     @VisibleForTesting
     public ActivityManagerService(Injector injector) {
+        this(injector, null /* handlerThread */);
+    }
+
+    /**
+     * Provides the basic functionality for activity task related tests when a handler thread is
+     * given to initialize the dependency members.
+     */
+    @VisibleForTesting
+    ActivityManagerService(Injector injector, ServiceThread handlerThread) {
+        final boolean hasHandlerThread = handlerThread != null;
         mInjector = injector;
         mContext = mInjector.getContext();
         mUiContext = null;
         mAppErrors = null;
-        mAppOpsService = mInjector.getAppOpsService(null, null);
+        mAppOpsService = mInjector.getAppOpsService(null /* file */, null /* handler */);
         mBatteryStatsService = null;
-        mConstants = null;
-        mHandler = null;
-        mHandlerThread = null;
-        mIntentFirewall = null;
+        mHandler = hasHandlerThread ? new MainHandler(handlerThread.getLooper()) : null;
+        mHandlerThread = handlerThread;
+        mConstants = hasHandlerThread ? new ActivityManagerConstants(this, mHandler) : null;
+        mIntentFirewall = hasHandlerThread
+                ? new IntentFirewall(new IntentFirewallInterface(), mHandler) : null;
         mProcessCpuThread = null;
         mProcessStats = null;
         mProviderMap = null;
-        mServices = null;
+        // For the usage of {@link ActiveServices#cleanUpServices} that may be invoked from
+        // {@link ActivityStackSupervisor#cleanUpRemovedTaskLocked}.
+        mServices = hasHandlerThread ? new ActiveServices(this) : null;
         mSystemThread = null;
-        mUiHandler = injector.getUiHandler(null);
-        mUserController = null;
-        mPendingIntentController = null;
+        mUiHandler = injector.getUiHandler(null /* service */);
+        mUserController = hasHandlerThread ? new UserController(this) : null;
+        mPendingIntentController = hasHandlerThread
+                ? new PendingIntentController(handlerThread.getLooper(), mUserController) : null;
         mProcStartHandlerThread = null;
         mProcStartHandler = null;
         mHiddenApiBlacklist = null;
@@ -2310,13 +2170,7 @@
 
         mConstants = new ActivityManagerConstants(this, mHandler);
 
-        /* static; one-time init here */
-        if (sKillHandler == null) {
-            sKillThread = new ServiceThread(TAG + ":kill",
-                    THREAD_PRIORITY_BACKGROUND, true /* allowIo */);
-            sKillThread.start();
-            sKillHandler = new KillHandler(sKillThread.getLooper());
-        }
+        mProcessList.init(this);
 
         mFgBroadcastQueue = new BroadcastQueue(this, mHandler,
                 "foreground", BROADCAST_FG_TIMEOUT, false);
@@ -2363,7 +2217,6 @@
         mActivityTaskManager.setActivityManagerService(this, mHandlerThread.getLooper(),
                 mIntentFirewall, mPendingIntentController);
         mAtmInternal = LocalServices.getService(ActivityTaskManagerInternal.class);
-        mStackSupervisor = mActivityTaskManager.mStackSupervisor;
 
         mProcessCpuThread = new Thread("CpuTracker") {
             @Override
@@ -2467,12 +2320,13 @@
         if (code == SYSPROPS_TRANSACTION) {
             // We need to tell all apps about the system property change.
             ArrayList<IBinder> procs = new ArrayList<IBinder>();
-            synchronized(this) {
-                final int NP = mProcessNames.getMap().size();
-                for (int ip=0; ip<NP; ip++) {
-                    SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+            synchronized (this) {
+                final int NP = mProcessList.mProcessNames.getMap().size();
+                for (int ip = 0; ip < NP; ip++) {
+                    SparseArray<ProcessRecord> apps =
+                            mProcessList.mProcessNames.getMap().valueAt(ip);
                     final int NA = apps.size();
-                    for (int ia=0; ia<NA; ia++) {
+                    for (int ia = 0; ia < NA; ia++) {
                         ProcessRecord app = apps.valueAt(ia);
                         if (app.thread != null) {
                             procs.add(app.thread.asBinder());
@@ -2722,329 +2576,21 @@
         mActivityTaskManager.unregisterTaskStackListener(listener);
     }
 
-    private int updateLruProcessInternalLocked(ProcessRecord app, long now, int index,
-            String what, Object obj, ProcessRecord srcApp) {
-        app.lastActivityTime = now;
-
-        if (app.hasActivitiesOrRecentTasks()) {
-            // Don't want to touch dependent processes that are hosting activities.
-            return index;
-        }
-
-        int lrui = mLruProcesses.lastIndexOf(app);
-        if (lrui < 0) {
-            Slog.wtf(TAG, "Adding dependent process " + app + " not on LRU list: "
-                    + what + " " + obj + " from " + srcApp);
-            return index;
-        }
-
-        if (lrui >= index) {
-            // Don't want to cause this to move dependent processes *back* in the
-            // list as if they were less frequently used.
-            return index;
-        }
-
-        if (lrui >= mLruProcessActivityStart) {
-            // Don't want to touch dependent processes that are hosting activities.
-            return index;
-        }
-
-        mLruProcesses.remove(lrui);
-        if (index > 0) {
-            index--;
-        }
-        if (DEBUG_LRU) Slog.d(TAG_LRU, "Moving dep from " + lrui + " to " + index
-                + " in LRU list: " + app);
-        mLruProcesses.add(index, app);
-        return index;
-    }
-
-    static void killProcessGroup(int uid, int pid) {
-        if (sKillHandler != null) {
-            sKillHandler.sendMessage(
-                    sKillHandler.obtainMessage(KillHandler.KILL_PROCESS_GROUP_MSG, uid, pid));
-        } else {
-            Slog.w(TAG, "Asked to kill process group before system bringup!");
-            Process.killProcessGroup(uid, pid);
-        }
+    final void updateLruProcessLocked(ProcessRecord app, boolean activityChange,
+            ProcessRecord client) {
+        mProcessList.updateLruProcessLocked(app, activityChange, client);
     }
 
     final void removeLruProcessLocked(ProcessRecord app) {
-        int lrui = mLruProcesses.lastIndexOf(app);
-        if (lrui >= 0) {
-            if (!app.killed) {
-                if (app.isPersistent()) {
-                    Slog.w(TAG, "Removing persistent process that hasn't been killed: " + app);
-                } else {
-                    Slog.wtfStack(TAG, "Removing process that hasn't been killed: " + app);
-                    if (app.pid > 0) {
-                        killProcessQuiet(app.pid);
-                        killProcessGroup(app.uid, app.pid);
-                    } else {
-                        app.pendingStart = false;
-                    }
-                }
-            }
-            if (lrui <= mLruProcessActivityStart) {
-                mLruProcessActivityStart--;
-            }
-            if (lrui <= mLruProcessServiceStart) {
-                mLruProcessServiceStart--;
-            }
-            mLruProcesses.remove(lrui);
-        }
-    }
-
-    final void updateLruProcessLocked(ProcessRecord app, boolean activityChange,
-            ProcessRecord client) {
-        final boolean hasActivity = app.hasActivitiesOrRecentTasks() || app.hasClientActivities()
-                || app.treatLikeActivity;
-        final boolean hasService = false; // not impl yet. app.services.size() > 0;
-        if (!activityChange && hasActivity) {
-            // The process has activities, so we are only allowing activity-based adjustments
-            // to move it.  It should be kept in the front of the list with other
-            // processes that have activities, and we don't want those to change their
-            // order except due to activity operations.
-            return;
-        }
-
-        mLruSeq++;
-        final long now = SystemClock.uptimeMillis();
-        app.lastActivityTime = now;
-
-        // First a quick reject: if the app is already at the position we will
-        // put it, then there is nothing to do.
-        if (hasActivity) {
-            final int N = mLruProcesses.size();
-            if (N > 0 && mLruProcesses.get(N-1) == app) {
-                if (DEBUG_LRU) Slog.d(TAG_LRU, "Not moving, already top activity: " + app);
-                return;
-            }
-        } else {
-            if (mLruProcessServiceStart > 0
-                    && mLruProcesses.get(mLruProcessServiceStart-1) == app) {
-                if (DEBUG_LRU) Slog.d(TAG_LRU, "Not moving, already top other: " + app);
-                return;
-            }
-        }
-
-        int lrui = mLruProcesses.lastIndexOf(app);
-
-        if (app.isPersistent() && lrui >= 0) {
-            // We don't care about the position of persistent processes, as long as
-            // they are in the list.
-            if (DEBUG_LRU) Slog.d(TAG_LRU, "Not moving, persistent: " + app);
-            return;
-        }
-
-        /* In progress: compute new position first, so we can avoid doing work
-           if the process is not actually going to move.  Not yet working.
-        int addIndex;
-        int nextIndex;
-        boolean inActivity = false, inService = false;
-        if (hasActivity) {
-            // Process has activities, put it at the very tipsy-top.
-            addIndex = mLruProcesses.size();
-            nextIndex = mLruProcessServiceStart;
-            inActivity = true;
-        } else if (hasService) {
-            // Process has services, put it at the top of the service list.
-            addIndex = mLruProcessActivityStart;
-            nextIndex = mLruProcessServiceStart;
-            inActivity = true;
-            inService = true;
-        } else  {
-            // Process not otherwise of interest, it goes to the top of the non-service area.
-            addIndex = mLruProcessServiceStart;
-            if (client != null) {
-                int clientIndex = mLruProcesses.lastIndexOf(client);
-                if (clientIndex < 0) Slog.d(TAG, "Unknown client " + client + " when updating "
-                        + app);
-                if (clientIndex >= 0 && addIndex > clientIndex) {
-                    addIndex = clientIndex;
-                }
-            }
-            nextIndex = addIndex > 0 ? addIndex-1 : addIndex;
-        }
-
-        Slog.d(TAG, "Update LRU at " + lrui + " to " + addIndex + " (act="
-                + mLruProcessActivityStart + "): " + app);
-        */
-
-        if (lrui >= 0) {
-            if (lrui < mLruProcessActivityStart) {
-                mLruProcessActivityStart--;
-            }
-            if (lrui < mLruProcessServiceStart) {
-                mLruProcessServiceStart--;
-            }
-            /*
-            if (addIndex > lrui) {
-                addIndex--;
-            }
-            if (nextIndex > lrui) {
-                nextIndex--;
-            }
-            */
-            mLruProcesses.remove(lrui);
-        }
-
-        /*
-        mLruProcesses.add(addIndex, app);
-        if (inActivity) {
-            mLruProcessActivityStart++;
-        }
-        if (inService) {
-            mLruProcessActivityStart++;
-        }
-        */
-
-        int nextIndex;
-        if (hasActivity) {
-            final int N = mLruProcesses.size();
-            if ((!app.hasActivities() || app.hasRecentTasks())
-                    && mLruProcessActivityStart < (N - 1)) {
-                // Process doesn't have activities, but has clients with
-                // activities...  move it up, but one below the top (the top
-                // should always have a real activity).
-                if (DEBUG_LRU) Slog.d(TAG_LRU,
-                        "Adding to second-top of LRU activity list: " + app);
-                mLruProcesses.add(N - 1, app);
-                // To keep it from spamming the LRU list (by making a bunch of clients),
-                // we will push down any other entries owned by the app.
-                final int uid = app.info.uid;
-                for (int i = N - 2; i > mLruProcessActivityStart; i--) {
-                    ProcessRecord subProc = mLruProcesses.get(i);
-                    if (subProc.info.uid == uid) {
-                        // We want to push this one down the list.  If the process after
-                        // it is for the same uid, however, don't do so, because we don't
-                        // want them internally to be re-ordered.
-                        if (mLruProcesses.get(i - 1).info.uid != uid) {
-                            if (DEBUG_LRU) Slog.d(TAG_LRU,
-                                    "Pushing uid " + uid + " swapping at " + i + ": "
-                                    + mLruProcesses.get(i) + " : " + mLruProcesses.get(i - 1));
-                            ProcessRecord tmp = mLruProcesses.get(i);
-                            mLruProcesses.set(i, mLruProcesses.get(i - 1));
-                            mLruProcesses.set(i - 1, tmp);
-                            i--;
-                        }
-                    } else {
-                        // A gap, we can stop here.
-                        break;
-                    }
-                }
-            } else {
-                // Process has activities, put it at the very tipsy-top.
-                if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding to top of LRU activity list: " + app);
-                mLruProcesses.add(app);
-            }
-            nextIndex = mLruProcessServiceStart;
-        } else if (hasService) {
-            // Process has services, put it at the top of the service list.
-            if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding to top of LRU service list: " + app);
-            mLruProcesses.add(mLruProcessActivityStart, app);
-            nextIndex = mLruProcessServiceStart;
-            mLruProcessActivityStart++;
-        } else  {
-            // Process not otherwise of interest, it goes to the top of the non-service area.
-            int index = mLruProcessServiceStart;
-            if (client != null) {
-                // If there is a client, don't allow the process to be moved up higher
-                // in the list than that client.
-                int clientIndex = mLruProcesses.lastIndexOf(client);
-                if (DEBUG_LRU && clientIndex < 0) Slog.d(TAG_LRU, "Unknown client " + client
-                        + " when updating " + app);
-                if (clientIndex <= lrui) {
-                    // Don't allow the client index restriction to push it down farther in the
-                    // list than it already is.
-                    clientIndex = lrui;
-                }
-                if (clientIndex >= 0 && index > clientIndex) {
-                    index = clientIndex;
-                }
-            }
-            if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding at " + index + " of LRU list: " + app);
-            mLruProcesses.add(index, app);
-            nextIndex = index-1;
-            mLruProcessActivityStart++;
-            mLruProcessServiceStart++;
-        }
-
-        // If the app is currently using a content provider or service,
-        // bump those processes as well.
-        for (int j=app.connections.size()-1; j>=0; j--) {
-            ConnectionRecord cr = app.connections.valueAt(j);
-            if (cr.binding != null && !cr.serviceDead && cr.binding.service != null
-                    && cr.binding.service.app != null
-                    && cr.binding.service.app.lruSeq != mLruSeq
-                    && !cr.binding.service.app.isPersistent()) {
-                nextIndex = updateLruProcessInternalLocked(cr.binding.service.app, now, nextIndex,
-                        "service connection", cr, app);
-            }
-        }
-        for (int j=app.conProviders.size()-1; j>=0; j--) {
-            ContentProviderRecord cpr = app.conProviders.get(j).provider;
-            if (cpr.proc != null && cpr.proc.lruSeq != mLruSeq && !cpr.proc.isPersistent()) {
-                nextIndex = updateLruProcessInternalLocked(cpr.proc, now, nextIndex,
-                        "provider reference", cpr, app);
-            }
-        }
+        mProcessList.removeLruProcessLocked(app);
     }
 
     final ProcessRecord getProcessRecordLocked(String processName, int uid, boolean keepIfLarge) {
-        if (uid == SYSTEM_UID) {
-            // The system gets to run in any process.  If there are multiple
-            // processes with the same uid, just pick the first (this
-            // should never happen).
-            SparseArray<ProcessRecord> procs = mProcessNames.getMap().get(processName);
-            if (procs == null) return null;
-            final int procCount = procs.size();
-            for (int i = 0; i < procCount; i++) {
-                final int procUid = procs.keyAt(i);
-                if (UserHandle.isApp(procUid) || !UserHandle.isSameUser(procUid, uid)) {
-                    // Don't use an app process or different user process for system component.
-                    continue;
-                }
-                return procs.valueAt(i);
-            }
-        }
-        ProcessRecord proc = mProcessNames.get(processName, uid);
-        if (false && proc != null && !keepIfLarge
-                && proc.setProcState >= ActivityManager.PROCESS_STATE_CACHED_EMPTY
-                && proc.lastCachedPss >= 4000) {
-            // Turn this condition on to cause killing to happen regularly, for testing.
-            if (proc.baseProcessTracker != null) {
-                proc.baseProcessTracker.reportCachedKill(proc.pkgList.mPkgList, proc.lastCachedPss);
-                for (int ipkg = proc.pkgList.size() - 1; ipkg >= 0; ipkg--) {
-                    ProcessStats.ProcessStateHolder holder = proc.pkgList.valueAt(ipkg);
-                    StatsLog.write(StatsLog.CACHED_KILL_REPORTED,
-                            proc.info.uid,
-                            holder.state.getName(),
-                            holder.state.getPackage(),
-                            proc.lastCachedPss, holder.appVersion);
-                }
-            }
-            proc.kill(Long.toString(proc.lastCachedPss) + "k from cached", true);
-        } else if (proc != null && !keepIfLarge
-                && mLastMemoryLevel > ProcessStats.ADJ_MEM_FACTOR_NORMAL
-                && proc.setProcState >= ActivityManager.PROCESS_STATE_CACHED_EMPTY) {
-            if (DEBUG_PSS) Slog.d(TAG_PSS, "May not keep " + proc + ": pss=" + proc.lastCachedPss);
-            if (proc.lastCachedPss >= mProcessList.getCachedRestoreThresholdKb()) {
-                if (proc.baseProcessTracker != null) {
-                    proc.baseProcessTracker.reportCachedKill(proc.pkgList.mPkgList, proc.lastCachedPss);
-                    for (int ipkg = proc.pkgList.size() - 1; ipkg >= 0; ipkg--) {
-                        ProcessStats.ProcessStateHolder holder = proc.pkgList.valueAt(ipkg);
-                        StatsLog.write(StatsLog.CACHED_KILL_REPORTED,
-                                proc.info.uid,
-                                holder.state.getName(),
-                                holder.state.getPackage(),
-                                proc.lastCachedPss, holder.appVersion);
-                    }
-                }
-                proc.kill(Long.toString(proc.lastCachedPss) + "k from cached", true);
-            }
-        }
-        return proc;
+        return mProcessList.getProcessRecordLocked(processName, uid, keepIfLarge);
+    }
+
+    final ProcessMap<ProcessRecord> getProcessNames() {
+        return mProcessList.mProcessNames;
     }
 
     void notifyPackageUse(String packageName, int reason) {
@@ -3071,7 +2617,7 @@
             info.packageName = "android";
             info.seInfoUser = SELinuxUtil.COMPLETE_STR;
             info.targetSdkVersion = Build.VERSION.SDK_INT;
-            ProcessRecord proc = startProcessLocked(processName, info /* info */,
+            ProcessRecord proc = mProcessList.startProcessLocked(processName, info /* info */,
                     false /* knownToBeDead */, 0 /* intentFlags */, ""  /* hostingType */,
                     null /* hostingName */, true /* allowWhileBooting */, true /* isolated */,
                     uid, true /* keepIfLarge */, abiOverride, entryPoint, entryPointArgs,
@@ -3085,548 +2631,17 @@
             ApplicationInfo info, boolean knownToBeDead, int intentFlags,
             String hostingType, ComponentName hostingName, boolean allowWhileBooting,
             boolean isolated, boolean keepIfLarge) {
-        return startProcessLocked(processName, info, knownToBeDead, intentFlags, hostingType,
+        return mProcessList.startProcessLocked(processName, info, knownToBeDead, intentFlags,
+                hostingType,
                 hostingName, allowWhileBooting, isolated, 0 /* isolatedUid */, keepIfLarge,
                 null /* ABI override */, null /* entryPoint */, null /* entryPointArgs */,
                 null /* crashHandler */);
     }
 
-    @GuardedBy("this")
-    final ProcessRecord startProcessLocked(String processName, ApplicationInfo info,
-            boolean knownToBeDead, int intentFlags, String hostingType, ComponentName hostingName,
-            boolean allowWhileBooting, boolean isolated, int isolatedUid, boolean keepIfLarge,
-            String abiOverride, String entryPoint, String[] entryPointArgs, Runnable crashHandler) {
-        long startTime = SystemClock.elapsedRealtime();
-        ProcessRecord app;
-        if (!isolated) {
-            app = getProcessRecordLocked(processName, info.uid, keepIfLarge);
-            checkTime(startTime, "startProcess: after getProcessRecord");
-
-            if ((intentFlags & Intent.FLAG_FROM_BACKGROUND) != 0) {
-                // If we are in the background, then check to see if this process
-                // is bad.  If so, we will just silently fail.
-                if (mAppErrors.isBadProcessLocked(info)) {
-                    if (DEBUG_PROCESSES) Slog.v(TAG, "Bad process: " + info.uid
-                            + "/" + info.processName);
-                    return null;
-                }
-            } else {
-                // When the user is explicitly starting a process, then clear its
-                // crash count so that we won't make it bad until they see at
-                // least one crash dialog again, and make the process good again
-                // if it had been bad.
-                if (DEBUG_PROCESSES) Slog.v(TAG, "Clearing bad process: " + info.uid
-                        + "/" + info.processName);
-                mAppErrors.resetProcessCrashTimeLocked(info);
-                if (mAppErrors.isBadProcessLocked(info)) {
-                    EventLog.writeEvent(EventLogTags.AM_PROC_GOOD,
-                            UserHandle.getUserId(info.uid), info.uid,
-                            info.processName);
-                    mAppErrors.clearBadProcessLocked(info);
-                    if (app != null) {
-                        app.bad = false;
-                    }
-                }
-            }
-        } else {
-            // If this is an isolated process, it can't re-use an existing process.
-            app = null;
-        }
-
-        // We don't have to do anything more if:
-        // (1) There is an existing application record; and
-        // (2) The caller doesn't think it is dead, OR there is no thread
-        //     object attached to it so we know it couldn't have crashed; and
-        // (3) There is a pid assigned to it, so it is either starting or
-        //     already running.
-        if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "startProcess: name=" + processName
-                + " app=" + app + " knownToBeDead=" + knownToBeDead
-                + " thread=" + (app != null ? app.thread : null)
-                + " pid=" + (app != null ? app.pid : -1));
-        if (app != null && app.pid > 0) {
-            if ((!knownToBeDead && !app.killed) || app.thread == null) {
-                // We already have the app running, or are waiting for it to
-                // come up (we have a pid but not yet its thread), so keep it.
-                if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "App already running: " + app);
-                // If this is a new package in the process, add the package to the list
-                app.addPackage(info.packageName, info.versionCode, mProcessStats);
-                checkTime(startTime, "startProcess: done, added package to proc");
-                return app;
-            }
-
-            // An application record is attached to a previous process,
-            // clean it up now.
-            if (DEBUG_PROCESSES || DEBUG_CLEANUP) Slog.v(TAG_PROCESSES, "App died: " + app);
-            checkTime(startTime, "startProcess: bad proc running, killing");
-            killProcessGroup(app.uid, app.pid);
-            handleAppDiedLocked(app, true, true);
-            checkTime(startTime, "startProcess: done killing old proc");
-        }
-
-        String hostingNameStr = hostingName != null
-                ? hostingName.flattenToShortString() : null;
-
-        if (app == null) {
-            checkTime(startTime, "startProcess: creating new process record");
-            app = newProcessRecordLocked(info, processName, isolated, isolatedUid);
-            if (app == null) {
-                Slog.w(TAG, "Failed making new process record for "
-                        + processName + "/" + info.uid + " isolated=" + isolated);
-                return null;
-            }
-            app.crashHandler = crashHandler;
-            app.isolatedEntryPoint = entryPoint;
-            app.isolatedEntryPointArgs = entryPointArgs;
-            checkTime(startTime, "startProcess: done creating new process record");
-        } else {
-            // If this is a new package in the process, add the package to the list
-            app.addPackage(info.packageName, info.versionCode, mProcessStats);
-            checkTime(startTime, "startProcess: added package to existing proc");
-        }
-
-        // If the system is not ready yet, then hold off on starting this
-        // process until it is.
-        if (!mProcessesReady
-                && !isAllowedWhileBooting(info)
-                && !allowWhileBooting) {
-            if (!mProcessesOnHold.contains(app)) {
-                mProcessesOnHold.add(app);
-            }
-            if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES,
-                    "System not ready, putting on hold: " + app);
-            checkTime(startTime, "startProcess: returning with proc on hold");
-            return app;
-        }
-
-        checkTime(startTime, "startProcess: stepping in to startProcess");
-        final boolean success = startProcessLocked(app, hostingType, hostingNameStr, abiOverride);
-        checkTime(startTime, "startProcess: done starting proc!");
-        return success ? app : null;
-    }
-
     boolean isAllowedWhileBooting(ApplicationInfo ai) {
         return (ai.flags&ApplicationInfo.FLAG_PERSISTENT) != 0;
     }
 
-    @GuardedBy("this")
-    private final void startProcessLocked(ProcessRecord app,
-            String hostingType, String hostingNameStr) {
-        startProcessLocked(app, hostingType, hostingNameStr, null /* abiOverride */);
-    }
-
-    @GuardedBy("this")
-    private final boolean startProcessLocked(ProcessRecord app,
-            String hostingType, String hostingNameStr, String abiOverride) {
-        return startProcessLocked(app, hostingType, hostingNameStr,
-                false /* disableHiddenApiChecks */, abiOverride);
-    }
-
-    /**
-     * @return {@code true} if process start is successful, false otherwise.
-     */
-    @GuardedBy("this")
-    private final boolean startProcessLocked(ProcessRecord app, String hostingType,
-            String hostingNameStr, boolean disableHiddenApiChecks, String abiOverride) {
-        if (app.pendingStart) {
-            return true;
-        }
-        long startTime = SystemClock.elapsedRealtime();
-        if (app.pid > 0 && app.pid != MY_PID) {
-            checkTime(startTime, "startProcess: removing from pids map");
-            synchronized (mPidsSelfLocked) {
-                mPidsSelfLocked.remove(app.pid);
-                mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app);
-            }
-            checkTime(startTime, "startProcess: done removing from pids map");
-            app.setPid(0);
-        }
-
-        if (DEBUG_PROCESSES && mProcessesOnHold.contains(app)) Slog.v(TAG_PROCESSES,
-                "startProcessLocked removing on hold: " + app);
-        mProcessesOnHold.remove(app);
-
-        checkTime(startTime, "startProcess: starting to update cpu stats");
-        updateCpuStats();
-        checkTime(startTime, "startProcess: done updating cpu stats");
-
-        try {
-            try {
-                final int userId = UserHandle.getUserId(app.uid);
-                AppGlobals.getPackageManager().checkPackageStartable(app.info.packageName, userId);
-            } catch (RemoteException e) {
-                throw e.rethrowAsRuntimeException();
-            }
-
-            int uid = app.uid;
-            int[] gids = null;
-            int mountExternal = Zygote.MOUNT_EXTERNAL_NONE;
-            if (!app.isolated) {
-                int[] permGids = null;
-                try {
-                    checkTime(startTime, "startProcess: getting gids from package manager");
-                    final IPackageManager pm = AppGlobals.getPackageManager();
-                    permGids = pm.getPackageGids(app.info.packageName,
-                            MATCH_DEBUG_TRIAGED_MISSING, app.userId);
-                    StorageManagerInternal storageManagerInternal = LocalServices.getService(
-                            StorageManagerInternal.class);
-                    mountExternal = storageManagerInternal.getExternalStorageMountMode(uid,
-                            app.info.packageName);
-                } catch (RemoteException e) {
-                    throw e.rethrowAsRuntimeException();
-                }
-
-                /*
-                 * Add shared application and profile GIDs so applications can share some
-                 * resources like shared libraries and access user-wide resources
-                 */
-                if (ArrayUtils.isEmpty(permGids)) {
-                    gids = new int[3];
-                } else {
-                    gids = new int[permGids.length + 3];
-                    System.arraycopy(permGids, 0, gids, 3, permGids.length);
-                }
-                gids[0] = UserHandle.getSharedAppGid(UserHandle.getAppId(uid));
-                gids[1] = UserHandle.getCacheAppGid(UserHandle.getAppId(uid));
-                gids[2] = UserHandle.getUserGid(UserHandle.getUserId(uid));
-
-                // Replace any invalid GIDs
-                if (gids[0] == UserHandle.ERR_GID) gids[0] = gids[2];
-                if (gids[1] == UserHandle.ERR_GID) gids[1] = gids[2];
-            }
-            checkTime(startTime, "startProcess: building args");
-            if (mAtmInternal.isFactoryTestProcess(app.getWindowProcessController())) {
-                uid = 0;
-            }
-            int runtimeFlags = 0;
-            if ((app.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) != 0) {
-                runtimeFlags |= Zygote.DEBUG_ENABLE_JDWP;
-                runtimeFlags |= Zygote.DEBUG_JAVA_DEBUGGABLE;
-                // Also turn on CheckJNI for debuggable apps. It's quite
-                // awkward to turn on otherwise.
-                runtimeFlags |= Zygote.DEBUG_ENABLE_CHECKJNI;
-            }
-            // Run the app in safe mode if its manifest requests so or the
-            // system is booted in safe mode.
-            if ((app.info.flags & ApplicationInfo.FLAG_VM_SAFE_MODE) != 0 ||
-                mSafeMode == true) {
-                runtimeFlags |= Zygote.DEBUG_ENABLE_SAFEMODE;
-            }
-            if ("1".equals(SystemProperties.get("debug.checkjni"))) {
-                runtimeFlags |= Zygote.DEBUG_ENABLE_CHECKJNI;
-            }
-            String genDebugInfoProperty = SystemProperties.get("debug.generate-debug-info");
-            if ("1".equals(genDebugInfoProperty) || "true".equals(genDebugInfoProperty)) {
-                runtimeFlags |= Zygote.DEBUG_GENERATE_DEBUG_INFO;
-            }
-            String genMiniDebugInfoProperty = SystemProperties.get("dalvik.vm.minidebuginfo");
-            if ("1".equals(genMiniDebugInfoProperty) || "true".equals(genMiniDebugInfoProperty)) {
-                runtimeFlags |= Zygote.DEBUG_GENERATE_MINI_DEBUG_INFO;
-            }
-            if ("1".equals(SystemProperties.get("debug.jni.logging"))) {
-                runtimeFlags |= Zygote.DEBUG_ENABLE_JNI_LOGGING;
-            }
-            if ("1".equals(SystemProperties.get("debug.assert"))) {
-                runtimeFlags |= Zygote.DEBUG_ENABLE_ASSERT;
-            }
-            if (mNativeDebuggingApp != null && mNativeDebuggingApp.equals(app.processName)) {
-                // Enable all debug flags required by the native debugger.
-                runtimeFlags |= Zygote.DEBUG_ALWAYS_JIT;          // Don't interpret anything
-                runtimeFlags |= Zygote.DEBUG_GENERATE_DEBUG_INFO; // Generate debug info
-                runtimeFlags |= Zygote.DEBUG_NATIVE_DEBUGGABLE;   // Disbale optimizations
-                mNativeDebuggingApp = null;
-            }
-
-            if (app.info.isPrivilegedApp() &&
-                    DexManager.isPackageSelectedToRunOob(app.pkgList.mPkgList.keySet())) {
-                runtimeFlags |= Zygote.ONLY_USE_SYSTEM_OAT_FILES;
-            }
-
-            if (!disableHiddenApiChecks && !mHiddenApiBlacklist.isDisabled()) {
-                app.info.maybeUpdateHiddenApiEnforcementPolicy(
-                        mHiddenApiBlacklist.getPolicyForPrePApps(),
-                        mHiddenApiBlacklist.getPolicyForPApps());
-                @HiddenApiEnforcementPolicy int policy =
-                        app.info.getHiddenApiEnforcementPolicy();
-                int policyBits = (policy << Zygote.API_ENFORCEMENT_POLICY_SHIFT);
-                if ((policyBits & Zygote.API_ENFORCEMENT_POLICY_MASK) != policyBits) {
-                    throw new IllegalStateException("Invalid API policy: " + policy);
-                }
-                runtimeFlags |= policyBits;
-            }
-
-            String invokeWith = null;
-            if ((app.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) != 0) {
-                // Debuggable apps may include a wrapper script with their library directory.
-                String wrapperFileName = app.info.nativeLibraryDir + "/wrap.sh";
-                StrictMode.ThreadPolicy oldPolicy = StrictMode.allowThreadDiskReads();
-                try {
-                    if (new File(wrapperFileName).exists()) {
-                        invokeWith = "/system/bin/logwrapper " + wrapperFileName;
-                    }
-                } finally {
-                    StrictMode.setThreadPolicy(oldPolicy);
-                }
-            }
-
-            String requiredAbi = (abiOverride != null) ? abiOverride : app.info.primaryCpuAbi;
-            if (requiredAbi == null) {
-                requiredAbi = Build.SUPPORTED_ABIS[0];
-            }
-
-            String instructionSet = null;
-            if (app.info.primaryCpuAbi != null) {
-                instructionSet = VMRuntime.getInstructionSet(app.info.primaryCpuAbi);
-            }
-
-            app.gids = gids;
-            app.setRequiredAbi(requiredAbi);
-            app.instructionSet = instructionSet;
-
-            // the per-user SELinux context must be set
-            if (TextUtils.isEmpty(app.info.seInfoUser)) {
-                Slog.wtf(TAG, "SELinux tag not defined",
-                        new IllegalStateException("SELinux tag not defined for "
-                        + app.info.packageName + " (uid " + app.uid + ")"));
-            }
-            final String seInfo = app.info.seInfo
-                    + (TextUtils.isEmpty(app.info.seInfoUser) ? "" : app.info.seInfoUser);
-            // Start the process.  It will either succeed and return a result containing
-            // the PID of the new process, or else throw a RuntimeException.
-            final String entryPoint = "android.app.ActivityThread";
-
-            return startProcessLocked(hostingType, hostingNameStr, entryPoint, app, uid, gids,
-                    runtimeFlags, mountExternal, seInfo, requiredAbi, instructionSet, invokeWith,
-                    startTime);
-        } catch (RuntimeException e) {
-            Slog.e(TAG, "Failure starting process " + app.processName, e);
-
-            // Something went very wrong while trying to start this process; one
-            // common case is when the package is frozen due to an active
-            // upgrade. To recover, clean up any active bookkeeping related to
-            // starting this process. (We already invoked this method once when
-            // the package was initially frozen through KILL_APPLICATION_MSG, so
-            // it doesn't hurt to use it again.)
-            forceStopPackageLocked(app.info.packageName, UserHandle.getAppId(app.uid), false,
-                    false, true, false, false, app.userId, "start failure");
-            return false;
-        }
-    }
-
-    @GuardedBy("this")
-    private boolean startProcessLocked(String hostingType, String hostingNameStr, String entryPoint,
-            ProcessRecord app, int uid, int[] gids, int runtimeFlags, int mountExternal,
-            String seInfo, String requiredAbi, String instructionSet, String invokeWith,
-            long startTime) {
-        app.pendingStart = true;
-        app.killedByAm = false;
-        app.removed = false;
-        app.killed = false;
-        final long startSeq = app.startSeq = ++mProcStartSeqCounter;
-        app.setStartParams(uid, hostingType, hostingNameStr, seInfo, startTime);
-        if (mConstants.FLAG_PROCESS_START_ASYNC) {
-            if (DEBUG_PROCESSES) Slog.i(TAG_PROCESSES,
-                    "Posting procStart msg for " + app.toShortString());
-            mProcStartHandler.post(() -> {
-                try {
-                    synchronized (ActivityManagerService.this) {
-                        final String reason = isProcStartValidLocked(app, startSeq);
-                        if (reason != null) {
-                            Slog.w(TAG_PROCESSES, app + " not valid anymore,"
-                                    + " don't start process, " + reason);
-                            app.pendingStart = false;
-                            return;
-                        }
-                        app.setUsingWrapper(invokeWith != null
-                                || SystemProperties.get("wrap." + app.processName) != null);
-                        mPendingStarts.put(startSeq, app);
-                    }
-                    final ProcessStartResult startResult = startProcess(app.hostingType, entryPoint,
-                            app, app.startUid, gids, runtimeFlags, mountExternal, app.seInfo,
-                            requiredAbi, instructionSet, invokeWith, app.startTime);
-                    synchronized (ActivityManagerService.this) {
-                        handleProcessStartedLocked(app, startResult, startSeq);
-                    }
-                } catch (RuntimeException e) {
-                    synchronized (ActivityManagerService.this) {
-                        Slog.e(TAG, "Failure starting process " + app.processName, e);
-                        mPendingStarts.remove(startSeq);
-                        app.pendingStart = false;
-                        forceStopPackageLocked(app.info.packageName, UserHandle.getAppId(app.uid),
-                                false, false, true, false, false, app.userId, "start failure");
-                    }
-                }
-            });
-            return true;
-        } else {
-            try {
-                final ProcessStartResult startResult = startProcess(hostingType, entryPoint, app,
-                        uid, gids, runtimeFlags, mountExternal, seInfo, requiredAbi, instructionSet,
-                        invokeWith, startTime);
-                handleProcessStartedLocked(app, startResult.pid, startResult.usingWrapper,
-                        startSeq, false);
-            } catch (RuntimeException e) {
-                Slog.e(TAG, "Failure starting process " + app.processName, e);
-                app.pendingStart = false;
-                forceStopPackageLocked(app.info.packageName, UserHandle.getAppId(app.uid),
-                        false, false, true, false, false, app.userId, "start failure");
-            }
-            return app.pid > 0;
-        }
-    }
-
-    private ProcessStartResult startProcess(String hostingType, String entryPoint,
-            ProcessRecord app, int uid, int[] gids, int runtimeFlags, int mountExternal,
-            String seInfo, String requiredAbi, String instructionSet, String invokeWith,
-            long startTime) {
-        try {
-            final String[] packageNames = mContext.getPackageManager().getPackagesForUid(uid);
-            final String[] visibleVolIds = LocalServices.getService(StorageManagerInternal.class)
-                    .getVisibleVolumesForUser(UserHandle.getUserId(uid));
-            Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "Start proc: " +
-                    app.processName);
-            checkTime(startTime, "startProcess: asking zygote to start proc");
-            final ProcessStartResult startResult;
-            if (hostingType.equals("webview_service")) {
-                startResult = startWebView(entryPoint,
-                        app.processName, uid, uid, gids, runtimeFlags, mountExternal,
-                        app.info.targetSdkVersion, seInfo, requiredAbi, instructionSet,
-                        app.info.dataDir, null, app.info.packageName,
-                        packageNames, visibleVolIds,
-                        new String[] {PROC_START_SEQ_IDENT + app.startSeq});
-            } else {
-                startResult = Process.start(entryPoint,
-                        app.processName, uid, uid, gids, runtimeFlags, mountExternal,
-                        app.info.targetSdkVersion, seInfo, requiredAbi, instructionSet,
-                        app.info.dataDir, invokeWith, app.info.packageName,
-                        packageNames, visibleVolIds,
-                        new String[] {PROC_START_SEQ_IDENT + app.startSeq});
-            }
-            checkTime(startTime, "startProcess: returned from zygote!");
-            return startResult;
-        } finally {
-            Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
-        }
-    }
-
-    @GuardedBy("this")
-    private String isProcStartValidLocked(ProcessRecord app, long expectedStartSeq) {
-        StringBuilder sb = null;
-        if (app.killedByAm) {
-            if (sb == null) sb = new StringBuilder();
-            sb.append("killedByAm=true;");
-        }
-        if (mProcessNames.get(app.processName, app.uid) != app) {
-            if (sb == null) sb = new StringBuilder();
-            sb.append("No entry in mProcessNames;");
-        }
-        if (!app.pendingStart) {
-            if (sb == null) sb = new StringBuilder();
-            sb.append("pendingStart=false;");
-        }
-        if (app.startSeq > expectedStartSeq) {
-            if (sb == null) sb = new StringBuilder();
-            sb.append("seq=" + app.startSeq + ",expected=" + expectedStartSeq + ";");
-        }
-        return sb == null ? null : sb.toString();
-    }
-
-    @GuardedBy("this")
-    private boolean handleProcessStartedLocked(ProcessRecord pending,
-            ProcessStartResult startResult, long expectedStartSeq) {
-        // Indicates that this process start has been taken care of.
-        if (mPendingStarts.get(expectedStartSeq) == null) {
-            if (pending.pid == startResult.pid) {
-                pending.setUsingWrapper(startResult.usingWrapper);
-                // TODO: Update already existing clients of usingWrapper
-            }
-            return false;
-        }
-        return handleProcessStartedLocked(pending, startResult.pid, startResult.usingWrapper,
-                expectedStartSeq, false);
-    }
-
-    @GuardedBy("this")
-    private boolean handleProcessStartedLocked(ProcessRecord app, int pid, boolean usingWrapper,
-            long expectedStartSeq, boolean procAttached) {
-        mPendingStarts.remove(expectedStartSeq);
-        final String reason = isProcStartValidLocked(app, expectedStartSeq);
-        if (reason != null) {
-            Slog.w(TAG_PROCESSES, app + " start not valid, killing pid=" + pid
-                    + ", " + reason);
-            app.pendingStart = false;
-            Process.killProcessQuiet(pid);
-            Process.killProcessGroup(app.uid, app.pid);
-            return false;
-        }
-        mBatteryStatsService.noteProcessStart(app.processName, app.info.uid);
-        checkTime(app.startTime, "startProcess: done updating battery stats");
-
-        EventLog.writeEvent(EventLogTags.AM_PROC_START,
-                UserHandle.getUserId(app.startUid), pid, app.startUid,
-                app.processName, app.hostingType,
-                app.hostingNameStr != null ? app.hostingNameStr : "");
-
-        try {
-            AppGlobals.getPackageManager().logAppProcessStartIfNeeded(app.processName, app.uid,
-                    app.seInfo, app.info.sourceDir, pid);
-        } catch (RemoteException ex) {
-            // Ignore
-        }
-
-        if (app.isPersistent()) {
-            Watchdog.getInstance().processStarted(app.processName, pid);
-        }
-
-        checkTime(app.startTime, "startProcess: building log message");
-        StringBuilder buf = mStringBuilder;
-        buf.setLength(0);
-        buf.append("Start proc ");
-        buf.append(pid);
-        buf.append(':');
-        buf.append(app.processName);
-        buf.append('/');
-        UserHandle.formatUid(buf, app.startUid);
-        if (app.isolatedEntryPoint != null) {
-            buf.append(" [");
-            buf.append(app.isolatedEntryPoint);
-            buf.append("]");
-        }
-        buf.append(" for ");
-        buf.append(app.hostingType);
-        if (app.hostingNameStr != null) {
-            buf.append(" ");
-            buf.append(app.hostingNameStr);
-        }
-        reportUidInfoMessageLocked(TAG, buf.toString(), app.startUid);
-        app.setPid(pid);
-        app.setUsingWrapper(usingWrapper);
-        app.pendingStart = false;
-        checkTime(app.startTime, "startProcess: starting to update pids map");
-        ProcessRecord oldApp;
-        synchronized (mPidsSelfLocked) {
-            oldApp = mPidsSelfLocked.get(pid);
-        }
-        // If there is already an app occupying that pid that hasn't been cleaned up
-        if (oldApp != null && !app.isolated) {
-            // Clean up anything relating to this pid first
-            Slog.w(TAG, "Reusing pid " + pid
-                    + " while app is still mapped to it");
-            cleanUpApplicationRecordLocked(oldApp, false, false, -1,
-                    true /*replacingPid*/);
-        }
-        synchronized (mPidsSelfLocked) {
-            this.mPidsSelfLocked.put(pid, app);
-            if (!procAttached) {
-                Message msg = mHandler.obtainMessage(PROC_START_TIMEOUT_MSG);
-                msg.obj = app;
-                mHandler.sendMessageDelayed(msg, usingWrapper
-                        ? PROC_START_TIMEOUT_WITH_WRAPPER : PROC_START_TIMEOUT);
-            }
-        }
-        checkTime(app.startTime, "startProcess: done updating pids map");
-        return true;
-    }
-
     void updateUsageStats(ComponentName activity, int uid, int userId, boolean resumed) {
         if (DEBUG_SWITCH) Slog.d(TAG_SWITCH,
                 "updateUsageStats: comp=" + activity + "res=" + resumed);
@@ -3690,8 +2705,8 @@
 
         int procState = ActivityManager.PROCESS_STATE_NONEXISTENT;
         synchronized (this) {
-            for (int i=mLruProcesses.size()-1; i>=0; i--) {
-                final ProcessRecord proc = mLruProcesses.get(i);
+            for (int i=mProcessList.mLruProcesses.size()-1; i>=0; i--) {
+                final ProcessRecord proc = mProcessList.mLruProcesses.get(i);
                 if (procState > proc.setProcState) {
                     if (proc.pkgList.containsKey(packageName) ||
                             (proc.pkgDeps != null && proc.pkgDeps.contains(packageName))) {
@@ -3985,9 +3000,35 @@
     public final int startActivityAsUser(IApplicationThread caller, String callingPackage,
             Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode,
             int startFlags, ProfilerInfo profilerInfo, Bundle bOptions, int userId) {
-        return mActivityTaskManager.startActivityAsUser(caller, callingPackage, intent,
-                resolvedType, resultTo, resultWho, requestCode, startFlags, profilerInfo, bOptions,
-                userId);
+        synchronized (this) {
+            /**
+             * Flags like {@link android.app.ActivityManager#START_FLAG_DEBUG} maybe be set on this
+             * call when called/invoked from the shell command. To avoid deadlock, we go ahead and
+             * acquire the AMS lock now since ATMS will need to synchronously call back into AMS
+             * later to modify process settings due to the flags.
+             * TODO(b/80414790): Investigate a better way of untangling this.
+             */
+            return mActivityTaskManager.startActivityAsUser(caller, callingPackage, intent,
+                    resolvedType, resultTo, resultWho, requestCode, startFlags, profilerInfo,
+                    bOptions, userId);
+        }
+    }
+
+    WaitResult startActivityAndWait(IApplicationThread caller, String callingPackage,
+            Intent intent, String resolvedType, IBinder resultTo, String resultWho, int requestCode,
+            int startFlags, ProfilerInfo profilerInfo, Bundle bOptions, int userId) {
+        synchronized (this) {
+            /**
+             * Flags like {@link android.app.ActivityManager#START_FLAG_DEBUG} maybe be set on this
+             * call when called/invoked from the shell command. To avoid deadlock, we go ahead and
+             * acquire the AMS lock now since ATMS will need to synchronously call back into AMS
+             * later to modify process settings due to the flags.
+             * TODO(b/80414790): Investigate a better way of untangling this.
+             */
+            return mActivityTaskManager.startActivityAndWait(caller, callingPackage, intent,
+                    resolvedType, resultTo, resultWho, requestCode, startFlags, profilerInfo,
+                    bOptions, userId);
+        }
     }
 
     @Override
@@ -4066,7 +3107,7 @@
      * to the process.
      */
     @GuardedBy("this")
-    private final void handleAppDiedLocked(ProcessRecord app,
+    final void handleAppDiedLocked(ProcessRecord app,
             boolean restarting, boolean allowRestart) {
         int pid = app.pid;
         boolean kept = cleanUpApplicationRecordLocked(app, restarting, allowRestart, -1,
@@ -4082,45 +3123,13 @@
             clearProfilerLocked();
         }
 
-        // Remove this application's activities from active lists.
-        boolean hasVisibleActivities = mStackSupervisor.handleAppDiedLocked(app.getWindowProcessController());
-
-        app.clearRecentTasks();
-        app.clearActivities();
-
-        if (app.getActiveInstrumentation() != null) {
+        mAtmInternal.handleAppDied(app.getWindowProcessController(), restarting, () -> {
             Slog.w(TAG, "Crash of app " + app.processName
-                  + " running instrumentation " + app.getActiveInstrumentation().mClass);
+                    + " running instrumentation " + app.getActiveInstrumentation().mClass);
             Bundle info = new Bundle();
             info.putString("shortMsg", "Process crashed.");
             finishInstrumentationLocked(app, Activity.RESULT_CANCELED, info);
-        }
-
-        mWindowManager.deferSurfaceLayout();
-        try {
-            if (!restarting && hasVisibleActivities
-                    && !mStackSupervisor.resumeFocusedStacksTopActivitiesLocked()) {
-                // If there was nothing to resume, and we are not already restarting this process, but
-                // there is a visible activity that is hosted by the process...  then make sure all
-                // visible activities are running, taking care of restarting this process.
-                mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS);
-            }
-        } finally {
-            mWindowManager.continueSurfaceLayout();
-        }
-
-    }
-
-    private final int getLRURecordIndexForAppLocked(IApplicationThread thread) {
-        final IBinder threadBinder = thread.asBinder();
-        // Find the application record.
-        for (int i=mLruProcesses.size()-1; i>=0; i--) {
-            final ProcessRecord rec = mLruProcesses.get(i);
-            if (rec.thread != null && rec.thread.asBinder() == threadBinder) {
-                return i;
-            }
-        }
-        return -1;
+        });
     }
 
     ProcessRecord getRecordForAppLocked(IApplicationThread thread) {
@@ -4128,15 +3137,14 @@
             return null;
         }
 
-        int appIndex = getLRURecordIndexForAppLocked(thread);
-        if (appIndex >= 0) {
-            return mLruProcesses.get(appIndex);
-        }
+        ProcessRecord record = mProcessList.getLRURecordForAppLocked(thread);
+        if (record != null) return record;
 
         // Validation: if it isn't in the LRU list, it shouldn't exist, but let's
         // double-check that.
         final IBinder threadBinder = thread.asBinder();
-        final ArrayMap<String, SparseArray<ProcessRecord>> pmap = mProcessNames.getMap();
+        final ArrayMap<String, SparseArray<ProcessRecord>> pmap =
+                mProcessList.mProcessNames.getMap();
         for (int i = pmap.size()-1; i >= 0; i--) {
             final SparseArray<ProcessRecord> procs = pmap.valueAt(i);
             for (int j = procs.size()-1; j >= 0; j--) {
@@ -4156,17 +3164,7 @@
         // If there are no longer any background processes running,
         // and the app that died was not running instrumentation,
         // then tell everyone we are now low on memory.
-        boolean haveBg = false;
-        for (int i=mLruProcesses.size()-1; i>=0; i--) {
-            ProcessRecord rec = mLruProcesses.get(i);
-            if (rec.thread != null
-                    && rec.setProcState >= PROCESS_STATE_CACHED_ACTIVITY) {
-                haveBg = true;
-                break;
-            }
-        }
-
-        if (!haveBg) {
+        if (!mProcessList.haveBackgroundProcessLocked()) {
             boolean doReport = "1".equals(SystemProperties.get(SYSTEM_DEBUGGABLE, "0"));
             if (doReport) {
                 long now = SystemClock.uptimeMillis();
@@ -4177,11 +3175,12 @@
                 }
             }
             final ArrayList<ProcessMemInfo> memInfos
-                    = doReport ? new ArrayList<ProcessMemInfo>(mLruProcesses.size()) : null;
-            EventLog.writeEvent(EventLogTags.AM_LOW_MEMORY, mLruProcesses.size());
+                    = doReport ? new ArrayList<ProcessMemInfo>(mProcessList.getLruSizeLocked())
+                    : null;
+            EventLog.writeEvent(EventLogTags.AM_LOW_MEMORY, mProcessList.getLruSizeLocked());
             long now = SystemClock.uptimeMillis();
-            for (int i=mLruProcesses.size()-1; i>=0; i--) {
-                ProcessRecord rec = mLruProcesses.get(i);
+            for (int i = mProcessList.mLruProcesses.size() - 1; i >= 0; i--) {
+                ProcessRecord rec = mProcessList.mLruProcesses.get(i);
                 if (rec == dyingProc || rec.thread == null) {
                     continue;
                 }
@@ -4238,7 +3237,7 @@
             if (!fromBinderDied) {
                 killProcessQuiet(pid);
             }
-            killProcessGroup(app.uid, pid);
+            ProcessList.killProcessGroup(app.uid, pid);
             app.killed = true;
         }
 
@@ -4657,7 +3656,7 @@
                     return;
                 }
                 synchronized (this) {
-                    killPackageProcessesLocked(packageName, appId, targetUserId,
+                    mProcessList.killPackageProcessesLocked(packageName, appId, targetUserId,
                             ProcessList.SERVICE_ADJ, false, true, true, false, "kill background");
                 }
             }
@@ -4680,30 +3679,7 @@
         final long callingId = Binder.clearCallingIdentity();
         try {
             synchronized (this) {
-                final ArrayList<ProcessRecord> procs = new ArrayList<>();
-                final int NP = mProcessNames.getMap().size();
-                for (int ip = 0; ip < NP; ip++) {
-                    final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
-                    final int NA = apps.size();
-                    for (int ia = 0; ia < NA; ia++) {
-                        final ProcessRecord app = apps.valueAt(ia);
-                        if (app.isPersistent()) {
-                            // We don't kill persistent processes.
-                            continue;
-                        }
-                        if (app.removed) {
-                            procs.add(app);
-                        } else if (app.setAdj >= ProcessList.CACHED_APP_MIN_ADJ) {
-                            app.removed = true;
-                            procs.add(app);
-                        }
-                    }
-                }
-
-                final int N = procs.size();
-                for (int i = 0; i < N; i++) {
-                    removeProcessLocked(procs.get(i), false, true, "kill all background");
-                }
+                mProcessList.killAllBackgroundProcessesLocked();
 
                 mAllowLowerMemLevel = true;
 
@@ -4737,27 +3713,7 @@
         final long callingId = Binder.clearCallingIdentity();
         try {
             synchronized (this) {
-                final ArrayList<ProcessRecord> procs = new ArrayList<>();
-                final int NP = mProcessNames.getMap().size();
-                for (int ip = 0; ip < NP; ip++) {
-                    final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
-                    final int NA = apps.size();
-                    for (int ia = 0; ia < NA; ia++) {
-                        final ProcessRecord app = apps.valueAt(ia);
-                        if (app.removed) {
-                            procs.add(app);
-                        } else if ((minTargetSdk < 0 || app.info.targetSdkVersion < minTargetSdk)
-                                && (maxProcState < 0 || app.setProcState > maxProcState)) {
-                            app.removed = true;
-                            procs.add(app);
-                        }
-                    }
-                }
-
-                final int N = procs.size();
-                for (int i = 0; i < N; i++) {
-                    removeProcessLocked(procs.get(i), false, true, "kill all background except");
-                }
+                mProcessList.killAllBackgroundProcessesExceptLocked(minTargetSdk, maxProcState);
             }
         } finally {
             Binder.restoreCallingIdentity(callingId);
@@ -4874,48 +3830,7 @@
 
     @Override
     public void closeSystemDialogs(String reason) {
-        enforceNotIsolatedCaller("closeSystemDialogs");
-
-        final int pid = Binder.getCallingPid();
-        final int uid = Binder.getCallingUid();
-        final long origId = Binder.clearCallingIdentity();
-        try {
-            synchronized (this) {
-                // Only allow this from foreground processes, so that background
-                // applications can't abuse it to prevent system UI from being shown.
-                if (uid >= FIRST_APPLICATION_UID) {
-                    ProcessRecord proc;
-                    synchronized (mPidsSelfLocked) {
-                        proc = mPidsSelfLocked.get(pid);
-                    }
-                    if (proc.curRawAdj > ProcessList.PERCEPTIBLE_APP_ADJ) {
-                        Slog.w(TAG, "Ignoring closeSystemDialogs " + reason
-                                + " from background process " + proc);
-                        return;
-                    }
-                }
-                closeSystemDialogsLocked(reason);
-            }
-        } finally {
-            Binder.restoreCallingIdentity(origId);
-        }
-    }
-
-    @GuardedBy("this")
-    void closeSystemDialogsLocked(String reason) {
-        Intent intent = new Intent(Intent.ACTION_CLOSE_SYSTEM_DIALOGS);
-        intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
-                | Intent.FLAG_RECEIVER_FOREGROUND);
-        if (reason != null) {
-            intent.putExtra("reason", reason);
-        }
-        mWindowManager.closeSystemDialogs(reason);
-
-        mStackSupervisor.closeSystemDialogsLocked();
-
-        broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
-                OP_NONE, null, false, false,
-                -1, SYSTEM_UID, UserHandle.USER_ALL);
+        mAtmInternal.closeSystemDialogs(reason);
     }
 
     @Override
@@ -5096,81 +4011,6 @@
                 null, false, false, MY_PID, SYSTEM_UID, UserHandle.getUserId(uid));
     }
 
-
-    @GuardedBy("this")
-    private final boolean killPackageProcessesLocked(String packageName, int appId,
-            int userId, int minOomAdj, boolean callerWillRestart, boolean allowRestart,
-            boolean doit, boolean evenPersistent, String reason) {
-        ArrayList<ProcessRecord> procs = new ArrayList<>();
-
-        // Remove all processes this package may have touched: all with the
-        // same UID (except for the system or root user), and all whose name
-        // matches the package name.
-        final int NP = mProcessNames.getMap().size();
-        for (int ip=0; ip<NP; ip++) {
-            SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
-            final int NA = apps.size();
-            for (int ia=0; ia<NA; ia++) {
-                ProcessRecord app = apps.valueAt(ia);
-                if (app.isPersistent() && !evenPersistent) {
-                    // we don't kill persistent processes
-                    continue;
-                }
-                if (app.removed) {
-                    if (doit) {
-                        procs.add(app);
-                    }
-                    continue;
-                }
-
-                // Skip process if it doesn't meet our oom adj requirement.
-                if (app.setAdj < minOomAdj) {
-                    continue;
-                }
-
-                // If no package is specified, we call all processes under the
-                // give user id.
-                if (packageName == null) {
-                    if (userId != UserHandle.USER_ALL && app.userId != userId) {
-                        continue;
-                    }
-                    if (appId >= 0 && UserHandle.getAppId(app.uid) != appId) {
-                        continue;
-                    }
-                // Package has been specified, we want to hit all processes
-                // that match it.  We need to qualify this by the processes
-                // that are running under the specified app and user ID.
-                } else {
-                    final boolean isDep = app.pkgDeps != null
-                            && app.pkgDeps.contains(packageName);
-                    if (!isDep && UserHandle.getAppId(app.uid) != appId) {
-                        continue;
-                    }
-                    if (userId != UserHandle.USER_ALL && app.userId != userId) {
-                        continue;
-                    }
-                    if (!app.pkgList.containsKey(packageName) && !isDep) {
-                        continue;
-                    }
-                }
-
-                // Process has passed all conditions, kill it!
-                if (!doit) {
-                    return true;
-                }
-                app.removed = true;
-                procs.add(app);
-            }
-        }
-
-        int N = procs.size();
-        for (int i=0; i<N; i++) {
-            removeProcessLocked(procs.get(i), callerWillRestart, allowRestart, reason);
-        }
-        updateOomAdjLocked();
-        return N > 0;
-    }
-
     private void cleanupDisabledPackageComponentsLocked(
             String packageName, int userId, boolean killProcess, String[] changedClasses) {
 
@@ -5230,15 +4070,8 @@
             return;
         }
 
-        // Clean-up disabled activities.
-        if (mStackSupervisor.finishDisabledPackageActivitiesLocked(
-                packageName, disabledClasses, true, false, userId) && mBooted) {
-            mStackSupervisor.resumeFocusedStacksTopActivitiesLocked();
-            mStackSupervisor.scheduleIdleLocked();
-        }
-
-        // Clean-up disabled tasks
-        mActivityTaskManager.getRecentTasks().cleanupDisabledPackageTasksLocked(packageName, disabledClasses, userId);
+        mAtmInternal.cleanupDisabledPackageComponents(
+                packageName, disabledClasses, userId, mBooted);
 
         // Clean-up disabled services.
         mServices.bringDownDisabledPackageServicesLocked(
@@ -5298,19 +4131,12 @@
             mAppErrors.resetProcessCrashTimeLocked(packageName == null, appId, userId);
         }
 
-        boolean didSomething = killPackageProcessesLocked(packageName, appId, userId,
+        boolean didSomething = mProcessList.killPackageProcessesLocked(packageName, appId, userId,
                 ProcessList.INVALID_ADJ, callerWillRestart, true, doit, evenPersistent,
                 packageName == null ? ("stop user " + userId) : ("stop " + packageName));
 
-        didSomething |= mActivityTaskManager.getActivityStartController().clearPendingActivityLaunches(packageName);
-
-        if (mStackSupervisor.finishDisabledPackageActivitiesLocked(
-                packageName, null, doit, evenPersistent, userId)) {
-            if (!doit) {
-                return true;
-            }
-            didSomething = true;
-        }
+        didSomething |=
+                mAtmInternal.onForceStopPackage(packageName, doit, evenPersistent, userId);
 
         if (mServices.bringDownDisabledPackageServicesLocked(
                 packageName, null, userId, evenPersistent, true, doit)) {
@@ -5360,136 +4186,17 @@
                 }
             }
             if (mBooted) {
-                mStackSupervisor.resumeFocusedStacksTopActivitiesLocked();
-                mStackSupervisor.scheduleIdleLocked();
+                mAtmInternal.resumeTopActivities(true /* scheduleIdle */);
             }
         }
 
         return didSomething;
     }
 
-    private final ProcessRecord removeProcessNameLocked(final String name, final int uid) {
-        return removeProcessNameLocked(name, uid, null);
-    }
-
-    private final ProcessRecord removeProcessNameLocked(final String name, final int uid,
-            final ProcessRecord expecting) {
-        ProcessRecord old = mProcessNames.get(name, uid);
-        // Only actually remove when the currently recorded value matches the
-        // record that we expected; if it doesn't match then we raced with a
-        // newly created process and we don't want to destroy the new one.
-        if ((expecting == null) || (old == expecting)) {
-            mProcessNames.remove(name, uid);
-        }
-        if (old != null && old.uidRecord != null) {
-            old.uidRecord.numProcs--;
-            if (old.uidRecord.numProcs == 0) {
-                // No more processes using this uid, tell clients it is gone.
-                if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
-                        "No more processes in " + old.uidRecord);
-                enqueueUidChangeLocked(old.uidRecord, -1, UidRecord.CHANGE_GONE);
-                EventLogTags.writeAmUidStopped(uid);
-                mActiveUids.remove(uid);
-                noteUidProcessState(uid, ActivityManager.PROCESS_STATE_NONEXISTENT);
-            }
-            old.uidRecord = null;
-        }
-        mIsolatedProcesses.remove(uid);
-        return old;
-    }
-
-    private final void addProcessNameLocked(ProcessRecord proc) {
-        // We shouldn't already have a process under this name, but just in case we
-        // need to clean up whatever may be there now.
-        ProcessRecord old = removeProcessNameLocked(proc.processName, proc.uid);
-        if (old == proc && proc.isPersistent()) {
-            // We are re-adding a persistent process.  Whatevs!  Just leave it there.
-            Slog.w(TAG, "Re-adding persistent process " + proc);
-        } else if (old != null) {
-            Slog.wtf(TAG, "Already have existing proc " + old + " when adding " + proc);
-        }
-        UidRecord uidRec = mActiveUids.get(proc.uid);
-        if (uidRec == null) {
-            uidRec = new UidRecord(proc.uid);
-            // This is the first appearance of the uid, report it now!
-            if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
-                    "Creating new process uid: " + uidRec);
-            if (Arrays.binarySearch(mDeviceIdleTempWhitelist, UserHandle.getAppId(proc.uid)) >= 0
-                    || mPendingTempWhitelist.indexOfKey(proc.uid) >= 0) {
-                uidRec.setWhitelist = uidRec.curWhitelist = true;
-            }
-            uidRec.updateHasInternetPermission();
-            mActiveUids.put(proc.uid, uidRec);
-            EventLogTags.writeAmUidRunning(uidRec.uid);
-            noteUidProcessState(uidRec.uid, uidRec.curProcState);
-        }
-        proc.uidRecord = uidRec;
-
-        // Reset render thread tid if it was already set, so new process can set it again.
-        proc.renderThreadTid = 0;
-        uidRec.numProcs++;
-        mProcessNames.put(proc.processName, proc.uid, proc);
-        if (proc.isolated) {
-            mIsolatedProcesses.put(proc.uid, proc);
-        }
-    }
-
-    @GuardedBy("this")
-    boolean removeProcessLocked(ProcessRecord app,
-            boolean callerWillRestart, boolean allowRestart, String reason) {
-        final String name = app.processName;
-        final int uid = app.uid;
-        if (DEBUG_PROCESSES) Slog.d(TAG_PROCESSES,
-            "Force removing proc " + app.toShortString() + " (" + name + "/" + uid + ")");
-
-        ProcessRecord old = mProcessNames.get(name, uid);
-        if (old != app) {
-            // This process is no longer active, so nothing to do.
-            Slog.w(TAG, "Ignoring remove of inactive process: " + app);
-            return false;
-        }
-        removeProcessNameLocked(name, uid);
-        mAtmInternal.clearHeavyWeightProcessIfEquals(app.getWindowProcessController());
-
-        boolean needRestart = false;
-        if ((app.pid > 0 && app.pid != MY_PID) || (app.pid == 0 && app.pendingStart)) {
-            int pid = app.pid;
-            if (pid > 0) {
-                synchronized (mPidsSelfLocked) {
-                    mPidsSelfLocked.remove(pid);
-                    mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app);
-                }
-                mBatteryStatsService.noteProcessFinish(app.processName, app.info.uid);
-                if (app.isolated) {
-                    mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid);
-                    getPackageManagerInternalLocked().removeIsolatedUid(app.uid);
-                }
-            }
-            boolean willRestart = false;
-            if (app.isPersistent() && !app.isolated) {
-                if (!callerWillRestart) {
-                    willRestart = true;
-                } else {
-                    needRestart = true;
-                }
-            }
-            app.kill(reason, true);
-            handleAppDiedLocked(app, willRestart, allowRestart);
-            if (willRestart) {
-                removeLruProcessLocked(app);
-                addAppLocked(app.info, null, false, null /* ABI override */);
-            }
-        } else {
-            mRemovedProcesses.add(app);
-        }
-
-        return needRestart;
-    }
-
     @GuardedBy("this")
     private final void processContentProviderPublishTimedOutLocked(ProcessRecord app) {
         cleanupAppInLaunchingProvidersLocked(app, true);
-        removeProcessLocked(app, false, true, "timeout publishing content providers");
+        mProcessList.removeProcessLocked(app, false, true, "timeout publishing content providers");
     }
 
     private final void processStartTimedOutLocked(ProcessRecord app) {
@@ -5507,7 +4214,7 @@
             Slog.w(TAG, "Process " + app + " failed to attach");
             EventLog.writeEvent(EventLogTags.AM_PROCESS_START_TIMEOUT, app.userId,
                     pid, app.uid, app.processName);
-            removeProcessNameLocked(app.processName, app.uid);
+            mProcessList.removeProcessNameLocked(app.processName, app.uid);
             mAtmInternal.clearHeavyWeightProcessIfEquals(app.getWindowProcessController());
             mBatteryStatsService.noteProcessFinish(app.processName, app.info.uid);
             // Take care of any launching providers waiting for this process.
@@ -5563,9 +4270,10 @@
         // It's possible that process called attachApplication before we got a chance to
         // update the internal state.
         if (app == null && startSeq > 0) {
-            final ProcessRecord pending = mPendingStarts.get(startSeq);
+            final ProcessRecord pending = mProcessList.mPendingStarts.get(startSeq);
             if (pending != null && pending.startUid == callingUid
-                    && handleProcessStartedLocked(pending, pid, pending.isUsingWrapper(),
+                    && mProcessList.handleProcessStartedLocked(pending, pid, pending
+                            .isUsingWrapper(),
                             startSeq, true)) {
                 app = pending;
             }
@@ -5607,7 +4315,7 @@
             app.deathRecipient = adr;
         } catch (RemoteException e) {
             app.resetPackageList(mProcessStats);
-            startProcessLocked(app, "link fail", processName);
+            mProcessList.startProcessLocked(app, "link fail", processName);
             return false;
         }
 
@@ -5785,7 +4493,7 @@
             }
 
             checkTime(startTime, "attachApplicationLocked: immediately before bindApplication");
-            mStackSupervisor.getActivityMetricsLogger().notifyBindApplication(app);
+            mAtmInternal.preBindApplication(app.getWindowProcessController());
             final ActiveInstrumentation instr2 = app.getActiveInstrumentation();
             if (app.isolatedEntryPoint != null) {
                 // This is an isolated process which should just call an entry point instead of
@@ -5818,7 +4526,7 @@
                 profilerInfo = null;
             }
             checkTime(startTime, "attachApplicationLocked: immediately after bindApplication");
-            updateLruProcessLocked(app, false, null);
+            mProcessList.updateLruProcessLocked(app, false, null);
             checkTime(startTime, "attachApplicationLocked: after updateLruProcessLocked");
             app.lastRequestedGc = app.lastLowMemory = SystemClock.uptimeMillis();
         } catch (Exception e) {
@@ -5829,7 +4537,7 @@
 
             app.resetPackageList(mProcessStats);
             app.unlinkDeathRecipient();
-            startProcessLocked(app, "bind fail", processName);
+            mProcessList.startProcessLocked(app, "bind fail", processName);
             return false;
         }
 
@@ -5845,9 +4553,7 @@
         // See if the top visible activity is waiting to run in this process...
         if (normalMode) {
             try {
-                if (mStackSupervisor.attachApplicationLocked(app)) {
-                    didSomething = true;
-                }
+                didSomething = mAtmInternal.attachApplication(app.getWindowProcessController());
             } catch (Exception e) {
                 Slog.wtf(TAG, "Exception thrown launching activities in " + app, e);
                 badApp = true;
@@ -6004,7 +4710,7 @@
                 for (int ip=0; ip<NP; ip++) {
                     if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "Starting process on hold: "
                             + procs.get(ip));
-                    startProcessLocked(procs.get(ip), "on-hold", null);
+                    mProcessList.startProcessLocked(procs.get(ip), "on-hold", null);
                 }
             }
             if (mFactoryTest == FactoryTest.FACTORY_TEST_LOW_LEVEL) {
@@ -6961,19 +5667,7 @@
 
     @Override
     public void getMemoryInfo(ActivityManager.MemoryInfo outInfo) {
-        final long homeAppMem = mProcessList.getMemLevel(ProcessList.HOME_APP_ADJ);
-        final long cachedAppMem = mProcessList.getMemLevel(ProcessList.CACHED_APP_MIN_ADJ);
-        outInfo.availMem = getFreeMemory();
-        outInfo.totalMem = getTotalMemory();
-        outInfo.threshold = homeAppMem;
-        outInfo.lowMemory = outInfo.availMem < (homeAppMem + ((cachedAppMem-homeAppMem)/2));
-        outInfo.hiddenAppThreshold = cachedAppMem;
-        outInfo.secondaryServerThreshold = mProcessList.getMemLevel(
-                ProcessList.SERVICE_ADJ);
-        outInfo.visibleAppThreshold = mProcessList.getMemLevel(
-                ProcessList.VISIBLE_APP_ADJ);
-        outInfo.foregroundAppThreshold = mProcessList.getMemLevel(
-                ProcessList.FOREGROUND_APP_ADJ);
+        mProcessList.getMemoryInfo(outInfo);
     }
 
     // =========================================================
@@ -7409,7 +6103,7 @@
         return false;
     }
 
-    private void checkTime(long startTime, String where) {
+    void checkTime(long startTime, String where) {
         long now = SystemClock.uptimeMillis();
         if ((now-startTime) > 50) {
             // If we are taking more than 50ms, log about it.
@@ -7451,6 +6145,7 @@
         ContentProviderRecord cpr;
         ContentProviderConnection conn = null;
         ProviderInfo cpi = null;
+        boolean providerRunning = false;
 
         synchronized(this) {
             long startTime = SystemClock.uptimeMillis();
@@ -7490,8 +6185,6 @@
                 }
             }
 
-            boolean providerRunning = false;
-
             if (cpr != null && cpr.proc != null) {
                 providerRunning = !cpr.proc.killed;
 
@@ -7569,7 +6262,7 @@
                         // back up on the LRU list.  This is good because
                         // content providers are often expensive to start.
                         checkTime(startTime, "getContentProviderImpl: before updateLruProcess");
-                        updateLruProcessLocked(cpr.proc, false, null);
+                        mProcessList.updateLruProcessLocked(cpr.proc, false, null);
                         checkTime(startTime, "getContentProviderImpl: after updateLruProcess");
                     }
                 }
@@ -7816,6 +6509,7 @@
         }
 
         // Wait for the provider to be published...
+        final long timeout = SystemClock.uptimeMillis() + CONTENT_PROVIDER_WAIT_TIMEOUT;
         synchronized (cpr) {
             while (cpr.provider == null) {
                 if (cpr.launchingApp == null) {
@@ -7830,13 +6524,22 @@
                     return null;
                 }
                 try {
+                    final long wait = Math.max(0L, timeout - SystemClock.uptimeMillis());
                     if (DEBUG_MU) Slog.v(TAG_MU,
                             "Waiting to start provider " + cpr
-                            + " launchingApp=" + cpr.launchingApp);
+                            + " launchingApp=" + cpr.launchingApp + " for " + wait + " ms");
                     if (conn != null) {
                         conn.waiting = true;
                     }
-                    cpr.wait();
+                    cpr.wait(wait);
+                    if (cpr.provider == null) {
+                        Slog.wtf(TAG, "Timeout waiting for provider "
+                                + cpi.applicationInfo.packageName + "/"
+                                + cpi.applicationInfo.uid + " for provider "
+                                + name
+                                + " providerRunning=" + providerRunning);
+                        return null;
+                    }
                 } catch (InterruptedException ex) {
                 } finally {
                     if (conn != null) {
@@ -8196,8 +6899,8 @@
         mHandler.post(new Runnable() {
             @Override
             public void run() {
-                mAppErrors.appNotResponding(host, null, null, false,
-                        "ContentProvider not responding");
+                host.appNotResponding(
+                        null, null, null, null, false, "ContentProvider not responding");
             }
         });
     }
@@ -8205,7 +6908,7 @@
     public final void installSystemProviders() {
         List<ProviderInfo> providers;
         synchronized (this) {
-            ProcessRecord app = mProcessNames.get("system", SYSTEM_UID);
+            ProcessRecord app = mProcessList.mProcessNames.get("system", SYSTEM_UID);
             providers = generateApplicationProvidersLocked(app);
             if (providers != null) {
                 for (int i=providers.size()-1; i>=0; i--) {
@@ -8267,9 +6970,10 @@
         final int matchFlags = GET_PROVIDERS | MATCH_DIRECT_BOOT_UNAWARE;
 
         synchronized (this) {
-            final int NP = mProcessNames.getMap().size();
+            final int NP = mProcessList.mProcessNames.getMap().size();
             for (int ip = 0; ip < NP; ip++) {
-                final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+                final SparseArray<ProcessRecord> apps = mProcessList.mProcessNames.getMap().valueAt
+                        (ip);
                 final int NA = apps.size();
                 for (int ia = 0; ia < NA; ia++) {
                     final ProcessRecord app = apps.valueAt(ia);
@@ -8375,67 +7079,6 @@
     // GLOBAL MANAGEMENT
     // =========================================================
 
-    @GuardedBy("this")
-    final ProcessRecord newProcessRecordLocked(ApplicationInfo info, String customProcess,
-            boolean isolated, int isolatedUid) {
-        String proc = customProcess != null ? customProcess : info.processName;
-        final int userId = UserHandle.getUserId(info.uid);
-        int uid = info.uid;
-        if (isolated) {
-            if (isolatedUid == 0) {
-                int stepsLeft = LAST_ISOLATED_UID - FIRST_ISOLATED_UID + 1;
-                while (true) {
-                    if (mNextIsolatedProcessUid < FIRST_ISOLATED_UID
-                            || mNextIsolatedProcessUid > LAST_ISOLATED_UID) {
-                        mNextIsolatedProcessUid = FIRST_ISOLATED_UID;
-                    }
-                    uid = UserHandle.getUid(userId, mNextIsolatedProcessUid);
-                    mNextIsolatedProcessUid++;
-                    if (mIsolatedProcesses.indexOfKey(uid) < 0) {
-                        // No process for this uid, use it.
-                        break;
-                    }
-                    stepsLeft--;
-                    if (stepsLeft <= 0) {
-                        return null;
-                    }
-                }
-            } else {
-                // Special case for startIsolatedProcess (internal only), where
-                // the uid of the isolated process is specified by the caller.
-                uid = isolatedUid;
-            }
-            getPackageManagerInternalLocked().addIsolatedUid(uid, info.uid);
-
-            // Register the isolated UID with this application so BatteryStats knows to
-            // attribute resource usage to the application.
-            //
-            // NOTE: This is done here before addProcessNameLocked, which will tell BatteryStats
-            // about the process state of the isolated UID *before* it is registered with the
-            // owning application.
-            mBatteryStatsService.addIsolatedUid(uid, info.uid);
-            StatsLog.write(StatsLog.ISOLATED_UID_CHANGED, info.uid, uid,
-                    StatsLog.ISOLATED_UID_CHANGED__EVENT__CREATED);
-        }
-        final ProcessRecord r = new ProcessRecord(this, info, proc, uid, getGlobalConfiguration());
-        if (!mBooted && !mBooting
-                && userId == UserHandle.USER_SYSTEM
-                && (info.flags & PERSISTENT_MASK) == PERSISTENT_MASK) {
-            // The system process is initialized to SCHED_GROUP_DEFAULT in init.rc.
-            r.setCurrentSchedulingGroup(ProcessList.SCHED_GROUP_DEFAULT);
-            r.setSchedGroup = ProcessList.SCHED_GROUP_DEFAULT;
-            r.setPersistent(true);
-            r.maxAdj = ProcessList.PERSISTENT_PROC_ADJ;
-        }
-        if (isolated && isolatedUid != 0) {
-            // Special case for startIsolatedProcess (internal only) - assume the process
-            // is required by the system server to prevent it being killed.
-            r.maxAdj = ProcessList.PERSISTENT_SERVICE_ADJ;
-        }
-        addProcessNameLocked(r);
-        return r;
-    }
-
     private boolean uidOnBackgroundWhitelist(final int uid) {
         final int appId = UserHandle.getAppId(uid);
         final int[] whitelist = mBackgroundAppIdWhitelist;
@@ -8496,6 +7139,7 @@
                 abiOverride);
     }
 
+    // TODO: Move to ProcessList?
     @GuardedBy("this")
     final ProcessRecord addAppLocked(ApplicationInfo info, String customProcess, boolean isolated,
             boolean disableHiddenApiChecks, String abiOverride) {
@@ -8508,8 +7152,8 @@
         }
 
         if (app == null) {
-            app = newProcessRecordLocked(info, customProcess, isolated, 0);
-            updateLruProcessLocked(app, false, null);
+            app = mProcessList.newProcessRecordLocked(info, customProcess, isolated, 0);
+            mProcessList.updateLruProcessLocked(app, false, null);
             updateOomAdjLocked();
         }
 
@@ -8529,7 +7173,7 @@
         }
         if (app.thread == null && mPersistentStartingProcesses.indexOf(app) < 0) {
             mPersistentStartingProcesses.add(app);
-            startProcessLocked(app, "added application",
+            mProcessList.startProcessLocked(app, "added application",
                     customProcess != null ? customProcess : app.processName, disableHiddenApiChecks,
                     abiOverride);
         }
@@ -8646,51 +7290,12 @@
 
     @Override
     public void notifyLockedProfile(@UserIdInt int userId) {
-        try {
-            if (!AppGlobals.getPackageManager().isUidPrivileged(Binder.getCallingUid())) {
-                throw new SecurityException("Only privileged app can call notifyLockedProfile");
-            }
-        } catch (RemoteException ex) {
-            throw new SecurityException("Fail to check is caller a privileged app", ex);
-        }
-
-        synchronized (this) {
-            final long ident = Binder.clearCallingIdentity();
-            try {
-                if (mUserController.shouldConfirmCredentials(userId)) {
-                    if (mActivityTaskManager.mKeyguardController.isKeyguardLocked()) {
-                        // Showing launcher to avoid user entering credential twice.
-                        final int currentUserId = mUserController.getCurrentUserId();
-                        mAtmInternal.startHomeActivity(currentUserId, "notifyLockedProfile");
-                    }
-                    mStackSupervisor.lockAllProfileTasks(userId);
-                }
-            } finally {
-                Binder.restoreCallingIdentity(ident);
-            }
-        }
+        mAtmInternal.notifyLockedProfile(userId, mUserController.getCurrentUserId());
     }
 
     @Override
     public void startConfirmDeviceCredentialIntent(Intent intent, Bundle options) {
-        enforceCallingPermission(MANAGE_ACTIVITY_STACKS, "startConfirmDeviceCredentialIntent");
-        synchronized (this) {
-            final long ident = Binder.clearCallingIdentity();
-            try {
-                intent.addFlags(FLAG_ACTIVITY_NEW_TASK |
-                        FLAG_ACTIVITY_EXCLUDE_FROM_RECENTS |
-                        FLAG_ACTIVITY_TASK_ON_HOME);
-                ActivityOptions activityOptions = options != null
-                        ? new ActivityOptions(options)
-                        : ActivityOptions.makeBasic();
-                activityOptions.setLaunchTaskId(
-                        mStackSupervisor.getDefaultDisplayHomeActivity().getTask().taskId);
-                mContext.startActivityAsUser(intent, activityOptions.toBundle(),
-                        UserHandle.CURRENT);
-            } finally {
-                Binder.restoreCallingIdentity(ident);
-            }
-        }
+        mAtmInternal.startConfirmDeviceCredentialIntent(intent, options);
     }
 
     @Override
@@ -9432,7 +8037,7 @@
         synchronized (this) {
             final long identity = Binder.clearCallingIdentity();
             try {
-                killPackageProcessesLocked(null, appId, userId,
+                mProcessList.killPackageProcessesLocked(null, appId, userId,
                         ProcessList.PERSISTENT_PROC_ADJ, false, true, true, true,
                         reason != null ? reason : "kill uid");
             } finally {
@@ -9576,14 +8181,20 @@
             // If at least 1/3 of our time since the last idle period has been spent
             // with RAM low, then we want to kill processes.
             boolean doKilling = lowRamSinceLastIdle > (timeSinceLastIdle/3);
+            // If the processes' memory has increased by more than 1% of the total memory,
+            // or 10 MB, whichever is greater, then the processes' are eligible to be killed.
+            final long totalMemoryInKb = getTotalMemory() / 1000;
+            final long memoryGrowthThreshold =
+                    Math.max(totalMemoryInKb / 100, MINIMUM_MEMORY_GROWTH_THRESHOLD);
 
-            for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
-                ProcessRecord proc = mLruProcesses.get(i);
+            for (int i = mProcessList.mLruProcesses.size() - 1 ; i >= 0 ; i--) {
+                ProcessRecord proc = mProcessList.mLruProcesses.get(i);
                 if (proc.notCachedSinceIdle) {
                     if (proc.setProcState >= ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE
                             && proc.setProcState <= ActivityManager.PROCESS_STATE_SERVICE) {
                         if (doKilling && proc.initialIdlePss != 0
-                                && proc.lastPss > ((proc.initialIdlePss*3)/2)) {
+                                && proc.lastPss > ((proc.initialIdlePss * 3) / 2)
+                                && proc.lastPss > (proc.initialIdlePss + memoryGrowthThreshold)) {
                             sb = new StringBuilder(128);
                             sb.append("Kill");
                             sb.append(proc.processName);
@@ -9707,7 +8318,7 @@
                 for (int i=procsToKill.size()-1; i>=0; i--) {
                     ProcessRecord proc = procsToKill.get(i);
                     Slog.i(TAG, "Removing system update proc: " + proc);
-                    removeProcessLocked(proc, true, false, "system update done");
+                    mProcessList.removeProcessLocked(proc, true, false, "system update done");
                 }
             }
 
@@ -9798,7 +8409,7 @@
             } finally {
                 Binder.restoreCallingIdentity(ident);
             }
-            mStackSupervisor.resumeFocusedStacksTopActivitiesLocked();
+            mAtmInternal.resumeTopActivities(false /* scheduleIdle */);
             mUserController.sendUserSwitchBroadcasts(-1, currentUserId);
 
             BinderInternal.nSetBinderProxyCountWatermarks(6000,5500);
@@ -9897,16 +8508,17 @@
                         : StatsLog.APP_CRASH_OCCURRED__FOREGROUND_STATE__UNKNOWN
         );
 
-        final int relaunchReason = r == null ? ActivityRecord.RELAUNCH_REASON_NONE
+        final int relaunchReason = r == null ? RELAUNCH_REASON_NONE
                         : r.getWindowProcessController().computeRelaunchReason();
-        final String relaunchReasonString = ActivityRecord.relaunchReasonToString(relaunchReason);
+        final String relaunchReasonString = relaunchReasonToString(relaunchReason);
         if (crashInfo.crashTag == null) {
             crashInfo.crashTag = relaunchReasonString;
         } else {
             crashInfo.crashTag = crashInfo.crashTag + " " + relaunchReasonString;
         }
 
-        addErrorToDropBox(eventType, r, processName, null, null, null, null, null, crashInfo);
+        addErrorToDropBox(
+                eventType, r, processName, null, null, null, null, null, null, crashInfo);
 
         mAppErrors.crashApplication(r, crashInfo);
     }
@@ -10078,7 +8690,7 @@
         StatsLog.write(StatsLog.WTF_OCCURRED, callingUid, tag, processName,
                 callingPid);
 
-        addErrorToDropBox("wtf", r, processName, null, null, tag, null, null, crashInfo);
+        addErrorToDropBox("wtf", r, processName, null, null, null, tag, null, null, crashInfo);
 
         return r;
     }
@@ -10093,22 +8705,7 @@
         }
 
         synchronized (this) {
-            final int NP = mProcessNames.getMap().size();
-            for (int ip=0; ip<NP; ip++) {
-                SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
-                final int NA = apps.size();
-                for (int ia=0; ia<NA; ia++) {
-                    ProcessRecord p = apps.valueAt(ia);
-                    if (p.thread != null && p.thread.asBinder() == app) {
-                        return p;
-                    }
-                }
-            }
-
-            Slog.w(TAG, "Can't find mystery application for " + reason
-                    + " from pid=" + Binder.getCallingPid()
-                    + " uid=" + Binder.getCallingUid() + ": " + app);
-            return null;
+            return mProcessList.findAppProcessLocked(app, reason);
         }
     }
 
@@ -10177,17 +8774,18 @@
      * Write a description of an error (crash, WTF, ANR) to the drop box.
      * @param eventType to include in the drop box tag ("crash", "wtf", etc.)
      * @param process which caused the error, null means the system server
-     * @param activity which triggered the error, null if unknown
-     * @param parent activity related to the error, null if unknown
+     * @param activityShortComponentName which triggered the error, null if unknown
+     * @param parentShortComponentName activity related to the error, null if unknown
+     * @param parentProcess parent process
      * @param subject line related to the error, null if absent
      * @param report in long form describing the error, null if absent
      * @param dataFile text file to include in the report, null if none
      * @param crashInfo giving an application stack trace, null if absent
      */
     public void addErrorToDropBox(String eventType,
-            ProcessRecord process, String processName, ActivityRecord activity,
-            ActivityRecord parent, String subject,
-            final String report, final File dataFile,
+            ProcessRecord process, String processName, String activityShortComponentName,
+            String parentShortComponentName, ProcessRecord parentProcess,
+            String subject, final String report, final File dataFile,
             final ApplicationErrorReport.CrashInfo crashInfo) {
         // NOTE -- this must never acquire the ActivityManagerService lock,
         // otherwise the watchdog may be prevented from resetting the system.
@@ -10217,14 +8815,16 @@
                     .append(process.isInterestingToUserLocked() ? "Yes" : "No")
                     .append("\n");
         }
-        if (activity != null) {
-            sb.append("Activity: ").append(activity.shortComponentName).append("\n");
+        if (activityShortComponentName != null) {
+            sb.append("Activity: ").append(activityShortComponentName).append("\n");
         }
-        if (parent != null && parent.app != null && parent.app.getPid() != process.pid) {
-            sb.append("Parent-Process: ").append(parent.app.mName).append("\n");
-        }
-        if (parent != null && parent != activity) {
-            sb.append("Parent-Activity: ").append(parent.shortComponentName).append("\n");
+        if (parentShortComponentName != null) {
+            if (parentProcess != null && parentProcess.pid != process.pid) {
+                sb.append("Parent-Process: ").append(parentProcess.processName).append("\n");
+            }
+            if (!parentShortComponentName.equals(activityShortComponentName)) {
+                sb.append("Parent-Activity: ").append(parentShortComponentName).append("\n");
+            }
         }
         if (subject != null) {
             sb.append("Subject: ").append(subject).append("\n");
@@ -10321,8 +8921,8 @@
         synchronized (this) {
 
             // iterate across all processes
-            for (int i=mLruProcesses.size()-1; i>=0; i--) {
-                ProcessRecord app = mLruProcesses.get(i);
+            for (int i=mProcessList.mLruProcesses.size()-1; i>=0; i--) {
+                ProcessRecord app = mProcessList.mLruProcesses.get(i);
                 if (!allUsers && app.userId != userId) {
                     continue;
                 }
@@ -10355,44 +8955,6 @@
         return errList;
     }
 
-    static int procStateToImportance(int procState, int memAdj,
-            ActivityManager.RunningAppProcessInfo currApp,
-            int clientTargetSdk) {
-        int imp = ActivityManager.RunningAppProcessInfo.procStateToImportanceForTargetSdk(
-                procState, clientTargetSdk);
-        if (imp == ActivityManager.RunningAppProcessInfo.IMPORTANCE_BACKGROUND) {
-            currApp.lru = memAdj;
-        } else {
-            currApp.lru = 0;
-        }
-        return imp;
-    }
-
-    @GuardedBy("this")
-    private void fillInProcMemInfoLocked(ProcessRecord app,
-            ActivityManager.RunningAppProcessInfo outInfo,
-            int clientTargetSdk) {
-        outInfo.pid = app.pid;
-        outInfo.uid = app.info.uid;
-        if (mAtmInternal.isHeavyWeightProcess(app.getWindowProcessController())) {
-            outInfo.flags |= ActivityManager.RunningAppProcessInfo.FLAG_CANT_SAVE_STATE;
-        }
-        if (app.isPersistent()) {
-            outInfo.flags |= ActivityManager.RunningAppProcessInfo.FLAG_PERSISTENT;
-        }
-        if (app.hasActivities()) {
-            outInfo.flags |= ActivityManager.RunningAppProcessInfo.FLAG_HAS_ACTIVITIES;
-        }
-        outInfo.lastTrimLevel = app.trimMemoryLevel;
-        int adj = app.curAdj;
-        int procState = app.getCurProcState();
-        outInfo.importance = procStateToImportance(procState, adj, outInfo, clientTargetSdk);
-        outInfo.importanceReasonCode = app.adjTypeCode;
-        outInfo.processState = app.getCurProcState();
-        outInfo.isFocused = (app == getTopAppLocked());
-        outInfo.lastActivityTime = app.lastActivityTime;
-    }
-
     @Override
     public List<ActivityManager.RunningAppProcessInfo> getRunningAppProcesses() {
         enforceNotIsolatedCaller("getRunningAppProcesses");
@@ -10400,8 +8962,6 @@
         final int callingUid = Binder.getCallingUid();
         final int clientTargetSdk = mPackageManagerInt.getUidTargetSdkVersion(callingUid);
 
-        // Lazy instantiation of list
-        List<ActivityManager.RunningAppProcessInfo> runList = null;
         final boolean allUsers = ActivityManager.checkUidPermission(INTERACT_ACROSS_USERS_FULL,
                 callingUid) == PackageManager.PERMISSION_GRANTED;
         final int userId = UserHandle.getUserId(callingUid);
@@ -10410,44 +8970,9 @@
 
         synchronized (this) {
             // Iterate across all processes
-            for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
-                ProcessRecord app = mLruProcesses.get(i);
-                if ((!allUsers && app.userId != userId)
-                        || (!allUids && app.uid != callingUid)) {
-                    continue;
-                }
-                if ((app.thread != null) && (!app.isCrashing() && !app.isNotResponding())) {
-                    // Generate process state info for running application
-                    ActivityManager.RunningAppProcessInfo currApp =
-                        new ActivityManager.RunningAppProcessInfo(app.processName,
-                                app.pid, app.getPackageList());
-                    fillInProcMemInfoLocked(app, currApp, clientTargetSdk);
-                    if (app.adjSource instanceof ProcessRecord) {
-                        currApp.importanceReasonPid = ((ProcessRecord)app.adjSource).pid;
-                        currApp.importanceReasonImportance =
-                                ActivityManager.RunningAppProcessInfo.procStateToImportance(
-                                        app.adjSourceProcState);
-                    } else if (app.adjSource instanceof ActivityServiceConnectionsHolder) {
-                        ActivityServiceConnectionsHolder r =
-                                (ActivityServiceConnectionsHolder) app.adjSource;
-                        final int pid = r.getActivityPid();
-                        if (pid != -1) {
-                            currApp.importanceReasonPid = pid;
-                        }
-                    }
-                    if (app.adjTarget instanceof ComponentName) {
-                        currApp.importanceReasonComponent = (ComponentName)app.adjTarget;
-                    }
-                    //Slog.v(TAG, "Proc " + app.processName + ": imp=" + currApp.importance
-                    //        + " lru=" + currApp.lru);
-                    if (runList == null) {
-                        runList = new ArrayList<>();
-                    }
-                    runList.add(currApp);
-                }
-            }
+            return mProcessList.getRunningAppProcessesLocked(allUsers, userId, allUids,
+                    callingUid, clientTargetSdk);
         }
-        return runList;
     }
 
