| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % RRRR EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| % R R E SS I ZZ E % |
| % RRRR EEE SSS I ZZZ EEE % |
| % R R E SS I ZZ E % |
| % R R EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| % % |
| % % |
| % MagickCore Image Resize Methods % |
| % % |
| % Software Design % |
| % John Cristy % |
| % July 1992 % |
| % % |
| % % |
| % Copyright 1999-2010 ImageMagick Studio LLC, a non-profit organization % |
| % dedicated to making software imaging solutions freely available. % |
| % % |
| % You may not use this file except in compliance with the License. You may % |
| % obtain a copy of the License at % |
| % % |
| % http://www.imagemagick.org/script/license.php % |
| % % |
| % Unless required by applicable law or agreed to in writing, software % |
| % distributed under the License is distributed on an "AS IS" BASIS, % |
| % WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. % |
| % See the License for the specific language governing permissions and % |
| % limitations under the License. % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % |
| */ |
| |
| /* |
| Include declarations. |
| */ |
| #include "magick/studio.h" |
| #include "magick/artifact.h" |
| #include "magick/blob.h" |
| #include "magick/cache.h" |
| #include "magick/cache-view.h" |
| #include "magick/color.h" |
| #include "magick/color-private.h" |
| #include "magick/draw.h" |
| #include "magick/exception.h" |
| #include "magick/exception-private.h" |
| #include "magick/gem.h" |
| #include "magick/image.h" |
| #include "magick/image-private.h" |
| #include "magick/list.h" |
| #include "magick/memory_.h" |
| #include "magick/pixel-private.h" |
| #include "magick/property.h" |
| #include "magick/monitor.h" |
| #include "magick/monitor-private.h" |
| #include "magick/pixel.h" |
| #include "magick/option.h" |
| #include "magick/resample.h" |
| #include "magick/resize.h" |
| #include "magick/resize-private.h" |
| #include "magick/string_.h" |
| #include "magick/thread-private.h" |
| #include "magick/utility.h" |
| #include "magick/version.h" |
| #if defined(MAGICKCORE_LQR_DELEGATE) |
| #include <lqr.h> |
| #endif |
| |
| /* |
| Typedef declarations. |
| */ |
| struct _ResizeFilter |
| { |
| MagickRealType |
| (*filter)(const MagickRealType,const ResizeFilter *), |
| (*window)(const MagickRealType,const ResizeFilter *), |
| support, /* filter region of support - the filter support limit */ |
| window_support, /* window support, usally equal to support (expert only) */ |
| scale, /* dimension to scale to fit window support (usally 1.0) */ |
| blur, /* x-scale (blur-sharpen) */ |
| cubic[8]; /* cubic coefficents for smooth Cubic filters */ |
| |
| unsigned long |
| signature; |
| }; |
| |
| /* |
| Forward declaractions. |
| */ |
| static MagickRealType |
| I0(MagickRealType x), |
| BesselOrderOne(MagickRealType); |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| + F i l t e r F u n c t i o n s % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % These are the various filter and windowing functions that are provided, |
| % |
| % They are all internal to this module only. See AcquireResizeFilterInfo() |
| % for details of the access to these functions, via the |
| % GetResizeFilterSupport() and GetResizeFilterWeight() API interface. |
| % |
| % The individual filter functions have this format... |
| % |
| % static MagickRealtype *FilterName(const MagickRealType x, |
| % const MagickRealType support) |
| % |
| % o x: the distance from the sampling point |
| % generally in the range of 0 to support |
| % The GetResizeFilterWeight() ensures this a positive value. |
| % |
| % o resize_filter: Current Filter Information |
| % This allows function to access support, and posibly other |
| % pre-calculated information defineding the functions. |
| % |
| */ |
| |
| static MagickRealType Bessel(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| See Pratt "Digital Image Processing" p.97 for Bessel functions |
| |
| This function actually a X-scaled Jinc(x) function. |
| http://mathworld.wolfram.com/JincFunction.html |
| And on page 11 of... |
| http://www.ph.ed.ac.uk/%7ewjh/teaching/mo/slides/lens/lens.pdf |
| */ |
| if (x == 0.0) |
| return((MagickRealType) (MagickPI/4.0)); |
| return(BesselOrderOne(MagickPI*x)/(2.0*x)); |
| } |
| |
| static MagickRealType Blackman(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| Blackman: 2rd Order cosine windowing function. |
| */ |
| return(0.42+0.5*cos(MagickPI*(double) x)+0.08*cos(2.0*MagickPI*(double) x)); |
| } |
| |
| static MagickRealType Bohman(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| Bohman: 2rd Order cosine windowing function. |
| */ |
| return((1-x)*cos(MagickPI*(double) x)+sin(MagickPI*(double) x)/MagickPI); |
| } |
| |
| static MagickRealType Box(const MagickRealType magick_unused(x), |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| Just return 1.0, filter will still be clipped by its support window. |
| */ |
| return(1.0); |
| } |
| |
| static MagickRealType CubicBC(const MagickRealType x, |
| const ResizeFilter *resize_filter) |
| { |
| /* |
| Cubic Filters using B,C determined values: |
| |
| Mitchell-Netravali B=1/3 C=1/3 Qualitively ideal Cubic Filter |
| Catmull-Rom B= 0 C=1/2 Cublic Interpolation Function |
| Cubic B-Spline B= 1 C= 0 Spline Approximation of Gaussian |
| Hermite B= 0 C= 0 Quadratic Spline (support = 1) |
| |
| See paper by Mitchell and Netravali, |
| Reconstruction Filters in Computer Graphics |
| Computer Graphics, Volume 22, Number 4, August 1988 |
| http://www.cs.utexas.edu/users/fussell/courses/cs384g/ |
| lectures/mitchell/Mitchell.pdf |
| |
| Coefficents are determined from B,C values |
| P0 = ( 6 - 2*B )/6 |
| P1 = 0 |
| P2 = (-18 +12*B + 6*C )/6 |
| P3 = ( 12 - 9*B - 6*C )/6 |
| Q0 = ( 8*B +24*C )/6 |
| Q1 = ( -12*B -48*C )/6 |
| Q2 = ( 6*B +30*C )/6 |
| Q3 = ( - 1*B - 6*C )/6 |
| |
| Which is used to define the filter... |
| P0 + P1*x + P2*x^2 + P3*x^3 0 <= x < 1 |
| Q0 + Q1*x + Q2*x^2 + Q3*x^3 1 <= x <= 2 |
| |
| Which ensures function is continuous in value and derivative (slope). |
| */ |
| if (x < 1.0) |
| return(resize_filter->cubic[0]+x*(resize_filter->cubic[1]+x* |
| (resize_filter->cubic[2]+x*resize_filter->cubic[3]))); |
| if (x < 2.0) |
| return(resize_filter->cubic[4] +x*(resize_filter->cubic[5]+x* |
| (resize_filter->cubic[6] +x*resize_filter->cubic[7]))); |
| return(0.0); |
| } |
| |
| static MagickRealType Gaussian(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| return(exp((double) (-2.0*x*x))*sqrt(2.0/MagickPI)); |
| } |
| |
| static MagickRealType Hanning(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| A Cosine windowing function. |
| */ |
| return(0.5+0.5*cos(MagickPI*(double) x)); |
| } |
| |
| static MagickRealType Hamming(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| A offset Cosine windowing function. |
| */ |
| return(0.54+0.46*cos(MagickPI*(double) x)); |
| } |
| |
| static MagickRealType Kaiser(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| #define Alpha 6.5 |
| #define I0A (1.0/I0(Alpha)) |
| |
| /* |
| Kaiser Windowing Function (bessel windowing): |
| Alpha is a free value from 5 to 8 (currently hardcoded to 6.5) |
| Future: make alphand the IOA pre-calculation, a 'expert' setting. |
| */ |
| return(I0A*I0(Alpha*sqrt((double) (1.0-x*x)))); |
| } |
| |
| static MagickRealType Lagrange(const MagickRealType x, |
| const ResizeFilter *resize_filter) |
| { |
| long |
| n, |
| order; |
| |
| MagickRealType |
| value; |
| |
| register long |
| i; |
| |
| /* |
| Lagrange Piece-Wise polynomial fit of Sinc: |
| N is the 'order' of the lagrange function and depends on |
| the overall support window size of the filter. That is for |
| a support of 2, gives a lagrange-4 or piece-wise cubic functions |
| |
| Note that n is the specific piece of the piece-wise function to calculate. |
| |
| See Survey: Interpolation Methods, IEEE Transactions on Medical Imaging, |
| Vol 18, No 11, November 1999, p1049-1075, -- Equation 27 on p1064 |
| */ |
| if (x > resize_filter->support) |
| return(0.0); |
| order=(long) (2.0*resize_filter->window_support); /* number of pieces */ |
| n=(long) ((1.0*order)/2.0+x); /* which piece does x belong to */ |
| value=1.0f; |
| for (i=0; i < order; i++) |
| if (i != n) |
| value*=(n-i-x)/(n-i); |
| return(value); |
| } |
| |
| static MagickRealType Quadratic(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| 2rd order (quadratic) B-Spline approximation of Gaussian. |
| */ |
| if (x < 0.5) |
| return(0.75-x*x); |
| if (x < 1.5) |
| return(0.5*(x-1.5)*(x-1.5)); |
| return(0.0); |
| } |
| |
| static MagickRealType Sinc(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| This function actually a X-scaled Sinc(x) function. |
| */ |
| if (x == 0.0) |
| return(1.0); |
| return(sin(MagickPI*(double) x)/(MagickPI*(double) x)); |
| } |
| |
| static MagickRealType Triangle(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| 1rd order (linear) B-Spline, bilinear interpolation, |
| Tent 1D filter, or a Bartlett 2D Cone filter |
| */ |
| if (x < 1.0) |
| return(1.0-x); |
| return(0.0); |
| } |
| |
| static MagickRealType Welsh(const MagickRealType x, |
| const ResizeFilter *magick_unused(resize_filter)) |
| { |
| /* |
| Welsh parabolic windowing filter. |
| */ |
| if (x < 1.0) |
| return(1.0-x*x); |
| return(0.0); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| + A c q u i r e R e s i z e F i l t e r % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % AcquireResizeFilter() allocates the ResizeFilter structure. Choose from |
| % these filters: |
| % |
| % FIR (Finite impulse Response) Filters |
| % Box Triangle Quadratic |
| % Cubic Hermite Catrom |
| % Mitchell |
| % |
| % IIR (Infinite impulse Response) Filters |
| % Gaussian Sinc Bessel |
| % |
| % Windowed Sinc/Bessel Method |
| % Blackman Hanning Hamming |
| % Kaiser Lancos (Sinc) |
| % |
| % FIR filters are used as is, and are limited by that filters support window |
| % (unless over-ridden). 'Gaussian' while classed as an IIR filter, is also |
| % simply clipped by its support size (1.5). |
| % |
| % Requesting a windowed filter will return either a windowed Sinc, for a one |
| % dimentional orthogonal filtering method, such as ResizeImage(), or a |
| % windowed Bessel for image operations requiring a two dimentional |
| % cylindrical filtering method, such a DistortImage(). Which function is |
| % is used set by the "cylindrical" boolean argument. |
