| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % EEEEE N N H H AAA N N CCCC EEEEE % |
| % E NN N H H A A NN N C E % |
| % EEE N N N HHHHH AAAAA N N N C EEE % |
| % E N NN H H A A N NN C E % |
| % EEEEE N N H H A A N N CCCC EEEEE % |
| % % |
| % % |
| % MagickCore Image Enhancement Methods % |
| % % |
| % Software Design % |
| % John Cristy % |
| % July 1992 % |
| % % |
| % % |
| % Copyright 1999-2010 ImageMagick Studio LLC, a non-profit organization % |
| % dedicated to making software imaging solutions freely available. % |
| % % |
| % You may not use this file except in compliance with the License. You may % |
| % obtain a copy of the License at % |
| % % |
| % http://www.imagemagick.org/script/license.php % |
| % % |
| % Unless required by applicable law or agreed to in writing, software % |
| % distributed under the License is distributed on an "AS IS" BASIS, % |
| % WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. % |
| % See the License for the specific language governing permissions and % |
| % limitations under the License. % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % |
| % |
| */ |
| |
| /* |
| Include declarations. |
| */ |
| #include "magick/studio.h" |
| #include "magick/artifact.h" |
| #include "magick/cache.h" |
| #include "magick/cache-view.h" |
| #include "magick/color.h" |
| #include "magick/color-private.h" |
| #include "magick/colorspace.h" |
| #include "magick/composite-private.h" |
| #include "magick/enhance.h" |
| #include "magick/exception.h" |
| #include "magick/exception-private.h" |
| #include "magick/fx.h" |
| #include "magick/gem.h" |
| #include "magick/geometry.h" |
| #include "magick/histogram.h" |
| #include "magick/image.h" |
| #include "magick/image-private.h" |
| #include "magick/memory_.h" |
| #include "magick/monitor.h" |
| #include "magick/monitor-private.h" |
| #include "magick/option.h" |
| #include "magick/quantum.h" |
| #include "magick/quantum-private.h" |
| #include "magick/resample.h" |
| #include "magick/resample-private.h" |
| #include "magick/statistic.h" |
| #include "magick/string_.h" |
| #include "magick/string-private.h" |
| #include "magick/thread-private.h" |
| #include "magick/token.h" |
| #include "magick/xml-tree.h" |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % A u t o G a m m a I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % AutoGammaImage() extract the 'mean' from the image and adjust the image |
| % to try make set its gamma appropriatally. |
| % |
| % The format of the AutoGammaImage method is: |
| % |
| % MagickBooleanType AutoGammaImage(Image *image) |
| % MagickBooleanType AutoGammaImageChannel(Image *image, |
| % const ChannelType channel) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: The image to auto-level |
| % |
| % o channel: The channels to auto-level. If the special 'SyncChannels' |
| % flag is set all given channels is adjusted in the same way using the |
| % mean average of those channels. |
| % |
| */ |
| |
| MagickExport MagickBooleanType AutoGammaImage(Image *image) |
| { |
| return(AutoGammaImageChannel(image,DefaultChannels)); |
| } |
| |
| MagickExport MagickBooleanType AutoGammaImageChannel(Image *image, |
| const ChannelType channel) |
| { |
| MagickStatusType |
| status; |
| |
| double |
| mean,sans,gamma,logmean; |
| |
| logmean=log(0.5); |
| |
| if ((channel & SyncChannels) != 0 ) |
| { |
| /* |
| Apply gamma correction equally accross all given channels |
| */ |
| (void) GetImageChannelMean(image,channel,&mean,&sans,&image->exception); |
| gamma=log(mean*QuantumScale)/logmean; |
| return LevelImageChannel(image, channel, |
| 0.0, (double)QuantumRange, gamma); |
| } |
| |
| /* |
| auto-gamma each channel separateally |
| */ |
| status = MagickTrue; |
| if ((channel & RedChannel) != 0) |
| { |
| (void) GetImageChannelMean(image,RedChannel,&mean,&sans, |
| &image->exception); |
| gamma=log(mean*QuantumScale)/logmean; |
| status = status && LevelImageChannel(image, RedChannel, |
| 0.0, (double)QuantumRange, gamma); |
| } |
| if ((channel & GreenChannel) != 0) |
| { |
| (void) GetImageChannelMean(image,GreenChannel,&mean,&sans, |
| &image->exception); |
| gamma=log(mean*QuantumScale)/logmean; |
| status = status && LevelImageChannel(image, GreenChannel, |
| 0.0, (double)QuantumRange, gamma); |
| } |
| if ((channel & BlueChannel) != 0) |
| { |
| (void) GetImageChannelMean(image,BlueChannel,&mean,&sans, |
| &image->exception); |
| gamma=log(mean*QuantumScale)/logmean; |
| status = status && LevelImageChannel(image, BlueChannel, |
| 0.0, (double)QuantumRange, gamma); |
| } |
| if (((channel & OpacityChannel) != 0) && |
| (image->matte == MagickTrue)) |
| { |
| (void) GetImageChannelMean(image,OpacityChannel,&mean,&sans, |
| &image->exception); |
| gamma=log(mean*QuantumScale)/logmean; |
| status = status && LevelImageChannel(image, OpacityChannel, |
| 0.0, (double)QuantumRange, gamma); |
| } |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| { |
| (void) GetImageChannelMean(image,IndexChannel,&mean,&sans, |
| &image->exception); |
| gamma=log(mean*QuantumScale)/logmean; |
| status = status && LevelImageChannel(image, IndexChannel, |
| 0.0, (double)QuantumRange, gamma); |
| } |
| return(status != 0 ? MagickTrue : MagickFalse); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % A u t o L e v e l I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % AutoLevelImage() adjusts the levels of a particular image channel by |
| % scaling the minimum and maximum values to the full quantum range. |
| % |
| % The format of the LevelImage method is: |
| % |
| % MagickBooleanType AutoLevelImage(Image *image) |
| % MagickBooleanType AutoLevelImageChannel(Image *image, |
| % const ChannelType channel) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: The image to auto-level |
| % |
| % o channel: The channels to auto-level. If the special 'SyncChannels' |
| % flag is set the min/max/mean value of all given channels is used for |
| % all given channels, to all channels in the same way. |
| % |
| */ |
| |
| MagickExport MagickBooleanType AutoLevelImage(Image *image) |
| { |
| return(AutoLevelImageChannel(image,DefaultChannels)); |
| } |
| |
| MagickExport MagickBooleanType AutoLevelImageChannel(Image *image, |
| const ChannelType channel) |
| { |
| /* |
| This is simply a convenience function around a Min/Max Histogram Stretch |
| */ |
| return MinMaxStretchImage(image, channel, 0.0, 0.0); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % B r i g h t n e s s C o n t r a s t I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % Use BrightnessContrastImage() to change the brightness and/or contrast of |
| % an image. It converts the brightness and contrast parameters into slope |
| % and intercept and calls a polynomical function to apply to the image. |
| % |
| % The format of the BrightnessContrastImage method is: |
| % |
| % MagickBooleanType BrightnessContrastImage(Image *image, |
| % const double brightness,const double contrast) |
| % MagickBooleanType BrightnessContrastImageChannel(Image *image, |
| % const ChannelType channel,const double brightness, |
| % const double contrast) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| % o brightness: the brightness percent (-100 .. 100). |
| % |
| % o contrast: the contrast percent (-100 .. 100). |
| % |
| */ |
| |
| MagickExport MagickBooleanType BrightnessContrastImage(Image *image, |
| const double brightness,const double contrast) |
| { |
| MagickBooleanType |
| status; |
| |
| status=BrightnessContrastImageChannel(image,DefaultChannels,brightness, |
| contrast); |
| return(status); |
| } |
| |
| MagickExport MagickBooleanType BrightnessContrastImageChannel(Image *image, |
| const ChannelType channel,const double brightness,const double contrast) |
| { |
| #define BrightnessContastImageTag "BrightnessContast/Image" |
| |
| double |
| alpha, |
| intercept, |
| coefficients[2], |
| slope; |
| |
| MagickBooleanType |
| status; |
| |
| /* |
| Compute slope and intercept. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| alpha=contrast; |
| if ((100-contrast) <= 0.1) |
| alpha=99.999999; |
| slope=MagickPI*(((alpha*alpha)/20000.0)+(3.0*alpha/200.0))/4.0; |
| slope=sin(slope)/cos(slope)+1.0; |
| if (slope < 0.0) |
| slope=0.0; |
| intercept=brightness/100.0+((100-brightness)/200.0)*(1.0-slope); |
| coefficients[0]=slope; |
| coefficients[1]=intercept; |
| status=FunctionImageChannel(image,channel,PolynomialFunction,2,coefficients, |
| &image->exception); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % C o l o r D e c i s i o n L i s t I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % ColorDecisionListImage() accepts a lightweight Color Correction Collection |
| % (CCC) file which solely contains one or more color corrections and applies |
| % the correction to the image. Here is a sample CCC file: |
| % |
| % <ColorCorrectionCollection xmlns="urn:ASC:CDL:v1.2"> |
| % <ColorCorrection id="cc03345"> |
| % <SOPNode> |
| % <Slope> 0.9 1.2 0.5 </Slope> |
| % <Offset> 0.4 -0.5 0.6 </Offset> |
| % <Power> 1.0 0.8 1.5 </Power> |
| % </SOPNode> |
| % <SATNode> |
| % <Saturation> 0.85 </Saturation> |
| % </SATNode> |
| % </ColorCorrection> |
| % </ColorCorrectionCollection> |
| % |
| % which includes the slop, offset, and power for each of the RGB channels |
| % as well as the saturation. |
| % |
| % The format of the ColorDecisionListImage method is: |
| % |
| % MagickBooleanType ColorDecisionListImage(Image *image, |
| % const char *color_correction_collection) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o color_correction_collection: the color correction collection in XML. |
| % |
| */ |
| MagickExport MagickBooleanType ColorDecisionListImage(Image *image, |
| const char *color_correction_collection) |
| { |
| #define ColorDecisionListCorrectImageTag "ColorDecisionList/Image" |
| |
| typedef struct _Correction |
| { |
| double |
| slope, |
| offset, |
| power; |
| } Correction; |
| |
| typedef struct _ColorCorrection |
| { |
| Correction |
| red, |
| green, |
| blue; |
| |
| double |
| saturation; |
| } ColorCorrection; |
| |
| CacheView |
| *image_view; |
| |
| char |
| token[MaxTextExtent]; |
| |
| ColorCorrection |
| color_correction; |
| |
| const char |
| *content, |
| *p; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| PixelPacket |
| *cdl_map; |
| |
| register long |
| i; |
| |
| XMLTreeInfo |
| *cc, |
| *ccc, |
| *sat, |
| *sop; |
| |
| /* |
| Allocate and initialize cdl maps. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| if (color_correction_collection == (const char *) NULL) |
| return(MagickFalse); |
| ccc=NewXMLTree((const char *) color_correction_collection,&image->exception); |
| if (ccc == (XMLTreeInfo *) NULL) |
| return(MagickFalse); |
| cc=GetXMLTreeChild(ccc,"ColorCorrection"); |
| if (cc == (XMLTreeInfo *) NULL) |
| { |
| ccc=DestroyXMLTree(ccc); |
| return(MagickFalse); |
| } |
| color_correction.red.slope=1.0; |
| color_correction.red.offset=0.0; |
| color_correction.red.power=1.0; |
| color_correction.green.slope=1.0; |
| color_correction.green.offset=0.0; |
| color_correction.green.power=1.0; |
| color_correction.blue.slope=1.0; |
| color_correction.blue.offset=0.0; |
| color_correction.blue.power=1.0; |
| color_correction.saturation=0.0; |
| sop=GetXMLTreeChild(cc,"SOPNode"); |
| if (sop != (XMLTreeInfo *) NULL) |
| { |
| XMLTreeInfo |
| *offset, |
| *power, |
| *slope; |
| |
| slope=GetXMLTreeChild(sop,"Slope"); |
| if (slope != (XMLTreeInfo *) NULL) |
| { |
| content=GetXMLTreeContent(slope); |
| p=(const char *) content; |
| for (i=0; (*p != '\0') && (i < 3); i++) |
