cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1 | /* |
| 2 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3 | % % |
| 4 | % % |
| 5 | % % |
| 6 | % RRRR EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| 7 | % R R E SS I ZZ E % |
| 8 | % RRRR EEE SSS I ZZZ EEE % |
| 9 | % R R E SS I ZZ E % |
| 10 | % R R EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| 11 | % % |
| 12 | % % |
| 13 | % MagickCore Image Resize Methods % |
| 14 | % % |
| 15 | % Software Design % |
| 16 | % John Cristy % |
| 17 | % July 1992 % |
| 18 | % % |
| 19 | % % |
cristy | 16af1cb | 2009-12-11 21:38:29 +0000 | [diff] [blame] | 20 | % Copyright 1999-2010 ImageMagick Studio LLC, a non-profit organization % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 21 | % dedicated to making software imaging solutions freely available. % |
| 22 | % % |
| 23 | % You may not use this file except in compliance with the License. You may % |
| 24 | % obtain a copy of the License at % |
| 25 | % % |
| 26 | % http://www.imagemagick.org/script/license.php % |
| 27 | % % |
| 28 | % Unless required by applicable law or agreed to in writing, software % |
| 29 | % distributed under the License is distributed on an "AS IS" BASIS, % |
| 30 | % WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. % |
| 31 | % See the License for the specific language governing permissions and % |
| 32 | % limitations under the License. % |
| 33 | % % |
| 34 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 35 | % |
| 36 | % |
| 37 | */ |
| 38 | |
| 39 | /* |
| 40 | Include declarations. |
| 41 | */ |
| 42 | #include "magick/studio.h" |
| 43 | #include "magick/artifact.h" |
| 44 | #include "magick/blob.h" |
| 45 | #include "magick/cache.h" |
| 46 | #include "magick/cache-view.h" |
| 47 | #include "magick/color.h" |
| 48 | #include "magick/color-private.h" |
| 49 | #include "magick/draw.h" |
| 50 | #include "magick/exception.h" |
| 51 | #include "magick/exception-private.h" |
| 52 | #include "magick/gem.h" |
| 53 | #include "magick/image.h" |
| 54 | #include "magick/image-private.h" |
| 55 | #include "magick/list.h" |
| 56 | #include "magick/memory_.h" |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 57 | #include "magick/magick.h" |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 58 | #include "magick/pixel-private.h" |
| 59 | #include "magick/property.h" |
| 60 | #include "magick/monitor.h" |
| 61 | #include "magick/monitor-private.h" |
| 62 | #include "magick/pixel.h" |
| 63 | #include "magick/option.h" |
| 64 | #include "magick/resample.h" |
| 65 | #include "magick/resize.h" |
| 66 | #include "magick/resize-private.h" |
| 67 | #include "magick/string_.h" |
cristy | f2f2727 | 2009-12-17 14:48:46 +0000 | [diff] [blame] | 68 | #include "magick/string-private.h" |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 69 | #include "magick/thread-private.h" |
| 70 | #include "magick/utility.h" |
| 71 | #include "magick/version.h" |
| 72 | #if defined(MAGICKCORE_LQR_DELEGATE) |
| 73 | #include <lqr.h> |
| 74 | #endif |
| 75 | |
| 76 | /* |
| 77 | Typedef declarations. |
| 78 | */ |
| 79 | struct _ResizeFilter |
| 80 | { |
| 81 | MagickRealType |
| 82 | (*filter)(const MagickRealType,const ResizeFilter *), |
| 83 | (*window)(const MagickRealType,const ResizeFilter *), |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 84 | support, /* filter region of support - the filter support limit */ |
| 85 | window_support, /* window support, usally equal to support (expert only) */ |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 86 | scale, /* dimension scaling to fit window support (usally 1.0) */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 87 | blur, /* x-scale (blur-sharpen) */ |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame^] | 88 | coeff[7]; /* cubic coefficents for BC-cubic spline filters */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 89 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 90 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 91 | signature; |
| 92 | }; |
| 93 | |
| 94 | /* |
| 95 | Forward declaractions. |
| 96 | */ |
| 97 | static MagickRealType |
| 98 | I0(MagickRealType x), |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 99 | BesselOrderOne(MagickRealType), |
anthony | 07a3f7f | 2010-09-16 03:03:11 +0000 | [diff] [blame] | 100 | Sinc(const MagickRealType, const ResizeFilter *), |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 101 | SincFast(const MagickRealType, const ResizeFilter *); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 102 | |
| 103 | /* |
| 104 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 105 | % % |
| 106 | % % |
| 107 | % % |
| 108 | + F i l t e r F u n c t i o n s % |
| 109 | % % |
| 110 | % % |
| 111 | % % |
| 112 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 113 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 114 | % These are the various filter and windowing functions that are provided. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 115 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 116 | % They are internal to this module only. See AcquireResizeFilterInfo() for |
| 117 | % details of the access to these functions, via the GetResizeFilterSupport() |
| 118 | % and GetResizeFilterWeight() API interface. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 119 | % |
| 120 | % The individual filter functions have this format... |
| 121 | % |
| 122 | % static MagickRealtype *FilterName(const MagickRealType x, |
| 123 | % const MagickRealType support) |
| 124 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 125 | % A description of each parameter follows: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 126 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 127 | % o x: the distance from the sampling point generally in the range of 0 to |
| 128 | % support. The GetResizeFilterWeight() ensures this a positive value. |
| 129 | % |
| 130 | % o resize_filter: current filter information. This allows function to |
| 131 | % access support, and possibly other pre-calculated information defining |
| 132 | % the functions. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 133 | % |
| 134 | */ |
| 135 | |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 136 | #define MagickPIL ((MagickRealType) 3.14159265358979323846264338327950288420L) |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 137 | |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 138 | static MagickRealType Jinc(const MagickRealType x, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 139 | const ResizeFilter *magick_unused(resize_filter)) |
| 140 | { |
| 141 | /* |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 142 | See Pratt "Digital Image Processing" p.97 for Jinc/Bessel functions. |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 143 | http://mathworld.wolfram.com/JincFunction.html and page 11 of |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 144 | http://www.ph.ed.ac.uk/%7ewjh/teaching/mo/slides/lens/lens.pdf |
| 145 | |
nicolas | e473f72 | 2010-10-07 00:05:13 +0000 | [diff] [blame] | 146 | The original "zoom" program by Paul Heckbert called this "Bessel". |
| 147 | But really it is more accurately named "Jinc". |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 148 | */ |
| 149 | if (x == 0.0) |
nicolas | 5a36f34 | 2010-10-07 00:11:32 +0000 | [diff] [blame] | 150 | return(0.5*MagickPIL); |
| 151 | return(BesselOrderOne(MagickPIL*x)/x); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 152 | } |
| 153 | |
| 154 | static MagickRealType Blackman(const MagickRealType x, |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 155 | const ResizeFilter *magick_unused(resize_filter)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 156 | { |
| 157 | /* |
cristy | 8301792 | 2010-09-05 20:45:15 +0000 | [diff] [blame] | 158 | Blackman: 2nd order cosine windowing function: |
cristy | 21ce88a | 2010-09-05 01:37:25 +0000 | [diff] [blame] | 159 | 0.42 + 0.5 cos(pi x) + 0.08 cos(2pi x) |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 160 | Refactored by Chantal Racette and Nicolas Robidoux to one trig |
| 161 | call and five flops. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 162 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 163 | const MagickRealType cospix = cos((double) (MagickPIL*x)); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 164 | return(0.34+cospix*(0.5+cospix*0.16)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 165 | } |
| 166 | |
| 167 | static MagickRealType Bohman(const MagickRealType x, |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 168 | const ResizeFilter *magick_unused(resize_filter)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 169 | { |
| 170 | /* |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 171 | Bohman: 2rd Order cosine windowing function: |
| 172 | (1-x) cos(pi x) + sin(pi x) / pi. |
nicolas | a4f7b4a | 2010-09-20 20:28:38 +0000 | [diff] [blame] | 173 | Refactored by Nicolas Robidoux to one trig call, one sqrt call, |
| 174 | and 7 flops, taking advantage of the fact that the support of |
| 175 | Bohman is 1 (so that we know that sin(pi x) >= 0). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 176 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 177 | const double cospix = cos((double) (MagickPIL*x)); |
nicolas | a4f7b4a | 2010-09-20 20:28:38 +0000 | [diff] [blame] | 178 | const double sinpix = sqrt(1.0-cospix*cospix); |
nicolas | 2ffd3b2 | 2010-09-24 20:27:31 +0000 | [diff] [blame] | 179 | return((1.0-x)*cospix+(1.0/MagickPIL)*sinpix); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 180 | } |
| 181 | |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 182 | static MagickRealType Box(const MagickRealType magick_unused(x), |
| 183 | const ResizeFilter *magick_unused(resize_filter)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 184 | { |
| 185 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 186 | A Box filter is a equal weighting function (all weights equal). |
anthony | c331dec | 2010-09-26 01:30:14 +0000 | [diff] [blame] | 187 | DO NOT LIMIT results by support or resize point sampling will work |
| 188 | as it requests points beyond its normal 0.0 support size. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 189 | */ |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 190 | return(1.0); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 191 | } |
| 192 | |
| 193 | static MagickRealType CubicBC(const MagickRealType x, |
| 194 | const ResizeFilter *resize_filter) |
| 195 | { |
| 196 | /* |
| 197 | Cubic Filters using B,C determined values: |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame^] | 198 | Mitchell-Netravali B= 1/3 C= 1/3 "Balanced" cubic spline filter |
| 199 | Catmull-Rom B= 0 C= 1/2 Interpolatory and exact on linears |
| 200 | Cubic B-Spline B= 1 C= 0 Spline approximation of Gaussian |
| 201 | Hermite B= 0 C= 0 Spline with small support (= 1) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 202 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 203 | See paper by Mitchell and Netravali, Reconstruction Filters in Computer |
| 204 | Graphics Computer Graphics, Volume 22, Number 4, August 1988 |
| 205 | http://www.cs.utexas.edu/users/fussell/courses/cs384g/lectures/mitchell/ |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 206 | Mitchell.pdf. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 207 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 208 | Coefficents are determined from B,C values: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 209 | P0 = ( 6 - 2*B )/6 |
| 210 | P1 = 0 |
| 211 | P2 = (-18 +12*B + 6*C )/6 |
| 212 | P3 = ( 12 - 9*B - 6*C )/6 |
| 213 | Q0 = ( 8*B +24*C )/6 |
| 214 | Q1 = ( -12*B -48*C )/6 |
| 215 | Q2 = ( 6*B +30*C )/6 |
| 216 | Q3 = ( - 1*B - 6*C )/6 |
| 217 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 218 | which are used to define the filter: |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 219 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 220 | P0 + P1*x + P2*x^2 + P3*x^3 0 <= x < 1 |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame^] | 221 | Q0 + Q1*x + Q2*x^2 + Q3*x^3 1 <= x < 2 |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 222 | |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame^] | 223 | which ensures function is continuous in value and derivative |
| 224 | (slope). This implies that P1 is always zero; for this reason, it |
| 225 | is skipped. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 226 | */ |
| 227 | if (x < 1.0) |
nicolas | c6bac3b | 2010-10-24 18:10:45 +0000 | [diff] [blame] | 228 | return(resize_filter->coeff[0]+x*(x* |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame^] | 229 | (resize_filter->coeff[1]+x*resize_filter->coeff[2]))); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 230 | if (x < 2.0) |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame^] | 231 | return(resize_filter->coeff[3]+x*(resize_filter->coeff[4]+x* |
| 232 | (resize_filter->coeff[5]+x*resize_filter->coeff[6]))); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 233 | return(0.0); |
| 234 | } |
| 235 | |
| 236 | static MagickRealType Gaussian(const MagickRealType x, |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 237 | const ResizeFilter *resize_filter) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 238 | { |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 239 | /* |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 240 | Gaussian with a fixed sigma = 1/2 |
| 241 | |
| 242 | Gaussian Formula... |
| 243 | exp( -(x^2)/((2.0*sigma^2) ) / sqrt(2*PI*sigma^2))) |
| 244 | The constants are pre-calculated... |
| 245 | exp( -coeff[0]*(x^2)) ) * coeff[1] |
| 246 | However the multiplier coefficent is not needed and not used. |
| 247 | |
| 248 | This separates the gaussian 'sigma' value from the 'blur/support' settings |
| 249 | allows for its use in special 'small sigma' gaussians, without the filter |
| 250 | 'missing' pixels when blur and thus support becomes too small. |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 251 | */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 252 | return(exp((double)(-resize_filter->coeff[0]*x*x))); } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 253 | |
| 254 | static MagickRealType Hanning(const MagickRealType x, |
| 255 | const ResizeFilter *magick_unused(resize_filter)) |
| 256 | { |
| 257 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 258 | Cosine window function: |
| 259 | .5+.5cos(pi x). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 260 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 261 | const MagickRealType cospix = cos((double) (MagickPIL*x)); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 262 | return(0.5+0.5*cospix); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 263 | } |
| 264 | |
| 265 | static MagickRealType Hamming(const MagickRealType x, |
| 266 | const ResizeFilter *magick_unused(resize_filter)) |
| 267 | { |
| 268 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 269 | Offset cosine window function: |
| 270 | .54 + .46 cos(pi x). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 271 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 272 | const MagickRealType cospix = cos((double) (MagickPIL*x)); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 273 | return(0.54+0.46*cospix); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 274 | } |
| 275 | |
| 276 | static MagickRealType Kaiser(const MagickRealType x, |
| 277 | const ResizeFilter *magick_unused(resize_filter)) |
| 278 | { |
| 279 | #define Alpha 6.5 |
| 280 | #define I0A (1.0/I0(Alpha)) |
| 281 | |
| 282 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 283 | Kaiser Windowing Function (bessel windowing): Alpha is a free |
| 284 | value from 5 to 8 (currently hardcoded to 6.5). |
| 285 | Future: make alpha the IOA pre-calculation, an 'expert' setting. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 286 | */ |
| 287 | return(I0A*I0(Alpha*sqrt((double) (1.0-x*x)))); |
| 288 | } |
| 289 | |
| 290 | static MagickRealType Lagrange(const MagickRealType x, |
| 291 | const ResizeFilter *resize_filter) |
| 292 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 293 | MagickRealType |
| 294 | value; |
| 295 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 296 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 297 | i; |
| 298 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 299 | ssize_t |
| 300 | n, |
| 301 | order; |
| 302 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 303 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 304 | Lagrange piecewise polynomial fit of sinc: N is the 'order' of the |
| 305 | lagrange function and depends on the overall support window size |
| 306 | of the filter. That is: for a support of 2, it gives a lagrange-4 |
| 307 | (piecewise cubic function). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 308 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 309 | "n" identifies the piece of the piecewise polynomial. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 310 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 311 | See Survey: Interpolation Methods, IEEE Transactions on Medical |
| 312 | Imaging, Vol 18, No 11, November 1999, p1049-1075, -- Equation 27 |
| 313 | on p1064. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 314 | */ |
| 315 | if (x > resize_filter->support) |
| 316 | return(0.0); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 317 | order=(ssize_t) (2.0*resize_filter->window_support); /* number of pieces */ |
anthony | c2d07db | 2010-09-15 23:47:40 +0000 | [diff] [blame] | 318 | /*n=(ssize_t)((1.0*order)/2.0+x); -- which piece does x belong to */ |
| 319 | n = (ssize_t)(resize_filter->window_support + x); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 320 | value=1.0f; |
| 321 | for (i=0; i < order; i++) |
| 322 | if (i != n) |
| 323 | value*=(n-i-x)/(n-i); |
| 324 | return(value); |
| 325 | } |
| 326 | |
| 327 | static MagickRealType Quadratic(const MagickRealType x, |
| 328 | const ResizeFilter *magick_unused(resize_filter)) |
| 329 | { |
| 330 | /* |
| 331 | 2rd order (quadratic) B-Spline approximation of Gaussian. |
| 332 | */ |
| 333 | if (x < 0.5) |
| 334 | return(0.75-x*x); |
| 335 | if (x < 1.5) |
| 336 | return(0.5*(x-1.5)*(x-1.5)); |
| 337 | return(0.0); |
| 338 | } |
| 339 | |
anthony | 07a3f7f | 2010-09-16 03:03:11 +0000 | [diff] [blame] | 340 | static MagickRealType Sinc(const MagickRealType x, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 341 | const ResizeFilter *magick_unused(resize_filter)) |
| 342 | { |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 343 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 344 | Scaled sinc(x) function using a trig call: |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 345 | sinc(x) == sin(pi x)/(pi x). |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 346 | */ |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 347 | if (x != 0.0) |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 348 | { |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 349 | const MagickRealType pix = (MagickRealType) (MagickPIL*x); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 350 | return(sin((double) pix)/pix); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 351 | } |
nicolas | 2ffd3b2 | 2010-09-24 20:27:31 +0000 | [diff] [blame] | 352 | return((MagickRealType) 1.0); |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 353 | } |
| 354 | |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 355 | static MagickRealType SincFast(const MagickRealType x, |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 356 | const ResizeFilter *magick_unused(resize_filter)) |
| 357 | { |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 358 | /* |
| 359 | Approximations of the sinc function sin(pi x)/(pi x) over the |
| 360 | interval [-4,4] constructed by Nicolas Robidoux and Chantal |
| 361 | Racette with funding from the Natural Sciences and Engineering |
| 362 | Research Council of Canada. |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 363 | |
| 364 | Although the approximations are polynomials (for low order of |
| 365 | approximation) and quotients of polynomials (for higher order of |
| 366 | approximation) and consequently are similar in form to Taylor |
| 367 | polynomials/Pade approximants, the approximations are computed |
| 368 | with a completely different technique. |
| 369 | |
| 370 | Summary: These approximations are "the best" in terms of bang |