| % |
| % Directly requesting 'Sinc' or 'Bessel' will force the use of that filter |
| % function, with a default 'Blackman' windowing method. This not however |
| % recommended as it removes the correct filter selection for different |
| % filtering image operations. Selecting a window filtering method is better. |
| % |
| % Lanczos is purely special case of a Sinc windowed Sinc, but defulting to |
| % a 3 lobe support, rather that the default 4 lobe support. |
| % |
| % Special options can be used to override specific, or all the filter |
| % settings. However doing so is not advisible unless you have expert |
| % knowledge of the use of resampling filtered techniques. Extreme caution is |
| % advised. |
| % |
| % "filter:filter" Select this function as the filter. |
| % If a "filter:window" operation is not provided, then no windowing |
| % will be performed on the selected filter, (support clipped) |
| % |
| % This can be used to force the use of a windowing method as filter, |
| % request a 'Sinc' filter in a radially filtered operation, or the |
| % 'Bessel' filter for a othogonal filtered operation. |
| % |
| % "filter:window" Select this windowing function for the filter. |
| % While any filter could be used as a windowing function, |
| % using that filters first lobe over the whole support window, |
| % using a non-windowing method is not advisible. |
| % |
| % "filter:lobes" Number of lobes to use for the Sinc/Bessel filter. |
| % This a simper method of setting filter support size that will |
| % correctly handle the Sinc/Bessel switch for an operators filtering |
| % requirements. |
| % |
| % "filter:support" Set the support size for filtering to the size given |
| % This not recomented for Sinc/Bessel windowed filters, but is |
| % used for simple filters like FIR filters, and the Gaussian Filter. |
| % This will override any 'filter:lobes' option. |
| % |
| % "filter:blur" Scale the filter and support window by this amount. |
| % A value >1 will generally result in a more burred image with |
| % more ringing effects, while a value <1 will sharpen the |
| % resulting image with more aliasing and Morie effects. |
| % |
| % "filter:win-support" Scale windowing function to this size instead. |
| % This causes the windowing (or self-windowing Lagrange filter) |
| % to act is if the support winodw it much much larger than what |
| % is actually supplied to the calling operator. The filter however |
| % is still clipped to the real support size given. If unset this |
| % will equal the normal filter support size. |
| % |
| % "filter:b" |
| % "filter:c" Override the preset B,C values for a Cubic type of filter |
| % If only one of these are given it is assumes to be a 'Keys' |
| % type of filter such that B+2C=1, where Keys 'alpha' value = C |
| % |
| % "filter:verbose" Output verbose plotting data for graphing the |
| % resulting filter over the whole support range (with blur effect). |
| % |
| % Set a true un-windowed Sinc filter with 10 lobes (very slow) |
| % -set option:filter:filter Sinc |
| % -set option:filter:lobes 8 |
| % |
| % For example force an 8 lobe Lanczos (Sinc or Bessel) filter... |
| % -filter Lanczos |
| % -set option:filter:lobes 8 |
| % |
| % The format of the AcquireResizeFilter method is: |
| % |
| % ResizeFilter *AcquireResizeFilter(const Image *image, |
| % const FilterTypes filter_type, const MagickBooleanType radial, |
| % ExceptionInfo *exception) |
| % |
| % o image: the image. |
| % |
| % o filter: the filter type, defining a preset filter, window and support. |
| % |
| % o blur: blur the filter by this amount, use 1.0 if unknown. |
| % Image artifact "filter:blur" will override this old usage |
| % |
| % o radial: 1D orthogonal filter (Sinc) or 2D radial filter (Bessel) |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport ResizeFilter *AcquireResizeFilter(const Image *image, |
| const FilterTypes filter, const MagickRealType blur, |
| const MagickBooleanType cylindrical,ExceptionInfo *exception) |
| { |
| const char |
| *artifact; |
| |
| FilterTypes |
| filter_type, |
| window_type; |
| |
| long |
| filter_artifact; |
| |
| MagickRealType |
| B, |
| C; |
| |
| register ResizeFilter |
| *resize_filter; |
| |
| /* |
| Table Mapping given Filter, into Weighting and Windowing functions. |
| A 'Box' windowing function means its a simble non-windowed filter. |
| A 'Sinc' filter function (must be windowed) could be upgraded to a |
| 'Bessel' filter if a "cylindrical" filter is requested, unless a "Sinc" |
| filter specifically request. |
| */ |
| static struct |
| { |
| FilterTypes |
| filter, |
| window; |
| } const mapping[SentinelFilter] = |
| { |
| { UndefinedFilter, BoxFilter }, /* undefined */ |
| { PointFilter, BoxFilter }, /* special, nearest-neighbour filter */ |
| { BoxFilter, BoxFilter }, /* Box averaging Filter */ |
| { TriangleFilter, BoxFilter }, /* Linear Interpolation Filter */ |
| { HermiteFilter, BoxFilter }, /* Hermite interpolation filter */ |
| { SincFilter, HanningFilter }, /* Hanning -- Cosine-Sinc */ |
| { SincFilter, HammingFilter }, /* Hamming -- '' variation */ |
| { SincFilter, BlackmanFilter }, /* Blackman -- 2*Cosine-Sinc */ |
| { GaussianFilter, BoxFilter }, /* Gaussain Blurring filter */ |
| { QuadraticFilter, BoxFilter }, /* Quadratic Gaussian approximation */ |
| { CubicFilter, BoxFilter }, /* Cubic Gaussian approximation */ |
| { CatromFilter, BoxFilter }, /* Cubic Interpolator */ |
| { MitchellFilter, BoxFilter }, /* 'ideal' Cubic Filter */ |
| { LanczosFilter, SincFilter }, /* Special, 3 lobed Sinc-Sinc */ |
| { BesselFilter, BlackmanFilter }, /* 3 lobed bessel -specific request */ |
| { SincFilter, BlackmanFilter }, /* 4 lobed sinc - specific request */ |
| { SincFilter, KaiserFilter }, /* Kaiser -- SqRoot-Sinc */ |
| { SincFilter, WelshFilter }, /* Welsh -- Parabolic-Sinc */ |
| { SincFilter, CubicFilter }, /* Parzen -- Cubic-Sinc */ |
| { LagrangeFilter, BoxFilter }, /* Lagrange self-windowing filter */ |
| { SincFilter, BohmanFilter }, /* Bohman -- 2*Cosine-Sinc */ |
| { SincFilter, TriangleFilter } /* Bartlett -- Triangle-Sinc */ |
| }; |
| /* |
| Table maping the filter/window function from the above table to the actual |
| filter/window function call to use. The default support size for that |
| filter as a weighting function, and the point to scale when that function |
| is used as a windowing function (typ 1.0). |
| */ |
| static struct |
| { |
| MagickRealType |
| (*function)(const MagickRealType, const ResizeFilter*), |
| support, /* default support size for function as a filter */ |
| scale, /* size windowing function, for scaling windowing function */ |
| B, |
| C; /* Cubic Filter factors for a CubicBC function, else ignored */ |
| } const filters[SentinelFilter] = |
| { |
| { Box, 0.0f, 0.5f, 0.0f, 0.0f }, /* Undefined */ |
| { Box, 0.0f, 0.5f, 0.0f, 0.0f }, /* Point */ |
| { Box, 0.5f, 0.5f, 0.0f, 0.0f }, /* Box */ |
| { Triangle, 1.0f, 1.0f, 0.0f, 0.0f }, /* Triangle */ |
| { CubicBC, 1.0f, 1.0f, 0.0f, 0.0f }, /* Hermite, Cubic B=C=0 */ |
| { Hanning, 1.0f, 1.0f, 0.0f, 0.0f }, /* Hanning, Cosine window */ |
| { Hamming, 1.0f, 1.0f, 0.0f, 0.0f }, /* Hamming, '' variation */ |
| { Blackman, 1.0f, 1.0f, 0.0f, 0.0f }, /* Blackman, 2*cos window */ |
| { Gaussian, 1.5f, 1.5f, 0.0f, 0.0f }, /* Gaussian */ |
| { Quadratic, 1.5f, 1.5f, 0.0f, 0.0f }, /* Quadratic Gaussian */ |
| { CubicBC, 2.0f, 2.0f, 1.0f, 0.0f }, /* B-Spline of Gaussian B=1 C=0 */ |
| { CubicBC, 2.0f, 1.0f, 0.0f, 0.5f }, /* Catmull-Rom B=0 C=1/2 */ |
| { CubicBC, 2.0f, 1.0f, 1.0f/3.0f, 1.0f/3.0f }, /* Mitchel B=C=1/3 */ |
| { Sinc, 3.0f, 1.0f, 0.0f, 0.0f }, /* Lanczos, 3 lobed Sinc-Sinc */ |
| { Bessel, 3.2383f,1.2197f,.0f,.0f }, /* 3 lobed Blackman-Bessel */ |
| { Sinc, 4.0f, 1.0f, 0.0f, 0.0f }, /* 4 lobed Blackman-Sinc */ |
| { Kaiser, 1.0f, 1.0f, 0.0f, 0.0f }, /* Kaiser, sq-root windowing */ |
| { Welsh, 1.0f, 1.0f, 0.0f, 0.0f }, /* Welsh, Parabolic windowing */ |
| { CubicBC, 2.0f, 2.0f, 1.0f, 0.0f }, /* Parzen, B-Spline windowing */ |
| { Lagrange, 2.0f, 1.0f, 0.0f, 0.0f }, /* Lagrangian Filter */ |
| { Bohman, 1.0f, 1.0f, 0.0f, 0.0f }, /* Bohman, 2*Cosine windowing */ |
| { Triangle, 1.0f, 1.0f, 0.0f, 0.0f } /* Bartlett, Triangle windowing */ |
| }; |
| /* |
| The known zero crossings of the Bessel() or the Jinc(x*PI) function |
| Found by using |
| http://cose.math.bas.bg/webMathematica/webComputing/BesselZeros.jsp |
| for Jv-function with v=1, then dividing X-roots by PI (tabled below) |
| */ |
| static MagickRealType |
| bessel_zeros[16] = |
| { |
| 1.21966989126651f, |
| 2.23313059438153f, |
| 3.23831548416624f, |
| 4.24106286379607f, |
| 5.24276437687019f, |
| 6.24392168986449f, |
| 7.24475986871996f, |
| 8.24539491395205f, |
| 9.24589268494948f, |
| 10.2462933487549f, |
| 11.2466227948779f, |
| 12.2468984611381f, |
| 13.2471325221811f, |
| 14.2473337358069f, |
| 15.2475085630373f, |
| 16.247661874701f |
| }; |
| |
| assert(image != (const Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(UndefinedFilter < filter && filter < SentinelFilter); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| |
| resize_filter=(ResizeFilter *) AcquireAlignedMemory(1,sizeof(*resize_filter)); |
| if (resize_filter == (ResizeFilter *) NULL) |
| ThrowFatalException(ResourceLimitFatalError,"MemoryAllocationFailed"); |
| |
| /* defaults for the requested filter */ |
| filter_type = mapping[filter].filter; |
| window_type = mapping[filter].window; |
| |
| |
| /* Filter blur -- scaling both filter and support window */ |
| resize_filter->blur = blur; |
| artifact=GetImageArtifact(image,"filter:blur"); |
| if (artifact != (const char *) NULL) |
| resize_filter->blur = atof(artifact); |
| if ( resize_filter->blur < MagickEpsilon ) |
| resize_filter->blur = (MagickRealType) MagickEpsilon; |
| |
| /* Modifications for Cylindrical filter use */ |
| if ( cylindrical != MagickFalse && filter != SincFilter ) { |
| /* promote 1D Sinc Filter to a 2D Bessel filter */ |
| if ( filter_type == SincFilter ) |
| filter_type = BesselFilter; |
| /* Prompote Lanczos (Sinc-Sinc) to Lanczos (Bessel-Bessel) */ |
| else if ( filter_type == LanczosFilter ) { |
| filter_type = BesselFilter; |
| window_type = BesselFilter; |
| } |
| /* Blur other filters appropriatally correct cylindrical usage */ |
| else if ( filter_type == GaussianFilter ) |
| /* Gaussian is scaled by 4*ln(2) and not 4*sqrt(2/MagickPI) |
| - according to Paul Heckbert's paper on EWA resampling */ |