| { |
| GetMagickToken(p,&p,token); |
| if (*token == ',') |
| GetMagickToken(p,&p,token); |
| switch (i) |
| { |
| case 0: color_correction.red.slope=StringToDouble(token); break; |
| case 1: color_correction.green.slope=StringToDouble(token); break; |
| case 2: color_correction.blue.slope=StringToDouble(token); break; |
| } |
| } |
| } |
| offset=GetXMLTreeChild(sop,"Offset"); |
| if (offset != (XMLTreeInfo *) NULL) |
| { |
| content=GetXMLTreeContent(offset); |
| p=(const char *) content; |
| for (i=0; (*p != '\0') && (i < 3); i++) |
| { |
| GetMagickToken(p,&p,token); |
| if (*token == ',') |
| GetMagickToken(p,&p,token); |
| switch (i) |
| { |
| case 0: color_correction.red.offset=StringToDouble(token); break; |
| case 1: color_correction.green.offset=StringToDouble(token); break; |
| case 2: color_correction.blue.offset=StringToDouble(token); break; |
| } |
| } |
| } |
| power=GetXMLTreeChild(sop,"Power"); |
| if (power != (XMLTreeInfo *) NULL) |
| { |
| content=GetXMLTreeContent(power); |
| p=(const char *) content; |
| for (i=0; (*p != '\0') && (i < 3); i++) |
| { |
| GetMagickToken(p,&p,token); |
| if (*token == ',') |
| GetMagickToken(p,&p,token); |
| switch (i) |
| { |
| case 0: color_correction.red.power=StringToDouble(token); break; |
| case 1: color_correction.green.power=StringToDouble(token); break; |
| case 2: color_correction.blue.power=StringToDouble(token); break; |
| } |
| } |
| } |
| } |
| sat=GetXMLTreeChild(cc,"SATNode"); |
| if (sat != (XMLTreeInfo *) NULL) |
| { |
| XMLTreeInfo |
| *saturation; |
| |
| saturation=GetXMLTreeChild(sat,"Saturation"); |
| if (saturation != (XMLTreeInfo *) NULL) |
| { |
| content=GetXMLTreeContent(saturation); |
| p=(const char *) content; |
| GetMagickToken(p,&p,token); |
| color_correction.saturation=StringToDouble(token); |
| } |
| } |
| ccc=DestroyXMLTree(ccc); |
| if (image->debug != MagickFalse) |
| { |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " Color Correction Collection:"); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.red.slope: %g",color_correction.red.slope); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.red.offset: %g",color_correction.red.offset); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.red.power: %g",color_correction.red.power); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.green.slope: %g",color_correction.green.slope); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.green.offset: %g",color_correction.green.offset); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.green.power: %g",color_correction.green.power); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.blue.slope: %g",color_correction.blue.slope); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.blue.offset: %g",color_correction.blue.offset); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.blue.power: %g",color_correction.blue.power); |
| (void) LogMagickEvent(TransformEvent,GetMagickModule(), |
| " color_correction.saturation: %g",color_correction.saturation); |
| } |
| cdl_map=(PixelPacket *) AcquireQuantumMemory(MaxMap+1UL,sizeof(*cdl_map)); |
| if (cdl_map == (PixelPacket *) NULL) |
| ThrowBinaryException(ResourceLimitError,"MemoryAllocationFailed", |
| image->filename); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) |
| #endif |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| cdl_map[i].red=ClampToQuantum((MagickRealType) ScaleMapToQuantum(( |
| MagickRealType) (MaxMap*(pow(color_correction.red.slope*i/MaxMap+ |
| color_correction.red.offset,color_correction.red.power))))); |
| cdl_map[i].green=ClampToQuantum((MagickRealType) ScaleMapToQuantum(( |
| MagickRealType) (MaxMap*(pow(color_correction.green.slope*i/MaxMap+ |
| color_correction.green.offset,color_correction.green.power))))); |
| cdl_map[i].blue=ClampToQuantum((MagickRealType) ScaleMapToQuantum(( |
| MagickRealType) (MaxMap*(pow(color_correction.blue.slope*i/MaxMap+ |
| color_correction.blue.offset,color_correction.blue.power))))); |
| } |
| if (image->storage_class == PseudoClass) |
| { |
| /* |
| Apply transfer function to colormap. |
| */ |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i < (long) image->colors; i++) |
| { |
| double |
| luma; |
| |
| luma=0.2126*image->colormap[i].red+0.7152*image->colormap[i].green+ |
| 0.0722*image->colormap[i].blue; |
| image->colormap[i].red=ClampToQuantum(luma+color_correction.saturation* |
| cdl_map[ScaleQuantumToMap(image->colormap[i].red)].red-luma); |
| image->colormap[i].green=ClampToQuantum(luma+ |
| color_correction.saturation*cdl_map[ScaleQuantumToMap( |
| image->colormap[i].green)].green-luma); |
| image->colormap[i].blue=ClampToQuantum(luma+color_correction.saturation* |
| cdl_map[ScaleQuantumToMap(image->colormap[i].blue)].blue-luma); |
| } |
| } |
| /* |
| Apply transfer function to image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| exception=(&image->exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| double |
| luma; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| for (x=0; x < (long) image->columns; x++) |
| { |
| luma=0.2126*q->red+0.7152*q->green+0.0722*q->blue; |
| q->red=ClampToQuantum(luma+color_correction.saturation* |
| (cdl_map[ScaleQuantumToMap(q->red)].red-luma)); |
| q->green=ClampToQuantum(luma+color_correction.saturation* |
| (cdl_map[ScaleQuantumToMap(q->green)].green-luma)); |
| q->blue=ClampToQuantum(luma+color_correction.saturation* |
| (cdl_map[ScaleQuantumToMap(q->blue)].blue-luma)); |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_ColorDecisionListImageChannel) |
| #endif |
| proceed=SetImageProgress(image,ColorDecisionListCorrectImageTag, |
| progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| cdl_map=(PixelPacket *) RelinquishMagickMemory(cdl_map); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % C l u t I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % ClutImage() replaces each color value in the given image, by using it as an |
| % index to lookup a replacement color value in a Color Look UP Table in the |
| % form of an image. The values are extracted along a diagonal of the CLUT |
| % image so either a horizontal or vertial gradient image can be used. |
| % |
| % Typically this is used to either re-color a gray-scale image according to a |
| % color gradient in the CLUT image, or to perform a freeform histogram |
| % (level) adjustment according to the (typically gray-scale) gradient in the |
| % CLUT image. |
| % |
| % When the 'channel' mask includes the matte/alpha transparency channel but |
| % one image has no such channel it is assumed that that image is a simple |
| % gray-scale image that will effect the alpha channel values, either for |
| % gray-scale coloring (with transparent or semi-transparent colors), or |
| % a histogram adjustment of existing alpha channel values. If both images |
| % have matte channels, direct and normal indexing is applied, which is rarely |
| % used. |
| % |
| % The format of the ClutImage method is: |
| % |
| % MagickBooleanType ClutImage(Image *image,Image *clut_image) |
| % MagickBooleanType ClutImageChannel(Image *image, |
| % const ChannelType channel,Image *clut_image) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image, which is replaced by indexed CLUT values |
| % |
| % o clut_image: the color lookup table image for replacement color values. |
| % |
| % o channel: the channel. |
| % |
| */ |
| |
| MagickExport MagickBooleanType ClutImage(Image *image,const Image *clut_image) |
| { |
| return(ClutImageChannel(image,DefaultChannels,clut_image)); |
| } |
| |
| MagickExport MagickBooleanType ClutImageChannel(Image *image, |
| const ChannelType channel,const Image *clut_image) |
| { |
| #define ClutImageTag "Clut/Image" |
| |
| CacheView |
| *image_view; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| adjust, |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| MagickPixelPacket |
| zero; |
| |
| ResampleFilter |
| **restrict resample_filter; |
| |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(clut_image != (Image *) NULL); |
| assert(clut_image->signature == MagickSignature); |
| if (SetImageStorageClass(image,DirectClass) == MagickFalse) |
| return(MagickFalse); |
| /* |
| Clut image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| GetMagickPixelPacket(clut_image,&zero); |
| adjust=clut_image->interpolate == IntegerInterpolatePixel ? 0 : 1; |
| exception=(&image->exception); |
| resample_filter=AcquireResampleFilterThreadSet(clut_image,MagickTrue, |
| exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| MagickPixelPacket |
| pixel; |
| |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| id, |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| pixel=zero; |
| id=GetOpenMPThreadId(); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| /* |
| PROGRAMMERS WARNING: |
| |
| Apply OpacityChannel BEFORE the color channels. Do not re-order. |
| |
| The handling special case 2 (coloring gray-scale), requires access to |
| the unmodified colors of the original image to determine the index |
| value. As such alpha/matte channel handling must be performed BEFORE, |
| any of the color channels are modified. |
| |
| */ |
| if ((channel & OpacityChannel) != 0) |
| { |
| if (clut_image->matte == MagickFalse) |
| { |
| /* |
| A gray-scale LUT replacement for an image alpha channel. |
| */ |
| (void) ResamplePixelColor(resample_filter[id],QuantumScale* |
| GetAlphaPixelComponent(q)*(clut_image->columns+adjust), |
| QuantumScale*GetAlphaPixelComponent(q)*(clut_image->rows+ |
| adjust),&pixel); |
| q->opacity=(Quantum) (QuantumRange-MagickPixelIntensityToQuantum( |
| &pixel)); |
| } |
| else |
| if (image->matte == MagickFalse) |
| { |
| /* |
| A greyscale image being colored by a LUT with transparency. |
| */ |
| (void) ResamplePixelColor(resample_filter[id],QuantumScale* |
| PixelIntensity(q)*(clut_image->columns-adjust),QuantumScale* |
| PixelIntensity(q)*(clut_image->rows-adjust),&pixel); |
| SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
| } |
| else |
| { |
| /* |
| Direct alpha channel lookup. |
| */ |
| (void) ResamplePixelColor(resample_filter[id],QuantumScale* |
| q->opacity*(clut_image->columns-adjust),QuantumScale* |
| q->opacity* (clut_image->rows-adjust),&pixel); |
| SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
| } |
| } |
| if ((channel & RedChannel) != 0) |
| { |
| (void) ResamplePixelColor(resample_filter[id],QuantumScale*q->red* |
| (clut_image->columns-adjust),QuantumScale*q->red* |
| (clut_image->rows-adjust),&pixel); |
| SetRedPixelComponent(q,ClampRedPixelComponent(&pixel)); |
| } |
| if ((channel & GreenChannel) != 0) |
| { |
| (void) ResamplePixelColor(resample_filter[id],QuantumScale*q->green* |
| (clut_image->columns-adjust),QuantumScale*q->green* |
| (clut_image->rows-adjust),&pixel); |
| SetGreenPixelComponent(q,ClampGreenPixelComponent(&pixel)); |
| } |
| if ((channel & BlueChannel) != 0) |
| { |
| (void) ResamplePixelColor(resample_filter[id],QuantumScale*q->blue* |
| (clut_image->columns-adjust),QuantumScale*q->blue* |
| (clut_image->rows-adjust),&pixel); |
| SetBluePixelComponent(q,ClampBluePixelComponent(&pixel)); |
| } |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| { |
| (void) ResamplePixelColor(resample_filter[id],QuantumScale*indexes[x]* |
| (clut_image->columns-adjust),QuantumScale*indexes[x]* |
| (clut_image->rows-adjust),&pixel); |
| indexes[x]=ClampToQuantum(pixel.index); |
| } |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_ClutImageChannel) |
| #endif |
| proceed=SetImageProgress(image,ClutImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| resample_filter=DestroyResampleFilterThreadSet(resample_filter); |
