cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1 | /* |
| 2 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3 | % % |
| 4 | % % |
| 5 | % % |
| 6 | % RRRR EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| 7 | % R R E SS I ZZ E % |
| 8 | % RRRR EEE SSS I ZZZ EEE % |
| 9 | % R R E SS I ZZ E % |
| 10 | % R R EEEEE SSSSS IIIII ZZZZZ EEEEE % |
| 11 | % % |
| 12 | % % |
| 13 | % MagickCore Image Resize Methods % |
| 14 | % % |
| 15 | % Software Design % |
| 16 | % John Cristy % |
| 17 | % July 1992 % |
| 18 | % % |
| 19 | % % |
cristy | 16af1cb | 2009-12-11 21:38:29 +0000 | [diff] [blame] | 20 | % Copyright 1999-2010 ImageMagick Studio LLC, a non-profit organization % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 21 | % dedicated to making software imaging solutions freely available. % |
| 22 | % % |
| 23 | % You may not use this file except in compliance with the License. You may % |
| 24 | % obtain a copy of the License at % |
| 25 | % % |
| 26 | % http://www.imagemagick.org/script/license.php % |
| 27 | % % |
| 28 | % Unless required by applicable law or agreed to in writing, software % |
| 29 | % distributed under the License is distributed on an "AS IS" BASIS, % |
| 30 | % WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. % |
| 31 | % See the License for the specific language governing permissions and % |
| 32 | % limitations under the License. % |
| 33 | % % |
| 34 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 35 | % |
| 36 | % |
| 37 | */ |
| 38 | |
| 39 | /* |
| 40 | Include declarations. |
| 41 | */ |
| 42 | #include "magick/studio.h" |
| 43 | #include "magick/artifact.h" |
| 44 | #include "magick/blob.h" |
| 45 | #include "magick/cache.h" |
| 46 | #include "magick/cache-view.h" |
| 47 | #include "magick/color.h" |
| 48 | #include "magick/color-private.h" |
| 49 | #include "magick/draw.h" |
| 50 | #include "magick/exception.h" |
| 51 | #include "magick/exception-private.h" |
| 52 | #include "magick/gem.h" |
| 53 | #include "magick/image.h" |
| 54 | #include "magick/image-private.h" |
| 55 | #include "magick/list.h" |
| 56 | #include "magick/memory_.h" |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 57 | #include "magick/magick.h" |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 58 | #include "magick/pixel-private.h" |
| 59 | #include "magick/property.h" |
| 60 | #include "magick/monitor.h" |
| 61 | #include "magick/monitor-private.h" |
| 62 | #include "magick/pixel.h" |
| 63 | #include "magick/option.h" |
| 64 | #include "magick/resample.h" |
cristy | a6a1878 | 2010-11-15 01:56:25 +0000 | [diff] [blame] | 65 | #include "magick/resample-private.h" |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 66 | #include "magick/resize.h" |
| 67 | #include "magick/resize-private.h" |
| 68 | #include "magick/string_.h" |
cristy | f2f2727 | 2009-12-17 14:48:46 +0000 | [diff] [blame] | 69 | #include "magick/string-private.h" |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 70 | #include "magick/thread-private.h" |
| 71 | #include "magick/utility.h" |
| 72 | #include "magick/version.h" |
| 73 | #if defined(MAGICKCORE_LQR_DELEGATE) |
| 74 | #include <lqr.h> |
| 75 | #endif |
| 76 | |
| 77 | /* |
| 78 | Typedef declarations. |
| 79 | */ |
| 80 | struct _ResizeFilter |
| 81 | { |
| 82 | MagickRealType |
| 83 | (*filter)(const MagickRealType,const ResizeFilter *), |
| 84 | (*window)(const MagickRealType,const ResizeFilter *), |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 85 | support, /* filter region of support - the filter support limit */ |
| 86 | window_support, /* window support, usally equal to support (expert only) */ |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 87 | scale, /* dimension scaling to fit window support (usally 1.0) */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 88 | blur, /* x-scale (blur-sharpen) */ |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 89 | coefficient[7]; /* cubic coefficents for BC-cubic spline filters */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 90 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 91 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 92 | signature; |
| 93 | }; |
| 94 | |
| 95 | /* |
| 96 | Forward declaractions. |
| 97 | */ |
| 98 | static MagickRealType |
| 99 | I0(MagickRealType x), |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 100 | BesselOrderOne(MagickRealType), |
anthony | 07a3f7f | 2010-09-16 03:03:11 +0000 | [diff] [blame] | 101 | Sinc(const MagickRealType, const ResizeFilter *), |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 102 | SincFast(const MagickRealType, const ResizeFilter *); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 103 | |
| 104 | /* |
| 105 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 106 | % % |
| 107 | % % |
| 108 | % % |
| 109 | + F i l t e r F u n c t i o n s % |
| 110 | % % |
| 111 | % % |
| 112 | % % |
| 113 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 114 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 115 | % These are the various filter and windowing functions that are provided. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 116 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 117 | % They are internal to this module only. See AcquireResizeFilterInfo() for |
| 118 | % details of the access to these functions, via the GetResizeFilterSupport() |
| 119 | % and GetResizeFilterWeight() API interface. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 120 | % |
| 121 | % The individual filter functions have this format... |
| 122 | % |
| 123 | % static MagickRealtype *FilterName(const MagickRealType x, |
| 124 | % const MagickRealType support) |
| 125 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 126 | % A description of each parameter follows: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 127 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 128 | % o x: the distance from the sampling point generally in the range of 0 to |
| 129 | % support. The GetResizeFilterWeight() ensures this a positive value. |
| 130 | % |
| 131 | % o resize_filter: current filter information. This allows function to |
| 132 | % access support, and possibly other pre-calculated information defining |
| 133 | % the functions. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 134 | % |
| 135 | */ |
| 136 | |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 137 | #define MagickPIL ((MagickRealType) 3.14159265358979323846264338327950288420L) |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 138 | |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 139 | static MagickRealType Jinc(const MagickRealType x, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 140 | const ResizeFilter *magick_unused(resize_filter)) |
| 141 | { |
| 142 | /* |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 143 | See Pratt "Digital Image Processing" p.97 for Jinc/Bessel functions. |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 144 | http://mathworld.wolfram.com/JincFunction.html and page 11 of |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 145 | http://www.ph.ed.ac.uk/%7ewjh/teaching/mo/slides/lens/lens.pdf |
| 146 | |
nicolas | e473f72 | 2010-10-07 00:05:13 +0000 | [diff] [blame] | 147 | The original "zoom" program by Paul Heckbert called this "Bessel". |
| 148 | But really it is more accurately named "Jinc". |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 149 | */ |
| 150 | if (x == 0.0) |
nicolas | 5a36f34 | 2010-10-07 00:11:32 +0000 | [diff] [blame] | 151 | return(0.5*MagickPIL); |
| 152 | return(BesselOrderOne(MagickPIL*x)/x); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 153 | } |
| 154 | |
| 155 | static MagickRealType Blackman(const MagickRealType x, |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 156 | const ResizeFilter *magick_unused(resize_filter)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 157 | { |
| 158 | /* |
cristy | 8301792 | 2010-09-05 20:45:15 +0000 | [diff] [blame] | 159 | Blackman: 2nd order cosine windowing function: |
cristy | 21ce88a | 2010-09-05 01:37:25 +0000 | [diff] [blame] | 160 | 0.42 + 0.5 cos(pi x) + 0.08 cos(2pi x) |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 161 | Refactored by Chantal Racette and Nicolas Robidoux to one trig |
| 162 | call and five flops. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 163 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 164 | const MagickRealType cospix = cos((double) (MagickPIL*x)); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 165 | return(0.34+cospix*(0.5+cospix*0.16)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 166 | } |
| 167 | |
| 168 | static MagickRealType Bohman(const MagickRealType x, |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 169 | const ResizeFilter *magick_unused(resize_filter)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 170 | { |
| 171 | /* |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 172 | Bohman: 2rd Order cosine windowing function: |
| 173 | (1-x) cos(pi x) + sin(pi x) / pi. |
nicolas | a4f7b4a | 2010-09-20 20:28:38 +0000 | [diff] [blame] | 174 | Refactored by Nicolas Robidoux to one trig call, one sqrt call, |
| 175 | and 7 flops, taking advantage of the fact that the support of |
| 176 | Bohman is 1 (so that we know that sin(pi x) >= 0). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 177 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 178 | const double cospix = cos((double) (MagickPIL*x)); |
nicolas | a4f7b4a | 2010-09-20 20:28:38 +0000 | [diff] [blame] | 179 | const double sinpix = sqrt(1.0-cospix*cospix); |
nicolas | 2ffd3b2 | 2010-09-24 20:27:31 +0000 | [diff] [blame] | 180 | return((1.0-x)*cospix+(1.0/MagickPIL)*sinpix); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 181 | } |
| 182 | |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 183 | static MagickRealType Box(const MagickRealType magick_unused(x), |
| 184 | const ResizeFilter *magick_unused(resize_filter)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 185 | { |
| 186 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 187 | A Box filter is a equal weighting function (all weights equal). |
anthony | c331dec | 2010-09-26 01:30:14 +0000 | [diff] [blame] | 188 | DO NOT LIMIT results by support or resize point sampling will work |
| 189 | as it requests points beyond its normal 0.0 support size. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 190 | */ |
anthony | 463be1d | 2010-09-26 01:07:36 +0000 | [diff] [blame] | 191 | return(1.0); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 192 | } |
| 193 | |
| 194 | static MagickRealType CubicBC(const MagickRealType x, |
| 195 | const ResizeFilter *resize_filter) |
| 196 | { |
| 197 | /* |
| 198 | Cubic Filters using B,C determined values: |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame] | 199 | Mitchell-Netravali B= 1/3 C= 1/3 "Balanced" cubic spline filter |
| 200 | Catmull-Rom B= 0 C= 1/2 Interpolatory and exact on linears |
| 201 | Cubic B-Spline B= 1 C= 0 Spline approximation of Gaussian |
| 202 | Hermite B= 0 C= 0 Spline with small support (= 1) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 203 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 204 | See paper by Mitchell and Netravali, Reconstruction Filters in Computer |
| 205 | Graphics Computer Graphics, Volume 22, Number 4, August 1988 |
| 206 | http://www.cs.utexas.edu/users/fussell/courses/cs384g/lectures/mitchell/ |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 207 | Mitchell.pdf. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 208 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 209 | Coefficents are determined from B,C values: |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 210 | P0 = ( 6 - 2*B )/6 = coeff[0] |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 211 | P1 = 0 |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 212 | P2 = (-18 +12*B + 6*C )/6 = coeff[1] |
| 213 | P3 = ( 12 - 9*B - 6*C )/6 = coeff[2] |
| 214 | Q0 = ( 8*B +24*C )/6 = coeff[3] |
| 215 | Q1 = ( -12*B -48*C )/6 = coeff[4] |
| 216 | Q2 = ( 6*B +30*C )/6 = coeff[5] |
| 217 | Q3 = ( - 1*B - 6*C )/6 = coeff[6] |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 218 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 219 | which are used to define the filter: |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 220 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 221 | P0 + P1*x + P2*x^2 + P3*x^3 0 <= x < 1 |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame] | 222 | Q0 + Q1*x + Q2*x^2 + Q3*x^3 1 <= x < 2 |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 223 | |
nicolas | e3b9eca | 2010-10-24 19:48:22 +0000 | [diff] [blame] | 224 | which ensures function is continuous in value and derivative |
nicolas | 89d73f9 | 2010-10-24 20:11:54 +0000 | [diff] [blame] | 225 | (slope). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 226 | */ |
| 227 | if (x < 1.0) |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 228 | return(resize_filter->coefficient[0]+x*(x* |
| 229 | (resize_filter->coefficient[1]+x*resize_filter->coefficient[2]))); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 230 | if (x < 2.0) |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 231 | return(resize_filter->coefficient[3]+x*(resize_filter->coefficient[4]+x* |
| 232 | (resize_filter->coefficient[5]+x*resize_filter->coefficient[6]))); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 233 | return(0.0); |
| 234 | } |
| 235 | |
| 236 | static MagickRealType Gaussian(const MagickRealType x, |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 237 | const ResizeFilter *resize_filter) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 238 | { |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 239 | /* |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 240 | Gaussian with a fixed sigma = 1/2 |
| 241 | |
| 242 | Gaussian Formula... |
| 243 | exp( -(x^2)/((2.0*sigma^2) ) / sqrt(2*PI*sigma^2))) |
| 244 | The constants are pre-calculated... |
| 245 | exp( -coeff[0]*(x^2)) ) * coeff[1] |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 246 | However the multiplier coefficent (1) is not needed and not used. |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 247 | |
| 248 | This separates the gaussian 'sigma' value from the 'blur/support' settings |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 249 | allowing for its use in special 'small sigma' gaussians, without the filter |
| 250 | 'missing' pixels when blurring because the support is too small. |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 251 | */ |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 252 | return(exp((double)(-resize_filter->coefficient[0]*x*x))); |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 253 | } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 254 | |
| 255 | static MagickRealType Hanning(const MagickRealType x, |
| 256 | const ResizeFilter *magick_unused(resize_filter)) |
| 257 | { |
| 258 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 259 | Cosine window function: |
| 260 | .5+.5cos(pi x). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 261 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 262 | const MagickRealType cospix = cos((double) (MagickPIL*x)); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 263 | return(0.5+0.5*cospix); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 264 | } |
| 265 | |
| 266 | static MagickRealType Hamming(const MagickRealType x, |
| 267 | const ResizeFilter *magick_unused(resize_filter)) |
| 268 | { |
| 269 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 270 | Offset cosine window function: |
| 271 | .54 + .46 cos(pi x). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 272 | */ |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 273 | const MagickRealType cospix = cos((double) (MagickPIL*x)); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 274 | return(0.54+0.46*cospix); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 275 | } |
| 276 | |
| 277 | static MagickRealType Kaiser(const MagickRealType x, |
| 278 | const ResizeFilter *magick_unused(resize_filter)) |
| 279 | { |
| 280 | #define Alpha 6.5 |
| 281 | #define I0A (1.0/I0(Alpha)) |
| 282 | |
| 283 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 284 | Kaiser Windowing Function (bessel windowing): Alpha is a free |
| 285 | value from 5 to 8 (currently hardcoded to 6.5). |
| 286 | Future: make alpha the IOA pre-calculation, an 'expert' setting. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 287 | */ |
| 288 | return(I0A*I0(Alpha*sqrt((double) (1.0-x*x)))); |
| 289 | } |
| 290 | |
| 291 | static MagickRealType Lagrange(const MagickRealType x, |
| 292 | const ResizeFilter *resize_filter) |
| 293 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 294 | MagickRealType |
| 295 | value; |
| 296 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 297 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 298 | i; |
| 299 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 300 | ssize_t |
| 301 | n, |
| 302 | order; |
| 303 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 304 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 305 | Lagrange piecewise polynomial fit of sinc: N is the 'order' of the |
| 306 | lagrange function and depends on the overall support window size |
| 307 | of the filter. That is: for a support of 2, it gives a lagrange-4 |
| 308 | (piecewise cubic function). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 309 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 310 | "n" identifies the piece of the piecewise polynomial. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 311 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 312 | See Survey: Interpolation Methods, IEEE Transactions on Medical |
| 313 | Imaging, Vol 18, No 11, November 1999, p1049-1075, -- Equation 27 |
| 314 | on p1064. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 315 | */ |
| 316 | if (x > resize_filter->support) |
| 317 | return(0.0); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 318 | order=(ssize_t) (2.0*resize_filter->window_support); /* number of pieces */ |
anthony | c2d07db | 2010-09-15 23:47:40 +0000 | [diff] [blame] | 319 | /*n=(ssize_t)((1.0*order)/2.0+x); -- which piece does x belong to */ |
| 320 | n = (ssize_t)(resize_filter->window_support + x); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 321 | value=1.0f; |
| 322 | for (i=0; i < order; i++) |
| 323 | if (i != n) |
| 324 | value*=(n-i-x)/(n-i); |
| 325 | return(value); |
| 326 | } |
| 327 | |
| 328 | static MagickRealType Quadratic(const MagickRealType x, |
| 329 | const ResizeFilter *magick_unused(resize_filter)) |
| 330 | { |
| 331 | /* |
| 332 | 2rd order (quadratic) B-Spline approximation of Gaussian. |
| 333 | */ |
| 334 | if (x < 0.5) |
| 335 | return(0.75-x*x); |
| 336 | if (x < 1.5) |
| 337 | return(0.5*(x-1.5)*(x-1.5)); |
| 338 | return(0.0); |
| 339 | } |
| 340 | |
anthony | 07a3f7f | 2010-09-16 03:03:11 +0000 | [diff] [blame] | 341 | static MagickRealType Sinc(const MagickRealType x, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 342 | const ResizeFilter *magick_unused(resize_filter)) |
| 343 | { |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 344 | /* |
nicolas | 4047745 | 2010-09-27 23:42:08 +0000 | [diff] [blame] | 345 | Scaled sinc(x) function using a trig call: |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 346 | sinc(x) == sin(pi x)/(pi x). |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 347 | */ |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 348 | if (x != 0.0) |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 349 | { |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 350 | const MagickRealType pix = (MagickRealType) (MagickPIL*x); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 351 | return(sin((double) pix)/pix); |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 352 | } |
nicolas | 2ffd3b2 | 2010-09-24 20:27:31 +0000 | [diff] [blame] | 353 | return((MagickRealType) 1.0); |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 354 | } |
| 355 | |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 356 | static MagickRealType SincFast(const MagickRealType x, |
anthony | 720660f | 2010-09-07 10:05:14 +0000 | [diff] [blame] | 357 | const ResizeFilter *magick_unused(resize_filter)) |
| 358 | { |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 359 | /* |
| 360 | Approximations of the sinc function sin(pi x)/(pi x) over the |
| 361 | interval [-4,4] constructed by Nicolas Robidoux and Chantal |
| 362 | Racette with funding from the Natural Sciences and Engineering |
| 363 | Research Council of Canada. |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 364 | |
| 365 | Although the approximations are polynomials (for low order of |
| 366 | approximation) and quotients of polynomials (for higher order of |
| 367 | approximation) and consequently are similar in form to Taylor |
| 368 | polynomials/Pade approximants, the approximations are computed |
| 369 | with a completely different technique. |
| 370 | |
| 371 | Summary: These approximations are "the best" in terms of bang |
| 372 | (accuracy) for the buck (flops). More specifically: Among the |