| 371 | (accuracy) for the buck (flops). More specifically: Among the |
| 372 | polynomial quotients that can be computed using a fixed number of |
| 373 | flops (with a given "+ - * / budget"), the chosen polynomial |
| 374 | quotient is the one closest to the approximated function with |
| 375 | respect to maximum absolute relative error over the given |
| 376 | interval. |
| 377 | |
| 378 | The Remez algorithm, as implemented in the boost library's minimax |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 379 | package, is the key to the construction: |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 380 | http://www.boost.org/doc/libs/1_36_0/libs/math/doc/... |
| 381 | ...sf_and_dist/html/math_toolkit/backgrounders/remez.html |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 382 | */ |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 383 | /* |
| 384 | If outside of the interval of approximation, use the standard trig |
| 385 | formula. |
| 386 | */ |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 387 | if (x > 4.0) |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 388 | { |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 389 | const MagickRealType pix = (MagickRealType) (MagickPIL*x); |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 390 | return(sin((double) pix)/pix); |
| 391 | } |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 392 | { |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 393 | /* |
| 394 | The approximations only depend on x^2 (sinc is an even |
| 395 | function). |
| 396 | */ |
| 397 | const MagickRealType xx = x*x; |
cristy | 8301792 | 2010-09-05 20:45:15 +0000 | [diff] [blame] | 398 | #if MAGICKCORE_QUANTUM_DEPTH <= 8 |
| 399 | /* |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 400 | Maximum absolute relative error 6.3e-6 < 1/2^17. |
cristy | 738e756 | 2010-09-01 12:48:07 +0000 | [diff] [blame] | 401 | */ |
| 402 | const MagickRealType c0 = 0.173610016489197553621906385078711564924e-2L; |
| 403 | const MagickRealType c1 = -0.384186115075660162081071290162149315834e-3L; |
| 404 | const MagickRealType c2 = 0.393684603287860108352720146121813443561e-4L; |
| 405 | const MagickRealType c3 = -0.248947210682259168029030370205389323899e-5L; |
| 406 | const MagickRealType c4 = 0.107791837839662283066379987646635416692e-6L; |
| 407 | const MagickRealType c5 = -0.324874073895735800961260474028013982211e-8L; |
| 408 | const MagickRealType c6 = 0.628155216606695311524920882748052490116e-10L; |
| 409 | const MagickRealType c7 = -0.586110644039348333520104379959307242711e-12L; |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 410 | const MagickRealType p = |
| 411 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*c7)))))); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 412 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)*p); |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 413 | #elif MAGICKCORE_QUANTUM_DEPTH <= 16 |
cristy | dbeb3eb | 2010-09-09 13:41:36 +0000 | [diff] [blame] | 414 | /* |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 415 | Max. abs. rel. error 2.2e-8 < 1/2^25. |
cristy | dbeb3eb | 2010-09-09 13:41:36 +0000 | [diff] [blame] | 416 | */ |
| 417 | const MagickRealType c0 = 0.173611107357320220183368594093166520811e-2L; |
| 418 | const MagickRealType c1 = -0.384240921114946632192116762889211361285e-3L; |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 419 | const MagickRealType c2 = 0.394201182359318128221229891724947048771e-4L; |
| 420 | const MagickRealType c3 = -0.250963301609117217660068889165550534856e-5L; |
| 421 | const MagickRealType c4 = 0.111902032818095784414237782071368805120e-6L; |
| 422 | const MagickRealType c5 = -0.372895101408779549368465614321137048875e-8L; |
| 423 | const MagickRealType c6 = 0.957694196677572570319816780188718518330e-10L; |
cristy | dbeb3eb | 2010-09-09 13:41:36 +0000 | [diff] [blame] | 424 | const MagickRealType c7 = -0.187208577776590710853865174371617338991e-11L; |
| 425 | const MagickRealType c8 = 0.253524321426864752676094495396308636823e-13L; |
| 426 | const MagickRealType c9 = -0.177084805010701112639035485248501049364e-15L; |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 427 | const MagickRealType p = |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 428 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*(c7+xx*(c8+xx*c9)))))))); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 429 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)*p); |
nicolas | c2d28f0 | 2010-09-27 18:56:15 +0000 | [diff] [blame] | 430 | #else |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 431 | /* |
| 432 | Max. abs. rel. error 1.2e-12 < 1/2^39. |
| 433 | */ |
| 434 | const MagickRealType c0 = 0.173611111110910715186413700076827593074e-2L; |
| 435 | const MagickRealType c1 = -0.289105544717893415815859968653611245425e-3L; |
| 436 | const MagickRealType c2 = 0.206952161241815727624413291940849294025e-4L; |
| 437 | const MagickRealType c3 = -0.834446180169727178193268528095341741698e-6L; |
| 438 | const MagickRealType c4 = 0.207010104171026718629622453275917944941e-7L; |
| 439 | const MagickRealType c5 = -0.319724784938507108101517564300855542655e-9L; |
| 440 | const MagickRealType c6 = 0.288101675249103266147006509214934493930e-11L; |
| 441 | const MagickRealType c7 = -0.118218971804934245819960233886876537953e-13L; |
| 442 | const MagickRealType p = |
| 443 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*c7)))))); |
| 444 | const MagickRealType d0 = 1.0L; |
| 445 | const MagickRealType d1 = 0.547981619622284827495856984100563583948e-1L; |
| 446 | const MagickRealType d2 = 0.134226268835357312626304688047086921806e-2L; |
| 447 | const MagickRealType d3 = 0.178994697503371051002463656833597608689e-4L; |
| 448 | const MagickRealType d4 = 0.114633394140438168641246022557689759090e-6L; |
| 449 | const MagickRealType q = d0+xx*(d1+xx*(d2+xx*(d3+xx*d4))); |
| 450 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)/q*p); |
cristy | 657c635 | 2010-08-29 14:05:08 +0000 | [diff] [blame] | 451 | #endif |
cristy | 8301792 | 2010-09-05 20:45:15 +0000 | [diff] [blame] | 452 | } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 453 | } |
| 454 | |
| 455 | static MagickRealType Triangle(const MagickRealType x, |
| 456 | const ResizeFilter *magick_unused(resize_filter)) |
| 457 | { |
| 458 | /* |
nicolas | 0edb086 | 2010-09-19 18:56:19 +0000 | [diff] [blame] | 459 | 1st order (linear) B-Spline, bilinear interpolation, Tent 1D |
| 460 | filter, or a Bartlett 2D Cone filter. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 461 | */ |
| 462 | if (x < 1.0) |
| 463 | return(1.0-x); |
| 464 | return(0.0); |
| 465 | } |
| 466 | |
| 467 | static MagickRealType Welsh(const MagickRealType x, |
| 468 | const ResizeFilter *magick_unused(resize_filter)) |
| 469 | { |
| 470 | /* |
| 471 | Welsh parabolic windowing filter. |
| 472 | */ |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 473 | if (x < 1.0) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 474 | return(1.0-x*x); |
| 475 | return(0.0); |
| 476 | } |
| 477 | |
| 478 | /* |
| 479 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 480 | % % |
| 481 | % % |
| 482 | % % |
| 483 | + A c q u i r e R e s i z e F i l t e r % |
| 484 | % % |
| 485 | % % |
| 486 | % % |
| 487 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 488 | % |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 489 | % AcquireResizeFilter() allocates the ResizeFilter structure. Choose |
| 490 | % from these filters: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 491 | % |
| 492 | % FIR (Finite impulse Response) Filters |
| 493 | % Box Triangle Quadratic |
| 494 | % Cubic Hermite Catrom |
| 495 | % Mitchell |
| 496 | % |
| 497 | % IIR (Infinite impulse Response) Filters |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 498 | % Gaussian Sinc Jinc (Bessel) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 499 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 500 | % Windowed Sinc/Jinc Filters |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 501 | % Blackman Hanning Hamming |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 502 | % Kaiser Lanczos |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 503 | % |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 504 | % Special purpose Filters |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 505 | % SincFast Lanczos2D Robidoux |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 506 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 507 | % The users "-filter" selection is used to lookup the default 'expert' |
| 508 | % settings for that filter from a internal table. However any provided |
| 509 | % 'expert' settings (see below) may override this selection. |
| 510 | % |
| 511 | % FIR filters are used as is, and are limited to that filters support |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 512 | % window (unless over-ridden). 'Gaussian' while classed as an IIR |
anthony | c331dec | 2010-09-26 01:30:14 +0000 | [diff] [blame] | 513 | % filter, is also simply clipped by its support size (currently 1.5 |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 514 | % or approximatally 3*sigma as recommended by many references) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 515 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 516 | % The selection is typically either a windowed Sinc, or interpolated |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 517 | % filter, for use by functions such as ResizeImage(). However if a |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 518 | % 'cylindrical' filter flag is requested, any default Sinc weighting |
| 519 | % and windowing functions will be promoted to cylindrical Jinc form of |
| 520 | % function. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 521 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 522 | % Directly requesting 'Sinc' or 'Jinc' will force the use of that |
| 523 | % filter function without any windowing. This is not recommended, |
| 524 | % except by image processing experts or in expert options. Selecting a |
| 525 | % window filtering version of these functions is better. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 526 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 527 | % Lanczos is a special case of a Sinc-windowed Sinc, (or Jinc-Jinc for |
| 528 | % the cylindrical case) but defaulting to 3-lobe support, rather that |
| 529 | % the default 4 lobe support of the other windowed sinc/jinc filters. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 530 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 531 | % Two forms of the 'Sinc' function are available: Sinc and SincFast. |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 532 | % Sinc is computed using the traditional sin(pi*x)/(pi*x); it is |
| 533 | % selected if the user specifically specifies the use of a Sinc |
| 534 | % filter. SincFast uses highly accurate (and fast) polynomial (low Q) |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 535 | % and rational (high Q) approximations, and will be used by default in |
| 536 | % most cases. |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 537 | % |
nicolas | 1eb2fcf | 2010-10-10 20:45:17 +0000 | [diff] [blame] | 538 | % The Lanczos2D and Robidoux filters are tuned for cylindrical |
| 539 | % (radial) EWA (Elliptical Weighted Average) distortion. Lanczos2D |
nicolas | dff19b4 | 2010-10-10 20:53:13 +0000 | [diff] [blame] | 540 | % is a 2 lobe Lanczos-like filter using Jinc (for EWA) or Sinc. |
nicolas | 6ca6e96 | 2010-10-10 20:49:01 +0000 | [diff] [blame] | 541 | % Robidoux used to be a sharpened version of Lanczos2D (with |
nicolas | 0d5e532 | 2010-10-22 15:29:30 +0000 | [diff] [blame] | 542 | % blur=0.958033808). Now, Robidoux is the unique Keys cubic spline |
| 543 | % filter satisfying the following condition: |
| 544 | % |
| 545 | % Robidoux exactly preserves images with only vertical or |
| 546 | % horizontal features when performing 'no-op" with EWA distortion. |
| 547 | % |
nicolas | 618a9a7 | 2010-10-22 19:23:43 +0000 | [diff] [blame] | 548 | % That is, Robidoux is the BC-Spline with B=(228 - 108 sqrt(2))/199 |
| 549 | % and C=(108 sqrt(2) - 29)/398. Robidoux turns out to be close to |
| 550 | % both plain Mitchell and "sharpened" Lanczos2D. For example, it's |
| 551 | % first crossing is (36 sqrt(2) + 123)/(72 sqrt(2) + 47) which is |
| 552 | % almost identical to the first crossing of the other two. |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 553 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 554 | % 'EXPERT' OPTIONS: |
nicolas | ce6dc29 | 2010-10-22 16:23:07 +0000 | [diff] [blame] | 555 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 556 | % (Not recommended without expert knowledge of resampling and |
| 557 | % filtering.) |
| 558 | % |
| 559 | % You can override any and all filter settings. Use "filter:verbose" |
| 560 | % to make sure that the overall effect of your selections is as |
| 561 | % expected. |
| 562 | % |
| 563 | % "filter:verbose" Output the exact results of the filter |
| 564 | % selections made, as well as plotting data for graphing the |
| 565 | % resulting filter over support range (blur adjusted). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 566 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 567 | % "filter:filter" Select the main function associated with |
| 568 | % this filter name, as the weighting function of the filter. |
| 569 | % This can be used to set a windowing function as a weighting |
| 570 | % function, for special purposes, such as graphing. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 571 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 572 | % If a "filter:window" operation has not been provided, then a |
| 573 | % 'Box' windowing function will be set to denote that no |
| 574 | % windowing function is being used. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 575 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 576 | % "filter:window" Select this windowing function for the filter. |
| 577 | % While any filter could be used as a windowing function, using |
| 578 | % the 'first lobe' of that filter over the whole support |
| 579 | % window, using a non-windowing function is not advisible. If |
| 580 | % no weighting filter function is specifed a 'SincFast' filter |
| 581 | % will be used. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 582 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 583 | % "filter:lobes" Number of lobes to use for the Sinc/Jinc filter. |
| 584 | % This a simpler method of setting filter support size that |
| 585 | % will correctly handle the Sinc/Jinc switch for an operators |
| 586 | % filtering requirements. Only integers should be given. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 587 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 588 | % "filter:support" Set the support size for filtering to the size |
| 589 | % given This not recommended for Sinc/Jinc windowed filters |
| 590 | % (lobes should be used instead). This will override any |
| 591 | % 'filter:lobes' option. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 592 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 593 | % "filter:win-support" Scale windowing function to this size |
| 594 | % instead. This causes the windowing (or self-windowing |
| 595 | % Lagrange filter) to act is if the support window it much much |
| 596 | % larger than what is actually supplied to the calling |
| 597 | % operator. The filter however is still clipped to the real |
| 598 | % support size given, by the support range suppiled to the |
| 599 | % caller. If unset this will equal the normal filter support |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 600 | % size. |
| 601 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 602 | % "filter:blur" Scale the filter and support window by this amount. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 603 | % A value >1 will generally result in a more burred image with |
| 604 | % more ringing effects, while a value <1 will sharpen the |
| 605 | % resulting image with more aliasing and Morie effects. |
| 606 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 607 | % "filter:sigma" The sigma value to use for the Gaussian filter |
| 608 | % only. Defaults to '1/2' for orthogonal and 'sqrt(2)/2' for |
| 609 | % cylindrical usage. It effectially provides a alturnative to |
| 610 | % 'blur' for Gaussians without it also effecting the final |
| 611 | % 'practical support' size. |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 612 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 613 | % "filter:b" |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 614 | % "filter:c" Override the preset B,C values for a Cubic type of |
| 615 | % filter If only one of these are given it is assumes to be a |
| 616 | % 'Keys' type of filter such that B+2C=1, where Keys 'alpha' |
| 617 | % value = C |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 618 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 619 | % Examples: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 620 | % |
nicolas | 6e1267a | 2010-10-22 16:35:52 +0000 | [diff] [blame] | 621 | % Set a true un-windowed Sinc filter with 10 lobes (very slow): |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 622 | % -define filter:filter=Sinc |
| 623 | % -define filter:lobes=8 |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 624 | % |
nicolas | 6e1267a | 2010-10-22 16:35:52 +0000 | [diff] [blame] | 625 | % Set an 8 lobe Lanczos (Sinc or Jinc) filter: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 626 | % -filter Lanczos |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 627 | % -define filter:lobes=8 |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 628 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 629 | % The format of the AcquireResizeFilter method is: |
| 630 | % |
| 631 | % ResizeFilter *AcquireResizeFilter(const Image *image, |
| 632 | % const FilterTypes filter_type, const MagickBooleanType radial, |
| 633 | % ExceptionInfo *exception) |
| 634 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 635 | % A description of each parameter follows: |
| 636 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 637 | % o image: the image. |
| 638 | % |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 639 | % o filter: the filter type, defining a preset filter, window and |
| 640 | % support. The artifact settings listed above will override |
| 641 | % those selections. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 642 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 643 | % o blur: blur the filter by this amount, use 1.0 if unknown. Image |
| 644 | % artifact "filter:blur" will override this API call usage, including |
| 645 | % any internal change (such as for cylindrical usage). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 646 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 647 | % o radial: use a 1D orthogonal filter (Sinc) or 2D cylindrical |
| 648 | % (radial) filter (Jinc) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 649 | % |
| 650 | % o exception: return any errors or warnings in this structure. |
| 651 | % |
| 652 | */ |
| 653 | MagickExport ResizeFilter *AcquireResizeFilter(const Image *image, |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 654 | const FilterTypes filter,const MagickRealType blur, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 655 | const MagickBooleanType cylindrical,ExceptionInfo *exception) |
| 656 | { |
| 657 | const char |
| 658 | *artifact; |
| 659 | |
| 660 | FilterTypes |
| 661 | filter_type, |
| 662 | window_type; |
| 663 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 664 | MagickRealType |
| 665 | B, |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 666 | C, |
| 667 | sigma; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 668 | |
| 669 | register ResizeFilter |
| 670 | *resize_filter; |
| 671 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 672 | ssize_t |
| 673 | option; |
| 674 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 675 | /* |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 676 | Table Mapping given Filter, into Weighting and Windowing functions. |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 677 | A 'Box' windowing function means its a simble non-windowed filter. |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 678 | An 'SincFast' filter function could be upgraded to a 'Jinc' filter |