| /* |
| Enable alpha channel if CLUT image could enable it. |
| */ |
| if ((clut_image->matte != MagickFalse) && ((channel & OpacityChannel) != 0)) |
| (void) SetImageAlphaChannel(image,ActivateAlphaChannel); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % C o n t r a s t I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % ContrastImage() enhances the intensity differences between the lighter and |
| % darker elements of the image. Set sharpen to a MagickTrue to increase the |
| % image contrast otherwise the contrast is reduced. |
| % |
| % The format of the ContrastImage method is: |
| % |
| % MagickBooleanType ContrastImage(Image *image, |
| % const MagickBooleanType sharpen) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o sharpen: Increase or decrease image contrast. |
| % |
| */ |
| |
| static void Contrast(const int sign,Quantum *red,Quantum *green,Quantum *blue) |
| { |
| double |
| brightness, |
| hue, |
| saturation; |
| |
| /* |
| Enhance contrast: dark color become darker, light color become lighter. |
| */ |
| assert(red != (Quantum *) NULL); |
| assert(green != (Quantum *) NULL); |
| assert(blue != (Quantum *) NULL); |
| hue=0.0; |
| saturation=0.0; |
| brightness=0.0; |
| ConvertRGBToHSB(*red,*green,*blue,&hue,&saturation,&brightness); |
| brightness+=0.5*sign*(0.5*(sin(MagickPI*(brightness-0.5))+1.0)-brightness); |
| if (brightness > 1.0) |
| brightness=1.0; |
| else |
| if (brightness < 0.0) |
| brightness=0.0; |
| ConvertHSBToRGB(hue,saturation,brightness,red,green,blue); |
| } |
| |
| MagickExport MagickBooleanType ContrastImage(Image *image, |
| const MagickBooleanType sharpen) |
| { |
| #define ContrastImageTag "Contrast/Image" |
| |
| CacheView |
| *image_view; |
| |
| ExceptionInfo |
| *exception; |
| |
| int |
| sign; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| register long |
| i; |
| |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| sign=sharpen != MagickFalse ? 1 : -1; |
| if (image->storage_class == PseudoClass) |
| { |
| /* |
| Contrast enhance colormap. |
| */ |
| for (i=0; i < (long) image->colors; i++) |
| Contrast(sign,&image->colormap[i].red,&image->colormap[i].green, |
| &image->colormap[i].blue); |
| } |
| /* |
| Contrast enhance image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| exception=(&image->exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| for (x=0; x < (long) image->columns; x++) |
| { |
| Contrast(sign,&q->red,&q->green,&q->blue); |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_ContrastImage) |
| #endif |
| proceed=SetImageProgress(image,ContrastImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % C o n t r a s t S t r e t c h I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % The ContrastStretchImage() is a simple image enhancement technique that |
| % attempts to improve the contrast in an image by `stretching' the range of |
| % intensity values it contains to span a desired range of values. It differs |
| % from the more sophisticated histogram equalization in that it can only |
| % apply % a linear scaling function to the image pixel values. As a result |
| % the `enhancement' is less harsh. |
| % |
| % The format of the ContrastStretchImage method is: |
| % |
| % MagickBooleanType ContrastStretchImage(Image *image, |
| % const char *levels) |
| % MagickBooleanType ContrastStretchImageChannel(Image *image, |
| % const unsigned long channel,const double black_point, |
| % const double white_point) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| % o black_point: the black point. |
| % |
| % o white_point: the white point. |
| % |
| % o levels: Specify the levels where the black and white points have the |
| % range of 0 to number-of-pixels (e.g. 1%, 10x90%, etc.). |
| % |
| */ |
| |
| MagickExport MagickBooleanType ContrastStretchImage(Image *image, |
| const char *levels) |
| { |
| double |
| black_point, |
| white_point; |
| |
| GeometryInfo |
| geometry_info; |
| |
| MagickBooleanType |
| status; |
| |
| MagickStatusType |
| flags; |
| |
| /* |
| Parse levels. |
| */ |
| if (levels == (char *) NULL) |
| return(MagickFalse); |
| flags=ParseGeometry(levels,&geometry_info); |
| black_point=geometry_info.rho; |
| white_point=(double) image->columns*image->rows; |
| if ((flags & SigmaValue) != 0) |
| white_point=geometry_info.sigma; |
| if ((flags & PercentValue) != 0) |
| { |
| black_point*=(double) QuantumRange/100.0; |
| white_point*=(double) QuantumRange/100.0; |
| } |
| if ((flags & SigmaValue) == 0) |
| white_point=(double) image->columns*image->rows-black_point; |
| status=ContrastStretchImageChannel(image,DefaultChannels,black_point, |
| white_point); |
| return(status); |
| } |
| |
| MagickExport MagickBooleanType ContrastStretchImageChannel(Image *image, |
| const ChannelType channel,const double black_point,const double white_point) |
| { |
| #define MaxRange(color) ((MagickRealType) ScaleQuantumToMap((Quantum) (color))) |
| #define ContrastStretchImageTag "ContrastStretch/Image" |
| |
| CacheView |
| *image_view; |
| |
| double |
| intensity; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| MagickPixelPacket |
| black, |
| *histogram, |
| *stretch_map, |
| white; |
| |
| register long |
| i; |
| |
| /* |
| Allocate histogram and stretch map. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| histogram=(MagickPixelPacket *) AcquireQuantumMemory(MaxMap+1UL, |
| sizeof(*histogram)); |
| stretch_map=(MagickPixelPacket *) AcquireQuantumMemory(MaxMap+1UL, |
| sizeof(*stretch_map)); |
| if ((histogram == (MagickPixelPacket *) NULL) || |
| (stretch_map == (MagickPixelPacket *) NULL)) |
| ThrowBinaryException(ResourceLimitError,"MemoryAllocationFailed", |
| image->filename); |
| /* |
| Form histogram. |
| */ |
| status=MagickTrue; |
| exception=(&image->exception); |
| (void) ResetMagickMemory(histogram,0,(MaxMap+1)*sizeof(*histogram)); |
| image_view=AcquireCacheView(image); |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register const PixelPacket |
| *restrict p; |
| |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| x; |
| |
| if (status == MagickFalse) |
| continue; |
| p=GetCacheViewVirtualPixels(image_view,0,y,image->columns,1,exception); |
| if (p == (const PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| if (channel == DefaultChannels) |
| for (x=0; x < (long) image->columns; x++) |
| { |
| Quantum |
| intensity; |
| |
| intensity=PixelIntensityToQuantum(p); |
| histogram[ScaleQuantumToMap(intensity)].red++; |
| histogram[ScaleQuantumToMap(intensity)].green++; |
| histogram[ScaleQuantumToMap(intensity)].blue++; |
| histogram[ScaleQuantumToMap(intensity)].index++; |
| p++; |
| } |
| else |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if ((channel & RedChannel) != 0) |
| histogram[ScaleQuantumToMap(GetRedPixelComponent(p))].red++; |
| if ((channel & GreenChannel) != 0) |
| histogram[ScaleQuantumToMap(GetGreenPixelComponent(p))].green++; |
| if ((channel & BlueChannel) != 0) |
| histogram[ScaleQuantumToMap(GetBluePixelComponent(p))].blue++; |
| if ((channel & OpacityChannel) != 0) |
| histogram[ScaleQuantumToMap(GetOpacityPixelComponent(p))].opacity++; |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| histogram[ScaleQuantumToMap(indexes[x])].index++; |
| p++; |
| } |
| } |
| /* |
| Find the histogram boundaries by locating the black/white levels. |
| */ |
| black.red=0.0; |
| white.red=MaxRange(QuantumRange); |
| if ((channel & RedChannel) != 0) |
| { |
| intensity=0.0; |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| intensity+=histogram[i].red; |
| if (intensity > black_point) |
| break; |
| } |
| black.red=(MagickRealType) i; |
| intensity=0.0; |
| for (i=(long) MaxMap; i != 0; i--) |
| { |
| intensity+=histogram[i].red; |
| if (intensity > ((double) image->columns*image->rows-white_point)) |
| break; |
| } |
| white.red=(MagickRealType) i; |
| } |
| black.green=0.0; |
| white.green=MaxRange(QuantumRange); |
| if ((channel & GreenChannel) != 0) |
| { |
| intensity=0.0; |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| intensity+=histogram[i].green; |
| if (intensity > black_point) |
| break; |
| } |
| black.green=(MagickRealType) i; |
| intensity=0.0; |
| for (i=(long) MaxMap; i != 0; i--) |
| { |
| intensity+=histogram[i].green; |
| if (intensity > ((double) image->columns*image->rows-white_point)) |
| break; |
| } |
| white.green=(MagickRealType) i; |
| } |
| black.blue=0.0; |
| white.blue=MaxRange(QuantumRange); |
| if ((channel & BlueChannel) != 0) |
| { |
| intensity=0.0; |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| intensity+=histogram[i].blue; |
| if (intensity > black_point) |
| break; |
| } |
| black.blue=(MagickRealType) i; |
| intensity=0.0; |
| for (i=(long) MaxMap; i != 0; i--) |
| { |
| intensity+=histogram[i].blue; |
| if (intensity > ((double) image->columns*image->rows-white_point)) |
| break; |
| } |
| white.blue=(MagickRealType) i; |
| } |
| black.opacity=0.0; |
| white.opacity=MaxRange(QuantumRange); |
| if ((channel & OpacityChannel) != 0) |
| { |
| intensity=0.0; |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| intensity+=histogram[i].opacity; |
| if (intensity > black_point) |
| break; |
| } |
| black.opacity=(MagickRealType) i; |
| intensity=0.0; |
| for (i=(long) MaxMap; i != 0; i--) |
| { |
| intensity+=histogram[i].opacity; |
| if (intensity > ((double) image->columns*image->rows-white_point)) |
| break; |
| } |
| white.opacity=(MagickRealType) i; |
| } |
| black.index=0.0; |
| white.index=MaxRange(QuantumRange); |
| if (((channel & IndexChannel) != 0) && (image->colorspace == CMYKColorspace)) |
| { |
| intensity=0.0; |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| intensity+=histogram[i].index; |
| if (intensity > black_point) |
| break; |
| } |
| black.index=(MagickRealType) i; |
| intensity=0.0; |
| for (i=(long) MaxMap; i != 0; i--) |
| { |
| intensity+=histogram[i].index; |
| if (intensity > ((double) image->columns*image->rows-white_point)) |
| break; |
| } |
| white.index=(MagickRealType) i; |
| } |
| histogram=(MagickPixelPacket *) RelinquishMagickMemory(histogram); |
| /* |
| Stretch the histogram to create the stretched image mapping. |
| */ |
| (void) ResetMagickMemory(stretch_map,0,(MaxMap+1)*sizeof(*stretch_map)); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| if ((channel & RedChannel) != 0) |
| { |
| if (i < (long) black.red) |
| stretch_map[i].red=0.0; |
| else |
| if (i > (long) white.red) |
| stretch_map[i].red=(MagickRealType) QuantumRange; |
| else |
| if (black.red != white.red) |
| stretch_map[i].red=(MagickRealType) ScaleMapToQuantum( |
| (MagickRealType) (MaxMap*(i-black.red)/(white.red-black.red))); |
| } |
| if ((channel & GreenChannel) != 0) |
| { |
| if (i < (long) black.green) |
| stretch_map[i].green=0.0; |
| else |
| if (i > (long) white.green) |
| stretch_map[i].green=(MagickRealType) QuantumRange; |
| else |
| if (black.green != white.green) |
| stretch_map[i].green=(MagickRealType) ScaleMapToQuantum( |
| (MagickRealType) (MaxMap*(i-black.green)/(white.green- |
| black.green))); |
| } |
| if ((channel & BlueChannel) != 0) |
| { |
| if (i < (long) black.blue) |
| stretch_map[i].blue=0.0; |
| else |
| if (i > (long) white.blue) |
| stretch_map[i].blue=(MagickRealType) QuantumRange; |
| else |
| if (black.blue != white.blue) |
| stretch_map[i].blue=(MagickRealType) ScaleMapToQuantum( |
| (MagickRealType) (MaxMap*(i-black.blue)/(white.blue- |
| black.blue))); |
| } |
| if ((channel & OpacityChannel) != 0) |
| { |
| if (i < (long) black.opacity) |