| 373 | polynomial quotients that can be computed using a fixed number of |
| 374 | flops (with a given "+ - * / budget"), the chosen polynomial |
| 375 | quotient is the one closest to the approximated function with |
| 376 | respect to maximum absolute relative error over the given |
| 377 | interval. |
| 378 | |
| 379 | The Remez algorithm, as implemented in the boost library's minimax |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 380 | package, is the key to the construction: |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 381 | http://www.boost.org/doc/libs/1_36_0/libs/math/doc/... |
| 382 | ...sf_and_dist/html/math_toolkit/backgrounders/remez.html |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 383 | */ |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 384 | /* |
| 385 | If outside of the interval of approximation, use the standard trig |
| 386 | formula. |
| 387 | */ |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 388 | if (x > 4.0) |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 389 | { |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 390 | const MagickRealType pix = (MagickRealType) (MagickPIL*x); |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 391 | return(sin((double) pix)/pix); |
| 392 | } |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 393 | { |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 394 | /* |
| 395 | The approximations only depend on x^2 (sinc is an even |
| 396 | function). |
| 397 | */ |
| 398 | const MagickRealType xx = x*x; |
cristy | 8301792 | 2010-09-05 20:45:15 +0000 | [diff] [blame] | 399 | #if MAGICKCORE_QUANTUM_DEPTH <= 8 |
| 400 | /* |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 401 | Maximum absolute relative error 6.3e-6 < 1/2^17. |
cristy | 738e756 | 2010-09-01 12:48:07 +0000 | [diff] [blame] | 402 | */ |
| 403 | const MagickRealType c0 = 0.173610016489197553621906385078711564924e-2L; |
| 404 | const MagickRealType c1 = -0.384186115075660162081071290162149315834e-3L; |
| 405 | const MagickRealType c2 = 0.393684603287860108352720146121813443561e-4L; |
| 406 | const MagickRealType c3 = -0.248947210682259168029030370205389323899e-5L; |
| 407 | const MagickRealType c4 = 0.107791837839662283066379987646635416692e-6L; |
| 408 | const MagickRealType c5 = -0.324874073895735800961260474028013982211e-8L; |
| 409 | const MagickRealType c6 = 0.628155216606695311524920882748052490116e-10L; |
| 410 | const MagickRealType c7 = -0.586110644039348333520104379959307242711e-12L; |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 411 | const MagickRealType p = |
| 412 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*c7)))))); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 413 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)*p); |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 414 | #elif MAGICKCORE_QUANTUM_DEPTH <= 16 |
cristy | dbeb3eb | 2010-09-09 13:41:36 +0000 | [diff] [blame] | 415 | /* |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 416 | Max. abs. rel. error 2.2e-8 < 1/2^25. |
cristy | dbeb3eb | 2010-09-09 13:41:36 +0000 | [diff] [blame] | 417 | */ |
| 418 | const MagickRealType c0 = 0.173611107357320220183368594093166520811e-2L; |
| 419 | const MagickRealType c1 = -0.384240921114946632192116762889211361285e-3L; |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 420 | const MagickRealType c2 = 0.394201182359318128221229891724947048771e-4L; |
| 421 | const MagickRealType c3 = -0.250963301609117217660068889165550534856e-5L; |
| 422 | const MagickRealType c4 = 0.111902032818095784414237782071368805120e-6L; |
| 423 | const MagickRealType c5 = -0.372895101408779549368465614321137048875e-8L; |
| 424 | const MagickRealType c6 = 0.957694196677572570319816780188718518330e-10L; |
cristy | dbeb3eb | 2010-09-09 13:41:36 +0000 | [diff] [blame] | 425 | const MagickRealType c7 = -0.187208577776590710853865174371617338991e-11L; |
| 426 | const MagickRealType c8 = 0.253524321426864752676094495396308636823e-13L; |
| 427 | const MagickRealType c9 = -0.177084805010701112639035485248501049364e-15L; |
anthony | 853d697 | 2010-10-08 06:01:31 +0000 | [diff] [blame] | 428 | const MagickRealType p = |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 429 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*(c7+xx*(c8+xx*c9)))))))); |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 430 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)*p); |
nicolas | c2d28f0 | 2010-09-27 18:56:15 +0000 | [diff] [blame] | 431 | #else |
nicolas | 3aab40c | 2010-09-19 21:14:15 +0000 | [diff] [blame] | 432 | /* |
| 433 | Max. abs. rel. error 1.2e-12 < 1/2^39. |
| 434 | */ |
| 435 | const MagickRealType c0 = 0.173611111110910715186413700076827593074e-2L; |
| 436 | const MagickRealType c1 = -0.289105544717893415815859968653611245425e-3L; |
| 437 | const MagickRealType c2 = 0.206952161241815727624413291940849294025e-4L; |
| 438 | const MagickRealType c3 = -0.834446180169727178193268528095341741698e-6L; |
| 439 | const MagickRealType c4 = 0.207010104171026718629622453275917944941e-7L; |
| 440 | const MagickRealType c5 = -0.319724784938507108101517564300855542655e-9L; |
| 441 | const MagickRealType c6 = 0.288101675249103266147006509214934493930e-11L; |
| 442 | const MagickRealType c7 = -0.118218971804934245819960233886876537953e-13L; |
| 443 | const MagickRealType p = |
| 444 | c0+xx*(c1+xx*(c2+xx*(c3+xx*(c4+xx*(c5+xx*(c6+xx*c7)))))); |
| 445 | const MagickRealType d0 = 1.0L; |
| 446 | const MagickRealType d1 = 0.547981619622284827495856984100563583948e-1L; |
| 447 | const MagickRealType d2 = 0.134226268835357312626304688047086921806e-2L; |
| 448 | const MagickRealType d3 = 0.178994697503371051002463656833597608689e-4L; |
| 449 | const MagickRealType d4 = 0.114633394140438168641246022557689759090e-6L; |
| 450 | const MagickRealType q = d0+xx*(d1+xx*(d2+xx*(d3+xx*d4))); |
| 451 | return((xx-1.0)*(xx-4.0)*(xx-9.0)*(xx-16.0)/q*p); |
cristy | 657c635 | 2010-08-29 14:05:08 +0000 | [diff] [blame] | 452 | #endif |
cristy | 8301792 | 2010-09-05 20:45:15 +0000 | [diff] [blame] | 453 | } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 454 | } |
| 455 | |
| 456 | static MagickRealType Triangle(const MagickRealType x, |
| 457 | const ResizeFilter *magick_unused(resize_filter)) |
| 458 | { |
| 459 | /* |
nicolas | 0edb086 | 2010-09-19 18:56:19 +0000 | [diff] [blame] | 460 | 1st order (linear) B-Spline, bilinear interpolation, Tent 1D |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 461 | filter, or a Bartlett 2D Cone filter. Also used as a |
| 462 | Bartlett Windowing function for Sinc(). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 463 | */ |
| 464 | if (x < 1.0) |
| 465 | return(1.0-x); |
| 466 | return(0.0); |
| 467 | } |
| 468 | |
| 469 | static MagickRealType Welsh(const MagickRealType x, |
| 470 | const ResizeFilter *magick_unused(resize_filter)) |
| 471 | { |
| 472 | /* |
| 473 | Welsh parabolic windowing filter. |
| 474 | */ |
cristy | 560d818 | 2010-09-08 22:36:25 +0000 | [diff] [blame] | 475 | if (x < 1.0) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 476 | return(1.0-x*x); |
| 477 | return(0.0); |
| 478 | } |
| 479 | |
| 480 | /* |
| 481 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 482 | % % |
| 483 | % % |
| 484 | % % |
| 485 | + A c q u i r e R e s i z e F i l t e r % |
| 486 | % % |
| 487 | % % |
| 488 | % % |
| 489 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 490 | % |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 491 | % AcquireResizeFilter() allocates the ResizeFilter structure. Choose |
| 492 | % from these filters: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 493 | % |
| 494 | % FIR (Finite impulse Response) Filters |
| 495 | % Box Triangle Quadratic |
| 496 | % Cubic Hermite Catrom |
| 497 | % Mitchell |
| 498 | % |
| 499 | % IIR (Infinite impulse Response) Filters |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 500 | % Gaussian Sinc Jinc (Bessel) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 501 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 502 | % Windowed Sinc/Jinc Filters |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 503 | % Blackman Hanning Hamming |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 504 | % Kaiser Lanczos |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 505 | % |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 506 | % Special purpose Filters |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 507 | % SincFast LanczosSharp Lanczos2D Lanczos2DSharp Robidoux |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 508 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 509 | % The users "-filter" selection is used to lookup the default 'expert' |
| 510 | % settings for that filter from a internal table. However any provided |
| 511 | % 'expert' settings (see below) may override this selection. |
| 512 | % |
| 513 | % FIR filters are used as is, and are limited to that filters support |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 514 | % window (unless over-ridden). 'Gaussian' while classed as an IIR |
anthony | c331dec | 2010-09-26 01:30:14 +0000 | [diff] [blame] | 515 | % filter, is also simply clipped by its support size (currently 1.5 |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 516 | % or approximatally 3*sigma as recommended by many references) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 517 | % |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 518 | % The special a 'cylindrical' filter flag will promote the default |
| 519 | % 4-lobed Windowed Sinc filter to a 3-lobed Windowed Jinc equivelent, |
| 520 | % which is better suited to this style of image resampling. This |
| 521 | % typically happens when using such a filter for images distortions. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 522 | % |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 523 | % Directly requesting 'Sinc', 'Jinc' function as a filter will force |
| 524 | % the use of function without any windowing, or promotion for |
| 525 | % cylindrical usage. This is not recommended, except by image |
| 526 | % processing experts, especially as part of expert option filter |
| 527 | % function selection. |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 528 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 529 | % Two forms of the 'Sinc' function are available: Sinc and SincFast. |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 530 | % Sinc is computed using the traditional sin(pi*x)/(pi*x); it is |
| 531 | % selected if the user specifically specifies the use of a Sinc |
| 532 | % filter. SincFast uses highly accurate (and fast) polynomial (low Q) |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 533 | % and rational (high Q) approximations, and will be used by default in |
| 534 | % most cases. |
anthony | ba5a7c3 | 2010-09-15 02:42:25 +0000 | [diff] [blame] | 535 | % |
nicolas | fc61294 | 2010-11-14 17:23:29 +0000 | [diff] [blame] | 536 | % The Lanczos filter is a special 3-lobed Sinc-windowed Sinc filter |
| 537 | % (promoted to Jinc-windowed Jinc for cylindrical (Elliptical |
| 538 | % Weighted Average) use). The Sinc version is the most popular |
| 539 | % windowed filter. |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 540 | % |
nicolas | fc61294 | 2010-11-14 17:23:29 +0000 | [diff] [blame] | 541 | % LanczosSharp is a slightly sharpened (blur=0.9812505644269356 < 1) |
nicolas | 2ab6510 | 2010-11-15 06:03:11 +0000 | [diff] [blame] | 542 | % form of the Lanczos filter, specifically designed for EWA |
| 543 | % distortion (as a Jinc-Jinc); it can also be used as a slightly |
| 544 | % sharper orthogonal Lanczos (Sinc-Sinc) filter. The chosen blur |
| 545 | % value comes as close as possible to satisfying the following |
| 546 | % condition without changing the character of the corresponding EWA |
| 547 | % filter: |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 548 | % |
| 549 | % 'No-Op' Vertical and Horizontal Line Preservation Condition: |
| 550 | % Images with only vertical or horizontal features are preserved |
| 551 | % when performing 'no-op" with EWA distortion. |
| 552 | % |
nicolas | 2d3579a | 2010-11-13 15:31:28 +0000 | [diff] [blame] | 553 | % The Lanczos2 and Lanczos2Sharp filters are 2-lobe versions of the |
| 554 | % Lanczos filters. The 'sharp' version uses a blur factor of |
nicolas | ca48bce | 2010-11-14 17:54:53 +0000 | [diff] [blame] | 555 | % 0.9549963639785485, again chosen because the resulting EWA filter |
nicolas | c22cc71 | 2010-11-13 16:39:10 +0000 | [diff] [blame] | 556 | % comes as close as possible to satisfying the above |
nicolas | ca48bce | 2010-11-14 17:54:53 +0000 | [diff] [blame] | 557 | % condition. |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 558 | % |
nicolas | b7dff64 | 2010-10-25 02:04:14 +0000 | [diff] [blame] | 559 | % Robidoux is another filter tuned for EWA. It is the Keys cubic |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 560 | % filter defined by B=(228 - 108 sqrt(2))/199. Robidoux satisfies the |
nicolas | b7dff64 | 2010-10-25 02:04:14 +0000 | [diff] [blame] | 561 | % "'No-Op' Vertical and Horizontal Line Preservation Condition" |
nicolas | c22cc71 | 2010-11-13 16:39:10 +0000 | [diff] [blame] | 562 | % exactly, and it moderately blurs high frequency 'pixel-hash' |
| 563 | % patterns under no-op. It turns out to be close to both Mitchell |
| 564 | % and Lanczos2Sharp. For example, its first crossing is at (36 |
| 565 | % sqrt(2) + 123)/(72 sqrt(2) + 47), almost the same as the first |
| 566 | % crossing of Mitchell and Lanczos2Sharp. |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 567 | % |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 568 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 569 | % 'EXPERT' OPTIONS: |
nicolas | ce6dc29 | 2010-10-22 16:23:07 +0000 | [diff] [blame] | 570 | % |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 571 | % These artifact "defines" are not recommended for production use |
| 572 | % without expert knowledge of resampling, filtering, and the effects |
| 573 | % they have on the resulting resampled (resize ro distorted) image. |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 574 | % |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 575 | % They can be used to override any and all filter default, and it is |
| 576 | % recommended you make good use of "filter:verbose" to make sure that |
| 577 | % the overall effect of your selection (before and after) is as |
| 578 | % expected. |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 579 | % |
anthony | 28ad1d7 | 2010-10-26 06:30:24 +0000 | [diff] [blame] | 580 | % "filter:verbose" controls whether to output the exact results of |
| 581 | % the filter selections made, as well as plotting data for |
| 582 | % graphing the resulting filter over the filters support range. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 583 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 584 | % "filter:filter" Select the main function associated with |
| 585 | % this filter name, as the weighting function of the filter. |
| 586 | % This can be used to set a windowing function as a weighting |
| 587 | % function, for special purposes, such as graphing. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 588 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 589 | % If a "filter:window" operation has not been provided, then a |
| 590 | % 'Box' windowing function will be set to denote that no |
| 591 | % windowing function is being used. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 592 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 593 | % "filter:window" Select this windowing function for the filter. |
| 594 | % While any filter could be used as a windowing function, using |
| 595 | % the 'first lobe' of that filter over the whole support |
| 596 | % window, using a non-windowing function is not advisible. If |
| 597 | % no weighting filter function is specifed a 'SincFast' filter |
| 598 | % will be used. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 599 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 600 | % "filter:lobes" Number of lobes to use for the Sinc/Jinc filter. |
| 601 | % This a simpler method of setting filter support size that |
| 602 | % will correctly handle the Sinc/Jinc switch for an operators |
| 603 | % filtering requirements. Only integers should be given. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 604 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 605 | % "filter:support" Set the support size for filtering to the size |
| 606 | % given This not recommended for Sinc/Jinc windowed filters |
| 607 | % (lobes should be used instead). This will override any |
| 608 | % 'filter:lobes' option. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 609 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 610 | % "filter:win-support" Scale windowing function to this size |
| 611 | % instead. This causes the windowing (or self-windowing |
| 612 | % Lagrange filter) to act is if the support window it much much |
| 613 | % larger than what is actually supplied to the calling |
| 614 | % operator. The filter however is still clipped to the real |
| 615 | % support size given, by the support range suppiled to the |
| 616 | % caller. If unset this will equal the normal filter support |
anthony | b6d08c5 | 2010-09-13 01:17:04 +0000 | [diff] [blame] | 617 | % size. |
| 618 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 619 | % "filter:blur" Scale the filter and support window by this amount. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 620 | % A value >1 will generally result in a more burred image with |
| 621 | % more ringing effects, while a value <1 will sharpen the |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 622 | % resulting image with more aliasing effects. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 623 | % |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 624 | % "filter:sigma" The sigma value to use for the Gaussian filter |
| 625 | % only. Defaults to '1/2' for orthogonal and 'sqrt(2)/2' for |
| 626 | % cylindrical usage. It effectially provides a alturnative to |
| 627 | % 'blur' for Gaussians without it also effecting the final |
| 628 | % 'practical support' size. |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 629 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 630 | % "filter:b" |
nicolas | 3061b8a | 2010-10-22 16:34:52 +0000 | [diff] [blame] | 631 | % "filter:c" Override the preset B,C values for a Cubic type of |
| 632 | % filter If only one of these are given it is assumes to be a |
| 633 | % 'Keys' type of filter such that B+2C=1, where Keys 'alpha' |
| 634 | % value = C |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 635 | % |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 636 | % Examples: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 637 | % |
nicolas | 6e1267a | 2010-10-22 16:35:52 +0000 | [diff] [blame] | 638 | % Set a true un-windowed Sinc filter with 10 lobes (very slow): |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 639 | % -define filter:filter=Sinc |
| 640 | % -define filter:lobes=8 |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 641 | % |
nicolas | 6e1267a | 2010-10-22 16:35:52 +0000 | [diff] [blame] | 642 | % Set an 8 lobe Lanczos (Sinc or Jinc) filter: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 643 | % -filter Lanczos |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 644 | % -define filter:lobes=8 |
anthony | 7bdc0ed | 2010-09-15 01:52:32 +0000 | [diff] [blame] | 645 | % |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 646 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 647 | % The format of the AcquireResizeFilter method is: |
| 648 | % |
| 649 | % ResizeFilter *AcquireResizeFilter(const Image *image, |
| 650 | % const FilterTypes filter_type, const MagickBooleanType radial, |
| 651 | % ExceptionInfo *exception) |
| 652 | % |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 653 | % A description of each parameter follows: |
| 654 | % |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 655 | % o image: the image. |
| 656 | % |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 657 | % o filter: the filter type, defining a preset filter, window and |
| 658 | % support. The artifact settings listed above will override |
| 659 | % those selections. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 660 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 661 | % o blur: blur the filter by this amount, use 1.0 if unknown. Image |
| 662 | % artifact "filter:blur" will override this API call usage, including |
| 663 | % any internal change (such as for cylindrical usage). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 664 | % |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 665 | % o radial: use a 1D orthogonal filter (Sinc) or 2D cylindrical |
| 666 | % (radial) filter (Jinc) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 667 | % |
| 668 | % o exception: return any errors or warnings in this structure. |
| 669 | % |
| 670 | */ |
| 671 | MagickExport ResizeFilter *AcquireResizeFilter(const Image *image, |