| 679 | if a "cylindrical", unless a 'Sinc' or 'SincFast' filter was |
| 680 | specifically requested. |
anthony | 449887b | 2010-09-10 02:23:33 +0000 | [diff] [blame] | 681 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 682 | WARNING: The order of this tabel must match the order of the |
| 683 | FilterTypes enumeration specified in "resample.h", or the filter |
| 684 | names will not match the filter being setup. |
anthony | 1e2d5ca | 2010-09-10 02:24:35 +0000 | [diff] [blame] | 685 | |
| 686 | You can check filter setups with the "filter:verbose" setting. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 687 | */ |
| 688 | static struct |
| 689 | { |
| 690 | FilterTypes |
| 691 | filter, |
| 692 | window; |
| 693 | } const mapping[SentinelFilter] = |
| 694 | { |
anthony | 462ee07 | 2010-09-27 12:34:02 +0000 | [diff] [blame] | 695 | { UndefinedFilter, BoxFilter }, /* Undefined (default to Box) */ |
| 696 | { PointFilter, BoxFilter }, /* SPECIAL: Nearest neighbour */ |
| 697 | { BoxFilter, BoxFilter }, /* Box averaging filter */ |
| 698 | { TriangleFilter, BoxFilter }, /* Linear interpolation filter */ |
| 699 | { HermiteFilter, BoxFilter }, /* Hermite interpolation filter */ |
| 700 | { SincFastFilter, HanningFilter }, /* Hanning -- cosine-sinc */ |
| 701 | { SincFastFilter, HammingFilter }, /* Hamming -- '' variation */ |
| 702 | { SincFastFilter, BlackmanFilter }, /* Blackman -- 2*cosine-sinc */ |
| 703 | { GaussianFilter, BoxFilter }, /* Gaussian blur filter */ |
| 704 | { QuadraticFilter, BoxFilter }, /* Quadratic Gaussian approximation */ |
| 705 | { CubicFilter, BoxFilter }, /* Cubic B-Spline */ |
| 706 | { CatromFilter, BoxFilter }, /* Cubic interpolator */ |
| 707 | { MitchellFilter, BoxFilter }, /* 'Ideal' cubic filter */ |
| 708 | { LanczosFilter, SincFastFilter }, /* SPECIAL: 3-lobed sinc-sinc */ |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 709 | { JincFilter, BoxFilter }, /* Raw 3-lobed Jinc function */ |
| 710 | { SincFilter, BoxFilter }, /* Raw 4-lobed Sinc function */ |
anthony | 462ee07 | 2010-09-27 12:34:02 +0000 | [diff] [blame] | 711 | { SincFastFilter, KaiserFilter }, /* Kaiser -- square root-sinc */ |
| 712 | { SincFastFilter, WelshFilter }, /* Welsh -- parabolic-sinc */ |
| 713 | { SincFastFilter, CubicFilter }, /* Parzen -- cubic-sinc */ |
| 714 | { LagrangeFilter, BoxFilter }, /* Lagrange self-windowing filter */ |
| 715 | { SincFastFilter, BohmanFilter }, /* Bohman -- 2*cosine-sinc */ |
| 716 | { SincFastFilter, TriangleFilter }, /* Bartlett -- triangle-sinc */ |
| 717 | { SincFastFilter, BoxFilter }, /* Raw fast sinc ("Pade"-type) */ |
nicolas | 5835ee0 | 2010-10-10 20:40:15 +0000 | [diff] [blame] | 718 | { Lanczos2DFilter, JincFilter }, /* SPECIAL: 2-lobed jinc-jinc */ |
anthony | e5f0645 | 2010-10-12 05:48:17 +0000 | [diff] [blame] | 719 | { Lanczos2DSharpFilter, JincFilter },/* SPECIAL: ditto sharpened */ |
| 720 | { RobidouxFilter, BoxFilter }, /* SPECIAL: Keys cubic tuned for EWA */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 721 | }; |
| 722 | /* |
nicolas | 32f44eb | 2010-09-20 01:23:12 +0000 | [diff] [blame] | 723 | Table mapping the filter/window from the above table to an actual |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 724 | function. The default support size for that filter as a weighting |
| 725 | function, the range to scale with to use that function as a sinc |
| 726 | windowing function, (typ 1.0). |
anthony | 933b4bf | 2010-09-10 02:31:37 +0000 | [diff] [blame] | 727 | |
anthony | 07a3f7f | 2010-09-16 03:03:11 +0000 | [diff] [blame] | 728 | Note that the filter_type -> function is 1 to 1 except for Sinc(), |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 729 | SincFast(), and CubicBC() functions, which may have multiple |
| 730 | filter to function associations. |
| 731 | |
| 732 | See "filter:verbose" handling below for the function -> filter |
| 733 | mapping. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 734 | */ |
| 735 | static struct |
| 736 | { |
| 737 | MagickRealType |
| 738 | (*function)(const MagickRealType, const ResizeFilter*), |
nicolas | 8eccc16 | 2010-10-16 19:48:13 +0000 | [diff] [blame] | 739 | lobes, /* Default lobes/support size of the weighting filter. */ |
anthony | 450db50 | 2010-10-19 04:03:03 +0000 | [diff] [blame] | 740 | scale, /* Support when function used as a windowing function |
| 741 | Typically equal to the location of the first zero crossing. */ |
| 742 | B,C; /* BC-spline coefficients, ignored if not a CubicBC filter. */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 743 | } const filters[SentinelFilter] = |
| 744 | { |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 745 | { Box, 0.5, 0.5, 0.0, 0.0 }, /* Undefined (default to Box) */ |
| 746 | { Box, 0.0, 0.5, 0.0, 0.0 }, /* Point (special handling) */ |
| 747 | { Box, 0.5, 0.5, 0.0, 0.0 }, /* Box */ |
| 748 | { Triangle, 1.0, 1.0, 0.0, 0.0 }, /* Triangle */ |
| 749 | { CubicBC, 1.0, 1.0, 0.0, 0.0 }, /* Hermite (cubic B=C=0) */ |
| 750 | { Hanning, 1.0, 1.0, 0.0, 0.0 }, /* Hanning, cosine window */ |
| 751 | { Hamming, 1.0, 1.0, 0.0, 0.0 }, /* Hamming, '' variation */ |
| 752 | { Blackman, 1.0, 1.0, 0.0, 0.0 }, /* Blackman, 2*cosine window */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 753 | { Gaussian, 2.0, 1.5, 0.0, 0.0 }, /* Gaussian */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 754 | { Quadratic, 1.5, 1.5, 0.0, 0.0 }, /* Quadratic gaussian */ |
| 755 | { CubicBC, 2.0, 2.0, 1.0, 0.0 }, /* Cubic B-Spline (B=1,C=0) */ |
| 756 | { CubicBC, 2.0, 1.0, 0.0, 0.5 }, /* Catmull-Rom (B=0,C=1/2) */ |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 757 | { CubicBC, 2.0, 1.0, 1./3., 1./3. }, /* Mitchell (B=C=1/3) */ |
| 758 | { SincFast, 3.0, 1.0, 0.0, 0.0 }, /* Lanczos, 3-lobed Sinc-Sinc */ |
nicolas | f8689f4 | 2010-10-18 16:14:08 +0000 | [diff] [blame] | 759 | { Jinc, 3.0, 1.2196698912665045, 0.0, 0.0 }, /* Raw 3-lobed Jinc */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 760 | { Sinc, 4.0, 1.0, 0.0, 0.0 }, /* Raw 4-lobed Sinc */ |
| 761 | { Kaiser, 1.0, 1.0, 0.0, 0.0 }, /* Kaiser (square root window) */ |
| 762 | { Welsh, 1.0, 1.0, 0.0, 0.0 }, /* Welsh (parabolic window) */ |
| 763 | { CubicBC, 2.0, 2.0, 1.0, 0.0 }, /* Parzen (B-Spline window) */ |
| 764 | { Lagrange, 2.0, 1.0, 0.0, 0.0 }, /* Lagrange sinc approximation */ |
| 765 | { Bohman, 1.0, 1.0, 0.0, 0.0 }, /* Bohman, 2*Cosine window */ |
| 766 | { Triangle, 1.0, 1.0, 0.0, 0.0 }, /* Bartlett (triangle window) */ |
| 767 | { SincFast, 4.0, 1.0, 0.0, 0.0 }, /* Raw fast sinc ("Pade"-type) */ |
nicolas | 8eccc16 | 2010-10-16 19:48:13 +0000 | [diff] [blame] | 768 | { Jinc, 2.0, 1.2196698912665045, 0.0, 0.0 }, |
| 769 | /* Lanczos2D (Jinc-Jinc) */ |
| 770 | { Jinc, 2.0, 1.1684849904329952, 0.0, 0.0 }, |
| 771 | /* Lanczos2D sharpened with blur=0.958033808 */ |
anthony | 450db50 | 2010-10-19 04:03:03 +0000 | [diff] [blame] | 772 | { CubicBC, 2.0, 1.1685777620836932, |
nicolas | 0d5e532 | 2010-10-22 15:29:30 +0000 | [diff] [blame] | 773 | 0.37821575509399867, 0.31089212245300067 } |
| 774 | /* Robidoux: Keys cubic close to Lanczos2D sharpened */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 775 | }; |
| 776 | /* |
anthony | 9a98fc6 | 2010-10-11 02:47:19 +0000 | [diff] [blame] | 777 | The known zero crossings of the Jinc() or more accurately the Jinc(x*PI) |
anthony | 450db50 | 2010-10-19 04:03:03 +0000 | [diff] [blame] | 778 | function being used as a filter. It is used by the "filter:lobes" expert |
| 779 | setting and for 'lobes' for Jinc functions in the previous table. This |
| 780 | way users do not have to deal with the highly irrational lobe sizes of the |
anthony | 9a98fc6 | 2010-10-11 02:47:19 +0000 | [diff] [blame] | 781 | Jinc filter. |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 782 | |
nicolas | e473f72 | 2010-10-07 00:05:13 +0000 | [diff] [blame] | 783 | Values taken from |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 784 | http://cose.math.bas.bg/webMathematica/webComputing/BesselZeros.jsp |
nicolas | e473f72 | 2010-10-07 00:05:13 +0000 | [diff] [blame] | 785 | using Jv-function with v=1, then dividing by PI. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 786 | */ |
| 787 | static MagickRealType |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 788 | jinc_zeros[16] = |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 789 | { |
nicolas | 8eccc16 | 2010-10-16 19:48:13 +0000 | [diff] [blame] | 790 | 1.2196698912665045, |
| 791 | 2.2331305943815286, |
| 792 | 3.2383154841662362, |
| 793 | 4.2410628637960699, |
| 794 | 5.2427643768701817, |
| 795 | 6.2439216898644877, |
| 796 | 7.244759868719957, |
| 797 | 8.2453949139520427, |
| 798 | 9.2458926849494673, |
| 799 | 10.246293348754916, |
| 800 | 11.246622794877883, |
| 801 | 12.246898461138105, |
| 802 | 13.247132522181061, |
| 803 | 14.247333735806849, |
anthony | c2d07db | 2010-09-15 23:47:40 +0000 | [diff] [blame] | 804 | 15.2475085630373, |
nicolas | 8eccc16 | 2010-10-16 19:48:13 +0000 | [diff] [blame] | 805 | 16.247661874700962 |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 806 | }; |
| 807 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 808 | /* |
| 809 | Allocate resize filter. |
| 810 | */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 811 | assert(image != (const Image *) NULL); |
| 812 | assert(image->signature == MagickSignature); |
| 813 | if (image->debug != MagickFalse) |
| 814 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 815 | assert(UndefinedFilter < filter && filter < SentinelFilter); |
| 816 | assert(exception != (ExceptionInfo *) NULL); |
| 817 | assert(exception->signature == MagickSignature); |
cristy | 73bd4a5 | 2010-10-05 11:24:23 +0000 | [diff] [blame] | 818 | resize_filter=(ResizeFilter *) AcquireMagickMemory(sizeof(*resize_filter)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 819 | if (resize_filter == (ResizeFilter *) NULL) |
| 820 | ThrowFatalException(ResourceLimitFatalError,"MemoryAllocationFailed"); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 821 | /* |
| 822 | Defaults for the requested filter. |
| 823 | */ |
| 824 | filter_type=mapping[filter].filter; |
| 825 | window_type=mapping[filter].window; |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 826 | resize_filter->blur = blur; |
| 827 | sigma = 0.5; |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 828 | /* Cylindrical Filters should use Jinc instead of Sinc */ |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 829 | if (cylindrical != MagickFalse) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 830 | switch (filter_type) |
| 831 | { |
| 832 | case SincFilter: |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 833 | /* Promote 1D Sinc Filter to a 2D Jinc filter. */ |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 834 | if ( filter != SincFilter ) |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 835 | filter_type=JincFilter; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 836 | break; |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 837 | case SincFastFilter: |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 838 | /* Ditto for SincFast variant */ |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 839 | if ( filter != SincFastFilter ) |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 840 | filter_type=JincFilter; |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 841 | break; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 842 | case LanczosFilter: |
nicolas | 45b58a9 | 2010-10-07 15:46:39 +0000 | [diff] [blame] | 843 | /* Promote Lanczos from a Sinc-Sinc to a Jinc-Jinc. */ |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 844 | filter_type=JincFilter; |
| 845 | window_type=JincFilter; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 846 | break; |
anthony | 0895846 | 2010-10-12 06:48:35 +0000 | [diff] [blame] | 847 | case Lanczos2DSharpFilter: |
nicolas | 1f4c051 | 2010-10-20 20:19:30 +0000 | [diff] [blame] | 848 | /* Sharpened by Nicolas Robidoux so as to optimize for minimal |
| 849 | * blurring of orthogonal lines |
anthony | 0895846 | 2010-10-12 06:48:35 +0000 | [diff] [blame] | 850 | */ |
| 851 | resize_filter->blur *= 0.958033808; |
| 852 | break; |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 853 | case GaussianFilter: |
cristy | 68f103e | 2010-10-14 01:19:07 +0000 | [diff] [blame] | 854 | sigma = (MagickRealType) (MagickSQ2/2.0); /* Cylindrical Gaussian sigma is sqrt(2)/2 */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 855 | break; |
cristy | a782ecf | 2010-01-25 02:59:14 +0000 | [diff] [blame] | 856 | default: |
| 857 | break; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 858 | } |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 859 | else |
| 860 | switch (filter_type) |
| 861 | { |
| 862 | case Lanczos2DFilter: |
anthony | e5f0645 | 2010-10-12 05:48:17 +0000 | [diff] [blame] | 863 | case Lanczos2DSharpFilter: |
nicolas | 45b58a9 | 2010-10-07 15:46:39 +0000 | [diff] [blame] | 864 | /* Demote to a 2-lobe Sinc-Sinc for orthogonal use. */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 865 | window_type=SincFastFilter; |
| 866 | break; |
| 867 | default: |
| 868 | break; |
| 869 | } |
| 870 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 871 | artifact=GetImageArtifact(image,"filter:filter"); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 872 | if (artifact != (const char *) NULL) |
| 873 | { |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 874 | option=ParseMagickOption(MagickFilterOptions,MagickFalse,artifact); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 875 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 876 | { /* Raw filter request - no window function. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 877 | filter_type=(FilterTypes) option; |
| 878 | window_type=BoxFilter; |
| 879 | } |
| 880 | if (option == LanczosFilter) |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 881 | { /* Lanczos is not a real filter but a self windowing Sinc/Jinc. */ |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 882 | filter_type=cylindrical != MagickFalse ? JincFilter : LanczosFilter; |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 883 | window_type=cylindrical != MagickFalse ? JincFilter : SincFastFilter; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 884 | } |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 885 | /* Filter override with a specific window function. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 886 | artifact=GetImageArtifact(image,"filter:window"); |
| 887 | if (artifact != (const char *) NULL) |
| 888 | { |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 889 | option=ParseMagickOption(MagickFilterOptions,MagickFalse,artifact); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 890 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
| 891 | { |
| 892 | if (option != LanczosFilter) |
| 893 | window_type=(FilterTypes) option; |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 894 | else |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 895 | window_type=cylindrical != MagickFalse ? JincFilter : |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 896 | SincFastFilter; |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 897 | } |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 898 | } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 899 | } |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 900 | else |
| 901 | { |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 902 | /* Window specified, but no filter function? Assume Sinc/Jinc. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 903 | artifact=GetImageArtifact(image,"filter:window"); |
| 904 | if (artifact != (const char *) NULL) |
| 905 | { |
| 906 | option=ParseMagickOption(MagickFilterOptions,MagickFalse, |
| 907 | artifact); |
| 908 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
| 909 | { |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 910 | filter_type=cylindrical != MagickFalse ? |
| 911 | JincFilter : SincFastFilter; |
cristy | 19eb641 | 2010-04-23 14:42:29 +0000 | [diff] [blame] | 912 | window_type=(FilterTypes) option; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 913 | } |
| 914 | } |
| 915 | } |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 916 | /* Assign the real functions to use for the filters selected. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 917 | resize_filter->filter=filters[filter_type].function; |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 918 | resize_filter->support=filters[filter_type].lobes; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 919 | resize_filter->window=filters[window_type].function; |
| 920 | resize_filter->scale=filters[window_type].scale; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 921 | resize_filter->signature=MagickSignature; |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 922 | |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 923 | /* Filter Modifications for orthogonal/cylindrical usage */ |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 924 | if (cylindrical != MagickFalse) |
| 925 | switch (filter_type) |
| 926 | { |
| 927 | case PointFilter: |
| 928 | case BoxFilter: |
| 929 | /* Support for Cylindrical Box should be sqrt(2)/2 */ |
cristy | 1c9bb45 | 2010-10-03 16:48:33 +0000 | [diff] [blame] | 930 | resize_filter->support=(MagickRealType) MagickSQ1_2; |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 931 | break; |
anthony | 81b8bf9 | 2010-10-02 13:54:34 +0000 | [diff] [blame] | 932 | default: |
| 933 | break; |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 934 | } |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 935 | else |
| 936 | switch (filter_type) |
| 937 | { |
| 938 | case Lanczos2DFilter: |
anthony | e5f0645 | 2010-10-12 05:48:17 +0000 | [diff] [blame] | 939 | case Lanczos2DSharpFilter: |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 940 | /* Demote to a 2-lobe Lanczos (Sinc-Sinc) for orthogonal use. */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 941 | resize_filter->filter=SincFast; |
| 942 | break; |
| 943 | default: |
| 944 | break; |
| 945 | } |
| 946 | |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 947 | /* |
| 948 | ** More Expert Option Modifications |
| 949 | */ |
| 950 | |
| 951 | /* User Sigma Override - no support change */ |
| 952 | artifact=GetImageArtifact(image,"filter:sigma"); |
| 953 | if (artifact != (const char *) NULL) |
| 954 | sigma=StringToDouble(artifact); |
| 955 | /* Define coefficents for Gaussian (assumes no cubic window) */ |
| 956 | if ( GaussianFilter ) { |
| 957 | resize_filter->coeff[0] = 1.0/(2.0*sigma*sigma); |
cristy | 68f103e | 2010-10-14 01:19:07 +0000 | [diff] [blame] | 958 | resize_filter->coeff[1] = (MagickRealType) (1.0/(Magick2PI*sigma*sigma)); /* unused */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 959 | } |
| 960 | |
| 961 | /* Blur Override */ |
| 962 | artifact=GetImageArtifact(image,"filter:blur"); |
| 963 | if (artifact != (const char *) NULL) |
| 964 | resize_filter->blur=StringToDouble(artifact); |
| 965 | if (resize_filter->blur < MagickEpsilon) |
| 966 | resize_filter->blur=(MagickRealType) MagickEpsilon; |
| 967 | |
| 968 | /* Support Overrides */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 969 | artifact=GetImageArtifact(image,"filter:lobes"); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 970 | if (artifact != (const char *) NULL) |
| 971 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 972 | ssize_t |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 973 | lobes; |
| 974 | |
cristy | 96b1613 | 2010-08-29 17:19:52 +0000 | [diff] [blame] | 975 | lobes=(ssize_t) StringToLong(artifact); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 976 | if (lobes < 1) |
| 977 | lobes=1; |
| 978 | resize_filter->support=(MagickRealType) lobes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 979 | } |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 980 | /* convert Jinc lobes to a real support value */ |
| 981 | if (resize_filter->filter == Jinc) |
| 982 | { |
| 983 | if (resize_filter->support > 16) |
| 984 | resize_filter->support=jinc_zeros[15]; /* largest entry in table */ |
| 985 | else |
| 986 | resize_filter->support = jinc_zeros[((long)resize_filter->support)-1]; |
| 987 | } |
| 988 | /* expert override of the support setting */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 989 | artifact=GetImageArtifact(image,"filter:support"); |