| stretch_map[i].opacity=0.0; |
| else |
| if (i > (long) white.opacity) |
| stretch_map[i].opacity=(MagickRealType) QuantumRange; |
| else |
| if (black.opacity != white.opacity) |
| stretch_map[i].opacity=(MagickRealType) ScaleMapToQuantum( |
| (MagickRealType) (MaxMap*(i-black.opacity)/(white.opacity- |
| black.opacity))); |
| } |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| { |
| if (i < (long) black.index) |
| stretch_map[i].index=0.0; |
| else |
| if (i > (long) white.index) |
| stretch_map[i].index=(MagickRealType) QuantumRange; |
| else |
| if (black.index != white.index) |
| stretch_map[i].index=(MagickRealType) ScaleMapToQuantum( |
| (MagickRealType) (MaxMap*(i-black.index)/(white.index- |
| black.index))); |
| } |
| } |
| /* |
| Stretch the image. |
| */ |
| if (((channel & OpacityChannel) != 0) || (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace))) |
| image->storage_class=DirectClass; |
| if (image->storage_class == PseudoClass) |
| { |
| /* |
| Stretch colormap. |
| */ |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i < (long) image->colors; i++) |
| { |
| if ((channel & RedChannel) != 0) |
| { |
| if (black.red != white.red) |
| image->colormap[i].red=ClampToQuantum(stretch_map[ |
| ScaleQuantumToMap(image->colormap[i].red)].red); |
| } |
| if ((channel & GreenChannel) != 0) |
| { |
| if (black.green != white.green) |
| image->colormap[i].green=ClampToQuantum(stretch_map[ |
| ScaleQuantumToMap(image->colormap[i].green)].green); |
| } |
| if ((channel & BlueChannel) != 0) |
| { |
| if (black.blue != white.blue) |
| image->colormap[i].blue=ClampToQuantum(stretch_map[ |
| ScaleQuantumToMap(image->colormap[i].blue)].blue); |
| } |
| if ((channel & OpacityChannel) != 0) |
| { |
| if (black.opacity != white.opacity) |
| image->colormap[i].opacity=ClampToQuantum(stretch_map[ |
| ScaleQuantumToMap(image->colormap[i].opacity)].opacity); |
| } |
| } |
| } |
| /* |
| Stretch image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if ((channel & RedChannel) != 0) |
| { |
| if (black.red != white.red) |
| q->red=ClampToQuantum(stretch_map[ScaleQuantumToMap(q->red)].red); |
| } |
| if ((channel & GreenChannel) != 0) |
| { |
| if (black.green != white.green) |
| q->green=ClampToQuantum(stretch_map[ScaleQuantumToMap( |
| q->green)].green); |
| } |
| if ((channel & BlueChannel) != 0) |
| { |
| if (black.blue != white.blue) |
| q->blue=ClampToQuantum(stretch_map[ScaleQuantumToMap( |
| q->blue)].blue); |
| } |
| if ((channel & OpacityChannel) != 0) |
| { |
| if (black.opacity != white.opacity) |
| q->opacity=ClampToQuantum(stretch_map[ScaleQuantumToMap( |
| q->opacity)].opacity); |
| } |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| { |
| if (black.index != white.index) |
| indexes[x]=(IndexPacket) ClampToQuantum(stretch_map[ |
| ScaleQuantumToMap(indexes[x])].index); |
| } |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_ContrastStretchImageChannel) |
| #endif |
| proceed=SetImageProgress(image,ContrastStretchImageTag,progress++, |
| image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| stretch_map=(MagickPixelPacket *) RelinquishMagickMemory(stretch_map); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % E n h a n c e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % EnhanceImage() applies a digital filter that improves the quality of a |
| % noisy image. |
| % |
| % The format of the EnhanceImage method is: |
| % |
| % Image *EnhanceImage(const Image *image,ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport Image *EnhanceImage(const Image *image,ExceptionInfo *exception) |
| { |
| #define Enhance(weight) \ |
| mean=((MagickRealType) r->red+pixel.red)/2; \ |
| distance=(MagickRealType) r->red-(MagickRealType) pixel.red; \ |
| distance_squared=QuantumScale*(2.0*((MagickRealType) QuantumRange+1.0)+ \ |
| mean)*distance*distance; \ |
| mean=((MagickRealType) r->green+pixel.green)/2; \ |
| distance=(MagickRealType) r->green-(MagickRealType) pixel.green; \ |
| distance_squared+=4.0*distance*distance; \ |
| mean=((MagickRealType) r->blue+pixel.blue)/2; \ |
| distance=(MagickRealType) r->blue-(MagickRealType) pixel.blue; \ |
| distance_squared+=QuantumScale*(3.0*((MagickRealType) \ |
| QuantumRange+1.0)-1.0-mean)*distance*distance; \ |
| mean=((MagickRealType) r->opacity+pixel.opacity)/2; \ |
| distance=(MagickRealType) r->opacity-(MagickRealType) pixel.opacity; \ |
| distance_squared+=QuantumScale*(3.0*((MagickRealType) \ |
| QuantumRange+1.0)-1.0-mean)*distance*distance; \ |
| if (distance_squared < ((MagickRealType) QuantumRange*(MagickRealType) \ |
| QuantumRange/25.0f)) \ |
| { \ |
| aggregate.red+=(weight)*r->red; \ |
| aggregate.green+=(weight)*r->green; \ |
| aggregate.blue+=(weight)*r->blue; \ |
| aggregate.opacity+=(weight)*r->opacity; \ |
| total_weight+=(weight); \ |
| } \ |
| r++; |
| #define EnhanceImageTag "Enhance/Image" |
| |
| CacheView |
| *enhance_view, |
| *image_view; |
| |
| Image |
| *enhance_image; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| MagickPixelPacket |
| zero; |
| |
| /* |
| Initialize enhanced image attributes. |
| */ |
| assert(image != (const Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| if ((image->columns < 5) || (image->rows < 5)) |
| return((Image *) NULL); |
| enhance_image=CloneImage(image,image->columns,image->rows,MagickTrue, |
| exception); |
| if (enhance_image == (Image *) NULL) |
| return((Image *) NULL); |
| if (SetImageStorageClass(enhance_image,DirectClass) == MagickFalse) |
| { |
| InheritException(exception,&enhance_image->exception); |
| enhance_image=DestroyImage(enhance_image); |
| return((Image *) NULL); |
| } |
| /* |
| Enhance image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| image_view=AcquireCacheView(image); |
| enhance_view=AcquireCacheView(enhance_image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register const PixelPacket |
| *restrict p; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| /* |
| Read another scan line. |
| */ |
| if (status == MagickFalse) |
| continue; |
| p=GetCacheViewVirtualPixels(image_view,-2,y-2,image->columns+4,5,exception); |
| q=QueueCacheViewAuthenticPixels(enhance_view,0,y,enhance_image->columns,1, |
| exception); |
| if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| for (x=0; x < (long) image->columns; x++) |
| { |
| MagickPixelPacket |
| aggregate; |
| |
| MagickRealType |
| distance, |
| distance_squared, |
| mean, |
| total_weight; |
| |
| PixelPacket |
| pixel; |
| |
| register const PixelPacket |
| *restrict r; |
| |
| /* |
| Compute weighted average of target pixel color components. |
| */ |
| aggregate=zero; |
| total_weight=0.0; |
| r=p+2*(image->columns+4)+2; |
| pixel=(*r); |
| r=p; |
| Enhance(5.0); Enhance(8.0); Enhance(10.0); Enhance(8.0); Enhance(5.0); |
| r=p+(image->columns+4); |
| Enhance(8.0); Enhance(20.0); Enhance(40.0); Enhance(20.0); Enhance(8.0); |
| r=p+2*(image->columns+4); |
| Enhance(10.0); Enhance(40.0); Enhance(80.0); Enhance(40.0); Enhance(10.0); |
| r=p+3*(image->columns+4); |
| Enhance(8.0); Enhance(20.0); Enhance(40.0); Enhance(20.0); Enhance(8.0); |
| r=p+4*(image->columns+4); |
| Enhance(5.0); Enhance(8.0); Enhance(10.0); Enhance(8.0); Enhance(5.0); |
| q->red=(Quantum) ((aggregate.red+(total_weight/2)-1)/total_weight); |
| q->green=(Quantum) ((aggregate.green+(total_weight/2)-1)/total_weight); |
| q->blue=(Quantum) ((aggregate.blue+(total_weight/2)-1)/total_weight); |
| q->opacity=(Quantum) ((aggregate.opacity+(total_weight/2)-1)/ |
| total_weight); |
| p++; |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(enhance_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_EnhanceImage) |
| #endif |
| proceed=SetImageProgress(image,EnhanceImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| enhance_view=DestroyCacheView(enhance_view); |
| image_view=DestroyCacheView(image_view); |
| return(enhance_image); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % E q u a l i z e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % EqualizeImage() applies a histogram equalization to the image. |
| % |
| % The format of the EqualizeImage method is: |
| % |
| % MagickBooleanType EqualizeImage(Image *image) |
| % MagickBooleanType EqualizeImageChannel(Image *image, |
| % const ChannelType channel) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| */ |
| |
| MagickExport MagickBooleanType EqualizeImage(Image *image) |
| { |
| return(EqualizeImageChannel(image,DefaultChannels)); |
| } |
| |
| MagickExport MagickBooleanType EqualizeImageChannel(Image *image, |
| const ChannelType channel) |
| { |
| #define EqualizeImageTag "Equalize/Image" |
| |
| CacheView |
| *image_view; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| MagickPixelPacket |
| black, |
| *equalize_map, |
| *histogram, |
| intensity, |
| *map, |
| white; |
| |
| register long |
| i; |
| |
| /* |
| Allocate and initialize histogram arrays. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| equalize_map=(MagickPixelPacket *) AcquireQuantumMemory(MaxMap+1UL, |
| sizeof(*equalize_map)); |
| histogram=(MagickPixelPacket *) AcquireQuantumMemory(MaxMap+1UL, |
| sizeof(*histogram)); |
| map=(MagickPixelPacket *) AcquireQuantumMemory(MaxMap+1UL,sizeof(*map)); |
| if ((equalize_map == (MagickPixelPacket *) NULL) || |
| (histogram == (MagickPixelPacket *) NULL) || |
| (map == (MagickPixelPacket *) NULL)) |
| { |
| if (map != (MagickPixelPacket *) NULL) |
| map=(MagickPixelPacket *) RelinquishMagickMemory(map); |
| if (histogram != (MagickPixelPacket *) NULL) |
| histogram=(MagickPixelPacket *) RelinquishMagickMemory(histogram); |
| if (equalize_map != (MagickPixelPacket *) NULL) |
| equalize_map=(MagickPixelPacket *) RelinquishMagickMemory(equalize_map); |
| ThrowBinaryException(ResourceLimitError,"MemoryAllocationFailed", |
| image->filename); |
| } |
| /* |
| Form histogram. |
| */ |
| (void) ResetMagickMemory(histogram,0,(MaxMap+1)*sizeof(*histogram)); |
| exception=(&image->exception); |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register const IndexPacket |
| *restrict indexes; |
| |
| register const PixelPacket |
| *restrict p; |
| |
| register long |
| x; |
| |
| p=GetVirtualPixels(image,0,y,image->columns,1,exception); |
| if (p == (const PixelPacket *) NULL) |
| break; |
| indexes=GetVirtualIndexQueue(image); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if ((channel & RedChannel) != 0) |
| histogram[ScaleQuantumToMap(GetRedPixelComponent(p))].red++; |
| if ((channel & GreenChannel) != 0) |
| histogram[ScaleQuantumToMap(GetGreenPixelComponent(p))].green++; |
| if ((channel & BlueChannel) != 0) |
| histogram[ScaleQuantumToMap(GetBluePixelComponent(p))].blue++; |
| if ((channel & OpacityChannel) != 0) |
| histogram[ScaleQuantumToMap(GetOpacityPixelComponent(p))].opacity++; |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| histogram[ScaleQuantumToMap(indexes[x])].index++; |
| p++; |
| } |
| } |
| /* |
| Integrate the histogram to get the equalization map. |
| */ |
| (void) ResetMagickMemory(&intensity,0,sizeof(intensity)); |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| if ((channel & RedChannel) != 0) |
| intensity.red+=histogram[i].red; |
| if ((channel & GreenChannel) != 0) |
| intensity.green+=histogram[i].green; |
| if ((channel & BlueChannel) != 0) |
| intensity.blue+=histogram[i].blue; |
| if ((channel & OpacityChannel) != 0) |
| intensity.opacity+=histogram[i].opacity; |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| intensity.index+=histogram[i].index; |
| map[i]=intensity; |
| } |
| black=map[0]; |
| white=map[(int) MaxMap]; |