cristy | f59a892 | 2010-02-28 19:51:23 +0000 | [diff] [blame] | 672 | const FilterTypes filter,const MagickRealType blur, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 673 | const MagickBooleanType cylindrical,ExceptionInfo *exception) |
| 674 | { |
| 675 | const char |
| 676 | *artifact; |
| 677 | |
| 678 | FilterTypes |
| 679 | filter_type, |
| 680 | window_type; |
| 681 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 682 | MagickRealType |
| 683 | B, |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 684 | C, |
| 685 | sigma; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 686 | |
| 687 | register ResizeFilter |
| 688 | *resize_filter; |
| 689 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 690 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 691 | /* |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 692 | Table Mapping given Filter, into Weighting and Windowing functions. |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 693 | A 'Box' windowing function means its a simble non-windowed filter. |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 694 | An 'SincFast' filter function could be upgraded to a 'Jinc' filter |
| 695 | if a "cylindrical", unless a 'Sinc' or 'SincFast' filter was |
| 696 | specifically requested. |
anthony | 449887b | 2010-09-10 02:23:33 +0000 | [diff] [blame] | 697 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 698 | WARNING: The order of this tabel must match the order of the |
| 699 | FilterTypes enumeration specified in "resample.h", or the filter |
| 700 | names will not match the filter being setup. |
anthony | 1e2d5ca | 2010-09-10 02:24:35 +0000 | [diff] [blame] | 701 | |
| 702 | You can check filter setups with the "filter:verbose" setting. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 703 | */ |
| 704 | static struct |
| 705 | { |
| 706 | FilterTypes |
| 707 | filter, |
| 708 | window; |
| 709 | } const mapping[SentinelFilter] = |
| 710 | { |
nicolas | b7dff64 | 2010-10-25 02:04:14 +0000 | [diff] [blame] | 711 | { UndefinedFilter, BoxFilter }, /* Undefined (default to Box) */ |
| 712 | { PointFilter, BoxFilter }, /* SPECIAL: Nearest neighbour */ |
| 713 | { BoxFilter, BoxFilter }, /* Box averaging filter */ |
| 714 | { TriangleFilter, BoxFilter }, /* Linear interpolation filter */ |
| 715 | { HermiteFilter, BoxFilter }, /* Hermite interpolation filter */ |
| 716 | { SincFastFilter, HanningFilter }, /* Hanning -- cosine-sinc */ |
| 717 | { SincFastFilter, HammingFilter }, /* Hamming -- '' variation */ |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 718 | { SincFastFilter, BlackmanFilter }, /* Blackman -- 2*cosine-sinc */ |
nicolas | b7dff64 | 2010-10-25 02:04:14 +0000 | [diff] [blame] | 719 | { GaussianFilter, BoxFilter }, /* Gaussian blur filter */ |
| 720 | { QuadraticFilter, BoxFilter }, /* Quadratic Gaussian approx */ |
| 721 | { CubicFilter, BoxFilter }, /* Cubic B-Spline */ |
| 722 | { CatromFilter, BoxFilter }, /* Cubic-Keys interpolator */ |
| 723 | { MitchellFilter, BoxFilter }, /* 'Ideal' Cubic-Keys filter */ |
nicolas | b7dff64 | 2010-10-25 02:04:14 +0000 | [diff] [blame] | 724 | { JincFilter, BoxFilter }, /* Raw 3-lobed Jinc function */ |
| 725 | { SincFilter, BoxFilter }, /* Raw 4-lobed Sinc function */ |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 726 | { SincFastFilter, BoxFilter }, /* Raw fast sinc ("Pade"-type) */ |
nicolas | b7dff64 | 2010-10-25 02:04:14 +0000 | [diff] [blame] | 727 | { SincFastFilter, KaiserFilter }, /* Kaiser -- square root-sinc */ |
| 728 | { SincFastFilter, WelshFilter }, /* Welsh -- parabolic-sinc */ |
| 729 | { SincFastFilter, CubicFilter }, /* Parzen -- cubic-sinc */ |
nicolas | b7dff64 | 2010-10-25 02:04:14 +0000 | [diff] [blame] | 730 | { SincFastFilter, BohmanFilter }, /* Bohman -- 2*cosine-sinc */ |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 731 | { SincFastFilter, TriangleFilter }, /* Bartlett -- triangle-sinc */ |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 732 | { LagrangeFilter, BoxFilter }, /* Lagrange self-windowing */ |
| 733 | { LanczosFilter, LanczosFilter }, /* Lanczos Sinc-Sinc filters */ |
| 734 | { LanczosSharpFilter, LanczosSharpFilter }, /* | these require */ |
| 735 | { Lanczos2Filter, Lanczos2Filter }, /* | special handling */ |
| 736 | { Lanczos2SharpFilter,Lanczos2SharpFilter }, |
| 737 | { RobidouxFilter, BoxFilter }, /* Cubic Keys tuned for EWA */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 738 | }; |
| 739 | /* |
nicolas | 32f44eb | 2010-09-20 01:23:12 +0000 | [diff] [blame] | 740 | Table mapping the filter/window from the above table to an actual |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 741 | function. The default support size for that filter as a weighting |
| 742 | function, the range to scale with to use that function as a sinc |
| 743 | windowing function, (typ 1.0). |
anthony | 933b4bf | 2010-09-10 02:31:37 +0000 | [diff] [blame] | 744 | |
anthony | 07a3f7f | 2010-09-16 03:03:11 +0000 | [diff] [blame] | 745 | Note that the filter_type -> function is 1 to 1 except for Sinc(), |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 746 | SincFast(), and CubicBC() functions, which may have multiple |
| 747 | filter to function associations. |
| 748 | |
| 749 | See "filter:verbose" handling below for the function -> filter |
| 750 | mapping. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 751 | */ |
| 752 | static struct |
| 753 | { |
| 754 | MagickRealType |
| 755 | (*function)(const MagickRealType, const ResizeFilter*), |
nicolas | 8eccc16 | 2010-10-16 19:48:13 +0000 | [diff] [blame] | 756 | lobes, /* Default lobes/support size of the weighting filter. */ |
anthony | 450db50 | 2010-10-19 04:03:03 +0000 | [diff] [blame] | 757 | scale, /* Support when function used as a windowing function |
| 758 | Typically equal to the location of the first zero crossing. */ |
| 759 | B,C; /* BC-spline coefficients, ignored if not a CubicBC filter. */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 760 | } const filters[SentinelFilter] = |
| 761 | { |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 762 | { Box, 0.5, 0.5, 0.0, 0.0 }, /* Undefined (default to Box) */ |
| 763 | { Box, 0.0, 0.5, 0.0, 0.0 }, /* Point (special handling) */ |
| 764 | { Box, 0.5, 0.5, 0.0, 0.0 }, /* Box */ |
| 765 | { Triangle, 1.0, 1.0, 0.0, 0.0 }, /* Triangle */ |
| 766 | { CubicBC, 1.0, 1.0, 0.0, 0.0 }, /* Hermite (cubic B=C=0) */ |
| 767 | { Hanning, 1.0, 1.0, 0.0, 0.0 }, /* Hanning, cosine window */ |
| 768 | { Hamming, 1.0, 1.0, 0.0, 0.0 }, /* Hamming, '' variation */ |
| 769 | { Blackman, 1.0, 1.0, 0.0, 0.0 }, /* Blackman, 2*cosine window */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 770 | { Gaussian, 2.0, 1.5, 0.0, 0.0 }, /* Gaussian */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 771 | { Quadratic, 1.5, 1.5, 0.0, 0.0 }, /* Quadratic gaussian */ |
| 772 | { CubicBC, 2.0, 2.0, 1.0, 0.0 }, /* Cubic B-Spline (B=1,C=0) */ |
| 773 | { CubicBC, 2.0, 1.0, 0.0, 0.5 }, /* Catmull-Rom (B=0,C=1/2) */ |
nicolas | d349be6 | 2010-10-28 18:57:38 +0000 | [diff] [blame] | 774 | { CubicBC, 2.0, 8.0/7.0, 1./3., 1./3. }, /* Mitchell (B=C=1/3) */ |
nicolas | f8689f4 | 2010-10-18 16:14:08 +0000 | [diff] [blame] | 775 | { Jinc, 3.0, 1.2196698912665045, 0.0, 0.0 }, /* Raw 3-lobed Jinc */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 776 | { Sinc, 4.0, 1.0, 0.0, 0.0 }, /* Raw 4-lobed Sinc */ |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 777 | { SincFast, 4.0, 1.0, 0.0, 0.0 }, /* Raw fast sinc ("Pade"-type) */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 778 | { Kaiser, 1.0, 1.0, 0.0, 0.0 }, /* Kaiser (square root window) */ |
| 779 | { Welsh, 1.0, 1.0, 0.0, 0.0 }, /* Welsh (parabolic window) */ |
| 780 | { CubicBC, 2.0, 2.0, 1.0, 0.0 }, /* Parzen (B-Spline window) */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 781 | { Bohman, 1.0, 1.0, 0.0, 0.0 }, /* Bohman, 2*Cosine window */ |
| 782 | { Triangle, 1.0, 1.0, 0.0, 0.0 }, /* Bartlett (triangle window) */ |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 783 | { Lagrange, 2.0, 1.0, 0.0, 0.0 }, /* Lagrange sinc approximation */ |
| 784 | { SincFast, 3.0, 1.0, 0.0, 0.0 }, /* Lanczos, 3-lobed Sinc-Sinc */ |
| 785 | { SincFast, 3.0, 1.0, 0.0, 0.0 }, /* lanczos, Sharpened */ |
| 786 | { SincFast, 2.0, 1.0, 0.0, 0.0 }, /* Lanczos, 2-lobed */ |
| 787 | { SincFast, 2.0, 1.0, 0.0, 0.0 }, /* Lanczos2, sharpened */ |
anthony | 450db50 | 2010-10-19 04:03:03 +0000 | [diff] [blame] | 788 | { CubicBC, 2.0, 1.1685777620836932, |
nicolas | 0d5e532 | 2010-10-22 15:29:30 +0000 | [diff] [blame] | 789 | 0.37821575509399867, 0.31089212245300067 } |
| 790 | /* Robidoux: Keys cubic close to Lanczos2D sharpened */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 791 | }; |
| 792 | /* |
anthony | 9a98fc6 | 2010-10-11 02:47:19 +0000 | [diff] [blame] | 793 | The known zero crossings of the Jinc() or more accurately the Jinc(x*PI) |
anthony | 450db50 | 2010-10-19 04:03:03 +0000 | [diff] [blame] | 794 | function being used as a filter. It is used by the "filter:lobes" expert |
| 795 | setting and for 'lobes' for Jinc functions in the previous table. This |
| 796 | way users do not have to deal with the highly irrational lobe sizes of the |
anthony | 9a98fc6 | 2010-10-11 02:47:19 +0000 | [diff] [blame] | 797 | Jinc filter. |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 798 | |
nicolas | e473f72 | 2010-10-07 00:05:13 +0000 | [diff] [blame] | 799 | Values taken from |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 800 | http://cose.math.bas.bg/webMathematica/webComputing/BesselZeros.jsp |
nicolas | e473f72 | 2010-10-07 00:05:13 +0000 | [diff] [blame] | 801 | using Jv-function with v=1, then dividing by PI. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 802 | */ |
| 803 | static MagickRealType |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 804 | jinc_zeros[16] = |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 805 | { |
nicolas | 8eccc16 | 2010-10-16 19:48:13 +0000 | [diff] [blame] | 806 | 1.2196698912665045, |
| 807 | 2.2331305943815286, |
| 808 | 3.2383154841662362, |
| 809 | 4.2410628637960699, |
| 810 | 5.2427643768701817, |
| 811 | 6.2439216898644877, |
| 812 | 7.244759868719957, |
| 813 | 8.2453949139520427, |
| 814 | 9.2458926849494673, |
| 815 | 10.246293348754916, |
| 816 | 11.246622794877883, |
| 817 | 12.246898461138105, |
| 818 | 13.247132522181061, |
| 819 | 14.247333735806849, |
anthony | c2d07db | 2010-09-15 23:47:40 +0000 | [diff] [blame] | 820 | 15.2475085630373, |
nicolas | 8eccc16 | 2010-10-16 19:48:13 +0000 | [diff] [blame] | 821 | 16.247661874700962 |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 822 | }; |
| 823 | |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 824 | /* |
| 825 | Allocate resize filter. |
| 826 | */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 827 | assert(image != (const Image *) NULL); |
| 828 | assert(image->signature == MagickSignature); |
| 829 | if (image->debug != MagickFalse) |
| 830 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 831 | assert(UndefinedFilter < filter && filter < SentinelFilter); |
| 832 | assert(exception != (ExceptionInfo *) NULL); |
| 833 | assert(exception->signature == MagickSignature); |
cristy | 73bd4a5 | 2010-10-05 11:24:23 +0000 | [diff] [blame] | 834 | resize_filter=(ResizeFilter *) AcquireMagickMemory(sizeof(*resize_filter)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 835 | if (resize_filter == (ResizeFilter *) NULL) |
| 836 | ThrowFatalException(ResourceLimitFatalError,"MemoryAllocationFailed"); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 837 | /* |
| 838 | Defaults for the requested filter. |
| 839 | */ |
| 840 | filter_type=mapping[filter].filter; |
| 841 | window_type=mapping[filter].window; |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 842 | resize_filter->blur = blur; |
| 843 | sigma = 0.5; |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 844 | /* Promote 1D Windowed Sinc Filters to a 2D Windowed Jinc filters */ |
| 845 | if (cylindrical != MagickFalse && filter_type == SincFastFilter |
| 846 | && filter != SincFastFilter ) |
| 847 | filter_type=JincFilter; |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 848 | |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 849 | /* Expert filter setting override */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 850 | artifact=GetImageArtifact(image,"filter:filter"); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 851 | if (artifact != (const char *) NULL) |
| 852 | { |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 853 | ssize_t |
| 854 | option; |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 855 | option=ParseMagickOption(MagickFilterOptions,MagickFalse,artifact); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 856 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 857 | { /* Raw filter request - no window function. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 858 | filter_type=(FilterTypes) option; |
| 859 | window_type=BoxFilter; |
| 860 | } |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 861 | /* Filter override with a specific window function. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 862 | artifact=GetImageArtifact(image,"filter:window"); |
| 863 | if (artifact != (const char *) NULL) |
| 864 | { |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 865 | option=ParseMagickOption(MagickFilterOptions,MagickFalse,artifact); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 866 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 867 | window_type=(FilterTypes) option; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 868 | } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 869 | } |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 870 | else |
| 871 | { |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 872 | /* Window specified, but no filter function? Assume Sinc/Jinc. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 873 | artifact=GetImageArtifact(image,"filter:window"); |
| 874 | if (artifact != (const char *) NULL) |
| 875 | { |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 876 | ssize_t |
| 877 | option; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 878 | option=ParseMagickOption(MagickFilterOptions,MagickFalse, |
| 879 | artifact); |
| 880 | if ((UndefinedFilter < option) && (option < SentinelFilter)) |
| 881 | { |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 882 | filter_type=cylindrical != MagickFalse ? |
| 883 | JincFilter : SincFastFilter; |
cristy | 19eb641 | 2010-04-23 14:42:29 +0000 | [diff] [blame] | 884 | window_type=(FilterTypes) option; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 885 | } |
| 886 | } |
| 887 | } |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 888 | |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 889 | /* Assign the real functions to use for the filters selected. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 890 | resize_filter->filter=filters[filter_type].function; |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 891 | resize_filter->support=filters[filter_type].lobes; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 892 | resize_filter->window=filters[window_type].function; |
| 893 | resize_filter->scale=filters[window_type].scale; |
anthony | 029ba0e | 2010-10-29 00:54:24 +0000 | [diff] [blame] | 894 | resize_filter->signature=MagickSignature; |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 895 | |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 896 | /* Filter Modifications for orthogonal/cylindrical usage */ |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 897 | if (cylindrical != MagickFalse) |
| 898 | switch (filter_type) |
| 899 | { |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 900 | case BoxFilter: |
| 901 | /* Support for Cylindrical Box should be sqrt(2)/2 */ |
cristy | 1c9bb45 | 2010-10-03 16:48:33 +0000 | [diff] [blame] | 902 | resize_filter->support=(MagickRealType) MagickSQ1_2; |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 903 | break; |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 904 | case LanczosFilter: |
| 905 | case LanczosSharpFilter: |
| 906 | case Lanczos2Filter: |
| 907 | case Lanczos2SharpFilter: |
| 908 | resize_filter->filter=filters[JincFilter].function; |
| 909 | resize_filter->window=filters[JincFilter].function; |
anthony | 029ba0e | 2010-10-29 00:54:24 +0000 | [diff] [blame] | 910 | resize_filter->scale=filters[JincFilter].scale; |
| 911 | /* number of lobes (support window size) remain unchanged */ |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 912 | break; |
| 913 | case GaussianFilter: |
| 914 | /* Cylindrical Gaussian sigma is sqrt(2)/2. */ |
| 915 | sigma = (MagickRealType) (MagickSQ2/2.0); |
| 916 | break; |
anthony | 81b8bf9 | 2010-10-02 13:54:34 +0000 | [diff] [blame] | 917 | default: |
| 918 | break; |
anthony | 10b8bc8 | 2010-10-02 12:48:46 +0000 | [diff] [blame] | 919 | } |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 920 | /* Global Sharpening (regardless of orthoginal/cylindrical) */ |
| 921 | switch (filter_type) |
| 922 | { |
| 923 | case LanczosSharpFilter: |
nicolas | af6ee7c | 2010-11-13 03:34:22 +0000 | [diff] [blame] | 924 | resize_filter->blur *= 0.9812505644269356; |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 925 | break; |
| 926 | case Lanczos2SharpFilter: |
nicolas | ca48bce | 2010-11-14 17:54:53 +0000 | [diff] [blame] | 927 | resize_filter->blur *= 0.9549963639785485; |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 928 | break; |
| 929 | default: |
| 930 | break; |
| 931 | } |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 932 | |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 933 | /* |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 934 | ** Other Expert Option Modifications |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 935 | */ |
| 936 | |
| 937 | /* User Sigma Override - no support change */ |
| 938 | artifact=GetImageArtifact(image,"filter:sigma"); |
| 939 | if (artifact != (const char *) NULL) |
| 940 | sigma=StringToDouble(artifact); |
| 941 | /* Define coefficents for Gaussian (assumes no cubic window) */ |
| 942 | if ( GaussianFilter ) { |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 943 | resize_filter->coefficient[0]=1.0/(2.0*sigma*sigma); |
| 944 | resize_filter->coefficient[1]=(MagickRealType) (1.0/(Magick2PI*sigma* |
| 945 | sigma)); /* unused */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 946 | } |
| 947 | |
| 948 | /* Blur Override */ |
| 949 | artifact=GetImageArtifact(image,"filter:blur"); |
| 950 | if (artifact != (const char *) NULL) |
| 951 | resize_filter->blur=StringToDouble(artifact); |
| 952 | if (resize_filter->blur < MagickEpsilon) |
| 953 | resize_filter->blur=(MagickRealType) MagickEpsilon; |
| 954 | |
| 955 | /* Support Overrides */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 956 | artifact=GetImageArtifact(image,"filter:lobes"); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 957 | if (artifact != (const char *) NULL) |
| 958 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 959 | ssize_t |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 960 | lobes; |
| 961 | |
cristy | 96b1613 | 2010-08-29 17:19:52 +0000 | [diff] [blame] | 962 | lobes=(ssize_t) StringToLong(artifact); |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 963 | if (lobes < 1) |
| 964 | lobes=1; |
| 965 | resize_filter->support=(MagickRealType) lobes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 966 | } |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 967 | /* Convert a Jinc function lobes value to a real support value */ |
anthony | 61b5ddd | 2010-10-05 02:33:31 +0000 | [diff] [blame] | 968 | if (resize_filter->filter == Jinc) |
| 969 | { |
| 970 | if (resize_filter->support > 16) |
| 971 | resize_filter->support=jinc_zeros[15]; /* largest entry in table */ |
| 972 | else |
| 973 | resize_filter->support = jinc_zeros[((long)resize_filter->support)-1]; |
| 974 | } |
| 975 | /* expert override of the support setting */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 976 | artifact=GetImageArtifact(image,"filter:support"); |
| 977 | if (artifact != (const char *) NULL) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 978 | resize_filter->support=fabs(StringToDouble(artifact)); |
| 979 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 980 | Scale windowing function separatally to the support 'clipping' |
| 981 | window that calling operator is planning to actually use. (Expert |
| 982 | override) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 983 | */ |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 984 | resize_filter->window_support=resize_filter->support; /* default */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 985 | artifact=GetImageArtifact(image,"filter:win-support"); |
| 986 | if (artifact != (const char *) NULL) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 987 | resize_filter->window_support=fabs(StringToDouble(artifact)); |
| 988 | /* |
anthony | 029ba0e | 2010-10-29 00:54:24 +0000 | [diff] [blame] | 989 | Adjust window function scaling to match windowing support for |
anthony | 1f90a6b | 2010-09-14 08:56:31 +0000 | [diff] [blame] | 990 | weighting function. This avoids a division on every filter call. |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 991 | */ |