| 990 | if (artifact != (const char *) NULL) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 991 | resize_filter->support=fabs(StringToDouble(artifact)); |
| 992 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 993 | Scale windowing function separatally to the support 'clipping' |
| 994 | window that calling operator is planning to actually use. (Expert |
| 995 | override) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 996 | */ |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 997 | resize_filter->window_support=resize_filter->support; /* default */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 998 | artifact=GetImageArtifact(image,"filter:win-support"); |
| 999 | if (artifact != (const char *) NULL) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1000 | resize_filter->window_support=fabs(StringToDouble(artifact)); |
| 1001 | /* |
anthony | 1f90a6b | 2010-09-14 08:56:31 +0000 | [diff] [blame] | 1002 | Adjust window function scaling to the windowing support for |
| 1003 | weighting function. This avoids a division on every filter call. |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1004 | */ |
| 1005 | resize_filter->scale /= resize_filter->window_support; |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1006 | |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1007 | /* |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1008 | * Set Cubic Spline B,C values, calculate Cubic coefficients. |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1009 | */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1010 | B=0.0; |
| 1011 | C=0.0; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1012 | if ((filters[filter_type].function == CubicBC) || |
| 1013 | (filters[window_type].function == CubicBC)) |
| 1014 | { |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 1015 | B=filters[filter_type].B; |
| 1016 | C=filters[filter_type].C; |
| 1017 | if (filters[window_type].function == CubicBC) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1018 | { |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 1019 | B=filters[window_type].B; |
| 1020 | C=filters[window_type].C; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1021 | } |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1022 | artifact=GetImageArtifact(image,"filter:b"); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1023 | if (artifact != (const char *) NULL) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1024 | { |
| 1025 | B=StringToDouble(artifact); |
nicolas | d15ee9a | 2010-10-24 18:39:45 +0000 | [diff] [blame] | 1026 | C=(1.0-B)/2.0; /* Calculate C to get a Keys cubic filter. */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1027 | artifact=GetImageArtifact(image,"filter:c"); /* user C override */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1028 | if (artifact != (const char *) NULL) |
| 1029 | C=StringToDouble(artifact); |
| 1030 | } |
| 1031 | else |
| 1032 | { |
| 1033 | artifact=GetImageArtifact(image,"filter:c"); |
| 1034 | if (artifact != (const char *) NULL) |
| 1035 | { |
| 1036 | C=StringToDouble(artifact); |
nicolas | d15ee9a | 2010-10-24 18:39:45 +0000 | [diff] [blame] | 1037 | B=1.0-2.0*C; /* Calculate B to get a Keys cubic filter. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1038 | } |
| 1039 | } |
nicolas | c6bac3b | 2010-10-24 18:10:45 +0000 | [diff] [blame] | 1040 | /* Convert B,C values into Cubic Coefficents. See CubicBC(). */ |
nicolas | d15ee9a | 2010-10-24 18:39:45 +0000 | [diff] [blame] | 1041 | { |
| 1042 | const double twoB = B+B; |
| 1043 | resize_filter->coeff[0]=1.0-(1.0/3.0)*B; |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame^] | 1044 | resize_filter->coeff[1]=-3.0+twoB+C; |
| 1045 | resize_filter->coeff[2]=2.0-1.5*B-C; |
| 1046 | resize_filter->coeff[3]=(4.0/3.0)*B+4.0*C; |
| 1047 | resize_filter->coeff[4]=-8.0*C-twoB; |
| 1048 | resize_filter->coeff[5]=B+5.0*C; |
| 1049 | resize_filter->coeff[6]=(-1.0/6.0)*B-C; |
nicolas | d15ee9a | 2010-10-24 18:39:45 +0000 | [diff] [blame] | 1050 | } |
nicolas | c6bac3b | 2010-10-24 18:10:45 +0000 | [diff] [blame] | 1051 | } |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1052 | |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1053 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 1054 | Expert Option Request for verbose details of the resulting filter. |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1055 | */ |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1056 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 1057 | #pragma omp master |
| 1058 | { |
| 1059 | #endif |
| 1060 | artifact=GetImageArtifact(image,"filter:verbose"); |
| 1061 | if (artifact != (const char *) NULL) |
| 1062 | { |
| 1063 | double |
anthony | 450db50 | 2010-10-19 04:03:03 +0000 | [diff] [blame] | 1064 | support, |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1065 | x; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1066 | |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1067 | /* |
| 1068 | Set the weighting function properly when the weighting |
| 1069 | function may not exactly match the filter of the same name. |
| 1070 | EG: a Point filter really uses a Box weighting function |
| 1071 | with a different support than is typically used. |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 1072 | |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1073 | */ |
| 1074 | if (resize_filter->filter == Box) filter_type=BoxFilter; |
| 1075 | if (resize_filter->filter == Sinc) filter_type=SincFilter; |
| 1076 | if (resize_filter->filter == SincFast) filter_type=SincFastFilter; |
| 1077 | if (resize_filter->filter == Jinc) filter_type=JincFilter; |
| 1078 | if (resize_filter->filter == CubicBC) filter_type=CubicFilter; |
| 1079 | /* |
| 1080 | Report Filter Details. |
| 1081 | */ |
| 1082 | support=GetResizeFilterSupport(resize_filter); /* practical_support */ |
| 1083 | (void) fprintf(stdout,"# Resize Filter (for graphing)\n#\n"); |
| 1084 | (void) fprintf(stdout,"# filter = %s\n",MagickOptionToMnemonic( |
| 1085 | MagickFilterOptions,filter_type)); |
| 1086 | (void) fprintf(stdout,"# window = %s\n",MagickOptionToMnemonic( |
| 1087 | MagickFilterOptions, window_type)); |
| 1088 | (void) fprintf(stdout,"# support = %.*g\n",GetMagickPrecision(), |
| 1089 | (double) resize_filter->support); |
| 1090 | (void) fprintf(stdout,"# win-support = %.*g\n",GetMagickPrecision(), |
| 1091 | (double) resize_filter->window_support); |
| 1092 | (void) fprintf(stdout,"# scale_blur = %.*g\n",GetMagickPrecision(), |
| 1093 | (double) resize_filter->blur); |
| 1094 | if ( filter_type == GaussianFilter ) |
| 1095 | (void) fprintf(stdout,"# gaussian_sigma = %.*g\n",GetMagickPrecision(), |
| 1096 | (double) sigma); |
| 1097 | (void) fprintf(stdout,"# practical_support = %.*g\n",GetMagickPrecision(), |
| 1098 | (double) support); |
| 1099 | if ( filter_type == CubicFilter || window_type == CubicFilter ) |
| 1100 | (void) fprintf(stdout,"# B,C = %.*g,%.*g\n",GetMagickPrecision(), |
| 1101 | (double) B,GetMagickPrecision(),(double) C); |
| 1102 | (void) fprintf(stdout,"\n"); |
| 1103 | /* |
| 1104 | Output values of resulting filter graph -- for graphing |
| 1105 | filter result. |
| 1106 | */ |
| 1107 | for (x=0.0; x <= support; x+=0.01f) |
| 1108 | (void) fprintf(stdout,"%5.2lf\t%.*g\n",x,GetMagickPrecision(), |
| 1109 | (double) GetResizeFilterWeight(resize_filter,x)); |
| 1110 | /* A final value so gnuplot can graph the 'stop' properly. */ |
| 1111 | (void) fprintf(stdout,"%5.2lf\t%.*g\n",support,GetMagickPrecision(), |
| 1112 | 0.0); |
| 1113 | } |
| 1114 | /* Output the above once only for each image - remove setting */ |
| 1115 | (void) DeleteImageArtifact((Image *) image,"filter:verbose"); |
| 1116 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 1117 | } |
| 1118 | #endif |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1119 | return(resize_filter); |
| 1120 | } |
| 1121 | |
| 1122 | /* |
| 1123 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1124 | % % |
| 1125 | % % |
| 1126 | % % |
| 1127 | % A d a p t i v e R e s i z e I m a g e % |
| 1128 | % % |
| 1129 | % % |
| 1130 | % % |
| 1131 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1132 | % |
| 1133 | % AdaptiveResizeImage() adaptively resize image with pixel resampling. |
| 1134 | % |
| 1135 | % The format of the AdaptiveResizeImage method is: |
| 1136 | % |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1137 | % Image *AdaptiveResizeImage(const Image *image,const size_t columns, |
| 1138 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1139 | % |
| 1140 | % A description of each parameter follows: |
| 1141 | % |
| 1142 | % o image: the image. |
| 1143 | % |
| 1144 | % o columns: the number of columns in the resized image. |
| 1145 | % |
| 1146 | % o rows: the number of rows in the resized image. |
| 1147 | % |
| 1148 | % o exception: return any errors or warnings in this structure. |
| 1149 | % |
| 1150 | */ |
| 1151 | MagickExport Image *AdaptiveResizeImage(const Image *image, |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1152 | const size_t columns,const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1153 | { |
| 1154 | #define AdaptiveResizeImageTag "Resize/Image" |
| 1155 | |
cristy | c4c8d13 | 2010-01-07 01:58:38 +0000 | [diff] [blame] | 1156 | CacheView |
| 1157 | *resize_view; |
| 1158 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1159 | Image |
| 1160 | *resize_image; |
| 1161 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1162 | MagickBooleanType |
| 1163 | proceed; |
| 1164 | |
| 1165 | MagickPixelPacket |
| 1166 | pixel; |
| 1167 | |
| 1168 | PointInfo |
| 1169 | offset; |
| 1170 | |
| 1171 | ResampleFilter |
| 1172 | *resample_filter; |
| 1173 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1174 | ssize_t |
| 1175 | y; |
| 1176 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1177 | /* |
| 1178 | Adaptively resize image. |
| 1179 | */ |
| 1180 | assert(image != (const Image *) NULL); |
| 1181 | assert(image->signature == MagickSignature); |
| 1182 | if (image->debug != MagickFalse) |
| 1183 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1184 | assert(exception != (ExceptionInfo *) NULL); |
| 1185 | assert(exception->signature == MagickSignature); |
| 1186 | if ((columns == 0) || (rows == 0)) |
| 1187 | return((Image *) NULL); |
| 1188 | if ((columns == image->columns) && (rows == image->rows)) |
| 1189 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 1190 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 1191 | if (resize_image == (Image *) NULL) |
| 1192 | return((Image *) NULL); |
| 1193 | if (SetImageStorageClass(resize_image,DirectClass) == MagickFalse) |
| 1194 | { |
| 1195 | InheritException(exception,&resize_image->exception); |
| 1196 | resize_image=DestroyImage(resize_image); |
| 1197 | return((Image *) NULL); |
| 1198 | } |
| 1199 | GetMagickPixelPacket(image,&pixel); |
| 1200 | resample_filter=AcquireResampleFilter(image,exception); |
cristy | 0c7e9eb | 2010-09-30 14:23:37 +0000 | [diff] [blame] | 1201 | (void) SetResampleFilter(resample_filter,PointFilter,1.0); |
anthony | ccf239d | 2010-09-30 04:23:46 +0000 | [diff] [blame] | 1202 | (void) SetResampleFilterInterpolateMethod(resample_filter, |
cristy | 0c7e9eb | 2010-09-30 14:23:37 +0000 | [diff] [blame] | 1203 | MeshInterpolatePixel); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1204 | resize_view=AcquireCacheView(resize_image); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1205 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1206 | { |
| 1207 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1208 | *restrict resize_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1209 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1210 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1211 | x; |
| 1212 | |
| 1213 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1214 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1215 | |
| 1216 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| 1217 | exception); |
| 1218 | if (q == (PixelPacket *) NULL) |
| 1219 | break; |
| 1220 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
| 1221 | offset.y=((MagickRealType) y*image->rows/resize_image->rows); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1222 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1223 | { |
| 1224 | offset.x=((MagickRealType) x*image->columns/resize_image->columns); |
| 1225 | (void) ResamplePixelColor(resample_filter,offset.x-0.5,offset.y-0.5, |
| 1226 | &pixel); |
| 1227 | SetPixelPacket(resize_image,&pixel,q,resize_indexes+x); |
| 1228 | q++; |
| 1229 | } |
| 1230 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 1231 | break; |
cristy | 96b1613 | 2010-08-29 17:19:52 +0000 | [diff] [blame] | 1232 | proceed=SetImageProgress(image,AdaptiveResizeImageTag,(MagickOffsetType) y, |
| 1233 | image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1234 | if (proceed == MagickFalse) |
| 1235 | break; |
| 1236 | } |
| 1237 | resample_filter=DestroyResampleFilter(resample_filter); |
| 1238 | resize_view=DestroyCacheView(resize_view); |
| 1239 | return(resize_image); |
| 1240 | } |
| 1241 | |
| 1242 | /* |
| 1243 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1244 | % % |
| 1245 | % % |
| 1246 | % % |
| 1247 | + B e s s e l O r d e r O n e % |
| 1248 | % % |
| 1249 | % % |
| 1250 | % % |
| 1251 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1252 | % |
| 1253 | % BesselOrderOne() computes the Bessel function of x of the first kind of |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 1254 | % order 0. This is used to create the Jinc() filter function below. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1255 | % |
| 1256 | % Reduce x to |x| since j1(x)= -j1(-x), and for x in (0,8] |
| 1257 | % |
| 1258 | % j1(x) = x*j1(x); |
| 1259 | % |
| 1260 | % For x in (8,inf) |
| 1261 | % |
| 1262 | % j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) |
| 1263 | % |
| 1264 | % where x1 = x-3*pi/4. Compute sin(x1) and cos(x1) as follow: |
| 1265 | % |
| 1266 | % cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) |
| 1267 | % = 1/sqrt(2) * (sin(x) - cos(x)) |
| 1268 | % sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) |
| 1269 | % = -1/sqrt(2) * (sin(x) + cos(x)) |
| 1270 | % |
| 1271 | % The format of the BesselOrderOne method is: |
| 1272 | % |
| 1273 | % MagickRealType BesselOrderOne(MagickRealType x) |
| 1274 | % |
| 1275 | % A description of each parameter follows: |
| 1276 | % |
| 1277 | % o x: MagickRealType value. |
| 1278 | % |
| 1279 | */ |
| 1280 | |
| 1281 | #undef I0 |
| 1282 | static MagickRealType I0(MagickRealType x) |
| 1283 | { |
| 1284 | MagickRealType |
| 1285 | sum, |
| 1286 | t, |
| 1287 | y; |
| 1288 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1289 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1290 | i; |
| 1291 | |
| 1292 | /* |
| 1293 | Zeroth order Bessel function of the first kind. |
| 1294 | */ |
| 1295 | sum=1.0; |
| 1296 | y=x*x/4.0; |
| 1297 | t=y; |
| 1298 | for (i=2; t > MagickEpsilon; i++) |
| 1299 | { |
| 1300 | sum+=t; |
| 1301 | t*=y/((MagickRealType) i*i); |
| 1302 | } |
| 1303 | return(sum); |
| 1304 | } |
| 1305 | |
| 1306 | #undef J1 |
| 1307 | static MagickRealType J1(MagickRealType x) |
| 1308 | { |
| 1309 | MagickRealType |
| 1310 | p, |
| 1311 | q; |
| 1312 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1313 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1314 | i; |
| 1315 | |
| 1316 | static const double |
| 1317 | Pone[] = |
| 1318 | { |
| 1319 | 0.581199354001606143928050809e+21, |
| 1320 | -0.6672106568924916298020941484e+20, |
| 1321 | 0.2316433580634002297931815435e+19, |
| 1322 | -0.3588817569910106050743641413e+17, |
| 1323 | 0.2908795263834775409737601689e+15, |
| 1324 | -0.1322983480332126453125473247e+13, |
| 1325 | 0.3413234182301700539091292655e+10, |
| 1326 | -0.4695753530642995859767162166e+7, |
| 1327 | 0.270112271089232341485679099e+4 |
| 1328 | }, |
| 1329 | Qone[] = |
| 1330 | { |
| 1331 | 0.11623987080032122878585294e+22, |
| 1332 | 0.1185770712190320999837113348e+20, |
| 1333 | 0.6092061398917521746105196863e+17, |
| 1334 | 0.2081661221307607351240184229e+15, |
| 1335 | 0.5243710262167649715406728642e+12, |
| 1336 | 0.1013863514358673989967045588e+10, |
| 1337 | 0.1501793594998585505921097578e+7, |
| 1338 | 0.1606931573481487801970916749e+4, |
| 1339 | 0.1e+1 |
| 1340 | }; |
| 1341 | |
| 1342 | p=Pone[8]; |
| 1343 | q=Qone[8]; |
| 1344 | for (i=7; i >= 0; i--) |
| 1345 | { |
| 1346 | p=p*x*x+Pone[i]; |
| 1347 | q=q*x*x+Qone[i]; |
| 1348 | } |
| 1349 | return(p/q); |
| 1350 | } |
| 1351 | |
| 1352 | #undef P1 |
| 1353 | static MagickRealType P1(MagickRealType x) |
| 1354 | { |
| 1355 | MagickRealType |
| 1356 | p, |
| 1357 | q; |
| 1358 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1359 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1360 | i; |
| 1361 | |
| 1362 | static const double |
| 1363 | Pone[] = |
| 1364 | { |
| 1365 | 0.352246649133679798341724373e+5, |
| 1366 | 0.62758845247161281269005675e+5, |
| 1367 | 0.313539631109159574238669888e+5, |
| 1368 | 0.49854832060594338434500455e+4, |
| 1369 | 0.2111529182853962382105718e+3, |
| 1370 | 0.12571716929145341558495e+1 |
| 1371 | }, |
| 1372 | Qone[] = |
| 1373 | { |
| 1374 | 0.352246649133679798068390431e+5, |
| 1375 | 0.626943469593560511888833731e+5, |
| 1376 | 0.312404063819041039923015703e+5, |
| 1377 | 0.4930396490181088979386097e+4, |
| 1378 | 0.2030775189134759322293574e+3, |
| 1379 | 0.1e+1 |
| 1380 | }; |
| 1381 | |
| 1382 | p=Pone[5]; |
| 1383 | q=Qone[5]; |
| 1384 | for (i=4; i >= 0; i--) |
| 1385 | { |
| 1386 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| 1387 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| 1388 | } |
| 1389 | return(p/q); |
| 1390 | } |
| 1391 | |
| 1392 | #undef Q1 |
| 1393 | static MagickRealType Q1(MagickRealType x) |
| 1394 | { |
| 1395 | MagickRealType |
| 1396 | p, |
| 1397 | q; |
| 1398 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1399 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1400 | i; |
| 1401 | |
| 1402 | static const double |
| 1403 | Pone[] = |
| 1404 | { |
| 1405 | 0.3511751914303552822533318e+3, |
| 1406 | 0.7210391804904475039280863e+3, |
| 1407 | 0.4259873011654442389886993e+3, |
| 1408 | 0.831898957673850827325226e+2, |
| 1409 | 0.45681716295512267064405e+1, |
| 1410 | 0.3532840052740123642735e-1 |
| 1411 | }, |
| 1412 | Qone[] = |
| 1413 | { |
| 1414 | 0.74917374171809127714519505e+4, |
| 1415 | 0.154141773392650970499848051e+5, |
| 1416 | 0.91522317015169922705904727e+4, |
| 1417 | 0.18111867005523513506724158e+4, |
| 1418 | 0.1038187585462133728776636e+3, |
| 1419 | 0.1e+1 |
| 1420 | }; |
| 1421 | |
| 1422 | p=Pone[5]; |
| 1423 | q=Qone[5]; |
| 1424 | for (i=4; i >= 0; i--) |
| 1425 | { |
| 1426 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| 1427 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| 1428 | } |
| 1429 | return(p/q); |
| 1430 | } |
| 1431 | |
| 1432 | static MagickRealType BesselOrderOne(MagickRealType x) |
| 1433 | { |
| 1434 | MagickRealType |
| 1435 | p, |
| 1436 | q; |
| 1437 | |
| 1438 | if (x == 0.0) |
| 1439 | return(0.0); |
| 1440 | p=x; |
| 1441 | if (x < 0.0) |
| 1442 | x=(-x); |
| 1443 | if (x < 8.0) |
| 1444 | return(p*J1(x)); |
| 1445 | q=sqrt((double) (2.0/(MagickPI*x)))*(P1(x)*(1.0/sqrt(2.0)*(sin((double) x)- |
| 1446 | cos((double) x)))-8.0/x*Q1(x)*(-1.0/sqrt(2.0)*(sin((double) x)+ |
| 1447 | cos((double) x)))); |
| 1448 | if (p < 0.0) |
| 1449 | q=(-q); |
| 1450 | return(q); |
| 1451 | } |
| 1452 | |
| 1453 | /* |
| 1454 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1455 | % % |
| 1456 | % % |
| 1457 | % % |
| 1458 | + D e s t r o y R e s i z e F i l t e r % |
| 1459 | % % |
| 1460 | % % |
| 1461 | % % |
| 1462 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1463 | % |
| 1464 | % DestroyResizeFilter() destroy the resize filter. |
| 1465 | % |
cristy | a2ffd7e | 2010-03-10 20:50:30 +0000 | [diff] [blame] | 1466 | % The format of the DestroyResizeFilter method is: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1467 | % |
| 1468 | % ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| 1469 | % |
| 1470 | % A description of each parameter follows: |
| 1471 | % |
| 1472 | % o resize_filter: the resize filter. |
| 1473 | % |
| 1474 | */ |
| 1475 | MagickExport ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| 1476 | { |
| 1477 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1478 | assert(resize_filter->signature == MagickSignature); |
| 1479 | resize_filter->signature=(~MagickSignature); |