| resize_filter->blur *= 2.0*log(2.0)/sqrt(2.0/MagickPI); |
| else if ( filter_type != BesselFilter ) |
| /* filters with a 1.0 zero root crossing by the first bessel_zero */ |
| resize_filter->blur *= bessel_zeros[0]; |
| } |
| |
| /* Override Filter Selection */ |
| artifact=GetImageArtifact(image,"filter:filter"); |
| if (artifact != (const char *) NULL) { |
| /* raw filter request - no window function */ |
| filter_artifact=ParseMagickOption(MagickFilterOptions, |
| MagickFalse,artifact); |
| if ( UndefinedFilter < filter_artifact && |
| filter_artifact < SentinelFilter ) { |
| filter_type = (FilterTypes) filter_artifact; |
| window_type = BoxFilter; |
| } |
| /* Lanczos is nor a real filter but a self windowing Sinc/Bessel */ |
| if ( filter_artifact == LanczosFilter ) { |
| filter_type = (cylindrical!=MagickFalse) ? BesselFilter : LanczosFilter; |
| window_type = (cylindrical!=MagickFalse) ? BesselFilter : SincFilter; |
| } |
| /* Filter overwide with a specific window function? */ |
| artifact=GetImageArtifact(image,"filter:window"); |
| if (artifact != (const char *) NULL) { |
| filter_artifact=ParseMagickOption(MagickFilterOptions, |
| MagickFalse,artifact); |
| if ( UndefinedFilter < filter_artifact && |
| filter_artifact < SentinelFilter ) { |
| if ( filter_artifact != LanczosFilter ) |
| window_type = (FilterTypes) filter_artifact; |
| else |
| window_type = (cylindrical!=MagickFalse) ? BesselFilter : SincFilter; |
| } |
| } |
| } |
| else { |
| /* window specified, but no filter function? Assume Sinc/Bessel */ |
| artifact=GetImageArtifact(image,"filter:window"); |
| if (artifact != (const char *) NULL) { |
| filter_artifact=ParseMagickOption(MagickFilterOptions,MagickFalse, |
| artifact); |
| if ( UndefinedFilter < filter_artifact && |
| filter_artifact < SentinelFilter ) { |
| filter_type = (cylindrical!=MagickFalse) ? BesselFilter : SincFilter; |
| if ( filter_artifact != LanczosFilter ) |
| window_type = (FilterTypes) filter_artifact; |
| else |
| window_type = filter_type; |
| } |
| } |
| } |
| |
| resize_filter->filter = filters[filter_type].function; |
| resize_filter->support = filters[filter_type].support; |
| resize_filter->window = filters[window_type].function; |
| resize_filter->scale = filters[window_type].scale; |
| resize_filter->signature=MagickSignature; |
| |
| /* Filter support overrides */ |
| artifact=GetImageArtifact(image,"filter:lobes"); |
| if (artifact != (const char *) NULL) { |
| long lobes = atol(artifact); |
| if ( lobes < 1 ) lobes = 1; |
| resize_filter->support = (MagickRealType) lobes; |
| if ( filter_type == BesselFilter ) { |
| if ( lobes > 16 ) lobes = 16; |
| resize_filter->support = bessel_zeros[lobes-1]; |
| } |
| } |
| artifact=GetImageArtifact(image,"filter:support"); |
| if (artifact != (const char *) NULL) |
| resize_filter->support = fabs(atof(artifact)); |
| |
| /* Scale windowing function separatally to the support 'clipping' window |
| that calling operator is planning to actually use. - Expert Use Only |
| */ |
| resize_filter->window_support = resize_filter->support; |
| artifact=GetImageArtifact(image,"filter:win-support"); |
| if (artifact != (const char *) NULL) |
| resize_filter->window_support = fabs(atof(artifact)); |
| |
| /* Set Cubic Spline B,C values, calculate Cubic coefficents */ |
| B=0.0; |
| C=0.0; |
| if ( filters[filter_type].function == CubicBC |
| || filters[window_type].function == CubicBC ) { |
| if ( filters[filter_type].function == CubicBC ) { |
| B=filters[filter_type].B; |
| C=filters[filter_type].C; |
| } |
| else if ( filters[window_type].function == CubicBC ) { |
| B=filters[window_type].B; |
| C=filters[window_type].C; |
| } |
| artifact=GetImageArtifact(image,"filter:b"); |
| if (artifact != (const char *) NULL) { |
| B=atof(artifact); |
| C=(1.0-B)/2.0; /* Calculate C as if it is a Keys cubic filter */ |
| artifact=GetImageArtifact(image,"filter:c"); |
| if (artifact != (const char *) NULL) |
| C=atof(artifact); |
| } |
| else { |
| artifact=GetImageArtifact(image,"filter:c"); |
| if (artifact != (const char *) NULL) { |
| C=atof(artifact); |
| B=1.0-2.0*C; /* Calculate B as if it is a Keys cubic filter */ |
| } |
| } |
| /* Convert B,C values into Cubic Coefficents - See CubicBC() */ |
| resize_filter->cubic[0]=( 6.0 -2.0*B )/6.0; |
| resize_filter->cubic[1]=0.0; |
| resize_filter->cubic[2]=(-18.0+12.0*B+ 6.0*C)/6.0; |
| resize_filter->cubic[3]=( 12.0- 9.0*B- 6.0*C)/6.0; |
| resize_filter->cubic[4]=( 8.0*B+24.0*C)/6.0; |
| resize_filter->cubic[5]=( -12.0*B-48.0*C)/6.0; |
| resize_filter->cubic[6]=( 6.0*B+30.0*C)/6.0; |
| resize_filter->cubic[7]=( - 1.0*B- 6.0*C)/6.0; |
| } |
| artifact=GetImageArtifact(image,"filter:verbose"); |
| if (artifact != (const char *) NULL) |
| { |
| double |
| support, |
| x; |
| |
| /* |
| Output filter graph -- for graphing filter result. |
| */ |
| support=GetResizeFilterSupport(resize_filter); |
| (void) printf("# support = %lg\n",support); |
| for (x=0.0; x <= support; x+=0.01f) |
| (void) printf("%5.2lf\t%lf\n",x,(double) GetResizeFilterWeight( |
| resize_filter,x)); |
| (void) printf("%5.2lf\t%lf\n",support,0.0); |
| } |
| return(resize_filter); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % A d a p t i v e R e s i z e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % AdaptiveResizeImage() adaptively resize image with pixel resampling. |
| % |
| % The format of the AdaptiveResizeImage method is: |
| % |
| % Image *AdaptiveResizeImage(const Image *image, |
| % const unsigned long columns,const unsigned long rows, |
| % ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o columns: the number of columns in the resized image. |
| % |
| % o rows: the number of rows in the resized image. |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport Image *AdaptiveResizeImage(const Image *image, |
| const unsigned long columns,const unsigned long rows,ExceptionInfo *exception) |
| { |
| #define AdaptiveResizeImageTag "Resize/Image" |
| |
| Image |
| *resize_image; |
| |
| long |
| y; |
| |
| MagickBooleanType |
| proceed; |
| |
| MagickPixelPacket |
| pixel; |
| |
| PointInfo |
| offset; |
| |
| ResampleFilter |
| *resample_filter; |
| |
| CacheView |
| *resize_view; |
| |
| /* |
| Adaptively resize image. |
| */ |
| assert(image != (const Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| if ((columns == 0) || (rows == 0)) |
| return((Image *) NULL); |
| if ((columns == image->columns) && (rows == image->rows)) |
| return(CloneImage(image,0,0,MagickTrue,exception)); |
| resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| if (resize_image == (Image *) NULL) |
| return((Image *) NULL); |
| if (SetImageStorageClass(resize_image,DirectClass) == MagickFalse) |
| { |
| InheritException(exception,&resize_image->exception); |
| resize_image=DestroyImage(resize_image); |
| return((Image *) NULL); |
| } |
| GetMagickPixelPacket(image,&pixel); |
| resample_filter=AcquireResampleFilter(image,exception); |
| if (image->interpolate == UndefinedInterpolatePixel) |
| (void) SetResampleFilterInterpolateMethod(resample_filter, |
| MeshInterpolatePixel); |
| resize_view=AcquireCacheView(resize_image); |
| for (y=0; y < (long) resize_image->rows; y++) |
| { |
| register IndexPacket |
| *restrict resize_indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| exception); |
| if (q == (PixelPacket *) NULL) |
| break; |
| resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
| offset.y=((MagickRealType) y*image->rows/resize_image->rows); |
| for (x=0; x < (long) resize_image->columns; x++) |
| { |
| offset.x=((MagickRealType) x*image->columns/resize_image->columns); |
| (void) ResamplePixelColor(resample_filter,offset.x-0.5,offset.y-0.5, |
| &pixel); |
| SetPixelPacket(resize_image,&pixel,q,resize_indexes+x); |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| break; |
| proceed=SetImageProgress(image,AdaptiveResizeImageTag,y,image->rows); |
| if (proceed == MagickFalse) |
| break; |
| } |
| resample_filter=DestroyResampleFilter(resample_filter); |
| resize_view=DestroyCacheView(resize_view); |
| return(resize_image); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| + B e s s e l O r d e r O n e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % BesselOrderOne() computes the Bessel function of x of the first kind of |
| % order 0: |
| % |
| % Reduce x to |x| since j1(x)= -j1(-x), and for x in (0,8] |
| % |
| % j1(x) = x*j1(x); |
| % |
| % For x in (8,inf) |
| % |
| % j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) |
| % |
| % where x1 = x-3*pi/4. Compute sin(x1) and cos(x1) as follow: |
| % |
| % cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) |
| % = 1/sqrt(2) * (sin(x) - cos(x)) |
| % sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) |
| % = -1/sqrt(2) * (sin(x) + cos(x)) |
| % |
| % The format of the BesselOrderOne method is: |
| % |
| % MagickRealType BesselOrderOne(MagickRealType x) |
| % |
| % A description of each parameter follows: |
| % |
| % o x: MagickRealType value. |
| % |
| */ |
| |
| #undef I0 |
| static MagickRealType I0(MagickRealType x) |
| { |
| MagickRealType |
| sum, |
| t, |
| y; |
| |
| register long |
| i; |
| |
| /* |
| Zeroth order Bessel function of the first kind. |
| */ |
| sum=1.0; |
| y=x*x/4.0; |
| t=y; |
| for (i=2; t > MagickEpsilon; i++) |
| { |
| sum+=t; |
| t*=y/((MagickRealType) i*i); |
| } |
| return(sum); |
| } |
| |
| #undef J1 |
| static MagickRealType J1(MagickRealType x) |
| { |
| MagickRealType |
| p, |
| q; |
| |
| register long |
| i; |
| |
| static const double |
| Pone[] = |
| { |
| 0.581199354001606143928050809e+21, |
| -0.6672106568924916298020941484e+20, |
| 0.2316433580634002297931815435e+19, |
| -0.3588817569910106050743641413e+17, |
| 0.2908795263834775409737601689e+15, |
| -0.1322983480332126453125473247e+13, |
| 0.3413234182301700539091292655e+10, |
| -0.4695753530642995859767162166e+7, |
| 0.270112271089232341485679099e+4 |
| }, |
| Qone[] = |
| { |
| 0.11623987080032122878585294e+22, |
| 0.1185770712190320999837113348e+20, |
| 0.6092061398917521746105196863e+17, |
| 0.2081661221307607351240184229e+15, |
| 0.5243710262167649715406728642e+12, |
| 0.1013863514358673989967045588e+10, |
| 0.1501793594998585505921097578e+7, |
| 0.1606931573481487801970916749e+4, |
| 0.1e+1 |
| }; |
| |
| p=Pone[8]; |
| q=Qone[8]; |
| for (i=7; i >= 0; i--) |
| { |
| p=p*x*x+Pone[i]; |
| q=q*x*x+Qone[i]; |
| } |
| return(p/q); |
| } |
| |
| #undef P1 |
| static MagickRealType P1(MagickRealType x) |
| { |
| MagickRealType |
| p, |
| q; |
| |