| 992 | resize_filter->scale /= resize_filter->window_support; |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 993 | |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 994 | /* |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 995 | * Set Cubic Spline B,C values, calculate Cubic coefficients. |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 996 | */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 997 | B=0.0; |
| 998 | C=0.0; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 999 | if ((filters[filter_type].function == CubicBC) || |
| 1000 | (filters[window_type].function == CubicBC)) |
| 1001 | { |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 1002 | B=filters[filter_type].B; |
| 1003 | C=filters[filter_type].C; |
| 1004 | if (filters[window_type].function == CubicBC) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1005 | { |
anthony | 2d9b8b5 | 2010-09-14 08:31:07 +0000 | [diff] [blame] | 1006 | B=filters[window_type].B; |
| 1007 | C=filters[window_type].C; |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1008 | } |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1009 | artifact=GetImageArtifact(image,"filter:b"); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1010 | if (artifact != (const char *) NULL) |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1011 | { |
| 1012 | B=StringToDouble(artifact); |
nicolas | d15ee9a | 2010-10-24 18:39:45 +0000 | [diff] [blame] | 1013 | C=(1.0-B)/2.0; /* Calculate C to get a Keys cubic filter. */ |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1014 | artifact=GetImageArtifact(image,"filter:c"); /* user C override */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1015 | if (artifact != (const char *) NULL) |
| 1016 | C=StringToDouble(artifact); |
| 1017 | } |
| 1018 | else |
| 1019 | { |
| 1020 | artifact=GetImageArtifact(image,"filter:c"); |
| 1021 | if (artifact != (const char *) NULL) |
| 1022 | { |
| 1023 | C=StringToDouble(artifact); |
nicolas | b7dff64 | 2010-10-25 02:04:14 +0000 | [diff] [blame] | 1024 | B=1.0-2.0*C; /* Calculate B to get a Keys cubic filter. */ |
cristy | 33b1c16 | 2010-01-23 22:51:51 +0000 | [diff] [blame] | 1025 | } |
| 1026 | } |
nicolas | c6bac3b | 2010-10-24 18:10:45 +0000 | [diff] [blame] | 1027 | /* Convert B,C values into Cubic Coefficents. See CubicBC(). */ |
nicolas | d15ee9a | 2010-10-24 18:39:45 +0000 | [diff] [blame] | 1028 | { |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 1029 | const double twoB = B+B; |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1030 | resize_filter->coefficient[0]=1.0-(1.0/3.0)*B; |
| 1031 | resize_filter->coefficient[1]=-3.0+twoB+C; |
| 1032 | resize_filter->coefficient[2]=2.0-1.5*B-C; |
| 1033 | resize_filter->coefficient[3]=(4.0/3.0)*B+4.0*C; |
| 1034 | resize_filter->coefficient[4]=-8.0*C-twoB; |
| 1035 | resize_filter->coefficient[5]=B+5.0*C; |
| 1036 | resize_filter->coefficient[6]=(-1.0/6.0)*B-C; |
nicolas | d15ee9a | 2010-10-24 18:39:45 +0000 | [diff] [blame] | 1037 | } |
nicolas | c6bac3b | 2010-10-24 18:10:45 +0000 | [diff] [blame] | 1038 | } |
anthony | f5e76ef | 2010-10-12 01:22:01 +0000 | [diff] [blame] | 1039 | |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1040 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 1041 | Expert Option Request for verbose details of the resulting filter. |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1042 | */ |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1043 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 1044 | #pragma omp master |
| 1045 | { |
| 1046 | #endif |
| 1047 | artifact=GetImageArtifact(image,"filter:verbose"); |
anthony | 28ad1d7 | 2010-10-26 06:30:24 +0000 | [diff] [blame] | 1048 | if (IsMagickTrue(artifact)) |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1049 | { |
| 1050 | double |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 1051 | support, |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1052 | x; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1053 | |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1054 | /* |
| 1055 | Set the weighting function properly when the weighting |
| 1056 | function may not exactly match the filter of the same name. |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 1057 | EG: a Point filter is really uses a Box weighting function |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1058 | with a different support than is typically used. |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1059 | */ |
| 1060 | if (resize_filter->filter == Box) filter_type=BoxFilter; |
| 1061 | if (resize_filter->filter == Sinc) filter_type=SincFilter; |
| 1062 | if (resize_filter->filter == SincFast) filter_type=SincFastFilter; |
| 1063 | if (resize_filter->filter == Jinc) filter_type=JincFilter; |
| 1064 | if (resize_filter->filter == CubicBC) filter_type=CubicFilter; |
anthony | 1ad2005 | 2010-10-29 01:53:03 +0000 | [diff] [blame] | 1065 | if (resize_filter->window == Box) window_type=BoxFilter; |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 1066 | if (resize_filter->window == Sinc) window_type=SincFilter; |
| 1067 | if (resize_filter->window == SincFast) window_type=SincFastFilter; |
anthony | 1ad2005 | 2010-10-29 01:53:03 +0000 | [diff] [blame] | 1068 | if (resize_filter->window == Jinc) window_type=JincFilter; |
anthony | 152700d | 2010-10-28 02:43:18 +0000 | [diff] [blame] | 1069 | if (resize_filter->window == CubicBC) window_type=CubicFilter; |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1070 | /* |
| 1071 | Report Filter Details. |
| 1072 | */ |
| 1073 | support=GetResizeFilterSupport(resize_filter); /* practical_support */ |
| 1074 | (void) fprintf(stdout,"# Resize Filter (for graphing)\n#\n"); |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 1075 | (void) fprintf(stdout,"# filter = %s\n", |
| 1076 | MagickOptionToMnemonic(MagickFilterOptions,filter_type)); |
| 1077 | (void) fprintf(stdout,"# window = %s\n", |
| 1078 | MagickOptionToMnemonic(MagickFilterOptions, window_type)); |
| 1079 | (void) fprintf(stdout,"# support = %.*g\n", |
| 1080 | GetMagickPrecision(),(double) resize_filter->support); |
| 1081 | (void) fprintf(stdout,"# win-support = %.*g\n", |
| 1082 | GetMagickPrecision(),(double) resize_filter->window_support); |
| 1083 | (void) fprintf(stdout,"# scale_blur = %.*g\n", |
| 1084 | GetMagickPrecision(), (double)resize_filter->blur); |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1085 | if ( filter_type == GaussianFilter ) |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 1086 | (void) fprintf(stdout,"# gaussian_sigma = %.*g\n", |
| 1087 | GetMagickPrecision(), (double)sigma); |
| 1088 | (void) fprintf(stdout,"# practical_support = %.*g\n", |
| 1089 | GetMagickPrecision(), (double)support); |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1090 | if ( filter_type == CubicFilter || window_type == CubicFilter ) |
anthony | 06b1edf | 2010-10-25 01:19:50 +0000 | [diff] [blame] | 1091 | (void) fprintf(stdout,"# B,C = %.*g,%.*g\n", |
| 1092 | GetMagickPrecision(),(double)B, GetMagickPrecision(),(double)C); |
cristy | f5b4937 | 2010-10-16 01:06:47 +0000 | [diff] [blame] | 1093 | (void) fprintf(stdout,"\n"); |
| 1094 | /* |
| 1095 | Output values of resulting filter graph -- for graphing |
| 1096 | filter result. |
| 1097 | */ |
| 1098 | for (x=0.0; x <= support; x+=0.01f) |
| 1099 | (void) fprintf(stdout,"%5.2lf\t%.*g\n",x,GetMagickPrecision(), |
| 1100 | (double) GetResizeFilterWeight(resize_filter,x)); |
| 1101 | /* A final value so gnuplot can graph the 'stop' properly. */ |
| 1102 | (void) fprintf(stdout,"%5.2lf\t%.*g\n",support,GetMagickPrecision(), |
| 1103 | 0.0); |
| 1104 | } |
| 1105 | /* Output the above once only for each image - remove setting */ |
| 1106 | (void) DeleteImageArtifact((Image *) image,"filter:verbose"); |
| 1107 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 1108 | } |
| 1109 | #endif |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1110 | return(resize_filter); |
| 1111 | } |
| 1112 | |
| 1113 | /* |
| 1114 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1115 | % % |
| 1116 | % % |
| 1117 | % % |
| 1118 | % A d a p t i v e R e s i z e I m a g e % |
| 1119 | % % |
| 1120 | % % |
| 1121 | % % |
| 1122 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1123 | % |
| 1124 | % AdaptiveResizeImage() adaptively resize image with pixel resampling. |
| 1125 | % |
| 1126 | % The format of the AdaptiveResizeImage method is: |
| 1127 | % |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1128 | % Image *AdaptiveResizeImage(const Image *image,const size_t columns, |
| 1129 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1130 | % |
| 1131 | % A description of each parameter follows: |
| 1132 | % |
| 1133 | % o image: the image. |
| 1134 | % |
| 1135 | % o columns: the number of columns in the resized image. |
| 1136 | % |
| 1137 | % o rows: the number of rows in the resized image. |
| 1138 | % |
| 1139 | % o exception: return any errors or warnings in this structure. |
| 1140 | % |
| 1141 | */ |
| 1142 | MagickExport Image *AdaptiveResizeImage(const Image *image, |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1143 | const size_t columns,const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1144 | { |
| 1145 | #define AdaptiveResizeImageTag "Resize/Image" |
| 1146 | |
cristy | c4c8d13 | 2010-01-07 01:58:38 +0000 | [diff] [blame] | 1147 | CacheView |
| 1148 | *resize_view; |
| 1149 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1150 | Image |
| 1151 | *resize_image; |
| 1152 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1153 | MagickBooleanType |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1154 | status; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1155 | |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1156 | MagickOffsetType |
| 1157 | progress; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1158 | |
| 1159 | ResampleFilter |
cristy | a6a1878 | 2010-11-15 01:56:25 +0000 | [diff] [blame] | 1160 | **resample_filter; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1161 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1162 | ssize_t |
| 1163 | y; |
| 1164 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1165 | /* |
| 1166 | Adaptively resize image. |
| 1167 | */ |
| 1168 | assert(image != (const Image *) NULL); |
| 1169 | assert(image->signature == MagickSignature); |
| 1170 | if (image->debug != MagickFalse) |
| 1171 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1172 | assert(exception != (ExceptionInfo *) NULL); |
| 1173 | assert(exception->signature == MagickSignature); |
| 1174 | if ((columns == 0) || (rows == 0)) |
| 1175 | return((Image *) NULL); |
| 1176 | if ((columns == image->columns) && (rows == image->rows)) |
| 1177 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 1178 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 1179 | if (resize_image == (Image *) NULL) |
| 1180 | return((Image *) NULL); |
| 1181 | if (SetImageStorageClass(resize_image,DirectClass) == MagickFalse) |
| 1182 | { |
| 1183 | InheritException(exception,&resize_image->exception); |
| 1184 | resize_image=DestroyImage(resize_image); |
| 1185 | return((Image *) NULL); |
| 1186 | } |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1187 | status=MagickTrue; |
| 1188 | progress=0; |
cristy | a6a1878 | 2010-11-15 01:56:25 +0000 | [diff] [blame] | 1189 | resample_filter=AcquireResampleFilterThreadSet(image, |
| 1190 | UndefinedVirtualPixelMethod,MagickTrue,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1191 | resize_view=AcquireCacheView(resize_image); |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1192 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 1193 | #pragma omp parallel for schedule(dynamic,4) shared(progress,status) omp_throttle(1) |
| 1194 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1195 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1196 | { |
cristy | a6a1878 | 2010-11-15 01:56:25 +0000 | [diff] [blame] | 1197 | const int |
| 1198 | id = GetOpenMPThreadId(); |
| 1199 | |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1200 | MagickPixelPacket |
| 1201 | pixel; |
| 1202 | |
| 1203 | PointInfo |
| 1204 | offset; |
| 1205 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1206 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1207 | *restrict resize_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1208 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1209 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1210 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1211 | |
cristy | b2a9be0 | 2010-11-15 15:00:14 +0000 | [diff] [blame^] | 1212 | register ssize_t |
| 1213 | x; |
| 1214 | |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1215 | if (status == MagickFalse) |
| 1216 | continue; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1217 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| 1218 | exception); |
| 1219 | if (q == (PixelPacket *) NULL) |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1220 | continue; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1221 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
| 1222 | offset.y=((MagickRealType) y*image->rows/resize_image->rows); |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1223 | GetMagickPixelPacket(image,&pixel); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1224 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1225 | { |
| 1226 | offset.x=((MagickRealType) x*image->columns/resize_image->columns); |
cristy | a6a1878 | 2010-11-15 01:56:25 +0000 | [diff] [blame] | 1227 | (void) ResamplePixelColor(resample_filter[id],offset.x-0.5,offset.y-0.5, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1228 | &pixel); |
| 1229 | SetPixelPacket(resize_image,&pixel,q,resize_indexes+x); |
| 1230 | q++; |
| 1231 | } |
| 1232 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1233 | continue; |
| 1234 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 1235 | { |
| 1236 | MagickBooleanType |
| 1237 | proceed; |
| 1238 | |
| 1239 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 1240 | #pragma omp critical (MagickCore_AdaptiveResizeImage) |
| 1241 | #endif |
| 1242 | proceed=SetImageProgress(image,AdaptiveResizeImageTag,progress++, |
| 1243 | image->rows); |
| 1244 | if (proceed == MagickFalse) |
| 1245 | status=MagickFalse; |
| 1246 | } |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1247 | } |
cristy | a6a1878 | 2010-11-15 01:56:25 +0000 | [diff] [blame] | 1248 | resample_filter=DestroyResampleFilterThreadSet(resample_filter); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1249 | resize_view=DestroyCacheView(resize_view); |
cristy | 5cce74b | 2010-11-15 03:24:28 +0000 | [diff] [blame] | 1250 | if (status == MagickFalse) |
| 1251 | resize_image=DestroyImage(resize_image); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1252 | return(resize_image); |
| 1253 | } |
| 1254 | |
| 1255 | /* |
| 1256 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1257 | % % |
| 1258 | % % |
| 1259 | % % |
| 1260 | + B e s s e l O r d e r O n e % |
| 1261 | % % |
| 1262 | % % |
| 1263 | % % |
| 1264 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1265 | % |
| 1266 | % BesselOrderOne() computes the Bessel function of x of the first kind of |
anthony | 48f7762 | 2010-10-03 14:32:31 +0000 | [diff] [blame] | 1267 | % order 0. This is used to create the Jinc() filter function below. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1268 | % |
| 1269 | % Reduce x to |x| since j1(x)= -j1(-x), and for x in (0,8] |
| 1270 | % |
| 1271 | % j1(x) = x*j1(x); |
| 1272 | % |
| 1273 | % For x in (8,inf) |
| 1274 | % |
| 1275 | % j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) |
| 1276 | % |
| 1277 | % where x1 = x-3*pi/4. Compute sin(x1) and cos(x1) as follow: |
| 1278 | % |
| 1279 | % cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) |
| 1280 | % = 1/sqrt(2) * (sin(x) - cos(x)) |
| 1281 | % sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) |
| 1282 | % = -1/sqrt(2) * (sin(x) + cos(x)) |
| 1283 | % |
| 1284 | % The format of the BesselOrderOne method is: |
| 1285 | % |
| 1286 | % MagickRealType BesselOrderOne(MagickRealType x) |
| 1287 | % |
| 1288 | % A description of each parameter follows: |
| 1289 | % |
| 1290 | % o x: MagickRealType value. |
| 1291 | % |
| 1292 | */ |
| 1293 | |
| 1294 | #undef I0 |
| 1295 | static MagickRealType I0(MagickRealType x) |
| 1296 | { |
| 1297 | MagickRealType |
| 1298 | sum, |
| 1299 | t, |
| 1300 | y; |
| 1301 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1302 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1303 | i; |
| 1304 | |
| 1305 | /* |
| 1306 | Zeroth order Bessel function of the first kind. |
| 1307 | */ |
| 1308 | sum=1.0; |
| 1309 | y=x*x/4.0; |
| 1310 | t=y; |
| 1311 | for (i=2; t > MagickEpsilon; i++) |
| 1312 | { |
| 1313 | sum+=t; |
| 1314 | t*=y/((MagickRealType) i*i); |
| 1315 | } |
| 1316 | return(sum); |
| 1317 | } |
| 1318 | |
| 1319 | #undef J1 |
| 1320 | static MagickRealType J1(MagickRealType x) |
| 1321 | { |
| 1322 | MagickRealType |
| 1323 | p, |
| 1324 | q; |
| 1325 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1326 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1327 | i; |
| 1328 | |
| 1329 | static const double |
| 1330 | Pone[] = |
| 1331 | { |
| 1332 | 0.581199354001606143928050809e+21, |
| 1333 | -0.6672106568924916298020941484e+20, |
| 1334 | 0.2316433580634002297931815435e+19, |
| 1335 | -0.3588817569910106050743641413e+17, |
| 1336 | 0.2908795263834775409737601689e+15, |
| 1337 | -0.1322983480332126453125473247e+13, |
| 1338 | 0.3413234182301700539091292655e+10, |
| 1339 | -0.4695753530642995859767162166e+7, |
| 1340 | 0.270112271089232341485679099e+4 |
| 1341 | }, |
| 1342 | Qone[] = |
| 1343 | { |
| 1344 | 0.11623987080032122878585294e+22, |
| 1345 | 0.1185770712190320999837113348e+20, |
| 1346 | 0.6092061398917521746105196863e+17, |
| 1347 | 0.2081661221307607351240184229e+15, |
| 1348 | 0.5243710262167649715406728642e+12, |
| 1349 | 0.1013863514358673989967045588e+10, |
| 1350 | 0.1501793594998585505921097578e+7, |
| 1351 | 0.1606931573481487801970916749e+4, |
| 1352 | 0.1e+1 |
| 1353 | }; |
| 1354 | |
| 1355 | p=Pone[8]; |
| 1356 | q=Qone[8]; |
| 1357 | for (i=7; i >= 0; i--) |
| 1358 | { |
| 1359 | p=p*x*x+Pone[i]; |
| 1360 | q=q*x*x+Qone[i]; |
| 1361 | } |
| 1362 | return(p/q); |
| 1363 | } |
| 1364 | |
| 1365 | #undef P1 |
| 1366 | static MagickRealType P1(MagickRealType x) |
| 1367 | { |
| 1368 | MagickRealType |
| 1369 | p, |
| 1370 | q; |
| 1371 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1372 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1373 | i; |
| 1374 | |
| 1375 | static const double |
| 1376 | Pone[] = |
| 1377 | { |
| 1378 | 0.352246649133679798341724373e+5, |
| 1379 | 0.62758845247161281269005675e+5, |
| 1380 | 0.313539631109159574238669888e+5, |
| 1381 | 0.49854832060594338434500455e+4, |
| 1382 | 0.2111529182853962382105718e+3, |
| 1383 | 0.12571716929145341558495e+1 |
| 1384 | }, |
| 1385 | Qone[] = |
| 1386 | { |
| 1387 | 0.352246649133679798068390431e+5, |
| 1388 | 0.626943469593560511888833731e+5, |
| 1389 | 0.312404063819041039923015703e+5, |
| 1390 | 0.4930396490181088979386097e+4, |
| 1391 | 0.2030775189134759322293574e+3, |
| 1392 | 0.1e+1 |
| 1393 | }; |
| 1394 | |
| 1395 | p=Pone[5]; |
| 1396 | q=Qone[5]; |
| 1397 | for (i=4; i >= 0; i--) |
| 1398 | { |
| 1399 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| 1400 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| 1401 | } |
| 1402 | return(p/q); |
| 1403 | } |
| 1404 | |
| 1405 | #undef Q1 |
| 1406 | static MagickRealType Q1(MagickRealType x) |
| 1407 | { |
| 1408 | MagickRealType |
| 1409 | p, |
| 1410 | q; |
| 1411 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1412 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1413 | i; |
| 1414 | |
| 1415 | static const double |
| 1416 | Pone[] = |
| 1417 | { |
| 1418 | 0.3511751914303552822533318e+3, |
| 1419 | 0.7210391804904475039280863e+3, |
| 1420 | 0.4259873011654442389886993e+3, |
| 1421 | 0.831898957673850827325226e+2, |
| 1422 | 0.45681716295512267064405e+1, |
| 1423 | 0.3532840052740123642735e-1 |
| 1424 | }, |
| 1425 | Qone[] = |
| 1426 | { |
| 1427 | 0.74917374171809127714519505e+4, |
| 1428 | 0.154141773392650970499848051e+5, |
| 1429 | 0.91522317015169922705904727e+4, |
| 1430 | 0.18111867005523513506724158e+4, |
| 1431 | 0.1038187585462133728776636e+3, |
| 1432 | 0.1e+1 |
| 1433 | }; |
| 1434 | |
| 1435 | p=Pone[5]; |
| 1436 | q=Qone[5]; |
| 1437 | for (i=4; i >= 0; i--) |
| 1438 | { |
| 1439 | p=p*(8.0/x)*(8.0/x)+Pone[i]; |
| 1440 | q=q*(8.0/x)*(8.0/x)+Qone[i]; |
| 1441 | } |
| 1442 | return(p/q); |
| 1443 | } |
| 1444 | |
| 1445 | static MagickRealType BesselOrderOne(MagickRealType x) |
| 1446 | { |
| 1447 | MagickRealType |
| 1448 | p, |
| 1449 | q; |
| 1450 | |
| 1451 | if (x == 0.0) |
| 1452 | return(0.0); |
| 1453 | p=x; |
| 1454 | if (x < 0.0) |
| 1455 | x=(-x); |
| 1456 | if (x < 8.0) |
| 1457 | return(p*J1(x)); |
| 1458 | q=sqrt((double) (2.0/(MagickPI*x)))*(P1(x)*(1.0/sqrt(2.0)*(sin((double) x)- |
| 1459 | cos((double) x)))-8.0/x*Q1(x)*(-1.0/sqrt(2.0)*(sin((double) x)+ |
| 1460 | cos((double) x)))); |
| 1461 | if (p < 0.0) |