| (void) ResetMagickMemory(equalize_map,0,(MaxMap+1)*sizeof(*equalize_map)); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| if (((channel & RedChannel) != 0) && (white.red != black.red)) |
| equalize_map[i].red=(MagickRealType) ScaleMapToQuantum((MagickRealType) |
| ((MaxMap*(map[i].red-black.red))/(white.red-black.red))); |
| if (((channel & GreenChannel) != 0) && (white.green != black.green)) |
| equalize_map[i].green=(MagickRealType) ScaleMapToQuantum((MagickRealType) |
| ((MaxMap*(map[i].green-black.green))/(white.green-black.green))); |
| if (((channel & BlueChannel) != 0) && (white.blue != black.blue)) |
| equalize_map[i].blue=(MagickRealType) ScaleMapToQuantum((MagickRealType) |
| ((MaxMap*(map[i].blue-black.blue))/(white.blue-black.blue))); |
| if (((channel & OpacityChannel) != 0) && (white.opacity != black.opacity)) |
| equalize_map[i].opacity=(MagickRealType) ScaleMapToQuantum( |
| (MagickRealType) ((MaxMap*(map[i].opacity-black.opacity))/ |
| (white.opacity-black.opacity))); |
| if ((((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) && |
| (white.index != black.index)) |
| equalize_map[i].index=(MagickRealType) ScaleMapToQuantum((MagickRealType) |
| ((MaxMap*(map[i].index-black.index))/(white.index-black.index))); |
| } |
| histogram=(MagickPixelPacket *) RelinquishMagickMemory(histogram); |
| map=(MagickPixelPacket *) RelinquishMagickMemory(map); |
| if (image->storage_class == PseudoClass) |
| { |
| /* |
| Equalize colormap. |
| */ |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i < (long) image->colors; i++) |
| { |
| if (((channel & RedChannel) != 0) && (white.red != black.red)) |
| image->colormap[i].red=ClampToQuantum(equalize_map[ |
| ScaleQuantumToMap(image->colormap[i].red)].red); |
| if (((channel & GreenChannel) != 0) && (white.green != black.green)) |
| image->colormap[i].green=ClampToQuantum(equalize_map[ |
| ScaleQuantumToMap(image->colormap[i].green)].green); |
| if (((channel & BlueChannel) != 0) && (white.blue != black.blue)) |
| image->colormap[i].blue=ClampToQuantum(equalize_map[ |
| ScaleQuantumToMap(image->colormap[i].blue)].blue); |
| if (((channel & OpacityChannel) != 0) && |
| (white.opacity != black.opacity)) |
| image->colormap[i].opacity=ClampToQuantum(equalize_map[ |
| ScaleQuantumToMap(image->colormap[i].opacity)].opacity); |
| } |
| } |
| /* |
| Equalize image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| exception=(&image->exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if (((channel & RedChannel) != 0) && (white.red != black.red)) |
| q->red=ClampToQuantum(equalize_map[ScaleQuantumToMap(q->red)].red); |
| if (((channel & GreenChannel) != 0) && (white.green != black.green)) |
| q->green=ClampToQuantum(equalize_map[ScaleQuantumToMap( |
| q->green)].green); |
| if (((channel & BlueChannel) != 0) && (white.blue != black.blue)) |
| q->blue=ClampToQuantum(equalize_map[ScaleQuantumToMap(q->blue)].blue); |
| if (((channel & OpacityChannel) != 0) && (white.opacity != black.opacity)) |
| q->opacity=ClampToQuantum(equalize_map[ScaleQuantumToMap( |
| q->opacity)].opacity); |
| if ((((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) && |
| (white.index != black.index)) |
| indexes[x]=ClampToQuantum(equalize_map[ScaleQuantumToMap( |
| indexes[x])].index); |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_EqualizeImageChannel) |
| #endif |
| proceed=SetImageProgress(image,EqualizeImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| equalize_map=(MagickPixelPacket *) RelinquishMagickMemory(equalize_map); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % G a m m a I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % GammaImage() gamma-corrects a particular image channel. The same |
| % image viewed on different devices will have perceptual differences in the |
| % way the image's intensities are represented on the screen. Specify |
| % individual gamma levels for the red, green, and blue channels, or adjust |
| % all three with the gamma parameter. Values typically range from 0.8 to 2.3. |
| % |
| % You can also reduce the influence of a particular channel with a gamma |
| % value of 0. |
| % |
| % The format of the GammaImage method is: |
| % |
| % MagickBooleanType GammaImage(Image *image,const double gamma) |
| % MagickBooleanType GammaImageChannel(Image *image, |
| % const ChannelType channel,const double gamma) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| % o gamma: the image gamma. |
| % |
| */ |
| MagickExport MagickBooleanType GammaImage(Image *image,const char *level) |
| { |
| GeometryInfo |
| geometry_info; |
| |
| MagickPixelPacket |
| gamma; |
| |
| MagickStatusType |
| flags, |
| status; |
| |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| if (level == (char *) NULL) |
| return(MagickFalse); |
| flags=ParseGeometry(level,&geometry_info); |
| gamma.red=geometry_info.rho; |
| gamma.green=geometry_info.sigma; |
| if ((flags & SigmaValue) == 0) |
| gamma.green=gamma.red; |
| gamma.blue=geometry_info.xi; |
| if ((flags & XiValue) == 0) |
| gamma.blue=gamma.red; |
| if ((gamma.red == 1.0) && (gamma.green == 1.0) && (gamma.blue == 1.0)) |
| return(MagickTrue); |
| if ((gamma.red == gamma.green) && (gamma.green == gamma.blue)) |
| status=GammaImageChannel(image,(const ChannelType) (RedChannel | |
| GreenChannel | BlueChannel),(double) gamma.red); |
| else |
| { |
| status=GammaImageChannel(image,RedChannel,(double) gamma.red); |
| status|=GammaImageChannel(image,GreenChannel,(double) gamma.green); |
| status|=GammaImageChannel(image,BlueChannel,(double) gamma.blue); |
| } |
| return(status != 0 ? MagickTrue : MagickFalse); |
| } |
| |
| MagickExport MagickBooleanType GammaImageChannel(Image *image, |
| const ChannelType channel,const double gamma) |
| { |
| #define GammaCorrectImageTag "GammaCorrect/Image" |
| |
| CacheView |
| *image_view; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| Quantum |
| *gamma_map; |
| |
| register long |
| i; |
| |
| /* |
| Allocate and initialize gamma maps. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| if (gamma == 1.0) |
| return(MagickTrue); |
| gamma_map=(Quantum *) AcquireQuantumMemory(MaxMap+1UL,sizeof(*gamma_map)); |
| if (gamma_map == (Quantum *) NULL) |
| ThrowBinaryException(ResourceLimitError,"MemoryAllocationFailed", |
| image->filename); |
| (void) ResetMagickMemory(gamma_map,0,(MaxMap+1)*sizeof(*gamma_map)); |
| if (gamma != 0.0) |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) |
| #endif |
| for (i=0; i <= (long) MaxMap; i++) |
| gamma_map[i]=ClampToQuantum((MagickRealType) ScaleMapToQuantum(( |
| MagickRealType) (MaxMap*pow((double) i/MaxMap,1.0/gamma)))); |
| if (image->storage_class == PseudoClass) |
| { |
| /* |
| Gamma-correct colormap. |
| */ |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i < (long) image->colors; i++) |
| { |
| if ((channel & RedChannel) != 0) |
| image->colormap[i].red=gamma_map[ |
| ScaleQuantumToMap(image->colormap[i].red)]; |
| if ((channel & GreenChannel) != 0) |
| image->colormap[i].green=gamma_map[ |
| ScaleQuantumToMap(image->colormap[i].green)]; |
| if ((channel & BlueChannel) != 0) |
| image->colormap[i].blue=gamma_map[ |
| ScaleQuantumToMap(image->colormap[i].blue)]; |
| if ((channel & OpacityChannel) != 0) |
| { |
| if (image->matte == MagickFalse) |
| image->colormap[i].opacity=gamma_map[ |
| ScaleQuantumToMap(image->colormap[i].opacity)]; |
| else |
| image->colormap[i].opacity=(Quantum) QuantumRange- |
| gamma_map[ScaleQuantumToMap((Quantum) (QuantumRange- |
| image->colormap[i].opacity))]; |
| } |
| } |
| } |
| /* |
| Gamma-correct image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| exception=(&image->exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if (channel == DefaultChannels) |
| { |
| q->red=gamma_map[ScaleQuantumToMap(q->red)]; |
| q->green=gamma_map[ScaleQuantumToMap(q->green)]; |
| q->blue=gamma_map[ScaleQuantumToMap(q->blue)]; |
| } |
| else |
| { |
| if ((channel & RedChannel) != 0) |
| q->red=gamma_map[ScaleQuantumToMap(q->red)]; |
| if ((channel & GreenChannel) != 0) |
| q->green=gamma_map[ScaleQuantumToMap(q->green)]; |
| if ((channel & BlueChannel) != 0) |
| q->blue=gamma_map[ScaleQuantumToMap(q->blue)]; |
| if ((channel & OpacityChannel) != 0) |
| { |
| if (image->matte == MagickFalse) |
| q->opacity=gamma_map[ScaleQuantumToMap(q->opacity)]; |
| else |
| q->opacity=(Quantum) QuantumRange-gamma_map[ |
| ScaleQuantumToMap((Quantum) GetAlphaPixelComponent(q))]; |
| } |
| } |
| q++; |
| } |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| for (x=0; x < (long) image->columns; x++) |
| indexes[x]=gamma_map[ScaleQuantumToMap(indexes[x])]; |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_GammaImageChannel) |
| #endif |
| proceed=SetImageProgress(image,GammaCorrectImageTag,progress++, |
| image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| gamma_map=(Quantum *) RelinquishMagickMemory(gamma_map); |
| if (image->gamma != 0.0) |
| image->gamma*=gamma; |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % H a l d C l u t I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % HaldClutImage() applies a Hald color lookup table to the image. A Hald |
| % color lookup table is a 3-dimensional color cube mapped to 2 dimensions. |
| % Create it with the HALD coder. You can apply any color transformation to |
| % the Hald image and then use this method to apply the transform to the |
| % image. |
| % |
| % The format of the HaldClutImage method is: |
| % |
| % MagickBooleanType HaldClutImage(Image *image,Image *hald_image) |
| % MagickBooleanType HaldClutImageChannel(Image *image, |
| % const ChannelType channel,Image *hald_image) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image, which is replaced by indexed CLUT values |
| % |
| % o hald_image: the color lookup table image for replacement color values. |
| % |
| % o channel: the channel. |
| % |
| */ |
| |
| static inline size_t MagickMin(const size_t x,const size_t y) |
| { |
| if (x < y) |
| return(x); |
| return(y); |
| } |
| |
| MagickExport MagickBooleanType HaldClutImage(Image *image, |
| const Image *hald_image) |
| { |
| return(HaldClutImageChannel(image,DefaultChannels,hald_image)); |
| } |
| |
| MagickExport MagickBooleanType HaldClutImageChannel(Image *image, |
| const ChannelType channel,const Image *hald_image) |
| { |
| #define HaldClutImageTag "Clut/Image" |
| |
| typedef struct _HaldInfo |
| { |
| MagickRealType |
| x, |
| y, |
| z; |
| } HaldInfo; |
| |
| CacheView |
| *image_view; |
| |
| double |
| width; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| MagickPixelPacket |
| zero; |
| |
| ResampleFilter |
| **restrict resample_filter; |
| |
| size_t |
| cube_size, |
| length, |
| level; |
| |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(hald_image != (Image *) NULL); |
| assert(hald_image->signature == MagickSignature); |
| if (SetImageStorageClass(image,DirectClass) == MagickFalse) |
| return(MagickFalse); |
| if (image->matte == MagickFalse) |
| (void) SetImageAlphaChannel(image,OpaqueAlphaChannel); |
| /* |
| Hald clut image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| length=MagickMin(hald_image->columns,hald_image->rows); |
| for (level=2; (level*level*level) < length; level++) ; |
| level*=level; |
| cube_size=level*level; |
| width=(double) hald_image->columns; |
| GetMagickPixelPacket(hald_image,&zero); |
| exception=(&image->exception); |
| resample_filter=AcquireResampleFilterThreadSet(hald_image,MagickTrue, |
| exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| double |
| offset; |
| |
| HaldInfo |
| point; |
| |
| MagickPixelPacket |
| pixel, |
| pixel1, |