| register long |
| i; |
| |
| static const double |
| Pone[] = |
| { |
| 0.352246649133679798341724373e+5, |
| 0.62758845247161281269005675e+5, |
| 0.313539631109159574238669888e+5, |
| 0.49854832060594338434500455e+4, |
| 0.2111529182853962382105718e+3, |
| 0.12571716929145341558495e+1 |
| }, |
| Qone[] = |
| { |
| 0.352246649133679798068390431e+5, |
| 0.626943469593560511888833731e+5, |
| 0.312404063819041039923015703e+5, |
| 0.4930396490181088979386097e+4, |
| 0.2030775189134759322293574e+3, |
| 0.1e+1 |
| }; |
| |
| p=Pone[5]; |
| q=Qone[5]; |
| for (i=4; i >= 0; i--) |
| { |
| p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| } |
| return(p/q); |
| } |
| |
| #undef Q1 |
| static MagickRealType Q1(MagickRealType x) |
| { |
| MagickRealType |
| p, |
| q; |
| |
| register long |
| i; |
| |
| static const double |
| Pone[] = |
| { |
| 0.3511751914303552822533318e+3, |
| 0.7210391804904475039280863e+3, |
| 0.4259873011654442389886993e+3, |
| 0.831898957673850827325226e+2, |
| 0.45681716295512267064405e+1, |
| 0.3532840052740123642735e-1 |
| }, |
| Qone[] = |
| { |
| 0.74917374171809127714519505e+4, |
| 0.154141773392650970499848051e+5, |
| 0.91522317015169922705904727e+4, |
| 0.18111867005523513506724158e+4, |
| 0.1038187585462133728776636e+3, |
| 0.1e+1 |
| }; |
| |
| p=Pone[5]; |
| q=Qone[5]; |
| for (i=4; i >= 0; i--) |
| { |
| p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| } |
| return(p/q); |
| } |
| |
| static MagickRealType BesselOrderOne(MagickRealType x) |
| { |
| MagickRealType |
| p, |
| q; |
| |
| if (x == 0.0) |
| return(0.0); |
| p=x; |
| if (x < 0.0) |
| x=(-x); |
| if (x < 8.0) |
| return(p*J1(x)); |
| q=sqrt((double) (2.0/(MagickPI*x)))*(P1(x)*(1.0/sqrt(2.0)*(sin((double) x)- |
| cos((double) x)))-8.0/x*Q1(x)*(-1.0/sqrt(2.0)*(sin((double) x)+ |
| cos((double) x)))); |
| if (p < 0.0) |
| q=(-q); |
| return(q); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| + D e s t r o y R e s i z e F i l t e r % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % DestroyResizeFilter() destroy the resize filter. |
| % |
| % The format of the AcquireResizeFilter method is: |
| % |
| % ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| % |
| % A description of each parameter follows: |
| % |
| % o resize_filter: the resize filter. |
| % |
| */ |
| MagickExport ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| { |
| assert(resize_filter != (ResizeFilter *) NULL); |
| assert(resize_filter->signature == MagickSignature); |
| resize_filter->signature=(~MagickSignature); |
| resize_filter=(ResizeFilter *) RelinquishMagickMemory(resize_filter); |
| return(resize_filter); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| + G e t R e s i z e F i l t e r S u p p o r t % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % GetResizeFilterSupport() return the current support window size for this |
| % filter. Note that this may have been enlarged by filter:blur factor. |
| % |
| % The format of the GetResizeFilterSupport method is: |
| % |
| % MagickRealType GetResizeFilterSupport(const ResizeFilter *resize_filter) |
| % |
| % A description of each parameter follows: |
| % |
| % o filter: Image filter to use. |
| % |
| */ |
| MagickExport MagickRealType GetResizeFilterSupport( |
| const ResizeFilter *resize_filter) |
| { |
| assert(resize_filter != (ResizeFilter *) NULL); |
| assert(resize_filter->signature == MagickSignature); |
| return(resize_filter->support*resize_filter->blur); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| + G e t R e s i z e F i l t e r W e i g h t % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % GetResizeFilterWeight evaluates the specified resize filter at the point x |
| % which usally lies between zero and the filters current 'support' and |
| % returns the weight of the filter function at that point. |
| % |
| % The format of the GetResizeFilterWeight method is: |
| % |
| % MagickRealType GetResizeFilterWeight(const ResizeFilter *resize_filter, |
| % const MagickRealType x) |
| % |
| % A description of each parameter follows: |
| % |
| % o filter: the filter type. |
| % |
| % o x: the point. |
| % |
| */ |
| MagickExport MagickRealType GetResizeFilterWeight( |
| const ResizeFilter *resize_filter,const MagickRealType x) |
| { |
| MagickRealType |
| blur, |
| scale; |
| |
| /* |
| Windowing function - scale the weighting filter by this amount. |
| */ |
| assert(resize_filter != (ResizeFilter *) NULL); |
| assert(resize_filter->signature == MagickSignature); |
| blur=fabs(x)/resize_filter->blur; /* X offset with blur scaling */ |
| if ((resize_filter->window_support < MagickEpsilon) || |
| (resize_filter->window == Box)) |
| scale=1.0; /* Point/Box Filter -- avoid division by zero */ |
| else |
| { |
| scale=resize_filter->scale/resize_filter->window_support; |
| scale=resize_filter->window(blur*scale,resize_filter); |
| } |
| return(scale*resize_filter->filter(blur,resize_filter)); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % M a g n i f y I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % MagnifyImage() is a convenience method that scales an image proportionally |
| % to twice its size. |
| % |
| % The format of the MagnifyImage method is: |
| % |
| % Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| { |
| Image |
| *magnify_image; |
| |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| magnify_image=ResizeImage(image,2*image->columns,2*image->rows,CubicFilter, |
| 1.0,exception); |
| return(magnify_image); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % M i n i f y I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % MinifyImage() is a convenience method that scales an image proportionally |
| % to half its size. |
| % |
| % The format of the MinifyImage method is: |
| % |
| % Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| { |
| Image |
| *minify_image; |
| |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| minify_image=ResizeImage(image,image->columns/2,image->rows/2,CubicFilter, |
| 1.0,exception); |
| return(minify_image); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % R e s a m p l e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % ResampleImage() resize image in terms of its pixel size, so that when |
| % displayed at the given resolution it will be the same size in terms of |
| % real world units as the original image at the original resolution. |
| % |
| % The format of the ResampleImage method is: |
| % |
| % Image *ResampleImage(Image *image,const double x_resolution, |
| % const double y_resolution,const FilterTypes filter,const double blur, |
| % ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image to be resized to fit the given resolution. |
| % |
| % o x_resolution: the new image x resolution. |
| % |
| % o y_resolution: the new image y resolution. |
| % |
| % o filter: Image filter to use. |
| % |
| % o blur: the blur factor where > 1 is blurry, < 1 is sharp. |
| % |
| */ |
| MagickExport Image *ResampleImage(const Image *image,const double x_resolution, |
| const double y_resolution,const FilterTypes filter,const double blur, |
| ExceptionInfo *exception) |
| { |
| #define ResampleImageTag "Resample/Image" |
| |
| Image |
| *resample_image; |
| |
| unsigned long |
| height, |
| width; |
| |
| /* |
| Initialize sampled image attributes. |
| */ |
| assert(image != (const Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| width=(unsigned long) (x_resolution*image->columns/ |
| (image->x_resolution == 0.0 ? 72.0 : image->x_resolution)+0.5); |
| height=(unsigned long) (y_resolution*image->rows/ |
| (image->y_resolution == 0.0 ? 72.0 : image->y_resolution)+0.5); |
| resample_image=ResizeImage(image,width,height,filter,blur,exception); |
| if (resample_image != (Image *) NULL) |
| { |
| resample_image->x_resolution=x_resolution; |
| resample_image->y_resolution=y_resolution; |
| } |
| return(resample_image); |
| } |
| #if defined(MAGICKCORE_LQR_DELEGATE) |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % L i q u i d R e s c a l e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % LiquidRescaleImage() rescales image with seam carving. |
| % |
| % The format of the LiquidRescaleImage method is: |
| % |
| % Image *LiquidRescaleImage(const Image *image, |
| % const unsigned long columns,const unsigned long rows, |
| % const double delta_x,const double rigidity,ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o columns: the number of columns in the rescaled image. |
| % |
| % o rows: the number of rows in the rescaled image. |
| % |
| % o delta_x: maximum seam transversal step (0 means straight seams). |
| % |
| % o rigidity: introduce a bias for non-straight seams (typically 0). |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport Image *LiquidRescaleImage(const Image *image, |
| const unsigned long columns,const unsigned long rows, |
| const double delta_x,const double rigidity,ExceptionInfo *exception) |
| { |
| #define LiquidRescaleImageTag "Rescale/Image" |
| |
| const char |
| *map; |
| |
| guchar |
| *packet; |
| |
| Image |
| *rescale_image; |
| |
| int |
| x, |
| y; |
| |
| LqrCarver |
| *carver; |
| |
| LqrRetVal |
| lqr_status; |
| |
| MagickBooleanType |
| status; |
| |
| MagickPixelPacket |
| pixel; |
| |
| unsigned char |
| *pixels; |
| |
| /* |
| Liquid rescale image. |
| */ |
| assert(image != (const Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| if ((columns == 0) || (rows == 0)) |
| return((Image *) NULL); |
| if ((columns == image->columns) && (rows == image->rows)) |
| return(CloneImage(image,0,0,MagickTrue,exception)); |
| if ((columns <= 2) || (rows <= 2)) |
| return(ZoomImage(image,columns,rows,exception)); |
| if ((columns >= (2*image->columns)) || (rows >= (2*image->rows))) |
| { |
| Image |
| *resize_image; |
| |
| unsigned long |
| height, |
| width; |
| |
| /* |
| Honor liquid resize size limitations. |
| */ |
| for (width=image->columns; columns >= (2*width-1); width*=2); |
| for (height=image->rows; rows >= (2*height-1); height*=2); |
| resize_image=ResizeImage(image,width,height,image->filter,image->blur, |
| exception); |
| if (resize_image == (Image *) NULL) |
| return((Image *) NULL); |
| rescale_image=LiquidRescaleImage(resize_image,columns,rows,delta_x, |
| rigidity,exception); |
| resize_image=DestroyImage(resize_image); |
| return(rescale_image); |
| } |
| map="RGB"; |
| if (image->matte == MagickFalse) |
| map="RGBA"; |
| if (image->colorspace == CMYKColorspace) |
| { |
| map="CMYK"; |
| if (image->matte == MagickFalse) |