| 1462 | q=(-q); |
| 1463 | return(q); |
| 1464 | } |
| 1465 | |
| 1466 | /* |
| 1467 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1468 | % % |
| 1469 | % % |
| 1470 | % % |
| 1471 | + D e s t r o y R e s i z e F i l t e r % |
| 1472 | % % |
| 1473 | % % |
| 1474 | % % |
| 1475 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1476 | % |
| 1477 | % DestroyResizeFilter() destroy the resize filter. |
| 1478 | % |
cristy | a2ffd7e | 2010-03-10 20:50:30 +0000 | [diff] [blame] | 1479 | % The format of the DestroyResizeFilter method is: |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1480 | % |
| 1481 | % ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| 1482 | % |
| 1483 | % A description of each parameter follows: |
| 1484 | % |
| 1485 | % o resize_filter: the resize filter. |
| 1486 | % |
| 1487 | */ |
| 1488 | MagickExport ResizeFilter *DestroyResizeFilter(ResizeFilter *resize_filter) |
| 1489 | { |
| 1490 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1491 | assert(resize_filter->signature == MagickSignature); |
| 1492 | resize_filter->signature=(~MagickSignature); |
| 1493 | resize_filter=(ResizeFilter *) RelinquishMagickMemory(resize_filter); |
| 1494 | return(resize_filter); |
| 1495 | } |
| 1496 | |
| 1497 | /* |
| 1498 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1499 | % % |
| 1500 | % % |
| 1501 | % % |
| 1502 | + G e t R e s i z e F i l t e r S u p p o r t % |
| 1503 | % % |
| 1504 | % % |
| 1505 | % % |
| 1506 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1507 | % |
| 1508 | % GetResizeFilterSupport() return the current support window size for this |
| 1509 | % filter. Note that this may have been enlarged by filter:blur factor. |
| 1510 | % |
| 1511 | % The format of the GetResizeFilterSupport method is: |
| 1512 | % |
| 1513 | % MagickRealType GetResizeFilterSupport(const ResizeFilter *resize_filter) |
| 1514 | % |
| 1515 | % A description of each parameter follows: |
| 1516 | % |
| 1517 | % o filter: Image filter to use. |
| 1518 | % |
| 1519 | */ |
| 1520 | MagickExport MagickRealType GetResizeFilterSupport( |
| 1521 | const ResizeFilter *resize_filter) |
| 1522 | { |
| 1523 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1524 | assert(resize_filter->signature == MagickSignature); |
| 1525 | return(resize_filter->support*resize_filter->blur); |
| 1526 | } |
| 1527 | |
| 1528 | /* |
| 1529 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1530 | % % |
| 1531 | % % |
| 1532 | % % |
| 1533 | + G e t R e s i z e F i l t e r W e i g h t % |
| 1534 | % % |
| 1535 | % % |
| 1536 | % % |
| 1537 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1538 | % |
| 1539 | % GetResizeFilterWeight evaluates the specified resize filter at the point x |
| 1540 | % which usally lies between zero and the filters current 'support' and |
| 1541 | % returns the weight of the filter function at that point. |
| 1542 | % |
| 1543 | % The format of the GetResizeFilterWeight method is: |
| 1544 | % |
| 1545 | % MagickRealType GetResizeFilterWeight(const ResizeFilter *resize_filter, |
| 1546 | % const MagickRealType x) |
| 1547 | % |
| 1548 | % A description of each parameter follows: |
| 1549 | % |
| 1550 | % o filter: the filter type. |
| 1551 | % |
| 1552 | % o x: the point. |
| 1553 | % |
| 1554 | */ |
| 1555 | MagickExport MagickRealType GetResizeFilterWeight( |
| 1556 | const ResizeFilter *resize_filter,const MagickRealType x) |
| 1557 | { |
| 1558 | MagickRealType |
cristy | b838586 | 2010-09-26 01:27:51 +0000 | [diff] [blame] | 1559 | scale, |
| 1560 | x_blur; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1561 | |
| 1562 | /* |
| 1563 | Windowing function - scale the weighting filter by this amount. |
| 1564 | */ |
| 1565 | assert(resize_filter != (ResizeFilter *) NULL); |
| 1566 | assert(resize_filter->signature == MagickSignature); |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1567 | x_blur=fabs((double) x)/resize_filter->blur; /* X offset with blur scaling */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1568 | if ((resize_filter->window_support < MagickEpsilon) || |
| 1569 | (resize_filter->window == Box)) |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1570 | scale=1.0; /* Point or Box Filter -- avoid division by zero */ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1571 | else |
| 1572 | { |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1573 | scale=resize_filter->scale; |
| 1574 | scale=resize_filter->window(x_blur*scale,resize_filter); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1575 | } |
anthony | 55f1233 | 2010-09-10 01:13:02 +0000 | [diff] [blame] | 1576 | return(scale*resize_filter->filter(x_blur,resize_filter)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1577 | } |
| 1578 | |
| 1579 | /* |
| 1580 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1581 | % % |
| 1582 | % % |
| 1583 | % % |
| 1584 | % M a g n i f y I m a g e % |
| 1585 | % % |
| 1586 | % % |
| 1587 | % % |
| 1588 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1589 | % |
| 1590 | % MagnifyImage() is a convenience method that scales an image proportionally |
| 1591 | % to twice its size. |
| 1592 | % |
| 1593 | % The format of the MagnifyImage method is: |
| 1594 | % |
| 1595 | % Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| 1596 | % |
| 1597 | % A description of each parameter follows: |
| 1598 | % |
| 1599 | % o image: the image. |
| 1600 | % |
| 1601 | % o exception: return any errors or warnings in this structure. |
| 1602 | % |
| 1603 | */ |
| 1604 | MagickExport Image *MagnifyImage(const Image *image,ExceptionInfo *exception) |
| 1605 | { |
| 1606 | Image |
| 1607 | *magnify_image; |
| 1608 | |
| 1609 | assert(image != (Image *) NULL); |
| 1610 | assert(image->signature == MagickSignature); |
| 1611 | if (image->debug != MagickFalse) |
| 1612 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1613 | assert(exception != (ExceptionInfo *) NULL); |
| 1614 | assert(exception->signature == MagickSignature); |
| 1615 | magnify_image=ResizeImage(image,2*image->columns,2*image->rows,CubicFilter, |
| 1616 | 1.0,exception); |
| 1617 | return(magnify_image); |
| 1618 | } |
| 1619 | |
| 1620 | /* |
| 1621 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1622 | % % |
| 1623 | % % |
| 1624 | % % |
| 1625 | % M i n i f y I m a g e % |
| 1626 | % % |
| 1627 | % % |
| 1628 | % % |
| 1629 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1630 | % |
| 1631 | % MinifyImage() is a convenience method that scales an image proportionally |
| 1632 | % to half its size. |
| 1633 | % |
| 1634 | % The format of the MinifyImage method is: |
| 1635 | % |
| 1636 | % Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| 1637 | % |
| 1638 | % A description of each parameter follows: |
| 1639 | % |
| 1640 | % o image: the image. |
| 1641 | % |
| 1642 | % o exception: return any errors or warnings in this structure. |
| 1643 | % |
| 1644 | */ |
| 1645 | MagickExport Image *MinifyImage(const Image *image,ExceptionInfo *exception) |
| 1646 | { |
| 1647 | Image |
| 1648 | *minify_image; |
| 1649 | |
| 1650 | assert(image != (Image *) NULL); |
| 1651 | assert(image->signature == MagickSignature); |
| 1652 | if (image->debug != MagickFalse) |
| 1653 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1654 | assert(exception != (ExceptionInfo *) NULL); |
| 1655 | assert(exception->signature == MagickSignature); |
| 1656 | minify_image=ResizeImage(image,image->columns/2,image->rows/2,CubicFilter, |
| 1657 | 1.0,exception); |
| 1658 | return(minify_image); |
| 1659 | } |
| 1660 | |
| 1661 | /* |
| 1662 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1663 | % % |
| 1664 | % % |
| 1665 | % % |
| 1666 | % R e s a m p l e I m a g e % |
| 1667 | % % |
| 1668 | % % |
| 1669 | % % |
| 1670 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1671 | % |
| 1672 | % ResampleImage() resize image in terms of its pixel size, so that when |
| 1673 | % displayed at the given resolution it will be the same size in terms of |
| 1674 | % real world units as the original image at the original resolution. |
| 1675 | % |
| 1676 | % The format of the ResampleImage method is: |
| 1677 | % |
| 1678 | % Image *ResampleImage(Image *image,const double x_resolution, |
| 1679 | % const double y_resolution,const FilterTypes filter,const double blur, |
| 1680 | % ExceptionInfo *exception) |
| 1681 | % |
| 1682 | % A description of each parameter follows: |
| 1683 | % |
| 1684 | % o image: the image to be resized to fit the given resolution. |
| 1685 | % |
| 1686 | % o x_resolution: the new image x resolution. |
| 1687 | % |
| 1688 | % o y_resolution: the new image y resolution. |
| 1689 | % |
| 1690 | % o filter: Image filter to use. |
| 1691 | % |
| 1692 | % o blur: the blur factor where > 1 is blurry, < 1 is sharp. |
| 1693 | % |
| 1694 | */ |
| 1695 | MagickExport Image *ResampleImage(const Image *image,const double x_resolution, |
| 1696 | const double y_resolution,const FilterTypes filter,const double blur, |
| 1697 | ExceptionInfo *exception) |
| 1698 | { |
| 1699 | #define ResampleImageTag "Resample/Image" |
| 1700 | |
| 1701 | Image |
| 1702 | *resample_image; |
| 1703 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1704 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1705 | height, |
| 1706 | width; |
| 1707 | |
| 1708 | /* |
| 1709 | Initialize sampled image attributes. |
| 1710 | */ |
| 1711 | assert(image != (const Image *) NULL); |
| 1712 | assert(image->signature == MagickSignature); |
| 1713 | if (image->debug != MagickFalse) |
| 1714 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1715 | assert(exception != (ExceptionInfo *) NULL); |
| 1716 | assert(exception->signature == MagickSignature); |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1717 | width=(size_t) (x_resolution*image->columns/(image->x_resolution == 0.0 ? |
| 1718 | 72.0 : image->x_resolution)+0.5); |
| 1719 | height=(size_t) (y_resolution*image->rows/(image->y_resolution == 0.0 ? |
| 1720 | 72.0 : image->y_resolution)+0.5); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1721 | resample_image=ResizeImage(image,width,height,filter,blur,exception); |
| 1722 | if (resample_image != (Image *) NULL) |
| 1723 | { |
| 1724 | resample_image->x_resolution=x_resolution; |
| 1725 | resample_image->y_resolution=y_resolution; |
| 1726 | } |
| 1727 | return(resample_image); |
| 1728 | } |
| 1729 | #if defined(MAGICKCORE_LQR_DELEGATE) |
| 1730 | |
| 1731 | /* |
| 1732 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1733 | % % |
| 1734 | % % |
| 1735 | % % |
| 1736 | % L i q u i d R e s c a l e I m a g e % |
| 1737 | % % |
| 1738 | % % |
| 1739 | % % |
| 1740 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1741 | % |
| 1742 | % LiquidRescaleImage() rescales image with seam carving. |
| 1743 | % |
| 1744 | % The format of the LiquidRescaleImage method is: |
| 1745 | % |
| 1746 | % Image *LiquidRescaleImage(const Image *image, |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1747 | % const size_t columns,const size_t rows, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1748 | % const double delta_x,const double rigidity,ExceptionInfo *exception) |
| 1749 | % |
| 1750 | % A description of each parameter follows: |
| 1751 | % |
| 1752 | % o image: the image. |
| 1753 | % |
| 1754 | % o columns: the number of columns in the rescaled image. |
| 1755 | % |
| 1756 | % o rows: the number of rows in the rescaled image. |
| 1757 | % |
| 1758 | % o delta_x: maximum seam transversal step (0 means straight seams). |
| 1759 | % |
| 1760 | % o rigidity: introduce a bias for non-straight seams (typically 0). |
| 1761 | % |
| 1762 | % o exception: return any errors or warnings in this structure. |
| 1763 | % |
| 1764 | */ |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1765 | MagickExport Image *LiquidRescaleImage(const Image *image,const size_t columns, |
| 1766 | const size_t rows,const double delta_x,const double rigidity, |
| 1767 | ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1768 | { |
| 1769 | #define LiquidRescaleImageTag "Rescale/Image" |
| 1770 | |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1771 | CacheView |
| 1772 | *rescale_view; |
| 1773 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1774 | const char |
| 1775 | *map; |
| 1776 | |
| 1777 | guchar |
| 1778 | *packet; |
| 1779 | |
| 1780 | Image |
| 1781 | *rescale_image; |
| 1782 | |
| 1783 | int |
| 1784 | x, |
| 1785 | y; |
| 1786 | |
| 1787 | LqrCarver |
| 1788 | *carver; |
| 1789 | |
| 1790 | LqrRetVal |
| 1791 | lqr_status; |
| 1792 | |
| 1793 | MagickBooleanType |
| 1794 | status; |
| 1795 | |
| 1796 | MagickPixelPacket |
| 1797 | pixel; |
| 1798 | |
| 1799 | unsigned char |
| 1800 | *pixels; |
| 1801 | |
| 1802 | /* |
| 1803 | Liquid rescale image. |
| 1804 | */ |
| 1805 | assert(image != (const Image *) NULL); |
| 1806 | assert(image->signature == MagickSignature); |
| 1807 | if (image->debug != MagickFalse) |
| 1808 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1809 | assert(exception != (ExceptionInfo *) NULL); |
| 1810 | assert(exception->signature == MagickSignature); |
| 1811 | if ((columns == 0) || (rows == 0)) |
| 1812 | return((Image *) NULL); |
| 1813 | if ((columns == image->columns) && (rows == image->rows)) |
| 1814 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 1815 | if ((columns <= 2) || (rows <= 2)) |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 1816 | return(ResizeImage(image,columns,rows,image->filter,image->blur,exception)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1817 | if ((columns >= (2*image->columns)) || (rows >= (2*image->rows))) |
| 1818 | { |
| 1819 | Image |
| 1820 | *resize_image; |
| 1821 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1822 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1823 | height, |
| 1824 | width; |
| 1825 | |
| 1826 | /* |
| 1827 | Honor liquid resize size limitations. |
| 1828 | */ |
| 1829 | for (width=image->columns; columns >= (2*width-1); width*=2); |
| 1830 | for (height=image->rows; rows >= (2*height-1); height*=2); |
| 1831 | resize_image=ResizeImage(image,width,height,image->filter,image->blur, |
| 1832 | exception); |
| 1833 | if (resize_image == (Image *) NULL) |
| 1834 | return((Image *) NULL); |
| 1835 | rescale_image=LiquidRescaleImage(resize_image,columns,rows,delta_x, |
| 1836 | rigidity,exception); |
| 1837 | resize_image=DestroyImage(resize_image); |
| 1838 | return(rescale_image); |
| 1839 | } |
| 1840 | map="RGB"; |
| 1841 | if (image->matte == MagickFalse) |
| 1842 | map="RGBA"; |
| 1843 | if (image->colorspace == CMYKColorspace) |
| 1844 | { |
| 1845 | map="CMYK"; |
| 1846 | if (image->matte == MagickFalse) |
| 1847 | map="CMYKA"; |
| 1848 | } |
| 1849 | pixels=(unsigned char *) AcquireQuantumMemory(image->columns,image->rows* |
| 1850 | strlen(map)*sizeof(*pixels)); |
| 1851 | if (pixels == (unsigned char *) NULL) |
| 1852 | return((Image *) NULL); |
| 1853 | status=ExportImagePixels(image,0,0,image->columns,image->rows,map,CharPixel, |
| 1854 | pixels,exception); |
| 1855 | if (status == MagickFalse) |
| 1856 | { |
| 1857 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1858 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 1859 | } |
| 1860 | carver=lqr_carver_new(pixels,image->columns,image->rows,strlen(map)); |
| 1861 | if (carver == (LqrCarver *) NULL) |
| 1862 | { |
| 1863 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1864 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 1865 | } |
| 1866 | lqr_status=lqr_carver_init(carver,(int) delta_x,rigidity); |
| 1867 | lqr_status=lqr_carver_resize(carver,columns,rows); |
| 1868 | rescale_image=CloneImage(image,lqr_carver_get_width(carver), |
| 1869 | lqr_carver_get_height(carver),MagickTrue,exception); |
| 1870 | if (rescale_image == (Image *) NULL) |
| 1871 | { |
| 1872 | pixels=(unsigned char *) RelinquishMagickMemory(pixels); |
| 1873 | return((Image *) NULL); |
| 1874 | } |
| 1875 | if (SetImageStorageClass(rescale_image,DirectClass) == MagickFalse) |
| 1876 | { |
| 1877 | InheritException(exception,&rescale_image->exception); |
| 1878 | rescale_image=DestroyImage(rescale_image); |
| 1879 | return((Image *) NULL); |
| 1880 | } |
| 1881 | GetMagickPixelPacket(rescale_image,&pixel); |
| 1882 | (void) lqr_carver_scan_reset(carver); |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1883 | rescale_view=AcquireCacheView(rescale_image); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1884 | while (lqr_carver_scan(carver,&x,&y,&packet) != 0) |
| 1885 | { |
| 1886 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1887 | *restrict rescale_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1888 | |
| 1889 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 1890 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1891 | |
anthony | 22aad25 | 2010-09-23 06:59:07 +0000 | [diff] [blame] | 1892 | q=QueueCacheViewAuthenticPixels(rescale_view,x,y,1,1,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1893 | if (q == (PixelPacket *) NULL) |
| 1894 | break; |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1895 | rescale_indexes=GetCacheViewAuthenticIndexQueue(rescale_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1896 | pixel.red=QuantumRange*(packet[0]/255.0); |
| 1897 | pixel.green=QuantumRange*(packet[1]/255.0); |
| 1898 | pixel.blue=QuantumRange*(packet[2]/255.0); |
| 1899 | if (image->colorspace != CMYKColorspace) |
| 1900 | { |
| 1901 | if (image->matte == MagickFalse) |
| 1902 | pixel.opacity=QuantumRange*(packet[3]/255.0); |
| 1903 | } |
| 1904 | else |
| 1905 | { |
| 1906 | pixel.index=QuantumRange*(packet[3]/255.0); |
| 1907 | if (image->matte == MagickFalse) |
| 1908 | pixel.opacity=QuantumRange*(packet[4]/255.0); |
| 1909 | } |
| 1910 | SetPixelPacket(rescale_image,&pixel,q,rescale_indexes); |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1911 | if (SyncCacheViewAuthenticPixels(rescale_view,exception) == MagickFalse) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1912 | break; |
| 1913 | } |
cristy | c5c6f66 | 2010-09-22 14:23:02 +0000 | [diff] [blame] | 1914 | rescale_view=DestroyCacheView(rescale_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1915 | /* |
| 1916 | Relinquish resources. |
| 1917 | */ |
| 1918 | lqr_carver_destroy(carver); |
| 1919 | return(rescale_image); |
| 1920 | } |
| 1921 | #else |
| 1922 | MagickExport Image *LiquidRescaleImage(const Image *image, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1923 | const size_t magick_unused(columns),const size_t magick_unused(rows), |
| 1924 | const double magick_unused(delta_x),const double magick_unused(rigidity), |
| 1925 | ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1926 | { |
| 1927 | assert(image != (const Image *) NULL); |
| 1928 | assert(image->signature == MagickSignature); |
| 1929 | if (image->debug != MagickFalse) |
| 1930 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 1931 | assert(exception != (ExceptionInfo *) NULL); |
| 1932 | assert(exception->signature == MagickSignature); |
| 1933 | (void) ThrowMagickException(exception,GetMagickModule(),MissingDelegateError, |
| 1934 | "DelegateLibrarySupportNotBuiltIn","`%s' (LQR)",image->filename); |
| 1935 | return((Image *) NULL); |
| 1936 | } |
| 1937 | #endif |
| 1938 | |
| 1939 | /* |
| 1940 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1941 | % % |
| 1942 | % % |
| 1943 | % % |
| 1944 | % R e s i z e I m a g e % |
| 1945 | % % |
| 1946 | % % |
| 1947 | % % |
| 1948 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 1949 | % |
| 1950 | % ResizeImage() scales an image to the desired dimensions, using the given |
cristy | 5d82438 | 2010-09-06 14:00:17 +0000 | [diff] [blame] | 1951 | % filter (see AcquireFilterInfo()). |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1952 | % |
| 1953 | % If an undefined filter is given the filter defaults to Mitchell for a |
| 1954 | % colormapped image, a image with a matte channel, or if the image is |
| 1955 | % enlarged. Otherwise the filter defaults to a Lanczos. |
| 1956 | % |
| 1957 | % ResizeImage() was inspired by Paul Heckbert's "zoom" program. |
| 1958 | % |
| 1959 | % The format of the ResizeImage method is: |
| 1960 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1961 | % Image *ResizeImage(Image *image,const size_t columns, |
| 1962 | % const size_t rows,const FilterTypes filter,const double blur, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1963 | % ExceptionInfo *exception) |
| 1964 | % |
| 1965 | % A description of each parameter follows: |
| 1966 | % |
| 1967 | % o image: the image. |
| 1968 | % |
| 1969 | % o columns: the number of columns in the scaled image. |
| 1970 | % |
| 1971 | % o rows: the number of rows in the scaled image. |
| 1972 | % |
| 1973 | % o filter: Image filter to use. |
| 1974 | % |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 1975 | % o blur: the blur factor where > 1 is blurry, < 1 is sharp. Typically set |
| 1976 | % this to 1.0. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1977 | % |
| 1978 | % o exception: return any errors or warnings in this structure. |
| 1979 | % |
| 1980 | */ |
| 1981 | |
| 1982 | typedef struct _ContributionInfo |
| 1983 | { |
| 1984 | MagickRealType |
| 1985 | weight; |