| pixel2, |
| pixel3, |
| pixel4; |
| |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| id, |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| pixel=zero; |
| pixel1=zero; |
| pixel2=zero; |
| pixel3=zero; |
| pixel4=zero; |
| id=GetOpenMPThreadId(); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| point.x=QuantumScale*(level-1.0)*q->red; |
| point.y=QuantumScale*(level-1.0)*q->green; |
| point.z=QuantumScale*(level-1.0)*q->blue; |
| offset=point.x+level*floor(point.y)+cube_size*floor(point.z); |
| point.x-=floor(point.x); |
| point.y-=floor(point.y); |
| point.z-=floor(point.z); |
| (void) ResamplePixelColor(resample_filter[id],fmod(offset,width), |
| floor(offset/width),&pixel1); |
| (void) ResamplePixelColor(resample_filter[id],fmod(offset+level,width), |
| floor((offset+level)/width),&pixel2); |
| MagickPixelCompositeAreaBlend(&pixel1,pixel1.opacity,&pixel2, |
| pixel2.opacity,point.y,&pixel3); |
| offset+=cube_size; |
| (void) ResamplePixelColor(resample_filter[id],fmod(offset,width), |
| floor(offset/width),&pixel1); |
| (void) ResamplePixelColor(resample_filter[id],fmod(offset+level,width), |
| floor((offset+level)/width),&pixel2); |
| MagickPixelCompositeAreaBlend(&pixel1,pixel1.opacity,&pixel2, |
| pixel2.opacity,point.y,&pixel4); |
| MagickPixelCompositeAreaBlend(&pixel3,pixel3.opacity,&pixel4, |
| pixel4.opacity,point.z,&pixel); |
| if ((channel & RedChannel) != 0) |
| SetRedPixelComponent(q,ClampRedPixelComponent(&pixel)); |
| if ((channel & GreenChannel) != 0) |
| SetGreenPixelComponent(q,ClampGreenPixelComponent(&pixel)); |
| if ((channel & BlueChannel) != 0) |
| SetBluePixelComponent(q,ClampBluePixelComponent(&pixel)); |
| if (((channel & OpacityChannel) != 0) && (image->matte != MagickFalse)) |
| SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| indexes[x]=ClampToQuantum(pixel.index); |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_HaldClutImageChannel) |
| #endif |
| proceed=SetImageProgress(image,HaldClutImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| resample_filter=DestroyResampleFilterThreadSet(resample_filter); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % L e v e l I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % LevelImage() adjusts the levels of a particular image channel by |
| % scaling the colors falling between specified white and black points to |
| % the full available quantum range. |
| % |
| % The parameters provided represent the black, and white points. The black |
| % point specifies the darkest color in the image. Colors darker than the |
| % black point are set to zero. White point specifies the lightest color in |
| % the image. Colors brighter than the white point are set to the maximum |
| % quantum value. |
| % |
| % If a '!' flag is given, map black and white colors to the given levels |
| % rather than mapping those levels to black and white. See |
| % LevelizeImageChannel() and LevelizeImageChannel(), below. |
| % |
| % Gamma specifies a gamma correction to apply to the image. |
| % |
| % The format of the LevelImage method is: |
| % |
| % MagickBooleanType LevelImage(Image *image,const char *levels) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o levels: Specify the levels where the black and white points have the |
| % range of 0-QuantumRange, and gamma has the range 0-10 (e.g. 10x90%+2). |
| % A '!' flag inverts the re-mapping. |
| % |
| */ |
| |
| MagickExport MagickBooleanType LevelImage(Image *image,const char *levels) |
| { |
| double |
| black_point, |
| gamma, |
| white_point; |
| |
| GeometryInfo |
| geometry_info; |
| |
| MagickBooleanType |
| status; |
| |
| MagickStatusType |
| flags; |
| |
| /* |
| Parse levels. |
| */ |
| if (levels == (char *) NULL) |
| return(MagickFalse); |
| flags=ParseGeometry(levels,&geometry_info); |
| black_point=geometry_info.rho; |
| white_point=(double) QuantumRange; |
| if ((flags & SigmaValue) != 0) |
| white_point=geometry_info.sigma; |
| gamma=1.0; |
| if ((flags & XiValue) != 0) |
| gamma=geometry_info.xi; |
| if ((flags & PercentValue) != 0) |
| { |
| black_point*=(double) image->columns*image->rows/100.0; |
| white_point*=(double) image->columns*image->rows/100.0; |
| } |
| if ((flags & SigmaValue) == 0) |
| white_point=(double) QuantumRange-black_point; |
| if ((flags & AspectValue ) == 0) |
| status=LevelImageChannel(image,DefaultChannels,black_point,white_point, |
| gamma); |
| else |
| status=LevelizeImage(image,black_point,white_point,gamma); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % L e v e l i z e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % LevelizeImage() applies the normal level operation to the image, spreading |
| % out the values between the black and white points over the entire range of |
| % values. Gamma correction is also applied after the values has been mapped. |
| % |
| % It is typically used to improve image contrast, or to provide a controlled |
| % linear threshold for the image. If the black and white points are set to |
| % the minimum and maximum values found in the image, the image can be |
| % normalized. or by swapping black and white values, negate the image. |
| % |
| % The format of the LevelizeImage method is: |
| % |
| % MagickBooleanType LevelizeImage(Image *image,const double black_point, |
| % const double white_point,const double gamma) |
| % MagickBooleanType LevelizeImageChannel(Image *image, |
| % const ChannelType channel,const double black_point, |
| % const double white_point,const double gamma) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| % o black_point: The level which is to be mapped to zero (black) |
| % |
| % o white_point: The level which is to be mapped to QuantiumRange (white) |
| % |
| % o gamma: adjust gamma by this factor before mapping values. |
| % use 1.0 for purely linear stretching of image color values |
| % |
| */ |
| |
| MagickExport MagickBooleanType LevelizeImage(Image *image, |
| const double black_point,const double white_point,const double gamma) |
| { |
| MagickBooleanType |
| status; |
| |
| status=LevelizeImageChannel(image,DefaultChannels,black_point,white_point, |
| gamma); |
| return(status); |
| } |
| |
| MagickExport MagickBooleanType LevelImageChannel(Image *image, |
| const ChannelType channel,const double black_point,const double white_point, |
| const double gamma) |
| { |
| #define LevelImageTag "Level/Image" |
| #define LevelValue(x) (ClampToQuantum((MagickRealType) QuantumRange* \ |
| pow(((double) (x)-black_point)/(white_point-black_point),1.0/gamma))) |
| |
| CacheView |
| *image_view; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| register long |
| i; |
| |
| /* |
| Allocate and initialize levels map. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| if (image->storage_class == PseudoClass) |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i < (long) image->colors; i++) |
| { |
| /* |
| Level colormap. |
| */ |
| if ((channel & RedChannel) != 0) |
| image->colormap[i].red=LevelValue(image->colormap[i].red); |
| if ((channel & GreenChannel) != 0) |
| image->colormap[i].green=LevelValue(image->colormap[i].green); |
| if ((channel & BlueChannel) != 0) |
| image->colormap[i].blue=LevelValue(image->colormap[i].blue); |
| if ((channel & OpacityChannel) != 0) |
| image->colormap[i].opacity=LevelValue(image->colormap[i].opacity); |
| } |
| /* |
| Level image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| exception=(&image->exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if ((channel & RedChannel) != 0) |
| q->red=LevelValue(q->red); |
| if ((channel & GreenChannel) != 0) |
| q->green=LevelValue(q->green); |
| if ((channel & BlueChannel) != 0) |
| q->blue=LevelValue(q->blue); |
| if (((channel & OpacityChannel) != 0) && |
| (image->matte == MagickTrue)) |
| q->opacity=LevelValue(q->opacity); |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| indexes[x]=LevelValue(indexes[x]); |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_LevelImageChannel) |
| #endif |
| proceed=SetImageProgress(image,LevelImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % L e v e l i z e I m a g e C h a n n e l % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % LevelizeImageChannel() applies the reversed LevelImage() operation to just |
| % the specific channels specified. It compresses the full range of color |
| % values, so that they lie between the given black and white points. Gamma is |
| % applied before the values are mapped. |
| % |
| % LevelizeImageChannel() can be called with by using a +level command line |
| % API option, or using a '!' on a -level or LevelImage() geometry string. |
| % |
| % It can be used for example de-contrast a greyscale image to the exact |
| % levels specified. Or by using specific levels for each channel of an image |
| % you can convert a gray-scale image to any linear color gradient, according |
| % to those levels. |
| % |
| % The format of the LevelizeImageChannel method is: |
| % |
| % MagickBooleanType LevelizeImageChannel(Image *image, |
| % const ChannelType channel,const char *levels) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| % o black_point: The level to map zero (black) to. |
| % |
| % o white_point: The level to map QuantiumRange (white) to. |
| % |
| % o gamma: adjust gamma by this factor before mapping values. |
| % |
| */ |
| MagickExport MagickBooleanType LevelizeImageChannel(Image *image, |
| const ChannelType channel,const double black_point,const double white_point, |
| const double gamma) |
| { |
| #define LevelizeImageTag "Levelize/Image" |
| #define LevelizeValue(x) (ClampToQuantum(((MagickRealType) \ |
| pow((double)(QuantumScale*(x)),1.0/gamma))*(white_point-black_point)+ \ |
| black_point)) |
| |
| CacheView |
| *image_view; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| register long |
| i; |
| |
| /* |
| Allocate and initialize levels map. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| if (image->storage_class == PseudoClass) |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i < (long) image->colors; i++) |
| { |
| /* |
| Level colormap. |
| */ |
| if ((channel & RedChannel) != 0) |
| image->colormap[i].red=LevelizeValue(image->colormap[i].red); |
| if ((channel & GreenChannel) != 0) |
| image->colormap[i].green=LevelizeValue(image->colormap[i].green); |
| if ((channel & BlueChannel) != 0) |
| image->colormap[i].blue=LevelizeValue(image->colormap[i].blue); |
| if ((channel & OpacityChannel) != 0) |
| image->colormap[i].opacity=LevelizeValue(image->colormap[i].opacity); |
| } |
| /* |
| Level image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| exception=(&image->exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if ((channel & RedChannel) != 0) |
| q->red=LevelizeValue(q->red); |
| if ((channel & GreenChannel) != 0) |
| q->green=LevelizeValue(q->green); |
| if ((channel & BlueChannel) != 0) |
| q->blue=LevelizeValue(q->blue); |
| if (((channel & OpacityChannel) != 0) && |
| (image->matte == MagickTrue)) |
| q->opacity=LevelizeValue(q->opacity); |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| indexes[x]=LevelizeValue(indexes[x]); |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_LevelizeImageChannel) |
| #endif |
| proceed=SetImageProgress(image,LevelizeImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % L e v e l I m a g e C o l o r s % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % LevelImageColor() maps the given color to "black" and "white" values, |
| % linearly spreading out the colors, and level values on a channel by channel |
| % bases, as per LevelImage(). The given colors allows you to specify |