| map="CMYKA"; |
| } |
| pixels=(unsigned char *) AcquireQuantumMemory(image->columns,image->rows* |
| strlen(map)*sizeof(*pixels)); |
| if (pixels == (unsigned char *) NULL) |
| return((Image *) NULL); |
| status=ExportImagePixels(image,0,0,image->columns,image->rows,map,CharPixel, |
| pixels,exception); |
| if (status == MagickFalse) |
| { |
| pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| } |
| carver=lqr_carver_new(pixels,image->columns,image->rows,strlen(map)); |
| if (carver == (LqrCarver *) NULL) |
| { |
| pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| } |
| lqr_status=lqr_carver_init(carver,(int) delta_x,rigidity); |
| lqr_status=lqr_carver_resize(carver,columns,rows); |
| rescale_image=CloneImage(image,lqr_carver_get_width(carver), |
| lqr_carver_get_height(carver),MagickTrue,exception); |
| if (rescale_image == (Image *) NULL) |
| { |
| pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| return((Image *) NULL); |
| } |
| if (SetImageStorageClass(rescale_image,DirectClass) == MagickFalse) |
| { |
| InheritException(exception,&rescale_image->exception); |
| rescale_image=DestroyImage(rescale_image); |
| return((Image *) NULL); |
| } |
| GetMagickPixelPacket(rescale_image,&pixel); |
| (void) lqr_carver_scan_reset(carver); |
| while (lqr_carver_scan(carver,&x,&y,&packet) != 0) |
| { |
| register IndexPacket |
| *restrict rescale_indexes; |
| |
| register PixelPacket |
| *restrict q; |
| |
| q=QueueAuthenticPixels(rescale_image,x,y,1,1,exception); |
| if (q == (PixelPacket *) NULL) |
| break; |
| rescale_indexes=GetAuthenticIndexQueue(rescale_image); |
| pixel.red=QuantumRange*(packet[0]/255.0); |
| pixel.green=QuantumRange*(packet[1]/255.0); |
| pixel.blue=QuantumRange*(packet[2]/255.0); |
| if (image->colorspace != CMYKColorspace) |
| { |
| if (image->matte == MagickFalse) |
| pixel.opacity=QuantumRange*(packet[3]/255.0); |
| } |
| else |
| { |
| pixel.index=QuantumRange*(packet[3]/255.0); |
| if (image->matte == MagickFalse) |
| pixel.opacity=QuantumRange*(packet[4]/255.0); |
| } |
| SetPixelPacket(rescale_image,&pixel,q,rescale_indexes); |
| if (SyncAuthenticPixels(rescale_image,exception) == MagickFalse) |
| break; |
| } |
| /* |
| Relinquish resources. |
| */ |
| lqr_carver_destroy(carver); |
| return(rescale_image); |
| } |
| #else |
| MagickExport Image *LiquidRescaleImage(const Image *image, |
| const unsigned long magick_unused(columns), |
| const unsigned long magick_unused(rows),const double magick_unused(delta_x), |
| const double magick_unused(rigidity),ExceptionInfo *exception) |
| { |
| assert(image != (const Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| (void) ThrowMagickException(exception,GetMagickModule(),MissingDelegateError, |
| "DelegateLibrarySupportNotBuiltIn","`%s' (LQR)",image->filename); |
| return((Image *) NULL); |
| } |
| #endif |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % R e s i z e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % ResizeImage() scales an image to the desired dimensions, using the given |
| % filter (see AcquireFilterInfo() ). |
| % |
| % If an undefined filter is given the filter defaults to Mitchell for a |
| % colormapped image, a image with a matte channel, or if the image is |
| % enlarged. Otherwise the filter defaults to a Lanczos. |
| % |
| % ResizeImage() was inspired by Paul Heckbert's "zoom" program. |
| % |
| % The format of the ResizeImage method is: |
| % |
| % Image *ResizeImage(Image *image,const unsigned long columns, |
| % const unsigned long rows,const FilterTypes filter,const double blur, |
| % ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o columns: the number of columns in the scaled image. |
| % |
| % o rows: the number of rows in the scaled image. |
| % |
| % o filter: Image filter to use. |
| % |
| % o blur: the blur factor where > 1 is blurry, < 1 is sharp. |
| % Typically set this to 1.0. |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| |
| typedef struct _ContributionInfo |
| { |
| MagickRealType |
| weight; |
| |
| long |
| pixel; |
| } ContributionInfo; |
| |
| static ContributionInfo **DestroyContributionThreadSet( |
| ContributionInfo **contribution) |
| { |
| register long |
| i; |
| |
| assert(contribution != (ContributionInfo **) NULL); |
| for (i=0; i < (long) GetOpenMPMaximumThreads(); i++) |
| if (contribution[i] != (ContributionInfo *) NULL) |
| contribution[i]=(ContributionInfo *) RelinquishMagickMemory( |
| contribution[i]); |
| contribution=(ContributionInfo **) RelinquishAlignedMemory(contribution); |
| return(contribution); |
| } |
| |
| static ContributionInfo **AcquireContributionThreadSet(const size_t count) |
| { |
| register long |
| i; |
| |
| ContributionInfo |
| **contribution; |
| |
| unsigned long |
| number_threads; |
| |
| number_threads=GetOpenMPMaximumThreads(); |
| contribution=(ContributionInfo **) AcquireAlignedMemory(number_threads, |
| sizeof(*contribution)); |
| if (contribution == (ContributionInfo **) NULL) |
| return((ContributionInfo **) NULL); |
| (void) ResetMagickMemory(contribution,0,number_threads*sizeof(*contribution)); |
| for (i=0; i < (long) number_threads; i++) |
| { |
| contribution[i]=(ContributionInfo *) AcquireQuantumMemory(count, |
| sizeof(**contribution)); |
| if (contribution[i] == (ContributionInfo *) NULL) |
| return(DestroyContributionThreadSet(contribution)); |
| } |
| return(contribution); |
| } |
| |
| static inline double MagickMax(const double x,const double y) |
| { |
| if (x > y) |
| return(x); |
| return(y); |
| } |
| |
| static inline double MagickMin(const double x,const double y) |
| { |
| if (x < y) |
| return(x); |
| return(y); |
| } |
| |
| static MagickBooleanType HorizontalFilter(const ResizeFilter *resize_filter, |
| const Image *image,Image *resize_image,const MagickRealType x_factor, |
| const MagickSizeType span,MagickOffsetType *quantum,ExceptionInfo *exception) |
| { |
| #define ResizeImageTag "Resize/Image" |
| |
| ClassType |
| storage_class; |
| |
| ContributionInfo |
| **contributions; |
| |
| long |
| x; |
| |
| MagickBooleanType |
| status; |
| |
| MagickPixelPacket |
| zero; |
| |
| MagickRealType |
| scale, |
| support; |
| |
| CacheView |
| *image_view, |
| *resize_view; |
| |
| /* |
| Apply filter to resize horizontally from image to resize image. |
| */ |
| scale=MagickMax(1.0/x_factor,1.0); |
| support=scale*GetResizeFilterSupport(resize_filter); |
| storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| { |
| InheritException(exception,&resize_image->exception); |
| return(MagickFalse); |
| } |
| if (support < 0.5) |
| { |
| /* |
| Support too small even for nearest neighbour: reduce to point sampling. |
| */ |
| support=(MagickRealType) 0.5; |
| scale=1.0; |
| } |
| contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| if (contributions == (ContributionInfo **) NULL) |
| { |
| (void) ThrowMagickException(exception,GetMagickModule(), |
| ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| return(MagickFalse); |
| } |
| status=MagickTrue; |
| scale=1.0/scale; |
| (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| image_view=AcquireCacheView(image); |
| resize_view=AcquireCacheView(resize_image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for shared(status) |
| #endif |
| for (x=0; x < (long) resize_image->columns; x++) |
| { |
| long |
| n, |
| start, |
| stop; |
| |
| MagickRealType |
| center, |
| density; |
| |
| register const IndexPacket |
| *restrict indexes; |
| |
| register const PixelPacket |
| *restrict p; |
| |
| register ContributionInfo |
| *restrict contribution; |
| |
| register IndexPacket |
| *restrict resize_indexes; |
| |
| register long |
| y; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| center=(MagickRealType) (x+0.5)/x_factor; |
| start=(long) (MagickMax(center-support-MagickEpsilon,0.0)+0.5); |
| stop=(long) (MagickMin(center+support,(double) image->columns)+0.5); |
| density=0.0; |
| contribution=contributions[GetOpenMPThreadId()]; |
| for (n=0; n < (stop-start); n++) |
| { |
| contribution[n].pixel=start+n; |
| contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| ((MagickRealType) (start+n)-center+0.5)); |
| density+=contribution[n].weight; |
| } |
| if ((density != 0.0) && (density != 1.0)) |
| { |
| register long |
| i; |
| |
| /* |
| Normalize. |
| */ |
| density=1.0/density; |
| for (i=0; i < n; i++) |
| contribution[i].weight*=density; |
| } |
| p=GetCacheViewVirtualPixels(image_view,contribution[0].pixel,0, |
| (unsigned long) (contribution[n-1].pixel-contribution[0].pixel+1), |
| image->rows,exception); |
| q=QueueCacheViewAuthenticPixels(resize_view,x,0,1,resize_image->rows, |
| exception); |
| if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewVirtualIndexQueue(image_view); |
| resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
| for (y=0; y < (long) resize_image->rows; y++) |
| { |
| long |
| j; |
| |
| MagickPixelPacket |
| pixel; |
| |
| MagickRealType |
| alpha; |
| |
| register long |
| i; |
| |
| pixel=zero; |
| if (image->matte == MagickFalse) |
| { |
| for (i=0; i < n; i++) |
| { |
| j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| (contribution[i].pixel-contribution[0].pixel); |
| alpha=contribution[i].weight; |
| pixel.red+=alpha*(p+j)->red; |
| pixel.green+=alpha*(p+j)->green; |
| pixel.blue+=alpha*(p+j)->blue; |
| pixel.opacity+=alpha*(p+j)->opacity; |
| } |
| q->red=RoundToQuantum(pixel.red); |
| q->green=RoundToQuantum(pixel.green); |
| q->blue=RoundToQuantum(pixel.blue); |
| q->opacity=RoundToQuantum(pixel.opacity); |
| if ((image->colorspace == CMYKColorspace) && |
| (resize_image->colorspace == CMYKColorspace)) |
| { |
| for (i=0; i < n; i++) |
| { |
| j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| (contribution[i].pixel-contribution[0].pixel); |
| alpha=contribution[i].weight; |
| pixel.index+=alpha*indexes[j]; |
| } |
| resize_indexes[y]=(IndexPacket) RoundToQuantum(pixel.index); |
| } |
| } |
| else |
| { |
| MagickRealType |
| gamma; |
| |
| gamma=0.0; |
| for (i=0; i < n; i++) |
| { |
| j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| (contribution[i].pixel-contribution[0].pixel); |
| alpha=contribution[i].weight*QuantumScale*((MagickRealType) |
| QuantumRange-(p+j)->opacity); |
| pixel.red+=alpha*(p+j)->red; |
| pixel.green+=alpha*(p+j)->green; |
| pixel.blue+=alpha*(p+j)->blue; |
| pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| gamma+=alpha; |
| } |
| gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
| q->red=RoundToQuantum(gamma*pixel.red); |