| 1986 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1987 | ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1988 | pixel; |
| 1989 | } ContributionInfo; |
| 1990 | |
| 1991 | static ContributionInfo **DestroyContributionThreadSet( |
| 1992 | ContributionInfo **contribution) |
| 1993 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1994 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1995 | i; |
| 1996 | |
| 1997 | assert(contribution != (ContributionInfo **) NULL); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 1998 | for (i=0; i < (ssize_t) GetOpenMPMaximumThreads(); i++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 1999 | if (contribution[i] != (ContributionInfo *) NULL) |
| 2000 | contribution[i]=(ContributionInfo *) RelinquishMagickMemory( |
| 2001 | contribution[i]); |
cristy | b41ee10 | 2010-10-04 16:46:15 +0000 | [diff] [blame] | 2002 | contribution=(ContributionInfo **) RelinquishMagickMemory(contribution); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2003 | return(contribution); |
| 2004 | } |
| 2005 | |
| 2006 | static ContributionInfo **AcquireContributionThreadSet(const size_t count) |
| 2007 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2008 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2009 | i; |
| 2010 | |
| 2011 | ContributionInfo |
| 2012 | **contribution; |
| 2013 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2014 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2015 | number_threads; |
| 2016 | |
| 2017 | number_threads=GetOpenMPMaximumThreads(); |
cristy | b41ee10 | 2010-10-04 16:46:15 +0000 | [diff] [blame] | 2018 | contribution=(ContributionInfo **) AcquireQuantumMemory(number_threads, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2019 | sizeof(*contribution)); |
| 2020 | if (contribution == (ContributionInfo **) NULL) |
| 2021 | return((ContributionInfo **) NULL); |
| 2022 | (void) ResetMagickMemory(contribution,0,number_threads*sizeof(*contribution)); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2023 | for (i=0; i < (ssize_t) number_threads; i++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2024 | { |
| 2025 | contribution[i]=(ContributionInfo *) AcquireQuantumMemory(count, |
| 2026 | sizeof(**contribution)); |
| 2027 | if (contribution[i] == (ContributionInfo *) NULL) |
| 2028 | return(DestroyContributionThreadSet(contribution)); |
| 2029 | } |
| 2030 | return(contribution); |
| 2031 | } |
| 2032 | |
| 2033 | static inline double MagickMax(const double x,const double y) |
| 2034 | { |
| 2035 | if (x > y) |
| 2036 | return(x); |
| 2037 | return(y); |
| 2038 | } |
| 2039 | |
| 2040 | static inline double MagickMin(const double x,const double y) |
| 2041 | { |
| 2042 | if (x < y) |
| 2043 | return(x); |
| 2044 | return(y); |
| 2045 | } |
| 2046 | |
| 2047 | static MagickBooleanType HorizontalFilter(const ResizeFilter *resize_filter, |
| 2048 | const Image *image,Image *resize_image,const MagickRealType x_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2049 | const MagickSizeType span,MagickOffsetType *offset,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2050 | { |
| 2051 | #define ResizeImageTag "Resize/Image" |
| 2052 | |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2053 | CacheView |
| 2054 | *image_view, |
| 2055 | *resize_view; |
| 2056 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2057 | ClassType |
| 2058 | storage_class; |
| 2059 | |
| 2060 | ContributionInfo |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2061 | **restrict contributions; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2062 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2063 | MagickBooleanType |
| 2064 | status; |
| 2065 | |
| 2066 | MagickPixelPacket |
| 2067 | zero; |
| 2068 | |
| 2069 | MagickRealType |
| 2070 | scale, |
| 2071 | support; |
| 2072 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2073 | ssize_t |
| 2074 | x; |
| 2075 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2076 | /* |
| 2077 | Apply filter to resize horizontally from image to resize image. |
| 2078 | */ |
cristy | 5d82438 | 2010-09-06 14:00:17 +0000 | [diff] [blame] | 2079 | scale=MagickMax(1.0/x_factor+MagickEpsilon,1.0); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2080 | support=scale*GetResizeFilterSupport(resize_filter); |
| 2081 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| 2082 | if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| 2083 | { |
| 2084 | InheritException(exception,&resize_image->exception); |
| 2085 | return(MagickFalse); |
| 2086 | } |
| 2087 | if (support < 0.5) |
| 2088 | { |
| 2089 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 2090 | Support too small even for nearest neighbour: Reduce to point |
| 2091 | sampling. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2092 | */ |
| 2093 | support=(MagickRealType) 0.5; |
| 2094 | scale=1.0; |
| 2095 | } |
| 2096 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| 2097 | if (contributions == (ContributionInfo **) NULL) |
| 2098 | { |
| 2099 | (void) ThrowMagickException(exception,GetMagickModule(), |
| 2100 | ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| 2101 | return(MagickFalse); |
| 2102 | } |
| 2103 | status=MagickTrue; |
| 2104 | scale=1.0/scale; |
| 2105 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2106 | image_view=AcquireCacheView(image); |
| 2107 | resize_view=AcquireCacheView(resize_image); |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2108 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2109 | #pragma omp parallel for shared(status) |
| 2110 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2111 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2112 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2113 | MagickRealType |
| 2114 | center, |
| 2115 | density; |
| 2116 | |
| 2117 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2118 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2119 | |
| 2120 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2121 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2122 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2123 | register ContributionInfo |
| 2124 | *restrict contribution; |
| 2125 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2126 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2127 | *restrict resize_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2128 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2129 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2130 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2131 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2132 | register ssize_t |
| 2133 | y; |
| 2134 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2135 | ssize_t |
| 2136 | n, |
| 2137 | start, |
| 2138 | stop; |
| 2139 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2140 | if (status == MagickFalse) |
| 2141 | continue; |
| 2142 | center=(MagickRealType) (x+0.5)/x_factor; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2143 | start=(ssize_t) MagickMax(center-support+0.5,0.0); |
| 2144 | stop=(ssize_t) MagickMin(center+support+0.5,(double) image->columns); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2145 | density=0.0; |
| 2146 | contribution=contributions[GetOpenMPThreadId()]; |
| 2147 | for (n=0; n < (stop-start); n++) |
| 2148 | { |
| 2149 | contribution[n].pixel=start+n; |
| 2150 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| 2151 | ((MagickRealType) (start+n)-center+0.5)); |
| 2152 | density+=contribution[n].weight; |
| 2153 | } |
| 2154 | if ((density != 0.0) && (density != 1.0)) |
| 2155 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2156 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2157 | i; |
| 2158 | |
| 2159 | /* |
| 2160 | Normalize. |
| 2161 | */ |
| 2162 | density=1.0/density; |
| 2163 | for (i=0; i < n; i++) |
| 2164 | contribution[i].weight*=density; |
| 2165 | } |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2166 | p=GetCacheViewVirtualPixels(image_view,contribution[0].pixel,0,(size_t) |
| 2167 | (contribution[n-1].pixel-contribution[0].pixel+1),image->rows,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2168 | q=QueueCacheViewAuthenticPixels(resize_view,x,0,1,resize_image->rows, |
| 2169 | exception); |
| 2170 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2171 | { |
| 2172 | status=MagickFalse; |
| 2173 | continue; |
| 2174 | } |
| 2175 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
| 2176 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2177 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2178 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2179 | MagickPixelPacket |
| 2180 | pixel; |
| 2181 | |
| 2182 | MagickRealType |
| 2183 | alpha; |
| 2184 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2185 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2186 | i; |
| 2187 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2188 | ssize_t |
| 2189 | j; |
| 2190 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2191 | pixel=zero; |
| 2192 | if (image->matte == MagickFalse) |
| 2193 | { |
| 2194 | for (i=0; i < n; i++) |
| 2195 | { |
| 2196 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2197 | (contribution[i].pixel-contribution[0].pixel); |
| 2198 | alpha=contribution[i].weight; |
| 2199 | pixel.red+=alpha*(p+j)->red; |
| 2200 | pixel.green+=alpha*(p+j)->green; |
| 2201 | pixel.blue+=alpha*(p+j)->blue; |
| 2202 | pixel.opacity+=alpha*(p+j)->opacity; |
| 2203 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2204 | SetRedPixelComponent(q,ClampRedPixelComponent(&pixel)); |
| 2205 | SetGreenPixelComponent(q,ClampGreenPixelComponent(&pixel)); |
| 2206 | SetBluePixelComponent(q,ClampBluePixelComponent(&pixel)); |
| 2207 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2208 | if ((image->colorspace == CMYKColorspace) && |
| 2209 | (resize_image->colorspace == CMYKColorspace)) |
| 2210 | { |
| 2211 | for (i=0; i < n; i++) |
| 2212 | { |
| 2213 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2214 | (contribution[i].pixel-contribution[0].pixel); |
| 2215 | alpha=contribution[i].weight; |
| 2216 | pixel.index+=alpha*indexes[j]; |
| 2217 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2218 | resize_indexes[y]=(IndexPacket) ClampToQuantum(pixel.index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2219 | } |
| 2220 | } |
| 2221 | else |
| 2222 | { |
| 2223 | MagickRealType |
| 2224 | gamma; |
| 2225 | |
| 2226 | gamma=0.0; |
| 2227 | for (i=0; i < n; i++) |
| 2228 | { |
| 2229 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2230 | (contribution[i].pixel-contribution[0].pixel); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2231 | alpha=contribution[i].weight*QuantumScale* |
| 2232 | GetAlphaPixelComponent(p+j); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2233 | pixel.red+=alpha*(p+j)->red; |
| 2234 | pixel.green+=alpha*(p+j)->green; |
| 2235 | pixel.blue+=alpha*(p+j)->blue; |
| 2236 | pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| 2237 | gamma+=alpha; |
| 2238 | } |
| 2239 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2240 | q->red=ClampToQuantum(gamma*GetRedPixelComponent(&pixel)); |
| 2241 | q->green=ClampToQuantum(gamma*GetGreenPixelComponent(&pixel)); |
| 2242 | q->blue=ClampToQuantum(gamma*GetBluePixelComponent(&pixel)); |
| 2243 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2244 | if ((image->colorspace == CMYKColorspace) && |
| 2245 | (resize_image->colorspace == CMYKColorspace)) |
| 2246 | { |
| 2247 | for (i=0; i < n; i++) |
| 2248 | { |
| 2249 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2250 | (contribution[i].pixel-contribution[0].pixel); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2251 | alpha=contribution[i].weight*QuantumScale* |
| 2252 | GetAlphaPixelComponent(p+j); |
cristy | c197d1c | 2009-10-13 19:56:53 +0000 | [diff] [blame] | 2253 | pixel.index+=alpha*indexes[j]; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2254 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2255 | resize_indexes[y]=(IndexPacket) ClampToQuantum(gamma* |
| 2256 | GetIndexPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2257 | } |
| 2258 | } |
| 2259 | if ((resize_image->storage_class == PseudoClass) && |
| 2260 | (image->storage_class == PseudoClass)) |
| 2261 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2262 | i=(ssize_t) (MagickMin(MagickMax(center,(double) start),(double) stop- |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2263 | 1.0)+0.5); |
| 2264 | j=y*(contribution[n-1].pixel-contribution[0].pixel+1)+ |
| 2265 | (contribution[i-start].pixel-contribution[0].pixel); |
| 2266 | resize_indexes[y]=indexes[j]; |
| 2267 | } |
| 2268 | q++; |
| 2269 | } |
| 2270 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 2271 | status=MagickFalse; |
| 2272 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2273 | { |
| 2274 | MagickBooleanType |
| 2275 | proceed; |
| 2276 | |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2277 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2278 | #pragma omp critical (MagickCore_HorizontalFilter) |
| 2279 | #endif |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2280 | proceed=SetImageProgress(image,ResizeImageTag,(*offset)++,span); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2281 | if (proceed == MagickFalse) |
| 2282 | status=MagickFalse; |
| 2283 | } |
| 2284 | } |
| 2285 | resize_view=DestroyCacheView(resize_view); |
| 2286 | image_view=DestroyCacheView(image_view); |
| 2287 | contributions=DestroyContributionThreadSet(contributions); |
| 2288 | return(status); |
| 2289 | } |
| 2290 | |
| 2291 | static MagickBooleanType VerticalFilter(const ResizeFilter *resize_filter, |
| 2292 | const Image *image,Image *resize_image,const MagickRealType y_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2293 | const MagickSizeType span,MagickOffsetType *offset,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2294 | { |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2295 | CacheView |
| 2296 | *image_view, |
| 2297 | *resize_view; |
| 2298 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2299 | ClassType |
| 2300 | storage_class; |
| 2301 | |
| 2302 | ContributionInfo |
cristy | fa11211 | 2010-01-04 17:48:07 +0000 | [diff] [blame] | 2303 | **restrict contributions; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2304 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2305 | MagickBooleanType |
| 2306 | status; |
| 2307 | |
| 2308 | MagickPixelPacket |
| 2309 | zero; |
| 2310 | |
| 2311 | MagickRealType |
| 2312 | scale, |
| 2313 | support; |
| 2314 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2315 | ssize_t |
| 2316 | y; |
| 2317 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2318 | /* |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2319 | Apply filter to resize vertically from image to resize image. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2320 | */ |
cristy | 5d82438 | 2010-09-06 14:00:17 +0000 | [diff] [blame] | 2321 | scale=MagickMax(1.0/y_factor+MagickEpsilon,1.0); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2322 | support=scale*GetResizeFilterSupport(resize_filter); |
| 2323 | storage_class=support > 0.5 ? DirectClass : image->storage_class; |
| 2324 | if (SetImageStorageClass(resize_image,storage_class) == MagickFalse) |
| 2325 | { |
| 2326 | InheritException(exception,&resize_image->exception); |
| 2327 | return(MagickFalse); |
| 2328 | } |
| 2329 | if (support < 0.5) |
| 2330 | { |
| 2331 | /* |
nicolas | 07bac81 | 2010-09-19 18:47:02 +0000 | [diff] [blame] | 2332 | Support too small even for nearest neighbour: Reduce to point |
| 2333 | sampling. |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2334 | */ |
| 2335 | support=(MagickRealType) 0.5; |
| 2336 | scale=1.0; |
| 2337 | } |
| 2338 | contributions=AcquireContributionThreadSet((size_t) (2.0*support+3.0)); |
| 2339 | if (contributions == (ContributionInfo **) NULL) |
| 2340 | { |
| 2341 | (void) ThrowMagickException(exception,GetMagickModule(), |
| 2342 | ResourceLimitError,"MemoryAllocationFailed","`%s'",image->filename); |
| 2343 | return(MagickFalse); |
| 2344 | } |
| 2345 | status=MagickTrue; |
| 2346 | scale=1.0/scale; |
| 2347 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2348 | image_view=AcquireCacheView(image); |
| 2349 | resize_view=AcquireCacheView(resize_image); |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2350 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2351 | #pragma omp parallel for shared(status) |
| 2352 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2353 | for (y=0; y < (ssize_t) resize_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2354 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2355 | MagickRealType |
| 2356 | center, |
| 2357 | density; |
| 2358 | |
| 2359 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2360 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2361 | |
| 2362 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2363 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2364 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2365 | register ContributionInfo |
| 2366 | *restrict contribution; |
| 2367 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2368 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2369 | *restrict resize_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2370 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2371 | register PixelPacket |
| 2372 | *restrict q; |
| 2373 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2374 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2375 | x; |
| 2376 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2377 | ssize_t |
| 2378 | n, |
| 2379 | start, |
| 2380 | stop; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2381 | |
| 2382 | if (status == MagickFalse) |
| 2383 | continue; |
cristy | 679e696 | 2010-03-18 00:42:45 +0000 | [diff] [blame] | 2384 | center=(MagickRealType) (y+0.5)/y_factor; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2385 | start=(ssize_t) MagickMax(center-support+0.5,0.0); |
| 2386 | stop=(ssize_t) MagickMin(center+support+0.5,(double) image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2387 | density=0.0; |
| 2388 | contribution=contributions[GetOpenMPThreadId()]; |
| 2389 | for (n=0; n < (stop-start); n++) |
| 2390 | { |
| 2391 | contribution[n].pixel=start+n; |
| 2392 | contribution[n].weight=GetResizeFilterWeight(resize_filter,scale* |
| 2393 | ((MagickRealType) (start+n)-center+0.5)); |
| 2394 | density+=contribution[n].weight; |
| 2395 | } |
| 2396 | if ((density != 0.0) && (density != 1.0)) |
| 2397 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2398 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2399 | i; |
| 2400 | |
| 2401 | /* |
| 2402 | Normalize. |
| 2403 | */ |
| 2404 | density=1.0/density; |
| 2405 | for (i=0; i < n; i++) |
| 2406 | contribution[i].weight*=density; |
| 2407 | } |
| 2408 | p=GetCacheViewVirtualPixels(image_view,0,contribution[0].pixel, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2409 | image->columns,(size_t) (contribution[n-1].pixel-contribution[0].pixel+1), |
| 2410 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2411 | q=QueueCacheViewAuthenticPixels(resize_view,0,y,resize_image->columns,1, |
| 2412 | exception); |
| 2413 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2414 | { |
| 2415 | status=MagickFalse; |
| 2416 | continue; |
| 2417 | } |
| 2418 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
| 2419 | resize_indexes=GetCacheViewAuthenticIndexQueue(resize_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2420 | for (x=0; x < (ssize_t) resize_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2421 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2422 | MagickPixelPacket |
| 2423 | pixel; |
| 2424 | |
| 2425 | MagickRealType |
| 2426 | alpha; |
| 2427 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2428 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2429 | i; |
| 2430 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2431 | ssize_t |
| 2432 | j; |
| 2433 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2434 | pixel=zero; |
| 2435 | if (image->matte == MagickFalse) |
| 2436 | { |
| 2437 | for (i=0; i < n; i++) |
| 2438 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2439 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2440 | image->columns+x); |
| 2441 | alpha=contribution[i].weight; |
| 2442 | pixel.red+=alpha*(p+j)->red; |
| 2443 | pixel.green+=alpha*(p+j)->green; |
| 2444 | pixel.blue+=alpha*(p+j)->blue; |
| 2445 | pixel.opacity+=alpha*(p+j)->opacity; |
| 2446 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2447 | SetRedPixelComponent(q,ClampRedPixelComponent(&pixel)); |
| 2448 | SetGreenPixelComponent(q,ClampGreenPixelComponent(&pixel)); |
| 2449 | SetBluePixelComponent(q,ClampBluePixelComponent(&pixel)); |
| 2450 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2451 | if ((image->colorspace == CMYKColorspace) && |
| 2452 | (resize_image->colorspace == CMYKColorspace)) |
| 2453 | { |
| 2454 | for (i=0; i < n; i++) |
| 2455 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2456 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2457 | image->columns+x); |
| 2458 | alpha=contribution[i].weight; |
| 2459 | pixel.index+=alpha*indexes[j]; |