| % different level ranges for each of the color channels seperatally. |
| % |
| % If the boolean 'invert' is set true the image values will modifyed in the |
| % reverse direction. That is any existing "black" and "white" colors in the |
| % image will become the color values given, with all other values compressed |
| % appropriatally. This effectivally maps a greyscale gradient into the given |
| % color gradient. |
| % |
| % The format of the LevelColorsImageChannel method is: |
| % |
| % MagickBooleanType LevelColorsImage(Image *image, |
| % const MagickPixelPacket *black_color, |
| % const MagickPixelPacket *white_color,const MagickBooleanType invert) |
| % MagickBooleanType LevelColorsImageChannel(Image *image, |
| % const ChannelType channel,const MagickPixelPacket *black_color, |
| % const MagickPixelPacket *white_color,const MagickBooleanType invert) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| % o black_color: The color to map black to/from |
| % |
| % o white_point: The color to map white to/from |
| % |
| % o invert: if true map the colors (levelize), rather than from (level) |
| % |
| */ |
| |
| MagickExport MagickBooleanType LevelColorsImage(Image *image, |
| const MagickPixelPacket *black_color,const MagickPixelPacket *white_color, |
| const MagickBooleanType invert) |
| { |
| MagickBooleanType |
| status; |
| |
| status=LevelColorsImageChannel(image,DefaultChannels,black_color,white_color, |
| invert); |
| return(status); |
| } |
| |
| MagickExport MagickBooleanType LevelColorsImageChannel(Image *image, |
| const ChannelType channel,const MagickPixelPacket *black_color, |
| const MagickPixelPacket *white_color,const MagickBooleanType invert) |
| { |
| MagickStatusType |
| status; |
| |
| /* |
| Allocate and initialize levels map. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| status=MagickFalse; |
| if (invert == MagickFalse) |
| { |
| if ((channel & RedChannel) != 0) |
| status|=LevelImageChannel(image,RedChannel, |
| black_color->red,white_color->red,(double) 1.0); |
| if ((channel & GreenChannel) != 0) |
| status|=LevelImageChannel(image,GreenChannel, |
| black_color->green,white_color->green,(double) 1.0); |
| if ((channel & BlueChannel) != 0) |
| status|=LevelImageChannel(image,BlueChannel, |
| black_color->blue,white_color->blue,(double) 1.0); |
| if (((channel & OpacityChannel) != 0) && |
| (image->matte == MagickTrue)) |
| status|=LevelImageChannel(image,OpacityChannel, |
| black_color->opacity,white_color->opacity,(double) 1.0); |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| status|=LevelImageChannel(image,IndexChannel, |
| black_color->index,white_color->index,(double) 1.0); |
| } |
| else |
| { |
| if ((channel & RedChannel) != 0) |
| status|=LevelizeImageChannel(image,RedChannel, |
| black_color->red,white_color->red,(double) 1.0); |
| if ((channel & GreenChannel) != 0) |
| status|=LevelizeImageChannel(image,GreenChannel, |
| black_color->green,white_color->green,(double) 1.0); |
| if ((channel & BlueChannel) != 0) |
| status|=LevelizeImageChannel(image,BlueChannel, |
| black_color->blue,white_color->blue,(double) 1.0); |
| if (((channel & OpacityChannel) != 0) && |
| (image->matte == MagickTrue)) |
| status|=LevelizeImageChannel(image,OpacityChannel, |
| black_color->opacity,white_color->opacity,(double) 1.0); |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| status|=LevelizeImageChannel(image,IndexChannel, |
| black_color->index,white_color->index,(double) 1.0); |
| } |
| return(status == 0 ? MagickFalse : MagickTrue); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % L i n e a r S t r e t c h I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % The LinearStretchImage() discards any pixels below the black point and |
| % above the white point and levels the remaining pixels. |
| % |
| % The format of the LinearStretchImage method is: |
| % |
| % MagickBooleanType LinearStretchImage(Image *image, |
| % const double black_point,const double white_point) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o black_point: the black point. |
| % |
| % o white_point: the white point. |
| % |
| */ |
| MagickExport MagickBooleanType LinearStretchImage(Image *image, |
| const double black_point,const double white_point) |
| { |
| #define LinearStretchImageTag "LinearStretch/Image" |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| black, |
| white, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| MagickRealType |
| *histogram, |
| intensity; |
| |
| MagickSizeType |
| number_pixels; |
| |
| /* |
| Allocate histogram and linear map. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| histogram=(MagickRealType *) AcquireQuantumMemory(MaxMap+1UL, |
| sizeof(*histogram)); |
| if (histogram == (MagickRealType *) NULL) |
| ThrowBinaryException(ResourceLimitError,"MemoryAllocationFailed", |
| image->filename); |
| /* |
| Form histogram. |
| */ |
| (void) ResetMagickMemory(histogram,0,(MaxMap+1)*sizeof(*histogram)); |
| exception=(&image->exception); |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register const PixelPacket |
| *restrict p; |
| |
| register long |
| x; |
| |
| p=GetVirtualPixels(image,0,y,image->columns,1,exception); |
| if (p == (const PixelPacket *) NULL) |
| break; |
| for (x=(long) image->columns-1; x >= 0; x--) |
| { |
| histogram[ScaleQuantumToMap(PixelIntensityToQuantum(p))]++; |
| p++; |
| } |
| } |
| /* |
| Find the histogram boundaries by locating the black and white point levels. |
| */ |
| number_pixels=(MagickSizeType) image->columns*image->rows; |
| intensity=0.0; |
| for (black=0; black < (long) MaxMap; black++) |
| { |
| intensity+=histogram[black]; |
| if (intensity >= black_point) |
| break; |
| } |
| intensity=0.0; |
| for (white=(long) MaxMap; white != 0; white--) |
| { |
| intensity+=histogram[white]; |
| if (intensity >= white_point) |
| break; |
| } |
| histogram=(MagickRealType *) RelinquishMagickMemory(histogram); |
| status=LevelImageChannel(image,DefaultChannels,(double) black,(double) white, |
| 1.0); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % M o d u l a t e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % ModulateImage() lets you control the brightness, saturation, and hue |
| % of an image. Modulate represents the brightness, saturation, and hue |
| % as one parameter (e.g. 90,150,100). If the image colorspace is HSL, the |
| % modulation is lightness, saturation, and hue. And if the colorspace is |
| % HWB, use blackness, whiteness, and hue. |
| % |
| % The format of the ModulateImage method is: |
| % |
| % MagickBooleanType ModulateImage(Image *image,const char *modulate) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o modulate: Define the percent change in brightness, saturation, and |
| % hue. |
| % |
| */ |
| |
| static void ModulateHSB(const double percent_hue, |
| const double percent_saturation,const double percent_brightness, |
| Quantum *red,Quantum *green,Quantum *blue) |
| { |
| double |
| brightness, |
| hue, |
| saturation; |
| |
| /* |
| Increase or decrease color brightness, saturation, or hue. |
| */ |
| assert(red != (Quantum *) NULL); |
| assert(green != (Quantum *) NULL); |
| assert(blue != (Quantum *) NULL); |
| ConvertRGBToHSB(*red,*green,*blue,&hue,&saturation,&brightness); |
| hue+=0.5*(0.01*percent_hue-1.0); |
| while (hue < 0.0) |
| hue+=1.0; |
| while (hue > 1.0) |
| hue-=1.0; |
| saturation*=0.01*percent_saturation; |
| brightness*=0.01*percent_brightness; |
| ConvertHSBToRGB(hue,saturation,brightness,red,green,blue); |
| } |
| |
| static void ModulateHSL(const double percent_hue, |
| const double percent_saturation,const double percent_lightness, |
| Quantum *red,Quantum *green,Quantum *blue) |
| { |
| double |
| hue, |
| lightness, |
| saturation; |
| |
| /* |
| Increase or decrease color lightness, saturation, or hue. |
| */ |
| assert(red != (Quantum *) NULL); |
| assert(green != (Quantum *) NULL); |
| assert(blue != (Quantum *) NULL); |
| ConvertRGBToHSL(*red,*green,*blue,&hue,&saturation,&lightness); |
| hue+=0.5*(0.01*percent_hue-1.0); |
| while (hue < 0.0) |
| hue+=1.0; |
| while (hue > 1.0) |
| hue-=1.0; |
| saturation*=0.01*percent_saturation; |
| lightness*=0.01*percent_lightness; |
| ConvertHSLToRGB(hue,saturation,lightness,red,green,blue); |
| } |
| |
| static void ModulateHWB(const double percent_hue,const double percent_whiteness, const double percent_blackness,Quantum *red,Quantum *green,Quantum *blue) |
| { |
| double |
| blackness, |
| hue, |
| whiteness; |
| |
| /* |
| Increase or decrease color blackness, whiteness, or hue. |
| */ |
| assert(red != (Quantum *) NULL); |
| assert(green != (Quantum *) NULL); |
| assert(blue != (Quantum *) NULL); |
| ConvertRGBToHWB(*red,*green,*blue,&hue,&whiteness,&blackness); |
| hue+=0.5*(0.01*percent_hue-1.0); |
| while (hue < 0.0) |
| hue+=1.0; |
| while (hue > 1.0) |
| hue-=1.0; |
| blackness*=0.01*percent_blackness; |
| whiteness*=0.01*percent_whiteness; |
| ConvertHWBToRGB(hue,whiteness,blackness,red,green,blue); |
| } |
| |
| MagickExport MagickBooleanType ModulateImage(Image *image,const char *modulate) |
| { |
| #define ModulateImageTag "Modulate/Image" |
| |
| CacheView |
| *image_view; |
| |
| ColorspaceType |
| colorspace; |
| |
| const char |
| *artifact; |
| |
| double |
| percent_brightness, |
| percent_hue, |
| percent_saturation; |
| |
| ExceptionInfo |
| *exception; |
| |
| GeometryInfo |
| geometry_info; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| MagickStatusType |
| flags; |
| |
| register long |
| i; |
| |
| /* |
| Initialize modulate table. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| if (modulate == (char *) NULL) |
| return(MagickFalse); |
| flags=ParseGeometry(modulate,&geometry_info); |
| percent_brightness=geometry_info.rho; |
| percent_saturation=geometry_info.sigma; |
| if ((flags & SigmaValue) == 0) |
| percent_saturation=100.0; |
| percent_hue=geometry_info.xi; |
| if ((flags & XiValue) == 0) |
| percent_hue=100.0; |
| colorspace=UndefinedColorspace; |
| artifact=GetImageArtifact(image,"modulate:colorspace"); |
| if (artifact != (const char *) NULL) |
| colorspace=(ColorspaceType) ParseMagickOption(MagickColorspaceOptions, |
| MagickFalse,artifact); |
| if (image->storage_class == PseudoClass) |
| { |
| /* |
| Modulate colormap. |
| */ |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i < (long) image->colors; i++) |
| switch (colorspace) |
| { |
| case HSBColorspace: |
| { |
| ModulateHSB(percent_hue,percent_saturation,percent_brightness, |
| &image->colormap[i].red,&image->colormap[i].green, |
| &image->colormap[i].blue); |
| break; |
| } |
| case HSLColorspace: |
| default: |
| { |
| ModulateHSL(percent_hue,percent_saturation,percent_brightness, |
| &image->colormap[i].red,&image->colormap[i].green, |
| &image->colormap[i].blue); |
| break; |
| } |
| case HWBColorspace: |
| { |
| ModulateHWB(percent_hue,percent_saturation,percent_brightness, |
| &image->colormap[i].red,&image->colormap[i].green, |
| &image->colormap[i].blue); |
| break; |
| } |
| } |
| } |
| /* |
| Modulate image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| exception=(&image->exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| for (x=0; x < (long) image->columns; x++) |
| { |
| switch (colorspace) |
| { |
| case HSBColorspace: |
| { |
| ModulateHSB(percent_hue,percent_saturation,percent_brightness, |
| &q->red,&q->green,&q->blue); |
| break; |
| } |
| case HSLColorspace: |
| default: |
| { |
| ModulateHSL(percent_hue,percent_saturation,percent_brightness, |
| &q->red,&q->green,&q->blue); |
| break; |
| } |