| 1480 | resize_filter=(ResizeFilter *) RelinquishMagickMemory(resize_filter); |
| 1481 | return(resize_filter); |
| 1482 | } |
| 1483 | |
| 1484 | /* |
| 1485 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1486 | % % |
| 1487 | % % |
| 1488 | % % |
| 1489 | + G e t R e s i z e F i l t e r S u p p o r t % |
| 1490 | % % |
| 1491 | % % |
| 1492 | % % |
| 1493 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1494 | % |
| 1495 | % GetResizeFilterSupport() return the current support window size for this |
| 1496 | % filter. Note that this may have been enlarged by filter:blur factor. |
| 1497 | % |
| 1498 | % The format of the GetResizeFilterSupport method is: |
| 1499 | % |
| 1500 | % MagickRealType GetResizeFilterSupport(const ResizeFilter *resize_filter) |
| 1501 | % |
| 1502 | % A description of each parameter follows: |
| 1503 | % |
| 1504 | % o filter: Image filter to use. |
| 1505 | % |
| 1506 | */ |
| 1507 | MagickExport MagickRealType GetResizeFilterSupport( |
| 1508 | const ResizeFilter *resize_filter) |
| 1509 | { |
| 1510 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1511 | assert(resize_filter->signature == MagickSignature); |
| 1512 | return(resize_filter->support*resize_filter->blur); |
| 1513 | } |
| 1514 | |
| 1515 | /* |
| 1516 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1517 | % % |
| 1518 | % % |
| 1519 | % % |
| 1520 | + G e t R e s i z e F i l t e r W e i g h t % |
| 1521 | % % |
| 1522 | % % |
| 1523 | % % |
| 1524 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1525 | % |
| 1526 | % GetResizeFilterWeight evaluates the specified resize filter at the point x |
| 1527 | % which usally lies between zero and the filters current 'support' and |
| 1528 | % returns the weight of the filter function at that point. |
| 1529 | % |
| 1530 | % The format of the GetResizeFilterWeight method is: |
| 1531 | % |
| 1532 | % MagickRealType GetResizeFilterWeight(const ResizeFilter *resize_filter, |
| 1533 | % const MagickRealType x) |
| 1534 | % |
| 1535 | % A description of each parameter follows: |
| 1536 | % |
| 1537 | % o filter: the filter type. |
| 1538 | % |
| 1539 | % o x: the point. |
| 1540 | % |
| 1541 | */ |
| 1542 | MagickExport MagickRealType GetResizeFilterWeight( |
| 1543 | const ResizeFilter *resize_filter,const MagickRealType x) |
| 1544 | { |
| 1545 | MagickRealType |
cristy | b838586 | 2010-09-26 01:27:51 +0000 | [diff] [blame] | 1546 | scale, |
| 1547 | x_blur; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1548 | |
| 1549 | /* |
| 1550 | Windowing function - scale the weighting filter by this amount. |
| 1551 | */ |
| 1552 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1553 | assert(resize_filter->signature == MagickSignature); |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1554 | x_blur=fabs((double) x)/resize_filter->blur; /* X offset with blur scaling */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1555 | if ((resize_filter->window_support < MagickEpsilon) || |
| 1556 | (resize_filter->window == Box)) |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1557 | scale=1.0; /* Point or Box Filter -- avoid division by zero */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1558 | else |
| 1559 | { |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1560 | scale=resize_filter->scale; |
| 1561 | scale=resize_filter->window(x_blur*scale,resize_filter); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1562 | } |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1563 | return(scale*resize_filter->filter(x_blur,resize_filter)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1564 | } |
| 1565 | |
| 1566 | /* |
| 1567 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1568 | % % |
| 1569 | % % |
| 1570 | % % |
| 1571 | % M a g n i f y I m a g e % |
| 1572 | % % |
| 1573 | % % |
| 1574 | % % |
| 1575 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1576 | % |
| 1577 | % MagnifyImage() is a convenience method that scales an image proportionally |
| 1578 | % to twice its size. |
| 1579 | % |
| 1580 | % The format of the MagnifyImage method is: |
| 1581 | % |
| 1582 | % Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| 1583 | % |
| 1584 | % A description of each parameter follows: |
| 1585 | % |
| 1586 | % o image: the image. |
| 1587 | % |
| 1588 | % o exception: return any errors or warnings in this structure. |
| 1589 | % |
| 1590 | */ |
| 1591 | MagickExport Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| 1592 | { |
| 1593 | Image |
| 1594 | *magnify_image; |
| 1595 | |
| 1596 | assert(image != (Image *) NULL); |
| 1597 | assert(image->signature == MagickSignature); |
| 1598 | if (image->debug != MagickFalse) |
| 1599 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1600 | assert(exception != (ExceptionInfo *) NULL); |
| 1601 | assert(exception->signature == MagickSignature); |
| 1602 | magnify_image=ResizeImage(image,2*image->columns,2*image->rows,CubicFilter, |
| 1603 | 1.0,exception); |
| 1604 | return(magnify_image); |
| 1605 | } |
| 1606 | |
| 1607 | /* |
| 1608 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1609 | % % |
| 1610 | % % |
| 1611 | % % |
| 1612 | % M i n i f y I m a g e % |
| 1613 | % % |
| 1614 | % % |
| 1615 | % % |
| 1616 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1617 | % |
| 1618 | % MinifyImage() is a convenience method that scales an image proportionally |
| 1619 | % to half its size. |
| 1620 | % |
| 1621 | % The format of the MinifyImage method is: |
| 1622 | % |
| 1623 | % Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| 1624 | % |
| 1625 | % A description of each parameter follows: |
| 1626 | % |
| 1627 | % o image: the image. |
| 1628 | % |
| 1629 | % o exception: return any errors or warnings in this structure. |
| 1630 | % |
| 1631 | */ |
| 1632 | MagickExport Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| 1633 | { |
| 1634 | Image |
| 1635 | *minify_image; |
| 1636 | |
| 1637 | assert(image != (Image *) NULL); |
| 1638 | assert(image->signature == MagickSignature); |
| 1639 | if (image->debug != MagickFalse) |
| 1640 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1641 | assert(exception != (ExceptionInfo *) NULL); |
| 1642 | assert(exception->signature == MagickSignature); |
| 1643 | minify_image=ResizeImage(image,image->columns/2,image->rows/2,CubicFilter, |
| 1644 | 1.0,exception); |
| 1645 | return(minify_image); |
| 1646 | } |
| 1647 | |
| 1648 | /* |
| 1649 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1650 | % % |
| 1651 | % % |
| 1652 | % % |
| 1653 | % R e s a m p l e I m a g e % |
| 1654 | % % |
| 1655 | % % |
| 1656 | % % |
| 1657 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1658 | % |
| 1659 | % ResampleImage() resize image in terms of its pixel size, so that when |
| 1660 | % displayed at the given resolution it will be the same size in terms of |
| 1661 | % real world units as the original image at the original resolution. |
| 1662 | % |
| 1663 | % The format of the ResampleImage method is: |
| 1664 | % |
| 1665 | % Image *ResampleImage(Image *image,const double x_resolution, |
| 1666 | % const double y_resolution,const FilterTypes filter,const double blur, |
| 1667 | % ExceptionInfo *exception) |
| 1668 | % |
| 1669 | % A description of each parameter follows: |
| 1670 | % |
| 1671 | % o image: the image to be resized to fit the given resolution. |
| 1672 | % |
| 1673 | % o x_resolution: the new image x resolution. |
| 1674 | % |
| 1675 | % o y_resolution: the new image y resolution. |
| 1676 | % |
| 1677 | % o filter: Image filter to use. |
| 1678 | % |
| 1679 | % o blur: the blur factor where > 1 is blurry, < 1 is sharp. |
| 1680 | % |
| 1681 | */ |
| 1682 | MagickExport Image *ResampleImage(const Image *image,const double x_resolution, |
| 1683 | const double y_resolution,const FilterTypes filter,const double blur, |
| 1684 | ExceptionInfo *exception) |
| 1685 | { |
| 1686 | #define ResampleImageTag "Resample/Image" |
| 1687 | |
| 1688 | Image |
| 1689 | *resample_image; |
| 1690 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1691 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1692 | height, |
| 1693 | width; |
| 1694 | |
| 1695 | /* |
| 1696 | Initialize sampled image attributes. |
| 1697 | */ |
| 1698 | assert(image != (const Image *) NULL); |
| 1699 | assert(image->signature == MagickSignature); |
| 1700 | if (image->debug != MagickFalse) |
| 1701 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1702 | assert(exception != (ExceptionInfo *) NULL); |
| 1703 | assert(exception->signature == MagickSignature); |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1704 | width=(size_t) (x_resolution*image->columns/(image->x_resolution == 0.0 ? |
| 1705 | 72.0 : image->x_resolution)+0.5); |
| 1706 | height=(size_t) (y_resolution*image->rows/(image->y_resolution == 0.0 ? |
| 1707 | 72.0 : image->y_resolution)+0.5); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1708 | resample_image=ResizeImage(image,width,height,filter,blur,exception); |
| 1709 | if (resample_image != (Image *) NULL) |
| 1710 | { |
| 1711 | resample_image->x_resolution=x_resolution; |
| 1712 | resample_image->y_resolution=y_resolution; |
| 1713 | } |
| 1714 | return(resample_image); |
| 1715 | } |
| 1716 | #if defined(MAGICKCORE_LQR_DELEGATE) |
| 1717 | |
| 1718 | /* |
| 1719 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1720 | % % |
| 1721 | % % |
| 1722 | % % |
| 1723 | % L i q u i d R e s c a l e I m a g e % |
| 1724 | % % |
| 1725 | % % |
| 1726 | % % |
| 1727 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1728 | % |
| 1729 | % LiquidRescaleImage() rescales image with seam carving. |
| 1730 | % |
| 1731 | % The format of the LiquidRescaleImage method is: |
| 1732 | % |
| 1733 | % Image *LiquidRescaleImage(const Image *image, |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1734 | % const size_t columns,const size_t rows, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1735 | % const double delta_x,const double rigidity,ExceptionInfo *exception) |
| 1736 | % |
| 1737 | % A description of each parameter follows: |
| 1738 | % |
| 1739 | % o image: the image. |
| 1740 | % |
| 1741 | % o columns: the number of columns in the rescaled image. |
| 1742 | % |
| 1743 | % o rows: the number of rows in the rescaled image. |
| 1744 | % |
| 1745 | % o delta_x: maximum seam transversal step (0 means straight seams). |
| 1746 | % |
| 1747 | % o rigidity: introduce a bias for non-straight seams (typically 0). |
| 1748 | % |
| 1749 | % o exception: return any errors or warnings in this structure. |
| 1750 | % |
| 1751 | */ |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1752 | MagickExport Image *LiquidRescaleImage(const Image *image,const size_t columns, |
| 1753 | const size_t rows,const double delta_x,const double rigidity, |
| 1754 | ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1755 | { |
| 1756 | #define LiquidRescaleImageTag "Rescale/Image" |
| 1757 | |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1758 | CacheView |
| 1759 | *rescale_view; |
| 1760 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1761 | const char |
| 1762 | *map; |
| 1763 | |
| 1764 | guchar |
| 1765 | *packet; |
| 1766 | |
| 1767 | Image |
| 1768 | *rescale_image; |
| 1769 | |
| 1770 | int |
| 1771 | x, |
| 1772 | y; |
| 1773 | |
| 1774 | LqrCarver |
| 1775 | *carver; |
| 1776 | |
| 1777 | LqrRetVal |
| 1778 | lqr_status; |
| 1779 | |
| 1780 | MagickBooleanType |
| 1781 | status; |
| 1782 | |
| 1783 | MagickPixelPacket |
| 1784 | pixel; |
| 1785 | |
| 1786 | unsigned char |
| 1787 | *pixels; |
| 1788 | |
| 1789 | /* |
| 1790 | Liquid rescale image. |
| 1791 | */ |
| 1792 | assert(image != (const Image *) NULL); |
| 1793 | assert(image->signature == MagickSignature); |
| 1794 | if (image->debug != MagickFalse) |
| 1795 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1796 | assert(exception != (ExceptionInfo *) NULL); |
| 1797 | assert(exception->signature == MagickSignature); |
| 1798 | if ((columns == 0) || (rows == 0)) |
| 1799 | return((Image *) NULL); |
| 1800 | if ((columns == image->columns) && (rows == image->rows)) |
| 1801 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 1802 | if ((columns <= 2) || (rows <= 2)) |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 1803 | return(ResizeImage(image,columns,rows,image->filter,image->blur,exception)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1804 | if ((columns >= (2*image->columns)) || (rows >= (2*image->rows))) |
| 1805 | { |
| 1806 | Image |
| 1807 | *resize_image; |
| 1808 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1809 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1810 | height, |
| 1811 | width; |
| 1812 | |
| 1813 | /* |
| 1814 | Honor liquid resize size limitations. |
| 1815 | */ |
| 1816 | for (width=image->columns; columns >= (2*width-1); width*=2); |
| 1817 | for (height=image->rows; rows >= (2*height-1); height*=2); |
| 1818 | resize_image=ResizeImage(image,width,height,image->filter,image->blur, |
| 1819 | exception); |
| 1820 | if (resize_image == (Image *) NULL) |
| 1821 | return((Image *) NULL); |
| 1822 | rescale_image=LiquidRescaleImage(resize_image,columns,rows,delta_x, |
| 1823 | rigidity,exception); |
| 1824 | resize_image=DestroyImage(resize_image); |
| 1825 | return(rescale_image); |
| 1826 | } |
| 1827 | map="RGB"; |
| 1828 | if (image->matte == MagickFalse) |
| 1829 | map="RGBA"; |
| 1830 | if (image->colorspace == CMYKColorspace) |
| 1831 | { |
| 1832 | map="CMYK"; |
| 1833 | if (image->matte == MagickFalse) |
| 1834 | map="CMYKA"; |
| 1835 | } |
| 1836 | pixels=(unsigned char *) AcquireQuantumMemory(image->columns,image->rows* |
| 1837 | strlen(map)*sizeof(*pixels)); |
| 1838 | if (pixels == (unsigned char *) NULL) |
| 1839 | return((Image *) NULL); |
| 1840 | status=ExportImagePixels(image,0,0,image->columns,image->rows,map,CharPixel, |
| 1841 | pixels,exception); |
| 1842 | if (status == MagickFalse) |
| 1843 | { |
| 1844 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1845 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 1846 | } |
| 1847 | carver=lqr_carver_new(pixels,image->columns,image->rows,strlen(map)); |
| 1848 | if (carver == (LqrCarver *) NULL) |
| 1849 | { |
| 1850 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1851 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 1852 | } |
| 1853 | lqr_status=lqr_carver_init(carver,(int) delta_x,rigidity); |
| 1854 | lqr_status=lqr_carver_resize(carver,columns,rows); |
| 1855 | rescale_image=CloneImage(image,lqr_carver_get_width(carver), |
| 1856 | lqr_carver_get_height(carver),MagickTrue,exception); |
| 1857 | if (rescale_image == (Image *) NULL) |
| 1858 | { |
| 1859 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1860 | return((Image *) NULL); |
| 1861 | } |
| 1862 | if (SetImageStorageClass(rescale_image,DirectClass) == MagickFalse) |
| 1863 | { |
| 1864 | InheritException(exception,&rescale_image->exception); |
| 1865 | rescale_image=DestroyImage(rescale_image); |
| 1866 | return((Image *) NULL); |
| 1867 | } |
| 1868 | GetMagickPixelPacket(rescale_image,&pixel); |
| 1869 | (void) lqr_carver_scan_reset(carver); |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1870 | rescale_view=AcquireCacheView(rescale_image); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1871 | while (lqr_carver_scan(carver,&x,&y,&packet) != 0) |
| 1872 | { |
| 1873 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1874 | *restrict rescale_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1875 | |
| 1876 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1877 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1878 | |
anthony | 22aad25 | 2010-09-23 06:59:07 +0000 | [diff] [blame] | 1879 | q=QueueCacheViewAuthenticPixels(rescale_view,x,y,1,1,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1880 | if (q == (PixelPacket *) NULL) |
| 1881 | break; |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1882 | rescale_indexes=GetCacheViewAuthenticIndexQueue(rescale_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1883 | pixel.red=QuantumRange*(packet[0]/255.0); |
| 1884 | pixel.green=QuantumRange*(packet[1]/255.0); |
| 1885 | pixel.blue=QuantumRange*(packet[2]/255.0); |
| 1886 | if (image->colorspace != CMYKColorspace) |
| 1887 | { |
| 1888 | if (image->matte == MagickFalse) |
| 1889 | pixel.opacity=QuantumRange*(packet[3]/255.0); |
| 1890 | } |
| 1891 | else |
| 1892 | { |
| 1893 | pixel.index=QuantumRange*(packet[3]/255.0); |
| 1894 | if (image->matte == MagickFalse) |
| 1895 | pixel.opacity=QuantumRange*(packet[4]/255.0); |
| 1896 | } |
| 1897 | SetPixelPacket(rescale_image,&pixel,q,rescale_indexes); |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1898 | if (SyncCacheViewAuthenticPixels(rescale_view,exception) == MagickFalse) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1899 | break; |
| 1900 | } |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1901 | rescale_view=DestroyCacheView(rescale_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1902 | /* |
| 1903 | Relinquish resources. |
| 1904 | */ |
| 1905 | lqr_carver_destroy(carver); |
| 1906 | return(rescale_image); |
| 1907 | } |
| 1908 | #else |
| 1909 | MagickExport Image *LiquidRescaleImage(const Image *image, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1910 | const size_t magick_unused(columns),const size_t magick_unused(rows), |
| 1911 | const double magick_unused(delta_x),const double magick_unused(rigidity), |
| 1912 | ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1913 | { |
| 1914 | assert(image != (const Image *) NULL); |
| 1915 | assert(image->signature == MagickSignature); |
| 1916 | if (image->debug != MagickFalse) |
| 1917 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1918 | assert(exception != (ExceptionInfo *) NULL); |
| 1919 | assert(exception->signature == MagickSignature); |
| 1920 | (void) ThrowMagickException(exception,GetMagickModule(),MissingDelegateError, |
| 1921 | "DelegateLibrarySupportNotBuiltIn","`%s' (LQR)",image->filename); |
| 1922 | return((Image *) NULL); |
| 1923 | } |
| 1924 | #endif |
| 1925 | |
| 1926 | /* |
| 1927 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1928 | % % |
| 1929 | % % |
| 1930 | % % |
| 1931 | % R e s i z e I m a g e % |
| 1932 | % % |
| 1933 | % % |
| 1934 | % % |
| 1935 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1936 | % |
| 1937 | % ResizeImage() scales an image to the desired dimensions, using the given |
cristy | 5d82438 | 2010-09-06 14:00:17 +0000 | [diff] [blame] | 1938 | % filter (see AcquireFilterInfo()). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1939 | % |
| 1940 | % If an undefined filter is given the filter defaults to Mitchell for a |
| 1941 | % colormapped image, a image with a matte channel, or if the image is |
| 1942 | % enlarged. Otherwise the filter defaults to a Lanczos. |
| 1943 | % |
| 1944 | % ResizeImage() was inspired by Paul Heckbert's "zoom" program. |
| 1945 | % |
| 1946 | % The format of the ResizeImage method is: |
| 1947 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1948 | % Image *ResizeImage(Image *image,const size_t columns, |
| 1949 | % const size_t rows,const FilterTypes filter,const double blur, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1950 | % ExceptionInfo *exception) |
| 1951 | % |
| 1952 | % A description of each parameter follows: |
| 1953 | % |
| 1954 | % o image: the image. |
| 1955 | % |
| 1956 | % o columns: the number of columns in the scaled image. |
| 1957 | % |
| 1958 | % o rows: the number of rows in the scaled image. |
| 1959 | % |
| 1960 | % o filter: Image filter to use. |
| 1961 | % |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1962 | % o blur: the blur factor where > 1 is blurry, < 1 is sharp. Typically set |
| 1963 | % this to 1.0. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1964 | % |
| 1965 | % o exception: return any errors or warnings in this structure. |
| 1966 | % |
| 1967 | */ |
| 1968 | |
| 1969 | typedef struct _ContributionInfo |
| 1970 | { |
| 1971 | MagickRealType |
| 1972 | weight; |
| 1973 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1974 | ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1975 | pixel; |
| 1976 | } ContributionInfo; |
| 1977 | |
| 1978 | static ContributionInfo **DestroyContributionThreadSet( |
| 1979 | ContributionInfo **contribution) |
| 1980 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1981 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1982 | i; |
| 1983 | |
| 1984 | assert(contribution != (ContributionInfo **) NULL); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1985 | for (i=0; i < (ssize_t) GetOpenMPMaximumThreads(); i++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1986 | if (contribution[i] != (ContributionInfo *) NULL) |