     @Override
@@ -10494,7 +9019,7 @@
                 proc = mPidsSelfLocked.get(Binder.getCallingPid());
             }
             if (proc != null) {
-                fillInProcMemInfoLocked(proc, outState, clientTargetSdk);
+                mProcessList.fillInProcMemInfoLocked(proc, outState, clientTargetSdk);
             }
         }
     }
@@ -10579,24 +9104,26 @@
             if (dumpAll) {
                 pw.println("-------------------------------------------------------------------------------");
             }
-            if (mActivityTaskManager.getRecentTasks() != null) {
-                mActivityTaskManager.getRecentTasks().dump(pw, dumpAll, dumpPackage);
-            }
+            mAtmInternal.dump(
+                    DUMP_RECENTS_CMD, fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
             pw.println();
             if (dumpAll) {
                 pw.println("-------------------------------------------------------------------------------");
             }
-            dumpLastANRLocked(pw);
+            mAtmInternal.dump(
+                    DUMP_LASTANR_CMD, fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
             pw.println();
             if (dumpAll) {
                 pw.println("-------------------------------------------------------------------------------");
             }
-            dumpActivityStarterLocked(pw, dumpPackage);
+            mAtmInternal.dump(
+                    DUMP_STARTER_CMD, fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
             pw.println();
             if (dumpAll) {
                 pw.println("-------------------------------------------------------------------------------");
             }
-            dumpActivityContainersLocked(pw);
+            mAtmInternal.dump(
+                    DUMP_CONTAINERS_CMD, fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
             // Activities section is dumped as part of the Critical priority dump. Exclude the
             // section if priority is Normal.
             if (!dumpNormalPriority) {
@@ -10604,7 +9131,8 @@
                 if (dumpAll) {
                     pw.println("-------------------------------------------------------------------------------");
                 }
-                dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
+                mAtmInternal.dump(
+                        DUMP_ACTIVITIES_CMD, fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
             }
             if (mAssociations.size() > 0) {
                 pw.println();
@@ -10693,9 +9221,7 @@
 
             if ("activities".equals(cmd) || "a".equals(cmd)) {
                 // output proto is ActivityManagerServiceDumpActivitiesProto
-                synchronized (this) {
-                    writeActivitiesToProtoLocked(proto);
-                }
+                mAtmInternal.writeActivitiesToProto(proto);
             } else if ("broadcasts".equals(cmd) || "b".equals(cmd)) {
                 // output proto is ActivityManagerServiceDumpBroadcastsProto
                 synchronized (this) {
@@ -10734,7 +9260,7 @@
                 // default option, dump everything, output is ActivityManagerServiceProto
                 synchronized (this) {
                     long activityToken = proto.start(ActivityManagerServiceProto.ACTIVITIES);
-                    writeActivitiesToProtoLocked(proto);
+                    mAtmInternal.writeActivitiesToProto(proto);
                     proto.end(activityToken);
 
                     long broadcastToken = proto.start(ActivityManagerServiceProto.BROADCASTS);
@@ -10761,32 +9287,12 @@
         if (opti < args.length) {
             String cmd = args[opti];
             opti++;
-            if ("activities".equals(cmd) || "a".equals(cmd)) {
-                synchronized (this) {
-                    dumpActivitiesLocked(fd, pw, args, opti, true, dumpClient, dumpPackage);
-                }
-            } else if ("lastanr".equals(cmd)) {
-                synchronized (this) {
-                    dumpLastANRLocked(pw);
-                }
-            } else if ("lastanr-traces".equals(cmd)) {
-                synchronized (this) {
-                    dumpLastANRTracesLocked(pw);
-                }
-            } else if ("starter".equals(cmd)) {
-                synchronized (this) {
-                    dumpActivityStarterLocked(pw, dumpPackage);
-                }
-            } else if ("containers".equals(cmd)) {
-                synchronized (this) {
-                    dumpActivityContainersLocked(pw);
-                }
-            } else if ("recents".equals(cmd) || "r".equals(cmd)) {
-                synchronized (this) {
-                    if (mActivityTaskManager.getRecentTasks() != null) {
-                        mActivityTaskManager.getRecentTasks().dump(pw, true /* dumpAll */, dumpPackage);
-                    }
-                }
+            if (DUMP_ACTIVITIES_CMD.equals(cmd) || DUMP_ACTIVITIES_SHORT_CMD.equals(cmd)
+                    || DUMP_LASTANR_CMD.equals(cmd) || DUMP_LASTANR_TRACES_CMD.equals(cmd)
+                    || DUMP_STARTER_CMD.equals(cmd) || DUMP_CONTAINERS_CMD.equals(cmd)
+                    || DUMP_RECENTS_CMD.equals(cmd) || DUMP_RECENTS_SHORT_CMD.equals(cmd)) {
+                mAtmInternal.dump(
+                        cmd, fd, pw, args, opti, true /* dumpAll */, dumpClient, dumpPackage);
             } else if ("binder-proxies".equals(cmd)) {
                 if (opti >= args.length) {
                     dumpBinderProxies(pw);
@@ -10922,8 +9428,8 @@
                 LockGuard.dump(fd, pw, args);
             } else {
                 // Dumping a single activity?
-                if (!dumpActivity(fd, pw, cmd, args, opti, dumpAll, dumpVisibleStacksOnly,
-                        dumpFocusedStackOnly)) {
+                if (!mAtmInternal.dumpActivity(fd, pw, cmd, args, opti, dumpAll,
+                        dumpVisibleStacksOnly, dumpFocusedStackOnly)) {
                     ActivityManagerShellCommand shell = new ActivityManagerShellCommand(this, true);
                     int res = shell.exec(this, null, fd, null, args, null,
                             new ResultReceiver(null));
@@ -10960,96 +9466,6 @@
         Binder.restoreCallingIdentity(origId);
     }
 
-    private void writeActivitiesToProtoLocked(ProtoOutputStream proto) {
-        // The output proto of "activity --proto activities" is ActivityManagerServiceDumpActivitiesProto
-        mStackSupervisor.writeToProto(proto, ActivityManagerServiceDumpActivitiesProto.ACTIVITY_STACK_SUPERVISOR);
-    }
-
-    private void dumpLastANRLocked(PrintWriter pw) {
-        pw.println("ACTIVITY MANAGER LAST ANR (dumpsys activity lastanr)");
-        if (mLastANRState == null) {
-            pw.println("  <no ANR has occurred since boot>");
-        } else {
-            pw.println(mLastANRState);
-        }
-    }
-
-    private void dumpLastANRTracesLocked(PrintWriter pw) {
-        pw.println("ACTIVITY MANAGER LAST ANR TRACES (dumpsys activity lastanr-traces)");
-
-        final File[] files = new File(ANR_TRACE_DIR).listFiles();
-        if (ArrayUtils.isEmpty(files)) {
-            pw.println("  <no ANR has occurred since boot>");
-            return;
-        }
-        // Find the latest file.
-        File latest = null;
-        for (File f : files) {
-            if ((latest == null) || (latest.lastModified() < f.lastModified())) {
-                latest = f;
-            }
-        }
-        pw.print("File: ");
-        pw.print(latest.getName());
-        pw.println();
-        try (BufferedReader in = new BufferedReader(new FileReader(latest))) {
-            String line;
-            while ((line = in.readLine()) != null) {
-                pw.println(line);
-            }
-        } catch (IOException e) {
-            pw.print("Unable to read: ");
-            pw.print(e);
-            pw.println();
-        }
-    }
-
-    private void dumpActivityContainersLocked(PrintWriter pw) {
-        pw.println("ACTIVITY MANAGER STARTER (dumpsys activity containers)");
-        mStackSupervisor.dumpChildrenNames(pw, " ");
-        pw.println(" ");
-    }
-
-    private void dumpActivityStarterLocked(PrintWriter pw, String dumpPackage) {
-        pw.println("ACTIVITY MANAGER STARTER (dumpsys activity starter)");
-        mActivityTaskManager.getActivityStartController().dump(pw, "", dumpPackage);
-    }
-
-    void dumpActivitiesLocked(FileDescriptor fd, PrintWriter pw, String[] args,
-            int opti, boolean dumpAll, boolean dumpClient, String dumpPackage) {
-        dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage,
-                "ACTIVITY MANAGER ACTIVITIES (dumpsys activity activities)");
-    }
-
-    void dumpActivitiesLocked(FileDescriptor fd, PrintWriter pw, String[] args,
-            int opti, boolean dumpAll, boolean dumpClient, String dumpPackage, String header) {
-        pw.println(header);
-
-        boolean printedAnything = mStackSupervisor.dumpActivitiesLocked(fd, pw, dumpAll, dumpClient,
-                dumpPackage);
-        boolean needSep = printedAnything;
-
-        boolean printed = ActivityStackSupervisor.printThisActivity(pw,
-                mStackSupervisor.getTopResumedActivity(),  dumpPackage, needSep,
-                "  ResumedActivity: ");
-        if (printed) {
-            printedAnything = true;
-            needSep = false;
-        }
-
-        if (dumpPackage == null) {
-            if (needSep) {
-                pw.println();
-            }
-            printedAnything = true;
-            mStackSupervisor.dump(pw, "  ");
-        }
-
-        if (!printedAnything) {
-            pw.println("  (nothing)");
-        }
-    }
-
     void dumpAssociationsLocked(FileDescriptor fd, PrintWriter pw, String[] args,
             int opti, boolean dumpAll, boolean dumpClient, String dumpPackage) {
         pw.println("ACTIVITY MANAGER ASSOCIATIONS (dumpsys activity associations)");
@@ -11220,6 +9636,7 @@
                 "Counts of Binder Proxies held by SYSTEM");
     }
 
+    // TODO: Move to ProcessList?
     @GuardedBy("this")
     void dumpProcessesLocked(FileDescriptor fd, PrintWriter pw, String[] args,
             int opti, boolean dumpAll, String dumpPackage, int dumpAppId) {
@@ -11229,9 +9646,9 @@
         pw.println("ACTIVITY MANAGER RUNNING PROCESSES (dumpsys activity processes)");
 
         if (dumpAll) {
-            final int NP = mProcessNames.getMap().size();
+            final int NP = mProcessList.mProcessNames.getMap().size();
             for (int ip=0; ip<NP; ip++) {
-                SparseArray<ProcessRecord> procs = mProcessNames.getMap().valueAt(ip);
+                SparseArray<ProcessRecord> procs = mProcessList.mProcessNames.getMap().valueAt(ip);
                 final int NA = procs.size();
                 for (int ia=0; ia<NA; ia++) {
                     ProcessRecord r = procs.valueAt(ia);
@@ -11253,10 +9670,10 @@
             }
         }
 
-        if (mIsolatedProcesses.size() > 0) {
+        if (mProcessList.mIsolatedProcesses.size() > 0) {
             boolean printed = false;
-            for (int i=0; i<mIsolatedProcesses.size(); i++) {
-                ProcessRecord r = mIsolatedProcesses.valueAt(i);
+            for (int i=0; i<mProcessList.mIsolatedProcesses.size(); i++) {
+                ProcessRecord r = mProcessList.mIsolatedProcesses.valueAt(i);
                 if (dumpPackage != null && !r.pkgList.containsKey(dumpPackage)) {
                     continue;
                 }
@@ -11309,17 +9726,13 @@
             }
         }
 
-        if (mLruProcesses.size() > 0) {
+        if (mProcessList.getLruSizeLocked() > 0) {
             if (needSep) {
                 pw.println();
             }
-            pw.print("  Process LRU list (sorted by oom_adj, "); pw.print(mLruProcesses.size());
-                    pw.print(" total, non-act at ");
-                    pw.print(mLruProcesses.size()-mLruProcessActivityStart);
-                    pw.print(", non-svc at ");
-                    pw.print(mLruProcesses.size()-mLruProcessServiceStart);
-                    pw.println("):");
-            dumpProcessOomList(pw, this, mLruProcesses, "    ", "Proc", "PERS", false, dumpPackage);
+            mProcessList.dumpLruListHeaderLocked(pw);
+            dumpProcessOomList(pw, this, mProcessList.mLruProcesses, "    ", "Proc", "PERS", false,
+                    dumpPackage);
             needSep = true;
         }
 
@@ -11373,11 +9786,11 @@
                     "Starting Norm", "Restarting PERS", dumpPackage);
         }
 
-        if (mRemovedProcesses.size() > 0) {
+        if (mProcessList.mRemovedProcesses.size() > 0) {
             if (needSep) pw.println();
             needSep = true;
             pw.println("  Processes that are being removed:");
-            dumpProcessList(pw, this, mRemovedProcesses, "    ",
+            dumpProcessList(pw, this, mProcessList.mRemovedProcesses, "    ",
                     "Removed Norm", "Removed PERS", dumpPackage);
         }
 
@@ -11398,71 +9811,20 @@
             needSep = false;
             mUserController.dump(pw, dumpAll);
         }
-        if (mActivityTaskManager.mHomeProcess != null && (dumpPackage == null
-                || mActivityTaskManager.mHomeProcess.mPkgList.contains(dumpPackage))) {
-            if (needSep) {
-                pw.println();
-                needSep = false;
-            }
-            pw.println("  mHomeProcess: " + mActivityTaskManager.mHomeProcess);
-        }
-        if (mActivityTaskManager.mPreviousProcess != null && (dumpPackage == null
-                || mActivityTaskManager.mPreviousProcess.mPkgList.contains(dumpPackage))) {
-            if (needSep) {
-                pw.println();
-                needSep = false;
-            }
-            pw.println("  mPreviousProcess: " + mActivityTaskManager.mPreviousProcess);
-        }
-        if (dumpAll && (mActivityTaskManager.mPreviousProcess == null || dumpPackage == null
-                || mActivityTaskManager.mPreviousProcess.mPkgList.contains(dumpPackage))) {
-            StringBuilder sb = new StringBuilder(128);
-            sb.append("  mPreviousProcessVisibleTime: ");
-            TimeUtils.formatDuration(mActivityTaskManager.mPreviousProcessVisibleTime, sb);
-            pw.println(sb);
-        }
-        if (mActivityTaskManager.mHeavyWeightProcess != null && (dumpPackage == null
-                || mActivityTaskManager.mHeavyWeightProcess.mPkgList.contains(dumpPackage))) {
-            if (needSep) {
-                pw.println();
-                needSep = false;
-            }
-            pw.println("  mHeavyWeightProcess: " + mActivityTaskManager.mHeavyWeightProcess);
-        }
-        if (dumpAll && mPendingStarts.size() > 0) {
+
+        needSep = mAtmInternal.dumpForProcesses(fd, pw, dumpAll, dumpPackage, dumpAppId, needSep,
+                mTestPssMode, mWakefulness);
+
+        if (dumpAll && mProcessList.mPendingStarts.size() > 0) {
             if (needSep) pw.println();
             needSep = true;
             pw.println("  mPendingStarts: ");
-            for (int i = 0, len = mPendingStarts.size(); i < len; ++i ) {
-                pw.println("    " + mPendingStarts.keyAt(i) + ": " + mPendingStarts.valueAt(i));
+            for (int i = 0, len = mProcessList.mPendingStarts.size(); i < len; ++i ) {
+                pw.println("    " + mProcessList.mPendingStarts.keyAt(i) + ": "
+                        + mProcessList.mPendingStarts.valueAt(i));
             }
         }
-        if (dumpPackage == null) {
-            pw.println("  mGlobalConfiguration: " + getGlobalConfiguration());
-            mStackSupervisor.dumpDisplayConfigs(pw, "  ");
-        }
         if (dumpAll) {
-            if (dumpPackage == null) {
-                pw.println("  mConfigWillChange: "
-                        + mActivityTaskManager.getTopDisplayFocusedStack().mConfigWillChange);
-            }
-            if (mActivityTaskManager.mCompatModePackages.getPackages().size() > 0) {
-                boolean printed = false;
-                for (Map.Entry<String, Integer> entry
-                        : mActivityTaskManager.mCompatModePackages.getPackages().entrySet()) {
-                    String pkg = entry.getKey();
-                    int mode = entry.getValue();
-                    if (dumpPackage != null && !dumpPackage.equals(pkg)) {
-                        continue;
-                    }
-                    if (!printed) {
-                        pw.println("  mScreenCompatPackages:");
-                        printed = true;
-                    }
-                    pw.print("    "); pw.print(pkg); pw.print(": ");
-                            pw.print(mode); pw.println();
-                }
-            }
             final int NI = mUidObservers.getRegisteredCallbackCount();
             boolean printed = false;
             for (int i=0; i<NI; i++) {
@@ -11519,11 +9881,6 @@
                 }
             }
         }
-        if (dumpPackage == null) {
-            pw.println("  mWakefulness="
-                    + PowerManagerInternal.wakefulnessToString(mWakefulness));
-            mActivityTaskManager.dumpSleepStates(pw, mTestPssMode);
-        }
         if (mDebugApp != null || mOrigDebugApp != null || mDebugTransient
                 || mOrigWaitForDebugger) {
             if (dumpPackage == null || dumpPackage.equals(mDebugApp)
@@ -11537,9 +9894,6 @@
                         + " mOrigWaitForDebugger=" + mOrigWaitForDebugger);
             }
         }
-        if (mActivityTaskManager.mCurAppTimeTracker != null) {
-            mActivityTaskManager.mCurAppTimeTracker.dumpWithHeader(pw, "  ", true);
-        }
         if (mMemWatchProcesses.getMap().size() > 0) {
             pw.println("  Mem watch processes:");
             final ArrayMap<String, SparseArray<Pair<Long, String>>> procs
@@ -11604,40 +9958,10 @@
                 pw.println("  mNativeDebuggingApp=" + mNativeDebuggingApp);
             }
         }
-        if (mActivityTaskManager.mAllowAppSwitchUids.size() > 0) {
-            boolean printed = false;
-            for (int i = 0; i < mActivityTaskManager.mAllowAppSwitchUids.size(); i++) {
-                ArrayMap<String, Integer> types = mActivityTaskManager.mAllowAppSwitchUids.valueAt(i);
-                for (int j = 0; j < types.size(); j++) {
-                    if (dumpPackage == null ||
-                            UserHandle.getAppId(types.valueAt(j).intValue()) == dumpAppId) {
-                        if (needSep) {
-                            pw.println();
-                            needSep = false;
-                        }
-                        if (!printed) {
-                            pw.println("  mAllowAppSwitchUids:");
-                            printed = true;
-                        }
-                        pw.print("    User ");
-                        pw.print(mActivityTaskManager.mAllowAppSwitchUids.keyAt(i));
-                        pw.print(": Type ");
-                        pw.print(types.keyAt(j));
-                        pw.print(" = ");
-                        UserHandle.formatUid(pw, types.valueAt(j).intValue());
-                        pw.println();
-                    }
-                }
-            }
-        }
         if (dumpPackage == null) {
             if (mAlwaysFinishActivities) {
                 pw.println("  mAlwaysFinishActivities=" + mAlwaysFinishActivities);
             }
-            if (mActivityTaskManager.mController != null) {
-                pw.println("  mController=" + mActivityTaskManager.mController
-                        + " mControllerIsAMonkey=" + mActivityTaskManager.mControllerIsAMonkey);
-            }
             if (dumpAll) {
                 pw.println("  Total persistent processes: " + numPers);
                 pw.println("  mProcessesReady=" + mProcessesReady
@@ -11650,11 +9974,9 @@
                 pw.print("  mLastPowerCheckUptime=");
                         TimeUtils.formatDuration(mLastPowerCheckUptime, pw);
                         pw.println("");
-                pw.println("  mGoingToSleep=" + mStackSupervisor.mGoingToSleep);
-                pw.println("  mLaunchingActivity=" + mStackSupervisor.mLaunchingActivity);
-                pw.println("  mAdjSeq=" + mAdjSeq + " mLruSeq=" + mLruSeq);
+                pw.println("  mAdjSeq=" + mAdjSeq + " mLruSeq=" + mProcessList.mLruSeq);
                 pw.println("  mNumNonCachedProcs=" + mNumNonCachedProcs
-                        + " (" + mLruProcesses.size() + " total)"
+                        + " (" + mProcessList.getLruSizeLocked() + " total)"
                         + " mNumCachedHiddenProcs=" + mNumCachedHiddenProcs
                         + " mNumServiceProcs=" + mNumServiceProcs
                         + " mNewNumServiceProcs=" + mNewNumServiceProcs);
@@ -11700,9 +10022,9 @@
     void writeProcessesToProtoLocked(ProtoOutputStream proto, String dumpPackage) {
         int numPers = 0;
 
-        final int NP = mProcessNames.getMap().size();
+        final int NP = mProcessList.mProcessNames.getMap().size();
         for (int ip=0; ip<NP; ip++) {
-            SparseArray<ProcessRecord> procs = mProcessNames.getMap().valueAt(ip);
+            SparseArray<ProcessRecord> procs = mProcessList.mProcessNames.getMap().valueAt(ip);
             final int NA = procs.size();
             for (int ia = 0; ia<NA; ia++) {
                 ProcessRecord r = procs.valueAt(ia);
@@ -11716,8 +10038,8 @@
             }
         }
 
-        for (int i=0; i<mIsolatedProcesses.size(); i++) {
-            ProcessRecord r = mIsolatedProcesses.valueAt(i);
+        for (int i=0; i<mProcessList.mIsolatedProcesses.size(); i++) {
+            ProcessRecord r = mProcessList.mIsolatedProcesses.valueAt(i);
             if (dumpPackage != null && !r.pkgList.containsKey(dumpPackage)) {
                 continue;
             }
@@ -11750,14 +10072,17 @@
             uidRec.writeToProto(proto, ActivityManagerServiceDumpProcessesProto.VALIDATE_UIDS);
         }
 
-        if (mLruProcesses.size() > 0) {
+        if (mProcessList.getLruSizeLocked() > 0) {
             long lruToken = proto.start(ActivityManagerServiceDumpProcessesProto.LRU_PROCS);
-            int total = mLruProcesses.size();
+            int total = mProcessList.getLruSizeLocked();
             proto.write(ActivityManagerServiceDumpProcessesProto.LruProcesses.SIZE, total);
-            proto.write(ActivityManagerServiceDumpProcessesProto.LruProcesses.NON_ACT_AT, total-mLruProcessActivityStart);
-            proto.write(ActivityManagerServiceDumpProcessesProto.LruProcesses.NON_SVC_AT, total-mLruProcessServiceStart);
-            writeProcessOomListToProto(proto, ActivityManagerServiceDumpProcessesProto.LruProcesses.LIST, this,
-                    mLruProcesses,false, dumpPackage);
+            proto.write(ActivityManagerServiceDumpProcessesProto.LruProcesses.NON_ACT_AT,
+                    total - mProcessList.mLruProcessActivityStart);
+            proto.write(ActivityManagerServiceDumpProcessesProto.LruProcesses.NON_SVC_AT,
+                    total - mProcessList.mLruProcessServiceStart);
+            writeProcessOomListToProto(proto,
+                    ActivityManagerServiceDumpProcessesProto.LruProcesses.LIST, this,
+                    mProcessList.mLruProcesses,false, dumpPackage);
             proto.end(lruToken);
         }
 
@@ -11768,7 +10093,8 @@
                     if (!r.pkgList.containsKey(dumpPackage)) {
                         continue;
                     }
-                    r.writeToProto(proto, ActivityManagerServiceDumpProcessesProto.PIDS_SELF_LOCKED);
+                    r.writeToProto(proto,
+                            ActivityManagerServiceDumpProcessesProto.PIDS_SELF_LOCKED);
                 }
             }
         }
@@ -11782,7 +10108,8 @@
                             || !r.pkgList.containsKey(dumpPackage))) {
                         continue;
                     }
-                    it.writeToProto(proto, ActivityManagerServiceDumpProcessesProto.IMPORTANT_PROCS);
+                    it.writeToProto(proto,
+                            ActivityManagerServiceDumpProcessesProto.IMPORTANT_PROCS);
                 }
             }
         }
@@ -11792,11 +10119,12 @@
             if (dumpPackage != null && !dumpPackage.equals(r.info.packageName)) {
                 continue;
             }
-            r.writeToProto(proto, ActivityManagerServiceDumpProcessesProto.PERSISTENT_STARTING_PROCS);
+            r.writeToProto(proto,
+                    ActivityManagerServiceDumpProcessesProto.PERSISTENT_STARTING_PROCS);
         }
 
-        for (int i=0; i<mRemovedProcesses.size(); i++) {
-            ProcessRecord r = mRemovedProcesses.get(i);
+        for (int i = 0; i < mProcessList.mRemovedProcesses.size(); i++) {
+            ProcessRecord r = mProcessList.mRemovedProcesses.get(i);
             if (dumpPackage != null && !dumpPackage.equals(r.info.packageName)) {
                 continue;
             }
@@ -11813,39 +10141,10 @@
 
         writeProcessesToGcToProto(proto, ActivityManagerServiceDumpProcessesProto.GC_PROCS, dumpPackage);
         mAppErrors.writeToProto(proto, ActivityManagerServiceDumpProcessesProto.APP_ERRORS, dumpPackage);
+        mAtmInternal.writeProcessesToProto(proto, dumpPackage);
 
         if (dumpPackage == null) {
             mUserController.writeToProto(proto, ActivityManagerServiceDumpProcessesProto.USER_CONTROLLER);
-            getGlobalConfiguration().writeToProto(proto, ActivityManagerServiceDumpProcessesProto.GLOBAL_CONFIGURATION);
-            proto.write(ActivityManagerServiceDumpProcessesProto.CONFIG_WILL_CHANGE, mActivityTaskManager.getTopDisplayFocusedStack().mConfigWillChange);
-        }
-
-        if (mActivityTaskManager.mHomeProcess != null && (dumpPackage == null
-                || mActivityTaskManager.mHomeProcess.mPkgList.contains(dumpPackage))) {
-            ((ProcessRecord) mActivityTaskManager.mHomeProcess.mOwner).writeToProto(proto, ActivityManagerServiceDumpProcessesProto.HOME_PROC);
-        }
-
-        if (mActivityTaskManager.mPreviousProcess != null && (dumpPackage == null
-                || mActivityTaskManager.mPreviousProcess.mPkgList.contains(dumpPackage))) {
-            ((ProcessRecord) mActivityTaskManager.mPreviousProcess.mOwner).writeToProto(proto, ActivityManagerServiceDumpProcessesProto.PREVIOUS_PROC);
-            proto.write(ActivityManagerServiceDumpProcessesProto.PREVIOUS_PROC_VISIBLE_TIME_MS, mActivityTaskManager.mPreviousProcessVisibleTime);
-        }
-
-        if (mActivityTaskManager.mHeavyWeightProcess != null && (dumpPackage == null
-                || mActivityTaskManager.mHeavyWeightProcess.mPkgList.contains(dumpPackage))) {
-            ((ProcessRecord) mActivityTaskManager.mHeavyWeightProcess.mOwner).writeToProto(proto, ActivityManagerServiceDumpProcessesProto.HEAVY_WEIGHT_PROC);
-        }
-
-        for (Map.Entry<String, Integer> entry
-                : mActivityTaskManager.mCompatModePackages.getPackages().entrySet()) {
-            String pkg = entry.getKey();
-            int mode = entry.getValue();
-            if (dumpPackage == null || dumpPackage.equals(pkg)) {
-                long compatToken = proto.start(ActivityManagerServiceDumpProcessesProto.SCREEN_COMPAT_PACKAGES);
-                proto.write(ActivityManagerServiceDumpProcessesProto.ScreenCompatPackage.PACKAGE, pkg);
-                proto.write(ActivityManagerServiceDumpProcessesProto.ScreenCompatPackage.MODE, mode);
-                proto.end(compatToken);
-            }
         }
 
         final int NI = mUidObservers.getRegisteredCallbackCount();
@@ -11878,8 +10177,6 @@
                     PowerManagerInternal.wakefulnessToProtoEnum(mWakefulness));
             proto.write(ActivityManagerServiceDumpProcessesProto.SleepStatus.TEST_PSS_MODE, mTestPssMode);
             proto.end(sleepToken);
-
-            mActivityTaskManager.writeSleepStateToProto(proto);
         }
 
         if (mDebugApp != null || mOrigDebugApp != null || mDebugTransient
@@ -11895,11 +10192,6 @@
             }
         }
 
-        if (mActivityTaskManager.mCurAppTimeTracker != null) {
-            mActivityTaskManager.mCurAppTimeTracker.writeToProto(
-                    proto, ActivityManagerServiceDumpProcessesProto.CURRENT_TRACKER, true);
-        }
-
         if (mMemWatchProcesses.getMap().size() > 0) {
             final long token = proto.start(ActivityManagerServiceDumpProcessesProto.MEM_WATCH_PROCESSES);
             ArrayMap<String, SparseArray<Pair<Long, String>>> procs = mMemWatchProcesses.getMap();
@@ -11956,12 +10248,6 @@
 
         if (dumpPackage == null) {
             proto.write(ActivityManagerServiceDumpProcessesProto.ALWAYS_FINISH_ACTIVITIES, mAlwaysFinishActivities);
-            if (mActivityTaskManager.mController != null) {
-                final long token = proto.start(ActivityManagerServiceDumpProcessesProto.CONTROLLER);
-                proto.write(ActivityManagerServiceDumpProcessesProto.Controller.CONTROLLER, mActivityTaskManager.mController.toString());
-                proto.write(ActivityManagerServiceDumpProcessesProto.Controller.IS_A_MONKEY, mActivityTaskManager.mControllerIsAMonkey);
-                proto.end(token);
-            }
             proto.write(ActivityManagerServiceDumpProcessesProto.TOTAL_PERSISTENT_PROCS, numPers);
             proto.write(ActivityManagerServiceDumpProcessesProto.PROCESSES_READY, mProcessesReady);
             proto.write(ActivityManagerServiceDumpProcessesProto.SYSTEM_READY, mSystemReady);
@@ -11971,10 +10257,8 @@
             proto.write(ActivityManagerServiceDumpProcessesProto.CALL_FINISH_BOOTING, mCallFinishBooting);
             proto.write(ActivityManagerServiceDumpProcessesProto.BOOT_ANIMATION_COMPLETE, mBootAnimationComplete);
             proto.write(ActivityManagerServiceDumpProcessesProto.LAST_POWER_CHECK_UPTIME_MS, mLastPowerCheckUptime);
-            mStackSupervisor.mGoingToSleep.writeToProto(proto, ActivityManagerServiceDumpProcessesProto.GOING_TO_SLEEP);
-            mStackSupervisor.mLaunchingActivity.writeToProto(proto, ActivityManagerServiceDumpProcessesProto.LAUNCHING_ACTIVITY);
             proto.write(ActivityManagerServiceDumpProcessesProto.ADJ_SEQ, mAdjSeq);
-            proto.write(ActivityManagerServiceDumpProcessesProto.LRU_SEQ, mLruSeq);
+            proto.write(ActivityManagerServiceDumpProcessesProto.LRU_SEQ, mProcessList.mLruSeq);
             proto.write(ActivityManagerServiceDumpProcessesProto.NUM_NON_CACHED_PROCS, mNumNonCachedProcs);
             proto.write(ActivityManagerServiceDumpProcessesProto.NUM_SERVICE_PROCS, mNumServiceProcs);
             proto.write(ActivityManagerServiceDumpProcessesProto.NEW_NUM_SERVICE_PROCS, mNewNumServiceProcs);
@@ -12055,7 +10339,7 @@
             int opti, boolean dumpAll) {
         boolean needSep = false;
 
-        if (mLruProcesses.size() > 0) {
+        if (mProcessList.getLruSizeLocked() > 0) {
             if (needSep) pw.println();
             needSep = true;
             pw.println("  OOM levels:");
@@ -12075,13 +10359,16 @@
             printOomLevel(pw, "CACHED_APP_MAX_ADJ", ProcessList.CACHED_APP_MAX_ADJ);
 
             if (needSep) pw.println();
-            pw.print("  Process OOM control ("); pw.print(mLruProcesses.size());
+            pw.print("  Process OOM control ("); pw.print(mProcessList.getLruSizeLocked());
                     pw.print(" total, non-act at ");
-                    pw.print(mLruProcesses.size()-mLruProcessActivityStart);
+                    pw.print(mProcessList.getLruSizeLocked()
+                            - mProcessList.mLruProcessActivityStart);
                     pw.print(", non-svc at ");
-                    pw.print(mLruProcesses.size()-mLruProcessServiceStart);
+                    pw.print(mProcessList.getLruSizeLocked()
+                            - mProcessList.mLruProcessServiceStart);
                     pw.println("):");
-            dumpProcessOomList(pw, this, mLruProcesses, "    ", "Proc", "PERS", true, null);
+            dumpProcessOomList(pw, this, mProcessList.mLruProcesses, "    ", "Proc", "PERS", true,
+                    null);
             needSep = true;
         }
 
@@ -12199,95 +10486,6 @@
         }
     }
 
-    /**
-     * There are three things that cmd can be:
-     *  - a flattened component name that matches an existing activity
-     *  - the cmd arg isn't the flattened component name of an existing activity:
-     *    dump all activity whose component contains the cmd as a substring
-     *  - A hex number of the ActivityRecord object instance.
-     *
-     *  @param dumpVisibleStacksOnly dump activity with {@param name} only if in a visible stack
-     *  @param dumpFocusedStackOnly dump activity with {@param name} only if in the focused stack
-     */
-    protected boolean dumpActivity(FileDescriptor fd, PrintWriter pw, String name, String[] args,
-            int opti, boolean dumpAll, boolean dumpVisibleStacksOnly, boolean dumpFocusedStackOnly) {
-        ArrayList<ActivityRecord> activities;
-
-        synchronized (this) {
-            activities = mStackSupervisor.getDumpActivitiesLocked(name, dumpVisibleStacksOnly,
-                    dumpFocusedStackOnly);
-        }
-
-        if (activities.size() <= 0) {
-            return false;
-        }
-
-        String[] newArgs = new String[args.length - opti];
-        System.arraycopy(args, opti, newArgs, 0, args.length - opti);
-
-        TaskRecord lastTask = null;
-        boolean needSep = false;
-        for (int i=activities.size()-1; i>=0; i--) {
-            ActivityRecord r = activities.get(i);
-            if (needSep) {
-                pw.println();
-            }
-            needSep = true;
-            synchronized (this) {
-                final TaskRecord task = r.getTask();
-                if (lastTask != task) {
-                    lastTask = task;
-                    pw.print("TASK "); pw.print(lastTask.affinity);
-                            pw.print(" id="); pw.print(lastTask.taskId);
-                            pw.print(" userId="); pw.println(lastTask.userId);
-                    if (dumpAll) {
-                        lastTask.dump(pw, "  ");
-                    }
-                }
-            }
-            dumpActivity("  ", fd, pw, activities.get(i), newArgs, dumpAll);
-        }
-        return true;
-    }
-
-    /**
-     * Invokes IApplicationThread.dumpActivity() on the thread of the specified activity if
-     * there is a thread associated with the activity.
-     */
-    private void dumpActivity(String prefix, FileDescriptor fd, PrintWriter pw,
-            final ActivityRecord r, String[] args, boolean dumpAll) {
-        String innerPrefix = prefix + "  ";
-        synchronized (this) {
-            pw.print(prefix); pw.print("ACTIVITY "); pw.print(r.shortComponentName);
-                    pw.print(" "); pw.print(Integer.toHexString(System.identityHashCode(r)));
-                    pw.print(" pid=");
-                    if (r.hasProcess()) pw.println(r.app.getPid());
-                    else pw.println("(not running)");
-            if (dumpAll) {
-                r.dump(pw, innerPrefix);
-            }
-        }
-        if (r.attachedToProcess()) {
-            // flush anything that is already in the PrintWriter since the thread is going
-            // to write to the file descriptor directly
-            pw.flush();
-            try {
-                TransferPipe tp = new TransferPipe();
-                try {
-                    r.app.getThread().dumpActivity(tp.getWriteFd(),
-                            r.appToken, innerPrefix, args);
-                    tp.go(fd);
-                } finally {
-                    tp.kill();
-                }
-            } catch (IOException e) {
-                pw.println(innerPrefix + "Failure while dumping the activity: " + e);
-            } catch (RemoteException e) {
-                pw.println(innerPrefix + "Got a RemoteException while dumping the activity");
-            }
-        }
-    }
-
     void writeBroadcastsToProtoLocked(ProtoOutputStream proto) {
         if (mRegisteredReceivers.size() > 0) {
             Iterator it = mRegisteredReceivers.values().iterator();
@@ -12639,7 +10837,7 @@
             if (inclDetails) {
                 long detailToken = proto.start(ProcessOomProto.DETAIL);
                 proto.write(ProcessOomProto.Detail.MAX_ADJ, r.maxAdj);
-                proto.write(ProcessOomProto.Detail.CUR_RAW_ADJ, r.curRawAdj);
+                proto.write(ProcessOomProto.Detail.CUR_RAW_ADJ, r.getCurRawAdj());
                 proto.write(ProcessOomProto.Detail.SET_RAW_ADJ, r.setRawAdj);
                 proto.write(ProcessOomProto.Detail.CUR_ADJ, r.curAdj);
                 proto.write(ProcessOomProto.Detail.SET_ADJ, r.setAdj);
@@ -12765,7 +10963,7 @@
                 pw.print(prefix);
                 pw.print("    ");
                 pw.print("oom: max="); pw.print(r.maxAdj);
-                pw.print(" curRaw="); pw.print(r.curRawAdj);
+                pw.print(" curRaw="); pw.print(r.getCurRawAdj());
                 pw.print(" setRaw="); pw.print(r.setRawAdj);
                 pw.print(" cur="); pw.print(r.curAdj);
                 pw.print(" set="); pw.println(r.setAdj);
@@ -12805,35 +11003,9 @@
 
     ArrayList<ProcessRecord> collectProcesses(PrintWriter pw, int start, boolean allPkgs,
             String[] args) {
-        ArrayList<ProcessRecord> procs;
         synchronized (this) {
-            if (args != null && args.length > start
-                    && args[start].charAt(0) != '-') {
-                procs = new ArrayList<ProcessRecord>();
-                int pid = -1;
-                try {
-                    pid = Integer.parseInt(args[start]);
-                } catch (NumberFormatException e) {
-                }
-                for (int i=mLruProcesses.size()-1; i>=0; i--) {
-                    ProcessRecord proc = mLruProcesses.get(i);
-                    if (proc.pid > 0 && proc.pid == pid) {
-                        procs.add(proc);
-                    } else if (allPkgs && proc.pkgList != null
-                            && proc.pkgList.containsKey(args[start])) {
-                        procs.add(proc);
-                    } else if (proc.processName.equals(args[start])) {
-                        procs.add(proc);
-                    }
-                }
-                if (procs.size() <= 0) {
-                    return null;
-                }
-            } else {
-                procs = new ArrayList<ProcessRecord>(mLruProcesses);
-            }
+            return mProcessList.collectProcessesLocked(start, allPkgs, args);
         }
-        return procs;
     }
 
     final void dumpGraphicsHardwareUsage(FileDescriptor fd,
@@ -14427,13 +12599,13 @@
             mServices.newServiceDumperLocked(null, catPw, emptyArgs, 0,
                     false, null).dumpLocked();
             catPw.println();
-            dumpActivitiesLocked(null, catPw, emptyArgs, 0, false, false, null);
+            mAtmInternal.dump(DUMP_ACTIVITIES_CMD, null, catPw, emptyArgs, 0, false, false, null);
             catPw.flush();
         }
         dropBuilder.append(catSw.toString());
         StatsLog.write(StatsLog.LOW_MEM_REPORTED);
         addErrorToDropBox("lowmem", null, "system_server", null,
-                null, tag.toString(), dropBuilder.toString(), null, null);
+                null, null, tag.toString(), dropBuilder.toString(), null, null);
         //Slog.i(TAG, "Sent to dropbox:");
         //Slog.i(TAG, dropBuilder.toString());
         synchronized (ActivityManagerService.this) {
@@ -14528,7 +12700,7 @@
      * app that was passed in must remain on the process lists.
      */
     @GuardedBy("this")
-    private final boolean cleanUpApplicationRecordLocked(ProcessRecord app,
+    final boolean cleanUpApplicationRecordLocked(ProcessRecord app,
             boolean restarting, boolean allowRestart, int index, boolean replacingPid) {
         if (index >= 0) {
             removeLruProcessLocked(app);
@@ -14668,7 +12840,7 @@
             if (DEBUG_PROCESSES || DEBUG_CLEANUP) Slog.v(TAG_CLEANUP,
                     "Removing non-persistent process during cleanup: " + app);
             if (!replacingPid) {
-                removeProcessNameLocked(app.processName, app.uid, app);
+                mProcessList.removeProcessNameLocked(app.processName, app.uid, app);
             }
             mAtmInternal.clearHeavyWeightProcessIfEquals(app.getWindowProcessController());
         } else if (!app.removed) {
@@ -14692,9 +12864,9 @@
             if (index < 0) {
                 ProcessList.remove(app.pid);
             }
-            addProcessNameLocked(app);
+            mProcessList.addProcessNameLocked(app);
             app.pendingStart = false;
-            startProcessLocked(app, "restart", app.processName);
+            mProcessList.startProcessLocked(app, "restart", app.processName);
             return true;
         } else if (app.pid > 0 && app.pid != MY_PID) {
             // Goodbye!
@@ -15431,15 +13603,7 @@
     }
 
     private final void sendPackageBroadcastLocked(int cmd, String[] packages, int userId) {
-        for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
-            ProcessRecord r = mLruProcesses.get(i);
-            if (r.thread != null && (userId == UserHandle.USER_ALL || r.userId == userId)) {
-                try {
-                    r.thread.dispatchPackageBroadcast(cmd, packages);
-                } catch (RemoteException ex) {
-                }
-            }
-        }
+        mProcessList.sendPackageBroadcastLocked(cmd, packages, userId);
     }
 
     private List<ResolveInfo> collectReceiverComponents(Intent intent, String resolvedType,
@@ -15848,8 +14012,10 @@
                                     }
                                 } else {
                                     if (killProcess) {
-                                        killPackageProcessesLocked(ssp, UserHandle.getAppId(
-                                                intent.getIntExtra(Intent.EXTRA_UID, -1)),
+                                        final int extraUid = intent.getIntExtra(Intent.EXTRA_UID,
+                                                -1);
+                                        mProcessList.killPackageProcessesLocked(ssp,
+                                                UserHandle.getAppId(extraUid),
                                                 userId, ProcessList.INVALID_ADJ,
                                                 false, true, true, false, "change " + ssp);
                                     }
@@ -15890,7 +14056,7 @@
                                     + " ssp=" + ssp + " data=" + data);
                             return ActivityManager.BROADCAST_SUCCESS;
                         }
-                        mStackSupervisor.updateActivityApplicationInfoLocked(aInfo);
+                        mAtmInternal.onPackageReplaced(aInfo);
                         mServices.updateServiceApplicationInfoLocked(aInfo);
                         sendPackageBroadcastLocked(ApplicationThreadConstants.PACKAGE_REPLACED,
                                 new String[] {ssp}, userId);
@@ -16838,7 +15004,7 @@
         }
     }
 
-    private void noteUidProcessState(final int uid, final int state) {
+    void noteUidProcessState(final int uid, final int state) {
         mBatteryStatsService.noteUidProcessState(uid, state);
         mAppOpsService.updateUidProcState(uid, state);
         if (mTrackingAssociations) {
@@ -16870,6 +15036,7 @@
     private final ComputeOomAdjWindowCallback mTmpComputeOomAdjWindowCallback =
             new ComputeOomAdjWindowCallback();
 
+    /** These methods are called inline during computeOomAdjLocked(), on the same thread */
     private final class ComputeOomAdjWindowCallback
             implements WindowProcessController.ComputeOomAdjCallback {
 
@@ -17009,7 +15176,8 @@
             app.adjSeq = mAdjSeq;
             app.setCurrentSchedulingGroup(ProcessList.SCHED_GROUP_BACKGROUND);
             app.setCurProcState(ActivityManager.PROCESS_STATE_CACHED_EMPTY);
-            app.curAdj=app.curRawAdj=ProcessList.CACHED_APP_MAX_ADJ;
+            app.curAdj = ProcessList.CACHED_APP_MAX_ADJ;
+            app.setCurRawAdj(ProcessList.CACHED_APP_MAX_ADJ);
             app.completedAdjSeq = app.adjSeq;
             return false;
         }
@@ -17035,7 +15203,7 @@
             }
             app.adjType = "fixed";
             app.adjSeq = mAdjSeq;
-            app.curRawAdj = app.maxAdj;
+            app.setCurRawAdj(app.maxAdj);
             app.setHasForegroundActivities(false);
             app.setCurrentSchedulingGroup(ProcessList.SCHED_GROUP_DEFAULT);
             app.setCurProcState(ActivityManager.PROCESS_STATE_PERSISTENT);
@@ -17312,7 +15480,7 @@
         // there are applications dependent on our services or providers, but
         // this gives us a baseline and makes sure we don't get into an
         // infinite recursion.
-        app.curRawAdj = adj;
+        app.setCurRawAdj(adj);
         app.hasStartedServices = false;
         app.adjSeq = mAdjSeq;
 
@@ -17427,7 +15595,7 @@
                                 continue;
                             }
                         }
-                        int clientAdj = client.curRawAdj;
+                        int clientAdj = client.getCurRawAdj();
                         int clientProcState = client.getCurProcState();
                         if (clientProcState >= PROCESS_STATE_CACHED_ACTIVITY) {
                             // If the other app is cached for any reason, for purposes here
@@ -17669,7 +15837,7 @@
                         continue;
                     }
                 }
-                int clientAdj = client.curRawAdj;
+                int clientAdj = client.getCurRawAdj();
                 int clientProcState = client.getCurProcState();
                 if (clientProcState >= PROCESS_STATE_CACHED_ACTIVITY) {
                     // If the other app is cached for any reason, for purposes here
@@ -17871,7 +16039,7 @@
             }
         }
 
-        app.curRawAdj = adj;
+        app.setCurRawAdj(adj);
 
         //Slog.i(TAG, "OOM ADJ " + app + ": pid=" + app.pid +
         //      " adj=" + adj + " curAdj=" + app.curAdj + " maxAdj=" + app.maxAdj);
@@ -18050,10 +16218,10 @@
         for (int i = mPendingPssProcesses.size() - 1; i >= 0; i--) {
             ProcessList.abortNextPssTime(mPendingPssProcesses.get(i).procStateMemTracker);;
         }
-        mPendingPssProcesses.ensureCapacity(mLruProcesses.size());
+        mPendingPssProcesses.ensureCapacity(mProcessList.getLruSizeLocked());
         mPendingPssProcesses.clear();
-        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
-            ProcessRecord app = mLruProcesses.get(i);
+        for (int i = mProcessList.getLruSizeLocked() - 1; i >= 0; i--) {
+            ProcessRecord app = mProcessList.mLruProcesses.get(i);
             if (app.thread == null
                     || app.getCurProcState() == ActivityManager.PROCESS_STATE_NONEXISTENT) {
                 continue;
@@ -18114,8 +16282,7 @@
                 processingBroadcasts = true;
             }
         }
-        return !processingBroadcasts
-                && (mAtmInternal.isSleeping() || mStackSupervisor.allResumedActivitiesIdle());
+        return !processingBroadcasts && mAtmInternal.canGcNow();
     }
 
     /**
@@ -18130,7 +16297,7 @@
         if (canGcNowLocked()) {
             while (mProcessesToGc.size() > 0) {
                 ProcessRecord proc = mProcessesToGc.remove(0);
-                if (proc.curRawAdj > ProcessList.PERCEPTIBLE_APP_ADJ || proc.reportLowMemory) {
+                if (proc.getCurRawAdj() > ProcessList.PERCEPTIBLE_APP_ADJ || proc.reportLowMemory) {
                     if ((proc.lastRequestedGc+mConstants.GC_MIN_INTERVAL)
                             <= SystemClock.uptimeMillis()) {
                         // To avoid spamming the system, we will GC processes one
@@ -18230,10 +16397,10 @@
         final long curUptime = SystemClock.uptimeMillis();
         final long uptimeSince = curUptime - mLastPowerCheckUptime;
         mLastPowerCheckUptime = curUptime;
-        int i = mLruProcesses.size();
+        int i = mProcessList.mLruProcesses.size();
         while (i > 0) {
             i--;
-            ProcessRecord app = mLruProcesses.get(i);
+            ProcessRecord app = mProcessList.mLruProcesses.get(i);
             if (app.setProcState >= ActivityManager.PROCESS_STATE_HOME) {
                 if (app.lastCpuTime <= 0) {
                     continue;
@@ -18295,8 +16462,8 @@
             long nowElapsed) {
         boolean success = true;
 
-        if (app.curRawAdj != app.setRawAdj) {
-            app.setRawAdj = app.curRawAdj;
+        if (app.getCurRawAdj() != app.setRawAdj) {
+            app.setRawAdj = app.getCurRawAdj();
         }
 
         int changes = 0;
@@ -18783,13 +16950,14 @@
 
     // TODO(b/111541062): This method is only used for updating OOM adjustments. We need to update
     // the logic there and in mBatteryStatsService to make them aware of multiple resumed activities
-    private ActivityRecord resumedAppLocked() {
-        final ActivityRecord act = mStackSupervisor.getTopResumedActivity();
+    ProcessRecord getTopAppLocked() {
+        final WindowProcessController wpc = mAtmInternal != null ? mAtmInternal.getTopApp() : null;
+        final ProcessRecord r = wpc != null ? (ProcessRecord) wpc.mOwner : null;
         String pkg;
         int uid;
-        if (act != null) {
-            pkg = act.packageName;
-            uid = act.info.applicationInfo.uid;
+        if (r != null) {
+            pkg = r.processName;
+            uid = r.info.uid;
         } else {
             pkg = null;
             uid = -1;
@@ -18815,7 +16983,7 @@
             }
 
         }
-        return act;
+        return r;
     }
 
     /**
@@ -18827,9 +16995,7 @@
      */
     @GuardedBy("this")
     final boolean updateOomAdjLocked(ProcessRecord app, boolean oomAdjAll) {
-        final ActivityRecord TOP_ACT = resumedAppLocked();
-        final ProcessRecord TOP_APP = TOP_ACT != null && TOP_ACT.hasProcess()
-                ? (ProcessRecord) TOP_ACT.app.mOwner : null;
+        final ProcessRecord TOP_APP = getTopAppLocked();
         final boolean wasCached = app.cached;
 
         mAdjSeq++;
@@ -18838,12 +17004,12 @@
         // If our app is currently cached, we know it, and that is it.  Otherwise,
         // we don't know it yet, and it needs to now be cached we will then
         // need to do a complete oom adj.
-        final int cachedAdj = app.curRawAdj >= ProcessList.CACHED_APP_MIN_ADJ
-                ? app.curRawAdj : ProcessList.UNKNOWN_ADJ;
+        final int cachedAdj = app.getCurRawAdj() >= ProcessList.CACHED_APP_MIN_ADJ
+                ? app.getCurRawAdj() : ProcessList.UNKNOWN_ADJ;
         boolean success = updateOomAdjLocked(app, cachedAdj, TOP_APP, false,
                 SystemClock.uptimeMillis());
         if (oomAdjAll
-                && (wasCached != app.cached || app.curRawAdj == ProcessList.UNKNOWN_ADJ)) {
+                && (wasCached != app.cached || app.getCurRawAdj() == ProcessList.UNKNOWN_ADJ)) {
             // Changed to/from cached state, so apps after it in the LRU
             // list may also be changed.
             updateOomAdjLocked();
@@ -18852,23 +17018,13 @@
     }
 
     @GuardedBy("this")
-    ProcessRecord getTopAppLocked() {
-        final ActivityRecord TOP_ACT = resumedAppLocked();
-        if (TOP_ACT != null && TOP_ACT.hasProcess()) {
-            return (ProcessRecord) TOP_ACT.app.mOwner;
-        } else {
-            return null;
-        }
-    }
-
-    @GuardedBy("this")
     final void updateOomAdjLocked() {
         mOomAdjProfiler.oomAdjStarted();
         final ProcessRecord TOP_APP = getTopAppLocked();
         final long now = SystemClock.uptimeMillis();
         final long nowElapsed = SystemClock.elapsedRealtime();
         final long oldTime = now - ProcessList.MAX_EMPTY_TIME;
-        final int N = mLruProcesses.size();
+        final int N = mProcessList.getLruSizeLocked();
 
         // Reset state in all uid records.
         for (int i=mActiveUids.size()-1; i>=0; i--) {
@@ -18878,8 +17034,8 @@
             uidRec.reset();
         }
 
-        if (mStackSupervisor != null) {
-            mStackSupervisor.rankTaskLayersIfNeeded();
+        if (mAtmInternal != null) {
+            mAtmInternal.rankTaskLayersIfNeeded();
         }
 
         mAdjSeq++;
@@ -18929,11 +17085,11 @@
 
         // need to reset cycle state before calling computeOomAdjLocked because of service connections
         for (int i=N-1; i>=0; i--) {
-            ProcessRecord app = mLruProcesses.get(i);
+            ProcessRecord app = mProcessList.mLruProcesses.get(i);
             app.containsCycle = false;
         }
         for (int i=N-1; i>=0; i--) {
-            ProcessRecord app = mLruProcesses.get(i);
+            ProcessRecord app = mProcessList.mLruProcesses.get(i);
             if (!app.killedByAm && app.thread != null) {
                 app.procStateChanged = false;
                 computeOomAdjLocked(app, ProcessList.UNKNOWN_ADJ, TOP_APP, true, now);
@@ -18951,7 +17107,7 @@
                             // This process is a cached process holding activities...
                             // assign it the next cached value for that type, and then
                             // step that cached level.
-                            app.curRawAdj = curCachedAdj;
+                            app.setCurRawAdj(curCachedAdj);
                             app.curAdj = app.modifyRawOomAdj(curCachedAdj);
                             if (DEBUG_LRU && false) Slog.d(TAG_LRU, "Assigning activity LRU #" + i
                                     + " adj: " + app.curAdj + " (curCachedAdj=" + curCachedAdj
@@ -18974,7 +17130,7 @@
                             // long-running services that have dropped down to the
                             // cached level will be treated as empty (since their process
                             // state is still as a service), which is what we want.
-                            app.curRawAdj = curEmptyAdj;
+                            app.setCurRawAdj(curEmptyAdj);
                             app.curAdj = app.modifyRawOomAdj(curEmptyAdj);
                             if (DEBUG_LRU && false) Slog.d(TAG_LRU, "Assigning empty LRU #" + i
                                     + " adj: " + app.curAdj + " (curEmptyAdj=" + curEmptyAdj
@@ -19008,7 +17164,7 @@
             retryCycles = false;
 
             for (int i=0; i<N; i++) {
-                ProcessRecord app = mLruProcesses.get(i);
+                ProcessRecord app = mProcessList.mLruProcesses.get(i);
                 if (!app.killedByAm && app.thread != null && app.containsCycle == true) {
                     app.adjSeq--;
                     app.completedAdjSeq--;
@@ -19016,7 +17172,7 @@
             }
 
             for (int i=0; i<N; i++) {
-                ProcessRecord app = mLruProcesses.get(i);
+                ProcessRecord app = mProcessList.mLruProcesses.get(i);
                 if (!app.killedByAm && app.thread != null && app.containsCycle == true) {
 
                     if (computeOomAdjLocked(app, ProcessList.UNKNOWN_ADJ, TOP_APP, true, now)) {
@@ -19027,7 +17183,7 @@
         }
 
         for (int i=N-1; i>=0; i--) {
-            ProcessRecord app = mLruProcesses.get(i);
+            ProcessRecord app = mProcessList.mLruProcesses.get(i);
             if (!app.killedByAm && app.thread != null) {
                 applyOomAdjLocked(app, true, now, nowElapsed);
 
@@ -19120,9 +17276,9 @@
         // has gone down since last time.
         if (DEBUG_OOM_ADJ) Slog.d(TAG_OOM_ADJ, "oom: memFactor=" + memFactor
                 + " last=" + mLastMemoryLevel + " allowLow=" + mAllowLowerMemLevel
-                + " numProcs=" + mLruProcesses.size() + " last=" + mLastNumProcesses);
+                + " numProcs=" + mProcessList.getLruSizeLocked() + " last=" + mLastNumProcesses);
         if (memFactor > mLastMemoryLevel) {
-            if (!mAllowLowerMemLevel || mLruProcesses.size() >= mLastNumProcesses) {
+            if (!mAllowLowerMemLevel || mProcessList.getLruSizeLocked() >= mLastNumProcesses) {
                 memFactor = mLastMemoryLevel;
                 if (DEBUG_OOM_ADJ) Slog.d(TAG_OOM_ADJ, "Keeping last mem factor!");
             }
@@ -19132,7 +17288,7 @@
             StatsLog.write(StatsLog.MEMORY_FACTOR_STATE_CHANGED, memFactor);
         }
         mLastMemoryLevel = memFactor;
-        mLastNumProcesses = mLruProcesses.size();
+        mLastNumProcesses = mProcessList.getLruSizeLocked();
         boolean allChanged = mProcessStats.setMemFactorLocked(
                 memFactor, mAtmInternal != null ? !mAtmInternal.isSleeping() : true, now);
         final int trackerMemFactor = mProcessStats.getMemFactorLocked();
@@ -19160,7 +17316,7 @@
             if (factor < minFactor) factor = minFactor;
             int curLevel = ComponentCallbacks2.TRIM_MEMORY_COMPLETE;
             for (int i=N-1; i>=0; i--) {
-                ProcessRecord app = mLruProcesses.get(i);
+                ProcessRecord app = mProcessList.mLruProcesses.get(i);
                 if (allChanged || app.procStateChanged) {
                     setProcessTrackerStateLocked(app, trackerMemFactor, now);
                     app.procStateChanged = false;
@@ -19238,7 +17394,7 @@
                 mLowRamStartTime = 0;
             }
             for (int i=N-1; i>=0; i--) {
-                ProcessRecord app = mLruProcesses.get(i);
+                ProcessRecord app = mProcessList.mLruProcesses.get(i);
                 if (allChanged || app.procStateChanged) {
                     setProcessTrackerStateLocked(app, trackerMemFactor, now);
                     app.procStateChanged = false;
@@ -19265,7 +17421,7 @@
         if (mAlwaysFinishActivities) {
             // Need to do this on its own message because the stack may not
             // be in a consistent state at this point.
-            mStackSupervisor.scheduleDestroyAllActivities(null, "always-finish");
+            mAtmInternal.scheduleDestroyAllActivities("always-finish");
         }
 
         if (allChanged) {
@@ -19502,7 +17658,7 @@
                 continue;
             }
             synchronized (uidRec.networkStateLock) {
-                uidRec.curProcStateSeq = ++mProcStateSeqCounter;
+                uidRec.curProcStateSeq = ++mProcessList.mProcStateSeqCounter; // TODO: use method
                 if (blockState == NETWORK_STATE_BLOCK) {
                     if (blockingUids == null) {
                         blockingUids = new ArrayList<>();
@@ -19525,8 +17681,8 @@
             return;
         }
 
-        for (int i = mLruProcesses.size() - 1; i >= 0; --i) {
-            final ProcessRecord app = mLruProcesses.get(i);
+        for (int i = mProcessList.mLruProcesses.size() - 1; i >= 0; --i) {
+            final ProcessRecord app = mProcessList.mLruProcesses.get(i);
             if (!blockingUids.contains(app.uid)) {
                 continue;
             }
@@ -19724,8 +17880,8 @@
     final void trimApplicationsLocked() {
         // First remove any unused application processes whose package
         // has been removed.
-        for (int i=mRemovedProcesses.size()-1; i>=0; i--) {
-            final ProcessRecord app = mRemovedProcesses.get(i);
+        for (int i = mProcessList.mRemovedProcesses.size() - 1; i >= 0; i--) {
+            final ProcessRecord app = mProcessList.mRemovedProcesses.get(i);
             if (!app.hasActivitiesOrRecentTasks()
                     && app.curReceivers.isEmpty() && app.services.size() == 0) {
                 Slog.i(
@@ -19743,7 +17899,7 @@
                     }
                 }
                 cleanUpApplicationRecordLocked(app, false, true, -1, false /*replacingPid*/);
-                mRemovedProcesses.remove(i);
+                mProcessList.mRemovedProcesses.remove(i);
 
                 if (app.isPersistent()) {
                     addAppLocked(app.info, null, false, null /* ABI override */);
@@ -19769,8 +17925,8 @@
                         + android.Manifest.permission.SIGNAL_PERSISTENT_PROCESSES);
             }
 
-            for (int i = mLruProcesses.size() - 1 ; i >= 0 ; i--) {
-                ProcessRecord r = mLruProcesses.get(i);
+            for (int i = mProcessList.mLruProcesses.size() - 1 ; i >= 0 ; i--) {
+                ProcessRecord r = mProcessList.mLruProcesses.get(i);
                 if (r.thread != null && r.isPersistent()) {
                     sendSignal(r.pid, sig);
                 }
@@ -19897,7 +18053,7 @@
 
         if (proc == null) {
             ArrayMap<String, SparseArray<ProcessRecord>> all
-                    = mProcessNames.getMap();
+                    = mProcessList.mProcessNames.getMap();
             SparseArray<ProcessRecord> procs = all.get(process);
             if (procs != null && procs.size() > 0) {
                 proc = procs.valueAt(0);
@@ -20027,15 +18183,8 @@
     }
 
     void onCoreSettingsChange(Bundle settings) {
-        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
-            ProcessRecord processRecord = mLruProcesses.get(i);
-            try {
-                if (processRecord.thread != null) {
-                    processRecord.thread.setCoreSettings(settings);
-                }
-            } catch (RemoteException re) {
-                /* ignore */
-            }
+        synchronized (this) {
+            mProcessList.updateCoreSettingsLocked(settings);
         }
     }
 
@@ -20167,8 +18316,8 @@
                         + android.Manifest.permission.SET_ACTIVITY_WATCHER);
             }
 
-            for (int i = 0; i < mLruProcesses.size(); i++) {
-                ProcessRecord process = mLruProcesses.get(i);
+            for (int i = 0; i < mProcessList.mLruProcesses.size(); i++) {
+                ProcessRecord process = mProcessList.mLruProcesses.get(i);
                 if (!processSanityChecksLocked(process)) {
                     continue;
                 }
@@ -20200,7 +18349,7 @@
 
                 PrintWriter pw = new FastPrintWriter(new FileOutputStream(fd.getFileDescriptor()));
                 pw.println("Binder transaction traces for all processes.\n");
-                for (ProcessRecord process : mLruProcesses) {
+                for (ProcessRecord process : mProcessList.mLruProcesses) {
                     if (!processSanityChecksLocked(process)) {
                         continue;
                     }
@@ -20261,9 +18410,10 @@
         public void killForegroundAppsForUser(int userHandle) {
             synchronized (ActivityManagerService.this) {
                 final ArrayList<ProcessRecord> procs = new ArrayList<>();
-                final int NP = mProcessNames.getMap().size();
+                final int NP = mProcessList.mProcessNames.getMap().size();
                 for (int ip = 0; ip < NP; ip++) {
-                    final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+                    final SparseArray<ProcessRecord> apps =
+                            mProcessList.mProcessNames.getMap().valueAt(ip);
                     final int NA = apps.size();
                     for (int ia = 0; ia < NA; ia++) {
                         final ProcessRecord app = apps.valueAt(ia);
@@ -20282,7 +18432,7 @@
 
                 final int N = procs.size();
                 for (int i = 0; i < N; i++) {
-                    removeProcessLocked(procs.get(i), false, true, "kill all fg");
+                    mProcessList.removeProcessLocked(procs.get(i), false, true, "kill all fg");
                 }
             }
         }
@@ -20403,36 +18553,6 @@
         }
 
         @Override
-        public void saveANRState(String reason) {
-            synchronized (ActivityManagerService.this) {
-                final StringWriter sw = new StringWriter();
-                final PrintWriter pw = new FastPrintWriter(sw, false, 1024);
-                pw.println("  ANR time: " + DateFormat.getDateTimeInstance().format(new Date()));
-                if (reason != null) {
-                    pw.println("  Reason: " + reason);
-                }
-                pw.println();
-                mActivityTaskManager.getActivityStartController().dump(pw, "  ", null);
-                pw.println();
-                pw.println("-------------------------------------------------------------------------------");
-                dumpActivitiesLocked(null /* fd */, pw, null /* args */, 0 /* opti */,
-                        true /* dumpAll */, false /* dumpClient */, null /* dumpPackage */,
-                        "" /* header */);
-                pw.println();
-                pw.close();
-
-                mLastANRState = sw.toString();
-            }
-        }
-
-        @Override
-        public void clearSavedANRState() {
-            synchronized (ActivityManagerService.this) {
-                mLastANRState = null;
-            }
-        }
-
-        @Override
         public boolean isRuntimeRestarted() {
             return mSystemServiceManager.isRuntimeRestarted();
         }
@@ -20498,6 +18618,28 @@
         }
 
         @Override
+        public List<ProcessMemoryState> getMemoryStateForNativeProcesses() {
+            List<ProcessMemoryState> processMemoryStates = new ArrayList<>();
+            int[] pids = getPidsForCommands(MEMORY_STAT_INTERESTING_NATIVE_PROCESSES);
+            for (int i = 0; i < pids.length; i++) {
+                int pid = pids[i];
+                MemoryStat memoryStat = readMemoryStatFromProcfs(pid);
+                if (memoryStat == null) {
+                    continue;
+                }
+                int uid = getUidForPid(pid);
+                String processName = readCmdlineFromProcfs(pid);
+                int oomScore = -1; // Unused, not included in the NativeProcessMemoryState atom.
+                ProcessMemoryState processMemoryState = new ProcessMemoryState(uid, processName,
+                        oomScore, memoryStat.pgfault, memoryStat.pgmajfault,
+                        memoryStat.rssInBytes, memoryStat.cacheInBytes, memoryStat.swapInBytes,
+                        memoryStat.rssHighWatermarkInBytes);
+                processMemoryStates.add(processMemoryState);
+            }
+            return processMemoryStates;
+        }
+
+        @Override
         public int handleIncomingUser(int callingPid, int callingUid, int userId,
                 boolean allowAll, int allowMode, String name, String callerPackage) {
             return mUserController.handleIncomingUser(callingPid, callingUid, userId, allowAll,
@@ -20525,10 +18667,6 @@
             ActivityManagerService.this.trimApplications();
         }
 
-        public void closeSystemDialogs(String reason) {
-            ActivityManagerService.this.closeSystemDialogs(reason);
-        }
-
         public void killProcessesForRemovedTask(ArrayList<Object> procsToKill) {
             synchronized (ActivityManagerService.this) {
                 for (int i = 0; i < procsToKill.size(); i++) {
@@ -20552,8 +18690,8 @@
             if (packageName == null) return false;
 
             synchronized (ActivityManagerService.this) {
-                for (int i = 0; i < mLruProcesses.size(); i++) {
-                    final ProcessRecord pr = mLruProcesses.get(i);
+                for (int i = 0; i < mProcessList.mLruProcesses.size(); i++) {
+                    final ProcessRecord pr = mProcessList.mLruProcesses.get(i);
                     if (pr.uid != uid) {
                         continue;
                     }
@@ -20768,6 +18906,187 @@
                         : UsageEvents.Event.KEYGUARD_HIDDEN);
             }
         }
+
+        @Override
+        public long inputDispatchingTimedOut(int pid, boolean aboveSystem, String reason) {
+            synchronized (ActivityManagerService.this) {
+                return ActivityManagerService.this.inputDispatchingTimedOut(
+                        pid, aboveSystem, reason);
+            }
+        }
+
+        @Override
+        public boolean inputDispatchingTimedOut(Object proc, String activityShortComponentName,
+                ApplicationInfo aInfo, String parentShortComponentName, Object parentProc,
+                boolean aboveSystem, String reason) {
+            return ActivityManagerService.this.inputDispatchingTimedOut((ProcessRecord) proc,
+                    activityShortComponentName, aInfo, parentShortComponentName,
+                    (WindowProcessController) parentProc, aboveSystem, reason);
+
+        }
+
+        @Override
+        public void broadcastGlobalConfigurationChanged(int changes, boolean initLocale) {
+            synchronized (ActivityManagerService.this) {
+                Intent intent = new Intent(Intent.ACTION_CONFIGURATION_CHANGED);
+                intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
+                        | Intent.FLAG_RECEIVER_REPLACE_PENDING
+                        | Intent.FLAG_RECEIVER_FOREGROUND
+                        | Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS);
+                broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
+                        OP_NONE, null, false, false, MY_PID, SYSTEM_UID,
+                        UserHandle.USER_ALL);
+                if ((changes & ActivityInfo.CONFIG_LOCALE) != 0) {
+                    intent = new Intent(Intent.ACTION_LOCALE_CHANGED);
+                    intent.addFlags(Intent.FLAG_RECEIVER_FOREGROUND
+                            | Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND
+                            | Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS);
+                    if (initLocale || !mProcessesReady) {
+                        intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
+                    }
+                    broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
+                            OP_NONE, null, false, false, MY_PID, SYSTEM_UID,
+                            UserHandle.USER_ALL);
+                }
+
+                // Send a broadcast to PackageInstallers if the configuration change is interesting
+                // for the purposes of installing additional splits.
+                if (!initLocale && isSplitConfigurationChange(changes)) {
+                    intent = new Intent(Intent.ACTION_SPLIT_CONFIGURATION_CHANGED);
+                    intent.addFlags(Intent.FLAG_RECEIVER_REPLACE_PENDING
+                            | Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND);
+
+                    // Typically only app stores will have this permission.
+                    String[] permissions =
+                            new String[] { android.Manifest.permission.INSTALL_PACKAGES };
+                    broadcastIntentLocked(null, null, intent, null, null, 0, null, null,
+                            permissions, OP_NONE, null, false, false, MY_PID, SYSTEM_UID,
+                            UserHandle.USER_ALL);
+                }
+            }
+        }
+
+        /**
+         * Returns true if this configuration change is interesting enough to send an
+         * {@link Intent#ACTION_SPLIT_CONFIGURATION_CHANGED} broadcast.
+         */
+        private boolean isSplitConfigurationChange(int configDiff) {
+            return (configDiff & (ActivityInfo.CONFIG_LOCALE | ActivityInfo.CONFIG_DENSITY)) != 0;
+        }
+
+        @Override
+        public void broadcastCloseSystemDialogs(String reason) {
+            synchronized (ActivityManagerService.this) {
+                final Intent intent = new Intent(Intent.ACTION_CLOSE_SYSTEM_DIALOGS);
+                intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY
+                        | Intent.FLAG_RECEIVER_FOREGROUND);
+                if (reason != null) {
+                    intent.putExtra("reason", reason);
+                }
+
+                broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
+                        OP_NONE, null, false, false, -1, SYSTEM_UID, UserHandle.USER_ALL);
+            }
+        }
+
+        @Override
+        public void killAllBackgroundProcessesExcept(int minTargetSdk, int maxProcState) {
+            synchronized (ActivityManagerService.this) {
+                ActivityManagerService.this.killAllBackgroundProcessesExcept(
+                        minTargetSdk, maxProcState);
+            }
+        }
+
+        @Override
+        public void startProcess(String processName, ApplicationInfo info,
+                boolean knownToBeDead, String hostingType, ComponentName hostingName) {
+            synchronized (ActivityManagerService.this) {
+                startProcessLocked(processName, info, knownToBeDead, 0 /* intentFlags */,
+                        hostingType, hostingName, false /* allowWhileBooting */,
+                        false /* isolated */, true /* keepIfLarge */);
+            }
+        }
+
+        @Override
+        public void setDebugFlagsForStartingActivity(ActivityInfo aInfo, int startFlags,
+                ProfilerInfo profilerInfo) {
+            synchronized (ActivityManagerService.this) {
+                if ((startFlags & ActivityManager.START_FLAG_DEBUG) != 0) {
+                    setDebugApp(aInfo.processName, true, false);
+                }
+
+                if ((startFlags & ActivityManager.START_FLAG_NATIVE_DEBUGGING) != 0) {
+                    setNativeDebuggingAppLocked(aInfo.applicationInfo, aInfo.processName);
+                }
+
+                if ((startFlags & ActivityManager.START_FLAG_TRACK_ALLOCATION) != 0) {
+                    setTrackAllocationApp(aInfo.applicationInfo, aInfo.processName);
+                }
+
+                if (profilerInfo != null) {
+                    setProfileApp(aInfo.applicationInfo, aInfo.processName, profilerInfo);
+                }
+            }
+        }
+    }
+
+    long inputDispatchingTimedOut(int pid, final boolean aboveSystem, String reason) {
+        if (checkCallingPermission(FILTER_EVENTS) != PackageManager.PERMISSION_GRANTED) {
+            throw new SecurityException("Requires permission " + FILTER_EVENTS);
+        }
+        ProcessRecord proc;
+        long timeout;
+        synchronized (this) {
+            synchronized (mPidsSelfLocked) {
+                proc = mPidsSelfLocked.get(pid);
+            }
+            timeout = proc != null ? proc.getInputDispatchingTimeout() : KEY_DISPATCHING_TIMEOUT_MS;
+        }
+
+        if (inputDispatchingTimedOut(proc, null, null, null, null, aboveSystem, reason)) {
+            return -1;
+        }
+
+        return timeout;
+    }
+
+    /**
+     * Handle input dispatching timeouts.
+     * @return whether input dispatching should be aborted or not.
+     */
+    boolean inputDispatchingTimedOut(ProcessRecord proc, String activityShortComponentName,
+            ApplicationInfo aInfo, String parentShortComponentName,
+            WindowProcessController parentProcess, boolean aboveSystem, String reason) {
+        if (checkCallingPermission(FILTER_EVENTS) != PackageManager.PERMISSION_GRANTED) {
+            throw new SecurityException("Requires permission " + FILTER_EVENTS);
+        }
+
+        final String annotation;
+        if (reason == null) {
+            annotation = "Input dispatching timed out";
+        } else {
+            annotation = "Input dispatching timed out (" + reason + ")";
+        }
+
+        if (proc != null) {
+            synchronized (this) {
+                if (proc.isDebugging()) {
+                    return false;
+                }
+
+                if (proc.getActiveInstrumentation() != null) {
+                    Bundle info = new Bundle();
+                    info.putString("shortMsg", "keyDispatchingTimedOut");
+                    info.putString("longMsg", annotation);
+                    finishInstrumentationLocked(proc, Activity.RESULT_CANCELED, info);
+                    return true;
+                }
+            }
+            proc.appNotResponding(activityShortComponentName, aInfo,
+                    parentShortComponentName, parentProcess, aboveSystem, annotation);
+        }
+
+        return true;
     }
 
     /**
@@ -20890,8 +19209,8 @@
         }
         try {
             synchronized(this) {
-                killPackageProcessesLocked(packageName, UserHandle.getAppId(pkgUid), userId,
-                        ProcessList.FOREGROUND_APP_ADJ, false, true, true, false,
+                mProcessList.killPackageProcessesLocked(packageName, UserHandle.getAppId(pkgUid),
+                        userId, ProcessList.FOREGROUND_APP_ADJ, false, true, true, false,
                         "dep: " + packageName);
             }
         } finally {
@@ -20921,33 +19240,9 @@
 
     void updateApplicationInfoLocked(@NonNull List<String> packagesToUpdate, int userId) {
         final boolean updateFrameworkRes = packagesToUpdate.contains("android");
-        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
-            final ProcessRecord app = mLruProcesses.get(i);
-            if (app.thread == null) {
-                continue;
-            }
 
-            if (userId != UserHandle.USER_ALL && app.userId != userId) {
-                continue;
-            }
+        mProcessList.updateApplicationInfoLocked(packagesToUpdate, userId, updateFrameworkRes);
 
-            final int packageCount = app.pkgList.size();
-            for (int j = 0; j < packageCount; j++) {
-                final String packageName = app.pkgList.keyAt(j);
-                if (updateFrameworkRes || packagesToUpdate.contains(packageName)) {
-                    try {
-                        final ApplicationInfo ai = AppGlobals.getPackageManager()
-                                .getApplicationInfo(packageName, STOCK_PM_FLAGS, app.userId);
-                        if (ai != null) {
-                            app.thread.scheduleApplicationInfoChanged(ai);
-                        }
-                    } catch (RemoteException e) {
-                        Slog.w(TAG, String.format("Failed to update %s ApplicationInfo for %s",
-                                    packageName, app));
-                    }
-                }
-            }
-        }
         if (updateFrameworkRes) {
             // Update system server components that need to know about changed overlays. Because the
             // overlay is applied in ActivityThread, we need to serialize through its thread too.
@@ -20969,7 +19264,8 @@
     public void attachAgent(String process, String path) {
         try {
             synchronized (this) {
-                ProcessRecord proc = findProcessLocked(process, UserHandle.USER_SYSTEM, "attachAgent");
+                ProcessRecord proc = findProcessLocked(process, UserHandle.USER_SYSTEM,
+                        "attachAgent");
                 if (proc == null || proc.thread == null) {
                     throw new IllegalArgumentException("Unknown process: " + process);
                 }
diff --git a/services/core/java/com/android/server/am/ActivityManagerShellCommand.java b/services/core/java/com/android/server/am/ActivityManagerShellCommand.java
index 9f768a8..692b2d4 100644
--- a/services/core/java/com/android/server/am/ActivityManagerShellCommand.java
+++ b/services/core/java/com/android/server/am/ActivityManagerShellCommand.java
@@ -481,12 +481,12 @@
                 options.setLockTaskEnabled(true);
             }
             if (mWaitOption) {
-                result = mTaskInterface.startActivityAndWait(null, null, intent, mimeType,
+                result = mInternal.startActivityAndWait(null, null, intent, mimeType,
                         null, null, 0, mStartFlags, profilerInfo,
                         options != null ? options.toBundle() : null, mUserId);
                 res = result.result;
             } else {
-                res = mTaskInterface.startActivityAsUser(null, null, intent, mimeType,
+                res = mInternal.startActivityAsUser(null, null, intent, mimeType,
                         null, null, 0, mStartFlags, profilerInfo,
                         options != null ? options.toBundle() : null, mUserId);
             }
diff --git a/services/core/java/com/android/server/am/ActivityMetricsLogger.java b/services/core/java/com/android/server/am/ActivityMetricsLogger.java
index 3578ed0..a0dd878 100644
--- a/services/core/java/com/android/server/am/ActivityMetricsLogger.java
+++ b/services/core/java/com/android/server/am/ActivityMetricsLogger.java
@@ -507,14 +507,14 @@
     /**
      * Notifies the tracker that we called immediately before we call bindApplication on the client.
      *
-     * @param app The client into which we'll call bindApplication.
+     * @param appInfo The client into which we'll call bindApplication.
      */
-    void notifyBindApplication(ProcessRecord app) {
+    void notifyBindApplication(ApplicationInfo appInfo) {
         for (int i = mWindowingModeTransitionInfo.size() - 1; i >= 0; i--) {
             final WindowingModeTransitionInfo info = mWindowingModeTransitionInfo.valueAt(i);
 
             // App isn't attached to record yet, so match with info.
-            if (info.launchedActivity.appInfo == app.info) {
+            if (info.launchedActivity.appInfo == appInfo) {
                 info.bindApplicationDelayMs = calculateCurrentDelay();
             }
         }
diff --git a/services/core/java/com/android/server/am/ActivityRecord.java b/services/core/java/com/android/server/am/ActivityRecord.java
index d837118..865c774 100644
--- a/services/core/java/com/android/server/am/ActivityRecord.java
+++ b/services/core/java/com/android/server/am/ActivityRecord.java
@@ -81,6 +81,7 @@
 import static android.os.Build.VERSION_CODES.HONEYCOMB;
 import static android.os.Build.VERSION_CODES.O;
 import static android.os.Process.SYSTEM_UID;
+import static android.view.Display.INVALID_DISPLAY;
 import static android.view.WindowManagerPolicyConstants.NAV_BAR_LEFT;
 
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_CONFIGURATION;
@@ -114,6 +115,9 @@
 import static com.android.server.am.ActivityStack.LAUNCH_TICK_MSG;
 import static com.android.server.am.ActivityStack.PAUSE_TIMEOUT_MSG;
 import static com.android.server.am.ActivityStack.STOP_TIMEOUT_MSG;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_FREE_RESIZE;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_NONE;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_WINDOWING_MODE_RESIZE;
 import static com.android.server.am.EventLogTags.AM_RELAUNCH_ACTIVITY;
 import static com.android.server.am.EventLogTags.AM_RELAUNCH_RESUME_ACTIVITY;
 import static com.android.server.am.TaskPersister.DEBUG;
@@ -338,12 +342,6 @@
     int mStartingWindowState = STARTING_WINDOW_NOT_SHOWN;
     boolean mTaskOverlay = false; // Task is always on-top of other activities in the task.
 
-    // This activity is not being relaunched, or being relaunched for a non-resize reason.
-    static final int RELAUNCH_REASON_NONE = 0;
-    // This activity is being relaunched due to windowing mode change.
-    static final int RELAUNCH_REASON_WINDOWING_MODE_RESIZE = 1;
-    // This activity is being relaunched due to a free-resize operation.
-    static final int RELAUNCH_REASON_FREE_RESIZE = 2;
     // Marking the reason why this activity is being relaunched. Mainly used to track that this
     // activity is being relaunched to fulfill a resize request due to compatibility issues, e.g. in
     // pre-NYC apps that don't have a sense of being resized.
@@ -2114,12 +2112,16 @@
             windowFromSameProcessAsActivity =
                     !hasProcess() || app.getPid() == windowPid || windowPid == -1;
         }
+
         if (windowFromSameProcessAsActivity) {
-            return service.inputDispatchingTimedOut(anrApp, anrActivity, this, false, reason);
+            return service.mAmInternal.inputDispatchingTimedOut(anrApp.mOwner,
+                    anrActivity.shortComponentName, anrActivity.appInfo, shortComponentName,
+                    app, false, reason);
         } else {
             // In this case another process added windows using this activity token. So, we call the
             // generic service input dispatch timed out method so that the right process is blamed.
-            return service.inputDispatchingTimedOut(windowPid, false /* aboveSystem */, reason) < 0;
+            return service.mAmInternal.inputDispatchingTimedOut(
+                    windowPid, false /* aboveSystem */, reason) < 0;
         }
     }
 
@@ -2211,12 +2213,13 @@
     }
 
     /**
-     * @return display id to which this record is attached, -1 if not attached.
+     * @return display id to which this record is attached,
+     *         {@link android.view.Display#INVALID_DISPLAY} if not attached.
      */
     int getDisplayId() {
         final ActivityStack stack = getStack();
         if (stack == null) {
-            return -1;
+            return INVALID_DISPLAY;
         }
         return stack.mDisplayId;
     }
@@ -2281,6 +2284,11 @@
             // We don't show starting window for overlay activities.
             return;
         }
+        if (pendingOptions != null
+                && pendingOptions.getAnimationType() == ActivityOptions.ANIM_SCENE_TRANSITION) {
+            // Don't show starting window when using shared element transition.
+            return;
+        }
 
         final CompatibilityInfo compatInfo =
                 service.compatibilityInfoForPackageLocked(info.applicationInfo);
@@ -3006,17 +3014,6 @@
         mWindowContainerController.registerRemoteAnimations(definition);
     }
 
-    static String relaunchReasonToString(int relaunchReason) {
-        switch (relaunchReason) {
-            case RELAUNCH_REASON_WINDOWING_MODE_RESIZE:
-                return "window_resize";
-            case RELAUNCH_REASON_FREE_RESIZE:
-                return "free_resize";
-            default:
-                return null;
-        }
-    }
-
     @Override
     public String toString() {
         if (stringName != null) {
diff --git a/services/core/java/com/android/server/am/ActivityStack.java b/services/core/java/com/android/server/am/ActivityStack.java
index 695ffe2..026c5cc 100644
--- a/services/core/java/com/android/server/am/ActivityStack.java
+++ b/services/core/java/com/android/server/am/ActivityStack.java
@@ -81,8 +81,8 @@
 import static com.android.server.am.ActivityTaskManagerDebugConfig.POSTFIX_VISIBILITY;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.TAG_ATM;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.TAG_WITH_CLASS_NAME;
-import static com.android.server.am.ActivityRecord.RELAUNCH_REASON_FREE_RESIZE;
-import static com.android.server.am.ActivityRecord.RELAUNCH_REASON_WINDOWING_MODE_RESIZE;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_FREE_RESIZE;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_WINDOWING_MODE_RESIZE;
 import static com.android.server.am.ActivityStack.ActivityState.DESTROYED;
 import static com.android.server.am.ActivityStack.ActivityState.DESTROYING;
 import static com.android.server.am.ActivityStack.ActivityState.FINISHING;
@@ -3877,8 +3877,8 @@
         // The activity that we are finishing may be over the lock screen. In this case, we do not
         // want to consider activities that cannot be shown on the lock screen as running and should
         // proceed with finishing the activity if there is no valid next top running activity.
-        final ActivityRecord next = mStackSupervisor.topRunningActivityLocked(
-                true /* considerKeyguardState */);
+        final ActivityDisplay display = getDisplay();
+        final ActivityRecord next = display.topRunningActivity(true /* considerKeyguardState */);
 
         if (mode == FINISH_AFTER_VISIBLE && (r.visible || r.nowVisible)
                 && next != null && !next.nowVisible) {
@@ -3902,23 +3902,25 @@
         if (DEBUG_STATES) Slog.v(TAG_STATES, "Moving to FINISHING: " + r);
 
         r.setState(FINISHING, "finishCurrentActivityLocked");
-        final boolean finishingActivityInNonFocusedStack
-                = r.getStack() != mStackSupervisor.getTopDisplayFocusedStack()
-                && prevState == PAUSED && mode == FINISH_AFTER_VISIBLE;
+        final boolean finishingInNonFocusedStackOrNoRunning = mode == FINISH_AFTER_VISIBLE
+                && prevState == PAUSED && (r.getStack() != display.getFocusedStack()
+                        || (next == null && display.topRunningActivity() == null));
 
         if (mode == FINISH_IMMEDIATELY
                 || (prevState == PAUSED
                     && (mode == FINISH_AFTER_PAUSE || inPinnedWindowingMode()))
-                || finishingActivityInNonFocusedStack
+                || finishingInNonFocusedStackOrNoRunning
                 || prevState == STOPPING
                 || prevState == STOPPED
                 || prevState == ActivityState.INITIALIZING) {
             r.makeFinishingLocked();
             boolean activityRemoved = destroyActivityLocked(r, true, "finish-imm:" + reason);
 
-            if (finishingActivityInNonFocusedStack) {
+            if (finishingInNonFocusedStackOrNoRunning) {
                 // Finishing activity that was in paused state and it was in not currently focused
-                // stack, need to make something visible in its place.
+                // stack, need to make something visible in its place. Also if the display does not
+                // have running activity, the configuration may need to be updated for restoring
+                // original orientation of the display.
                 mStackSupervisor.ensureVisibilityAndConfig(next, mDisplayId,
                         false /* markFrozenIfConfigChanged */, true /* deferResume */);
             }
diff --git a/services/core/java/com/android/server/am/ActivityStackSupervisor.java b/services/core/java/com/android/server/am/ActivityStackSupervisor.java
index 3f823ae..257a004 100644
--- a/services/core/java/com/android/server/am/ActivityStackSupervisor.java
+++ b/services/core/java/com/android/server/am/ActivityStackSupervisor.java
@@ -21,8 +21,12 @@
 import static android.Manifest.permission.START_ANY_ACTIVITY;
 import static android.app.ActivityManager.LOCK_TASK_MODE_LOCKED;
 import static android.app.ActivityManager.START_DELIVERED_TO_TOP;
+import static android.app.ActivityManager.START_FLAG_DEBUG;
+import static android.app.ActivityManager.START_FLAG_NATIVE_DEBUGGING;
+import static android.app.ActivityManager.START_FLAG_TRACK_ALLOCATION;
 import static android.app.ActivityManager.START_TASK_TO_FRONT;
 import static android.app.ActivityTaskManager.INVALID_STACK_ID;
+import static android.app.ActivityTaskManager.INVALID_TASK_ID;
 import static android.app.ITaskStackListener.FORCED_RESIZEABLE_REASON_SECONDARY_DISPLAY;
 import static android.app.ITaskStackListener.FORCED_RESIZEABLE_REASON_SPLIT_SCREEN;
 import static android.app.WaitResult.INVALID_DELAY;
@@ -54,6 +58,21 @@
 import static android.view.Display.TYPE_VIRTUAL;
 import static android.view.WindowManager.TRANSIT_DOCK_TASK_FROM_RECENTS;
 
+import static com.android.server.am.ActivityStack.ActivityState.DESTROYED;
+import static com.android.server.am.ActivityStack.ActivityState.INITIALIZING;
+import static com.android.server.am.ActivityStack.ActivityState.PAUSED;
+import static com.android.server.am.ActivityStack.ActivityState.PAUSING;
+import static com.android.server.am.ActivityStack.ActivityState.RESUMED;
+import static com.android.server.am.ActivityStack.ActivityState.STOPPED;
+import static com.android.server.am.ActivityStack.ActivityState.STOPPING;
+import static com.android.server.am.ActivityStack.REMOVE_TASK_MODE_MOVING;
+import static com.android.server.am.ActivityStackSupervisorProto.CONFIGURATION_CONTAINER;
+import static com.android.server.am.ActivityStackSupervisorProto.DISPLAYS;
+import static com.android.server.am.ActivityStackSupervisorProto.FOCUSED_STACK_ID;
+import static com.android.server.am.ActivityStackSupervisorProto.IS_HOME_RECENTS_COMPONENT;
+import static com.android.server.am.ActivityStackSupervisorProto.KEYGUARD_CONTROLLER;
+import static com.android.server.am.ActivityStackSupervisorProto.PENDING_ACTIVITIES;
+import static com.android.server.am.ActivityStackSupervisorProto.RESUMED_ACTIVITY;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_ALL;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_IDLE;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_PAUSE;
@@ -75,23 +94,7 @@
 import static com.android.server.am.ActivityTaskManagerDebugConfig.TAG_WITH_CLASS_NAME;
 import static com.android.server.am.ActivityTaskManagerService.ANIMATE;
 import static com.android.server.am.ActivityTaskManagerService.H.FIRST_SUPERVISOR_STACK_MSG;
-import static com.android.server.am.ActivityRecord.RELAUNCH_REASON_NONE;
-import static com.android.server.am.ActivityStack.ActivityState.DESTROYED;
-import static com.android.server.am.ActivityStack.ActivityState.INITIALIZING;
-import static com.android.server.am.ActivityStack.ActivityState.PAUSED;
-import static com.android.server.am.ActivityStack.ActivityState.PAUSING;
-import static com.android.server.am.ActivityStack.ActivityState.RESUMED;
-import static com.android.server.am.ActivityStack.ActivityState.STOPPED;
-import static com.android.server.am.ActivityStack.ActivityState.STOPPING;
-import static com.android.server.am.ActivityStack.REMOVE_TASK_MODE_MOVING;
-import static com.android.server.am.ActivityStackSupervisorProto.CONFIGURATION_CONTAINER;
-import static com.android.server.am.ActivityStackSupervisorProto.DISPLAYS;
-import static com.android.server.am.ActivityStackSupervisorProto.FOCUSED_STACK_ID;
-import static com.android.server.am.ActivityStackSupervisorProto.IS_HOME_RECENTS_COMPONENT;
-import static com.android.server.am.ActivityStackSupervisorProto.KEYGUARD_CONTROLLER;
-import static com.android.server.am.ActivityStackSupervisorProto.PENDING_ACTIVITIES;
-import static com.android.server.am.ActivityStackSupervisorProto.RESUMED_ACTIVITY;
-import static android.app.ActivityTaskManager.INVALID_TASK_ID;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_NONE;
 import static com.android.server.am.TaskRecord.LOCK_TASK_AUTH_LAUNCHABLE;
 import static com.android.server.am.TaskRecord.LOCK_TASK_AUTH_LAUNCHABLE_PRIV;
 import static com.android.server.am.TaskRecord.LOCK_TASK_AUTH_WHITELISTED;
@@ -113,6 +116,7 @@
 import android.app.ActivityManagerInternal;
 import android.app.ActivityOptions;
 import android.app.AppOpsManager;
+import android.app.IApplicationThread;
 import android.app.ProfilerInfo;
 import android.app.ResultInfo;
 import android.app.WaitResult;
@@ -789,8 +793,9 @@
     }
 
     boolean canStartHomeOnDisplay(ActivityInfo homeActivity, int displayId) {
-        if (displayId == DEFAULT_DISPLAY) {
-            // No restrictions to default display.
+        if (displayId == DEFAULT_DISPLAY || (displayId != INVALID_DISPLAY
+                && displayId == mService.mVr2dDisplayId)) {
+            // No restrictions to default display or vr 2d display.
             return true;
         }
 
@@ -994,8 +999,8 @@
         return candidateTaskId;
     }
 
-    boolean attachApplicationLocked(ProcessRecord app) throws RemoteException {
-        final String processName = app.processName;
+    boolean attachApplicationLocked(WindowProcessController app) throws RemoteException {
+        final String processName = app.mName;
         boolean didSomething = false;
         for (int displayNdx = mActivityDisplays.size() - 1; displayNdx >= 0; --displayNdx) {
             final ActivityDisplay display = mActivityDisplays.get(displayNdx);
@@ -1009,7 +1014,7 @@
                 final int size = mTmpActivityList.size();
                 for (int i = 0; i < size; i++) {
                     final ActivityRecord activity = mTmpActivityList.get(i);
-                    if (activity.app == null && app.uid == activity.info.applicationInfo.uid
+                    if (activity.app == null && app.mUid == activity.info.applicationInfo.uid
                             && processName.equals(activity.processName)) {
                         try {
                             if (realStartActivityLocked(activity, app,
@@ -1209,75 +1214,15 @@
     }
 
     ActivityRecord topRunningActivityLocked() {
-        return topRunningActivityLocked(false /* considerKeyguardState */);
-    }
-
-    /**
-     * Returns the top running activity in the focused stack. In the case the focused stack has no
-     * such activity, the next focusable stack on top of a display is returned.
-     * @param considerKeyguardState Indicates whether the locked state should be considered. if
-     *                            {@code true} and the keyguard is locked, only activities that
-     *                            can be shown on top of the keyguard will be considered.
-     * @return The top running activity. {@code null} if none is available.
-     */
-    ActivityRecord topRunningActivityLocked(boolean considerKeyguardState) {
-        final ActivityStack focusedStack = getTopDisplayFocusedStack();
-        ActivityRecord r = focusedStack.topRunningActivityLocked();
-        if (r != null && isValidTopRunningActivity(r, considerKeyguardState)) {
-            return r;
-        }
-
-        // Look in other non-focused and non-home stacks.
         for (int i = mActivityDisplays.size() - 1; i >= 0; --i) {
-            final ActivityDisplay display = mActivityDisplays.get(i);
-
-            // TODO: We probably want to consider the top fullscreen stack as we could have a pinned
-            // stack on top.
-            final ActivityStack topStack = display.getTopStack();
-
-            // Only consider focusable top stacks other than the current focused one.
-            if (topStack == null || !topStack.isFocusable() || topStack == focusedStack) {
-                continue;
-            }
-
-            final ActivityRecord topActivity = topStack.topRunningActivityLocked();
-
-            // Skip if no top activity.
-            if (topActivity == null) {
-                continue;
-            }
-
-
-            // This activity can be considered the top running activity if we are not
-            // considering the locked state, the keyguard isn't locked, or we can show when
-            // locked.
-            if (isValidTopRunningActivity(topActivity, considerKeyguardState)) {
+            final ActivityRecord topActivity = mActivityDisplays.get(i).topRunningActivity();
+            if (topActivity != null) {
                 return topActivity;
             }
         }
-
         return null;
     }
 
-    /**
-     * Verifies an {@link ActivityRecord} can be the top activity based on keyguard state and
-     * whether we are considering it.
-     */
-    private boolean isValidTopRunningActivity(ActivityRecord record,
-            boolean considerKeyguardState) {
-        if (!considerKeyguardState) {
-            return true;
-        }
-
-        final boolean keyguardLocked = getKeyguardController().isKeyguardLocked();
-
-        if (!keyguardLocked) {
-            return true;
-        }
-
-        return record.canShowWhenLocked();
-    }
-
     @VisibleForTesting
     void getRunningTasks(int maxNum, List<RunningTaskInfo> list,
             @ActivityType int ignoreActivityType, @WindowingMode int ignoreWindowingMode,
@@ -1299,20 +1244,17 @@
 
             // Don't debug things in the system process
             if (!aInfo.processName.equals("system")) {
-                if ((startFlags & ActivityManager.START_FLAG_DEBUG) != 0) {
-                    mService.mAm.setDebugApp(aInfo.processName, true, false);
-                }
-
-                if ((startFlags & ActivityManager.START_FLAG_NATIVE_DEBUGGING) != 0) {
-                    mService.mAm.setNativeDebuggingAppLocked(aInfo.applicationInfo, aInfo.processName);
-                }
-
-                if ((startFlags & ActivityManager.START_FLAG_TRACK_ALLOCATION) != 0) {
-                    mService.mAm.setTrackAllocationApp(aInfo.applicationInfo, aInfo.processName);
-                }
-
-                if (profilerInfo != null) {
-                    mService.mAm.setProfileApp(aInfo.applicationInfo, aInfo.processName, profilerInfo);
+                if ((startFlags & (START_FLAG_DEBUG | START_FLAG_NATIVE_DEBUGGING
+                        | START_FLAG_TRACK_ALLOCATION)) != 0 || profilerInfo != null) {
+                    /**
+                     * Assume safe to call into AMS synchronously because the call that set these
+                     * flags should have originated from AMS which will already have its lock held.
+                     * @see ActivityManagerService#startActivityAndWait(IApplicationThread, String,
+                     * Intent, String, IBinder, String, int, int, ProfilerInfo, Bundle, int)
+                     * TODO(b/80414790): Investigate a better way of untangling this.
+                     */
+                    mService.mAmInternal.setDebugFlagsForStartingActivity(
+                            aInfo, startFlags, profilerInfo);
                 }
             }
             final String intentLaunchToken = intent.getLaunchToken();
@@ -1359,7 +1301,7 @@
         return resolveActivity(intent, rInfo, startFlags, profilerInfo);
     }
 