| 2460 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2461 | resize_indexes[x]=(IndexPacket) ClampToQuantum(pixel.index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2462 | } |
| 2463 | } |
| 2464 | else |
| 2465 | { |
| 2466 | MagickRealType |
| 2467 | gamma; |
| 2468 | |
| 2469 | gamma=0.0; |
| 2470 | for (i=0; i < n; i++) |
| 2471 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2472 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2473 | image->columns+x); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2474 | alpha=contribution[i].weight*QuantumScale* |
| 2475 | GetAlphaPixelComponent(p+j); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2476 | pixel.red+=alpha*(p+j)->red; |
| 2477 | pixel.green+=alpha*(p+j)->green; |
| 2478 | pixel.blue+=alpha*(p+j)->blue; |
| 2479 | pixel.opacity+=contribution[i].weight*(p+j)->opacity; |
| 2480 | gamma+=alpha; |
| 2481 | } |
| 2482 | gamma=1.0/(fabs((double) gamma) <= MagickEpsilon ? 1.0 : gamma); |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2483 | q->red=ClampToQuantum(gamma*GetRedPixelComponent(&pixel)); |
| 2484 | q->green=ClampToQuantum(gamma*GetGreenPixelComponent(&pixel)); |
| 2485 | q->blue=ClampToQuantum(gamma*GetBluePixelComponent(&pixel)); |
| 2486 | SetOpacityPixelComponent(q,ClampOpacityPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2487 | if ((image->colorspace == CMYKColorspace) && |
| 2488 | (resize_image->colorspace == CMYKColorspace)) |
| 2489 | { |
| 2490 | for (i=0; i < n; i++) |
| 2491 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2492 | j=(ssize_t) ((contribution[i].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2493 | image->columns+x); |
cristy | 46f0820 | 2010-01-10 04:04:21 +0000 | [diff] [blame] | 2494 | alpha=contribution[i].weight*QuantumScale* |
| 2495 | GetAlphaPixelComponent(p+j); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2496 | pixel.index+=alpha*indexes[j]; |
| 2497 | } |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2498 | resize_indexes[x]=(IndexPacket) ClampToQuantum(gamma* |
| 2499 | GetIndexPixelComponent(&pixel)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2500 | } |
| 2501 | } |
| 2502 | if ((resize_image->storage_class == PseudoClass) && |
| 2503 | (image->storage_class == PseudoClass)) |
| 2504 | { |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2505 | i=(ssize_t) (MagickMin(MagickMax(center,(double) start),(double) stop- |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2506 | 1.0)+0.5); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2507 | j=(ssize_t) ((contribution[i-start].pixel-contribution[0].pixel)* |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2508 | image->columns+x); |
| 2509 | resize_indexes[x]=indexes[j]; |
| 2510 | } |
| 2511 | q++; |
| 2512 | } |
| 2513 | if (SyncCacheViewAuthenticPixels(resize_view,exception) == MagickFalse) |
| 2514 | status=MagickFalse; |
| 2515 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2516 | { |
| 2517 | MagickBooleanType |
| 2518 | proceed; |
| 2519 | |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2520 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2521 | #pragma omp critical (MagickCore_VerticalFilter) |
| 2522 | #endif |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2523 | proceed=SetImageProgress(image,ResizeImageTag,(*offset)++,span); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2524 | if (proceed == MagickFalse) |
| 2525 | status=MagickFalse; |
| 2526 | } |
| 2527 | } |
| 2528 | resize_view=DestroyCacheView(resize_view); |
| 2529 | image_view=DestroyCacheView(image_view); |
| 2530 | contributions=DestroyContributionThreadSet(contributions); |
| 2531 | return(status); |
| 2532 | } |
| 2533 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2534 | MagickExport Image *ResizeImage(const Image *image,const size_t columns, |
| 2535 | const size_t rows,const FilterTypes filter,const double blur, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2536 | ExceptionInfo *exception) |
| 2537 | { |
| 2538 | #define WorkLoadFactor 0.265 |
| 2539 | |
| 2540 | FilterTypes |
| 2541 | filter_type; |
| 2542 | |
| 2543 | Image |
| 2544 | *filter_image, |
| 2545 | *resize_image; |
| 2546 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2547 | MagickOffsetType |
| 2548 | offset; |
| 2549 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2550 | MagickRealType |
| 2551 | x_factor, |
| 2552 | y_factor; |
| 2553 | |
| 2554 | MagickSizeType |
| 2555 | span; |
| 2556 | |
| 2557 | MagickStatusType |
| 2558 | status; |
| 2559 | |
| 2560 | ResizeFilter |
| 2561 | *resize_filter; |
| 2562 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2563 | /* |
| 2564 | Acquire resize image. |
| 2565 | */ |
| 2566 | assert(image != (Image *) NULL); |
| 2567 | assert(image->signature == MagickSignature); |
| 2568 | if (image->debug != MagickFalse) |
| 2569 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2570 | assert(exception != (ExceptionInfo *) NULL); |
| 2571 | assert(exception->signature == MagickSignature); |
| 2572 | if ((columns == 0) || (rows == 0)) |
| 2573 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| 2574 | if ((columns == image->columns) && (rows == image->rows) && |
| 2575 | (filter == UndefinedFilter) && (blur == 1.0)) |
| 2576 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2577 | resize_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2578 | if (resize_image == (Image *) NULL) |
| 2579 | return(resize_image); |
| 2580 | /* |
| 2581 | Acquire resize filter. |
| 2582 | */ |
| 2583 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| 2584 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| 2585 | if ((x_factor*y_factor) > WorkLoadFactor) |
| 2586 | filter_image=CloneImage(image,columns,image->rows,MagickTrue,exception); |
| 2587 | else |
| 2588 | filter_image=CloneImage(image,image->columns,rows,MagickTrue,exception); |
| 2589 | if (filter_image == (Image *) NULL) |
| 2590 | return(DestroyImage(resize_image)); |
| 2591 | filter_type=LanczosFilter; |
| 2592 | if (filter != UndefinedFilter) |
| 2593 | filter_type=filter; |
| 2594 | else |
| 2595 | if ((x_factor == 1.0) && (y_factor == 1.0)) |
| 2596 | filter_type=PointFilter; |
| 2597 | else |
| 2598 | if ((image->storage_class == PseudoClass) || |
| 2599 | (image->matte != MagickFalse) || ((x_factor*y_factor) > 1.0)) |
| 2600 | filter_type=MitchellFilter; |
| 2601 | resize_filter=AcquireResizeFilter(image,filter_type,blur,MagickFalse, |
| 2602 | exception); |
| 2603 | /* |
| 2604 | Resize image. |
| 2605 | */ |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2606 | offset=0; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2607 | if ((x_factor*y_factor) > WorkLoadFactor) |
| 2608 | { |
| 2609 | span=(MagickSizeType) (filter_image->columns+rows); |
| 2610 | status=HorizontalFilter(resize_filter,image,filter_image,x_factor,span, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2611 | &offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2612 | status&=VerticalFilter(resize_filter,filter_image,resize_image,y_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2613 | span,&offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2614 | } |
| 2615 | else |
| 2616 | { |
| 2617 | span=(MagickSizeType) (filter_image->rows+columns); |
| 2618 | status=VerticalFilter(resize_filter,image,filter_image,y_factor,span, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2619 | &offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2620 | status&=HorizontalFilter(resize_filter,filter_image,resize_image,x_factor, |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2621 | span,&offset,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2622 | } |
| 2623 | /* |
| 2624 | Free resources. |
| 2625 | */ |
| 2626 | filter_image=DestroyImage(filter_image); |
| 2627 | resize_filter=DestroyResizeFilter(resize_filter); |
| 2628 | if ((status == MagickFalse) || (resize_image == (Image *) NULL)) |
| 2629 | return((Image *) NULL); |
| 2630 | resize_image->type=image->type; |
| 2631 | return(resize_image); |
| 2632 | } |
| 2633 | |
| 2634 | /* |
| 2635 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2636 | % % |
| 2637 | % % |
| 2638 | % % |
| 2639 | % S a m p l e I m a g e % |
| 2640 | % % |
| 2641 | % % |
| 2642 | % % |
| 2643 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2644 | % |
| 2645 | % SampleImage() scales an image to the desired dimensions with pixel |
| 2646 | % sampling. Unlike other scaling methods, this method does not introduce |
| 2647 | % any additional color into the scaled image. |
| 2648 | % |
| 2649 | % The format of the SampleImage method is: |
| 2650 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2651 | % Image *SampleImage(const Image *image,const size_t columns, |
| 2652 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2653 | % |
| 2654 | % A description of each parameter follows: |
| 2655 | % |
| 2656 | % o image: the image. |
| 2657 | % |
| 2658 | % o columns: the number of columns in the sampled image. |
| 2659 | % |
| 2660 | % o rows: the number of rows in the sampled image. |
| 2661 | % |
| 2662 | % o exception: return any errors or warnings in this structure. |
| 2663 | % |
| 2664 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2665 | MagickExport Image *SampleImage(const Image *image,const size_t columns, |
| 2666 | const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2667 | { |
| 2668 | #define SampleImageTag "Sample/Image" |
| 2669 | |
cristy | c4c8d13 | 2010-01-07 01:58:38 +0000 | [diff] [blame] | 2670 | CacheView |
| 2671 | *image_view, |
| 2672 | *sample_view; |
| 2673 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2674 | Image |
| 2675 | *sample_image; |
| 2676 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2677 | MagickBooleanType |
| 2678 | status; |
| 2679 | |
cristy | 5f95947 | 2010-05-27 22:19:46 +0000 | [diff] [blame] | 2680 | MagickOffsetType |
| 2681 | progress; |
| 2682 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2683 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2684 | x; |
| 2685 | |
cristy | 5f95947 | 2010-05-27 22:19:46 +0000 | [diff] [blame] | 2686 | ssize_t |
| 2687 | *x_offset, |
| 2688 | y; |
| 2689 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2690 | /* |
| 2691 | Initialize sampled image attributes. |
| 2692 | */ |
| 2693 | assert(image != (const Image *) NULL); |
| 2694 | assert(image->signature == MagickSignature); |
| 2695 | if (image->debug != MagickFalse) |
| 2696 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2697 | assert(exception != (ExceptionInfo *) NULL); |
| 2698 | assert(exception->signature == MagickSignature); |
| 2699 | if ((columns == 0) || (rows == 0)) |
| 2700 | ThrowImageException(ImageError,"NegativeOrZeroImageSize"); |
| 2701 | if ((columns == image->columns) && (rows == image->rows)) |
| 2702 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2703 | sample_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2704 | if (sample_image == (Image *) NULL) |
| 2705 | return((Image *) NULL); |
| 2706 | /* |
| 2707 | Allocate scan line buffer and column offset buffers. |
| 2708 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2709 | x_offset=(ssize_t *) AcquireQuantumMemory((size_t) sample_image->columns, |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2710 | sizeof(*x_offset)); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2711 | if (x_offset == (ssize_t *) NULL) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2712 | { |
| 2713 | sample_image=DestroyImage(sample_image); |
| 2714 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 2715 | } |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2716 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
| 2717 | x_offset[x]=(ssize_t) (((MagickRealType) x+0.5)*image->columns/ |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2718 | sample_image->columns); |
| 2719 | /* |
| 2720 | Sample each row. |
| 2721 | */ |
| 2722 | status=MagickTrue; |
| 2723 | progress=0; |
| 2724 | image_view=AcquireCacheView(image); |
| 2725 | sample_view=AcquireCacheView(sample_image); |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2726 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
| 2727 | #pragma omp parallel for schedule(dynamic,4) shared(progress,status) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2728 | #endif |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2729 | for (y=0; y < (ssize_t) sample_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2730 | { |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2731 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2732 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2733 | |
| 2734 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2735 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2736 | |
| 2737 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2738 | *restrict sample_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2739 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2740 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2741 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2742 | |
cristy | 03dbbd2 | 2010-09-19 23:04:47 +0000 | [diff] [blame] | 2743 | register ssize_t |
| 2744 | x; |
| 2745 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2746 | ssize_t |
| 2747 | y_offset; |
| 2748 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2749 | if (status == MagickFalse) |
| 2750 | continue; |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2751 | y_offset=(ssize_t) (((MagickRealType) y+0.5)*image->rows/ |
| 2752 | sample_image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2753 | p=GetCacheViewVirtualPixels(image_view,0,y_offset,image->columns,1, |
| 2754 | exception); |
| 2755 | q=QueueCacheViewAuthenticPixels(sample_view,0,y,sample_image->columns,1, |
| 2756 | exception); |
| 2757 | if ((p == (const PixelPacket *) NULL) || (q == (PixelPacket *) NULL)) |
| 2758 | { |
| 2759 | status=MagickFalse; |
| 2760 | continue; |
| 2761 | } |
| 2762 | indexes=GetCacheViewAuthenticIndexQueue(image_view); |
| 2763 | sample_indexes=GetCacheViewAuthenticIndexQueue(sample_view); |
| 2764 | /* |
| 2765 | Sample each column. |
| 2766 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2767 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2768 | *q++=p[x_offset[x]]; |
| 2769 | if ((image->storage_class == PseudoClass) || |
| 2770 | (image->colorspace == CMYKColorspace)) |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2771 | for (x=0; x < (ssize_t) sample_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2772 | sample_indexes[x]=indexes[x_offset[x]]; |
| 2773 | if (SyncCacheViewAuthenticPixels(sample_view,exception) == MagickFalse) |
| 2774 | status=MagickFalse; |
| 2775 | if (image->progress_monitor != (MagickProgressMonitor) NULL) |
| 2776 | { |
| 2777 | MagickBooleanType |
| 2778 | proceed; |
| 2779 | |
cristy | b5d5f72 | 2009-11-04 03:03:49 +0000 | [diff] [blame] | 2780 | #if defined(MAGICKCORE_OPENMP_SUPPORT) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2781 | #pragma omp critical (MagickCore_SampleImage) |
| 2782 | #endif |
| 2783 | proceed=SetImageProgress(image,SampleImageTag,progress++,image->rows); |
| 2784 | if (proceed == MagickFalse) |
| 2785 | status=MagickFalse; |
| 2786 | } |
| 2787 | } |
| 2788 | image_view=DestroyCacheView(image_view); |
| 2789 | sample_view=DestroyCacheView(sample_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2790 | x_offset=(ssize_t *) RelinquishMagickMemory(x_offset); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2791 | sample_image->type=image->type; |
| 2792 | return(sample_image); |
| 2793 | } |
| 2794 | |
| 2795 | /* |
| 2796 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2797 | % % |
| 2798 | % % |
| 2799 | % % |
| 2800 | % S c a l e I m a g e % |
| 2801 | % % |
| 2802 | % % |
| 2803 | % % |
| 2804 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 2805 | % |
| 2806 | % ScaleImage() changes the size of an image to the given dimensions. |
| 2807 | % |
| 2808 | % The format of the ScaleImage method is: |
| 2809 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2810 | % Image *ScaleImage(const Image *image,const size_t columns, |
| 2811 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2812 | % |
| 2813 | % A description of each parameter follows: |
| 2814 | % |
| 2815 | % o image: the image. |
| 2816 | % |
| 2817 | % o columns: the number of columns in the scaled image. |
| 2818 | % |
| 2819 | % o rows: the number of rows in the scaled image. |
| 2820 | % |
| 2821 | % o exception: return any errors or warnings in this structure. |
| 2822 | % |
| 2823 | */ |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2824 | MagickExport Image *ScaleImage(const Image *image,const size_t columns, |
| 2825 | const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2826 | { |
| 2827 | #define ScaleImageTag "Scale/Image" |
| 2828 | |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2829 | CacheView |
| 2830 | *image_view, |
| 2831 | *scale_view; |
| 2832 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2833 | Image |
| 2834 | *scale_image; |
| 2835 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2836 | MagickBooleanType |
| 2837 | next_column, |
| 2838 | next_row, |
| 2839 | proceed; |
| 2840 | |
| 2841 | MagickPixelPacket |
| 2842 | pixel, |
| 2843 | *scale_scanline, |
| 2844 | *scanline, |
| 2845 | *x_vector, |
| 2846 | *y_vector, |
| 2847 | zero; |
| 2848 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2849 | PointInfo |
| 2850 | scale, |
| 2851 | span; |
| 2852 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2853 | register ssize_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2854 | i; |
| 2855 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2856 | ssize_t |
| 2857 | number_rows, |
| 2858 | y; |
| 2859 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2860 | /* |
| 2861 | Initialize scaled image attributes. |
| 2862 | */ |
| 2863 | assert(image != (const Image *) NULL); |
| 2864 | assert(image->signature == MagickSignature); |
| 2865 | if (image->debug != MagickFalse) |
| 2866 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 2867 | assert(exception != (ExceptionInfo *) NULL); |
| 2868 | assert(exception->signature == MagickSignature); |
| 2869 | if ((columns == 0) || (rows == 0)) |
| 2870 | return((Image *) NULL); |
| 2871 | if ((columns == image->columns) && (rows == image->rows)) |
| 2872 | return(CloneImage(image,0,0,MagickTrue,exception)); |
| 2873 | scale_image=CloneImage(image,columns,rows,MagickTrue,exception); |
| 2874 | if (scale_image == (Image *) NULL) |
| 2875 | return((Image *) NULL); |
| 2876 | if (SetImageStorageClass(scale_image,DirectClass) == MagickFalse) |
| 2877 | { |
| 2878 | InheritException(exception,&scale_image->exception); |
| 2879 | scale_image=DestroyImage(scale_image); |
| 2880 | return((Image *) NULL); |
| 2881 | } |
| 2882 | /* |
| 2883 | Allocate memory. |
| 2884 | */ |
| 2885 | x_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2886 | sizeof(*x_vector)); |
| 2887 | scanline=x_vector; |
| 2888 | if (image->rows != scale_image->rows) |
| 2889 | scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2890 | sizeof(*scanline)); |
| 2891 | scale_scanline=(MagickPixelPacket *) AcquireQuantumMemory((size_t) |
| 2892 | scale_image->columns,sizeof(*scale_scanline)); |
| 2893 | y_vector=(MagickPixelPacket *) AcquireQuantumMemory((size_t) image->columns, |
| 2894 | sizeof(*y_vector)); |
| 2895 | if ((scanline == (MagickPixelPacket *) NULL) || |
| 2896 | (scale_scanline == (MagickPixelPacket *) NULL) || |
| 2897 | (x_vector == (MagickPixelPacket *) NULL) || |
| 2898 | (y_vector == (MagickPixelPacket *) NULL)) |
| 2899 | { |
| 2900 | scale_image=DestroyImage(scale_image); |
| 2901 | ThrowImageException(ResourceLimitError,"MemoryAllocationFailed"); |
| 2902 | } |
| 2903 | /* |
| 2904 | Scale image. |
| 2905 | */ |
| 2906 | number_rows=0; |
| 2907 | next_row=MagickTrue; |
| 2908 | span.y=1.0; |
| 2909 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 2910 | (void) ResetMagickMemory(y_vector,0,(size_t) image->columns* |
| 2911 | sizeof(*y_vector)); |
| 2912 | GetMagickPixelPacket(image,&pixel); |
| 2913 | (void) ResetMagickMemory(&zero,0,sizeof(zero)); |
| 2914 | i=0; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2915 | image_view=AcquireCacheView(image); |
| 2916 | scale_view=AcquireCacheView(scale_image); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2917 | for (y=0; y < (ssize_t) scale_image->rows; y++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2918 | { |
| 2919 | register const IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2920 | *restrict indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2921 | |
| 2922 | register const PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2923 | *restrict p; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2924 | |
| 2925 | register IndexPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2926 | *restrict scale_indexes; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2927 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2928 | register MagickPixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2929 | *restrict s, |
| 2930 | *restrict t; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2931 | |
| 2932 | register PixelPacket |