| 1987 | contribution[i]=(ContributionInfo *) RelinquishMagickMemory( |
| 1988 | contribution[i]); |
cristy | b41ee10 | 2010-10-04 16:46:15 +0000 | [diff] [blame] | 1989 | contribution=(ContributionInfo **) RelinquishMagickMemory(contribution); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1990 | return(contribution); |
| 1991 | } |
| 1992 | |
| 1993 | static ContributionInfo **AcquireContributionThreadSet(const size_t count) |
| 1994 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1995 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1996 | i; |
| 1997 | |
| 1998 | ContributionInfo |
| 1999 | **contribution; |
| 2000 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2001 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2002 | number_threads; |
| 2003 | |
| 2004 | number_threads=GetOpenMPMaximumThreads(); |
cristy | b41ee10 | 2010-10-04 16:46:15 +0000 | [diff] [blame] | 2005 | contribution=(ContributionInfo **) AcquireQuantumMemory(number_threads, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2006 | sizeof(*contribution)); |
| 2007 | if (contribution == (ContributionInfo **) NULL) |
| 2008 | return((ContributionInfo **) NULL); |
| 2009 | (void) ResetMagickMemory(contribution,0,number_threads*sizeof(*contribution)); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2010 | for (i=0; i < (ssize_t) number_threads; i++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2011 | { |
| 2012 | contribution[i]=(ContributionInfo *) AcquireQuantumMemory(count, |
| 2013 | sizeof(**contribution)); |
| 2014 | if (contribution[i] == (ContributionInfo *) NULL) |
| 2015 | return(DestroyContributionThreadSet(contribution)); |
| 2016 | } |
| 2017 | return(contribution); |
| 2018 | } |
| 2019 | |
| 2020 | static inline double MagickMax(const double x,const double y) |
| 2021 | { |
| 2022 | if (x > y) |
| 2023 | return(x); |
| 2024 | return(y); |
| 2025 | } |
| 2026 | |
| 2027 | static inline double MagickMin(const double x,const double y) |
| 2028 | { |
| 2029 | if (x < y) |
| 2030 | return(x); |
| 2031 | return(y); |
| 2032 | } |
| 2033 | |
| 2034 | static MagickBooleanType HorizontalFilter(const ResizeFilter *resize_filter, |
| 2035 | const Image *image,Image *resize_image,const MagickRealType x_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2036 | const MagickSizeType span,MagickOffsetType *offset,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2037 | { |
| 2038 | #define ResizeImageTag "Resize/Image" |
| 2039 | |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2040 | CacheView |
| 2041 | *image_view, |
| 2042 | *resize_view; |
| 2043 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2044 | ClassType |
| 2045 | storage_class; |
| 2046 | |
| 2047 | ContributionInfo |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2048 | **restrict contributions; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2049 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2050 | MagickBooleanType |
| 2051 | status; |
| 2052 | |
| 2053 | MagickPixelPacket |
| 2054 | zero; |
| 2055 | |
| 2056 | MagickRealType |
| 2057 | scale, |
| 2058 | support; |
| 2059 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2060 | ssize_t |
| 2061 | x; |
| 2062 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2063 | /* |
| 2064 | Apply filter to resize horizontally from image to resize image. |
| 2065 | */ |
cristy | 5d82438 | 2010-09-06 14:00:17 +0000 | [diff] [blame] | 2066 | scale=MagickMax(1.0/x_factor+MagickEpsilon,1.0); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2067 | support=scale*GetResizeFilterSupport(resize_filter); |
| 2068 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| 2069 | if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| 2070 | { |
| 2071 | InheritException(exception,&resize_image->exception); |
| 2072 | return(MagickFalse); |
| 2073 | } |
| 2074 | if (support < 0.5) |
| 2075 | { |
| 2076 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 2077 | Support too small even for nearest neighbour: Reduce to point |
| 2078 | sampling. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2079 | */ |
| 2080 | support=(MagickRealType) 0.5; |
| 2081 | scale=1.0; |
| 2082 | } |
| 2083 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| 2084 | if (contributions == (ContributionInfo **) NULL) |
| 2085 | { |
| 2086 | (void) ThrowMagickException(exception,GetMagickModule(), |
| 2087 | ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| 2088 | return(MagickFalse); |
| 2089 | } |
| 2090 | status=MagickTrue; |
| 2091 | scale=1.0/scale; |
| 2092 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2093 | image_view=AcquireCacheView(image); |
| 2094 | resize_view=AcquireCacheView(resize_image); |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2095 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2096 | #pragma omp parallel for shared(status) |
| 2097 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2098 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2099 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2100 | MagickRealType |
| 2101 | center, |
| 2102 | density; |
| 2103 | |
| 2104 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2105 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2106 | |
| 2107 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2108 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2109 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2110 | register ContributionInfo |
| 2111 | *restrict contribution; |
| 2112 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2113 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2114 | *restrict resize_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2115 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2116 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2117 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2118 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2119 | register ssize_t |
| 2120 | y; |
| 2121 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2122 | ssize_t |
| 2123 | n, |
| 2124 | start, |
| 2125 | stop; |
| 2126 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2127 | if (status == MagickFalse) |
| 2128 | continue; |
| 2129 | center=(MagickRealType) (x+0.5)/x_factor; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2130 | start=(ssize_t) MagickMax(center-support+0.5,0.0); |
| 2131 | stop=(ssize_t) MagickMin(center+support+0.5,(double) image->columns); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2132 | density=0.0; |
| 2133 | contribution=contributions[GetOpenMPThreadId()]; |
| 2134 | for (n=0; n < (stop-start); n++) |
| 2135 | { |
| 2136 | contribution[n].pixel=start+n; |
| 2137 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| 2138 | ((MagickRealType) (start+n)-center+0.5)); |
| 2139 | density+=contribution[n].weight; |
| 2140 | } |
| 2141 | if ((density != 0.0) && (density != 1.0)) |
| 2142 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2143 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2144 | i; |
| 2145 | |
| 2146 | /* |
| 2147 | Normalize. |
| 2148 | */ |
| 2149 | density=1.0/density; |
| 2150 | for (i=0; i < n; i++) |
| 2151 | contribution[i].weight*=density; |
| 2152 | } |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2153 | p=GetCacheViewVirtualPixels(image_view,contribution[0].pixel,0,(size_t) |
| 2154 | (contribution[n-1].pixel-contribution[0].pixel+1),image->rows,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2155 | q=QueueCacheViewAuthenticPixels(resize_view,x,0,1,resize_image->rows, |
| 2156 | exception); |
| 2157 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2158 | { |
| 2159 | status=MagickFalse; |
| 2160 | continue; |
| 2161 | } |
| 2162 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
| 2163 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2164 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2165 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2166 | MagickPixelPacket |
| 2167 | pixel; |
| 2168 | |
| 2169 | MagickRealType |
| 2170 | alpha; |
| 2171 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2172 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2173 | i; |
| 2174 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2175 | ssize_t |
| 2176 | j; |
| 2177 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2178 | pixel=zero; |
| 2179 | if (image->matte == MagickFalse) |
| 2180 | { |
| 2181 | for (i=0; i < n; i++) |
| 2182 | { |
| 2183 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2184 | (contribution[i].pixel-contribution[0].pixel); |
| 2185 | alpha=contribution[i].weight; |
| 2186 | pixel.red+=alpha*(p+j)->red; |
| 2187 | pixel.green+=alpha*(p+j)->green; |
| 2188 | pixel.blue+=alpha*(p+j)->blue; |
| 2189 | pixel.opacity+=alpha*(p+j)->opacity; |
| 2190 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2191 | SetRedPixelComponent(q,ClampRedPixelComponent(&pixel)); |
| 2192 | SetGreenPixelComponent(q,ClampGreenPixelComponent(&pixel)); |
| 2193 | SetBluePixelComponent(q,ClampBluePixelComponent(&pixel)); |
| 2194 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2195 | if ((image->colorspace == CMYKColorspace) && |
| 2196 | (resize_image->colorspace == CMYKColorspace)) |
| 2197 | { |
| 2198 | for (i=0; i < n; i++) |
| 2199 | { |
| 2200 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2201 | (contribution[i].pixel-contribution[0].pixel); |
| 2202 | alpha=contribution[i].weight; |
| 2203 | pixel.index+=alpha*indexes[j]; |
| 2204 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2205 | resize_indexes[y]=(IndexPacket) ClampToQuantum(pixel.index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2206 | } |
| 2207 | } |
| 2208 | else |
| 2209 | { |
| 2210 | MagickRealType |
| 2211 | gamma; |
| 2212 | |
| 2213 | gamma=0.0; |
| 2214 | for (i=0; i < n; i++) |
| 2215 | { |
| 2216 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2217 | (contribution[i].pixel-contribution[0].pixel); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2218 | alpha=contribution[i].weight*QuantumScale* |
| 2219 | GetAlphaPixelComponent(p+j); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2220 | pixel.red+=alpha*(p+j)->red; |
| 2221 | pixel.green+=alpha*(p+j)->green; |
| 2222 | pixel.blue+=alpha*(p+j)->blue; |
| 2223 | pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| 2224 | gamma+=alpha; |
| 2225 | } |
| 2226 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2227 | q->red=ClampToQuantum(gamma*GetRedPixelComponent(&pixel)); |
| 2228 | q->green=ClampToQuantum(gamma*GetGreenPixelComponent(&pixel)); |
| 2229 | q->blue=ClampToQuantum(gamma*GetBluePixelComponent(&pixel)); |
| 2230 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2231 | if ((image->colorspace == CMYKColorspace) && |
| 2232 | (resize_image->colorspace == CMYKColorspace)) |
| 2233 | { |
| 2234 | for (i=0; i < n; i++) |
| 2235 | { |
| 2236 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2237 | (contribution[i].pixel-contribution[0].pixel); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2238 | alpha=contribution[i].weight*QuantumScale* |
| 2239 | GetAlphaPixelComponent(p+j); |
cristy | c197d1c | 2009-10-13 19:56:53 +0000 | [diff] [blame] | 2240 | pixel.index+=alpha*indexes[j]; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2241 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2242 | resize_indexes[y]=(IndexPacket) ClampToQuantum(gamma* |
| 2243 | GetIndexPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2244 | } |
| 2245 | } |
| 2246 | if ((resize_image->storage_class == PseudoClass) && |
| 2247 | (image->storage_class == PseudoClass)) |
| 2248 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2249 | i=(ssize_t) (MagickMin(MagickMax(center,(double) start),(double) stop- |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2250 | 1.0)+0.5); |
| 2251 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2252 | (contribution[i-start].pixel-contribution[0].pixel); |
| 2253 | resize_indexes[y]=indexes[j]; |
| 2254 | } |
| 2255 | q++; |
| 2256 | } |
| 2257 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 2258 | status=MagickFalse; |
| 2259 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2260 | { |
| 2261 | MagickBooleanType |
| 2262 | proceed; |
| 2263 | |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2264 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2265 | #pragma omp critical (MagickCore_HorizontalFilter) |
| 2266 | #endif |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2267 | proceed=SetImageProgress(image,ResizeImageTag,(*offset)++,span); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2268 | if (proceed == MagickFalse) |
| 2269 | status=MagickFalse; |
| 2270 | } |
| 2271 | } |
| 2272 | resize_view=DestroyCacheView(resize_view); |
| 2273 | image_view=DestroyCacheView(image_view); |
| 2274 | contributions=DestroyContributionThreadSet(contributions); |
| 2275 | return(status); |
| 2276 | } |
| 2277 | |
| 2278 | static MagickBooleanType VerticalFilter(const ResizeFilter *resize_filter, |
| 2279 | const Image *image,Image *resize_image,const MagickRealType y_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2280 | const MagickSizeType span,MagickOffsetType *offset,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2281 | { |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2282 | CacheView |
| 2283 | *image_view, |
| 2284 | *resize_view; |
| 2285 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2286 | ClassType |
| 2287 | storage_class; |
| 2288 | |
| 2289 | ContributionInfo |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2290 | **restrict contributions; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2291 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2292 | MagickBooleanType |
| 2293 | status; |
| 2294 | |
| 2295 | MagickPixelPacket |
| 2296 | zero; |
| 2297 | |
| 2298 | MagickRealType |
| 2299 | scale, |
| 2300 | support; |
| 2301 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2302 | ssize_t |
| 2303 | y; |
| 2304 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2305 | /* |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2306 | Apply filter to resize vertically from image to resize image. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2307 | */ |
cristy | 5d82438 | 2010-09-06 14:00:17 +0000 | [diff] [blame] | 2308 | scale=MagickMax(1.0/y_factor+MagickEpsilon,1.0); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2309 | support=scale*GetResizeFilterSupport(resize_filter); |
| 2310 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| 2311 | if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| 2312 | { |
| 2313 | InheritException(exception,&resize_image->exception); |
| 2314 | return(MagickFalse); |
| 2315 | } |
| 2316 | if (support < 0.5) |
| 2317 | { |
| 2318 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 2319 | Support too small even for nearest neighbour: Reduce to point |
| 2320 | sampling. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2321 | */ |
| 2322 | support=(MagickRealType) 0.5; |
| 2323 | scale=1.0; |
| 2324 | } |
| 2325 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| 2326 | if (contributions == (ContributionInfo **) NULL) |
| 2327 | { |
| 2328 | (void) ThrowMagickException(exception,GetMagickModule(), |
| 2329 | ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| 2330 | return(MagickFalse); |
| 2331 | } |
| 2332 | status=MagickTrue; |
| 2333 | scale=1.0/scale; |
| 2334 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2335 | image_view=AcquireCacheView(image); |
| 2336 | resize_view=AcquireCacheView(resize_image); |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2337 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2338 | #pragma omp parallel for shared(status) |
| 2339 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2340 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2341 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2342 | MagickRealType |
| 2343 | center, |
| 2344 | density; |
| 2345 | |
| 2346 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2347 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2348 | |
| 2349 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2350 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2351 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2352 | register ContributionInfo |
| 2353 | *restrict contribution; |
| 2354 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2355 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2356 | *restrict resize_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2357 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2358 | register PixelPacket |
| 2359 | *restrict q; |
| 2360 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2361 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2362 | x; |
| 2363 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2364 | ssize_t |
| 2365 | n, |
| 2366 | start, |
| 2367 | stop; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2368 | |
| 2369 | if (status == MagickFalse) |
| 2370 | continue; |
cristy | 679e696 | 2010-03-18 00:42:45 +0000 | [diff] [blame] | 2371 | center=(MagickRealType) (y+0.5)/y_factor; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2372 | start=(ssize_t) MagickMax(center-support+0.5,0.0); |
| 2373 | stop=(ssize_t) MagickMin(center+support+0.5,(double) image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2374 | density=0.0; |
| 2375 | contribution=contributions[GetOpenMPThreadId()]; |
| 2376 | for (n=0; n < (stop-start); n++) |
| 2377 | { |
| 2378 | contribution[n].pixel=start+n; |
| 2379 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| 2380 | ((MagickRealType) (start+n)-center+0.5)); |
| 2381 | density+=contribution[n].weight; |
| 2382 | } |
| 2383 | if ((density != 0.0) && (density != 1.0)) |
| 2384 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2385 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2386 | i; |
| 2387 | |
| 2388 | /* |
| 2389 | Normalize. |
| 2390 | */ |
| 2391 | density=1.0/density; |
| 2392 | for (i=0; i < n; i++) |
| 2393 | contribution[i].weight*=density; |
| 2394 | } |
| 2395 | p=GetCacheViewVirtualPixels(image_view,0,contribution[0].pixel, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2396 | image->columns,(size_t) (contribution[n-1].pixel-contribution[0].pixel+1), |
| 2397 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2398 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| 2399 | exception); |
| 2400 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2401 | { |
| 2402 | status=MagickFalse; |
| 2403 | continue; |
| 2404 | } |
| 2405 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
| 2406 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2407 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2408 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2409 | MagickPixelPacket |
| 2410 | pixel; |
| 2411 | |
| 2412 | MagickRealType |
| 2413 | alpha; |
| 2414 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2415 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2416 | i; |
| 2417 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2418 | ssize_t |
| 2419 | j; |
| 2420 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2421 | pixel=zero; |
| 2422 | if (image->matte == MagickFalse) |
| 2423 | { |
| 2424 | for (i=0; i < n; i++) |
| 2425 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2426 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2427 | image->columns+x); |
| 2428 | alpha=contribution[i].weight; |
| 2429 | pixel.red+=alpha*(p+j)->red; |
| 2430 | pixel.green+=alpha*(p+j)->green; |
| 2431 | pixel.blue+=alpha*(p+j)->blue; |
| 2432 | pixel.opacity+=alpha*(p+j)->opacity; |
| 2433 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2434 | SetRedPixelComponent(q,ClampRedPixelComponent(&pixel)); |
| 2435 | SetGreenPixelComponent(q,ClampGreenPixelComponent(&pixel)); |
| 2436 | SetBluePixelComponent(q,ClampBluePixelComponent(&pixel)); |
| 2437 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2438 | if ((image->colorspace == CMYKColorspace) && |
| 2439 | (resize_image->colorspace == CMYKColorspace)) |
| 2440 | { |
| 2441 | for (i=0; i < n; i++) |
| 2442 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2443 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2444 | image->columns+x); |
| 2445 | alpha=contribution[i].weight; |
| 2446 | pixel.index+=alpha*indexes[j]; |
| 2447 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2448 | resize_indexes[x]=(IndexPacket) ClampToQuantum(pixel.index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2449 | } |