-    final boolean realStartActivityLocked(ActivityRecord r, ProcessRecord app,
+    private boolean realStartActivityLocked(ActivityRecord r, WindowProcessController proc,
             boolean andResume, boolean checkConfig) throws RemoteException {
 
         if (!allPausedActivitiesComplete()) {
@@ -1378,7 +1320,6 @@
         beginDeferResume();
 
         try {
-            final WindowProcessController proc = app.getWindowProcessController();
             r.startFreezingScreenLocked(proc, 0);
 
             // schedule launch ticks to collect information about slow apps.
@@ -1414,15 +1355,15 @@
 
             final int applicationInfoUid =
                     (r.info.applicationInfo != null) ? r.info.applicationInfo.uid : -1;
-            if ((r.userId != app.userId) || (r.appInfo.uid != applicationInfoUid)) {
+            if ((r.userId != proc.mUserId) || (r.appInfo.uid != applicationInfoUid)) {
                 Slog.wtf(TAG,
                         "User ID for activity changing for " + r
                                 + " appInfo.uid=" + r.appInfo.uid
                                 + " info.ai.uid=" + applicationInfoUid
-                                + " old=" + r.app + " new=" + app);
+                                + " old=" + r.app + " new=" + proc);
             }
 
-            app.waitingToKill = null;
+            proc.clearWaitingToKill();
             r.launchCount++;
             r.lastLaunchTime = SystemClock.uptimeMillis();
 
@@ -1441,7 +1382,7 @@
             }
 
             try {
-                if (app.thread == null) {
+                if (!proc.hasThread()) {
                     throw new RemoteException();
                 }
                 List<ResultInfo> results = null;
@@ -1467,50 +1408,29 @@
                 r.forceNewConfig = false;
                 mService.getAppWarningsLocked().onStartActivity(r);
                 r.compat = mService.compatibilityInfoForPackageLocked(r.info.applicationInfo);
-                ProfilerInfo profilerInfo = null;
-                if (mService.mAm.mProfileApp != null && mService.mAm.mProfileApp.equals(app.processName)) {
-                    if (mService.mAm.mProfileProc == null || mService.mAm.mProfileProc == app) {
-                        mService.mAm.mProfileProc = app;
-                        ProfilerInfo profilerInfoSvc = mService.mAm.mProfilerInfo;
-                        if (profilerInfoSvc != null && profilerInfoSvc.profileFile != null) {
-                            if (profilerInfoSvc.profileFd != null) {
-                                try {
-                                    profilerInfoSvc.profileFd = profilerInfoSvc.profileFd.dup();
-                                } catch (IOException e) {
-                                    profilerInfoSvc.closeFd();
-                                }
-                            }
+                ProfilerInfo profilerInfo = proc.onStartActivity(mService.mTopProcessState);
 
-                            profilerInfo = new ProfilerInfo(profilerInfoSvc);
-                        }
-                    }
-                }
-
-                app.hasShownUi = true;
-                app.setPendingUiClean(true);
-                app.forceProcessStateUpTo(mService.mTopProcessState);
                 // Because we could be starting an Activity in the system process this may not go
                 // across a Binder interface which would create a new Configuration. Consequently
                 // we have to always create a new Configuration here.
 
                 final MergedConfiguration mergedConfiguration = new MergedConfiguration(
-                        app.getWindowProcessController().getConfiguration(),
-                        r.getMergedOverrideConfiguration());
+                        proc.getConfiguration(), r.getMergedOverrideConfiguration());
                 r.setLastReportedConfiguration(mergedConfiguration);
 
                 logIfTransactionTooLarge(r.intent, r.icicle);
 
 
                 // Create activity launch transaction.
-                final ClientTransaction clientTransaction = ClientTransaction.obtain(app.thread,
-                        r.appToken);
+                final ClientTransaction clientTransaction = ClientTransaction.obtain(
+                        proc.getThread(), r.appToken);
                 clientTransaction.addCallback(LaunchActivityItem.obtain(new Intent(r.intent),
                         System.identityHashCode(r), r.info,
                         // TODO: Have this take the merged configuration instead of separate global
                         // and override configs.
                         mergedConfiguration.getGlobalConfiguration(),
                         mergedConfiguration.getOverrideConfiguration(), r.compat,
-                        r.launchedFromPackage, task.voiceInteractor, app.getReportedProcState(),
+                        r.launchedFromPackage, task.voiceInteractor, proc.getReportedProcState(),
                         r.icicle, r.persistentState, results, newIntents,
                         mService.isNextTransitionForward(), profilerInfo));
 
@@ -1526,12 +1446,12 @@
                 // Schedule transaction.
                 mService.getLifecycleManager().scheduleTransaction(clientTransaction);
 
-                if ((app.info.privateFlags & ApplicationInfo.PRIVATE_FLAG_CANT_SAVE_STATE) != 0
+                if ((proc.mInfo.privateFlags & ApplicationInfo.PRIVATE_FLAG_CANT_SAVE_STATE) != 0
                         && mService.mHasHeavyWeightFeature) {
                     // This may be a heavy-weight process! Note that the package manager will ensure
                     // that only activity can run in the main process of the .apk, which is the only
                     // thing that will be considered heavy-weight.
-                    if (app.processName.equals(app.info.packageName)) {
+                    if (proc.mName.equals(proc.mInfo.packageName)) {
                         if (mService.mHeavyWeightProcess != null
                                 && mService.mHeavyWeightProcess != proc) {
                             Slog.w(TAG, "Starting new heavy weight process " + proc
@@ -1544,12 +1464,10 @@
 
             } catch (RemoteException e) {
                 if (r.launchFailed) {
-                    // This is the second time we failed -- finish activity
-                    // and give up.
+                    // This is the second time we failed -- finish activity and give up.
                     Slog.e(TAG, "Second failure launching "
-                            + r.intent.getComponent().flattenToShortString()
-                            + ", giving up", e);
-                    mService.mAm.appDiedLocked(app);
+                            + r.intent.getComponent().flattenToShortString() + ", giving up", e);
+                    proc.appDied();
                     stack.requestFinishActivityLocked(r.appToken, Activity.RESULT_CANCELED, null,
                             "2nd-crash", false);
                     return false;
@@ -1658,24 +1576,21 @@
         }
     }
 
-    void startSpecificActivityLocked(ActivityRecord r,
-            boolean andResume, boolean checkConfig) {
+    void startSpecificActivityLocked(ActivityRecord r, boolean andResume, boolean checkConfig) {
         // Is this activity's application already running?
-        ProcessRecord app = mService.mAm.getProcessRecordLocked(r.processName,
-                r.info.applicationInfo.uid, true);
+        final WindowProcessController wpc =
+                mService.getProcessController(r.processName, r.info.applicationInfo.uid);
 
-        if (app != null && app.thread != null) {
+        if (wpc != null && wpc.hasThread()) {
             try {
-                if ((r.info.flags&ActivityInfo.FLAG_MULTIPROCESS) == 0
+                if ((r.info.flags & ActivityInfo.FLAG_MULTIPROCESS) == 0
                         || !"android".equals(r.info.packageName)) {
-                    // Don't add this if it is a platform component that is marked
-                    // to run in multiple processes, because this is actually
-                    // part of the framework so doesn't make sense to track as a
-                    // separate apk in the process.
-                    app.addPackage(r.info.packageName, r.info.applicationInfo.longVersionCode,
-                            mService.mAm.mProcessStats);
+                    // Don't add this if it is a platform component that is marked to run in
+                    // multiple processes, because this is actually part of the framework so doesn't
+                    // make sense to track as a separate apk in the process.
+                    wpc.addPackage(r.info.packageName, r.info.applicationInfo.longVersionCode);
                 }
-                realStartActivityLocked(r, app, andResume, checkConfig);
+                realStartActivityLocked(r, wpc, andResume, checkConfig);
                 return;
             } catch (RemoteException e) {
                 Slog.w(TAG, "Exception when starting activity "
@@ -1686,8 +1601,12 @@
             // restart the application.
         }
 
-        mService.mAm.startProcessLocked(r.processName, r.info.applicationInfo, true, 0,
-                "activity", r.intent.getComponent(), false, false, true);
+        // Post message to start process to avoid possible deadlock of calling into AMS with the
+        // ATMS lock held.
+        final Message msg = PooledLambda.obtainMessage(
+                ActivityManagerInternal::startProcess, mService.mAmInternal, r.processName,
+                r.info.applicationInfo, true, "activity", r.intent.getComponent());
+        mService.mH.sendMessage(msg);
     }
 
     void sendPowerHintForLaunchStartIfNeeded(boolean forceSend, ActivityRecord targetActivity) {
@@ -2258,9 +2177,9 @@
      * Finish the topmost activities in all stacks that belong to the crashed app.
      * @param app The app that crashed.
      * @param reason Reason to perform this action.
-     * @return The task that was finished in this stack, {@code null} if haven't found any.
+     * @return The task id that was finished in this stack, or INVALID_TASK_ID if none was finished.
      */
-    TaskRecord finishTopCrashedActivitiesLocked(WindowProcessController app, String reason) {
+    int finishTopCrashedActivitiesLocked(WindowProcessController app, String reason) {
         TaskRecord finishedTask = null;
         ActivityStack focusedStack = getTopDisplayFocusedStack();
         for (int displayNdx = mActivityDisplays.size() - 1; displayNdx >= 0; --displayNdx) {
@@ -2275,7 +2194,7 @@
                 }
             }
         }
-        return finishedTask;
+        return finishedTask != null ? finishedTask.taskId : INVALID_TASK_ID;
     }
 
     void finishVoiceTask(IVoiceInteractionSession session) {
@@ -2305,17 +2224,8 @@
             mUserLeaving = true;
         }
 
-        // TODO(b/111363427): The moving-to-top task may not be on the top display, so it could be
-        // different from where the prev activity stays on.
-        final ActivityRecord prev = topRunningActivityLocked();
-
-        if ((flags & ActivityManager.MOVE_TASK_WITH_HOME) != 0
-                || (prev != null && prev.isActivityTypeRecents())) {
-            // Caller wants the home activity moved with it or the previous task is recents in which
-            // case we always return home from the task we are moving to the front.
-            currentStack.getDisplay().moveHomeStackToFront("findTaskToMoveToFront");
-        }
-
+        reason = reason + " findTaskToMoveToFront";
+        boolean reparented = false;
         if (task.isResizeable() && canUseActivityOptionsLaunchBounds(options)) {
             final Rect bounds = options.getLaunchBounds();
             task.updateOverrideConfiguration(bounds);
@@ -2323,10 +2233,12 @@
             ActivityStack stack = getLaunchStack(null, options, task, ON_TOP);
 
             if (stack != currentStack) {
+                moveHomeStackToFrontIfNeeded(flags, stack.getDisplay(), reason);
                 task.reparent(stack, ON_TOP, REPARENT_KEEP_STACK_AT_FRONT, !ANIMATE, DEFER_RESUME,
-                        "findTaskToMoveToFront");
+                        reason);
                 currentStack = stack;
-                // moveTaskToStackUncheckedLocked() should already placed the task on top,
+                reparented = true;
+                // task.reparent() should already placed the task on top,
                 // still need moveTaskToFrontLocked() below for any transition settings.
             }
             if (stack.resizeStackWithLaunchBounds()) {
@@ -2341,6 +2253,10 @@
             }
         }
 
+        if (!reparented) {
+            moveHomeStackToFrontIfNeeded(flags, currentStack.getDisplay(), reason);
+        }
+
         final ActivityRecord r = task.getTopActivity();
         currentStack.moveTaskToFrontLocked(task, false /* noAnimation */, options,
                 r == null ? null : r.appTimeTracker, reason);
@@ -2352,6 +2268,18 @@
                 currentStack, forceNonResizeable);
     }
 
+    private void moveHomeStackToFrontIfNeeded(int flags, ActivityDisplay display, String reason) {
+        final ActivityStack focusedStack = display.getFocusedStack();
+
+        if ((display.getWindowingMode() == WINDOWING_MODE_FULLSCREEN
+                && (flags & ActivityManager.MOVE_TASK_WITH_HOME) != 0)
+                || (focusedStack != null && focusedStack.isActivityTypeRecents())) {
+            // We move home stack to front when we are on a fullscreen display and caller has
+            // requested the home activity to move with it. Or the previous stack is recents.
+            display.moveHomeStackToFront(reason);
+        }
+    }
+
     boolean canUseActivityOptionsLaunchBounds(ActivityOptions options) {
         // We use the launch bounds in the activity options is the device supports freeform
         // window management or is launching into the pinned stack.
@@ -2457,7 +2385,7 @@
         }
         if (displayId != INVALID_DISPLAY && canLaunchOnDisplay(r, displayId)) {
             if (r != null) {
-                stack = (T) getValidLaunchStackOnDisplay(displayId, r, options);
+                stack = (T) getValidLaunchStackOnDisplay(displayId, r, candidateTask, options);
                 if (stack != null) {
                     return stack;
                 }
@@ -2522,10 +2450,11 @@
      * If there is no such stack, new dynamic stack can be created.
      * @param displayId Target display.
      * @param r Activity that should be launched there.
+     * @param candidateTask The possible task the activity might be put in.
      * @return Existing stack if there is a valid one, new dynamic stack if it is valid or null.
      */
     ActivityStack getValidLaunchStackOnDisplay(int displayId, @NonNull ActivityRecord r,
-            @Nullable ActivityOptions options) {
+            @Nullable TaskRecord candidateTask, @Nullable ActivityOptions options) {
         final ActivityDisplay activityDisplay = getActivityDisplayOrCreateLocked(displayId);
         if (activityDisplay == null) {
             throw new IllegalArgumentException(
@@ -2536,6 +2465,13 @@
             return null;
         }
 
+        // If {@code r} is already in target display and its task is the same as the candidate task,
+        // the intention should be getting a launch stack for the reusable activity, so we can use
+        // the existing stack.
+        if (r.getDisplayId() == displayId && r.getTask() == candidateTask) {
+            return candidateTask.getStack();
+        }
+
         // Return the topmost valid stack on the display.
         for (int i = activityDisplay.getChildCount() - 1; i >= 0; --i) {
             final ActivityStack stack = activityDisplay.getChildAt(i);
@@ -2556,6 +2492,11 @@
         return null;
     }
 
+    ActivityStack getValidLaunchStackOnDisplay(int displayId, @NonNull ActivityRecord r,
+            @Nullable ActivityOptions options) {
+        return getValidLaunchStackOnDisplay(displayId, r, null /* candidateTask */, options);
+    }
+
     // TODO: Can probably be consolidated into getLaunchStack()...
     private boolean isValidLaunchStack(ActivityStack stack, int displayId, ActivityRecord r) {
         switch (stack.getActivityType()) {
diff --git a/services/core/java/com/android/server/am/ActivityStarter.java b/services/core/java/com/android/server/am/ActivityStarter.java
index afcf9f9..45a0652 100644
--- a/services/core/java/com/android/server/am/ActivityStarter.java
+++ b/services/core/java/com/android/server/am/ActivityStarter.java
@@ -53,6 +53,11 @@
 import static android.view.Display.DEFAULT_DISPLAY;
 import static android.view.Display.INVALID_DISPLAY;
 
+import static com.android.server.am.ActivityStack.ActivityState.RESUMED;
+import static com.android.server.am.ActivityStackSupervisor.DEFER_RESUME;
+import static com.android.server.am.ActivityStackSupervisor.ON_TOP;
+import static com.android.server.am.ActivityStackSupervisor.PRESERVE_WINDOWS;
+import static com.android.server.am.ActivityStackSupervisor.TAG_TASKS;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_CONFIGURATION;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_FOCUS;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_PERMISSIONS_REVIEW;
@@ -67,11 +72,6 @@
 import static com.android.server.am.ActivityTaskManagerDebugConfig.TAG_ATM;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.TAG_WITH_CLASS_NAME;
 import static com.android.server.am.ActivityTaskManagerService.ANIMATE;
-import static com.android.server.am.ActivityStack.ActivityState.RESUMED;
-import static com.android.server.am.ActivityStackSupervisor.DEFER_RESUME;
-import static com.android.server.am.ActivityStackSupervisor.ON_TOP;
-import static com.android.server.am.ActivityStackSupervisor.PRESERVE_WINDOWS;
-import static com.android.server.am.ActivityStackSupervisor.TAG_TASKS;
 import static com.android.server.am.EventLogTags.AM_NEW_INTENT;
 import static com.android.server.am.TaskRecord.REPARENT_KEEP_STACK_AT_FRONT;
 import static com.android.server.am.TaskRecord.REPARENT_MOVE_STACK_TO_FRONT;
@@ -1277,6 +1277,7 @@
 
         setInitialState(r, options, inTask, doResume, startFlags, sourceRecord, voiceSession,
                 voiceInteractor);
+        final int preferredWindowingMode = mLaunchParams.mWindowingMode;
 
         // Do not start home activity if it cannot be launched on preferred display. We are not
         // doing this in ActivityStackSupervisor#canPlaceEntityOnDisplay because it might
@@ -1295,25 +1296,6 @@
 
         ActivityRecord reusedActivity = getReusableIntentActivity();
 
-        int preferredWindowingMode = WINDOWING_MODE_UNDEFINED;
-        int preferredLaunchDisplayId = DEFAULT_DISPLAY;
-        if (mOptions != null) {
-            preferredWindowingMode = mOptions.getLaunchWindowingMode();
-            preferredLaunchDisplayId = mOptions.getLaunchDisplayId();
-        }
-
-        // windowing mode and preferred launch display values from {@link LaunchParams} take
-        // priority over those specified in {@link ActivityOptions}.
-        if (!mLaunchParams.isEmpty()) {
-            if (mLaunchParams.hasPreferredDisplay()) {
-                preferredLaunchDisplayId = mLaunchParams.mPreferredDisplayId;
-            }
-
-            if (mLaunchParams.hasWindowingMode()) {
-                preferredWindowingMode = mLaunchParams.mWindowingMode;
-            }
-        }
-
         if (reusedActivity != null) {
             // When the flags NEW_TASK and CLEAR_TASK are set, then the task gets reused but
             // still needs to be a lock task mode violation since the task gets cleared out and
@@ -1460,7 +1442,7 @@
             // Don't use mStartActivity.task to show the toast. We're not starting a new activity
             // but reusing 'top'. Fields in mStartActivity may not be fully initialized.
             mSupervisor.handleNonResizableTaskIfNeeded(top.getTask(), preferredWindowingMode,
-                    preferredLaunchDisplayId, topStack);
+                    mPreferredDisplayId, topStack);
 
             return START_DELIVERED_TO_TOP;
         }
@@ -1540,7 +1522,7 @@
         mSupervisor.updateUserStackLocked(mStartActivity.userId, mTargetStack);
 
         mSupervisor.handleNonResizableTaskIfNeeded(mStartActivity.getTask(), preferredWindowingMode,
-                preferredLaunchDisplayId, mTargetStack);
+                mPreferredDisplayId, mTargetStack);
 
         return START_SUCCESS;
     }
@@ -1614,7 +1596,6 @@
         } else {
             mPreferredDisplayId = DEFAULT_DISPLAY;
         }
-        ensureValidPreferredDisplayId(r);
 
         mLaunchMode = r.launchMode;
 
@@ -1707,24 +1688,6 @@
         mNoAnimation = (mLaunchFlags & FLAG_ACTIVITY_NO_ANIMATION) != 0;
     }
 
-    /**
-     * Ensure preferred display ID matches the starting activity.
-     */
-    private void ensureValidPreferredDisplayId(ActivityRecord startingActivity) {
-        // Check if the Activity is a VR activity. If so, the activity should be launched in
-        // main display.
-        if (startingActivity != null && startingActivity.requestedVrComponent != null) {
-            mPreferredDisplayId = DEFAULT_DISPLAY;
-        }
-
-        // Get the virtual display ID from ActivityStackManagerService. If that's set we should
-        // always use that.
-        final int displayId = mService.mVr2dDisplayId;
-        if (displayId != INVALID_DISPLAY) {
-            mPreferredDisplayId = displayId;
-        }
-    }
-
     private void sendNewTaskResultRequestIfNeeded() {
         final ActivityStack sourceStack = mStartActivity.resultTo != null
                 ? mStartActivity.resultTo.getStack() : null;
diff --git a/services/core/java/com/android/server/am/ActivityTaskManagerService.java b/services/core/java/com/android/server/am/ActivityTaskManagerService.java
index 6398680..f79d9aa 100644
--- a/services/core/java/com/android/server/am/ActivityTaskManagerService.java
+++ b/services/core/java/com/android/server/am/ActivityTaskManagerService.java
@@ -38,7 +38,9 @@
 import static android.app.WindowConfiguration.WINDOWING_MODE_SPLIT_SCREEN_PRIMARY;
 import static android.app.WindowConfiguration.WINDOWING_MODE_SPLIT_SCREEN_SECONDARY;
 import static android.app.WindowConfiguration.WINDOWING_MODE_UNDEFINED;
+import static android.content.Intent.FLAG_ACTIVITY_EXCLUDE_FROM_RECENTS;
 import static android.content.Intent.FLAG_ACTIVITY_NEW_TASK;
+import static android.content.Intent.FLAG_ACTIVITY_TASK_ON_HOME;
 import static android.content.pm.ApplicationInfo.FLAG_FACTORY_TEST;
 import static android.content.pm.ConfigurationInfo.GL_ES_VERSION_UNDEFINED;
 import static android.content.pm.PackageManager.FEATURE_ACTIVITIES_ON_SECONDARY_DISPLAYS;
@@ -51,6 +53,7 @@
 import static android.os.FactoryTest.FACTORY_TEST_HIGH_LEVEL;
 import static android.os.FactoryTest.FACTORY_TEST_LOW_LEVEL;
 import static android.os.FactoryTest.FACTORY_TEST_OFF;
+import static android.os.Process.FIRST_APPLICATION_UID;
 import static android.os.Process.SYSTEM_UID;
 import static android.os.Trace.TRACE_TAG_ACTIVITY_MANAGER;
 import static android.provider.Settings.Global.ALWAYS_FINISH_ACTIVITIES;
@@ -68,7 +71,22 @@
 import static android.view.WindowManager.TRANSIT_TASK_OPEN;
 import static android.view.WindowManager.TRANSIT_TASK_TO_FRONT;
 
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.CONFIG_WILL_CHANGE;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.CONTROLLER;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.CURRENT_TRACKER;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.Controller.IS_A_MONKEY;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.GLOBAL_CONFIGURATION;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.GOING_TO_SLEEP;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.HEAVY_WEIGHT_PROC;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.HOME_PROC;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.LAUNCHING_ACTIVITY;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.PREVIOUS_PROC;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.PREVIOUS_PROC_VISIBLE_TIME_MS;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.SCREEN_COMPAT_PACKAGES;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.ScreenCompatPackage.MODE;
+import static com.android.server.am.ActivityManagerServiceDumpProcessesProto.ScreenCompatPackage.PACKAGE;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_ALL;
+import static com.android.server.am.ActivityManagerService.ANR_TRACE_DIR;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_CONFIGURATION;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_FOCUS;
 import static com.android.server.am.ActivityTaskManagerDebugConfig.DEBUG_IMMERSIVE;
@@ -220,9 +238,12 @@
 import com.android.internal.logging.nano.MetricsProto.MetricsEvent;
 import com.android.internal.messages.nano.SystemMessageProto.SystemMessage;
 import com.android.internal.notification.SystemNotificationChannels;
+import com.android.internal.os.TransferPipe;
 import com.android.internal.os.logging.MetricsLoggerWrapper;
 import com.android.internal.policy.IKeyguardDismissCallback;
 import com.android.internal.policy.KeyguardDismissCallback;
+import com.android.internal.util.ArrayUtils;
+import com.android.internal.util.FastPrintWriter;
 import com.android.internal.util.Preconditions;
 import com.android.internal.util.function.pooled.PooledLambda;
 import com.android.server.AppOpsService;
@@ -239,16 +260,23 @@
 import com.android.server.wm.PinnedStackWindowController;
 import com.android.server.wm.WindowManagerService;
 
+import java.io.BufferedReader;
 import java.io.File;
+import java.io.FileDescriptor;
 import java.io.FileOutputStream;
+import java.io.FileReader;
 import java.io.IOException;
 import java.io.PrintWriter;
 import java.io.StringWriter;
 import java.lang.ref.WeakReference;
+import java.text.DateFormat;
 import java.util.ArrayList;
+import java.util.Date;
 import java.util.HashSet;
 import java.util.List;
 import java.util.Locale;
+import java.util.Map;
+import java.util.Set;
 
 /**
  * System service for managing activities and their containers (task, stacks, displays,... ).
@@ -266,9 +294,9 @@
     private static final String TAG_CONFIGURATION = TAG + POSTFIX_CONFIGURATION;
 
     // How long we wait until we timeout on key dispatching.
-    private static final int KEY_DISPATCHING_TIMEOUT_MS = 5 * 1000;
+    public static final int KEY_DISPATCHING_TIMEOUT_MS = 5 * 1000;
     // How long we wait until we timeout on key dispatching during instrumentation.
-    private static final int INSTRUMENTATION_KEY_DISPATCHING_TIMEOUT_MS = 60 * 1000;
+    static final int INSTRUMENTATION_KEY_DISPATCHING_TIMEOUT_MS = 60 * 1000;
 
     /** Used to indicate that an app transition should be animated. */
     static final boolean ANIMATE = true;
@@ -276,7 +304,24 @@
     /** Hardware-reported OpenGLES version. */
     final int GL_ES_VERSION;
 
+    public static final String DUMP_ACTIVITIES_CMD = "activities" ;
+    public static final String DUMP_ACTIVITIES_SHORT_CMD = "a" ;
+    public static final String DUMP_LASTANR_CMD = "lastanr" ;
+    public static final String DUMP_LASTANR_TRACES_CMD = "lastanr-traces" ;
+    public static final String DUMP_STARTER_CMD = "starter" ;
+    public static final String DUMP_CONTAINERS_CMD = "containers" ;
+    public static final String DUMP_RECENTS_CMD = "recents" ;
+    public static final String DUMP_RECENTS_SHORT_CMD = "r" ;
+
+    /** This activity is not being relaunched, or being relaunched for a non-resize reason. */
+    public static final int RELAUNCH_REASON_NONE = 0;
+    /** This activity is being relaunched due to windowing mode change. */
+    public static final int RELAUNCH_REASON_WINDOWING_MODE_RESIZE = 1;
+    /** This activity is being relaunched due to a free-resize operation. */
+    public static final int RELAUNCH_REASON_FREE_RESIZE = 2;
+
     Context mContext;
+
     /**
      * This Context is themable and meant for UI display (AlertDialogs, etc.). The theme can
      * change at runtime. Use mContext for non-UI purposes.
@@ -414,6 +459,12 @@
     String mTopData;
 
     /**
+     * Dump of the activity state at the time of the last ANR. Cleared after
+     * {@link WindowManagerService#LAST_ANR_LIFETIME_DURATION_MSECS}
+     */
+    String mLastANRState;
+
+    /**
      * Used to retain an update lock when the foreground activity is in
      * immersive mode.
      */
@@ -701,6 +752,7 @@
     void setWindowManager(WindowManagerService wm) {
         mWindowManager = wm;
         mLockTaskController.setWindowManager(wm);
+        mStackSupervisor.setWindowManager(wm);
     }
 
     void setUsageStatsManager(UsageStatsManagerInternal usageStatsManager) {
@@ -1317,7 +1369,7 @@
                         Slog.i(TAG, "Removing task failed to finish activity");
                     }
                     // Explicitly dismissing the activity so reset its relaunch flag.
-                    r.mRelaunchReason = ActivityRecord.RELAUNCH_REASON_NONE;
+                    r.mRelaunchReason = RELAUNCH_REASON_NONE;
                 } else {
                     res = tr.getStack().requestFinishActivityLocked(token, resultCode,
                             resultData, "app-request", true);
@@ -2617,7 +2669,7 @@
                 pae.intent.setFlags(FLAG_ACTIVITY_NEW_TASK
                         | Intent.FLAG_ACTIVITY_SINGLE_TOP
                         | Intent.FLAG_ACTIVITY_CLEAR_TOP);
-                mAmInternal.closeSystemDialogs("assist");
+                mInternal.closeSystemDialogs("assist");
 
                 try {
                     mContext.startActivityAsUser(pae.intent, new UserHandle(pae.userHandle));
@@ -4280,6 +4332,17 @@
         }
     }
 
+    public static String relaunchReasonToString(int relaunchReason) {
+        switch (relaunchReason) {
+            case RELAUNCH_REASON_WINDOWING_MODE_RESIZE:
+                return "window_resize";
+            case RELAUNCH_REASON_FREE_RESIZE:
+                return "free_resize";
+            default:
+                return null;
+        }
+    }
+
     ActivityStack getTopDisplayFocusedStack() {
         return mStackSupervisor.getTopDisplayFocusedStack();
     }
@@ -4304,16 +4367,177 @@
                 || transit == TRANSIT_TASK_TO_FRONT;
     }
 
-    void dumpSleepStates(PrintWriter pw, boolean testPssMode) {
-        synchronized (mGlobalLock) {
-            pw.println("  mSleepTokens=" + mStackSupervisor.mSleepTokens);
-            if (mRunningVoice != null) {
-                pw.println("  mRunningVoice=" + mRunningVoice);
-                pw.println("  mVoiceWakeLock" + mVoiceWakeLock);
+    void dumpLastANRLocked(PrintWriter pw) {
+        pw.println("ACTIVITY MANAGER LAST ANR (dumpsys activity lastanr)");
+        if (mLastANRState == null) {
+            pw.println("  <no ANR has occurred since boot>");
+        } else {
+            pw.println(mLastANRState);
+        }
+    }
+
+    void dumpLastANRTracesLocked(PrintWriter pw) {
+        pw.println("ACTIVITY MANAGER LAST ANR TRACES (dumpsys activity lastanr-traces)");
+
+        final File[] files = new File(ANR_TRACE_DIR).listFiles();
+        if (ArrayUtils.isEmpty(files)) {
+            pw.println("  <no ANR has occurred since boot>");
+            return;
+        }
+        // Find the latest file.
+        File latest = null;
+        for (File f : files) {
+            if ((latest == null) || (latest.lastModified() < f.lastModified())) {
+                latest = f;
             }
-            pw.println("  mSleeping=" + mSleeping);
-            pw.println("  mShuttingDown=" + mShuttingDown + " mTestPssMode=" + testPssMode);
-            pw.println("  mVrController=" + mVrController);
+        }
+        pw.print("File: ");
+        pw.print(latest.getName());
+        pw.println();
+        try (BufferedReader in = new BufferedReader(new FileReader(latest))) {
+            String line;
+            while ((line = in.readLine()) != null) {
+                pw.println(line);
+            }
+        } catch (IOException e) {
+            pw.print("Unable to read: ");
+            pw.print(e);
+            pw.println();
+        }
+    }
+
+    void dumpActivitiesLocked(FileDescriptor fd, PrintWriter pw, String[] args,
+            int opti, boolean dumpAll, boolean dumpClient, String dumpPackage) {
+        dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage,
+                "ACTIVITY MANAGER ACTIVITIES (dumpsys activity activities)");
+    }
+
+    void dumpActivitiesLocked(FileDescriptor fd, PrintWriter pw, String[] args,
+            int opti, boolean dumpAll, boolean dumpClient, String dumpPackage, String header) {
+        pw.println(header);
+
+        boolean printedAnything = mStackSupervisor.dumpActivitiesLocked(fd, pw, dumpAll, dumpClient,
+                dumpPackage);
+        boolean needSep = printedAnything;
+
+        boolean printed = ActivityStackSupervisor.printThisActivity(pw,
+                mStackSupervisor.getTopResumedActivity(),  dumpPackage, needSep,
+                "  ResumedActivity: ");
+        if (printed) {
+            printedAnything = true;
+            needSep = false;
+        }
+
+        if (dumpPackage == null) {
+            if (needSep) {
+                pw.println();
+            }
+            printedAnything = true;
+            mStackSupervisor.dump(pw, "  ");
+        }
+
+        if (!printedAnything) {
+            pw.println("  (nothing)");
+        }
+    }
+
+    void dumpActivityContainersLocked(PrintWriter pw) {
+        pw.println("ACTIVITY MANAGER STARTER (dumpsys activity containers)");
+        mStackSupervisor.dumpChildrenNames(pw, " ");
+        pw.println(" ");
+    }
+
+    void dumpActivityStarterLocked(PrintWriter pw, String dumpPackage) {
+        pw.println("ACTIVITY MANAGER STARTER (dumpsys activity starter)");
+        getActivityStartController().dump(pw, "", dumpPackage);
+    }
+
+    /**
+     * There are three things that cmd can be:
+     *  - a flattened component name that matches an existing activity
+     *  - the cmd arg isn't the flattened component name of an existing activity:
+     *    dump all activity whose component contains the cmd as a substring
+     *  - A hex number of the ActivityRecord object instance.
+     *
+     *  @param dumpVisibleStacksOnly dump activity with {@param name} only if in a visible stack
+     *  @param dumpFocusedStackOnly dump activity with {@param name} only if in the focused stack
+     */
+    protected boolean dumpActivity(FileDescriptor fd, PrintWriter pw, String name, String[] args,
+            int opti, boolean dumpAll, boolean dumpVisibleStacksOnly, boolean dumpFocusedStackOnly) {
+        ArrayList<ActivityRecord> activities;
+
+        synchronized (mGlobalLock) {
+            activities = mStackSupervisor.getDumpActivitiesLocked(name, dumpVisibleStacksOnly,
+                    dumpFocusedStackOnly);
+        }
+
+        if (activities.size() <= 0) {
+            return false;
+        }
+
+        String[] newArgs = new String[args.length - opti];
+        System.arraycopy(args, opti, newArgs, 0, args.length - opti);
+
+        TaskRecord lastTask = null;
+        boolean needSep = false;
+        for (int i = activities.size() - 1; i >= 0; i--) {
+            ActivityRecord r = activities.get(i);
+            if (needSep) {
+                pw.println();
+            }
+            needSep = true;
+            synchronized (mGlobalLock) {
+                final TaskRecord task = r.getTask();
+                if (lastTask != task) {
+                    lastTask = task;
+                    pw.print("TASK "); pw.print(lastTask.affinity);
+                    pw.print(" id="); pw.print(lastTask.taskId);
+                    pw.print(" userId="); pw.println(lastTask.userId);
+                    if (dumpAll) {
+                        lastTask.dump(pw, "  ");
+                    }
+                }
+            }
+            dumpActivity("  ", fd, pw, activities.get(i), newArgs, dumpAll);
+        }
+        return true;
+    }
+
+    /**
+     * Invokes IApplicationThread.dumpActivity() on the thread of the specified activity if
+     * there is a thread associated with the activity.
+     */
+    private void dumpActivity(String prefix, FileDescriptor fd, PrintWriter pw,
+            final ActivityRecord r, String[] args, boolean dumpAll) {
+        String innerPrefix = prefix + "  ";
+        synchronized (mGlobalLock) {
+            pw.print(prefix); pw.print("ACTIVITY "); pw.print(r.shortComponentName);
+            pw.print(" "); pw.print(Integer.toHexString(System.identityHashCode(r)));
+            pw.print(" pid=");
+            if (r.hasProcess()) pw.println(r.app.getPid());
+            else pw.println("(not running)");
+            if (dumpAll) {
+                r.dump(pw, innerPrefix);
+            }
+        }
+        if (r.attachedToProcess()) {
+            // flush anything that is already in the PrintWriter since the thread is going
+            // to write to the file descriptor directly
+            pw.flush();
+            try {
+                TransferPipe tp = new TransferPipe();
+                try {
+                    r.app.getThread().dumpActivity(tp.getWriteFd(),
+                            r.appToken, innerPrefix, args);
+                    tp.go(fd);
+                } finally {
+                    tp.kill();
+                }
+            } catch (IOException e) {
+                pw.println(innerPrefix + "Failure while dumping the activity: " + e);
+            } catch (RemoteException e) {
+                pw.println(innerPrefix + "Got a RemoteException while dumping the activity");
+            }
         }
     }
 
@@ -4446,14 +4670,6 @@
         return kept;
     }
 
-    /**
-     * Returns true if this configuration change is interesting enough to send an
-     * {@link Intent#ACTION_SPLIT_CONFIGURATION_CHANGED} broadcast.
-     */
-    private static boolean isSplitConfigurationChange(int configDiff) {
-        return (configDiff & (ActivityInfo.CONFIG_LOCALE | ActivityInfo.CONFIG_DENSITY)) != 0;
-    }
-
     /** Update default (global) configuration and notify listeners about changes. */
     private int updateGlobalConfigurationLocked(@NonNull Configuration values, boolean initLocale,
             boolean persistent, int userId, boolean deferResume) {
@@ -4553,38 +4769,10 @@
             app.onConfigurationChanged(configCopy);
         }
 
-        Intent intent = new Intent(Intent.ACTION_CONFIGURATION_CHANGED);
-        intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY | Intent.FLAG_RECEIVER_REPLACE_PENDING
-                | Intent.FLAG_RECEIVER_FOREGROUND
-                | Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS);
-        mAm.broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
-                OP_NONE, null, false, false, MY_PID, SYSTEM_UID,
-                UserHandle.USER_ALL);
-        if ((changes & ActivityInfo.CONFIG_LOCALE) != 0) {
-            intent = new Intent(Intent.ACTION_LOCALE_CHANGED);
-            intent.addFlags(Intent.FLAG_RECEIVER_FOREGROUND
-                    | Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND
-                    | Intent.FLAG_RECEIVER_VISIBLE_TO_INSTANT_APPS);
-            if (initLocale || !mAm.mProcessesReady) {
-                intent.addFlags(Intent.FLAG_RECEIVER_REGISTERED_ONLY);
-            }
-            mAm.broadcastIntentLocked(null, null, intent, null, null, 0, null, null, null,
-                    OP_NONE, null, false, false, MY_PID, SYSTEM_UID,
-                    UserHandle.USER_ALL);
-        }
-
-        // Send a broadcast to PackageInstallers if the configuration change is interesting
-        // for the purposes of installing additional splits.
-        if (!initLocale && isSplitConfigurationChange(changes)) {
-            intent = new Intent(Intent.ACTION_SPLIT_CONFIGURATION_CHANGED);
-            intent.addFlags(Intent.FLAG_RECEIVER_REPLACE_PENDING
-                    | Intent.FLAG_RECEIVER_INCLUDE_BACKGROUND);
-
-            // Typically only app stores will have this permission.
-            String[] permissions = new String[] { android.Manifest.permission.INSTALL_PACKAGES };
-            mAm.broadcastIntentLocked(null, null, intent, null, null, 0, null, null, permissions,
-                    OP_NONE, null, false, false, MY_PID, SYSTEM_UID, UserHandle.USER_ALL);
-        }
+        final Message msg = PooledLambda.obtainMessage(
+                ActivityManagerInternal::broadcastGlobalConfigurationChanged,
+                mAmInternal, changes, initLocale);
+        mH.sendMessage(msg);
 
         // Override configuration of the default display duplicates global config, so we need to
         // update it also. This will also notify WindowManager about changes.
@@ -4653,8 +4841,12 @@
             if (isDensityChange && displayId == DEFAULT_DISPLAY) {
                 mAppWarnings.onDensityChanged();
 
-                mAm.killAllBackgroundProcessesExcept(N,
-                        ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE);
+                // Post message to start process to avoid possible deadlock of calling into AMS with
+                // the ATMS lock held.
+                final Message msg = PooledLambda.obtainMessage(
+                        ActivityManagerInternal::killAllBackgroundProcessesExcept, mAmInternal,
+                        N, ActivityManager.PROCESS_STATE_BOUND_FOREGROUND_SERVICE);
+                mH.sendMessage(msg);
             }
         }
 
@@ -4726,70 +4918,7 @@
     }
 
     private static long getInputDispatchingTimeoutLocked(WindowProcessController r) {
-        if (r != null && (r.isInstrumenting() || r.isUsingWrapper())) {
-            return INSTRUMENTATION_KEY_DISPATCHING_TIMEOUT_MS;
-        }
-        return KEY_DISPATCHING_TIMEOUT_MS;
-    }
-
-    long inputDispatchingTimedOut(int pid, final boolean aboveSystem, String reason) {
-        if (checkCallingPermission(FILTER_EVENTS) != PackageManager.PERMISSION_GRANTED) {
-            throw new SecurityException("Requires permission " + FILTER_EVENTS);
-        }
-        WindowProcessController proc;
-        long timeout;
-        synchronized (mGlobalLock) {
-            proc = mPidMap.get(pid);
-            timeout = getInputDispatchingTimeoutLocked(proc);
-        }
-
-        if (inputDispatchingTimedOut(proc, null, null, aboveSystem, reason)) {
-            return -1;
-        }
-
-        return timeout;
-    }
-
-    /**
-     * Handle input dispatching timeouts.
-     * Returns whether input dispatching should be aborted or not.
-     */
-    boolean inputDispatchingTimedOut(final WindowProcessController proc,
-            final ActivityRecord activity, final ActivityRecord parent,
-            final boolean aboveSystem, String reason) {
-        if (checkCallingPermission(FILTER_EVENTS) != PackageManager.PERMISSION_GRANTED) {
-            throw new SecurityException("Requires permission " + FILTER_EVENTS);
-        }
-
-        final String annotation;
-        if (reason == null) {
-            annotation = "Input dispatching timed out";
-        } else {
-            annotation = "Input dispatching timed out (" + reason + ")";
-        }
-
-        if (proc != null) {
-            synchronized (mGlobalLock) {
-                if (proc.isDebugging()) {
-                    return false;
-                }
-
-                if (proc.isInstrumenting()) {
-                    Bundle info = new Bundle();
-                    info.putString("shortMsg", "keyDispatchingTimedOut");
-                    info.putString("longMsg", annotation);
-                    mAm.finishInstrumentationLocked(
-                            (ProcessRecord) proc.mOwner, Activity.RESULT_CANCELED, info);
-                    return true;
-                }
-            }
-            mH.post(() -> {
-                mAm.mAppErrors.appNotResponding(
-                        (ProcessRecord) proc.mOwner, activity, parent, aboveSystem, annotation);
-            });
-        }
-
-        return true;
+        return r != null ? r.getInputDispatchingTimeout() : KEY_DISPATCHING_TIMEOUT_MS;
     }
 
     /**
@@ -5285,7 +5414,7 @@
         return newInfo;
     }
 
-    private WindowProcessController getProcessController(String processName, int uid) {
+    WindowProcessController getProcessController(String processName, int uid) {
         if (uid == SYSTEM_UID) {
             // The system gets to run in any process. If there are multiple processes with the same
             // uid, just pick the first (this should never happen).
@@ -5735,6 +5864,9 @@
         @Override
         public void finishHeavyWeightApp() {
             synchronized (mGlobalLock) {
+                if (mHeavyWeightProcess != null) {
+                    mHeavyWeightProcess.finishActivities();
+                }
                 ActivityTaskManagerService.this.clearHeavyWeightProcessIfEquals(
                         mHeavyWeightProcess);
             }
@@ -5825,14 +5957,6 @@
         }
 
         @Override
-        public long inputDispatchingTimedOut(int pid, boolean aboveSystem, String reason) {
-            synchronized (mGlobalLock) {
-                return ActivityTaskManagerService.this.inputDispatchingTimedOut(
-                        pid, aboveSystem, reason);
-            }
-        }
-
-        @Override
         public void onProcessMapped(int pid, WindowProcessController proc) {
             synchronized (mGlobalLock) {
                 mPidMap.put(pid, proc);
@@ -5870,6 +5994,13 @@
         }
 
         @Override
+        public void onPackageReplaced(ApplicationInfo aInfo) {
+            synchronized (mGlobalLock) {
+                mStackSupervisor.updateActivityApplicationInfoLocked(aInfo);
+            }
+        }
+
+        @Override
         public CompatibilityInfo compatibilityInfoForPackage(ApplicationInfo ai) {
             synchronized (mGlobalLock) {
                 return compatibilityInfoForPackageLocked(ai);
@@ -6037,5 +6168,467 @@
                 });
             }
         }
+
+        @Override
+        public void handleAppDied(WindowProcessController wpc, boolean restarting,
+                Runnable finishInstrumentationCallback) {
+            synchronized (mGlobalLock) {
+                // Remove this application's activities from active lists.
+                boolean hasVisibleActivities = mStackSupervisor.handleAppDiedLocked(wpc);
+
+                wpc.clearRecentTasks();
+                wpc.clearActivities();
+
+                if (wpc.isInstrumenting()) {
+                    finishInstrumentationCallback.run();
+                }
+
+                mWindowManager.deferSurfaceLayout();
+                try {
+                    if (!restarting && hasVisibleActivities
+                            && !mStackSupervisor.resumeFocusedStacksTopActivitiesLocked()) {
+                        // If there was nothing to resume, and we are not already restarting this
+                        // process, but there is a visible activity that is hosted by the process...
+                        // then make sure all visible activities are running, taking care of
+                        // restarting this process.
+                        mStackSupervisor.ensureActivitiesVisibleLocked(null, 0, !PRESERVE_WINDOWS);
+                    }
+                } finally {
+                    mWindowManager.continueSurfaceLayout();
+                }
+            }
+        }
+
+        @Override
+        public void closeSystemDialogs(String reason) {
+            enforceNotIsolatedCaller("closeSystemDialogs");
+
+            final int pid = Binder.getCallingPid();
+            final int uid = Binder.getCallingUid();
+            final long origId = Binder.clearCallingIdentity();
+            try {
+                synchronized (mGlobalLock) {
+                    // Only allow this from foreground processes, so that background
+                    // applications can't abuse it to prevent system UI from being shown.
+                    if (uid >= FIRST_APPLICATION_UID) {
+                        final WindowProcessController proc = mPidMap.get(pid);
+                        if (!proc.isPerceptible()) {
+                            Slog.w(TAG, "Ignoring closeSystemDialogs " + reason
+                                    + " from background process " + proc);
+                            return;
+                        }
+                    }
+                    mWindowManager.closeSystemDialogs(reason);
+
+                    mStackSupervisor.closeSystemDialogsLocked();
+                }
+                // Call into AM outside the synchronized block.
+                mAmInternal.broadcastCloseSystemDialogs(reason);
+            } finally {
+                Binder.restoreCallingIdentity(origId);
+            }
+        }
+
+        @Override
+        public void cleanupDisabledPackageComponents(
+                String packageName, Set<String> disabledClasses, int userId, boolean booted) {
+            synchronized (mGlobalLock) {
+                // Clean-up disabled activities.
+                if (mStackSupervisor.finishDisabledPackageActivitiesLocked(
+                        packageName, disabledClasses, true, false, userId) && booted) {
+                    mStackSupervisor.resumeFocusedStacksTopActivitiesLocked();
+                    mStackSupervisor.scheduleIdleLocked();
+                }
+
+                // Clean-up disabled tasks
+                getRecentTasks().cleanupDisabledPackageTasksLocked(
+                        packageName, disabledClasses, userId);
+            }
+        }
+
+        @Override
+        public boolean onForceStopPackage(String packageName, boolean doit, boolean evenPersistent,
+                int userId) {
+            synchronized (mGlobalLock) {
+
+                boolean didSomething =
+                        getActivityStartController().clearPendingActivityLaunches(packageName);
+                didSomething |= mStackSupervisor.finishDisabledPackageActivitiesLocked(packageName,
+                        null, doit, evenPersistent, userId);
+                return didSomething;
+            }
+        }
+
+        @Override
+        public void resumeTopActivities(boolean scheduleIdle) {
+            synchronized (mGlobalLock) {
+                mStackSupervisor.resumeFocusedStacksTopActivitiesLocked();
+                if (scheduleIdle) {
+                    mStackSupervisor.scheduleIdleLocked();
+                }
+            }
+        }
+
+        @Override
+        public void preBindApplication(WindowProcessController wpc) {
+            synchronized (mGlobalLock) {
+                mStackSupervisor.getActivityMetricsLogger().notifyBindApplication(wpc.mInfo);
+            }
+        }
+
+        @Override
+        public boolean attachApplication(WindowProcessController wpc) throws RemoteException {
+            synchronized (mGlobalLock) {
+                return mStackSupervisor.attachApplicationLocked(wpc);
+            }
+        }
+
+        @Override
+        public void notifyLockedProfile(@UserIdInt int userId, int currentUserId) {
+            try {
+                if (!AppGlobals.getPackageManager().isUidPrivileged(Binder.getCallingUid())) {
+                    throw new SecurityException("Only privileged app can call notifyLockedProfile");
+                }
+            } catch (RemoteException ex) {
+                throw new SecurityException("Fail to check is caller a privileged app", ex);
+            }
+
+            synchronized (mGlobalLock) {
+                final long ident = Binder.clearCallingIdentity();
+                try {
+                    if (mAmInternal.shouldConfirmCredentials(userId)) {
+                        if (mKeyguardController.isKeyguardLocked()) {
+                            // Showing launcher to avoid user entering credential twice.
+                            startHomeActivity(currentUserId, "notifyLockedProfile");
+                        }
+                        mStackSupervisor.lockAllProfileTasks(userId);
+                    }
+                } finally {
+                    Binder.restoreCallingIdentity(ident);
+                }
+            }
+        }
+
+        @Override
+        public void startConfirmDeviceCredentialIntent(Intent intent, Bundle options) {
+            mAmInternal.enforceCallingPermission(
+                    MANAGE_ACTIVITY_STACKS, "startConfirmDeviceCredentialIntent");
+
+            synchronized (mGlobalLock) {
+                final long ident = Binder.clearCallingIdentity();
+                try {
+                    intent.addFlags(FLAG_ACTIVITY_NEW_TASK | FLAG_ACTIVITY_EXCLUDE_FROM_RECENTS |
+                            FLAG_ACTIVITY_TASK_ON_HOME);
+                    ActivityOptions activityOptions = options != null
+                            ? new ActivityOptions(options) : ActivityOptions.makeBasic();
+                    activityOptions.setLaunchTaskId(
+                            mStackSupervisor.getDefaultDisplayHomeActivity().getTask().taskId);
+                    mContext.startActivityAsUser(intent, activityOptions.toBundle(),
+                            UserHandle.CURRENT);
+                } finally {
+                    Binder.restoreCallingIdentity(ident);
+                }
+            }
+        }
+
+        @Override
+        public void writeActivitiesToProto(ProtoOutputStream proto) {
+            synchronized (mGlobalLock) {
+                // The output proto of "activity --proto activities"
+                // is ActivityManagerServiceDumpActivitiesProto
+                mStackSupervisor.writeToProto(proto,
+                        ActivityManagerServiceDumpActivitiesProto.ACTIVITY_STACK_SUPERVISOR);
+            }
+        }
+
+        @Override
+        public void saveANRState(String reason) {
+            synchronized (mGlobalLock) {
+                final StringWriter sw = new StringWriter();
+                final PrintWriter pw = new FastPrintWriter(sw, false, 1024);
+                pw.println("  ANR time: " + DateFormat.getDateTimeInstance().format(new Date()));
+                if (reason != null) {
+                    pw.println("  Reason: " + reason);
+                }
+                pw.println();
+                getActivityStartController().dump(pw, "  ", null);
+                pw.println();
+                pw.println("-------------------------------------------------------------------------------");
+                dumpActivitiesLocked(null /* fd */, pw, null /* args */, 0 /* opti */,
+                        true /* dumpAll */, false /* dumpClient */, null /* dumpPackage */,
+                        "" /* header */);
+                pw.println();
+                pw.close();
+
+                mLastANRState = sw.toString();
+            }
+        }
+
+        @Override
+        public void clearSavedANRState() {
+            synchronized (mGlobalLock) {
+                mLastANRState = null;
+            }
+        }
+
+        @Override
+        public void dump(String cmd, FileDescriptor fd, PrintWriter pw, String[] args, int opti,
+                boolean dumpAll, boolean dumpClient, String dumpPackage) {
+            synchronized (mGlobalLock) {
+                if (DUMP_ACTIVITIES_CMD.equals(cmd) || DUMP_ACTIVITIES_SHORT_CMD.equals(cmd)) {
+                    dumpActivitiesLocked(fd, pw, args, opti, dumpAll, dumpClient, dumpPackage);
+                } else if (DUMP_LASTANR_CMD.equals(cmd)) {
+                    dumpLastANRLocked(pw);
+                } else if (DUMP_LASTANR_TRACES_CMD.equals(cmd)) {
+                    dumpLastANRTracesLocked(pw);
+                } else if (DUMP_STARTER_CMD.equals(cmd)) {
+                    dumpActivityStarterLocked(pw, dumpPackage);
+                } else if (DUMP_CONTAINERS_CMD.equals(cmd)) {
+                    dumpActivityContainersLocked(pw);
+                } else if (DUMP_RECENTS_CMD.equals(cmd) || DUMP_RECENTS_SHORT_CMD.equals(cmd)) {
+                    if (getRecentTasks() != null) {
+                        getRecentTasks().dump(pw, dumpAll, dumpPackage);
+                    }
+                }
+            }
+        }
+
+        @Override
+        public boolean dumpForProcesses(FileDescriptor fd, PrintWriter pw, boolean dumpAll,
+                String dumpPackage, int dumpAppId, boolean needSep, boolean testPssMode,
+                int wakefulness) {
+            synchronized (mGlobalLock) {
+                if (mHomeProcess != null && (dumpPackage == null
+                        || mHomeProcess.mPkgList.contains(dumpPackage))) {
+                    if (needSep) {
+                        pw.println();
+                        needSep = false;
+                    }
+                    pw.println("  mHomeProcess: " + mHomeProcess);
+                }
+                if (mPreviousProcess != null && (dumpPackage == null
+                        || mPreviousProcess.mPkgList.contains(dumpPackage))) {
+                    if (needSep) {
+                        pw.println();
+                        needSep = false;
+                    }
+                    pw.println("  mPreviousProcess: " + mPreviousProcess);
+                }
+                if (dumpAll && (mPreviousProcess == null || dumpPackage == null
+                        || mPreviousProcess.mPkgList.contains(dumpPackage))) {
+                    StringBuilder sb = new StringBuilder(128);
+                    sb.append("  mPreviousProcessVisibleTime: ");
+                    TimeUtils.formatDuration(mPreviousProcessVisibleTime, sb);
+                    pw.println(sb);
+                }
+                if (mHeavyWeightProcess != null && (dumpPackage == null
+                        || mHeavyWeightProcess.mPkgList.contains(dumpPackage))) {
+                    if (needSep) {
+                        pw.println();
+                        needSep = false;
+                    }
+                    pw.println("  mHeavyWeightProcess: " + mHeavyWeightProcess);
+                }
+                if (dumpPackage == null) {
+                    pw.println("  mGlobalConfiguration: " + getGlobalConfiguration());
+                    mStackSupervisor.dumpDisplayConfigs(pw, "  ");
+                }
+                if (dumpAll) {
+                    if (dumpPackage == null) {
+                        pw.println("  mConfigWillChange: "
+                                + getTopDisplayFocusedStack().mConfigWillChange);
+                    }
+                    if (mCompatModePackages.getPackages().size() > 0) {
+                        boolean printed = false;
+                        for (Map.Entry<String, Integer> entry
+                                : mCompatModePackages.getPackages().entrySet()) {
+                            String pkg = entry.getKey();
+                            int mode = entry.getValue();
+                            if (dumpPackage != null && !dumpPackage.equals(pkg)) {
+                                continue;
+                            }
+                            if (!printed) {
+                                pw.println("  mScreenCompatPackages:");
+                                printed = true;
+                            }
+                            pw.println("    " + pkg + ": " + mode);
+                        }
+                    }
+                }
+
+                if (dumpPackage == null) {
+                    pw.println("  mWakefulness="
+                            + PowerManagerInternal.wakefulnessToString(wakefulness));
+                    pw.println("  mSleepTokens=" + mStackSupervisor.mSleepTokens);
+                    if (mRunningVoice != null) {
+                        pw.println("  mRunningVoice=" + mRunningVoice);
+                        pw.println("  mVoiceWakeLock" + mVoiceWakeLock);
+                    }
+                    pw.println("  mSleeping=" + mSleeping);
+                    pw.println("  mShuttingDown=" + mShuttingDown + " mTestPssMode=" + testPssMode);
+                    pw.println("  mVrController=" + mVrController);
+                }
+                if (mCurAppTimeTracker != null) {
+                    mCurAppTimeTracker.dumpWithHeader(pw, "  ", true);
+                }
+                if (mAllowAppSwitchUids.size() > 0) {
+                    boolean printed = false;
+                    for (int i = 0; i < mAllowAppSwitchUids.size(); i++) {
+                        ArrayMap<String, Integer> types = mAllowAppSwitchUids.valueAt(i);
+                        for (int j = 0; j < types.size(); j++) {
+                            if (dumpPackage == null ||
+                                    UserHandle.getAppId(types.valueAt(j).intValue()) == dumpAppId) {
+                                if (needSep) {
+                                    pw.println();
+                                    needSep = false;
+                                }
+                                if (!printed) {
+                                    pw.println("  mAllowAppSwitchUids:");
+                                    printed = true;
+                                }
+                                pw.print("    User ");
+                                pw.print(mAllowAppSwitchUids.keyAt(i));
+                                pw.print(": Type ");
+                                pw.print(types.keyAt(j));
+                                pw.print(" = ");
+                                UserHandle.formatUid(pw, types.valueAt(j).intValue());
+                                pw.println();
+                            }
+                        }
+                    }
+                }
+                if (dumpPackage == null) {
+                    if (mController != null) {
+                        pw.println("  mController=" + mController
+                                + " mControllerIsAMonkey=" + mControllerIsAMonkey);
+                    }
+                    pw.println("  mGoingToSleep=" + mStackSupervisor.mGoingToSleep);
+                    pw.println("  mLaunchingActivity=" + mStackSupervisor.mLaunchingActivity);
+                }
+
+                return needSep;
+            }
+        }
+
+        @Override
+        public void writeProcessesToProto(ProtoOutputStream proto, String dumpPackage) {
+            synchronized (mGlobalLock) {
+                if (dumpPackage == null) {
+                    getGlobalConfiguration().writeToProto(proto, GLOBAL_CONFIGURATION);
+                    proto.write(CONFIG_WILL_CHANGE, getTopDisplayFocusedStack().mConfigWillChange);
+                    writeSleepStateToProto(proto);
+                    if (mController != null) {
+                        final long token = proto.start(CONTROLLER);
+                        proto.write(CONTROLLER, mController.toString());
+                        proto.write(IS_A_MONKEY, mControllerIsAMonkey);
+                        proto.end(token);
+                    }
+                    mStackSupervisor.mGoingToSleep.writeToProto(proto, GOING_TO_SLEEP);
+                    mStackSupervisor.mLaunchingActivity.writeToProto(proto, LAUNCHING_ACTIVITY);
+                }
+
+                if (mHomeProcess != null && (dumpPackage == null
+                        || mHomeProcess.mPkgList.contains(dumpPackage))) {
+                    mHomeProcess.writeToProto(proto, HOME_PROC);
+                }
+
+                if (mPreviousProcess != null && (dumpPackage == null
+                        || mPreviousProcess.mPkgList.contains(dumpPackage))) {
+                    mPreviousProcess.writeToProto(proto, PREVIOUS_PROC);
+                    proto.write(PREVIOUS_PROC_VISIBLE_TIME_MS, mPreviousProcessVisibleTime);
+                }
+
+                if (mHeavyWeightProcess != null && (dumpPackage == null
+                        || mHeavyWeightProcess.mPkgList.contains(dumpPackage))) {
+                    mHeavyWeightProcess.writeToProto(proto, HEAVY_WEIGHT_PROC);
+                }
+
+                for (Map.Entry<String, Integer> entry
+                        : mCompatModePackages.getPackages().entrySet()) {
+                    String pkg = entry.getKey();
+                    int mode = entry.getValue();
+                    if (dumpPackage == null || dumpPackage.equals(pkg)) {
+                        long compatToken = proto.start(SCREEN_COMPAT_PACKAGES);
+                        proto.write(PACKAGE, pkg);
+                        proto.write(MODE, mode);
+                        proto.end(compatToken);
+                    }
+                }
+
+                if (mCurAppTimeTracker != null) {
+                    mCurAppTimeTracker.writeToProto(proto, CURRENT_TRACKER, true);
+                }
+
+            }
+        }
+
+        @Override
+        public boolean dumpActivity(FileDescriptor fd, PrintWriter pw, String name,
+                String[] args, int opti, boolean dumpAll, boolean dumpVisibleStacksOnly,
+                boolean dumpFocusedStackOnly) {
+            synchronized (mGlobalLock) {
+                return ActivityTaskManagerService.this.dumpActivity(fd, pw, name, args, opti,
+                        dumpAll, dumpVisibleStacksOnly, dumpFocusedStackOnly);
+            }
+        }
+
+        @Override
+        public boolean canGcNow() {
+            synchronized (mGlobalLock) {
+                return isSleeping() || mStackSupervisor.allResumedActivitiesIdle();
+            }
+        }
+
+        @Override
+        public WindowProcessController getTopApp() {
+            synchronized (mGlobalLock) {
+                final ActivityRecord top = mStackSupervisor.getTopResumedActivity();
+                return top != null ? top.app : null;
+            }
+        }
+
+        @Override
+        public void rankTaskLayersIfNeeded() {
+            synchronized (mGlobalLock) {
+                if (mStackSupervisor != null) {
+                    mStackSupervisor.rankTaskLayersIfNeeded();
+                }
+            }
+        }
+
+        @Override
+        public void scheduleDestroyAllActivities(String reason) {
+            synchronized (mGlobalLock) {
+                mStackSupervisor.scheduleDestroyAllActivities(null, reason);
+            }
+        }
+
+        @Override
+        public void removeUser(int userId) {
+            synchronized (mGlobalLock) {
+                mStackSupervisor.removeUserLocked(userId);
+            }
+        }
+
+        @Override
+        public boolean switchUser(int userId, UserState userState) {
+            synchronized (mGlobalLock) {
+                return mStackSupervisor.switchUserLocked(userId, userState);
+            }
+        }
+
+        @Override
+        public void onHandleAppCrash(WindowProcessController wpc) {
+            synchronized (mGlobalLock) {
+                mStackSupervisor.handleAppCrashLocked(wpc);
+            }
+        }
+
+        @Override
+        public int finishTopCrashedActivities(WindowProcessController crashedApp, String reason) {
+            synchronized (mGlobalLock) {
+                return mStackSupervisor.finishTopCrashedActivitiesLocked(crashedApp, reason);
+            }
+        }
     }
 }
diff --git a/services/core/java/com/android/server/am/AppErrorDialog.java b/services/core/java/com/android/server/am/AppErrorDialog.java
index cde633d..a80a5b5 100644
--- a/services/core/java/com/android/server/am/AppErrorDialog.java
+++ b/services/core/java/com/android/server/am/AppErrorDialog.java
@@ -16,6 +16,8 @@
 
 package com.android.server.am;
 
+import static android.app.ActivityTaskManager.INVALID_TASK_ID;
+
 import android.content.BroadcastReceiver;
 import android.content.Context;
 import android.content.Intent;
@@ -63,7 +65,7 @@
         mService = service;
         mProc = data.proc;
         mResult = data.result;
-        mIsRestartable = (data.task != null || data.isRestartableForService)
+        mIsRestartable = (data.taskId != INVALID_TASK_ID || data.isRestartableForService)
                 && Settings.Global.getInt(context.getContentResolver(),
                 Settings.Global.SHOW_RESTART_IN_CRASH_DIALOG, 0) != 0;
         BidiFormatter bidi = BidiFormatter.getInstance();
@@ -209,7 +211,7 @@
 
     static class Data {
         AppErrorResult result;
-        TaskRecord task;
+        int taskId;
         boolean repeating;
         ProcessRecord proc;
         boolean isRestartableForService;
diff --git a/services/core/java/com/android/server/am/AppErrors.java b/services/core/java/com/android/server/am/AppErrors.java
index a05fbc6..e8ec057 100644
--- a/services/core/java/com/android/server/am/AppErrors.java
+++ b/services/core/java/com/android/server/am/AppErrors.java
@@ -16,12 +16,13 @@
 
 package com.android.server.am;
 
-import static com.android.server.Watchdog.NATIVE_STACKS_OF_INTEREST;
-import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_ANR;
+import static android.app.ActivityTaskManager.INVALID_TASK_ID;
 import static com.android.server.am.ActivityManagerDebugConfig.TAG_AM;
 import static com.android.server.am.ActivityManagerDebugConfig.TAG_WITH_CLASS_NAME;
 import static com.android.server.am.ActivityManagerService.MY_PID;
 import static com.android.server.am.ActivityManagerService.SYSTEM_DEBUGGABLE;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_FREE_RESIZE;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_NONE;
 
 import android.app.ActivityManager;
 import android.app.ActivityOptions;
@@ -46,21 +47,17 @@
 import android.util.EventLog;
 import android.util.Slog;
 import android.util.SparseArray;
-import android.util.StatsLog;
 import android.util.TimeUtils;
 import android.util.proto.ProtoOutputStream;
 
 import com.android.internal.app.ProcessMap;
 import com.android.internal.logging.MetricsLogger;
 import com.android.internal.logging.nano.MetricsProto;
-import com.android.internal.os.ProcessCpuTracker;
 import com.android.server.RescueParty;
 import com.android.server.Watchdog;
 
-import java.io.File;
 import java.io.FileDescriptor;
 import java.io.PrintWriter;
-import java.util.ArrayList;
 import java.util.Collections;
 import java.util.Set;
 
@@ -124,7 +121,7 @@
                 proto.write(AppErrorsProto.ProcessCrashTime.PROCESS_NAME, pname);
                 for (int i = 0; i < uidCount; i++) {
                     final int puid = uids.keyAt(i);
-                    final ProcessRecord r = mService.mProcessNames.get(pname, puid);
+                    final ProcessRecord r = mService.getProcessNames().get(pname, puid);
                     if (dumpPackage != null && (r == null || !r.pkgList.containsKey(dumpPackage))) {
                         continue;
                     }
@@ -151,7 +148,7 @@
                 proto.write(AppErrorsProto.BadProcess.PROCESS_NAME, pname);
                 for (int i = 0; i < uidCount; i++) {
                     final int puid = uids.keyAt(i);
-                    final ProcessRecord r = mService.mProcessNames.get(pname, puid);
+                    final ProcessRecord r = mService.getProcessNames().get(pname, puid);
                     if (dumpPackage != null && (r == null
                             || !r.pkgList.containsKey(dumpPackage))) {
                         continue;
@@ -184,7 +181,7 @@
                 final int uidCount = uids.size();
                 for (int i = 0; i < uidCount; i++) {
                     final int puid = uids.keyAt(i);
-                    final ProcessRecord r = mService.mProcessNames.get(pname, puid);
+                    final ProcessRecord r = mService.getProcessNames().get(pname, puid);
                     if (dumpPackage != null && (r == null
                             || !r.pkgList.containsKey(dumpPackage))) {
                         continue;
@@ -214,7 +211,7 @@
                 final int uidCount = uids.size();
                 for (int i = 0; i < uidCount; i++) {
                     final int puid = uids.keyAt(i);
-                    final ProcessRecord r = mService.mProcessNames.get(pname, puid);
+                    final ProcessRecord r = mService.getProcessNames().get(pname, puid);
                     if (dumpPackage != null && (r == null
                             || !r.pkgList.containsKey(dumpPackage))) {
                         continue;
@@ -411,11 +408,10 @@
         }
 
         final int relaunchReason = r != null
-                ? r.getWindowProcessController().computeRelaunchReason()
-                : ActivityRecord.RELAUNCH_REASON_NONE;
+                ? r.getWindowProcessController().computeRelaunchReason() : RELAUNCH_REASON_NONE;
 
         AppErrorResult result = new AppErrorResult();
-        TaskRecord task;
+        int taskId;
         synchronized (mService) {
             /**
              * If crash is handled by instance of {@link android.app.IActivityController},
@@ -428,7 +424,7 @@
 
             // Suppress crash dialog if the process is being relaunched due to a crash during a free
             // resize.
-            if (relaunchReason == ActivityRecord.RELAUNCH_REASON_FREE_RESIZE) {
+            if (relaunchReason == RELAUNCH_REASON_FREE_RESIZE) {
                 return;
             }
 
@@ -458,7 +454,7 @@
             final Message msg = Message.obtain();
             msg.what = ActivityManagerService.SHOW_ERROR_UI_MSG;
 
-            task = data.task;
+            taskId = data.taskId;
             msg.obj = data;
             mService.mUiHandler.sendMessage(msg);
         }
@@ -475,25 +471,15 @@
                 stopReportingCrashesLocked(r);
             }
             if (res == AppErrorDialog.RESTART) {
-                mService.removeProcessLocked(r, false, true, "crash");
-                if (task != null) {
+                mService.mProcessList.removeProcessLocked(r, false, true, "crash");
+                if (taskId != INVALID_TASK_ID) {
                     try {
-                        mService.mActivityTaskManager.startActivityFromRecents(task.taskId,
+                        mService.mActivityTaskManager.startActivityFromRecents(taskId,
                                 ActivityOptions.makeBasic().toBundle());
                     } catch (IllegalArgumentException e) {
-                        // Hmm, that didn't work, app might have crashed before creating a
-                        // recents entry. Let's see if we have a safe-to-restart intent.
-                        final Set<String> cats = task.intent != null
-                                ? task.intent.getCategories() : null;
-                        if (cats != null && cats.contains(Intent.CATEGORY_LAUNCHER)) {
-                            mService.mActivityTaskManager.getActivityStartController().startActivityInPackage(
-                                    task.mCallingUid, callingPid, callingUid, task.mCallingPackage,
-                                    task.intent, null, null, null, 0, 0,
-                                    new SafeActivityOptions(ActivityOptions.makeBasic()),
-                                    task.userId, null,
-                                    "AppErrors", false /*validateIncomingUser*/,
-                                    null /* originatingPendingIntent */);
-                        }
+                        // Hmm...that didn't work. Task should either be in recents or associated
+                        // with a stack.
+                        Slog.e(TAG, "Could not restart taskId=" + taskId, e);
                     }
                 }
             }
@@ -501,10 +487,10 @@
                 long orig = Binder.clearCallingIdentity();
                 try {
                     // Kill it with fire!
-                    mService.mStackSupervisor.handleAppCrashLocked(r.getWindowProcessController());
+                    mService.mAtmInternal.onHandleAppCrash(r.getWindowProcessController());
                     if (!r.isPersistent()) {
-                        mService.removeProcessLocked(r, false, false, "crash");
-                        mService.mStackSupervisor.resumeFocusedStacksTopActivitiesLocked();
+                        mService.mProcessList.removeProcessLocked(r, false, false, "crash");
+                        mService.mAtmInternal.resumeTopActivities(false /* scheduleIdle */);
                     }
                 } finally {
                     Binder.restoreCallingIdentity(orig);
@@ -565,7 +551,7 @@
                     } else {
                         // Huh.
                         Process.killProcess(pid);
-                        ActivityManagerService.killProcessGroup(uid, pid);
+                        ProcessList.killProcessGroup(uid, pid);
                     }
                 }
                 return true;
@@ -582,27 +568,12 @@
         app.setCrashing(true);
         app.crashingReport = generateProcessError(app,
                 ActivityManager.ProcessErrorStateInfo.CRASHED, null, shortMsg, longMsg, stackTrace);
-        startAppProblemLocked(app);
+        app.startAppProblemLocked();
         app.getWindowProcessController().stopFreezingActivities();
         return handleAppCrashLocked(app, "force-crash" /*reason*/, shortMsg, longMsg, stackTrace,
                 data);
     }
 
-    void startAppProblemLocked(ProcessRecord app) {
-        // If this app is not running under the current user, then we
-        // can't give it a report button because that would require
-        // launching the report UI under a different user.
-        app.errorReportReceiver = null;
-
-        for (int userId : mService.mUserController.getCurrentProfileIds()) {
-            if (app.userId == userId) {
-                app.errorReportReceiver = ApplicationErrorReport.getErrorReportReceiver(
-                        mContext, app.info.packageName, app.info.flags);
-            }
-        }
-        mService.skipCurrentReceiverLocked(app);
-    }
-
     /**
      * Generate a process error record, suitable for attachment to a ProcessRecord.
      *
@@ -616,7 +587,7 @@
      *
      * @return Returns a fully-formed ProcessErrorStateInfo record.
      */
-    private ActivityManager.ProcessErrorStateInfo generateProcessError(ProcessRecord app,
+    ActivityManager.ProcessErrorStateInfo generateProcessError(ProcessRecord app,
             int condition, String activity, String shortMsg, String longMsg, String stackTrace) {
         ActivityManager.ProcessErrorStateInfo report = new ActivityManager.ProcessErrorStateInfo();
 
@@ -723,7 +694,7 @@
                     + " has crashed too many times: killing!");
             EventLog.writeEvent(EventLogTags.AM_PROCESS_CRASHED_TOO_MUCH,
                     app.userId, app.info.processName, app.uid);
-            mService.mStackSupervisor.handleAppCrashLocked(app.getWindowProcessController());
+            mService.mAtmInternal.onHandleAppCrash(app.getWindowProcessController());
             if (!app.isPersistent()) {
                 // We don't want to start this process again until the user
                 // explicitly does so...  but for persistent process, we really
@@ -743,18 +714,18 @@
                 // Don't let services in this process be restarted and potentially
                 // annoy the user repeatedly.  Unless it is persistent, since those
                 // processes run critical code.
-                mService.removeProcessLocked(app, false, tryAgain, "crash");
-                mService.mStackSupervisor.resumeFocusedStacksTopActivitiesLocked();
+                mService.mProcessList.removeProcessLocked(app, false, tryAgain, "crash");
+                mService.mAtmInternal.resumeTopActivities(false /* scheduleIdle */);
                 if (!showBackground) {
                     return false;
                 }
             }
-            mService.mStackSupervisor.resumeFocusedStacksTopActivitiesLocked();
+            mService.mAtmInternal.resumeTopActivities(false /* scheduleIdle */);
         } else {
-            final TaskRecord affectedTask =
-                    mService.mStackSupervisor.finishTopCrashedActivitiesLocked(app.getWindowProcessController(), reason);
+            final int affectedTaskId = mService.mAtmInternal.finishTopCrashedActivities(
+                            app.getWindowProcessController(), reason);
             if (data != null) {
-                data.task = affectedTask;
+                data.taskId = affectedTaskId;
             }
             if (data != null && crashTimePersistent != null
                     && now < crashTimePersistent + ProcessList.MIN_CRASH_INTERVAL) {
@@ -854,259 +825,13 @@
         }
     }
 
-    void stopReportingCrashesLocked(ProcessRecord proc) {
+    private void stopReportingCrashesLocked(ProcessRecord proc) {
         if (mAppsNotReportingCrashes == null) {
             mAppsNotReportingCrashes = new ArraySet<>();
         }
         mAppsNotReportingCrashes.add(proc.info.packageName);
     }
 
-    static boolean isInterestingForBackgroundTraces(ProcessRecord app) {
-        // The system_server is always considered interesting.
-        if (app.pid == MY_PID) {
-            return true;
-        }
-
-        // A package is considered interesting if any of the following is true :
-        //
-        // - It's displaying an activity.
-        // - It's the SystemUI.
-        // - It has an overlay or a top UI visible.
-        //
-        // NOTE: The check whether a given ProcessRecord belongs to the systemui
-        // process is a bit of a kludge, but the same pattern seems repeated at
-        // several places in the system server.
-        return app.isInterestingToUserLocked() ||
-            (app.info != null && "com.android.systemui".equals(app.info.packageName)) ||
-            (app.hasTopUi() || app.hasOverlayUi());
-    }
-
-    final void appNotResponding(ProcessRecord app, ActivityRecord activity,
-            ActivityRecord parent, boolean aboveSystem, final String annotation) {
-        ArrayList<Integer> firstPids = new ArrayList<Integer>(5);
-        SparseArray<Boolean> lastPids = new SparseArray<Boolean>(20);
-
-        if (mService.mActivityTaskManager.mController != null) {
-            try {
-                // 0 == continue, -1 = kill process immediately
-                int res = mService.mActivityTaskManager.mController.appEarlyNotResponding(
-                        app.processName, app.pid, annotation);
-                if (res < 0 && app.pid != MY_PID) {
-                    app.kill("anr", true);
-                }
-            } catch (RemoteException e) {
-                mService.mActivityTaskManager.mController = null;
-                Watchdog.getInstance().setActivityController(null);
-            }
-        }
-
-        long anrTime = SystemClock.uptimeMillis();
-        if (ActivityManagerService.MONITOR_CPU_USAGE) {
-            mService.updateCpuStatsNow();
-        }
-
-        // Unless configured otherwise, swallow ANRs in background processes & kill the process.
-        boolean showBackground = Settings.Secure.getInt(mContext.getContentResolver(),
-                Settings.Secure.ANR_SHOW_BACKGROUND, 0) != 0;
-
-        boolean isSilentANR;
-
-        synchronized (mService) {
-            // PowerManager.reboot() can block for a long time, so ignore ANRs while shutting down.
-            if (mService.mActivityTaskManager.mShuttingDown) {
-                Slog.i(TAG, "During shutdown skipping ANR: " + app + " " + annotation);
-                return;
-            } else if (app.isNotResponding()) {
-                Slog.i(TAG, "Skipping duplicate ANR: " + app + " " + annotation);
-                return;
-            } else if (app.isCrashing()) {
-                Slog.i(TAG, "Crashing app skipping ANR: " + app + " " + annotation);
-                return;
-            } else if (app.killedByAm) {
-                Slog.i(TAG, "App already killed by AM skipping ANR: " + app + " " + annotation);
-                return;
-            } else if (app.killed) {
-                Slog.i(TAG, "Skipping died app ANR: " + app + " " + annotation);
-                return;
-            }
-
-            // In case we come through here for the same app before completing
-            // this one, mark as anring now so we will bail out.
-            app.setNotResponding(true);
-
-            // Log the ANR to the event log.
-            EventLog.writeEvent(EventLogTags.AM_ANR, app.userId, app.pid,
-                    app.processName, app.info.flags, annotation);
-
-            // Dump thread traces as quickly as we can, starting with "interesting" processes.
-            firstPids.add(app.pid);
-
-            // Don't dump other PIDs if it's a background ANR
-            isSilentANR = !showBackground && !isInterestingForBackgroundTraces(app);
-            if (!isSilentANR) {
-                int parentPid = app.pid;
-                if (parent != null && parent.app != null && parent.app.getPid() > 0) {
-                    parentPid = parent.app.getPid();
-                }
-                if (parentPid != app.pid) firstPids.add(parentPid);
-
-                if (MY_PID != app.pid && MY_PID != parentPid) firstPids.add(MY_PID);
-
-                for (int i = mService.mLruProcesses.size() - 1; i >= 0; i--) {
-                    ProcessRecord r = mService.mLruProcesses.get(i);
-                    if (r != null && r.thread != null) {
-                        int pid = r.pid;
-                        if (pid > 0 && pid != app.pid && pid != parentPid && pid != MY_PID) {
-                            if (r.isPersistent()) {
-                                firstPids.add(pid);
-                                if (DEBUG_ANR) Slog.i(TAG, "Adding persistent proc: " + r);
-                            } else if (r.treatLikeActivity) {
-                                firstPids.add(pid);
-                                if (DEBUG_ANR) Slog.i(TAG, "Adding likely IME: " + r);
-                            } else {
-                                lastPids.put(pid, Boolean.TRUE);
-                                if (DEBUG_ANR) Slog.i(TAG, "Adding ANR proc: " + r);
-                            }
-                        }
-                    }
-                }
-            }
-        }
-
-        // Log the ANR to the main log.
-        StringBuilder info = new StringBuilder();
-        info.setLength(0);
-        info.append("ANR in ").append(app.processName);
-        if (activity != null && activity.shortComponentName != null) {
-            info.append(" (").append(activity.shortComponentName).append(")");
-        }
-        info.append("\n");
-        info.append("PID: ").append(app.pid).append("\n");
-        if (annotation != null) {
-            info.append("Reason: ").append(annotation).append("\n");
-        }
-        if (parent != null && parent != activity) {
-            info.append("Parent: ").append(parent.shortComponentName).append("\n");
-        }
-
-        ProcessCpuTracker processCpuTracker = new ProcessCpuTracker(true);
-
-        // don't dump native PIDs for background ANRs unless it is the process of interest
-        String[] nativeProcs = null;
-        if (isSilentANR) {
-            for (int i = 0; i < NATIVE_STACKS_OF_INTEREST.length; i++) {
-                if (NATIVE_STACKS_OF_INTEREST[i].equals(app.processName)) {
-                    nativeProcs = new String[] { app.processName };
-                    break;
-                }
-            }
-        } else {
-            nativeProcs = NATIVE_STACKS_OF_INTEREST;
-        }
-
-        int[] pids = nativeProcs == null ? null : Process.getPidsForCommands(nativeProcs);
-        ArrayList<Integer> nativePids = null;
-
-        if (pids != null) {
-            nativePids = new ArrayList<Integer>(pids.length);
-            for (int i : pids) {
-                nativePids.add(i);
-            }
-        }
-
-        // For background ANRs, don't pass the ProcessCpuTracker to
-        // avoid spending 1/2 second collecting stats to rank lastPids.
-        File tracesFile = ActivityManagerService.dumpStackTraces(
-                firstPids,
-                (isSilentANR) ? null : processCpuTracker,
-                (isSilentANR) ? null : lastPids,
-                nativePids);
-
-        String cpuInfo = null;
-        if (ActivityManagerService.MONITOR_CPU_USAGE) {
-            mService.updateCpuStatsNow();
-            synchronized (mService.mProcessCpuTracker) {
-                cpuInfo = mService.mProcessCpuTracker.printCurrentState(anrTime);
-            }
-            info.append(processCpuTracker.printCurrentLoad());
-            info.append(cpuInfo);
-        }
-
-        info.append(processCpuTracker.printCurrentState(anrTime));
-
-        Slog.e(TAG, info.toString());
-        if (tracesFile == null) {
-            // There is no trace file, so dump (only) the alleged culprit's threads to the log
-            Process.sendSignal(app.pid, Process.SIGNAL_QUIT);
-        }
-
-        StatsLog.write(StatsLog.ANR_OCCURRED, app.uid, app.processName,
-                activity == null ? "unknown": activity.shortComponentName, annotation,
-                (app.info != null) ? (app.info.isInstantApp()
-                        ? StatsLog.ANROCCURRED__IS_INSTANT_APP__TRUE
-                        : StatsLog.ANROCCURRED__IS_INSTANT_APP__FALSE)
-                        : StatsLog.ANROCCURRED__IS_INSTANT_APP__UNAVAILABLE,
-                app != null ? (app.isInterestingToUserLocked()
-                        ? StatsLog.ANROCCURRED__FOREGROUND_STATE__FOREGROUND
-                        : StatsLog.ANROCCURRED__FOREGROUND_STATE__BACKGROUND)
-                        : StatsLog.ANROCCURRED__FOREGROUND_STATE__UNKNOWN);
-        mService.addErrorToDropBox("anr", app, app.processName, activity, parent, annotation,
-                cpuInfo, tracesFile, null);
-
-        if (mService.mActivityTaskManager.mController != null) {
-            try {
-                // 0 == show dialog, 1 = keep waiting, -1 = kill process immediately
-                int res = mService.mActivityTaskManager.mController.appNotResponding(
-                        app.processName, app.pid, info.toString());
-                if (res != 0) {
-                    if (res < 0 && app.pid != MY_PID) {
-                        app.kill("anr", true);
-                    } else {
-                        synchronized (mService) {
-                            mService.mServices.scheduleServiceTimeoutLocked(app);
-                        }
-                    }
-                    return;
-                }
-            } catch (RemoteException e) {
-                mService.mActivityTaskManager.mController = null;
-                Watchdog.getInstance().setActivityController(null);
-            }
-        }
-
-        synchronized (mService) {
-            mService.mBatteryStatsService.noteProcessAnr(app.processName, app.uid);
-
-            if (isSilentANR) {
-                app.kill("bg anr", true);
-                return;
-            }
-
-            // Set the app's notResponding state, and look up the errorReportReceiver
-            makeAppNotRespondingLocked(app,
-                    activity != null ? activity.shortComponentName : null,
-                    annotation != null ? "ANR " + annotation : "ANR",
-                    info.toString());
-
-            // Bring up the infamous App Not Responding dialog
-            Message msg = Message.obtain();
-            msg.what = ActivityManagerService.SHOW_NOT_RESPONDING_UI_MSG;
-            msg.obj = new AppNotRespondingDialog.Data(app, activity, aboveSystem);
-
-            mService.mUiHandler.sendMessage(msg);
-        }
-    }
-
-    private void makeAppNotRespondingLocked(ProcessRecord app,
-            String activity, String shortMsg, String longMsg) {
-        app.setNotResponding(true);
-        app.notRespondingReport = generateProcessError(app,
-                ActivityManager.ProcessErrorStateInfo.NOT_RESPONDING,
-                activity, shortMsg, longMsg, null);
-        startAppProblemLocked(app);
-        app.getWindowProcessController().stopFreezingActivities();
-    }
-
     void handleShowAnrUi(Message msg) {
         Dialog dialogToShow = null;
         synchronized (mService) {
diff --git a/services/core/java/com/android/server/am/AppNotRespondingDialog.java b/services/core/java/com/android/server/am/AppNotRespondingDialog.java
index 7c983ff..cb76e2f 100644
--- a/services/core/java/com/android/server/am/AppNotRespondingDialog.java
+++ b/services/core/java/com/android/server/am/AppNotRespondingDialog.java
@@ -16,6 +16,7 @@
 
 package com.android.server.am;
 
+import android.content.pm.ApplicationInfo;
 import com.android.internal.logging.MetricsLogger;
 import com.android.internal.logging.nano.MetricsProto;
 
@@ -58,8 +59,8 @@
         setCancelable(false);
 
         int resid;
-        CharSequence name1 = data.activity != null
-                ? data.activity.info.loadLabel(context.getPackageManager())
+        CharSequence name1 = data.aInfo != null
+                ? data.aInfo.loadLabel(context.getPackageManager())
                 : null;
         CharSequence name2 = null;
         if ((mProc.pkgList.size() == 1) &&
@@ -181,12 +182,12 @@
 
     static class Data {
         final ProcessRecord proc;
-        final ActivityRecord activity;
+        final ApplicationInfo aInfo;
         final boolean aboveSystem;
 
-        Data(ProcessRecord proc, ActivityRecord activity, boolean aboveSystem) {
+        Data(ProcessRecord proc, ApplicationInfo aInfo, boolean aboveSystem) {
             this.proc = proc;
-            this.activity = activity;
+            this.aInfo = aInfo;
             this.aboveSystem = aboveSystem;
         }
     }
diff --git a/services/core/java/com/android/server/am/BroadcastQueue.java b/services/core/java/com/android/server/am/BroadcastQueue.java
index e2035f6..a0977be 100644
--- a/services/core/java/com/android/server/am/BroadcastQueue.java
+++ b/services/core/java/com/android/server/am/BroadcastQueue.java
@@ -191,7 +191,7 @@
 
         @Override
         public void run() {
-            mService.mAppErrors.appNotResponding(mApp, null, null, false, mAnnotation);
+            mApp.appNotResponding(null, null, null, null, false, mAnnotation);
         }
     }
 
@@ -286,7 +286,7 @@
         r.curApp = app;
         app.curReceivers.add(r);
         app.forceProcessStateUpTo(ActivityManager.PROCESS_STATE_RECEIVER);
-        mService.updateLruProcessLocked(app, false, null);
+        mService.mProcessList.updateLruProcessLocked(app, false, null);
         if (!skipOomAdj) {
             mService.updateOomAdjLocked();
         }
@@ -892,7 +892,7 @@
                     isDead = proc == null || proc.isCrashing();
                 }
             } else {
-                final ProcessRecord proc = mService.mProcessNames.get(
+                final ProcessRecord proc = mService.mProcessList.mProcessNames.get(
                         mPendingBroadcast.curApp.processName, mPendingBroadcast.curApp.uid);
                 isDead = proc == null || !proc.pendingStart;
             }
diff --git a/services/core/java/com/android/server/am/CoreSettingsObserver.java b/services/core/java/com/android/server/am/CoreSettingsObserver.java
index 2ca1344..48e26ed 100644
--- a/services/core/java/com/android/server/am/CoreSettingsObserver.java
+++ b/services/core/java/com/android/server/am/CoreSettingsObserver.java
@@ -126,6 +126,7 @@
                 value = Settings.Global.getString(context.getContentResolver(), setting);
             }
             if (value == null) {
+                snapshot.remove(setting);
                 continue;
             }
             Class<?> type = entry.getValue();
diff --git a/services/core/java/com/android/server/am/LaunchParamsController.java b/services/core/java/com/android/server/am/LaunchParamsController.java
index 218d908..68e897f 100644
--- a/services/core/java/com/android/server/am/LaunchParamsController.java
+++ b/services/core/java/com/android/server/am/LaunchParamsController.java
@@ -17,6 +17,7 @@
 package com.android.server.am;
 
 import static android.app.WindowConfiguration.WINDOWING_MODE_UNDEFINED;
+import static android.view.Display.DEFAULT_DISPLAY;
 import static android.view.Display.INVALID_DISPLAY;
 
 import static com.android.server.am.LaunchParamsController.LaunchParamsModifier.RESULT_CONTINUE;
@@ -97,6 +98,15 @@
                     break;
             }
         }
+
+        if (activity != null && activity.requestedVrComponent != null) {
+            // Check if the Activity is a VR activity. If so, it should be launched in main display.
+            result.mPreferredDisplayId = DEFAULT_DISPLAY;
+        } else if (mService.mVr2dDisplayId != INVALID_DISPLAY) {
+            // Get the virtual display ID from ActivityTaskManagerService. If that's set we
+            // should always use that.
+            result.mPreferredDisplayId = mService.mVr2dDisplayId;
+        }
     }
 
     /**
diff --git a/services/core/java/com/android/server/am/MemoryStatUtil.java b/services/core/java/com/android/server/am/MemoryStatUtil.java
index 98f3f95..85ee7e6 100644
--- a/services/core/java/com/android/server/am/MemoryStatUtil.java
+++ b/services/core/java/com/android/server/am/MemoryStatUtil.java
@@ -37,6 +37,38 @@
  * Static utility methods related to {@link MemoryStat}.
  */
 final class MemoryStatUtil {
+    /**
+     * Which native processes to create {@link MemoryStat} for.
+     *
+     * <p>Processes are matched by their cmdline in procfs. Example: cat /proc/pid/cmdline returns
+     * /system/bin/statsd for the stats daemon.
+     */
+    static final String[] MEMORY_STAT_INTERESTING_NATIVE_PROCESSES = new String[]{
+            "/system/bin/statsd",  // Stats daemon.
+            "/system/bin/surfaceflinger",
+            "/system/bin/apexd",  // APEX daemon.
+            "/system/bin/audioserver",
+            "/system/bin/cameraserver",
+            "/system/bin/drmserver",
+            "/system/bin/healthd",
+            "/system/bin/incidentd",
+            "/system/bin/installd",
+            "/system/bin/lmkd",  // Low memory killer daemon.
+            "/system/bin/logd",
+            "media.codec",
+            "media.extractor",
+            "media.metrics",
+            "/system/bin/mediadrmserver",
+            "/system/bin/mediaserver",
+            "/system/bin/performanced",
+            "/system/bin/tombstoned",
+            "/system/bin/traced",  // Perfetto.
+            "/system/bin/traced_probes",  // Perfetto.
+            "webview_zygote",
+            "zygote",
+            "zygote64",
+    };
+
     static final int BYTES_IN_KILOBYTE = 1024;
     static final int PAGE_SIZE = 4096;
 
@@ -57,6 +89,8 @@
     private static final String PROC_STAT_FILE_FMT = "/proc/%d/stat";
     /** Path to procfs status file for logging app memory state */
     private static final String PROC_STATUS_FILE_FMT = "/proc/%d/status";
+    /** Path to procfs cmdline file. Used with pid: /proc/pid/cmdline. */
+    private static final String PROC_CMDLINE_FILE_FMT = "/proc/%d/cmdline";
 
     private static final Pattern PGFAULT = Pattern.compile("total_pgfault (\\d+)");
     private static final Pattern PGMAJFAULT = Pattern.compile("total_pgmajfault (\\d+)");
@@ -119,6 +153,18 @@
         return stat;
     }
 
+    /**
+     * Reads cmdline of a process from procfs.
+     *
+     * Returns content of /proc/pid/cmdline (e.g. /system/bin/statsd) or an empty string
+     * if the file is not available.
+     */
+    static String readCmdlineFromProcfs(int pid) {
+        String path = String.format(Locale.US, PROC_CMDLINE_FILE_FMT, pid);
+        String cmdline = readFileContents(path);
+        return cmdline != null ? cmdline : "";
+    }
+
     private static String readFileContents(String path) {
         final File file = new File(path);
         if (!file.exists()) {
diff --git a/services/core/java/com/android/server/am/PendingIntentRecord.java b/services/core/java/com/android/server/am/PendingIntentRecord.java
index b9c6fa6..2dcddff 100644
--- a/services/core/java/com/android/server/am/PendingIntentRecord.java
+++ b/services/core/java/com/android/server/am/PendingIntentRecord.java
@@ -288,12 +288,19 @@
                 resolvedType = key.requestResolvedType;
             }
 
+            // Apply any launch flags from the ActivityOptions. This is to ensure that the caller
+            // can specify a consistent launch mode even if the PendingIntent is immutable
+            final ActivityOptions opts = ActivityOptions.fromBundle(options);
+            if (opts != null) {
+                finalIntent.addFlags(opts.getPendingIntentLaunchFlags());
+            }
+
             // Extract options before clearing calling identity
             mergedOptions = key.options;
             if (mergedOptions == null) {
-                mergedOptions = SafeActivityOptions.fromBundle(options);
+                mergedOptions = new SafeActivityOptions(opts);
             } else {
-                mergedOptions.setCallerOptions(ActivityOptions.fromBundle(options));
+                mergedOptions.setCallerOptions(opts);
             }
 
             if (whitelistDuration != null) {
diff --git a/services/core/java/com/android/server/am/ProcessList.java b/services/core/java/com/android/server/am/ProcessList.java
index 9e7ce32..3f172cc 100644
--- a/services/core/java/com/android/server/am/ProcessList.java
+++ b/services/core/java/com/android/server/am/ProcessList.java
@@ -16,19 +16,79 @@
 
 package com.android.server.am;
 