| case HWBColorspace: |
| { |
| ModulateHWB(percent_hue,percent_saturation,percent_brightness, |
| &q->red,&q->green,&q->blue); |
| break; |
| } |
| } |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_ModulateImage) |
| #endif |
| proceed=SetImageProgress(image,ModulateImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % N e g a t e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % NegateImage() negates the colors in the reference image. The grayscale |
| % option means that only grayscale values within the image are negated. |
| % |
| % The format of the NegateImageChannel method is: |
| % |
| % MagickBooleanType NegateImage(Image *image, |
| % const MagickBooleanType grayscale) |
| % MagickBooleanType NegateImageChannel(Image *image, |
| % const ChannelType channel,const MagickBooleanType grayscale) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| % o grayscale: If MagickTrue, only negate grayscale pixels within the image. |
| % |
| */ |
| |
| MagickExport MagickBooleanType NegateImage(Image *image, |
| const MagickBooleanType grayscale) |
| { |
| MagickBooleanType |
| status; |
| |
| status=NegateImageChannel(image,DefaultChannels,grayscale); |
| return(status); |
| } |
| |
| MagickExport MagickBooleanType NegateImageChannel(Image *image, |
| const ChannelType channel,const MagickBooleanType grayscale) |
| { |
| #define NegateImageTag "Negate/Image" |
| |
| CacheView |
| *image_view; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| register long |
| i; |
| |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| if (image->storage_class == PseudoClass) |
| { |
| /* |
| Negate colormap. |
| */ |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i < (long) image->colors; i++) |
| { |
| if (grayscale != MagickFalse) |
| if ((image->colormap[i].red != image->colormap[i].green) || |
| (image->colormap[i].green != image->colormap[i].blue)) |
| continue; |
| if ((channel & RedChannel) != 0) |
| image->colormap[i].red=(Quantum) QuantumRange- |
| image->colormap[i].red; |
| if ((channel & GreenChannel) != 0) |
| image->colormap[i].green=(Quantum) QuantumRange- |
| image->colormap[i].green; |
| if ((channel & BlueChannel) != 0) |
| image->colormap[i].blue=(Quantum) QuantumRange- |
| image->colormap[i].blue; |
| } |
| } |
| /* |
| Negate image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| exception=(&image->exception); |
| image_view=AcquireCacheView(image); |
| if (grayscale != MagickFalse) |
| { |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| MagickBooleanType |
| sync; |
| |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1, |
| exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if ((q->red != q->green) || (q->green != q->blue)) |
| { |
| q++; |
| continue; |
| } |
| if ((channel & RedChannel) != 0) |
| q->red=(Quantum) QuantumRange-q->red; |
| if ((channel & GreenChannel) != 0) |
| q->green=(Quantum) QuantumRange-q->green; |
| if ((channel & BlueChannel) != 0) |
| q->blue=(Quantum) QuantumRange-q->blue; |
| if ((channel & OpacityChannel) != 0) |
| q->opacity=(Quantum) QuantumRange-q->opacity; |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| indexes[x]=(IndexPacket) QuantumRange-indexes[x]; |
| q++; |
| } |
| sync=SyncCacheViewAuthenticPixels(image_view,exception); |
| if (sync == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_NegateImageChannel) |
| #endif |
| proceed=SetImageProgress(image,NegateImageTag,progress++, |
| image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| return(MagickTrue); |
| } |
| /* |
| Negate image. |
| */ |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if ((channel & RedChannel) != 0) |
| q->red=(Quantum) QuantumRange-q->red; |
| if ((channel & GreenChannel) != 0) |
| q->green=(Quantum) QuantumRange-q->green; |
| if ((channel & BlueChannel) != 0) |
| q->blue=(Quantum) QuantumRange-q->blue; |
| if ((channel & OpacityChannel) != 0) |
| q->opacity=(Quantum) QuantumRange-q->opacity; |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| indexes[x]=(IndexPacket) QuantumRange-indexes[x]; |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_NegateImageChannel) |
| #endif |
| proceed=SetImageProgress(image,NegateImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| return(status); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % N o r m a l i z e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % The NormalizeImage() method enhances the contrast of a color image by |
| % mapping the darkest 2 percent of all pixel to black and the brightest |
| % 1 percent to white. |
| % |
| % The format of the NormalizeImage method is: |
| % |
| % MagickBooleanType NormalizeImage(Image *image) |
| % MagickBooleanType NormalizeImageChannel(Image *image, |
| % const ChannelType channel) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| */ |
| |
| MagickExport MagickBooleanType NormalizeImage(Image *image) |
| { |
| MagickBooleanType |
| status; |
| |
| status=NormalizeImageChannel(image,DefaultChannels); |
| return(status); |
| } |
| |
| MagickExport MagickBooleanType NormalizeImageChannel(Image *image, |
| const ChannelType channel) |
| { |
| double |
| black_point, |
| white_point; |
| |
| black_point=(double) image->columns*image->rows*0.02; |
| white_point=(double) image->columns*image->rows*0.99; |
| return(ContrastStretchImageChannel(image,channel,black_point,white_point)); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % S i g m o i d a l C o n t r a s t I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % SigmoidalContrastImage() adjusts the contrast of an image with a non-linear |
| % sigmoidal contrast algorithm. Increase the contrast of the image using a |
| % sigmoidal transfer function without saturating highlights or shadows. |
| % Contrast indicates how much to increase the contrast (0 is none; 3 is |
| % typical; 20 is pushing it); mid-point indicates where midtones fall in the |
| % resultant image (0 is white; 50% is middle-gray; 100% is black). Set |
| % sharpen to MagickTrue to increase the image contrast otherwise the contrast |
| % is reduced. |
| % |
| % The format of the SigmoidalContrastImage method is: |
| % |
| % MagickBooleanType SigmoidalContrastImage(Image *image, |
| % const MagickBooleanType sharpen,const char *levels) |
| % MagickBooleanType SigmoidalContrastImageChannel(Image *image, |
| % const ChannelType channel,const MagickBooleanType sharpen, |
| % const double contrast,const double midpoint) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o channel: the channel. |
| % |
| % o sharpen: Increase or decrease image contrast. |
| % |
| % o contrast: control the "shoulder" of the contast curve. |
| % |
| % o midpoint: control the "toe" of the contast curve. |
| % |
| */ |
| |
| MagickExport MagickBooleanType SigmoidalContrastImage(Image *image, |
| const MagickBooleanType sharpen,const char *levels) |
| { |
| GeometryInfo |
| geometry_info; |
| |
| MagickBooleanType |
| status; |
| |
| MagickStatusType |
| flags; |
| |
| flags=ParseGeometry(levels,&geometry_info); |
| if ((flags & SigmaValue) == 0) |
| geometry_info.sigma=1.0*QuantumRange/2.0; |
| if ((flags & PercentValue) != 0) |
| geometry_info.sigma=1.0*QuantumRange*geometry_info.sigma/100.0; |
| status=SigmoidalContrastImageChannel(image,DefaultChannels,sharpen, |
| geometry_info.rho,geometry_info.sigma); |
| return(status); |
| } |
| |
| MagickExport MagickBooleanType SigmoidalContrastImageChannel(Image *image, |
| const ChannelType channel,const MagickBooleanType sharpen, |
| const double contrast,const double midpoint) |
| { |
| #define SigmoidalContrastImageTag "SigmoidalContrast/Image" |
| |
| CacheView |
| *image_view; |
| |
| ExceptionInfo |
| *exception; |
| |
| long |
| progress, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| MagickRealType |
| *sigmoidal_map; |
| |
| register long |
| i; |
| |
| /* |
| Allocate and initialize sigmoidal maps. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| sigmoidal_map=(MagickRealType *) AcquireQuantumMemory(MaxMap+1UL, |
| sizeof(*sigmoidal_map)); |
| if (sigmoidal_map == (MagickRealType *) NULL) |
| ThrowBinaryException(ResourceLimitError,"MemoryAllocationFailed", |
| image->filename); |
| (void) ResetMagickMemory(sigmoidal_map,0,(MaxMap+1)*sizeof(*sigmoidal_map)); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i <= (long) MaxMap; i++) |
| { |
| if (sharpen != MagickFalse) |
| { |
| sigmoidal_map[i]=(MagickRealType) ScaleMapToQuantum((MagickRealType) |
| (MaxMap*((1.0/(1.0+exp(contrast*(midpoint/(double) QuantumRange- |
| (double) i/MaxMap))))-(1.0/(1.0+exp(contrast*(midpoint/ |
| (double) QuantumRange)))))/((1.0/(1.0+exp(contrast*(midpoint/ |
| (double) QuantumRange-1.0))))-(1.0/(1.0+exp(contrast*(midpoint/ |
| (double) QuantumRange)))))+0.5)); |
| continue; |
| } |
| sigmoidal_map[i]=(MagickRealType) ScaleMapToQuantum((MagickRealType) |
| (MaxMap*(QuantumScale*midpoint-log((1.0-(1.0/(1.0+exp(midpoint/ |
| (double) QuantumRange*contrast))+((double) i/MaxMap)*((1.0/ |
| (1.0+exp(contrast*(midpoint/(double) QuantumRange-1.0))))-(1.0/ |
| (1.0+exp(midpoint/(double) QuantumRange*contrast))))))/ |
| (1.0/(1.0+exp(midpoint/(double) QuantumRange*contrast))+ |
| ((double) i/MaxMap)*((1.0/(1.0+exp(contrast*(midpoint/ |
| (double) QuantumRange-1.0))))-(1.0/(1.0+exp(midpoint/ |
| (double) QuantumRange*contrast))))))/contrast))); |
| } |
| if (image->storage_class == PseudoClass) |
| { |
| /* |
| Sigmoidal-contrast enhance colormap. |
| */ |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (i=0; i < (long) image->colors; i++) |
| { |
| if ((channel & RedChannel) != 0) |
| image->colormap[i].red=ClampToQuantum(sigmoidal_map[ |
| ScaleQuantumToMap(image->colormap[i].red)]); |
| if ((channel & GreenChannel) != 0) |
| image->colormap[i].green=ClampToQuantum(sigmoidal_map[ |
| ScaleQuantumToMap(image->colormap[i].green)]); |
| if ((channel & BlueChannel) != 0) |
| image->colormap[i].blue=ClampToQuantum(sigmoidal_map[ |
| ScaleQuantumToMap(image->colormap[i].blue)]); |
| if ((channel & OpacityChannel) != 0) |
| image->colormap[i].opacity=ClampToQuantum(sigmoidal_map[ |
| ScaleQuantumToMap(image->colormap[i].opacity)]); |
| } |
| } |
| /* |
| Sigmoidal-contrast enhance image. |
| */ |
| status=MagickTrue; |
| progress=0; |
| exception=(&image->exception); |
| image_view=AcquireCacheView(image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) image->rows; y++) |
| { |
| register IndexPacket |
| *restrict indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| q=GetCacheViewAuthenticPixels(image_view,0,y,image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| if ((channel & RedChannel) != 0) |
| q->red=ClampToQuantum(sigmoidal_map[ScaleQuantumToMap(q->red)]); |
| if ((channel & GreenChannel) != 0) |
| q->green=ClampToQuantum(sigmoidal_map[ScaleQuantumToMap(q->green)]); |
| if ((channel & BlueChannel) != 0) |
| q->blue=ClampToQuantum(sigmoidal_map[ScaleQuantumToMap(q->blue)]); |
| if ((channel & OpacityChannel) != 0) |
| q->opacity=ClampToQuantum(sigmoidal_map[ScaleQuantumToMap(q->opacity)]); |
| if (((channel & IndexChannel) != 0) && |
| (image->colorspace == CMYKColorspace)) |
| indexes[x]=(IndexPacket) ClampToQuantum(sigmoidal_map[ |
| ScaleQuantumToMap(indexes[x])]); |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(image_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_SigmoidalContrastImageChannel) |
| #endif |
| proceed=SetImageProgress(image,SigmoidalContrastImageTag,progress++, |
| image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| sigmoidal_map=(MagickRealType *) RelinquishMagickMemory(sigmoidal_map); |
| return(status); |
| } |