| q->green=RoundToQuantum(gamma*pixel.green); |
| q->blue=RoundToQuantum(gamma*pixel.blue); |
| q->opacity=RoundToQuantum(pixel.opacity); |
| if ((image->colorspace == CMYKColorspace) && |
| (resize_image->colorspace == CMYKColorspace)) |
| { |
| for (i=0; i < n; i++) |
| { |
| j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| (contribution[i].pixel-contribution[0].pixel); |
| alpha=contribution[i].weight*QuantumScale*((MagickRealType) |
| QuantumRange-(p+j)->opacity); |
| pixel.index+=alpha*indexes[j]; |
| } |
| resize_indexes[y]=(IndexPacket) RoundToQuantum(gamma*pixel.index); |
| } |
| } |
| if ((resize_image->storage_class == PseudoClass) && |
| (image->storage_class == PseudoClass)) |
| { |
| i=(long) (MagickMin(MagickMax(center,(double) start),(double) stop- |
| 1.0)+0.5); |
| j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| (contribution[i-start].pixel-contribution[0].pixel); |
| resize_indexes[y]=indexes[j]; |
| } |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_HorizontalFilter) |
| #endif |
| proceed=SetImageProgress(image,ResizeImageTag,(*quantum)++,span); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| resize_view=DestroyCacheView(resize_view); |
| image_view=DestroyCacheView(image_view); |
| contributions=DestroyContributionThreadSet(contributions); |
| return(status); |
| } |
| |
| static MagickBooleanType VerticalFilter(const ResizeFilter *resize_filter, |
| const Image *image,Image *resize_image,const MagickRealType y_factor, |
| const MagickSizeType span,MagickOffsetType *quantum,ExceptionInfo *exception) |
| { |
| ClassType |
| storage_class; |
| |
| ContributionInfo |
| **contributions; |
| |
| long |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| MagickPixelPacket |
| zero; |
| |
| MagickRealType |
| scale, |
| support; |
| |
| CacheView |
| *image_view, |
| *resize_view; |
| |
| /* |
| Apply filter to resize vertically from image to resize_image. |
| */ |
| scale=MagickMax(1.0/y_factor,1.0); |
| support=scale*GetResizeFilterSupport(resize_filter); |
| storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| { |
| InheritException(exception,&resize_image->exception); |
| return(MagickFalse); |
| } |
| if (support < 0.5) |
| { |
| /* |
| Support too small even for nearest neighbour: reduce to point sampling. |
| */ |
| support=(MagickRealType) 0.5; |
| scale=1.0; |
| } |
| contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| if (contributions == (ContributionInfo **) NULL) |
| { |
| (void) ThrowMagickException(exception,GetMagickModule(), |
| ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| return(MagickFalse); |
| } |
| status=MagickTrue; |
| scale=1.0/scale; |
| (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| image_view=AcquireCacheView(image); |
| resize_view=AcquireCacheView(resize_image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for shared(status) |
| #endif |
| for (y=0; y < (long) resize_image->rows; y++) |
| { |
| long |
| n, |
| start, |
| stop; |
| |
| MagickRealType |
| center, |
| density; |
| |
| register const IndexPacket |
| *restrict indexes; |
| |
| register const PixelPacket |
| *restrict p; |
| |
| register ContributionInfo |
| *restrict contribution; |
| |
| register IndexPacket |
| *restrict resize_indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| center=(MagickRealType) (y+0.5)/y_factor; |
| start=(long) (MagickMax(center-support-MagickEpsilon,0.0)+0.5); |
| stop=(long) (MagickMin(center+support,(double) image->rows)+0.5); |
| density=0.0; |
| contribution=contributions[GetOpenMPThreadId()]; |
| for (n=0; n < (stop-start); n++) |
| { |
| contribution[n].pixel=start+n; |
| contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| ((MagickRealType) (start+n)-center+0.5)); |
| density+=contribution[n].weight; |
| } |
| if ((density != 0.0) && (density != 1.0)) |
| { |
| register long |
| i; |
| |
| /* |
| Normalize. |
| */ |
| density=1.0/density; |
| for (i=0; i < n; i++) |
| contribution[i].weight*=density; |
| } |
| p=GetCacheViewVirtualPixels(image_view,0,contribution[0].pixel, |
| image->columns,(unsigned long) (contribution[n-1].pixel- |
| contribution[0].pixel+1),exception); |
| q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| exception); |
| if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewVirtualIndexQueue(image_view); |
| resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
| for (x=0; x < (long) resize_image->columns; x++) |
| { |
| long |
| j; |
| |
| MagickPixelPacket |
| pixel; |
| |
| MagickRealType |
| alpha; |
| |
| register long |
| i; |
| |
| pixel=zero; |
| if (image->matte == MagickFalse) |
| { |
| for (i=0; i < n; i++) |
| { |
| j=(long) ((contribution[i].pixel-contribution[0].pixel)* |
| image->columns+x); |
| alpha=contribution[i].weight; |
| pixel.red+=alpha*(p+j)->red; |
| pixel.green+=alpha*(p+j)->green; |
| pixel.blue+=alpha*(p+j)->blue; |
| pixel.opacity+=alpha*(p+j)->opacity; |
| } |
| q->red=RoundToQuantum(pixel.red); |
| q->green=RoundToQuantum(pixel.green); |
| q->blue=RoundToQuantum(pixel.blue); |
| q->opacity=RoundToQuantum(pixel.opacity); |
| if ((image->colorspace == CMYKColorspace) && |
| (resize_image->colorspace == CMYKColorspace)) |
| { |
| for (i=0; i < n; i++) |
| { |
| j=(long) ((contribution[i].pixel-contribution[0].pixel)* |
| image->columns+x); |
| alpha=contribution[i].weight; |
| pixel.index+=alpha*indexes[j]; |
| } |
| resize_indexes[x]=(IndexPacket) RoundToQuantum(pixel.index); |
| } |
| } |
| else |
| { |
| MagickRealType |
| gamma; |
| |
| gamma=0.0; |
| for (i=0; i < n; i++) |
| { |
| j=(long) ((contribution[i].pixel-contribution[0].pixel)* |
| image->columns+x); |
| alpha=contribution[i].weight*QuantumScale*((MagickRealType) |
| QuantumRange-(p+j)->opacity); |
| pixel.red+=alpha*(p+j)->red; |
| pixel.green+=alpha*(p+j)->green; |
| pixel.blue+=alpha*(p+j)->blue; |
| pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| gamma+=alpha; |
| } |
| gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
| q->red=RoundToQuantum(gamma*pixel.red); |
| q->green=RoundToQuantum(gamma*pixel.green); |
| q->blue=RoundToQuantum(gamma*pixel.blue); |
| q->opacity=RoundToQuantum(pixel.opacity); |
| if ((image->colorspace == CMYKColorspace) && |
| (resize_image->colorspace == CMYKColorspace)) |
| { |
| for (i=0; i < n; i++) |
| { |
| j=(long) ((contribution[i].pixel-contribution[0].pixel)* |
| image->columns+x); |
| alpha=contribution[i].weight*QuantumScale*((MagickRealType) |
| QuantumRange-(p+j)->opacity); |
| pixel.index+=alpha*indexes[j]; |
| } |
| resize_indexes[x]=(IndexPacket) RoundToQuantum(gamma*pixel.index); |
| } |
| } |
| if ((resize_image->storage_class == PseudoClass) && |
| (image->storage_class == PseudoClass)) |
| { |
| i=(long) (MagickMin(MagickMax(center,(double) start),(double) stop- |
| 1.0)+0.5); |
| j=(long) ((contribution[i-start].pixel-contribution[0].pixel)* |
| image->columns+x); |
| resize_indexes[x]=indexes[j]; |
| } |
| q++; |
| } |
| if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_VerticalFilter) |
| #endif |
| proceed=SetImageProgress(image,ResizeImageTag,(*quantum)++,span); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| resize_view=DestroyCacheView(resize_view); |
| image_view=DestroyCacheView(image_view); |
| contributions=DestroyContributionThreadSet(contributions); |
| return(status); |
| } |
| |
| MagickExport Image *ResizeImage(const Image *image,const unsigned long columns, |
| const unsigned long rows,const FilterTypes filter,const double blur, |
| ExceptionInfo *exception) |
| { |
| #define WorkLoadFactor 0.265 |
| |
| FilterTypes |
| filter_type; |
| |
| Image |
| *filter_image, |
| *resize_image; |
| |
| MagickRealType |
| x_factor, |
| y_factor; |
| |
| MagickSizeType |
| span; |
| |
| MagickStatusType |
| status; |
| |
| ResizeFilter |
| *resize_filter; |
| |
| MagickOffsetType |
| quantum; |
| |
| /* |
| Acquire resize image. |
| */ |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| if ((columns == 0) || (rows == 0)) |
| ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| if ((columns == image->columns) && (rows == image->rows) && |
| (filter == UndefinedFilter) && (blur == 1.0)) |
| return(CloneImage(image,0,0,MagickTrue,exception)); |
| resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| if (resize_image == (Image *) NULL) |
| return(resize_image); |
| /* |
| Acquire resize filter. |
| */ |
| x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| if ((x_factor*y_factor) > WorkLoadFactor) |
| filter_image=CloneImage(image,columns,image->rows,MagickTrue,exception); |
| else |
| filter_image=CloneImage(image,image->columns,rows,MagickTrue,exception); |
| if (filter_image == (Image *) NULL) |
| return(DestroyImage(resize_image)); |
| filter_type=LanczosFilter; |
| if (filter != UndefinedFilter) |
| filter_type=filter; |
| else |
| if ((x_factor == 1.0) && (y_factor == 1.0)) |
| filter_type=PointFilter; |
| else |
| if ((image->storage_class == PseudoClass) || |
| (image->matte != MagickFalse) || ((x_factor*y_factor) > 1.0)) |
| filter_type=MitchellFilter; |
| resize_filter=AcquireResizeFilter(image,filter_type,blur,MagickFalse, |
| exception); |
| /* |
| Resize image. |
| */ |
| quantum=0; |
| if ((x_factor*y_factor) > WorkLoadFactor) |
| { |
| span=(MagickSizeType) (filter_image->columns+rows); |
| status=HorizontalFilter(resize_filter,image,filter_image,x_factor,span, |
| &quantum,exception); |
| status&=VerticalFilter(resize_filter,filter_image,resize_image,y_factor, |
| span,&quantum,exception); |
| } |
| else |
| { |
| span=(MagickSizeType) (filter_image->rows+columns); |
| status=VerticalFilter(resize_filter,image,filter_image,y_factor,span, |
| &quantum,exception); |
| status&=HorizontalFilter(resize_filter,filter_image,resize_image,x_factor, |
| span,&quantum,exception); |
| } |
| /* |
| Free resources. |
| */ |
| filter_image=DestroyImage(filter_image); |
| resize_filter=DestroyResizeFilter(resize_filter); |
| if ((status == MagickFalse) || (resize_image == (Image *) NULL)) |
| return((Image *) NULL); |
| resize_image->type=image->type; |
| return(resize_image); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % S a m p l e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % SampleImage() scales an image to the desired dimensions with pixel |
| % sampling. Unlike other scaling methods, this method does not introduce |
| % any additional color into the scaled image. |
| % |
| % The format of the SampleImage method is: |
| % |