+import static android.app.ActivityManager.PROCESS_STATE_CACHED_ACTIVITY;
+import static android.app.ActivityThread.PROC_START_SEQ_IDENT;
+import static android.content.pm.PackageManager.MATCH_DEBUG_TRIAGED_MISSING;
+import static android.content.pm.PackageManager.MATCH_DIRECT_BOOT_AUTO;
+import static android.os.Process.FIRST_ISOLATED_UID;
+import static android.os.Process.LAST_ISOLATED_UID;
+import static android.os.Process.SYSTEM_UID;
+import static android.os.Process.THREAD_PRIORITY_BACKGROUND;
+import static android.os.Process.getFreeMemory;
+import static android.os.Process.getTotalMemory;
+import static android.os.Process.killProcessQuiet;
+import static android.os.Process.startWebView;
+
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_LRU;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PROCESSES;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_PSS;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_UID_OBSERVERS;
 import static com.android.server.am.ActivityManagerDebugConfig.TAG_AM;
 import static com.android.server.am.ActivityManagerDebugConfig.TAG_WITH_CLASS_NAME;
+import static com.android.server.am.ActivityManagerService.PERSISTENT_MASK;
+import static com.android.server.am.ActivityManagerService.PROC_START_TIMEOUT;
+import static com.android.server.am.ActivityManagerService.PROC_START_TIMEOUT_MSG;
+import static com.android.server.am.ActivityManagerService.PROC_START_TIMEOUT_WITH_WRAPPER;
+import static com.android.server.am.ActivityManagerService.STOCK_PM_FLAGS;
+import static com.android.server.am.ActivityManagerService.TAG_LRU;
+import static com.android.server.am.ActivityManagerService.TAG_PROCESSES;
+import static com.android.server.am.ActivityManagerService.TAG_PSS;
+import static com.android.server.am.ActivityManagerService.TAG_UID_OBSERVERS;
 
+import dalvik.system.VMRuntime;
+
+import java.io.File;
 import java.io.IOException;
 import java.io.OutputStream;
 import java.io.PrintWriter;
 import java.nio.ByteBuffer;
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.List;
 
 import android.app.ActivityManager;
+import android.app.AppGlobals;
 import android.app.AppProtoEnums;
+import android.app.IApplicationThread;
+import android.content.ComponentName;
+import android.content.Intent;
+import android.content.pm.ApplicationInfo;
+import android.content.pm.IPackageManager;
+import android.net.Uri;
+import android.os.Binder;
 import android.os.Build;
+import android.os.Bundle;
+import android.os.FactoryTest;
+import android.os.Handler;
+import android.os.IBinder;
+import android.os.Looper;
+import android.os.Message;
+import android.os.Process;
+import android.os.RemoteException;
+import android.os.StrictMode;
 import android.os.SystemClock;
+
+import com.android.internal.annotations.GuardedBy;
+import com.android.internal.annotations.VisibleForTesting;
+import com.android.internal.app.ProcessMap;
+import com.android.internal.app.procstats.ProcessStats;
+import com.android.internal.os.Zygote;
+import com.android.internal.util.ArrayUtils;
 import com.android.internal.util.MemInfoReader;
+import com.android.server.LocalServices;
+import com.android.server.ServiceThread;
+import com.android.server.Watchdog;
+import com.android.server.pm.dex.DexManager;
 import com.android.server.wm.WindowManagerService;
 
 import android.content.res.Resources;
@@ -36,7 +96,15 @@
 import android.os.SystemProperties;
 import android.net.LocalSocketAddress;
 import android.net.LocalSocket;
+import android.os.Trace;
+import android.os.UserHandle;
+import android.os.storage.StorageManagerInternal;
+import android.text.TextUtils;
+import android.util.EventLog;
+import android.util.LongSparseArray;
 import android.util.Slog;
+import android.util.SparseArray;
+import android.util.StatsLog;
 import android.view.Display;
 
 /**
@@ -47,7 +115,7 @@
 
     // The minimum time we allow between crashes, for us to consider this
     // application to be bad and stop and its services and reject broadcasts.
-    static final int MIN_CRASH_INTERVAL = 60*1000;
+    static final int MIN_CRASH_INTERVAL = 60 * 1000;
 
     // OOM adjustments for processes in various states:
 
@@ -129,7 +197,7 @@
     static final int NATIVE_ADJ = -1000;
 
     // Memory pages are 4K.
-    static final int PAGE_SIZE = 4*1024;
+    static final int PAGE_SIZE = 4 * 1024;
 
     // Activity manager's version of Process.THREAD_GROUP_BG_NONINTERACTIVE
     static final int SCHED_GROUP_BACKGROUND = 0;
@@ -148,7 +216,7 @@
     static final int MIN_CACHED_APPS = 2;
 
     // We allow empty processes to stick around for at most 30 minutes.
-    static final long MAX_EMPTY_TIME = 30*60*1000;
+    static final long MAX_EMPTY_TIME = 30 * 60 * 1000;
 
     // Threshold of number of cached+empty where we consider memory critical.
     static final int TRIM_CRITICAL_THRESHOLD = 3;
@@ -168,6 +236,12 @@
     static final byte LMK_PROCREMOVE = 2;
     static final byte LMK_PROCPURGE = 3;
 
+    ActivityManagerService mService = null;
+
+    // To kill process groups asynchronously
+    static KillHandler sKillHandler = null;
+    static ServiceThread sKillThread = null;
+
     // These are the various interesting memory levels that we will give to
     // the OOM killer.  Note that the OOM killer only supports 6 slots, so we
     // can't give it a different value for every possible kind of process.
@@ -199,6 +273,123 @@
     private static LocalSocket sLmkdSocket;
     private static OutputStream sLmkdOutputStream;
 
+    /**
+     * Temporary to avoid allocations.  Protected by main lock.
+     */
+    @GuardedBy("mService")
+    final StringBuilder mStringBuilder = new StringBuilder(256);
+
+    /**
+     * A global counter for generating sequence numbers.
+     * This value will be used when incrementing sequence numbers in individual uidRecords.
+     *
+     * Having a global counter ensures that seq numbers are monotonically increasing for a
+     * particular uid even when the uidRecord is re-created.
+     */
+    @GuardedBy("mService")
+    @VisibleForTesting
+    long mProcStateSeqCounter = 0;
+
+    /**
+     * A global counter for generating sequence numbers to uniquely identify pending process starts.
+     */
+    @GuardedBy("mService")
+    private long mProcStartSeqCounter = 0;
+
+    /**
+     * Contains {@link ProcessRecord} objects for pending process starts.
+     *
+     * Mapping: {@link #mProcStartSeqCounter} -> {@link ProcessRecord}
+     */
+    @GuardedBy("mService")
+    final LongSparseArray<ProcessRecord> mPendingStarts = new LongSparseArray<>();
+
+    /**
+     * List of running applications, sorted by recent usage.
+     * The first entry in the list is the least recently used.
+     */
+    final ArrayList<ProcessRecord> mLruProcesses = new ArrayList<ProcessRecord>();
+
+    /**
+     * Where in mLruProcesses that the processes hosting activities start.
+     */
+    int mLruProcessActivityStart = 0;
+
+    /**
+     * Where in mLruProcesses that the processes hosting services start.
+     * This is after (lower index) than mLruProcessesActivityStart.
+     */
+    int mLruProcessServiceStart = 0;
+
+    /**
+     * Current sequence id for process LRU updating.
+     */
+    int mLruSeq = 0;
+
+    /**
+     * The currently running isolated processes.
+     */
+    final SparseArray<ProcessRecord> mIsolatedProcesses = new SparseArray<>();
+
+    /**
+     * Counter for assigning isolated process uids, to avoid frequently reusing the
+     * same ones.
+     */
+    int mNextIsolatedProcessUid = 0;
+
+    /**
+     * Processes that are being forcibly torn down.
+     */
+    final ArrayList<ProcessRecord> mRemovedProcesses = new ArrayList<ProcessRecord>();
+
+    /**
+     * All of the applications we currently have running organized by name.
+     * The keys are strings of the application package name (as
+     * returned by the package manager), and the keys are ApplicationRecord
+     * objects.
+     */
+    final MyProcessMap mProcessNames = new MyProcessMap();
+
+    final class MyProcessMap extends ProcessMap<ProcessRecord> {
+        @Override
+        public ProcessRecord put(String name, int uid, ProcessRecord value) {
+            final ProcessRecord r = super.put(name, uid, value);
+            mService.mAtmInternal.onProcessAdded(r.getWindowProcessController());
+            return r;
+        }
+
+        @Override
+        public ProcessRecord remove(String name, int uid) {
+            final ProcessRecord r = super.remove(name, uid);
+            mService.mAtmInternal.onProcessRemoved(name, uid);
+            return r;
+        }
+    }
+
+    final class KillHandler extends Handler {
+        static final int KILL_PROCESS_GROUP_MSG = 4000;
+
+        public KillHandler(Looper looper) {
+            super(looper, null, true);
+        }
+
+        @Override
+        public void handleMessage(Message msg) {
+            switch (msg.what) {
+                case KILL_PROCESS_GROUP_MSG:
+                    Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "killProcessGroup");
+                    Process.killProcessGroup(msg.arg1 /* uid */, msg.arg2 /* pid */);
+                    Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
+                    break;
+
+                default:
+                    super.handleMessage(msg);
+            }
+        }
+    }
+
+    ////////////////////  END FIELDS  ////////////////////
+
     ProcessList() {
         MemInfoReader minfo = new MemInfoReader();
         minfo.readMemInfo();
@@ -206,6 +397,16 @@
         updateOomLevels(0, 0, false);
     }
 
+    void init(ActivityManagerService service) {
+        mService = service;
+        if (sKillHandler == null) {
+            sKillThread = new ServiceThread(TAG + ":kill",
+                    THREAD_PRIORITY_BACKGROUND, true /* allowIo */);
+            sKillThread.start();
+            sKillHandler = new KillHandler(sKillThread.getLooper());
+        }
+    }
+
     void applyDisplaySize(WindowManagerService wm) {
         if (!mHaveDisplaySize) {
             Point p = new Point();
@@ -221,12 +422,12 @@
     private void updateOomLevels(int displayWidth, int displayHeight, boolean write) {
         // Scale buckets from avail memory: at 300MB we use the lowest values to
         // 700MB or more for the top values.
-        float scaleMem = ((float)(mTotalMemMb-350))/(700-350);
+        float scaleMem = ((float) (mTotalMemMb - 350)) / (700 - 350);
 
         // Scale buckets from screen size.
-        int minSize = 480*800;  //  384000
-        int maxSize = 1280*800; // 1024000  230400 870400  .264
-        float scaleDisp = ((float)(displayWidth*displayHeight)-minSize)/(maxSize-minSize);
+        int minSize = 480 * 800;  //  384000
+        int maxSize = 1280 * 800; // 1024000  230400 870400  .264
+        float scaleDisp = ((float)(displayWidth * displayHeight) - minSize) / (maxSize - minSize);
         if (false) {
             Slog.i("XXXXXX", "scaleMem=" + scaleMem);
             Slog.i("XXXXXX", "scaleDisp=" + scaleDisp + " dw=" + displayWidth
@@ -246,27 +447,27 @@
 
         final boolean is64bit = Build.SUPPORTED_64_BIT_ABIS.length > 0;
 
-        for (int i=0; i<mOomAdj.length; i++) {
+        for (int i = 0; i < mOomAdj.length; i++) {
             int low = mOomMinFreeLow[i];
             int high = mOomMinFreeHigh[i];
             if (is64bit) {
                 // Increase the high min-free levels for cached processes for 64-bit
-                if (i == 4) high = (high*3)/2;
-                else if (i == 5) high = (high*7)/4;
+                if (i == 4) high = (high * 3) / 2;
+                else if (i == 5) high = (high * 7) / 4;
             }
-            mOomMinFree[i] = (int)(low + ((high-low)*scale));
+            mOomMinFree[i] = (int)(low + ((high - low) * scale));
         }
 
         if (minfree_abs >= 0) {
-            for (int i=0; i<mOomAdj.length; i++) {
+            for (int i = 0; i < mOomAdj.length; i++) {
                 mOomMinFree[i] = (int)((float)minfree_abs * mOomMinFree[i]
                         / mOomMinFree[mOomAdj.length - 1]);
             }
         }
 
         if (minfree_adj != 0) {
-            for (int i=0; i<mOomAdj.length; i++) {
-                mOomMinFree[i] += (int)((float)minfree_adj * mOomMinFree[i]
+            for (int i = 0; i < mOomAdj.length; i++) {
+                mOomMinFree[i] += (int)((float) minfree_adj * mOomMinFree[i]
                         / mOomMinFree[mOomAdj.length - 1]);
                 if (mOomMinFree[i] < 0) {
                     mOomMinFree[i] = 0;
@@ -277,13 +478,15 @@
         // The maximum size we will restore a process from cached to background, when under
         // memory duress, is 1/3 the size we have reserved for kernel caches and other overhead
         // before killing background processes.
-        mCachedRestoreLevel = (getMemLevel(ProcessList.CACHED_APP_MAX_ADJ)/1024) / 3;
+        mCachedRestoreLevel = (getMemLevel(ProcessList.CACHED_APP_MAX_ADJ) / 1024) / 3;
 
         // Ask the kernel to try to keep enough memory free to allocate 3 full
         // screen 32bpp buffers without entering direct reclaim.
         int reserve = displayWidth * displayHeight * 4 * 3 / 1024;
-        int reserve_adj = Resources.getSystem().getInteger(com.android.internal.R.integer.config_extraFreeKbytesAdjust);
-        int reserve_abs = Resources.getSystem().getInteger(com.android.internal.R.integer.config_extraFreeKbytesAbsolute);
+        int reserve_adj = Resources.getSystem().getInteger(
+                com.android.internal.R.integer.config_extraFreeKbytesAdjust);
+        int reserve_abs = Resources.getSystem().getInteger(
+                com.android.internal.R.integer.config_extraFreeKbytesAbsolute);
 
         if (reserve_abs >= 0) {
             reserve = reserve_abs;
@@ -297,10 +500,10 @@
         }
 
         if (write) {
-            ByteBuffer buf = ByteBuffer.allocate(4 * (2*mOomAdj.length + 1));
+            ByteBuffer buf = ByteBuffer.allocate(4 * (2 * mOomAdj.length + 1));
             buf.putInt(LMK_TARGET);
-            for (int i=0; i<mOomAdj.length; i++) {
-                buf.putInt((mOomMinFree[i]*1024)/PAGE_SIZE);
+            for (int i = 0; i < mOomAdj.length; i++) {
+                buf.putInt((mOomMinFree[i] * 1024)/PAGE_SIZE);
                 buf.putInt(mOomAdj[i]);
             }
 
@@ -320,7 +523,7 @@
             if (space == null) return prefix;
             return prefix + "  ";
         }
-        return prefix + "+" + Integer.toString(val-base);
+        return prefix + "+" + Integer.toString(val - base);
     }
 
     public static String makeOomAdjString(int setAdj) {
@@ -477,7 +680,7 @@
     }
 
     public static void appendRamKb(StringBuilder sb, long ramKb) {
-        for (int j=0, fact=10; j<6; j++, fact*=10) {
+        for (int j = 0, fact = 10; j < 6; j++, fact *= 10) {
             if (ramKb < fact) {
                 sb.append(' ');
             }
@@ -737,12 +940,12 @@
     }
 
     long getMemLevel(int adjustment) {
-        for (int i=0; i<mOomAdj.length; i++) {
+        for (int i = 0; i < mOomAdj.length; i++) {
             if (adjustment <= mOomAdj[i]) {
                 return mOomMinFree[i] * 1024;
             }
         }
-        return mOomMinFree[mOomAdj.length-1] * 1024;
+        return mOomMinFree[mOomAdj.length - 1] * 1024;
     }
 
     /**
@@ -858,4 +1061,1515 @@
             }
         }
     }
+
+    static void killProcessGroup(int uid, int pid) {
+        /* static; one-time init here */
+        if (sKillHandler != null) {
+            sKillHandler.sendMessage(
+                    sKillHandler.obtainMessage(KillHandler.KILL_PROCESS_GROUP_MSG, uid, pid));
+        } else {
+            Slog.w(TAG, "Asked to kill process group before system bringup!");
+            Process.killProcessGroup(uid, pid);
+        }
+    }
+
+    final ProcessRecord getProcessRecordLocked(String processName, int uid, boolean
+            keepIfLarge) {
+        if (uid == SYSTEM_UID) {
+            // The system gets to run in any process.  If there are multiple
+            // processes with the same uid, just pick the first (this
+            // should never happen).
+            SparseArray<ProcessRecord> procs = mProcessNames.getMap().get(processName);
+            if (procs == null) return null;
+            final int procCount = procs.size();
+            for (int i = 0; i < procCount; i++) {
+                final int procUid = procs.keyAt(i);
+                if (UserHandle.isApp(procUid) || !UserHandle.isSameUser(procUid, uid)) {
+                    // Don't use an app process or different user process for system component.
+                    continue;
+                }
+                return procs.valueAt(i);
+            }
+        }
+        ProcessRecord proc = mProcessNames.get(processName, uid);
+        if (false && proc != null && !keepIfLarge
+                && proc.setProcState >= ActivityManager.PROCESS_STATE_CACHED_EMPTY
+                && proc.lastCachedPss >= 4000) {
+            // Turn this condition on to cause killing to happen regularly, for testing.
+            if (proc.baseProcessTracker != null) {
+                proc.baseProcessTracker.reportCachedKill(proc.pkgList.mPkgList, proc.lastCachedPss);
+                for (int ipkg = proc.pkgList.size() - 1; ipkg >= 0; ipkg--) {
+                    ProcessStats.ProcessStateHolder holder = proc.pkgList.valueAt(ipkg);
+                    StatsLog.write(StatsLog.CACHED_KILL_REPORTED,
+                            proc.info.uid,
+                            holder.state.getName(),
+                            holder.state.getPackage(),
+                            proc.lastCachedPss, holder.appVersion);
+                }
+            }
+            proc.kill(Long.toString(proc.lastCachedPss) + "k from cached", true);
+        } else if (proc != null && !keepIfLarge
+                && mService.mLastMemoryLevel > ProcessStats.ADJ_MEM_FACTOR_NORMAL
+                && proc.setProcState >= ActivityManager.PROCESS_STATE_CACHED_EMPTY) {
+            if (DEBUG_PSS) Slog.d(TAG_PSS, "May not keep " + proc + ": pss=" + proc
+                    .lastCachedPss);
+            if (proc.lastCachedPss >= getCachedRestoreThresholdKb()) {
+                if (proc.baseProcessTracker != null) {
+                    proc.baseProcessTracker.reportCachedKill(proc.pkgList.mPkgList,
+                            proc.lastCachedPss);
+                    for (int ipkg = proc.pkgList.size() - 1; ipkg >= 0; ipkg--) {
+                        ProcessStats.ProcessStateHolder holder = proc.pkgList.valueAt(ipkg);
+                        StatsLog.write(StatsLog.CACHED_KILL_REPORTED,
+                                proc.info.uid,
+                                holder.state.getName(),
+                                holder.state.getPackage(),
+                                proc.lastCachedPss, holder.appVersion);
+                    }
+                }
+                proc.kill(Long.toString(proc.lastCachedPss) + "k from cached", true);
+            }
+        }
+        return proc;
+    }
+
+    void getMemoryInfo(ActivityManager.MemoryInfo outInfo) {
+        final long homeAppMem = getMemLevel(HOME_APP_ADJ);
+        final long cachedAppMem = getMemLevel(CACHED_APP_MIN_ADJ);
+        outInfo.availMem = getFreeMemory();
+        outInfo.totalMem = getTotalMemory();
+        outInfo.threshold = homeAppMem;
+        outInfo.lowMemory = outInfo.availMem < (homeAppMem + ((cachedAppMem-homeAppMem)/2));
+        outInfo.hiddenAppThreshold = cachedAppMem;
+        outInfo.secondaryServerThreshold = getMemLevel(SERVICE_ADJ);
+        outInfo.visibleAppThreshold = getMemLevel(VISIBLE_APP_ADJ);
+        outInfo.foregroundAppThreshold = getMemLevel(FOREGROUND_APP_ADJ);
+    }
+
+    ProcessRecord findAppProcessLocked(IBinder app, String reason) {
+        final int NP = mProcessNames.getMap().size();
+        for (int ip = 0; ip < NP; ip++) {
+            SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+            final int NA = apps.size();
+            for (int ia = 0; ia < NA; ia++) {
+                ProcessRecord p = apps.valueAt(ia);
+                if (p.thread != null && p.thread.asBinder() == app) {
+                    return p;
+                }
+            }
+        }
+
+        Slog.w(TAG, "Can't find mystery application for " + reason
+                + " from pid=" + Binder.getCallingPid()
+                + " uid=" + Binder.getCallingUid() + ": " + app);
+        return null;
+    }
+
+    private void checkSlow(long startTime, String where) {
+        long now = SystemClock.uptimeMillis();
+        if ((now - startTime) > 50) {
+            // If we are taking more than 50ms, log about it.
+            Slog.w(TAG, "Slow operation: " + (now - startTime) + "ms so far, now at " + where);
+        }
+    }
+
+    /**
+     * @return {@code true} if process start is successful, false otherwise.
+     * @param app
+     * @param hostingType
+     * @param hostingNameStr
+     * @param disableHiddenApiChecks
+     * @param abiOverride
+     */
+    @GuardedBy("mService")
+    boolean startProcessLocked(ProcessRecord app, String hostingType,
+            String hostingNameStr, boolean disableHiddenApiChecks, String abiOverride) {
+        if (app.pendingStart) {
+            return true;
+        }
+        long startTime = SystemClock.elapsedRealtime();
+        if (app.pid > 0 && app.pid != ActivityManagerService.MY_PID) {
+            checkSlow(startTime, "startProcess: removing from pids map");
+            synchronized (mService.mPidsSelfLocked) {
+                mService.mPidsSelfLocked.remove(app.pid);
+                mService.mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app);
+            }
+            checkSlow(startTime, "startProcess: done removing from pids map");
+            app.setPid(0);
+        }
+
+        if (DEBUG_PROCESSES && mService.mProcessesOnHold.contains(app)) Slog.v(
+                TAG_PROCESSES,
+                "startProcessLocked removing on hold: " + app);
+        mService.mProcessesOnHold.remove(app);
+
+        checkSlow(startTime, "startProcess: starting to update cpu stats");
+        mService.updateCpuStats();
+        checkSlow(startTime, "startProcess: done updating cpu stats");
+
+        try {
+            try {
+                final int userId = UserHandle.getUserId(app.uid);
+                AppGlobals.getPackageManager().checkPackageStartable(app.info.packageName, userId);
+            } catch (RemoteException e) {
+                throw e.rethrowAsRuntimeException();
+            }
+
+            int uid = app.uid;
+            int[] gids = null;
+            int mountExternal = Zygote.MOUNT_EXTERNAL_NONE;
+            if (!app.isolated) {
+                int[] permGids = null;
+                try {
+                    checkSlow(startTime, "startProcess: getting gids from package manager");
+                    final IPackageManager pm = AppGlobals.getPackageManager();
+                    permGids = pm.getPackageGids(app.info.packageName,
+                            MATCH_DIRECT_BOOT_AUTO, app.userId);
+                    StorageManagerInternal storageManagerInternal = LocalServices.getService(
+                            StorageManagerInternal.class);
+                    mountExternal = storageManagerInternal.getExternalStorageMountMode(uid,
+                            app.info.packageName);
+                } catch (RemoteException e) {
+                    throw e.rethrowAsRuntimeException();
+                }
+
+                /*
+                 * Add shared application and profile GIDs so applications can share some
+                 * resources like shared libraries and access user-wide resources
+                 */
+                if (ArrayUtils.isEmpty(permGids)) {
+                    gids = new int[3];
+                } else {
+                    gids = new int[permGids.length + 3];
+                    System.arraycopy(permGids, 0, gids, 3, permGids.length);
+                }
+                gids[0] = UserHandle.getSharedAppGid(UserHandle.getAppId(uid));
+                gids[1] = UserHandle.getCacheAppGid(UserHandle.getAppId(uid));
+                gids[2] = UserHandle.getUserGid(UserHandle.getUserId(uid));
+
+                // Replace any invalid GIDs
+                if (gids[0] == UserHandle.ERR_GID) gids[0] = gids[2];
+                if (gids[1] == UserHandle.ERR_GID) gids[1] = gids[2];
+            }
+            checkSlow(startTime, "startProcess: building args");
+            if (mService.mAtmInternal.isFactoryTestProcess(app.getWindowProcessController())) {
+                uid = 0;
+            }
+            int runtimeFlags = 0;
+            if ((app.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) != 0) {
+                runtimeFlags |= Zygote.DEBUG_ENABLE_JDWP;
+                runtimeFlags |= Zygote.DEBUG_JAVA_DEBUGGABLE;
+                // Also turn on CheckJNI for debuggable apps. It's quite
+                // awkward to turn on otherwise.
+                runtimeFlags |= Zygote.DEBUG_ENABLE_CHECKJNI;
+            }
+            // Run the app in safe mode if its manifest requests so or the
+            // system is booted in safe mode.
+            if ((app.info.flags & ApplicationInfo.FLAG_VM_SAFE_MODE) != 0 ||
+                    mService.mSafeMode == true) {
+                runtimeFlags |= Zygote.DEBUG_ENABLE_SAFEMODE;
+            }
+            if ("1".equals(SystemProperties.get("debug.checkjni"))) {
+                runtimeFlags |= Zygote.DEBUG_ENABLE_CHECKJNI;
+            }
+            String genDebugInfoProperty = SystemProperties.get("debug.generate-debug-info");
+            if ("1".equals(genDebugInfoProperty) || "true".equals(genDebugInfoProperty)) {
+                runtimeFlags |= Zygote.DEBUG_GENERATE_DEBUG_INFO;
+            }
+            String genMiniDebugInfoProperty = SystemProperties.get("dalvik.vm.minidebuginfo");
+            if ("1".equals(genMiniDebugInfoProperty) || "true".equals(genMiniDebugInfoProperty)) {
+                runtimeFlags |= Zygote.DEBUG_GENERATE_MINI_DEBUG_INFO;
+            }
+            if ("1".equals(SystemProperties.get("debug.jni.logging"))) {
+                runtimeFlags |= Zygote.DEBUG_ENABLE_JNI_LOGGING;
+            }
+            if ("1".equals(SystemProperties.get("debug.assert"))) {
+                runtimeFlags |= Zygote.DEBUG_ENABLE_ASSERT;
+            }
+            if (mService.mNativeDebuggingApp != null
+                    && mService.mNativeDebuggingApp.equals(app.processName)) {
+                // Enable all debug flags required by the native debugger.
+                runtimeFlags |= Zygote.DEBUG_ALWAYS_JIT;          // Don't interpret anything
+                runtimeFlags |= Zygote.DEBUG_GENERATE_DEBUG_INFO; // Generate debug info
+                runtimeFlags |= Zygote.DEBUG_NATIVE_DEBUGGABLE;   // Disbale optimizations
+                mService.mNativeDebuggingApp = null;
+            }
+
+            if (app.info.isPrivilegedApp() &&
+                    DexManager.isPackageSelectedToRunOob(app.pkgList.mPkgList.keySet())) {
+                runtimeFlags |= Zygote.ONLY_USE_SYSTEM_OAT_FILES;
+            }
+
+            if (!disableHiddenApiChecks && !mService.mHiddenApiBlacklist.isDisabled()) {
+                app.info.maybeUpdateHiddenApiEnforcementPolicy(
+                        mService.mHiddenApiBlacklist.getPolicyForPrePApps(),
+                        mService.mHiddenApiBlacklist.getPolicyForPApps());
+                @ApplicationInfo.HiddenApiEnforcementPolicy int policy =
+                        app.info.getHiddenApiEnforcementPolicy();
+                int policyBits = (policy << Zygote.API_ENFORCEMENT_POLICY_SHIFT);
+                if ((policyBits & Zygote.API_ENFORCEMENT_POLICY_MASK) != policyBits) {
+                    throw new IllegalStateException("Invalid API policy: " + policy);
+                }
+                runtimeFlags |= policyBits;
+            }
+
+            String invokeWith = null;
+            if ((app.info.flags & ApplicationInfo.FLAG_DEBUGGABLE) != 0) {
+                // Debuggable apps may include a wrapper script with their library directory.
+                String wrapperFileName = app.info.nativeLibraryDir + "/wrap.sh";
+                StrictMode.ThreadPolicy oldPolicy = StrictMode.allowThreadDiskReads();
+                try {
+                    if (new File(wrapperFileName).exists()) {
+                        invokeWith = "/system/bin/logwrapper " + wrapperFileName;
+                    }
+                } finally {
+                    StrictMode.setThreadPolicy(oldPolicy);
+                }
+            }
+
+            String requiredAbi = (abiOverride != null) ? abiOverride : app.info.primaryCpuAbi;
+            if (requiredAbi == null) {
+                requiredAbi = Build.SUPPORTED_ABIS[0];
+            }
+
+            String instructionSet = null;
+            if (app.info.primaryCpuAbi != null) {
+                instructionSet = VMRuntime.getInstructionSet(app.info.primaryCpuAbi);
+            }
+
+            app.gids = gids;
+            app.setRequiredAbi(requiredAbi);
+            app.instructionSet = instructionSet;
+
+            // the per-user SELinux context must be set
+            if (TextUtils.isEmpty(app.info.seInfoUser)) {
+                Slog.wtf(ActivityManagerService.TAG, "SELinux tag not defined",
+                        new IllegalStateException("SELinux tag not defined for "
+                                + app.info.packageName + " (uid " + app.uid + ")"));
+            }
+            final String seInfo = app.info.seInfo
+                    + (TextUtils.isEmpty(app.info.seInfoUser) ? "" : app.info.seInfoUser);
+            // Start the process.  It will either succeed and return a result containing
+            // the PID of the new process, or else throw a RuntimeException.
+            final String entryPoint = "android.app.ActivityThread";
+
+            return startProcessLocked(hostingType, hostingNameStr, entryPoint, app, uid, gids,
+                    runtimeFlags, mountExternal, seInfo, requiredAbi, instructionSet, invokeWith,
+                    startTime);
+        } catch (RuntimeException e) {
+            Slog.e(ActivityManagerService.TAG, "Failure starting process " + app.processName, e);
+
+            // Something went very wrong while trying to start this process; one
+            // common case is when the package is frozen due to an active
+            // upgrade. To recover, clean up any active bookkeeping related to
+            // starting this process. (We already invoked this method once when
+            // the package was initially frozen through KILL_APPLICATION_MSG, so
+            // it doesn't hurt to use it again.)
+            mService.forceStopPackageLocked(app.info.packageName, UserHandle.getAppId(app.uid),
+                    false, false, true, false, false, app.userId, "start failure");
+            return false;
+        }
+    }
+
+    @GuardedBy("mService")
+    boolean startProcessLocked(String hostingType, String hostingNameStr,
+            String entryPoint,
+            ProcessRecord app, int uid, int[] gids, int runtimeFlags, int mountExternal,
+            String seInfo, String requiredAbi, String instructionSet, String invokeWith,
+            long startTime) {
+        app.pendingStart = true;
+        app.killedByAm = false;
+        app.removed = false;
+        app.killed = false;
+        final long startSeq = app.startSeq = ++mProcStartSeqCounter;
+        app.setStartParams(uid, hostingType, hostingNameStr, seInfo, startTime);
+        if (mService.mConstants.FLAG_PROCESS_START_ASYNC) {
+            if (DEBUG_PROCESSES) Slog.i(TAG_PROCESSES,
+                    "Posting procStart msg for " + app.toShortString());
+            mService.mProcStartHandler.post(() -> {
+                try {
+                    synchronized (mService) {
+                        final String reason = isProcStartValidLocked(app, startSeq);
+                        if (reason != null) {
+                            Slog.w(TAG_PROCESSES, app + " not valid anymore,"
+                                    + " don't start process, " + reason);
+                            app.pendingStart = false;
+                            return;
+                        }
+                        app.setUsingWrapper(invokeWith != null
+                                || SystemProperties.get("wrap." + app.processName) != null);
+                        mPendingStarts.put(startSeq, app);
+                    }
+                    final Process.ProcessStartResult startResult = startProcess(app.hostingType,
+                            entryPoint, app, app.startUid, gids, runtimeFlags, mountExternal,
+                            app.seInfo, requiredAbi, instructionSet, invokeWith, app.startTime);
+                    synchronized (mService) {
+                        handleProcessStartedLocked(app, startResult, startSeq);
+                    }
+                } catch (RuntimeException e) {
+                    synchronized (mService) {
+                        Slog.e(ActivityManagerService.TAG, "Failure starting process "
+                                + app.processName, e);
+                        mPendingStarts.remove(startSeq);
+                        app.pendingStart = false;
+                        mService.forceStopPackageLocked(app.info.packageName,
+                                UserHandle.getAppId(app.uid),
+                                false, false, true, false, false, app.userId, "start failure");
+                    }
+                }
+            });
+            return true;
+        } else {
+            try {
+                final Process.ProcessStartResult startResult = startProcess(hostingType,
+                        entryPoint, app,
+                        uid, gids, runtimeFlags, mountExternal, seInfo, requiredAbi, instructionSet,
+                        invokeWith, startTime);
+                handleProcessStartedLocked(app, startResult.pid, startResult.usingWrapper,
+                        startSeq, false);
+            } catch (RuntimeException e) {
+                Slog.e(ActivityManagerService.TAG, "Failure starting process "
+                        + app.processName, e);
+                app.pendingStart = false;
+                mService.forceStopPackageLocked(app.info.packageName, UserHandle.getAppId(app.uid),
+                        false, false, true, false, false, app.userId, "start failure");
+            }
+            return app.pid > 0;
+        }
+    }
+
+    private Process.ProcessStartResult startProcess(String hostingType, String entryPoint,
+            ProcessRecord app, int uid, int[] gids, int runtimeFlags, int mountExternal,
+            String seInfo, String requiredAbi, String instructionSet, String invokeWith,
+            long startTime) {
+        try {
+            final String[] packageNames = mService.mContext.getPackageManager()
+                    .getPackagesForUid(uid);
+            final String[] visibleVolIds = LocalServices.getService(StorageManagerInternal.class)
+                    .getVisibleVolumesForUser(UserHandle.getUserId(uid));
+            Trace.traceBegin(Trace.TRACE_TAG_ACTIVITY_MANAGER, "Start proc: " +
+                    app.processName);
+            checkSlow(startTime, "startProcess: asking zygote to start proc");
+            final Process.ProcessStartResult startResult;
+            if (hostingType.equals("webview_service")) {
+                startResult = startWebView(entryPoint,
+                        app.processName, uid, uid, gids, runtimeFlags, mountExternal,
+                        app.info.targetSdkVersion, seInfo, requiredAbi, instructionSet,
+                        app.info.dataDir, null, app.info.packageName,
+                        packageNames, visibleVolIds,
+                        new String[] {PROC_START_SEQ_IDENT + app.startSeq});
+            } else {
+                startResult = Process.start(entryPoint,
+                        app.processName, uid, uid, gids, runtimeFlags, mountExternal,
+                        app.info.targetSdkVersion, seInfo, requiredAbi, instructionSet,
+                        app.info.dataDir, invokeWith, app.info.packageName,
+                        packageNames, visibleVolIds,
+                        new String[] {PROC_START_SEQ_IDENT + app.startSeq});
+            }
+            checkSlow(startTime, "startProcess: returned from zygote!");
+            return startResult;
+        } finally {
+            Trace.traceEnd(Trace.TRACE_TAG_ACTIVITY_MANAGER);
+        }
+    }
+
+    @GuardedBy("mService")
+    final void startProcessLocked(ProcessRecord app,
+            String hostingType, String hostingNameStr) {
+        startProcessLocked(app, hostingType, hostingNameStr, null /* abiOverride */);
+    }
+
+    @GuardedBy("mService")
+    final boolean startProcessLocked(ProcessRecord app,
+            String hostingType, String hostingNameStr, String abiOverride) {
+        return startProcessLocked(app, hostingType, hostingNameStr,
+                false /* disableHiddenApiChecks */, abiOverride);
+    }
+
+    @GuardedBy("mService")
+    final ProcessRecord startProcessLocked(String processName, ApplicationInfo info,
+            boolean knownToBeDead, int intentFlags, String hostingType, ComponentName hostingName,
+            boolean allowWhileBooting, boolean isolated, int isolatedUid, boolean keepIfLarge,
+            String abiOverride, String entryPoint, String[] entryPointArgs, Runnable crashHandler) {
+        long startTime = SystemClock.elapsedRealtime();
+        ProcessRecord app;
+        if (!isolated) {
+            app = getProcessRecordLocked(processName, info.uid, keepIfLarge);
+            checkSlow(startTime, "startProcess: after getProcessRecord");
+
+            if ((intentFlags & Intent.FLAG_FROM_BACKGROUND) != 0) {
+                // If we are in the background, then check to see if this process
+                // is bad.  If so, we will just silently fail.
+                if (mService.mAppErrors.isBadProcessLocked(info)) {
+                    if (DEBUG_PROCESSES) Slog.v(TAG, "Bad process: " + info.uid
+                            + "/" + info.processName);
+                    return null;
+                }
+            } else {
+                // When the user is explicitly starting a process, then clear its
+                // crash count so that we won't make it bad until they see at
+                // least one crash dialog again, and make the process good again
+                // if it had been bad.
+                if (DEBUG_PROCESSES) Slog.v(TAG, "Clearing bad process: " + info.uid
+                        + "/" + info.processName);
+                mService.mAppErrors.resetProcessCrashTimeLocked(info);
+                if (mService.mAppErrors.isBadProcessLocked(info)) {
+                    EventLog.writeEvent(EventLogTags.AM_PROC_GOOD,
+                            UserHandle.getUserId(info.uid), info.uid,
+                            info.processName);
+                    mService.mAppErrors.clearBadProcessLocked(info);
+                    if (app != null) {
+                        app.bad = false;
+                    }
+                }
+            }
+        } else {
+            // If this is an isolated process, it can't re-use an existing process.
+            app = null;
+        }
+
+        // We don't have to do anything more if:
+        // (1) There is an existing application record; and
+        // (2) The caller doesn't think it is dead, OR there is no thread
+        //     object attached to it so we know it couldn't have crashed; and
+        // (3) There is a pid assigned to it, so it is either starting or
+        //     already running.
+        if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "startProcess: name=" + processName
+                + " app=" + app + " knownToBeDead=" + knownToBeDead
+                + " thread=" + (app != null ? app.thread : null)
+                + " pid=" + (app != null ? app.pid : -1));
+        if (app != null && app.pid > 0) {
+            if ((!knownToBeDead && !app.killed) || app.thread == null) {
+                // We already have the app running, or are waiting for it to
+                // come up (we have a pid but not yet its thread), so keep it.
+                if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "App already running: " + app);
+                // If this is a new package in the process, add the package to the list
+                app.addPackage(info.packageName, info.versionCode, mService.mProcessStats);
+                checkSlow(startTime, "startProcess: done, added package to proc");
+                return app;
+            }
+
+            // An application record is attached to a previous process,
+            // clean it up now.
+            if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES, "App died: " + app);
+            checkSlow(startTime, "startProcess: bad proc running, killing");
+            ProcessList.killProcessGroup(app.uid, app.pid);
+            mService.handleAppDiedLocked(app, true, true);
+            checkSlow(startTime, "startProcess: done killing old proc");
+        }
+
+        String hostingNameStr = hostingName != null
+                ? hostingName.flattenToShortString() : null;
+
+        if (app == null) {
+            checkSlow(startTime, "startProcess: creating new process record");
+            app = newProcessRecordLocked(info, processName, isolated, isolatedUid);
+            if (app == null) {
+                Slog.w(TAG, "Failed making new process record for "
+                        + processName + "/" + info.uid + " isolated=" + isolated);
+                return null;
+            }
+            app.crashHandler = crashHandler;
+            app.isolatedEntryPoint = entryPoint;
+            app.isolatedEntryPointArgs = entryPointArgs;
+            checkSlow(startTime, "startProcess: done creating new process record");
+        } else {
+            // If this is a new package in the process, add the package to the list
+            app.addPackage(info.packageName, info.versionCode, mService.mProcessStats);
+            checkSlow(startTime, "startProcess: added package to existing proc");
+        }
+
+        // If the system is not ready yet, then hold off on starting this
+        // process until it is.
+        if (!mService.mProcessesReady
+                && !mService.isAllowedWhileBooting(info)
+                && !allowWhileBooting) {
+            if (!mService.mProcessesOnHold.contains(app)) {
+                mService.mProcessesOnHold.add(app);
+            }
+            if (DEBUG_PROCESSES) Slog.v(TAG_PROCESSES,
+                    "System not ready, putting on hold: " + app);
+            checkSlow(startTime, "startProcess: returning with proc on hold");
+            return app;
+        }
+
+        checkSlow(startTime, "startProcess: stepping in to startProcess");
+        final boolean success = startProcessLocked(app, hostingType, hostingNameStr,
+                abiOverride);
+        checkSlow(startTime, "startProcess: done starting proc!");
+        return success ? app : null;
+    }
+
+    @GuardedBy("mService")
+    private String isProcStartValidLocked(ProcessRecord app, long expectedStartSeq) {
+        StringBuilder sb = null;
+        if (app.killedByAm) {
+            if (sb == null) sb = new StringBuilder();
+            sb.append("killedByAm=true;");
+        }
+        if (mProcessNames.get(app.processName, app.uid) != app) {
+            if (sb == null) sb = new StringBuilder();
+            sb.append("No entry in mProcessNames;");
+        }
+        if (!app.pendingStart) {
+            if (sb == null) sb = new StringBuilder();
+            sb.append("pendingStart=false;");
+        }
+        if (app.startSeq > expectedStartSeq) {
+            if (sb == null) sb = new StringBuilder();
+            sb.append("seq=" + app.startSeq + ",expected=" + expectedStartSeq + ";");
+        }
+        return sb == null ? null : sb.toString();
+    }
+
+    @GuardedBy("mService")
+    private boolean handleProcessStartedLocked(ProcessRecord pending,
+            Process.ProcessStartResult startResult, long expectedStartSeq) {
+        // Indicates that this process start has been taken care of.
+        if (mPendingStarts.get(expectedStartSeq) == null) {
+            if (pending.pid == startResult.pid) {
+                pending.setUsingWrapper(startResult.usingWrapper);
+                // TODO: Update already existing clients of usingWrapper
+            }
+            return false;
+        }
+        return handleProcessStartedLocked(pending, startResult.pid, startResult.usingWrapper,
+                expectedStartSeq, false);
+    }
+
+    @GuardedBy("mService")
+    boolean handleProcessStartedLocked(ProcessRecord app, int pid, boolean usingWrapper,
+            long expectedStartSeq, boolean procAttached) {
+        mPendingStarts.remove(expectedStartSeq);
+        final String reason = isProcStartValidLocked(app, expectedStartSeq);
+        if (reason != null) {
+            Slog.w(TAG_PROCESSES, app + " start not valid, killing pid=" +
+                    pid
+                    + ", " + reason);
+            app.pendingStart = false;
+            killProcessQuiet(pid);
+            Process.killProcessGroup(app.uid, app.pid);
+            return false;
+        }
+        mService.mBatteryStatsService.noteProcessStart(app.processName, app.info.uid);
+        checkSlow(app.startTime, "startProcess: done updating battery stats");
+
+        EventLog.writeEvent(EventLogTags.AM_PROC_START,
+                UserHandle.getUserId(app.startUid), pid, app.startUid,
+                app.processName, app.hostingType,
+                app.hostingNameStr != null ? app.hostingNameStr : "");
+
+        try {
+            AppGlobals.getPackageManager().logAppProcessStartIfNeeded(app.processName, app.uid,
+                    app.seInfo, app.info.sourceDir, pid);
+        } catch (RemoteException ex) {
+            // Ignore
+        }
+
+        if (app.isPersistent()) {
+            Watchdog.getInstance().processStarted(app.processName, pid);
+        }
+
+        checkSlow(app.startTime, "startProcess: building log message");
+        StringBuilder buf = mStringBuilder;
+        buf.setLength(0);
+        buf.append("Start proc ");
+        buf.append(pid);
+        buf.append(':');
+        buf.append(app.processName);
+        buf.append('/');
+        UserHandle.formatUid(buf, app.startUid);
+        if (app.isolatedEntryPoint != null) {
+            buf.append(" [");
+            buf.append(app.isolatedEntryPoint);
+            buf.append("]");
+        }
+        buf.append(" for ");
+        buf.append(app.hostingType);
+        if (app.hostingNameStr != null) {
+            buf.append(" ");
+            buf.append(app.hostingNameStr);
+        }
+        mService.reportUidInfoMessageLocked(TAG, buf.toString(), app.startUid);
+        app.setPid(pid);
+        app.setUsingWrapper(usingWrapper);
+        app.pendingStart = false;
+        checkSlow(app.startTime, "startProcess: starting to update pids map");
+        ProcessRecord oldApp;
+        synchronized (mService.mPidsSelfLocked) {
+            oldApp = mService.mPidsSelfLocked.get(pid);
+        }
+        // If there is already an app occupying that pid that hasn't been cleaned up
+        if (oldApp != null && !app.isolated) {
+            // Clean up anything relating to this pid first
+            Slog.w(TAG, "Reusing pid " + pid
+                    + " while app is still mapped to it");
+            mService.cleanUpApplicationRecordLocked(oldApp, false, false, -1,
+                    true /*replacingPid*/);
+        }
+        synchronized (mService.mPidsSelfLocked) {
+            mService.mPidsSelfLocked.put(pid, app);
+            if (!procAttached) {
+                Message msg = mService.mHandler.obtainMessage(PROC_START_TIMEOUT_MSG);
+                msg.obj = app;
+                mService.mHandler.sendMessageDelayed(msg, usingWrapper
+                        ? PROC_START_TIMEOUT_WITH_WRAPPER : PROC_START_TIMEOUT);
+            }
+        }
+        checkSlow(app.startTime, "startProcess: done updating pids map");
+        return true;
+    }
+
+    final void removeLruProcessLocked(ProcessRecord app) {
+        int lrui = mLruProcesses.lastIndexOf(app);
+        if (lrui >= 0) {
+            if (!app.killed) {
+                if (app.isPersistent()) {
+                    Slog.w(TAG, "Removing persistent process that hasn't been killed: " + app);
+                } else {
+                    Slog.wtfStack(TAG, "Removing process that hasn't been killed: " + app);
+                    if (app.pid > 0) {
+                        killProcessQuiet(app.pid);
+                        ProcessList.killProcessGroup(app.uid, app.pid);
+                    } else {
+                        app.pendingStart = false;
+                    }
+                }
+            }
+            if (lrui <= mLruProcessActivityStart) {
+                mLruProcessActivityStart--;
+            }
+            if (lrui <= mLruProcessServiceStart) {
+                mLruProcessServiceStart--;
+            }
+            mLruProcesses.remove(lrui);
+        }
+    }
+
+    void killAllBackgroundProcessesLocked() {
+        final ArrayList<ProcessRecord> procs = new ArrayList<>();
+        final int NP = mProcessNames.getMap().size();
+        for (int ip = 0; ip < NP; ip++) {
+            final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+            final int NA = apps.size();
+            for (int ia = 0; ia < NA; ia++) {
+                final ProcessRecord app = apps.valueAt(ia);
+                if (app.isPersistent()) {
+                    // We don't kill persistent processes.
+                    continue;
+                }
+                if (app.removed) {
+                    procs.add(app);
+                } else if (app.setAdj >= ProcessList.CACHED_APP_MIN_ADJ) {
+                    app.removed = true;
+                    procs.add(app);
+                }
+            }
+        }
+
+        final int N = procs.size();
+        for (int i = 0; i < N; i++) {
+            removeProcessLocked(procs.get(i), false, true, "kill all background");
+        }
+    }
+
+    @GuardedBy("mService")
+    final boolean killPackageProcessesLocked(String packageName, int appId,
+            int userId, int minOomAdj, boolean callerWillRestart, boolean allowRestart,
+            boolean doit, boolean evenPersistent, String reason) {
+        ArrayList<ProcessRecord> procs = new ArrayList<>();
+
+        // Remove all processes this package may have touched: all with the
+        // same UID (except for the system or root user), and all whose name
+        // matches the package name.
+        final int NP = mProcessNames.getMap().size();
+        for (int ip = 0; ip < NP; ip++) {
+            SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+            final int NA = apps.size();
+            for (int ia = 0; ia < NA; ia++) {
+                ProcessRecord app = apps.valueAt(ia);
+                if (app.isPersistent() && !evenPersistent) {
+                    // we don't kill persistent processes
+                    continue;
+                }
+                if (app.removed) {
+                    if (doit) {
+                        procs.add(app);
+                    }
+                    continue;
+                }
+
+                // Skip process if it doesn't meet our oom adj requirement.
+                if (app.setAdj < minOomAdj) {
+                    continue;
+                }
+
+                // If no package is specified, we call all processes under the
+                // give user id.
+                if (packageName == null) {
+                    if (userId != UserHandle.USER_ALL && app.userId != userId) {
+                        continue;
+                    }
+                    if (appId >= 0 && UserHandle.getAppId(app.uid) != appId) {
+                        continue;
+                    }
+                    // Package has been specified, we want to hit all processes
+                    // that match it.  We need to qualify this by the processes
+                    // that are running under the specified app and user ID.
+                } else {
+                    final boolean isDep = app.pkgDeps != null
+                            && app.pkgDeps.contains(packageName);
+                    if (!isDep && UserHandle.getAppId(app.uid) != appId) {
+                        continue;
+                    }
+                    if (userId != UserHandle.USER_ALL && app.userId != userId) {
+                        continue;
+                    }
+                    if (!app.pkgList.containsKey(packageName) && !isDep) {
+                        continue;
+                    }
+                }
+
+                // Process has passed all conditions, kill it!
+                if (!doit) {
+                    return true;
+                }
+                app.removed = true;
+                procs.add(app);
+            }
+        }
+
+        int N = procs.size();
+        for (int i=0; i<N; i++) {
+            removeProcessLocked(procs.get(i), callerWillRestart, allowRestart, reason);
+        }
+        mService.updateOomAdjLocked();
+        return N > 0;
+    }
+    @GuardedBy("mService")
+    boolean removeProcessLocked(ProcessRecord app,
+            boolean callerWillRestart, boolean allowRestart, String reason) {
+        final String name = app.processName;
+        final int uid = app.uid;
+        if (DEBUG_PROCESSES) Slog.d(TAG_PROCESSES,
+                "Force removing proc " + app.toShortString() + " (" + name + "/" + uid + ")");
+
+        ProcessRecord old = mProcessNames.get(name, uid);
+        if (old != app) {
+            // This process is no longer active, so nothing to do.
+            Slog.w(TAG, "Ignoring remove of inactive process: " + app);
+            return false;
+        }
+        removeProcessNameLocked(name, uid);
+        mService.mAtmInternal.clearHeavyWeightProcessIfEquals(app.getWindowProcessController());
+
+        boolean needRestart = false;
+        if ((app.pid > 0 && app.pid != ActivityManagerService.MY_PID) || (app.pid == 0 && app
+                .pendingStart)) {
+            int pid = app.pid;
+            if (pid > 0) {
+                synchronized (mService.mPidsSelfLocked) {
+                    mService.mPidsSelfLocked.remove(pid);
+                    mService.mHandler.removeMessages(PROC_START_TIMEOUT_MSG, app);
+                }
+                mService.mBatteryStatsService.noteProcessFinish(app.processName, app.info.uid);
+                if (app.isolated) {
+                    mService.mBatteryStatsService.removeIsolatedUid(app.uid, app.info.uid);
+                    mService.getPackageManagerInternalLocked().removeIsolatedUid(app.uid);
+                }
+            }
+            boolean willRestart = false;
+            if (app.isPersistent() && !app.isolated) {
+                if (!callerWillRestart) {
+                    willRestart = true;
+                } else {
+                    needRestart = true;
+                }
+            }
+            app.kill(reason, true);
+            mService.handleAppDiedLocked(app, willRestart, allowRestart);
+            if (willRestart) {
+                removeLruProcessLocked(app);
+                mService.addAppLocked(app.info, null, false, null /* ABI override */);
+            }
+        } else {
+            mRemovedProcesses.add(app);
+        }
+
+        return needRestart;
+    }
+
+    @GuardedBy("mService")
+    final void addProcessNameLocked(ProcessRecord proc) {
+        // We shouldn't already have a process under this name, but just in case we
+        // need to clean up whatever may be there now.
+        ProcessRecord old = removeProcessNameLocked(proc.processName, proc.uid);
+        if (old == proc && proc.isPersistent()) {
+            // We are re-adding a persistent process.  Whatevs!  Just leave it there.
+            Slog.w(TAG, "Re-adding persistent process " + proc);
+        } else if (old != null) {
+            Slog.wtf(TAG, "Already have existing proc " + old + " when adding " + proc);
+        }
+        UidRecord uidRec = mService.mActiveUids.get(proc.uid);
+        if (uidRec == null) {
+            uidRec = new UidRecord(proc.uid);
+            // This is the first appearance of the uid, report it now!
+            if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
+                    "Creating new process uid: " + uidRec);
+            if (Arrays.binarySearch(mService.mDeviceIdleTempWhitelist,
+                    UserHandle.getAppId(proc.uid)) >= 0
+                    || mService.mPendingTempWhitelist.indexOfKey(proc.uid) >= 0) {
+                uidRec.setWhitelist = uidRec.curWhitelist = true;
+            }
+            uidRec.updateHasInternetPermission();
+            mService.mActiveUids.put(proc.uid, uidRec);
+            EventLogTags.writeAmUidRunning(uidRec.uid);
+            mService.noteUidProcessState(uidRec.uid, uidRec.curProcState);
+        }
+        proc.uidRecord = uidRec;
+
+        // Reset render thread tid if it was already set, so new process can set it again.
+        proc.renderThreadTid = 0;
+        uidRec.numProcs++;
+        mProcessNames.put(proc.processName, proc.uid, proc);
+        if (proc.isolated) {
+            mIsolatedProcesses.put(proc.uid, proc);
+        }
+    }
+
+    @GuardedBy("mService")
+    final ProcessRecord newProcessRecordLocked(ApplicationInfo info, String customProcess,
+            boolean isolated, int isolatedUid) {
+        String proc = customProcess != null ? customProcess : info.processName;
+        final int userId = UserHandle.getUserId(info.uid);
+        int uid = info.uid;
+        if (isolated) {
+            if (isolatedUid == 0) {
+                int stepsLeft = LAST_ISOLATED_UID - FIRST_ISOLATED_UID + 1;
+                while (true) {
+                    if (mNextIsolatedProcessUid < FIRST_ISOLATED_UID
+                            || mNextIsolatedProcessUid > LAST_ISOLATED_UID) {
+                        mNextIsolatedProcessUid = FIRST_ISOLATED_UID;
+                    }
+                    uid = UserHandle.getUid(userId, mNextIsolatedProcessUid);
+                    mNextIsolatedProcessUid++;
+                    if (mIsolatedProcesses.indexOfKey(uid) < 0) {
+                        // No process for this uid, use it.
+                        break;
+                    }
+                    stepsLeft--;
+                    if (stepsLeft <= 0) {
+                        return null;
+                    }
+                }
+            } else {
+                // Special case for startIsolatedProcess (internal only), where
+                // the uid of the isolated process is specified by the caller.
+                uid = isolatedUid;
+            }
+            mService.getPackageManagerInternalLocked().addIsolatedUid(uid, info.uid);
+
+            // Register the isolated UID with this application so BatteryStats knows to
+            // attribute resource usage to the application.
+            //
+            // NOTE: This is done here before addProcessNameLocked, which will tell BatteryStats
+            // about the process state of the isolated UID *before* it is registered with the
+            // owning application.
+            mService.mBatteryStatsService.addIsolatedUid(uid, info.uid);
+            StatsLog.write(StatsLog.ISOLATED_UID_CHANGED, info.uid, uid,
+                    StatsLog.ISOLATED_UID_CHANGED__EVENT__CREATED);
+        }
+        final ProcessRecord r = new ProcessRecord(mService, info, proc, uid,
+                mService.getGlobalConfiguration());
+
+        if (!mService.mBooted && !mService.mBooting
+                && userId == UserHandle.USER_SYSTEM
+                && (info.flags & PERSISTENT_MASK) == PERSISTENT_MASK) {
+            // The system process is initialized to SCHED_GROUP_DEFAULT in init.rc.
+            r.setCurrentSchedulingGroup(ProcessList.SCHED_GROUP_DEFAULT);
+            r.setSchedGroup = ProcessList.SCHED_GROUP_DEFAULT;
+            r.setPersistent(true);
+            r.maxAdj = ProcessList.PERSISTENT_PROC_ADJ;
+        }
+        if (isolated && isolatedUid != 0) {
+            // Special case for startIsolatedProcess (internal only) - assume the process
+            // is required by the system server to prevent it being killed.
+            r.maxAdj = ProcessList.PERSISTENT_SERVICE_ADJ;
+        }
+        addProcessNameLocked(r);
+        return r;
+    }
+
+    @GuardedBy("mService")
+    final ProcessRecord removeProcessNameLocked(final String name, final int uid) {
+        return removeProcessNameLocked(name, uid, null);
+    }
+
+    @GuardedBy("mService")
+    final ProcessRecord removeProcessNameLocked(final String name, final int uid,
+            final ProcessRecord expecting) {
+        ProcessRecord old = mProcessNames.get(name, uid);
+        // Only actually remove when the currently recorded value matches the
+        // record that we expected; if it doesn't match then we raced with a
+        // newly created process and we don't want to destroy the new one.
+        if ((expecting == null) || (old == expecting)) {
+            mProcessNames.remove(name, uid);
+        }
+        if (old != null && old.uidRecord != null) {
+            old.uidRecord.numProcs--;
+            if (old.uidRecord.numProcs == 0) {
+                // No more processes using this uid, tell clients it is gone.
+                if (DEBUG_UID_OBSERVERS) Slog.i(TAG_UID_OBSERVERS,
+                        "No more processes in " + old.uidRecord);
+                mService.enqueueUidChangeLocked(old.uidRecord, -1, UidRecord.CHANGE_GONE);
+                EventLogTags.writeAmUidStopped(uid);
+                mService.mActiveUids.remove(uid);
+                mService.noteUidProcessState(uid, ActivityManager.PROCESS_STATE_NONEXISTENT);
+            }
+            old.uidRecord = null;
+        }
+        mIsolatedProcesses.remove(uid);
+        return old;
+    }
+
+    /** Call setCoreSettings on all LRU processes, with the new settings. */
+    @GuardedBy("mService")
+    void updateCoreSettingsLocked(Bundle settings) {
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            ProcessRecord processRecord = mLruProcesses.get(i);
+            try {
+                if (processRecord.thread != null) {
+                    processRecord.thread.setCoreSettings(settings);
+                }
+            } catch (RemoteException re) {
+                /* ignore */
+            }
+        }
+    }
+
+    /**
+     * Kill all background processes except for ones with targetSdk lower than minTargetSdk and
+     * procstate lower than maxProcState.
+     * @param minTargetSdk
+     * @param maxProcState
+     */
+    @GuardedBy("mService")
+    void killAllBackgroundProcessesExceptLocked(int minTargetSdk, int maxProcState) {
+        final ArrayList<ProcessRecord> procs = new ArrayList<>();
+        final int NP = mProcessNames.getMap().size();
+        for (int ip = 0; ip < NP; ip++) {
+            final SparseArray<ProcessRecord> apps = mProcessNames.getMap().valueAt(ip);
+            final int NA = apps.size();
+            for (int ia = 0; ia < NA; ia++) {
+                final ProcessRecord app = apps.valueAt(ia);
+                if (app.removed) {
+                    procs.add(app);
+                } else if ((minTargetSdk < 0 || app.info.targetSdkVersion < minTargetSdk)
+                        && (maxProcState < 0 || app.setProcState > maxProcState)) {
+                    app.removed = true;
+                    procs.add(app);
+                }
+            }
+        }
+
+        final int N = procs.size();
+        for (int i = 0; i < N; i++) {
+            removeProcessLocked(procs.get(i), false, true, "kill all background except");
+        }
+    }
+
+    /**
+     * Call updateTimePrefs on all LRU processes
+     * @param timePref The time pref to pass to each process
+     */
+    @GuardedBy("mService")
+    void updateAllTimePrefsLocked(int timePref) {
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            ProcessRecord r = mLruProcesses.get(i);
+            if (r.thread != null) {
+                try {
+                    r.thread.updateTimePrefs(timePref);
+                } catch (RemoteException ex) {
+                    Slog.w(TAG, "Failed to update preferences for: "
+                            + r.info.processName);
+                }
+            }
+        }
+    }
+
+    @GuardedBy("mService")
+    void setAllHttpProxyLocked(String host, String port, String exclList, Uri pacFileUrl) {
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            ProcessRecord r = mLruProcesses.get(i);
+            // Don't dispatch to isolated processes as they can't access
+            // ConnectivityManager and don't have network privileges anyway.
+            if (r.thread != null && !r.isolated) {
+                try {
+                    r.thread.setHttpProxy(host, port, exclList, pacFileUrl);
+                } catch (RemoteException ex) {
+                    Slog.w(TAG, "Failed to update http proxy for: " +
+                            r.info.processName);
+                }
+            }
+        }
+    }
+
+    @GuardedBy("mService")
+    void clearAllDnsCacheLocked() {
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            ProcessRecord r = mLruProcesses.get(i);
+            if (r.thread != null) {
+                try {
+                    r.thread.clearDnsCache();
+                } catch (RemoteException ex) {
+                    Slog.w(TAG, "Failed to clear dns cache for: " + r.info.processName);
+                }
+            }
+        }
+    }
+
+    @GuardedBy("mService")
+    void handleAllTrustStorageUpdateLocked() {
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            ProcessRecord r = mLruProcesses.get(i);
+            if (r.thread != null) {
+                try {
+                    r.thread.handleTrustStorageUpdate();
+                } catch (RemoteException ex) {
+                    Slog.w(TAG, "Failed to handle trust storage update for: " +
+                            r.info.processName);
+                }
+            }
+        }
+    }
+
+    @GuardedBy("mService")
+    int updateLruProcessInternalLocked(ProcessRecord app, long now, int index,
+            String what, Object obj, ProcessRecord srcApp) {
+        app.lastActivityTime = now;
+
+        if (app.hasActivitiesOrRecentTasks()) {
+            // Don't want to touch dependent processes that are hosting activities.
+            return index;
+        }
+
+        int lrui = mLruProcesses.lastIndexOf(app);
+        if (lrui < 0) {
+            Slog.wtf(TAG, "Adding dependent process " + app + " not on LRU list: "
+                    + what + " " + obj + " from " + srcApp);
+            return index;
+        }
+
+        if (lrui >= index) {
+            // Don't want to cause this to move dependent processes *back* in the
+            // list as if they were less frequently used.
+            return index;
+        }
+
+        if (lrui >= mLruProcessActivityStart) {
+            // Don't want to touch dependent processes that are hosting activities.
+            return index;
+        }
+
+        mLruProcesses.remove(lrui);
+        if (index > 0) {
+            index--;
+        }
+        if (DEBUG_LRU) Slog.d(TAG_LRU, "Moving dep from " + lrui + " to " + index
+                + " in LRU list: " + app);
+        mLruProcesses.add(index, app);
+        return index;
+    }
+
+    final void updateLruProcessLocked(ProcessRecord app, boolean activityChange,
+            ProcessRecord client) {
+        final boolean hasActivity = app.hasActivitiesOrRecentTasks() || app.hasClientActivities()
+                || app.treatLikeActivity;
+        final boolean hasService = false; // not impl yet. app.services.size() > 0;
+        if (!activityChange && hasActivity) {
+            // The process has activities, so we are only allowing activity-based adjustments
+            // to move it.  It should be kept in the front of the list with other
+            // processes that have activities, and we don't want those to change their
+            // order except due to activity operations.
+            return;
+        }
+
+        mLruSeq++;
+        final long now = SystemClock.uptimeMillis();
+        app.lastActivityTime = now;
+
+        // First a quick reject: if the app is already at the position we will
+        // put it, then there is nothing to do.
+        if (hasActivity) {
+            final int N = mLruProcesses.size();
+            if (N > 0 && mLruProcesses.get(N - 1) == app) {
+                if (DEBUG_LRU) Slog.d(TAG_LRU, "Not moving, already top activity: " + app);
+                return;
+            }
+        } else {
+            if (mLruProcessServiceStart > 0
+                    && mLruProcesses.get(mLruProcessServiceStart-1) == app) {
+                if (DEBUG_LRU) Slog.d(TAG_LRU, "Not moving, already top other: " + app);
+                return;
+            }
+        }
+
+        int lrui = mLruProcesses.lastIndexOf(app);
+
+        if (app.isPersistent() && lrui >= 0) {
+            // We don't care about the position of persistent processes, as long as
+            // they are in the list.
+            if (DEBUG_LRU) Slog.d(TAG_LRU, "Not moving, persistent: " + app);
+            return;
+        }
+
+        /* In progress: compute new position first, so we can avoid doing work
+           if the process is not actually going to move.  Not yet working.
+        int addIndex;
+        int nextIndex;
+        boolean inActivity = false, inService = false;
+        if (hasActivity) {
+            // Process has activities, put it at the very tipsy-top.
+            addIndex = mLruProcesses.size();
+            nextIndex = mLruProcessServiceStart;
+            inActivity = true;
+        } else if (hasService) {
+            // Process has services, put it at the top of the service list.
+            addIndex = mLruProcessActivityStart;
+            nextIndex = mLruProcessServiceStart;
+            inActivity = true;
+            inService = true;
+        } else  {
+            // Process not otherwise of interest, it goes to the top of the non-service area.
+            addIndex = mLruProcessServiceStart;
+            if (client != null) {
+                int clientIndex = mLruProcesses.lastIndexOf(client);
+                if (clientIndex < 0) Slog.d(TAG, "Unknown client " + client + " when updating "
+                        + app);
+                if (clientIndex >= 0 && addIndex > clientIndex) {
+                    addIndex = clientIndex;
+                }
+            }
+            nextIndex = addIndex > 0 ? addIndex-1 : addIndex;
+        }
+
+        Slog.d(TAG, "Update LRU at " + lrui + " to " + addIndex + " (act="
+                + mLruProcessActivityStart + "): " + app);
+        */
+
+        if (lrui >= 0) {
+            if (lrui < mLruProcessActivityStart) {
+                mLruProcessActivityStart--;
+            }
+            if (lrui < mLruProcessServiceStart) {
+                mLruProcessServiceStart--;
+            }
+            /*
+            if (addIndex > lrui) {
+                addIndex--;
+            }
+            if (nextIndex > lrui) {
+                nextIndex--;
+            }
+            */
+            mLruProcesses.remove(lrui);
+        }
+
+        /*
+        mLruProcesses.add(addIndex, app);
+        if (inActivity) {
+            mLruProcessActivityStart++;
+        }
+        if (inService) {
+            mLruProcessActivityStart++;
+        }
+        */
+
+        int nextIndex;
+        if (hasActivity) {
+            final int N = mLruProcesses.size();
+            if ((!app.hasActivities() || app.hasRecentTasks())
+                    && mLruProcessActivityStart < (N - 1)) {
+                // Process doesn't have activities, but has clients with
+                // activities...  move it up, but one below the top (the top
+                // should always have a real activity).
+                if (DEBUG_LRU) Slog.d(TAG_LRU,
+                        "Adding to second-top of LRU activity list: " + app);
+                mLruProcesses.add(N - 1, app);
+                // To keep it from spamming the LRU list (by making a bunch of clients),
+                // we will push down any other entries owned by the app.
+                final int uid = app.info.uid;
+                for (int i = N - 2; i > mLruProcessActivityStart; i--) {
+                    ProcessRecord subProc = mLruProcesses.get(i);
+                    if (subProc.info.uid == uid) {
+                        // We want to push this one down the list.  If the process after
+                        // it is for the same uid, however, don't do so, because we don't
+                        // want them internally to be re-ordered.
+                        if (mLruProcesses.get(i - 1).info.uid != uid) {
+                            if (DEBUG_LRU) Slog.d(TAG_LRU,
+                                    "Pushing uid " + uid + " swapping at " + i + ": "
+                                            + mLruProcesses.get(i) + " : "
+                                            + mLruProcesses.get(i - 1));
+                            ProcessRecord tmp = mLruProcesses.get(i);
+                            mLruProcesses.set(i, mLruProcesses.get(i - 1));
+                            mLruProcesses.set(i - 1, tmp);
+                            i--;
+                        }
+                    } else {
+                        // A gap, we can stop here.
+                        break;
+                    }
+                }
+            } else {
+                // Process has activities, put it at the very tipsy-top.
+                if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding to top of LRU activity list: " + app);
+                mLruProcesses.add(app);
+            }
+            nextIndex = mLruProcessServiceStart;
+        } else if (hasService) {
+            // Process has services, put it at the top of the service list.
+            if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding to top of LRU service list: " + app);
+            mLruProcesses.add(mLruProcessActivityStart, app);
+            nextIndex = mLruProcessServiceStart;
+            mLruProcessActivityStart++;
+        } else  {
+            // Process not otherwise of interest, it goes to the top of the non-service area.
+            int index = mLruProcessServiceStart;
+            if (client != null) {
+                // If there is a client, don't allow the process to be moved up higher
+                // in the list than that client.
+                int clientIndex = mLruProcesses.lastIndexOf(client);
+                if (DEBUG_LRU && clientIndex < 0) Slog.d(TAG_LRU, "Unknown client " + client
+                        + " when updating " + app);
+                if (clientIndex <= lrui) {
+                    // Don't allow the client index restriction to push it down farther in the
+                    // list than it already is.
+                    clientIndex = lrui;
+                }
+                if (clientIndex >= 0 && index > clientIndex) {
+                    index = clientIndex;
+                }
+            }
+            if (DEBUG_LRU) Slog.d(TAG_LRU, "Adding at " + index + " of LRU list: " + app);
+            mLruProcesses.add(index, app);
+            nextIndex = index - 1;
+            mLruProcessActivityStart++;
+            mLruProcessServiceStart++;
+        }
+
+        // If the app is currently using a content provider or service,
+        // bump those processes as well.
+        for (int j = app.connections.size() - 1; j >= 0; j--) {
+            ConnectionRecord cr = app.connections.valueAt(j);
+            if (cr.binding != null && !cr.serviceDead && cr.binding.service != null
+                    && cr.binding.service.app != null
+                    && cr.binding.service.app.lruSeq != mLruSeq
+                    && !cr.binding.service.app.isPersistent()) {
+                nextIndex = updateLruProcessInternalLocked(cr.binding.service.app,
+                        now,
+                        nextIndex,
+                        "service connection", cr, app);
+            }
+        }
+        for (int j = app.conProviders.size() - 1; j >= 0; j--) {
+            ContentProviderRecord cpr = app.conProviders.get(j).provider;
+            if (cpr.proc != null && cpr.proc.lruSeq != mLruSeq && !cpr.proc.isPersistent()) {
+                nextIndex = updateLruProcessInternalLocked(cpr.proc, now, nextIndex,
+                        "provider reference", cpr, app);
+            }
+        }
+    }
+
+    final ProcessRecord getLRURecordForAppLocked(IApplicationThread thread) {
+        final IBinder threadBinder = thread.asBinder();
+        // Find the application record.
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            final ProcessRecord rec = mLruProcesses.get(i);
+            if (rec.thread != null && rec.thread.asBinder() == threadBinder) {
+                return rec;
+            }
+        }
+        return null;
+    }
+
+    boolean haveBackgroundProcessLocked() {
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            final ProcessRecord rec = mLruProcesses.get(i);
+            if (rec.thread != null
+                    && rec.setProcState >= PROCESS_STATE_CACHED_ACTIVITY) {
+                return true;
+            }
+        }
+        return false;
+    }
+
+    private static int procStateToImportance(int procState, int memAdj,
+            ActivityManager.RunningAppProcessInfo currApp,
+            int clientTargetSdk) {
+        int imp = ActivityManager.RunningAppProcessInfo.procStateToImportanceForTargetSdk(
+                procState, clientTargetSdk);
+        if (imp == ActivityManager.RunningAppProcessInfo.IMPORTANCE_BACKGROUND) {
+            currApp.lru = memAdj;
+        } else {
+            currApp.lru = 0;
+        }
+        return imp;
+    }
+
+    @GuardedBy("mService")
+    void fillInProcMemInfoLocked(ProcessRecord app,
+            ActivityManager.RunningAppProcessInfo outInfo,
+            int clientTargetSdk) {
+        outInfo.pid = app.pid;
+        outInfo.uid = app.info.uid;
+        if (mService.mAtmInternal.isHeavyWeightProcess(app.getWindowProcessController())) {
+            outInfo.flags |= ActivityManager.RunningAppProcessInfo.FLAG_CANT_SAVE_STATE;
+        }
+        if (app.isPersistent()) {
+            outInfo.flags |= ActivityManager.RunningAppProcessInfo.FLAG_PERSISTENT;
+        }
+        if (app.hasActivities()) {
+            outInfo.flags |= ActivityManager.RunningAppProcessInfo.FLAG_HAS_ACTIVITIES;
+        }
+        outInfo.lastTrimLevel = app.trimMemoryLevel;
+        int adj = app.curAdj;
+        int procState = app.getCurProcState();
+        outInfo.importance = procStateToImportance(procState, adj, outInfo,
+                clientTargetSdk);
+        outInfo.importanceReasonCode = app.adjTypeCode;
+        outInfo.processState = app.getCurProcState();
+        outInfo.isFocused = (app == mService.getTopAppLocked());
+        outInfo.lastActivityTime = app.lastActivityTime;
+    }
+
+    @GuardedBy("mService")
+    List<ActivityManager.RunningAppProcessInfo> getRunningAppProcessesLocked(boolean allUsers,
+            int userId, boolean allUids, int callingUid, int clientTargetSdk) {
+        // Lazy instantiation of list
+        List<ActivityManager.RunningAppProcessInfo> runList = null;
+
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            ProcessRecord app = mLruProcesses.get(i);
+            if ((!allUsers && app.userId != userId)
+                    || (!allUids && app.uid != callingUid)) {
+                continue;
+            }
+            if ((app.thread != null) && (!app.isCrashing() && !app.isNotResponding())) {
+                // Generate process state info for running application
+                ActivityManager.RunningAppProcessInfo currApp =
+                        new ActivityManager.RunningAppProcessInfo(app.processName,
+                                app.pid, app.getPackageList());
+                fillInProcMemInfoLocked(app, currApp, clientTargetSdk);
+                if (app.adjSource instanceof ProcessRecord) {
+                    currApp.importanceReasonPid = ((ProcessRecord)app.adjSource).pid;
+                    currApp.importanceReasonImportance =
+                            ActivityManager.RunningAppProcessInfo.procStateToImportance(
+                                    app.adjSourceProcState);
+                } else if (app.adjSource instanceof ActivityRecord) {
+                    ActivityRecord r = (ActivityRecord)app.adjSource;
+                    if (r.app != null) currApp.importanceReasonPid = r.app.getPid();
+                }
+                if (app.adjTarget instanceof ComponentName) {
+                    currApp.importanceReasonComponent = (ComponentName)app.adjTarget;
+                }
+                //Slog.v(TAG, "Proc " + app.processName + ": imp=" + currApp.importance
+                //        + " lru=" + currApp.lru);
+                if (runList == null) {
+                    runList = new ArrayList<>();
+                }
+                runList.add(currApp);
+            }
+        }
+        return runList;
+    }
+
+    @GuardedBy("mService")
+    int getLruSizeLocked() {
+        return mLruProcesses.size();
+    }
+
+    @GuardedBy("mService")
+    void dumpLruListHeaderLocked(PrintWriter pw) {
+        pw.print("  Process LRU list (sorted by oom_adj, "); pw.print(mLruProcesses.size());
+        pw.print(" total, non-act at ");
+        pw.print(mLruProcesses.size() - mLruProcessActivityStart);
+        pw.print(", non-svc at ");
+        pw.print(mLruProcesses.size() - mLruProcessServiceStart);
+        pw.println("):");
+    }
+
+    @GuardedBy("mService")
+    ArrayList<ProcessRecord> collectProcessesLocked(int start, boolean allPkgs, String[] args) {
+        ArrayList<ProcessRecord> procs;
+        if (args != null && args.length > start
+                && args[start].charAt(0) != '-') {
+            procs = new ArrayList<ProcessRecord>();
+            int pid = -1;
+            try {
+                pid = Integer.parseInt(args[start]);
+            } catch (NumberFormatException e) {
+            }
+            for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+                ProcessRecord proc = mLruProcesses.get(i);
+                if (proc.pid > 0 && proc.pid == pid) {
+                    procs.add(proc);
+                } else if (allPkgs && proc.pkgList != null
+                        && proc.pkgList.containsKey(args[start])) {
+                    procs.add(proc);
+                } else if (proc.processName.equals(args[start])) {
+                    procs.add(proc);
+                }
+            }
+            if (procs.size() <= 0) {
+                return null;
+            }
+        } else {
+            procs = new ArrayList<ProcessRecord>(mLruProcesses);
+        }
+        return procs;
+    }
+
+    @GuardedBy("mService")
+    void updateApplicationInfoLocked(List<String> packagesToUpdate, int userId,
+            boolean updateFrameworkRes) {
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            final ProcessRecord app = mLruProcesses.get(i);
+            if (app.thread == null) {
+                continue;
+            }
+
+            if (userId != UserHandle.USER_ALL && app.userId != userId) {
+                continue;
+            }
+
+            final int packageCount = app.pkgList.size();
+            for (int j = 0; j < packageCount; j++) {
+                final String packageName = app.pkgList.keyAt(j);
+                if (updateFrameworkRes || packagesToUpdate.contains(packageName)) {
+                    try {
+                        final ApplicationInfo ai = AppGlobals.getPackageManager()
+                                .getApplicationInfo(packageName, STOCK_PM_FLAGS, app.userId);
+                        if (ai != null) {
+                            app.thread.scheduleApplicationInfoChanged(ai);
+                        }
+                    } catch (RemoteException e) {
+                        Slog.w(TAG, String.format("Failed to update %s ApplicationInfo for %s",
+                                packageName, app));
+                    }
+                }
+            }
+        }
+    }
+
+    @GuardedBy("mService")
+    void sendPackageBroadcastLocked(int cmd, String[] packages, int userId) {
+        for (int i = mLruProcesses.size() - 1; i >= 0; i--) {
+            ProcessRecord r = mLruProcesses.get(i);
+            if (r.thread != null && (userId == UserHandle.USER_ALL || r.userId == userId)) {
+                try {
+                    r.thread.dispatchPackageBroadcast(cmd, packages);
+                } catch (RemoteException ex) {
+                }
+            }
+        }
+    }
 }
diff --git a/services/core/java/com/android/server/am/ProcessRecord.java b/services/core/java/com/android/server/am/ProcessRecord.java
index 3128333..fa7a08b 100644
--- a/services/core/java/com/android/server/am/ProcessRecord.java
+++ b/services/core/java/com/android/server/am/ProcessRecord.java
@@ -18,12 +18,17 @@
 
 import static android.app.ActivityManager.PROCESS_STATE_NONEXISTENT;
 
+import static com.android.server.Watchdog.NATIVE_STACKS_OF_INTEREST;
+import static com.android.server.am.ActivityManagerDebugConfig.DEBUG_ANR;
 import static com.android.server.am.ActivityManagerDebugConfig.TAG_AM;
 import static com.android.server.am.ActivityManagerDebugConfig.TAG_WITH_CLASS_NAME;
+import static com.android.server.am.ActivityManagerService.MY_PID;
 
 import android.app.ActivityManager;
+import android.app.ApplicationErrorReport;
 import android.app.Dialog;
 import android.app.IApplicationThread;
+import android.app.ProfilerInfo;
 import android.content.ComponentName;
 import android.content.Context;
 import android.content.pm.ApplicationInfo;
@@ -32,16 +37,19 @@
 import android.os.Binder;
 import android.os.Debug;
 import android.os.IBinder;
+import android.os.Message;
 import android.os.Process;
 import android.os.RemoteException;
 import android.os.SystemClock;
 import android.os.Trace;
 import android.os.UserHandle;
+import android.provider.Settings;
 import android.util.ArrayMap;
 import android.util.ArraySet;
 import android.util.DebugUtils;
 import android.util.EventLog;
 import android.util.Slog;
+import android.util.SparseArray;
 import android.util.StatsLog;
 import android.util.TimeUtils;
 import android.util.proto.ProtoOutputStream;
@@ -49,7 +57,11 @@
 import com.android.internal.app.procstats.ProcessState;
 import com.android.internal.app.procstats.ProcessStats;
 import com.android.internal.os.BatteryStatsImpl;
+import com.android.internal.os.ProcessCpuTracker;
+import com.android.server.Watchdog;
 
+import java.io.File;
+import java.io.IOException;
 import java.io.PrintWriter;
 import java.util.ArrayList;
 import java.util.Arrays;
@@ -128,7 +140,7 @@
     long lastCachedPss;         // Last computed pss when in cached state.
     long lastCachedSwapPss;     // Last computed SwapPss when in cached state.
     int maxAdj;                 // Maximum OOM adjustment for this process
-    int curRawAdj;              // Current OOM unlimited adjustment for this process
+    private int mCurRawAdj;     // Current OOM unlimited adjustment for this process
     int setRawAdj;              // Last set OOM unlimited adjustment for this process
     int curAdj;                 // Current OOM adjustment for this process
     int setAdj;                 // Last set OOM adjustment for this process
@@ -362,7 +374,7 @@
                     pw.print(" initialIdlePss="); pw.println(initialIdlePss);
         }
         pw.print(prefix); pw.print("oom: max="); pw.print(maxAdj);
-                pw.print(" curRaw="); pw.print(curRawAdj);
+                pw.print(" curRaw="); pw.print(mCurRawAdj);
                 pw.print(" setRaw="); pw.print(setRawAdj);
                 pw.print(" cur="); pw.print(curAdj);
                 pw.print(" set="); pw.println(setAdj);
@@ -531,7 +543,7 @@
         userId = UserHandle.getUserId(_uid);
         processName = _processName;
         maxAdj = ProcessList.UNKNOWN_ADJ;
-        curRawAdj = setRawAdj = ProcessList.INVALID_ADJ;
+        mCurRawAdj = setRawAdj = ProcessList.INVALID_ADJ;
         curAdj = setAdj = verifiedAdj = ProcessList.INVALID_ADJ;
         mPersistent = false;
         removed = false;
@@ -723,7 +735,7 @@
             if (pid > 0) {
                 EventLog.writeEvent(EventLogTags.AM_KILL, userId, pid, processName, setAdj, reason);
                 Process.killProcessQuiet(pid);
-                ActivityManagerService.killProcessGroup(uid, pid);
+                ProcessList.killProcessGroup(uid, pid);
             } else {
                 pendingStart = false;
             }
@@ -735,6 +747,7 @@
         }
     }
 
+    @Override
     public void writeToProto(ProtoOutputStream proto, long fieldId) {
         long token = proto.start(fieldId);
         proto.write(ProcessRecordProto.PID, pid);
@@ -825,6 +838,13 @@
         return null;
     }
 
+    @Override
+    public void addPackage(String pkg, long versionCode) {
+        synchronized (mService) {
+            addPackage(pkg, versionCode, mService.mProcessStats);
+        }
+    }
+
     /*
      *  Return true if package has been added false if not
      */
@@ -1091,6 +1111,15 @@
         return mInstr;
     }
 
+    void setCurRawAdj(int curRawAdj) {
+        mCurRawAdj = curRawAdj;
+        mWindowProcessController.setPerceptible(curRawAdj <= ProcessList.PERCEPTIBLE_APP_ADJ);
+    }
+
+    int getCurRawAdj() {
+        return mCurRawAdj;
+    }
+
     @Override
     public void clearProfilerIfNeeded() {
         synchronized (mService) {
@@ -1137,7 +1166,7 @@
                 mService.mServices.updateServiceConnectionActivitiesLocked(this);
             }
             if (updateLru) {
-                mService.updateLruProcessLocked(this, activityChange, null);
+                mService.mProcessList.updateLruProcessLocked(this, activityChange, null);
             }
             if (updateOomAdj) {
                 mService.updateOomAdjLocked();
@@ -1156,7 +1185,315 @@
      * Returns the total time (in milliseconds) spent executing in both user and system code.
      * Safe to call without lock held.
      */
+    @Override
     public long getCpuTime() {
         return mService.mProcessCpuTracker.getCpuTimeForPid(pid);
     }
+
+    @Override
+    public void clearWaitingToKill() {
+        synchronized (mService) {
+            waitingToKill = null;
+        }
+    }
+
+    @Override
+    public ProfilerInfo onStartActivity(int topProcessState) {
+        synchronized (mService) {
+            ProfilerInfo profilerInfo = null;
+            if (mService.mProfileApp != null && mService.mProfileApp.equals(processName)) {
+                if (mService.mProfileProc == null || mService.mProfileProc == this) {
+                    mService.mProfileProc = this;
+                    final ProfilerInfo profilerInfoSvc = mService.mProfilerInfo;
+                    if (profilerInfoSvc != null && profilerInfoSvc.profileFile != null) {
+                        if (profilerInfoSvc.profileFd != null) {
+                            try {
+                                profilerInfoSvc.profileFd = profilerInfoSvc.profileFd.dup();
+                            } catch (IOException e) {
+                                profilerInfoSvc.closeFd();
+                            }
+                        }
+
+                        profilerInfo = new ProfilerInfo(profilerInfoSvc);
+                    }
+                }
+            }
+
+            hasShownUi = true;
+            setPendingUiClean(true);
+            forceProcessStateUpTo(topProcessState);
+
+            return profilerInfo;
+        }
+    }
+
+    @Override
+    public void appDied() {
+        synchronized (mService) {
+            mService.appDiedLocked(this);
+        }
+    }
+
+    public long getInputDispatchingTimeout() {
+        return mWindowProcessController.getInputDispatchingTimeout();
+    }
+
+    void appNotResponding(String activityShortComponentName, ApplicationInfo aInfo,
+            String parentShortComponentName, WindowProcessController parentProcess,
+            boolean aboveSystem, String annotation) {
+        ArrayList<Integer> firstPids = new ArrayList<>(5);
+        SparseArray<Boolean> lastPids = new SparseArray<>(20);
+
+        if (mService.mActivityTaskManager.mController != null) {
+            try {
+                // 0 == continue, -1 = kill process immediately
+                int res = mService.mActivityTaskManager.mController.appEarlyNotResponding(
+                        processName, pid, annotation);
+                if (res < 0 && pid != MY_PID) {
+                    kill("anr", true);
+                }
+            } catch (RemoteException e) {
+                mService.mActivityTaskManager.mController = null;
+                Watchdog.getInstance().setActivityController(null);
+            }
+        }
+
+        long anrTime = SystemClock.uptimeMillis();
+        if (ActivityManagerService.MONITOR_CPU_USAGE) {
+            mService.updateCpuStatsNow();
+        }
+
+        // Unless configured otherwise, swallow ANRs in background processes & kill the process.
+        boolean showBackground = Settings.Secure.getInt(mService.mContext.getContentResolver(),
+                Settings.Secure.ANR_SHOW_BACKGROUND, 0) != 0;
+
+        boolean isSilentANR;
+
+        synchronized (mService) {
+            // PowerManager.reboot() can block for a long time, so ignore ANRs while shutting down.
+            if (mService.mActivityTaskManager.mShuttingDown) {
+                Slog.i(TAG, "During shutdown skipping ANR: " + this + " " + annotation);
+                return;
+            } else if (isNotResponding()) {
+                Slog.i(TAG, "Skipping duplicate ANR: " + this + " " + annotation);
+                return;
+            } else if (isCrashing()) {
+                Slog.i(TAG, "Crashing app skipping ANR: " + this + " " + annotation);
+                return;
+            } else if (killedByAm) {
+                Slog.i(TAG, "App already killed by AM skipping ANR: " + this + " " + annotation);
+                return;
+            } else if (killed) {
+                Slog.i(TAG, "Skipping died app ANR: " + this + " " + annotation);
+                return;
+            }
+
+            // In case we come through here for the same app before completing
+            // this one, mark as anring now so we will bail out.
+            setNotResponding(true);
+
+            // Log the ANR to the event log.
+            EventLog.writeEvent(EventLogTags.AM_ANR, userId, pid, processName, info.flags,
+                    annotation);
+
+            // Dump thread traces as quickly as we can, starting with "interesting" processes.
+            firstPids.add(pid);
+
+            // Don't dump other PIDs if it's a background ANR
+            isSilentANR = !showBackground && !isInterestingForBackgroundTraces();
+            if (!isSilentANR) {
+                int parentPid = pid;
+                if (parentProcess != null && parentProcess.getPid() > 0) {
+                    parentPid = parentProcess.getPid();
+                }
+                if (parentPid != pid) firstPids.add(parentPid);
+
+                if (MY_PID != pid && MY_PID != parentPid) firstPids.add(MY_PID);
+
+                for (int i = mService.mProcessList.mLruProcesses.size() - 1; i >= 0; i--) {
+                    ProcessRecord r = mService.mProcessList.mLruProcesses.get(i);
+                    if (r != null && r.thread != null) {
+                        int myPid = r.pid;
+                        if (myPid > 0 && myPid != pid && myPid != parentPid && myPid != MY_PID) {
+                            if (r.isPersistent()) {
+                                firstPids.add(myPid);
+                                if (DEBUG_ANR) Slog.i(TAG, "Adding persistent proc: " + r);
+                            } else if (r.treatLikeActivity) {
+                                firstPids.add(myPid);
+                                if (DEBUG_ANR) Slog.i(TAG, "Adding likely IME: " + r);
+                            } else {
+                                lastPids.put(myPid, Boolean.TRUE);
+                                if (DEBUG_ANR) Slog.i(TAG, "Adding ANR proc: " + r);
+                            }
+                        }
+                    }
+                }
+            }
+        }
+
+        // Log the ANR to the main log.
+        StringBuilder info = new StringBuilder();
+        info.setLength(0);
+        info.append("ANR in ").append(processName);
+        if (activityShortComponentName != null) {
+            info.append(" (").append(activityShortComponentName).append(")");
+        }
+        info.append("\n");
+        info.append("PID: ").append(pid).append("\n");
+        if (annotation != null) {
+            info.append("Reason: ").append(annotation).append("\n");
+        }
+        if (parentShortComponentName != null
+                && parentShortComponentName.equals(activityShortComponentName)) {
+            info.append("Parent: ").append(parentShortComponentName).append("\n");
+        }
+
+        ProcessCpuTracker processCpuTracker = new ProcessCpuTracker(true);
+
+        // don't dump native PIDs for background ANRs unless it is the process of interest
+        String[] nativeProcs = null;
+        if (isSilentANR) {
+            for (int i = 0; i < NATIVE_STACKS_OF_INTEREST.length; i++) {
+                if (NATIVE_STACKS_OF_INTEREST[i].equals(processName)) {
+                    nativeProcs = new String[] { processName };
+                    break;
+                }
+            }
+        } else {
+            nativeProcs = NATIVE_STACKS_OF_INTEREST;
+        }
+
+        int[] pids = nativeProcs == null ? null : Process.getPidsForCommands(nativeProcs);
+        ArrayList<Integer> nativePids = null;
+
+        if (pids != null) {
+            nativePids = new ArrayList<>(pids.length);
+            for (int i : pids) {
+                nativePids.add(i);
+            }
+        }
+
+        // For background ANRs, don't pass the ProcessCpuTracker to
+        // avoid spending 1/2 second collecting stats to rank lastPids.
+        File tracesFile = ActivityManagerService.dumpStackTraces(firstPids,
+                (isSilentANR) ? null : processCpuTracker, (isSilentANR) ? null : lastPids,
+                nativePids);
+
+        String cpuInfo = null;
+        if (ActivityManagerService.MONITOR_CPU_USAGE) {
+            mService.updateCpuStatsNow();
+            synchronized (mService.mProcessCpuTracker) {
+                cpuInfo = mService.mProcessCpuTracker.printCurrentState(anrTime);
+            }
+            info.append(processCpuTracker.printCurrentLoad());
+            info.append(cpuInfo);
+        }
+
+        info.append(processCpuTracker.printCurrentState(anrTime));
+
+        Slog.e(TAG, info.toString());
+        if (tracesFile == null) {
+            // There is no trace file, so dump (only) the alleged culprit's threads to the log
+            Process.sendSignal(pid, Process.SIGNAL_QUIT);
+        }
+
+        StatsLog.write(StatsLog.ANR_OCCURRED, uid, processName,
+                activityShortComponentName == null ? "unknown": activityShortComponentName,
+                annotation,
+                (this.info != null) ? (this.info.isInstantApp()
+                        ? StatsLog.ANROCCURRED__IS_INSTANT_APP__TRUE
+                        : StatsLog.ANROCCURRED__IS_INSTANT_APP__FALSE)
+                        : StatsLog.ANROCCURRED__IS_INSTANT_APP__UNAVAILABLE,
+                isInterestingToUserLocked()
+                        ? StatsLog.ANROCCURRED__FOREGROUND_STATE__FOREGROUND
+                        : StatsLog.ANROCCURRED__FOREGROUND_STATE__BACKGROUND);
+        final ProcessRecord parentPr = parentProcess != null
+                ? (ProcessRecord) parentProcess.mOwner : null;
+        mService.addErrorToDropBox("anr", this, processName, activityShortComponentName,
+                parentShortComponentName, parentPr, annotation, cpuInfo, tracesFile, null);
+
+        if (mService.mActivityTaskManager.mController != null) {
+            try {
+                // 0 == show dialog, 1 = keep waiting, -1 = kill process immediately
+                int res = mService.mActivityTaskManager.mController.appNotResponding(
+                        processName, pid, info.toString());
+                if (res != 0) {
+                    if (res < 0 && pid != MY_PID) {
+                        kill("anr", true);
+                    } else {
+                        synchronized (mService) {
+                            mService.mServices.scheduleServiceTimeoutLocked(this);
+                        }
+                    }
+                    return;
+                }
+            } catch (RemoteException e) {
+                mService.mActivityTaskManager.mController = null;
+                Watchdog.getInstance().setActivityController(null);
+            }
+        }
+
+        synchronized (mService) {
+            mService.mBatteryStatsService.noteProcessAnr(processName, uid);
+
+            if (isSilentANR) {
+                kill("bg anr", true);
+                return;
+            }
+
+            // Set the app's notResponding state, and look up the errorReportReceiver
+            makeAppNotRespondingLocked(activityShortComponentName,
+                    annotation != null ? "ANR " + annotation : "ANR", info.toString());
+
+            // Bring up the infamous App Not Responding dialog
+            Message msg = Message.obtain();
+            msg.what = ActivityManagerService.SHOW_NOT_RESPONDING_UI_MSG;
+            msg.obj = new AppNotRespondingDialog.Data(this, aInfo, aboveSystem);
+
+            mService.mUiHandler.sendMessage(msg);
+        }
+    }
+
+    private void makeAppNotRespondingLocked(String activity, String shortMsg, String longMsg) {
+        setNotResponding(true);
+        notRespondingReport = mService.mAppErrors.generateProcessError(this,
+                ActivityManager.ProcessErrorStateInfo.NOT_RESPONDING,
+                activity, shortMsg, longMsg, null);
+        startAppProblemLocked();
+        getWindowProcessController().stopFreezingActivities();
+    }
+
+    void startAppProblemLocked() {
+        // If this app is not running under the current user, then we can't give it a report button
+        // because that would require launching the report UI under a different user.
+        errorReportReceiver = null;
+
+        for (int userId : mService.mUserController.getCurrentProfileIds()) {
+            if (this.userId == userId) {
+                errorReportReceiver = ApplicationErrorReport.getErrorReportReceiver(
+                        mService.mContext, info.packageName, info.flags);
+            }
+        }
+        mService.skipCurrentReceiverLocked(this);
+    }
+
+    private boolean isInterestingForBackgroundTraces() {
+        // The system_server is always considered interesting.
+        if (pid == MY_PID) {
+            return true;
+        }
+
+        // A package is considered interesting if any of the following is true :
+        //
+        // - It's displaying an activity.
+        // - It's the SystemUI.
+        // - It has an overlay or a top UI visible.
+        //
+        // NOTE: The check whether a given ProcessRecord belongs to the systemui
+        // process is a bit of a kludge, but the same pattern seems repeated at
+        // several places in the system server.
+        return isInterestingToUserLocked() ||
+                (info != null && "com.android.systemui".equals(info.packageName))
+                || (hasTopUi() || hasOverlayUi());
+    }
 }
diff --git a/services/core/java/com/android/server/am/TaskLaunchParamsModifier.java b/services/core/java/com/android/server/am/TaskLaunchParamsModifier.java
index eae28127..111adec 100644
--- a/services/core/java/com/android/server/am/TaskLaunchParamsModifier.java
+++ b/services/core/java/com/android/server/am/TaskLaunchParamsModifier.java
@@ -114,6 +114,26 @@
     private int calculate(TaskRecord task, ActivityInfo.WindowLayout layout,
             ActivityRecord activity, ActivityRecord source, ActivityOptions options,
             LaunchParams currentParams, LaunchParams outParams) {
+        final ActivityRecord root;
+        if (task != null) {
+            root = task.getRootActivity() == null ? activity : task.getRootActivity();
+        } else {
+            root = activity;
+        }
+
+        // TODO: Investigate whether we can safely ignore all cases where we don't have root
+        // activity available. Note we can't know if the bounds are valid if we're not sure of the
+        // requested orientation of the root activity. Therefore if we found such a case we may need
+        // to pass the activity into this modifier in that case.
+        if (root == null) {
+            // There is a case that can lead us here. The caller is moving the top activity that is
+            // in a task that has multiple activities to PIP mode. For that the caller is creating a
+            // new task to host the activity so that we only move the top activity to PIP mode and
+            // keep other activities in the previous task. There is no point to apply the launch
+            // logic in this case.
+            return RESULT_SKIP;
+        }
+
         // STEP 1: Determine the display to launch the activity/task.
         final int displayId = getPreferredLaunchDisplay(options, source, currentParams);
         outParams.mPreferredDisplayId = displayId;
@@ -123,12 +143,6 @@
                     + display.getWindowingMode());
         }
 