| 2450 | } |
| 2451 | else |
| 2452 | { |
| 2453 | MagickRealType |
| 2454 | gamma; |
| 2455 | |
| 2456 | gamma=0.0; |
| 2457 | for (i=0; i < n; i++) |
| 2458 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2459 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2460 | image->columns+x); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2461 | alpha=contribution[i].weight*QuantumScale* |
| 2462 | GetAlphaPixelComponent(p+j); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2463 | pixel.red+=alpha*(p+j)->red; |
| 2464 | pixel.green+=alpha*(p+j)->green; |
| 2465 | pixel.blue+=alpha*(p+j)->blue; |
| 2466 | pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| 2467 | gamma+=alpha; |
| 2468 | } |
| 2469 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2470 | q->red=ClampToQuantum(gamma*GetRedPixelComponent(&pixel)); |
| 2471 | q->green=ClampToQuantum(gamma*GetGreenPixelComponent(&pixel)); |
| 2472 | q->blue=ClampToQuantum(gamma*GetBluePixelComponent(&pixel)); |
| 2473 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2474 | if ((image->colorspace == CMYKColorspace) && |
| 2475 | (resize_image->colorspace == CMYKColorspace)) |
| 2476 | { |
| 2477 | for (i=0; i < n; i++) |
| 2478 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2479 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2480 | image->columns+x); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2481 | alpha=contribution[i].weight*QuantumScale* |
| 2482 | GetAlphaPixelComponent(p+j); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2483 | pixel.index+=alpha*indexes[j]; |
| 2484 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2485 | resize_indexes[x]=(IndexPacket) ClampToQuantum(gamma* |
| 2486 | GetIndexPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2487 | } |
| 2488 | } |
| 2489 | if ((resize_image->storage_class == PseudoClass) && |
| 2490 | (image->storage_class == PseudoClass)) |
| 2491 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2492 | i=(ssize_t) (MagickMin(MagickMax(center,(double) start),(double) stop- |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2493 | 1.0)+0.5); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2494 | j=(ssize_t) ((contribution[i-start].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2495 | image->columns+x); |
| 2496 | resize_indexes[x]=indexes[j]; |
| 2497 | } |
| 2498 | q++; |
| 2499 | } |
| 2500 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 2501 | status=MagickFalse; |
| 2502 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2503 | { |
| 2504 | MagickBooleanType |
| 2505 | proceed; |
| 2506 | |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2507 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2508 | #pragma omp critical (MagickCore_VerticalFilter) |
| 2509 | #endif |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2510 | proceed=SetImageProgress(image,ResizeImageTag,(*offset)++,span); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2511 | if (proceed == MagickFalse) |
| 2512 | status=MagickFalse; |
| 2513 | } |
| 2514 | } |
| 2515 | resize_view=DestroyCacheView(resize_view); |
| 2516 | image_view=DestroyCacheView(image_view); |
| 2517 | contributions=DestroyContributionThreadSet(contributions); |
| 2518 | return(status); |
| 2519 | } |
| 2520 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2521 | MagickExport Image *ResizeImage(const Image *image,const size_t columns, |
| 2522 | const size_t rows,const FilterTypes filter,const double blur, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2523 | ExceptionInfo *exception) |
| 2524 | { |
| 2525 | #define WorkLoadFactor 0.265 |
| 2526 | |
| 2527 | FilterTypes |
| 2528 | filter_type; |
| 2529 | |
| 2530 | Image |
| 2531 | *filter_image, |
| 2532 | *resize_image; |
| 2533 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2534 | MagickOffsetType |
| 2535 | offset; |
| 2536 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2537 | MagickRealType |
| 2538 | x_factor, |
| 2539 | y_factor; |
| 2540 | |
| 2541 | MagickSizeType |
| 2542 | span; |
| 2543 | |
| 2544 | MagickStatusType |
| 2545 | status; |
| 2546 | |
| 2547 | ResizeFilter |
| 2548 | *resize_filter; |
| 2549 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2550 | /* |
| 2551 | Acquire resize image. |
| 2552 | */ |
| 2553 | assert(image != (Image *) NULL); |
| 2554 | assert(image->signature == MagickSignature); |
| 2555 | if (image->debug != MagickFalse) |
| 2556 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2557 | assert(exception != (ExceptionInfo *) NULL); |
| 2558 | assert(exception->signature == MagickSignature); |
| 2559 | if ((columns == 0) || (rows == 0)) |
| 2560 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| 2561 | if ((columns == image->columns) && (rows == image->rows) && |
| 2562 | (filter == UndefinedFilter) && (blur == 1.0)) |
| 2563 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2564 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2565 | if (resize_image == (Image *) NULL) |
| 2566 | return(resize_image); |
| 2567 | /* |
| 2568 | Acquire resize filter. |
| 2569 | */ |
| 2570 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| 2571 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| 2572 | if ((x_factor*y_factor) > WorkLoadFactor) |
| 2573 | filter_image=CloneImage(image,columns,image->rows,MagickTrue,exception); |
| 2574 | else |
| 2575 | filter_image=CloneImage(image,image->columns,rows,MagickTrue,exception); |
| 2576 | if (filter_image == (Image *) NULL) |
| 2577 | return(DestroyImage(resize_image)); |
| 2578 | filter_type=LanczosFilter; |
| 2579 | if (filter != UndefinedFilter) |
| 2580 | filter_type=filter; |
| 2581 | else |
| 2582 | if ((x_factor == 1.0) && (y_factor == 1.0)) |
| 2583 | filter_type=PointFilter; |
| 2584 | else |
| 2585 | if ((image->storage_class == PseudoClass) || |
| 2586 | (image->matte != MagickFalse) || ((x_factor*y_factor) > 1.0)) |
| 2587 | filter_type=MitchellFilter; |
| 2588 | resize_filter=AcquireResizeFilter(image,filter_type,blur,MagickFalse, |
| 2589 | exception); |
| 2590 | /* |
| 2591 | Resize image. |
| 2592 | */ |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2593 | offset=0; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2594 | if ((x_factor*y_factor) > WorkLoadFactor) |
| 2595 | { |
| 2596 | span=(MagickSizeType) (filter_image->columns+rows); |
| 2597 | status=HorizontalFilter(resize_filter,image,filter_image,x_factor,span, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2598 | &offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2599 | status&=VerticalFilter(resize_filter,filter_image,resize_image,y_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2600 | span,&offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2601 | } |
| 2602 | else |
| 2603 | { |
| 2604 | span=(MagickSizeType) (filter_image->rows+columns); |
| 2605 | status=VerticalFilter(resize_filter,image,filter_image,y_factor,span, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2606 | &offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2607 | status&=HorizontalFilter(resize_filter,filter_image,resize_image,x_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2608 | span,&offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2609 | } |
| 2610 | /* |
| 2611 | Free resources. |
| 2612 | */ |
| 2613 | filter_image=DestroyImage(filter_image); |
| 2614 | resize_filter=DestroyResizeFilter(resize_filter); |
| 2615 | if ((status == MagickFalse) || (resize_image == (Image *) NULL)) |
| 2616 | return((Image *) NULL); |
| 2617 | resize_image->type=image->type; |
| 2618 | return(resize_image); |
| 2619 | } |
| 2620 | |
| 2621 | /* |
| 2622 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2623 | % % |
| 2624 | % % |
| 2625 | % % |
| 2626 | % S a m p l e I m a g e % |
| 2627 | % % |
| 2628 | % % |
| 2629 | % % |
| 2630 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2631 | % |
| 2632 | % SampleImage() scales an image to the desired dimensions with pixel |
| 2633 | % sampling. Unlike other scaling methods, this method does not introduce |
| 2634 | % any additional color into the scaled image. |
| 2635 | % |
| 2636 | % The format of the SampleImage method is: |
| 2637 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2638 | % Image *SampleImage(const Image *image,const size_t columns, |
| 2639 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2640 | % |
| 2641 | % A description of each parameter follows: |
| 2642 | % |
| 2643 | % o image: the image. |
| 2644 | % |
| 2645 | % o columns: the number of columns in the sampled image. |
| 2646 | % |
| 2647 | % o rows: the number of rows in the sampled image. |
| 2648 | % |
| 2649 | % o exception: return any errors or warnings in this structure. |
| 2650 | % |
| 2651 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2652 | MagickExport Image *SampleImage(const Image *image,const size_t columns, |
| 2653 | const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2654 | { |
| 2655 | #define SampleImageTag "Sample/Image" |
| 2656 | |
cristy | c4c8d13 | 2010-01-07 01:58:38 +0000 | [diff] [blame] | 2657 | CacheView |
| 2658 | *image_view, |
| 2659 | *sample_view; |
| 2660 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2661 | Image |
| 2662 | *sample_image; |
| 2663 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2664 | MagickBooleanType |
| 2665 | status; |
| 2666 | |
cristy | 5f95947 | 2010-05-27 22:19:46 +0000 | [diff] [blame] | 2667 | MagickOffsetType |
| 2668 | progress; |
| 2669 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2670 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2671 | x; |
| 2672 | |
cristy | 5f95947 | 2010-05-27 22:19:46 +0000 | [diff] [blame] | 2673 | ssize_t |
| 2674 | *x_offset, |
| 2675 | y; |
| 2676 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2677 | /* |
| 2678 | Initialize sampled image attributes. |
| 2679 | */ |
| 2680 | assert(image != (const Image *) NULL); |
| 2681 | assert(image->signature == MagickSignature); |
| 2682 | if (image->debug != MagickFalse) |
| 2683 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2684 | assert(exception != (ExceptionInfo *) NULL); |
| 2685 | assert(exception->signature == MagickSignature); |
| 2686 | if ((columns == 0) || (rows == 0)) |
| 2687 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| 2688 | if ((columns == image->columns) && (rows == image->rows)) |
| 2689 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2690 | sample_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2691 | if (sample_image == (Image *) NULL) |
| 2692 | return((Image *) NULL); |
| 2693 | /* |
| 2694 | Allocate scan line buffer and column offset buffers. |
| 2695 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2696 | x_offset=(ssize_t *) AcquireQuantumMemory((size_t) sample_image->columns, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2697 | sizeof(*x_offset)); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2698 | if (x_offset == (ssize_t *) NULL) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2699 | { |
| 2700 | sample_image=DestroyImage(sample_image); |
| 2701 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 2702 | } |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2703 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
| 2704 | x_offset[x]=(ssize_t) (((MagickRealType) x+0.5)*image->columns/ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2705 | sample_image->columns); |
| 2706 | /* |
| 2707 | Sample each row. |
| 2708 | */ |
| 2709 | status=MagickTrue; |
| 2710 | progress=0; |
| 2711 | image_view=AcquireCacheView(image); |
| 2712 | sample_view=AcquireCacheView(sample_image); |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2713 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 2714 | #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2715 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2716 | for (y=0; y < (ssize_t) sample_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2717 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2718 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2719 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2720 | |
| 2721 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2722 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2723 | |
| 2724 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2725 | *restrict sample_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2726 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2727 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2728 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2729 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2730 | register ssize_t |
| 2731 | x; |
| 2732 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2733 | ssize_t |
| 2734 | y_offset; |
| 2735 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2736 | if (status == MagickFalse) |
| 2737 | continue; |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2738 | y_offset=(ssize_t) (((MagickRealType) y+0.5)*image->rows/ |
| 2739 | sample_image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2740 | p=GetCacheViewVirtualPixels(image_view,0,y_offset,image->columns,1, |
| 2741 | exception); |
| 2742 | q=QueueCacheViewAuthenticPixels(sample_view,0,y,sample_image->columns,1, |
| 2743 | exception); |
| 2744 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2745 | { |
| 2746 | status=MagickFalse; |
| 2747 | continue; |
| 2748 | } |
| 2749 | indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| 2750 | sample_indexes=GetCacheViewAuthenticIndexQueue(sample_view); |
| 2751 | /* |
| 2752 | Sample each column. |
| 2753 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2754 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2755 | *q++=p[x_offset[x]]; |
| 2756 | if ((image->storage_class == PseudoClass) || |
| 2757 | (image->colorspace == CMYKColorspace)) |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2758 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2759 | sample_indexes[x]=indexes[x_offset[x]]; |
| 2760 | if (SyncCacheViewAuthenticPixels(sample_view,exception) == MagickFalse) |
| 2761 | status=MagickFalse; |
| 2762 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2763 | { |
| 2764 | MagickBooleanType |
| 2765 | proceed; |
| 2766 | |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2767 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2768 | #pragma omp critical (MagickCore_SampleImage) |
| 2769 | #endif |
| 2770 | proceed=SetImageProgress(image,SampleImageTag,progress++,image->rows); |
| 2771 | if (proceed == MagickFalse) |
| 2772 | status=MagickFalse; |
| 2773 | } |
| 2774 | } |
| 2775 | image_view=DestroyCacheView(image_view); |
| 2776 | sample_view=DestroyCacheView(sample_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2777 | x_offset=(ssize_t *) RelinquishMagickMemory(x_offset); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2778 | sample_image->type=image->type; |
| 2779 | return(sample_image); |
| 2780 | } |
| 2781 | |
| 2782 | /* |
| 2783 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2784 | % % |
| 2785 | % % |
| 2786 | % % |
| 2787 | % S c a l e I m a g e % |
| 2788 | % % |
| 2789 | % % |
| 2790 | % % |
| 2791 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2792 | % |
| 2793 | % ScaleImage() changes the size of an image to the given dimensions. |
| 2794 | % |
| 2795 | % The format of the ScaleImage method is: |
| 2796 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2797 | % Image *ScaleImage(const Image *image,const size_t columns, |
| 2798 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2799 | % |
| 2800 | % A description of each parameter follows: |
| 2801 | % |
| 2802 | % o image: the image. |
| 2803 | % |
| 2804 | % o columns: the number of columns in the scaled image. |
| 2805 | % |
| 2806 | % o rows: the number of rows in the scaled image. |
| 2807 | % |
| 2808 | % o exception: return any errors or warnings in this structure. |
| 2809 | % |
| 2810 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2811 | MagickExport Image *ScaleImage(const Image *image,const size_t columns, |
| 2812 | const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2813 | { |
| 2814 | #define ScaleImageTag "Scale/Image" |
| 2815 | |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2816 | CacheView |
| 2817 | *image_view, |
| 2818 | *scale_view; |
| 2819 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2820 | Image |
| 2821 | *scale_image; |
| 2822 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2823 | MagickBooleanType |
| 2824 | next_column, |
| 2825 | next_row, |
| 2826 | proceed; |
| 2827 | |
| 2828 | MagickPixelPacket |
| 2829 | pixel, |
| 2830 | *scale_scanline, |
| 2831 | *scanline, |
| 2832 | *x_vector, |
| 2833 | *y_vector, |
| 2834 | zero; |
| 2835 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2836 | PointInfo |
| 2837 | scale, |
| 2838 | span; |
| 2839 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2840 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2841 | i; |
| 2842 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2843 | ssize_t |
| 2844 | number_rows, |
| 2845 | y; |
| 2846 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2847 | /* |
| 2848 | Initialize scaled image attributes. |
| 2849 | */ |
| 2850 | assert(image != (const Image *) NULL); |
| 2851 | assert(image->signature == MagickSignature); |
| 2852 | if (image->debug != MagickFalse) |
| 2853 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2854 | assert(exception != (ExceptionInfo *) NULL); |
| 2855 | assert(exception->signature == MagickSignature); |
| 2856 | if ((columns == 0) || (rows == 0)) |
| 2857 | return((Image *) NULL); |
| 2858 | if ((columns == image->columns) && (rows == image->rows)) |
| 2859 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2860 | scale_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2861 | if (scale_image == (Image *) NULL) |
| 2862 | return((Image *) NULL); |
| 2863 | if (SetImageStorageClass(scale_image,DirectClass) == MagickFalse) |
| 2864 | { |
| 2865 | InheritException(exception,&scale_image->exception); |
| 2866 | scale_image=DestroyImage(scale_image); |
| 2867 | return((Image *) NULL); |
| 2868 | } |
| 2869 | /* |
| 2870 | Allocate memory. |
| 2871 | */ |
| 2872 | x_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2873 | sizeof(*x_vector)); |
| 2874 | scanline=x_vector; |
| 2875 | if (image->rows != scale_image->rows) |
| 2876 | scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2877 | sizeof(*scanline)); |
| 2878 | scale_scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) |
| 2879 | scale_image->columns,sizeof(*scale_scanline)); |
| 2880 | y_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2881 | sizeof(*y_vector)); |
| 2882 | if ((scanline == (MagickPixelPacket *) NULL) || |
| 2883 | (scale_scanline == (MagickPixelPacket *) NULL) || |
| 2884 | (x_vector == (MagickPixelPacket *) NULL) || |
| 2885 | (y_vector == (MagickPixelPacket *) NULL)) |
| 2886 | { |
| 2887 | scale_image=DestroyImage(scale_image); |
| 2888 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 2889 | } |
| 2890 | /* |
| 2891 | Scale image. |
| 2892 | */ |
| 2893 | number_rows=0; |
| 2894 | next_row=MagickTrue; |
| 2895 | span.y=1.0; |
| 2896 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 2897 | (void) ResetMagickMemory(y_vector,0,(size_t) image->columns* |
| 2898 | sizeof(*y_vector)); |
| 2899 | GetMagickPixelPacket(image,&pixel); |
| 2900 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2901 | i=0; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2902 | image_view=AcquireCacheView(image); |
| 2903 | scale_view=AcquireCacheView(scale_image); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2904 | for (y=0; y < (ssize_t) scale_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2905 | { |
| 2906 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2907 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2908 | |
| 2909 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2910 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2911 | |
| 2912 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2913 | *restrict scale_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2914 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2915 | register MagickPixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2916 | *restrict s, |
| 2917 | *restrict t; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2918 | |
| 2919 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2920 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2921 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2922 | register ssize_t |