| % Image *SampleImage(const Image *image,const unsigned long columns, |
| % const unsigned long rows,ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o columns: the number of columns in the sampled image. |
| % |
| % o rows: the number of rows in the sampled image. |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport Image *SampleImage(const Image *image,const unsigned long columns, |
| const unsigned long rows,ExceptionInfo *exception) |
| { |
| #define SampleImageTag "Sample/Image" |
| |
| Image |
| *sample_image; |
| |
| long |
| progress, |
| *x_offset, |
| y; |
| |
| MagickBooleanType |
| status; |
| |
| register long |
| x; |
| |
| CacheView |
| *image_view, |
| *sample_view; |
| |
| /* |
| Initialize sampled image attributes. |
| */ |
| assert(image != (const Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| if ((columns == 0) || (rows == 0)) |
| ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| if ((columns == image->columns) && (rows == image->rows)) |
| return(CloneImage(image,0,0,MagickTrue,exception)); |
| sample_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| if (sample_image == (Image *) NULL) |
| return((Image *) NULL); |
| /* |
| Allocate scan line buffer and column offset buffers. |
| */ |
| x_offset=(long *) AcquireQuantumMemory((size_t) sample_image->columns, |
| sizeof(*x_offset)); |
| if (x_offset == (long *) NULL) |
| { |
| sample_image=DestroyImage(sample_image); |
| ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| } |
| for (x=0; x < (long) sample_image->columns; x++) |
| x_offset[x]=(long) (((MagickRealType) x+0.5)*image->columns/ |
| sample_image->columns); |
| /* |
| Sample each row. |
| */ |
| status=MagickTrue; |
| progress=0; |
| image_view=AcquireCacheView(image); |
| sample_view=AcquireCacheView(sample_image); |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
| #endif |
| for (y=0; y < (long) sample_image->rows; y++) |
| { |
| long |
| y_offset; |
| |
| register const IndexPacket |
| *restrict indexes; |
| |
| register const PixelPacket |
| *restrict p; |
| |
| register IndexPacket |
| *restrict sample_indexes; |
| |
| register long |
| x; |
| |
| register PixelPacket |
| *restrict q; |
| |
| if (status == MagickFalse) |
| continue; |
| y_offset=(long) (((MagickRealType) y+0.5)*image->rows/sample_image->rows); |
| p=GetCacheViewVirtualPixels(image_view,0,y_offset,image->columns,1, |
| exception); |
| q=QueueCacheViewAuthenticPixels(sample_view,0,y,sample_image->columns,1, |
| exception); |
| if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| { |
| status=MagickFalse; |
| continue; |
| } |
| indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| sample_indexes=GetCacheViewAuthenticIndexQueue(sample_view); |
| /* |
| Sample each column. |
| */ |
| for (x=0; x < (long) sample_image->columns; x++) |
| *q++=p[x_offset[x]]; |
| if ((image->storage_class == PseudoClass) || |
| (image->colorspace == CMYKColorspace)) |
| for (x=0; x < (long) sample_image->columns; x++) |
| sample_indexes[x]=indexes[x_offset[x]]; |
| if (SyncCacheViewAuthenticPixels(sample_view,exception) == MagickFalse) |
| status=MagickFalse; |
| if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| { |
| MagickBooleanType |
| proceed; |
| |
| #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| #pragma omp critical (MagickCore_SampleImage) |
| #endif |
| proceed=SetImageProgress(image,SampleImageTag,progress++,image->rows); |
| if (proceed == MagickFalse) |
| status=MagickFalse; |
| } |
| } |
| image_view=DestroyCacheView(image_view); |
| sample_view=DestroyCacheView(sample_view); |
| x_offset=(long *) RelinquishMagickMemory(x_offset); |
| sample_image->type=image->type; |
| return(sample_image); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % S c a l e I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % ScaleImage() changes the size of an image to the given dimensions. |
| % |
| % The format of the ScaleImage method is: |
| % |
| % Image *ScaleImage(const Image *image,const unsigned long columns, |
| % const unsigned long rows,ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o columns: the number of columns in the scaled image. |
| % |
| % o rows: the number of rows in the scaled image. |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport Image *ScaleImage(const Image *image,const unsigned long columns, |
| const unsigned long rows,ExceptionInfo *exception) |
| { |
| #define ScaleImageTag "Scale/Image" |
| |
| Image |
| *scale_image; |
| |
| long |
| number_rows, |
| y; |
| |
| MagickBooleanType |
| next_column, |
| next_row, |
| proceed; |
| |
| MagickPixelPacket |
| pixel, |
| *scale_scanline, |
| *scanline, |
| *x_vector, |
| *y_vector, |
| zero; |
| |
| PointInfo |
| scale, |
| span; |
| |
| register long |
| i; |
| |
| /* |
| Initialize scaled image attributes. |
| */ |
| assert(image != (const Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| if ((columns == 0) || (rows == 0)) |
| return((Image *) NULL); |
| if ((columns == image->columns) && (rows == image->rows)) |
| return(CloneImage(image,0,0,MagickTrue,exception)); |
| scale_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| if (scale_image == (Image *) NULL) |
| return((Image *) NULL); |
| if (SetImageStorageClass(scale_image,DirectClass) == MagickFalse) |
| { |
| InheritException(exception,&scale_image->exception); |
| scale_image=DestroyImage(scale_image); |
| return((Image *) NULL); |
| } |
| /* |
| Allocate memory. |
| */ |
| x_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| sizeof(*x_vector)); |
| scanline=x_vector; |
| if (image->rows != scale_image->rows) |
| scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| sizeof(*scanline)); |
| scale_scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) |
| scale_image->columns,sizeof(*scale_scanline)); |
| y_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| sizeof(*y_vector)); |
| if ((scanline == (MagickPixelPacket *) NULL) || |
| (scale_scanline == (MagickPixelPacket *) NULL) || |
| (x_vector == (MagickPixelPacket *) NULL) || |
| (y_vector == (MagickPixelPacket *) NULL)) |
| { |
| scale_image=DestroyImage(scale_image); |
| ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| } |
| /* |
| Scale image. |
| */ |
| number_rows=0; |
| next_row=MagickTrue; |
| span.y=1.0; |
| scale.y=(double) scale_image->rows/(double) image->rows; |
| (void) ResetMagickMemory(y_vector,0,(size_t) image->columns* |
| sizeof(*y_vector)); |
| GetMagickPixelPacket(image,&pixel); |
| (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| i=0; |
| for (y=0; y < (long) scale_image->rows; y++) |
| { |
| register const IndexPacket |
| *restrict indexes; |
| |
| register const PixelPacket |
| *restrict p; |
| |
| register IndexPacket |
| *restrict scale_indexes; |
| |
| register long |
| x; |
| |
| register MagickPixelPacket |
| *restrict s, |
| *restrict t; |
| |
| register PixelPacket |
| *restrict q; |
| |
| q=QueueAuthenticPixels(scale_image,0,y,scale_image->columns,1,exception); |
| if (q == (PixelPacket *) NULL) |
| break; |
| scale_indexes=GetAuthenticIndexQueue(scale_image); |
| if (scale_image->rows == image->rows) |
| { |
| /* |
| Read a new scanline. |
| */ |
| p=GetVirtualPixels(image,0,i++,image->columns,1,exception); |
| if (p == (const PixelPacket *) NULL) |
| break; |
| indexes=GetVirtualIndexQueue(image); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| x_vector[x].red=(MagickRealType) p->red; |
| x_vector[x].green=(MagickRealType) p->green; |
| x_vector[x].blue=(MagickRealType) p->blue; |
| if (image->matte != MagickFalse) |
| x_vector[x].opacity=(MagickRealType) p->opacity; |
| if (indexes != (IndexPacket *) NULL) |
| x_vector[x].index=(MagickRealType) indexes[x]; |
| p++; |
| } |
| } |
| else |
| { |
| /* |
| Scale Y direction. |
| */ |
| while (scale.y < span.y) |
| { |
| if ((next_row != MagickFalse) && (number_rows < (long) image->rows)) |
| { |
| /* |
| Read a new scanline. |
| */ |
| p=GetVirtualPixels(image,0,i++,image->columns,1,exception); |
| if (p == (const PixelPacket *) NULL) |
| break; |
| indexes=GetVirtualIndexQueue(image); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| x_vector[x].red=(MagickRealType) p->red; |
| x_vector[x].green=(MagickRealType) p->green; |
| x_vector[x].blue=(MagickRealType) p->blue; |
| if (image->matte != MagickFalse) |
| x_vector[x].opacity=(MagickRealType) p->opacity; |
| if (indexes != (IndexPacket *) NULL) |
| x_vector[x].index=(MagickRealType) indexes[x]; |
| p++; |
| } |
| number_rows++; |
| } |
| for (x=0; x < (long) image->columns; x++) |
| { |
| y_vector[x].red+=scale.y*x_vector[x].red; |
| y_vector[x].green+=scale.y*x_vector[x].green; |
| y_vector[x].blue+=scale.y*x_vector[x].blue; |
| if (scale_image->matte != MagickFalse) |
| y_vector[x].opacity+=scale.y*x_vector[x].opacity; |
| if (scale_indexes != (IndexPacket *) NULL) |
| y_vector[x].index+=scale.y*x_vector[x].index; |
| } |
| span.y-=scale.y; |
| scale.y=(double) scale_image->rows/(double) image->rows; |
| next_row=MagickTrue; |
| } |
| if ((next_row != MagickFalse) && (number_rows < (long) image->rows)) |
| { |
| /* |
| Read a new scanline. |
| */ |
| p=GetVirtualPixels(image,0,i++,image->columns,1,exception); |
| if (p == (const PixelPacket *) NULL) |
| break; |
| indexes=GetVirtualIndexQueue(image); |
| for (x=0; x < (long) image->columns; x++) |
| { |
| x_vector[x].red=(MagickRealType) p->red; |
| x_vector[x].green=(MagickRealType) p->green; |
| x_vector[x].blue=(MagickRealType) p->blue; |
| if (image->matte != MagickFalse) |
| x_vector[x].opacity=(MagickRealType) p->opacity; |
| if (indexes != (IndexPacket *) NULL) |
| x_vector[x].index=(MagickRealType) indexes[x]; |
| p++; |
| } |
| number_rows++; |
| next_row=MagickFalse; |
| } |
| s=scanline; |
| for (x=0; x < (long) image->columns; x++) |
| { |
| pixel.red=y_vector[x].red+span.y*x_vector[x].red; |
| pixel.green=y_vector[x].green+span.y*x_vector[x].green; |
| pixel.blue=y_vector[x].blue+span.y*x_vector[x].blue; |
| if (image->matte != MagickFalse) |
| pixel.opacity=y_vector[x].opacity+span.y*x_vector[x].opacity; |
| if (scale_indexes != (IndexPacket *) NULL) |
| pixel.index=y_vector[x].index+span.y*x_vector[x].index; |
| s->red=pixel.red; |
| s->green=pixel.green; |
| s->blue=pixel.blue; |
| if (scale_image->matte != MagickFalse) |
| s->opacity=pixel.opacity; |
| if (scale_indexes != (IndexPacket *) NULL) |
| s->index=pixel.index; |
| s++; |
| y_vector[x]=zero; |
| } |
| scale.y-=span.y; |
| if (scale.y <= 0) |
| { |
| scale.y=(double) scale_image->rows/(double) image->rows; |