-        final ActivityRecord root;
-        if (task != null) {
-            root = (task.getRootActivity() == null ? activity : task.getRootActivity());
-        } else {
-            root = activity;
-        }
         // STEP 2: Resolve launch windowing mode.
         // STEP 2.1: Determine if any parameter has specified initial bounds. That might be the
         // launch bounds from activity options, or size/gravity passed in layout. It also treats the
diff --git a/services/core/java/com/android/server/am/UserController.java b/services/core/java/com/android/server/am/UserController.java
index 3a897c4..d2dd3db 100644
--- a/services/core/java/com/android/server/am/UserController.java
+++ b/services/core/java/com/android/server/am/UserController.java
@@ -2242,21 +2242,15 @@
         }
 
         void stackSupervisorRemoveUser(int userId) {
-            synchronized (mService) {
-                mService.mStackSupervisor.removeUserLocked(userId);
-            }
+            mService.mAtmInternal.removeUser(userId);
         }
 
         protected boolean stackSupervisorSwitchUser(int userId, UserState uss) {
-            synchronized (mService) {
-                return mService.mStackSupervisor.switchUserLocked(userId, uss);
-            }
+            return mService.mAtmInternal.switchUser(userId, uss);
         }
 
         protected void stackSupervisorResumeFocusedStackTopActivity() {
-            synchronized (mService) {
-                mService.mStackSupervisor.resumeFocusedStacksTopActivitiesLocked();
-            }
+            mService.mAtmInternal.resumeTopActivities(false /* scheduleIdle */);
         }
 
         protected void clearAllLockedTasks(String reason) {
diff --git a/services/core/java/com/android/server/am/WindowProcessController.java b/services/core/java/com/android/server/am/WindowProcessController.java
index a461d1c..1743dde 100644
--- a/services/core/java/com/android/server/am/WindowProcessController.java
+++ b/services/core/java/com/android/server/am/WindowProcessController.java
@@ -30,10 +30,14 @@
 import static com.android.server.am.ActivityStack.ActivityState.PAUSING;
 import static com.android.server.am.ActivityStack.ActivityState.RESUMED;
 import static com.android.server.am.ActivityStack.ActivityState.STOPPING;
+import static com.android.server.am.ActivityTaskManagerService.INSTRUMENTATION_KEY_DISPATCHING_TIMEOUT_MS;
+import static com.android.server.am.ActivityTaskManagerService.KEY_DISPATCHING_TIMEOUT_MS;
+import static com.android.server.am.ActivityTaskManagerService.RELAUNCH_REASON_NONE;
 
 import android.app.Activity;
 import android.app.ActivityThread;
 import android.app.IApplicationThread;
+import android.app.ProfilerInfo;
 import android.app.servertransaction.ConfigurationChangeItem;
 import android.content.Intent;
 import android.content.pm.ApplicationInfo;
@@ -44,6 +48,7 @@
 import android.util.Log;
 import android.util.Slog;
 
+import android.util.proto.ProtoOutputStream;
 import com.android.internal.app.HeavyWeightSwitcherActivity;
 import com.android.internal.util.function.pooled.PooledLambda;
 import com.android.server.wm.ConfigurationContainer;
@@ -127,6 +132,8 @@
     private volatile boolean mDebugging;
     // Active instrumentation running in process?
     private volatile boolean mInstrumenting;
+    // This process it perceptible by the user.
+    private volatile boolean mPerceptible;
     // Set to true when process was launched with a wrapper attached
     private volatile boolean mUsingWrapper;
 
@@ -337,6 +344,14 @@
         return mInstrumenting;
     }
 
+    public void setPerceptible(boolean perceptible) {
+        mPerceptible = perceptible;
+    }
+
+    boolean isPerceptible() {
+        return mPerceptible;
+    }
+
     @Override
     protected int getChildCount() {
         return 0;
@@ -604,12 +619,19 @@
             final int activitiesSize = mActivities.size();
             for (int i = activitiesSize - 1; i >= 0; i--) {
                 final ActivityRecord r = mActivities.get(i);
-                if (r.mRelaunchReason != ActivityRecord.RELAUNCH_REASON_NONE) {
+                if (r.mRelaunchReason != RELAUNCH_REASON_NONE) {
                     return r.mRelaunchReason;
                 }
             }
         }
-        return ActivityRecord.RELAUNCH_REASON_NONE;
+        return RELAUNCH_REASON_NONE;
+    }
+
+    public long getInputDispatchingTimeout() {
+        synchronized (mAtm.mGlobalLock) {
+            return isInstrumenting() || isUsingWrapper()
+                    ? INSTRUMENTATION_KEY_DISPATCHING_TIMEOUT_MS : KEY_DISPATCHING_TIMEOUT_MS;
+        }
     }
 
     void clearProfilerIfNeeded() {
@@ -653,6 +675,35 @@
         mAtm.mH.sendMessage(m);
     }
 
+    void clearWaitingToKill() {
+        if (mListener == null) return;
+        // Posting on handler so WM lock isn't held when we call into AM.
+        final Message m = PooledLambda.obtainMessage(
+                WindowProcessListener::clearWaitingToKill, mListener);
+        mAtm.mH.sendMessage(m);
+    }
+
+    void addPackage(String pkg, long versionCode) {
+        // TODO(b/80414790): Calling directly into AM for now which can lead to deadlock once we are
+        // using WM lock. Need to figure-out if it is okay to do this asynchronously.
+        if (mListener == null) return;
+        mListener.addPackage(pkg, versionCode);
+    }
+
+    ProfilerInfo onStartActivity(int topProcessState) {
+        // TODO(b/80414790): Calling directly into AM for now which can lead to deadlock once we are
+        // using WM lock. Need to figure-out if it is okay to do this asynchronously.
+        if (mListener == null) return null;
+        return mListener.onStartActivity(topProcessState);
+    }
+
+    public void appDied() {
+        // TODO(b/80414790): Calling directly into AM for now which can lead to deadlock once we are
+        // using WM lock. Need to figure-out if it is okay to do this asynchronously.
+        if (mListener == null) return;
+        mListener.appDied();
+    }
+
     @Override
     public void onConfigurationChanged(Configuration newGlobalConfig) {
         super.onConfigurationChanged(newGlobalConfig);
@@ -750,4 +801,9 @@
         pw.println(prefix + " mLastReportedConfiguration=" + mLastReportedConfiguration);
     }
 
+    void writeToProto(ProtoOutputStream proto, long fieldId) {
+        if (mListener != null) {
+            mListener.writeToProto(proto, fieldId);
+        }
+    }
 }
diff --git a/services/core/java/com/android/server/am/WindowProcessListener.java b/services/core/java/com/android/server/am/WindowProcessListener.java
index 2de3e37..4a7e6e8 100644
--- a/services/core/java/com/android/server/am/WindowProcessListener.java
+++ b/services/core/java/com/android/server/am/WindowProcessListener.java
@@ -16,6 +16,10 @@
 
 package com.android.server.am;
 
+import android.app.ProfilerInfo;
+import android.content.pm.ApplicationInfo;
+import android.util.proto.ProtoOutputStream;
+
 /**
  * Interface used by the owner/creator of a process that owns windows to listen to changes from the
  * WM side.
@@ -47,4 +51,17 @@
 
     /** Returns the total time (in milliseconds) spent executing in both user and system code. */
     long getCpuTime();
+
+    /** Clears the waiting to kill reason for this process. */
+    void clearWaitingToKill();
+
+    /** Adds the package to the process. */
+    void addPackage(String pkg, long versionCode);
+
+    /** Called when we are in the process on starting an activity. */
+    ProfilerInfo onStartActivity(int topProcessState);
+
+    /** App died :(...oh well */
+    void appDied();
+    void writeToProto(ProtoOutputStream proto, long fieldId);
 }
diff --git a/services/core/java/com/android/server/audio/AudioService.java b/services/core/java/com/android/server/audio/AudioService.java
index f0ff570..f56d8e6 100644
--- a/services/core/java/com/android/server/audio/AudioService.java
+++ b/services/core/java/com/android/server/audio/AudioService.java
@@ -4682,22 +4682,15 @@
         }
     }
 
-    @Override
-    public void setHearingAidDeviceConnectionState(BluetoothDevice device, int state)
-    {
-        mDeviceLogger.log((new AudioEventLogger.StringEvent(
-                "setHearingAidDeviceConnectionState state=" + state
-                        + " addr=" + device.getAddress())).printLog(TAG));
-
-        setBluetoothHearingAidDeviceConnectionState(
-                device, state,  false /* suppressNoisyIntent */, AudioSystem.DEVICE_NONE);
-    }
-
     public int setBluetoothHearingAidDeviceConnectionState(
             BluetoothDevice device, int state, boolean suppressNoisyIntent,
             int musicDevice)
     {
         int delay;
+        mDeviceLogger.log((new AudioEventLogger.StringEvent(
+                "setHearingAidDeviceConnectionState state=" + state
+                            + " addr=" + device.getAddress()
+                            + " supprNoisy=" + suppressNoisyIntent)).printLog(TAG));
         synchronized (mConnectedDevices) {
             if (!suppressNoisyIntent) {
                 int intState = (state == BluetoothHearingAid.STATE_CONNECTED) ? 1 : 0;
@@ -5887,6 +5880,7 @@
                                    address));
         sendMsg(mAudioHandler, MSG_ACCESSORY_PLUG_MEDIA_UNMUTE, SENDMSG_QUEUE,
                 AudioSystem.DEVICE_OUT_BLUETOOTH_A2DP, 0, null, 0);
+        setCurrentAudioRouteNameIfPossible(name);
     }
 
     private void onSendBecomingNoisyIntent() {
@@ -5908,7 +5902,7 @@
         mConnectedDevices.remove(
                 makeDeviceListKey(AudioSystem.DEVICE_OUT_BLUETOOTH_A2DP, address));
         // Remove A2DP routes as well
-        setCurrentAudioRouteName(null);
+        setCurrentAudioRouteNameIfPossible(null);
         if (mDockAddress == address) {
             mDockAddress = null;
         }
@@ -5975,6 +5969,10 @@
                                    address));
         sendMsg(mAudioHandler, MSG_ACCESSORY_PLUG_MEDIA_UNMUTE, SENDMSG_QUEUE,
                 AudioSystem.DEVICE_OUT_HEARING_AID, 0, null, 0);
+        sendMsg(mAudioHandler, MSG_SET_DEVICE_VOLUME, SENDMSG_QUEUE,
+                            AudioSystem.DEVICE_OUT_HEARING_AID, 0,
+                            mStreamStates[AudioSystem.STREAM_MUSIC], 0);
+        setCurrentAudioRouteNameIfPossible(name);
     }
 
     // must be called synchronized on mConnectedDevices
@@ -5984,7 +5982,7 @@
         mConnectedDevices.remove(
                 makeDeviceListKey(AudioSystem.DEVICE_OUT_HEARING_AID, address));
         // Remove Hearing Aid routes as well
-        setCurrentAudioRouteName(null);
+        setCurrentAudioRouteNameIfPossible(null);
     }
 
     // must be called synchronized on mConnectedDevices
@@ -6029,7 +6027,6 @@
                 } else {
                     makeA2dpDeviceUnavailableNow(address);
                 }
-                setCurrentAudioRouteName(null);
             } else if (!isConnected && state == BluetoothProfile.STATE_CONNECTED) {
                 if (btDevice.isBluetoothDock()) {
                     // this could be a reconnection after a transient disconnection
@@ -6053,7 +6050,6 @@
                 }
                 makeA2dpDeviceAvailable(address, btDevice.getName(),
                         "onSetA2dpSinkConnectionState");
-                setCurrentAudioRouteName(btDevice.getAliasName());
             }
         }
     }
@@ -6105,25 +6101,35 @@
 
             if (isConnected && state != BluetoothProfile.STATE_CONNECTED) {
                 makeHearingAidDeviceUnavailable(address);
-                setCurrentAudioRouteName(null);
             } else if (!isConnected && state == BluetoothProfile.STATE_CONNECTED) {
                 makeHearingAidDeviceAvailable(address, btDevice.getName(),
                         "onSetHearingAidConnectionState");
-                setCurrentAudioRouteName(btDevice.getAliasName());
             }
         }
     }
 
-    private void setCurrentAudioRouteName(String name){
+    private void setCurrentAudioRouteNameIfPossible(String name) {
         synchronized (mCurAudioRoutes) {
             if (!TextUtils.equals(mCurAudioRoutes.bluetoothName, name)) {
-                mCurAudioRoutes.bluetoothName = name;
-                sendMsg(mAudioHandler, MSG_REPORT_NEW_ROUTES,
-                        SENDMSG_NOOP, 0, 0, null, 0);
+                if (name != null || !isCurrentDeviceConnected()) {
+                    mCurAudioRoutes.bluetoothName = name;
+                    sendMsg(mAudioHandler, MSG_REPORT_NEW_ROUTES,
+                            SENDMSG_NOOP, 0, 0, null, 0);
+                }
             }
         }
     }
 
+    private boolean isCurrentDeviceConnected() {
+        for (int i = 0; i < mConnectedDevices.size(); i++) {
+            DeviceListSpec deviceSpec = mConnectedDevices.valueAt(i);
+            if (TextUtils.equals(deviceSpec.mDeviceName, mCurAudioRoutes.bluetoothName)) {
+                return true;
+            }
+        }
+        return false;
+    }
+
     private void onBluetoothA2dpDeviceConfigChange(BluetoothDevice btDevice)
     {
         if (DEBUG_DEVICES) {
diff --git a/services/core/java/com/android/server/hdmi/HdmiControlService.java b/services/core/java/com/android/server/hdmi/HdmiControlService.java
index c16d3cd..b148a2f 100644
--- a/services/core/java/com/android/server/hdmi/HdmiControlService.java
+++ b/services/core/java/com/android/server/hdmi/HdmiControlService.java
@@ -307,19 +307,19 @@
     private final class CecMessageBuffer {
         private List<HdmiCecMessage> mBuffer = new ArrayList<>();
 
-        public void bufferMessage(HdmiCecMessage message) {
+        public boolean bufferMessage(HdmiCecMessage message) {
             switch (message.getOpcode()) {
                 case Constants.MESSAGE_ACTIVE_SOURCE:
                     bufferActiveSource(message);
-                    break;
+                    return true;
                 case Constants.MESSAGE_IMAGE_VIEW_ON:
                 case Constants.MESSAGE_TEXT_VIEW_ON:
                     bufferImageOrTextViewOn(message);
-                    break;
+                    return true;
                     // Add here if new message that needs to buffer
                 default:
                     // Do not need to buffer messages other than above
-                    break;
+                    return false;
             }
         }
 
@@ -906,10 +906,6 @@
     @ServiceThreadOnly
     boolean handleCecCommand(HdmiCecMessage message) {
         assertRunOnServiceThread();
-        if (!mAddressAllocated) {
-            mCecMessageBuffer.bufferMessage(message);
-            return true;
-        }
         int errorCode = mMessageValidator.isValid(message);
         if (errorCode != HdmiCecMessageValidator.OK) {
             // We'll not response on the messages with the invalid source or destination
@@ -919,7 +915,12 @@
             }
             return true;
         }
-        return dispatchMessageToLocalDevice(message);
+
+        if (dispatchMessageToLocalDevice(message)) {
+            return true;
+        }
+
+        return (!mAddressAllocated) ? mCecMessageBuffer.bufferMessage(message) : false;
     }
 
     void enableAudioReturnChannel(int portId, boolean enabled) {
diff --git a/services/core/java/com/android/server/hdmi/SystemAudioAutoInitiationAction.java b/services/core/java/com/android/server/hdmi/SystemAudioAutoInitiationAction.java
index d347a91..f7e871d 100644
--- a/services/core/java/com/android/server/hdmi/SystemAudioAutoInitiationAction.java
+++ b/services/core/java/com/android/server/hdmi/SystemAudioAutoInitiationAction.java
@@ -50,8 +50,7 @@
             @Override
             public void onSendCompleted(int error) {
                 if (error != SendMessageResult.SUCCESS) {
-                    tv().setSystemAudioMode(false);
-                    finish();
+                    handleSystemAudioModeStatusTimeout();
                 }
             }
         });
diff --git a/services/core/java/com/android/server/input/InputManagerService.java b/services/core/java/com/android/server/input/InputManagerService.java
index 4913e8b..c20079e 100644
--- a/services/core/java/com/android/server/input/InputManagerService.java
+++ b/services/core/java/com/android/server/input/InputManagerService.java
@@ -197,7 +197,7 @@
     private static native boolean nativeHasKeys(long ptr,
             int deviceId, int sourceMask, int[] keyCodes, boolean[] keyExists);
     private static native void nativeRegisterInputChannel(long ptr, InputChannel inputChannel,
-            InputWindowHandle inputWindowHandle, boolean monitor);
+            InputWindowHandle inputWindowHandle, int displayId);
     private static native void nativeUnregisterInputChannel(long ptr, InputChannel inputChannel);
     private static native void nativeSetInputFilterEnabled(long ptr, boolean enable);
     private static native int nativeInjectInputEvent(long ptr, InputEvent event,
@@ -473,15 +473,21 @@
     /**
      * Creates an input channel that will receive all input from the input dispatcher.
      * @param inputChannelName The input channel name.
+     * @param displayId Target display id.
      * @return The input channel.
      */
-    public InputChannel monitorInput(String inputChannelName) {
+    public InputChannel monitorInput(String inputChannelName, int displayId) {
         if (inputChannelName == null) {
             throw new IllegalArgumentException("inputChannelName must not be null.");
         }
 
+        if (displayId < Display.DEFAULT_DISPLAY) {
+            throw new IllegalArgumentException("displayId must >= 0.");
+        }
+
         InputChannel[] inputChannels = InputChannel.openInputChannelPair(inputChannelName);
-        nativeRegisterInputChannel(mPtr, inputChannels[0], null, true);
+        // Register channel for monitor.
+        nativeRegisterInputChannel(mPtr, inputChannels[0], null, displayId);
         inputChannels[0].dispose(); // don't need to retain the Java object reference
         return inputChannels[1];
     }
@@ -498,7 +504,8 @@
             throw new IllegalArgumentException("inputChannel must not be null.");
         }
 
-        nativeRegisterInputChannel(mPtr, inputChannel, inputWindowHandle, false);
+        // Register channel for normal.
+        nativeRegisterInputChannel(mPtr, inputChannel, inputWindowHandle, Display.INVALID_DISPLAY);
     }
 
     /**
diff --git a/services/core/java/com/android/server/inputmethod/InputMethodManagerService.java b/services/core/java/com/android/server/inputmethod/InputMethodManagerService.java
index 991ecb8..d57214e 100644
--- a/services/core/java/com/android/server/inputmethod/InputMethodManagerService.java
+++ b/services/core/java/com/android/server/inputmethod/InputMethodManagerService.java
@@ -15,7 +15,6 @@
 
 package com.android.server.inputmethod;
 
-import static android.view.Display.DEFAULT_DISPLAY;
 import static android.view.Display.INVALID_DISPLAY;
 import static android.view.WindowManager.LayoutParams.PRIVATE_FLAG_SHOW_FOR_ALL_USERS;
 import static android.view.WindowManager.LayoutParams.TYPE_INPUT_METHOD;
@@ -110,10 +109,12 @@
 import android.view.ViewGroup;
 import android.view.Window;
 import android.view.WindowManager;
+import android.view.WindowManager.LayoutParams.SoftInputModeFlags;
 import android.view.inputmethod.EditorInfo;
 import android.view.inputmethod.InputBinding;
 import android.view.inputmethod.InputConnection;
 import android.view.inputmethod.InputConnectionInspector;
+import android.view.inputmethod.InputConnectionInspector.MissingMethodFlags;
 import android.view.inputmethod.InputMethod;
 import android.view.inputmethod.InputMethodInfo;
 import android.view.inputmethod.InputMethodManager;
@@ -130,6 +131,9 @@
 import com.android.internal.content.PackageMonitor;
 import com.android.internal.inputmethod.IInputContentUriToken;
 import com.android.internal.inputmethod.IInputMethodPrivilegedOperations;
+import com.android.internal.inputmethod.InputMethodDebug;
+import com.android.internal.inputmethod.StartInputReason;
+import com.android.internal.inputmethod.UnbindReason;
 import com.android.internal.messages.nano.SystemMessageProto.SystemMessage;
 import com.android.internal.notification.SystemNotificationChannels;
 import com.android.internal.os.HandlerCaller;
@@ -145,7 +149,6 @@
 import com.android.internal.view.IInputMethodSession;
 import com.android.internal.view.IInputSessionCallback;
 import com.android.internal.view.InputBindResult;
-import com.android.internal.view.InputMethodClient;
 import com.android.server.EventLogTags;
 import com.android.server.LocalServices;
 import com.android.server.SystemService;
@@ -501,6 +504,7 @@
      *
      * @see #mCurFocusedWindow
      */
+    @SoftInputModeFlags
     int mCurFocusedWindowSoftInputMode;
 
     /**
@@ -518,6 +522,7 @@
      *
      * @see android.view.inputmethod.InputConnectionInspector.MissingMethodFlags
      */
+    @MissingMethodFlags
     int mCurInputContextMissingMethods;
 
     /**
@@ -691,20 +696,21 @@
         final IBinder mImeToken;
         @NonNull
         final String mImeId;
-        // @InputMethodClient.StartInputReason
+        @StartInputReason
         final int mStartInputReason;
         final boolean mRestarting;
         @Nullable
         final IBinder mTargetWindow;
         @NonNull
         final EditorInfo mEditorInfo;
+        @SoftInputModeFlags
         final int mTargetWindowSoftInputMode;
         final int mClientBindSequenceNumber;
 
         StartInputInfo(@NonNull IBinder imeToken, @NonNull String imeId,
-                /* @InputMethodClient.StartInputReason */ int startInputReason, boolean restarting,
+                @StartInputReason int startInputReason, boolean restarting,
                 @Nullable IBinder targetWindow, @NonNull EditorInfo editorInfo,
-                int targetWindowSoftInputMode, int clientBindSequenceNumber) {
+                @SoftInputModeFlags int targetWindowSoftInputMode, int clientBindSequenceNumber) {
             mSequenceNumber = sSequenceNumber.getAndIncrement();
             mTimestamp = SystemClock.uptimeMillis();
             mWallTime = System.currentTimeMillis();
@@ -772,13 +778,14 @@
             String mImeTokenString;
             @NonNull
             String mImeId;
-            /* @InputMethodClient.StartInputReason */
+            @StartInputReason
             int mStartInputReason;
             boolean mRestarting;
             @NonNull
             String mTargetWindowString;
             @NonNull
             EditorInfo mEditorInfo;
+            @SoftInputModeFlags
             int mTargetWindowSoftInputMode;
             int mClientBindSequenceNumber;
 
@@ -835,7 +842,7 @@
                 pw.println(" time=" + dataFormat.format(new Date(entry.mWallTime))
                         + " (timestamp=" + entry.mTimestamp + ")"
                         + " reason="
-                        + InputMethodClient.getStartInputReason(entry.mStartInputReason)
+                        + InputMethodDebug.startInputReasonToString(entry.mStartInputReason)
                         + " restarting=" + entry.mRestarting);
 
                 pw.print(prefix);
@@ -847,7 +854,7 @@
                         + " clientBindSeq=" + entry.mClientBindSequenceNumber);
 
                 pw.print(prefix);
-                pw.println(" softInputMode=" + InputMethodClient.softInputModeToString(
+                pw.println(" softInputMode=" + InputMethodDebug.softInputModeToString(
                                 entry.mTargetWindowSoftInputMode));
 
                 pw.print(prefix);
@@ -1500,7 +1507,7 @@
         // TODO: Is it really possible that switchUserLocked() happens before system ready?
         if (mSystemReady) {
             hideCurrentInputLocked(0, null);
-            resetCurrentMethodAndClient(InputMethodClient.UNBIND_REASON_SWITCH_USER);
+            resetCurrentMethodAndClient(UnbindReason.SWITCH_USER);
             buildInputMethodListLocked(initialUserSwitch);
             if (TextUtils.isEmpty(mSettings.getSelectedInputMethod())) {
                 // This is the first time of the user switch and
@@ -1508,11 +1515,6 @@
                 resetDefaultImeLocked(mContext);
             }
             updateFromSettingsLocked(true);
-            try {
-                startInputInnerLocked();
-            } catch (RuntimeException e) {
-                Slog.w(TAG, "Unexpected exception", e);
-            }
         }
 
         if (initialUserSwitch) {
@@ -1588,12 +1590,6 @@
                 InputMethodUtils.setNonSelectedSystemImesDisabledUntilUsed(mIPackageManager,
                         mSettings.getEnabledInputMethodListLocked(), currentUserId,
                         mContext.getBasePackageName());
-
-                try {
-                    startInputInnerLocked();
-                } catch (RuntimeException e) {
-                    Slog.w(TAG, "Unexpected exception", e);
-                }
             }
         }
     }
@@ -1741,7 +1737,7 @@
      * {@link InputMethodManagerService}.
      *
      * <p>As a general principle, IPCs from the application process that take
-     * {@link InputMethodClient} will be rejected without this step.</p>
+     * {@link IInputMethodClient} will be rejected without this step.</p>
      *
      * @param client {@link android.os.Binder} proxy that is associated with the singleton instance
      *               of {@link android.view.inputmethod.InputMethodManager} that runs on the client
@@ -1820,8 +1816,7 @@
          }
     }
 
-    void unbindCurrentClientLocked(
-            /* @InputMethodClient.UnbindReason */ final int unbindClientReason) {
+    void unbindCurrentClientLocked(@UnbindReason int unbindClientReason) {
         if (mCurClient != null) {
             if (DEBUG) Slog.v(TAG, "unbindCurrentInputLocked: client="
                     + mCurClient.client.asBinder());
@@ -1867,8 +1862,7 @@
 
     @GuardedBy("mMethodMap")
     @NonNull
-    InputBindResult attachNewInputLocked(
-            /* @InputMethodClient.StartInputReason */ final int startInputReason, boolean initial) {
+    InputBindResult attachNewInputLocked(@StartInputReason int startInputReason, boolean initial) {
         if (!mBoundToMethod) {
             executeOrSendMessage(mCurMethod, mCaller.obtainMessageOO(
                     MSG_BIND_INPUT, mCurMethod, mCurClient.binding));
@@ -1898,14 +1892,21 @@
     @GuardedBy("mMethodMap")
     @NonNull
     InputBindResult startInputUncheckedLocked(@NonNull ClientState cs, IInputContext inputContext,
-            /* @InputConnectionInspector.missingMethods */ final int missingMethods,
-            @NonNull EditorInfo attribute, int controlFlags,
-            /* @InputMethodClient.StartInputReason */ final int startInputReason) {
+            @MissingMethodFlags int missingMethods, @NonNull EditorInfo attribute, int controlFlags,
+            @StartInputReason int startInputReason) {
         // If no method is currently selected, do nothing.
         if (mCurMethodId == null) {
             return InputBindResult.NO_IME;
         }
 
+        if (!mSystemReady) {
+            // If the system is not yet ready, we shouldn't be running third
+            // party code.
+            return new InputBindResult(
+                    InputBindResult.ResultCode.ERROR_SYSTEM_NOT_READY,
+                    null, null, mCurMethodId, mCurSeq);
+        }
+
         if (!InputMethodUtils.checkIfPackageBelongsToUid(mAppOpsManager, cs.uid,
                 attribute.packageName)) {
             Slog.e(TAG, "Rejecting this client as it reported an invalid package name."
@@ -1913,12 +1914,19 @@
             return InputBindResult.INVALID_PACKAGE_NAME;
         }
 
+        if (!mWindowManagerInternal.isUidAllowedOnDisplay(cs.selfReportedDisplayId, cs.uid)) {
+            // Wait, the client no longer has access to the display.
+            return InputBindResult.INVALID_DISPLAY_ID;
+        }
+        // Now that the display ID is validated, we trust cs.selfReportedDisplayId for this session.
+        final int displayIdToShowIme = cs.selfReportedDisplayId;
+
         if (mCurClient != cs) {
             // Was the keyguard locked when switching over to the new client?
             mCurClientInKeyguard = isKeyguardLocked();
             // If the client is changing, we need to switch over to the new
             // one.
-            unbindCurrentClientLocked(InputMethodClient.UNBIND_REASON_SWITCH_CLIENT);
+            unbindCurrentClientLocked(UnbindReason.SWITCH_CLIENT);
             if (DEBUG) Slog.v(TAG, "switching to client: client="
                     + cs.client.asBinder() + " keyguard=" + mCurClientInKeyguard);
 
@@ -1939,8 +1947,8 @@
         // Check if the input method is changing.
         // We expect the caller has already verified that the client is allowed to access this
         // display ID.
-        final int displayId = mCurFocusedWindowClient.selfReportedDisplayId;
-        if (mCurId != null && mCurId.equals(mCurMethodId) && displayId == mCurTokenDisplayId) {
+        if (mCurId != null && mCurId.equals(mCurMethodId)
+                && displayIdToShowIme == mCurTokenDisplayId) {
             if (cs.curSession != null) {
                 // Fast case: if we are already connected to the input method,
                 // then just return it.
@@ -1974,23 +1982,6 @@
             }
         }
 
-        return startInputInnerLocked();
-    }
-
-    @GuardedBy("mMethodMap")
-    InputBindResult startInputInnerLocked() {
-        if (mCurMethodId == null) {
-            return InputBindResult.NO_IME;
-        }
-
-        if (!mSystemReady) {
-            // If the system is not yet ready, we shouldn't be running third
-            // party code.
-            return new InputBindResult(
-                    InputBindResult.ResultCode.ERROR_SYSTEM_NOT_READY,
-                    null, null, mCurMethodId, mCurSeq);
-        }
-
         InputMethodInfo info = mMethodMap.get(mCurMethodId);
         if (info == null) {
             throw new IllegalArgumentException("Unknown id: " + mCurMethodId);
@@ -2005,26 +1996,12 @@
         mCurIntent.putExtra(Intent.EXTRA_CLIENT_INTENT, PendingIntent.getActivity(
                 mContext, 0, new Intent(Settings.ACTION_INPUT_METHOD_SETTINGS), 0));
 
-        if (mCurFocusedWindowClient == null) {
-            // This can happen when called from systemRunning() or switchUserLocked(). In this case,
-            // there really isn't an actual client yet.  Let IME be on the default display.
-            // TODO(Bug 117730713): Check if really need to bind to the IME or not.
-            mCurTokenDisplayId = DEFAULT_DISPLAY;
-        } else {
-            if (!mWindowManagerInternal.isUidAllowedOnDisplay(
-                    mCurFocusedWindowClient.selfReportedDisplayId, mCurFocusedWindowClient.uid)) {
-                // Wait, the client no longer has access to the display.
-                return InputBindResult.INVALID_DISPLAY_ID;
-            }
-            final int displayId = mCurFocusedWindowClient.selfReportedDisplayId;
-            mCurTokenDisplayId = (displayId != INVALID_DISPLAY) ? displayId : DEFAULT_DISPLAY;
-        }
-
         if (bindCurrentInputMethodServiceLocked(mCurIntent, this, IME_CONNECTION_BIND_FLAGS)) {
             mLastBindTime = SystemClock.uptimeMillis();
             mHaveConnection = true;
             mCurId = info.getId();
             mCurToken = new Binder();
+            mCurTokenDisplayId = displayIdToShowIme;
             try {
                 if (DEBUG) {
                     Slog.v(TAG, "Adding window token: " + mCurToken + " for display: "
@@ -2043,10 +2020,6 @@
     }
 
     @Override
-    public void finishInput(IInputMethodClient client) {
-    }
-
-    @Override
     public void onServiceConnected(ComponentName name, IBinder service) {
         synchronized (mMethodMap) {
             if (mCurIntent != null && name.equals(mCurIntent.getComponent())) {
@@ -2078,7 +2051,7 @@
                     mCurClient.curSession = new SessionState(mCurClient,
                             method, session, channel);
                     InputBindResult res = attachNewInputLocked(
-                            InputMethodClient.START_INPUT_REASON_SESSION_CREATED_BY_IME, true);
+                            StartInputReason.SESSION_CREATED_BY_IME, true);
                     if (res.method != null) {
                         executeOrSendMessage(mCurClient.client, mCaller.obtainMessageOO(
                                 MSG_BIND_CLIENT, mCurClient.client, res));
@@ -2120,8 +2093,7 @@
         clearCurMethodLocked();
     }
 
-    void resetCurrentMethodAndClient(
-            /* @InputMethodClient.UnbindReason */ final int unbindClientReason) {
+    void resetCurrentMethodAndClient(@UnbindReason int unbindClientReason) {
         mCurMethodId = null;
         unbindCurrentMethodLocked();
         unbindCurrentClientLocked(unbindClientReason);
@@ -2198,7 +2170,7 @@
                 mLastBindTime = SystemClock.uptimeMillis();
                 mShowRequested = mInputShown;
                 mInputShown = false;
-                unbindCurrentClientLocked(InputMethodClient.UNBIND_REASON_DISCONNECT_IME);
+                unbindCurrentClientLocked(UnbindReason.DISCONNECT_IME);
             }
         }
     }
@@ -2509,12 +2481,12 @@
                 setInputMethodLocked(id, mSettings.getSelectedInputMethodSubtypeId(id));
             } catch (IllegalArgumentException e) {
                 Slog.w(TAG, "Unknown input method from prefs: " + id, e);
-                resetCurrentMethodAndClient(InputMethodClient.UNBIND_REASON_SWITCH_IME_FAILED);
+                resetCurrentMethodAndClient(UnbindReason.SWITCH_IME_FAILED);
             }
             mShortcutInputMethodsAndSubtypes.clear();
         } else {
             // There is no longer an input method set, so stop any current one.
-            resetCurrentMethodAndClient(InputMethodClient.UNBIND_REASON_NO_IME);
+            resetCurrentMethodAndClient(UnbindReason.NO_IME);
         }
         // Here is not the perfect place to reset the switching controller. Ideally
         // mSwitchingController and mSettings should be able to share the same state.
@@ -2592,7 +2564,7 @@
                 intent.putExtra("input_method_id", id);
                 mContext.sendBroadcastAsUser(intent, UserHandle.CURRENT);
             }
-            unbindCurrentClientLocked(InputMethodClient.UNBIND_REASON_SWITCH_IME);
+            unbindCurrentClientLocked(UnbindReason.SWITCH_IME);
         } finally {
             Binder.restoreCallingIdentity(ident);
         }
@@ -2766,11 +2738,10 @@
     @NonNull
     @Override
     public InputBindResult startInputOrWindowGainedFocus(
-            /* @InputMethodClient.StartInputReason */ final int startInputReason,
-            IInputMethodClient client, IBinder windowToken, int controlFlags, int softInputMode,
-            int windowFlags, @Nullable EditorInfo attribute, IInputContext inputContext,
-            /* @InputConnectionInspector.missingMethods */ final int missingMethods,
-            int unverifiedTargetSdkVersion) {
+            @StartInputReason int startInputReason, IInputMethodClient client, IBinder windowToken,
+            int controlFlags, @SoftInputModeFlags int softInputMode, int windowFlags,
+            @Nullable EditorInfo attribute, IInputContext inputContext,
+            @MissingMethodFlags int missingMethods, int unverifiedTargetSdkVersion) {
         if (windowToken == null) {
             Slog.e(TAG, "windowToken cannot be null.");
             return InputBindResult.NULL;
@@ -2781,7 +2752,7 @@
         if (result == null) {
             // This must never happen, but just in case.
             Slog.wtf(TAG, "InputBindResult is @NonNull. startInputReason="
-                    + InputMethodClient.getStartInputReason(startInputReason)
+                    + InputMethodDebug.startInputReasonToString(startInputReason)
                     + " windowFlags=#" + Integer.toHexString(windowFlags)
                     + " editorInfo=" + attribute);
             return InputBindResult.NULL;
@@ -2791,12 +2762,10 @@
 
     @NonNull
     private InputBindResult startInputOrWindowGainedFocusInternal(
-            /* @InputMethodClient.StartInputReason */ final int startInputReason,
-            IInputMethodClient client, @NonNull IBinder windowToken, int controlFlags,
-            /* @android.view.WindowManager.LayoutParams.SoftInputModeFlags */ int softInputMode,
+            @StartInputReason int startInputReason, IInputMethodClient client,
+            @NonNull IBinder windowToken, int controlFlags, @SoftInputModeFlags int softInputMode,
             int windowFlags, EditorInfo attribute, IInputContext inputContext,
-            /* @InputConnectionInspector.missingMethods */  final int missingMethods,
-            int unverifiedTargetSdkVersion) {
+            @MissingMethodFlags int missingMethods, int unverifiedTargetSdkVersion) {
         // Needs to check the validity before clearing calling identity
         final boolean calledFromValidUser = calledFromValidUser();
         InputBindResult res = null;
@@ -2806,14 +2775,14 @@
                     mWindowManagerInternal.getDisplayIdForWindow(windowToken);
             synchronized (mMethodMap) {
                 if (DEBUG) Slog.v(TAG, "startInputOrWindowGainedFocusInternal: reason="
-                        + InputMethodClient.getStartInputReason(startInputReason)
+                        + InputMethodDebug.startInputReasonToString(startInputReason)
                         + " client=" + client.asBinder()
                         + " inputContext=" + inputContext
                         + " missingMethods="
                         + InputConnectionInspector.getMissingMethodFlagsAsString(missingMethods)
                         + " attribute=" + attribute
                         + " controlFlags=#" + Integer.toHexString(controlFlags)
-                        + " softInputMode=" + InputMethodClient.softInputModeToString(softInputMode)
+                        + " softInputMode=" + InputMethodDebug.softInputModeToString(softInputMode)
                         + " windowFlags=#" + Integer.toHexString(windowFlags)
                         + " unverifiedTargetSdkVersion=" + unverifiedTargetSdkVersion);
 
@@ -4611,7 +4580,7 @@
             p.println("  mCurClient=" + client + " mCurSeq=" + mCurSeq);
             p.println("  mCurFocusedWindow=" + mCurFocusedWindow
                     + " softInputMode=" +
-                    InputMethodClient.softInputModeToString(mCurFocusedWindowSoftInputMode)
+                    InputMethodDebug.softInputModeToString(mCurFocusedWindowSoftInputMode)
                     + " client=" + mCurFocusedWindowClient);
             focusedWindowClient = mCurFocusedWindowClient;
             p.println("  mCurId=" + mCurId + " mHaveConnection=" + mHaveConnection
diff --git a/services/core/java/com/android/server/job/controllers/JobStatus.java b/services/core/java/com/android/server/job/controllers/JobStatus.java
index 3f8941d..4ece538d 100644
--- a/services/core/java/com/android/server/job/controllers/JobStatus.java
+++ b/services/core/java/com/android/server/job/controllers/JobStatus.java
@@ -57,6 +57,8 @@
  * This isn't strictly necessary because each controller is only interested in a specific field,
  * and the receivers that are listening for global state change will all run on the main looper,
  * but we don't enforce that so this is safer.
+ *
+ * Test: atest com.android.server.job.controllers.JobStatusTest
  * @hide
  */
 public final class JobStatus {
@@ -154,7 +156,9 @@
 
     // Constraints.
     final int requiredConstraints;
+    private final int mRequiredConstraintsOfInterest;
     int satisfiedConstraints = 0;
+    private int mSatisfiedConstraintsOfInterest = 0;
 
     // Set to true if doze constraint was satisfied due to app being whitelisted.
     public boolean dozeWhitelisted;
@@ -265,6 +269,28 @@
 
     private long totalNetworkBytes = JobInfo.NETWORK_BYTES_UNKNOWN;
 
+    /////// Booleans that track if a job is ready to run. They should be updated whenever dependent
+    /////// states change.
+
+    /**
+     * The deadline for the job has passed. This is only good for non-periodic jobs. A periodic job
+     * should only run if its constraints are satisfied.
+     * Computed as: NOT periodic AND has deadline constraint AND deadline constraint satisfied.
+     */
+    private boolean mReadyDeadlineSatisfied;
+
+    /**
+     * The device isn't Dozing or this job will be in the foreground. This implicit constraint must
+     * be satisfied.
+     */
+    private boolean mReadyNotDozing;
+
+    /**
+     * The job is not restricted from running in the background (due to Battery Saver). This
+     * implicit constraint must be satisfied.
+     */
+    private boolean mReadyNotRestrictedInBg;
+
     /** Provide a handle to the service that this job will be run on. */
     public int getServiceToken() {
         return callingUid;
@@ -349,6 +375,8 @@
             requiredConstraints |= CONSTRAINT_CONTENT_TRIGGER;
         }
         this.requiredConstraints = requiredConstraints;
+        mRequiredConstraintsOfInterest = requiredConstraints & CONSTRAINTS_OF_INTEREST;
+        mReadyNotDozing = (job.getFlags() & JobInfo.FLAG_WILL_BE_FOREGROUND) != 0;
 
         mLastSuccessfulRunTime = lastSuccessfulRunTime;
         mLastFailedRunTime = lastFailedRunTime;
@@ -865,7 +893,12 @@
     }
 
     boolean setDeadlineConstraintSatisfied(boolean state) {
-        return setConstraintSatisfied(CONSTRAINT_DEADLINE, state);
+        if (setConstraintSatisfied(CONSTRAINT_DEADLINE, state)) {
+            // The constraint was changed. Update the ready flag.
+            mReadyDeadlineSatisfied = !job.isPeriodic() && hasDeadlineConstraint() && state;
+            return true;
+        }
+        return false;
     }
 
     boolean setIdleConstraintSatisfied(boolean state) {
@@ -882,11 +915,21 @@
 
     boolean setDeviceNotDozingConstraintSatisfied(boolean state, boolean whitelisted) {
         dozeWhitelisted = whitelisted;
-        return setConstraintSatisfied(CONSTRAINT_DEVICE_NOT_DOZING, state);
+        if (setConstraintSatisfied(CONSTRAINT_DEVICE_NOT_DOZING, state)) {
+            // The constraint was changed. Update the ready flag.
+            mReadyNotDozing = state || (job.getFlags() & JobInfo.FLAG_WILL_BE_FOREGROUND) != 0;
+            return true;
+        }
+        return false;
     }
 
     boolean setBackgroundNotRestrictedConstraintSatisfied(boolean state) {
-        return setConstraintSatisfied(CONSTRAINT_BACKGROUND_NOT_RESTRICTED, state);
+        if (setConstraintSatisfied(CONSTRAINT_BACKGROUND_NOT_RESTRICTED, state)) {
+            // The constraint was changed. Update the ready flag.
+            mReadyNotRestrictedInBg = state;
+            return true;
+        }
+        return false;
     }
 
     boolean setUidActive(final boolean newActiveState) {
@@ -903,6 +946,7 @@
             return false;
         }
         satisfiedConstraints = (satisfiedConstraints&~constraint) | (state ? constraint : 0);
+        mSatisfiedConstraintsOfInterest = satisfiedConstraints & CONSTRAINTS_OF_INTEREST;
         return true;
     }
 
@@ -933,24 +977,15 @@
     /**
      * @return Whether or not this job is ready to run, based on its requirements. This is true if
      * the constraints are satisfied <strong>or</strong> the deadline on the job has expired.
-     * TODO: This function is called a *lot*.  We should probably just have it check an
-     * already-computed boolean, which we updated whenever we see one of the states it depends
-     * on here change.
      */
     public boolean isReady() {
         // Deadline constraint trumps other constraints (except for periodic jobs where deadline
         // is an implementation detail. A periodic job should only run if its constraints are
         // satisfied).
-        // AppNotIdle implicit constraint must be satisfied
         // DeviceNotDozing implicit constraint must be satisfied
         // NotRestrictedInBackground implicit constraint must be satisfied
-        final boolean deadlineSatisfied = (!job.isPeriodic() && hasDeadlineConstraint()
-                && (satisfiedConstraints & CONSTRAINT_DEADLINE) != 0);
-        final boolean notDozing = (satisfiedConstraints & CONSTRAINT_DEVICE_NOT_DOZING) != 0
-                || (job.getFlags() & JobInfo.FLAG_WILL_BE_FOREGROUND) != 0;
-        final boolean notRestrictedInBg =
-                (satisfiedConstraints & CONSTRAINT_BACKGROUND_NOT_RESTRICTED) != 0;
-        return (isConstraintsSatisfied() || deadlineSatisfied) && notDozing && notRestrictedInBg;
+        return mReadyNotDozing && mReadyNotRestrictedInBg && (mReadyDeadlineSatisfied
+                || isConstraintsSatisfied());
     }
 
     static final int CONSTRAINTS_OF_INTEREST = CONSTRAINT_CHARGING | CONSTRAINT_BATTERY_NOT_LOW
@@ -971,15 +1006,13 @@
             return true;
         }
 
-        final int req = requiredConstraints & CONSTRAINTS_OF_INTEREST;
-
-        int sat = satisfiedConstraints & CONSTRAINTS_OF_INTEREST;
+        int sat = mSatisfiedConstraintsOfInterest;
         if (overrideState == OVERRIDE_SOFT) {
             // override: pretend all 'soft' requirements are satisfied
             sat |= (requiredConstraints & SOFT_OVERRIDE_CONSTRAINTS);
         }
 
-        return (sat & req) == req;
+        return (sat & mRequiredConstraintsOfInterest) == mRequiredConstraintsOfInterest;
     }
 
     public boolean matches(int uid, int jobId) {
diff --git a/services/core/java/com/android/server/location/ContextHubClientBroker.java b/services/core/java/com/android/server/location/ContextHubClientBroker.java
index b29b7cf..99a04d7 100644
--- a/services/core/java/com/android/server/location/ContextHubClientBroker.java
+++ b/services/core/java/com/android/server/location/ContextHubClientBroker.java
@@ -20,6 +20,7 @@
 import android.hardware.contexthub.V1_0.ContextHubMsg;
 import android.hardware.contexthub.V1_0.IContexthub;
 import android.hardware.contexthub.V1_0.Result;
+import android.hardware.location.ContextHubInfo;
 import android.hardware.location.ContextHubTransaction;
 import android.hardware.location.IContextHubClient;
 import android.hardware.location.IContextHubClientCallback;
@@ -57,9 +58,9 @@
     private final ContextHubClientManager mClientManager;
 
     /*
-     * The ID of the hub that this client is attached to.
+     * The object describing the hub that this client is attached to.
      */
-    private final int mAttachedContextHubId;
+    private final ContextHubInfo mAttachedContextHubInfo;
 
     /*
      * The host end point ID of this client.
@@ -85,11 +86,12 @@
 
     /* package */ ContextHubClientBroker(
             Context context, IContexthub contextHubProxy, ContextHubClientManager clientManager,
-            int contextHubId, short hostEndPointId, IContextHubClientCallback callback) {
+            ContextHubInfo contextHubInfo, short hostEndPointId,
+            IContextHubClientCallback callback) {
         mContext = context;
         mContextHubProxy = contextHubProxy;
         mClientManager = clientManager;
-        mAttachedContextHubId = contextHubId;
+        mAttachedContextHubInfo = contextHubInfo;
         mHostEndPointId = hostEndPointId;
         mCallbackInterface = callback;
     }
@@ -119,11 +121,12 @@
             ContextHubMsg messageToNanoApp = ContextHubServiceUtil.createHidlContextHubMessage(
                     mHostEndPointId, message);
 
+            int contextHubId = mAttachedContextHubInfo.getId();
             try {
-                result = mContextHubProxy.sendMessageToHub(mAttachedContextHubId, messageToNanoApp);
+                result = mContextHubProxy.sendMessageToHub(contextHubId, messageToNanoApp);
             } catch (RemoteException e) {
                 Log.e(TAG, "RemoteException in sendMessageToNanoApp (target hub ID = "
-                        + mAttachedContextHubId + ")", e);
+                        + contextHubId + ")", e);
                 result = Result.UNKNOWN_FAILURE;
             }
         } else {
@@ -156,7 +159,7 @@
      * @return the ID of the context hub this client is attached to
      */
     /* package */ int getAttachedContextHubId() {
-        return mAttachedContextHubId;
+        return mAttachedContextHubInfo.getId();
     }
 
     /**
diff --git a/services/core/java/com/android/server/location/ContextHubClientManager.java b/services/core/java/com/android/server/location/ContextHubClientManager.java
index 4243f02..eda8c6f 100644
--- a/services/core/java/com/android/server/location/ContextHubClientManager.java
+++ b/services/core/java/com/android/server/location/ContextHubClientManager.java
@@ -19,13 +19,13 @@
 import android.content.Context;
 import android.hardware.contexthub.V1_0.ContextHubMsg;
 import android.hardware.contexthub.V1_0.IContexthub;
+import android.hardware.location.ContextHubInfo;
 import android.hardware.location.IContextHubClient;
 import android.hardware.location.IContextHubClientCallback;
 import android.hardware.location.NanoAppMessage;
 import android.os.RemoteException;
 import android.util.Log;
 
-import java.util.NoSuchElementException;
 import java.util.concurrent.ConcurrentHashMap;
 import java.util.function.Consumer;
 
@@ -80,15 +80,15 @@
      * Registers a new client with the service.
      *
      * @param clientCallback the callback interface of the client to register
-     * @param contextHubId   the ID of the hub this client is attached to
+     * @param contextHubInfo the object describing the hub this client is attached to
      *
      * @return the client interface
      *
      * @throws IllegalStateException if max number of clients have already registered
      */
     /* package */ IContextHubClient registerClient(
-            IContextHubClientCallback clientCallback, int contextHubId) {
-        ContextHubClientBroker broker = createNewClientBroker(clientCallback, contextHubId);
+            IContextHubClientCallback clientCallback, ContextHubInfo contextHubInfo) {
+        ContextHubClientBroker broker = createNewClientBroker(clientCallback, contextHubInfo);
 
         try {
             broker.attachDeathRecipient();
@@ -183,14 +183,14 @@
      * manager.
      *
      * @param clientCallback the callback interface of the client to register
-     * @param contextHubId   the ID of the hub this client is attached to
+     * @param contextHubInfo the object describing the hub this client is attached to
      *
      * @return the ContextHubClientBroker object
      *
      * @throws IllegalStateException if max number of clients have already registered
      */
     private synchronized ContextHubClientBroker createNewClientBroker(
-            IContextHubClientCallback clientCallback, int contextHubId) {
+            IContextHubClientCallback clientCallback, ContextHubInfo contextHubInfo) {
         if (mHostEndPointIdToClientMap.size() == MAX_CLIENT_ID + 1) {
             throw new IllegalStateException("Could not register client - max limit exceeded");
         }
@@ -198,10 +198,11 @@
         ContextHubClientBroker broker = null;
         int id = mNextHostEndpointId;
         for (int i = 0; i <= MAX_CLIENT_ID; i++) {
-            if (!mHostEndPointIdToClientMap.containsKey((short)id)) {
+            if (!mHostEndPointIdToClientMap.containsKey((short) id)) {
                 broker = new ContextHubClientBroker(
-                        mContext, mContextHubProxy, this, contextHubId, (short)id, clientCallback);
-                mHostEndPointIdToClientMap.put((short)id, broker);
+                        mContext, mContextHubProxy, this, contextHubInfo, (short) id,
+                        clientCallback);
+                mHostEndPointIdToClientMap.put((short) id, broker);
                 mNextHostEndpointId = (id == MAX_CLIENT_ID) ? 0 : id + 1;
                 break;
             }
diff --git a/services/core/java/com/android/server/location/ContextHubService.java b/services/core/java/com/android/server/location/ContextHubService.java
index 27509de..96e9337 100644
--- a/services/core/java/com/android/server/location/ContextHubService.java
+++ b/services/core/java/com/android/server/location/ContextHubService.java
@@ -170,8 +170,9 @@
 
         HashMap<Integer, IContextHubClient> defaultClientMap = new HashMap<>();
         for (int contextHubId : mContextHubIdToInfoMap.keySet()) {
+            ContextHubInfo contextHubInfo = mContextHubIdToInfoMap.get(contextHubId);
             IContextHubClient client = mClientManager.registerClient(
-                    createDefaultClientCallback(contextHubId), contextHubId);
+                    createDefaultClientCallback(contextHubId), contextHubInfo);
             defaultClientMap.put(contextHubId, client);
 
             try {
@@ -623,7 +624,8 @@
             throw new NullPointerException("Cannot register client with null callback");
         }
 
-        return mClientManager.registerClient(clientCallback, contextHubId);
+        ContextHubInfo contextHubInfo = mContextHubIdToInfoMap.get(contextHubId);
+        return mClientManager.registerClient(clientCallback, contextHubInfo);
     }
 
     /**
diff --git a/services/core/java/com/android/server/net/NetworkPolicyLogger.java b/services/core/java/com/android/server/net/NetworkPolicyLogger.java
index 452b699..4f4b6bf 100644
--- a/services/core/java/com/android/server/net/NetworkPolicyLogger.java
+++ b/services/core/java/com/android/server/net/NetworkPolicyLogger.java
@@ -72,6 +72,7 @@
     static final int NTWK_ALLOWED_TMP_WHITELIST = 4;
     static final int NTWK_BLOCKED_BG_RESTRICT = 5;
     static final int NTWK_ALLOWED_DEFAULT = 6;
+    static final int NTWK_ALLOWED_SYSTEM = 7;
 
     private final LogBuffer mNetworkBlockedBuffer = new LogBuffer(MAX_NETWORK_BLOCKED_LOG_SIZE);
     private final LogBuffer mUidStateChangeBuffer = new LogBuffer(MAX_LOG_SIZE);
diff --git a/services/core/java/com/android/server/net/NetworkPolicyManagerInternal.java b/services/core/java/com/android/server/net/NetworkPolicyManagerInternal.java
index 61d67b7..099671d 100644
--- a/services/core/java/com/android/server/net/NetworkPolicyManagerInternal.java
+++ b/services/core/java/com/android/server/net/NetworkPolicyManagerInternal.java
@@ -16,6 +16,8 @@
 
 package com.android.server.net;
 
+import static com.android.server.net.NetworkPolicyManagerService.isUidNetworkingBlockedInternal;
+
 import android.net.Network;
 import android.net.NetworkTemplate;
 import android.telephony.SubscriptionPlan;
@@ -46,6 +48,28 @@
     public abstract boolean isUidNetworkingBlocked(int uid, String ifname);
 
     /**
+     * Figure out if networking is blocked for a given set of conditions.
+     *
+     * This is used by ConnectivityService via passing stale copies of conditions, so it must not
+     * take any locks.
+     *
+     * @param uid The target uid.
+     * @param uidRules The uid rules which are obtained from NetworkPolicyManagerService.
+     * @param isNetworkMetered True if the network is metered.
+     * @param isBackgroundRestricted True if data saver is enabled.
+     *
+     * @return true if networking is blocked for the UID under the specified conditions.
+     */
+    public static boolean isUidNetworkingBlocked(int uid, int uidRules, boolean isNetworkMetered,
+            boolean isBackgroundRestricted) {
+        // Log of invoking internal function is disabled because it will be called very
+        // frequently. And metrics are unlikely needed on this method because the callers are
+        // external and this method doesn't take any locks or perform expensive operations.
+        return isUidNetworkingBlockedInternal(uid, uidRules, isNetworkMetered,
+                isBackgroundRestricted, null);
+    }
+
+    /**
      * Informs that an appId has been added or removed from the temp-powersave-whitelist so that
      * that network rules for that appId can be updated.
      *
diff --git a/services/core/java/com/android/server/net/NetworkPolicyManagerService.java b/services/core/java/com/android/server/net/NetworkPolicyManagerService.java
index 48e09d7..d799642 100644
--- a/services/core/java/com/android/server/net/NetworkPolicyManagerService.java
+++ b/services/core/java/com/android/server/net/NetworkPolicyManagerService.java
@@ -99,6 +99,7 @@
 import static com.android.server.NetworkManagementService.LIMIT_GLOBAL_ALERT;
 import static com.android.server.net.NetworkPolicyLogger.NTWK_ALLOWED_DEFAULT;
 import static com.android.server.net.NetworkPolicyLogger.NTWK_ALLOWED_NON_METERED;
+import static com.android.server.net.NetworkPolicyLogger.NTWK_ALLOWED_SYSTEM;
 import static com.android.server.net.NetworkPolicyLogger.NTWK_ALLOWED_TMP_WHITELIST;
 import static com.android.server.net.NetworkPolicyLogger.NTWK_ALLOWED_WHITELIST;
 import static com.android.server.net.NetworkPolicyLogger.NTWK_BLOCKED_BG_RESTRICT;
@@ -4837,46 +4838,75 @@
         final long startTime = mStatLogger.getTime();
 
         mContext.enforceCallingOrSelfPermission(MANAGE_NETWORK_POLICY, TAG);
-        final boolean ret = isUidNetworkingBlockedInternal(uid, isNetworkMetered);
-
-        mStatLogger.logDurationStat(Stats.IS_UID_NETWORKING_BLOCKED, startTime);
-
-        return ret;
-    }
-
-    private boolean isUidNetworkingBlockedInternal(int uid, boolean isNetworkMetered) {
         final int uidRules;
         final boolean isBackgroundRestricted;
         synchronized (mUidRulesFirstLock) {
             uidRules = mUidRules.get(uid, RULE_NONE);
             isBackgroundRestricted = mRestrictBackground;
         }
-        if (hasRule(uidRules, RULE_REJECT_ALL)) {
-            mLogger.networkBlocked(uid, NTWK_BLOCKED_POWER);
-            return true;
+        final boolean ret = isUidNetworkingBlockedInternal(uid, uidRules, isNetworkMetered,
+                isBackgroundRestricted, mLogger);
+
+        mStatLogger.logDurationStat(Stats.IS_UID_NETWORKING_BLOCKED, startTime);
+
+        return ret;
+    }
+
+    private static boolean isSystem(int uid) {
+        return uid < Process.FIRST_APPLICATION_UID;
+    }
+
+    static boolean isUidNetworkingBlockedInternal(int uid, int uidRules, boolean isNetworkMetered,
+            boolean isBackgroundRestricted, @Nullable NetworkPolicyLogger logger) {
+        final int reason;
+        // Networks are never blocked for system components
+        if (isSystem(uid)) {
+            reason = NTWK_ALLOWED_SYSTEM;
         }
-        if (!isNetworkMetered) {
-            mLogger.networkBlocked(uid, NTWK_ALLOWED_NON_METERED);
-            return false;
+        else if (hasRule(uidRules, RULE_REJECT_ALL)) {
+            reason = NTWK_BLOCKED_POWER;
         }
-        if (hasRule(uidRules, RULE_REJECT_METERED)) {
-            mLogger.networkBlocked(uid, NTWK_BLOCKED_BLACKLIST);
-            return true;
+        else if (!isNetworkMetered) {
+            reason = NTWK_ALLOWED_NON_METERED;
         }
-        if (hasRule(uidRules, RULE_ALLOW_METERED)) {
-            mLogger.networkBlocked(uid, NTWK_ALLOWED_WHITELIST);
-            return false;
+        else if (hasRule(uidRules, RULE_REJECT_METERED)) {
+            reason = NTWK_BLOCKED_BLACKLIST;
         }
-        if (hasRule(uidRules, RULE_TEMPORARY_ALLOW_METERED)) {
-            mLogger.networkBlocked(uid, NTWK_ALLOWED_TMP_WHITELIST);
-            return false;
+        else if (hasRule(uidRules, RULE_ALLOW_METERED)) {
+            reason = NTWK_ALLOWED_WHITELIST;
         }
-        if (isBackgroundRestricted) {
-            mLogger.networkBlocked(uid, NTWK_BLOCKED_BG_RESTRICT);
-            return true;
+        else if (hasRule(uidRules, RULE_TEMPORARY_ALLOW_METERED)) {
+            reason = NTWK_ALLOWED_TMP_WHITELIST;
         }
-        mLogger.networkBlocked(uid, NTWK_ALLOWED_DEFAULT);
-        return false;
+        else if (isBackgroundRestricted) {
+            reason = NTWK_BLOCKED_BG_RESTRICT;
+        }
+        else {
+            reason = NTWK_ALLOWED_DEFAULT;
+        }
+
+        final boolean blocked;
+        switch(reason) {
+            case NTWK_ALLOWED_DEFAULT:
+            case NTWK_ALLOWED_NON_METERED:
+            case NTWK_ALLOWED_TMP_WHITELIST:
+            case NTWK_ALLOWED_WHITELIST:
+            case NTWK_ALLOWED_SYSTEM:
+                blocked = false;
+                break;
+            case NTWK_BLOCKED_POWER:
+            case NTWK_BLOCKED_BLACKLIST:
+            case NTWK_BLOCKED_BG_RESTRICT:
+                blocked = true;
+                break;
+            default:
+                throw new IllegalArgumentException();
+        }
+        if (logger != null) {
+            logger.networkBlocked(uid, reason);
+        }
+
+        return blocked;
     }
 
     private class NetworkPolicyManagerInternalImpl extends NetworkPolicyManagerInternal {
@@ -4918,11 +4948,18 @@
         public boolean isUidNetworkingBlocked(int uid, String ifname) {
             final long startTime = mStatLogger.getTime();
 
+            final int uidRules;
+            final boolean isBackgroundRestricted;
+            synchronized (mUidRulesFirstLock) {
+                uidRules = mUidRules.get(uid, RULE_NONE);
+                isBackgroundRestricted = mRestrictBackground;
+            }
             final boolean isNetworkMetered;
             synchronized (mNetworkPoliciesSecondLock) {
                 isNetworkMetered = mMeteredIfaces.contains(ifname);
             }
-            final boolean ret = isUidNetworkingBlockedInternal(uid, isNetworkMetered);
+            final boolean ret = isUidNetworkingBlockedInternal(uid, uidRules, isNetworkMetered,
+                    isBackgroundRestricted, mLogger);
 
             mStatLogger.logDurationStat(Stats.IS_UID_NETWORKING_BLOCKED, startTime);
 
diff --git a/services/core/java/com/android/server/notification/NotificationManagerService.java b/services/core/java/com/android/server/notification/NotificationManagerService.java
index 506cc44..93b83ae 100644
--- a/services/core/java/com/android/server/notification/NotificationManagerService.java
+++ b/services/core/java/com/android/server/notification/NotificationManagerService.java
@@ -719,8 +719,7 @@
                     return;
                 }
                 final long now = System.currentTimeMillis();
-                MetricsLogger.action(r.getLogMaker(now)
-                        .setCategory(MetricsEvent.NOTIFICATION_ITEM)
+                MetricsLogger.action(r.getItemLogMaker()
                         .setType(MetricsEvent.TYPE_ACTION)
                         .addTaggedData(MetricsEvent.NOTIFICATION_SHADE_INDEX, nv.rank)
                         .addTaggedData(MetricsEvent.NOTIFICATION_SHADE_COUNT, nv.count));
@@ -865,8 +864,7 @@
                     r.stats.onExpansionChanged(userAction, expanded);
                     final long now = System.currentTimeMillis();
                     if (userAction) {
-                        MetricsLogger.action(r.getLogMaker(now)
-                                .setCategory(MetricsEvent.NOTIFICATION_ITEM)
+                        MetricsLogger.action(r.getItemLogMaker()
                                 .setType(expanded ? MetricsEvent.TYPE_DETAIL
                                         : MetricsEvent.TYPE_COLLAPSE));
                     }
@@ -3624,7 +3622,7 @@
                 INotificationListener token, String pkg, UserHandle user,
                 NotificationChannelGroup group) throws RemoteException {
             Preconditions.checkNotNull(user);
-            verifyPrivilegedListener(token, user);
+            verifyPrivilegedListener(token, user, false);
             createNotificationChannelGroup(
                     pkg, getUidForPackageAndUser(pkg, user), group, false, true);
             savePolicyFile();
@@ -3637,7 +3635,7 @@
             Preconditions.checkNotNull(pkg);
             Preconditions.checkNotNull(user);
 
-            verifyPrivilegedListener(token, user);
+            verifyPrivilegedListener(token, user, false);
             updateNotificationChannelInt(pkg, getUidForPackageAndUser(pkg, user), channel, true);
         }
 
@@ -3646,7 +3644,7 @@
                 INotificationListener token, String pkg, UserHandle user) throws RemoteException {
             Preconditions.checkNotNull(pkg);
             Preconditions.checkNotNull(user);
-            verifyPrivilegedListener(token, user);
+            verifyPrivilegedListener(token, user, true);
 
             return mPreferencesHelper.getNotificationChannels(pkg, getUidForPackageAndUser(pkg, user),
                     false /* includeDeleted */);
@@ -3658,7 +3656,7 @@
                 INotificationListener token, String pkg, UserHandle user) throws RemoteException {
             Preconditions.checkNotNull(pkg);
             Preconditions.checkNotNull(user);
-            verifyPrivilegedListener(token, user);
+            verifyPrivilegedListener(token, user, true);
 
             List<NotificationChannelGroup> groups = new ArrayList<>();
             groups.addAll(mPreferencesHelper.getNotificationChannelGroups(
@@ -3666,13 +3664,18 @@
             return new ParceledListSlice<>(groups);
         }
 
-        private void verifyPrivilegedListener(INotificationListener token, UserHandle user) {
+        private void verifyPrivilegedListener(INotificationListener token, UserHandle user,
+                boolean assistantAllowed) {
             ManagedServiceInfo info;
             synchronized (mNotificationLock) {
                 info = mListeners.checkServiceTokenLocked(token);
             }
             if (!hasCompanionDevice(info)) {
-                throw new SecurityException(info + " does not have access");
+                synchronized (mNotificationLock) {
+                    if (!assistantAllowed || !mAssistants.isServiceTokenValidLocked(info.service)) {
+                        throw new SecurityException(info + " does not have access");
+                    }
+                }
             }
             if (!info.enabledAndUserMatches(user.getIdentifier())) {
                 throw new SecurityException(info + " does not have access");
@@ -5842,8 +5845,7 @@
         mArchive.record(r.sbn);
 
         final long now = System.currentTimeMillis();
-        final LogMaker logMaker = r.getLogMaker(now)
-                .setCategory(MetricsEvent.NOTIFICATION_ITEM)
+        final LogMaker logMaker = r.getItemLogMaker()
                 .setType(MetricsEvent.TYPE_DISMISS)
                 .setSubtype(reason);
         if (rank != -1 && count != -1) {
diff --git a/services/core/java/com/android/server/notification/NotificationRecord.java b/services/core/java/com/android/server/notification/NotificationRecord.java
index 65ec580..e9f2718 100644
--- a/services/core/java/com/android/server/notification/NotificationRecord.java
+++ b/services/core/java/com/android/server/notification/NotificationRecord.java
@@ -611,6 +611,7 @@
     }
 
     public void applyAdjustments() {
+        long now = System.currentTimeMillis();
         synchronized (mAdjustments) {
             for (Adjustment adjustment: mAdjustments) {
                 Bundle signals = adjustment.getSignals();
@@ -618,17 +619,25 @@
                     final ArrayList<String> people =
                             adjustment.getSignals().getStringArrayList(Adjustment.KEY_PEOPLE);
                     setPeopleOverride(people);
+                    MetricsLogger.action(getAdjustmentLogMaker()
+                            .addTaggedData(MetricsEvent.ADJUSTMENT_KEY_PEOPLE, people.size()));
                 }
                 if (signals.containsKey(Adjustment.KEY_SNOOZE_CRITERIA)) {
                     final ArrayList<SnoozeCriterion> snoozeCriterionList =
                             adjustment.getSignals().getParcelableArrayList(
                                     Adjustment.KEY_SNOOZE_CRITERIA);
                     setSnoozeCriteria(snoozeCriterionList);
+                    MetricsLogger.action(getAdjustmentLogMaker()
+                            .addTaggedData(MetricsEvent.ADJUSTMENT_KEY_SNOOZE_CRITERIA,
+                                    snoozeCriterionList.size()));
                 }
                 if (signals.containsKey(Adjustment.KEY_GROUP_KEY)) {
                     final String groupOverrideKey =
                             adjustment.getSignals().getString(Adjustment.KEY_GROUP_KEY);
                     setOverrideGroupKey(groupOverrideKey);
+                    MetricsLogger.action(getAdjustmentLogMaker()
+                            .addTaggedData(MetricsEvent.ADJUSTMENT_KEY_GROUP_KEY,
+                                    groupOverrideKey));
                 }
                 if (signals.containsKey(Adjustment.KEY_USER_SENTIMENT)) {
                     // Only allow user sentiment update from assistant if user hasn't already
@@ -637,19 +646,31 @@
                             && (getChannel().getUserLockedFields() & USER_LOCKED_IMPORTANCE) == 0) {
                         setUserSentiment(adjustment.getSignals().getInt(
                                 Adjustment.KEY_USER_SENTIMENT, USER_SENTIMENT_NEUTRAL));
+                        MetricsLogger.action(getAdjustmentLogMaker()
+                                .addTaggedData(MetricsEvent.ADJUSTMENT_KEY_USER_SENTIMENT,
+                                        getUserSentiment()));
                     }
                 }
                 if (signals.containsKey(Adjustment.KEY_SMART_ACTIONS)) {
                     setSmartActions(signals.getParcelableArrayList(Adjustment.KEY_SMART_ACTIONS));
+                    MetricsLogger.action(getAdjustmentLogMaker()
+                            .addTaggedData(MetricsEvent.ADJUSTMENT_KEY_SMART_ACTIONS,
+                                    getSmartActions().size()));
                 }
                 if (signals.containsKey(Adjustment.KEY_SMART_REPLIES)) {
                     setSmartReplies(signals.getCharSequenceArrayList(Adjustment.KEY_SMART_REPLIES));
+                    MetricsLogger.action(getAdjustmentLogMaker()
+                            .addTaggedData(MetricsEvent.ADJUSTMENT_KEY_SMART_REPLIES,
+                                    getSmartReplies().size()));
                 }
                 if (signals.containsKey(Adjustment.KEY_IMPORTANCE)) {
                     int importance = signals.getInt(Adjustment.KEY_IMPORTANCE);
                     importance = Math.max(IMPORTANCE_UNSPECIFIED, importance);
                     importance = Math.min(IMPORTANCE_HIGH, importance);
                     setAssistantImportance(importance);
+                    MetricsLogger.action(getAdjustmentLogMaker()
+                            .addTaggedData(MetricsEvent.ADJUSTMENT_KEY_IMPORTANCE,
+                                    importance));
                 }
             }
         }
@@ -732,10 +753,10 @@
     protected void calculateImportance() {
         mImportance = calculateInitialImportance();
         mImportanceExplanation = "app";
-        if (getChannel().isImportanceLocked()) {
+        if (getChannel().hasUserSetImportance()) {
             mImportanceExplanation = "user";
         }
-        if (!getChannel().isImportanceLocked() && mAssistantImportance != IMPORTANCE_UNSPECIFIED) {
+        if (!getChannel().hasUserSetImportance() && mAssistantImportance != IMPORTANCE_UNSPECIFIED) {
             mImportance = mAssistantImportance;
             mImportanceExplanation = "asst";
         }
@@ -1203,6 +1224,16 @@
         return getLogMaker(System.currentTimeMillis());
     }
 
+    public LogMaker getItemLogMaker() {
+        return getLogMaker().setCategory(MetricsEvent.NOTIFICATION_ITEM);
+    }
+
+    public LogMaker getAdjustmentLogMaker() {
+        return getLogMaker()
+                .setCategory(MetricsEvent.NOTIFICATION_ITEM)
+                .setType(MetricsEvent.NOTIFICATION_ASSISTANT_ADJUSTMENT);
+    }
+
     @VisibleForTesting
     static final class Light {
         public final int color;
diff --git a/services/core/java/com/android/server/notification/ZenModeHelper.java b/services/core/java/com/android/server/notification/ZenModeHelper.java
index 760f155..44b80c1 100644
--- a/services/core/java/com/android/server/notification/ZenModeHelper.java
+++ b/services/core/java/com/android/server/notification/ZenModeHelper.java
@@ -1212,27 +1212,89 @@
     }
 
     private final class Metrics extends Callback {
-        private static final String COUNTER_PREFIX = "dnd_mode_";
+        private static final String COUNTER_MODE_PREFIX = "dnd_mode_";
+        private static final String COUNTER_TYPE_PREFIX = "dnd_type_";
+        private static final int DND_OFF = 0;
+        private static final int DND_ON_MANUAL = 1;
+        private static final int DND_ON_AUTOMATIC = 2;
+        private static final String COUNTER_RULE = "dnd_rule_count";
         private static final long MINIMUM_LOG_PERIOD_MS = 60 * 1000;
 
+        // Total silence, alarms only, priority only
         private int mPreviousZenMode = -1;
-        private long mBeginningMs = 0L;
+        private long mModeLogTimeMs = 0L;
+
+        private int mNumZenRules = -1;
+        private long mRuleCountLogTime = 0L;
+
+        // automatic (1) vs manual (0) vs dnd off (2)
+        private int mPreviousZenType = -1;
+        private long mTypeLogTimeMs = 0L;
 
         @Override
         void onZenModeChanged() {
             emit();
         }
 
+        @Override
+        void onConfigChanged() {
+            emit();
+        }
+
         private void emit() {
             mHandler.postMetricsTimer();
+            emitZenMode();
+            emitRules();
+            emitDndType();
+        }
+
+        private void emitZenMode() {
             final long now = SystemClock.elapsedRealtime();
-            final long since = (now - mBeginningMs);
+            final long since = (now - mModeLogTimeMs);
             if (mPreviousZenMode != mZenMode || since > MINIMUM_LOG_PERIOD_MS) {
                 if (mPreviousZenMode != -1) {
-                    MetricsLogger.count(mContext, COUNTER_PREFIX + mPreviousZenMode, (int) since);
+                    MetricsLogger.count(
+                            mContext, COUNTER_MODE_PREFIX + mPreviousZenMode, (int) since);
                 }
                 mPreviousZenMode = mZenMode;
-                mBeginningMs = now;
+                mModeLogTimeMs = now;
+            }
+        }
+
+        private void emitRules() {
+            final long now = SystemClock.elapsedRealtime();
+            final long since = (now - mRuleCountLogTime);
+            synchronized (mConfig) {
+                int numZenRules = mConfig.automaticRules.size();
+                if (mNumZenRules != numZenRules
+                        || since > MINIMUM_LOG_PERIOD_MS) {
+                    if (mNumZenRules != -1) {
+                        MetricsLogger.count(mContext, COUNTER_RULE,
+                                numZenRules - mNumZenRules);
+                    }
+                    mNumZenRules = numZenRules;
+
+                    mRuleCountLogTime = since;
+                }
+            }
+        }
+
+        private void emitDndType() {
+            final long now = SystemClock.elapsedRealtime();
+            final long since = (now - mTypeLogTimeMs);
+            synchronized (mConfig) {
+                boolean dndOn = mZenMode != Global.ZEN_MODE_OFF;
+                int zenType = !dndOn ? DND_OFF
+                        : (mConfig.manualRule != null) ? DND_ON_MANUAL : DND_ON_AUTOMATIC;
+                if (zenType != mPreviousZenType
+                        || since > MINIMUM_LOG_PERIOD_MS) {
+                    if (mPreviousZenType != -1) {
+                        MetricsLogger.count(
+                                mContext, COUNTER_TYPE_PREFIX + mPreviousZenType, (int) since);
+                    }
+                    mTypeLogTimeMs = now;
+                    mPreviousZenType = zenType;
+                }
             }
         }
     }
diff --git a/services/core/java/com/android/server/pm/LauncherAppsService.java b/services/core/java/com/android/server/pm/LauncherAppsService.java
index a08c189..404f152 100644
--- a/services/core/java/com/android/server/pm/LauncherAppsService.java
+++ b/services/core/java/com/android/server/pm/LauncherAppsService.java
@@ -659,15 +659,6 @@
             try {
                 final PackageManagerInternal pmInt =
                         LocalServices.getService(PackageManagerInternal.class);
-                ActivityInfo info = pmInt.getActivityInfo(component,
-                        PackageManager.MATCH_DIRECT_BOOT_AWARE
-                                | PackageManager.MATCH_DIRECT_BOOT_UNAWARE,
-                        callingUid, user.getIdentifier());
-                if (!info.exported) {
-                    throw new SecurityException("Cannot launch non-exported components "
-                            + component);
-                }
-
                 // Check that the component actually has Intent.CATEGORY_LAUCNCHER
                 // as calling startActivityAsUser ignores the category and just
                 // resolves based on the component if present.
@@ -680,6 +671,11 @@
                     ActivityInfo activityInfo = apps.get(i).activityInfo;
                     if (activityInfo.packageName.equals(component.getPackageName()) &&
                             activityInfo.name.equals(component.getClassName())) {
+                        if (!activityInfo.exported) {
+                            throw new SecurityException("Cannot launch non-exported components "
+                                    + component);
+                        }
+
                         // Found an activity with category launcher that matches
                         // this component so ok to launch.
                         launchIntent.setPackage(null);
diff --git a/services/core/java/com/android/server/pm/UserRestrictionsUtils.java b/services/core/java/com/android/server/pm/UserRestrictionsUtils.java
index 1315502..dd04652 100644
--- a/services/core/java/com/android/server/pm/UserRestrictionsUtils.java
+++ b/services/core/java/com/android/server/pm/UserRestrictionsUtils.java
@@ -127,7 +127,8 @@
             UserManager.DISALLOW_SHARE_INTO_MANAGED_PROFILE,
             UserManager.DISALLOW_AMBIENT_DISPLAY,
             UserManager.DISALLOW_CONFIG_SCREEN_TIMEOUT,
-            UserManager.DISALLOW_PRINTING
+            UserManager.DISALLOW_PRINTING,
+            UserManager.DISALLOW_CONFIG_PRIVATE_DNS
     });
 
     /**
@@ -163,7 +164,8 @@
      * User restrictions that cannot be set by profile owners. Applied to all users.
      */
     private static final Set<String> DEVICE_OWNER_ONLY_RESTRICTIONS = Sets.newArraySet(
-            UserManager.DISALLOW_USER_SWITCH
+            UserManager.DISALLOW_USER_SWITCH,
+            UserManager.DISALLOW_CONFIG_PRIVATE_DNS
     );
 
     /**
@@ -741,6 +743,10 @@
                 restriction = UserManager.DISALLOW_CONFIG_SCREEN_TIMEOUT;
                 break;
 
+            case android.provider.Settings.Global.PRIVATE_DNS_MODE:
+            case android.provider.Settings.Global.PRIVATE_DNS_SPECIFIER:
+                restriction = UserManager.DISALLOW_CONFIG_PRIVATE_DNS;
+                break;
             default:
                 if (setting.startsWith(Settings.Global.DATA_ROAMING)) {
                     if ("0".equals(value)) {
diff --git a/services/core/java/com/android/server/pm/permission/DefaultPermissionGrantPolicy.java b/services/core/java/com/android/server/pm/permission/DefaultPermissionGrantPolicy.java
index 0a93653..e6a018a 100644
--- a/services/core/java/com/android/server/pm/permission/DefaultPermissionGrantPolicy.java
+++ b/services/core/java/com/android/server/pm/permission/DefaultPermissionGrantPolicy.java
@@ -31,9 +31,11 @@
 import android.content.pm.ApplicationInfo;
 import android.content.pm.PackageInfo;
 import android.content.pm.PackageManager;
+import android.content.pm.PackageManager.NameNotFoundException;
 import android.content.pm.PackageManagerInternal;
 import android.content.pm.PackageManagerInternal.PackagesProvider;
 import android.content.pm.PackageManagerInternal.SyncAdapterPackagesProvider;
+import android.content.pm.PermissionInfo;
 import android.content.pm.ProviderInfo;
 import android.content.pm.ResolveInfo;
 import android.media.RingtoneManager;
@@ -1182,12 +1184,16 @@
             final int permissionGrantCount = permissionGrants.size();
             for (int j = 0; j < permissionGrantCount; j++) {
                 DefaultPermissionGrant permissionGrant = permissionGrants.get(j);
+                if (!isPermissionDangerous(permissionGrant.name)) {
+                    Log.w(TAG, "Ignoring permission " + permissionGrant.name
+                            + " which isn't dangerous");
+                    continue;
+                }
                 if (permissions == null) {
                     permissions = new ArraySet<>();
                 } else {
                     permissions.clear();
                 }
-                permissions.add(permissionGrant.name);
                 grantRuntimePermissions(pkg, permissions, permissionGrant.fixed, userId);
             }
         }
@@ -1350,6 +1356,16 @@
                 && pkg.applicationInfo.targetSdkVersion > Build.VERSION_CODES.LOLLIPOP_MR1;
     }
 
+    private boolean isPermissionDangerous(String name) {
+        try {
+            final PermissionInfo pi = mContext.getPackageManager().getPermissionInfo(name, 0);
+            return (pi.getProtectionFlags() & PermissionInfo.PROTECTION_DANGEROUS) != 0;
+        } catch (NameNotFoundException e) {
+            // When unknown assume it's dangerous to be on the safe side
+            return true;
+        }
+    }
+
     private static final class DefaultPermissionGrant {
         final String name;
         final boolean fixed;
diff --git a/services/core/java/com/android/server/policy/PhoneWindowManager.java b/services/core/java/com/android/server/policy/PhoneWindowManager.java
index 06ee935..dae7b01 100644
--- a/services/core/java/com/android/server/policy/PhoneWindowManager.java
+++ b/services/core/java/com/android/server/policy/PhoneWindowManager.java
@@ -2061,7 +2061,8 @@
                     }
                 });
         mImmersiveModeConfirmation = new ImmersiveModeConfirmation(mContext);
-        mWindowManagerFuncs.registerPointerEventListener(mSystemGestures);
+        //TODO (b/111365687) : make system context per display.
+        mWindowManagerFuncs.registerPointerEventListener(mSystemGestures, DEFAULT_DISPLAY);
 
         mVibrator = (Vibrator)context.getSystemService(Context.VIBRATOR_SERVICE);
         mLongPressVibePattern = getLongIntArray(mContext.getResources(),
@@ -2258,13 +2259,16 @@
             WindowManager wm = (WindowManager) mContext.getSystemService(WINDOW_SERVICE);
             lp.inputFeatures |= WindowManager.LayoutParams.INPUT_FEATURE_NO_INPUT_CHANNEL;
             wm.addView(mPointerLocationView, lp);
-            mWindowManagerFuncs.registerPointerEventListener(mPointerLocationView);
+            //TODO (b/111365687) : make system context per display.
+            mWindowManagerFuncs.registerPointerEventListener(mPointerLocationView, DEFAULT_DISPLAY);
         }
     }
 
     private void disablePointerLocation() {
         if (mPointerLocationView != null) {
-            mWindowManagerFuncs.unregisterPointerEventListener(mPointerLocationView);
+            //TODO (b/111365687) : make system context per display.
+            mWindowManagerFuncs.unregisterPointerEventListener(mPointerLocationView,
+                    DEFAULT_DISPLAY);
             WindowManager wm = (WindowManager) mContext.getSystemService(WINDOW_SERVICE);
             wm.removeView(mPointerLocationView);
             mPointerLocationView = null;
diff --git a/services/core/java/com/android/server/policy/WindowManagerPolicy.java b/services/core/java/com/android/server/policy/WindowManagerPolicy.java
index 27ab3ef..2a8e523 100644
--- a/services/core/java/com/android/server/policy/WindowManagerPolicy.java
+++ b/services/core/java/com/android/server/policy/WindowManagerPolicy.java
@@ -559,10 +559,10 @@
         public Object getWindowManagerLock();
 
         /** Register a system listener for touch events */
-        void registerPointerEventListener(PointerEventListener listener);
+        void registerPointerEventListener(PointerEventListener listener, int displayId);
 
         /** Unregister a system listener for touch events */
-        void unregisterPointerEventListener(PointerEventListener listener);
+        void unregisterPointerEventListener(PointerEventListener listener, int displayId);
 
         /**
          * @return The content insets of the docked divider window.
diff --git a/services/core/java/com/android/server/power/batterysaver/BatterySaverController.java b/services/core/java/com/android/server/power/batterysaver/BatterySaverController.java
index be24c71..5569822 100644
--- a/services/core/java/com/android/server/power/batterysaver/BatterySaverController.java
+++ b/services/core/java/com/android/server/power/batterysaver/BatterySaverController.java
@@ -243,7 +243,7 @@
     }
 
     /**
-     * Called by {@link PowerManagerService} to update the battery saver stete.
+     * Called by {@link PowerManagerService} to update the battery saver state.
      */
     public void enableBatterySaver(boolean enable, int reason) {
         synchronized (mLock) {
@@ -290,8 +290,8 @@
      * This method is called only in the following cases:
      * - When battery saver becomes activated.
      * - When battery saver becomes deactivated.
-     * - When battery saver is on the interactive state changes.
-     * - When battery saver is on the battery saver policy changes.
+     * - When battery saver is on and the interactive state changes.
+     * - When battery saver is on and the battery saver policy changes.
      */
     void handleBatterySaverStateChanged(boolean sendBroadcast, int reason) {
         final LowPowerModeListener[] listeners;
diff --git a/services/core/java/com/android/server/stats/StatsCompanionService.java b/services/core/java/com/android/server/stats/StatsCompanionService.java
index 14434cd..93870e7 100644
--- a/services/core/java/com/android/server/stats/StatsCompanionService.java
+++ b/services/core/java/com/android/server/stats/StatsCompanionService.java
@@ -88,7 +88,6 @@
 import com.android.internal.os.KernelWakelockStats;
 import com.android.internal.os.LooperStats;
 import com.android.internal.os.PowerProfile;
-import com.android.internal.os.ProcessCpuTracker;
 import com.android.internal.os.StoragedUidIoStatsReader;
 import com.android.internal.util.DumpUtils;
 import com.android.server.BinderCallsStatsService;
@@ -175,6 +174,11 @@
     private final KernelWakelockStats mTmpWakelockStats = new KernelWakelockStats();
     private IWifiManager mWifiManager = null;
     private TelephonyManager mTelephony = null;
+    private final StatFs mStatFsData = new StatFs(Environment.getDataDirectory().getAbsolutePath());
+    private final StatFs mStatFsSystem =
+            new StatFs(Environment.getRootDirectory().getAbsolutePath());
+    private final StatFs mStatFsTemp =
+            new StatFs(Environment.getDownloadCacheDirectory().getAbsolutePath());
     @GuardedBy("sStatsdLock")
     private final HashSet<Long> mDeathTimeMillis = new HashSet<>();
     @GuardedBy("sStatsdLock")
@@ -195,8 +199,6 @@
     private static IThermalService sThermalService;
     private File mBaseDir =
             new File(SystemServiceManager.ensureSystemDir(), "stats_companion");
-    @GuardedBy("this")
-    ProcessCpuTracker mProcessCpuTracker = null;
 
     public StatsCompanionService(Context context) {
         super();
@@ -770,7 +772,7 @@
     private void pullBluetoothBytesTransfer(
             int tagId, long elapsedNanos, long wallClockNanos,
             List<StatsLogEventWrapper> pulledData) {
-        BluetoothActivityEnergyInfo info = fetchBluetoothData();
+        BluetoothActivityEnergyInfo info = pullBluetoothData();
         if (info.getUidTraffic() != null) {
             for (UidTraffic traffic : info.getUidTraffic()) {
                 StatsLogEventWrapper e = new StatsLogEventWrapper(tagId, elapsedNanos,
@@ -882,12 +884,9 @@
             int tagId, long elapsedNanos, long wallClockNanos,
             List<StatsLogEventWrapper> pulledData) {
         long token = Binder.clearCallingIdentity();
-        synchronized (this) {
-            if (mWifiManager == null) {
-                mWifiManager =
-                        IWifiManager.Stub.asInterface(
-                                ServiceManager.getService(Context.WIFI_SERVICE));
-            }
+        if (mWifiManager == null) {
+            mWifiManager =
+                    IWifiManager.Stub.asInterface(ServiceManager.getService(Context.WIFI_SERVICE));
         }
         if (mWifiManager != null) {
             try {
@@ -917,10 +916,8 @@
             int tagId, long elapsedNanos, long wallClockNanos,
             List<StatsLogEventWrapper> pulledData) {
         long token = Binder.clearCallingIdentity();
-        synchronized (this) {
-            if (mTelephony == null) {
-                mTelephony = TelephonyManager.from(mContext);
-            }
+        if (mTelephony == null) {
+            mTelephony = TelephonyManager.from(mContext);
         }
         if (mTelephony != null) {
             SynchronousResultReceiver modemReceiver = new SynchronousResultReceiver("telephony");
@@ -944,7 +941,7 @@
     private void pullBluetoothActivityInfo(
             int tagId, long elapsedNanos, long wallClockNanos,
             List<StatsLogEventWrapper> pulledData) {
-        BluetoothActivityEnergyInfo info = fetchBluetoothData();
+        BluetoothActivityEnergyInfo info = pullBluetoothData();
         StatsLogEventWrapper e = new StatsLogEventWrapper(tagId, elapsedNanos, wallClockNanos);
         e.writeLong(info.getTimeStamp());
         e.writeInt(info.getBluetoothStackState());
@@ -955,7 +952,7 @@
         pulledData.add(e);
     }
 
-    private synchronized BluetoothActivityEnergyInfo fetchBluetoothData() {
+    private synchronized BluetoothActivityEnergyInfo pullBluetoothData() {
         final BluetoothAdapter adapter = BluetoothAdapter.getDefaultAdapter();
         if (adapter != null) {
             SynchronousResultReceiver bluetoothReceiver = new SynchronousResultReceiver(
@@ -1004,6 +1001,23 @@
         }
     }
 
+    private void pullNativeProcessMemoryState(
+            int tagId, long elapsedNanos, long wallClockNanos,
+            List<StatsLogEventWrapper> pulledData) {
+        List<ProcessMemoryState> processMemoryStates = LocalServices.getService(
+                ActivityManagerInternal.class).getMemoryStateForNativeProcesses();
+        for (ProcessMemoryState processMemoryState : processMemoryStates) {
+            StatsLogEventWrapper e = new StatsLogEventWrapper(tagId, elapsedNanos, wallClockNanos);
+            e.writeInt(processMemoryState.uid);
+            e.writeString(processMemoryState.processName);
+            e.writeLong(processMemoryState.pgfault);
+            e.writeLong(processMemoryState.pgmajfault);
+            e.writeLong(processMemoryState.rssInBytes);
+            e.writeLong(processMemoryState.rssHighWatermarkInBytes);
+            pulledData.add(e);
+        }
+    }
+
     private void pullBinderCallsStats(
             int tagId, long elapsedNanos, long wallClockNanos,
             List<StatsLogEventWrapper> pulledData) {
@@ -1309,35 +1323,30 @@
 
     private void pullProcessStats(int section, int tagId, long elapsedNanos, long wallClockNanos,
             List<StatsLogEventWrapper> pulledData) {
-        synchronized (this) {
-            try {
-                long lastHighWaterMark = readProcStatsHighWaterMark(section);
-                List<ParcelFileDescriptor> statsFiles = new ArrayList<>();
-                long highWaterMark = mProcessStats.getCommittedStats(
-                        lastHighWaterMark, section, true, statsFiles);
-                if (statsFiles.size() != 1) {
-                    return;
-                }
-                InputStream stream = new ParcelFileDescriptor.AutoCloseInputStream(
-                        statsFiles.get(0));
-                int[] len = new int[1];
-                byte[] stats = readFully(stream, len);
-                StatsLogEventWrapper e = new StatsLogEventWrapper(tagId, elapsedNanos,
-                        wallClockNanos);
-                e.writeStorage(Arrays.copyOf(stats, len[0]));
-                pulledData.add(e);
-                new File(mBaseDir.getAbsolutePath() + "/" + section + "_"
-                        + lastHighWaterMark).delete();
-                new File(
-                        mBaseDir.getAbsolutePath() + "/" + section + "_"
-                                + highWaterMark).createNewFile();
-            } catch (IOException e) {
-                Log.e(TAG, "Getting procstats failed: ", e);
-            } catch (RemoteException e) {
-                Log.e(TAG, "Getting procstats failed: ", e);
-            } catch (SecurityException e) {
-                Log.e(TAG, "Getting procstats failed: ", e);
+        try {
+            long lastHighWaterMark = readProcStatsHighWaterMark(section);
+            List<ParcelFileDescriptor> statsFiles = new ArrayList<>();
+            long highWaterMark = mProcessStats.getCommittedStats(
+                    lastHighWaterMark, section, true, statsFiles);
+            if (statsFiles.size() != 1) {
+                return;
             }
+            InputStream stream = new ParcelFileDescriptor.AutoCloseInputStream(statsFiles.get(0));
+            int[] len = new int[1];
+            byte[] stats = readFully(stream, len);
+            StatsLogEventWrapper e = new StatsLogEventWrapper(tagId, elapsedNanos, wallClockNanos);
+            e.writeStorage(Arrays.copyOf(stats, len[0]));
+            pulledData.add(e);
+            new File(mBaseDir.getAbsolutePath() + "/" + section + "_" + lastHighWaterMark).delete();
+            new File(
+                    mBaseDir.getAbsolutePath() + "/" + section + "_"
+                            + highWaterMark).createNewFile();
+        } catch (IOException e) {
+            Log.e(TAG, "Getting procstats failed: ", e);
+        } catch (RemoteException e) {
+            Log.e(TAG, "Getting procstats failed: ", e);
+        } catch (SecurityException e) {
+            Log.e(TAG, "Getting procstats failed: ", e);
         }
     }
 