| 2923 | x; |
| 2924 | |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2925 | q=QueueCacheViewAuthenticPixels(scale_view,0,y,scale_image->columns,1, |
| 2926 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2927 | if (q == (PixelPacket *) NULL) |
| 2928 | break; |
| 2929 | scale_indexes=GetAuthenticIndexQueue(scale_image); |
| 2930 | if (scale_image->rows == image->rows) |
| 2931 | { |
| 2932 | /* |
| 2933 | Read a new scanline. |
| 2934 | */ |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2935 | p=GetCacheViewVirtualPixels(image_view,0,i++,image->columns,1, |
| 2936 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2937 | if (p == (const PixelPacket *) NULL) |
| 2938 | break; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2939 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2940 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2941 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2942 | x_vector[x].red=(MagickRealType) GetRedPixelComponent(p); |
| 2943 | x_vector[x].green=(MagickRealType) GetGreenPixelComponent(p); |
| 2944 | x_vector[x].blue=(MagickRealType) GetBluePixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2945 | if (image->matte != MagickFalse) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2946 | x_vector[x].opacity=(MagickRealType) GetOpacityPixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2947 | if (indexes != (IndexPacket *) NULL) |
| 2948 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2949 | p++; |
| 2950 | } |
| 2951 | } |
| 2952 | else |
| 2953 | { |
| 2954 | /* |
| 2955 | Scale Y direction. |
| 2956 | */ |
| 2957 | while (scale.y < span.y) |
| 2958 | { |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2959 | if ((next_row != MagickFalse) && |
| 2960 | (number_rows < (ssize_t) image->rows)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2961 | { |
| 2962 | /* |
| 2963 | Read a new scanline. |
| 2964 | */ |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2965 | p=GetCacheViewVirtualPixels(image_view,0,i++,image->columns,1, |
| 2966 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2967 | if (p == (const PixelPacket *) NULL) |
| 2968 | break; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2969 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2970 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2971 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2972 | x_vector[x].red=(MagickRealType) GetRedPixelComponent(p); |
| 2973 | x_vector[x].green=(MagickRealType) GetGreenPixelComponent(p); |
| 2974 | x_vector[x].blue=(MagickRealType) GetBluePixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2975 | if (image->matte != MagickFalse) |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2976 | x_vector[x].opacity=(MagickRealType) |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2977 | GetOpacityPixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2978 | if (indexes != (IndexPacket *) NULL) |
| 2979 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2980 | p++; |
| 2981 | } |
| 2982 | number_rows++; |
| 2983 | } |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2984 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2985 | { |
| 2986 | y_vector[x].red+=scale.y*x_vector[x].red; |
| 2987 | y_vector[x].green+=scale.y*x_vector[x].green; |
| 2988 | y_vector[x].blue+=scale.y*x_vector[x].blue; |
| 2989 | if (scale_image->matte != MagickFalse) |
| 2990 | y_vector[x].opacity+=scale.y*x_vector[x].opacity; |
| 2991 | if (scale_indexes != (IndexPacket *) NULL) |
| 2992 | y_vector[x].index+=scale.y*x_vector[x].index; |
| 2993 | } |
| 2994 | span.y-=scale.y; |
| 2995 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 2996 | next_row=MagickTrue; |
| 2997 | } |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2998 | if ((next_row != MagickFalse) && (number_rows < (ssize_t) image->rows)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2999 | { |
| 3000 | /* |
| 3001 | Read a new scanline. |
| 3002 | */ |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3003 | p=GetCacheViewVirtualPixels(image_view,0,i++,image->columns,1, |
| 3004 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3005 | if (p == (const PixelPacket *) NULL) |
| 3006 | break; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3007 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3008 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3009 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3010 | x_vector[x].red=(MagickRealType) GetRedPixelComponent(p); |
| 3011 | x_vector[x].green=(MagickRealType) GetGreenPixelComponent(p); |
| 3012 | x_vector[x].blue=(MagickRealType) GetBluePixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3013 | if (image->matte != MagickFalse) |
cristy | 2b726bd | 2010-01-11 01:05:39 +0000 | [diff] [blame] | 3014 | x_vector[x].opacity=(MagickRealType) |
| 3015 | GetOpacityPixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3016 | if (indexes != (IndexPacket *) NULL) |
| 3017 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 3018 | p++; |
| 3019 | } |
| 3020 | number_rows++; |
| 3021 | next_row=MagickFalse; |
| 3022 | } |
| 3023 | s=scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3024 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3025 | { |
| 3026 | pixel.red=y_vector[x].red+span.y*x_vector[x].red; |
| 3027 | pixel.green=y_vector[x].green+span.y*x_vector[x].green; |
| 3028 | pixel.blue=y_vector[x].blue+span.y*x_vector[x].blue; |
| 3029 | if (image->matte != MagickFalse) |
| 3030 | pixel.opacity=y_vector[x].opacity+span.y*x_vector[x].opacity; |
| 3031 | if (scale_indexes != (IndexPacket *) NULL) |
| 3032 | pixel.index=y_vector[x].index+span.y*x_vector[x].index; |
| 3033 | s->red=pixel.red; |
| 3034 | s->green=pixel.green; |
| 3035 | s->blue=pixel.blue; |
| 3036 | if (scale_image->matte != MagickFalse) |
| 3037 | s->opacity=pixel.opacity; |
| 3038 | if (scale_indexes != (IndexPacket *) NULL) |
| 3039 | s->index=pixel.index; |
| 3040 | s++; |
| 3041 | y_vector[x]=zero; |
| 3042 | } |
| 3043 | scale.y-=span.y; |
| 3044 | if (scale.y <= 0) |
| 3045 | { |
| 3046 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 3047 | next_row=MagickTrue; |
| 3048 | } |
| 3049 | span.y=1.0; |
| 3050 | } |
| 3051 | if (scale_image->columns == image->columns) |
| 3052 | { |
| 3053 | /* |
| 3054 | Transfer scanline to scaled image. |
| 3055 | */ |
| 3056 | s=scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3057 | for (x=0; x < (ssize_t) scale_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3058 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3059 | q->red=ClampToQuantum(s->red); |
| 3060 | q->green=ClampToQuantum(s->green); |
| 3061 | q->blue=ClampToQuantum(s->blue); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3062 | if (scale_image->matte != MagickFalse) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3063 | q->opacity=ClampToQuantum(s->opacity); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3064 | if (scale_indexes != (IndexPacket *) NULL) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3065 | scale_indexes[x]=(IndexPacket) ClampToQuantum(s->index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3066 | q++; |
| 3067 | s++; |
| 3068 | } |
| 3069 | } |
| 3070 | else |
| 3071 | { |
| 3072 | /* |
| 3073 | Scale X direction. |
| 3074 | */ |
| 3075 | pixel=zero; |
| 3076 | next_column=MagickFalse; |
| 3077 | span.x=1.0; |
| 3078 | s=scanline; |
| 3079 | t=scale_scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3080 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3081 | { |
| 3082 | scale.x=(double) scale_image->columns/(double) image->columns; |
| 3083 | while (scale.x >= span.x) |
| 3084 | { |
| 3085 | if (next_column != MagickFalse) |
| 3086 | { |
| 3087 | pixel=zero; |
| 3088 | t++; |
| 3089 | } |
| 3090 | pixel.red+=span.x*s->red; |
| 3091 | pixel.green+=span.x*s->green; |
| 3092 | pixel.blue+=span.x*s->blue; |
| 3093 | if (image->matte != MagickFalse) |
| 3094 | pixel.opacity+=span.x*s->opacity; |
| 3095 | if (scale_indexes != (IndexPacket *) NULL) |
| 3096 | pixel.index+=span.x*s->index; |
| 3097 | t->red=pixel.red; |
| 3098 | t->green=pixel.green; |
| 3099 | t->blue=pixel.blue; |
| 3100 | if (scale_image->matte != MagickFalse) |
| 3101 | t->opacity=pixel.opacity; |
| 3102 | if (scale_indexes != (IndexPacket *) NULL) |
| 3103 | t->index=pixel.index; |
| 3104 | scale.x-=span.x; |
| 3105 | span.x=1.0; |
| 3106 | next_column=MagickTrue; |
| 3107 | } |
| 3108 | if (scale.x > 0) |
| 3109 | { |
| 3110 | if (next_column != MagickFalse) |
| 3111 | { |
| 3112 | pixel=zero; |
| 3113 | next_column=MagickFalse; |
| 3114 | t++; |
| 3115 | } |
| 3116 | pixel.red+=scale.x*s->red; |
| 3117 | pixel.green+=scale.x*s->green; |
| 3118 | pixel.blue+=scale.x*s->blue; |
| 3119 | if (scale_image->matte != MagickFalse) |
| 3120 | pixel.opacity+=scale.x*s->opacity; |
| 3121 | if (scale_indexes != (IndexPacket *) NULL) |
| 3122 | pixel.index+=scale.x*s->index; |
| 3123 | span.x-=scale.x; |
| 3124 | } |
| 3125 | s++; |
| 3126 | } |
| 3127 | if (span.x > 0) |
| 3128 | { |
| 3129 | s--; |
| 3130 | pixel.red+=span.x*s->red; |
| 3131 | pixel.green+=span.x*s->green; |
| 3132 | pixel.blue+=span.x*s->blue; |
| 3133 | if (scale_image->matte != MagickFalse) |
| 3134 | pixel.opacity+=span.x*s->opacity; |
| 3135 | if (scale_indexes != (IndexPacket *) NULL) |
| 3136 | pixel.index+=span.x*s->index; |
| 3137 | } |
| 3138 | if ((next_column == MagickFalse) && |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3139 | ((ssize_t) (t-scale_scanline) < (ssize_t) scale_image->columns)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3140 | { |
| 3141 | t->red=pixel.red; |
| 3142 | t->green=pixel.green; |
| 3143 | t->blue=pixel.blue; |
| 3144 | if (scale_image->matte != MagickFalse) |
| 3145 | t->opacity=pixel.opacity; |
| 3146 | if (scale_indexes != (IndexPacket *) NULL) |
| 3147 | t->index=pixel.index; |
| 3148 | } |
| 3149 | /* |
| 3150 | Transfer scanline to scaled image. |
| 3151 | */ |
| 3152 | t=scale_scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3153 | for (x=0; x < (ssize_t) scale_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3154 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3155 | q->red=ClampToQuantum(t->red); |
| 3156 | q->green=ClampToQuantum(t->green); |
| 3157 | q->blue=ClampToQuantum(t->blue); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3158 | if (scale_image->matte != MagickFalse) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3159 | q->opacity=ClampToQuantum(t->opacity); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3160 | if (scale_indexes != (IndexPacket *) NULL) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3161 | scale_indexes[x]=(IndexPacket) ClampToQuantum(t->index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3162 | t++; |
| 3163 | q++; |
| 3164 | } |
| 3165 | } |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3166 | if (SyncCacheViewAuthenticPixels(scale_view,exception) == MagickFalse) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3167 | break; |
cristy | 96b1613 | 2010-08-29 17:19:52 +0000 | [diff] [blame] | 3168 | proceed=SetImageProgress(image,ScaleImageTag,(MagickOffsetType) y, |
| 3169 | image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3170 | if (proceed == MagickFalse) |
| 3171 | break; |
| 3172 | } |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3173 | scale_view=DestroyCacheView(scale_view); |
| 3174 | image_view=DestroyCacheView(image_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3175 | /* |
| 3176 | Free allocated memory. |
| 3177 | */ |
| 3178 | y_vector=(MagickPixelPacket *) RelinquishMagickMemory(y_vector); |
| 3179 | scale_scanline=(MagickPixelPacket *) RelinquishMagickMemory(scale_scanline); |
| 3180 | if (scale_image->rows != image->rows) |
| 3181 | scanline=(MagickPixelPacket *) RelinquishMagickMemory(scanline); |
| 3182 | x_vector=(MagickPixelPacket *) RelinquishMagickMemory(x_vector); |
| 3183 | scale_image->type=image->type; |
| 3184 | return(scale_image); |
| 3185 | } |
| 3186 | |
anthony | 02b4cb4 | 2010-10-10 04:54:35 +0000 | [diff] [blame] | 3187 | #if 0 |
| 3188 | THIS IS NOT USED -- to be removed |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3189 | /* |
| 3190 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3191 | % % |
| 3192 | % % |
| 3193 | % % |
| 3194 | + S e t R e s i z e F i l t e r S u p p o r t % |
| 3195 | % % |
| 3196 | % % |
| 3197 | % % |
| 3198 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3199 | % |
| 3200 | % SetResizeFilterSupport() specifies which IR filter to use to window |
| 3201 | % |
| 3202 | % The format of the SetResizeFilterSupport method is: |
| 3203 | % |
| 3204 | % void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| 3205 | % const MagickRealType support) |
| 3206 | % |
| 3207 | % A description of each parameter follows: |
| 3208 | % |
| 3209 | % o resize_filter: the resize filter. |
| 3210 | % |
| 3211 | % o support: the filter spport radius. |
| 3212 | % |
| 3213 | */ |
| 3214 | MagickExport void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| 3215 | const MagickRealType support) |
| 3216 | { |
| 3217 | assert(resize_filter != (ResizeFilter *) NULL); |
| 3218 | assert(resize_filter->signature == MagickSignature); |
| 3219 | resize_filter->support=support; |
| 3220 | } |
anthony | 02b4cb4 | 2010-10-10 04:54:35 +0000 | [diff] [blame] | 3221 | #endif |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3222 | |
| 3223 | /* |
| 3224 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3225 | % % |
| 3226 | % % |
| 3227 | % % |
| 3228 | % T h u m b n a i l I m a g e % |
| 3229 | % % |
| 3230 | % % |
| 3231 | % % |
| 3232 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3233 | % |
| 3234 | % ThumbnailImage() changes the size of an image to the given dimensions and |
| 3235 | % removes any associated profiles. The goal is to produce small low cost |
| 3236 | % thumbnail images suited for display on the Web. |
| 3237 | % |
| 3238 | % The format of the ThumbnailImage method is: |
| 3239 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3240 | % Image *ThumbnailImage(const Image *image,const size_t columns, |
| 3241 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3242 | % |
| 3243 | % A description of each parameter follows: |
| 3244 | % |
| 3245 | % o image: the image. |
| 3246 | % |
| 3247 | % o columns: the number of columns in the scaled image. |
| 3248 | % |
| 3249 | % o rows: the number of rows in the scaled image. |
| 3250 | % |
| 3251 | % o exception: return any errors or warnings in this structure. |
| 3252 | % |
| 3253 | */ |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 3254 | MagickExport Image *ThumbnailImage(const Image *image,const size_t columns, |
| 3255 | const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3256 | { |
| 3257 | #define SampleFactor 5 |
| 3258 | |
| 3259 | char |
| 3260 | value[MaxTextExtent]; |
| 3261 | |
| 3262 | const char |
| 3263 | *name; |
| 3264 | |
| 3265 | Image |
| 3266 | *thumbnail_image; |
| 3267 | |
| 3268 | MagickRealType |
| 3269 | x_factor, |
| 3270 | y_factor; |
| 3271 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3272 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3273 | version; |
| 3274 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 3275 | struct stat |
| 3276 | attributes; |
| 3277 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3278 | assert(image != (Image *) NULL); |
| 3279 | assert(image->signature == MagickSignature); |
| 3280 | if (image->debug != MagickFalse) |
| 3281 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 3282 | assert(exception != (ExceptionInfo *) NULL); |
| 3283 | assert(exception->signature == MagickSignature); |
| 3284 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| 3285 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| 3286 | if ((x_factor*y_factor) > 0.1) |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 3287 | thumbnail_image=ResizeImage(image,columns,rows,image->filter,image->blur, |
| 3288 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3289 | else |
| 3290 | if (((SampleFactor*columns) < 128) || ((SampleFactor*rows) < 128)) |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 3291 | thumbnail_image=ResizeImage(image,columns,rows,image->filter, |
| 3292 | image->blur,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3293 | else |
| 3294 | { |
| 3295 | Image |
| 3296 | *sample_image; |
| 3297 | |
| 3298 | sample_image=SampleImage(image,SampleFactor*columns,SampleFactor*rows, |
| 3299 | exception); |
| 3300 | if (sample_image == (Image *) NULL) |
| 3301 | return((Image *) NULL); |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 3302 | thumbnail_image=ResizeImage(sample_image,columns,rows,image->filter, |
| 3303 | image->blur,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3304 | sample_image=DestroyImage(sample_image); |
| 3305 | } |
| 3306 | if (thumbnail_image == (Image *) NULL) |
| 3307 | return(thumbnail_image); |
| 3308 | (void) ParseAbsoluteGeometry("0x0+0+0",&thumbnail_image->page); |
| 3309 | if (thumbnail_image->matte == MagickFalse) |
| 3310 | (void) SetImageAlphaChannel(thumbnail_image,OpaqueAlphaChannel); |
| 3311 | thumbnail_image->depth=8; |
| 3312 | thumbnail_image->interlace=NoInterlace; |
| 3313 | /* |
| 3314 | Strip all profiles except color profiles. |
| 3315 | */ |
| 3316 | ResetImageProfileIterator(thumbnail_image); |
| 3317 | for (name=GetNextImageProfile(thumbnail_image); name != (const char *) NULL; ) |
| 3318 | { |
| 3319 | if ((LocaleCompare(name,"icc") != 0) && (LocaleCompare(name,"icm") != 0)) |
| 3320 | { |
cristy | 2b726bd | 2010-01-11 01:05:39 +0000 | [diff] [blame] | 3321 | (void) DeleteImageProfile(thumbnail_image,name); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3322 | ResetImageProfileIterator(thumbnail_image); |
| 3323 | } |
| 3324 | name=GetNextImageProfile(thumbnail_image); |
| 3325 | } |
| 3326 | (void) DeleteImageProperty(thumbnail_image,"comment"); |
| 3327 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
cristy | 7b63d66 | 2009-11-13 01:58:56 +0000 | [diff] [blame] | 3328 | if (strstr(image->magick_filename,"//") == (char *) NULL) |
| 3329 | (void) FormatMagickString(value,MaxTextExtent,"file://%s", |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3330 | image->magick_filename); |
| 3331 | (void) SetImageProperty(thumbnail_image,"Thumb::URI",value); |
| 3332 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
| 3333 | if (GetPathAttributes(image->filename,&attributes) != MagickFalse) |
| 3334 | { |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3335 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3336 | attributes.st_mtime); |
| 3337 | (void) SetImageProperty(thumbnail_image,"Thumb::MTime",value); |
| 3338 | } |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3339 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3340 | attributes.st_mtime); |
cristy | b9080c9 | 2009-12-01 20:13:26 +0000 | [diff] [blame] | 3341 | (void) FormatMagickSize(GetBlobSize(image),MagickFalse,value); |
cristy | 2ce15c9 | 2010-03-12 14:03:41 +0000 | [diff] [blame] | 3342 | (void) ConcatenateMagickString(value,"B",MaxTextExtent); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3343 | (void) SetImageProperty(thumbnail_image,"Thumb::Size",value); |
| 3344 | (void) FormatMagickString(value,MaxTextExtent,"image/%s",image->magick); |
| 3345 | LocaleLower(value); |
| 3346 | (void) SetImageProperty(thumbnail_image,"Thumb::Mimetype",value); |
| 3347 | (void) SetImageProperty(thumbnail_image,"software", |
| 3348 | GetMagickVersion(&version)); |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3349 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
| 3350 | image->magick_columns); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3351 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::Width",value); |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3352 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
cristy | f2faecf | 2010-05-28 19:19:36 +0000 | [diff] [blame] | 3353 | image->magick_rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3354 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::height",value); |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3355 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
| 3356 | GetImageListLength(image)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3357 | (void) SetImageProperty(thumbnail_image,"Thumb::Document::Pages",value); |
| 3358 | return(thumbnail_image); |
| 3359 | } |