| next_row=MagickTrue; |
| } |
| span.y=1.0; |
| } |
| if (scale_image->columns == image->columns) |
| { |
| /* |
| Transfer scanline to scaled image. |
| */ |
| s=scanline; |
| for (x=0; x < (long) scale_image->columns; x++) |
| { |
| q->red=RoundToQuantum(s->red); |
| q->green=RoundToQuantum(s->green); |
| q->blue=RoundToQuantum(s->blue); |
| if (scale_image->matte != MagickFalse) |
| q->opacity=RoundToQuantum(s->opacity); |
| if (scale_indexes != (IndexPacket *) NULL) |
| scale_indexes[x]=(IndexPacket) RoundToQuantum(s->index); |
| q++; |
| s++; |
| } |
| } |
| else |
| { |
| /* |
| Scale X direction. |
| */ |
| pixel=zero; |
| next_column=MagickFalse; |
| span.x=1.0; |
| s=scanline; |
| t=scale_scanline; |
| for (x=0; x < (long) image->columns; x++) |
| { |
| scale.x=(double) scale_image->columns/(double) image->columns; |
| while (scale.x >= span.x) |
| { |
| if (next_column != MagickFalse) |
| { |
| pixel=zero; |
| t++; |
| } |
| pixel.red+=span.x*s->red; |
| pixel.green+=span.x*s->green; |
| pixel.blue+=span.x*s->blue; |
| if (image->matte != MagickFalse) |
| pixel.opacity+=span.x*s->opacity; |
| if (scale_indexes != (IndexPacket *) NULL) |
| pixel.index+=span.x*s->index; |
| t->red=pixel.red; |
| t->green=pixel.green; |
| t->blue=pixel.blue; |
| if (scale_image->matte != MagickFalse) |
| t->opacity=pixel.opacity; |
| if (scale_indexes != (IndexPacket *) NULL) |
| t->index=pixel.index; |
| scale.x-=span.x; |
| span.x=1.0; |
| next_column=MagickTrue; |
| } |
| if (scale.x > 0) |
| { |
| if (next_column != MagickFalse) |
| { |
| pixel=zero; |
| next_column=MagickFalse; |
| t++; |
| } |
| pixel.red+=scale.x*s->red; |
| pixel.green+=scale.x*s->green; |
| pixel.blue+=scale.x*s->blue; |
| if (scale_image->matte != MagickFalse) |
| pixel.opacity+=scale.x*s->opacity; |
| if (scale_indexes != (IndexPacket *) NULL) |
| pixel.index+=scale.x*s->index; |
| span.x-=scale.x; |
| } |
| s++; |
| } |
| if (span.x > 0) |
| { |
| s--; |
| pixel.red+=span.x*s->red; |
| pixel.green+=span.x*s->green; |
| pixel.blue+=span.x*s->blue; |
| if (scale_image->matte != MagickFalse) |
| pixel.opacity+=span.x*s->opacity; |
| if (scale_indexes != (IndexPacket *) NULL) |
| pixel.index+=span.x*s->index; |
| } |
| if ((next_column == MagickFalse) && |
| ((long) (t-scale_scanline) < (long) scale_image->columns)) |
| { |
| t->red=pixel.red; |
| t->green=pixel.green; |
| t->blue=pixel.blue; |
| if (scale_image->matte != MagickFalse) |
| t->opacity=pixel.opacity; |
| if (scale_indexes != (IndexPacket *) NULL) |
| t->index=pixel.index; |
| } |
| /* |
| Transfer scanline to scaled image. |
| */ |
| t=scale_scanline; |
| for (x=0; x < (long) scale_image->columns; x++) |
| { |
| q->red=RoundToQuantum(t->red); |
| q->green=RoundToQuantum(t->green); |
| q->blue=RoundToQuantum(t->blue); |
| if (scale_image->matte != MagickFalse) |
| q->opacity=RoundToQuantum(t->opacity); |
| if (scale_indexes != (IndexPacket *) NULL) |
| scale_indexes[x]=(IndexPacket) RoundToQuantum(t->index); |
| t++; |
| q++; |
| } |
| } |
| if (SyncAuthenticPixels(scale_image,exception) == MagickFalse) |
| break; |
| proceed=SetImageProgress(image,ScaleImageTag,y,image->rows); |
| if (proceed == MagickFalse) |
| break; |
| } |
| /* |
| Free allocated memory. |
| */ |
| y_vector=(MagickPixelPacket *) RelinquishMagickMemory(y_vector); |
| scale_scanline=(MagickPixelPacket *) RelinquishMagickMemory(scale_scanline); |
| if (scale_image->rows != image->rows) |
| scanline=(MagickPixelPacket *) RelinquishMagickMemory(scanline); |
| x_vector=(MagickPixelPacket *) RelinquishMagickMemory(x_vector); |
| scale_image->type=image->type; |
| return(scale_image); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| + S e t R e s i z e F i l t e r S u p p o r t % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % SetResizeFilterSupport() specifies which IR filter to use to window |
| % |
| % The format of the SetResizeFilterSupport method is: |
| % |
| % void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| % const MagickRealType support) |
| % |
| % A description of each parameter follows: |
| % |
| % o resize_filter: the resize filter. |
| % |
| % o support: the filter spport radius. |
| % |
| */ |
| MagickExport void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| const MagickRealType support) |
| { |
| assert(resize_filter != (ResizeFilter *) NULL); |
| assert(resize_filter->signature == MagickSignature); |
| resize_filter->support=support; |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % T h u m b n a i l I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % ThumbnailImage() changes the size of an image to the given dimensions and |
| % removes any associated profiles. The goal is to produce small low cost |
| % thumbnail images suited for display on the Web. |
| % |
| % The format of the ThumbnailImage method is: |
| % |
| % Image *ThumbnailImage(const Image *image,const unsigned long columns, |
| % const unsigned long rows,ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o columns: the number of columns in the scaled image. |
| % |
| % o rows: the number of rows in the scaled image. |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport Image *ThumbnailImage(const Image *image, |
| const unsigned long columns,const unsigned long rows,ExceptionInfo *exception) |
| { |
| #define SampleFactor 5 |
| |
| char |
| value[MaxTextExtent]; |
| |
| const char |
| *name; |
| |
| Image |
| *thumbnail_image; |
| |
| MagickRealType |
| x_factor, |
| y_factor; |
| |
| struct stat |
| attributes; |
| |
| unsigned long |
| version; |
| |
| assert(image != (Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| if ((x_factor*y_factor) > 0.1) |
| thumbnail_image=ZoomImage(image,columns,rows,exception); |
| else |
| if (((SampleFactor*columns) < 128) || ((SampleFactor*rows) < 128)) |
| thumbnail_image=ZoomImage(image,columns,rows,exception); |
| else |
| { |
| Image |
| *sample_image; |
| |
| sample_image=SampleImage(image,SampleFactor*columns,SampleFactor*rows, |
| exception); |
| if (sample_image == (Image *) NULL) |
| return((Image *) NULL); |
| thumbnail_image=ZoomImage(sample_image,columns,rows,exception); |
| sample_image=DestroyImage(sample_image); |
| } |
| if (thumbnail_image == (Image *) NULL) |
| return(thumbnail_image); |
| (void) ParseAbsoluteGeometry("0x0+0+0",&thumbnail_image->page); |
| if (thumbnail_image->matte == MagickFalse) |
| (void) SetImageAlphaChannel(thumbnail_image,OpaqueAlphaChannel); |
| thumbnail_image->depth=8; |
| thumbnail_image->interlace=NoInterlace; |
| /* |
| Strip all profiles except color profiles. |
| */ |
| ResetImageProfileIterator(thumbnail_image); |
| for (name=GetNextImageProfile(thumbnail_image); name != (const char *) NULL; ) |
| { |
| if ((LocaleCompare(name,"icc") != 0) && (LocaleCompare(name,"icm") != 0)) |
| { |
| DeleteImageProfile(thumbnail_image,name); |
| ResetImageProfileIterator(thumbnail_image); |
| } |
| name=GetNextImageProfile(thumbnail_image); |
| } |
| (void) DeleteImageProperty(thumbnail_image,"comment"); |
| (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
| if (strstr(image->magick_filename,"//") == (char *) NULL) |
| (void) FormatMagickString(value,MaxTextExtent,"file://%s", |
| image->magick_filename); |
| (void) SetImageProperty(thumbnail_image,"Thumb::URI",value); |
| (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
| if (GetPathAttributes(image->filename,&attributes) != MagickFalse) |
| { |
| (void) FormatMagickString(value,MaxTextExtent,"%ld",(long) |
| attributes.st_mtime); |
| (void) SetImageProperty(thumbnail_image,"Thumb::MTime",value); |
| } |
| (void) FormatMagickString(value,MaxTextExtent,"%ld",(long) |
| attributes.st_mtime); |
| (void) FormatMagickSize(GetBlobSize(image),MagickFalse,value); |
| (void) SetImageProperty(thumbnail_image,"Thumb::Size",value); |
| (void) FormatMagickString(value,MaxTextExtent,"image/%s",image->magick); |
| LocaleLower(value); |
| (void) SetImageProperty(thumbnail_image,"Thumb::Mimetype",value); |
| (void) SetImageProperty(thumbnail_image,"software", |
| GetMagickVersion(&version)); |
| (void) FormatMagickString(value,MaxTextExtent,"%lu",image->magick_columns); |
| (void) SetImageProperty(thumbnail_image,"Thumb::Image::Width",value); |
| (void) FormatMagickString(value,MaxTextExtent,"%lu",image->magick_rows); |
| (void) SetImageProperty(thumbnail_image,"Thumb::Image::height",value); |
| (void) FormatMagickString(value,MaxTextExtent,"%lu", |
| GetImageListLength(image)); |
| (void) SetImageProperty(thumbnail_image,"Thumb::Document::Pages",value); |
| return(thumbnail_image); |
| } |
| |
| /* |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % % |
| % % |
| % % |
| % Z o o m I m a g e % |
| % % |
| % % |
| % % |
| %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| % |
| % ZoomImage() creates a new image that is a scaled size of an existing one. |
| % It allocates the memory necessary for the new Image structure and returns a |
| % pointer to the new image. The Point filter gives fast pixel replication, |
| % Triangle is equivalent to bi-linear interpolation, and Mitchel giver slower, |
| % very high-quality results. See Graphic Gems III for details on this |
| % algorithm. |
| % |
| % The filter member of the Image structure specifies which image filter to |
| % use. Blur specifies the blur factor where > 1 is blurry, < 1 is sharp. |
| % |
| % The format of the ZoomImage method is: |
| % |
| % Image *ZoomImage(const Image *image,const unsigned long columns, |
| % const unsigned long rows,ExceptionInfo *exception) |
| % |
| % A description of each parameter follows: |
| % |
| % o image: the image. |
| % |
| % o columns: An integer that specifies the number of columns in the zoom |
| % image. |
| % |
| % o rows: An integer that specifies the number of rows in the scaled |
| % image. |
| % |
| % o exception: return any errors or warnings in this structure. |
| % |
| */ |
| MagickExport Image *ZoomImage(const Image *image,const unsigned long columns, |
| const unsigned long rows,ExceptionInfo *exception) |
| { |
| Image |
| *zoom_image; |
| |
| assert(image != (const Image *) NULL); |
| assert(image->signature == MagickSignature); |
| if (image->debug != MagickFalse) |
| (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| assert(exception != (ExceptionInfo *) NULL); |
| assert(exception->signature == MagickSignature); |
| zoom_image=ResizeImage(image,columns,rows,image->filter,image->blur, |
| exception); |
| return(zoom_image); |
| } |