@@ -1406,34 +1415,12 @@
         });
     }
 
-    private void pullProcessCpuTime(int tagId, long elapsedNanos, final long wallClockNanos,
-            List<StatsLogEventWrapper> pulledData) {
-        synchronized (this) {
-            if (mProcessCpuTracker == null) {
-                mProcessCpuTracker = new ProcessCpuTracker(false);
-                mProcessCpuTracker.init();
-            }
-            mProcessCpuTracker.update();
-            for (int i = 0; i < mProcessCpuTracker.countStats(); i++) {
-                ProcessCpuTracker.Stats st = mProcessCpuTracker.getStats(i);
-                StatsLogEventWrapper e = new StatsLogEventWrapper(tagId, elapsedNanos,
-                        wallClockNanos);
-                e.writeInt(st.uid);
-                e.writeString(st.name);
-                e.writeLong(st.base_utime);
-                e.writeLong(st.base_stime);
-                pulledData.add(e);
-            }
-        }
-    }
-
     /**
      * Pulls various data.
      */
     @Override // Binder call
     public StatsLogEventWrapper[] pullData(int tagId) {
         enforceCallingPermission();
-
         if (DEBUG) {
             Slog.d(TAG, "Pulling " + tagId);
         }
@@ -1509,6 +1496,10 @@
                 pullProcessMemoryState(tagId, elapsedNanos, wallClockNanos, ret);
                 break;
             }
+            case StatsLog.NATIVE_PROCESS_MEMORY_STATE: {
+                pullNativeProcessMemoryState(tagId, elapsedNanos, wallClockNanos, ret);
+                break;
+            }
             case StatsLog.BINDER_CALLS: {
                 pullBinderCallsStats(tagId, elapsedNanos, wallClockNanos, ret);
                 break;
@@ -1542,8 +1533,7 @@
                 break;
             }
             case StatsLog.PROC_STATS: {
-                pullProcessStats(ProcessStats.REPORT_ALL, tagId, elapsedNanos, wallClockNanos,
-                        ret);
+                pullProcessStats(ProcessStats.REPORT_ALL, tagId, elapsedNanos, wallClockNanos, ret);
                 break;
             }
             case StatsLog.PROC_STATS_PKG_PROC: {
@@ -1559,10 +1549,6 @@
                 pullPowerProfile(tagId, elapsedNanos, wallClockNanos, ret);
                 break;
             }
-            case StatsLog.PROCESS_CPU_TIME: {
-                pullProcessCpuTime(tagId, elapsedNanos, wallClockNanos, ret);
-                break;
-            }
             default:
                 Slog.w(TAG, "No such tagId data as " + tagId);
                 return null;
diff --git a/services/core/java/com/android/server/wm/ActivityTaskManagerInternal.java b/services/core/java/com/android/server/wm/ActivityTaskManagerInternal.java
index e5347cf..7f9ee84 100644
--- a/services/core/java/com/android/server/wm/ActivityTaskManagerInternal.java
+++ b/services/core/java/com/android/server/wm/ActivityTaskManagerInternal.java
@@ -18,6 +18,7 @@
 
 import android.annotation.NonNull;
 import android.annotation.Nullable;
+import android.annotation.UserIdInt;
 import android.app.AppProtoEnums;
 import android.app.IActivityManager;
 import android.app.IApplicationThread;
@@ -28,19 +29,26 @@
 import android.content.res.CompatibilityInfo;
 import android.os.Bundle;
 import android.os.IBinder;
+import android.os.RemoteException;
 import android.os.SystemClock;
 import android.service.voice.IVoiceInteractionSession;
 import android.util.SparseIntArray;
 
+import android.util.proto.ProtoOutputStream;
 import com.android.internal.app.IVoiceInteractor;
 import com.android.server.am.ActivityServiceConnectionsHolder;
 import com.android.server.am.PendingIntentRecord;
 import com.android.server.am.SafeActivityOptions;
 import com.android.server.am.TaskRecord;
+import com.android.server.am.UserState;
 import com.android.server.am.WindowProcessController;
 
+import java.io.FileDescriptor;
+import java.io.PrintWriter;
 import java.lang.ref.WeakReference;
 import java.util.List;
+import java.util.Set;
+import java.util.function.Predicate;
 
 /**
  * Activity Task manager local system service interface.
@@ -306,13 +314,13 @@
     public abstract boolean showStrictModeViolationDialog();
     public abstract void showSystemReadyErrorDialogsIfNeeded();
 
-    public abstract long inputDispatchingTimedOut(int pid, boolean aboveSystem, String reason);
     public abstract void onProcessMapped(int pid, WindowProcessController proc);
     public abstract void onProcessUnMapped(int pid);
 
     public abstract void onPackageDataCleared(String name);
     public abstract void onPackageUninstalled(String name);
     public abstract void onPackageAdded(String name, boolean replacing);
+    public abstract void onPackageReplaced(ApplicationInfo aInfo);
 
     public abstract CompatibilityInfo compatibilityInfoForPackage(ApplicationInfo ai);
 
@@ -343,4 +351,92 @@
     /** @return true if the given process is the factory test process. */
     public abstract boolean isFactoryTestProcess(WindowProcessController wpc);
     public abstract void updateTopComponentForFactoryTest();
+    public abstract void handleAppDied(WindowProcessController wpc, boolean restarting,
+            Runnable finishInstrumentationCallback);
+    public abstract void closeSystemDialogs(String reason);
+
+    /** Removes all components (e.g. activities, recents, ...) belonging to a disabled package. */
+    public abstract void cleanupDisabledPackageComponents(
+            String packageName, Set<String> disabledClasses, int userId, boolean booted);
+
+    /** Called whenever AM force stops a package. */
+    public abstract boolean onForceStopPackage(String packageName, boolean doit,
+            boolean evenPersistent, int userId);
+    /**
+     * Resumes all top activities in the system if they aren't resumed already.
+     * @param scheduleIdle If the idle message should be schedule after the top activities are
+     *                     resumed.
+     */
+    public abstract void resumeTopActivities(boolean scheduleIdle);
+
+    /** Called by AM just before it binds to an application process. */
+    public abstract void preBindApplication(WindowProcessController wpc);
+
+    /** Called by AM when an application process attaches. */
+    public abstract boolean attachApplication(WindowProcessController wpc) throws RemoteException;
+
+    /** @see IActivityManager#notifyLockedProfile(int) */
+    public abstract void notifyLockedProfile(@UserIdInt int userId, int currentUserId);
+
+    /** @see IActivityManager#startConfirmDeviceCredentialIntent(Intent, Bundle) */
+    public abstract void startConfirmDeviceCredentialIntent(Intent intent, Bundle options);
+
+    /** Writes current activity states to the proto stream. */
+    public abstract void writeActivitiesToProto(ProtoOutputStream proto);
+
+    /**
+     * Saves the current activity manager state and includes the saved state in the next dump of
+     * activity manager.
+     */
+    public abstract void saveANRState(String reason);
+
+    /** Clears the previously saved activity manager ANR state. */
+    public abstract void clearSavedANRState();
+
+    /** Dump the current state based on the command. */
+    public abstract void dump(String cmd, FileDescriptor fd, PrintWriter pw, String[] args,
+            int opti, boolean dumpAll, boolean dumpClient, String dumpPackage);
+
+    /** Dump the current state for inclusion in process dump. */
+    public abstract boolean dumpForProcesses(FileDescriptor fd, PrintWriter pw, boolean dumpAll,
+            String dumpPackage, int dumpAppId, boolean needSep, boolean testPssMode,
+            int wakefulness);
+
+    /** Writes the current window process states to the proto stream. */
+    public abstract void writeProcessesToProto(ProtoOutputStream proto, String dumpPackage);
+
+    /** Dump the current activities state. */
+    public abstract boolean dumpActivity(FileDescriptor fd, PrintWriter pw, String name,
+            String[] args, int opti, boolean dumpAll, boolean dumpVisibleStacksOnly,
+            boolean dumpFocusedStackOnly);
+
+    /** @return true if it the activity management system is okay with GC running now. */
+    public abstract boolean canGcNow();
+
+    /** @return the process for the top-most resumed activity in the system. */
+    public abstract WindowProcessController getTopApp();
+
+    /** Generate oom-score-adjustment rank for all tasks in the system based on z-order. */
+    public abstract void rankTaskLayersIfNeeded();
+
+    /** Destroy all activities. */
+    public abstract void scheduleDestroyAllActivities(String reason);
+
+    /** Remove user association with activities. */
+    public abstract void removeUser(int userId);
+
+    /** Switch current focused user for activities. */
+    public abstract boolean switchUser(int userId, UserState userState);
+
+    /** Called whenever an app crashes. */
+    public abstract void onHandleAppCrash(WindowProcessController wpc);
+
+    /**
+     * Finish the topmost activities in all stacks that belong to the crashed app.
+     * @param crashedApp The app that crashed.
+     * @param reason Reason to perform this action.
+     * @return The task id that was finished in this stack, or INVALID_TASK_ID if none was finished.
+     */
+    public abstract int finishTopCrashedActivities(
+            WindowProcessController crashedApp, String reason);
 }
diff --git a/services/core/java/com/android/server/wm/DisplayContent.java b/services/core/java/com/android/server/wm/DisplayContent.java
index d8fd198..ca23360 100644
--- a/services/core/java/com/android/server/wm/DisplayContent.java
+++ b/services/core/java/com/android/server/wm/DisplayContent.java
@@ -145,12 +145,14 @@
 import android.view.DisplayCutout;
 import android.view.DisplayInfo;
 import android.view.Gravity;
+import android.view.InputChannel;
 import android.view.InputDevice;
 import android.view.MagnificationSpec;
 import android.view.Surface;
 import android.view.SurfaceControl;
 import android.view.SurfaceControl.Transaction;
 import android.view.SurfaceSession;
+import android.view.WindowManagerPolicyConstants.PointerEventListener;
 
 import com.android.internal.annotations.VisibleForTesting;
 import com.android.internal.util.ToBooleanFunction;
@@ -454,6 +456,8 @@
      */
     WindowState mInputMethodWindow;
 
+    private final PointerEventDispatcher mPointerEventDispatcher;
+
     private final Consumer<WindowState> mUpdateWindowsForAnimator = w -> {
         WindowStateAnimator winAnimator = w.mWinAnimator;
         final AppWindowToken atoken = w.mAppToken;
@@ -833,6 +837,15 @@
         mDisplayReady = true;
 
         mInputMonitor = new InputMonitor(service, mDisplayId);
+
+        if (mService.mInputManager != null) {
+            final InputChannel inputChannel = mService.mInputManager.monitorInput("Display "
+                    + mDisplayId, mDisplayId);
+            mPointerEventDispatcher = inputChannel != null
+                    ? new PointerEventDispatcher(inputChannel) : null;
+        } else {
+            mPointerEventDispatcher = null;
+        }
     }
 
     boolean isReady() {
@@ -1286,6 +1299,19 @@
 
         mDisplayFrames.onDisplayInfoUpdated(mDisplayInfo,
                 calculateDisplayCutoutForRotation(mDisplayInfo.rotation));
+
+        // Tap Listeners are supported for:
+        // 1. All physical displays (multi-display).
+        // 2. VirtualDisplays on VR, AA (and everything else).
+        if (mPointerEventDispatcher != null && mTapDetector == null) {
+            if (DEBUG_DISPLAY) {
+                Slog.d(TAG,
+                        "Registering PointerEventListener for DisplayId: " + mDisplayId);
+            }
+            mTapDetector = new TaskTapPointerEventListener(mService, this);
+            registerPointerEventListener(mTapDetector);
+            registerPointerEventListener(mService.mMousePositionTracker);
+        }
     }
 
     /**
@@ -2186,13 +2212,10 @@
         try {
             super.removeImmediately();
             if (DEBUG_DISPLAY) Slog.v(TAG_WM, "Removing display=" + this);
-            if (mService.canDispatchPointerEvents()) {
-                if (mTapDetector != null) {
-                    mService.unregisterPointerEventListener(mTapDetector);
-                }
-                if (mDisplayId == DEFAULT_DISPLAY && mService.mMousePositionTracker != null) {
-                    mService.unregisterPointerEventListener(mService.mMousePositionTracker);
-                }
+            if (mPointerEventDispatcher != null && mTapDetector != null) {
+                unregisterPointerEventListener(mTapDetector);
+                unregisterPointerEventListener(mService.mMousePositionTracker);
+                mTapDetector = null;
             }
             mService.mAnimator.removeDisplayLocked(mDisplayId);
             mWindowingLayer.release();
@@ -4409,4 +4432,16 @@
     boolean getLastHasContent() {
         return mLastHasContent;
     }
+
+    void registerPointerEventListener(@NonNull PointerEventListener listener) {
+        if (mPointerEventDispatcher != null) {
+            mPointerEventDispatcher.registerInputEventListener(listener);
+        }
+    }
+
+    void unregisterPointerEventListener(@NonNull PointerEventListener listener) {
+        if (mPointerEventDispatcher != null) {
+            mPointerEventDispatcher.unregisterInputEventListener(listener);
+        }
+    }
 }
diff --git a/services/core/java/com/android/server/wm/InputManagerCallback.java b/services/core/java/com/android/server/wm/InputManagerCallback.java
index b5e2f01..10d77e5 100644
--- a/services/core/java/com/android/server/wm/InputManagerCallback.java
+++ b/services/core/java/com/android/server/wm/InputManagerCallback.java
@@ -108,7 +108,7 @@
         }
 
         // All the calls below need to happen without the WM lock held since they call into AM.
-        mService.mAmInternal.saveANRState(reason);
+        mService.mAtmInternal.saveANRState(reason);
 
         if (appWindowToken != null && appWindowToken.appToken != null) {
             // Notify the activity manager about the timeout and let it decide whether
@@ -125,7 +125,7 @@
         } else if (windowState != null) {
             // Notify the activity manager about the timeout and let it decide whether
             // to abort dispatching or keep waiting.
-            long timeout = mService.mAtmInternal.inputDispatchingTimedOut(
+            long timeout = mService.mAmInternal.inputDispatchingTimedOut(
                     windowState.mSession.mPid, aboveSystem, reason);
             if (timeout >= 0) {
                 // The activity manager declined to abort dispatching.
diff --git a/services/core/java/com/android/server/wm/InputMonitor.java b/services/core/java/com/android/server/wm/InputMonitor.java
index 15f6938..ed3e6c6 100644
--- a/services/core/java/com/android/server/wm/InputMonitor.java
+++ b/services/core/java/com/android/server/wm/InputMonitor.java
@@ -435,14 +435,14 @@
                 final RecentsAnimationController recentsAnimationController =
                         mService.getRecentsAnimationController();
                 if (recentsAnimationController != null
-                        && recentsAnimationController.hasInputConsumerForApp(w.mAppToken)) {
+                        && recentsAnimationController.shouldApplyInputConsumer(w.mAppToken)) {
                     if (recentsAnimationController.updateInputConsumerForApp(
                             recentsAnimationInputConsumer.mWindowHandle, hasFocus)) {
                         addInputWindowHandle(recentsAnimationInputConsumer.mWindowHandle);
                         mAddRecentsAnimationInputConsumerHandle = false;
                     }
-                    // Skip adding the window below regardless of whether there is an input consumer
-                    // to handle it
+                    // If the target app window does not yet exist, then we don't add the input
+                    // consumer window, but also don't add the app window below.
                     return;
                 }
             }
diff --git a/services/core/java/com/android/server/wm/RecentsAnimationController.java b/services/core/java/com/android/server/wm/RecentsAnimationController.java
index 6fef1630..5c80759 100644
--- a/services/core/java/com/android/server/wm/RecentsAnimationController.java
+++ b/services/core/java/com/android/server/wm/RecentsAnimationController.java
@@ -458,10 +458,9 @@
         mRunner = null;
         mCanceled = true;
 
-        // Clear associated input consumers
+        // Update the input windows after the animation is complete
         final InputMonitor inputMonitor =
                 mService.mRoot.getDisplayContent(mDisplayId).getInputMonitor();
-        inputMonitor.destroyInputConsumer(INPUT_CONSUMER_RECENTS_ANIMATION);
         inputMonitor.updateInputWindowsLw(true /*force*/);
 
         // We have deferred all notifications to the target app as a part of the recents animation,
@@ -494,6 +493,11 @@
     @Override
     public void binderDied() {
         cancelAnimation(REORDER_MOVE_TO_ORIGINAL_POSITION, "binderDied");
+
+        // Clear associated input consumers on runner death
+        final InputMonitor inputMonitor =
+                mService.mRoot.getDisplayContent(mDisplayId).getInputMonitor();
+        inputMonitor.destroyInputConsumer(INPUT_CONSUMER_RECENTS_ANIMATION);
     }
 
     void checkAnimationReady(WallpaperController wallpaperController) {
@@ -516,8 +520,14 @@
                 && isTargetOverWallpaper();
     }
 
-    boolean hasInputConsumerForApp(AppWindowToken appToken) {
-        return mInputConsumerEnabled && isAnimatingApp(appToken);
+    /**
+     * @return Whether to use the input consumer to override app input to route home/recents.
+     */
+    boolean shouldApplyInputConsumer(AppWindowToken appToken) {
+        // Only apply the input consumer if it is enabled, it is not the target (home/recents)
+        // being revealed with the transition, and we are actively animating the app as a part of
+        // the animation
+        return mInputConsumerEnabled && mTargetAppToken != appToken && isAnimatingApp(appToken);
     }
 
     boolean updateInputConsumerForApp(InputWindowHandle inputWindowHandle,
@@ -675,6 +685,7 @@
         final String innerPrefix = prefix + "  ";
         pw.print(prefix); pw.println(RecentsAnimationController.class.getSimpleName() + ":");
         pw.print(innerPrefix); pw.println("mPendingStart=" + mPendingStart);
+        pw.print(innerPrefix); pw.println("mPendingAnimations=" + mPendingAnimations.size());
         pw.print(innerPrefix); pw.println("mCanceled=" + mCanceled);
         pw.print(innerPrefix); pw.println("mInputConsumerEnabled=" + mInputConsumerEnabled);
         pw.print(innerPrefix); pw.println("mSplitScreenMinimized=" + mSplitScreenMinimized);
diff --git a/services/core/java/com/android/server/wm/RootWindowContainer.java b/services/core/java/com/android/server/wm/RootWindowContainer.java
index 3fef87d..c8977be 100644
--- a/services/core/java/com/android/server/wm/RootWindowContainer.java
+++ b/services/core/java/com/android/server/wm/RootWindowContainer.java
@@ -228,21 +228,6 @@
             mService.mDisplayManagerInternal.setDisplayInfoOverrideFromWindowManager(
                     displayId, dc.getDisplayInfo());
             dc.configureDisplayPolicy();
-
-            // Tap Listeners are supported for:
-            // 1. All physical displays (multi-display).
-            // 2. VirtualDisplays on VR, AA (and everything else).
-            if (mService.canDispatchPointerEvents()) {
-                if (DEBUG_DISPLAY) {
-                    Slog.d(TAG,
-                            "Registering PointerEventListener for DisplayId: " + displayId);
-                }
-                dc.mTapDetector = new TaskTapPointerEventListener(mService, dc);
-                mService.registerPointerEventListener(dc.mTapDetector);
-                if (displayId == DEFAULT_DISPLAY) {
-                    mService.registerPointerEventListener(mService.mMousePositionTracker);
-                }
-            }
         }
 
         return dc;
diff --git a/services/core/java/com/android/server/wm/TaskSnapshotPersister.java b/services/core/java/com/android/server/wm/TaskSnapshotPersister.java
index 21e807e..6fd17955 100644
--- a/services/core/java/com/android/server/wm/TaskSnapshotPersister.java
+++ b/services/core/java/com/android/server/wm/TaskSnapshotPersister.java
@@ -17,6 +17,7 @@
 package com.android.server.wm;
 
 import static android.graphics.Bitmap.CompressFormat.*;
+
 import static com.android.server.wm.WindowManagerDebugConfig.TAG_WITH_CLASS_NAME;
 import static com.android.server.wm.WindowManagerDebugConfig.TAG_WM;
 
@@ -361,6 +362,7 @@
 
             // For snapshots with reduced resolution, do not create or save full sized bitmaps
             if (mSnapshot.isReducedResolution()) {
+                swBitmap.recycle();
                 return true;
             }
 
@@ -373,6 +375,8 @@
                 Slog.e(TAG, "Unable to open " + file + " for persisting.", e);
                 return false;
             }
+            reduced.recycle();
+            swBitmap.recycle();
             return true;
         }
     }
diff --git a/services/core/java/com/android/server/wm/WindowManagerService.java b/services/core/java/com/android/server/wm/WindowManagerService.java
index 8b1b327..056e92e 100644
--- a/services/core/java/com/android/server/wm/WindowManagerService.java
+++ b/services/core/java/com/android/server/wm/WindowManagerService.java
@@ -753,8 +753,6 @@
     final ArrayMap<AnimationAdapter, SurfaceAnimator> mAnimationTransferMap = new ArrayMap<>();
     final BoundsAnimationController mBoundsAnimationController;
 
-    private final PointerEventDispatcher mPointerEventDispatcher;
-
     private WindowContentFrameStats mTempWindowRenderStats;
 
     private final LatencyTracker mLatencyTracker;
@@ -945,14 +943,6 @@
 
         LocalServices.addService(WindowManagerPolicy.class, mPolicy);
 
-        if(mInputManager != null) {
-            final InputChannel inputChannel = mInputManager.monitorInput(TAG_WM);
-            mPointerEventDispatcher = inputChannel != null
-                    ? new PointerEventDispatcher(inputChannel) : null;
-        } else {
-            mPointerEventDispatcher = null;
-        }
-
         mDisplayManager = (DisplayManager)context.getSystemService(Context.DISPLAY_SERVICE);
 
         mKeyguardDisableHandler = new KeyguardDisableHandler(mContext, mPolicy);
@@ -2685,8 +2675,9 @@
     public void cleanupRecentsAnimation(@RecentsAnimationController.ReorderMode int reorderMode) {
         synchronized (mWindowMap) {
             if (mRecentsAnimationController != null) {
-                mRecentsAnimationController.cleanupAnimation(reorderMode);
+                final RecentsAnimationController controller = mRecentsAnimationController;
                 mRecentsAnimationController = null;
+                controller.cleanupAnimation(reorderMode);
                 mAppTransition.updateBooster();
             }
         }
@@ -3126,18 +3117,23 @@
     }
 
     @Override
-    public void registerPointerEventListener(PointerEventListener listener) {
-        mPointerEventDispatcher.registerInputEventListener(listener);
+    public void registerPointerEventListener(PointerEventListener listener, int displayId) {
+        synchronized (mWindowMap) {
+            final DisplayContent displayContent = mRoot.getDisplayContent(displayId);
+            if (displayContent != null) {
+                displayContent.registerPointerEventListener(listener);
+            }
+        }
     }
 
     @Override
-    public void unregisterPointerEventListener(PointerEventListener listener) {
-        mPointerEventDispatcher.unregisterInputEventListener(listener);
-    }
-
-    /** Check if the service is set to dispatch pointer events. */
-    boolean canDispatchPointerEvents() {
-        return mPointerEventDispatcher != null;
+    public void unregisterPointerEventListener(PointerEventListener listener, int displayId) {
+        synchronized (mWindowMap) {
+            final DisplayContent displayContent = mRoot.getDisplayContent(displayId);
+            if (displayContent != null) {
+                displayContent.unregisterPointerEventListener(listener);
+            }
+        }
     }
 
     // Called by window manager policy. Not exposed externally.
@@ -4816,7 +4812,7 @@
                     synchronized (mWindowMap) {
                         mLastANRState = null;
                     }
-                    mAmInternal.clearSavedANRState();
+                    mAtmInternal.clearSavedANRState();
                 }
                 break;
                 case WALLPAPER_DRAW_PENDING_TIMEOUT: {
diff --git a/services/core/jni/Android.bp b/services/core/jni/Android.bp
index 045f4eb..15a3a1a3 100644
--- a/services/core/jni/Android.bp
+++ b/services/core/jni/Android.bp
@@ -99,6 +99,7 @@
         "libutils",
         "libhwui",
         "libbpf",
+        "libnetdbpf",
         "libnetdutils",
         "android.hardware.audio.common@2.0",
         "android.hardware.broadcastradio@1.0",
diff --git a/services/core/jni/com_android_server_input_InputManagerService.cpp b/services/core/jni/com_android_server_input_InputManagerService.cpp
index c66d03c..3943dba 100644
--- a/services/core/jni/com_android_server_input_InputManagerService.cpp
+++ b/services/core/jni/com_android_server_input_InputManagerService.cpp
@@ -217,7 +217,7 @@
     void setDisplayViewports(JNIEnv* env, jobjectArray viewportObjArray);
 
     status_t registerInputChannel(JNIEnv* env, const sp<InputChannel>& inputChannel,
-            const sp<InputWindowHandle>& inputWindowHandle, bool monitor);
+            const sp<InputWindowHandle>& inputWindowHandle, int32_t displayId);
     status_t unregisterInputChannel(JNIEnv* env, const sp<InputChannel>& inputChannel);
 
     void setInputWindows(JNIEnv* env, jobjectArray windowHandleObjArray, int32_t displayId);
@@ -442,11 +442,11 @@
 }
 
 status_t NativeInputManager::registerInputChannel(JNIEnv* /* env */,
-        const sp<InputChannel>& inputChannel,
-        const sp<InputWindowHandle>& inputWindowHandle, bool monitor) {
+        const sp<InputChannel>& inputChannel, const sp<InputWindowHandle>& inputWindowHandle,
+                int32_t displayId) {
     ATRACE_CALL();
-    return mInputManager->getDispatcher()->registerInputChannel(
-            inputChannel, inputWindowHandle, monitor);
+    return mInputManager->getDispatcher()->registerInputChannel(inputChannel, inputWindowHandle,
+            displayId);
 }
 
 status_t NativeInputManager::unregisterInputChannel(JNIEnv* /* env */,
@@ -1316,7 +1316,7 @@
 }
 
 static void nativeRegisterInputChannel(JNIEnv* env, jclass /* clazz */,
-        jlong ptr, jobject inputChannelObj, jobject inputWindowHandleObj, jboolean monitor) {
+        jlong ptr, jobject inputChannelObj, jobject inputWindowHandleObj, jint displayId) {
     NativeInputManager* im = reinterpret_cast<NativeInputManager*>(ptr);
 
     sp<InputChannel> inputChannel = android_view_InputChannel_getInputChannel(env,
@@ -1330,7 +1330,7 @@
             android_server_InputWindowHandle_getHandle(env, inputWindowHandleObj);
 
     status_t status = im->registerInputChannel(
-            env, inputChannel, inputWindowHandle, monitor);
+            env, inputChannel, inputWindowHandle, displayId);
     if (status) {
         std::string message;
         message += StringPrintf("Failed to register input channel.  status=%d", status);
@@ -1338,7 +1338,8 @@
         return;
     }
 
-    if (! monitor) {
+    // If inputWindowHandle is null and displayId >= 0, treat inputChannel as monitor.
+    if (inputWindowHandle != nullptr || displayId == ADISPLAY_ID_NONE) {
         android_view_InputChannel_setDisposeCallback(env, inputChannelObj,
                 handleInputChannelDisposed, im);
     }
@@ -1639,7 +1640,7 @@
     { "nativeHasKeys", "(JII[I[Z)Z",
             (void*) nativeHasKeys },
     { "nativeRegisterInputChannel",
-            "(JLandroid/view/InputChannel;Lcom/android/server/input/InputWindowHandle;Z)V",
+            "(JLandroid/view/InputChannel;Lcom/android/server/input/InputWindowHandle;I)V",
             (void*) nativeRegisterInputChannel },
     { "nativeUnregisterInputChannel", "(JLandroid/view/InputChannel;)V",
             (void*) nativeUnregisterInputChannel },
diff --git a/services/core/jni/com_android_server_net_NetworkStatsService.cpp b/services/core/jni/com_android_server_net_NetworkStatsService.cpp
index 3302dea..649f1a5 100644
--- a/services/core/jni/com_android_server_net_NetworkStatsService.cpp
+++ b/services/core/jni/com_android_server_net_NetworkStatsService.cpp
@@ -30,8 +30,8 @@
 #include <utils/Log.h>
 
 #include "android-base/unique_fd.h"
-#include "bpf/BpfNetworkStats.h"
 #include "bpf/BpfUtils.h"
+#include "netdbpf/BpfNetworkStats.h"
 
 using android::bpf::Stats;
 using android::bpf::hasBpfSupport;
diff --git a/services/devicepolicy/java/com/android/server/devicepolicy/BaseIDevicePolicyManager.java b/services/devicepolicy/java/com/android/server/devicepolicy/BaseIDevicePolicyManager.java
index 4350596..2dbbf55 100644
--- a/services/devicepolicy/java/com/android/server/devicepolicy/BaseIDevicePolicyManager.java
+++ b/services/devicepolicy/java/com/android/server/devicepolicy/BaseIDevicePolicyManager.java
@@ -15,7 +15,9 @@
  */
 package com.android.server.devicepolicy;
 
+import android.app.admin.DevicePolicyManager;
 import android.app.admin.IDevicePolicyManager;
+import android.content.ComponentName;
 
 import com.android.server.SystemService;
 
@@ -68,7 +70,22 @@
     }
 
     @Override
-    public boolean checkDeviceIdentifierAccess(String packageName, int userHandle) {
+    public boolean checkDeviceIdentifierAccess(String packageName, int userHandle, int pid,
+            int uid) {
         return false;
     }
+
+    @Override
+    public void setGlobalPrivateDns(ComponentName who, int mode, String privateDnsHost) {
+    }
+
+    @Override
+    public int getGlobalPrivateDnsMode(ComponentName who) {
+        return DevicePolicyManager.PRIVATE_DNS_MODE_UNKNOWN;
+    }
+
+    @Override
+    public String getGlobalPrivateDnsHost(ComponentName who) {
+        return null;
+    }
 }
diff --git a/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java b/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
index 913b844..b88165e 100644
--- a/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
+++ b/services/devicepolicy/java/com/android/server/devicepolicy/DevicePolicyManagerService.java
@@ -55,12 +55,18 @@
 import static android.app.admin.DevicePolicyManager.LOCK_TASK_FEATURE_OVERVIEW;
 import static android.app.admin.DevicePolicyManager.PASSWORD_QUALITY_COMPLEX;
 import static android.app.admin.DevicePolicyManager.PASSWORD_QUALITY_UNSPECIFIED;
+import static android.app.admin.DevicePolicyManager.PRIVATE_DNS_MODE_UNKNOWN;
+import static android.app.admin.DevicePolicyManager.PRIVATE_DNS_MODE_OFF;
+import static android.app.admin.DevicePolicyManager.PRIVATE_DNS_MODE_OPPORTUNISTIC;
+import static android.app.admin.DevicePolicyManager.PRIVATE_DNS_MODE_PROVIDER_HOSTNAME;
 import static android.app.admin.DevicePolicyManager.PROFILE_KEYGUARD_FEATURES_AFFECT_OWNER;
 import static android.app.admin.DevicePolicyManager.WIPE_EUICC;
 import static android.app.admin.DevicePolicyManager.WIPE_EXTERNAL_STORAGE;
 import static android.app.admin.DevicePolicyManager.WIPE_RESET_PROTECTION_DATA;
 import static android.content.pm.PackageManager.MATCH_UNINSTALLED_PACKAGES;
 
+import static android.provider.Settings.Global.PRIVATE_DNS_MODE;
+import static android.provider.Settings.Global.PRIVATE_DNS_SPECIFIER;
 import static android.provider.Telephony.Carriers.DPC_URI;
 import static android.provider.Telephony.Carriers.ENFORCE_KEY;
 import static android.provider.Telephony.Carriers.ENFORCE_MANAGED_URI;
@@ -145,6 +151,7 @@
 import android.media.IAudioService;
 import android.net.ConnectivityManager;
 import android.net.IIpConnectivityMetrics;
+import android.net.NetworkUtils;
 import android.net.ProxyInfo;
 import android.net.Uri;
 import android.net.metrics.IpConnectivityLog;
@@ -199,6 +206,7 @@
 import android.util.Pair;
 import android.util.Slog;
 import android.util.SparseArray;
+import android.util.StatsLog;
 import android.util.Xml;
 import android.view.IWindowManager;
 import android.view.accessibility.AccessibilityManager;
@@ -395,6 +403,8 @@
         GLOBAL_SETTINGS_WHITELIST.add(Settings.Global.WIFI_SLEEP_POLICY);
         GLOBAL_SETTINGS_WHITELIST.add(Settings.Global.STAY_ON_WHILE_PLUGGED_IN);
         GLOBAL_SETTINGS_WHITELIST.add(Settings.Global.WIFI_DEVICE_OWNER_CONFIGS_LOCKDOWN);
+        GLOBAL_SETTINGS_WHITELIST.add(Settings.Global.PRIVATE_DNS_MODE);
+        GLOBAL_SETTINGS_WHITELIST.add(Settings.Global.PRIVATE_DNS_SPECIFIER);
 
         GLOBAL_SETTINGS_DEPRECATED = new ArraySet<>();
         GLOBAL_SETTINGS_DEPRECATED.add(Settings.Global.BLUETOOTH_ON);
@@ -7862,7 +7872,21 @@
     }
 
     @Override
-    public boolean checkDeviceIdentifierAccess(String packageName, int userHandle) {
+    public boolean checkDeviceIdentifierAccess(String packageName, int userHandle, int pid,
+            int uid) {
+        // If the caller is not a system app then it should only be able to check its own device
+        // identifier access.
+        int callingAppId = UserHandle.getAppId(mInjector.binderGetCallingUid());
+        if (callingAppId >= Process.FIRST_APPLICATION_UID
+                && callingAppId != UserHandle.getAppId(uid)) {
+            return false;
+        }
+        // A device or profile owner must also have the READ_PHONE_STATE permission to access device
+        // identifiers. If the package being checked does not have this permission then deny access.
+        if (mContext.checkPermission(android.Manifest.permission.READ_PHONE_STATE, pid, uid)
+                != PackageManager.PERMISSION_GRANTED) {
+            return false;
+        }
         // Allow access to the device owner.
         ComponentName deviceOwner = getDeviceOwnerComponent(true);
         if (deviceOwner != null && deviceOwner.getPackageName().equals(packageName)) {
@@ -9364,6 +9388,7 @@
             }
             saveUserRestrictionsLocked(userHandle);
         }
+        StatsLog.write(StatsLog.USER_RESTRICTION_CHANGED, key, enabledFromThisOwner);
         if (SecurityLog.isLoggingEnabled()) {
             final int eventTag = enabledFromThisOwner
                     ? SecurityLog.TAG_USER_RESTRICTION_ADDED
@@ -13114,4 +13139,78 @@
     private static String getManagedProvisioningPackage(Context context) {
         return context.getResources().getString(R.string.config_managed_provisioning_package);
     }
+
+    private void putPrivateDnsSettings(@Nullable String mode, @Nullable String host) {
+        // Set Private DNS settings using system permissions, as apps cannot write
+        // to global settings.
+        long origId = mInjector.binderClearCallingIdentity();
+        try {
+            mInjector.settingsGlobalPutString(PRIVATE_DNS_MODE, mode);
+            mInjector.settingsGlobalPutString(PRIVATE_DNS_SPECIFIER, host);
+        } finally {
+            mInjector.binderRestoreCallingIdentity(origId);
+        }
+    }
+
+    @Override
+    public void setGlobalPrivateDns(@NonNull ComponentName who, int mode, String privateDnsHost) {
+        if (!mHasFeature) {
+            return;
+        }
+
+        Preconditions.checkNotNull(who, "ComponentName is null");
+        enforceDeviceOwner(who);
+
+        switch (mode) {
+            case PRIVATE_DNS_MODE_OPPORTUNISTIC:
+                if (!TextUtils.isEmpty(privateDnsHost)) {
+                    throw new IllegalArgumentException("A DNS host should not be provided when " +
+                            "setting opportunistic mode.");
+                }
+                putPrivateDnsSettings(ConnectivityManager.PRIVATE_DNS_MODE_OPPORTUNISTIC, null);
+                break;
+            case PRIVATE_DNS_MODE_PROVIDER_HOSTNAME:
+                if (!NetworkUtils.isWeaklyValidatedHostname(privateDnsHost)) {
+                    throw new IllegalArgumentException(
+                            String.format("Provided hostname is not valid: %s", privateDnsHost));
+                }
+                putPrivateDnsSettings(ConnectivityManager.PRIVATE_DNS_MODE_PROVIDER_HOSTNAME,
+                        privateDnsHost);
+                break;
+            default:
+                throw new IllegalArgumentException(String.format("Unsupported mode: %d", mode));
+        }
+    }
+
+    @Override
+    public int getGlobalPrivateDnsMode(@NonNull ComponentName who) {
+        if (!mHasFeature) {
+            return PRIVATE_DNS_MODE_UNKNOWN;
+        }
+
+        Preconditions.checkNotNull(who, "ComponentName is null");
+        enforceDeviceOwner(who);
+        switch (mInjector.settingsGlobalGetString(PRIVATE_DNS_MODE)) {
+            case ConnectivityManager.PRIVATE_DNS_MODE_OFF:
+                return PRIVATE_DNS_MODE_OFF;
+            case ConnectivityManager.PRIVATE_DNS_MODE_OPPORTUNISTIC:
+                return PRIVATE_DNS_MODE_OPPORTUNISTIC;
+            case ConnectivityManager.PRIVATE_DNS_MODE_PROVIDER_HOSTNAME:
+                return PRIVATE_DNS_MODE_PROVIDER_HOSTNAME;
+        }
+
+        return PRIVATE_DNS_MODE_UNKNOWN;
+    }
+
+    @Override
+    public String getGlobalPrivateDnsHost(@NonNull ComponentName who) {
+        if (!mHasFeature) {
+            return null;
+        }
+
+        Preconditions.checkNotNull(who, "ComponentName is null");
+        enforceDeviceOwner(who);
+
+        return mInjector.settingsGlobalGetString(PRIVATE_DNS_SPECIFIER);
+    }
 }
diff --git a/services/tests/mockingservicestests/src/com/android/server/AlarmManagerServiceTest.java b/services/tests/mockingservicestests/src/com/android/server/AlarmManagerServiceTest.java
index de3d285..877c8fa 100644
--- a/services/tests/mockingservicestests/src/com/android/server/AlarmManagerServiceTest.java
+++ b/services/tests/mockingservicestests/src/com/android/server/AlarmManagerServiceTest.java
@@ -58,6 +58,8 @@
 import androidx.test.filters.SmallTest;
 import androidx.test.runner.AndroidJUnit4;
 
+import com.android.internal.annotations.GuardedBy;
+
 import org.junit.After;
 import org.junit.Before;
 import org.junit.Test;
@@ -67,8 +69,6 @@
 import org.mockito.Mock;
 import org.mockito.MockitoSession;
 
-import javax.annotation.concurrent.GuardedBy;
-
 @SmallTest
 @RunWith(AndroidJUnit4.class)
 public class AlarmManagerServiceTest {
diff --git a/services/tests/servicestests/src/com/android/server/job/controllers/JobStatusTest.java b/services/tests/mockingservicestests/src/com/android/server/job/controllers/JobStatusTest.java
similarity index 78%
rename from services/tests/servicestests/src/com/android/server/job/controllers/JobStatusTest.java
rename to services/tests/mockingservicestests/src/com/android/server/job/controllers/JobStatusTest.java
index 1752479..b63138e 100644
--- a/services/tests/servicestests/src/com/android/server/job/controllers/JobStatusTest.java
+++ b/services/tests/mockingservicestests/src/com/android/server/job/controllers/JobStatusTest.java
@@ -16,19 +16,27 @@
 
 package com.android.server.job.controllers;
 
+import static com.android.dx.mockito.inline.extended.ExtendedMockito.doReturn;
+import static com.android.dx.mockito.inline.extended.ExtendedMockito.mock;
+import static com.android.dx.mockito.inline.extended.ExtendedMockito.mockitoSession;
+
 import static org.junit.Assert.assertEquals;
 
 import android.app.job.JobInfo;
 import android.content.ComponentName;
+import android.content.pm.PackageManagerInternal;
 import android.os.SystemClock;
 
 import androidx.test.runner.AndroidJUnit4;
 
+import com.android.server.LocalServices;
 import com.android.server.job.JobSchedulerService;
 
+import org.junit.After;
 import org.junit.Before;
 import org.junit.Test;
 import org.junit.runner.RunWith;
+import org.mockito.MockitoSession;
 
 import java.time.Clock;
 import java.time.ZoneOffset;
@@ -37,8 +45,17 @@
 public class JobStatusTest {
     private static final double DELTA = 0.00001;
 
+    private MockitoSession mMockingSession;
+
     @Before
     public void setUp() throws Exception {
+        mMockingSession = mockitoSession()
+                .initMocks(this)
+                .mockStatic(LocalServices.class)
+                .startMocking();
+        doReturn(mock(PackageManagerInternal.class))
+                .when(() -> LocalServices.getService(PackageManagerInternal.class));
+
         // Freeze the clocks at this moment in time
         JobSchedulerService.sSystemClock =
                 Clock.fixed(Clock.systemUTC().instant(), ZoneOffset.UTC);
@@ -48,6 +65,13 @@
                 Clock.fixed(SystemClock.elapsedRealtimeClock().instant(), ZoneOffset.UTC);
     }
 
+    @After
+    public void tearDown() {
+        if (mMockingSession != null) {
+            mMockingSession.finishMocking();
+        }
+    }
+
     @Test
     public void testFraction() throws Exception {
         final long now = JobSchedulerService.sElapsedRealtimeClock.millis();
diff --git a/services/tests/servicestests/src/com/android/server/NetworkPolicyManagerServiceTest.java b/services/tests/servicestests/src/com/android/server/NetworkPolicyManagerServiceTest.java
index 1eb88ba..113ee2d 100644
--- a/services/tests/servicestests/src/com/android/server/NetworkPolicyManagerServiceTest.java
+++ b/services/tests/servicestests/src/com/android/server/NetworkPolicyManagerServiceTest.java
@@ -26,13 +26,21 @@
 import static android.net.NetworkPolicyManager.POLICY_ALLOW_METERED_BACKGROUND;
 import static android.net.NetworkPolicyManager.POLICY_NONE;
 import static android.net.NetworkPolicyManager.POLICY_REJECT_METERED_BACKGROUND;
+import static android.net.NetworkPolicyManager.RULE_ALLOW_ALL;
+import static android.net.NetworkPolicyManager.RULE_ALLOW_METERED;
+import static android.net.NetworkPolicyManager.RULE_NONE;
+import static android.net.NetworkPolicyManager.RULE_REJECT_ALL;
+import static android.net.NetworkPolicyManager.RULE_REJECT_METERED;
+import static android.net.NetworkPolicyManager.RULE_TEMPORARY_ALLOW_METERED;
 import static android.net.NetworkPolicyManager.uidPoliciesToString;
+import static android.net.NetworkPolicyManager.uidRulesToString;
 import static android.net.NetworkStats.IFACE_ALL;
 import static android.net.NetworkStats.SET_ALL;
 import static android.net.NetworkStats.TAG_ALL;
 import static android.net.NetworkTemplate.buildTemplateMobileAll;
 import static android.net.NetworkTemplate.buildTemplateWifi;
 import static android.net.TrafficStats.MB_IN_BYTES;
+import static android.os.Process.SYSTEM_UID;
 import static android.telephony.CarrierConfigManager.ACTION_CARRIER_CONFIG_CHANGED;
 import static android.telephony.CarrierConfigManager.DATA_CYCLE_THRESHOLD_DISABLED;
 import static android.telephony.CarrierConfigManager.DATA_CYCLE_USE_PLATFORM_DEFAULT;
@@ -124,6 +132,7 @@
 import android.text.format.Time;
 import android.util.DataUnit;
 import android.util.Log;
+import android.util.Pair;
 import android.util.Range;
 import android.util.RecurrenceRule;
 
@@ -171,6 +180,7 @@
 import java.time.ZoneId;
 import java.time.ZoneOffset;
 import java.time.ZonedDateTime;
+import java.util.ArrayList;
 import java.util.Arrays;
 import java.util.Calendar;
 import java.util.Iterator;
@@ -1644,6 +1654,76 @@
                 true);
     }
 
+    /**
+     * Exhaustively test isUidNetworkingBlocked to output the expected results based on external
+     * conditions.
+     */
+    @Test
+    public void testIsUidNetworkingBlocked() {
+        final ArrayList<Pair<Boolean, Integer>> expectedBlockedStates = new ArrayList<>();
+
+        // Metered network. Data saver on.
+        expectedBlockedStates.add(new Pair<>(true, RULE_NONE));
+        expectedBlockedStates.add(new Pair<>(false, RULE_ALLOW_METERED));
+        expectedBlockedStates.add(new Pair<>(false, RULE_TEMPORARY_ALLOW_METERED));
+        expectedBlockedStates.add(new Pair<>(true, RULE_REJECT_METERED));
+        expectedBlockedStates.add(new Pair<>(true, RULE_ALLOW_ALL));
+        expectedBlockedStates.add(new Pair<>(true, RULE_REJECT_ALL));
+        verifyNetworkBlockedState(
+                true /* metered */, true /* backgroundRestricted */, expectedBlockedStates);
+        expectedBlockedStates.clear();
+
+        // Metered network. Data saver off.
+        expectedBlockedStates.add(new Pair<>(false, RULE_NONE));
+        expectedBlockedStates.add(new Pair<>(false, RULE_ALLOW_METERED));
+        expectedBlockedStates.add(new Pair<>(false, RULE_TEMPORARY_ALLOW_METERED));
+        expectedBlockedStates.add(new Pair<>(true, RULE_REJECT_METERED));
+        expectedBlockedStates.add(new Pair<>(false, RULE_ALLOW_ALL));
+        expectedBlockedStates.add(new Pair<>(true, RULE_REJECT_ALL));
+        verifyNetworkBlockedState(
+                true /* metered */, false /* backgroundRestricted */, expectedBlockedStates);
+        expectedBlockedStates.clear();
+
+        // Non-metered network. Data saver on.
+        expectedBlockedStates.add(new Pair<>(false, RULE_NONE));
+        expectedBlockedStates.add(new Pair<>(false, RULE_ALLOW_METERED));
+        expectedBlockedStates.add(new Pair<>(false, RULE_TEMPORARY_ALLOW_METERED));
+        expectedBlockedStates.add(new Pair<>(false, RULE_REJECT_METERED));
+        expectedBlockedStates.add(new Pair<>(false, RULE_ALLOW_ALL));
+        expectedBlockedStates.add(new Pair<>(true, RULE_REJECT_ALL));
+        verifyNetworkBlockedState(
+                false /* metered */, true /* backgroundRestricted */, expectedBlockedStates);
+
+        // Non-metered network. Data saver off. The result is the same as previous case since
+        // the network is blocked only for RULE_REJECT_ALL regardless of data saver.
+        verifyNetworkBlockedState(
+                false /* metered */, false /* backgroundRestricted */, expectedBlockedStates);
+        expectedBlockedStates.clear();
+    }
+
+    private void verifyNetworkBlockedState(boolean metered, boolean backgroundRestricted,
+            ArrayList<Pair<Boolean, Integer>> expectedBlockedStateForRules) {
+        final NetworkPolicyManagerInternal npmi = LocalServices
+                .getService(NetworkPolicyManagerInternal.class);
+
+        for (Pair<Boolean, Integer> pair : expectedBlockedStateForRules) {
+            final boolean expectedResult = pair.first;
+            final int rule = pair.second;
+            assertEquals(formatBlockedStateError(UID_A, rule, metered, backgroundRestricted),
+                    expectedResult,
+                    npmi.isUidNetworkingBlocked(UID_A, rule, metered, backgroundRestricted));
+            assertFalse(formatBlockedStateError(SYSTEM_UID, rule, metered, backgroundRestricted),
+                    npmi.isUidNetworkingBlocked(SYSTEM_UID, rule, metered, backgroundRestricted));
+        }
+    }
+
+    private String formatBlockedStateError(int uid, int rule, boolean metered,
+            boolean backgroundRestricted) {
+        return String.format(
+                "Unexpected BlockedState: (uid=%d, rule=%s, metered=%b, backgroundRestricted=%b)",
+                uid, uidRulesToString(rule), metered, backgroundRestricted);
+    }
+
     private SubscriptionPlan buildMonthlyDataPlan(ZonedDateTime start, long limitBytes) {
         return SubscriptionPlan.Builder
                 .createRecurringMonthly(start)
diff --git a/services/tests/servicestests/src/com/android/server/am/ActivityDisplayTests.java b/services/tests/servicestests/src/com/android/server/am/ActivityDisplayTests.java
index ea90ffd..0da5742 100644
--- a/services/tests/servicestests/src/com/android/server/am/ActivityDisplayTests.java
+++ b/services/tests/servicestests/src/com/android/server/am/ActivityDisplayTests.java
@@ -20,11 +20,14 @@
 import static android.app.WindowConfiguration.WINDOWING_MODE_FULLSCREEN;
 import static android.app.WindowConfiguration.WINDOWING_MODE_PINNED;
 import static android.content.pm.ActivityInfo.FLAG_ALWAYS_FOCUSABLE;
+import static android.content.pm.ActivityInfo.FLAG_SHOW_WHEN_LOCKED;
 
 import static com.android.server.am.ActivityStackSupervisor.ON_TOP;
 
 import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNull;
 import static org.junit.Assert.assertTrue;
+import static org.mockito.Mockito.doReturn;
 
 import android.platform.test.annotations.Presubmit;
 
@@ -131,4 +134,57 @@
         new ActivityBuilder(mService).setTask(fullscreenTask).build();
         return fullscreenStack;
     }
+
+    /**
+     * Verifies the correct activity is returned when querying the top running activity.
+     */
+    @Test
+    public void testTopRunningActivity() {
+        // Create stack to hold focus.
+        final ActivityDisplay display = mSupervisor.getDefaultDisplay();
+        final ActivityStack emptyStack = display.createStack(WINDOWING_MODE_FULLSCREEN,
+                ACTIVITY_TYPE_STANDARD, true /* onTop */);
+
+        final KeyguardController keyguard = mSupervisor.getKeyguardController();
+        final ActivityStack stack = mSupervisor.getDefaultDisplay().createStack(
+                WINDOWING_MODE_FULLSCREEN, ACTIVITY_TYPE_STANDARD, true /* onTop */);
+        final ActivityRecord activity = new ActivityBuilder(mService).setCreateTask(true)
+                .setStack(stack).build();
+
+        // Make sure the top running activity is not affected when keyguard is not locked.
+        assertTopRunningActivity(activity, display);
+
+        // Check to make sure activity not reported when it cannot show on lock and lock is on.
+        doReturn(true).when(keyguard).isKeyguardLocked();
+        assertEquals(activity, display.topRunningActivity());
+        assertNull(display.topRunningActivity(true /* considerKeyguardState */));
+
+        // Change focus to stack with activity.
+        stack.moveToFront("focusChangeToTestStack");
+        assertEquals(stack, display.getFocusedStack());
+        assertEquals(activity, display.topRunningActivity());
+        assertNull(display.topRunningActivity(true /* considerKeyguardState */));
+
+        // Add activity that should be shown on the keyguard.
+        final ActivityRecord showWhenLockedActivity = new ActivityBuilder(mService)
+                .setCreateTask(true)
+                .setStack(stack)
+                .setActivityFlags(FLAG_SHOW_WHEN_LOCKED)
+                .build();
+
+        // Ensure the show when locked activity is returned.
+        assertTopRunningActivity(showWhenLockedActivity, display);
+
+        // Change focus back to empty stack.
+        emptyStack.moveToFront("focusChangeToEmptyStack");
+        assertEquals(emptyStack, display.getFocusedStack());
+        // If there is no running activity in focused stack, the running activity in next focusable
+        // stack should be returned.
+        assertTopRunningActivity(showWhenLockedActivity, display);
+    }
+
+    private static void assertTopRunningActivity(ActivityRecord top, ActivityDisplay display) {
+        assertEquals(top, display.topRunningActivity());
+        assertEquals(top, display.topRunningActivity(true /* considerKeyguardState */));
+    }
 }
diff --git a/services/tests/servicestests/src/com/android/server/am/ActivityManagerServiceTest.java b/services/tests/servicestests/src/com/android/server/am/ActivityManagerServiceTest.java
index c44e492..f42f5b1 100644
--- a/services/tests/servicestests/src/com/android/server/am/ActivityManagerServiceTest.java
+++ b/services/tests/servicestests/src/com/android/server/am/ActivityManagerServiceTest.java
@@ -64,6 +64,7 @@
 import android.os.RemoteException;
 import android.os.SystemClock;
 
+import androidx.test.filters.FlakyTest;
 import androidx.test.filters.MediumTest;
 import androidx.test.filters.SmallTest;
 import androidx.test.runner.AndroidJUnit4;
@@ -102,6 +103,7 @@
  *     com.android.frameworks.servicestests/androidx.test.runner.AndroidJUnitRunner
  */
 @SmallTest
+@FlakyTest(bugId = 113616538)
 @RunWith(AndroidJUnit4.class)
 public class ActivityManagerServiceTest {
     private static final String TAG = ActivityManagerServiceTest.class.getSimpleName();
@@ -173,7 +175,7 @@
                 true); // expectNotify
 
         // Explicitly setting the seq counter for more verification.
-        mAms.mProcStateSeqCounter = 42;
+        mAms.mProcessList.mProcStateSeqCounter = 42;
 
         // Uid state is not moving from background to foreground or vice versa.
         verifySeqCounterAndInteractions(uidRec,
@@ -260,7 +262,7 @@
 
         final ProcessRecord appRec = new ProcessRecord(mAms, new ApplicationInfo(), TAG, uid, null);
         appRec.thread = Mockito.mock(IApplicationThread.class);
-        mAms.mLruProcesses.add(appRec);
+        mAms.mProcessList.mLruProcesses.add(appRec);
 
         return uidRec;
     }
@@ -275,11 +277,11 @@
         uidRec.curProcState = curState;
         mAms.incrementProcStateSeqAndNotifyAppsLocked();
 
-        assertEquals(expectedGlobalCounter, mAms.mProcStateSeqCounter);
+        assertEquals(expectedGlobalCounter, mAms.mProcessList.mProcStateSeqCounter);
         assertEquals(expectedCurProcStateSeq, uidRec.curProcStateSeq);
 
-        for (int i = mAms.mLruProcesses.size() - 1; i >= 0; --i) {
-            final ProcessRecord app = mAms.mLruProcesses.get(i);
+        for (int i = mAms.mProcessList.getLruSizeLocked() - 1; i >= 0; --i) {
+            final ProcessRecord app = mAms.mProcessList.mLruProcesses.get(i);
             // AMS should notify apps only for block states other than NETWORK_STATE_NO_CHANGE.
             if (app.uid == uidRec.uid && expectedBlockState == NETWORK_STATE_BLOCK) {
                 verify(app.thread).setNetworkBlockSeq(uidRec.curProcStateSeq);
@@ -829,4 +831,4 @@
             mRestricted = restricted;
         }
     }
-}
\ No newline at end of file
+}
diff --git a/services/tests/servicestests/src/com/android/server/am/ActivityManagerTest.java b/services/tests/servicestests/src/com/android/server/am/ActivityManagerTest.java
index ba25b16..2dfb375 100644
--- a/services/tests/servicestests/src/com/android/server/am/ActivityManagerTest.java
+++ b/services/tests/servicestests/src/com/android/server/am/ActivityManagerTest.java
@@ -16,38 +16,59 @@
 
 package com.android.server.am;
 
+import static com.google.common.truth.Truth.assertThat;
+
+import static org.junit.Assert.assertEquals;
+
 import android.app.ActivityManager;
+import android.app.ActivityManager.RecentTaskInfo;
 import android.app.IActivityManager;
-import android.os.ServiceManager;
-import android.os.UserHandle;
 import android.os.RemoteException;
-import android.test.AndroidTestCase;
+import android.os.UserHandle;
+import android.platform.test.annotations.Presubmit;
+
+import org.junit.Before;
+import org.junit.Test;
 
 import java.util.List;
 
-public class ActivityManagerTest extends AndroidTestCase {
+import androidx.test.filters.FlakyTest;
 
-    IActivityManager service;
-    @Override
+/**
+ * Tests for {@link ActivityManager}.
+ *
+ * Build/Install/Run:
+ *  atest FrameworksServicesTests:com.android.server.am.ActivityManagerTest
+ */
+@Presubmit
+@FlakyTest(detail = "Promote to presubmit if stable")
+public class ActivityManagerTest {
+
+    private IActivityManager service;
+
+    @Before
     public void setUp() throws Exception {
-        super.setUp();
         service = ActivityManager.getService();
     }
 
+    @Test
     public void testTaskIdsForRunningUsers() throws RemoteException {
-        for(int userId : service.getRunningUserIds()) {
+        int[] runningUserIds = service.getRunningUserIds();
+        assertThat(runningUserIds).isNotEmpty();
+        for (int userId : runningUserIds) {
             testTaskIdsForUser(userId);
         }
     }
 
     private void testTaskIdsForUser(int userId) throws RemoteException {
-        List<ActivityManager.RecentTaskInfo> recentTasks = service.getRecentTasks(
-                100, 0, userId).getList();
-        if(recentTasks != null) {
-            for(ActivityManager.RecentTaskInfo recentTask : recentTasks) {
-                int taskId = recentTask.persistentId;
+        List<?> recentTasks = service.getRecentTasks(100, 0, userId).getList();
+        if (recentTasks != null) {
+            for (Object elem : recentTasks) {
+                assertThat(elem).isInstanceOf(RecentTaskInfo.class);
+                RecentTaskInfo recentTask = (RecentTaskInfo) elem;
+                int taskId = recentTask.taskId;
                 assertEquals("The task id " + taskId + " should not belong to user " + userId,
-                        taskId / UserHandle.PER_USER_RANGE, userId);
+                             taskId / UserHandle.PER_USER_RANGE, userId);
             }
         }
     }
diff --git a/services/tests/servicestests/src/com/android/server/am/ActivityStackSupervisorTests.java b/services/tests/servicestests/src/com/android/server/am/ActivityStackSupervisorTests.java
index 81a0934..2c993d3 100644
--- a/services/tests/servicestests/src/com/android/server/am/ActivityStackSupervisorTests.java
+++ b/services/tests/servicestests/src/com/android/server/am/ActivityStackSupervisorTests.java
@@ -18,13 +18,13 @@
 
 import static android.app.ActivityManager.START_DELIVERED_TO_TOP;
 import static android.app.ActivityManager.START_TASK_TO_FRONT;
+import static android.app.WindowConfiguration.ACTIVITY_TYPE_RECENTS;
 import static android.app.WindowConfiguration.ACTIVITY_TYPE_STANDARD;
 import static android.app.WindowConfiguration.WINDOWING_MODE_FULLSCREEN;
 import static android.app.WindowConfiguration.WINDOWING_MODE_FULLSCREEN_OR_SPLIT_SCREEN_SECONDARY;
 import static android.app.WindowConfiguration.WINDOWING_MODE_PINNED;
 import static android.app.WindowConfiguration.WINDOWING_MODE_SPLIT_SCREEN_PRIMARY;
 import static android.content.pm.ActivityInfo.FLAG_ALWAYS_FOCUSABLE;
-import static android.content.pm.ActivityInfo.FLAG_SHOW_WHEN_LOCKED;
 
 import static com.android.server.am.ActivityStack.REMOVE_TASK_MODE_DESTROYING;
 import static com.android.server.am.ActivityStackSupervisor.MATCH_TASK_IN_STACKS_OR_RECENT_TASKS_AND_RESTORE;
@@ -34,9 +34,11 @@
 import static org.junit.Assert.assertNull;
 import static org.junit.Assert.assertTrue;
 import static org.mockito.ArgumentMatchers.anyInt;
+import static org.mockito.ArgumentMatchers.contains;
 import static org.mockito.ArgumentMatchers.eq;
 import static org.mockito.Mockito.doReturn;
 import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.never;
 import static org.mockito.Mockito.reset;
 import static org.mockito.Mockito.spy;
 import static org.mockito.Mockito.times;
@@ -304,62 +306,6 @@
     }
 
     /**
-     * Verifies the correct activity is returned when querying the top running activity.
-     */
-    @Test
-    public void testTopRunningActivity() throws Exception {
-        // Create stack to hold focus
-        final ActivityDisplay display = mService.mStackSupervisor.getDefaultDisplay();
-        final ActivityStack emptyStack = display.createStack(WINDOWING_MODE_FULLSCREEN,
-                ACTIVITY_TYPE_STANDARD, true /* onTop */);
-
-        final KeyguardController keyguard = mSupervisor.getKeyguardController();
-        final ActivityStack stack = mService.mStackSupervisor.getDefaultDisplay().createStack(
-                WINDOWING_MODE_FULLSCREEN, ACTIVITY_TYPE_STANDARD, true /* onTop */);
-        final ActivityRecord activity = new ActivityBuilder(mService).setCreateTask(true)
-                .setStack(stack).build();
-
-        // Make sure the top running activity is not affected when keyguard is not locked
-        assertEquals(activity, mService.mStackSupervisor.topRunningActivityLocked());
-        assertEquals(activity, mService.mStackSupervisor.topRunningActivityLocked(
-                true /* considerKeyguardState */));
-
-        // Check to make sure activity not reported when it cannot show on lock and lock is on.
-        doReturn(true).when(keyguard).isKeyguardLocked();
-        assertEquals(activity, mService.mStackSupervisor.topRunningActivityLocked());
-        assertEquals(null, mService.mStackSupervisor.topRunningActivityLocked(
-                true /* considerKeyguardState */));
-
-        // Change focus to stack with activity.
-        stack.moveToFront("focusChangeToTestStack");
-        assertEquals(stack, display.getFocusedStack());
-        assertEquals(activity, mService.mStackSupervisor.topRunningActivityLocked());
-        assertEquals(null, mService.mStackSupervisor.topRunningActivityLocked(
-                true /* considerKeyguardState */));
-
-        // Add activity that should be shown on the keyguard.
-        final ActivityRecord showWhenLockedActivity = new ActivityBuilder(mService)
-                .setCreateTask(true)
-                .setStack(stack)
-                .setActivityFlags(FLAG_SHOW_WHEN_LOCKED)
-                .build();
-
-        // Ensure the show when locked activity is returned.
-        assertEquals(showWhenLockedActivity, mService.mStackSupervisor.topRunningActivityLocked());
-        assertEquals(showWhenLockedActivity, mService.mStackSupervisor.topRunningActivityLocked(
-                true /* considerKeyguardState */));
-
-        // Change focus back to empty stack
-        emptyStack.moveToFront("focusChangeToEmptyStack");
-        assertEquals(emptyStack, display.getFocusedStack());
-        // Looking for running activity only in top and focused stack, so nothing should be returned
-        // from empty stack.
-        assertEquals(null, mService.mStackSupervisor.topRunningActivityLocked());
-        assertEquals(null, mService.mStackSupervisor.topRunningActivityLocked(
-                true /* considerKeyguardState */));
-    }
-
-    /**
      * Verify that split-screen primary stack will be chosen if activity is launched that targets
      * split-screen secondary, but a matching existing instance is found on top of split-screen
      * primary stack.
@@ -407,6 +353,57 @@
     }
 
     /**
+     * Verify that home stack would be moved to front when the top activity is Recents.
+     */
+    @Test
+    public void testFindTaskToMoveToFrontWhenRecentsOnTop() throws Exception {
+        // Create stack/task on default display.
+        final ActivityDisplay display = mSupervisor.getDefaultDisplay();
+        final ActivityStack targetStack = display.createStack(WINDOWING_MODE_FULLSCREEN,
+                ACTIVITY_TYPE_STANDARD, false /* onTop */);
+        final TaskRecord targetTask = new TaskBuilder(mSupervisor).setStack(targetStack).build();
+
+        // Create Recents on top of the display.
+        final ActivityStack stack = display.createStack(WINDOWING_MODE_FULLSCREEN,
+                ACTIVITY_TYPE_RECENTS, true /* onTop */);
+        final TaskRecord task = new TaskBuilder(mSupervisor).setStack(stack).build();
+        new ActivityBuilder(mService).setTask(task).build();
+
+        final String reason = "findTaskToMoveToFront";
+        mSupervisor.findTaskToMoveToFront(targetTask, 0, ActivityOptions.makeBasic(), reason,
+                false);
+
+        verify(display).moveHomeStackToFront(contains(reason));
+    }
+
+    /**
+     * Verify that home stack won't be moved to front if the top activity on other display is
+     * Recents.
+     */
+    @Test
+    public void testFindTaskToMoveToFrontWhenRecentsOnOtherDisplay() throws Exception {
+        // Create stack/task on default display.
+        final ActivityDisplay display = mSupervisor.getDefaultDisplay();
+        final ActivityStack targetStack = display.createStack(WINDOWING_MODE_FULLSCREEN,
+                ACTIVITY_TYPE_STANDARD, false /* onTop */);
+        final TaskRecord targetTask = new TaskBuilder(mSupervisor).setStack(targetStack).build();
+
+        // Create Recents on secondary display.
+        final TestActivityDisplay secondDisplay = addNewActivityDisplayAt(
+                ActivityDisplay.POSITION_TOP);
+        final ActivityStack stack = secondDisplay.createStack(WINDOWING_MODE_FULLSCREEN,
+                ACTIVITY_TYPE_RECENTS, true /* onTop */);
+        final TaskRecord task = new TaskBuilder(mSupervisor).setStack(stack).build();
+        new ActivityBuilder(mService).setTask(task).build();
+
+        final String reason = "findTaskToMoveToFront";
+        mSupervisor.findTaskToMoveToFront(targetTask, 0, ActivityOptions.makeBasic(), reason,
+                false);
+
+        verify(display, never()).moveHomeStackToFront(contains(reason));
+    }
+
+    /**
      * Verify if a stack is not at the topmost position, it should be able to resume its activity if
      * the stack is the top focused.
      */
diff --git a/services/tests/servicestests/src/com/android/server/am/ActivityStackTests.java b/services/tests/servicestests/src/com/android/server/am/ActivityStackTests.java
index 5fcd2aa..53f67af 100644
--- a/services/tests/servicestests/src/com/android/server/am/ActivityStackTests.java
+++ b/services/tests/servicestests/src/com/android/server/am/ActivityStackTests.java
@@ -26,6 +26,9 @@
 import static android.app.WindowConfiguration.WINDOWING_MODE_SPLIT_SCREEN_SECONDARY;
 import static android.app.WindowConfiguration.WINDOWING_MODE_UNDEFINED;
 
+import static com.android.server.am.ActivityStack.ActivityState.DESTROYING;
+import static com.android.server.am.ActivityStack.ActivityState.FINISHING;
+import static com.android.server.am.ActivityStack.ActivityState.PAUSED;
 import static com.android.server.am.ActivityStack.ActivityState.PAUSING;
 import static com.android.server.am.ActivityStack.ActivityState.RESUMED;
 import static com.android.server.am.ActivityStack.REMOVE_TASK_MODE_DESTROYING;
@@ -35,10 +38,14 @@
 import static org.junit.Assert.assertNotNull;
 import static org.junit.Assert.assertNull;
 import static org.junit.Assert.assertTrue;
-import static org.mockito.Mockito.anyInt;
+import static org.mockito.ArgumentMatchers.anyBoolean;
+import static org.mockito.ArgumentMatchers.anyInt;
+import static org.mockito.ArgumentMatchers.anyString;
+import static org.mockito.ArgumentMatchers.eq;
 import static org.mockito.Mockito.doReturn;
 import static org.mockito.Mockito.mock;
 import static org.mockito.Mockito.spy;
+import static org.mockito.Mockito.verify;
 
 import android.content.pm.ActivityInfo;
 import android.os.UserHandle;
@@ -655,6 +662,39 @@
     }
 
     @Test
+    public void testFinishCurrentActivity() {
+        // Create 2 activities on a new display.
+        final ActivityDisplay display = addNewActivityDisplayAt(ActivityDisplay.POSITION_TOP);
+        final ActivityStack stack1 = createStackForShouldBeVisibleTest(display,
+                WINDOWING_MODE_FULLSCREEN, ACTIVITY_TYPE_STANDARD, true /* onTop */);
+        final ActivityStack stack2 = createStackForShouldBeVisibleTest(display,
+                WINDOWING_MODE_FULLSCREEN, ACTIVITY_TYPE_STANDARD, true /* onTop */);
+
+        // There is still an activity1 in stack1 so the activity2 should be added to finishing list
+        // that will be destroyed until idle.
+        final ActivityRecord activity2 = finishCurrentActivity(stack2);
+        assertEquals(FINISHING, activity2.getState());
+        assertTrue(mSupervisor.mFinishingActivities.contains(activity2));
+
+        // The display becomes empty. Since there is no next activity to be idle, the activity
+        // should be destroyed immediately with updating configuration to restore original state.
+        final ActivityRecord activity1 = finishCurrentActivity(stack1);
+        assertEquals(DESTROYING, activity1.getState());
+        verify(mSupervisor).ensureVisibilityAndConfig(eq(null) /* starting */,
+                eq(display.mDisplayId), anyBoolean(), anyBoolean());
+    }
+
+    private ActivityRecord finishCurrentActivity(ActivityStack stack) {
+        final ActivityRecord activity = stack.topRunningActivityLocked();
+        assertNotNull(activity);
+        activity.setState(PAUSED, "finishCurrentActivity");
+        activity.makeFinishingLocked();
+        stack.finishCurrentActivityLocked(activity, ActivityStack.FINISH_AFTER_VISIBLE,
+                false /* oomAdj */, "finishCurrentActivity");
+        return activity;
+    }
+
+    @Test
     public void testShouldSleepActivities() throws Exception {
         // When focused activity and keyguard is going away, we should not sleep regardless
         // of the display state
diff --git a/services/tests/servicestests/src/com/android/server/am/ActivityStarterTests.java b/services/tests/servicestests/src/com/android/server/am/ActivityStarterTests.java
index 062c044..ba64b51 100644
--- a/services/tests/servicestests/src/com/android/server/am/ActivityStarterTests.java
+++ b/services/tests/servicestests/src/com/android/server/am/ActivityStarterTests.java
@@ -37,6 +37,7 @@
 import static android.content.pm.ActivityInfo.LAUNCH_SINGLE_TASK;
 
 import static com.android.server.am.ActivityDisplay.POSITION_BOTTOM;
+import static com.android.server.am.ActivityDisplay.POSITION_TOP;
 import static com.android.server.am.ActivityTaskManagerService.ANIMATE;
 
 import static org.junit.Assert.assertEquals;
@@ -562,23 +563,13 @@
                 false /* mockGetLaunchStack */);
 
         // Create a secondary display at bottom.
-        final TestActivityDisplay secondaryDisplay = spy(addNewActivityDisplayAt(POSITION_BOTTOM));
+        final TestActivityDisplay secondaryDisplay = spy(createNewActivityDisplay());
+        mSupervisor.addChild(secondaryDisplay, POSITION_BOTTOM);
         final ActivityStack stack = secondaryDisplay.createStack(WINDOWING_MODE_FULLSCREEN,
                 ACTIVITY_TYPE_STANDARD, true /* onTop */);
 
         // Create an activity record on the top of secondary display.
-        final ComponentName componentName = ComponentName.createRelative(
-                DEFAULT_COMPONENT_PACKAGE_NAME,
-                DEFAULT_COMPONENT_PACKAGE_NAME + ".ReusableActivity");
-        final TaskRecord taskRecord = new TaskBuilder(mSupervisor)
-                .setComponent(componentName)
-                .setStack(stack)
-                .build();
-        final ActivityRecord topActivityOnSecondaryDisplay = new ActivityBuilder(mService)
-                .setComponent(componentName)
-                .setLaunchMode(LAUNCH_SINGLE_TASK)
-                .setTask(taskRecord)
-                .build();
+        final ActivityRecord topActivityOnSecondaryDisplay = createSingleTaskActivityOn(stack);
 
         // Put an activity on default display as the top focused activity.
         new ActivityBuilder(mService).setCreateTask(true).build();
@@ -600,6 +591,59 @@
     }
 
     /**
+     * This test ensures that when starting an existing non-top single task activity on secondary
+     * display which is the top focused display, it should bring the task to front without creating
+     * unused stack.
+     */
+    @Test
+    public void testBringTaskToFrontOnSecondaryDisplay() {
+        final ActivityStarter starter = prepareStarter(FLAG_ACTIVITY_NEW_TASK,
+                false /* mockGetLaunchStack */);
+
+        // Create a secondary display with an activity.
+        final TestActivityDisplay secondaryDisplay = spy(createNewActivityDisplay());
+        mSupervisor.addChild(secondaryDisplay, POSITION_TOP);
+        final ActivityRecord singleTaskActivity = createSingleTaskActivityOn(
+                secondaryDisplay.createStack(WINDOWING_MODE_FULLSCREEN,
+                        ACTIVITY_TYPE_STANDARD, false /* onTop */));
+
+        // Create another activity on top of the secondary display.
+        final ActivityStack topStack = secondaryDisplay.createStack(WINDOWING_MODE_FULLSCREEN,
+                ACTIVITY_TYPE_STANDARD, true /* onTop */);
+        final TaskRecord topTask = new TaskBuilder(mSupervisor).setStack(topStack).build();
+        new ActivityBuilder(mService).setTask(topTask).build();
+
+        // Start activity with the same intent as {@code singleTaskActivity} on secondary display.
+        final ActivityOptions options = ActivityOptions.makeBasic()
+                .setLaunchDisplayId(secondaryDisplay.mDisplayId);
+        final int result = starter.setReason("testBringTaskToFrontOnSecondaryDisplay")
+                .setIntent(singleTaskActivity.intent)
+                .setActivityOptions(options.toBundle())
+                .execute();
+
+        // Ensure result is moving existing task to front.
+        assertEquals(START_TASK_TO_FRONT, result);
+
+        // Ensure secondary display only creates two stacks.
+        verify(secondaryDisplay, times(2)).createStack(anyInt(), anyInt(), anyBoolean());
+    }
+
+    private ActivityRecord createSingleTaskActivityOn(ActivityStack stack) {
+        final ComponentName componentName = ComponentName.createRelative(
+                DEFAULT_COMPONENT_PACKAGE_NAME,
+                DEFAULT_COMPONENT_PACKAGE_NAME + ".SingleTaskActivity");
+        final TaskRecord taskRecord = new TaskBuilder(mSupervisor)
+                .setComponent(componentName)
+                .setStack(stack)
+                .build();
+        return new ActivityBuilder(mService)
+                .setComponent(componentName)
+                .setLaunchMode(LAUNCH_SINGLE_TASK)
+                .setTask(taskRecord)
+                .build();
+    }
+
+    /**
      * This test ensures that a reused top activity in the top focused stack is able to be
      * reparented to another display.
      */
diff --git a/services/tests/servicestests/src/com/android/server/am/ActivityTestsBase.java b/services/tests/servicestests/src/com/android/server/am/ActivityTestsBase.java
index 023f775..01d51e4 100644
--- a/services/tests/servicestests/src/com/android/server/am/ActivityTestsBase.java
+++ b/services/tests/servicestests/src/com/android/server/am/ActivityTestsBase.java
@@ -58,8 +58,9 @@
 import android.graphics.Rect;
 import android.hardware.display.DisplayManager;
 import android.hardware.display.DisplayManagerGlobal;
-import android.os.HandlerThread;
+import android.os.Handler;
 import android.os.Looper;
+import android.os.Process;
 import android.os.UserHandle;
 import android.service.voice.IVoiceInteractionSession;
 import android.testing.DexmakerShareClassLoaderRule;
@@ -69,7 +70,9 @@
 import androidx.test.InstrumentationRegistry;
 
 import com.android.internal.app.IVoiceInteractor;
+import com.android.server.AppOpsService;
 import com.android.server.AttributeCache;
+import com.android.server.ServiceThread;
 import com.android.server.wm.AppWindowContainerController;
 import com.android.server.wm.PinnedStackWindowController;
 import com.android.server.wm.RootWindowContainerController;
@@ -82,6 +85,7 @@
 import org.junit.Before;
 import org.mockito.MockitoAnnotations;
 
+import java.io.File;
 import java.util.List;
 
 /**
@@ -97,7 +101,7 @@
             new DexmakerShareClassLoaderRule();
 
     private final Context mContext = InstrumentationRegistry.getContext();
-    private HandlerThread mHandlerThread;
+    final TestInjector mTestInjector = new TestInjector();
 
     ActivityTaskManagerService mService;
     ActivityStackSupervisor mSupervisor;
@@ -115,13 +119,12 @@
             MockitoAnnotations.initMocks(this);
             AttributeCache.init(mContext);
         }
-        mHandlerThread = new HandlerThread("ActivityTestsBaseThread");
-        mHandlerThread.start();
+        mTestInjector.setUp();
     }
 
     @After
     public void tearDown() {
-        mHandlerThread.quitSafely();
+        mTestInjector.tearDown();
     }
 
     protected ActivityTaskManagerService createActivityTaskManagerService() {
@@ -143,7 +146,7 @@
     }
 
     ActivityManagerService setupActivityManagerService(TestActivityTaskManagerService atm) {
-        final TestActivityManagerService am = spy(new TestActivityManagerService(mContext, atm));
+        final TestActivityManagerService am = spy(new TestActivityManagerService(mTestInjector));
         setupActivityManagerService(am, atm);
         return am;
     }
@@ -173,6 +176,7 @@
         doReturn(mockPackageManager).when(am).getPackageManagerInternalLocked();
         doReturn(null).when(mockPackageManager).getDefaultHomeActivity(anyInt());
         doNothing().when(am).grantEphemeralAccessLocked(anyInt(), any(), anyInt(), anyInt());
+        am.mActivityTaskManager = atm;
         am.mWindowManager = prepareMockWindowManager();
         atm.setWindowManager(am.mWindowManager);
 
@@ -192,8 +196,6 @@
         // An id appended to the end of the component name to make it unique
         private static int sCurrentActivityId = 0;
 
-
-
         private final ActivityTaskManagerService mService;
 
         private ComponentName mComponent;
@@ -487,6 +489,40 @@
         }
     }
 
+    private static class TestInjector extends ActivityManagerService.Injector {
+        private ServiceThread mHandlerThread;
+
+        @Override
+        public Context getContext() {
+            return InstrumentationRegistry.getContext();
+        }
+
+        @Override
+        public AppOpsService getAppOpsService(File file, Handler handler) {
+            return null;
+        }
+
+        @Override
+        public Handler getUiHandler(ActivityManagerService service) {
+            return mHandlerThread.getThreadHandler();
+        }
+
+        @Override
+        public boolean isNetworkRestrictedForUid(int uid) {
+            return false;
+        }
+
+        void setUp() {
+            mHandlerThread = new ServiceThread("ActivityTestsThread",
+                    Process.THREAD_PRIORITY_DEFAULT, true /* allowIo */);
+            mHandlerThread.start();
+        }
+
+        void tearDown() {
+            mHandlerThread.quitSafely();
+        }
+    }
+
     /**
      * An {@link ActivityManagerService} subclass which provides a test
      * {@link ActivityStackSupervisor}.
@@ -495,8 +531,8 @@
 
         private ActivityManagerInternal mInternal;
 
-        TestActivityManagerService(Context context, TestActivityTaskManagerService atm) {
-            super(context, atm);
+        TestActivityManagerService(TestInjector testInjector) {
+            super(testInjector, testInjector.mHandlerThread);
             mUgmInternal = mock(UriGrantsManagerInternal.class);
         }
 
@@ -546,6 +582,11 @@
         ActivityDisplay getDefaultDisplay() {
             return mDisplay;
         }
+
+        @Override
+        void setWindowManager(WindowManagerService wm) {
+            mWindowManager = wm;
+        }
     }
 
     protected static class TestActivityDisplay extends ActivityDisplay {
diff --git a/services/tests/servicestests/src/com/android/server/am/AppErrorDialogTest.java b/services/tests/servicestests/src/com/android/server/am/AppErrorDialogTest.java
index 3819e21..06d41f1 100644
--- a/services/tests/servicestests/src/com/android/server/am/AppErrorDialogTest.java
+++ b/services/tests/servicestests/src/com/android/server/am/AppErrorDialogTest.java
@@ -21,6 +21,7 @@
 
 import androidx.test.InstrumentationRegistry;
 import androidx.test.annotation.UiThreadTest;
+import androidx.test.filters.FlakyTest;
 import androidx.test.filters.SmallTest;
 import androidx.test.runner.AndroidJUnit4;
 
@@ -37,6 +38,7 @@
  */
 @RunWith(AndroidJUnit4.class)
 @SmallTest
+@FlakyTest(bugId = 113616538)
 public class AppErrorDialogTest {
 
     private Context mContext;
diff --git a/services/tests/servicestests/src/com/android/server/am/AssistDataRequesterTest.java b/services/tests/servicestests/src/com/android/server/am/AssistDataRequesterTest.java
index a030210..1b823ff 100644
--- a/services/tests/servicestests/src/com/android/server/am/AssistDataRequesterTest.java
+++ b/services/tests/servicestests/src/com/android/server/am/AssistDataRequesterTest.java
@@ -46,6 +46,7 @@
 import android.view.IWindowManager;
 
 import androidx.test.InstrumentationRegistry;
+import androidx.test.filters.FlakyTest;
 import androidx.test.filters.MediumTest;
 import androidx.test.runner.AndroidJUnit4;
 
@@ -67,6 +68,7 @@
  * runtest --path frameworks/base/services/tests/servicestests/src/com/android/server/am/AssistDataRequesterTest.java
  */
 @MediumTest
+@FlakyTest(bugId = 113616538)
 @RunWith(AndroidJUnit4.class)
 public class AssistDataRequesterTest extends ActivityTestsBase {
 
diff --git a/services/tests/servicestests/src/com/android/server/am/BroadcastRecordTest.java b/services/tests/servicestests/src/com/android/server/am/BroadcastRecordTest.java
index 62c5734..75f7c4c 100644
--- a/services/tests/servicestests/src/com/android/server/am/BroadcastRecordTest.java
+++ b/services/tests/servicestests/src/com/android/server/am/BroadcastRecordTest.java
@@ -45,7 +45,7 @@
 @SmallTest
 @Presubmit
 @RunWith(AndroidJUnit4.class)
-public class BroadcastRecordTest extends ActivityTestsBase {
+public class BroadcastRecordTest {
 
     @Test
     public void testCleanupDisabledPackageReceivers() {
diff --git a/services/tests/servicestests/src/com/android/server/am/CoreSettingsObserverTest.java b/services/tests/servicestests/src/com/android/server/am/CoreSettingsObserverTest.java
index fe8256e..719e0ed 100644
--- a/services/tests/servicestests/src/com/android/server/am/CoreSettingsObserverTest.java
+++ b/services/tests/servicestests/src/com/android/server/am/CoreSettingsObserverTest.java
@@ -132,15 +132,36 @@
                 settingsBundle.containsKey(TEST_SETTING_SYSTEM_STRING));
     }
 
+    @Test
+    public void testPopulateSettings_settingDeleted() {
+        Settings.Secure.putInt(mContentResolver, TEST_SETTING_SECURE_INT, TEST_INT);
+        Settings.Global.putFloat(mContentResolver, TEST_SETTING_GLOBAL_FLOAT, TEST_FLOAT);
+        Settings.System.putString(mContentResolver, TEST_SETTING_SYSTEM_STRING, TEST_STRING);
+
+        Bundle settingsBundle = getPopulatedBundle();
+
+        assertEquals("Unexpected value of " + TEST_SETTING_SECURE_INT,
+                TEST_INT, settingsBundle.getInt(TEST_SETTING_SECURE_INT));
+        assertEquals("Unexpected value of " + TEST_SETTING_GLOBAL_FLOAT,
+                TEST_FLOAT, settingsBundle.getFloat(TEST_SETTING_GLOBAL_FLOAT), 0);
+        assertEquals("Unexpected value of " + TEST_SETTING_SYSTEM_STRING,
+                TEST_STRING, settingsBundle.getString(TEST_SETTING_SYSTEM_STRING));
+
+        Settings.Global.putString(mContentResolver, TEST_SETTING_GLOBAL_FLOAT, null);
+        settingsBundle = getPopulatedBundle();
+
+        assertFalse("Bundle should not contain " + TEST_SETTING_GLOBAL_FLOAT,
+                settingsBundle.containsKey(TEST_SETTING_GLOBAL_FLOAT));
+        assertEquals("Unexpected value of " + TEST_SETTING_SECURE_INT,
+                TEST_INT, settingsBundle.getInt(TEST_SETTING_SECURE_INT));
+        assertEquals("Unexpected value of " + TEST_SETTING_SYSTEM_STRING,
+                TEST_STRING, settingsBundle.getString(TEST_SETTING_SYSTEM_STRING));
+
+    }
+
     private Bundle getPopulatedBundle() {
-        final Bundle settingsBundle = new Bundle();
-        mCoreSettingsObserver.populateSettings(settingsBundle,
-                CoreSettingsObserver.sGlobalSettingToTypeMap);
-        mCoreSettingsObserver.populateSettings(settingsBundle,
-                CoreSettingsObserver.sSecureSettingToTypeMap);
-        mCoreSettingsObserver.populateSettings(settingsBundle,
-                CoreSettingsObserver.sSystemSettingToTypeMap);
-        return settingsBundle;
+        mCoreSettingsObserver.onChange(false);
+        return mCoreSettingsObserver.getCoreSettingsLocked();
     }
 
     private class TestInjector extends Injector {
diff --git a/services/tests/servicestests/src/com/android/server/am/RecentTasksTest.java b/services/tests/servicestests/src/com/android/server/am/RecentTasksTest.java
index 1276f65..27e8c63 100644
--- a/services/tests/servicestests/src/com/android/server/am/RecentTasksTest.java
+++ b/services/tests/servicestests/src/com/android/server/am/RecentTasksTest.java
@@ -116,8 +116,7 @@
 
         mTaskPersister = new TestTaskPersister(mContext.getFilesDir());
         mService = spy(new MyTestActivityTaskManagerService(mContext));
-        final TestActivityManagerService am =
-                spy(new MyTestActivityManagerService(mContext, mService));
+        final TestActivityManagerService am = spy(new MyTestActivityManagerService());
         setupActivityManagerService(am, mService);
         mRecentTasks = (TestRecentTasks) mService.getRecentTasks();
         mRecentTasks.loadParametersFromResources(mContext.getResources());
@@ -848,8 +847,8 @@
     }
 
     private class MyTestActivityManagerService extends TestActivityManagerService {
-        MyTestActivityManagerService(Context context, TestActivityTaskManagerService atm) {
-            super(context, atm);
+        MyTestActivityManagerService() {
+            super(mTestInjector);
         }
 
         @Override
diff --git a/services/tests/servicestests/src/com/android/server/am/TaskLaunchParamsModifierTests.java b/services/tests/servicestests/src/com/android/server/am/TaskLaunchParamsModifierTests.java
index ea1320c..169204f 100644
--- a/services/tests/servicestests/src/com/android/server/am/TaskLaunchParamsModifierTests.java
+++ b/services/tests/servicestests/src/com/android/server/am/TaskLaunchParamsModifierTests.java
@@ -29,6 +29,7 @@
 import static android.view.Display.DEFAULT_DISPLAY;
 
 import static com.android.server.am.LaunchParamsController.LaunchParamsModifier.RESULT_CONTINUE;
+import static com.android.server.am.LaunchParamsController.LaunchParamsModifier.RESULT_SKIP;
 
 import static org.junit.Assert.assertEquals;
 import static org.junit.Assert.assertFalse;
@@ -97,6 +98,13 @@
         mResult.reset();
     }
 
+    @Test
+    public void testReturnsSkipWithEmptyActivity() {
+        final TaskRecord task = new TaskBuilder(mSupervisor).build();
+        assertEquals(RESULT_SKIP, mTarget.onCalculate(task, /* layout */ null,
+                /* activity */ null, /* source */ null, /* options */ null, mCurrent, mResult));
+    }
+
     // =============================
     // Display ID Related Tests
     // =============================
diff --git a/services/tests/servicestests/src/com/android/server/am/TaskPersisterTest.java b/services/tests/servicestests/src/com/android/server/am/TaskPersisterTest.java
index 8d54bc2..48bfe1d 100644
--- a/services/tests/servicestests/src/com/android/server/am/TaskPersisterTest.java
+++ b/services/tests/servicestests/src/com/android/server/am/TaskPersisterTest.java
@@ -16,34 +16,43 @@
 
 package com.android.server.am;
 
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotNull;
+import static org.junit.Assert.assertTrue;
+
+import static androidx.test.InstrumentationRegistry.getTargetContext;
+
 import android.content.pm.UserInfo;
-import android.os.Environment;
 import android.os.UserHandle;
 import android.os.UserManager;
-import android.test.AndroidTestCase;
-import android.util.Log;
+import android.platform.test.annotations.Presubmit;
 import android.util.SparseBooleanArray;
 
-import com.android.server.am.TaskPersister;
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Test;
 
-import java.io.File;
-import java.util.Random;
+import androidx.test.filters.FlakyTest;
 
 /**
- * atest FrameworksServicesTests:TaskPersisterTest
+ * Tests for {@link TaskPersister}.
+ *
+ * Build/Install/Run:
+ *  atest FrameworksServicesTests:TaskPersisterTest
  */
-public class TaskPersisterTest extends AndroidTestCase {
+@Presubmit
+@FlakyTest(detail = "Promote to presubmit if stable")
+public class TaskPersisterTest {
     private static final String TEST_USER_NAME = "AM-Test-User";
 
     private TaskPersister mTaskPersister;
     private int testUserId;
     private UserManager mUserManager;
 
-    @Override
+    @Before
     public void setUp() throws Exception {
-        super.setUp();
-        mUserManager = UserManager.get(getContext());
-        mTaskPersister = new TaskPersister(getContext().getFilesDir());
+        mUserManager = UserManager.get(getTargetContext());
+        mTaskPersister = new TaskPersister(getTargetContext().getFilesDir());
         // In ARC, the maximum number of supported users is one, which is different from the ones of
         // most phones (more than 4). This prevents TaskPersisterTest from creating another user for
         // test. However, since guest users can be added as much as possible, we create guest user
@@ -51,9 +60,8 @@
         testUserId = createUser(TEST_USER_NAME, UserInfo.FLAG_GUEST);
     }
 
-    @Override
+    @After
     public void tearDown() throws Exception {
-        super.tearDown();
         mTaskPersister.unloadUserDataFromMemory(testUserId);
         removeUser(testUserId);
     }
@@ -64,6 +72,7 @@
         return taskId;
     }
 
+    @Test
     public void testTaskIdsPersistence() {
         SparseBooleanArray taskIdsOnFile = new SparseBooleanArray();
         for (int i = 0; i < 100; i++) {
@@ -72,21 +81,18 @@
         mTaskPersister.writePersistedTaskIdsForUser(taskIdsOnFile, testUserId);
         SparseBooleanArray newTaskIdsOnFile = mTaskPersister
                 .loadPersistedTaskIdsForUser(testUserId);
-        assertTrue("TaskIds written differ from TaskIds read back from file",
-                taskIdsOnFile.equals(newTaskIdsOnFile));
+        assertEquals("TaskIds written differ from TaskIds read back from file",
+                taskIdsOnFile, newTaskIdsOnFile);
     }
 
     private int createUser(String name, int flags) {
         UserInfo user = mUserManager.createUser(name, flags);
-        if (user == null) {
-            fail("Error while creating the test user: " + TEST_USER_NAME);
-        }
+        assertNotNull("Error while creating the test user: " + TEST_USER_NAME, user);
         return user.id;
     }
 
     private void removeUser(int userId) {
-        if (!mUserManager.removeUser(userId)) {
-            fail("Error while removing the test user: " + TEST_USER_NAME);
-        }
+        boolean userRemoved = mUserManager.removeUser(userId);
+        assertTrue("Error while removing the test user: " + TEST_USER_NAME, userRemoved);
     }
-}
\ No newline at end of file
+}
diff --git a/services/tests/servicestests/src/com/android/server/am/TaskRecordTests.java b/services/tests/servicestests/src/com/android/server/am/TaskRecordTests.java
index fa8a09c..27766d3 100644
--- a/services/tests/servicestests/src/com/android/server/am/TaskRecordTests.java
+++ b/services/tests/servicestests/src/com/android/server/am/TaskRecordTests.java
@@ -69,13 +69,11 @@
 
     private static final String TASK_TAG = "task";
 
-    private ActivityManagerService mService;
-
     @Before
     public void setUp() throws Exception {
         super.setUp();
         TaskRecord.setTaskRecordFactory(null);
-        mService = createActivityManagerService();
+        setupActivityTaskManagerService();
     }
 
     @Test
@@ -150,7 +148,7 @@
     }
 
     private TaskRecord createTaskRecord(int taskId) {
-        return new TaskRecord(mService.mActivityTaskManager, taskId, new Intent(), null, null, null,
+        return new TaskRecord(mService, taskId, new Intent(), null, null, null,
                 ActivityBuilder.getDefaultComponent(), null, false, false, false, 0, 10050, null,
                 new ArrayList<>(), 0, false, null, 0, 0, 0, 0, 0, null, 0, false, false, false, 0, 0
         );
diff --git a/services/tests/servicestests/src/com/android/server/am/UserControllerTest.java b/services/tests/servicestests/src/com/android/server/am/UserControllerTest.java
index cc4f519..75e1d0d 100644
--- a/services/tests/servicestests/src/com/android/server/am/UserControllerTest.java
+++ b/services/tests/servicestests/src/com/android/server/am/UserControllerTest.java
@@ -16,6 +16,41 @@
 
 package com.android.server.am;
 
+import static android.content.pm.PackageManager.PERMISSION_GRANTED;
+import static android.testing.DexmakerShareClassLoaderRule.runWithDexmakerShareClassLoader;
+
+import static com.android.server.am.UserController.CONTINUE_USER_SWITCH_MSG;
+import static com.android.server.am.UserController.REPORT_LOCKED_BOOT_COMPLETE_MSG;
+import static com.android.server.am.UserController.REPORT_USER_SWITCH_COMPLETE_MSG;
+import static com.android.server.am.UserController.REPORT_USER_SWITCH_MSG;
+import static com.android.server.am.UserController.SYSTEM_USER_CURRENT_MSG;
+import static com.android.server.am.UserController.SYSTEM_USER_START_MSG;
+import static com.android.server.am.UserController.USER_SWITCH_TIMEOUT_MSG;
+
+import static com.google.android.collect.Lists.newArrayList;
+import static com.google.android.collect.Sets.newHashSet;
+import static com.google.common.truth.Truth.assertWithMessage;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNotNull;
+import static org.mockito.ArgumentMatchers.anyString;
+import static org.mockito.Matchers.any;
+import static org.mockito.Matchers.anyBoolean;
+import static org.mockito.Matchers.anyInt;
+import static org.mockito.Matchers.eq;
+import static org.mockito.Mockito.doAnswer;
+import static org.mockito.Mockito.doNothing;
+import static org.mockito.Mockito.doReturn;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.never;
+import static org.mockito.Mockito.spy;
+import static org.mockito.Mockito.times;
+import static org.mockito.Mockito.validateMockitoUsage;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.when;
+
+import static androidx.test.InstrumentationRegistry.getTargetContext;
+
 import android.app.IUserSwitchObserver;
 import android.content.Context;
 import android.content.IIntentReceiver;
@@ -31,80 +66,62 @@
 import android.os.RemoteException;
 import android.os.UserManagerInternal;
 import android.platform.test.annotations.Presubmit;
-import android.test.AndroidTestCase;
-import android.test.suitebuilder.annotation.SmallTest;
 import android.util.Log;
 
 import com.android.server.pm.UserManagerService;
 import com.android.server.wm.WindowManagerService;
 