cristy | c47d1f8 | 2009-11-26 01:44:43 +0000 | [diff] [blame] | 2933 | *restrict q; |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2934 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2935 | register ssize_t |
| 2936 | x; |
| 2937 | |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2938 | q=QueueCacheViewAuthenticPixels(scale_view,0,y,scale_image->columns,1, |
| 2939 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2940 | if (q == (PixelPacket *) NULL) |
| 2941 | break; |
cristy | ba9a1e2 | 2010-11-10 23:14:28 +0000 | [diff] [blame] | 2942 | scale_indexes=GetCacheViewAuthenticIndexQueue(scale_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2943 | if (scale_image->rows == image->rows) |
| 2944 | { |
| 2945 | /* |
| 2946 | Read a new scanline. |
| 2947 | */ |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2948 | p=GetCacheViewVirtualPixels(image_view,0,i++,image->columns,1, |
| 2949 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2950 | if (p == (const PixelPacket *) NULL) |
| 2951 | break; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2952 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2953 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2954 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2955 | x_vector[x].red=(MagickRealType) GetRedPixelComponent(p); |
| 2956 | x_vector[x].green=(MagickRealType) GetGreenPixelComponent(p); |
| 2957 | x_vector[x].blue=(MagickRealType) GetBluePixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2958 | if (image->matte != MagickFalse) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2959 | x_vector[x].opacity=(MagickRealType) GetOpacityPixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2960 | if (indexes != (IndexPacket *) NULL) |
| 2961 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2962 | p++; |
| 2963 | } |
| 2964 | } |
| 2965 | else |
| 2966 | { |
| 2967 | /* |
| 2968 | Scale Y direction. |
| 2969 | */ |
| 2970 | while (scale.y < span.y) |
| 2971 | { |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2972 | if ((next_row != MagickFalse) && |
| 2973 | (number_rows < (ssize_t) image->rows)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2974 | { |
| 2975 | /* |
| 2976 | Read a new scanline. |
| 2977 | */ |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2978 | p=GetCacheViewVirtualPixels(image_view,0,i++,image->columns,1, |
| 2979 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2980 | if (p == (const PixelPacket *) NULL) |
| 2981 | break; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2982 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2983 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2984 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 2985 | x_vector[x].red=(MagickRealType) GetRedPixelComponent(p); |
| 2986 | x_vector[x].green=(MagickRealType) GetGreenPixelComponent(p); |
| 2987 | x_vector[x].blue=(MagickRealType) GetBluePixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2988 | if (image->matte != MagickFalse) |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 2989 | x_vector[x].opacity=(MagickRealType) |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 2990 | GetOpacityPixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2991 | if (indexes != (IndexPacket *) NULL) |
| 2992 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 2993 | p++; |
| 2994 | } |
| 2995 | number_rows++; |
| 2996 | } |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 2997 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 2998 | { |
| 2999 | y_vector[x].red+=scale.y*x_vector[x].red; |
| 3000 | y_vector[x].green+=scale.y*x_vector[x].green; |
| 3001 | y_vector[x].blue+=scale.y*x_vector[x].blue; |
| 3002 | if (scale_image->matte != MagickFalse) |
| 3003 | y_vector[x].opacity+=scale.y*x_vector[x].opacity; |
| 3004 | if (scale_indexes != (IndexPacket *) NULL) |
| 3005 | y_vector[x].index+=scale.y*x_vector[x].index; |
| 3006 | } |
| 3007 | span.y-=scale.y; |
| 3008 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 3009 | next_row=MagickTrue; |
| 3010 | } |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3011 | if ((next_row != MagickFalse) && (number_rows < (ssize_t) image->rows)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3012 | { |
| 3013 | /* |
| 3014 | Read a new scanline. |
| 3015 | */ |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3016 | p=GetCacheViewVirtualPixels(image_view,0,i++,image->columns,1, |
| 3017 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3018 | if (p == (const PixelPacket *) NULL) |
| 3019 | break; |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3020 | indexes=GetCacheViewVirtualIndexQueue(image_view); |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3021 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3022 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3023 | x_vector[x].red=(MagickRealType) GetRedPixelComponent(p); |
| 3024 | x_vector[x].green=(MagickRealType) GetGreenPixelComponent(p); |
| 3025 | x_vector[x].blue=(MagickRealType) GetBluePixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3026 | if (image->matte != MagickFalse) |
cristy | 2b726bd | 2010-01-11 01:05:39 +0000 | [diff] [blame] | 3027 | x_vector[x].opacity=(MagickRealType) |
| 3028 | GetOpacityPixelComponent(p); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3029 | if (indexes != (IndexPacket *) NULL) |
| 3030 | x_vector[x].index=(MagickRealType) indexes[x]; |
| 3031 | p++; |
| 3032 | } |
| 3033 | number_rows++; |
| 3034 | next_row=MagickFalse; |
| 3035 | } |
| 3036 | s=scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3037 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3038 | { |
| 3039 | pixel.red=y_vector[x].red+span.y*x_vector[x].red; |
| 3040 | pixel.green=y_vector[x].green+span.y*x_vector[x].green; |
| 3041 | pixel.blue=y_vector[x].blue+span.y*x_vector[x].blue; |
| 3042 | if (image->matte != MagickFalse) |
| 3043 | pixel.opacity=y_vector[x].opacity+span.y*x_vector[x].opacity; |
| 3044 | if (scale_indexes != (IndexPacket *) NULL) |
| 3045 | pixel.index=y_vector[x].index+span.y*x_vector[x].index; |
| 3046 | s->red=pixel.red; |
| 3047 | s->green=pixel.green; |
| 3048 | s->blue=pixel.blue; |
| 3049 | if (scale_image->matte != MagickFalse) |
| 3050 | s->opacity=pixel.opacity; |
| 3051 | if (scale_indexes != (IndexPacket *) NULL) |
| 3052 | s->index=pixel.index; |
| 3053 | s++; |
| 3054 | y_vector[x]=zero; |
| 3055 | } |
| 3056 | scale.y-=span.y; |
| 3057 | if (scale.y <= 0) |
| 3058 | { |
| 3059 | scale.y=(double) scale_image->rows/(double) image->rows; |
| 3060 | next_row=MagickTrue; |
| 3061 | } |
| 3062 | span.y=1.0; |
| 3063 | } |
| 3064 | if (scale_image->columns == image->columns) |
| 3065 | { |
| 3066 | /* |
| 3067 | Transfer scanline to scaled image. |
| 3068 | */ |
| 3069 | s=scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3070 | for (x=0; x < (ssize_t) scale_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3071 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3072 | q->red=ClampToQuantum(s->red); |
| 3073 | q->green=ClampToQuantum(s->green); |
| 3074 | q->blue=ClampToQuantum(s->blue); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3075 | if (scale_image->matte != MagickFalse) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3076 | q->opacity=ClampToQuantum(s->opacity); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3077 | if (scale_indexes != (IndexPacket *) NULL) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3078 | scale_indexes[x]=(IndexPacket) ClampToQuantum(s->index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3079 | q++; |
| 3080 | s++; |
| 3081 | } |
| 3082 | } |
| 3083 | else |
| 3084 | { |
| 3085 | /* |
| 3086 | Scale X direction. |
| 3087 | */ |
| 3088 | pixel=zero; |
| 3089 | next_column=MagickFalse; |
| 3090 | span.x=1.0; |
| 3091 | s=scanline; |
| 3092 | t=scale_scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3093 | for (x=0; x < (ssize_t) image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3094 | { |
| 3095 | scale.x=(double) scale_image->columns/(double) image->columns; |
| 3096 | while (scale.x >= span.x) |
| 3097 | { |
| 3098 | if (next_column != MagickFalse) |
| 3099 | { |
| 3100 | pixel=zero; |
| 3101 | t++; |
| 3102 | } |
| 3103 | pixel.red+=span.x*s->red; |
| 3104 | pixel.green+=span.x*s->green; |
| 3105 | pixel.blue+=span.x*s->blue; |
| 3106 | if (image->matte != MagickFalse) |
| 3107 | pixel.opacity+=span.x*s->opacity; |
| 3108 | if (scale_indexes != (IndexPacket *) NULL) |
| 3109 | pixel.index+=span.x*s->index; |
| 3110 | t->red=pixel.red; |
| 3111 | t->green=pixel.green; |
| 3112 | t->blue=pixel.blue; |
| 3113 | if (scale_image->matte != MagickFalse) |
| 3114 | t->opacity=pixel.opacity; |
| 3115 | if (scale_indexes != (IndexPacket *) NULL) |
| 3116 | t->index=pixel.index; |
| 3117 | scale.x-=span.x; |
| 3118 | span.x=1.0; |
| 3119 | next_column=MagickTrue; |
| 3120 | } |
| 3121 | if (scale.x > 0) |
| 3122 | { |
| 3123 | if (next_column != MagickFalse) |
| 3124 | { |
| 3125 | pixel=zero; |
| 3126 | next_column=MagickFalse; |
| 3127 | t++; |
| 3128 | } |
| 3129 | pixel.red+=scale.x*s->red; |
| 3130 | pixel.green+=scale.x*s->green; |
| 3131 | pixel.blue+=scale.x*s->blue; |
| 3132 | if (scale_image->matte != MagickFalse) |
| 3133 | pixel.opacity+=scale.x*s->opacity; |
| 3134 | if (scale_indexes != (IndexPacket *) NULL) |
| 3135 | pixel.index+=scale.x*s->index; |
| 3136 | span.x-=scale.x; |
| 3137 | } |
| 3138 | s++; |
| 3139 | } |
| 3140 | if (span.x > 0) |
| 3141 | { |
| 3142 | s--; |
| 3143 | pixel.red+=span.x*s->red; |
| 3144 | pixel.green+=span.x*s->green; |
| 3145 | pixel.blue+=span.x*s->blue; |
| 3146 | if (scale_image->matte != MagickFalse) |
| 3147 | pixel.opacity+=span.x*s->opacity; |
| 3148 | if (scale_indexes != (IndexPacket *) NULL) |
| 3149 | pixel.index+=span.x*s->index; |
| 3150 | } |
| 3151 | if ((next_column == MagickFalse) && |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3152 | ((ssize_t) (t-scale_scanline) < (ssize_t) scale_image->columns)) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3153 | { |
| 3154 | t->red=pixel.red; |
| 3155 | t->green=pixel.green; |
| 3156 | t->blue=pixel.blue; |
| 3157 | if (scale_image->matte != MagickFalse) |
| 3158 | t->opacity=pixel.opacity; |
| 3159 | if (scale_indexes != (IndexPacket *) NULL) |
| 3160 | t->index=pixel.index; |
| 3161 | } |
| 3162 | /* |
| 3163 | Transfer scanline to scaled image. |
| 3164 | */ |
| 3165 | t=scale_scanline; |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3166 | for (x=0; x < (ssize_t) scale_image->columns; x++) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3167 | { |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3168 | q->red=ClampToQuantum(t->red); |
| 3169 | q->green=ClampToQuantum(t->green); |
| 3170 | q->blue=ClampToQuantum(t->blue); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3171 | if (scale_image->matte != MagickFalse) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3172 | q->opacity=ClampToQuantum(t->opacity); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3173 | if (scale_indexes != (IndexPacket *) NULL) |
cristy | ce70c17 | 2010-01-07 17:15:30 +0000 | [diff] [blame] | 3174 | scale_indexes[x]=(IndexPacket) ClampToQuantum(t->index); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3175 | t++; |
| 3176 | q++; |
| 3177 | } |
| 3178 | } |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3179 | if (SyncCacheViewAuthenticPixels(scale_view,exception) == MagickFalse) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3180 | break; |
cristy | 96b1613 | 2010-08-29 17:19:52 +0000 | [diff] [blame] | 3181 | proceed=SetImageProgress(image,ScaleImageTag,(MagickOffsetType) y, |
| 3182 | image->rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3183 | if (proceed == MagickFalse) |
| 3184 | break; |
| 3185 | } |
cristy | ed6cb23 | 2010-01-20 03:07:53 +0000 | [diff] [blame] | 3186 | scale_view=DestroyCacheView(scale_view); |
| 3187 | image_view=DestroyCacheView(image_view); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3188 | /* |
| 3189 | Free allocated memory. |
| 3190 | */ |
| 3191 | y_vector=(MagickPixelPacket *) RelinquishMagickMemory(y_vector); |
| 3192 | scale_scanline=(MagickPixelPacket *) RelinquishMagickMemory(scale_scanline); |
| 3193 | if (scale_image->rows != image->rows) |
| 3194 | scanline=(MagickPixelPacket *) RelinquishMagickMemory(scanline); |
| 3195 | x_vector=(MagickPixelPacket *) RelinquishMagickMemory(x_vector); |
| 3196 | scale_image->type=image->type; |
| 3197 | return(scale_image); |
| 3198 | } |
| 3199 | |
anthony | 02b4cb4 | 2010-10-10 04:54:35 +0000 | [diff] [blame] | 3200 | #if 0 |
| 3201 | THIS IS NOT USED -- to be removed |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3202 | /* |
| 3203 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3204 | % % |
| 3205 | % % |
| 3206 | % % |
| 3207 | + S e t R e s i z e F i l t e r S u p p o r t % |
| 3208 | % % |
| 3209 | % % |
| 3210 | % % |
| 3211 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3212 | % |
| 3213 | % SetResizeFilterSupport() specifies which IR filter to use to window |
| 3214 | % |
| 3215 | % The format of the SetResizeFilterSupport method is: |
| 3216 | % |
| 3217 | % void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| 3218 | % const MagickRealType support) |
| 3219 | % |
| 3220 | % A description of each parameter follows: |
| 3221 | % |
| 3222 | % o resize_filter: the resize filter. |
| 3223 | % |
| 3224 | % o support: the filter spport radius. |
| 3225 | % |
| 3226 | */ |
| 3227 | MagickExport void SetResizeFilterSupport(ResizeFilter *resize_filter, |
| 3228 | const MagickRealType support) |
| 3229 | { |
| 3230 | assert(resize_filter != (ResizeFilter *) NULL); |
| 3231 | assert(resize_filter->signature == MagickSignature); |
| 3232 | resize_filter->support=support; |
| 3233 | } |
anthony | 02b4cb4 | 2010-10-10 04:54:35 +0000 | [diff] [blame] | 3234 | #endif |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3235 | |
| 3236 | /* |
| 3237 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3238 | % % |
| 3239 | % % |
| 3240 | % % |
| 3241 | % T h u m b n a i l I m a g e % |
| 3242 | % % |
| 3243 | % % |
| 3244 | % % |
| 3245 | %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% |
| 3246 | % |
| 3247 | % ThumbnailImage() changes the size of an image to the given dimensions and |
| 3248 | % removes any associated profiles. The goal is to produce small low cost |
| 3249 | % thumbnail images suited for display on the Web. |
| 3250 | % |
| 3251 | % The format of the ThumbnailImage method is: |
| 3252 | % |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3253 | % Image *ThumbnailImage(const Image *image,const size_t columns, |
| 3254 | % const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3255 | % |
| 3256 | % A description of each parameter follows: |
| 3257 | % |
| 3258 | % o image: the image. |
| 3259 | % |
| 3260 | % o columns: the number of columns in the scaled image. |
| 3261 | % |
| 3262 | % o rows: the number of rows in the scaled image. |
| 3263 | % |
| 3264 | % o exception: return any errors or warnings in this structure. |
| 3265 | % |
| 3266 | */ |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 3267 | MagickExport Image *ThumbnailImage(const Image *image,const size_t columns, |
| 3268 | const size_t rows,ExceptionInfo *exception) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3269 | { |
| 3270 | #define SampleFactor 5 |
| 3271 | |
| 3272 | char |
| 3273 | value[MaxTextExtent]; |
| 3274 | |
| 3275 | const char |
| 3276 | *name; |
| 3277 | |
| 3278 | Image |
| 3279 | *thumbnail_image; |
| 3280 | |
| 3281 | MagickRealType |
| 3282 | x_factor, |
| 3283 | y_factor; |
| 3284 | |
cristy | bb50337 | 2010-05-27 20:51:26 +0000 | [diff] [blame] | 3285 | size_t |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3286 | version; |
| 3287 | |
cristy | 9af9b5d | 2010-08-15 17:04:28 +0000 | [diff] [blame] | 3288 | struct stat |
| 3289 | attributes; |
| 3290 | |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3291 | assert(image != (Image *) NULL); |
| 3292 | assert(image->signature == MagickSignature); |
| 3293 | if (image->debug != MagickFalse) |
| 3294 | (void) LogMagickEvent(TraceEvent,GetMagickModule(),"%s",image->filename); |
| 3295 | assert(exception != (ExceptionInfo *) NULL); |
| 3296 | assert(exception->signature == MagickSignature); |
| 3297 | x_factor=(MagickRealType) columns/(MagickRealType) image->columns; |
| 3298 | y_factor=(MagickRealType) rows/(MagickRealType) image->rows; |
| 3299 | if ((x_factor*y_factor) > 0.1) |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 3300 | thumbnail_image=ResizeImage(image,columns,rows,image->filter,image->blur, |
| 3301 | exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3302 | else |
| 3303 | if (((SampleFactor*columns) < 128) || ((SampleFactor*rows) < 128)) |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 3304 | thumbnail_image=ResizeImage(image,columns,rows,image->filter, |
| 3305 | image->blur,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3306 | else |
| 3307 | { |
| 3308 | Image |
| 3309 | *sample_image; |
| 3310 | |
| 3311 | sample_image=SampleImage(image,SampleFactor*columns,SampleFactor*rows, |
| 3312 | exception); |
| 3313 | if (sample_image == (Image *) NULL) |
| 3314 | return((Image *) NULL); |
cristy | d1bb3bc | 2010-09-07 00:43:58 +0000 | [diff] [blame] | 3315 | thumbnail_image=ResizeImage(sample_image,columns,rows,image->filter, |
| 3316 | image->blur,exception); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3317 | sample_image=DestroyImage(sample_image); |
| 3318 | } |
| 3319 | if (thumbnail_image == (Image *) NULL) |
| 3320 | return(thumbnail_image); |
| 3321 | (void) ParseAbsoluteGeometry("0x0+0+0",&thumbnail_image->page); |
| 3322 | if (thumbnail_image->matte == MagickFalse) |
| 3323 | (void) SetImageAlphaChannel(thumbnail_image,OpaqueAlphaChannel); |
| 3324 | thumbnail_image->depth=8; |
| 3325 | thumbnail_image->interlace=NoInterlace; |
| 3326 | /* |
| 3327 | Strip all profiles except color profiles. |
| 3328 | */ |
| 3329 | ResetImageProfileIterator(thumbnail_image); |
| 3330 | for (name=GetNextImageProfile(thumbnail_image); name != (const char *) NULL; ) |
| 3331 | { |
| 3332 | if ((LocaleCompare(name,"icc") != 0) && (LocaleCompare(name,"icm") != 0)) |
| 3333 | { |
cristy | 2b726bd | 2010-01-11 01:05:39 +0000 | [diff] [blame] | 3334 | (void) DeleteImageProfile(thumbnail_image,name); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3335 | ResetImageProfileIterator(thumbnail_image); |
| 3336 | } |
| 3337 | name=GetNextImageProfile(thumbnail_image); |
| 3338 | } |
| 3339 | (void) DeleteImageProperty(thumbnail_image,"comment"); |
| 3340 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
cristy | 7b63d66 | 2009-11-13 01:58:56 +0000 | [diff] [blame] | 3341 | if (strstr(image->magick_filename,"//") == (char *) NULL) |
| 3342 | (void) FormatMagickString(value,MaxTextExtent,"file://%s", |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3343 | image->magick_filename); |
| 3344 | (void) SetImageProperty(thumbnail_image,"Thumb::URI",value); |
| 3345 | (void) CopyMagickString(value,image->magick_filename,MaxTextExtent); |
| 3346 | if (GetPathAttributes(image->filename,&attributes) != MagickFalse) |
| 3347 | { |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3348 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3349 | attributes.st_mtime); |
| 3350 | (void) SetImageProperty(thumbnail_image,"Thumb::MTime",value); |
| 3351 | } |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3352 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3353 | attributes.st_mtime); |
cristy | b9080c9 | 2009-12-01 20:13:26 +0000 | [diff] [blame] | 3354 | (void) FormatMagickSize(GetBlobSize(image),MagickFalse,value); |
cristy | 2ce15c9 | 2010-03-12 14:03:41 +0000 | [diff] [blame] | 3355 | (void) ConcatenateMagickString(value,"B",MaxTextExtent); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3356 | (void) SetImageProperty(thumbnail_image,"Thumb::Size",value); |
| 3357 | (void) FormatMagickString(value,MaxTextExtent,"image/%s",image->magick); |
| 3358 | LocaleLower(value); |
| 3359 | (void) SetImageProperty(thumbnail_image,"Thumb::Mimetype",value); |
| 3360 | (void) SetImageProperty(thumbnail_image,"software", |
| 3361 | GetMagickVersion(&version)); |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3362 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
| 3363 | image->magick_columns); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3364 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::Width",value); |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3365 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
cristy | f2faecf | 2010-05-28 19:19:36 +0000 | [diff] [blame] | 3366 | image->magick_rows); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3367 | (void) SetImageProperty(thumbnail_image,"Thumb::Image::height",value); |
cristy | e8c25f9 | 2010-06-03 00:53:06 +0000 | [diff] [blame] | 3368 | (void) FormatMagickString(value,MaxTextExtent,"%.20g",(double) |
| 3369 | GetImageListLength(image)); |
cristy | 3ed852e | 2009-09-05 21:47:34 +0000 | [diff] [blame] | 3370 | (void) SetImageProperty(thumbnail_image,"Thumb::Document::Pages",value); |
| 3371 | return(thumbnail_image); |
| 3372 | } |