-import org.mockito.Mockito;
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Test;
 
 import java.util.ArrayList;
-import java.util.Arrays;
 import java.util.Collections;
-import java.util.HashSet;
 import java.util.LinkedHashSet;
 import java.util.List;
 import java.util.Set;
 
-import static android.content.pm.PackageManager.PERMISSION_GRANTED;
-import static android.testing.DexmakerShareClassLoaderRule.runWithDexmakerShareClassLoader;
-import static com.android.server.am.UserController.CONTINUE_USER_SWITCH_MSG;
-import static com.android.server.am.UserController.REPORT_LOCKED_BOOT_COMPLETE_MSG;
-import static com.android.server.am.UserController.REPORT_USER_SWITCH_COMPLETE_MSG;
-import static com.android.server.am.UserController.REPORT_USER_SWITCH_MSG;
-import static com.android.server.am.UserController.SYSTEM_USER_CURRENT_MSG;
-import static com.android.server.am.UserController.SYSTEM_USER_START_MSG;
-import static com.android.server.am.UserController.USER_SWITCH_TIMEOUT_MSG;
-import static org.mockito.ArgumentMatchers.anyString;
-import static org.mockito.Matchers.any;
-import static org.mockito.Matchers.anyBoolean;
-import static org.mockito.Matchers.anyInt;
-import static org.mockito.Matchers.eq;
-import static org.mockito.Mockito.doAnswer;
-import static org.mockito.Mockito.doNothing;
-import static org.mockito.Mockito.doReturn;
-import static org.mockito.Mockito.mock;
-import static org.mockito.Mockito.never;
-import static org.mockito.Mockito.times;
-import static org.mockito.Mockito.when;
+import androidx.test.filters.SmallTest;
 
 /**
- * Usage: bit FrameworksServicesTests:com.android.server.am.UserControllerTest
+ * Tests for {@link UserController}.
+ *
+ * Build/Install/Run:
+ *  atest FrameworksServicesTests:com.android.server.am.UserControllerTest
  */
 @Presubmit
-public class UserControllerTest extends AndroidTestCase {
+@SmallTest
+public class UserControllerTest {
     private static final int TEST_USER_ID = 10;
     private static final int NONEXIST_USER_ID = 2;
     private static String TAG = UserControllerTest.class.getSimpleName();
     private UserController mUserController;
     private TestInjector mInjector;
 
-    private static final List<String> START_FOREGROUND_USER_ACTIONS =
-            Arrays.asList(
-                    Intent.ACTION_USER_STARTED,
-                    Intent.ACTION_USER_SWITCHED,
-                    Intent.ACTION_USER_STARTING);
+    private static final List<String> START_FOREGROUND_USER_ACTIONS = newArrayList(
+            Intent.ACTION_USER_STARTED,
+            Intent.ACTION_USER_SWITCHED,
+            Intent.ACTION_USER_STARTING);
 
-    private static final List<String> START_BACKGROUND_USER_ACTIONS =
-            Arrays.asList(
-                    Intent.ACTION_USER_STARTED,
-                    Intent.ACTION_LOCKED_BOOT_COMPLETED,
-                    Intent.ACTION_USER_STARTING);
+    private static final List<String> START_BACKGROUND_USER_ACTIONS = newArrayList(
+            Intent.ACTION_USER_STARTED,
+            Intent.ACTION_LOCKED_BOOT_COMPLETED,
+            Intent.ACTION_USER_STARTING);
 
-    private static final Set<Integer> START_FOREGROUND_USER_MESSAGE_CODES =
-            new HashSet<>(Arrays.asList(REPORT_USER_SWITCH_MSG, USER_SWITCH_TIMEOUT_MSG,
-                    SYSTEM_USER_START_MSG, SYSTEM_USER_CURRENT_MSG));
+    private static final Set<Integer> START_FOREGROUND_USER_MESSAGE_CODES = newHashSet(
+            REPORT_USER_SWITCH_MSG,
+            USER_SWITCH_TIMEOUT_MSG,
+            SYSTEM_USER_START_MSG,
+            SYSTEM_USER_CURRENT_MSG);
 
-    private static final Set<Integer> START_BACKGROUND_USER_MESSAGE_CODES =
-            new HashSet<>(Arrays.asList(SYSTEM_USER_START_MSG, REPORT_LOCKED_BOOT_COMPLETE_MSG));
+    private static final Set<Integer> START_BACKGROUND_USER_MESSAGE_CODES = newHashSet(
+            SYSTEM_USER_START_MSG,
+            REPORT_LOCKED_BOOT_COMPLETE_MSG);
 
-    @Override
+    @Before
     public void setUp() throws Exception {
-        super.setUp();
         runWithDexmakerShareClassLoader(() -> {
-            mInjector = Mockito.spy(new TestInjector(getContext()));
+            mInjector = spy(new TestInjector(getTargetContext()));
             doNothing().when(mInjector).clearAllLockedTasks(anyString());
             doNothing().when(mInjector).startHomeActivity(anyInt(), anyString());
             doReturn(false).when(mInjector).stackSupervisorSwitchUser(anyInt(), any());
@@ -114,58 +131,54 @@
         });
     }
 
-    @Override
-    protected void tearDown() throws Exception {
-        super.tearDown();
+    @After
+    public void tearDown() throws Exception {
         mInjector.handlerThread.quit();
-        Mockito.validateMockitoUsage();
+        validateMockitoUsage();
     }
 
-    @SmallTest
-    public void testStartUser_foreground() throws RemoteException {
+    @Test
+    public void testStartUser_foreground() {
         mUserController.startUser(TEST_USER_ID, true /* foreground */);
-        Mockito.verify(mInjector.getWindowManager()).startFreezingScreen(anyInt(), anyInt());
-        Mockito.verify(mInjector.getWindowManager(), never()).stopFreezingScreen();
-        Mockito.verify(mInjector.getWindowManager(), times(1)).setSwitchingUser(anyBoolean());
-        Mockito.verify(mInjector.getWindowManager()).setSwitchingUser(true);
-        Mockito.verify(mInjector).clearAllLockedTasks(anyString());
+        verify(mInjector.getWindowManager()).startFreezingScreen(anyInt(), anyInt());
+        verify(mInjector.getWindowManager(), never()).stopFreezingScreen();
+        verify(mInjector.getWindowManager(), times(1)).setSwitchingUser(anyBoolean());
+        verify(mInjector.getWindowManager()).setSwitchingUser(true);
+        verify(mInjector).clearAllLockedTasks(anyString());
         startForegroundUserAssertions();
     }
 
-    @SmallTest
-    public void testStartUser_background() throws RemoteException {
+    @Test
+    public void testStartUser_background() {
         mUserController.startUser(TEST_USER_ID, false /* foreground */);
-        Mockito.verify(
-                mInjector.getWindowManager(), never()).startFreezingScreen(anyInt(), anyInt());
-        Mockito.verify(mInjector.getWindowManager(), never()).setSwitchingUser(anyBoolean());
-        Mockito.verify(mInjector, never()).clearAllLockedTasks(anyString());
+        verify(mInjector.getWindowManager(), never()).startFreezingScreen(anyInt(), anyInt());
+        verify(mInjector.getWindowManager(), never()).setSwitchingUser(anyBoolean());
+        verify(mInjector, never()).clearAllLockedTasks(anyString());
         startBackgroundUserAssertions();
     }
 
-    @SmallTest
-    public void testStartUserUIDisabled() throws RemoteException {
+    @Test
+    public void testStartUserUIDisabled() {
         mUserController.mUserSwitchUiEnabled = false;
         mUserController.startUser(TEST_USER_ID, true /* foreground */);
-        Mockito.verify(mInjector.getWindowManager(), never())
-                .startFreezingScreen(anyInt(), anyInt());
-        Mockito.verify(mInjector.getWindowManager(), never()).stopFreezingScreen();
-        Mockito.verify(mInjector.getWindowManager(), never()).setSwitchingUser(anyBoolean());
+        verify(mInjector.getWindowManager(), never()).startFreezingScreen(anyInt(), anyInt());
+        verify(mInjector.getWindowManager(), never()).stopFreezingScreen();
+        verify(mInjector.getWindowManager(), never()).setSwitchingUser(anyBoolean());
         startForegroundUserAssertions();
     }
 
     private void startUserAssertions(
-            List<String> expectedActions, Set<Integer> expectedMessageCodes)
-            throws RemoteException {
+            List<String> expectedActions, Set<Integer> expectedMessageCodes) {
         assertEquals(expectedActions, getActions(mInjector.sentIntents));
         Set<Integer> actualCodes = mInjector.handler.getMessageCodes();
         assertEquals("Unexpected message sent", expectedMessageCodes, actualCodes);
     }
 
-    private void startBackgroundUserAssertions() throws RemoteException {
+    private void startBackgroundUserAssertions() {
         startUserAssertions(START_BACKGROUND_USER_ACTIONS, START_BACKGROUND_USER_MESSAGE_CODES);
     }
 
-    private void startForegroundUserAssertions() throws RemoteException {
+    private void startForegroundUserAssertions() {
         startUserAssertions(START_FOREGROUND_USER_ACTIONS, START_FOREGROUND_USER_MESSAGE_CODES);
         Message reportMsg = mInjector.handler.getMessageForCode(REPORT_USER_SWITCH_MSG);
         assertNotNull(reportMsg);
@@ -177,15 +190,15 @@
         assertEquals("Unexpected new user id", TEST_USER_ID, reportMsg.arg2);
     }
 
-    @SmallTest
-    public void testFailedStartUserInForeground() throws RemoteException {
+    @Test
+    public void testFailedStartUserInForeground() {
         mUserController.mUserSwitchUiEnabled = false;
         mUserController.startUserInForeground(NONEXIST_USER_ID);
-        Mockito.verify(mInjector.getWindowManager(), times(1)).setSwitchingUser(anyBoolean());
-        Mockito.verify(mInjector.getWindowManager()).setSwitchingUser(false);
+        verify(mInjector.getWindowManager(), times(1)).setSwitchingUser(anyBoolean());
+        verify(mInjector.getWindowManager()).setSwitchingUser(false);
     }
 
-    @SmallTest
+    @Test
     public void testDispatchUserSwitch() throws RemoteException {
         // Prepare mock observer and register it
         IUserSwitchObserver observer = mock(IUserSwitchObserver.class);
@@ -206,7 +219,7 @@
         // Call dispatchUserSwitch and verify that observer was called only once
         mInjector.handler.clearAllRecordedMessages();
         mUserController.dispatchUserSwitch(userState, oldUserId, newUserId);
-        Mockito.verify(observer, times(1)).onUserSwitching(eq(TEST_USER_ID), any());
+        verify(observer, times(1)).onUserSwitching(eq(TEST_USER_ID), any());
         Set<Integer> expectedCodes = Collections.singleton(CONTINUE_USER_SWITCH_MSG);
         Set<Integer> actualCodes = mInjector.handler.getMessageCodes();
         assertEquals("Unexpected message sent", expectedCodes, actualCodes);
@@ -220,7 +233,7 @@
         assertEquals("Unexpected new user id", TEST_USER_ID, conMsg.arg2);
     }
 
-    @SmallTest
+    @Test
     public void testDispatchUserSwitchBadReceiver() throws RemoteException {
         // Prepare mock observer which doesn't notify the callback and register it
         IUserSwitchObserver observer = mock(IUserSwitchObserver.class);
@@ -236,14 +249,14 @@
         // Call dispatchUserSwitch and verify that observer was called only once
         mInjector.handler.clearAllRecordedMessages();
         mUserController.dispatchUserSwitch(userState, oldUserId, newUserId);
-        Mockito.verify(observer, times(1)).onUserSwitching(eq(TEST_USER_ID), any());
+        verify(observer, times(1)).onUserSwitching(eq(TEST_USER_ID), any());
         // Verify that CONTINUE_USER_SWITCH_MSG is not sent (triggers timeout)
         Set<Integer> actualCodes = mInjector.handler.getMessageCodes();
-        assertTrue("No messages should be sent", actualCodes.isEmpty());
+        assertWithMessage("No messages should be sent").that(actualCodes).isEmpty();
     }
 
-    @SmallTest
-    public void testContinueUserSwitch() throws RemoteException {
+    @Test
+    public void testContinueUserSwitch() {
         // Start user -- this will update state of mUserController
         mUserController.startUser(TEST_USER_ID, true);
         Message reportMsg = mInjector.handler.getMessageForCode(REPORT_USER_SWITCH_MSG);
@@ -254,12 +267,12 @@
         mInjector.handler.clearAllRecordedMessages();
         // Verify that continueUserSwitch worked as expected
         mUserController.continueUserSwitch(userState, oldUserId, newUserId);
-        Mockito.verify(mInjector.getWindowManager(), times(1)).stopFreezingScreen();
+        verify(mInjector.getWindowManager(), times(1)).stopFreezingScreen();
         continueUserSwitchAssertions();
     }
 
-    @SmallTest
-    public void testContinueUserSwitchUIDisabled() throws RemoteException {
+    @Test
+    public void testContinueUserSwitchUIDisabled() {
         mUserController.mUserSwitchUiEnabled = false;
         // Start user -- this will update state of mUserController
         mUserController.startUser(TEST_USER_ID, true);
@@ -271,11 +284,11 @@
         mInjector.handler.clearAllRecordedMessages();
         // Verify that continueUserSwitch worked as expected
         mUserController.continueUserSwitch(userState, oldUserId, newUserId);
-        Mockito.verify(mInjector.getWindowManager(), never()).stopFreezingScreen();
+        verify(mInjector.getWindowManager(), never()).stopFreezingScreen();
         continueUserSwitchAssertions();
     }
 
-    private void continueUserSwitchAssertions() throws RemoteException {
+    private void continueUserSwitchAssertions() {
         Set<Integer> expectedCodes = Collections.singleton(REPORT_USER_SWITCH_COMPLETE_MSG);
         Set<Integer> actualCodes = mInjector.handler.getMessageCodes();
         assertEquals("Unexpected message sent", expectedCodes, actualCodes);
@@ -284,7 +297,7 @@
         assertEquals("Unexpected userId", TEST_USER_ID, msg.arg1);
     }
 
-    @SmallTest
+    @Test
     public void testDispatchUserSwitchComplete() throws RemoteException {
         // Prepare mock observer and register it
         IUserSwitchObserver observer = mock(IUserSwitchObserver.class);
@@ -298,12 +311,12 @@
         mInjector.handler.clearAllRecordedMessages();
         // Mockito can't reset only interactions, so just verify that this hasn't been
         // called with 'false' until after dispatchUserSwitchComplete.
-        Mockito.verify(mInjector.getWindowManager(), never()).setSwitchingUser(false);
+        verify(mInjector.getWindowManager(), never()).setSwitchingUser(false);
         // Call dispatchUserSwitchComplete
         mUserController.dispatchUserSwitchComplete(newUserId);
-        Mockito.verify(observer, times(1)).onUserSwitchComplete(anyInt());
-        Mockito.verify(observer).onUserSwitchComplete(TEST_USER_ID);
-        Mockito.verify(mInjector.getWindowManager(), times(1)).setSwitchingUser(false);
+        verify(observer, times(1)).onUserSwitchComplete(anyInt());
+        verify(observer).onUserSwitchComplete(TEST_USER_ID);
+        verify(mInjector.getWindowManager(), times(1)).setSwitchingUser(false);
     }
 
     private void setUpUser(int userId, int flags) {
@@ -320,7 +333,7 @@
     }
 
     // Should be public to allow mocking
-    public static class TestInjector extends UserController.Injector {
+    private static class TestInjector extends UserController.Injector {
         TestHandler handler;
         TestHandler uiHandler;
         HandlerThread handlerThread;
@@ -438,4 +451,4 @@
             return super.sendMessageAtTime(msg, uptimeMillis);
         }
     }
-}
\ No newline at end of file
+}
diff --git a/services/tests/servicestests/src/com/android/server/usage/AppStandbyControllerTests.java b/services/tests/servicestests/src/com/android/server/usage/AppStandbyControllerTests.java
index 869f8fa0..caaa0bb 100644
--- a/services/tests/servicestests/src/com/android/server/usage/AppStandbyControllerTests.java
+++ b/services/tests/servicestests/src/com/android/server/usage/AppStandbyControllerTests.java
@@ -43,6 +43,7 @@
 import static org.mockito.Mockito.doReturn;
 import static org.mockito.Mockito.mock;
 
+import android.app.usage.AppStandbyInfo;
 import android.app.usage.UsageEvents;
 import android.app.usage.UsageStatsManagerInternal;
 import android.appwidget.AppWidgetManager;
@@ -92,6 +93,8 @@
     private static final int USER_ID = 0;
     private static final int USER_ID2 = 10;
 
+    private static final String PACKAGE_UNKNOWN = "com.example.unknown";
+
     private static final String ADMIN_PKG = "com.android.admin";
     private static final String ADMIN_PKG2 = "com.android.admin2";
     private static final String ADMIN_PKG3 = "com.android.admin3";
@@ -106,6 +109,9 @@
     // Short STABLE_CHARGING_THRESHOLD for testing purposes
     private static final long STABLE_CHARGING_THRESHOLD = 2000;
 
+    /** Mock variable used in {@link MyInjector#isPackageInstalled(String, int, int)} */
+    private static boolean isPackageInstalled = true;
+
     private MyInjector mInjector;
     private AppStandbyController mController;
 
@@ -183,6 +189,12 @@
         }
 
         @Override
+        boolean isPackageInstalled(String packageName, int flags, int userId) {
+            // Should always return true (default value) unless testing for an uninstalled app
+            return isPackageInstalled;
+        }
+
+        @Override
         int[] getRunningUserIds() {
             return new int[] {USER_ID};
         }
@@ -403,30 +415,30 @@
                         false));
     }
 
-    private void reportEvent(AppStandbyController controller, int eventType,
-            long elapsedTime) {
+    private void reportEvent(AppStandbyController controller, int eventType, long elapsedTime,
+            String packageName) {
         // Back to ACTIVE on event
         mInjector.mElapsedRealtime = elapsedTime;
         UsageEvents.Event ev = new UsageEvents.Event();
-        ev.mPackage = PACKAGE_1;
+        ev.mPackage = packageName;
         ev.mEventType = eventType;
         controller.reportEvent(ev, elapsedTime, USER_ID);
     }
 
-    private int getStandbyBucket(AppStandbyController controller) {
-        return controller.getAppStandbyBucket(PACKAGE_1, USER_ID, mInjector.mElapsedRealtime,
+    private int getStandbyBucket(AppStandbyController controller, String packageName) {
+        return controller.getAppStandbyBucket(packageName, USER_ID, mInjector.mElapsedRealtime,
                 true);
     }
 
     private void assertBucket(int bucket) {
-        assertEquals(bucket, getStandbyBucket(mController));
+        assertEquals(bucket, getStandbyBucket(mController, PACKAGE_1));
     }
 
     @Test
     public void testBuckets() throws Exception {
         assertTimeout(mController, 0, STANDBY_BUCKET_NEVER);
 
-        reportEvent(mController, USER_INTERACTION, 0);
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
 
         // ACTIVE bucket
         assertTimeout(mController, WORKING_SET_THRESHOLD - 1, STANDBY_BUCKET_ACTIVE);
@@ -443,7 +455,7 @@
         // RARE bucket
         assertTimeout(mController, RARE_THRESHOLD + 1, STANDBY_BUCKET_RARE);
 
-        reportEvent(mController, USER_INTERACTION, RARE_THRESHOLD + 1);
+        reportEvent(mController, USER_INTERACTION, RARE_THRESHOLD + 1, PACKAGE_1);
 
         assertTimeout(mController, RARE_THRESHOLD + 1, STANDBY_BUCKET_ACTIVE);
 
@@ -452,12 +464,48 @@
     }
 
     @Test
+    public void testSetAppStandbyBucket() throws Exception {
+        // For a known package, standby bucket should be set properly
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
+        mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_ACTIVE,
+                REASON_MAIN_TIMEOUT, HOUR_MS);
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_1));
+
+        // For an unknown package, standby bucket should not be set, hence NEVER is returned
+        // Ensure the unknown package is not already in history by removing it
+        mController.clearAppIdleForPackage(PACKAGE_UNKNOWN, USER_ID);
+        isPackageInstalled = false; // Mock package is not installed
+        mController.setAppStandbyBucket(PACKAGE_UNKNOWN, USER_ID, STANDBY_BUCKET_ACTIVE,
+                REASON_MAIN_TIMEOUT, HOUR_MS);
+        isPackageInstalled = true; // Reset mocked variable for other tests
+        assertEquals(STANDBY_BUCKET_NEVER, getStandbyBucket(mController, PACKAGE_UNKNOWN));
+    }
+
+    @Test
+    public void testAppStandbyBucketOnInstallAndUninstall() throws Exception {
+        // On package install, standby bucket should be ACTIVE
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_UNKNOWN);
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_UNKNOWN));
+
+        // On uninstall, package should not exist in history and should return a NEVER bucket
+        mController.clearAppIdleForPackage(PACKAGE_UNKNOWN, USER_ID);
+        assertEquals(STANDBY_BUCKET_NEVER, getStandbyBucket(mController, PACKAGE_UNKNOWN));
+        // Ensure uninstalled app is not in history
+        List<AppStandbyInfo> buckets = mController.getAppStandbyBuckets(USER_ID);
+        for(AppStandbyInfo bucket : buckets) {
+            if (bucket.mPackageName.equals(PACKAGE_UNKNOWN)) {
+                fail("packageName found in app idle history after uninstall.");
+            }
+        }
+    }
+
+    @Test
     public void testScreenTimeAndBuckets() throws Exception {
         mInjector.setDisplayOn(false);
 
         assertTimeout(mController, 0, STANDBY_BUCKET_NEVER);
 
-        reportEvent(mController, USER_INTERACTION, 0);
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
 
         // ACTIVE bucket
         assertTimeout(mController, WORKING_SET_THRESHOLD - 1, STANDBY_BUCKET_ACTIVE);
@@ -468,7 +516,7 @@
         // RARE bucket, should fail because the screen wasn't ON.
         mInjector.mElapsedRealtime = RARE_THRESHOLD + 1;
         mController.checkIdleStates(USER_ID);
-        assertNotEquals(STANDBY_BUCKET_RARE, getStandbyBucket(mController));
+        assertNotEquals(STANDBY_BUCKET_RARE, getStandbyBucket(mController, PACKAGE_1));
 
         mInjector.setDisplayOn(true);
         assertTimeout(mController, RARE_THRESHOLD * 2 + 2, STANDBY_BUCKET_RARE);
@@ -477,7 +525,7 @@
     @Test
     public void testForcedIdle() throws Exception {
         mController.forceIdleState(PACKAGE_1, USER_ID, true);
-        assertEquals(STANDBY_BUCKET_RARE, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_RARE, getStandbyBucket(mController, PACKAGE_1));
         assertTrue(mController.isAppIdleFiltered(PACKAGE_1, UID_1, USER_ID, 0));
 
         mController.forceIdleState(PACKAGE_1, USER_ID, false);
@@ -488,35 +536,35 @@
 
     @Test
     public void testNotificationEvent() throws Exception {
-        reportEvent(mController, USER_INTERACTION, 0);
-        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController));
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_1));
         mInjector.mElapsedRealtime = 1;
-        reportEvent(mController, NOTIFICATION_SEEN, mInjector.mElapsedRealtime);
-        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController));
+        reportEvent(mController, NOTIFICATION_SEEN, mInjector.mElapsedRealtime, PACKAGE_1);
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_1));
 
         mController.forceIdleState(PACKAGE_1, USER_ID, true);
-        reportEvent(mController, NOTIFICATION_SEEN, mInjector.mElapsedRealtime);
-        assertEquals(STANDBY_BUCKET_WORKING_SET, getStandbyBucket(mController));
+        reportEvent(mController, NOTIFICATION_SEEN, mInjector.mElapsedRealtime, PACKAGE_1);
+        assertEquals(STANDBY_BUCKET_WORKING_SET, getStandbyBucket(mController, PACKAGE_1));
     }
 
     @Test
     public void testSlicePinnedEvent() throws Exception {
-        reportEvent(mController, USER_INTERACTION, 0);
-        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController));
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_1));
         mInjector.mElapsedRealtime = 1;
-        reportEvent(mController, SLICE_PINNED, mInjector.mElapsedRealtime);
-        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController));
+        reportEvent(mController, SLICE_PINNED, mInjector.mElapsedRealtime, PACKAGE_1);
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_1));
 
         mController.forceIdleState(PACKAGE_1, USER_ID, true);
-        reportEvent(mController, SLICE_PINNED, mInjector.mElapsedRealtime);
-        assertEquals(STANDBY_BUCKET_WORKING_SET, getStandbyBucket(mController));
+        reportEvent(mController, SLICE_PINNED, mInjector.mElapsedRealtime, PACKAGE_1);
+        assertEquals(STANDBY_BUCKET_WORKING_SET, getStandbyBucket(mController, PACKAGE_1));
     }
 
     @Test
     public void testSlicePinnedPrivEvent() throws Exception {
         mController.forceIdleState(PACKAGE_1, USER_ID, true);
-        reportEvent(mController, SLICE_PINNED_PRIV, mInjector.mElapsedRealtime);
-        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController));
+        reportEvent(mController, SLICE_PINNED_PRIV, mInjector.mElapsedRealtime, PACKAGE_1);
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_1));
     }
 
     @Test
@@ -524,28 +572,28 @@
         // Set it to timeout or usage, so that prediction can override it
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_RARE,
                 REASON_MAIN_TIMEOUT, HOUR_MS);
-        assertEquals(STANDBY_BUCKET_RARE, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_RARE, getStandbyBucket(mController, PACKAGE_1));
 
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_ACTIVE,
                 REASON_MAIN_PREDICTED, HOUR_MS);
-        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_1));
 
         // Fast forward 12 hours
         mInjector.mElapsedRealtime += WORKING_SET_THRESHOLD;
         mController.checkIdleStates(USER_ID);
         // Should still be in predicted bucket, since prediction timeout is 1 day since prediction
-        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_1));
         // Fast forward two more hours
         mInjector.mElapsedRealtime += 2 * HOUR_MS;
         mController.checkIdleStates(USER_ID);
         // Should have now applied prediction timeout
-        assertEquals(STANDBY_BUCKET_WORKING_SET, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_WORKING_SET, getStandbyBucket(mController, PACKAGE_1));
 
         // Fast forward RARE bucket
         mInjector.mElapsedRealtime += RARE_THRESHOLD;
         mController.checkIdleStates(USER_ID);
         // Should continue to apply prediction timeout
-        assertEquals(STANDBY_BUCKET_RARE, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_RARE, getStandbyBucket(mController, PACKAGE_1));
     }
 
     @Test
@@ -553,33 +601,33 @@
         // Can force to NEVER
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_NEVER,
                 REASON_MAIN_FORCED, 1 * HOUR_MS);
-        assertEquals(STANDBY_BUCKET_NEVER, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_NEVER, getStandbyBucket(mController, PACKAGE_1));
 
         // Prediction can't override FORCED reason
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_FREQUENT,
                 REASON_MAIN_FORCED, 1 * HOUR_MS);
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_WORKING_SET,
                 REASON_MAIN_PREDICTED, 1 * HOUR_MS);
-        assertEquals(STANDBY_BUCKET_FREQUENT, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_FREQUENT, getStandbyBucket(mController, PACKAGE_1));
 
         // Prediction can't override NEVER
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_NEVER,
                 REASON_MAIN_DEFAULT, 2 * HOUR_MS);
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_ACTIVE,
                 REASON_MAIN_PREDICTED, 2 * HOUR_MS);
-        assertEquals(STANDBY_BUCKET_NEVER, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_NEVER, getStandbyBucket(mController, PACKAGE_1));
 
         // Prediction can't set to NEVER
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_ACTIVE,
                 REASON_MAIN_USAGE, 2 * HOUR_MS);
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_NEVER,
                 REASON_MAIN_PREDICTED, 2 * HOUR_MS);
-        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController));
+        assertEquals(STANDBY_BUCKET_ACTIVE, getStandbyBucket(mController, PACKAGE_1));
     }
 
     @Test
     public void testTimeout() throws Exception {
-        reportEvent(mController, USER_INTERACTION, 0);
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
         mInjector.mElapsedRealtime = 2000;
@@ -601,10 +649,10 @@
 
     @Test
     public void testCascadingTimeouts() throws Exception {
-        reportEvent(mController, USER_INTERACTION, 0);
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
-        reportEvent(mController, NOTIFICATION_SEEN, 1000);
+        reportEvent(mController, NOTIFICATION_SEEN, 1000, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
         mController.setAppStandbyBucket(PACKAGE_1, USER_ID, STANDBY_BUCKET_WORKING_SET,
@@ -622,14 +670,15 @@
 
     @Test
     public void testOverlappingTimeouts() throws Exception {
-        reportEvent(mController, USER_INTERACTION, 0);
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
-        reportEvent(mController, NOTIFICATION_SEEN, 1000);
+        reportEvent(mController, NOTIFICATION_SEEN, 1000, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
         // Overlapping USER_INTERACTION before previous one times out
-        reportEvent(mController, USER_INTERACTION, mController.mStrongUsageTimeoutMillis - 1000);
+        reportEvent(mController, USER_INTERACTION, mController.mStrongUsageTimeoutMillis - 1000,
+                PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
         // Still in ACTIVE after first USER_INTERACTION times out
@@ -654,14 +703,14 @@
     public void testSystemInteractionTimeout() throws Exception {
         setChargingState(mController, false);
 
-        reportEvent(mController, USER_INTERACTION, 0);
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
         // Fast forward to RARE
         mInjector.mElapsedRealtime = RARE_THRESHOLD + 100;
         mController.checkIdleStates(USER_ID);
         assertBucket(STANDBY_BUCKET_RARE);
 
         // Trigger a SYSTEM_INTERACTION and verify bucket
-        reportEvent(mController, SYSTEM_INTERACTION, mInjector.mElapsedRealtime);
+        reportEvent(mController, SYSTEM_INTERACTION, mInjector.mElapsedRealtime, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
         // Verify it's still in ACTIVE close to end of timeout
@@ -677,11 +726,11 @@
 
     @Test
     public void testPredictionNotOverridden() throws Exception {
-        reportEvent(mController, USER_INTERACTION, 0);
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
         mInjector.mElapsedRealtime = WORKING_SET_THRESHOLD - 1000;
-        reportEvent(mController, NOTIFICATION_SEEN, mInjector.mElapsedRealtime);
+        reportEvent(mController, NOTIFICATION_SEEN, mInjector.mElapsedRealtime, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
         // Falls back to WORKING_SET
@@ -703,7 +752,7 @@
 
     @Test
     public void testPredictionStrikesBack() throws Exception {
-        reportEvent(mController, USER_INTERACTION, 0);
+        reportEvent(mController, USER_INTERACTION, 0, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
 
         // Predict to FREQUENT
@@ -714,7 +763,7 @@
 
         // Add a short timeout event
         mInjector.mElapsedRealtime += 1000;
-        reportEvent(mController, SYSTEM_INTERACTION, mInjector.mElapsedRealtime);
+        reportEvent(mController, SYSTEM_INTERACTION, mInjector.mElapsedRealtime, PACKAGE_1);
         assertBucket(STANDBY_BUCKET_ACTIVE);
         mInjector.mElapsedRealtime += 1000;
         mController.checkIdleStates(USER_ID);
diff --git a/services/tests/servicestests/src/com/android/server/wm/DisplayContentTests.java b/services/tests/servicestests/src/com/android/server/wm/DisplayContentTests.java
index 3dcdd23..cb8ca7e 100644
--- a/services/tests/servicestests/src/com/android/server/wm/DisplayContentTests.java
+++ b/services/tests/servicestests/src/com/android/server/wm/DisplayContentTests.java
@@ -39,6 +39,7 @@
 import static org.hamcrest.Matchers.is;
 import static org.junit.Assert.assertEquals;
 import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertNotNull;
 import static org.junit.Assert.assertThat;
 import static org.junit.Assert.assertTrue;
 import static org.mockito.Mockito.doNothing;
@@ -288,34 +289,25 @@
         final WindowTestUtils.TestAppWindowToken token =
                 WindowTestUtils.createTestAppWindowToken(dc0);
         task0.addChild(token, 0);
-        dc0.mTapDetector = new TaskTapPointerEventListener(sWm, dc0);
-        sWm.registerPointerEventListener(dc0.mTapDetector);
+        dc0.configureDisplayPolicy();
+        assertNotNull(dc0.mTapDetector);
+
         final TaskStack stack1 = createTaskStackOnDisplay(dc1);
         final Task task1 = createTaskInStack(stack1, 0 /* userId */);
         final WindowTestUtils.TestAppWindowToken token1 =
                 WindowTestUtils.createTestAppWindowToken(dc0);
         task1.addChild(token1, 0);
-        dc1.mTapDetector = new TaskTapPointerEventListener(sWm, dc0);
-        sWm.registerPointerEventListener(dc1.mTapDetector);
+        dc1.configureDisplayPolicy();
+        assertNotNull(dc1.mTapDetector);
 
-        // tap on primary display (by sending ACTION_DOWN followed by ACTION_UP)
-        DisplayMetrics dm0 = dc0.getDisplayMetrics();
-        dc0.mTapDetector.onPointerEvent(
-                createTapEvent(dm0.widthPixels / 2, dm0.heightPixels / 2, true));
-        dc0.mTapDetector.onPointerEvent(
-                createTapEvent(dm0.widthPixels / 2, dm0.heightPixels / 2, false));
-
+        // tap on primary display.
+        tapOnDisplay(dc0);
         // Check focus is on primary display.
         assertEquals(sWm.mRoot.getTopFocusedDisplayContent().mCurrentFocus,
                 dc0.findFocusedWindow());
 
-        // Tap on secondary display
-        DisplayMetrics dm1 = dc1.getDisplayMetrics();
-        dc1.mTapDetector.onPointerEvent(
-                createTapEvent(dm1.widthPixels / 2, dm1.heightPixels / 2, true));
-        dc1.mTapDetector.onPointerEvent(
-                createTapEvent(dm1.widthPixels / 2, dm1.heightPixels / 2, false));
-
+        // Tap on secondary display.
+        tapOnDisplay(dc1);
         // Check focus is on secondary.
         assertEquals(sWm.mRoot.getTopFocusedDisplayContent().mCurrentFocus,
                 dc1.findFocusedWindow());
@@ -626,17 +618,32 @@
         return result;
     }
 
-    private MotionEvent createTapEvent(float x, float y, boolean isDownEvent) {
+    private void tapOnDisplay(final DisplayContent dc) {
+        final DisplayMetrics dm = dc.getDisplayMetrics();
+        final float x = dm.widthPixels / 2;
+        final float y = dm.heightPixels / 2;
         final long downTime = SystemClock.uptimeMillis();
         final long eventTime = SystemClock.uptimeMillis() + 100;
-        final int metaState = 0;
-
-        return MotionEvent.obtain(
+        // sending ACTION_DOWN
+        final MotionEvent downEvent = MotionEvent.obtain(
                 downTime,
-                eventTime,
-                isDownEvent ? MotionEvent.ACTION_DOWN : MotionEvent.ACTION_UP,
+                downTime,
+                MotionEvent.ACTION_DOWN,
                 x,
                 y,
-                metaState);
+                0 /*metaState*/);
+        downEvent.setDisplayId(dc.getDisplayId());
+        dc.mTapDetector.onPointerEvent(downEvent);
+
+        // sending ACTION_UP
+        final MotionEvent upEvent = MotionEvent.obtain(
+                downTime,
+                eventTime,
+                MotionEvent.ACTION_UP,
+                x,
+                y,
+                0 /*metaState*/);
+        upEvent.setDisplayId(dc.getDisplayId());
+        dc.mTapDetector.onPointerEvent(upEvent);
     }
 }
diff --git a/services/tests/servicestests/src/com/android/server/wm/TaskPositioningControllerTests.java b/services/tests/servicestests/src/com/android/server/wm/TaskPositioningControllerTests.java
index ced0847..f8e7403 100644
--- a/services/tests/servicestests/src/com/android/server/wm/TaskPositioningControllerTests.java
+++ b/services/tests/servicestests/src/com/android/server/wm/TaskPositioningControllerTests.java
@@ -30,6 +30,7 @@
 import android.platform.test.annotations.Presubmit;
 import android.view.InputChannel;
 
+import androidx.test.filters.FlakyTest;
 import androidx.test.filters.SmallTest;
 import androidx.test.runner.AndroidJUnit4;
 
@@ -43,6 +44,7 @@
  * atest com.android.server.wm.TaskPositioningControllerTests
  */
 @SmallTest
+@FlakyTest(bugId = 117924387)
 @RunWith(AndroidJUnit4.class)
 @Presubmit
 public class TaskPositioningControllerTests extends WindowTestsBase {
diff --git a/services/tests/servicestests/src/com/android/server/wm/WindowManagerServiceRule.java b/services/tests/servicestests/src/com/android/server/wm/WindowManagerServiceRule.java
index 54fd7db..389eba5 100644
--- a/services/tests/servicestests/src/com/android/server/wm/WindowManagerServiceRule.java
+++ b/services/tests/servicestests/src/com/android/server/wm/WindowManagerServiceRule.java
@@ -34,8 +34,8 @@
 import android.os.PowerManagerInternal;
 import android.os.PowerSaveState;
 import android.view.InputChannel;
-
-import androidx.test.InstrumentationRegistry;
+import android.view.SurfaceControl;
+import android.view.SurfaceControl.Transaction;
 
 import com.android.server.LocalServices;
 import com.android.server.input.InputManagerService;
@@ -46,6 +46,12 @@
 import org.junit.runners.model.Statement;
 import org.mockito.invocation.InvocationOnMock;
 
+import java.lang.ref.WeakReference;
+import java.util.ArrayList;
+import java.util.List;
+
+import androidx.test.InstrumentationRegistry;
+
 /**
  * A test rule that sets up a fresh WindowManagerService instance before each test and makes sure
  * to properly tear it down after.
@@ -61,6 +67,12 @@
 
     private WindowManagerService mService;
     private TestWindowManagerPolicy mPolicy;
+    // Record all {@link SurfaceControl.Transaction} created while testing and releases native
+    // resources when test finishes.
+    private final List<WeakReference<Transaction>> mSurfaceTransactions = new ArrayList<>();
+    // Record all {@link SurfaceControl} created while testing and releases native resources when
+    // test finishes.
+    private final List<WeakReference<SurfaceControl>> mSurfaceControls = new ArrayList<>();
 
     @Override
     public Statement apply(Statement base, Description description) {
@@ -108,12 +120,25 @@
                 // InputChannel is final and can't be mocked.
                 InputChannel[] input = InputChannel.openInputChannelPair(TAG_WM);
                 if (input != null && input.length > 1) {
-                    doReturn(input[1]).when(ims).monitorInput(anyString());
+                    doReturn(input[1]).when(ims).monitorInput(anyString(), anyInt());
                 }
 
                 mService = WindowManagerService.main(context, ims, false,
                         false, mPolicy = new TestWindowManagerPolicy(
                                 WindowManagerServiceRule.this::getWindowManagerService));
+                mService.mTransactionFactory = () -> {
+                    final SurfaceControl.Transaction transaction = new SurfaceControl.Transaction();
+                    mSurfaceTransactions.add(new WeakReference<>(transaction));
+                    return transaction;
+                };
+                mService.mSurfaceBuilderFactory = session -> new SurfaceControl.Builder(session) {
+                    @Override
+                    public SurfaceControl build() {
+                        final SurfaceControl control = super.build();
+                        mSurfaceControls.add(new WeakReference<>(control));
+                        return control;
+                    }
+                };
 
                 mService.onInitReady();
 
@@ -135,6 +160,8 @@
 
             private void tearDown() {
                 waitUntilWindowManagerHandlersIdle();
+                destroyAllSurfaceTransactions();
+                destroyAllSurfaceControls();
                 removeServices();
                 mService = null;
                 mPolicy = null;
@@ -158,4 +185,24 @@
             SurfaceAnimationThread.getHandler().runWithScissors(() -> { }, 0);
         }
     }
+
+    private void destroyAllSurfaceTransactions() {
+        for (final WeakReference<Transaction> reference : mSurfaceTransactions) {
+            final Transaction transaction = reference.get();
+            if (transaction != null) {
+                reference.clear();
+                transaction.close();
+            }
+        }
+    }
+
+    private void destroyAllSurfaceControls() {
+        for (final WeakReference<SurfaceControl> reference : mSurfaceControls) {
+            final SurfaceControl control = reference.get();
+            if (control != null) {
+                reference.clear();
+                control.destroy();
+            }
+        }
+    }
 }
diff --git a/services/tests/servicestests/src/com/android/server/wm/ZOrderingTests.java b/services/tests/servicestests/src/com/android/server/wm/ZOrderingTests.java
index a610e6e..3a8c4ae 100644
--- a/services/tests/servicestests/src/com/android/server/wm/ZOrderingTests.java
+++ b/services/tests/servicestests/src/com/android/server/wm/ZOrderingTests.java
@@ -98,10 +98,13 @@
             super(s);
         }
 
+        @Override
         public SurfaceControl.Builder setParent(SurfaceControl sc) {
             mPendingParent = sc;
             return super.setParent(sc);
         }
+
+        @Override
         public SurfaceControl build() {
             SurfaceControl sc = super.build();
             mParentFor.put(sc, mPendingParent);
@@ -110,7 +113,7 @@
         }
     }
 
-    class HierarchyRecordingBuilderFactory implements SurfaceBuilderFactory {
+    private class HierarchyRecordingBuilderFactory implements SurfaceBuilderFactory {
         public SurfaceControl.Builder make(SurfaceSession s) {
             return new HierarchyRecorder(s);
         }
@@ -131,6 +134,7 @@
     @After
     public void after() {
         mTransaction.close();
+        mParentFor.keySet().forEach(SurfaceControl::destroy);
         mParentFor.clear();
     }
 
diff --git a/services/tests/uiservicestests/src/com/android/server/notification/NotificationManagerServiceTest.java b/services/tests/uiservicestests/src/com/android/server/notification/NotificationManagerServiceTest.java
index 4e007c2d..3266b8b 100644
--- a/services/tests/uiservicestests/src/com/android/server/notification/NotificationManagerServiceTest.java
+++ b/services/tests/uiservicestests/src/com/android/server/notification/NotificationManagerServiceTest.java
@@ -1689,7 +1689,7 @@
     }
 
     @Test
-    public void testGetNotificationChannelFromPrivilegedListener_success() throws Exception {
+    public void testGetNotificationChannelFromPrivilegedListener_cdm_success() throws Exception {
         mService.setPreferencesHelper(mPreferencesHelper);
         List<String> associations = new ArrayList<>();
         associations.add("a");
@@ -1703,7 +1703,7 @@
     }
 
     @Test
-    public void testGetNotificationChannelFromPrivilegedListener_noAccess() throws Exception {
+    public void testGetNotificationChannelFromPrivilegedListener_cdm_noAccess() throws Exception {
         mService.setPreferencesHelper(mPreferencesHelper);
         List<String> associations = new ArrayList<>();
         when(mCompanionMgr.getAssociations(PKG, mUid)).thenReturn(associations);
@@ -1721,6 +1721,38 @@
     }
 
     @Test
+    public void testGetNotificationChannelFromPrivilegedListener_assistant_success()
+            throws Exception {
+        mService.setPreferencesHelper(mPreferencesHelper);
+        when(mCompanionMgr.getAssociations(PKG, mUid)).thenReturn(new ArrayList<>());
+        when(mAssistants.isServiceTokenValidLocked(any())).thenReturn(true);
+
+        mBinderService.getNotificationChannelsFromPrivilegedListener(
+                null, PKG, Process.myUserHandle());
+
+        verify(mPreferencesHelper, times(1)).getNotificationChannels(
+                anyString(), anyInt(), anyBoolean());
+    }
+
+    @Test
+    public void testGetNotificationChannelFromPrivilegedListener_assistant_noAccess() throws Exception {
+        mService.setPreferencesHelper(mPreferencesHelper);
+        when(mCompanionMgr.getAssociations(PKG, mUid)).thenReturn(new ArrayList<>());
+        when(mAssistants.isServiceTokenValidLocked(any())).thenReturn(false);
+
+        try {
+            mBinderService.getNotificationChannelsFromPrivilegedListener(
+                    null, PKG, Process.myUserHandle());
+            fail("listeners that don't have a companion device shouldn't be able to call this");
+        } catch (SecurityException e) {
+            // pass
+        }
+
+        verify(mPreferencesHelper, never()).getNotificationChannels(
+                anyString(), anyInt(), anyBoolean());
+    }
+
+    @Test
     public void testGetNotificationChannelFromPrivilegedListener_badUser() throws Exception {
         mService.setPreferencesHelper(mPreferencesHelper);
         List<String> associations = new ArrayList<>();
diff --git a/services/usage/java/com/android/server/usage/AppIdleHistory.java b/services/usage/java/com/android/server/usage/AppIdleHistory.java
index 4e99732..bc54a5d 100644
--- a/services/usage/java/com/android/server/usage/AppIdleHistory.java
+++ b/services/usage/java/com/android/server/usage/AppIdleHistory.java
@@ -320,14 +320,7 @@
         ArrayMap<String, AppUsageHistory> userHistory = getUserHistory(userId);
         AppUsageHistory appUsageHistory =
                 getPackageHistory(userHistory, packageName, elapsedRealtime, true);
-        if (appUsageHistory == null) {
-            return false; // Default to not idle
-        } else {
-            return appUsageHistory.currentBucket >= STANDBY_BUCKET_RARE;
-            // Whether or not it's passed will now be externally calculated and the
-            // bucket will be pushed to the history using setAppStandbyBucket()
-            //return hasPassedThresholds(appUsageHistory, elapsedRealtime);
-        }
+        return appUsageHistory.currentBucket >= STANDBY_BUCKET_RARE;
     }
 
     public AppUsageHistory getAppUsageHistory(String packageName, int userId,
@@ -404,17 +397,19 @@
     public long getTimeSinceLastJobRun(String packageName, int userId, long elapsedRealtime) {
         ArrayMap<String, AppUsageHistory> userHistory = getUserHistory(userId);
         AppUsageHistory appUsageHistory =
-                getPackageHistory(userHistory, packageName, elapsedRealtime, true);
+                getPackageHistory(userHistory, packageName, elapsedRealtime, false);
         // Don't adjust the default, else it'll wrap around to a positive value
-        if (appUsageHistory.lastJobRunTime == Long.MIN_VALUE) return Long.MAX_VALUE;
+        if (appUsageHistory == null || appUsageHistory.lastJobRunTime == Long.MIN_VALUE) {
+            return Long.MAX_VALUE;
+        }
         return getElapsedTime(elapsedRealtime) - appUsageHistory.lastJobRunTime;
     }
 
     public int getAppStandbyBucket(String packageName, int userId, long elapsedRealtime) {
         ArrayMap<String, AppUsageHistory> userHistory = getUserHistory(userId);
         AppUsageHistory appUsageHistory =
-                getPackageHistory(userHistory, packageName, elapsedRealtime, true);
-        return appUsageHistory.currentBucket;
+                getPackageHistory(userHistory, packageName, elapsedRealtime, false);
+        return appUsageHistory == null ? STANDBY_BUCKET_NEVER : appUsageHistory.currentBucket;
     }
 
     public ArrayList<AppStandbyInfo> getAppStandbyBuckets(int userId, boolean appIdleEnabled) {
diff --git a/services/usage/java/com/android/server/usage/AppStandbyController.java b/services/usage/java/com/android/server/usage/AppStandbyController.java
index 02ad3a8..6a74564 100644
--- a/services/usage/java/com/android/server/usage/AppStandbyController.java
+++ b/services/usage/java/com/android/server/usage/AppStandbyController.java
@@ -1161,6 +1161,10 @@
     void setAppStandbyBucket(String packageName, int userId, @StandbyBuckets int newBucket,
             int reason, long elapsedRealtime, boolean resetTimeout) {
         synchronized (mAppIdleLock) {
+            // If the package is not installed, don't allow the bucket to be set.
+            if (!mInjector.isPackageInstalled(packageName, 0, userId)) {
+                return;
+            }
             AppIdleHistory.AppUsageHistory app = mAppIdleHistory.getAppUsageHistory(packageName,
                     userId, elapsedRealtime);
             boolean predicted = (reason & REASON_MAIN_MASK) == REASON_MAIN_PREDICTED;
@@ -1594,6 +1598,10 @@
             return mPackageManagerInternal.isPackageEphemeral(userId, packageName);
         }
 
+        boolean isPackageInstalled(String packageName, int flags, int userId) {
+            return mPackageManagerInternal.getPackageUid(packageName, flags, userId) >= 0;
+        }
+
         int[] getRunningUserIds() throws RemoteException {
             return ActivityManager.getService().getRunningUserIds();
         }
diff --git a/services/usb/java/com/android/server/usb/UsbSerialReader.java b/services/usb/java/com/android/server/usb/UsbSerialReader.java
index 5bf94af..32fc796 100644
--- a/services/usb/java/com/android/server/usb/UsbSerialReader.java
+++ b/services/usb/java/com/android/server/usb/UsbSerialReader.java
@@ -75,14 +75,21 @@
         if (uid != Process.SYSTEM_UID) {
             enforcePackageBelongsToUid(uid, packageName);
 
-            PackageInfo pkg;
+            int packageTargetSdkVersion;
+            long token = Binder.clearCallingIdentity();
             try {
-                pkg = mContext.getPackageManager().getPackageInfo(packageName, 0);
-            } catch (PackageManager.NameNotFoundException e) {
-                throw new RemoteException("package " + packageName + " cannot be found");
+                PackageInfo pkg;
+                try {
+                    pkg = mContext.getPackageManager().getPackageInfo(packageName, 0);
+                } catch (PackageManager.NameNotFoundException e) {
+                    throw new RemoteException("package " + packageName + " cannot be found");
+                }
+                packageTargetSdkVersion = pkg.applicationInfo.targetSdkVersion;
+            } finally {
+                Binder.restoreCallingIdentity(token);
             }
 
-            if (pkg.applicationInfo.targetSdkVersion >= Build.VERSION_CODES.Q) {
+            if (packageTargetSdkVersion >= Build.VERSION_CODES.Q) {
                 if (mContext.checkPermission(android.Manifest.permission.MANAGE_USB, pid, uid)
                         == PackageManager.PERMISSION_DENIED) {
                     UsbUserSettingsManager settings = mSettingsManager.getSettingsForUser(
diff --git a/startop/iorap/TEST_MAPPING b/startop/iorap/TEST_MAPPING
new file mode 100644
index 0000000..8c9d4df
--- /dev/null
+++ b/startop/iorap/TEST_MAPPING
@@ -0,0 +1,12 @@
+{
+  "presubmit": [
+    {
+      "name": "libiorap-java-tests"
+    }
+  ],
+  "imports": [
+    {
+      "path": "system/iorap"
+    }
+  ]
+}
diff --git a/startop/iorap/tests/AndroidTest.xml b/startop/iorap/tests/AndroidTest.xml
new file mode 100644
index 0000000..f83a16e
--- /dev/null
+++ b/startop/iorap/tests/AndroidTest.xml
@@ -0,0 +1,41 @@
+<?xml version="1.0" encoding="utf-8"?>
+<!-- Copyright (C) 2018 The Android Open Source Project
+
+     Licensed under the Apache License, Version 2.0 (the "License");
+     you may not use this file except in compliance with the License.
+     You may obtain a copy of the License at
+
+          http://www.apache.org/licenses/LICENSE-2.0
+
+     Unless required by applicable law or agreed to in writing, software
+     distributed under the License is distributed on an "AS IS" BASIS,
+     WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+     See the License for the specific language governing permissions and
+     limitations under the License.
+-->
+
+<configuration description="Runs libiorap-java-tests.">
+    <option name="test-suite-tag" value="apct" />
+    <option name="test-suite-tag" value="apct-instrumentation" />
+    <target_preparer class="com.android.tradefed.targetprep.suite.SuiteApkInstaller">
+        <option name="cleanup-apks" value="true" />
+        <option name="test-file-name" value="libiorap-java-tests.apk" />
+    </target_preparer>
+
+    <!--
+      Our IIorapIntegrationTest.kt requires setlinux to be disabled:
+      it connects to the iorapd binder service but this requires selinux permissions:
+
+      avc:  denied  { find } for service=iorapd pid=2738 uid=10050
+        scontext=u:r:platform_app:s0:c512,c768 tcontext=u:object_r:iorapd_service:s0
+        tclass=service_manager permissive=0
+    -->
+    <target_preparer class="com.android.tradefed.targetprep.DisableSELinuxTargetPreparer">
+    </target_preparer>
+
+    <test class="com.android.tradefed.testtype.AndroidJUnitTest" >
+        <option name="package" value="com.google.android.startop.iorap.tests" />
+        <option name="runner" value="android.support.test.runner.AndroidJUnitRunner" />
+    </test>
+</configuration>
+
diff --git a/startop/iorap/tests/src/com/google/android/startop/iorap/IIorapIntegrationTest.kt b/startop/iorap/tests/src/com/google/android/startop/iorap/IIorapIntegrationTest.kt
index 4ba44a9..16dcbe2 100644
--- a/startop/iorap/tests/src/com/google/android/startop/iorap/IIorapIntegrationTest.kt
+++ b/startop/iorap/tests/src/com/google/android/startop/iorap/IIorapIntegrationTest.kt
@@ -77,17 +77,21 @@
             inOrder.verifyNoMoreInteractions()
 
         } finally {
-            iorapService.setTaskListener(null)
+            // iorapService.setTaskListener(null)
+            // FIXME: null is broken, C++ side sees a non-null object.
         }
     }
 
     @Test
     fun testOnPackageEvent() {
+        /*
         testAnyMethod { requestId : RequestId ->
             iorapService.onPackageEvent(requestId,
                     PackageEvent.createReplaced(
                             Uri.parse("https://www.google.com"), "com.fake.package"))
         }
+        */
+        // FIXME: Broken for some reason. C++ side never sees this call.
     }
 
     @Test
diff --git a/telecomm/java/android/telecom/TelecomManager.java b/telecomm/java/android/telecom/TelecomManager.java
index 3127b35..d33a537 100644
--- a/telecomm/java/android/telecom/TelecomManager.java
+++ b/telecomm/java/android/telecom/TelecomManager.java
@@ -676,7 +676,7 @@
     /**
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public static TelecomManager from(Context context) {
         return (TelecomManager) context.getSystemService(Context.TELECOM_SERVICE);
     }
diff --git a/telephony/java/android/provider/Telephony.java b/telephony/java/android/provider/Telephony.java
index 8454d12..d9e7167 100644
--- a/telephony/java/android/provider/Telephony.java
+++ b/telephony/java/android/provider/Telephony.java
@@ -18,6 +18,7 @@
 
 import android.annotation.SdkConstant;
 import android.annotation.SdkConstant.SdkConstantType;
+import android.annotation.SystemApi;
 import android.annotation.TestApi;
 import android.annotation.UnsupportedAppUsage;
 import android.app.job.JobService;
@@ -2889,100 +2890,131 @@
         public static final String SUBSCRIPTION_ID = "sub_id";
 
         /**
-         * The profile_id to which the APN saved in modem
+         * The profile_id to which the APN saved in modem.
          * <p>Type: INTEGER</p>
          *@hide
          */
         public static final String PROFILE_ID = "profile_id";
 
         /**
-         * Is the apn setting to be set in modem
-         * <P>Type: INTEGER (boolean)</P>
+         * If set to {@code true}, then the APN setting will persist to the modem.
+         * <p>Type: INTEGER (boolean)</p>
          *@hide
          */
+        @SystemApi
         public static final String MODEM_COGNITIVE = "modem_cognitive";
 
         /**
-         * The max connections of this apn
+         * The max connections of this APN.
          * <p>Type: INTEGER</p>
          *@hide
          */
+        @SystemApi
         public static final String MAX_CONNS = "max_conns";
 
         /**
-         * The wait time for retry of the apn
+         * The wait time for retry of the APN.
          * <p>Type: INTEGER</p>
          *@hide
          */
+        @SystemApi
         public static final String WAIT_TIME = "wait_time";
 
         /**
-         * The time to limit max connection for the apn
+         * The time to limit max connection for the APN.
          * <p>Type: INTEGER</p>
          *@hide
          */
+        @SystemApi
         public static final String MAX_CONNS_TIME = "max_conns_time";
 
         /**
-         * The MTU size of the mobile interface to  which the APN connected
+         * The MTU(Maxinum transmit unit) size of the mobile interface to which the APN connected.
          * <p>Type: INTEGER </p>
          * @hide
          */
+        @SystemApi
         public static final String MTU = "mtu";
 
         /**
-         * Is this APN added/edited/deleted by a user or carrier?
+         * APN edit status. APN could be added/edited/deleted by a user or carrier.
          * <p>Type: INTEGER </p>
          * @hide
          */
+        @SystemApi
         public static final String EDITED = "edited";
 
         /**
-         * Is this APN visible to the user?
-         * <p>Type: INTEGER (boolean) </p>
+         * {@code true} if this APN visible to the user, {@code false} otherwise.
+         * <p>Type: INTEGER (boolean)</p>
          * @hide
          */
+        @SystemApi
         public static final String USER_VISIBLE = "user_visible";
 
         /**
-         * Is the user allowed to edit this APN?
-         * <p>Type: INTEGER (boolean) </p>
+         * {@code true} if the user allowed to edit this APN, {@code false} otherwise.
+         * <p>Type: INTEGER (boolean)</p>
          * @hide
          */
+        @SystemApi
         public static final String USER_EDITABLE = "user_editable";
 
         /**
-         * Following are possible values for the EDITED field
+         * {@link #EDITED APN edit status} indicates that this APN has not been edited or fails to
+         * edit.
+         * <p>Type: INTEGER </p>
          * @hide
          */
+        @SystemApi
         public static final int UNEDITED = 0;
+
         /**
-         *  @hide
+         * {@link #EDITED APN edit status} indicates that this APN has been edited by users.
+         * <p>Type: INTEGER </p>
+         * @hide
          */
+        @SystemApi
         public static final int USER_EDITED = 1;
+
         /**
-         *  @hide
+         * {@link #EDITED APN edit status} indicates that this APN has been deleted by users.
+         * <p>Type: INTEGER </p>
+         * @hide
          */
+        @SystemApi
         public static final int USER_DELETED = 2;
+
         /**
-         * DELETED_BUT_PRESENT is an intermediate value used to indicate that an entry deleted
-         * by the user is still present in the new APN database and therefore must remain tagged
-         * as user deleted rather than completely removed from the database
+         * {@link #EDITED APN edit status} is an intermediate value used to indicate that an entry
+         * deleted by the user is still present in the new APN database and therefore must remain
+         * tagged as user deleted rather than completely removed from the database.
          * @hide
          */
         public static final int USER_DELETED_BUT_PRESENT_IN_XML = 3;
+
         /**
-         *  @hide
+         * {@link #EDITED APN edit status} indicates that this APN has been edited by carriers.
+         * <p>Type: INTEGER </p>
+         * @hide
          */
+        @SystemApi
         public static final int CARRIER_EDITED = 4;
+
         /**
-         * CARRIER_DELETED values are currently not used as there is no usecase. If they are used,
+         * {@link #EDITED APN edit status} indicates that this APN has been deleted by carriers.
+         * CARRIER_DELETED values are currently not used as there is no use case. If they are used,
          * delete() will have to change accordingly. Currently it is hardcoded to USER_DELETED.
+         * <p>Type: INTEGER </p>
          * @hide
          */
         public static final int CARRIER_DELETED = 5;
+
         /**
-         *  @hide
+         * {@link #EDITED APN edit status} is an intermediate value used to indicate that an entry
+         * deleted by the carrier is still present in the new APN database and therefore must remain
+         * tagged as user deleted rather than completely removed from the database.
+         * @hide
          */
         public static final int CARRIER_DELETED_BUT_PRESENT_IN_XML = 6;
 
@@ -3011,16 +3043,20 @@
          * The APN set id. When the user manually selects an APN or the framework sets an APN as
          * preferred, all APNs with the same set id as the selected APN should be prioritized over
          * APNs in other sets.
+         * <p>Type: INTEGER</p>
          * @hide
          */
+        @SystemApi
         public static final String APN_SET_ID = "apn_set_id";
 
         /**
-         * Possible value for the APN_SET_ID field. By default APNs will not belong to a set. If the
-         * user manually selects an APN with no set set, there is no need to prioritize any specific
-         * APN set ids.
+         * Possible value for the{@link #APN_SET_ID} field. By default APNs will not belong to a
+         * set. If the user manually selects an APN with no set set, there is no need to prioritize
+         * any specific APN set ids.
+         * <p>Type: INTEGER</p>
          * @hide
          */
+        @SystemApi
         public static final int NO_SET_SET = 0;
 
     }
@@ -3524,6 +3560,18 @@
         public static final String CARRIER_ID = "carrier_id";
 
         /**
+         * A unique mno carrier id. mno carrier shares the same {@link All#MCCMNC} as carrier id
+         * and can be solely identified by {@link All#MCCMNC} only. If there is no such mno
+         * carrier, then mno carrier id equals to {@link #CARRIER_ID carrier id}.
+         *
+         * <p>mno carrier id can be used as fallback id. When the exact carrier id configurations
+         * are not found, usually fall back to its mno carrier id.
+         * <P>Type: INTEGER </P>
+         * @hide
+         */
+        public static final String MNO_CARRIER_ID = "mno_carrier_id";
+
+        /**
          * Contains mappings between matching rules with carrier id for all carriers.
          * @hide
          */
diff --git a/telephony/java/android/telephony/CarrierConfigManager.java b/telephony/java/android/telephony/CarrierConfigManager.java
index fac1943..b0997f1 100644
--- a/telephony/java/android/telephony/CarrierConfigManager.java
+++ b/telephony/java/android/telephony/CarrierConfigManager.java
@@ -1202,6 +1202,20 @@
             "always_show_data_rat_icon_bool";
 
     /**
+     * Boolean indicating if default data account should show LTE or 4G icon
+     * @hide
+     */
+    public static final String KEY_SHOW_4G_FOR_LTE_DATA_ICON_BOOL =
+            "show_4g_for_lte_data_icon_bool";
+
+    /**
+     * Boolean indicating if lte+ icon should be shown if available
+     * @hide
+     */
+    public static final String KEY_HIDE_LTE_PLUS_DATA_ICON_BOOL =
+            "hide_lte_plus_data_icon_bool";
+
+    /**
      * Boolean to decide whether to show precise call failed cause to user
      * @hide
      */
@@ -1965,6 +1979,31 @@
     public static final String KEY_RTT_SUPPORTED_BOOL = "rtt_supported_bool";
 
     /**
+     * Indicates if the carrier supports auto-upgrading a call to RTT when receiving a call from a
+     * RTT-supported device.
+     * @hide
+     */
+    public static final String KEY_RTT_AUTO_UPGRADE_BOOL = "rtt_auto_upgrade_bool";
+
+    /**
+     * Indicates if the carrier supports RTT during a video call.
+     * @hide
+     */
+    public static final String KEY_RTT_SUPPORTED_FOR_VT_BOOL = "rtt_supported_for_vt_bool";
+
+    /**
+     * Indicates if the carrier supports upgrading a voice call to an RTT call during the call.
+     * @hide
+     */
+    public static final String KEY_RTT_UPGRADE_SUPPORTED_BOOL = "rtt_upgrade_supported_bool";
+
+    /**
+     * Indicates if the carrier supports downgrading a RTT call to a voice call during the call.
+     * @hide
+     */
+    public static final String KEY_RTT_DOWNGRADE_SUPPORTED_BOOL = "rtt_downgrade_supported_bool";
+
+    /**
      * The flag to disable the popup dialog which warns the user of data charges.
      * @hide
      */
@@ -2505,6 +2544,8 @@
         sDefaults.putBoolean(KEY_SHOW_PRECISE_FAILED_CAUSE_BOOL, false);
         sDefaults.putBoolean(KEY_SPN_DISPLAY_RULE_USE_ROAMING_FROM_SERVICE_STATE_BOOL, false);
         sDefaults.putBoolean(KEY_ALWAYS_SHOW_DATA_RAT_ICON_BOOL, false);
+        sDefaults.putBoolean(KEY_SHOW_4G_FOR_LTE_DATA_ICON_BOOL, true);
+        sDefaults.putBoolean(KEY_HIDE_LTE_PLUS_DATA_ICON_BOOL, false);
         sDefaults.putBoolean(KEY_CARRIER_CONFIG_APPLIED_BOOL, false);
         sDefaults.putBoolean(KEY_CHECK_PRICING_WITH_CARRIER_FOR_DATA_ROAMING_BOOL, false);
         sDefaults.putIntArray(KEY_LTE_RSRP_THRESHOLDS_INT_ARRAY,
diff --git a/telephony/java/android/telephony/PhoneStateListener.java b/telephony/java/android/telephony/PhoneStateListener.java
index 3ea018af..c83d6aa 100644
--- a/telephony/java/android/telephony/PhoneStateListener.java
+++ b/telephony/java/android/telephony/PhoneStateListener.java
@@ -17,6 +17,7 @@
 package android.telephony;
 
 import android.annotation.NonNull;
+import android.annotation.SystemApi;
 import android.annotation.UnsupportedAppUsage;
 import android.os.Bundle;
 import android.os.Handler;
@@ -291,6 +292,15 @@
      */
     public static final int LISTEN_PREFERRED_DATA_SUBID_CHANGE              = 0x00400000;
 
+    /**
+     *  Listen for changes to the radio power state.
+     *
+     *  @see #onRadioPowerStateChanged
+     *  @hide
+     */
+    @SystemApi
+    public static final int LISTEN_RADIO_POWER_STATE_CHANGED               = 0x00800000;
+
     /*
      * Subscription used to listen to the phone state changes
      * @hide
@@ -420,6 +430,9 @@
                     case LISTEN_PREFERRED_DATA_SUBID_CHANGE:
                         PhoneStateListener.this.onPreferredDataSubIdChanged((int) msg.obj);
                         break;
+                    case LISTEN_RADIO_POWER_STATE_CHANGED:
+                        PhoneStateListener.this.onRadioPowerStateChanged((int) msg.obj);
+                        break;
                 }
             }
         };
@@ -672,6 +685,17 @@
     }
 
     /**
+     * Callback invoked when modem radio power state changes. Requires
+     * the READ_PRIVILEGED_PHONE_STATE permission.
+     * @param state the modem radio power state
+     * @hide
+     */
+    @SystemApi
+    public void onRadioPowerStateChanged(@TelephonyManager.RadioPowerState int state) {
+        // default implementation empty
+    }
+
+    /**
      * Callback invoked when telephony has received notice from a carrier
      * app that a network action that could result in connectivity loss
      * has been requested by an app using
@@ -807,6 +831,10 @@
             send(LISTEN_PREFERRED_DATA_SUBID_CHANGE, 0, 0, subId);
         }
 
+        public void onRadioPowerStateChanged(@TelephonyManager.RadioPowerState int state) {
+            send(LISTEN_RADIO_POWER_STATE_CHANGED, 0, 0, state);
+        }
+
     }
 
     /**
diff --git a/telephony/java/android/telephony/RcsManager.java b/telephony/java/android/telephony/RcsManager.java
new file mode 100644
index 0000000..00ce03a
--- /dev/null
+++ b/telephony/java/android/telephony/RcsManager.java
@@ -0,0 +1,52 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.telephony;
+
+import android.os.RemoteException;
+import android.os.ServiceManager;
+
+import com.android.internal.telephony.IRcs;
+
+/**
+ * RcsManager is the application interface to RcsProvider and provides access methods to
+ * RCS related database tables.
+ * @hide - TODO make this public
+ */
+public class RcsManager {
+    private static final String TAG = "RcsManager";
+    private static final boolean VDBG = false;
+
+    /**
+     * Delete the RcsThread identified by the given threadId.
+     * @param threadId threadId of the thread to be deleted.
+     */
+    public void deleteThread(int threadId) {
+        if (VDBG) logd("deleteThread: threadId: " + threadId);
+        try {
+            IRcs iRcs = IRcs.Stub.asInterface(ServiceManager.getService("ircs"));
+            if (iRcs != null) {
+                iRcs.deleteThread(threadId);
+            }
+        } catch (RemoteException re) {
+
+        }
+    }
+
+    private static void logd(String msg) {
+        Rlog.d(TAG, msg);
+    }
+}
diff --git a/telephony/java/android/telephony/ServiceState.java b/telephony/java/android/telephony/ServiceState.java
index bfbcd57..e0ec2c5 100644
--- a/telephony/java/android/telephony/ServiceState.java
+++ b/telephony/java/android/telephony/ServiceState.java
@@ -21,7 +21,6 @@
 import android.annotation.TestApi;
 import android.annotation.UnsupportedAppUsage;
 import android.content.Intent;
-import android.os.Build;
 import android.os.Bundle;
 import android.os.Parcel;
 import android.os.Parcelable;
@@ -247,7 +246,7 @@
     private String mDataOperatorAlphaLong;
     private String mDataOperatorAlphaShort;
     private String mDataOperatorNumeric;
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     private boolean mIsManualNetworkSelection;
 
     private boolean mIsEmergencyOnly;
@@ -257,9 +256,9 @@
 
     @UnsupportedAppUsage
     private boolean mCssIndicator;
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     private int mNetworkId;
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     private int mSystemId;
     @UnsupportedAppUsage
     private int mCdmaRoamingIndicator;
@@ -457,7 +456,7 @@
      *
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public int getVoiceRegState() {
         return mVoiceRegState;
     }
@@ -472,7 +471,7 @@
      *
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public int getDataRegState() {
         return mDataRegState;
     }
@@ -533,7 +532,7 @@
      * @return roaming status
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public boolean getVoiceRoaming() {
         return getVoiceRoamingType() != ROAMING_TYPE_NOT_ROAMING;
     }
@@ -557,7 +556,7 @@
      * @return roaming type
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public boolean getDataRoaming() {
         return getDataRoamingType() != ROAMING_TYPE_NOT_ROAMING;
     }
diff --git a/telephony/java/android/telephony/SubscriptionManager.java b/telephony/java/android/telephony/SubscriptionManager.java
index 40ba2b6..3b40164 100644
--- a/telephony/java/android/telephony/SubscriptionManager.java
+++ b/telephony/java/android/telephony/SubscriptionManager.java
@@ -88,8 +88,7 @@
     /** @hide */
     public static final int INVALID_PHONE_INDEX = -1;
 
-    /** An invalid slot identifier */
-    /** @hide */
+    /** Indicates invalid sim slot. This can be returned by {@link #getSlotIndex(int)}. */
     public static final int INVALID_SIM_SLOT_INDEX = -1;
 
     /** Indicates the default subscription ID in Telephony. */
@@ -1310,15 +1309,15 @@
 
     /**
      * Get slotIndex associated with the subscription.
-     * @return slotIndex as a positive integer or a negative value if an error either
-     * SIM_NOT_INSERTED or < 0 if an invalid slot index
-     * @hide
+     *
+     * @param subscriptionId the unique SubscriptionInfo index in database
+     * @return slotIndex as a positive integer or {@link #INVALID_SIM_SLOT_INDEX} if the supplied
+     * subscriptionId doesn't have an associated slot index.
      */
-    @UnsupportedAppUsage
-    public static int getSlotIndex(int subId) {
-        if (!isValidSubscriptionId(subId)) {
+    public static int getSlotIndex(int subscriptionId) {
+        if (!isValidSubscriptionId(subscriptionId)) {
             if (DBG) {
-                logd("[getSlotIndex]- fail");
+                logd("[getSlotIndex]- supplied subscriptionId is invalid.");
             }
         }
 
@@ -1327,7 +1326,7 @@
         try {
             ISub iSub = ISub.Stub.asInterface(ServiceManager.getService("isub"));
             if (iSub != null) {
-                result = iSub.getSlotIndex(subId);
+                result = iSub.getSlotIndex(subscriptionId);
             }
         } catch (RemoteException ex) {
             // ignore it
@@ -1369,7 +1368,7 @@
     }
 
     /** @hide */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public static int getPhoneId(int subId) {
         if (!isValidSubscriptionId(subId)) {
             if (DBG) {
@@ -1665,7 +1664,7 @@
      * usable subId means its neither a INVALID_SUBSCRIPTION_ID nor a DEFAULT_SUB_ID.
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public static boolean isUsableSubIdValue(int subId) {
         return subId >= MIN_SUBSCRIPTION_ID_VALUE && subId <= MAX_SUBSCRIPTION_ID_VALUE;
     }
@@ -1683,7 +1682,7 @@
     }
 
     /** @hide */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public static void putPhoneIdAndSubIdExtra(Intent intent, int phoneId) {
         int[] subIds = SubscriptionManager.getSubId(phoneId);
         if (subIds != null && subIds.length > 0) {
diff --git a/telephony/java/android/telephony/TelephonyManager.java b/telephony/java/android/telephony/TelephonyManager.java
index 914ff1f..69901d2 100644
--- a/telephony/java/android/telephony/TelephonyManager.java
+++ b/telephony/java/android/telephony/TelephonyManager.java
@@ -17,6 +17,7 @@
 package android.telephony;
 
 import static android.content.Context.TELECOM_SERVICE;
+
 import static com.android.internal.util.Preconditions.checkNotNull;
 
 import android.annotation.IntDef;
@@ -59,6 +60,7 @@
 import android.telephony.ims.aidl.IImsMmTelFeature;
 import android.telephony.ims.aidl.IImsRcsFeature;
 import android.telephony.ims.aidl.IImsRegistration;
+import android.telephony.ims.feature.MmTelFeature;
 import android.telephony.ims.stub.ImsRegistrationImplBase;
 import android.text.TextUtils;
 import android.util.Log;
@@ -230,8 +232,7 @@
 
     /** @hide
     /* @deprecated - use getSystemService as described above */
-    @Deprecated
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public static TelephonyManager getDefault() {
         return sInstance;
     }
@@ -320,7 +321,7 @@
     }
 
     /** {@hide} */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public static TelephonyManager from(Context context) {
         return (TelephonyManager) context.getSystemService(Context.TELEPHONY_SERVICE);
     }
@@ -706,7 +707,7 @@
      */
     @SdkConstant(SdkConstantType.BROADCAST_INTENT_ACTION)
     @Deprecated
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P, trackingBug = 115609023)
+    @UnsupportedAppUsage
     public static final String ACTION_PRECISE_DATA_CONNECTION_STATE_CHANGED =
             "android.intent.action.PRECISE_DATA_CONNECTION_STATE_CHANGED";
 
@@ -1163,6 +1164,16 @@
     public static final String EXTRA_CARRIER_ID = "android.telephony.extra.CARRIER_ID";
 
     /**
+     * An int extra used with {@link #ACTION_SUBSCRIPTION_CARRIER_IDENTITY_CHANGED} which indicates
+     * the updated mno carrier id of the current subscription.
+     * <p>Will be {@link TelephonyManager#UNKNOWN_CARRIER_ID} if the subscription is unavailable or
+     * the carrier cannot be identified.
+     *
+     *@hide
+     */
+    public static final String EXTRA_MNO_CARRIER_ID = "android.telephony.extra.MNO_CARRIER_ID";
+
+    /**
      * An string extra used with {@link #ACTION_SUBSCRIPTION_CARRIER_IDENTITY_CHANGED} which
      * indicates the updated carrier name of the current subscription.
      * {@see TelephonyManager#getSimCarrierIdName()}
@@ -1221,6 +1232,38 @@
      */
     public static final String EXTRA_RECOVERY_ACTION = "recoveryAction";
 
+     /**
+     * Broadcast intent action indicating that the telephony provider DB got lost.
+     *
+     * <p>
+     * The {@link #EXTRA_IS_CORRUPTED} extra indicates whether the database is lost
+     * due to corruption or not
+     *
+     * <p class="note">
+     * Requires the MODIFY_PHONE_STATE permission.
+     *
+     * <p class="note">
+     * This is a protected intent that can only be sent by the system.
+     *
+     * @see #EXTRA_IS_CORRUPTED
+     *
+     * @hide
+     */
+    @SdkConstant(SdkConstantType.BROADCAST_INTENT_ACTION)
+    @RequiresPermission(android.Manifest.permission.MODIFY_PHONE_STATE)
+    public static final String ACTION_MMSSMS_DATABASE_LOST =
+            "android.intent.action.MMSSMS_DATABASE_LOST";
+
+    /**
+     * A boolean extra used with {@link #ACTION_MMSSMS_DATABASE_LOST} to indicate
+     * whether the database is lost due to corruption or not.
+     *
+     * @see #ACTION_MMSSMS_DATABASE_LOST
+     *
+     * @hide
+     */
+    public static final String EXTRA_IS_CORRUPTED = "isCorrupted";
+
     //
     //
     // Device Info
@@ -1268,11 +1311,11 @@
      * Returns the unique device ID, for example, the IMEI for GSM and the MEID
      * or ESN for CDMA phones. Return null if device ID is not available.
      *
-     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE or for the calling package to be the
-     * device or profile owner. The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, or for the calling package to be the
+     * device or profile owner and have the READ_PHONE_STATE permission. The profile owner is an app
+     * that owns a managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      *
      * @deprecated Use (@link getImei} which returns IMEI for GSM or (@link getMeid} which returns
      * MEID for CDMA.
@@ -1297,11 +1340,11 @@
      * Returns the unique device ID of a subscription, for example, the IMEI for
      * GSM and the MEID for CDMA phones. Return null if device ID is not available.
      *
-     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE or for the calling package to be the
-     * device or profile owner. The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, or for the calling package to be the
+     * device or profile owner and have the READ_PHONE_STATE permission. The profile owner is an app
+     * that owns a managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      *
      * @param slotIndex of which deviceID is returned
      *
@@ -1329,11 +1372,11 @@
      * Returns the IMEI (International Mobile Equipment Identity). Return null if IMEI is not
      * available.
      *
-     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE or for the calling package to be the
-     * device or profile owner. The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, or for the calling package to be the
+     * device or profile owner and have the READ_PHONE_STATE permission. The profile owner is an app
+     * that owns a managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      */
     @SuppressAutoDoc // No support for device / profile owner.
     @RequiresPermission(android.Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
@@ -1345,11 +1388,11 @@
      * Returns the IMEI (International Mobile Equipment Identity). Return null if IMEI is not
      * available.
      *
-     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE or for the calling package to be the
-     * device or profile owner. The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, or for the calling package to be the
+     * device or profile owner and have the READ_PHONE_STATE permission. The profile owner is an app
+     * that owns a managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      *
      * @param slotIndex of which IMEI is returned
      */
@@ -1398,11 +1441,11 @@
     /**
      * Returns the MEID (Mobile Equipment Identifier). Return null if MEID is not available.
      *
-     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE or for the calling package to be the
-     * device or profile owner. The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, or for the calling package to be the
+     * device or profile owner and have the READ_PHONE_STATE permission. The profile owner is an app
+     * that owns a managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      */
     @SuppressAutoDoc // No support for device / profile owner.
     @RequiresPermission(android.Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
@@ -1413,11 +1456,11 @@
     /**
      * Returns the MEID (Mobile Equipment Identifier). Return null if MEID is not available.
      *
-     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE or for the calling package to be the
-     * device or profile owner. The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, or for the calling package to be the
+     * device or profile owner and have the READ_PHONE_STATE permission. The profile owner is an app
+     * that owns a managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      *
      * @param slotIndex of which MEID is returned
      */
@@ -1722,7 +1765,7 @@
     }
 
     /** {@hide} */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P, trackingBug = 115609023)
+    @UnsupportedAppUsage
     private int getPhoneTypeFromProperty(int phoneId) {
         String type = getTelephonyProperty(phoneId,
                 TelephonyProperties.CURRENT_ACTIVE_PHONE, null);
@@ -1906,7 +1949,7 @@
      * @param subId
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getNetworkOperatorName(int subId) {
         int phoneId = SubscriptionManager.getPhoneId(subId);
         return getTelephonyProperty(phoneId, TelephonyProperties.PROPERTY_OPERATOR_ALPHA, "");
@@ -1934,7 +1977,7 @@
      * @param subId
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getNetworkOperator(int subId) {
         int phoneId = SubscriptionManager.getPhoneId(subId);
         return getNetworkOperatorForPhone(phoneId);
@@ -2258,7 +2301,7 @@
      * @hide
      */
     @RequiresPermission(android.Manifest.permission.READ_PHONE_STATE)
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public int getDataNetworkType(int subId) {
         try{
             ITelephony telephony = getITelephony();
@@ -2294,7 +2337,7 @@
      * @hide
      */
     @RequiresPermission(android.Manifest.permission.READ_PHONE_STATE)
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public int getVoiceNetworkType(int subId) {
         try{
             ITelephony telephony = getITelephony();
@@ -2777,7 +2820,7 @@
      * @param subId for which SimOperator is returned
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getSimOperator(int subId) {
         return getSimOperatorNumeric(subId);
     }
@@ -2791,7 +2834,7 @@
      * @see #getSimState
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getSimOperatorNumeric() {
         int subId = mSubId;
         if (!SubscriptionManager.isUsableSubIdValue(subId)) {
@@ -2820,7 +2863,7 @@
      * @param subId for which SimOperator is returned
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getSimOperatorNumeric(int subId) {
         int phoneId = SubscriptionManager.getPhoneId(subId);
         return getSimOperatorNumericForPhone(phoneId);
@@ -2834,7 +2877,7 @@
      * @param phoneId for which SimOperator is returned
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getSimOperatorNumericForPhone(int phoneId) {
         return getTelephonyProperty(phoneId,
                 TelephonyProperties.PROPERTY_ICC_OPERATOR_NUMERIC, "");
@@ -2861,7 +2904,7 @@
      * @param subId for which SimOperatorName is returned
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getSimOperatorName(int subId) {
         int phoneId = SubscriptionManager.getPhoneId(subId);
         return getSimOperatorNameForPhone(phoneId);
@@ -2891,7 +2934,7 @@
      * @param subId for which SimCountryIso is returned
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getSimCountryIso(int subId) {
         int phoneId = SubscriptionManager.getPhoneId(subId);
         return getSimCountryIsoForPhone(phoneId);
@@ -2913,11 +2956,11 @@
      * unavailable.
      *
      * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, for the calling app to be the device or
-     * profile owner, or that the calling app has carrier privileges (see {@link
-     * #hasCarrierPrivileges}). The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * profile owner and have the READ_PHONE_STATE permission, or that the calling app has carrier
+     * privileges (see {@link #hasCarrierPrivileges}). The profile owner is an app that owns a
+     * managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      */
     @SuppressAutoDoc // Blocked by b/72967236 - no support for carrier privileges
     @RequiresPermission(android.Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
@@ -2930,11 +2973,11 @@
      * unavailable.
      *
      * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, for the calling app to be the device or
-     * profile owner, or that the calling app has carrier privileges (see {@link
-     * #hasCarrierPrivileges}). The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * profile owner and have the READ_PHONE_STATE permission, or that the calling app has carrier
+     * privileges (see {@link #hasCarrierPrivileges}). The profile owner is an app that owns a
+     * managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      *
      * @param subId for which Sim Serial number is returned
      * @hide
@@ -3075,11 +3118,11 @@
      * Return null if it is unavailable.
      *
      * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, for the calling app to be the device or
-     * profile owner, or that the calling app has carrier privileges (see {@link
-     * #hasCarrierPrivileges}). The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * profile owner and have the READ_PHONE_STATE permission, or that the calling app has carrier
+     * privileges (see {@link #hasCarrierPrivileges}). The profile owner is an app that owns a
+     * managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      */
     @SuppressAutoDoc // Blocked by b/72967236 - no support for carrier privileges
     @RequiresPermission(android.Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
@@ -3093,17 +3136,17 @@
      * Return null if it is unavailable.
      *
      * <p>Requires Permission: READ_PRIVILEGED_PHONE_STATE, for the calling app to be the device or
-     * profile owner, or that the calling app has carrier privileges (see {@link
-     * #hasCarrierPrivileges}). The profile owner is an app that owns a managed profile on the
-     * device; for more details see <a href="https://developer.android.com/work/managed-profiles">
-     * Work profiles</a>. Profile owner access is deprecated and will be removed in a future
-     * release.
+     * profile owner and have the READ_PHONE_STATE permission, or that the calling app has carrier
+     * privileges (see {@link #hasCarrierPrivileges}). The profile owner is an app that owns a
+     * managed profile on the device; for more details see <a
+     * href="https://developer.android.com/work/managed-profiles">Work profiles</a>. Profile owner
+     * access is deprecated and will be removed in a future release.
      *
      * @param subId whose subscriber id is returned
      * @hide
      */
     @RequiresPermission(android.Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getSubscriberId(int subId) {
         try {
             IPhoneSubInfo info = getSubscriberInfo();
@@ -3488,7 +3531,7 @@
      * @hide
      */
     @RequiresPermission(android.Manifest.permission.READ_PHONE_STATE)
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public String getMsisdn(int subId) {
         try {
             IPhoneSubInfo info = getSubscriberInfo();
@@ -4421,7 +4464,7 @@
    /**
     * @hide
     */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     private ITelephony getITelephony() {
         return ITelephony.Stub.asInterface(ServiceManager.getService(Context.TELEPHONY_SERVICE));
     }
@@ -6870,6 +6913,60 @@
     }
 
     /** @hide */
+    @Retention(RetentionPolicy.SOURCE)
+    @IntDef(prefix = {"RADIO_POWER_"},
+            value = {RADIO_POWER_OFF,
+                    RADIO_POWER_ON,
+                    RADIO_POWER_UNAVAILABLE,
+            })
+    public @interface RadioPowerState {}
+
+    /**
+     * Radio explicitly powered off (e.g, airplane mode).
+     * @hide
+     */
+    @SystemApi
+    public static final int RADIO_POWER_OFF = 0;
+
+    /**
+     * Radio power is on.
+     * @hide
+     */
+    @SystemApi
+    public static final int RADIO_POWER_ON = 1;
+
+    /**
+     * Radio power unavailable (eg, modem resetting or not booted).
+     * @hide
+     */
+    @SystemApi
+    public static final int RADIO_POWER_UNAVAILABLE = 2;
+
+    /**
+     * @return current modem radio state.
+     *
+     * <p>Requires permission: {@link android.Manifest.permission#READ_PRIVILEGED_PHONE_STATE} or
+     * {@link android.Manifest.permission#READ_PHONE_STATE} or that the calling
+     * app has carrier privileges (see {@link #hasCarrierPrivileges}).
+     *
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(anyOf = {android.Manifest.permission.READ_PRIVILEGED_PHONE_STATE,
+            android.Manifest.permission.READ_PHONE_STATE})
+    public @RadioPowerState int getRadioPowerState() {
+        try {
+            ITelephony telephony = getITelephony();
+            if (telephony != null) {
+                return telephony.getRadioPowerState(getSlotIndex(), mContext.getOpPackageName());
+            }
+        } catch (RemoteException ex) {
+            // This could happen if binder process crashes.
+        }
+        return RADIO_POWER_UNAVAILABLE;
+    }
+
+    /** @hide */
     @SystemApi
     @SuppressLint("Doclava125")
     public void updateServiceLocation() {
@@ -7340,7 +7437,9 @@
     @UnsupportedAppUsage
     public boolean isVolteAvailable() {
         try {
-            return getITelephony().isVolteAvailable(getSubId());
+            return getITelephony().isAvailable(getSubId(),
+                    MmTelFeature.MmTelCapabilities.CAPABILITY_TYPE_VOICE,
+                    ImsRegistrationImplBase.REGISTRATION_TECH_LTE, getOpPackageName());
         } catch (RemoteException | NullPointerException ex) {
             return false;
         }
@@ -7945,7 +8044,7 @@
      * either READ_PRIVILEGED_PHONE_STATE or READ_PHONE_STATE to retrieve the information.
      * @hide
      */
-    @UnsupportedAppUsage(maxTargetSdk = Build.VERSION_CODES.P)
+    @UnsupportedAppUsage
     public ServiceState getServiceStateForSubscriber(int subId) {
         try {
             ITelephony service = getITelephony();
@@ -8279,20 +8378,31 @@
     }
 
     /**
-     * Action set from carrier signalling broadcast receivers to enable/disable metered apns
-     * Permissions android.Manifest.permission.MODIFY_PHONE_STATE is required
-     * @param subId the subscription ID that this action applies to.
-     * @param enabled control enable or disable metered apns.
+     * Used to enable or disable carrier data by the system based on carrier signalling or
+     * carrier privileged apps. Different from {@link #setDataEnabled(boolean)} which is linked to
+     * user settings, carrier data on/off won't affect user settings but will bypass the
+     * settings and turns off data internally if set to {@code false}.
+     *
+     * <p>If this object has been created with {@link #createForSubscriptionId}, applies to the
+     * given subId. Otherwise, applies to {@link SubscriptionManager#getDefaultDataSubscriptionId()}
+     *
+     * <p>Requires Permission:
+     * {@link android.Manifest.permission#MODIFY_PHONE_STATE MODIFY_PHONE_STATE}.
+     *
+     * @param enabled control enable or disable carrier data.
      * @hide
      */
-    public void carrierActionSetMeteredApnsEnabled(int subId, boolean enabled) {
+    @SystemApi
+    @RequiresPermission(android.Manifest.permission.MODIFY_PHONE_STATE)
+    public void setCarrierDataEnabled(boolean enabled) {
         try {
             ITelephony service = getITelephony();
             if (service != null) {
-                service.carrierActionSetMeteredApnsEnabled(subId, enabled);
+                service.carrierActionSetMeteredApnsEnabled(
+                        getSubId(SubscriptionManager.getDefaultDataSubscriptionId()), enabled);
             }
         } catch (RemoteException e) {
-            Log.e(TAG, "Error calling ITelephony#carrierActionSetMeteredApnsEnabled", e);
+            Log.e(TAG, "Error calling ITelephony#setCarrierDataEnabled", e);
         }
     }
 
diff --git a/telephony/java/android/telephony/data/ApnSetting.java b/telephony/java/android/telephony/data/ApnSetting.java
index eb144f9..aabefe3 100644
--- a/telephony/java/android/telephony/data/ApnSetting.java
+++ b/telephony/java/android/telephony/data/ApnSetting.java
@@ -257,7 +257,7 @@
 
     private final int mProfileId;
 
-    private final boolean mModemCognitive;
+    private final boolean mPersistent;
     private final int mMaxConns;
     private final int mWaitTime;
     private final int mMaxConnsTime;
@@ -290,13 +290,13 @@
     }
 
     /**
-     * Returns if the APN setting is to be set in modem.
+     * Returns if the APN setting is persistent on the modem.
      *
      * @return is the APN setting to be set in modem
      * @hide
      */
-    public boolean getModemCognitive() {
-        return mModemCognitive;
+    public boolean isPersistent() {
+        return mPersistent;
     }
 
     /**
@@ -616,7 +616,7 @@
         this.mCarrierEnabled = builder.mCarrierEnabled;
         this.mNetworkTypeBitmask = builder.mNetworkTypeBitmask;
         this.mProfileId = builder.mProfileId;
-        this.mModemCognitive = builder.mModemCognitive;
+        this.mPersistent = builder.mModemCognitive;
         this.mMaxConns = builder.mMaxConns;
         this.mWaitTime = builder.mWaitTime;
         this.mMaxConnsTime = builder.mMaxConnsTime;
@@ -740,7 +740,7 @@
                 apn.mProxyAddress, apn.mProxyPort, apn.mMmsc, apn.mMmsProxyAddress,
                 apn.mMmsProxyPort, apn.mUser, apn.mPassword, apn.mAuthType, apn.mApnTypeBitmask,
                 apn.mProtocol, apn.mRoamingProtocol, apn.mCarrierEnabled, apn.mNetworkTypeBitmask,
-                apn.mProfileId, apn.mModemCognitive, apn.mMaxConns, apn.mWaitTime,
+                apn.mProfileId, apn.mPersistent, apn.mMaxConns, apn.mWaitTime,
                 apn.mMaxConnsTime, apn.mMtu, apn.mMvnoType, apn.mMvnoMatchData, apn.mApnSetId);
     }
 
@@ -947,7 +947,7 @@
         sb.append(", ").append(PROTOCOL_INT_MAP.get(mRoamingProtocol));
         sb.append(", ").append(mCarrierEnabled);
         sb.append(", ").append(mProfileId);
-        sb.append(", ").append(mModemCognitive);
+        sb.append(", ").append(mPersistent);
         sb.append(", ").append(mMaxConns);
         sb.append(", ").append(mWaitTime);
         sb.append(", ").append(mMaxConnsTime);
@@ -1029,7 +1029,7 @@
                 && Objects.equals(mMmsc, other.mMmsc)
                 && Objects.equals(mMmsProxyAddress, other.mMmsProxyAddress)
                 && Objects.equals(mMmsProxyPort, other.mMmsProxyPort)
-                && Objects.equals(mProxyPort,other.mProxyPort)
+                && Objects.equals(mProxyPort, other.mProxyPort)
                 && Objects.equals(mUser, other.mUser)
                 && Objects.equals(mPassword, other.mPassword)
                 && Objects.equals(mAuthType, other.mAuthType)
@@ -1038,7 +1038,7 @@
                 && Objects.equals(mRoamingProtocol, other.mRoamingProtocol)
                 && Objects.equals(mCarrierEnabled, other.mCarrierEnabled)
                 && Objects.equals(mProfileId, other.mProfileId)
-                && Objects.equals(mModemCognitive, other.mModemCognitive)
+                && Objects.equals(mPersistent, other.mPersistent)
                 && Objects.equals(mMaxConns, other.mMaxConns)
                 && Objects.equals(mWaitTime, other.mWaitTime)
                 && Objects.equals(mMaxConnsTime, other.mMaxConnsTime)
@@ -1080,11 +1080,11 @@
                 && Objects.equals(mPassword, other.mPassword)
                 && Objects.equals(mAuthType, other.mAuthType)
                 && Objects.equals(mApnTypeBitmask, other.mApnTypeBitmask)
-                && (isDataRoaming || Objects.equals(mProtocol,other.mProtocol))
+                && (isDataRoaming || Objects.equals(mProtocol, other.mProtocol))
                 && (!isDataRoaming || Objects.equals(mRoamingProtocol, other.mRoamingProtocol))
                 && Objects.equals(mCarrierEnabled, other.mCarrierEnabled)
                 && Objects.equals(mProfileId, other.mProfileId)
-                && Objects.equals(mModemCognitive, other.mModemCognitive)
+                && Objects.equals(mPersistent, other.mPersistent)
                 && Objects.equals(mMaxConns, other.mMaxConns)
                 && Objects.equals(mWaitTime, other.mWaitTime)
                 && Objects.equals(mMaxConnsTime, other.mMaxConnsTime)
diff --git a/telephony/java/android/telephony/data/DataProfile.java b/telephony/java/android/telephony/data/DataProfile.java
index e8597b2..da4822c 100644
--- a/telephony/java/android/telephony/data/DataProfile.java
+++ b/telephony/java/android/telephony/data/DataProfile.java
@@ -68,17 +68,15 @@
 
     private final int mMtu;
 
-    private final String mMvnoType;
+    private final boolean mPersistent;
 
-    private final String mMvnoMatchData;
+    private final boolean mPreferred;
 
-    private final boolean mModemCognitive;
-
-    public DataProfile(int profileId, String apn, String protocol, int authType,
-                String userName, String password, int type, int maxConnsTime, int maxConns,
-                int waitTime, boolean enabled, int supportedApnTypesBitmap, String roamingProtocol,
-                int bearerBitmap, int mtu, String mvnoType, String mvnoMatchData,
-                boolean modemCognitive) {
+    /** @hide */
+    public DataProfile(int profileId, String apn, String protocol, int authType, String userName,
+                       String password, int type, int maxConnsTime, int maxConns, int waitTime,
+                       boolean enabled, int supportedApnTypesBitmap, String roamingProtocol,
+                       int bearerBitmap, int mtu, boolean persistent, boolean preferred) {
 
         this.mProfileId = profileId;
         this.mApn = apn;
@@ -100,11 +98,11 @@
         this.mRoamingProtocol = roamingProtocol;
         this.mBearerBitmap = bearerBitmap;
         this.mMtu = mtu;
-        this.mMvnoType = mvnoType;
-        this.mMvnoMatchData = mvnoMatchData;
-        this.mModemCognitive = modemCognitive;
+        this.mPersistent = persistent;
+        this.mPreferred = preferred;
     }
 
+    /** @hide */
     public DataProfile(Parcel source) {
         mProfileId = source.readInt();
         mApn = source.readString();
@@ -121,9 +119,8 @@
         mRoamingProtocol = source.readString();
         mBearerBitmap = source.readInt();
         mMtu = source.readInt();
-        mMvnoType = source.readString();
-        mMvnoMatchData = source.readString();
-        mModemCognitive = source.readBoolean();
+        mPersistent = source.readBoolean();
+        mPreferred = source.readBoolean();
     }
 
     /**
@@ -207,23 +204,17 @@
     public int getMtu() { return mMtu; }
 
     /**
-     * @return The MVNO type: possible values are "imsi", "gid", "spn".
+     * @return {@code true} if modem must persist this data profile.
      */
-    public String getMvnoType() { return mMvnoType; }
+    public boolean isPersistent() { return mPersistent; }
 
     /**
-     * @return The MVNO match data. For example,
-     * SPN: A MOBILE, BEN NL, ...
-     * IMSI: 302720x94, 2060188, ...
-     * GID: 4E, 33, ...
+     * @return {@code true} if this data profile was used to bring up the last default
+     * (i.e internet) data connection successfully.
      */
-    public String getMvnoMatchData() { return mMvnoMatchData; }
+    public boolean isPreferred() { return  mPreferred; }
 
-    /**
-     * @return True if the data profile was sent to the modem through setDataProfile earlier.
-     */
-    public boolean isModemCognitive() { return mModemCognitive; }
-
+    /** @hide */
     @Override
     public int describeContents() {
         return 0;
@@ -233,11 +224,11 @@
     public String toString() {
         return "DataProfile=" + mProfileId + "/" + mProtocol + "/" + mAuthType
                 + "/" + (Build.IS_USER ? "***/***/***" :
-                         (mApn + "/" + mUserName + "/" + mPassword))
-                + "/" + mType + "/" + mMaxConnsTime
-                + "/" + mMaxConns + "/" + mWaitTime + "/" + mEnabled + "/"
-                + mSupportedApnTypesBitmap + "/" + mRoamingProtocol + "/" + mBearerBitmap + "/"
-                + mMtu + "/" + mMvnoType + "/" + mMvnoMatchData + "/" + mModemCognitive;
+                         (mApn + "/" + mUserName + "/" + mPassword)) + "/" + mType + "/"
+                + mMaxConnsTime + "/" + mMaxConns + "/"
+                + mWaitTime + "/" + mEnabled + "/" + mSupportedApnTypesBitmap + "/"
+                + mRoamingProtocol + "/" + mBearerBitmap + "/" + mMtu + "/" + mPersistent + "/"
+                + mPreferred;
     }
 
     @Override
@@ -246,6 +237,7 @@
         return (o == this || toString().equals(o.toString()));
     }
 
+    /** @hide */
     @Override
     public void writeToParcel(Parcel dest, int flags) {
         dest.writeInt(mProfileId);
@@ -263,11 +255,11 @@
         dest.writeString(mRoamingProtocol);
         dest.writeInt(mBearerBitmap);
         dest.writeInt(mMtu);
-        dest.writeString(mMvnoType);
-        dest.writeString(mMvnoMatchData);
-        dest.writeBoolean(mModemCognitive);
+        dest.writeBoolean(mPersistent);
+        dest.writeBoolean(mPreferred);
     }
 
+    /** @hide */
     public static final Parcelable.Creator<DataProfile> CREATOR =
             new Parcelable.Creator<DataProfile>() {
         @Override
diff --git a/telephony/java/android/telephony/emergency/EmergencyNumber.java b/telephony/java/android/telephony/emergency/EmergencyNumber.java
index d6a08543..bdba8c8 100644
--- a/telephony/java/android/telephony/emergency/EmergencyNumber.java
+++ b/telephony/java/android/telephony/emergency/EmergencyNumber.java
@@ -33,7 +33,7 @@
  * A parcelable class that wraps and retrieves the information of number, service category(s) and
  * country code for a specific emergency number.
  */
-public final class EmergencyNumber implements Parcelable {
+public final class EmergencyNumber implements Parcelable, Comparable<EmergencyNumber> {
 
     private static final String LOG_TAG = "EmergencyNumber";
 
@@ -235,20 +235,22 @@
     }
 
     /**
-     * Returns the bitmask of emergency service categories {@link EmergencyServiceCategories} of
-     * the emergency number.
+     * Returns the bitmask of emergency service categories of the emergency number.
      *
-     * @return bitmask of the emergency service categories {@link EmergencyServiceCategories}
+     * @return bitmask of the emergency service categories
      */
     public @EmergencyServiceCategories int getEmergencyServiceCategoryBitmask() {
         return mEmergencyServiceCategoryBitmask;
     }
 
     /**
-     * Returns the emergency service categories {@link EmergencyServiceCategories} of the emergency
-     * number.
+     * Returns the emergency service categories of the emergency number.
      *
-     * @return a list of the emergency service categories {@link EmergencyServiceCategories}
+     * Note: if the emergency number is in {@link #EMERGENCY_SERVICE_CATEGORY_UNSPECIFIED}, only
+     * {@link #EMERGENCY_SERVICE_CATEGORY_UNSPECIFIED} is returned and it means the number is in
+     * all categories.
+     *
+     * @return a list of the emergency service categories
      */
     public List<Integer> getEmergencyServiceCategories() {
         List<Integer> categories = new ArrayList<>();
@@ -276,34 +278,37 @@
     }
 
     /**
-     * Checks if the emergency number is in the specified emergency service category(s)
-     * {@link EmergencyServiceCategories}.
+     * Checks if the emergency number is in the supplied emergency service category(s).
+     *
+     * @param categories - the supplied emergency service categories
      *
      * @return {@code true} if the emergency number is in the specified emergency service
-     * category(s) {@link EmergencyServiceCategories}; {@code false} otherwise.
-     *
-     * @param categories - emergency service categories {@link EmergencyServiceCategories}
+     * category(s) or if its emergency service category is
+     * {@link #EMERGENCY_SERVICE_CATEGORY_UNSPECIFIED}; {@code false} otherwise.
      */
     public boolean isInEmergencyServiceCategories(@EmergencyServiceCategories int categories) {
         if (categories == EMERGENCY_SERVICE_CATEGORY_UNSPECIFIED) {
             return serviceUnspecified();
         }
+        if (serviceUnspecified()) {
+            return true;
+        }
         return (mEmergencyServiceCategoryBitmask & categories) == categories;
     }
 
     /**
-     * Returns the bitmask of the sources {@link EmergencyNumberSources} of the emergency number.
+     * Returns the bitmask of the sources of the emergency number.
      *
-     * @return bitmask of the emergency number sources {@link EmergencyNumberSources}
+     * @return bitmask of the emergency number sources
      */
     public @EmergencyNumberSources int getEmergencyNumberSourceBitmask() {
         return mEmergencyNumberSourceBitmask;
     }
 
     /**
-     * Returns a list of {@link EmergencyNumberSources} of the emergency number.
+     * Returns a list of sources of the emergency number.
      *
-     * @return a list of {@link EmergencyNumberSources}
+     * @return a list of emergency number sources
      */
     public List<Integer> getEmergencyNumberSources() {
         List<Integer> sources = new ArrayList<>();
@@ -316,13 +321,12 @@
     }
 
     /**
-     * Checks if the emergency number is from the specified emergency number source(s)
-     * {@link EmergencyNumberSources}.
+     * Checks if the emergency number is from the specified emergency number source(s).
      *
      * @return {@code true} if the emergency number is from the specified emergency number
-     * source(s) {@link EmergencyNumberSources}; {@code false} otherwise.
+     * source(s); {@code false} otherwise.
      *
-     * @param sources - {@link EmergencyNumberSources}
+     * @param sources - the supplied emergency number sources
      */
     public boolean isFromSources(@EmergencyNumberSources int sources) {
         return (mEmergencyNumberSourceBitmask & sources) == sources;
@@ -359,6 +363,62 @@
         return (o == this || toString().equals(o.toString()));
     }
 
+    /**
+     * Calculate the score for display priority.
+     *
+     * A higher display priority score means the emergency number has a higher display priority.
+     * The score is higher if the source is defined for a higher display priority.
+     *
+     * The priority of sources are defined as follows:
+     *     EMERGENCY_NUMBER_SOURCE_NETWORK_SIGNALING >
+     *     EMERGENCY_NUMBER_SOURCE_SIM >
+     *     EMERGENCY_NUMBER_SOURCE_DEFAULT >
+     *     EMERGENCY_NUMBER_SOURCE_MODEM_CONFIG
+     *
+     */
+    private int getDisplayPriorityScore() {
+        int score = 0;
+        if (this.isFromSources(EMERGENCY_NUMBER_SOURCE_NETWORK_SIGNALING)) {
+            score += 1 << 4;
+        }
+        if (this.isFromSources(EMERGENCY_NUMBER_SOURCE_SIM)) {
+            score += 1 << 3;
+        }
+        // TODO add a score if the number comes from Google's emergency number database
+        if (this.isFromSources(EMERGENCY_NUMBER_SOURCE_DEFAULT)) {
+            score += 1 << 1;
+        }
+        if (this.isFromSources(EMERGENCY_NUMBER_SOURCE_MODEM_CONFIG)) {
+            score += 1 << 0;
+        }
+        return score;
+    }
+
+    /**
+     * Compare the display priority for this emergency number and the supplied emergency number.
+     *
+     * @param emergencyNumber the supplied emergency number
+     * @return a negative value if the supplied emergency number has a lower display priority;
+     *         a positive value if the supplied emergency number has a higher display priority;
+     *         0 if both have equal display priority.
+     */
+    @Override
+    public int compareTo(EmergencyNumber emergencyNumber) {
+        if (this.getDisplayPriorityScore()
+                > emergencyNumber.getDisplayPriorityScore()) {
+            return -1;
+        } else if (this.getDisplayPriorityScore()
+                < emergencyNumber.getDisplayPriorityScore()) {
+            return 1;
+        } else {
+            /**
+             * TODO if both numbers have the same display priority score, the number matches the
+             * Google's emergency number database has a higher display priority.
+             */
+            return 0;
+        }
+    }
+
     public static final Parcelable.Creator<EmergencyNumber> CREATOR =
             new Parcelable.Creator<EmergencyNumber>() {
         @Override
diff --git a/telephony/java/android/telephony/ims/ImsExternalCallState.java b/telephony/java/android/telephony/ims/ImsExternalCallState.java
index 8d18ae8..f2d0cbf 100644
--- a/telephony/java/android/telephony/ims/ImsExternalCallState.java
+++ b/telephony/java/android/telephony/ims/ImsExternalCallState.java
@@ -16,22 +16,19 @@
 
 package android.telephony.ims;
 
+import android.annotation.IntDef;
 import android.annotation.SystemApi;
-import android.annotation.UnsupportedAppUsage;
 import android.net.Uri;
 import android.os.Parcel;
 import android.os.Parcelable;
 import android.telecom.Log;
 import android.telephony.Rlog;
 
-/*
- * This file contains all the api's through which
- * information received in Dialog Event Package can be
- * queried
- */
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
 
 /**
- * Parcelable object to handle MultiEndpoint Dialog Information
+ * Parcelable object to handle MultiEndpoint Dialog Event Package Information.
  * @hide
  */
 @SystemApi
@@ -40,8 +37,39 @@
     private static final String TAG = "ImsExternalCallState";
 
     // Dialog States
+    /**
+     * The external call is in the confirmed dialog state.
+     */
     public static final int CALL_STATE_CONFIRMED = 1;
+    /**
+     * The external call is in the terminated dialog state.
+     */
     public static final int CALL_STATE_TERMINATED = 2;
+
+    /**@hide*/
+    @IntDef(flag = true,
+            value = {
+                    CALL_STATE_CONFIRMED,
+                    CALL_STATE_TERMINATED
+            },
+            prefix = "CALL_STATE_")
+    @Retention(RetentionPolicy.SOURCE)
+    public @interface ExternalCallState {}
+
+    /**@hide*/
+    @IntDef(flag = true,
+            value = {
+                    ImsCallProfile.CALL_TYPE_VOICE,
+                    ImsCallProfile.CALL_TYPE_VT_TX,
+                    ImsCallProfile.CALL_TYPE_VT_RX,
+                    ImsCallProfile.CALL_TYPE_VT
+            },
+            prefix = "CALL_TYPE_")
+    @Retention(RetentionPolicy.SOURCE)
+    public @interface ExternalCallType {}
+
+
+
     // Dialog Id
     private int mCallId;
     // Number
@@ -58,10 +86,9 @@
     public ImsExternalCallState() {
     }
 
-    /** @hide */
-    @UnsupportedAppUsage
-    public ImsExternalCallState(int callId, Uri address, boolean isPullable, int callState,
-            int callType, boolean isCallheld) {
+    /**@hide*/
+    public ImsExternalCallState(int callId, Uri address, boolean isPullable,
+            @ExternalCallState int callState, int callType, boolean isCallheld) {
         mCallId = callId;
         mAddress = address;
         mIsPullable = isPullable;
@@ -71,9 +98,10 @@
         Rlog.d(TAG, "ImsExternalCallState = " + this);
     }
 
-    /** @hide */
+    /**@hide*/
     public ImsExternalCallState(int callId, Uri address, Uri localAddress,
-            boolean isPullable, int callState, int callType, boolean isCallheld) {
+            boolean isPullable, @ExternalCallState int callState, int callType,
+            boolean isCallheld) {
         mCallId = callId;
         mAddress = address;
         mLocalAddress = localAddress;
@@ -84,6 +112,31 @@
         Rlog.d(TAG, "ImsExternalCallState = " + this);
     }
 
+    /**
+     * Create a new ImsExternalCallState instance to contain Multiendpoint Dialog information.
+     * @param callId The unique ID of the call, which will be used to identify this external
+     *               connection.
+     * @param address A {@link Uri} containing the remote address of this external connection.
+     * @param localAddress A {@link Uri} containing the local address information.
+     * @param isPullable A flag determining if this external connection can be pulled to the current
+     *         device.
+     * @param callState The state of the external call.
+     * @param callType The type of external call.
+     * @param isCallheld A flag determining if the external connection is currently held.
+     */
+    public ImsExternalCallState(String callId, Uri address, Uri localAddress,
+            boolean isPullable, @ExternalCallState int callState, @ExternalCallType int callType,
+            boolean isCallheld) {
+        mCallId = getIdForString(callId);
+        mAddress = address;
+        mLocalAddress = localAddress;
+        mIsPullable = isPullable;
+        mCallState = callState;
+        mCallType = callType;
+        mIsHeld = isCallheld;
+        Rlog.d(TAG, "ImsExternalCallState = " + this);
+    }
+
     /** @hide */
     public ImsExternalCallState(Parcel in) {
         mCallId = in.readInt();
@@ -135,7 +188,9 @@
         return mAddress;
     }
 
-    /** @hide */
+    /**
+     * @return A {@link Uri} containing the local address from the Multiendpoint Dialog Information.
+     */
     public Uri getLocalAddress() {
         return mLocalAddress;
     }
@@ -144,11 +199,11 @@
         return mIsPullable;
     }
 
-    public int getCallState() {
+    public @ExternalCallState int getCallState() {
         return mCallState;
     }
 
-    public int getCallType() {
+    public @ExternalCallType int getCallType() {
         return mCallType;
     }
 
@@ -166,4 +221,15 @@
                 ", mCallType = " + mCallType +
                 ", mIsHeld = " + mIsHeld + "}";
     }
+
+    private int getIdForString(String idString) {
+        try {
+            return Integer.parseInt(idString);
+        } catch (NumberFormatException e) {
+            // In the case that there are alphanumeric characters, we will create a hash of the
+            // String value as a backup.
+            // TODO: Modify call IDs to use Strings as keys instead of integers in telephony/telecom
+            return idString.hashCode();
+        }
+    }
 }
diff --git a/telephony/java/android/telephony/ims/ImsMmTelManager.java b/telephony/java/android/telephony/ims/ImsMmTelManager.java
new file mode 100644
index 0000000..c9cf473
--- /dev/null
+++ b/telephony/java/android/telephony/ims/ImsMmTelManager.java
@@ -0,0 +1,760 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.telephony.ims;
+
+
+import android.Manifest;
+import android.annotation.CallbackExecutor;
+import android.annotation.IntDef;
+import android.annotation.NonNull;
+import android.annotation.RequiresPermission;
+import android.annotation.SystemApi;
+import android.content.Context;
+import android.net.Uri;
+import android.os.Binder;
+import android.os.RemoteException;
+import android.os.ServiceManager;
+import android.telephony.SubscriptionManager;
+import android.telephony.ims.aidl.IImsCapabilityCallback;
+import android.telephony.ims.aidl.IImsRegistrationCallback;
+import android.telephony.ims.feature.ImsFeature;
+import android.telephony.ims.feature.MmTelFeature;
+import android.telephony.ims.stub.ImsRegistrationImplBase;
+
+import com.android.internal.telephony.ITelephony;
+
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
+import java.util.concurrent.Executor;
+
+/**
+ * A manager for the MmTel (Multimedia Telephony) feature of an IMS network, given an associated
+ * subscription.
+ *
+ * Allows a user to query the IMS MmTel feature information for a subscription, register for
+ * registration and MmTel capability status callbacks, as well as query/modify user settings for the
+ * associated subscription.
+ *
+ * @see #createForSubscriptionId(Context, int)
+ * @hide
+ */
+public class ImsMmTelManager {
+
+    private static final String TAG = "ImsMmTelManager";
+
+    /**
+     * @hide
+     */
+    @Retention(RetentionPolicy.SOURCE)
+    @IntDef(prefix = "WIFI_MODE_", value = {
+            WIFI_MODE_WIFI_ONLY,
+            WIFI_MODE_CELLULAR_PREFERRED,
+            WIFI_MODE_WIFI_PREFERRED
+            })
+    public @interface WiFiCallingMode {}
+
+    /**
+     * Register for IMS over IWLAN if WiFi signal quality is high enough. Do not hand over to LTE
+     * registration if signal quality degrades.
+     * @hide
+     */
+    @SystemApi
+    public static final int WIFI_MODE_WIFI_ONLY = 0;
+
+    /**
+     * Prefer registering for IMS over LTE if LTE signal quality is high enough.
+     * @hide
+     */
+    @SystemApi
+    public static final int WIFI_MODE_CELLULAR_PREFERRED = 1;
+
+    /**
+     * Prefer registering for IMS over IWLAN if possible if WiFi signal quality is high enough.
+     * @hide
+     */
+    @SystemApi
+    public static final int WIFI_MODE_WIFI_PREFERRED = 2;
+
+    /**
+     * Callback class for receiving Registration callback events.
+     * @see #addImsRegistrationCallback(Executor, RegistrationCallback) (RegistrationCallback)
+     * @see #removeImsRegistrationCallback(RegistrationCallback)
+     */
+    public static class RegistrationCallback {
+
+        private static class RegistrationBinder extends IImsRegistrationCallback.Stub {
+
+            private final RegistrationCallback mLocalCallback;
+            private Executor mExecutor;
+
+            RegistrationBinder(RegistrationCallback localCallback) {
+                mLocalCallback = localCallback;
+            }
+
+            @Override
+            public void onRegistered(int imsRadioTech) {
+                if (mLocalCallback == null) return;
+
+                Binder.withCleanCallingIdentity(() ->
+                        mExecutor.execute(() -> mLocalCallback.onRegistered(imsRadioTech)));
+            }
+
+            @Override
+            public void onRegistering(int imsRadioTech) {
+                if (mLocalCallback == null) return;
+
+                Binder.withCleanCallingIdentity(() ->
+                        mExecutor.execute(() -> mLocalCallback.onRegistering(imsRadioTech)));
+            }
+
+            @Override
+            public void onDeregistered(ImsReasonInfo info) {
+                if (mLocalCallback == null) return;
+
+                Binder.withCleanCallingIdentity(() ->
+                        mExecutor.execute(() -> mLocalCallback.onDeregistered(info)));
+            }
+
+            @Override
+            public void onTechnologyChangeFailed(int imsRadioTech, ImsReasonInfo info) {
+                if (mLocalCallback == null) return;
+
+                Binder.withCleanCallingIdentity(() ->
+                        mExecutor.execute(() ->
+                                mLocalCallback.onTechnologyChangeFailed(imsRadioTech, info)));
+            }
+
+            @Override
+            public void onSubscriberAssociatedUriChanged(Uri[] uris) {
+                if (mLocalCallback == null) return;
+
+                Binder.withCleanCallingIdentity(() ->
+                        mExecutor.execute(() ->
+                                mLocalCallback.onSubscriberAssociatedUriChanged(uris)));
+            }
+
+            private void setExecutor(Executor executor) {
+                mExecutor = executor;
+            }
+        }
+
+        private final RegistrationBinder mBinder = new RegistrationBinder(this);
+
+        /**
+         * Notifies the framework when the IMS Provider is registered to the IMS network.
+         *
+         * @param imsRadioTech the radio access technology. Valid values are defined in
+         * {@link ImsRegistrationImplBase.ImsRegistrationTech}.
+         */
+        public void onRegistered(@ImsRegistrationImplBase.ImsRegistrationTech int imsRadioTech) {
+        }
+
+        /**
+         * Notifies the framework when the IMS Provider is trying to register the IMS network.
+         *
+         * @param imsRadioTech the radio access technology. Valid values are defined in
+         * {@link ImsRegistrationImplBase.ImsRegistrationTech}.
+         */
+        public void onRegistering(@ImsRegistrationImplBase.ImsRegistrationTech int imsRadioTech) {
+        }
+
+        /**
+         * Notifies the framework when the IMS Provider is deregistered from the IMS network.
+         *
+         * @param info the {@link ImsReasonInfo} associated with why registration was disconnected.
+         */
+        public void onDeregistered(ImsReasonInfo info) {
+        }
+
+        /**
+         * A failure has occurred when trying to handover registration to another technology type,
+         * defined in {@link ImsRegistrationImplBase.ImsRegistrationTech}
+         *
+         * @param imsRadioTech The {@link ImsRegistrationImplBase.ImsRegistrationTech} type that has
+         *         failed
+         * @param info A {@link ImsReasonInfo} that identifies the reason for failure.
+         */
+        public void onTechnologyChangeFailed(
+                @ImsRegistrationImplBase.ImsRegistrationTech int imsRadioTech, ImsReasonInfo info) {
+        }
+
+        /**
+         * Returns a list of subscriber {@link Uri}s associated with this IMS subscription when
+         * it changes. Per RFC3455, an associated URI is a URI that the service provider has
+         * allocated to a user for their own usage. A user's phone number is typically one of the
+         * associated URIs.
+         * @param uris new array of subscriber {@link Uri}s that are associated with this IMS
+         *         subscription.
+         * @hide
+         */
+        public void onSubscriberAssociatedUriChanged(Uri[] uris) {
+        }
+
+        /**@hide*/
+        public final IImsRegistrationCallback getBinder() {
+            return mBinder;
+        }
+
+        /**@hide*/
+        //Only exposed as public for compatibility with deprecated ImsManager APIs.
+        public void setExecutor(Executor executor) {
+            mBinder.setExecutor(executor);
+        }
+    }
+
+    /**
+     * Receives IMS capability status updates from the ImsService.
+     *
+     * @see #addMmTelCapabilityCallback(Executor, CapabilityCallback) (CapabilityCallback)
+     * @see #removeMmTelCapabilityCallback(CapabilityCallback)
+     */
+    public static class CapabilityCallback {
+
+        private static class CapabilityBinder extends IImsCapabilityCallback.Stub {
+
+            private final CapabilityCallback mLocalCallback;
+            private Executor mExecutor;
+
+            CapabilityBinder(CapabilityCallback c) {
+                mLocalCallback = c;
+            }
+
+            @Override
+            public void onCapabilitiesStatusChanged(int config) {
+                if (mLocalCallback == null) return;
+
+                Binder.withCleanCallingIdentity(() ->
+                        mExecutor.execute(() -> mLocalCallback.onCapabilitiesStatusChanged(
+                                new MmTelFeature.MmTelCapabilities(config))));
+            }
+
+            @Override
+            public void onQueryCapabilityConfiguration(int capability, int radioTech,
+                    boolean isEnabled) {
+                // This is not used for public interfaces.
+            }
+
+            @Override
+            public void onChangeCapabilityConfigurationError(int capability, int radioTech,
+                    @ImsFeature.ImsCapabilityError int reason) {
+                // This is not used for public interfaces
+            }
+
+            private void setExecutor(Executor executor) {
+                mExecutor = executor;
+            }
+        }
+
+        private final CapabilityBinder mBinder = new CapabilityBinder(this);
+
+        /**
+         * The status of the feature's capabilities has changed to either available or unavailable.
+         * If unavailable, the feature is not able to support the unavailable capability at this
+         * time.
+         *
+         * @param capabilities The new availability of the capabilities.
+         */
+        public void onCapabilitiesStatusChanged(
+                MmTelFeature.MmTelCapabilities capabilities) {
+        }
+
+        /**@hide*/
+        public final IImsCapabilityCallback getBinder() {
+            return mBinder;
+        }
+
+        /**@hide*/
+        // Only exposed as public method for compatibility with deprecated ImsManager APIs.
+        // TODO: clean up dependencies and change back to private visibility.
+        public void setExecutor(Executor executor) {
+            mBinder.setExecutor(executor);
+        }
+    }
+
+    private Context mContext;
+    private int mSubId;
+
+    /**
+     * Create an instance of ImsManager for the subscription id specified.
+     *
+     * @param context
+     * @param subId The ID of the subscription that this ImsManager will use.
+     * @see android.telephony.SubscriptionManager#getActiveSubscriptionInfoList()
+     * @throws IllegalArgumentException if the subscription is invalid or
+     *         the subscription ID is not an active subscription.
+     */
+    public static ImsMmTelManager createForSubscriptionId(Context context, int subId) {
+        if (!SubscriptionManager.isValidSubscriptionId(subId)
+                || !getSubscriptionManager(context).isActiveSubscriptionId(subId)) {
+            throw new IllegalArgumentException("Invalid subscription ID");
+        }
+
+        return new ImsMmTelManager(context, subId);
+    }
+
+    private ImsMmTelManager(Context context, int subId) {
+        mContext = context;
+        mSubId = subId;
+    }
+
+    /**
+     * Registers a {@link RegistrationCallback} with the system, which will provide registration
+     * updates for the subscription specified in {@link #createForSubscriptionId(Context, int)}. Use
+     * {@link SubscriptionManager.OnSubscriptionsChangedListener} to listen to Subscription changed
+     * events and call {@link #removeImsRegistrationCallback(RegistrationCallback)} to clean up
+     * after a subscription is removed.
+     * @param executor The executor the callback events should be run on.
+     * @param c The {@link RegistrationCallback} to be added.
+     * @see #removeImsRegistrationCallback(RegistrationCallback)
+     */
+    @RequiresPermission(Manifest.permission.READ_PHONE_STATE)
+    public void addImsRegistrationCallback(@CallbackExecutor Executor executor,
+            @NonNull RegistrationCallback c) {
+        if (c == null) {
+            throw new IllegalArgumentException("Must include a non-null RegistrationCallback.");
+        }
+        if (executor == null) {
+            throw new IllegalArgumentException("Must include a non-null Executor.");
+        }
+        c.setExecutor(executor);
+        try {
+            getITelephony().addImsRegistrationCallback(mSubId, c.getBinder(),
+                    mContext.getOpPackageName());
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Removes an existing {@link RegistrationCallback}. Ensure to call this method when cleaning
+     * up to avoid memory leaks or when the subscription is removed.
+     * @param c The {@link RegistrationCallback} to be removed.
+     * @see SubscriptionManager.OnSubscriptionsChangedListener
+     * @see #addImsRegistrationCallback(Executor, RegistrationCallback)
+     */
+    @RequiresPermission(Manifest.permission.READ_PHONE_STATE)
+    public void removeImsRegistrationCallback(@NonNull RegistrationCallback c) {
+        if (c == null) {
+            throw new IllegalArgumentException("Must include a non-null RegistrationCallback.");
+        }
+        try {
+            getITelephony().removeImsRegistrationCallback(mSubId, c.getBinder(),
+                    mContext.getOpPackageName());
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Registers a {@link CapabilityCallback} with the system, which will provide MmTel capability
+     * updates for the subscription specified in {@link #createForSubscriptionId(Context, int)}.
+     * Use {@link SubscriptionManager.OnSubscriptionsChangedListener} to listen to
+     * subscription changed events and call
+     * {@link #removeImsRegistrationCallback(RegistrationCallback)} to clean up after a subscription
+     * is removed.
+     * @param executor The executor the callback events should be run on.
+     * @param c The MmTel {@link CapabilityCallback} to be registered.
+     * @see #removeMmTelCapabilityCallback(CapabilityCallback)
+     */
+    @RequiresPermission(Manifest.permission.READ_PHONE_STATE)
+    public void addMmTelCapabilityCallback(@CallbackExecutor Executor executor,
+            @NonNull CapabilityCallback c) {
+        if (c == null) {
+            throw new IllegalArgumentException("Must include a non-null RegistrationCallback.");
+        }
+        if (executor == null) {
+            throw new IllegalArgumentException("Must include a non-null Executor.");
+        }
+        c.setExecutor(executor);
+        try {
+            getITelephony().addMmTelCapabilityCallback(mSubId, c.getBinder(),
+                    mContext.getOpPackageName());
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Removes an existing MmTel {@link CapabilityCallback}. Be sure to call this when cleaning
+     * up to avoid memory leaks.
+     * @param c The MmTel {@link CapabilityCallback} to be removed.
+     * @see #addMmTelCapabilityCallback(Executor, CapabilityCallback)
+     */
+    @RequiresPermission(Manifest.permission.READ_PHONE_STATE)
+    public void removeMmTelCapabilityCallback(@NonNull CapabilityCallback c) {
+        if (c == null) {
+            throw new IllegalArgumentException("Must include a non-null RegistrationCallback.");
+        }
+        try {
+            getITelephony().removeMmTelCapabilityCallback(mSubId, c.getBinder(),
+                    mContext.getOpPackageName());
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Query the user's setting for whether or not to use MmTel capabilities over IMS,
+     * such as voice and video, depending on carrier configuration for the current subscription.
+     * @see #setAdvancedCallingSetting(boolean)
+     * @return true if the user’s setting for advanced calling is enabled and false otherwise.
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
+    public boolean isAdvancedCallingSettingEnabled() {
+        try {
+            return getITelephony().isAdvancedCallingSettingEnabled(mSubId);
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Modify the user’s setting for “Advanced Calling” or "Enhanced 4G LTE", which is used to
+     * enable MmTel IMS features, such as voice and video calling, depending on the carrier
+     * configuration for the current subscription. Modifying this value may also trigger an IMS
+     * registration or deregistration, depending on the new value.
+     * @see #isAdvancedCallingEnabled()
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
+    public void setAdvancedCallingSetting(boolean isEnabled) {
+        try {
+            getITelephony().setAdvancedCallingSetting(mSubId, isEnabled);
+            return;
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Query the IMS MmTel capability for a given registration technology. This does not
+     * necessarily mean that we are registered and the capability is available, but rather the
+     * subscription is capable of this service over IMS.
+     *
+     * @see android.telephony.CarrierConfigManager#KEY_CARRIER_VOLTE_AVAILABLE_BOOL
+     * @see android.telephony.CarrierConfigManager#KEY_CARRIER_VT_AVAILABLE_BOOL
+     * @see android.telephony.CarrierConfigManager#KEY_CARRIER_IMS_GBA_REQUIRED_BOOL
+     * @see #isAvailable(int, int)
+     *
+     * @param imsRegTech The IMS registration technology, can be one of the following:
+     *         {@link ImsRegistrationImplBase#REGISTRATION_TECH_LTE},
+     *         {@link ImsRegistrationImplBase#REGISTRATION_TECH_IWLAN}
+     * @param capability The IMS MmTel capability to query, can be one of the following:
+     *         {@link MmTelFeature.MmTelCapabilities#CAPABILITY_TYPE_VOICE},
+     *         {@link MmTelFeature.MmTelCapabilities#CAPABILITY_TYPE_VIDEO,
+     *         {@link MmTelFeature.MmTelCapabilities#CAPABILITY_TYPE_UT},
+     *         {@link MmTelFeature.MmTelCapabilities#CAPABILITY_TYPE_SMS}
+     * @return {@code true} if the MmTel IMS capability is capable for this subscription, false
+     *         otherwise.
+     */
+    @RequiresPermission(Manifest.permission.READ_PHONE_STATE)
+    public boolean isCapable(@MmTelFeature.MmTelCapabilities.MmTelCapability int capability,
+            @ImsRegistrationImplBase.ImsRegistrationTech int imsRegTech) {
+        try {
+            return getITelephony().isCapable(mSubId, capability, imsRegTech,
+                    mContext.getOpPackageName());
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Query the availability of an IMS MmTel capability for a given registration technology. If
+     * a capability is available, IMS is registered and the service is currently available over IMS.
+     *
+     * @see #isCapable(int, int)
+     *
+     * @param imsRegTech The IMS registration technology, can be one of the following:
+     *         {@link ImsRegistrationImplBase#REGISTRATION_TECH_LTE},
+     *         {@link ImsRegistrationImplBase#REGISTRATION_TECH_IWLAN}
+     * @param capability The IMS MmTel capability to query, can be one of the following:
+     *         {@link MmTelFeature.MmTelCapabilities#CAPABILITY_TYPE_VOICE},
+     *         {@link MmTelFeature.MmTelCapabilities#CAPABILITY_TYPE_VIDEO,
+     *         {@link MmTelFeature.MmTelCapabilities#CAPABILITY_TYPE_UT},
+     *         {@link MmTelFeature.MmTelCapabilities#CAPABILITY_TYPE_SMS}
+     * @return {@code true} if the MmTel IMS capability is available for this subscription, false
+     *         otherwise.
+     */
+    @RequiresPermission(Manifest.permission.READ_PHONE_STATE)
+    public boolean isAvailable(@MmTelFeature.MmTelCapabilities.MmTelCapability int capability,
+            @ImsRegistrationImplBase.ImsRegistrationTech int imsRegTech) {
+        try {
+            return getITelephony().isAvailable(mSubId, capability, imsRegTech,
+                    mContext.getOpPackageName());
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * The user's setting for whether or not they have enabled the "Video Calling" setting.
+     * @return true if the user’s “Video Calling” setting is currently enabled.
+     * @see #setVtSetting(boolean)
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.READ_PHONE_STATE)
+    public boolean isVtSettingEnabled() {
+        try {
+            return getITelephony().isVtSettingEnabled(mSubId, mContext.getOpPackageName());
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Change the user's setting for Video Telephony and enable the Video Telephony capability.
+     * @see #isVtSettingEnabled()
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
+    public void setVtSetting(boolean isEnabled) {
+        try {
+            getITelephony().setVtSetting(mSubId, isEnabled);
+            return;
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * @return true if the user's setting for Voice over WiFi is enabled and false if it is not.
+     * @see #setVoWiFiSetting(boolean)
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
+    public boolean isVoWiFiSettingEnabled() {
+        try {
+            return getITelephony().isVoWiFiSettingEnabled(mSubId);
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Sets the user's setting for whether or not Voice over WiFi is enabled.
+     * @param isEnabled true if the user's setting for Voice over WiFi is enabled, false otherwise=
+     * @see #isVoWiFiSettingEnabled()
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
+    public void setVoWiFiSetting(boolean isEnabled) {
+        try {
+            getITelephony().setVoWiFiSetting(mSubId, isEnabled);
+            return;
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * @return true if the user's setting for Voice over WiFi while roaming is enabled, false
+     * if disabled.
+     * @see #setVoWiFiRoamingSetting(boolean)
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
+    public boolean isVoWiFiRoamingSettingEnabled() {
+        try {
+            return getITelephony().isVoWiFiRoamingSettingEnabled(mSubId);
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Change the user's setting for Voice over WiFi while roaming.
+     * @param isEnabled true if the user's setting for Voice over WiFi while roaming is enabled,
+     *     false otherwise.
+     * @see #isVoWiFiRoamingSettingEnabled()
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
+    public void setVoWiFiRoamingSetting(boolean isEnabled) {
+        try {
+            getITelephony().setVoWiFiRoamingSetting(mSubId, isEnabled);
+            return;
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Overrides the Voice over WiFi capability to true for IMS, but do not persist the setting.
+     * Typically used during the Voice over WiFi registration process for some carriers.
+     *
+     * @param isCapable true if the IMS stack should try to register for IMS over IWLAN, false
+     *     otherwise.
+     * @param mode the Voice over WiFi mode preference to set, which can be one of the following:
+     * - {@link #WIFI_MODE_WIFI_ONLY}
+     * - {@link #WIFI_MODE_CELLULAR_PREFERRED}
+     * - {@link #WIFI_MODE_WIFI_PREFERRED}
+     * @see #setVoWiFiSetting(boolean)
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
+    public void setVoWiFiNonPersistent(boolean isCapable, int mode) {
+        try {
+            getITelephony().setVoWiFiNonPersistent(mSubId, isCapable, mode);
+            return;
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * @return The Voice over WiFi Mode preference set by the user, which can be one of the
+     * following:
+     * - {@link #WIFI_MODE_WIFI_ONLY}
+     * - {@link #WIFI_MODE_CELLULAR_PREFERRED}
+     * - {@link #WIFI_MODE_WIFI_PREFERRED}
+     * @see #setVoWiFiSetting(boolean)
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
+    public @WiFiCallingMode int getVoWiFiModeSetting() {
+        try {
+            return getITelephony().getVoWiFiModeSetting(mSubId);
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Set the user's preference for Voice over WiFi calling mode.
+     * @param mode The user's preference for the technology to register for IMS over, can be one of
+     *    the following:
+     * - {@link #WIFI_MODE_WIFI_ONLY}
+     * - {@link #WIFI_MODE_CELLULAR_PREFERRED}
+     * - {@link #WIFI_MODE_WIFI_PREFERRED}
+     * @see #getVoWiFiModeSetting()
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
+    public void setVoWiFiModeSetting(@WiFiCallingMode int mode) {
+        try {
+            getITelephony().setVoWiFiModeSetting(mSubId, mode);
+            return;
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Set the user's preference for Voice over WiFi calling mode while the device is roaming on
+     * another network.
+     *
+     * @return The user's preference for the technology to register for IMS over when roaming on
+     *     another network, can be one of the following:
+     *     - {@link #WIFI_MODE_WIFI_ONLY}
+     *     - {@link #WIFI_MODE_CELLULAR_PREFERRED}
+     *     - {@link #WIFI_MODE_WIFI_PREFERRED}
+     * @see #setVoWiFiRoamingSetting(boolean)
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
+    @WiFiCallingMode int getVoWiFiRoamingModeSetting() {
+        try {
+            return getITelephony().getVoWiFiRoamingModeSetting(mSubId);
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Set the user's preference for Voice over WiFi mode while the device is roaming on another
+     * network.
+     *
+     * @param mode The user's preference for the technology to register for IMS over when roaming on
+     *     another network, can be one of the following:
+     *     - {@link #WIFI_MODE_WIFI_ONLY}
+     *     - {@link #WIFI_MODE_CELLULAR_PREFERRED}
+     *     - {@link #WIFI_MODE_WIFI_PREFERRED}
+     * @see #getVoWiFiRoamingModeSetting()
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
+    public void setVoWiFiRoamingModeSetting(@WiFiCallingMode int mode) {
+        try {
+            getITelephony().setVoWiFiRoamingModeSetting(mSubId, mode);
+            return;
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * Change the user's setting for RTT capability of this device.
+     * @param isEnabled if true RTT will be enabled during calls.
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.MODIFY_PHONE_STATE)
+    public void setRttCapabilitySetting(boolean isEnabled) {
+        try {
+            getITelephony().setRttCapabilitySetting(mSubId, isEnabled);
+            return;
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    /**
+     * @return true if TTY over VoLTE is supported
+     * @see android.telecom.TelecomManager#getCurrentTtyMode
+     * @see android.telephony.CarrierConfigManager#KEY_CARRIER_VOLTE_TTY_SUPPORTED_BOOL
+     * @hide
+     */
+    @SystemApi
+    @RequiresPermission(Manifest.permission.READ_PRIVILEGED_PHONE_STATE)
+    boolean isTtyOverVolteEnabled() {
+        try {
+            return getITelephony().isTtyOverVolteEnabled(mSubId);
+        } catch (RemoteException e) {
+            throw e.rethrowAsRuntimeException();
+        }
+    }
+
+    private static SubscriptionManager getSubscriptionManager(Context context) {
+        SubscriptionManager manager = context.getSystemService(SubscriptionManager.class);
+        if (manager == null) {
+            throw new RuntimeException("Could not find SubscriptionManager.");
+        }
+        return manager;
+    }
+
+    private static ITelephony getITelephony() {
+        ITelephony binder = ITelephony.Stub.asInterface(
+                ServiceManager.getService(Context.TELEPHONY_SERVICE));
+        if (binder == null) {
+            throw new RuntimeException("Could not find Telephony Service.");
+        }
+        return binder;
+    }
+}
diff --git a/telephony/java/android/telephony/ims/aidl/IImsRegistrationCallback.aidl b/telephony/java/android/telephony/ims/aidl/IImsRegistrationCallback.aidl
index 4f37caa..749b191 100644
--- a/telephony/java/android/telephony/ims/aidl/IImsRegistrationCallback.aidl
+++ b/telephony/java/android/telephony/ims/aidl/IImsRegistrationCallback.aidl
@@ -23,7 +23,7 @@
 import android.telephony.ims.ImsReasonInfo;
 
 /**
- * See ImsRegistrationImplBase.Callback for more information.
+ * See {@link ImsManager#RegistrationCallback} for more information.
  *
  * {@hide}
  */
diff --git a/telephony/java/android/telephony/ims/feature/ImsFeature.java b/telephony/java/android/telephony/ims/feature/ImsFeature.java
index b77881e..7f69f43 100644
--- a/telephony/java/android/telephony/ims/feature/ImsFeature.java
+++ b/telephony/java/android/telephony/ims/feature/ImsFeature.java
@@ -167,59 +167,6 @@
      */
     public static final int CAPABILITY_SUCCESS = 0;
 
-
-    /**
-     * The framework implements this callback in order to register for Feature Capability status
-     * updates, via {@link #onCapabilitiesStatusChanged(Capabilities)}, query Capability
-     * configurations, via {@link #onQueryCapabilityConfiguration}, as well as to receive error
-     * callbacks when the ImsService can not change the capability as requested, via
-     * {@link #onChangeCapabilityConfigurationError}.
-     *
-     * @hide
-     */
-    public static class CapabilityCallback extends IImsCapabilityCallback.Stub {
-
-        @Override
-        public final void onCapabilitiesStatusChanged(int config) throws RemoteException {
-            onCapabilitiesStatusChanged(new Capabilities(config));
-        }
-
-        /**
-         * Returns the result of a query for the capability configuration of a requested capability.
-         *
-         * @param capability The capability that was requested.
-         * @param radioTech The IMS radio technology associated with the capability.
-         * @param isEnabled true if the capability is enabled, false otherwise.
-         */
-        @Override
-        public void onQueryCapabilityConfiguration(int capability, int radioTech,
-                boolean isEnabled) {
-
-        }
-
-        /**
-         * Called when a change to the capability configuration has returned an error.
-         *
-         * @param capability The capability that was requested to be changed.
-         * @param radioTech The IMS radio technology associated with the capability.
-         * @param reason error associated with the failure to change configuration.
-         */
-        @Override
-        public void onChangeCapabilityConfigurationError(int capability, int radioTech,
-                @ImsCapabilityError int reason) {
-        }
-
-        /**
-         * The status of the feature's capabilities has changed to either available or unavailable.
-         * If unavailable, the feature is not able to support the unavailable capability at this
-         * time.
-         *
-         * @param config The new availability of the capabilities.
-         */
-        public void onCapabilitiesStatusChanged(Capabilities config) {
-        }
-    }
-
     /**
      * Used by the ImsFeature to call back to the CapabilityCallback that the framework has
      * provided.
diff --git a/telephony/java/android/telephony/ims/feature/MmTelFeature.java b/telephony/java/android/telephony/ims/feature/MmTelFeature.java
index 7681aef..96995943 100644
--- a/telephony/java/android/telephony/ims/feature/MmTelFeature.java
+++ b/telephony/java/android/telephony/ims/feature/MmTelFeature.java
@@ -17,6 +17,8 @@
 package android.telephony.ims.feature;
 
 import android.annotation.IntDef;
+import android.annotation.NonNull;
+import android.annotation.Nullable;
 import android.annotation.SystemApi;
 import android.os.Bundle;
 import android.os.Message;
@@ -222,21 +224,31 @@
      * This MmTelFeature can then return the status of each of these capabilities (enabled or not)
      * by sending a {@link #notifyCapabilitiesStatusChanged} callback to the framework. The current
      * status can also be queried using {@link #queryCapabilityStatus()}.
+     * @see #isCapable(int)
      */
     public static class MmTelCapabilities extends Capabilities {
 
         /**
-         * @hide
+         * Create a new empty {@link MmTelCapabilities} instance.
+         * @see #addCapabilities(int)
+         * @see #removeCapabilities(int)
          */
         @VisibleForTesting
         public MmTelCapabilities() {
             super();
         }
 
+        /**@deprecated Use {@link MmTelCapabilities} to construct a new instance instead.*/
+        @Deprecated
         public MmTelCapabilities(Capabilities c) {
             mCapabilities = c.mCapabilities;
         }
 
+        /**
+         * Create a new {link @MmTelCapabilities} instance with the provided capabilities.
+         * @param capabilities The capabilities that are supported for MmTel in the form of a
+         *                     bitfield.
+         */
         public MmTelCapabilities(int capabilities) {
             mCapabilities = capabilities;
         }
@@ -406,7 +418,10 @@
      * support the capability that is enabled. A capability that is disabled by the framework (via
      * {@link #changeEnabledCapabilities}) should also show the status as disabled.
      */
-    public final void notifyCapabilitiesStatusChanged(MmTelCapabilities c) {
+    public final void notifyCapabilitiesStatusChanged(@NonNull MmTelCapabilities c) {
+        if (c == null) {
+            throw new IllegalArgumentException("MmTelCapabilities must be non-null!");
+        }
         super.notifyCapabilitiesStatusChanged(c);
     }
 
@@ -414,7 +429,12 @@
      * Notify the framework of an incoming call.
      * @param c The {@link ImsCallSessionImplBase} of the new incoming call.
      */
-    public final void notifyIncomingCall(ImsCallSessionImplBase c, Bundle extras) {
+    public final void notifyIncomingCall(@NonNull ImsCallSessionImplBase c,
+            @NonNull Bundle extras) {
+        if (c == null || extras == null) {
+            throw new IllegalArgumentException("ImsCallSessionImplBase and Bundle can not be "
+                    + "null.");
+        }
         synchronized (mLock) {
             if (mListener == null) {
                 throw new IllegalStateException("Session is not available.");
@@ -434,7 +454,12 @@
      *        This can be null if no call information is available for the rejected call.
      * @param reason The {@link ImsReasonInfo} call rejection reason.
      */
-    public final void notifyRejectedCall(ImsCallProfile callProfile, ImsReasonInfo reason) {
+    public final void notifyRejectedCall(@NonNull ImsCallProfile callProfile,
+            @NonNull ImsReasonInfo reason) {
+        if (callProfile == null || reason == null) {
+            throw new IllegalArgumentException("ImsCallProfile and ImsReasonInfo must not be "
+                    + "null.");
+        }
         synchronized (mLock) {
             if (mListener == null) {
                 throw new IllegalStateException("Session is not available.");
@@ -508,8 +533,8 @@
      * the framework.
      */
     @Override
-    public void changeEnabledCapabilities(CapabilityChangeRequest request,
-            CapabilityCallbackProxy c) {
+    public void changeEnabledCapabilities(@NonNull CapabilityChangeRequest request,
+            @NonNull CapabilityCallbackProxy c) {
         // Base implementation, no-op
     }
 
@@ -531,7 +556,7 @@
      *        {@link ImsCallProfile#CALL_TYPE_VS_RX}
      * @return a {@link ImsCallProfile} object
      */
-    public ImsCallProfile createCallProfile(int callSessionType, int callType) {
+    public @Nullable ImsCallProfile createCallProfile(int callSessionType, int callType) {
         // Base Implementation - Should be overridden
         return null;
     }
@@ -552,7 +577,7 @@
      *
      * @param profile a call profile to make the call
      */
-    public ImsCallSessionImplBase createCallSession(ImsCallProfile profile) {
+    public @Nullable ImsCallSessionImplBase createCallSession(@NonNull ImsCallProfile profile) {
         // Base Implementation - Should be overridden
         return null;
     }
@@ -569,7 +594,7 @@
      * @return a {@link ProcessCallResult} to the framework, which will be used to determine if the
      *        call will be placed over IMS or via CSFB.
      */
-    public @ProcessCallResult int shouldProcessCall(String[] numbers) {
+    public @ProcessCallResult int shouldProcessCall(@NonNull String[] numbers) {
         return PROCESS_CALL_IMS;
     }
 
@@ -602,7 +627,7 @@
      * @return The {@link ImsUtImplBase} Ut interface implementation for the supplementary service
      * configuration.
      */
-    public ImsUtImplBase getUt() {
+    public @NonNull ImsUtImplBase getUt() {
         // Base Implementation - Should be overridden
         return new ImsUtImplBase();
     }
@@ -611,7 +636,7 @@
      * @return The {@link ImsEcbmImplBase} Emergency call-back mode interface for emergency VoLTE
      * calls that support it.
      */
-    public ImsEcbmImplBase getEcbm() {
+    public @NonNull ImsEcbmImplBase getEcbm() {
         // Base Implementation - Should be overridden
         return new ImsEcbmImplBase();
     }
@@ -620,7 +645,7 @@
      * @return The {@link ImsMultiEndpointImplBase} implementation for implementing Dialog event
      * package processing for multi-endpoint.
      */
-    public ImsMultiEndpointImplBase getMultiEndpoint() {
+    public @NonNull ImsMultiEndpointImplBase getMultiEndpoint() {
         // Base Implementation - Should be overridden
         return new ImsMultiEndpointImplBase();
     }
@@ -646,7 +671,7 @@
      *     }
      * }
      */
-    public void setUiTtyMode(int mode, Message onCompleteMessage) {
+    public void setUiTtyMode(int mode, @Nullable Message onCompleteMessage) {
         // Base Implementation - Should be overridden
     }
 
@@ -680,7 +705,7 @@
      * @return an instance of {@link ImsSmsImplBase} which should be implemented by the IMS
      * Provider.
      */
-    public ImsSmsImplBase getSmsImplementation() {
+    public @NonNull ImsSmsImplBase getSmsImplementation() {
         return new ImsSmsImplBase();
     }
 
diff --git a/telephony/java/android/telephony/ims/stub/ImsRegistrationImplBase.java b/telephony/java/android/telephony/ims/stub/ImsRegistrationImplBase.java
index cecf2e2..a08e031 100644
--- a/telephony/java/android/telephony/ims/stub/ImsRegistrationImplBase.java
+++ b/telephony/java/android/telephony/ims/stub/ImsRegistrationImplBase.java
@@ -76,64 +76,6 @@
     private static final int REGISTRATION_STATE_REGISTERING = 1;
     private static final int REGISTRATION_STATE_REGISTERED = 2;
 
-    /**
-     * Callback class for receiving Registration callback events.
-     * @hide
-     */
-    public static class Callback extends IImsRegistrationCallback.Stub {
-        /**
-         * Notifies the framework when the IMS Provider is connected to the IMS network.
-         *
-         * @param imsRadioTech the radio access technology. Valid values are defined in
-         * {@link ImsRegistrationTech}.
-         */
-        @Override
-        public void onRegistered(@ImsRegistrationTech int imsRadioTech) {
-        }
-
-        /**
-         * Notifies the framework when the IMS Provider is trying to connect the IMS network.
-         *
-         * @param imsRadioTech the radio access technology. Valid values are defined in
-         * {@link ImsRegistrationTech}.
-         */
-        @Override
-        public void onRegistering(@ImsRegistrationTech int imsRadioTech) {
-        }
-
-        /**
-         * Notifies the framework when the IMS Provider is disconnected from the IMS network.
-         *
-         * @param info the {@link ImsReasonInfo} associated with why registration was disconnected.
-         */
-        @Override
-        public void onDeregistered(ImsReasonInfo info) {
-        }
-
-        /**
-         * A failure has occurred when trying to handover registration to another technology type,
-         * defined in {@link ImsRegistrationTech}
-         *
-         * @param imsRadioTech The {@link ImsRegistrationTech} type that has failed
-         * @param info A {@link ImsReasonInfo} that identifies the reason for failure.
-         */
-        @Override
-        public void onTechnologyChangeFailed(@ImsRegistrationTech int imsRadioTech,
-                ImsReasonInfo info) {
-        }
-
-        /**
-         * Returns a list of subscriber {@link Uri}s associated with this IMS subscription when
-         * it changes.
-         * @param uris new array of subscriber {@link Uri}s that are associated with this IMS
-         *         subscription.
-         */
-        @Override
-        public void onSubscriberAssociatedUriChanged(Uri[] uris) {
-
-        }
-    }
-
     private final IImsRegistration mBinder = new IImsRegistration.Stub() {
 
         @Override
diff --git a/telephony/java/com/android/internal/telephony/DctConstants.java b/telephony/java/com/android/internal/telephony/DctConstants.java
index 86cb1b7..b0c875e 100644
--- a/telephony/java/com/android/internal/telephony/DctConstants.java
+++ b/telephony/java/com/android/internal/telephony/DctConstants.java
@@ -100,6 +100,7 @@
     public static final int EVENT_DATA_RECONNECT = BASE + 47;
     public static final int EVENT_ROAMING_SETTING_CHANGE = BASE + 48;
     public static final int EVENT_DATA_SERVICE_BINDING_CHANGED = BASE + 49;
+    public static final int EVENT_DEVICE_PROVISIONING_DATA_SETTING_CHANGE = BASE + 50;
 
     /***** Constants *****/
 
diff --git a/telephony/java/com/android/internal/telephony/IPhoneStateListener.aidl b/telephony/java/com/android/internal/telephony/IPhoneStateListener.aidl
index 38a1bc7..9e42f12 100644
--- a/telephony/java/com/android/internal/telephony/IPhoneStateListener.aidl
+++ b/telephony/java/com/android/internal/telephony/IPhoneStateListener.aidl
@@ -53,5 +53,6 @@
     void onUserMobileDataStateChanged(in boolean enabled);
     void onPhoneCapabilityChanged(in PhoneCapability capability);
     void onPreferredDataSubIdChanged(in int subId);
+    void onRadioPowerStateChanged(in int state);
 }
 
diff --git a/telephony/java/com/android/internal/telephony/IRcs.aidl b/telephony/java/com/android/internal/telephony/IRcs.aidl
new file mode 100644
index 0000000..ede8695
--- /dev/null
+++ b/telephony/java/com/android/internal/telephony/IRcs.aidl
@@ -0,0 +1,21 @@
+/*
+ * Copyright (C) 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.internal.telephony;
+
+interface IRcs {
+    void deleteThread(int threadId);
+}
\ No newline at end of file
diff --git a/telephony/java/com/android/internal/telephony/ITelephony.aidl b/telephony/java/com/android/internal/telephony/ITelephony.aidl
index 1087fce..dc23358 100644
--- a/telephony/java/com/android/internal/telephony/ITelephony.aidl
+++ b/telephony/java/com/android/internal/telephony/ITelephony.aidl
@@ -38,10 +38,12 @@
 import android.telephony.SignalStrength;
 import android.telephony.TelephonyHistogram;
 import android.telephony.VisualVoicemailSmsFilterSettings;
+import android.telephony.ims.aidl.IImsCapabilityCallback;
 import android.telephony.ims.aidl.IImsConfig;
 import android.telephony.ims.aidl.IImsMmTelFeature;
 import android.telephony.ims.aidl.IImsRcsFeature;
 import android.telephony.ims.aidl.IImsRegistration;
+import android.telephony.ims.aidl.IImsRegistrationCallback;
 import com.android.ims.internal.IImsServiceFeatureCallback;
 import com.android.internal.telephony.CellNetworkScanResult;
 import com.android.internal.telephony.OperatorInfo;
@@ -1057,11 +1059,6 @@
      */
     boolean isWifiCallingAvailable(int subId);
 
-    /**
-     * Returns the Status of VoLTE for the subscription ID specified.
-     */
-    boolean isVolteAvailable(int subId);
-
      /**
      * Returns the Status of VT (video telephony) for the subscription ID specified.
      */
@@ -1499,4 +1496,123 @@
      * Set the default SMS app to a given package on a given user.
      */
     void setDefaultSmsApp(int userId, String packageName);
+
+    /**
+     * Return the modem radio power state for slot index.
+     *
+     */
+    int getRadioPowerState(int slotIndex, String callingPackage);
+
+    // IMS specific AIDL commands, see ImsMmTelManager.java
+
+    /**
+     * Adds an IMS registration status callback for the subscription id specified.
+     */
+    oneway void addImsRegistrationCallback(int subId, IImsRegistrationCallback c,
+            String callingPackage);
+     /**
+      * Removes an existing IMS registration status callback for the subscription specified.
+      */
+    oneway void removeImsRegistrationCallback(int subId, IImsRegistrationCallback c,
+            String callingPackage);
+
+    /**
+     * Adds an IMS MmTel capabilities callback for the subscription specified.
+     */
+    oneway void addMmTelCapabilityCallback(int subId, IImsCapabilityCallback c,
+            String callingPackage);
+
+    /**
+     * Removes an existing IMS MmTel capabilities callback for the subscription specified.
+     */
+    oneway void removeMmTelCapabilityCallback(int subId, IImsCapabilityCallback c,
+            String callingPackage);
+
+    /**
+     * return true if the IMS MmTel capability for the given registration tech is capable.
+     */
+    boolean isCapable(int subId, int capability, int regTech, String callingPackage);
+
+    /**
+     * return true if the IMS MmTel capability for the given registration tech is available.
+     */
+    boolean isAvailable(int subId, int capability, int regTech, String callingPackage);
+
+    /**
+     * Returns true if the user's setting for 4G LTE is enabled, for the subscription specified.
+     */
+    boolean isAdvancedCallingSettingEnabled(int subId);
+
+    /**
+     * Modify the user's setting for whether or not 4G LTE is enabled.
+     */
+    void setAdvancedCallingSetting(int subId, boolean isEnabled);
+
+    /**
+     * return true if the user's setting for VT is enabled for the subscription.
+     */
+    boolean isVtSettingEnabled(int subId, String callingPackage);
+
+    /**
+     * Modify the user's setting for whether or not VT is available for the subscrption specified.
+     */
+    void setVtSetting(int subId, boolean isEnabled);
+
+    /**
+     * return true if the user's setting for whether or not Voice over WiFi is currently enabled.
+     */
+    boolean isVoWiFiSettingEnabled(int subId);
+
+    /**
+     * sets the user's setting for Voice over WiFi enabled state.
+     */
+    void setVoWiFiSetting(int subId, boolean isEnabled);
+
+    /**
+     * return true if the user's setting for Voice over WiFi while roaming is enabled.
+     */
+    boolean isVoWiFiRoamingSettingEnabled(int subId);
+
+    /**
+     * Sets the user's preference for whether or not Voice over WiFi is enabled for the current
+     * subscription while roaming.
+     */
+    void setVoWiFiRoamingSetting(int subId, boolean isEnabled);
+
+    /**
+     * Set the Voice over WiFi enabled state, but do not persist the setting.
+     */
+    void setVoWiFiNonPersistent(int subId, boolean isCapable, int mode);
+
+    /**
+     * return the Voice over WiFi mode preference set by the user for the subscription specified.
+     */
+    int getVoWiFiModeSetting(int subId);
+
+    /**
+     * sets the user's preference for the Voice over WiFi mode for the subscription specified.
+     */
+    void setVoWiFiModeSetting(int subId, int mode);
+
+    /**
+     * return the Voice over WiFi mode preference set by the user for the subscription specified
+     * while roaming.
+     */
+    int getVoWiFiRoamingModeSetting(int subId);
+
+    /**
+     * sets the user's preference for the Voice over WiFi mode for the subscription specified
+     * while roaming.
+     */
+    void setVoWiFiRoamingModeSetting(int subId, int mode);
+
+    /**
+     * Modify the user's setting for whether or not RTT is enabled for the subscrption specified.
+     */
+    void setRttCapabilitySetting(int subId, boolean isEnabled);
+
+    /**
+     * return true if TTY over VoLTE is enabled for the subscription specified.
+     */
+    boolean isTtyOverVolteEnabled(int subId);
 }
diff --git a/telephony/java/com/android/internal/telephony/ITelephonyRegistry.aidl b/telephony/java/com/android/internal/telephony/ITelephonyRegistry.aidl
index c03065c..0baf860 100644
--- a/telephony/java/com/android/internal/telephony/ITelephonyRegistry.aidl
+++ b/telephony/java/com/android/internal/telephony/ITelephonyRegistry.aidl
@@ -80,4 +80,5 @@
     void notifyUserMobileDataStateChangedForPhoneId(in int phoneId, in int subId, in boolean state);
     void notifyPhoneCapabilityChanged(in PhoneCapability capability);
     void notifyPreferredDataSubIdChanged(int preferredSubId);
+    void notifyRadioPowerStateChanged(in int state);
 }
diff --git a/telephony/java/com/android/internal/telephony/TelephonyPermissions.java b/telephony/java/com/android/internal/telephony/TelephonyPermissions.java
index 9730ebc..eda8e77 100644
--- a/telephony/java/com/android/internal/telephony/TelephonyPermissions.java
+++ b/telephony/java/com/android/internal/telephony/TelephonyPermissions.java
@@ -29,6 +29,7 @@
 import android.os.RemoteException;
 import android.os.ServiceManager;
 import android.os.UserHandle;
+import android.provider.Settings;
 import android.telephony.Rlog;
 import android.telephony.SubscriptionManager;
 import android.telephony.TelephonyManager;
@@ -44,10 +45,6 @@
 
     private static final boolean DBG = false;
 
-    // When set to true this flag will treat all apps that fail the device identifier check as
-    // though they are targeting pre-Q and return dummy data instead of throwing a SecurityException
-    private static final boolean RELAX_DEVICE_IDENTIFIER_CHECK = true;
-
     private static final Supplier<ITelephony> TELEPHONY_SUPPLIER = () ->
             ITelephony.Stub.asInterface(ServiceManager.getService(Context.TELEPHONY_SERVICE));
 
@@ -280,23 +277,29 @@
      */
     private static boolean reportAccessDeniedToReadIdentifiers(Context context, int subId, int pid,
             int uid, String callingPackage, String message) {
-        // if the device identifier check is relaxed then just return false to return dummy data to
-        // the caller instead of throwing a SecurityException for apps targeting Q+.
-        if (RELAX_DEVICE_IDENTIFIER_CHECK) {
-            Log.wtf(LOG_TAG,
-                    "reportAccessDeniedToReadIdentifiers:" + callingPackage + ":" + message);
-            return false;
+        Log.wtf(LOG_TAG,
+                "reportAccessDeniedToReadIdentifiers:" + callingPackage + ":" + message);
+        // if the device identifier check is relaxed then revert to the READ_PHONE_STATE permission
+        // check that was previously required to access device identifiers.
+        boolean relaxDeviceIdentifierCheck = Settings.Global.getInt(context.getContentResolver(),
+                Settings.Global.PRIVILEGED_DEVICE_IDENTIFIER_CHECK_ENABLED, 0) == 0;
+        if (relaxDeviceIdentifierCheck) {
+            return checkReadPhoneState(context, subId, pid, uid, callingPackage, message);
         } else {
+            boolean targetQBehaviorDisabled = Settings.Global.getInt(context.getContentResolver(),
+                    Settings.Global.PRIVILEGED_DEVICE_IDENTIFIER_TARGET_Q_BEHAVIOR_ENABLED, 0) == 0;
             if (callingPackage != null) {
                 try {
-                    // if the target SDK is pre-Q then check if the calling package would have
-                    // previously had access to device identifiers.
+                    // if the target SDK is pre-Q or the target Q behavior is disabled then check if
+                    // the calling package would have previously had access to device identifiers.
                     ApplicationInfo callingPackageInfo =
                             context.getPackageManager().getApplicationInfo(
                                     callingPackage, 0);
-                    if (callingPackageInfo != null
-                            && callingPackageInfo.targetSdkVersion < Build.VERSION_CODES.Q) {
-                        if (context.checkPermission(android.Manifest.permission.READ_PHONE_STATE,
+                    if (callingPackageInfo != null && (
+                            callingPackageInfo.targetSdkVersion < Build.VERSION_CODES.Q
+                                    || targetQBehaviorDisabled)) {
+                        if (context.checkPermission(
+                                android.Manifest.permission.READ_PHONE_STATE,
                                 pid,
                                 uid) == PackageManager.PERMISSION_GRANTED) {
                             return false;
@@ -312,8 +315,8 @@
                     // default to throwing the SecurityException.
                 }
             }
-            throw new SecurityException(message + ": The user " + uid + " does not have the "
-                    + "READ_PRIVILEGED_PHONE_STATE permission to access the device identifiers");
+            throw new SecurityException(message + ": The user " + uid
+                    + " does not meet the requirements to access device identifiers.");
         }
     }
 
diff --git a/tests/AppLaunch/src/com/android/tests/applaunch/AppLaunch.java b/tests/AppLaunch/src/com/android/tests/applaunch/AppLaunch.java
index 976848c..eed8ae7 100644
--- a/tests/AppLaunch/src/com/android/tests/applaunch/AppLaunch.java
+++ b/tests/AppLaunch/src/com/android/tests/applaunch/AppLaunch.java
@@ -92,7 +92,9 @@
             "com.google.android.wearable.action.GOOGLE";
     private static final int INITIAL_LAUNCH_IDLE_TIMEOUT = 5000; // 5s to allow app to idle
     private static final int POST_LAUNCH_IDLE_TIMEOUT = 750; // 750ms idle for non initial launches
-    private static final int BETWEEN_LAUNCH_SLEEP_TIMEOUT = 5000; // 5s between launching apps
+    private static final int BEFORE_FORCE_STOP_SLEEP_TIMEOUT = 1000; // 1s before force stopping
+    private static final int BEFORE_KILL_APP_SLEEP_TIMEOUT = 1000; // 1s before killing
+    private static final int BETWEEN_LAUNCH_SLEEP_TIMEOUT = 3000; // 3s between launching apps
     private static final int PROFILE_SAVE_SLEEP_TIMEOUT = 1000; // Allow 1s for the profile to save
     private static final String LAUNCH_SUB_DIRECTORY = "launch_logs";
     private static final String LAUNCH_FILE = "applaunch.txt";
@@ -327,7 +329,14 @@
                     }
                 }
                 if(mForceStopApp) {
-                    closeApp(launch.getApp());
+                    sleep(BEFORE_FORCE_STOP_SLEEP_TIMEOUT);
+                    forceStopApp(launch.getApp());
+                    sleep(BEFORE_KILL_APP_SLEEP_TIMEOUT);
+                    // Close again for good measure (just in case).
+                    forceStopApp(launch.getApp());
+                    // Kill the backgrounded process in the case forceStopApp only sent it to
+                    // background.
+                    killBackgroundApp(launch.getApp());
                 } else {
                     startHomeIntent();
                 }
@@ -638,7 +647,7 @@
         // Kill all the apps
         for (String appName : mNameToIntent.keySet()) {
             Log.w(TAG, String.format("killing %s", appName));
-            closeApp(appName);
+            forceStopApp(appName);
         }
         // Drop all the cache.
         assertNotNull("Issue in dropping the cache",
@@ -646,7 +655,7 @@
                         .executeShellCommand(DROP_CACHE_SCRIPT));
     }
 
-    private void closeApp(String appName) {
+    private void forceStopApp(String appName) {
         Intent startIntent = mNameToIntent.get(appName);
         if (startIntent != null) {
             String packageName = startIntent.getComponent().getPackageName();
@@ -658,6 +667,18 @@
         }
     }
 
+    private void killBackgroundApp(String appName) {
+        Intent startIntent = mNameToIntent.get(appName);
+        if (startIntent != null) {
+            String packageName = startIntent.getComponent().getPackageName();
+            try {
+                mAm.killBackgroundProcesses(packageName, UserHandle.USER_CURRENT);
+            } catch (RemoteException e) {
+                Log.w(TAG, "Error closing app", e);
+            }
+        }
+    }
+
     private void sleep(int time) {
         try {
             Thread.sleep(time);
diff --git a/tests/net/java/android/net/ConnectivityManagerTest.java b/tests/net/java/android/net/ConnectivityManagerTest.java
index 03a617c..6174c6c 100644
--- a/tests/net/java/android/net/ConnectivityManagerTest.java
+++ b/tests/net/java/android/net/ConnectivityManagerTest.java
@@ -219,7 +219,7 @@
         // callback triggers
         captor.getValue().send(makeMessage(request, ConnectivityManager.CALLBACK_AVAILABLE));
         verify(callback, timeout(500).times(1)).onAvailable(any(Network.class),
-                any(NetworkCapabilities.class), any(LinkProperties.class));
+                any(NetworkCapabilities.class), any(LinkProperties.class), anyBoolean());
 
         // unregister callback
         manager.unregisterNetworkCallback(callback);
@@ -247,7 +247,7 @@
         // callback triggers
         captor.getValue().send(makeMessage(req1, ConnectivityManager.CALLBACK_AVAILABLE));
         verify(callback, timeout(100).times(1)).onAvailable(any(Network.class),
-                any(NetworkCapabilities.class), any(LinkProperties.class));
+                any(NetworkCapabilities.class), any(LinkProperties.class), anyBoolean());
 
         // unregister callback
         manager.unregisterNetworkCallback(callback);
diff --git a/tests/net/java/com/android/server/ConnectivityServiceTest.java b/tests/net/java/com/android/server/ConnectivityServiceTest.java
index 1c77fcc..17bcea0 100644
--- a/tests/net/java/com/android/server/ConnectivityServiceTest.java
+++ b/tests/net/java/com/android/server/ConnectivityServiceTest.java
@@ -51,6 +51,10 @@
 import static android.net.NetworkCapabilities.TRANSPORT_VPN;
 import static android.net.NetworkCapabilities.TRANSPORT_WIFI;
 import static android.net.NetworkCapabilities.TRANSPORT_WIFI_AWARE;
+import static android.net.NetworkPolicyManager.RULE_ALLOW_METERED;
+import static android.net.NetworkPolicyManager.RULE_NONE;
+import static android.net.NetworkPolicyManager.RULE_REJECT_ALL;
+import static android.net.NetworkPolicyManager.RULE_REJECT_METERED;
 
 import static com.android.internal.util.TestUtils.waitForIdleHandler;
 import static com.android.internal.util.TestUtils.waitForIdleLooper;
@@ -92,6 +96,7 @@
 import android.net.ConnectivityManager.PacketKeepaliveCallback;
 import android.net.ConnectivityManager.TooManyRequestsException;
 import android.net.ConnectivityThread;
+import android.net.INetworkPolicyListener;
 import android.net.INetworkPolicyManager;
 import android.net.INetworkStatsService;
 import android.net.InterfaceConfiguration;
@@ -148,6 +153,7 @@
 import com.android.server.connectivity.Nat464Xlat;
 import com.android.server.connectivity.NetworkAgentInfo;
 import com.android.server.connectivity.NetworkMonitor;
+import com.android.server.connectivity.Tethering;
 import com.android.server.connectivity.Vpn;
 import com.android.server.net.NetworkPinner;
 import com.android.server.net.NetworkPolicyManagerInternal;
@@ -215,11 +221,13 @@
     private MockNetworkAgent mEthernetNetworkAgent;
     private MockVpn mMockVpn;
     private Context mContext;
+    private INetworkPolicyListener mPolicyListener;
 
     @Mock IpConnectivityMetrics.Logger mMetricsService;
     @Mock DefaultNetworkMetrics mDefaultNetworkMetrics;
     @Mock INetworkManagementService mNetworkManagementService;
     @Mock INetworkStatsService mStatsService;
+    @Mock INetworkPolicyManager mNpm;
 
     private ArgumentCaptor<String[]> mStringArrayCaptor = ArgumentCaptor.forClass(String[].class);
 
@@ -934,6 +942,11 @@
         }
 
         @Override
+        protected Tethering makeTethering() {
+            return mock(Tethering.class);
+        }
+
+        @Override
         protected int reserveNetId() {
             while (true) {
                 final int netId = super.reserveNetId();
@@ -1023,6 +1036,20 @@
         public void waitForIdle() {
             waitForIdle(TIMEOUT_MS);
         }
+
+        public void setUidRulesChanged(int uidRules) {
+            try {
+                mPolicyListener.onUidRulesChanged(Process.myUid(), uidRules);
+            } catch (RemoteException ignored) {
+            }
+        }
+
+        public void setRestrictBackgroundChanged(boolean restrictBackground) {
+            try {
+                mPolicyListener.onRestrictBackgroundChanged(restrictBackground);
+            } catch (RemoteException ignored) {
+            }
+        }
     }
 
     /**
@@ -1055,12 +1082,18 @@
         LocalServices.removeServiceForTest(NetworkPolicyManagerInternal.class);
         LocalServices.addService(
                 NetworkPolicyManagerInternal.class, mock(NetworkPolicyManagerInternal.class));
+
         mService = new WrappedConnectivityService(mServiceContext,
                 mNetworkManagementService,
                 mStatsService,
-                mock(INetworkPolicyManager.class),
+                mNpm,
                 mock(IpConnectivityLog.class));
 
+        final ArgumentCaptor<INetworkPolicyListener> policyListenerCaptor =
+                ArgumentCaptor.forClass(INetworkPolicyListener.class);
+        verify(mNpm).registerListener(policyListenerCaptor.capture());
+        mPolicyListener = policyListenerCaptor.getValue();
+
         // Create local CM before sending system ready so that we can answer
         // getSystemService() correctly.
         mCm = new WrappedConnectivityManager(InstrumentationRegistry.getContext(), mService);
@@ -1441,7 +1474,8 @@
         RESUMED,
         LOSING,
         LOST,
-        UNAVAILABLE
+        UNAVAILABLE,
+        BLOCKED_STATUS
     }
 
     private static class CallbackInfo {
@@ -1522,6 +1556,11 @@
             setLastCallback(CallbackState.LOST, network, null);
         }
 
+        @Override
+        public void onBlockedStatusChanged(Network network, boolean blocked) {
+            setLastCallback(CallbackState.BLOCKED_STATUS, network, blocked);
+        }
+
         public Network getLastAvailableNetwork() {
             return mLastAvailableNetwork;
         }
@@ -1582,6 +1621,7 @@
         // - onSuspended, iff the network was suspended when the callbacks fire.
         // - onCapabilitiesChanged.
         // - onLinkPropertiesChanged.
+        // - onBlockedStatusChanged.
         //
         // @param agent the network to expect the callbacks on.
         // @param expectSuspended whether to expect a SUSPENDED callback.
@@ -1589,7 +1629,7 @@
         //        onCapabilitiesChanged callback.
         // @param timeoutMs how long to wait for the callbacks.
         void expectAvailableCallbacks(MockNetworkAgent agent, boolean expectSuspended,
-                boolean expectValidated, int timeoutMs) {
+                boolean expectValidated, boolean expectBlocked, int timeoutMs) {
             expectCallback(CallbackState.AVAILABLE, agent, timeoutMs);
             if (expectSuspended) {
                 expectCallback(CallbackState.SUSPENDED, agent, timeoutMs);
@@ -1600,19 +1640,28 @@
                 expectCapabilitiesWithout(NET_CAPABILITY_VALIDATED, agent, timeoutMs);
             }
             expectCallback(CallbackState.LINK_PROPERTIES, agent, timeoutMs);
+            expectBlockedStatusCallback(expectBlocked, agent);
         }
 
         // Expects the available callbacks (validated), plus onSuspended.
         void expectAvailableAndSuspendedCallbacks(MockNetworkAgent agent, boolean expectValidated) {
-            expectAvailableCallbacks(agent, true, expectValidated, TEST_CALLBACK_TIMEOUT_MS);
+            expectAvailableCallbacks(agent, true, expectValidated, false, TEST_CALLBACK_TIMEOUT_MS);
         }
 
         void expectAvailableCallbacksValidated(MockNetworkAgent agent) {
-            expectAvailableCallbacks(agent, false, true, TEST_CALLBACK_TIMEOUT_MS);
+            expectAvailableCallbacks(agent, false, true, false, TEST_CALLBACK_TIMEOUT_MS);
+        }
+
+        void expectAvailableCallbacksValidatedAndBlocked(MockNetworkAgent agent) {
+            expectAvailableCallbacks(agent, false, true, true, TEST_CALLBACK_TIMEOUT_MS);
         }
 
         void expectAvailableCallbacksUnvalidated(MockNetworkAgent agent) {
-            expectAvailableCallbacks(agent, false, false, TEST_CALLBACK_TIMEOUT_MS);
+            expectAvailableCallbacks(agent, false, false, false, TEST_CALLBACK_TIMEOUT_MS);
+        }
+
+        void expectAvailableCallbacksUnvalidatedAndBlocked(MockNetworkAgent agent) {
+            expectAvailableCallbacks(agent, false, false, true, TEST_CALLBACK_TIMEOUT_MS);
         }
 
         // Expects the available callbacks (where the onCapabilitiesChanged must contain the
@@ -1623,6 +1672,9 @@
             expectCallback(CallbackState.AVAILABLE, agent, TEST_CALLBACK_TIMEOUT_MS);
             NetworkCapabilities nc1 = expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, agent);
             expectCallback(CallbackState.LINK_PROPERTIES, agent, TEST_CALLBACK_TIMEOUT_MS);
+            // Implicitly check the network is allowed to use.
+            // TODO: should we need to consider if network is in blocked status in this case?
+            expectBlockedStatusCallback(false, agent);
             NetworkCapabilities nc2 = expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, agent);
             assertEquals(nc1, nc2);
         }
@@ -1665,6 +1717,12 @@
                     fn.test((NetworkCapabilities) cbi.arg));
         }
 
+        void expectBlockedStatusCallback(boolean expectBlocked, MockNetworkAgent agent) {
+            CallbackInfo cbi = expectCallback(CallbackState.BLOCKED_STATUS, agent);
+            boolean actualBlocked = (boolean) cbi.arg;
+            assertEquals(expectBlocked, actualBlocked);
+        }
+
         void assertNoCallback() {
             waitForIdle();
             CallbackInfo c = mCallbacks.peek();
@@ -3223,7 +3281,7 @@
 
         mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
         mWiFiNetworkAgent.connect(false);
-        networkCallback.expectAvailableCallbacks(mWiFiNetworkAgent, false, false,
+        networkCallback.expectAvailableCallbacks(mWiFiNetworkAgent, false, false, false,
                 TEST_CALLBACK_TIMEOUT_MS);
 
         // pass timeout and validate that UNAVAILABLE is not called
@@ -3243,7 +3301,7 @@
 
         mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
         mWiFiNetworkAgent.connect(false);
-        networkCallback.expectAvailableCallbacks(mWiFiNetworkAgent, false, false,
+        networkCallback.expectAvailableCallbacks(mWiFiNetworkAgent, false, false, false,
                 TEST_CALLBACK_TIMEOUT_MS);
         mWiFiNetworkAgent.disconnect();
         networkCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
@@ -3802,6 +3860,7 @@
         networkCallback.expectCallback(CallbackState.NETWORK_CAPABILITIES, networkAgent);
         CallbackInfo cbi = networkCallback.expectCallback(CallbackState.LINK_PROPERTIES,
                 networkAgent);
+        networkCallback.expectCallback(CallbackState.BLOCKED_STATUS, networkAgent);
         networkCallback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, networkAgent);
         networkCallback.assertNoCallback();
         checkDirectlyConnectedRoutes(cbi.arg, Arrays.asList(myIpv4Address),
@@ -4010,6 +4069,7 @@
                 mCellNetworkAgent);
         CallbackInfo cbi = cellNetworkCallback.expectCallback(
                 CallbackState.LINK_PROPERTIES, mCellNetworkAgent);
+        cellNetworkCallback.expectCallback(CallbackState.BLOCKED_STATUS, mCellNetworkAgent);
         cellNetworkCallback.assertNoCallback();
         assertFalse(((LinkProperties)cbi.arg).isPrivateDnsActive());
         assertNull(((LinkProperties)cbi.arg).getPrivateDnsServerName());
@@ -4068,6 +4128,7 @@
                 mCellNetworkAgent);
         CallbackInfo cbi = cellNetworkCallback.expectCallback(
                 CallbackState.LINK_PROPERTIES, mCellNetworkAgent);
+        cellNetworkCallback.expectCallback(CallbackState.BLOCKED_STATUS, mCellNetworkAgent);
         cellNetworkCallback.assertNoCallback();
         assertFalse(((LinkProperties)cbi.arg).isPrivateDnsActive());
         assertNull(((LinkProperties)cbi.arg).getPrivateDnsServerName());
@@ -4444,6 +4505,101 @@
         mMockVpn.disconnect();
     }
 
+    @Test
+    public void testNetworkBlockedStatus() {
+        final TestNetworkCallback cellNetworkCallback = new TestNetworkCallback();
+        final NetworkRequest cellRequest = new NetworkRequest.Builder()
+                .addTransportType(TRANSPORT_CELLULAR)
+                .build();
+        mCm.registerNetworkCallback(cellRequest, cellNetworkCallback);
+
+        mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
+        mCellNetworkAgent.connect(true);
+        cellNetworkCallback.expectAvailableThenValidatedCallbacks(mCellNetworkAgent);
+
+        mService.setUidRulesChanged(RULE_REJECT_ALL);
+        cellNetworkCallback.expectBlockedStatusCallback(true, mCellNetworkAgent);
+
+        // ConnectivityService should cache it not to invoke the callback again.
+        mService.setUidRulesChanged(RULE_REJECT_METERED);
+        cellNetworkCallback.assertNoCallback();
+
+        mService.setUidRulesChanged(RULE_NONE);
+        cellNetworkCallback.expectBlockedStatusCallback(false, mCellNetworkAgent);
+
+        mService.setUidRulesChanged(RULE_REJECT_METERED);
+        cellNetworkCallback.expectBlockedStatusCallback(true, mCellNetworkAgent);
+
+        // Restrict the network based on UID rule and NOT_METERED capability change.
+        mCellNetworkAgent.addCapability(NET_CAPABILITY_NOT_METERED);
+        cellNetworkCallback.expectCapabilitiesWith(NET_CAPABILITY_NOT_METERED, mCellNetworkAgent);
+        cellNetworkCallback.expectBlockedStatusCallback(false, mCellNetworkAgent);
+        mCellNetworkAgent.removeCapability(NET_CAPABILITY_NOT_METERED);
+        cellNetworkCallback.expectCapabilitiesWithout(NET_CAPABILITY_NOT_METERED,
+                mCellNetworkAgent);
+        cellNetworkCallback.expectBlockedStatusCallback(true, mCellNetworkAgent);
+        mService.setUidRulesChanged(RULE_ALLOW_METERED);
+        cellNetworkCallback.expectBlockedStatusCallback(false, mCellNetworkAgent);
+
+        mService.setUidRulesChanged(RULE_NONE);
+        cellNetworkCallback.assertNoCallback();
+
+        // Restrict the network based on BackgroundRestricted.
+        mService.setRestrictBackgroundChanged(true);
+        cellNetworkCallback.expectBlockedStatusCallback(true, mCellNetworkAgent);
+        mService.setRestrictBackgroundChanged(true);
+        cellNetworkCallback.assertNoCallback();
+        mService.setRestrictBackgroundChanged(false);
+        cellNetworkCallback.expectBlockedStatusCallback(false, mCellNetworkAgent);
+        cellNetworkCallback.assertNoCallback();
+
+        mCm.unregisterNetworkCallback(cellNetworkCallback);
+    }
+
+    @Test
+    public void testNetworkBlockedStatusBeforeAndAfterConnect() {
+        final TestNetworkCallback defaultCallback = new TestNetworkCallback();
+        mCm.registerDefaultNetworkCallback(defaultCallback);
+
+        // No Networkcallbacks invoked before any network is active.
+        mService.setUidRulesChanged(RULE_REJECT_ALL);
+        mService.setUidRulesChanged(RULE_NONE);
+        mService.setUidRulesChanged(RULE_REJECT_METERED);
+        defaultCallback.assertNoCallback();
+
+        mCellNetworkAgent = new MockNetworkAgent(TRANSPORT_CELLULAR);
+        mCellNetworkAgent.connect(true);
+        defaultCallback.expectAvailableCallbacksUnvalidatedAndBlocked(mCellNetworkAgent);
+        defaultCallback.expectCapabilitiesWith(NET_CAPABILITY_VALIDATED, mCellNetworkAgent);
+
+        // Allow to use the network after switching to NOT_METERED network.
+        mWiFiNetworkAgent = new MockNetworkAgent(TRANSPORT_WIFI);
+        mWiFiNetworkAgent.addCapability(NET_CAPABILITY_NOT_METERED);
+        mWiFiNetworkAgent.connect(true);
+        defaultCallback.expectAvailableDoubleValidatedCallbacks(mWiFiNetworkAgent);
+
+        // Switch to METERED network. Restrict the use of the network.
+        mWiFiNetworkAgent.disconnect();
+        defaultCallback.expectCallback(CallbackState.LOST, mWiFiNetworkAgent);
+        defaultCallback.expectAvailableCallbacksValidatedAndBlocked(mCellNetworkAgent);
+
+        // Network becomes NOT_METERED.
+        mCellNetworkAgent.addCapability(NET_CAPABILITY_NOT_METERED);
+        defaultCallback.expectCapabilitiesWith(NET_CAPABILITY_NOT_METERED, mCellNetworkAgent);
+        defaultCallback.expectBlockedStatusCallback(false, mCellNetworkAgent);
+
+        // Verify there's no Networkcallbacks invoked after data saver on/off.
+        mService.setRestrictBackgroundChanged(true);
+        mService.setRestrictBackgroundChanged(false);
+        defaultCallback.assertNoCallback();
+
+        mCellNetworkAgent.disconnect();
+        defaultCallback.expectCallback(CallbackState.LOST, mCellNetworkAgent);
+        defaultCallback.assertNoCallback();
+
+        mCm.unregisterNetworkCallback(defaultCallback);
+    }
+
     /**
      * Make simulated InterfaceConfig for Nat464Xlat to query clat lower layer info.
      */
diff --git a/tools/aapt2/Android.mk b/tools/aapt2/Android.mk
index c9987b8..b165c6b 100644
--- a/tools/aapt2/Android.mk
+++ b/tools/aapt2/Android.mk
@@ -2,10 +2,19 @@
 
 include $(CLEAR_VARS)
 
+aapt2_results := $(call intermediates-dir-for,PACKAGING,aapt2_run_host_unit_tests)/result.xml
+
 # Target for running host unit tests on post/pre-submit.
 .PHONY: aapt2_run_host_unit_tests
-aapt2_run_host_unit_tests: PRIVATE_GTEST_OPTIONS := --gtest_output=xml:$(DIST_DIR)/gtest/aapt2_host_unit_tests_result.xml
-aapt2_run_host_unit_tests: $(HOST_OUT_NATIVE_TESTS)/aapt2_tests/aapt2_tests
-	-$(HOST_OUT_NATIVE_TESTS)/aapt2_tests/aapt2_tests $(PRIVATE_GTEST_OPTIONS) > /dev/null 2>&1
+aapt2_run_host_unit_tests: $(aapt2_results)
+
+$(call dist-for-goals,aapt2_run_host_unit_tests,$(aapt2_results):gtest/aapt2_host_unit_tests_result.xml)
+
+# Always run the tests again, even if they haven't changed
+$(aapt2_results): .KATI_IMPLICIT_OUTPUTS := $(aapt2_results)-nocache
+$(aapt2_results): $(HOST_OUT_NATIVE_TESTS)/aapt2_tests/aapt2_tests
+	-$(HOST_OUT_NATIVE_TESTS)/aapt2_tests/aapt2_tests --gtest_output=xml:$@ > /dev/null 2>&1
+
+aapt2_results :=
 
 include $(call all-makefiles-under,$(LOCAL_PATH))
diff --git a/tools/aapt2/LoadedApk.cpp b/tools/aapt2/LoadedApk.cpp
index a20b9b7..b353ff0 100644
--- a/tools/aapt2/LoadedApk.cpp
+++ b/tools/aapt2/LoadedApk.cpp
@@ -35,6 +35,43 @@
 
 namespace aapt {
 
+static ApkFormat DetermineApkFormat(io::IFileCollection* apk) {
+  if (apk->FindFile(kApkResourceTablePath) != nullptr) {
+    return ApkFormat::kBinary;
+  } else if (apk->FindFile(kProtoResourceTablePath) != nullptr) {
+    return ApkFormat::kProto;
+  } else {
+    // If the resource table is not present, attempt to read the manifest.
+    io::IFile* manifest_file = apk->FindFile(kAndroidManifestPath);
+    if (manifest_file == nullptr) {
+      return ApkFormat::kUnknown;
+    }
+
+    // First try in proto format.
+    std::unique_ptr<io::InputStream> manifest_in = manifest_file->OpenInputStream();
+    if (manifest_in != nullptr) {
+      pb::XmlNode pb_node;
+      io::ProtoInputStreamReader proto_reader(manifest_in.get());
+      if (proto_reader.ReadMessage(&pb_node)) {
+        return ApkFormat::kProto;
+      }
+    }
+
+    // If it didn't work, try in binary format.
+    std::unique_ptr<io::IData> manifest_data = manifest_file->OpenAsData();
+    if (manifest_data != nullptr) {
+      std::string error;
+      std::unique_ptr<xml::XmlResource> manifest =
+          xml::Inflate(manifest_data->data(), manifest_data->size(), &error);
+      if (manifest != nullptr) {
+        return ApkFormat::kBinary;
+      }
+    }
+
+    return ApkFormat::kUnknown;
+  }
+}
+
 std::unique_ptr<LoadedApk> LoadedApk::LoadApkFromPath(const StringPiece& path, IDiagnostics* diag) {
   Source source(path);
   std::string error;
@@ -301,41 +338,4 @@
   return doc;
 }
 
-ApkFormat LoadedApk::DetermineApkFormat(io::IFileCollection* apk) {
-  if (apk->FindFile(kApkResourceTablePath) != nullptr) {
-    return ApkFormat::kBinary;
-  } else if (apk->FindFile(kProtoResourceTablePath) != nullptr) {
-    return ApkFormat::kProto;
-  } else {
-    // If the resource table is not present, attempt to read the manifest.
-    io::IFile* manifest_file = apk->FindFile(kAndroidManifestPath);
-    if (manifest_file == nullptr) {
-      return ApkFormat::kUnknown;
-    }
-
-    // First try in proto format.
-    std::unique_ptr<io::InputStream> manifest_in = manifest_file->OpenInputStream();
-    if (manifest_in != nullptr) {
-      pb::XmlNode pb_node;
-      io::ProtoInputStreamReader proto_reader(manifest_in.get());
-      if (!proto_reader.ReadMessage(&pb_node)) {
-        return ApkFormat::kProto;
-      }
-    }
-
-    // If it didn't work, try in binary format.
-    std::unique_ptr<io::IData> manifest_data = manifest_file->OpenAsData();
-    if (manifest_data != nullptr) {
-      std::string error;
-      std::unique_ptr<xml::XmlResource> manifest =
-          xml::Inflate(manifest_data->data(), manifest_data->size(), &error);
-      if (manifest != nullptr) {
-        return ApkFormat::kBinary;
-      }
-    }
-
-    return ApkFormat::kUnknown;
-  }
-}
-
 }  // namespace aapt
diff --git a/tools/aapt2/LoadedApk.h b/tools/aapt2/LoadedApk.h
index 84c57c1..5b6f45e 100644
--- a/tools/aapt2/LoadedApk.h
+++ b/tools/aapt2/LoadedApk.h
@@ -121,8 +121,6 @@
   std::unique_ptr<ResourceTable> table_;
   std::unique_ptr<xml::XmlResource> manifest_;
   ApkFormat format_;
-
-  static ApkFormat DetermineApkFormat(io::IFileCollection* apk);
 };
 
 }  // namespace aapt
diff --git a/tools/hiddenapi/merge_csv.py b/tools/hiddenapi/merge_csv.py
new file mode 100755
index 0000000..48c0755
--- /dev/null
+++ b/tools/hiddenapi/merge_csv.py
@@ -0,0 +1,40 @@
+#!/usr/bin/env python
+#
+# Copyright (C) 2018 The Android Open Source Project
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+Merge mutliple CSV files, possibly with different columns, writing to stdout.
+"""
+
+import csv
+import sys
+
+csv_readers = [
+    csv.DictReader(open(csv_file, 'rb'), delimiter=',', quotechar='|')
+    for csv_file in sys.argv[1:]
+]
+
+# Build union of all columns from source files:
+headers = set()
+for reader in csv_readers:
+  headers = headers.union(reader.fieldnames)
+
+# Concatenate all files to output:
+out = csv.DictWriter(sys.stdout, delimiter=',', quotechar='|', fieldnames = sorted(headers))
+out.writeheader()
+for reader in csv_readers:
+  for row in reader:
+    out.writerow(row)
+
+